molecules
dict | messages
listlengths 3
3
|
|---|---|
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, a emulsifier, and a stabilizing cytochrome oxidase, and it impacts tangier disease. The molecule is a food additive, stabilizing mitochondrial structure, apoptosis, surfactant that impacts aging. The molecule is a energy storage and a nutritional supplement, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a energy source, a proton trap for oxidative phosphorylation, and a cholesterol translocation, it impacts barth syndrome and is smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1N(c2ccc(-c3ccc(-c4cccc5oc6c(-c7ccc(-n8c(=O)c9ccc(-c%10ccccc%10)cc9n(-c9ccc(-c%10cccc%11c%10oc%10ccccc%10%11)cc9)c8=O)cc7)cccc6c45)c4c3oc3ccccc34)cc2)c2ccc(-c3ccccc3)cc2C(O)N1c1ccc(-c2cccc3c2oc2ccccc23)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to both the electroluminescent and organic electroluminescent device classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"OCC(O)C(O)C(O)C(O)C(O)CO"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both metabolic syndrome and cardiovascular disease. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both atherosclerosis and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(Oc1ccc([N+](=O)[O-])cc1)OC1CCCCCC1SSc1ccccn1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts tangier disease, aging, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCc1oc(CCCCC)c(C)c1C)COP(=O)(O)OCCN"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, parkinson's disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and tangier disease. The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"C(=CC=COc1ccccc1)C=CCC1CO1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a histone deacetylase inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC(O)C=CC=CCC=CC=CC(O)C=CCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It impacts alzheimer's disease, cardiovascular disease, seizure, and diabetes mellitus. It has an effect on stomach cancer, breast cancer, colorectal cancer, and impacts parkinson's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, a membrane stabilizer, and a food additive, and it impacts non-alcoholic fatty liver disease. The molecule is a energy source, emulsifier, nutritional supplement, energy storage that impacts diabetic heart disease. The molecule is a apoptosis, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a surfactant, which impacts both tangier disease and aging, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)c2ccccc2-c2ccc(-c3c4ccc(N5CCCc6ccccc65)cc4c(-c4cccc5ccccc45)c4cc(N5CCCc6ccccc65)ccc34)cc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a electroluminescent member of the organic electroluminescent compound class.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts aging, barth syndrome, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, fat storage, nutrient that impacts obesity, pancreatitis, and cancer. The molecule is a energy storage that impacts both atherosclerosis and thyroxine treatment. The molecule is a inflammatory and a energy source, impacting both cardiovascular disease and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(CNC(=O)c2cc(C(F)(F)F)cnc2NCc2ccc(-c3cnc4n[nH]c(N)c4c3)cc2)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a pdk1 inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts aging, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a fat storage and nutrient, and it impacts atherosclerosis. It impacts thyroxine treatment, cardiovascular disease, metabolic syndrome, and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CC=CCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a energy source that impacts celiac disease, heart failure, and inflammatory bowel disease. It has an effect on breast cancer, and impacts cardiovascular disease, diabetes mellitus type 2, and renal cell carcinoma.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and aging. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and aging. The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1COCCN1c1cc(OCc2ccc(Oc3ccc(Cl)c(C(F)(F)F)c3)c(F)c2)nc(=O)n1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a lppla2 inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CC=CC(O)CCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It impacts parkinson's disease, cardiovascular disease, seizure, and alzheimer's disease. It has an effect on colorectal cancer, and impacts breast cancer, diabetes mellitus, and stomach cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts aging and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cccc(-c2ccc3c(c2)C(O)(C(F)(F)F)c2ccccc2-3)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is diabetes treatment and it impacts both cardiovascular disease treatment and cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, emulsifier, membrane stabilizer, cholesterol translocation. The molecule is a energy storage, a energy source, and a nutritional supplement, it impacts barth syndrome and is smooth. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, surfactant, food additive that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(CNc2ncnc3c2c(C)c(CNC(=O)OC(C)(C)C)n3C(C)C)c(OC)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a ret kinase inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CN(C)C(=O)Nc1cccc(-c2cnc3cc(-c4ccc(F)cc4)ccn23)c1.O=CO"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a fgfr inhibitor and belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCc1oc(CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCc2oc(CCCCC)c(C)c2C)COP(=O)(O)OCCN)c(C)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, nutritional supplement, surfactant, energy source, food additive that impacts diabetes mellitus type 2. The molecule is smooth and it impacts both non-alcoholic fatty liver disease and parkinson's disease. The molecule is a emulsifier, a nutrient, and a energy storage, and it impacts alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CC(O)C=CC=CCC=CC=CC(O)CC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, ulcerative colitis, and breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts tangier disease, barth syndrome, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both pancreatitis and metabolic syndrome. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both cardiovascular disease and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient, fat storage, inflammatory that impacts atherosclerosis, obesity, and cancer. The molecule is a energy source and membrane stabilizer, and it impacts metabolic syndrome. The molecule is a energy storage that impacts cardiovascular disease, pancreatitis, and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CN1C(=O)Cc2cnc(Nc3ccc(S(=O)(=O)NCCc4ccccc4)cc3)nc2-c2ccccc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a protein kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)N(Cc1ccccc1OCCCCCC(=O)O)C(=O)c1ccc(-c2ccco2)c(F)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to the ppar agonist class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCN1CC2COCC(C1)C2O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a potassium channel inhibitor and is diabetes treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cccc(C(=O)Cl)c1I"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor and is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"Cn1nc(NC(=O)C(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cc1Br"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, diabetic heart disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1c(CN(C)CC(O)c2ccccc2)sc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It belongs to the anti viral class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC1CCC(C2CCC(C3CCCC(C#N)(CCC)C3)CC2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a dielectric.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(C)OC(=O)N1CCC(CCN2CCC(c3ccc(C(=O)NCCCO)cc3)CC2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a member of the diabetes treatment class and affects obesity treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCn1nc(C)c2c(C(F)(F)F)cc(NNC(=O)Nc3cc(Cl)nc(Cl)c3)nc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"O=Cc1ccc(Oc2ncccc2C2CCOC2)cc1-c1nc2ccccc2[nH]1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a pde10 inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
] |
{
"smiles": [
"CCN(CC)CCNC(=O)c1c(C)[nH]c(C=C2C(=O)Nc3cc(NC(=O)Nc4cc(NC(=O)c5ccccc5)ccc4C)ccc32)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a protein kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a energy source, nutrient, energy storage that impacts pancreatitis, metabolic syndrome, and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, and it impacts atherosclerosis. The molecule is a inflammatory and a membrane stabilizer, with effects on cancer and impacts on obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, a food additive, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a nutritional supplement that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a energy source, a cholesterol translocation, a apoptosis, and smooth. The molecule is a surfactant, emulsifier, energy storage, stabilizing mitochondrial structure that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting metabolic syndrome. The molecule is a fat storage that impacts atherosclerosis, cardiovascular disease, and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient, membrane stabilizer, energy source that impacts atherosclerosis, cardiovascular disease, and pancreatitis. The molecule is a fat storage that impacts both obesity and cancer. The molecule is a inflammatory and a energy storage, it impacts metabolic syndrome, and is thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)c1cccc(OCc2cc(OC)ccc2CS)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a autotaxin inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(N)(CC(=O)O)c1ccc(Cl)nc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a parkinson's treatment and belongs to the positive allosteric modulator class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a food additive, a energy storage, and a emulsifier, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, energy source that impacts barth syndrome and aging. The molecule is a apoptosis and a membrane stabilizer, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, surfactant, nutritional supplement, and smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a apoptosis, food additive, surfactant that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a emulsifier, a stabilizing mitochondrial structure, and a energy source, and it impacts tangier disease. The molecule is a nutritional supplement, a membrane stabilizer, and a energy storage, it impacts aging and is smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"C=C(CSC)c1nccc2ccccc12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a luminescent member of the electroluminescent class.",
"role": "assistant"
}
] |
{
"smiles": [
"c1ccc(-c2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)nn3c(-c4ccccc4)cc4ccccc4c23)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It belongs to the organic light-emitting class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(Nc1cccc(Cl)c1)c1cccnc1SCc1ccnc(NC2CCC2)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a angiogenesis inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts pancreatitis, metabolic syndrome, and thyroxine treatment. The molecule is a nutrient and a fat storage, impacting both atherosclerosis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCC(NC(=O)C1C(C)C(C)CN1C(=O)C(NC(=O)C(NC(=O)C(NC(=O)OC)C(C)(C)C)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a protease inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"Cn1nc(C(C)(C)CC(=O)N2C3CC4CC2CC(C#N)(C4)C3)c2c(F)cccc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a 11βhsd1 inhibitor and belongs to the diabetes treatment class of molecules, impacting obesity treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, energy storage, membrane stabilizer, apoptosis. The molecule is a cholesterol translocation, a emulsifier, and a surfactant, it impacts aging and is smooth. The molecule is a proton trap for oxidative phosphorylation and a food additive, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a energy source, nutritional supplement, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient, energy source, fat storage that impacts cardiovascular disease, obesity, and metabolic syndrome. The molecule is a membrane stabilizer that impacts both pancreatitis and cancer. The molecule is a energy storage and a inflammatory, it impacts atherosclerosis, and is thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)C4(c6ccccc6O5)c5ccccc5-c5ccccc54)n3)cc2)c(C)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a member of the organic light-emitting device class and affects light emission.",
"role": "assistant"
}
] |
{
"smiles": [
"CSCCC(O)C(=O)O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, a nutrient, and a signalling molecule. The molecule is a surfactant, emulsifier, energy storage, energy source.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(c1ccccc1O)n1nnc2ccccc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a chemokine inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cc(C(C)(C)C)c(N(C(=O)O)S(=O)(=O)Cl)c(C(C)(C)C)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a atherosclerosis treatment, a acat inhibitor, and a hypercholesterolemia treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease. The molecule is a apoptosis that impacts diabetic heart disease, barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CC=CC(=O)CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects breast cancer by impacting cervical cancer, ulcerative colitis, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)N(c3c(-c5ccc(-c6ccccc6)cc5)cc(-c5ccccc5)cc3-c3ccc(-c5ccccc5)cc3)c3cc(-c5ccc6c(c5)C(C)(C)C5CCCCC65)ccc3O4)cc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a organic electroluminescent device and is electroluminescent.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCc1cc(C)c(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCc2oc(CCC)c(C)c2C)o1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a food additive, membrane stabilizer, nutritional supplement, energy storage, energy source that impacts cervical cancer. The molecule is a surfactant that impacts both atherosclerosis and ulcerative colitis. The molecule is a emulsifier and nutrient, smooth, and has an effect on breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, inflammatory, fat storage that impacts metabolic syndrome, cardiovascular disease, and pancreatitis. The molecule is a energy storage that impacts both obesity and cancer. The molecule is a energy source and a nutrient, impacting both atherosclerosis and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(=O)OCC=C(C)CCC=C(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is both a waste product and a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)c2cc(-c3ccc(-c4cn5ccccc5n4)cc3)ccc2-c2cc3c(-c4ccc5ccccc5c4)c4ccccc4c(-c4ccc5ccccc5c4)c3cc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a organic light-emitting device and belongs to the organic light-emitting diode class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCC=CCCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts cardiovascular disease, atherosclerosis, and pancreatitis. The molecule is a nutrient and a fat storage, impacting both thyroxine treatment and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC=CC(O)C(CO)NC(=O)CCCC=CCC1C=CC(=O)C1C=CC(O)CCCCC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts insulin resistance, neurodegenerative disease, and diabetes mellitus.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCC(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a energy source, fat storage, nutrient, membrane stabilizer, inflammatory that impacts pancreatitis. This molecule is a member of the thyroxine treatment class, known to influence cancer and affect atherosclerosis. The molecule is a energy storage that impacts metabolic syndrome, cardiovascular disease, and obesity.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.