molecules
dict
messages
listlengths
3
3
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy storage that impacts aging, tangier disease, and diabetic heart disease. The molecule is a membrane stabilizer, proton trap for oxidative phosphorylation, nutritional supplement that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a food additive, a stabilizing mitochondrial structure, a emulsifier, and smooth. The molecule is a stabilizing cytochrome oxidase, surfactant, apoptosis, cholesterol translocation, energy source.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a membrane stabilizer, fat storage, inflammatory that impacts obesity, pancreatitis, and cardiovascular disease. The molecule is a nutrient that affects cancer by impacting metabolic syndrome. The molecule is a energy source, a thyroxine treatment, and a energy storage, and it impacts atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "C=C(C)COC(C)C(NC(=O)OC(C)(C)C)C(=O)OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is anti retroviral.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCC=CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts both atherosclerosis and pancreatitis. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both metabolic syndrome and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a emulsifier and a nutritional supplement, impacting both aging and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation, energy source, surfactant. The molecule is a food additive and a stabilizing mitochondrial structure, impacting both barth syndrome and diabetic heart disease. The molecule is a energy storage, a membrane stabilizer, and a cholesterol translocation, it impacts tangier disease and is smooth.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, barth syndrome, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCn1c(=O)n(CCCO)c(=O)c2c1nc(-c1ccc(OC3CCC3C)nc1)n2Cc1ccc(Cl)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a ion channel inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CC#CC(=O)N(C)C1CCCN(c2c(F)cc(C(N)=O)c3[nH]c4ccccc4c23)C1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a kinase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "Cc1cc(N)nc(C)c1CNC(=O)Cc1c(C)ccn(NCc2nc[nH]c2C)c1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti coagulant.", "role": "assistant" } ]
{ "smiles": [ "Cc1nc2cc(OCc3cccc(F)c3)ccc2c(=O)n1CCNC(=O)OC(C)(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is alzheimer's disease treatment.", "role": "assistant" } ]
{ "smiles": [ "NC(=O)Nc1sc2c(c1C(N)=O)CCc1cc(Cl)cc(Cl)c1-2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a kinase inhibitor and belongs to the anti inflammatory class of molecules, with the characteristic of being cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "c1ccc2c(Cn3c4ccccc4c4ccccc43)ccc(Cn3c4ccccc4c4ccccc43)c2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is phosphorescent.", "role": "assistant" } ]
{ "smiles": [ "O=S(=O)(Cl)c1ccc(-c2ccsc2)s1.O=S(=O)(Cl)c1ccc(-c2ccsc2)s1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a modulate.", "role": "assistant" } ]
{ "smiles": [ "C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)(O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a emulsifier, membrane stabilizer, energy storage, nutrient, surfactant, energy source.", "role": "assistant" } ]
{ "smiles": [ "CCCCOC(=O)CCn1c(=S)sc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is both a corrosion inhibitor and a anti oxidant.", "role": "assistant" } ]
{ "smiles": [ "CCOc1ccc2c(C(C)=O)c(-c3ccc(NC(=O)NC4CCC4)cc3)n(C3CCC3)c2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a hcv inhibitor and is anti viral.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutritional supplement and a apoptosis, impacting both barth syndrome and diabetic heart disease. The molecule is a food additive, cholesterol translocation, emulsifier that impacts aging and tangier disease. The molecule is a energy source, a surfactant, a proton trap for oxidative phosphorylation, and smooth. The molecule is a membrane stabilizer, energy storage, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC(O)C(O)CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC=CCCCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, alzheimer's disease, parkinson's disease, and diabetes mellitus type 2.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "COc1ccccc1[N+]1(C2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)CCN(C(C)=O)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti fungal.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCC=COC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, alzheimer's disease, parkinson's disease, and diabetes mellitus type 2.", "role": "assistant" } ]
{ "smiles": [ "CCCCCn1nc(CC=S)nc1Cc1ccc(-c2ccccc2C(=O)O)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the angiotensin ii antagonist class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging. The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC(O)C=CC=CC=CC(O)CC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, diabetes mellitus type 2, parkinson's disease, and alzheimer's disease.", "role": "assistant" } ]
{ "smiles": [ "CCc1nc2c(cnn2CC)c(NC2CCCCC2)c1CNC(=O)c1cccc(C(=O)NCc2ccc(F)c(-c3cccc(CN4CCN(c5ccncc5)CC4)c3)c2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a pde4 inhibitor.", "role": "assistant" } ]
{ "smiles": [ "O=P(O)(O)CCc1c(Cl)ccc2ncc(P(=O)(O)O)n12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is anti convulsant.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and aging. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CC1CCCC(O)(C#Cc2nc(N)c3ncn(C4OC(C(=O)NC5CC5)C(O)C4O)c3n2)C1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is inflammation treatment.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "Nc1ncc2ncn(C3COC(CO)O3)c2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a anti viral that impacts hiv treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCC=CCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It impacts insulin resistance.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a fat storage that impacts both metabolic syndrome and pancreatitis. The molecule is a nutrient that impacts atherosclerosis, thyroxine treatment, and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CC(=O)NC1COC(COS(=O)(=O)O)CC1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a anti coagulant and belongs to the anti thrombotic class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis that impacts aging, tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CC1=C(CC(C)(C)CC(=O)O)Nc2c(O)cccc2N(C(=O)C2CC2)C1c1ccc(OCc2ccccc2)cc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a hcv inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage, a emulsifier, a energy source, and smooth. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, surfactant, apoptosis that impacts aging. The molecule is a proton trap for oxidative phosphorylation and a food additive, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, stabilizing cytochrome oxidase, nutritional supplement that impacts diabetic heart disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "C=C(C)C(=O)OCCCCCCCCOc1ccc(C(C#N)=Cc2ccc3c(c2)OCCO3)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the liquid crystal class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCC=CC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient and thyroxine treatment, and it impacts metabolic syndrome. The molecule is a fat storage that impacts atherosclerosis, pancreatitis, and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCl" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule has Sweet odor. When heated to decomposition it emits highly toxic fumes of phosgene and chloride.", "role": "assistant" } ]
{ "smiles": [ "Cc1cc(N2CCc3nc(COc4ccccc4)cn3C2=O)ncc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is positive allosteric modulator.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CC(NC(=O)C(CC(=O)N(C)C)NC(=O)C(NC(=O)CC(C)(C)C)C(C)(C)C)C(=O)C(F)(F)C(=O)NCc1ccccc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a protease inhibitor and is anti viral.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "COc1ccc(C2=NC(S)(c3ccc(OC)cc3)N=C2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti inflammatory.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CC=CC(O)CCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COP(=O)([O-])OCC[N+](C)(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, atherosclerosis, and cervical cancer.", "role": "assistant" } ]
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC(O)C(O)CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, parkinson's disease, and alzheimer's disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, non-alcoholic fatty liver disease, and aging. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CC(C)(C)c1nn(C2CC2)cc1C1CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a bromodomain inhibitor and is modulate.", "role": "assistant" } ]
{ "smiles": [ "CCC(=O)C1(c2cccc(O)c2)CCN(C)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a xenobiotic metabolite.", "role": "assistant" } ]
{ "smiles": [ "C=C1C(=O)OC2C3=C(C)C(O)CC(O)C3(C)CCC12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is both a nutrient and a flavoring agent.", "role": "assistant" } ]
{ "smiles": [ "Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc2c(-c3ccccc3)c3ccccc3c(-c3ccccc3)c2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is light-emitting.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, diabetic heart disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "COc1cccc(C(C)(C)N2CCN(C(=O)OC(C)(C)C)CC2)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a energy source and nutrient, belonging to the thyroxine treatment class of molecules, with effects on cancer and impacts on both metabolic syndrome and obesity. The molecule is a membrane stabilizer that impacts both cardiovascular disease and pancreatitis. The molecule is a inflammatory, a fat storage, and a energy storage, and it impacts atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "COC(=O)NC(C(=O)N1CCCC1c1nc(-c2ccc(-c3ccc(-c4cnc(C5CCCN5C(=O)C(NC5OCO5)C(C)C)[nH]4)cc3)cc2)c(-c2ccnn2C)[nH]1)C(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a hcv inhibitor and ns5a inhibitor, belonging to the anti viral compound class of molecules, and is anti viral.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome. The molecule is a apoptosis and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CC(O)CC=CC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient that impacts parkinson's disease, non-alcoholic fatty liver disease, diabetes mellitus type 2, and alzheimer's disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a fat storage, a inflammatory, and a membrane stabilizer that impacts both pancreatitis and cancer, and is thyroxine treatment. The molecule is a energy storage and nutrient, and it impacts obesity. The molecule is a energy source that impacts metabolic syndrome, atherosclerosis, and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CC=CC(O)CC)c(C)c1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient that impacts cervical cancer, ulcerative colitis, breast cancer, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a fat storage and nutrient, and it impacts metabolic syndrome. The molecule is thyroxine treatment and impacts atherosclerosis, pancreatitis, and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient, inflammatory, fat storage that impacts obesity, metabolic syndrome, and cardiovascular disease. The molecule is a energy source that affects cancer by impacting pancreatitis. The molecule is a membrane stabilizer and a energy storage, impacting both atherosclerosis and thyroxine treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC(O)C=CC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, diabetes mellitus type 2, and alzheimer's disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy source, fat storage, inflammatory that impacts cancer, obesity, and pancreatitis. The molecule is a energy storage that impacts both cardiovascular disease and atherosclerosis. The molecule is a nutrient and membrane stabilizer, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "C=C1NC(C2CCCN2C(=O)C(NC(O)OC)C(C)C)=NCC=CC2=C1C=CC(C)(C1=CCC3(C)C(=C1)C=Cc1nc(C4CC(SC)CN4C(=O)C(NC(=O)OC)c4ccccc4)[nH]c13)C2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti viral.", "role": "assistant" } ]
{ "smiles": [ "Cc1ccc(-c2nn(C(C)(C)CNS(=O)(=O)c3ccccc3)c3ncnc(N)c23)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a protein kinase inhibitor and belongs to the proliferative disorder treatment class of molecules.", "role": "assistant" } ]
{ "smiles": [ "C=C(C)C(CC)CCC(C)C1CCC2C3CC=C4CC(OC5OC(CO)C(O)C(O)C5O)CCC4(C)C3CCC12C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a membrane stabilizer, a signalling molecule, and a nutrient. The molecule is a energy source, surfactant, emulsifier, energy storage.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC(O)c1ccccc1COc1cccc2ccc(=O)[nH]c12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is both a anti allergic and a lipoxygenase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts tangier disease, aging, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCC1OC(C(O)CCC(O)C2CCC(CCCCCCCC(O)CC3=CC(C)OC3=O)O2)CCC1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a membrane stabilizer, nutrient, energy source, energy storage.", "role": "assistant" } ]
{ "smiles": [ "COc1cc(C=Cc2cc(OC)c(OC)c(OC)c2)cc(NS(=O)(=O)c2cccc(N)c2)c1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It belongs to the anti cancer class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts aging and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCOC(OCC)(OP=O)c1cc2sc(NC(=O)OC(C)(C)C)nc2c(-c2cccc([N+](=O)[O-])c2)c1OC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a pde4 inhibitor and belongs to both the cardiovascular treatment and inflammatory treatment classes of molecules.", "role": "assistant" } ]
{ "smiles": [ "COCCCn1c(C2CCCN(C(=O)CC(Cc3ccc(N4CCC(C(=O)OC)CC4)cc3)NC(=O)OC(C)(C)C)C2)nc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a renin inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It impacts breast cancer, cardiovascular disease, diabetes mellitus, and parkinson's disease. It has an effect on stomach cancer, and impacts alzheimer's disease, colorectal cancer, and seizure.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts aging.", "role": "assistant" } ]
{ "smiles": [ "O=c1c2cc(F)ccc2[se]n1-c1ccc2c(c1)OCO2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti viral.", "role": "assistant" } ]
{ "smiles": [ "Cc1ccc(Nc2ccc(Nc3ccc(C)cc3S(=O)(=O)[O-])c3c2C(=O)c2ccccc2C3=O)c(S(=O)(=O)[O-])c1.[Na+].[Na+]" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "When heated to decomposition it emits very toxic fumes of nitrogen and sulfur oxides as well as sodium monoxide.", "role": "assistant" } ]
{ "smiles": [ "COc1ccc(CN2CC3CCC2CC3c2ccc(-c3cc(OCCC4COC5C(O)COC45)cn4ncc(C#N)c34)cn2)cn1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCC=COCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, alzheimer's disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CC=CC(O)CCCCCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It influences both breast cancer and stomach cancer, as well as affecting colorectal cancer and alzheimer's disease. It impacts seizure, parkinson's disease, cardiovascular disease, and diabetes mellitus.", "role": "assistant" } ]
{ "smiles": [ "CC(C)C(C)(C)[SiH2]ON" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cytokine inhibitor, a anti inflammatory, and anti cancer.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a energy storage, energy source, inflammatory, membrane stabilizer that impacts metabolic syndrome and lipotoxicity.", "role": "assistant" } ]
{ "smiles": [ "C=CC=CC=COCC(=O)OCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is both a rock inhibitor and a kinase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CN(C)CCn1ncc2ccc(C3CCN(C)CC3)cc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is migraine treatment.", "role": "assistant" } ]