molecules dict | messages listlengths 3 3 |
|---|---|
{
"smiles": [
"CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, fat storage, nutrient that impacts cancer, metabolic syndrome, and pancreatitis. The molecule is a energy storage and thyroxine treatment, and it impacts obesity. The molecule is a energy source and a inflammatory, impacting both atherosclerosis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCN(Cc1cc(C(=O)OCCCCCCCCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)cc(Br)c1N)C1CCCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is anti inflammatory.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a energy storage and a energy source that impacts metabolic syndrome, atherosclerosis, pancreatitis, and obesity. The molecule is a membrane stabilizer and nutrient with an effect on cancer. The molecule is a inflammatory, a fat storage, and a thyroxine treatment, and it impacts cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC(=O)C=CC=CCC=CCC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It has an effect on breast cancer, and impacts seizure, alzheimer's disease, and stomach cancer. It has an effect on colorectal cancer, and impacts parkinson's disease, cardiovascular disease, and diabetes mellitus.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a energy source, it impacts aging, and is smooth. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, energy storage, emulsifier that impacts tangier disease. The molecule is a membrane stabilizer and a nutritional supplement, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a food additive, proton trap for oxidative phosphorylation, surfactant, stabilizing cytochrome oxidase that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"NCCCCCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule has both a Tasteless and a Odorless, or nearly so.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CC=CC(O)CCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It has an effect on colorectal cancer, and impacts parkinson's disease, breast cancer, and alzheimer's disease. It has an effect on stomach cancer, and impacts diabetes mellitus, cardiovascular disease, and seizure.",
"role": "assistant"
}
] |
{
"smiles": [
"CN(CC(Nc1ncnc2c(C(N)=O)cccc12)c1cccc([N+](=O)[O-])c1)C(=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is both a protein kinase inhibitor and a cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"C=C(C)C(=O)Oc1ccc(OC(=O)c2ccc(OC(=O)C(=C)C)c(F)c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the liquid crystal class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a fat storage and a inflammatory that impacts thyroxine treatment, cardiovascular disease, pancreatitis, and metabolic syndrome. The molecule is a nutrient and energy storage, and it impacts cancer. The molecule is a membrane stabilizer and a energy source, impacting both atherosclerosis and obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, a food additive, and a stabilizing cytochrome oxidase, and it impacts aging. The molecule is a apoptosis, nutritional supplement, energy storage that impacts barth syndrome and tangier disease. The molecule is a emulsifier and a proton trap for oxidative phosphorylation, it impacts diabetic heart disease, and is smooth. The molecule is a energy source, membrane stabilizer, stabilizing mitochondrial structure, surfactant that impacts non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)N1CCC(Oc2ccc(NC(=O)c3nc[nH]c3C(=O)Nc3nc4ccccc4[nH]3)c(C)c2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a jak2 inhibitor, a protein kinase inhibitor, and a protein tyrosine kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer and a energy source, which impacts obesity, metabolic syndrome, and atherosclerosis, and is characterized as thyroxine treatment. The molecule is a fat storage and energy storage, and it impacts pancreatitis. The molecule is a nutrient and a inflammatory, impacting both cancer and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(Oc2cccc(-c3ccc4c(c3)n(C)c(=O)n4CC3CC3)c2)nc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a positive allosteric modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCn1nnc2c(C)c(C(c3ccc(C)c(CN4Cc5ccccc5OC(C)(C)C4)c3)C(C)C(=O)N3C(=O)OCC3Cc3ccccc3)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is copd treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1nnc(CC(O)c2cc(OCCCN(C)C)ccc2F)o1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is anti epileptic.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(NC(=O)Cc2cc(F)ccc2F)ccc1-c1cnco1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a tyrosine kinase inhibitor and is anti cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC=CC(O)C(COC1OC(CO)C(OC2OC(CO)C(OC3OC(CO)C(O)C(O)C3CC(C)=O)C(OC3(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(CO)OC4(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(CO)OC5(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O5)O4)O3)C2O)C(O)C1O)NC(=O)CCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy source, signalling molecule, food additive. The molecule is a emulsifier, surfactant, nutritional supplement, energy storage, and smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)c1nn(Cc2ccc(-c3ccc(C)nc3)nc2)c2c(Cl)cccc2c1=S"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a alzheimer's treatment and is positive allosteric modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CC12CCC(CC1=O)C2(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule has both a Pungent aromatic taste and a Fragrant and penetrating odor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer and energy storage, affecting cancer, and impacting metabolic syndrome, cardiovascular disease, and obesity. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting pancreatitis. The molecule is a inflammatory, a energy source, and a nutrient, and it impacts atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"c1ccc(-c2ccc(N(c3ccccc3)c3cc(-c4nc(-c5ccc6oc7ccccc7c6c5)c5ccccc5n4)c4oc5cc6ccccc6cc5c4c3)cc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a organic light-emitting diode.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a emulsifier, surfactant, stabilizing mitochondrial structure, energy source. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a energy storage and a stabilizing cytochrome oxidase, it impacts barth syndrome, and is smooth. The molecule is a cholesterol translocation, food additive, membrane stabilizer, nutritional supplement that impacts aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCN(CC)C1C=CC=CC1(C)N"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is photosensitive.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)C(=O)Nc2ccc(OCCSc3ccc(Cl)c(Cl)c3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a phosphodiesterase inhibitor and belongs to the anti thrombotic class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1nc(-c2ccc(NC(=O)C(O)c3cc(F)cc(C(F)(F)F)c3)cc2F)c2c(N)ncc(C(F)(F)F)n12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging and barth syndrome. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease. The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)C(C(=O)NCC=O)N(C)CCOCCOCCNC=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a anti bodydrug conjugate.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, nutrient, energy storage, fat storage, energy source that impacts metabolic syndrome. The molecule is a thyroxine treatment and inflammatory, and it impacts atherosclerosis. It impacts cardiovascular disease, cancer, obesity, and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1CC2C=Nc3cc(OCCCC(=O)Nc4cn(C)c(C(=O)Nc5cc(C(=O)Nc6cc(C(=O)n7ccc8cc(NC(=O)C(C)NC(=O)C(NC(=O)CCOCCOCCNC(=O)CCN9C(=O)CC(S)C9=O)C(C)C)ccc87)n(C)c6)n(C)c5)n4)c(OC)cc3C(=O)N2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti bodydrug conjugate member of the anti tumor class.",
"role": "assistant"
}
] |
{
"smiles": [
"CC=C(C)C(=O)NC(C(=O)OCC1OC(n2cc(F)c(=O)[nH]c2=O)C2OC(C)(C)OC12)C(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a anti tumor activity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is pharmaceutical.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both cardiovascular disease and atherosclerosis. The molecule is a fat storage that impacts pancreatitis, thyroxine treatment, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a energy source, a energy storage, and a apoptosis, and it impacts tangier disease. The molecule is a emulsifier, a membrane stabilizer, and a stabilizing cytochrome oxidase, it impacts diabetic heart disease and is smooth. The molecule is a surfactant and a stabilizing mitochondrial structure, impacting both non-alcoholic fatty liver disease and aging. The molecule is a nutritional supplement, cholesterol translocation, food additive, proton trap for oxidative phosphorylation that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"COCc1cc(-c2nc(-c3cc(Cl)cc(CN(C)CC(=O)O)c3)no2)ccc1-c1ccccc1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a s1p1 agonist.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CC=CC=CC(SCC(N)C(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O)C(O)CCCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCC=CCC=CCC=CCC=CCC(O)CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts cardiovascular disease, diabetes mellitus type 2, and pick's disease. The molecule is a nutrient that impacts diabetes mellitus type 1, atherosclerosis, and insulin resistance.",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1CCC2(CN(C(=O)c3csc(Br)c3)C2)N1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti inflammatory.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cc2nc(-c3ccc(-n4c5c(c6cc(-c7ccccc7)ccc64)C=C(c4ccccc4)CC5)cc3)c(-c3ccc(-n4c5ccc(-c6ccccc6)cc5c5cc(-c6ccccc6)ccc54)cc3)nc2cc1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a electronic device.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"O=S(=O)(O)OC1C(O)C(CO)OC(Oc2cc(O)cc(C=Cc3ccc(O)cc3)c2)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts tangier disease, aging, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)C1=C(Cl)CCC=C1OCc1cc(=O)n2[nH]c(C(F)(F)F)nc2n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cardiovascular disease treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC1CC(=O)N(CCCOc2ccc(C(C)(C)CC)cc2C(C)(C)CC)C(=O)N1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It belongs to the liquid crystal class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(CO)CC(=O)NCCNC(=O)Cc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is anti microbial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC1OC1CC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts diabetes mellitus, cardiovascular disease, alzheimer's disease, and seizure. It influences both colorectal cancer and breast cancer, as well as affecting parkinson's disease and stomach cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a food additive, a apoptosis, and a membrane stabilizer, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and diabetic heart disease. The molecule is a nutritional supplement, energy source, energy storage, stabilizing mitochondrial structure. The molecule is a emulsifier and a surfactant, which impacts both aging and non-alcoholic fatty liver disease, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CC1(C)C=C2CCC3C(C)(C)C(O)CCC3(C)C2CC1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a surfactant, energy source, emulsifier, energy storage, membrane stabilizer, nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts cardiovascular disease, metabolic syndrome, and atherosclerosis. The molecule is a nutrient and a fat storage, it impacts pancreatitis, and is thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CC=CC(O)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, ulcerative colitis, and breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCOC(=O)N1CCN(C(=O)C(C=[P+]([O-])OC(C(=O)OCC)C(=O)OCC)NC(=O)c2cc(N3CCC(OC)C3)nc(-c3ccccc3)n2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a platelet aggregation inhibitor and belongs to the thrombosis treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CNCN(C)c1cncc(-c2cncc(Nc3cccc(Cl)c3)n2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a tyrosine kinase inhibitor and a angiogenesis inhibitor, belonging to the anti tumor agent class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"NC1=NC(Cc2ccc(F)c(F)c2)CO1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a depression treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a apoptosis that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts aging and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(O)C(CC1CCCCC1)SCc1ccco1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cysteine protease inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts metabolic syndrome, atherosclerosis, and pancreatitis. The molecule is a nutrient and a fat storage, it impacts cardiovascular disease, and is thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a energy storage, membrane stabilizer, thyroxine treatment that impacts pancreatitis, cancer, and cardiovascular disease. The molecule is a nutrient and energy source, and it impacts atherosclerosis. The molecule is a inflammatory and a fat storage, impacting both obesity and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(C)OC(=O)n1cc(B(O)O)c2ccncc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy source, inflammatory that impacts atherosclerosis, metabolic syndrome, and pancreatitis. The molecule is a energy storage that impacts both obesity and cardiovascular disease. The molecule is a fat storage and a nutrient, with effects on cancer and impacts on thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CC=CC(=O)CCCCCCCC(=O)NC(CO)C(O)C=CCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It impacts diabetes mellitus, neurodegenerative disease, and insulin resistance.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(C)c2c1OC1c3c(c4cccc5c4n3CCC5=O)CC3(O)C4C(CC213)N4CCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti tussive.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"COCC1(C2(NS(=O)(=O)c3ccc4ccccc4c3)C(O)CCN2CCC=O)CCCCN1C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a thrombin inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer and nutrient, affecting cancer, and impacting obesity, pancreatitis, and atherosclerosis. The molecule is a inflammatory and energy source, and it impacts cardiovascular disease. The molecule is a energy storage and fat storage, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC1OC1CC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, diabetes mellitus type 2, parkinson's disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"NC(=O)C1c2cc(CNCCc3cccc(F)c3)ccc2CC1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a muscarinic agonist.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CC=CC(=O)CCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, diabetes mellitus type 2, parkinson's disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, membrane stabilizer, energy source that belongs to the thyroxine treatment class of molecules and impacts both cardiovascular disease and obesity. The molecule is a energy storage that impacts both metabolic syndrome and atherosclerosis. The molecule is a fat storage and a nutrient, with effects on cancer and impacts on pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage, membrane stabilizer, nutrient, inflammatory that impacts atherosclerosis and pancreatitis. It impacts thyroxine treatment, metabolic syndrome, and cardiovascular disease. The molecule is a energy source and a energy storage, impacting both cancer and obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"C#CC(C)Oc1cnc2c(Nc3cc(F)c(F)c(C4(C)N=C(N)SC(C)(C(=O)N(C)C)C4C)c3)nccc2n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a betasecretase inhibitor that impacts alzheimer's disease treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)OC1C(O)C(COC(=O)CC(=O)OC2C(Oc3cc(O)c4c(O)c(OC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)c(-c5ccc(O)cc5)[o+]c4c3)OC(C(=O)O)C(O)C2O)OC(Oc2cc3c(=O)cc(O)cc-3oc2-c2ccc(O)c(O)c2)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, surfactant, emulsifier, energy storage, nutrient, energy source.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.