molecules dict | messages listlengths 3 3 |
|---|---|
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a emulsifier, a stabilizing cytochrome oxidase, and a membrane stabilizer, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, a surfactant, and a apoptosis, it impacts diabetic heart disease and is smooth. The molecule is a cholesterol translocation, energy source, energy storage, nutritional supplement. The molecule is a food additive and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient and a fat storage that impacts obesity, atherosclerosis, pancreatitis, and cardiovascular disease. The molecule is a energy source, a membrane stabilizer, and a thyroxine treatment. The molecule is a energy storage and a inflammatory, impacting both cancer and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient and thyroxine treatment, impacting both atherosclerosis and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both cardiovascular disease and atherosclerosis. The molecule is a nutrient and thyroxine treatment, impacting both metabolic syndrome and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC(O)C=CC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCC)COP(=O)(O)OCC(N)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)OC1(NC(=O)C(=Cc2ccccc2)OC(F)(F)F)C=C(O)C2=C3C1OC1CCCC4C(C2)[N+](CCc2ccccc2)(CC(C)C)CCC314"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is anti tussive.",
"role": "assistant"
}
] |
{
"smiles": [
"CN1C(NC(=O)OC(C)(C)C)=NC(C)(c2cc(NC(=O)c3ccc(Cl)cn3)ccc2F)C2(CC2)S1(=O)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a bace inhibitor that impacts alzheimer's treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat storage, energy storage, inflammatory that impacts atherosclerosis, obesity, and metabolic syndrome. The molecule is a nutrient and thyroxine treatment, and it impacts pancreatitis. The molecule is a energy source and a membrane stabilizer, impacting both cardiovascular disease and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCCO)COP(=O)(O)OCC(N)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1c(N(C)C2CCN(Cc3ccccc3)C2)cc(F)c(S(=O)(=O)Nc2cccc(F)n2)c1F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a sodium channel inhibitor and a epilepsy treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts aging and tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(C=CC(=O)OCC2OC(OCC3OC(Oc4cc5c(O)cc(OC6OC(COC(=O)C=Cc7cc(OC)c(O)c(OC)c7)C(O)C(O)C6O)cc5[o+]c4-c4ccc(O)c(OC5OC(CO)C(O)C(O)C5O)c4)C(O)C(O)C3O)C(O)C(O)C2O)cc(OC)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a energy source, cholesterol translocation, emulsifier, food additive. The molecule is a stabilizing mitochondrial structure and a surfactant, which impacts both tangier disease and non-alcoholic fatty liver disease, and is characterized as smooth. The molecule is a energy storage and a nutritional supplement, impacting both diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis, membrane stabilizer that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts aging and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient, thyroxine treatment, inflammatory, energy source that impacts metabolic syndrome and pancreatitis. The molecule is a membrane stabilizer that affects cancer by impacting obesity. The molecule is a energy storage and a fat storage, impacting both cardiovascular disease and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"NCN1CCCc2cc(-c3cccnc3)cnc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts cardiovascular disease treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(Nc1cc2c3c(c1)nc(-c1ccc(C#N)cn1)n3CCCO2)C(N)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a pi3k inhibitor and belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and diabetic heart disease. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage, thyroxine treatment, and nutrient that has an effect on cancer and impacts both cardiovascular disease and metabolic syndrome. The molecule is a inflammatory and membrane stabilizer, and it impacts pancreatitis. The molecule is a energy source and a energy storage, impacting both obesity and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC1COC(=O)CC=CCC2C(O)CC(O)C(C=CC(O)CCCCC)C(O)C(OP(=O)(O)O)C(OP(=O)(O)OC1)C(O)C(O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts seizure, alzheimer's disease, cardiovascular disease, and breast cancer. It has an effect on stomach cancer, and impacts colorectal cancer, parkinson's disease, and diabetes mellitus.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient, a fat storage, and a thyroxine treatment. It impacts pancreatitis, cardiovascular disease, atherosclerosis, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCC(CCC)C(N)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a flatulent.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, a cholesterol translocation, and a emulsifier, and it impacts diabetic heart disease. The molecule is a food additive, a stabilizing cytochrome oxidase, and a surfactant, it impacts barth syndrome and is smooth. The molecule is a energy source and a stabilizing mitochondrial structure, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, energy storage, nutritional supplement that impacts aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a surfactant, a stabilizing mitochondrial structure, and a emulsifier, and it impacts non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and aging. The molecule is a energy storage and a energy source, it impacts diabetic heart disease, and is smooth. The molecule is a food additive, apoptosis, nutritional supplement, cholesterol translocation that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C([O-])[O-].[Ba+2]"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule has both a Tasteless and a Odorless.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1nnc(NC(N)c2cccc(C(F)(F)F)c2F)c2cc(N3CC(C)(N(C)C)C3)ncc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a kras g12c inhibitor and belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, a stabilizing cytochrome oxidase, and a membrane stabilizer, and it impacts aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, food additive, energy source, stabilizing mitochondrial structure. The molecule is a energy storage, a nutritional supplement, and a emulsifier, and it impacts barth syndrome. The molecule is a surfactant and smooth, impacting tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and barth syndrome. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1csc(=Nc2ccc(C(C)C(=O)O)c(F)c2)n1C.[Ca]"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti inflammatory and belongs to the anti pyretic class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"O=c1c2cnc(NCCN3CCOCC3)c3cccc(c32)n2c([N+](=O)[O-])ccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to both the anti fungal and anti microbial classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a thyroxine treatment, inflammatory, energy storage, energy source that has an effect on cancer and impacts atherosclerosis. The molecule is a fat storage and membrane stabilizer, and it impacts pancreatitis. The molecule is a nutrient that impacts cardiovascular disease, obesity, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCCCCCCCC)COC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient and thyroxine treatment, and it impacts atherosclerosis. The molecule is a fat storage that impacts metabolic syndrome, pancreatitis, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both metabolic syndrome and atherosclerosis. The molecule is a thyroxine treatment and a fat storage, impacting both pancreatitis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)CCc1c(C=C2C(=O)Nc3ccc(NS(=O)(=O)c4ccccc4)cc32)[nH]c2c1C(=O)CCCC2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(O)NC(=O)C=C1c1cccc(F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to both the anti microbial and anti bacterial classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, fat storage, nutrient, and energy source, impacts atherosclerosis, and is thyroxine treatment. The molecule is a energy storage and inflammatory, and it impacts metabolic syndrome. It impacts pancreatitis, obesity, cardiovascular disease, and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"N#Cc1cc(C(CN2CCC2)Nc2ncnc3c(C(N)=O)cccc23)ccc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a cancer treatment and a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and tangier disease. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a energy source and is part of the thyroxine treatment class, affecting cancer, obesity, cardiovascular disease, and pancreatitis. The molecule is a membrane stabilizer and fat storage, and it impacts atherosclerosis. The molecule is a inflammatory, a energy storage, and a nutrient, and it impacts metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts aging and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, a surfactant, and a stabilizing mitochondrial structure, and it impacts diabetic heart disease. The molecule is a energy storage, cholesterol translocation, membrane stabilizer, emulsifier that impacts tangier disease. The molecule is a apoptosis, a food additive, and a stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a nutritional supplement and a energy source, which impacts both aging and barth syndrome, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"c1ccc(-c2nc(-c3cccc4ccccc34)nc(-c3ccccc3)c2-c2cccc(-c3nc4ccccc4c4c3ccc3c5ccccc5oc34)c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It belongs to both the electroluminescent and organic light-emitting classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, barth syndrome, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts tangier disease and aging. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC=CCC=C(Nc1ccc(C(=O)CC(=N)CCCCNCC(=O)O)c(CC)c1)C(C)=N"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the anti bacterial class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts tangier disease, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, energy storage. The molecule is a nutritional supplement, surfactant, food additive that impacts aging and non-alcoholic fatty liver disease. The molecule is a emulsifier and a energy source, impacting both tangier disease and diabetic heart disease. The molecule is a apoptosis, a cholesterol translocation, and a stabilizing cytochrome oxidase, it impacts barth syndrome and is smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"ClCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule has Rather unpleasant, irritating odor. Polymerizes with evolution of heat and hydrogen chloride when in contact with all common metals except nickel and lead. Energy of decomposition (in range 290-370 °c) measured as 0.14 kj/g.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CC(O)Cc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is radish.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a emulsifier, a membrane stabilizer, a apoptosis, and smooth. The molecule is a energy storage, surfactant, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging. The molecule is a energy source, food additive, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, nutritional supplement.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)(CC(C)(C)C(=O)OCCOC(=O)COc1ccc2oc(=O)ccc2c1)C(=O)OC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is dielectric.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(CN(Cc2ccc(OC)cc2)C(c2ccccc2C)C(C)O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is both a cancer treatment and a erk inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts aging, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)NS(=O)(=O)c1ccc(N)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "When heated to decomposition it emits very toxic fumes of nitrogen oxides and sulfur oxides.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both atherosclerosis and metabolic syndrome. The molecule is a fat storage and a thyroxine treatment, impacting both pancreatitis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, a surfactant, and a membrane stabilizer, and it impacts diabetic heart disease. The molecule is a emulsifier, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, it impacts barth syndrome and is smooth. The molecule is a food additive, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is a energy storage, energy source, nutritional supplement that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(O)c1c(C(c2ccccc2)c2ccccc2)nc(-n2cccn2)[nH]c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to the anemia treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCc1cc(OC)c(O)cc1OCCCCCC(C)(C)c1nn[nH]n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a inflammation treatment, a leukotriene antagonist, and asthma treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a energy source and thyroxine treatment, impacting metabolic syndrome, obesity, pancreatitis, and atherosclerosis. The molecule is a inflammatory and nutrient, and it impacts cancer. The molecule is a fat storage, a energy storage, and a membrane stabilizer, and it impacts cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Oc1ccccc1-c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has Mild characteristic odor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCN(C)CCC(CSc1ccccc1)NC1=CCC(S(=O)(=O)Nc2ncnc3c2CCN(C2CCC(Cc4ccccc4Br)(OC)CC2)C3)C=C1S(=O)(=O)C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"NNC(=O)c1ccccc1OCc1ccccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a fluorescent.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and barth syndrome. The molecule is a cholesterol translocation and a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"COCn1ncc2c(Cl)ccc(S(=O)(=O)C(F)(F)F)c21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(C=CCN(O)C(N)=O)o1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is both a lipoxygenase inhibitor and a 5lipoxygenase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(-c2n[nH]c(-c3nc4ccc(C(N)=O)cc4[nH]3)c2O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a serine protease inhibitor and a factor ixa inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It has an effect on breast cancer, and impacts seizure, parkinson's disease, and colorectal cancer. It has an effect on stomach cancer, and impacts diabetes mellitus, cardiovascular disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC=CCCCCCCCCC=CCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, atherosclerosis, and cervical cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy storage and a energy source that impacts atherosclerosis, cardiovascular disease, metabolic syndrome, and pancreatitis. The molecule is a fat storage and membrane stabilizer, and it impacts thyroxine treatment. The molecule is a nutrient and a inflammatory, impacting both cancer and obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"Cn1ncc(Cl)c1-c1cc(C(=O)NC(C)(N)Cc2ccc(F)c(F)c2)sc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a pi3k inhibitor, akt inhibitor, jak inhibitor, cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CNC(=O)c1c(-c2ccc(C)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccnc(-c4cc5ccccc5[nH]4)n3)cc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a viral replication inhibitor and a hcv inhibitor, belonging to the anti viral class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts aging and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a apoptosis that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CC(C(=O)NCC(=O)CNS(=O)(=O)c1ccccc1OCc1ccccc1)[N+](=C=O)c1ccncc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a protease inhibitor and a cysteine protease inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts aging, diabetic heart disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy source, inflammatory, energy storage that impacts metabolic syndrome and lipotoxicity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, aging, and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cc(N2CCCC2)cc2c(=O)n(CC(O)CC3NCCCC3O)cnc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It belongs to the anti inflammatory class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"c1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2N(c2ccc(-c3cccc4ccccc34)cc2)c2ccc(-c3cccc4c3oc3ccccc34)cc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a electronic device and belongs to both the electroluminescent and organic electroluminescent classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"NC(N)=N[NH+]=Cc1cccc(OCc2cc(Cl)cc(Cl)c2Cl)c1Cl.[Cl-]"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is anti microbial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis that impacts aging, diabetic heart disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC(O)C=CC=CCC=CC=CC(O)C=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts alzheimer's disease, non-alcoholic fatty liver disease, diabetes mellitus type 2, and parkinson's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.