molecules
dict | messages
listlengths 3
3
|
|---|---|
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts aging and barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1OCc2ccccc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, surfactant, emulsifier, energy source, nutrient, energy storage.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts aging, tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts atherosclerosis, pancreatitis, and metabolic syndrome. The molecule is a nutrient and a fat storage, impacting both cardiovascular disease and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, a energy storage, and a energy source, and it impacts tangier disease. The molecule is a food additive, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging. The molecule is a cholesterol translocation, a surfactant, a emulsifier, and smooth. The molecule is a stabilizing cytochrome oxidase, nutritional supplement, membrane stabilizer that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)N(C(=O)C(N)C(c1ccccc1)c1ccccc1)C(c1ccc(C(CO)N(CCC(C)(C)C)S(=O)(=O)c2ccc3[nH]ncc3c2)s1)C(F)(F)F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a hiv protease inhibitor and is aids treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCc1cn(C2CC(O)C(CNC(=O)C(C)Sc3ccc(Cl)cc3Cl)O2)c(=O)[nH]c1=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It belongs to the anti viral class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCC(C)(CCCCCCC)c1nccs1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a ra inhibitor that is anti cancer agent and anti cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"NC(C(=O)Nc1ccc2ccccc2c1)c1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "It belongs to the neurological treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC(O)C=CC=CCC=CC=CC(O)C=CCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts atherosclerosis and ulcerative colitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy storage, energy source, membrane stabilizer that impacts metabolic syndrome, obesity, and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, and it impacts pancreatitis. The molecule is a inflammatory and a nutrient, impacting both atherosclerosis and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)C=CC1C(C)(O)C(OC(C)=O)C(O)C2C(C)(C)CCCC21C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a signalling molecule, a membrane stabilizer, and a emulsifier. The molecule is a surfactant, energy storage, nutrient, energy source.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC(=O)OCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCOc1ccc(OCC(COP(=O)(O)Oc2cccc(C[n+]3ccsc3)c2)OCC)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a platelet aggregation inhibitor and a paf antagonist, belonging to the allergic disease treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)CC(NC(=O)c2nc(Cl)c3ccccn23)CCO1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cb2 agonist and belongs to the pain treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1c(C)cnc(COC(=O)Nc2ccc(F)c(CC(OC(C)C)C(=O)O)c2)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti inflammatory that impacts hyperglycemia treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ncc(-c2ccc(CCNC(=O)c3ccc4c5c3OC3C(=O)CCC6(O)C(CCCC536)C4)cc2)c(OC)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is addiction treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cc(C)c(S(=O)(=O)NC(CNC(=O)c2ccc3c(cnn3CCCNC3NCCN3)c2)C(=O)O)c(C)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a integrin inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC1OC1CC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCCc1oc(CCCCC)c(C)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects both breast cancer and cervical cancer, and also impacts ulcerative colitis and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCOCc1nc(C(C)(C)O)c(C(=O)O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a angiotensin ii antagonist and belongs to the hypertension treatment class of molecules, impacting cardiovascular disease treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CS(=O)(=O)OC(CCc1ccc(C(F)(F)F)cc1)Cn1ccnc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a anti microbial member of the anti fungal class.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cc(N2CC(C)(NC(=O)Oc3ccc(Cl)s3)CC2=O)ccc1N1CCOCC1=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to the anti thrombotic class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a apoptosis that impacts aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)C(=O)c1c(C)c(C(=O)Nc2ccc(F)c(C#N)c2)c(Cl)n1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a hepatitis b treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCC=CCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts heart failure, celiac disease, breast cancer, and cardiovascular disease. The molecule is a energy source that impacts renal cell carcinoma, inflammatory bowel disease, and diabetes mellitus type 2.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCC=CCC=CCCCC(=O)OC1COC(=O)CCCC=CCC2C(=O)CC(O)C(C=CC(O)CCCCC)C(O)C(O)C(OP(=O)(O)OC1)C(O)C(O)C2O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It has an effect on stomach cancer, and impacts alzheimer's disease, parkinson's disease, and cardiovascular disease. It impacts breast cancer, seizure, diabetes mellitus, and colorectal cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a emulsifier, impacting both non-alcoholic fatty liver disease and aging. The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, it impacts diabetic heart disease and is smooth. The molecule is a surfactant, a apoptosis, and a nutritional supplement, and it impacts barth syndrome. The molecule is a food additive, energy source, energy storage, membrane stabilizer that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(-c2ccccc2C(C)OCC(O)CNC(C)(C)Cc2ccc(C)c(F)c2)cc1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a calcium receptor antagonist.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCC=CC=CC(=O)CCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CN(C(=O)CC#N)CC1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a jak3 inhibitor and inflammatory treatment, and it impacts autoimmune treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule has Mild odor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy source, fat storage, thyroxine treatment that has an effect on cancer and impacts metabolic syndrome. It impacts cardiovascular disease, pancreatitis, and atherosclerosis. The molecule is a energy storage, a nutrient, and a inflammatory, and it impacts obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"Fc1cc(C(F)(F)F)cc(C(Cc2ccccc2)(NCc2cc(Cl)ccc2Cl)c2ccc(Cl)cn2)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cetp inhibitor and is atherosclerosis treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCC=CCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both pancreatitis and atherosclerosis. The molecule is a nutrient and thyroxine treatment, impacting both cardiovascular disease and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a energy storage, inflammatory, membrane stabilizer that belongs to the thyroxine treatment class of molecules and impacts both obesity and cardiovascular disease. It has an effect on cancer, impacting both metabolic syndrome and pancreatitis. The molecule is a energy source, a fat storage, and a nutrient, and it impacts atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC1OC1CC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"NCCc1cc(CCc2cc(O)c3ccccc3c2)n[nH]1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a cancer treatment and a mcl1 inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and barth syndrome. The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CC(=CI)c1ccc2cc(-c3ccc4c(c3)-c3ccccc3-c3cc(-c5ccc6cc(-c7ccccc7)ccc6c5)ccc3O4)ccc2c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a optoelectronic member of the electroluminescent class.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient and membrane stabilizer, affecting cancer, and impacting pancreatitis, metabolic syndrome, and obesity. The molecule is a energy source and a inflammatory, belonging to the thyroxine treatment class of molecules. The molecule is a fat storage and a energy storage, impacting both atherosclerosis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(OC(=O)c3cc(=O)[nH]c(=O)[nH]3)c3ccccc3)C2SC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the anti biotic class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCn1nc(C(=C)C)c2cc(-c3cnc(C)nc3)cc(C)c21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a complement factor d inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"COCC=CC(=O)NC(C)c1nc(-c2ccc(C(=O)Nc3ccc(C)cn3)c(OC)c2)c2c(N)nccn12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a btk inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a energy storage and thyroxine treatment, impacting metabolic syndrome, cardiovascular disease, pancreatitis, and atherosclerosis. The molecule is a inflammatory and nutrient, and it impacts cancer. The molecule is a fat storage, a energy source, and a membrane stabilizer, and it impacts obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"COC(C)Cn1cc(C)cn1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a pde10 inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)C(C)(C)N1CCN(c2ccc(N3CCN(C(=O)NC4C5CC6CC4CC(O)(C6)C5)c4ccccc43)cc2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a metabolic syndrome treatment member of the type 2 diabetes treatment class.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It has an effect on stomach cancer, and impacts alzheimer's disease, diabetes mellitus, and parkinson's disease. It has an effect on colorectal cancer, and impacts breast cancer, cardiovascular disease, and seizure.",
"role": "assistant"
}
] |
{
"smiles": [
"Oc1ccc(-c2oc3ccc(C=Cc4cc(O)cc5c4C(c4cc(O)cc(O)c4)C(c4ccc(O)cc4)O5)cc3c2-c2cc(O)cc3c2C(c2cc(O)cc(O)c2)C(c2ccc(O)cc2)O3)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a emulsifier and a stabilizing mitochondrial structure, impacting both tangier disease and diabetic heart disease. The molecule is a cholesterol translocation, food additive, apoptosis that impacts aging and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a membrane stabilizer, a energy storage, and smooth. The molecule is a nutritional supplement, surfactant, proton trap for oxidative phosphorylation, energy source that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, breast cancer, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both pancreatitis and atherosclerosis. The molecule is a nutrient that impacts thyroxine treatment, cardiovascular disease, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"N=C(N)c1cccc(N2CC(COc3cccc(C(=O)N4CCCC4)c3)OC2=O)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a integrin inhibitor, a protease inhibitor, and anti angiogenic.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient and fat storage, and it impacts atherosclerosis. It impacts metabolic syndrome, cardiovascular disease, pancreatitis, and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1OC(OC2C(OC3C(OC4CCC5(C)C(CCC6(C)C5CC=C5C7CC(C)(C)CC(O)C7(C)CCC56C)C4(C)CO)OC(C(=O)O)C(O)C3O)OCC(O)C2O)C(O)C(O)C1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a energy storage, emulsifier, nutrient, energy source, membrane stabilizer, surfactant.",
"role": "assistant"
}
] |
{
"smiles": [
"C=C(C#N)C(=O)OC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "Decomposition: degradation products include formaldehyde; thermal decomposition products may include highly toxic fumes of hydrogen cyanide and toxic oxides of carbon and nitrogen. The molecule has Strong, acrid odor.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CC=CC=CCNC(=O)N1CCC(NS(=O)(=O)C(C)(C)C)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a npy y5 antagonist and is anti obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both pancreatitis and thyroxine treatment. The molecule is a nutrient that impacts metabolic syndrome, cardiovascular disease, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, aging, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(C=CC(=O)NCCc2c[nH]c3ccc(OC4OC(CO)C(O)C(O)C4O)cc23)ccc1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, fat storage, and nutrient that has an effect on cancer and impacts both metabolic syndrome and obesity. The molecule is a energy storage and membrane stabilizer, and it impacts thyroxine treatment. The molecule is a energy source that impacts cardiovascular disease, pancreatitis, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, energy storage, nutrient that impacts cardiovascular disease, metabolic syndrome, and atherosclerosis. The molecule is a energy source and a membrane stabilizer, belonging to the thyroxine treatment class of molecules. The molecule is a fat storage that impacts pancreatitis, cancer, and obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"OCC1OC(OC2C(OC3C(Oc4cc5c(O)cc(O)cc5[o+]c4-c4ccc(O)c(O)c4)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a drug and a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a energy source, energy storage, nutrient that impacts obesity, cancer, and metabolic syndrome. The molecule is a inflammatory and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a fat storage and a membrane stabilizer, impacting both pancreatitis and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCC)COC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both metabolic syndrome and pancreatitis. The molecule is a thyroxine treatment and a fat storage, impacting both cardiovascular disease and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a inflammatory and a energy storage that impacts cardiovascular disease, atherosclerosis, metabolic syndrome, and pancreatitis. It impacts obesity, thyroxine treatment, and cancer. The molecule is a fat storage, energy source, membrane stabilizer, nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"[Ba+2].[O-][Cl+2]([O-])[O-].[O-][Cl+2]([O-])[O-]"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "When heated to decomposition, can emit toxic fumes and explode ... chlorates/",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts colorectal cancer, parkinson's disease, diabetes mellitus, and seizure. It has an effect on breast cancer, and impacts stomach cancer, cardiovascular disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient, a inflammatory, and a membrane stabilizer that impacts both cancer and obesity, and is thyroxine treatment. The molecule is a energy storage that impacts both pancreatitis and cardiovascular disease. The molecule is a fat storage and a energy source, impacting both atherosclerosis and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)c1cc(C(=O)N(C)C2CC2)nn1C(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is anti retroviral and it impacts hiv treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, barth syndrome, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"C=C(F)C(=O)N1CCN(c2nc(OCC3CCCN3C)nc3c(F)c(-c4cccc5c4C(C)CC5)ncc23)CC1CC#N"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a kras inhibitor that is cancer treatment and inflammation treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts aging and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both cardiovascular disease and metabolic syndrome. The molecule is a fat storage that impacts atherosclerosis, pancreatitis, and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.