molecules
dict | messages
listlengths 3
3
|
|---|---|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a membrane stabilizer, impacting both diabetic heart disease and barth syndrome. The molecule is a energy source, nutritional supplement, proton trap for oxidative phosphorylation, food additive, and smooth. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a surfactant, and it impacts non-alcoholic fatty liver disease. The molecule is a emulsifier, apoptosis, energy storage that impacts tangier disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCSSSS"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a hypotensive that impacts cancer preventive.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)Nc1scc(C)c1-c1ccc(C)c(CO)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a member of the bradykinin antagonist class and affects hypertension treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(O)c1ccc(-c2cnc[nH]c2=O)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a coagulation inhibitor and a anti coagulant, belonging to the thrombosis treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(=O)SCn1cnc2c1c(=O)n(C)c(=O)n2C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is anti inflammatory.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts aging and tangier disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCCO)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts parkinson's disease, alzheimer's disease, stomach cancer, and cardiovascular disease. It has an effect on colorectal cancer, and impacts diabetes mellitus, seizure, and breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCC1C(O)CC(O)C1C=CC(O)CCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a nutritional supplement, impacting both barth syndrome and aging. The molecule is a food additive, a stabilizing cytochrome oxidase, and a surfactant, it impacts non-alcoholic fatty liver disease and is smooth. The molecule is a proton trap for oxidative phosphorylation, a energy source, and a apoptosis, and it impacts tangier disease. The molecule is a cholesterol translocation, membrane stabilizer, energy storage, emulsifier that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage and thyroxine treatment, and it impacts atherosclerosis. The molecule is a nutrient that impacts pancreatitis, metabolic syndrome, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient and fat storage, and it impacts metabolic syndrome. It impacts atherosclerosis, cardiovascular disease, pancreatitis, and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient, membrane stabilizer, and energy source that has an effect on cancer and impacts both metabolic syndrome and obesity. It impacts cardiovascular disease, pancreatitis, and atherosclerosis. The molecule is a inflammatory, a energy storage, a fat storage, and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat storage, nutrient, inflammatory, membrane stabilizer that impacts thyroxine treatment and atherosclerosis. The molecule is a energy source that affects cancer by impacting metabolic syndrome. The molecule is a energy storage that impacts pancreatitis, obesity, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COC12CCCC(C1)C(C)C(C)C2"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a sodium channel inhibitor and is pain treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCCN"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, alzheimer's disease, and diabetes mellitus type 2.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(C=CC(O)CCCCC)C(=O)CC(O)C(CC=CCCCC(=O)O1)C(O)C(O)C2O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts seizure, alzheimer's disease, breast cancer, and cardiovascular disease. It has an effect on stomach cancer, and impacts diabetes mellitus, colorectal cancer, and parkinson's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CC=CC(=O)CCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, non-alcoholic fatty liver disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"OCCc1ccc(O)c(O)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a mitogen and lipoxygenase inhibitor, belonging to the anti oxidant class, and is characterized as anti viral agent, anti carcinogenic, and fungicide.",
"role": "assistant"
}
] |
{
"smiles": [
"C1=C(c2cc3c(-c4ccc5ccn(Cc6ccccc6)c5c4)ncnc3[nH]2)CCNC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCC(O)C=CC=CC=CC(O)CC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It has an effect on colorectal cancer, and impacts stomach cancer, alzheimer's disease, and cardiovascular disease. It impacts breast cancer, parkinson's disease, seizure, and diabetes mellitus.",
"role": "assistant"
}
] |
{
"smiles": [
"c1ccc2c(c1)oc1c(-n3c4ccccc4c4cc5c(cc43)c3cccc4c6cc7c(cc6n5c34)c3cccc4c5cc6c(cc5n7c43)c3ccc(-c4ccc5c(c4)c4cccc7c8c9c%10ccccc%10n%10c%11cc%12c%13cc%14c(c%15cccc%16c%17ccccc%17n%14c%16%15)c%14c%15ccccc%15n(c%12cc%11c(cc8n5c47)c9%10)c%13%14)cc3n6-c3cccc4c3oc3ccccc34)cccc12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "This molecule is a member of the electroluminescent class and influences organic electroluminescence.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a energy storage, a inflammatory, and a nutrient that impacts both pancreatitis and cancer, and is thyroxine treatment. It impacts obesity, metabolic syndrome, and atherosclerosis. The molecule is a energy source, a fat storage, and a membrane stabilizer, and it impacts cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CCN(CCc2ccc(-n3ccc(NC(=O)N4CCN(C(=O)C(C)(C)N)CC4)nc3=O)cc2)CCC1N"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a anti bacterial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCS(=O)(=O)c1cc(C(=O)C(C)(C)O)ccc1C(=O)c1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a member of the photoinitiators class and affects photopolymerization.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a emulsifier, surfactant, energy source, nutritional supplement. The molecule is a stabilizing mitochondrial structure, membrane stabilizer, proton trap for oxidative phosphorylation, energy storage, food additive. The molecule is a apoptosis and a stabilizing cytochrome oxidase, it impacts diabetic heart disease, and is smooth. The molecule is a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, aging, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)COP(=O)([O-])OCC[N+](C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, atherosclerosis, and breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and diabetic heart disease. The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts atherosclerosis, pancreatitis, and metabolic syndrome. The molecule is a nutrient and fat storage, belonging to the thyroxine treatment class of molecules, and impacts cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, aging, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is odorless.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease. The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCc1nc(CCC2CCCCC2)nn1Cc1ccc(-c2ccccc2C(=O)O)cn1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a glaucoma treatment and belongs to the angiotensin ii antagonist class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CC(O)CC=CC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCCCCCCCC=CCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It impacts alzheimer's disease, diabetes mellitus, cardiovascular disease, and seizure. It has an effect on breast cancer, and impacts stomach cancer, parkinson's disease, and colorectal cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, a surfactant, and a apoptosis, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase, emulsifier, stabilizing mitochondrial structure, energy storage that impacts non-alcoholic fatty liver disease. The molecule is a energy source and a cholesterol translocation, it impacts aging, and is smooth. The molecule is a nutritional supplement, food additive, membrane stabilizer that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, fat storage, energy source that impacts obesity, cancer, and cardiovascular disease. The molecule is a nutrient, a inflammatory, and thyroxine treatment. The molecule is a energy storage that impacts atherosclerosis, metabolic syndrome, and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CC=CC(O)CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, cervical cancer, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)Nc1cc(Cl)ncc1C(=O)NC(C)CO"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cl.NCCCCCOc1cccc(-c2n[nH]c(=O)c3ccccc23)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a parp inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CNCCOC1CNCC(OCc2ccc3c(c2)N(CCCOC)CCO3)C1c1ccc(COCC(C)COC)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is both a hiv protease inhibitor and a betasecretase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts aging, barth syndrome, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(C2CCC2)nc(NCc2c(-c3ccc(OC4CCCC(C(=O)O)C4)c(C)n3)nnn2C)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It belongs to the lpa antagonist class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a apoptosis that impacts aging, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(C)Cc1ccc2c(c1)C(NCC(O)C(Cc1cc(F)cc(F)c1)NC(=O)c1ccccc1)CCC2"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a betasecretase inhibitor that impacts alzheimer's treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a energy storage, a food additive, and a cholesterol translocation, and it impacts non-alcoholic fatty liver disease. The molecule is a surfactant, energy source, nutritional supplement, membrane stabilizer that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a emulsifier, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase and a apoptosis, which impacts both tangier disease and aging, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a fat storage, energy storage, thyroxine treatment that impacts cardiovascular disease, pancreatitis, and atherosclerosis. The molecule is a energy source and inflammatory, and it impacts metabolic syndrome. The molecule is a membrane stabilizer and a nutrient, impacting both obesity and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCc1cc(OCc2c(-c3ccc(OCC4CCC4C(=O)O)c(C)n3)nnn2C)ncn1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It belongs to the lpa antagonist class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, tangier disease, and diabetic heart disease. The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts tangier disease, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient, energy storage, and fat storage that has an effect on cancer and impacts both atherosclerosis and obesity. The molecule is thyroxine treatment and it impacts both pancreatitis and metabolic syndrome. The molecule is a inflammatory, a energy source, and a membrane stabilizer, and it impacts cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1c(-c2ccc(=O)n(Cc3ccccc3)c2)c2cc(Cl)ccc2n1CC(=O)O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the crth2 antagonist class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1oc([N+](=O)[O-])cc1C(=O)NC(C)C(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a ccr3 antagonist and a chemokine receptor antagonist.",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1COC(=O)C12CC1CCCC(C)C1(C)C2"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is odorless.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat storage and a energy storage that impacts metabolic syndrome, cancer, obesity, and cardiovascular disease. The molecule is a energy source and nutrient, and it impacts atherosclerosis. The molecule is a thyroxine treatment, a membrane stabilizer, and a inflammatory, and it impacts pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"O=[N+]([O-])c1ccc2nc[nH]c2c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "When heated to decomposition it emits toxic fumes of nitrogen oxides.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cn2c(-c3cn[nH]c3)cnc2c(Nc2ccc(CN3CCNCC3)cc2)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a aurora kinase inhibitor and a protein kinase inhibitor, it impacts cancer treatment, and is anti mitotic.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(-c2cc(=O)c3c(O)cc(OC4OC(C(=O)O)C(O)C(O)C4OC4OC(C(=O)O)C(O)C(O)C4OC(=O)C=Cc4ccc(O)cc4)cc3o2)cc(OC)c1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, inflammatory, energy source that impacts metabolic syndrome, obesity, and cardiovascular disease. It impacts thyroxine treatment, pancreatitis, and atherosclerosis. The molecule is a nutrient, energy storage, fat storage with an effect on cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis that impacts diabetic heart disease, aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCN(NC(=O)C1CNC(=O)C1)C(=O)c1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It belongs to the anti ulcer class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both cardiovascular disease and pancreatitis. The molecule is a fat storage that impacts atherosclerosis, thyroxine treatment, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a emulsifier and a proton trap for oxidative phosphorylation, it impacts aging, and is smooth. The molecule is a energy source, nutritional supplement, apoptosis, food additive, stabilizing mitochondrial structure. The molecule is a stabilizing cytochrome oxidase and a surfactant, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a energy storage, membrane stabilizer, cholesterol translocation that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CC=CCCCCCC)OC(=O)CCCCCCCC=CC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a energy source and a food additive, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a surfactant, stabilizing mitochondrial structure, emulsifier, energy storage, and smooth. The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a membrane stabilizer, and it impacts aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, nutritional supplement that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC=CCCCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts ulcerative colitis and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCC(=O)OC1COC(=O)CCCCCCC2C(O)CC(=O)C(C=CC(O)CCCCC)C(O)C(O)C(OP(=O)(O)OC1)C(O)C(O)C2O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It has an effect on breast cancer, and impacts seizure, stomach cancer, and alzheimer's disease. It has an effect on colorectal cancer, and impacts diabetes mellitus, parkinson's disease, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCCCC(=O)OC(COCCCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a fat storage, a nutrient, and thyroxine treatment. It impacts atherosclerosis, metabolic syndrome, pancreatitis, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"N#Cc1ccc(C(=O)NOCC(O)CO)c(Nc2ccc(I)cc2F)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a mek inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCC(Nc1nc(N)nc(N)c1C#N)c1nc2cccc(Cl)c2c(=O)n1-c1cccc(C(N)=O)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a pi3k inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCC=CCC=CCC=CC=CC(=O)CCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts parkinson's disease, seizure, cardiovascular disease, and colorectal cancer. It influences both breast cancer and stomach cancer, as well as affecting alzheimer's disease and diabetes mellitus.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCC1(S(=O)(=O)n2cc(C)c3c(C(=O)NCc4c(C)cc(C)[nH]c4=O)cc(-c4ccc(CN(C)C)cc4F)cc32)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a ezh2 inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCS(=O)(=O)NC(=O)Nc1ccc(C)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a factor xia inhibitor.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.