prefix
stringlengths
0
918k
middle
stringlengths
0
812k
suffix
stringlengths
0
962k
# Copyright 2015 Adam Greenstein <adamgreenstein@comcast.net> # # Switcharoo Cartographer is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Switcharoo Cartographer is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # You should have received a copy of the GNU General Public License # along with Switcharoo Cartographer. If not, see <http://www.gnu.org/licenses/>. from data import Access, Entry, EntryError from Queue import Queue class EntryQueue(Queue): def __init__(self, transverse, maxsize=0): self.reddit = transverse.reddit self.events = transverse.events Queue.__init__(self, maxsize) def _init(self, maxsize): Queue._init(self, maxsize) nodes = Access(self.events).get_entry(maxsize) for node in nodes: try: self.queue.append(Entry(node['raw_url'], self.reddit)) self.events.on_adding_to_queue(node['raw_url']) except EntryError: # TODO Remove old entry from DB pass def _put(self, url): try: entry = Entry(url, self.reddit) if self._is_unique(entry): self.events.on_adding_to_queue(url) self.queue.append(entry) else: self.events.on_not_adding_to_queue(url) except EntryError: self.ev
ents.on_not_adding_to_queue(url) def _get(self): return self.queue.popleft() def _is_unique(self, entry): # TODO Logic here to determine if new url found if entry not in self.queue: return Access(self.eve
nts).is_unique_entry(entry) else: return False
class A: def <weak_w
arning descr="Function name should be lowercase">fooBar</weak_warning>(self): pass class B(A
): def fooBar(self): pass
# Tweepy # Copyright 2009-2010 Joshua Roesslein # See LICENSE for details. import httplib import urllib import time import re from tweepy.error import TweepError from tweepy.utils import convert_to_utf8_str from tweepy.models import Model re_path_template = re.compile('{\w+}') def bind_api(**config): class APIMethod(object): path = config['path'] payload_type = config.get('payload_type', None) payload_list = config.get('payload_list', False) allowed_param = config.get('allowed_param', []) method = config.get('method', 'GET') require_auth = config.get('require_auth', False) search_api = config.get('search_api', False) use_cache = config.get('use_cache', True) def __init__(self, api, args, kargs): # If authentication is required and no credentials # are provided, throw an error. if self.require_auth and not api.auth: raise TweepError('Authentication required!') self.api = api self.post_data = kargs.pop('post_data', None) self.retry_count = kargs.pop('retry_count', api.retry_count) self.retry_delay = kargs.pop('retry_delay', api.retry_delay) self.retry_errors = kargs.pop('retry_errors', api.retry_errors) self.headers = kargs.pop('headers', {}) self.build_parameters(args, kargs) # Pick correct URL root to use if self.search_api: self.api_root = api.search_root else: self.api_root = api.api_root # Perform any path variable substitution self.build_path() if api.secure: self.scheme = 'https://' else: self.scheme = 'http://' if self.search_api: self.host = api.search_host else: self.host = api.host # Manually set Host header to fix an issue in python 2.5 # or older where Host is set including the 443 port. # This causes Twitter to issue 301 redirect. # See Issue https://github.com/tweepy/tweepy/issues/12 self.headers['Host'] = self.host def build_parameters(self, args, kargs): self.parameters = {} for idx, arg in enumerate(args): if arg is None: continue try: self.parameters[self.allowed_param[idx]] = convert_to_utf8_str(arg) except IndexError: raise TweepError('Too many parameters supplied!') for k, arg in kargs.items(): if arg is None: continue if k in self.parameters: raise TweepError('Multiple values for parameter %s supplied!' % k) self.parameters[k] = convert_to_utf8_str(arg) def build_path(self): for variable in re_path_template.findall(self.path): name = variable.strip('{}') if name == 'user' and 'user' not in self.parameters and self.api.auth: # No 'user' parameter provided, fetch it from Auth instead. value = self.api.auth.get_username() else: try: value = urllib.quote(self.parameters[name]) except KeyError:
raise TweepError('No parameter value found for path variable: %s' % name) del self.parameters[name] self.pa
th = self.path.replace(variable, value) def execute(self): # Build the request URL url = self.api_root + self.path if len(self.parameters): url = '%s?%s' % (url, urllib.urlencode(self.parameters)) # Query the cache if one is available # and this request uses a GET method. if self.use_cache and self.api.cache and self.method == 'GET': cache_result = self.api.cache.get(url) # if cache result found and not expired, return it if cache_result: # must restore api reference if isinstance(cache_result, list): for result in cache_result: if isinstance(result, Model): result._api = self.api else: if isinstance(cache_result, Model): cache_result._api = self.api return cache_result # Continue attempting request until successful # or maximum number of retries is reached. retries_performed = 0 while retries_performed < self.retry_count + 1: # Open connection # FIXME: add timeout if self.api.secure: conn = httplib.HTTPSConnection(self.host) else: conn = httplib.HTTPConnection(self.host) # Apply authentication if self.api.auth: self.api.auth.apply_auth( self.scheme + self.host + url, self.method, self.headers, self.parameters ) # Execute request try: conn.request(self.method, url, headers=self.headers, body=self.post_data) resp = conn.getresponse() except Exception, e: raise TweepError('Failed to send request: %s' % e) # Exit request loop if non-retry error code if self.retry_errors: if resp.status not in self.retry_errors: break else: if resp.status == 200: break # Sleep before retrying request again time.sleep(self.retry_delay) retries_performed += 1 # If an error was returned, throw an exception self.api.last_response = resp if resp.status != 200: try: error_msg = self.api.parser.parse_error(resp.read()) except Exception: error_msg = "Twitter error response: status code = %s" % resp.status raise TweepError(error_msg, resp) # Parse the response payload result = self.api.parser.parse(self, resp.read()) conn.close() # Store result into cache if one is available. if self.use_cache and self.api.cache and self.method == 'GET' and result: self.api.cache.store(url, result) return result def _call(api, *args, **kargs): method = APIMethod(api, args, kargs) return method.execute() # Set pagination mode if 'cursor' in APIMethod.allowed_param: _call.pagination_mode = 'cursor' elif 'page' in APIMethod.allowed_param: _call.pagination_mode = 'page' return _call
return dict_strip_unicode_keys(qs_filters) def apply_sorting(self, obj_list, options=None): """ Given a dictionary of options, apply some ORM-level sorting to the provided ``QuerySet``. Looks for the ``sort_by`` key and handles either ascending (just the field name) or descending (the field name with a ``-`` in front). The field name should be the resource field, **NOT** model field. """ if options is None: options = {} if not 'sort_by' in options: # Nothing to alter the sort order. Return what we've got. return obj_list order_by_args = [] if hasattr(options, 'getlist'): sort_bits = options.getlist('sort_by') else: sort_bits = options.get('sort_by') if not isinstance(sort_bits, (list, tuple)): sort_bits = [sort_bits] for sort_by in sort_bits: sort_by_bits = sort_by.split(LOOKUP_SEP) field_name = sort_by_bits[0] order = '' if sort_by_bits[0].startswith('-'): field_name = sort_by_bits[0][1:] order = '-' if not field_name in self.fields: # It's not a field we know about. Move along citizen. raise InvalidSortError("No matching '%s' field for ordering on." % field_name) if not field_name in self._meta.ordering: raise InvalidSortError("The '%s' field does not allow ordering." % field_name) if self.fields[field_name].attribute is None: raise InvalidSortError("The '%s' field has no 'attribute' for ordering with." % field_name) order_by_args.append("%s%s" % (order, LOOKUP_SEP.join([self.fields[field_name].attribute] + sort_by_bits[1:]))) return obj_list.order_by(*order_by_args) def get_object_list(self, request): """ An ORM-specific implementation of ``get_object_list``. Returns a queryset that may have been limited by authorization or other overrides. """ base_object_list = self._meta.queryset # Limit it as needed. authed_object_list = self.apply_authorization_limits(request, base_object_list) return authed_object_list def obj_get_list(self, request=None, **kwargs): """ A ORM-specific implementation of ``obj_get_list``. Takes an optional ``request`` object, whose ``GET`` dictionary can be used to narrow the query. """ filters = None if hasattr(request, 'GET'): filters = request.GET applicable_filters = self.build_filters(filters=filters) try: return self.get_object_list(request).filter(**applicable_filters) except ValueError, e: raise NotFound("Invalid resource lookup data provided (mismatched type).") def obj_get(self, request=None, **kwargs): """ A ORM-specific implementation of ``obj_get``. Takes optional ``kwargs``, which are used to narrow the query to find the instance. """ try: return self.get_object_list(request).get(**kwargs) except ValueError, e: raise NotFound("Invalid resource lookup data provided
(mismatched type).") def obj_create(self, bundle, request=None, **kwargs): """ A ORM-specific implementation of ``obj_create``. """ bundle.obj = self._meta.object_class() for key, value in kwargs.items(): setattr(bundle.obj, key, value) bundle = self.full_hydr
ate(bundle) bundle.obj.save() # Now pick up the M2M bits. m2m_bundle = self.hydrate_m2m(bundle) self.save_m2m(m2m_bundle) return bundle def obj_update(self, bundle, request=None, **kwargs): """ A ORM-specific implementation of ``obj_update``. """ if not bundle.obj or not bundle.obj.pk: # Attempt to hydrate data from kwargs before doing a lookup for the object. # This step is needed so certain values (like datetime) will pass model validation. try: bundle.obj = self.get_object_list(request).model() bundle.data.update(kwargs) bundle = self.full_hydrate(bundle) lookup_kwargs = kwargs.copy() lookup_kwargs.update(dict( (k, getattr(bundle.obj, k)) for k in kwargs.keys() if getattr(bundle.obj, k) is not None)) except: # if there is trouble hydrating the data, fall back to just # using kwargs by itself (usually it only contains a "pk" key # and this will work fine. lookup_kwargs = kwargs try: bundle.obj = self.get_object_list(request).get(**lookup_kwargs) except ObjectDoesNotExist: raise NotFound("A model instance matching the provided arguments could not be found.") bundle = self.full_hydrate(bundle) bundle.obj.save() # Now pick up the M2M bits. m2m_bundle = self.hydrate_m2m(bundle) self.save_m2m(m2m_bundle) return bundle def obj_delete_list(self, request=None, **kwargs): """ A ORM-specific implementation of ``obj_delete_list``. Takes optional ``kwargs``, which can be used to narrow the query. """ self.get_object_list(request).filter(**kwargs).delete() def obj_delete(self, request=None, **kwargs): """ A ORM-specific implementation of ``obj_delete``. Takes optional ``kwargs``, which are used to narrow the query to find the instance. """ try: obj = self.get_object_list(request).get(**kwargs) except ObjectDoesNotExist: raise NotFound("A model instance matching the provided arguments could not be found.") obj.delete() def rollback(self, bundles): """ A ORM-specific implementation of ``rollback``. Given the list of bundles, delete all models pertaining to those bundles. """ for bundle in bundles: if bundle.obj and getattr(bundle.obj, 'pk', None): bundle.obj.delete() def save_m2m(self, bundle): """ Handles the saving of related M2M data. Due to the way Django works, the M2M data must be handled after the main instance, which is why this isn't a part of the main ``save`` bits. Currently slightly inefficient in that it will clear out the whole relation and recreate the related data as needed. """ for field_name, field_object in self.fields.items(): if not getattr(field_object, 'is_m2m', False): continue if not field_object.attribute: continue # Get the manager. related_mngr = getattr(bundle.obj, field_object.attribute) if hasattr(related_mngr, 'clear'): # Clear it out, just to be safe. related_mngr.clear() related_objs = [] for related_bundle in bundle.data[field_name]: related_bundle.obj.save() related_objs.append(related_bundle.obj) related_mngr.add(*related_objs) def get_resource_uri(self, bundle_or_obj): """ Handles generating a resource URI for a single resource. Uses the model's ``pk`` in order to create the URI. """ kwargs = { 'resource_name
from django.urls import r
e_path from systextil.views import apoio_index from systextil.views.table import ( deposito, colecao, estagio, periodo_confeccao, unidade, ) urlpatterns = [ re_path(r'^colecao/$', colecao.view, name='colecao'), re_path(r'^deposito/$', deposito.deposito, name='deposito'), re_p
ath(r'^estagio/$', estagio.view, name='estagio'), re_path(r'^periodo_confeccao/$', periodo_confeccao.view, name='periodo_confeccao'), re_path(r'^unidade/$', unidade.view, name='unidade'), ]
############################################################################## # Copyright (c) 2013-2018, Lawrence Livermore National Security, LLC. # Produce
d at the Lawrence Livermore National Laboratory. # # This file is part of Spack. # Created by Todd Gamblin, tgamblin@llnl.gov, All rights reserved. # LLNL-CODE-647188 # # For details, see https://github.com/spack/spack # Please also see the NOTICE and LICENSE files for our notice and the LGPL. # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public
License (as # published by the Free Software Foundation) version 2.1, February 1999. # # This program is distributed in the hope that it will be useful, but # WITHOUT ANY WARRANTY; without even the IMPLIED WARRANTY OF # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the terms and # conditions of the GNU Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this program; if not, write to the Free Software # Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA ############################################################################## from spack import * class RFutileOptions(RPackage): """A scoped options management framework""" homepage = "https://cran.rstudio.com/web/packages/futile.options/index.html" url = "https://cran.rstudio.com/src/contrib/futile.options_1.0.0.tar.gz" list_url = "https://cran.rstudio.com/src/contrib/Archive/futile.options" version('1.0.0', '8fd845774bbce56f41f7c43c3b4c13ba')
import numpy as np import pandas as pd from bokeh import mpl ts = pd.Series(np.random.randn
(1000), index=pd.date_range('1/1/2000', periods=1000)) ts = ts.cumsum() df = pd.DataFrame(np.random.randn(1000, 4), index=ts.index, columns=list('ABCD')) df = df.cumsum() df.plot
(legend=False) mpl.to_bokeh(name="dataframe")
# -*- coding: utf-8 -*- # Generated by Django 1.10.5 on 2017-04-04 22:45 from __future__ import unicode_literals from django.d
b import migrations, models class Migration(migrations.Migration):
dependencies = [ ('domain_api', '0009_remove_topleveldomain_slug'), ] operations = [ migrations.AddField( model_name='topleveldomain', name='slug', field=models.CharField(max_length=100, null=True), ), ]
''' Created on
Nov 21, 2016 @author: julimatt ''
' from django import forms
from distuti
ls.core import setup from distutils.extension import Extension from Cython.Distutils import build_ext ext_modules = [Extension("_nbt", ["_nbt.pyx"])] import numpy setup( name = 'NBT library (Cython implementation)', cmdclass
= {'build_ext': build_ext}, ext_modules = ext_modules, include_dirs = numpy.get_include() )
s ``True`` if ``lhs`` is a file name or file object in the project store.""" return (lhs in self._sourcefiles or lhs in self._targetfiles or lhs in self._transfiles or lhs in self._files or lhs in self._files.values()) # METHODS # def append_file(self, afile, fname, ftype='trans', delete_orig=False): """Append the given file to the project with the given filename, marked to be of type ``ftype`` ('src', 'trans', 'tgt'). :type delete_orig: bool :param delete_orig: Whether or not the original (given) file should be deleted after being appended. This is set to ``True`` by :meth:`~translate.storage.project.convert_forward` . Not used in this class. """ if ftype not in self.TYPE_INFO['f_prefix']: raise ValueError('Invalid file type: %s' % (ftype)) if isinstance(afile, six.string_types) and os.path.isfile(afile) and not fname: # Try and use afile as the file name fname, afile = afile, open(afile) # Check if we can get an real file name realfname = fname if realfname is None or not os.path.isfile(realfname): realfname = getattr(afile, 'name', None) if realfname is None or not os.path.isfile(realfname): realfname = getattr(afile, 'filename', None) if not realfname or not os.path.isfile(realfname): realfname = None # Try to get the file name from the file object, if it was not given: if not fname: fname = getattr(afile, 'name', None) if not fname: fname = getattr(afile, 'filename', None) fname = self._fix_type_filename(ftype, fname) if not fname: raise ValueError('Could not deduce file name and none given') if fname in self._files: raise FileExistsInProjectError(fname) if realfname is not None and os.path.isfile(realfname): self._files[fname] = realfname else: self._files[fname] = afile self.TYPE_INFO['lists'][ftype].append(fname) return afile, fname def append_sourcefile(self, afile, fname=None): return self.append_file(afile, fname, ftype='src') def append_targetfile(self, afile, fname=None): return self.append_file(afile, fname, ftype='tgt') def append_transfile(self, afile, fname=None): return self.append_file(afile, fname, ftype='trans') def remove_file(self, fname, ftype=None): """Remove the file with the given project name from the project. If the file type ('src', 'trans' or 'tgt') is not given, it is guessed. """ if fname no
t in self._files: rai
se FileNotInProjectError(fname) if not ftype: # Guess file type (source/trans/target) for ft, prefix in self.TYPE_INFO['f_prefix'].items(): if fname.startswith(prefix): ftype = ft break self.TYPE_INFO['lists'][ftype].remove(fname) if self._files[fname] and hasattr(self._files[fname], 'close'): self._files[fname].close() del self._files[fname] def remove_sourcefile(self, fname): self.remove_file(fname, ftype='src') def remove_targetfile(self, fname): self.remove_file(fname, ftype='tgt') def remove_transfile(self, fname): self.remove_file(fname, ftype='trans') def close(self): self.save() def get_file(self, fname, mode='rb'): """Retrieve the file with the given name from the project store. The file is looked up in the ``self._files`` dictionary. The values in this dictionary may be ``None``, to indicate that the file is not cacheable and needs to be retrieved in a special way. This special way must be defined in this method of sub-classes. The value may also be a string, which indicates that it is a real file accessible via ``open``. :type mode: str :param mode: The mode in which to re-open the file (if it is closed). """ if fname not in self._files: raise FileNotInProjectError(fname) rfile = self._files[fname] if isinstance(rfile, six.string_types): rfile = open(rfile, 'rb') # Check that the file is actually open if getattr(rfile, 'closed', False): rfname = fname if not os.path.isfile(rfname): rfname = getattr(rfile, 'name', None) if not rfile or not os.path.isfile(rfname): rfname = getattr(rfile, 'filename', None) if not rfile or not os.path.isfile(rfname): raise IOError('Could not locate file: %s (%s)' % (rfile, fname)) rfile = open(rfname, mode) self._files[fname] = rfile return rfile def get_filename_type(self, fname): """Get the type of file ('src', 'trans', 'tgt') with the given name.""" for ftype in self.TYPE_INFO['lists']: if fname in self.TYPE_INFO['lists'][ftype]: return ftype raise FileNotInProjectError(fname) def get_proj_filename(self, realfname): """Try and find a project file name for the given real file name.""" for fname in self._files: if fname == realfname or self._files[fname] == realfname: return fname raise ValueError('Real file not in project store: %s' % (realfname)) def load(self, *args, **kwargs): """Load the project in some way. Undefined for this (base) class.""" pass def save(self, filename=None, *args, **kwargs): """Save the project in some way. Undefined for this (base) class.""" pass def update_file(self, pfname, infile): """Remove the project file with name ``pfname`` and add the contents from ``infile`` to the project under the same file name. :returns: the results from :meth:`ProjectStore.append_file`. """ ftype = self.get_filename_type(pfname) self.remove_file(pfname) self.append_file(infile, pfname, ftype) def _fix_type_filename(self, ftype, fname): """Strip the path from the filename and prepend the correct prefix.""" path, fname = os.path.split(fname) return self.TYPE_INFO['f_prefix'][ftype] + fname def _generate_settings(self): """@returns A XML string that represents the current settings.""" xml = etree.Element('translationproject') # Add file names to settings XML if self._sourcefiles: sources_el = etree.Element('sources') for fname in self._sourcefiles: src_el = etree.Element('filename') src_el.text = fname sources_el.append(src_el) xml.append(sources_el) if self._transfiles: transfiles_el = etree.Element('transfiles') for fname in self._transfiles: trans_el = etree.Element('filename') trans_el.text = fname transfiles_el.append(trans_el) xml.append(transfiles_el) if self._targetfiles: target_el = etree.Element('targets') for fname in self._targetfiles: tgt_el = etree.Element('filename') tgt_el.text = fname target_el.append(tgt_el) xml.append(target_el) # Add conversion mappings if self.convert_map: conversions_el = etree.Element('conversions') for in_fname, (out_fname, templ_fname) in six.iteritems(self.convert_map): if in_fname not in self._files or out_fname not in self._files: continue conv_el = etree.Element('conv') input_el = etree.Element('input') input_el.text = in_fname conv_el.append(input_el)
from myhdl import * from str_builder import StrBuilder import os import sys class GenWrapperFile(object): '''| | This class is used to generate a python wrapper of a verilog design |________''' def __init__(self): self.module_name = '' self.interface = [] # keeps the order of the declarations self.parameters = [] self.inputs = [] self.outputs = [] def generateWrapperFile(self): '''| | Generate <module_name_wrapper>.py file |________''' print "\nGenerating .py wrapper file." s = StrBuilder() self.genWrapperInterface(s) s += '# Need this in order to work...\n' # We assume that the clock is 'clk'!!!!! s += '@always(clk.posedge)\n' s += 'def pass_thru():\n' s += s.indent() + 'pass\n\n' s.dedent() self.genTheWrapper(s) self.genConvertFunc(s) filename = self.module_name + '_wrp.py' s.write(filename) def genWrapperInterface(self, s): '''| | Generate the interfaces of the wrapper file |________''' s += 'from myhdl import *\n\n' s += 'def ' + self.module_name + '_wrapper(\n' s.indent(5) for i in self.interface: # to preserve the order if i['type'] != 'parameter': s += i['name'] + ',\n' s+= 'INST_NAME = "' + self.module_name.upper() + '",\n' for p in self.parameters: s += p['name'] + ' = ' + p['value'] + ',\n' s -= 2 s += s.noIndent() + '):\n\n' s.dedent(3) def genTheWrapper(self, s, py_name=None): '''| | Generate the wrapper |________''' s += '#---------------------------------------------#\n' s += '# Define the i
nterface to the verilog ip core #\n' s += '#---------------------------------------------#\n' str_name = self.module_name i
f py_name == None else py_name s += str_name + '_wrp.verilog_code = \\' + '\n' if self.parameters != []: s += '"""' + self.module_name + '#(\\n""" + \\' + '\n' for p in self.parameters: s += '""" .' + p["name"] + '($' + p["name"] + '),\\n""" + \\' + '\n' s = s-11 + (s.noIndent() + '\\n""" + \\' + '\n') s += '""" ) $INST_NAME (\\n""" + \\' + '\n' else: s += '"""' + self.module_name + ' $INST_NAME (\\n""" + \\' + '\n' for i in self.interface: if i["type"] != "parameter": s += '""" .' + i["name"] + '($' + i["name"] + '),\\n""" + \\' + '\n' s = s-11 + (s.noIndent() + '\\n""" + \\' + '\n') s += '""");"""\n\n' s += '#-------------------------------------------------------#\n' s += '# output, needed when converting the wrapper to verilog #\n' s += '#-------------------------------------------------------#\n' for o in self.outputs: s += o["name"] + '.driven = "wire"\n' s += '\n' s += 'return pass_thru\n\n\n' def genConvertFunc(self, s): '''| | Generate function convert() |________''' s += s.noIndent() + 'def convert():\n\n' for i in self.parameters: s += i['name'] + ' = ' + i['value'] + '\n' s += '\n' # Declare signals for i in self.interface: if i['type'] != 'parameter': x = i["size"] stype = 'bool(0)' if x.startswith('['): stype = 'intbv(0)' x = x.replace(":0", "+1:") s += i['name'] + '= Signal(' + stype + x + ')\n' s += '\n' s += 'toVerilog(' + self.module_name + '_wrapper,\n' s.indent(2) for i in self.interface: if i['type'] != 'parameter': s += i['name'] + ' = ' + i['name'] + ',\n' for p in self.parameters: s += p['name'] + ' = ' + p['name'] + ',\n' s = s-2 + (s.noIndent() + ' )\n\n\n') s.dedent(4) s += 'if __name__ == "__main__":\n' s += s.indent() + 'convert()\n' def initialize(self, filename): '''| | Initialize the GenWrapperFile object |________''' with open(filename) as f: for line_number, line in enumerate(f): w_list = line.split() if w_list != []: if w_list[0]=='module': self.module_name = w_list[1] elif w_list[0] == 'parameter': name = w_list[1].replace(',','') value = w_list[3].replace(',','') self.parameters.append( {'name':name, 'value':value}) self.interface.append( {'name':name, 'value':value, 'type':w_list[0]}) elif w_list[0] == 'input' or w_list[0] == 'output': name = w_list[3] if w_list[2].startswith('[') else w_list[2] size = w_list[2] if w_list[2].startswith('[') else '' if w_list[0] == 'input': self.inputs.append( {'name':name.replace(',',''), 'size':size}) elif w_list[0] == 'output': self.outputs.append({'name':name.replace(',',''), 'size':size}) self.interface.append( {'name':name.replace(',',''), 'size':size, 'type':w_list[0]}) elif w_list[0] == ');': break def main( args ): gwf = GenWrapperFile() gwf.initialize(args.file_name) gwf.generateWrapperFile() import argparse if __name__ == "__main__": parser = argparse.ArgumentParser(description='Create a myhdl wrapper file.') parser.add_argument('-f', '--file', dest='file_name', default="", help='top-level verilog (.v) file') args = parser.parse_args() main( args )
# encoding: utf8 from django.db import models, migrations class Migration(migrations.Migration): dependencies = [ ('letter_
to_editor', '0004_company_newspaper_webcache_wikipediapage'), ] operations = [ migrations.AddField( model_name='newspaper', name='sister_newspapers', field=models.ForeignKey(to='letter_to_editor.Newspaper', to_field='newspaper_name')
, preserve_default=True, ), ]
import itertools import pickle import numpy as np from numpy.testing import assert_array_almost_equal import pytest from scipy.spatial.distance import cdist from sklearn.neighbors import DistanceMetric from sklearn.neighbors import BallTree from sklearn.utils import check_random_state from sklearn.utils._testing import create_memmap_backed_data from sklearn.utils.fixes import sp_version, parse_version def dist_func(x1, x2, p): return np.sum((x1 - x2) ** p) ** (1.0 / p) rng = check_random_state(0) d = 4 n1 = 20 n2 = 25 X1 = rng.random_sample((n1, d)).astype("float64", copy=False) X2 = rng.random_sample((n2, d)).astype("float64", copy=False) [X1_mmap, X2_mmap] = create_memmap_backed_data([X1, X2]) # make boolean arrays: ones and zeros X1_bool = X1.round(0) X2_bool = X2.round(0) [X1_bool_mmap, X2_bool_mmap] = create_memmap_backed_data([X1_bool, X2_bool]) V = rng.random_sample((d, d)) VI = np.dot(V, V.T) BOOL_METRICS = [ "matching", "jaccard", "dice", "kulsinski", "rogerstanimoto", "russellrao", "sokalmichener", "sokalsneath", ] METRICS_DEFAULT_PARAMS = { "euclidean": {}, "cityblock": {}, "minkowski": dict(p=(1, 1.5, 2, 3)), "chebyshev": {}, "seuclidean": dict(V=(rng.random_sample(d),)), "wminkowski": dict(p=(1, 1.5, 3), w=(rng.random_sample(d),)), "mahalanobis": dict(VI=(VI,)), "hamming": {}, "canberra": {}, "braycurtis": {}, } @pytest.mark.parametrize("metric", METRICS_DEFAULT_PARAMS) @pytest.mark.parametrize("X1, X2", [(X1, X2), (X1_mmap, X2_mmap)]) def test_cdist(metric, X1, X2): argdict = METRICS_DEFAULT_PARAMS[metric] keys = argdict.keys() for vals in itertools.product(*argdict.values()): kwargs = dict(zip(keys, vals)) if metric == "mahalanobis": # See: https://github.com/scipy/scipy/issues/13861 pytest.xfail("scipy#13861: cdist with 'mahalanobis' fails onmemmap data") elif metric == "wminkowski": if sp_version >= parse_version("1.8.0"): pytest.skip("wminkowski will be removed in SciPy 1.8.0") # wminkoski is deprecated in SciPy 1.6.0 and removed in 1.8.0 ExceptionToAssert = None if sp_version >= parse_version("1.6.0"): ExceptionToAssert = DeprecationWarning with pytest.warns(ExceptionToAssert): D_true = cdist(X1, X2, metric, **kwargs) else: D_true = cdist(X1, X2, metric, **kwargs) check_cdist(metric, kwargs, D_true) @pytest.mark.parametrize("metric", BOOL_METRICS) @pytest.mark.parametrize( "X1_bool, X2_bool", [(X1_bool, X2_bool), (X1_bool_mmap, X2_bool_mmap)] ) def test_cdist_bool_metric(metric, X1_bool, X2_bool): D_true = cdist(X1_bool, X2_bool, metric) check_cdist_bool(metric, D_true) def check_cdist(metric, kwargs, D_true): dm = DistanceMetric.get_metric(metric, **kwargs) D12 = dm.pairwise(X1, X2) assert_array_almost_equal(D12, D_true) def check_cdist_bool(metric, D_true): dm = DistanceMetric.get_metric(metric) D12 = dm.pairwise(X1_bool, X2_bool) assert_array_almost_equal(D12, D_true) @pytest.mark.parametrize("metric", METRICS_DEFAULT_PARAMS) @pytest.mark.parametrize("X1, X2", [(X1, X2), (X1_mmap, X2_mmap)]) def test_pdist(metric, X1, X2): argdict = METRICS_DEFAULT_PARAMS[metric] keys = argdict.keys() for vals in itertools.product(*argdict.values()): kwargs = dict(zip(keys, vals)) if metric == "mahalanobis": # See: https://github.com/scipy/scipy/issues/13861 pytest.xfail("scipy#13861: pdist with 'mahalanobis' fails onmemmap data") elif metric == "wminkowski": if sp_version >= parse_version("1.8.0"): pytest.skip("wminkowski will be removed in SciPy 1.8.0") # wminkoski is deprecated in SciPy 1.6.0 and removed in 1.8.0 ExceptionToAssert = None if sp_version >= parse_version("1.6.0"): ExceptionToAssert = DeprecationWarning with pytest.warns(ExceptionToAssert): D_true = cdist(X1, X1, metric, **kwargs) else: D_true = cdist(X1, X1, metric, **kwargs) check_pdist(metric, kwargs, D_true) @pytest.mark.parametrize("metric", BOOL_METRICS) @pytest.mark.parametrize("X1_bool", [X1_bool, X1_bool_mmap]) def test_pdist_bool_metrics(metric, X1_bool): D_true = cdist(X1_bool, X1_bool, metric) check_pdist_bool(metric, D_true) def check_pdist(metric, kwargs, D_true): dm = DistanceMetric.get_metric(metric, **kwargs) D12 = dm.pairwise(X1) assert_array_almost_equal(D12, D_true) def check_pdist_bool(metric, D_true): dm = DistanceMetric.get_metric(metric) D12 = dm.pairwise(X1_bool) # Based on https://github.com/scipy/scipy/pull/7373 # When comparing two all-zero vectors, scipy>=1.2.0 jaccard metric # was changed to return 0, instead of nan. if metric == "jaccard" and sp_version < parse_version("1.2.0"): D_true[np.isnan(D_true)] = 0 assert_array_almost_equal(D12, D_true) @pytest.mark.parametrize("metric", METRICS_DEFAULT_PARAMS) def test_pickle(metric): argdict = METRICS_DEFAULT_PARAMS[metric] keys = argdict.keys() for vals in itertools.product(*argdict.values()): kwargs = dict(zip(keys, vals)) check_pickle(metric, kwargs) @pytest.mark.parametrize("metric", BOOL_METRICS) @pytest.mark.parametrize("X1_bool", [X1_bool, X1_bool_mmap]) def test_pickle_bool_metrics(metric, X1_bool): dm = DistanceMetric.get_metric(metric) D1 = dm.pairwise(X1_bool) dm2 = pickle.loads(pickle.dumps(dm)) D2 = dm2.pairwise(X1_bool) assert_array_almost_equal(D1, D2) def check_pickle(metric, kwargs): dm = DistanceMetric.get_metric(metric, **kwargs) D1 = dm.pairwise(X1) dm2 = pickle.loads(pickle.dumps(dm)) D2 = dm2.pairwise(X1) assert_array_almost_equal(D1, D2) def test_haversine_metric(): def haversine_slow(x1, x2): return 2 * np.arcsin( np.sqrt( np.sin(0.5 * (x1[0] - x2[0])) ** 2 + np.cos(x1[0]) * np.cos(x2[0]) * np.sin(0.5 * (x1[1] - x2[1])) ** 2 ) ) X = np.random.random((10, 2)) haversine = DistanceMetric.get_metric("haversine") D1 = haversine.pairwise(X) D2 = np.zeros_like(D1) for i, x1 in enumerate(X): for j, x2 in enumerate(X): D2[i, j] = haversine_slow(x1, x2) assert_array_almost_equal(D1, D2) assert_array_almost_equal(haversine.dist_to_rdist(D1), np.sin(0.5 * D2) ** 2) def test_pyfunc_metric(): X = np.random.random((10, 3)) euclidean = DistanceMetric.get_metric("euclidean") pyfunc = DistanceMetric.get_metric("pyfunc", func=dist_func, p=2) # Check if both callable metric and predefined metric initialized # DistanceMetric object is picklable euclidean_pkl = pickle.loads(pickle.dumps(euclidean)) pyfunc_pkl = pickle.loads(pickle.dumps(pyfunc)) D1 = euclidean.pairwise(X) D2 = pyfunc.pairwise(X) D1_pkl = euclidean_pkl.pairwise(X) D2_pkl = pyfunc_pkl.pairwise(X) assert_array_almost_equal(D1, D2) assert_array_almost_equal(D1_pkl, D2_pkl) def test_bad_pyfunc_metric(): def wrong_distance(x, y): return "1" X = np.ones((5, 2)) msg = "Custom distance function must accept two vectors" with pytest.raises(TypeError, match=msg): BallTree(X, metric=wrong_distance) def test_input_data_size(): # Regression test for #6288 # Previously, a metric requiring a particular input dimension would fail def custom_metric(x, y): assert x.shape[0] == 3 return np.sum((x - y) ** 2) rng
= check_random_state(0) X = rng.rand(10, 3) pyfunc = DistanceMetric.get_metric("pyfunc", func=custom_metric) eucl = DistanceMetric.get_metric("euclidean") asser
t_array_almost_equal(pyfunc.pairwise(X), eucl.pairwise(X) ** 2)
#!/usr/bin/python3 import exhibition import inputdevice import data from levels import level1 import os import pygame import logging log = logging.getLogger(__name__) class Engine: """ Main class responsible for running the game. Controls game setup and runs the main loop. Passes input to game and handles the event queue. """ def __init__(self): """ Creates the display surface and loads the game assets. """ pygame.init() log.info("Initializing display surface at {}x{}".format( data.SCREEN_RESOLUTION[0], data.SCREEN_RESOLUTION[1])) self.screen = pygame.display.set_mode(data.SCREEN_RESOLUTION) pygame.display.set_caption("digital heist") # load image resources exhibition.images(os.path.join(data.DATA_DIR, "images"))
exhibi
tion.optimize() self.level = level1.Level1() self.input = inputdevice.KeyboardInput() def run(self): """ Starts the game and runs the main game loop. """ self.main_loop() pygame.quit() def main_loop(self): clock = pygame.time.Clock() while True: for event in pygame.event.get(): if event.type == pygame.QUIT: return if event.type == pygame.KEYUP: if event.key == pygame.K_ESCAPE: return # game update self.input.update() self.level.process_input(self.input) complete = self.level.update() self.screen.fill((0, 0, 0)) self.level.render() pygame.display.flip() # noinspection PyUnusedLocal,PyUnusedLocal ms = clock.tick(60) if complete: break
# Copyright 2018 The Exoplanet ML Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Functions for computing evaluation metrics.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import tensorflow as tf def _metric_variable(name, shape, dtype): """Creates a Variable in LOCAL_VARIABLES and METRIC_VARIABLES collections.""" return tf.Variable( initial_value=tf.zeros(shape, dtype), trainable=False, collections=[tf.GraphKeys.LOCAL_VARIABLES, tf.GraphKeys.METRIC_VARIABLES], name=name) def _build_metrics(labels, predictions, weights, batch_losses, output_dim=1): """Builds TensorFlow operations to compute model evaluation metrics. Args: labels: Tensor with shape [batch_size]. predictions: Tensor with shape [batch_size, output_dim]. weights: Tensor with shape [batch_size]. batch_losses: Tensor with shape [batch_size]. output_dim: Dimension of model output Returns: A dictionary {metric_name: (metric_value, update_op). """ # Compute the predicted labels. assert len(predictions.shape) == 2 binary_classification = output_dim == 1 if binary_classification: assert predictions.shape[1] == 1 predictions = tf.squeeze(predictions, axis=[1]) predicted_labels = tf.cast( tf.greater(predictions, 0.5), tf.int32, name="predicted_labels") else: predicted_labels = tf.argmax( predictions, 1, name="predicted_labels", output_type=tf.int32) metrics = {} with tf.name_scope("metrics"): # Total number of examples. num_examples = _metric_variable("num_examples", [], tf.float32) update_num_examples = tf.assign_add(num_examples, tf.reduce_sum(weights)) metrics["num_examples"] = (num_examples.read_value(), update_num_examples) # Accuracy metrics. num_correct = _metric_variable("num_correct", [], tf.float32) is_correct = tf.equal(labels, predicted_labels) weighted_is_correct = weights * tf.cast(is_correct, tf.float32) update_num_correct = tf.assign_add(num_correct, tf.reduce_sum(weighted_is_correct)) metrics["accuracy/num_correct"] = (num_correct.read_value(), update_num_correct) accuracy = tf.div(num_correct, num_examples, name="accuracy") metrics["accuracy/accuracy"] = (accuracy, tf.no_op
()) # Weighted cross-entropy loss. metrics["losses/weighted_cross_entropy"] = tf.metrics.mean( batch_losses, weights=weights, name="cross_entropy_loss") def _count_condition(name, labels_value, predicted_value): """Creates a counter for given values of predictions and labels.""" count = _metric_variable(name, [], tf.float32) is_equal = tf.logical_and( tf.equal(labels, labels_value),
tf.equal(predicted_labels, predicted_value)) weighted_is_equal = weights * tf.cast(is_equal, tf.float32) update_op = tf.assign_add(count, tf.reduce_sum(weighted_is_equal)) return count.read_value(), update_op # Confusion matrix metrics. num_labels = 2 if binary_classification else output_dim for gold_label in range(num_labels): for pred_label in range(num_labels): metric_name = "confusion_matrix/label_{}_pred_{}".format( gold_label, pred_label) metrics[metric_name] = _count_condition( metric_name, labels_value=gold_label, predicted_value=pred_label) # Possibly create AUC metric for binary classification. if binary_classification: labels = tf.cast(labels, dtype=tf.bool) metrics["auc"] = tf.metrics.auc( labels, predictions, weights=weights, num_thresholds=1000) return metrics def create_metric_fn(model): """Creates a tuple (metric_fn, metric_fn_inputs). This function is primarily used for creating a TPUEstimator. The result of calling metric_fn(**metric_fn_inputs) is a dictionary {metric_name: (metric_value, update_op)}. Args: model: Instance of AstroModel. Returns: A tuple (metric_fn, metric_fn_inputs). """ weights = model.weights if weights is None: weights = tf.ones_like(model.labels, dtype=tf.float32) metric_fn_inputs = { "labels": model.labels, "predictions": model.predictions, "weights": weights, "batch_losses": model.batch_losses, } def metric_fn(labels, predictions, weights, batch_losses): return _build_metrics( labels, predictions, weights, batch_losses, output_dim=model.hparams.output_dim) return metric_fn, metric_fn_inputs def create_metrics(model): """Creates a dictionary {metric_name: (metric_value, update_op)}. This function is primarily used for creating an Estimator. Args: model: Instance of AstroModel. Returns: A dictionary {metric_name: (metric_value, update_op). """ metric_fn, metric_fn_inputs = create_metric_fn(model) return metric_fn(**metric_fn_inputs)
weakened, flagged = set(), set() infected = {(i,j) for i,a in enu
merate(open('22.in')) for j,b in enumerate(a.strip('\n')) if b=='#'} s = len(open('22.in').readlines())/2 p = (s,s) total = 0 d = (-1,0) for _ in xrange(10**7): if p in infected: d = d[1], -1*d[0] infected.remove(p) flagged.ad
d(p) elif p in weakened: total += 1 weakened.remove(p) infected.add(p) elif p in flagged: d = -1*d[0], -1*d[1] flagged.remove(p) else: d = -1*d[1], d[0] weakened.add(p) p = p[0]+d[0], p[1]+d[1] print total
from oscarbluelight.ba
sket_utils import BluelightLineOfferConsumer a
s LineOfferConsumer __all__ = [ "LineOfferConsumer", ]
# -*- coding: utf-8 -*- from south.utils import datetime_utils as datetime from south.db import db from south.v2 import SchemaMigration from django.db import models class Migration(SchemaMigration): def forwards(self, orm): # Adding model 'Feedback' db.create_table('feedback_form_feedback', ( ('id', self.gf('django.db.models.fields.AutoField')(primary_key=True)), ('user', self.gf('django.db.models.fields.related.ForeignKey')(to=orm['auth.User'], null=True)), ('name', self.gf('django.db.models.fields.CharField')(max_length=100)), ('email', self.gf('django.db.models.fields.EmailField')(max_length=75)), ('body', self.gf('django.db.models.fields.TextField')()), ('sent_time', self.gf('django.db.models.fields.DateTimeField')(auto_now_add=True, blank=True)), )) db.send_create_signal('feedback_form', ['Feedback']) def backwards(self, orm): # Deleting model 'Feedback' db.delete_table('feedback_form_feedback') models = { 'auth.group': { 'Meta': {'object_name': 'Group'}, 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, 'auth.permission': { 'Meta': {'ordering': "('content_type__app_label', 'content_type__model', 'codename')", 'unique_together': "(('content_type', 'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['contenttypes.ContentType']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, 'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) }, 'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"},
'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) },
'feedback_form.feedback': { 'Meta': {'object_name': 'Feedback'}, 'body': ('django.db.models.fields.TextField', [], {}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'sent_time': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}), 'user': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']", 'null': 'True'}) } } complete_apps = ['feedback_form']
# -*- coding: utf-8 -*- import re from mobify.source import MobifySource class OReillySource(MobifySource): HEADER = u""" <h1>{title}</h1> <p><strong>{lead}</strong></p> <p><small>{author} @ oreilly.com</small><br></p> """ @staticmethod def is_my_url(url): # https://www.ore
illy.com/ideas/the-evolution-of-devops return 'oreilly.com/ideas/' in url def get_inner_html(self): article = self.xpath('//*[@itemprop="articleBody"]') xpaths = [ 'aside', 'div', 'figure[@class]', ] # clean up the HTML article = self.remove_nodes(article, xpaths) html = self.get_node_html(article)
return html def get_html(self): # add a title and a footer return '\n'.join([ self.HEADER.format(title=self.get_title(), author=self.get_author(), lead=self.get_lead()).strip(), self.get_inner_html() ]).strip() def get_title(self): # <meta property="og:title" content="Radio w Poznaniu rozpoczęło nadawanie 90 lat temu" /> return self.get_node('//meta[@property="og:title"]', attr='content').strip() def get_lead(self): # <meta property="og:description" content="90 lat temu, 24 kwietnia 1927 roku nadawanie rozpoczęła..." /> lead = self.get_node('//meta[@property="og:description"]', attr='content').strip() return lead.strip() if lead else '' def get_author(self): return self.get_node('//meta[@property="article:author"]', attr='content').strip() def get_language(self): return 'en'
generating PDIP models in X3D format # # from https://bitbucket.org/hyOzd/freecad-macros # author hyOzd # This is a # Dimensions are from Microchips Packaging Specification document: # DS00000049BY. Body drawing is the same as QFP generator# ## requirements ## cadquery FreeCAD plugin ## https://github.com/jmwright/cadquery-freecad-module ## to run the script just do: freecad main_generator.py modelName ## e.g. c:\freecad\bin\freecad main_generator.py DIP8 ## the script will generate STEP and VRML parametric models ## to be used with kicad StepUp script #* These are a FreeCAD & cadquery tools * #* to export generated models in STEP & VRML format. * #* * #* cadquery script for generating QFP/SOIC/SSOP/TSSOP models in STEP AP214 * #* Copyright (c) 2015 * #* Maurice https://launchpad.net/~easyw * #* All trademarks within this guide belong to their legitimate owners. * #* * #* This program is free software; you can redistribute it and/or modify * #* it under the terms of the GNU Lesser General Public License (LGPL) * #* as published by the Free Software Foundation; either version 2 of * #* the License, or (at your option) any later version. * #* for detail see the LICENCE text file. * #* * #* This program is distributed in the hope that it will be useful, * #* but WITHOUT ANY WARRANTY; without even the implied warranty of * #* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * #* GNU Library General Public License for more details. * #* * #* You should have received a copy of the GNU Library General Public * #* License along with this program; if not, write to the Free Software * #* Foundation, Inc., * #* 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA * #* * #**************************************************************************** __title__ = "make Valve 3D models" __author__ = "Stefan, based on Valve script" __Comment__ = 'make varistor 3D models exported to STEP and VRML for Kicad StepUP script' ___ver___ = "1.3.3 14/08/2015" # maui import cadquery as cq # maui from Helpers import show from collections import namedtuple import math import sys, os import datetime from datetime import datetime sys.path.append("../_tools") import exportPartToVRML as expVRML import shaderColors # maui start import FreeCAD, Draft, FreeCADGui import ImportGui import FreeCADGui as Gui #from Gui.Command import * outdir=os.path.dirname(os.path.realpath(__file__) + os.sep + '..' + os.sep + '_3Dmodels') scriptdir=os.path.dirname(os.path.realpath(__file__)) sys.path.append(outdir) sys.path.append(scriptdir) if FreeCAD.GuiUp: from PySide import QtCore, QtGui # Licence information of the generated models. ################################################################################################# STR_licAuthor = "kicad StepUp" STR_licEmail = "ksu" STR_licOrgSys = "kicad StepUp" STR_licPreProc = "OCC" STR_licOrg = "FreeCAD" #############################################################################
#################### import cq_belfuse # modules parameters from cq_belfuse import * import cq_keystone # modules parameters from cq_keystone import * import cq_bulgin # modules parameters from cq_bulgin import * import cq_schurter # modules parameters from cq_schurter import * import cq_tme # modul
es parameters from cq_tme import * import cq_littlefuse # modules parameters from cq_littlefuse import * different_models = [ cq_belfuse(), cq_keystone(), cq_bulgin(), cq_schurter(), cq_tme(), cq_littlefuse(), ] def make_3D_model(models_dir, model_class, modelID): LIST_license = ["",] CheckedmodelName = 'A_' + modelID.replace('.', '').replace('-', '_').replace('(', '').replace(')', '') CheckedmodelName = CheckedmodelName Newdoc = App.newDocument(CheckedmodelName) App.setActiveDocument(CheckedmodelName) Gui.ActiveDocument=Gui.getDocument(CheckedmodelName) destination_dir = model_class.get_dest_3D_dir(modelID) material_substitutions = model_class.make_3D_model(modelID) modelName = model_class.get_model_name(modelID) doc = FreeCAD.ActiveDocument doc.Label = CheckedmodelName objs=GetListOfObjects(FreeCAD, doc) objs[0].Label = CheckedmodelName restore_Main_Tools() script_dir=os.path.dirname(os.path.realpath(__file__)) expVRML.say(models_dir) out_dir=models_dir+os.sep+destination_dir if not os.path.exists(out_dir): os.makedirs(out_dir) exportSTEP(doc, modelName, out_dir) if LIST_license[0]=="": LIST_license=Lic.LIST_int_license LIST_license.append("") Lic.addLicenseToStep(out_dir + os.sep, modelName+".step", LIST_license,\ STR_licAuthor, STR_licEmail, STR_licOrgSys, STR_licOrg, STR_licPreProc) # scale and export Vrml model scale=1/2.54 #exportVRML(doc,modelName,scale,out_dir) del objs objs=GetListOfObjects(FreeCAD, doc) expVRML.say("######################################################################") expVRML.say(objs) expVRML.say("######################################################################") export_objects, used_color_keys = expVRML.determineColors(Gui, objs, material_substitutions) export_file_name=out_dir+os.sep+modelName+'.wrl' colored_meshes = expVRML.getColoredMesh(Gui, export_objects , scale) #expVRML.writeVRMLFile(colored_meshes, export_file_name, used_color_keys)# , LIST_license expVRML.writeVRMLFile(colored_meshes, export_file_name, used_color_keys, LIST_license) #scale=0.3937001 #exportVRML(doc,modelName,scale,out_dir) # Save the doc in Native FC format saveFCdoc(App, Gui, doc, modelName,out_dir) #display BBox Gui.activateWorkbench("PartWorkbench") Gui.SendMsgToActiveView("ViewFit") Gui.activeDocument().activeView().viewAxometric() #FreeCADGui.ActiveDocument.activeObject.BoundingBox = True def run(): ## # get variant names from command line return #import step_license as L import add_license as Lic # when run from command line if __name__ == "__main__" or __name__ == "main_generator": FreeCAD.Console.PrintMessage('\r\nRunning...\r\n') full_path=os.path.realpath(__file__) expVRML.say(full_path) scriptdir=os.path.dirname(os.path.realpath(__file__)) expVRML.say(scriptdir) sub_path = full_path.split(scriptdir) expVRML.say(sub_path) sub_dir_name =full_path.split(os.sep)[-2] expVRML.say(sub_dir_name) sub_path = full_path.split(sub_dir_name)[0] expVRML.say(sub_path) models_dir=sub_path+"_3Dmodels" model_to_build = '' if len(sys.argv) < 3: FreeCAD.Console.PrintMessage('No variant name is given, add a valid model name as an argument or the argument "all"\r\n') sys.exit() else: model_to_build=sys.argv[2] found_one = False if len(model_to_build) > 0: if model_to_build == 'all' or model_to_build == 'All' or model_to_build == 'ALL': found_one = True for n in different_models: listall = n.get_list_all() for i in listall: make_3D_model(models_dir, n, i) elif model_to_build == 'list': found_one = True FreeCAD.Console.PrintMessage('\r\n') for n in different_models: listall = n.get_list_all() for i in listall:
######################################################################### # # Copyright (C) 2012 OpenPlans # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ######################################################################### from django.conf import settings from geonode import get_version from geonode.catalogue import default_catalogue_backend from django.contrib.sites.models import Site from django.core.urlresolvers import reverse from geonode.utils import ogc_server_settings def resource_urls(request): """Global values to pass to templates""" site = Site.objects.get_current() return dict( STATIC_URL=settings.STATIC_URL, GEOSERVER_BASE_URL=ogc_server_settings.pub
lic_url, CATALOGUE_BASE_URL=default_catalogue_backend()['URL'], REGISTRATION_OPEN=settings.REGISTRATION_OPEN, VERSION=get_version(), SITE_NAME=site.name, SITE_DOMAIN=site.domain, GROUPS_APP = True if "geonode.contrib.groups" in settings.INSTALLED_APPS else False, UPLOADER_URL = reverse('data_upload') if getattr(settings, 'UPLOADER', dict()).get('BACKEND', 'geonode.rest') == 'geonode.importer' else reverse('laye
r_upload'), GEOGIT_ENABLED = ogc_server_settings.GEOGIT_ENABLED, TIME_ENABLED = getattr(settings, 'UPLOADER', dict()).get('OPTIONS', dict()).get('TIME_ENABLED', False), DEBUG_STATIC = getattr(settings, "DEBUG_STATIC", False), MF_PRINT_ENABLED = ogc_server_settings.MAPFISH_PRINT_ENABLED, PRINTNG_ENABLED = ogc_server_settings.PRINTNG_ENABLED, GS_SECURITY_ENABLED = ogc_server_settings.GEONODE_SECURITY_ENABLED, PROXY_URL = getattr(settings, 'PROXY_URL', '/proxy/?url='), SOCIAL_BUTTONS = getattr(settings, 'SOCIAL_BUTTONS', True), USE_DOCUMENTS = 'geonode.documents' in settings.INSTALLED_APPS )
# # Copyright (C) 2008 The Android Open Source Project # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import fcntl import re import os import select import sys import subprocess from color import Coloring from command import Command, MirrorSafeCommand _CAN_COLOR = [ 'branch', 'diff', 'grep', 'log', ] class ForallColoring(Coloring): def __init__(self, config): Coloring.__init__(self, config, 'forall') self.project = self.printer('project', attr='bold') class Forall(Command, MirrorSafeCommand): common = False helpSummary = "Run a shell command in each project" helpUsage = """ %prog [<project>...] -c <command> [<arg>...] """ helpDescription = """ Executes the same shell command in each project. Output Formatting ----------------- The -p option causes '%prog' to bind pipes to the command's stdin, stdout and stderr streams, and pipe all output into a continuous stream that is displayed in a single pager session. Project headings are inserted before the output of each command is displayed. If the command produces no output in a project, no heading is displayed. The formatting convention used by -p is very suitable for some types of searching, e.g. `repo forall -p -c git log -SFoo` will print all commits that add or remove references to Foo. The -v option causes '%prog' to display stderr messages if a command produces output only on stderr. Normally the -p option causes command output to be suppressed until the command produces at least one byte of output on stdout. Environment ----------- pwd is the project's working directory. If the current client is a mirror client, then pwd is the Git repository. REPO_PROJECT is set to the unique name of the project. REPO_PATH is the path relative the the root of the client. REPO_REMOTE is the name of the remote system from the manifest. REPO_LREV is the name of the revision from the manifest, translated to a local tracking branch. If you need to pass the manifest revision to a locally executed git command, use REPO_LREV. REPO_RREV is the name of the revision from the manifest, exactly as written in the manifest. shell positional arguments ($1, $2, .., $#) are set to any arguments following <command>. Unless -p is used, stdin, stdout, stderr are inherited from the terminal and are not redirected. """ def _Options(self, p): def cmd(option, opt_str, value, parser): setattr(parser.values, option.dest, list(parser.rargs)) while parser.rargs: del parser.rargs[0] p.add_option('-c', '--command', help='Command (and arguments) to execute', dest='command', action='callback', callback=cmd) g = p.add_option_group('Output') g.add_option('-p', dest='project_header', action='store_true', help='Show project headers before output') g.add_option('-v', '--verbose', dest='verbose', action='store_true', help='Show command error messages') def WantPager(self, opt): return opt.project_header def Execute(self, opt, args): if not opt.command: self.Usage() cmd = [opt.command[0]] shell = True if re.compile(r'^[a-z0-9A-Z_/\.-]+$').match(cmd[0]): shell = False if shell: cmd.append(cmd[0]) cmd.extend(opt.command[1:]) if opt.project_header \ and not shell \ and cmd[0] == 'git': # If this is a direct git command that can enable colorized # output and the user prefers coloring, add --color i
nto the # command line because we are going to wrap the command into # a pipe and git won't know coloring should activate. # for cn in cmd[1:]: if not cn.startswith('-'): break if cn in _CAN_COLOR: class ColorCmd(Coloring): def __init__(self, c
onfig, cmd): Coloring.__init__(self, config, cmd) if ColorCmd(self.manifest.manifestProject.config, cn).is_on: cmd.insert(cmd.index(cn) + 1, '--color') mirror = self.manifest.IsMirror out = ForallColoring(self.manifest.manifestProject.config) out.redirect(sys.stdout) rc = 0 first = True for project in self.GetProjects(args): env = dict(os.environ.iteritems()) def setenv(name, val): if val is None: val = '' env[name] = val setenv('REPO_PROJECT', project.name) setenv('REPO_PATH', project.relpath) setenv('REPO_REMOTE', project.remote.name) setenv('REPO_LREV', project.GetRevisionId()) setenv('REPO_RREV', project.revisionExpr) if mirror: setenv('GIT_DIR', project.gitdir) cwd = project.gitdir else: cwd = project.worktree if not os.path.exists(cwd): if (opt.project_header and opt.verbose) \ or not opt.project_header: print >>sys.stderr, 'skipping %s/' % project.relpath continue if opt.project_header: stdin = subprocess.PIPE stdout = subprocess.PIPE stderr = subprocess.PIPE else: stdin = None stdout = None stderr = None p = subprocess.Popen(cmd, cwd = cwd, shell = shell, env = env, stdin = stdin, stdout = stdout, stderr = stderr) if opt.project_header: class sfd(object): def __init__(self, fd, dest): self.fd = fd self.dest = dest def fileno(self): return self.fd.fileno() empty = True didout = False errbuf = '' p.stdin.close() s_in = [sfd(p.stdout, sys.stdout), sfd(p.stderr, sys.stderr)] for s in s_in: flags = fcntl.fcntl(s.fd, fcntl.F_GETFL) fcntl.fcntl(s.fd, fcntl.F_SETFL, flags | os.O_NONBLOCK) while s_in: in_ready, out_ready, err_ready = select.select(s_in, [], []) for s in in_ready: buf = s.fd.read(4096) if not buf: s.fd.close() s_in.remove(s) continue if not opt.verbose: if s.fd == p.stdout: didout = True else: errbuf += buf continue if empty: if first: first = False else: out.nl() out.project('project %s/', project.relpath) out.nl() out.flush() if errbuf: sys.stderr.write(errbuf) sys.stderr.flush() errbuf = '' empty = False s.dest.write(buf) s.dest.flush() r = p.wait() if r != 0 and r != rc: rc = r if rc != 0: sys.exit(rc)
ePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.widget.sizePolicy().hasHeightForWidth()) self.widget.setSizePolicy(sizePolicy) self.widget.setMaximumSize(QtCore.QSize(16777215, 16777215)) self.widget.setObjectName("widget") self.gridLayout = QtGui.QGridLayout(self.widget) self.gridLayout.setContentsMargins(0, 0, 0, 0) self.gridLayout.setObjectName("gridLayout") self.widget1 = QtGui.QWidget(self.widget) self.widget1.setMaximumSize(QtCore.QSize(500, 16777215)) self.widget1.setObjectName("widget1") self.verticalLayout_3 = QtGui.QVBoxLayout(self.widget1) self.verticalLayout_3.setContentsMargins(0, 0, 0, 0) self.verticalLayout_3.setObjectName("verticalLayout_3") self.verticalLayout = QtGui.QVBoxLayout() self.verticalLayout.setSizeConstraint(QtGui.QLayout.SetDefaultConstraint) self.verticalLayout.setObjectName("verticalLayout") self.tableWidget = QtGui.QTableWidget(self.widget1) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Preferred, QtGui.QSizePolicy.Expanding) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.tableWidget.sizePolicy().hasHeightForWidth()) self.tableWidget.setSizePolicy(sizePolicy) self.tableWidget.setObjectName("tableWidget") self.tableWidget.setColumnCount(2) self.tableWidget.setRowCount(0) item = QtGui.QTableWidgetItem() self.tableWidget.setHorizontalHeaderItem(0, item) item = QtGui.QTableWidgetItem() self.tableWidget.setHorizontalHeaderItem(1, item) self.tableWidget.horizontalHeader().setVisible(True) self.tableWidget.horizontalHeader().setCascadingSectionResizes(False) self.tableWidget.horizontalHeader().setDefaultSectionSize(100) self.verticalLayout.addWidget(self.tableWidget) self.sliceplanegroup = QtGui.QGroupBox(self.widget1) self.sliceplanegroup.setEnabled(False) self.sliceplanegroup.setObjectName("sliceplanegroup") self.horizontalLayout = QtGui.QHBoxLayout(self.sliceplanegroup) self.horizontalLayout.setObjectName("horizontalLayout") self.slicePlaneRadioX = QtGui.QRadioButton(self.sliceplanegroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Fixed, QtGui.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.slicePlaneRadioX.sizePolicy().hasHeightForWidth()) self.slicePlaneRadioX.setSizePolicy(sizePolicy) self.slicePlaneRadioX.setChecked(False) self.slicePlaneRadioX.setObjectName("slicePlaneRadioX") self.horizontalLayout.addWidget(self.slicePlaneRadioX) self.slicePlaneRadioY = QtGui.QRadioButton(self.sliceplanegroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Fixed, QtGui.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.slicePlaneRadioY.sizePolicy().hasHeightForWidth()) self.slicePlaneRadioY.setSizePolicy(sizePolicy) self.slicePlaneRadioY.setChecked(True) self.slicePlaneRadioY.setObjectName("slicePlaneRadioY") self.horizontalLayout.addWidget(self.slicePlaneRadioY) self.slicePlaneRadioZ = QtGui.QRadioButton(self.sliceplanegroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Fixed, QtGui.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.slicePlaneRadioZ.sizePolicy().hasHeightForWidth()) self.slicePlaneRadioZ.setSizePolicy(sizePolicy) self.slicePlaneRadioZ.setObjectName("slicePlaneRadioZ") self.horizontalLayout.addWidget(self.slicePlaneRadioZ) self.verticalLayout.addWidget(self.sliceplanegroup) self.screenshotgroup = QtGui.QGroupBox(self.widget1) self.screenshotgroup.setAlignment(QtCore.Qt.AlignLeading|QtCore.Qt.AlignLeft|QtCore.Qt.AlignVCenter) self.screenshotgroup.setObjectName("screenshotgroup") self.formLayout = QtGui.QFormLayout(self.screenshotgroup) self.formLayout.setFieldGrowthPolicy(QtGui.QFormLayout.AllNonFixedFieldsGrow) self.formLayout.setObjectName("formLayout") self.pixelsXLabel = QtGui.QLabel(self.screenshotgroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Fixed, QtGui.QSizePolicy.Preferred) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.pixelsXLabel.sizePolicy().hasHeightForWidth()) self.pixelsXLabel.setSizePolicy(sizePolicy) self.pixelsXLabel.setObjectName("pixelsXLabel") self.formLayout.setWidget(0, QtGui.QFormLayout.LabelRole, self.pixelsXLabel) self.screenshotPixelXLineEdit = QtGui.QLineEdit(self.screenshotgroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Expanding, QtGui.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.screenshotPixelXLineEdit.sizePolicy().hasHeightForWidth()) self.screenshotPixelXLineEdit.setSizePolicy(sizePolicy) self.screenshotPixelXLineEdit.setObjectName("screenshotPixelXLineEdit") self.formLayout.setWidget(0, QtGui.QFormLayout.FieldRole, self.screenshotPixelXLineEdit) self.pixelsYLabel = QtGui.QLabel(self.screenshotgroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Fixed, QtGui.QSizePolicy.Preferred) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.pixelsYLabel.sizePolicy().hasHeightForWidth()) self.pixelsYLabel.setSizePolicy(sizePolicy) self.pixelsYLabel.setObjectName("pixelsYLabel") self.formLayout.setWidget(1, QtGui.QFormLayout.LabelRole, self.pixelsYLabel) self.screenshotPixelYLineEdit = QtGui.QLineEdit(self.screenshotgroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Expanding, QtGui.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.se
tVerticalStretch(0) sizePolicy.setHeightForWidth(self.screenshotPixelYLineEdit.sizePolicy().hasHeightForWidth()) self.screenshotPixelYLineEdit.setSizePolicy(sizePolicy) self.screenshotPixelYLineEdit.setObjectName("screenshotPixelYLineEdit") self.formLayout.setWidget(1, QtGui.QFormLayout.FieldRol
e, self.screenshotPixelYLineEdit) self.screenshotFilenameLabel = QtGui.QLabel(self.screenshotgroup) self.screenshotFilenameLabel.setObjectName("screenshotFilenameLabel") self.formLayout.setWidget(2, QtGui.QFormLayout.LabelRole, self.screenshotFilenameLabel) self.screenshotFilenameLineEdit = QtGui.QLineEdit(self.screenshotgroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Expanding, QtGui.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.screenshotFilenameLineEdit.sizePolicy().hasHeightForWidth()) self.screenshotFilenameLineEdit.setSizePolicy(sizePolicy) self.screenshotFilenameLineEdit.setObjectName("screenshotFilenameLineEdit") self.formLayout.setWidget(2, QtGui.QFormLayout.FieldRole, self.screenshotFilenameLineEdit) self.screenshotSaveButton = QtGui.QPushButton(self.screenshotgroup) sizePolicy = QtGui.QSizePolicy(QtGui.QSizePolicy.Preferred, QtGui.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.screenshotSaveButton.sizePolicy().hasHeightForWidth()) self.screenshotSaveButton.setSizePolicy(sizePolicy) self.screenshotSaveButton.setObjectName("screenshotSaveButton") self.formLayout.setWidget(3, QtGui.QFormLayout.FieldRole, self.screenshotSaveButton) self.verticalLayout.addWidget(self.scre
# -*- coding: utf-8 -*- # Akvo RSR is covered by the GNU Affero General Public License. # See more details in the license.txt file located at the root folder of the Akvo RSR module. # For additional details on the GNU license please see < http://www.gnu.org/licenses/agpl.html >. from lxml import etree def participating_org(project): """ Generate the participating-org element. :param project: Project object :return: A list of Etree elements """ partnership_elements = [] from akvo.rsr.models import Partnership for partnership in project.partnerships.all(): # Don't include reporting orgs or sponsor partners if partnership.iati_organisation_role in Partnership.IATI_ROLE_LIST[:4] and \ partnership.organisation: org = partnership.organisation.get_original() element = etree.Element("participating-org") if org.iati_org_id: element.attrib['ref'] = org.iati_org_id if org.new_organisation_type: element.attrib['type'] = str(org.new_organisation_type) if partnership.iati_organisation_role: element.attrib['role'] = str(partnership.iati_organisation_role) if partnership.iati_activity_id: element.attrib['activity-id'] = partnership.iati_activity_id # TODO: Funding amount narrative_eleme
nt = etree.SubElement(element, "narrative") if org.long_name: narrative_element.text = org.long_name elif org.name: narrative_element.text = org.name partnership_elements.append(element) r
eturn partnership_elements
- retry_limit (int, optional): Automatic retry count. Default: 0 - engine_version (str, optional): Engine version to be used. If none is specified, the account's default engine version would be set. {"stable", "experimental"} - pool_name (str, optional): For Presto only. Pool name to be used, if not specified, default pool would be used. - result (str, optional): Location where to store the result of the query. e.g. 'tableau://user:password@host.com:1234/datasource' Returns: :class:`datetime.datetime`: Start date time. """ if "cron" not in params: raise ValueError("'cron' option is required") if "query" not in params: raise ValueError("'query' option is required") params = {} if params is None else params return self.api.create_schedule(name, params) def delete_schedule(self, name): """Delete the scheduled query with the specified name. Args: name (str): Target scheduled query name. Returns: (str, str): Tuple of cron and query. """ return self.api.delete_schedule(name) def schedules(self): """Get the list of all the scheduled queries. Returns: [:class:`tdclient.models.Schedule`] """ result = self.api.list_schedules() return [models.Schedule(self, **m) for m in result] def update_schedule(self, name, params=None): """Update the scheduled query. Args: name (str): Target scheduled query name. params (dict): Extra parameters. - type (str): Query type. {"presto", "hive"}. Default: "hive" - database (str): Target database name. - timezone (str): Scheduled query's timezone. e.g. "UTC" For details, see also: https://gist.github.com/frsyuki/4533752 - cron (str, optional): Schedule of the query. {``"@daily"``, ``"@hourly"``, ``"10 * * * *"`` (custom cron)} See also: https://tddocs.atlassian.net/wiki/spaces/PD/pages/1084633/Scheduling+Jobs+Using+TD+Console - delay (int, optional): A delay ensures all buffered events are imported before running the query. Default: 0 - query (str): Is a language used to retrieve, insert, update and modify data. See also: https://tddocs.atlassian.net/wiki/spaces/PD/pages/1084438/SQL+Examples+of+Scheduled+Queries - priority (int, optional): Priority of the query.
Range is from -2 (very low) to 2 (very high). Default: 0 - retry_limit (i
nt, optional): Automatic retry count. Default: 0 - engine_version (str, optional): Engine version to be used. If none is specified, the account's default engine version would be set. {"stable", "experimental"} - pool_name (str, optional): For Presto only. Pool name to be used, if not specified, default pool would be used. - result (str, optional): Location where to store the result of the query. e.g. 'tableau://user:password@host.com:1234/datasource' """ params = {} if params is None else params self.api.update_schedule(name, params) def history(self, name, _from=None, to=None): """Get the history details of the saved query for the past 90days. Args: name (str): Target name of the scheduled query. _from (int, optional): Indicates from which nth record in the run history would be fetched. Default: 0. Note: Count starts from zero. This means that the first record in the list has a count of zero. to (int, optional): Indicates up to which nth record in the run history would be fetched. Default: 20 Returns: [:class:`tdclient.models.ScheduledJob`] """ result = self.api.history(name, _from, to) def scheduled_job(m): ( scheduled_at, job_id, type, status, query, start_at, end_at, result_url, priority, database, ) = m job_param = { "url": None, "debug": None, "start_at": start_at, "end_at": end_at, "cpu_time": None, "result_size": None, "result": None, "result_url": result_url, "hive_result_schema": None, "priority": priority, "retry_limit": None, "org_name": None, "database": database, } return models.ScheduledJob( self, scheduled_at, job_id, type, query, **job_param ) return [scheduled_job(m) for m in result] def run_schedule(self, name, time, num): """Execute the specified query. Args: name (str): Target scheduled query name. time (int): Time in Unix epoch format that would be set as TD_SCHEDULED_TIME num (int): Indicates how many times the query will be executed. Value should be 9 or less. Returns: [:class:`tdclient.models.ScheduledJob`] """ results = self.api.run_schedule(name, time, num) def scheduled_job(m): job_id, type, scheduled_at = m return models.ScheduledJob(self, scheduled_at, job_id, type, None) return [scheduled_job(m) for m in results] def import_data( self, db_name, table_name, format, bytes_or_stream, size, unique_id=None ): """Import data into Treasure Data Service Args: db_name (str): name of a database table_name (str): name of a table format (str): format of data type (e.g. "msgpack.gz") bytes_or_stream (str or file-like): a byte string or a file-like object contains the data size (int): the length of the data unique_id (str): a unique identifier of the data Returns: second in float represents elapsed time to import data """ return self.api.import_data( db_name, table_name, format, bytes_or_stream, size, unique_id=unique_id ) def import_file(self, db_name, table_name, format, file, unique_id=None): """Import data into Treasure Data Service, from an existing file on filesystem. This method will decompress/deserialize records from given file, and then convert it into format acceptable from Treasure Data Service ("msgpack.gz"). Args: db_name (str): name of a database table_name (str): name of a table format (str): format of data type (e.g. "msgpack", "json") file (str or file-like): a name of a file, or a file-like object contains the data unique_id (str): a unique identifier of the data Returns: float represents the elapsed time to import data """ return self.api.import_file( db_name, table_name, format, file, unique_id=unique_id ) def results(self): """Get the list of all the available authentications. Returns: a list of :class:`tdclient.models.Result` """ results = self.api.list_result()
""" API views for badges """ from edx_rest_framework_extensions.auth.session.authentication import SessionAuthenticationAllowInactiveUser from opaque_keys import InvalidKeyError from opaque_keys.edx.django.models import CourseKeyField from opaque_keys.edx.keys import CourseKey from rest_framework import generics from rest_framework.exceptions import APIException from badges.models import BadgeAssertion from openedx.core.djangoapps.user_api.permissions import is_field_shared_factory from openedx.core.lib.api.authentication import OAuth2AuthenticationAllowInactiveUser from .serializers import BadgeAssertionSerializer class InvalidCourseKeyError(APIException): """ Raised the course key given isn't valid. """ status_code = 400 default_detail = "The course key provided was invalid." class UserBadgeAssertions(generics.ListAPIView): """ ** Use cases ** Request a list of assertions for a user, optionally constrained to a course. ** Example Requests ** GET /api/badges/v1/assertions/user/{username}/ ** Response Values ** Body comprised of a list of objects with the following fields: * badge_class: The badge class the assertion was awarded for. Represented as an object with the following fields: * slug: The identifier for the badge class * issuing_component: The software component responsible for issuing this badge. * display_name: The display name of the badge. * course_id: The course key of the course this badge is scoped to, or null if it isn't scoped to a course. * description: A description of the award and its significance. * criteria: A description of what is needed to obtain this award. * image_url: A URL to the icon image used to represent this award. * image_url: The baked assertion image derived from the badge_class icon-- contains metadata about the award in its headers. * assertion_url: The URL to the OpenBadges BadgeAssertion object, for verification by compatible tools and software. ** Params ** * slug (optional): The identifier for a particular badge class to filter by. * issuing_component (optional): The issu
ing component for a particular badge class to filter by (requires slug to have been specified, or this will be ignored.) If slug is provided and this is not, assumes
the issuing_component should be empty. * course_id (optional): Returns assertions that were awarded as part of a particular course. If slug is provided, and this field is not specified, assumes that the target badge has an empty course_id field. '*' may be used to get all badges with the specified slug, issuing_component combination across all courses. ** Returns ** * 200 on success, with a list of Badge Assertion objects. * 403 if a user who does not have permission to masquerade as another user specifies a username other than their own. * 404 if the specified user does not exist { "count": 7, "previous": null, "num_pages": 1, "results": [ { "badge_class": { "slug": "special_award", "issuing_component": "openedx__course", "display_name": "Very Special Award", "course_id": "course-v1:edX+DemoX+Demo_Course", "description": "Awarded for people who did something incredibly special", "criteria": "Do something incredibly special.", "image": "http://example.com/media/badge_classes/badges/special_xdpqpBv_9FYOZwN.png" }, "image_url": "http://badges.example.com/media/issued/cd75b69fc1c979fcc1697c8403da2bdf.png", "assertion_url": "http://badges.example.com/public/assertions/07020647-e772-44dd-98b7-d13d34335ca6" }, ... ] } """ serializer_class = BadgeAssertionSerializer authentication_classes = ( OAuth2AuthenticationAllowInactiveUser, SessionAuthenticationAllowInactiveUser ) permission_classes = (is_field_shared_factory("accomplishments_shared"),) def filter_queryset(self, queryset): """ Return most recent to least recent badge. """ return queryset.order_by('-created') def get_queryset(self): """ Get all badges for the username specified. """ queryset = BadgeAssertion.objects.filter(user__username=self.kwargs['username']) provided_course_id = self.request.query_params.get('course_id') if provided_course_id == '*': # We might want to get all the matching course scoped badges to see how many courses # a user managed to get a specific award on. course_id = None elif provided_course_id: try: course_id = CourseKey.from_string(provided_course_id) except InvalidKeyError: raise InvalidCourseKeyError elif 'slug' not in self.request.query_params: # Need to get all badges for the user. course_id = None else: # Django won't let us use 'None' for querying a ForeignKey field. We have to use this special # 'Empty' value to indicate we're looking only for badges without a course key set. course_id = CourseKeyField.Empty if course_id is not None: queryset = queryset.filter(badge_class__course_id=course_id) if self.request.query_params.get('slug'): queryset = queryset.filter( badge_class__slug=self.request.query_params['slug'], badge_class__issuing_component=self.request.query_params.get('issuing_component', '') ) return queryset
"""Imports for Python API. This file is MACHINE GENERATED! Do not edit. Generated by: tensorflow/tools/api/generator/create_python_api.py script. """ from
tensorflow.python.platform.resource_loader import get_data_files_path from t
ensorflow.python.platform.resource_loader import get_path_to_datafile from tensorflow.python.platform.resource_loader import get_root_dir_with_all_resources from tensorflow.python.platform.resource_loader import load_resource from tensorflow.python.platform.resource_loader import readahead_file_path
import sst import sst.actions # tests for simulate_keys sst.actions.set_base_url('http://localhost:%s/' % sst.DEVSERVER_PORT) sst.actions.go_to('/') sst.actions.assert_title('The Page Title') sst.actions.write_textfield('text_1', 'Foobar..') sst.actions.simulate_keys('text_1', 'BACK_SPACE') sst.actions.simulate_keys('text_1', 'back_space') # not case sensitive sst.actions.simulate_keys('text_1', 'SPACE') sst.actions.simulate_keys('text_1', 'Space') sst.actions.assert_text('text_1', 'Foobar ') # available keys (from selenium/webdriver/c
ommon/keys.py): # # 'NULL' # 'CANCEL' # 'HELP' # 'BACK_SPACE' # 'TAB' # 'CLEAR' # 'RETURN' # 'ENTER' # 'SHIFT' # 'LEFT_SHIFT' # 'CONTROL' # 'LEFT_CONTROL' # 'ALT' # 'LEFT_ALT' # 'PAUSE' # 'ESCAPE' # 'SPACE' # 'PAGE_UP' # 'PAGE_DOWN' # 'END' # 'HOME' # 'LEFT' # 'ARROW_LEFT' # 'UP' # 'ARROW_UP' # 'RIGHT' # 'ARROW_RIGHT' # 'DOWN' # 'ARROW_DOWN' # 'INSERT' # 'DELETE' # 'SEMICOLON' # 'EQUALS' # 'NUMPAD0' # 'NUMPAD1' # 'NUMPAD2' # '
NUMPAD3' # 'NUMPAD4' # 'NUMPAD5' # 'NUMPAD6' # 'NUMPAD7' # 'NUMPAD8' # 'NUMPAD9' # 'MULTIPLY' # 'ADD' # 'SEPARATOR' # 'SUBTRACT' # 'DECIMAL' # 'DIVIDE' # 'F1' # 'F2' # 'F3' # 'F4' # 'F5' # 'F6' # 'F7' # 'F8' # 'F9' # 'F10' # 'F11' # 'F12' # 'META' # 'COMMAND'
# D
O NOT EDIT THIS FILE! # # Python module CosTradingDynamic generated by omniidl import omniORB omniORB.updateModule("CosTradingDynam
ic") # ** 1. Stub files contributing to this module import CosTradingDynamic_idl # ** 2. Sub-modules # ** 3. End
# -*- coding: utf-
8 -*- __author__ = 'massimo' import unittest class UtilTestFunctions(unittest.TestCase): def test_verify_url(self): self.assertTrue(True) if __name__ == "__main__": UtilTestFunctions.main
()
from __future__ import unicode_literals from django.db import models from wagtail.core.models import Site class SystemString(models.Model): DEFAULT_GROUP = 'general' identifier = models.CharField(max_length=1024) string = models.CharField(max_length=1024, blank=True, null=True) group = models.CharField(max_length=255, default=DEFAULT_GROUP) site = models.ForeignKey(Site, on_delete=models.CASCADE) created = models.DateTimeField(auto_now_add=True) updated = models.DateTimeField(null=True, blank=True) accessed = mod
els.DateTimeField(null=True, blank=True)
modified = models.BooleanField(default=False) class Meta: unique_together = ['identifier', 'site', 'group'] def __unicode__(self): return unicode(self.identifier)
""" Siren protocol adapter. See `SIREN specification <https://github.com/kevinswiber/siren>`_. """ from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals from ripozo.adapters import AdapterBase from ripozo.utilities import titlize_endpoint from ripozo.resources.resource_base import create_url from ripozo.resources.constants import input_categories import json import six _CONTENT_TYPE = 'application/vnd.siren+json' class SirenAdapter(AdapterBase): """ An adapter that formats the response in the SIREN format. A description of a SIREN format can be found here: `SIREN specification <https://github.com/kevinswiber/siren>`_ """ formats = [_CONTENT_TYPE, 'siren'] extra_headers = {'Content-Type': _CONTENT_TYPE} @property def formatted_body(self): """ Gets the formatted body of the response in unicode form. If ``self.status_code == 204`` then this will return an empty string. :return: The siren formatted response body :rtype: unicode """ # 204's are supposed to be empty responses if self.status_code == 204: return '' links = self.generate_links() entities = self.get_entities() response = dict(properties=self.resource.properties, actions=self._actions, links=links, entities=entities) # need to do this separately since class is a reserved keyword response['class'] = [self.resource.resource_name] return json.dumps(response) @property def _actions(self): """ Gets the list of actions in an appropriately SIREN format :return: The list of actions :rtype: list """ actions = [] for endpoint, options in six.iteritems(self.resource.endpoint_dictionary()): options = options[0] all_methods = options.get('methods', ('GET',)) meth = all_methods[0] if all_methods else 'GET' base_route = options.get('route', self.resource.base_url) route = create_url(base_route, **self.resource.properties) route = self.combine_base_url_with_resource_url(route) fields = self.generate_fields_for
_endpoint_funct(options.get('endpoint_func')) actn = dict(name=endpoint, title=titlize_endpoint(endpoint), method=meth, href=route, fields=fields) actions.append(actn)
return actions def generate_fields_for_endpoint_funct(self, endpoint_func): """ Returns the action's fields attribute in a SIREN appropriate format. :param apimethod endpoint_func: :return: A dictionary of action fields :rtype: dict """ return_fields = [] fields_method = getattr(endpoint_func, 'fields', None) if not fields_method: return [] fields = fields_method(self.resource.manager) for field in fields: if field.arg_type is input_categories.URL_PARAMS: continue field_dict = dict(name=field.name, type=field.field_type.__name__, location=field.arg_type, required=field.required) return_fields.append(field_dict) return return_fields def generate_links(self): """ Generates the Siren links for the resource. :return: The list of Siren formatted links. :rtype: list """ href = self.combine_base_url_with_resource_url(self.resource.url) links = [dict(rel=['self'], href=href)] for link, link_name, embedded in self.resource.linked_resources: links.append(dict(rel=[link_name], href=self.combine_base_url_with_resource_url(link.url))) return links def get_entities(self): """ Gets a list of related entities in an appropriate SIREN format :return: A list of entities :rtype: list """ entities = [] for resource, name, embedded in self.resource.related_resources: for ent in self.generate_entity(resource, name, embedded): entities.append(ent) return entities def generate_entity(self, resource, name, embedded): """ A generator that yields entities """ if isinstance(resource, list): for res in resource: for ent in self.generate_entity(res, name, embedded): yield ent else: if not resource.has_all_pks: return ent = {'class': [resource.resource_name], 'rel': [name]} resource_url = self.combine_base_url_with_resource_url(resource.url) if not embedded: ent['href'] = resource_url else: ent['properties'] = resource.properties ent['links'] = [dict(rel=['self'], href=resource_url)] yield ent @classmethod def format_exception(cls, exc): """ Takes an exception and appropriately formats it in the siren format. Mostly. It doesn't return a self in this circumstance. :param Exception exc: The exception to format. :return: A tuple containing: response body, format, http response code :rtype: tuple """ status_code = getattr(exc, 'status_code', 500) body = {'class': ['exception', exc.__class__.__name__], 'actions': [], 'entities': [], 'links': [], 'properties': dict(status=status_code, message=six.text_type(exc))} return json.dumps(body), cls.formats[0], status_code @classmethod def format_request(cls, request): """ Simply returns request :param RequestContainer request: The request to handler :rtype: RequestContainer """ return request
from PyQt4 import QtCore from PyQt4 import QtGui from Action import Speech from UI.ActionPushButton import ActionPushButton class BaseStudy(QtGui.QWidget): def __init__(self): super(BaseStudy, self).__init__() self._actionQueue = None self._nao = None self._widgets = None self._buttons = None #END __init__() def LEDActive(self): if self._nao is not None: self._nao.LEDrandomEyes(1.0, True) #END if #END LEDActive() def LEDNormal(self): if self._nao is not None: self._nao.LEDNormal() #END if #END LEDNormal() def setActionQueue(self, actionQueue): self._actionQueue = actionQueue #END setActionQueue() def setNao(self, nao): if self._nao is not None: self._nao.connected.disconnect(self.on_nao_connected) self._nao.disconnected.disconnect(self.on_nao_disconnected) #END if self._nao = nao if self._nao is not None: self._nao.connected.connect(self.on_nao_connected) self._nao.disconnected.connect(self.on_nao_disconnected) #END if #END setNao() def speech(self, txt, speed, shaping): return None #END speech() def on_button_clicked(self): if self._actionQueue is not None: self._actionQueue.addActions(self.sender().getRobotActions()) #END if #END on_button_clicked() def on_nao_connected(self): pass #END on_nao_connected() def on_nao_disconnected(self): pass #END on_nao_disconnected() def on_runSpeech_clicked(self): if self._actionQueue is not None: self._actionQueue.addActions(self.sender().getRobotActions()) #END if #END on_runSpeech_clicked() def _setupUi(self, general_panel = True, custom_widget = None): wgtGeneral = None if general_panel: wgtGeneral = QtGui.QWidget() wgtGeneral.setMaximumHeight(80) wgtGeneral.setMinimumHeight(80) ################################################## # General Speech ################################################## self._speechs = [ ActionPushButton(None, "Hello", Speech("Hello")), ActionPushButton(None, "Thanks", Speech("Thank you")), ActionPushButton(None, "Sorry", Speech("I'm sorry")), ActionPushButton(None, "Good", Speech("Good!")), ActionPushButton(None, "Okay", Speech("Okay")), ActionPushButton(None, "Yes", Speech("Yes")), ActionPushButton(None, "No", Speech("No")), ActionPushButton(None, "Hmmm", Speech("Heum,")), None, ActionPushButton(None, "Louder", Speech("Please speak louder")), ActionPushButton(None, "Say again?", Speech("Can you say one more time?")), ActionPushButton(None, "Repeat?", Speech("Would you like me to repeat that?")), ActionPushButton(None, "Understood?", Speech("Do you understand?")), ActionPushButton(None, "Don't Understand", Speech("I don't understand")), ActionPushButton(None, "Greeting", Speech("Hello, my name is NAO, nice to meet you")), ActionPushButton(None, "End Experiment", Speech("Thank you for participating in our experiment")), ] self._grpSpeech = QtGui.QGroupBox(wgtGeneral) self._grpSpeech.setTitle("General Speech") layoutSpeech = QtGui.QVBoxLayout(self._grpSpeech) layoutSpeech.setMargin(6)
layoutSpeech.addSpacing(3) widget = QtGui.QWidget(self._grpSpeech) layout = QtGui.QHBoxLayout(widget) layout.setMargin(0) for item in self._speechs: if item is None: layoutSpeech.addWidget(widget)
widget = QtGui.QWidget(self._grpSpeech) layout = QtGui.QHBoxLayout(widget) layout.setMargin(0) else: item.setParent(widget) item.clicked.connect(self.on_runSpeech_clicked) layout.addWidget(item) #END if #END for layoutSpeech.addWidget(widget) #END if wgtButtons = None if self._widgets is not None and self._buttons is not None: wgtButtons = QtGui.QWidget() layout = QtGui.QHBoxLayout(wgtButtons) layout.setMargin(0) for i in range(len(self._widgets)): layoutButtons = QtGui.QVBoxLayout(self._widgets[i]) layoutButtons.setMargin(0) for button in self._buttons[i]: if isinstance(button, ActionPushButton): button.clicked.connect(self.on_button_clicked) #END if layoutButtons.addWidget(button) #END for scroll = QtGui.QScrollArea() scroll.setAlignment(QtCore.Qt.AlignCenter) scroll.setWidget(self._widgets[i]) layoutScroll = QtGui.QHBoxLayout() layoutScroll.setMargin(0) layoutScroll.addWidget(scroll) layout.addLayout(layoutScroll) #END for #END if if wgtGeneral is not None or wgtButtons is not None or custom_widget is not None: splitter = QtGui.QSplitter(self) splitter.setOrientation(QtCore.Qt.Vertical) layout = QtGui.QHBoxLayout(self) layout.setMargin(0) layout.addWidget(splitter) if wgtGeneral is not None: wgtGeneral.setParent(splitter) #END if if wgtButtons is not None: wgtButtons.setParent(splitter) #END if if custom_widget is not None: custom_widget.setParent(splitter) #END if #END if #END _setupUi() #END BaseStudy
# Copyright 2014 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. """ Function/method decorators that provide timeout and retry logic. """ import functools import itertools import sys from devil.android import device_errors from devil.utils import cmd_helper from devil.utils import reraiser_thread from devil.utils import timeout_retry DEFAULT_TIMEOUT_ATTR = '_default_timeout' DEFAULT_RETRIES_ATTR = '_default_retries' def _TimeoutRetryWrapper(f, timeout_func, retries_func, pass_values=False): """ Wraps a funcion with timeout and retry handling logic. Args: f: The function to wrap. timeout_func: A callable that returns the timeout value. retries_func: A callable that returns the retries value. pass_values: If True, passes the values returned by |timeout_func| and |retries_func| to the wrapped function as 'timeout' and 'retries' kwargs, respectively. Returns: The wrapped function. """ @functools.wraps(f) def timeout_retry_wrapper(*args, **kwargs): timeout = timeout_func(*args, **kwargs) retries = retries_func(*args
, **kwargs) if pass_values: kwargs['timeout'] = timeout kwargs['retries'] = retries @functools.wraps(f) def impl(): return f(*args, **kwargs) try: if timeout_retry.CurrentTime
outThreadGroup(): # Don't wrap if there's already an outer timeout thread. return impl() else: desc = '%s(%s)' % (f.__name__, ', '.join(itertools.chain( (str(a) for a in args), ('%s=%s' % (k, str(v)) for k, v in kwargs.iteritems())))) return timeout_retry.Run(impl, timeout, retries, desc=desc) except reraiser_thread.TimeoutError as e: raise device_errors.CommandTimeoutError(str(e)), None, ( sys.exc_info()[2]) except cmd_helper.TimeoutError as e: raise device_errors.CommandTimeoutError(str(e)), None, ( sys.exc_info()[2]) return timeout_retry_wrapper def WithTimeoutAndRetries(f): """A decorator that handles timeouts and retries. 'timeout' and 'retries' kwargs must be passed to the function. Args: f: The function to decorate. Returns: The decorated function. """ get_timeout = lambda *a, **kw: kw['timeout'] get_retries = lambda *a, **kw: kw['retries'] return _TimeoutRetryWrapper(f, get_timeout, get_retries) def WithExplicitTimeoutAndRetries(timeout, retries): """Returns a decorator that handles timeouts and retries. The provided |timeout| and |retries| values are always used. Args: timeout: The number of seconds to wait for the decorated function to return. Always used. retries: The number of times the decorated function should be retried on failure. Always used. Returns: The actual decorator. """ def decorator(f): get_timeout = lambda *a, **kw: timeout get_retries = lambda *a, **kw: retries return _TimeoutRetryWrapper(f, get_timeout, get_retries) return decorator def WithTimeoutAndRetriesDefaults(default_timeout, default_retries): """Returns a decorator that handles timeouts and retries. The provided |default_timeout| and |default_retries| values are used only if timeout and retries values are not provided. Args: default_timeout: The number of seconds to wait for the decorated function to return. Only used if a 'timeout' kwarg is not passed to the decorated function. default_retries: The number of times the decorated function should be retried on failure. Only used if a 'retries' kwarg is not passed to the decorated function. Returns: The actual decorator. """ def decorator(f): get_timeout = lambda *a, **kw: kw.get('timeout', default_timeout) get_retries = lambda *a, **kw: kw.get('retries', default_retries) return _TimeoutRetryWrapper(f, get_timeout, get_retries, pass_values=True) return decorator def WithTimeoutAndRetriesFromInstance( default_timeout_name=DEFAULT_TIMEOUT_ATTR, default_retries_name=DEFAULT_RETRIES_ATTR, min_default_timeout=None): """Returns a decorator that handles timeouts and retries. The provided |default_timeout_name| and |default_retries_name| are used to get the default timeout value and the default retries value from the object instance if timeout and retries values are not provided. Note that this should only be used to decorate methods, not functions. Args: default_timeout_name: The name of the default timeout attribute of the instance. default_retries_name: The name of the default retries attribute of the instance. min_timeout: Miniumum timeout to be used when using instance timeout. Returns: The actual decorator. """ def decorator(f): def get_timeout(inst, *_args, **kwargs): ret = getattr(inst, default_timeout_name) if min_default_timeout is not None: ret = max(min_default_timeout, ret) return kwargs.get('timeout', ret) def get_retries(inst, *_args, **kwargs): return kwargs.get('retries', getattr(inst, default_retries_name)) return _TimeoutRetryWrapper(f, get_timeout, get_retries, pass_values=True) return decorator
# -*- coding: utf-8 -*- """ Django settings for blog project. Generated by 'django-admin startproject' using Django 1.11.4. For more information on this file, see https://docs.djangoproject.com/en/1.11/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/1.11/ref/settings/ """ import os # Build paths inside the project like this: os.path.join(BASE_DIR, ...) BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__))) # Quick-start development settings - unsuitable for production # See https://docs.djangoproject.com/en/1.11/howto/deployment/checklist/ # SECURITY WARNING: keep the secret key used in production secret! SECRET_KEY = '2y8c!z@9!s%(0=epe+2n3k8+_!$vg--xz^3p4rs)6ov)c^2a*t' # SECURITY WARNING: don't run with debug turned on in production! DEBUG = True ALLOWED_HOSTS = ['*'] # Application definition INSTALLED_APPS = [ 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', 'blogadmin', 'DjangoUeditor', ] MIDDLEWARE = [ 'django.middleware.security.SecurityMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', ] ROOT_URLCONF = 'blog.urls' TEMPLATES = [ { 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': [], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.c
ontrib.messages.context_processors.messages', ], }, }, ] WSGI_APPLICATION = 'blog.wsgi.application' # Database # https://docs.djangoproject.com/en/1.11/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(BASE_DIR, 'db.sqlite3'), } } # # DATABASES = { # 'default': { # 'ENGINE': 'django.db.backe
nds.mysql', # 'NAME': 'blog', # app's database name # 'USER': 'root', # 'PASSWORD': 'root', # 'HOST': '127.0.0.1', # localhost or cloudhost # 'PORT': '3306', # }, # 'another_db':{ # 'ENGINE': 'django.db.backends.mysql', # 'NAME': 'app2_database', # app2's database name # 'USER': 'root', # 'PASSWORD': 'root', # 'HOST': '127.0.0.1', # localhost or cloudhost # 'PORT': '3306', # }, # } # Password validation # https://docs.djangoproject.com/en/1.11/ref/settings/#auth-password-validators AUTH_PASSWORD_VALIDATORS = [ { 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator', }, { 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', }, { 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator', }, { 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator', }, ] # Internationalization # https://docs.djangoproject.com/en/1.11/topics/i18n/ LANGUAGE_CODE = 'zh-hans' TIME_ZONE = 'Asia/Shanghai' USE_I18N = True USE_L10N = True USE_TZ = True # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/1.11/howto/static-files/ STATIC_URL = '/static/' STATIC_ROOT = os.path.join(BASE_DIR,'static') # 公共的static文件夹 STATIC_DIRS = ( os.path.join(BASE_DIR,'static'), os.path.join(BASE_DIR,'media'), ) # 上传数据的文件夹 MEDIA_URL = '/media/' MEDIA_ROOT = os.path.join(BASE_DIR,'media') STATICFILES_FINDERS = ("django.contrib.staticfiles.finders.FileSystemFinder", "django.contrib.staticfiles.finders.AppDirectoriesFinder",)
#!/usr/bin/env python """ Largest product in a grid Problem 11 Published on 22 February 2002 at 06:00 pm [Server Time] In the 20x20 grid below, four numbers along a diagonal line have been marked in red. The product of these numbers is 26 * 63 * 78 * 14 = 1788696. What is the greatest product of four adjacent numbers in the same direction (up, down, left, right, or diagonally) in the 20x20 grid? """ THE_GRID = [[int(column) for column in row.split(' ')] for row in """ 08 02 22 97 38 15 00 40 00 75 04 05 07 78 52 12 50 77 91 08 49 49 99 40 17 81 18 57 60 87 17 40 98 43 69 48 04 56 62 00 81 49 31 73 55 79 14 29 93 71 40 67 53 88 30 03 49 13 36 65 52 70 95 23 04 60 11 42 69 24 68 56 01 32 56 71 37 02 36 91 22 31 16 71 51 67 63 89 41 92 36 54 22 40 40 28 66 33 13 80 24 47 32 60 99 03 45 02 44 75 33 53 78 36 84 20 35 17 12 50 32 98 81 28 64 23 67 10 26 38 40 67 59 54 70 66 18 38 64 70 67 26 20 68 02 62 12 20 95 63 94 39 63 08 40 91 66 49 94 21 24 55 58 05 66 73 99 26 97 17 78 78 96 83 14 88 34 89 63 72 21 36 23 09 75 00 76 44 20 45 35 14 00 61 33 97 34 31 33 95 78 17 53 28 22 75 31 67 15 94 03 80 04 62 16 14 09 53 56 92 16 39 05 42 96 35 31 47 55 58 88 24 00 17 54 24 36 29 85 57 86 56 00 48 35 71 89 07 05 44 44 37 44 60 21 58 51 54 17 58 19 80 81 68 05 94 47 69 28 73 92 13 86 52 17 77 04 89 55 40 04 52 08 83 97 35 99 16 07 97 57 32 16 26 26 79 33 27 98 66 88 36 68 87 57 62 20 72 03 46 33 67 46 55 12 32 63 93 53 69 04 42 16 73 38 25 39 11 24 94 72 18 08 46 29 32 40 62 76 36 20 69 36 41 72 30 23 88 34 62 99 69 82 67 59 85 74 04 36 16 20 73 35 29 78 31 90 01 74 31 49 71 48 86 81 16 23 57 05 54 01 70 54 71 83 51 54 69 16 92 33 48 61 43 52 01 89 19 67 48 """.strip().split('\n')] """ A few words about the declaration of THE_GRID: This is not the easiest thing to digest on first look. I think it is "pythonic" in its implementation and it allows to copy/paste the grid straight out of the problem statement without a bunch of mucking around to manually turn it into a 2d array ( or nested lists, actually ). It is arranged as a list of rows. Each row is a list of numbers for each column in that row. Looking at it, the multi-line string definition actually converts to a list of strings from the split operation. One string for each row. The top list comprehension converts each row into a list of short strings ( the columns ) which are also converted to int. """ #------------------------------------------------------------------------------ import operator #------------------------------------------------------------------------------ def product(iterable): return reduce(operator.mul, iterable, 1) def solve(run_length): height = len(THE_GRID) width = len(THE_GRID[0]) for row in range(height-run_length+1): for column in range(width-run_length+1): for y_dir in (0, 1): for x_dir in (0,1): for i in range(run_length): print THE_GRID[row+(y_dir*i)][column+x_dir*i] def solve(run_length): height = len(THE_GRID) width = len(THE_GRID[0]) for row in range(height-run_length+1): for column in range(width-run_length+1): for i in range(run_length): for y_dir in (0, 1): for x_dir in (0,1): print THE_GRID[row+(y_dir*i)][column+x_
dir*i] def solve(run_length): height = len(THE_GRID) width = len(THE_GRID[0]) highest = 0 for row in range(height-run_length+1): for column in range(width-run_length+1): for x_dir, y_dir in [(1, 0), (0, 1), (1, 1)]: for i in range(run_length): print THE_GRID[row+(y_dir*i)][column+x
_dir*i] def solve(run_length): height = len(THE_GRID) width = len(THE_GRID[0]) highest = 0 for row in range(height-run_length+1): for column in range(width-run_length+1): for x_dir, y_dir in [(1, 0), (0, 1), (1, 1)]: run =[THE_GRID[row+(y_dir*i)][column+x_dir*i] for i in range(run_length)] result = product(run) print run, result #if result > highest: # highest = result #return(highest) #------------------------------------------------------------------------------ def solve(): g = THE_GRID maxp = 0 rows, cols, path_size = len(g), len(g[0]), 5 for i in range(rows): for j in range(cols - path_size + 1): phv = max(product([g[i][j+s] for s in range(path_size)]), product([g[j+s][i] for s in range(path_size)])) #phv = max(g[i][j] * g[i][j+1] * g[i][j+2] * g[i][j+3], # g[j][i] * g[j+1][i] * g[j+2][i] * g[j+3][i]) if i < rows - path_size: pdd = max(product([g[i+s][j+s] for s in range(path_size)]), product([g[i+s][j+path_size-s-1] for s in range(path_size)])) #pdd = max(g[i][j] * g[i+1][j+1] * g[i+2][j+2] * g[i+3][j+3], # g[i][j+3] * g[i+1][j+2] * g[i+2][j+1] * g[i+3][j]) maxp = max(maxp, phv, pdd) return maxp #------------------------------------------------------------------------------ def main(): print "PROBLEM:\n" for line in __doc__.strip().split('\n'): print '\t', line print "\nSOLUTION:" print "\n\t", solve() #------------------------------------------------------------------------------ if __name__ == "__main__": main()
#!/usr/bin/env python import json my_list = range(10) my_list.append('whatever') my_list.append('some thing') my_dict = { 'ke
y1': 'val1', 'key2': 'val2', 'key3': 'val3' } my_dict['key4'] = my_list my_dict['key5'] = False print my_dict print json.dumps(my_dict) with o
pen("my_file.json", "w") as f: json.dump(my_dict, f)
"""This submodule contains objects for handling different representations of models and model functions
. :synopsis: This submodule contains objects for handling different representations of models and model functions. .. moduleauthor:: Johannes
Gaessler <johannes.gaessler@student.kit.edu> """ from ._base import * from .yaml_drepr import *
from pygfa.graph_element.parser import line, field_validator as fv SERIALIZATION_ERROR_MESSAGGE = "Couldn't serialize object identified by: " def _format_exception(identifier, exception): return SERIALIZATION_ERROR_MESSAGGE + identifier \ + "\n\t" + repr(exception) def _remove_common_edge_fields
(edge_dict): edge_dict.pop('eid') edge_dict.pop('from_node') edge_dict.pop('from_orn') edge_dict.pop('to_node') edge_dict.pop('to_orn') edge_dict.pop('from_positio
ns') edge_dict.pop('to_positions') edge_dict.pop('alignment') edge_dict.pop('distance') edge_dict.pop('variance') def _serialize_opt_fields(opt_fields): fields = [] for key, opt_field in opt_fields.items(): if line.is_optfield(opt_field): fields.append(str(opt_field)) return fields def _are_fields_defined(fields): try: for field in fields: if field is None: return False except: return False return True def _check_fields(fields, required_fields): """Check if each field has the correct format as stated from the specification. """ try: for field in range(0, len(required_fields)): if not fv.is_valid(fields[field], required_fields[field]): return False return True except: return False def _check_identifier(identifier): if not isinstance(identifier, str): identifier = "'{0}' - id of type {1}.".format(\ str(identifier), \ type(identifier) \ ) return identifier
from django.conf.urls import patterns, include, url from django.views.generic import TemplateV
iew from django.contrib import admin admin.autodiscover() urlpatterns = patterns('', url(r'^admin/', include(admin.site.urls)), url(
r'^$', TemplateView.as_view(template_name='base.html')) )
# Copyright 2017 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Experimental API for building input pipelines. This module contains experimental `Dataset` sources and transformations that can be used in conjunction with the `tf.data.Dataset` API. Note that the `tf.contrib.data` API is not subject to the same backwards compatibility guarantees as `tf.data`, but we will provide deprecation advice in advance of removing existing functionality. See [Importing Data](https://tensorflow.org/guide/datasets) for an overview. @@Counter @@CheckpointInputPipelineHook @@CsvDataset @@LMDBDataset @@Optional @@RandomDataset @@Reducer @@SqlDataset @@TFRecordWriter @@assert_element_shape @@batch_and_drop_remainder @@bucket_by_sequence_length @@choose_from_datasets @@copy_to_device @@dense_to_sparse_batch @@enumerate_dataset @@get_next_as_optional @@get_single_element @@group_by_reducer @@group_by_window @@ignore_errors @@make_batched_features_dataset @@make_csv_dataset @@make_saveable_from_iterator @@map_and_batch @@padded_batch_and_drop_remainder @@parallel_interleave @@parse_example_dataset @@prefetch_to_device @@read_batch_features @@rejection_resample @@reduce_dataset @@sample_from_datasets @@scan @@shuffle_and_repeat @@sliding_window_batch @@sloppy_interleave @@unbatch @@unique """ from __future__ import absolute_import from __future__ import division from __future__ import print_function # pylint: disable=unused-import from tensorflow.contrib.data.python.ops.batching import as
sert_element_shape from tensorflow.contrib.data.python.ops.batching import batch_and_drop_remainder from tensorflow.contrib.data.python.ops.batching import dense_to_sparse_batch from tensorflow.contrib.data.python.ops.batching import map_and_batch from tensorflow.contrib.data.python.ops.batching import padded_batch_and_drop_remainder from tensorflow.contrib.data.python
.ops.batching import unbatch from tensorflow.contrib.data.python.ops.counter import Counter from tensorflow.contrib.data.python.ops.enumerate_ops import enumerate_dataset from tensorflow.contrib.data.python.ops.error_ops import ignore_errors from tensorflow.contrib.data.python.ops.get_single_element import get_single_element from tensorflow.contrib.data.python.ops.get_single_element import reduce_dataset from tensorflow.contrib.data.python.ops.grouping import bucket_by_sequence_length from tensorflow.contrib.data.python.ops.grouping import group_by_reducer from tensorflow.contrib.data.python.ops.grouping import group_by_window from tensorflow.contrib.data.python.ops.grouping import Reducer from tensorflow.contrib.data.python.ops.interleave_ops import choose_from_datasets from tensorflow.contrib.data.python.ops.interleave_ops import parallel_interleave from tensorflow.contrib.data.python.ops.interleave_ops import sample_from_datasets from tensorflow.contrib.data.python.ops.interleave_ops import sloppy_interleave from tensorflow.contrib.data.python.ops.iterator_ops import CheckpointInputPipelineHook from tensorflow.contrib.data.python.ops.iterator_ops import make_saveable_from_iterator from tensorflow.contrib.data.python.ops.parsing_ops import parse_example_dataset from tensorflow.contrib.data.python.ops.prefetching_ops import copy_to_device from tensorflow.contrib.data.python.ops.prefetching_ops import prefetch_to_device from tensorflow.contrib.data.python.ops.random_ops import RandomDataset from tensorflow.contrib.data.python.ops.readers import CsvDataset from tensorflow.contrib.data.python.ops.readers import LMDBDataset from tensorflow.contrib.data.python.ops.readers import make_batched_features_dataset from tensorflow.contrib.data.python.ops.readers import make_csv_dataset from tensorflow.contrib.data.python.ops.readers import read_batch_features from tensorflow.contrib.data.python.ops.readers import SqlDataset from tensorflow.contrib.data.python.ops.resampling import rejection_resample from tensorflow.contrib.data.python.ops.scan_ops import scan from tensorflow.contrib.data.python.ops.shuffle_ops import shuffle_and_repeat from tensorflow.contrib.data.python.ops.sliding import sliding_window_batch from tensorflow.contrib.data.python.ops.unique import unique from tensorflow.contrib.data.python.ops.writers import TFRecordWriter from tensorflow.python.data.ops.iterator_ops import get_next_as_optional from tensorflow.python.data.ops.optional_ops import Optional # pylint: enable=unused-import from tensorflow.python.util.all_util import remove_undocumented remove_undocumented(__name__) # A constant that can be used to enable auto-tuning. AUTOTUNE = -1
#!/usr/bin/env python # -*- coding: utf-8 -*- import sys from telesto import plot OFFSET = 1000 # REMEMBER TO CALCULATE MANUALLY! def main(): path = sys.argv[1] mean = plot.mean(
plot.rows(path, plot.parse_middleware_line), ("waiting", "parsing", "database", "response") ) dev = plot.standard_deviation( plot.rows(path, plot.parse_middleware_line), mean ) print "#", for key in mean: print key, print for key in mean: print mean[key], print for key in mean: p
rint 100.0 * mean[key] / sum(mean.itervalues()), print for key in mean: print dev[key], print if __name__ == "__main__": main()
def len2mask(len): """Convert a bit length to a dotted netmask (aka. CIDR to netmask)""" mask
= '' if not isinstance(len, int) or len < 0 or len > 32: print "Illegal subnet length: %s (which is a %s)" % \ (str(len), type(len).__name__) return None for t in range(4): if len > 7: mask += '255.' else: dec = 255 - (2**(8 - len) - 1) mask += str(dec) + '.' len -= 8 if len < 0: len = 0 return mask[:-1] def mask2len(subnet): """Convert a dotted netmask t
o bit length (aka. netmask to CIDR)""" octets = [int(x) for x in subnet.split(".")] count = 0 for octet in octets: highest_bit = 128 while highest_bit > 0: if octet >= highest_bit: count = count + 1 octet = octet - highest_bit highest_bit = highest_bit / 2 else: return count return count class FilterModule(object): ''' utility to convert cidr netmasks into len and reverse ''' def filters(self): return {'mask2len': mask2len, 'len2mask': len2mask}
# coding=utf-8 import sys import os sys.path.insert(0, os.path.abspath(os.path.join(os.getcwd(), ".."))) from db.MysqlUtil import initMysql, execute, select, batchInsert, disconnect from common.JsonHelper import loadJsonConfig from api.tushareApi import getSimpleHistoryData from datetime import datetime, timedelta from common.LoggerHelper import writeErrorLog, writeWarningLog, writeInfoLog, writeDebugLog, writeLog, writeExceptionLog from wechat.weChatSender import sendMessageToMySelf from common.HttpHelper import httpGet from common.FileHelper import saveFile import time import json # 从同花顺抓取历史行情数据(前复权) def updateStockHistoryInfoByTHS(stockList): for stock in stockList: code = stock[0] i = 2010 thisYear = datetime.now().year while (i <= thisYear): # time.sleep(1) infos = getStockInfos(code, i) if infos is None: continue for date in infos: open = infos.get(date).get('open') close = infos.get(date).get('close') high = infos.get(date).get('high') low = infos.get(date).get('low') volume = infos.get(date).get('volume') amount = infos.get(date).get('amount') checkExistSql = unicode("select count(*) from s_stock where code='{0}' and date='{1}'").format(code, date) count = select(checkExistSql, False)[0] if count > 0: updateSql = unicode( "update s_stock set volume={2},highPrice={3},lowPrice={4},openPrice={5},closePrice={6},amount='{7}' where c
ode='{0}' and date='{1}'").format( code, date, volume, high, low, open, close, amount) execute(updateSql) print code, date, updateSql else: insertSql = unicode( "insert into s_stock(code,date,timestamp,volume,highPric
e,lowPrice,openPrice,closePrice,amount) VALUES ('{0}','{1}',{2},{3},{4},{5},{6},{7},'{8}')").format( code, date, int(time.mktime(time.strptime(date, '%Y-%m-%d'))), volume, high, low, open, close, amount) execute(insertSql) print code, date, insertSql i = i + 1 # 解析同花顺年行情数据(前复权) def getStockInfos(code, year): try: url = "http://d.10jqka.com.cn/v2/line/hs_{0}/01/{1}.js".format(code, year) res = httpGet(url).decode("utf-8") index = res.find("(") if (index < 0): writeErrorLog(unicode("解析行情失败: code:{0}, year:{1}, res:{2}").format(code, year, res)) return [] res = res[index + 1:-1] writeLog(unicode("获取股票历史行情: code: {0}, year:{1}").format(code, year)) jo = json.loads(res) dataInfo = jo['data'].split(';') result = {} for item in dataInfo: infos = item.split(',') dic = {} dic['open'] = infos[1] dic['high'] = infos[2] dic['low'] = infos[3] dic['close'] = infos[4] dic['volume'] = infos[5] dic['amount'] = "{0}亿".format(round(float(infos[6]) / 100000000, 1)) result[datetime.strptime(infos[0], '%Y%m%d').strftime('%Y-%m-%d')] = dic return result except Exception, e: writeErrorLog(unicode("解析行情失败: code:{0}, year:{1}, e:{2}").format(code, year, str(e))) if "404" in str(e): return [] else: return None def getStockHistoryInfoFromDb(): sql = unicode("SELECT code,count(*) from s_stock GROUP by code HAVING count(*)<20") data = select(sql) updateStockHistoryInfoByTHS(data) def getStockHistoryInfoFromConfig(): stockList = loadJsonConfig(os.path.abspath(os.path.join(os.getcwd(), "../config/newStockList.json"))) updateStockHistoryInfoByTHS(stockList) def updateAllStockHistoryInfo(): sql = unicode("select code,name from s_stock_info order by code asc") data = select(sql) updateStockHistoryInfoByTHS(data) def updateStockOtherInfo(): sql = unicode("select code,name from s_stock_info order by code asc") stockList = select(sql) for stock in stockList: code = stock[0] if int(code) < 601126: continue selectInfoSql = unicode("select date,closePrice from s_stock where code='{0}' order by date asc").format(code) data = select(selectInfoSql) writeLog(unicode("更新股票其他指标数据: code: {0}").format(code)) updataStockBias(code, data, 6) updataStockBias(code, data, 12) updataStockBias(code, data, 24) updateStockMA(code, data, 5) updateStockMA(code, data, 10) updateStockMA(code, data, 20) updateStockMA(code, data, 30) updateStockMA(code, data, 60) updateStockMA(code, data, 120) updateStockMA(code, data, 250) updateStockChangePercent(code, data) def updateStockChangePercent(code, data): for i in range(1, len(data)): try: changeAmount = data[i][1] - data[i - 1][1] changePercent = round(changeAmount * 100 / data[i - 1][1], 2) updateSql = unicode( "update s_stock set changePercent={0},changeAmount={1} where code='{2}' and date='{3}'").format( changePercent, changeAmount, code, data[i][0]) execute(updateSql) except Exception, e: writeErrorLog( unicode("更新涨幅数据失败: code:{0}, i:{1}, date:{2}, closePrice:{3}").format(code, i, data[i][0], data[i][1])) def updateStockMA(code, data, n): for i in range(n - 1, len(data)): j = i sum = 0 while (i - j < n): sum = sum + data[j][1] j = j - 1 avg = round(sum / n, 2) sql = unicode("update s_stock set MA{0}={1} where code='{2}' and date='{3}'").format(n, avg, code, data[i][0]) execute(sql) def updataStockBias(code, data, n): for i in range(n - 1, len(data)): j = i sum = 0 while (i - j < n): sum = sum + data[j][1] j = j - 1 avg = round(sum / n, 2) todayClosePrice = float(data[i][1]) bias = 0 if avg == 0 else round((todayClosePrice - avg) * 100 / avg, 2) number = 1 if n == 6 else (2 if n == 12 else 3) sql = unicode("update s_stock set BIAS{0}={1} where code='{2}' and date='{3}'").format(number, bias, code, data[i][0]) execute(sql) def main(argv): try: reload(sys) sys.setdefaultencoding('utf-8') # sendMessageToMySelf(unicode("开始查询股票历史行情数据")) begin = datetime.now() initMysql() # getStockHistoryInfoFromDb() # getStockHistoryInfoFromConfig() updateStockOtherInfo() disconnect() end = datetime.now() message = unicode("查询股票历史行情数据的任务执行完毕,当前时间:{0},执行用时:{1}").format(datetime.now(), end - begin) writeLog(message) sendMessageToMySelf(message) except: writeExceptionLog('RealTimeRemindTask Error.') if __name__ == '__main__': main(sys.argv)
from .
import * offline_providers = { 'builtin': builtin.ProviderBuil
tin, }
""" SleekXMPP: The Sleek XMPP Library Copyright (C) 2011 Nathanael C. Fritz, Lance J.T. Stout This file is part of SleekXMPP. See the file LICENSE for copying permissio """ import logging import sleekxmpp from sleekxmpp.stanza import Message from sleekxmpp.xmlstream.handler import Callback from sleekxmpp.xmlstream.matcher import StanzaPath from sleekxmpp.xmlstream import register_stanza_plugin, ElementBase, ET from sleekxmpp.plugins import BasePlugin from sleekxmpp.plugins.xep_0085 import stanza, ChatState log = logging.getLogger(__name__) class XEP_0085(BasePlugin): """ XEP-0085 Chat State Notifications """ name = 'xep_0085' description = 'XEP-0085: Chat State Notifications' dependencies = set(['xep_0030']) stanza = stanza def plugin_init(self): self.xmpp.register_handler( Callback('Chat State', StanzaPath('message/chat_state'), self._handle_chat_state)) register_stanza_plugin(Message, stanza.Active) register_stanza_plugin(Message, stanza.Composing) register_stanza_plugin(Message, stanza.Gone) re
gister_stanza_plugin(Message, stanza.Inactive) register_stanza_plugin(Message, stanza.Paused) def plugin_end(self): s
elf.xmpp.remove_handler('Chat State') def session_bind(self, jid): self.xmpp.plugin['xep_0030'].add_feature(ChatState.namespace) def _handle_chat_state(self, msg): state = msg['chat_state'] log.debug("Chat State: %s, %s", state, msg['from'].jid) self.xmpp.event('chatstate_%s' % state, msg)
er def put(self, item, block=True, timeout=None): """Process event.""" self._handler(item) def _get_entity_from_soco_uid(hass, uid): """Return SonosEntity from SoCo uid.""" for entity in hass.data[DATA_SONOS].entities: if uid == entity.unique_id: return entity return None def soco_error(errorcodes=None): """Filter out specified UPnP errors from logs and avoid exceptions.""" def decorator(funct): """Decorate functions.""" @ft.wraps(funct) def wrapper(*args, **kwargs): """Wrap for all soco UPnP exception.""" try: return funct(*args, **kwargs) except SoCoUPnPException as err: if errorcodes and err.error_code in errorcodes: pass else: _LOGGER.error("Error on %s with %s", funct.__name__, err) except SoCoException as err: _LOGGER.error("Error on %s with %s", funct.__name__, err) return wrapper return decorator def soco_coordinator(funct): """Call function on coordinator.""" @ft.wraps(funct) def wrapper(entity, *args, **kwargs): """Wrap for call to coordinator.""" if entity.is_coordinator: return funct(entity, *args, **kwargs) return funct(entity.coordinator, *args, **kwargs) return wrapper def _timespan_secs(timespan): """Parse a time-span into number of seconds.""" if timespan in ('', 'NOT_IMPLEMENTED', None): return None return sum(60 ** x[0] * int(x[1]) for x in enumerate( reversed(timespan.split(':')))) def _is_radio_uri(uri): """Return whether the URI is a radio stream.""" radio_schemes = ( 'x-rincon-mp3radio:', 'x-sonosapi-stream:', 'x-sonosapi-radio:', 'x-sonosapi-hls:', 'hls-radio:') return uri.startswith(radio_schemes) class SonosEntity(MediaPlayerDevice): """Representation of a Sonos entity.""" def __init__(self, player): """Initialize the Sonos entity.""" self._seen = None self._subscriptions = [] self._receives_events = False self._volume_increment = 2 self._unique_id = player.uid self._player = player self._model = None self._player_volume = None self._player_muted = None self._shuffle = None self._name = None self._coordinator = None self._sonos_group = [self] self._status = None self._media_duration = None self._media_position = None self._media_position_updated_at = None self._media_image_url = None self._media_artist = None self._media_album_name = None self._media_title = None self._night_sound = None self._speech_enhance = None self._source_name = None self._available = True self._favorites = None self._soco_snapshot = None self._snapshot_group = None self._set_basic_information() self.seen() async def async_added_to_hass(self): """Subscribe sonos events.""" self.hass.data[DATA_SONOS].entities.append(self) self.hass.async_add_executor_job(self._subscribe_to_player_events) @property def unique_id(self): """Return a unique ID.""" return self._unique_id def __hash__(self): """Return a hash of self.""" return hash(self.unique_id) @property def name(self): """Return the name of the entity.""" return self._name @property def device_info(self): """Return information about the device.""" return { 'identifiers': { (SONOS_DOMAIN, self._unique_id) }, 'name': self._name, 'model': self._model.replace("Sonos ", ""), 'manufacturer': 'Sonos', } @property @soco_coordinator def state(self): """Return the state of the entity.""" if self._status in ('PAUSED_PLAYBACK', 'STOPPED'): return STATE_PAUSED if self._status in ('PLAYING', 'TRANSITIONING'): return STATE_PLAYING return STATE_IDLE @property def is_coordinator(self): """Return true if player is a coordinator.""" return self._coordinator is None @property def soco(self): """Return soco object.""" return self._player @property def coordinator(self): """Return coordinator of this player.""" return self._coordinator def seen(self): """Record that this player was seen right now.""" self._seen = time.monotonic() if self._available: return self._available = True self._set_basic_information() self._subscribe_to_player_events() self.schedule_update_ha_state() def check_unseen(self): """Make this player unavailable if it was not seen recently.""" if not self._available: return if self._seen < time.monotonic() - 2*DISCOVERY_INTERVAL: self._available = False def _unsub(subscriptions): for subscription in subscriptions: subscription.unsubscribe() self.hass.add_job(_unsub, self._subscriptions) self._subscriptions = [] self.schedule_update_ha_state() @property def available(self) -> bool: """Return True if entity is available.""" return self._available def _set_basic_information(self): """Set initial entity information.""" speaker_info = self.soco.get_speaker_info(True) self._name = speaker_info['zone_name'] self._model = speaker_info['model_name'] self._shuffle = self.soco.shuffle self.update_volume() self._set_favorites() def _set_favorites(self): """Set available favorites.""" favorites = self.soco.music_library.get_sonos_favorites() # Exclude favorites that are non-playable due to no linked resources self._favorites = [f for f in favorites if f.reference.resources] def _radio_artwork(self, url): """Return the private URL with artwork for a radio stream.""" if url not in ('', 'NOT_IMPLEMENTED', None): if url.find('tts_proxy') > 0: # If the content is a tts don't try to fetch an image from it. return None url = 'http://{host}:{port}/getaa?s=1&u={uri}'.format( host=self.soco.ip_address, port=1400, uri=urllib.parse.quote(url, safe='') ) return url def _subscribe_to_player_events(self): """Add event subscriptions.""" self._receives_events = False # New player available, build the current group topology for entity in self.hass.data[DATA_SONOS].entities: entity.update_groups() player = self.soco def subscribe(service, action): """Add a subscription to a pysonos service.""" queue = _ProcessSonosEventQueue(action) sub = service.subscribe(auto_renew=True, event_queue=queue) self._subscriptions.append(sub) subscribe(player.avTransport, self.update_media) subscribe(player.renderingControl, self.update_volume) subscribe(player.zoneGroupTopology, self.update_grou
ps) subscribe(player.contentDirectory, self.update_content) def update(self): """Retrieve latest state.""" if self._available and not self._receives_events: try: self.update_groups() self.update_volume() if self.is_coordinator: self.update_media() except SoC
oException: pass def update_media(self, event=None): """Update information about currently playing media.""" transport_info = self.soco.get_current_transport_info() new_status = transport_info.get('current_transport_state') # Ignore transiti
""" The latest version of this package is available at: <http://github.com/jantman/webhook2lambda2sqs> ################################################################################ Copyright 2016 Jason Antman <jason@jasonantman.com> <http://www.jasonantman.com> This file is part of webhook2lambda2sqs, also known as webhook2lambda2sqs. webhook2lambda2sqs is free software: you can redistribute it and/or modify it under the terms of the GNU Affero General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. webhook
2lambda2sqs is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
See the GNU Affero General Public License for more details. You should have received a copy of the GNU Affero General Public License along with webhook2lambda2sqs. If not, see <http://www.gnu.org/licenses/>. The Copyright and Authors attributions contained herein may not be removed or otherwise altered, except to add the Author attribution of a contributor to this work. (Additional Terms pursuant to Section 7b of the AGPL v3) ################################################################################ While not legally required, I sincerely request that anyone who finds bugs please submit them at <https://github.com/jantman/webhook2lambda2sqs> or to me via email, and that you send any contributions or improvements either as a pull request on GitHub, or to me via email. ################################################################################ AUTHORS: Jason Antman <jason@jasonantman.com> <http://www.jasonantman.com> ################################################################################ """ VERSION = '0.2.0' PROJECT_URL = 'https://github.com/jantman/webhook2lambda2sqs'
import os CA
CHE_PORT = 8080 HTTP_PORT = 8000 HTTPS_PORT = 4430 DEFAULT_MAX_AGE = 3600 DEFAULT_LOG_PATH = os.path.dirname(__file__) DEFAULT_LOG_FILE = os.path.join(DEFAULT_LOG_PATH, 'default-hendrix.lo
g')
# SET THE FOLLOWING EITHER BEFORE RUNNING THIS FILE OR BELOW, BEFORE INITIALIZING # PRAW! # set variables for interacting with reddit. # my_user_agent = "" # my_username = "" # my_password = "" # reddit_post_id = -1 # import praw - install: pip install praw # Praw doc: https://praw.readthedocs.org/en/latest/index.html import praw # python base imports import datetime import pprint # import python_utilities from python_utilities.logging.summary_helper import SummaryHelper # declare variables. my_summary_helper = None r = None post = None comments = None flat_comments = None test_comment = None comment_prop_map = None summary_string = "" # set variables for interacting with reddit. my_user_agent = "<user_agent>" my_username = "<reddit_username>" my_password = "<reddit_password>" #reddit_post_id = "1cp0i3" reddit_post_id = "1bvkol" # init summary helper. my_summary_helper = SummaryHelper() print( "Starting PRAW test at " + str( start_dt ) ) # set user agent. r = praw.Reddit( user_agent = my_user_agent ) # got login set? if ( ( ( my_username ) and ( my_username != "" ) ) and ( ( my_password ) and ( my_password != "" ) ) ): # yes. Login. r.login( my_username, my_password ) print( "==> Logged in." ) #-- END check to see if we log in. --# print( "==> Created reddit instance." ) # retrieve post # - post with lots of comments - 1bvkol has 22014 #reddit_post_id = "1bvkol" post = r.get_submission( submission_id = reddit_post_id, comment_limit = 1500, comment_sort = "old" ) print( "Retrieved post " + str( reddit_post_id ) ) # output number of comments based on post print( "==> post.permalink: " + post.permalink ) print( "==> post.num_comments: " + str( post.num_comments ) ) # use the replace_more_comments() method to pull in as many comments as possible. post.replace_more_comments( limit = None, threshold = 0 ) print( "==> After replace_more_comments()" ) # get the comments comments = post.comments # print out number of comments print( "==> len( comments ): " + str( len( comments ) ) ) # 3,915 and counting # these are objects where parent comments reference children. flatten... flat_comments = praw.helpers.flatten_tree( post.comments ) # how many now? print( "==> after flatten_tree(), comment count: " + str ( len( flat_comments ) ) ) # 13364 - closer to 22000, but still not all of them. # get a comment test_comment = flat_comments[ 0 ] print( "Looking at comment 0:") # what is in it? print( "==> str( comment ): " + str( test_comment ) ) # outputs the text of comment, nothing more. # reddit ID of comment: print( "==> comment id: " + str( test_comment.id ) ) # body of comment print( "==> comment body: " + test_comment.body ) # to get map of property names to values in a praw object: comment_prop_map = vars( test_comment ) # pretty-print it with pprint library. pprint.pprint( comment_prop_map ) ''' Example: {'_info_url': 'http://www.reddit.com/api/info/', '_replies': [<praw.objects.MoreComments object at 0x4867550>], '_submission': <praw.objects.Submission object at 0x4867790>, '_underscore_names': ['replies'], 'approved_by': None, 'author': Redditor(user_name='worldclasssteez'), 'author_flair_css_class': None, 'author_flair_text': None, 'banned_by': None, 'body': u'Using the "J" and "K" keys on VLC player to sync up the audio. ', 'body_html': u'&lt;div class="md"&gt;&lt;p&gt;Using the &amp;quot;J&amp;quot; and &amp;quot;K&amp;quot; keys on VLC player to sync up the audio. &lt;/p&gt;\n&lt;/div&gt;', 'created': 1365399487.0, 'created_utc': 1365395887.0, 'distinguished': None, 'downs': 44, 'edited': False, 'gilded': 0, 'has_fetched': True, 'id': u'c9ap3fp', 'json_dict': None, 'likes': None, 'link_id': u't3_1bvkol', 'name': u't1_c9ap3fp', 'num_reports': None, 'parent_id': u't3_1bvkol', 'reddit_session': <praw.Reddit object at 0x48539d0>, 'saved': False, 'score_hidden': False, 'subreddit': Subreddit(display_name='AskReddit'), 'subreddit_id': u't5_2qh1i', 'ups': 201} ''' # each name in that map can be invoked as a variable on the object itself. # test summary counter my_summary_helper.set_prop_value( "comment_count", 0 ) # look at utc date order of comments: # for comment in flat_comments[ 0:15 ]: for index in range( 0, len( flat_comments ) ): # get vars comment = flat_comments[ index ] comment_prop_map = vars( comment ) created_from_map = comment_prop_map[ 'created_utc' ] created_from_obj = comment.created_utc created_dt = datetime.datetime.fromtimestamp( created_from_map ) comment_id = comment.name print( "==> " + str( index ) + " ( " + comment_id + " ) - Created UTC: " + str( created_from_map ) + " (map); " + str( created_from_obj ) + " (obj); " + str( created_dt ) ) # increment comment count my_summary_helper.increment_prop_value( "comment_count" ) #-- END loop over comments --# print( "==> Created: " + st
r( created_from_map ) + " (map); " + str( created_from_obj ) + " (obj); " + str( created_dt
) ) summary_string = "\nPRAW testing complete!\n" # generate summary string # set stop time. my_summary_helper.set_stop_time() # generate summary string. summary_string += my_summary_helper.create_summary_string( item_prefix_IN = "==> " ) print( summary_string )
""" Fiber-based fixed point location in the Lorenz system f(v)[0] = s*(v[1]-v[0]) f(v)[1] = r*v[0] - v[1] - v[0]*v[2] f(v)[2] = v[0]*v[1] - b*v[2] Reference: http://www.emba.uvm.edu/~jxyang/teaching/Math266notes13.pdf https://en.wikipedia.org/wiki/Lorenz_system """ import numpy as np import matplotlib.pyplot as pt import scipy.integrate as si import dfibers.traversal as tv import dfibers.numerical_utilities as nu import dfibers.fixed_points as fx import dfibers.solvers as sv from mpl_toolkits.mplot3d import Axes3D N = 3 s, b, r = 10, 8./3., 28 def f(v): return np.array([ s*(v[1,:]-v[0,:]), r*v[0,:] - v[1,:] - v[0,:]*v[2,:], v[0,:]*v[1,:] - b*v[2,:], ]) def ef(v): return 0.001*np.ones((N,1)) def Df(v): Dfv = np.empty((v.shape[1],3,3)) Dfv[:,0,0], Dfv[:,0,1], Dfv[:,0,2] = -s, s, 0 Dfv[:,1,0], Dfv[:,1,1], Dfv[:,1,2] = r - v[2], -1, -v[0] Dfv[:,2,0], Dfv[:,2,1], Dfv[:,2,2] = v[1], v[0], -b return Dfv if __name__ == "__main__": # Collect attractor points t = np.arange(0,40,0.01) v = np.ones((N,1)) A = si.odeint(lambda v, t: f(v.reshape((N,1))).flatten(), v.flatten(), t).T # Set up fiber arguments v = np.zeros((N,1)) # c = np.random.randn(N,1) c = np.array([[0.83736021, -1.87848114, 0.43935044]]).T fiber_kwargs = { "f": f, "ef": ef, "Df": Df, "compute_step_amount": lambda trace: (0.1, 0, False), "v": v, "c": c, "terminate": lambda trace: (np.fabs(trace.x[:N,:]) > 50).any(), "max_step_size": 1, "max_traverse_steps": 2000, "max_solve_iterations": 2**5, } print("using c:") print(c.T) # Visualize strange attractor ax = pt.gca(projection="3d") ax.plot(*A, color='gray', linestyle='-', alpha=0.5) br1 = np.sqrt(b*(r-1)) U = np.array([[0, 0, 0],[br1,br1,r-1],[-br1,-br1,r-1]]).T ax.scatter(*U, color='black') # Run and visualize fiber components, for each fxpt xlims, ylims, zlims = [-20,20], [-30,30], [-20,60] for fc in [0,2]: # start from current fxp
t fiber_kwargs["v"] = U[:,[fc]]
# ax.text(U[0,fc],U[1,fc],U[2,fc], str(fc)) # Run in one direction solution = sv.fiber_solver(**fiber_kwargs) V1 = np.concatenate(solution["Fiber trace"].points, axis=1)[:N,:] z = solution["Fiber trace"].z_initial # Run in other direction (negate initial tangent) fiber_kwargs["z"] = -z solution = sv.fiber_solver(**fiber_kwargs) V2 = np.concatenate(solution["Fiber trace"].points, axis=1)[:N,:] # Join fiber segments, restrict to figure limits V = np.concatenate((np.fliplr(V1), V2), axis=1) V = V[:,::50] for i, (lo, hi) in enumerate([xlims, ylims, zlims]): V = V[:,(lo < V[i,:]) & (V[i,:] < hi)] C = f(V) # Visualize fiber ax.plot(*V, color='black', linestyle='-') ax.quiver(*np.concatenate((V,.1*C),axis=0),color='black') ax.set_xlabel("x") ax.set_ylabel("y") ax.set_zlabel("z") ax.view_init(elev=15,azim=145) pt.tight_layout() pt.show()
OTHER DEALINGS IN THE # SOFTWARE. # ============================================================================= # DOCS # ============================================================================= """Synthetic light curve generator. """ # ============================================================================= # IMPORTS # ============================================================================= import numpy as np from .base import Data # ============================================================================= # CONSTANTS # ============================================================================= DS_NAME = "feets-synthetic" DESCRIPTION = "Lightcurve created with random numbers" BANDS = ("B", "V") METADATA = None DEFAULT_SIZE = 10000 # ============================================================================= # FUNCTIONS # ============================================================================= def create_random( magf, magf_params, errf, errf_params, timef=np.linspace, timef_params=None, size=DEFAULT_SIZE, id=None, ds_name=DS_NAME, description=DESCRIPTION, bands=BANDS, metadata=METADATA, ): """Generate a data with any given random function. Parameters ---------- magf : callable Function to generate the magnitudes. magf_params : dict-like Parameters to feed the `magf` function. errf : callable Function to generate the magnitudes. errf_params : dict-like Parameters to feed the `errf` function. timef : callable, (default=numpy.linspace) Function to generate the times. timef_params : dict-like or None, (default={"start": 0., "stop": 1.}) Parameters to feed the `timef` callable. size : int (default=10000) Number of obervation of the light curves id : object (default=None) Id of the created data. ds_name : str (default="feets-synthetic") Name of the dataset description : str (default="Lightcurve created with random numbers") Description of the data bands : tuple of strings (default=("B", "V")) The bands to be created metadata : dict-like or None (default=None) The metadata of the created data Returns ------- data A Data object with a random lightcurves. Examples -------- .. code-block:: pycon >>> from numpy import random >>> create_random( ... magf=random.normal, magf_params={"loc": 0, "scale": 1}, ... errf=random.normal, errf_params={"loc": 0, "scale": 0.008}) Data(id=None, ds_name='feets-synthetic', bands=('B', 'V')) """ timef_params = ( {"start": 0.0, "stop": 1.0} if timef_params is None else timef_params.copy() ) timef_params.update(num=size) magf_params = magf_params.copy() magf_params.update(size=size) errf_params = errf_params.copy() errf_params.update(size=size) data = {} for band in bands: data[band] = { "time": timef(**timef_params), "magnitude": magf(**magf_params), "error": errf(**errf_params), } return Data(
id=id, ds_name=ds_name, desc
ription=description, bands=bands, metadata=metadata, data=data, ) def create_normal( mu=0.0, sigma=1.0, mu_err=0.0, sigma_err=1.0, seed=None, **kwargs ): """Generate a data with magnitudes that follows a Gaussian distribution. Also their errors are gaussian. Parameters ---------- mu : float (default=0) Mean of the gaussian distribution of magnitudes sigma : float (default=1) Standar deviation of the gaussian distribution of magnitude errors mu_err : float (default=0) Mean of the gaussian distribution of magnitudes sigma_err : float (default=1) Standar deviation of the gaussian distribution of magnitude errorrs seed : {None, int, array_like}, optional Random seed used to initialize the pseudo-random number generator. Can be any integer between 0 and 2**32 - 1 inclusive, an array (or other sequence) of such integers, or None (the default). If seed is None, then RandomState will try to read data from /dev/urandom (or the Windows analogue) if available or seed from the clock otherwise. kwargs : optional extra arguments for create_random. Returns ------- data A Data object with a random lightcurves. Examples -------- .. code-block:: pycon >>> ds = create_normal(0, 1, 0, .0008, seed=42) >>> ds Data(id=None, ds_name='feets-synthetic', bands=('B', 'V')) >>> ds.data.B LightCurve(time[10000], magnitude[10000], error[10000]) >>> ds.data.B.time array([ 0.00000000e+00, 1.00010001e-04, 2.00020002e-04, ..., 9.99799980e-01, 9.99899990e-01, 1.00000000e+00]) """ random = np.random.RandomState(seed) return create_random( magf=random.normal, magf_params={"loc": mu, "scale": sigma}, errf=random.normal, errf_params={"loc": mu_err, "scale": sigma_err}, **kwargs, ) def create_uniform( low=0.0, high=1.0, mu_err=0.0, sigma_err=1.0, seed=None, **kwargs ): """Generate a data with magnitudes that follows a uniform distribution; the error instead are gaussian. Parameters ---------- low : float, optional Lower boundary of the output interval. All values generated will be greater than or equal to low. The default value is 0. high : float, optional Upper boundary of the output interval. All values generated will be less than high. The default value is 1.0. mu_err : float (default=0) Mean of the gaussian distribution of magnitudes sigma_err : float (default=1) Standar deviation of the gaussian distribution of magnitude errorrs seed : {None, int, array_like}, optional Random seed used to initialize the pseudo-random number generator. Can be any integer between 0 and 2**32 - 1 inclusive, an array (or other sequence) of such integers, or None (the default). If seed is None, then RandomState will try to read data from /dev/urandom (or the Windows analogue) if available or seed from the clock otherwise. kwargs : optional extra arguments for create_random. Returns ------- data A Data object with a random lightcurves. Examples -------- .. code-block:: pycon >>> ds = synthetic.create_uniform(1, 2, 0, .0008, 42) >>> ds Data(id=None, ds_name='feets-synthetic', bands=('B', 'V')) >>> ds.data.B.magnitude array([ 1.37454012, 1.95071431, 1.73199394, ..., 1.94670792, 1.39748799, 1.2171404 ]) """ random = np.random.RandomState(seed) return create_random( magf=random.uniform, magf_params={"low": low, "high": high}, errf=random.normal, errf_params={"loc": mu_err, "scale": sigma_err}, **kwargs, ) def create_periodic(mu_err=0.0, sigma_err=1.0, seed=None, **kwargs): """Generate a data with magnitudes with periodic variability distribution; the error instead are gaussian. Parameters ---------- mu_err : float (default=0) Mean of the gaussian distribution of magnitudes sigma_err : float (default=1) Standar deviation of the gaussian distribution of magnitude errorrs seed : {None, int, array_like}, optional Random seed used to initialize the pseudo-random number generator. Can be any integer between 0 and 2**32 - 1 inclusive, an array (or other sequence) of such integers, or None (the default). If seed is None, then RandomState will try to read data from /dev/urandom (or the Windows analogue) if available or seed from the clock otherwise. kwargs : optional extra arguments for create_random. Returns ------- da
#
Say hello to Django
string = '\xe4\x03\x01\x00' struct.unpack("i", string) # (66532,) bytes = '\x01\xc2' struct.pack("<h", struct.unpack(">h", bytes)[0]) # '\xc2\x01' import base64 base64.b64encode('encodings are fun...') # 'ZW5jb2RpbmdzIGFyZSBmdW4uLi4=' base64.b64decode(_) # 'encodings are fun...' string = "hello\x00" binary_string = ' '.join('{:08b}'.format(ord(char)) for char in string) " ".join(binary_string[i:i+6] for i in range(0, len(binary_string), 6)) # '011010 000110 010101 101100 011011 000110 111100 000000' bin_string = '011010 000110 010101 101100 011011 000110 111100 000000' [int(b, 2) for b in bin_string.split()] # [26, 6, 21, 44, 27, 6, 60, 0] u'◑ \u2020'.encode('utf8') # '\xe2\x97\x91 \xe2\x80\xa0' '\xe2\x97\x91 \xe2\x80\xa0'.decode('utf8') # u'\u25d1 \u2020' unicode('\xe2\x97\x91 \xe2\x80\xa0', encoding='utf8') # u'\u25d1 \u2020' utf8_string = 'Åêíòü' utf8_string # '\xc3\x85\xc3\xaa\xc3\xad\xc3\xb2\xc3\xbc' unicode_string = utf8_string.decode('utf8') unicode_string # u'\xc5\xea\xed\xf2\xfc' unicode_string.encode('mac roman') # '\x81\x90\x92\x98\x9f' 'Åêíòü'.decode('utf8').encode('ascii') # Traceback (most recent call last): #   File "<stdin>", line 1, in <module> # UnicodeEncodeError: 'ascii' codec can't encode characters in position 0-4: ordinal not in range(128) file = """潍楪慢敫椠⁳桴⁥慧扲敬⁤整瑸琠慨⁴獩琠敨爠獥汵⁴景琠硥⁴敢湩⁧敤潣敤⁤獵湩⁧湡甠楮瑮湥敤⁤档 牡捡整⁲湥潣楤杮楷桴挠浯汰瑥汥⁹湵敲慬整⁤湯獥景整牦浯愠搠晩敦敲瑮眠楲楴杮猠獹整⹭‧⠊慔敫 牦浯攠⹮楷楫数楤⹡牯⥧""" print file.decode('utf8').encode('utf16') # ??Mojibake is the garbled text that is the result of text being decoded using an # unintended character encoding with completely unrelated ones, often from a # different writing system.' (Taken from en.wikipedia.org) import ftfy ftfy.fix_text(u"“Mojibake“ can be fixed.") # u'"Mojibake" can be fixed.' bin(0b1010 & 0b1111110111) # '0b10' bin(0b1010 | 0b0110) # '0b1110' bin(0b10111 | 0b01000) # '0b11111' bin(0b100 ^ 0b110) # '0b10' bin(-0b1010 >> 0b10) # '-0b11' x = 0b1111 y = 0b1010 bin(int("{:b}{:b}".format(x, y), 2)) # '0b11111010' bin(x << 4 | y
) # '0b11111010' ################################################
#################### # 4. Cryptography #################################################################### import random import string   r = random.SystemRandom() # Get a random integer between 0 and 20 r.randint(0, 20) # 5   # Get a random number between 0 and 1 r.random() # 0.8282475835972263   # Generate a random 40-bit number r.getrandbits(40) # 595477188771L # Choose a random item from a string or list chars = string.printable r.choice(chars) # 'e'  # Randomize the order of a sequence seq = ['a', 'b', 'c', 'd', 'e'] r.shuffle(seq) print seq # ['c','d', 'a', 'e', 'b'] "ALLIGATOR".encode('rot13') # 'NYYVTNGBE' "NYYVTNGBE".encode('rot13') # 'ALLIGATOR' plaintext = "A secret-ish message!" "".join(chr((ord(c) + 20) % 256) for c in plaintext) # 'U4\x87yw\x86y\x88A}\x87|4\x81y\x87\x87u{y5' ciphertext = 'U4\x87yw\x86y\x88A}\x87|4\x81y\x87\x87u{y5' "".join(chr((ord(c) - 20) % 256) for c in ciphertext) # 'A secret-ish message!' plaintext = 0b110100001101001 one_time_pad = 0b110000011100001 bin(plaintext ^ one_time_pad) # '0b100010001000' decrypted = 0b100010001000 ^ one_time_pad format(decrypted, 'x').decode('hex') # 'hi' import os import binascii # ASCII-encoded plaintext plaintext = "this is a secret message" plaintext_bits = int(binascii.hexlify(plaintext), 16) print "plaintext (ascii):", plaintext print "plaintext (hex):", plaintext_bits # Generate the one-time pad onetime_pad = int(binascii.hexlify(os.urandom(len(plaintext))), 16) print "one-time pad: (hex):", onetime_pad # Encrypt plaintext using XOR operation with one-time pad ciphertext_bits = plaintext_bits ^ onetime_pad print "encrypted text (hex):", ciphertext_bits # Decrypt using XOR operation with one-time pad decrypted_text = ciphertext_bits ^ onetime_pad decrypted_text = binascii.unhexlify(hex(decrypted_text)[2:-1]) print "decrypted text (ascii):", decrypted_text import random import binascii p1 = "this is the part where you run away" p2 = "from bad cryptography practices." # pad plaintexts with spaces to ensure equal length p1 = p1.ljust(len(p2)) p2 = p2.ljust(len(p1)) p1 = int(binascii.hexlify(p1), 16) p2 = int(binascii.hexlify(p2), 16) # get random one-time pad otp = random.SystemRandom().getrandbits(p1.bit_length()) # encrypt c1 = p1 ^ otp c2 = p2 ^ otp # otp reuse...not good! print "c1 ^ c2 == p1 ^ p2 ?", c1 ^ c2 == p1 ^ p2 print "c1 ^ c2 =", hex(c1 ^ c2) # the crib crib = " the " crib = int(binascii.hexlify(crib), 16) xored = c1 ^ c2 print "crib =", hex(crib) cbl = crib.bit_length() xbl = xored.bit_length() print mask = (2**(cbl + 1) - 1) fill = len(str(xbl / 8)) # crib dragging for s in range(0, xbl - cbl + 8, 8): xor = (xored ^ (crib << s)) & (mask << s) out = binascii.unhexlify(hex(xor)[2:-1]) print "{:>{}} {}".format(s/8, fill, out) from cryptography.fernet import Fernet key = Fernet.generate_key() f = Fernet(key) ciphertext = f.encrypt("this is my plaintext") decrypted = f.decrypt(ciphertext) print decrypted # this is my plaintext import os from cryptography.hazmat.primitives import padding from cryptography.hazmat.primitives.ciphers import Cipher, algorithms, modes from cryptography.hazmat.backends import default_backend pt = "my plaintext" backend = default_backend() key = os.urandom(32) iv = os.urandom(16) padder = padding.PKCS7(128).padder() pt = padder.update(pt) + padder.finalize() cipher = Cipher(algorithms.AES(key), modes.CBC(iv), backend=backend) encryptor = cipher.encryptor() ct = encryptor.update(pt) + encryptor.finalize() decryptor = cipher.decryptor() out = decryptor.update(ct) + decryptor.finalize() unpadder = padding.PKCS7(128).unpadder() out = unpadder.update(out) + unpadder.finalize() print out import hashlib hashlib.md5("hash me please").hexdigest() # '760d92b6a6f974ae11904cd0a6fc2e90' hashlib.sha1("hash me please").hexdigest() # '1a58c9b3d138a45519518ee42e634600d1b52153' import os from cryptography.hazmat.primitives.kdf.scrypt import Scrypt from cryptography.hazmat.backends import default_backend backend = default_backend() salt = os.urandom(16) kdf = Scrypt(salt=salt, length=64, n=2**14, r=8, p=1, backend=backend) key = kdf.derive("your favorite password") key import hmac import hashlib secret_key = "my secret key" ciphertext = "my ciphertext" # generate HMAC h = hmac.new(key=secret_key, msg=ciphertext, digestmod=hashlib.sha256) print h.hexdigest() # verify HMAC hmac.compare_digest(h.hexdigest(), h.hexdigest()) p = 9576890767 q = 1299827 n = p * q print n # 12448301194997309 e = 65537 phi = (p - 1) * (q - 1) phi % e != 0 # True import sympy d = sympy.numbers.igcdex(e, phi)[0] print d # 1409376745910033 m = 12345 c = pow(m, e, n) print c # 3599057382134015 pow(c, d, n) # 12345 m = 0 while pow(m, e, n) != c:     m += 1 print m from cryptography.hazmat.backends import default_backend from cryptography.hazmat.primitives.asymmetric import rsa from cryptography.hazmat.primitives import serialization private_key = rsa.generate_private_key(public_exponent=65537, key_size=2048, b ackend=default_backend()) public_key = private_key.public_key() private_pem = private_key.private_bytes(encoding=serialization.Encoding.PEM, format=serialization.PrivateFormat.PKCS8, encryption_algorithm=serialization.BestAvailableEncryption('your password here')) public_pem = public_key.public_bytes(encoding=serialization.Encoding.PEM, format=serialization.PublicFormat.SubjectPublicKeyInfo) print public_pem print private_pem from cryptography.hazmat.primitives import hashes from cryptography.hazmat.primitives.asymmetric import padding import base64 with open("path/to/public_key.pem", "rb") as key_file: public_key = serialization.load_pem_public_key(key_file.read(), backend=default_backend()) message = "your secret message" ciphertext = public_key.encrypt(message, padding.OAEP(mgf=padding.MGF1(algorithm=hashes.SHA256()),
#! /usr/bin/env python3 import math, sys import shtns impor
t numpy as np class shtnsfiledata: # # Adopted from https://bitbucket.org/nschaeff/shtns/src/master/examples/shallow_water.py # def __init__( self, rsphere = 1.0 ): self.rsphere = rsphere def setup(self, file_info, anti_aliasing=False): import s
htns import numpy as np if file_info['modes_m_max'] != file_info['modes_m_max']: raise Exception("Only num_lon == num_lat supported") ntrunc = file_info['modes_n_max'] self._shtns = shtns.sht(ntrunc, ntrunc, 1, shtns.sht_orthonormal+shtns.SHT_NO_CS_PHASE) nlons = (ntrunc + 1) * 2 nlats = (ntrunc + 1) if anti_aliasing: if nlons & 1: raise Exception("Only even numbers of longitudinal coordinates allowed for anti-aliasing") if nlats & 1: raise Exception("Only even numbers of latitudinal coordinates allowed for anti-aliasing") print("Anti-aliasing:") print(" + old lon/lat: ", nlons, nlats) nlons += nlons//2 nlats += nlats//2 print(" + new lon/lat: ", nlons, nlats) if file_info['grid_type'] == 'GAUSSIAN': #self._shtns.set_grid(nlats,nlons,shtns.sht_gauss_fly|shtns.SHT_PHI_CONTIGUOUS, 1.e-10) self._shtns.set_grid(nlats, nlons, shtns.sht_quick_init|shtns.SHT_PHI_CONTIGUOUS, 0) elif file_info['grid_type'] == 'REGULAR': #self._shtns.set_grid(nlats,nlons,shtns.sht_reg_dct|shtns.SHT_PHI_CONTIGUOUS, 1.e-10) self._shtns.set_grid(nlats, nlons, shtns.sht_reg_dct|shtns.SHT_PHI_CONTIGUOUS, 0) else: raise Exception("Grid type '"+file_info['grid_type']+"' not supported!") self.lats = np.arcsin(self._shtns.cos_theta) self.lons = (2.*np.pi/nlons)*np.arange(nlons) self.nlons = nlons self.nlats = nlats self.ntrunc = ntrunc self.nlm = self._shtns.nlm self.degree = self._shtns.l self.lap = -self.degree*(self.degree+1.0).astype(np.complex) self.invlap = np.zeros(self.lap.shape, self.lap.dtype) self.invlap[1:] = 1./self.lap[1:] self.lap = self.lap/self.rsphere**2 self.invlap = self.invlap*self.rsphere**2 def phys2spec(self, data): return self._shtns.analys(data) def spec2phys(self, dataspec): return self._shtns.synth(dataspec) def vrtdiv2uv(self, vrtspec, divspec): return self._shtns.synth((self.invlap/self.rsphere)*vrtspec, (self.invlap/self.rsphere)*divspec) def uv2vrtdiv(self,u,v): vrtspec, divspec = self._shtns.analys(u, v) return self.lap*self.rsphere*vrtspec, self.lap*self.rsphere*divspec def getuv(self,divspec): vrtspec = np.zeros(divspec.shape, dtype=np.complex) u,v = self._shtns.synth(vrtspec,divspec) return u, v def rotateX90(self, i_field): return self._shtns.Xrotate90(i_field) def rotateY90(self, i_field): return self._shtns.Yrotate90(i_field) def rotateZ90(self, i_field, angle): return self._shtns.Zrotate(i_field, angle)
# -*- coding: utf-8 -*- import inspect import random import numpy as np from django.contrib import messages from django.views.generic import RedirectView from django.contrib.contenttypes.models import ContentType from django.http import Http404 from django.contrib.auth.mixins import UserPassesTestMixin class RunActionView(UserPassesTestMixin, RedirectView): """ Runs common Actions for Systems and Techniques """ permanent = False #: Available Actions ACTIONS = { "perform_inference": { "type": "object", "str": "PERFORMING INFERENCE", "method": "perform_inference", "kwargs": { "recalculate": True }, }, "reset_inference": { "type": "object", "str": "RESETING INFERENCE", "method": "reset_inference", "kwargs": {}, }, "reinitialize_rng": { "type": "general", "str": "REINITIALIZING RNG", "method": "action_reinitialize_rng", "kwargs": {}, } } def test_func(self): return(self.request.user.is_superuser) def action_reinitialize_rng(self): """ Reinitialize both generators """ random.seed() np.random.seed() def get_ct_object(self, content_type, object_id): ct = ContentType.objects.get(model=content_type) return(ct.model_class().objects.get(id=object_id)) def run_action(self, action, action_object=None): try: if action_object: action_method = getattr(action_object, action['method']) else: action_method = getattr(self, action['method']) action_method(**action['kwargs']) messages.success(self.request, "SUCCESS AT {}".format(action['str'])) except Exception as e: msg = e.args[0] frm = inspect.trace()[-
1] mod = inspect.getmodule(frm[0]) modname = mod.__name__ if mod else frm[1] messages.error(self.request, "ERROR WHILE {}: [{}] {}".format(
action['str'], modname, str(msg))) def get_redirect_url(self, *args, **kwargs): if kwargs['action'] not in self.ACTIONS: raise Http404("Action not Found") if self.ACTIONS[kwargs['action']]["type"] == 'object': action_object = self.get_ct_object(kwargs['content_type'], kwargs['object_id']) else: action_object = None self.run_action(self.ACTIONS[kwargs['action']], action_object) return(self.request.META.get('HTTP_REFERER', '/'))
# This file is part of cclib (http://cclib.github.io), a library for parsing # and interpreting the results of computational chemistry packages. # # Copyright (C) 2014, the cclib development team # # The library is free software, distributed under the terms of # the GNU Lesser General Public version 2.1 or later. You should have # received a copy of the license along with cclib. You can also access # the full license online at http://www.gnu.org/copyleft/lgpl.html. """A writer for chemical JSON (CJSON) files.""" try: import openbabel as ob has_openbabel = True except ImportError: has_openbabel = False import os.path import json from . import filewriter class CJSON(filewriter.Writer): """A writer for chemical JSON (CJSON) files.""" def __init__(self, ccdata, *args, **kwargs): """Initialize the chemical JSON writer object. Inputs: ccdata - An instance of ccData, parsed from a logfile. """ # Call the __init__ method of the superclass super(CJSON, self).__init__(ccdata, *args, **kwargs) self.generate_repr() def generate_repr(self): """Generate the CJSON representation of the logfile data.""" cjson_dict = dict() cjson_dict['chemical json'] = 0 if self.jobfilename is not None: cjson_dict['name'] = os.path.splitext(self.jobfilename)[0] # These are properties that can be collected using Open Babel. if has_openbabel: cjson_dict['smiles'] = self.pbmol.write('smiles') cjson_dict['inchi'] = self.pbmol.write('inchi') cjson_dict['inchikey'] = self.pbmol.write('inchikey') cjson_dict['formula'] = self.pbmol.formula cjson_dict['atoms'] = dict() cjson_dict['atoms']['elements'] = dict() cjson_dict['atoms']['elements']['number'] = self.ccdata.atomnos.tolist() cjson_dict['atoms']['coords'] = d
ict() cjson_dict['atoms']['coords']['3d'] = self.ccdata.atomcoords[-1].flatten().tolist()
cjson_dict['bonds'] = dict() cjson_dict['bonds']['connections'] = dict() cjson_dict['bonds']['connections']['index'] = [] if has_openbabel: for bond in self.bond_connectivities: cjson_dict['bonds']['connections']['index'].append(bond[0] + 1) cjson_dict['bonds']['connections']['index'].append(bond[1] + 1) cjson_dict['bonds']['order'] = [bond[2] for bond in self.bond_connectivities] cjson_dict['properties'] = dict() if has_openbabel: cjson_dict['properties']['molecular mass'] = self.pbmol.molwt cjson_dict['atomCount'] = len(self.ccdata.atomnos) cjson_dict['heavyAtomCount'] = len([x for x in self.ccdata.atomnos if x > 1]) if has_openbabel: cjson_dict['diagram'] = self.pbmol.write(format='svg') # These are properties that can be collected using cclib. # Do there need to be any unit conversions here? homo_idx_alpha = int(self.ccdata.homos[0]) homo_idx_beta = int(self.ccdata.homos[-1]) energy_alpha_homo = self.ccdata.moenergies[0][homo_idx_alpha] energy_alpha_lumo = self.ccdata.moenergies[0][homo_idx_alpha + 1] energy_alpha_gap = energy_alpha_lumo - energy_alpha_homo energy_beta_homo = self.ccdata.moenergies[-1][homo_idx_beta] energy_beta_lumo = self.ccdata.moenergies[-1][homo_idx_beta + 1] energy_beta_gap = energy_beta_lumo - energy_beta_homo cjson_dict['energy'] = dict() cjson_dict['energy']['total'] = self.ccdata.scfenergies[-1] cjson_dict['energy']['alpha'] = dict() cjson_dict['energy']['alpha']['homo'] = energy_alpha_homo cjson_dict['energy']['alpha']['lumo'] = energy_alpha_lumo cjson_dict['energy']['alpha']['gap'] = energy_alpha_gap cjson_dict['energy']['beta'] = dict() cjson_dict['energy']['beta']['homo'] = energy_beta_homo cjson_dict['energy']['beta']['lumo'] = energy_beta_lumo cjson_dict['energy']['beta']['gap'] = energy_beta_gap cjson_dict['totalDipoleMoment'] = self._calculate_total_dipole_moment() # Can/should we append the entire original log file? # cjson_dict['files'] = dict() # cjson_dict['files']['log'] = [] # cjson_dict['files']['log'].append() return json.dumps(cjson_dict) if __name__ == "__main__": pass
steriors.sum(axis=1), np.ones(nobs)) viterbi_ll, stateseq = h.decode(obs) assert_array_equal(stateseq, gaussidx) def test_sample(self, n=1000): h = hmm.GaussianHMM(self.n_components, self.covariance_type) # Make sure the means are far apart so posteriors.argmax() # picks the actual component used to generate the observations. h.means_ = 20 * self.means h.covars_ = np.maximum(self.covars[self.covariance_type], 0.1) h.startprob_ = self.startprob samples = h.sample(n)[0] self.assertEquals(samples.shape, (n, self.n_features)) def test_fit(self, params='stmc', n_iter=5, verbose=False, **kwargs): h = hmm.GaussianHMM(self.n_components, self.covariance_type) h.startprob_ = self.startprob h.transmat_ = hmm.normalize(self.transmat + np.diag(self.prng.rand(self.n_components)), 1) h.means_ = 20 * self.means h.covars_ = self.covars[self.covariance_type] # Create training data by sampling from the HMM. train_obs = [h.sample(n=10)[0] for x in xrange(10)] # Mess up the parameters and see if we can re-learn them. h.n_iter = 0 h.fit(train_obs) trainll = train_hmm_and_keep_track_of_log_likelihood( h, train_obs, n_iter=n_iter, params=params, **kwargs)[1:] # Check that the loglik is always increasing during training if not np.all(np.diff(trainll) > 0) and verbose: print print ('Test train: %s (%s)\n %s\n %s' % (self.covariance_type, params, trainll, np.diff(trainll))) delta_min = np.diff(trainll).min() self.assertTrue( delta_min > -0.8, "The min nll increase is %f which is lower than the admissible" " threshold of %f, for model %s. The likelihoods are %s." % (delta_min, -0.8, self.covariance_type, trainll)) def test_fit_works_on_sequences_of_different_length(self): obs = [self.prng.rand(3, self.n_features), self.prng.rand(4, self.n_features), self.prng.rand(5, self.n_features)] h = hmm.GaussianHMM(self.n_components, self.covariance_type) # This shouldn't raise # ValueError: setting an array element with a sequence. h.fit(obs) def test_fit_with_priors(self, params='stmc', n_iter=5, verbose=False): startprob_prior = 10 * self.startprob + 2.0 transmat_prior = 10 * self.transmat + 2.0 means_prior = self.means means_weight = 2.0 covars_weight = 2.0 if self.covariance_type in ('full', 'tied'): covars_weight += self.n_features covars_prior = self.covars[self.covariance_type] h = hmm.GaussianHMM(self.n_components, self.covariance_type) h.startprob_ = self.startprob h.startprob_prior = startprob_prior h.transmat_ = hmm.normalize(self.transmat + np.diag(self.prng.rand(self.n_components)), 1) h.transmat_prior = transmat_prior h.means_ = 20 * self.means h.means_prior = means_prior h.means_weight = means_weight h.covars_ = self.covars[self.covariance_type] h.covars_prior = covars_prior h.covars_weight = covars_weight # Create training data by sampling from the HMM. train_obs = [h.sample(n=10)[0] for x in xrange(10)] # Mess up the parameters and see if we can re-learn them. h.n_iter = 0 h.fit(train_obs[:1]) trainll = train_hmm_and_keep_track_of_log_likelihood( h, train_obs, n_iter=n_iter, params=params)[1:] # Check that the loglik is always increasing during training if not np.all(np.diff(trainll) > 0) and verbose: print print ('Test MAP train: %s (%s)\n %s\n %s' % (self.covariance_type, params, trainll, np.diff(trainll))) # XXX: Why such a large tolerance? self.assertTrue(np.all(np.diff(trainll) > -0.5)) class TestGaussianHMMWithSphericalCovars(GaussianHMMBaseTester, TestCase): covariance_type = 'spherical' def test_fit_startprob_and_transmat(self): self.test_fit('st') class TestGaussianHMMWithDiagonalCovars(GaussianHMMBaseTester, TestCase): covariance_type = 'diag' class TestGaussianHMMWithTiedCovars(GaussianHMMBaseTester, TestCase): covariance_type = 'tied' class TestGaussianHMMWithFullCovars(GaussianHMMBaseTester, TestCase): covariance_type = 'full' class MultinomialHMMTestCase(TestCase): """Using examples from Wikipedia - http://en.wikipedia.or
g/wiki/Hidden_Markov_model - http://en.wikipedia.org/wiki/Viterbi_algorithm """ def setUp(self): self.prng = np.random.RandomState(9) self.n_components = 2 # ('Rainy', 'Sunny') self.n_symbols = 3 # ('walk', 'shop', 'clean') self.emissionprob = [[0.1, 0.4, 0.5], [0.6, 0.3, 0.1]] self.startprob = [0.6, 0.4] self.transmat = [[0.7, 0.3], [0.4, 0.6]] self.h = hmm.MultinomialHMM(self.n_components,
startprob=self.startprob, transmat=self.transmat) self.h.emissionprob_ = self.emissionprob def test_wikipedia_viterbi_example(self): # From http://en.wikipedia.org/wiki/Viterbi_algorithm: # "This reveals that the observations ['walk', 'shop', 'clean'] # were most likely generated by states ['Sunny', 'Rainy', # 'Rainy'], with probability 0.01344." observations = [0, 1, 2] logprob, state_sequence = self.h.decode(observations) self.assertAlmostEqual(np.exp(logprob), 0.01344) assert_array_equal(state_sequence, [1, 0, 0]) def test_attributes(self): h = hmm.MultinomialHMM(self.n_components) self.assertEquals(h.n_components, self.n_components) h.startprob_ = self.startprob assert_array_almost_equal(h.startprob_, self.startprob) self.assertRaises(ValueError, h.__setattr__, 'startprob_', 2 * self.startprob) self.assertRaises(ValueError, h.__setattr__, 'startprob_', []) self.assertRaises(ValueError, h.__setattr__, 'startprob_', np.zeros((self.n_components - 2, self.n_symbols))) h.transmat_ = self.transmat assert_array_almost_equal(h.transmat_, self.transmat) self.assertRaises(ValueError, h.__setattr__, 'transmat_', 2 * self.transmat) self.assertRaises(ValueError, h.__setattr__, 'transmat_', []) self.assertRaises(ValueError, h.__setattr__, 'transmat_', np.zeros((self.n_components - 2, self.n_components))) h.emissionprob_ = self.emissionprob assert_array_almost_equal(h.emissionprob_, self.emissionprob) self.assertRaises(ValueError, h.__setattr__, 'emissionprob_', []) self.assertRaises(ValueError, h.__setattr__, 'emissionprob_', np.zeros((self.n_components - 2, self.n_symbols))) self.assertEquals(h.n_symbols, self.n_symbols) def test_eval(self): idx = np.repeat(range(self.n_components), 10) nobs = len(idx) obs = [int(x) for x in np.floor(self.prng.rand(nobs) * self.n_symbols)] ll, posteriors = self.h.eval(obs) self.assertEqual(posteriors.shape, (nobs, self.n_components)) assert_array_almost_equal(posteriors.sum(axis=1), np.ones(nobs)) def test_sample(self, n=1000): samples = self.h.sample(n)[0] self.assertEquals(len(samples), n) self.assertEquals(len(np.unique(samples)), self.n_symbols) def test_fit(self, params='ste', n_iter=5, verbose=False, **kwargs): h = self.h # Create training data by sampling from the HMM. train_obs = [h.sample(n=10)[0] for x in xrange(10)] # Mess up the parameters and see if we can re-learn them. h.startprob_ = hmm.normalize(self.prng.rand(self.n_components)) h.transmat_ = hmm.normalize(self.prng.rand(self.n_components,
f copy(self, name=None): if not name: name = self.name + "copy" navigate_to(self, 'Details') tb.select('Configuration', 'Copy this Role to a new Role') new_role = Role(name=name) fill(self.form, {'name_txt': new_role.name}, action=form_buttons.add) flash.assert_success_message('Role "{}" was saved'.format(new_role.name)) return new_role @navigator.register(Role, 'All') class RoleAll(CFMENavigateStep): prerequisite = NavigateToAttribute('appliance.server', 'Configuration') def step(self): accordion.tree("Access Control", self.obj.appliance.server_region_string(), "Roles") def resetter(self): accordion.refresh("Access Control") @navigator.register(Role, 'Add') class RoleAdd(CFMENavigateStep): prerequisite = NavigateToSibling('All') def step(self): tb_select("Add a new Role") @navigator.register(Role, 'Details') class RoleDetails(CFMENavigateStep): prerequisite = NavigateToSibling('All') def step(self): accordion.tree( "Access Control", self.obj.appliance.server_region_string(), "Roles", self.obj.name ) def resetter(self): accordion.refresh("Access Control") @navigator.register(Role, 'Edit') class RoleEdit(CFMENavigateStep): prerequisite = NavigateToSibling('Details') def step(self): tb_select('Edit this Role') class Tenant(Updateable, Pretty, Navigatable): """ Class representing CFME tenants in the UI. * Kudos to mfalesni * The behaviour is shared with Project, which is the same except it cannot create more nested tenants/projects. Args: name: Name of the tenant description: Description of the tenant parent_tenant: Parent tenant, can be None, can be passed as string or object """ save_changes = form_buttons.FormButton("Save changes") # TODO: # Temporary defining elements with "//input" as Input() is not working.Seems to be # with html elements,looking into it. quota_form = Form( fields=[ ('cpu_cb', CFMECheckbox('cpu_allocated')), ('cpu_txt', "//input[@id='id_cpu_allocated']"), ('memory_cb', CFMECheckbox('mem_allocated')), ('memory_txt', "//input[@id='id_mem_allocated']"), ('storage_cb', CFMECheckbox('storage_allocated')), ('storage_txt', "//input[@id='id_storage_allocated']"), ('vm_cb', CFMECheckbox('vms_allocated')), ('vm_txt', "//input[@id='id_vms_allocated']"), ('template_cb', CFMECheckbox('templates_allocated')), ('template_txt', "//input[@id='id_templates_allocated']") ]) tenant_form = Form( fields=[ ('name', Input('name')), ('description', Input('description')) ]) pretty_attrs = ["name", "description"] @classmethod def get_root_tenant(cls): return cls(name="My Company", _default=True) def __init__(self, name=None, description=None, parent_tenant=None, _default=False,
appliance=None): Navigatable.__init__(self, appliance=appliance) self.name = name self.description = description self.parent_tenant = parent_tenant self._default = _default @property def parent_tenant(self): if self._default: return None if self._parent_tenant: return self._parent_tenant return self.get_root_tenant() @parent_tenant.setter def parent_tenant(self, t
enant): if tenant is not None and isinstance(tenant, Project): # If we try to raise ValueError("Project cannot be a parent object.") if isinstance(tenant, basestring): # If parent tenant is passed as string, # we assume that tenant name was passed instead of object tenant = Tenant(tenant) self._parent_tenant = tenant def __eq__(self, other): if not isinstance(other, type(self)): return False else: return self.name == other.name @property def exists(self): try: navigate_to(self, 'Details') return True except CandidateNotFound: return False @property def tree_path(self): if self._default: return [self.name] else: return self.parent_tenant.tree_path + [self.name] @property def parent_path(self): return self.tree_path[:-1] def create(self, cancel=False): if self._default: raise ValueError("Cannot create the root tenant {}".format(self.name)) navigate_to(self, 'Add') fill(self.tenant_form, self, action=form_buttons.add) if type(self) is Tenant: flash.assert_success_message('Tenant "{}" was saved'.format(self.name)) elif type(self) is Project: flash.assert_success_message('Project "{}" was saved'.format(self.name)) else: raise TypeError( 'No Tenant or Project class passed to create method{}'.format( type(self).__name__)) def update(self, updates): navigate_to(self, 'Edit') # Workaround - form is appearing after short delay sel.wait_for_element(self.tenant_form.description) fill(self.tenant_form, updates, action=self.save_changes) flash.assert_success_message( 'Project "{}" was saved'.format(updates.get('name', self.name))) def delete(self, cancel=False): navigate_to(self, 'Details') tb_select("Delete this item", invokes_alert=True) sel.handle_alert(cancel=cancel) flash.assert_success_message('Tenant "{}": Delete successful'.format(self.description)) def set_quota(self, **kwargs): navigate_to(self, 'ManageQuotas') # Workaround - form is appearing after short delay sel.wait_for_element(self.quota_form.cpu_txt) fill(self.quota_form, {'cpu_cb': kwargs.get('cpu_cb'), 'cpu_txt': kwargs.get('cpu'), 'memory_cb': kwargs.get('memory_cb'), 'memory_txt': kwargs.get('memory'), 'storage_cb': kwargs.get('storage_cb'), 'storage_txt': kwargs.get('storage'), 'vm_cb': kwargs.get('vm_cb'), 'vm_txt': kwargs.get('vm'), 'template_cb': kwargs.get('template_cb'), 'template_txt': kwargs.get('template')}, action=self.save_changes) flash.assert_success_message('Quotas for Tenant "{}" were saved'.format(self.name)) @navigator.register(Tenant, 'All') class TenantAll(CFMENavigateStep): prerequisite = NavigateToAttribute('appliance.server', 'Configuration') def step(self): accordion.tree("Access Control", self.obj.appliance.server_region_string(), "Tenants") def resetter(self): accordion.refresh("Access Control") @navigator.register(Tenant, 'Details') class TenantDetails(CFMENavigateStep): prerequisite = NavigateToSibling('All') def step(self, *args, **kwargs): accordion.tree( "Access Control", self.obj.appliance.server_region_string(), "Tenants", *self.obj.tree_path ) @navigator.register(Tenant, 'Add') class TenantAdd(CFMENavigateStep): def prerequisite(self, *args, **kwargs): navigate_to(self.obj.parent_tenant, 'Details') def step(self, *args, **kwargs): if isinstance(self.obj, Tenant): add_selector = 'Add child Tenant to this Tenant' elif isinstance(self.obj, Project): add_selector = 'Add Project to this Tenant' else: raise OptionNotAvailable('Object type unsupported for Tenant Add: {}' .format(type(self.obj).__name__)) tb.select('Configuration', add_selector) @navigator.register(Tenant, 'Edit') class TenantEdit(CFMENavigateStep):
""" Signals for user profiles """ from django.conf import settings from django.db import transaction from django.db.models.signals import post_delete, post_save from django.dispatch import receiver from discussions import tasks from profiles.models import Profile from roles.models import Role from roles.roles import Permissions @receiver(post_save, sender=Profile, dispatch_uid="sync_user_profile") def sync_user_profile(sender, instance, created, **kwargs): # pylint: disable=unused-argument """ Signal handler create/update a Disc
ussionUser every time a profile is created/updated """ if not settings.FEATURES.get('OPEN_DISCUSSIONS_USER_SYNC', False): return transaction.on_commit(lambda
: tasks.sync_discussion_user.delay(instance.user_id)) @receiver(post_save, sender=Role, dispatch_uid="add_staff_as_moderator") def add_staff_as_moderator(sender, instance, created, **kwargs): # pylint: disable=unused-argument """ Signal handler add user as moderator when his staff role on program is added """ if not settings.FEATURES.get('OPEN_DISCUSSIONS_USER_SYNC', False): return if instance.role not in Role.permission_to_roles[Permissions.CAN_CREATE_FORUMS]: return transaction.on_commit( lambda: tasks.add_user_as_moderator_to_channel.delay( instance.user_id, instance.program_id, ) ) @receiver(post_delete, sender=Role, dispatch_uid="delete_staff_as_moderator") def delete_staff_as_moderator(sender, instance, **kwargs): # pylint: disable=unused-argument """ Signal handler removes user as moderator when his staff role on program is deleted """ if not settings.FEATURES.get('OPEN_DISCUSSIONS_USER_SYNC', False): return if instance.role not in Role.permission_to_roles[Permissions.CAN_CREATE_FORUMS]: return transaction.on_commit( lambda: tasks.remove_user_as_moderator_from_channel.delay( instance.user_id, instance.program_id, ) )
ever" (always use the default regular endpoint) and "auto" (auto switch to the default mTLS endpoint if client certificate is present, this is the default value). However, the ``api_endpoint`` property takes precedence if provided. (2) If GOOGLE_API_USE_CLIENT_CERTIFICATE environment variable is "true", then the ``client_cert_source`` property can be used to provide client certificate for mutual TLS transport. If not provided, the default SSL client certificate will be used if present. If GOOGLE_API_USE_CLIENT_CERTIFICATE is "false" or not
set, no client certificate will be used. client_info (google.api_core.gapic_v1.client_info.ClientInfo): The client info used to send a user-agent string along with API requests. If ``None``, then default info will be used. Generally, you only need to set this if you're developing your own client library. Raises: google.auth.exceptions.MutualTLSChannelErr
or: If mutual TLS transport creation failed for any reason. """ if isinstance(client_options, dict): client_options = client_options_lib.from_dict(client_options) if client_options is None: client_options = client_options_lib.ClientOptions() # Create SSL credentials for mutual TLS if needed. use_client_cert = bool( util.strtobool( os.getenv("GOOGLE_API_USE_CLIENT_CERTIFICATE", "false") ) ) ssl_credentials = None is_mtls = False if use_client_cert: if client_options.client_cert_source: import grpc # type: ignore cert, key = client_options.client_cert_source() ssl_credentials = grpc.ssl_channel_credentials( certificate_chain=cert, private_key=key ) is_mtls = True else: creds = SslCredentials() is_mtls = creds.is_mtls ssl_credentials = creds.ssl_credentials if is_mtls else None # Figure out which api endpoint to use. if client_options.api_endpoint is not None: api_endpoint = client_options.api_endpoint else: use_mtls_env = os.getenv("GOOGLE_API_USE_MTLS_ENDPOINT", "auto") if use_mtls_env == "never": api_endpoint = self.DEFAULT_ENDPOINT elif use_mtls_env == "always": api_endpoint = self.DEFAULT_MTLS_ENDPOINT elif use_mtls_env == "auto": api_endpoint = ( self.DEFAULT_MTLS_ENDPOINT if is_mtls else self.DEFAULT_ENDPOINT ) else: raise MutualTLSChannelError( "Unsupported GOOGLE_API_USE_MTLS_ENDPOINT value. Accepted values: never, auto, always" ) # Save or instantiate the transport. # Ordinarily, we provide the transport, but allowing a custom transport # instance provides an extensibility point for unusual situations. if isinstance(transport, AdServiceTransport): # transport is a AdServiceTransport instance. if credentials: raise ValueError( "When providing a transport instance, " "provide its credentials directly." ) self._transport = transport elif isinstance(transport, str): Transport = type(self).get_transport_class(transport) self._transport = Transport( credentials=credentials, host=self.DEFAULT_ENDPOINT ) else: self._transport = AdServiceGrpcTransport( credentials=credentials, host=api_endpoint, ssl_channel_credentials=ssl_credentials, client_info=client_info, ) def get_ad( self, request: ad_service.GetAdRequest = None, *, resource_name: str = None, retry: retries.Retry = gapic_v1.method.DEFAULT, timeout: float = None, metadata: Sequence[Tuple[str, str]] = (), ) -> ad.Ad: r"""Returns the requested ad in full detail. List of thrown errors: `AuthenticationError <>`__ `AuthorizationError <>`__ `HeaderError <>`__ `InternalError <>`__ `QuotaError <>`__ `RequestError <>`__ Args: request (:class:`google.ads.googleads.v8.services.types.GetAdRequest`): The request object. Request message for [AdService.GetAd][google.ads.googleads.v8.services.AdService.GetAd]. resource_name (:class:`str`): Required. The resource name of the ad to fetch. This corresponds to the ``resource_name`` field on the ``request`` instance; if ``request`` is provided, this should not be set. retry (google.api_core.retry.Retry): Designation of what errors, if any, should be retried. timeout (float): The timeout for this request. metadata (Sequence[Tuple[str, str]]): Strings which should be sent along with the request as metadata. Returns: google.ads.googleads.v8.resources.types.Ad: An ad. """ # Create or coerce a protobuf request object. # Sanity check: If we got a request object, we should *not* have # gotten any keyword arguments that map to the request. if request is not None and any([resource_name]): raise ValueError( "If the `request` argument is set, then none of " "the individual field arguments should be set." ) # Minor optimization to avoid making a copy if the user passes # in a ad_service.GetAdRequest. # There's no risk of modifying the input as we've already verified # there are no flattened fields. if not isinstance(request, ad_service.GetAdRequest): request = ad_service.GetAdRequest(request) # If we have keyword arguments corresponding to fields on the # request, apply these. if resource_name is not None: request.resource_name = resource_name # Wrap the RPC method; this adds retry and timeout information, # and friendly error handling. rpc = self._transport._wrapped_methods[self._transport.get_ad] # Certain fields should be provided within the metadata header; # add these here. metadata = tuple(metadata) + ( gapic_v1.routing_header.to_grpc_metadata( (("resource_name", request.resource_name),) ), ) # Send the request. response = rpc( request, retry=retry, timeout=timeout, metadata=metadata, ) # Done; return the response. return response def mutate_ads( self, request: ad_service.MutateAdsRequest = None, *, customer_id: str = None, operations: Sequence[ad_service.AdOperation] = None, retry: retries.Retry = gapic_v1.method.DEFAULT, timeout: float = None, metadata: Sequence[Tuple[str, str]] = (), ) -> ad_service.MutateAdsResponse: r"""Updates ads. Operation statuses are returned. Updating ads is not supported for TextAd, ExpandedDynamicSearchAd, GmailAd and ImageAd. List of thrown errors: `AdCustomizerError <>`__ `AdError <>`__ `AdSharingError <>`__ `AdxError <>`__ `AssetError <>`__ `AssetLinkError <>`__ `AuthenticationError <>`__ `AuthorizationError <>`__ `CollectionSizeError <>`__ `DatabaseError <>`__ `DateError <>`__ `DistinctError <>`__ `FeedAttributeReferenceError <>`__ `FieldError <>`__ `FieldMa
# This Source Code Form is subject to the terms of the Mozilla Public # License, v. 2.0. If a copy of the MPL was not distributed with this # file, You can obtain one at http://mozilla.org/MPL/2.0/. from django.core.exceptions import PermissionDenied from mock import Mock, patch from nose.tools import eq_, raises from oneanddone.base.tests import TestCase from oneanddone.users.mixins import BaseUserProfileRequiredMixin, PrivacyPolicyRequiredMixin, MyStaffUserRequiredMixin from oneanddone.users.tests import UserFactory, UserProfileFactory class FakeMixin(object): def dispatch(self, request, *args, **kwargs): return 'fakemixin' class FakeView(BaseUserProfileRequiredMixin, FakeMixin): pass class FakeViewNeedsPrivacyPolicy(PrivacyPolicyRequiredMixin, FakeMixin): pass class FakeViewNeedsStaff(MyStaffUserRequiredMixin, FakeMixin): pass class MyStaffUserRequiredMixinTests(TestCase): def setUp(self): self.view = FakeViewNeedsStaff() def test_is_staff(self): """ If the user is staff, call the parent class's dispatch method. """ request = Mock() request.user = UserFactory.create(is_staff=True) eq_(self.view.dispatch(request), 'fakemixin') @raises(PermissionDenied) def test_not_staff(self): """ If the user is not staff, raise a PermissionDenied exception. """ request = Mock() request.user = UserFactory.create(is_staff=False) self.view.dispatch(request) class PrivacyPolicyRequiredMixinTests(TestCase): def setUp(self): self.view = FakeViewNeedsPrivacyPolicy() def test_has_profile_and_accepts_privacy_policy(self): """ If the user has created a profile, and has accepted privacy policy call the parent class's dispatch method. """ reque
st = Mock()
request.user = UserProfileFactory.create(privacy_policy_accepted=True).user eq_(self.view.dispatch(request), 'fakemixin') def test_has_profile_and_not_accepted_privacy_policy(self): """ If the user has created a profile, and has not accepted privacy policy redirect them to profile update view. """ request = Mock() request.user = UserProfileFactory.create(privacy_policy_accepted=False).user with patch('oneanddone.users.mixins.redirect') as redirect: eq_(self.view.dispatch(request), redirect.return_value) redirect.assert_called_with('users.profile.update') def test_no_profile(self): """ If the user hasn't created a profile, redirect them to the profile creation view. """ request = Mock() request.user = UserFactory.create() with patch('oneanddone.users.mixins.redirect') as redirect: eq_(self.view.dispatch(request), redirect.return_value) redirect.assert_called_with('users.profile.create') class UserProfileRequiredMixinTests(TestCase): def setUp(self): self.view = FakeView() def test_has_profile(self): """ If the user has created a profile, and has accepted privacy policy call the parent class's dispatch method. """ request = Mock() request.user = UserProfileFactory.create(privacy_policy_accepted=True).user eq_(self.view.dispatch(request), 'fakemixin') def test_no_profile(self): """ If the user hasn't created a profile, redirect them to the profile creation view. """ request = Mock() request.user = UserFactory.create() with patch('oneanddone.users.mixins.redirect') as redirect: eq_(self.view.dispatch(request), redirect.return_value) redirect.assert_called_with('users.profile.create')
import frappe from frappe.utils import get_fullname def execute(): for user_id in frappe.db.sql_list("""select distinct user_id from `tabEmployee` where ifnull(user_id, '')!='' group by user_id having count(name) > 1"""): fullname = get_fullname(user_id) employee = frappe.db.get_value("Employee", {"employee_name": fu
llname, "user_id": user_id}) if employee: frappe.db.sql("""update `tabEmployee` set user_id=null where user_id=%s and name!=%s""", (user_id, emplo
yee))
from django.apps import AppConfig class VotesConfig(AppConfig):
name = 'meinberlin.apps.votes'
label = 'meinberlin_votes'
return "test_PoissonSolver failed! calc/theory field ratio at 0: {}".format(g.electric_field[1] / field[0]) assert np.allclose(g.electric_field, field), plots() # def test_PoissonSolver_complex(debug=DEBUG): # L = 1 # N = 32 * 2**5 # epsilon_0 = 1 # x, dx = np.linspace(0, L, N, retstep=True, endpoint=False) # anal_potential = lambda x: np.sin(x * 2 * np.pi) + 0.5 * \ # np.sin(x * 6 * np.pi) + 0.1 * np.sin(x * 20 * np.pi) # anal_field = lambda x: -(2 * np.pi * np.cos(x * 2 * np.pi) + 3 * np.pi * # np.cos(x * 6 * np.pi) + 20 * np.pi * 0.1 * np.cos(x * 20 * np.pi)) # charge_density_anal = lambda x: ((2 * np.pi)**2 * np.sin(x * 2 * np.pi) + 18 * np.pi**2 * np.sin( # x * 6 * np.pi) + (20 * np.pi)**2 * 0.1 * np.sin(x * 20 * np.pi)) * epsilon_0 # # NG = 32 # g = Frame(L, NG, epsilon_0) # # indices_in_denser_grid = np.searchsorted(x, g.x) # g.charge_density = charge_density_anal(g.x) # energy_fourier = g.init_solver_fourier() # energy_direct = 0.5 * (g.electric_field**2).sum() * g.dx # print("dx", dx, "fourier", energy_fourier, "direct", energy_direct, energy_fourier / energy_direct) # # def plots(): # fig, xspace = plt.subplots() # xspace.set_title( # r"Solving the Poisson equation $\Delta \psi = \rho / \epsilon_0$ via Fourier transform") # xspace.plot(g.x, g.charge_density, "ro--", label=r"$\rho$") # xspace.plot(x, charge_density_anal(x), "r-", lw=6, alpha=0.5, label=r"$\rho_a$") # xspace.plot(g.x, g.potential, "go--", label=r"$V$") # xspace.plot(x, anal_potential(x), "g-", lw=6, alpha=0.5, label=r"$V_a$") # xspace.plot(g.x, g.electric_field, "bo--", alpha=0.5, label=r"$E$") # EplotAnal, = xspace.plot(x, anal_field(x), "b-", lw=6, alpha=0.5, label=r"$E_a$") # xspace.set_xlim(0, L) # xspace.set_xlabel("$x$") # xspace.grid() # xspace.legend(loc='best') # # fig2, fspace = plt.subplots() # fspace.plot(g.k_plot, g.energy_per_mode, "bo--", label=r"electric energy $\rho_F V_F^\dagger$") # fspace.set_xlabel("k") # fspace.set_ylabel("mode energy") # fspace.set_title("Fourier space") # fspace.grid() # fspace.legend(loc='best') # plt.show() # return "test_PoissonSolver_complex failed!" # # energy_correct = np.
isclose(energy_fouri
er, energy_direct) # field_correct = np.isclose(g.electric_field, anal_field(g.x)).all() # potential_correct = np.isclose(g.potential, anal_potential(g.x)).all() # assert field_correct and potential_correct and energy_correct, plots() def test_PoissonSolver_energy_sine(_NG, ): _L = 1 resolution_increase = _NG N = _NG * resolution_increase epsilon_0 = 1 x, dx = np.linspace(0, _L, N, retstep=True, endpoint=False) anal_field = np.zeros((N, 3)) anal_field[:, 0] = -(2 * np.pi * np.cos(x * 2 * np.pi / _L)) charge_density_anal = ((2 * np.pi) ** 2 * np.sin(x * 2 * np.pi)) g = PeriodicTestGrid(1, _L, _NG, epsilon_0) indices_in_denser_grid = np.searchsorted(x, g.x) g.charge_density[:-1] = charge_density_anal[indices_in_denser_grid] # / resolution_increase g.init_solve() g.save_field_values(0) g.postprocess() energy_fourier = g.grid_energy_history[0] energy_direct = g.direct_energy_calculation() print("dx", dx, "fourier", energy_fourier, "direct", energy_direct, energy_fourier / energy_direct) def plots(): fig, xspace = plt.subplots() xspace.set_title( r"Solving the Poisson equation $\Delta \psi = \rho / \epsilon_0$ via Fourier transform") xspace.plot(g.x, g.charge_density, "ro--", label=r"$\rho$") xspace.plot(x, charge_density_anal, "r-", lw=6, alpha=0.5, label=r"$\rho_a$") xspace.plot(g.x, g.electric_field, "bo--", alpha=0.5, label=r"$E$") xspace.plot(x, anal_field, "b-", lw=6, alpha=0.5, label=r"$E_a$") xspace.set_xlim(0, _L) xspace.set_xlabel("$x$") xspace.grid() xspace.legend(loc='best') fig2, fspace = plt.subplots() fspace.plot(g.k_plot, g.energy_per_mode, "bo--", label=r"electric energy $\rho_F V_F^\dagger$") fspace.set_xlabel("k") fspace.set_ylabel("mode energy") fspace.set_title("Fourier space") fspace.grid() fspace.legend(loc='best') plt.show() return "test_PoissonSolver_complex failed!" energy_correct = np.allclose(energy_fourier, energy_direct) assert energy_correct, plots() field_correct = np.allclose(g.electric_field[1:-1, 0], anal_field[indices_in_denser_grid][:, 0]) assert field_correct, plots() def test_PoissonSolver_sheets(_NG, _L, _test_charge_density=1): epsilon_0 = 1 x, dx = np.linspace(0, _L, _NG, retstep=True, endpoint=False) charge_density = np.zeros_like(x) region1 = (_L * 1 / 8 < x) * (x < _L * 2 / 8) region2 = (_L * 5 / 8 < x) * (x < _L * 6 / 8) charge_density[region1] = _test_charge_density charge_density[region2] = -_test_charge_density g = PeriodicTestGrid(1, _L, _NG, epsilon_0) g.charge_density[:-1] = charge_density g.init_solve() def plots(): fig, axes = plt.subplots(3) ax0, ax1 = axes ax0.plot(x, charge_density) ax0.set_title("Charge density") ax1.set_title("Field") ax1.plot(x, g.electric_field, "r-") for ax in axes: ax.grid() ax.legend() plt.show() return "test_PoissonSolver_sheets failed!" polynomial_coefficients = np.polyfit(x[region1], g.electric_field[1:-1, 0][region1], 1) first_bump_right = np.isclose( polynomial_coefficients[0], _test_charge_density, rtol=1e-2) assert first_bump_right, plots() polynomial_coefficients = np.polyfit(x[region2], g.electric_field[1:-1, 0][region2], 1) second_bump_right = np.isclose( polynomial_coefficients[0], -_test_charge_density, rtol=1e-2) assert second_bump_right, plots() def test_PoissonSolver_ramp(_NG, _L): """ For a charge density rho = Ax + B d2phi/dx2 = -rho/epsilon_0 set epsilon_0 to 1 d2phi/dx2 = Ax phi must be of form phi = -Ax^3/6 + Bx^2 + Cx + D""" a = 1 # noinspection PyArgumentEqualDefault g = PeriodicTestGrid(1, _L, _NG, epsilon_0=1) g.charge_density[:-1] = a * g.x g.init_solve() field = a * (g.x - _L / 2) ** 2 / 2 def plots(): fig, axes = plt.subplots(2) ax0, ax1 = axes ax0.plot(g.x, g.charge_density) ax0.set_title("Charge density") ax1.set_title("Field") ax1.plot(g.x, g.electric_field, "r-") ax1.plot(g.x, field, "g-") for ax in axes: ax.grid() ax.legend() plt.show() return "test_PoissonSolver_ramp failed!" polynomial_coefficients = np.polyfit(g.x, g.electric_field[1:-1, 0], 2) assert np.isclose(polynomial_coefficients[0], a / 2, rtol=1e-2), (polynomial_coefficients[0], a / 2, plots()) def test_BunemanSolver(__t, _NG, _L, _test_charge_density): g = NonperiodicTestGrid(__t, _L, _NG) charge_index = _NG // 2 g.current_density_x[charge_index] = _test_charge_density g.solve() g.save_field_values(0) S = Simulation(g) pulled_field = g.electric_field[charge_index, 0] expected_field = - g.dt / g.epsilon_0 * _test_charge_density def plot(): fig, (ax1, ax2) = plt.subplots(2) CurrentPlot(S, ax1, 0).update(0) FieldPlot(S, ax2, 0).update(0) plt.show() assert np.isclose(pulled_field, expected_field), plot() def test_BunemanSolver_charge(__t, _NG, _L, _test_charge_density): g = NonperiodicTestGrid(__t, _L, _NG) v = 0.5 g.current_density_x[1:-2] = v * _test_charge_density g.solve() g.save_field_values(0) S = Simulation(g).postprocess() def plot(): fig, (ax1, ax2) = plt.subplots(2) CurrentPlot(S, ax1, 0).update(0) FieldPlot(S, ax2, 0).update(0) plt.show() assert np.allclose(g.electric_field[1:-1,0], -v * _test_charge_d
# -*- coding: utf-8 -*- """ Tests for the WMS Service Type. """ import unittest from httmock import with_httmock import mocks.warper from aggregator.models import Service class TestWarper(unittest.TestCase): @with_httmock(mocks.warper.resource_get) def test_create_wms_service(self): # create the service service = Service( type='WARPER', url='http://warper.example.com/warper/maps', ) service.save() # check layer number self.assertEqual(service.layer_set.all().count(), 15) # check layer 0 (public) layer_0 = service.layer_set.all()[0] self.assertEqual(layer_0.name, '29568') self.assertEqual(layer_0.title, 'Plate 24: Map bounded by Myrtle Avenue') self.assertTrue(layer_0.is_public) self.assertEqual(layer_0.keywords.all().count(), 0) self.assertEqual(layer_0.srs.all().count(), 3) self.assertEqual(layer_0.check_set.all().count(), 1) self.assertEqual(layer_0.layerdate_set.all()[0].date, '1855-01-01') # a layer with no bbox must be stored with None coordinates layer_no_bbox = service.layer_set.get(name='16239') self.assertEqual(layer_no_bbox.bbox_x0, None) self.assertEqual(layer_no_bbox.bbox_
y0, None) self.assertEqual(layer_no_bbox.bbox_x1, None) self.assertEqual(layer_no_bbox.bbox_y1, None) # test that if creating the service and is already exiting it is not being duplicated # create the service def create_duplicated_service(): duplicated_service = Ser
vice( type='WARPER', url='http://warper.example.com/warper/maps', ) duplicated_service.save() self.assertRaises(Exception, create_duplicated_service) if __name__ == '__main__': unittest.main()
class Solution(object): def asteroidCollision(self, asteroids): """ :type asteroids: List[int] :rtype: List[int] """ ret = [] for elem in asteroids: if elem > 0:
ret.append(elem) else: while ret: if 0 < ret[-1] <= -elem: temp = ret.pop() if temp == -elem: break else: if ret[-1] < 0: ret.append(elem) break else: ret.append(elem) return ret print(Solution().asteroidCollision([5, 10, -5])) print(Solution().asteroidCollision([8, -8])) print(Solution().asteroidCollision([10, 2, -5])) print(Solution().asteroidCollision([-2, -1, 1, 2]))
# Copyright 2021 The TF-Coder Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific lang
uage governing permissions and # limitations under the License. # Lint as: python3 """Serialization of objects relevant to TF-Coder. This module will be used to send information from the public Colab notebook to Google Analytics, in string form. Using BigQuery we can extract the strings that were sent, and then parse the strings back into the Python objects that they
represent. The information we want to log includes: * Input/output objects. Usually these are multidimensional lists, Tensors, or SparseTensors, but in principle these can be anything that value search supports (e.g., primitives, dtypes, tuples of Tensors etc.). * Constants. Usually these are Python primitives, but again they may be anything value search supports (e.g., a shape tuple). * Natural language description. This should be a string and may contain tricky characters like Unicode or quotes. * Settings for the TF-Coder tool. These may use standard Python collections, i.e. lists/tuples/sets/dicts. This category of information should be treated generally to be future-proof. * Results of the TF-Coder tool. These would include timestamps and solution expressions. * Other metadata, e.g., session/problem IDs, and whether the data can be released in a dataset. """ import ast from typing import Any, List, Text import numpy as np import tensorflow as tf # Constant strings for dict representations of objects. _KIND_KEY = 'kind' _DTYPE_KIND = 'DType' _TENSOR_KIND = 'Tensor' _SPARSE_TENSOR_KIND = 'SparseTensor' _DICT_KIND = 'Dict' def _object_to_literal(to_serialize: Any, container_stack: List[Any]) -> Any: """Turns a supported object into a Python literal.""" if isinstance(to_serialize, (int, float, bool, str, bytes, type(None))): return to_serialize elif isinstance(to_serialize, tf.DType): dtype_string = repr(to_serialize) assert dtype_string.startswith('tf.') dtype_string = dtype_string[len('tf.'):] return {_KIND_KEY: _DTYPE_KIND, 'dtype': dtype_string} elif isinstance(to_serialize, tf.Tensor): tensor_content = to_serialize.numpy() # Sometimes tensor_content is a numpy type, and sometimes it's a normal # Python type. if type(tensor_content).__module__ == np.__name__: tensor_content = tensor_content.tolist() return {_KIND_KEY: _TENSOR_KIND, 'content': tensor_content, 'dtype': _object_to_literal(to_serialize.dtype, container_stack)} elif isinstance(to_serialize, tf.SparseTensor): return {_KIND_KEY: _SPARSE_TENSOR_KIND, 'indices': _object_to_literal(to_serialize.indices, container_stack), 'values': _object_to_literal(to_serialize.values, container_stack), 'dense_shape': _object_to_literal(to_serialize.dense_shape, container_stack)} elif isinstance(to_serialize, dict): if any(to_serialize is seen for seen in container_stack): raise ValueError('Cycle detected in object dependencies.') container_stack.append(to_serialize) result = {_object_to_literal(key, container_stack): _object_to_literal(value, container_stack) for key, value in to_serialize.items()} container_stack.pop() return {_KIND_KEY: _DICT_KIND, 'dict': result} elif isinstance(to_serialize, (list, tuple, set)): if any(to_serialize is seen for seen in container_stack): raise ValueError('Cycle detected in object dependencies.') container_stack.append(to_serialize) generator = (_object_to_literal(x, container_stack) for x in to_serialize) container_type = type(to_serialize) result = container_type(generator) container_stack.pop() return result else: raise TypeError('Cannot convert object {} with type {} to a literal.' .format(to_serialize, type(to_serialize))) def _literal_to_object(literal: Any) -> Any: """Turns a literal created by _object_to_literal back into the object.""" if isinstance(literal, (int, float, bool, str, bytes, type(None))): return literal elif isinstance(literal, dict): # If the dict was not created by _object_to_literal, we may throw KeyError. kind = literal[_KIND_KEY] if kind == _DTYPE_KIND: return getattr(tf, literal['dtype']) elif kind == _TENSOR_KIND: return tf.constant(literal['content'], dtype=_literal_to_object(literal['dtype'])) elif kind == _SPARSE_TENSOR_KIND: return tf.SparseTensor( indices=_literal_to_object(literal['indices']), values=_literal_to_object(literal['values']), dense_shape=_literal_to_object(literal['dense_shape'])) elif kind == _DICT_KIND: return {_literal_to_object(key): _literal_to_object(value) for key, value in literal['dict'].items()} else: raise ValueError('Unsupported kind in dict: {}'.format(kind)) elif isinstance(literal, (list, tuple, set)): generator = (_literal_to_object(x) for x in literal) container_type = type(literal) return container_type(generator) else: raise TypeError('Cannot convert literal {} with type {} to an object.' .format(literal, type(literal))) def serialize(to_serialize: Any) -> Text: """Serializes an object into a string. Note: This does not work in Python 2 because its ast.literal_eval does not support sets. Args: to_serialize: The object to serialize. This may be a Python literal (int, float, boolean, string, or None), Tensor, SparseTensor, or possibly-nested lists/tuples/sets/dicts of these. Returns: A string representation of the object. """ return repr(_object_to_literal(to_serialize, container_stack=[])) def parse(serialized: Text) -> Any: """Unparses a string into an object (the inverse of serialize_object).""" literal = ast.literal_eval(serialized) return _literal_to_object(literal)
ta from django.db import models from django.contrib.sites.models import Site from django.core.validators import MinValueValidator from clubdata.models import Club def range_date_inclusive(start_date, end_date): for n in range((end_date - start_date).days+1): yield start_date + timedelta(n) def num_days_in_month(d): dmonth = d.month if dmonth == 12: return 31 else: return (d.replace(month=dmonth+1, day=1) - timedelta(days=1)).day def last_day_in_month(d): dmonth = d.month if dmonth == 12: return d.replace(day=31) else: return d.replace(month=dmonth+1, day=1) - timedelta(days=1) def decode_weekly_criteria(criteria): c = criteria.split(",") dow_possible = ('mo','tu','we','th','fr','sa','su') dow = [False,False,False,False,False,False,False] for x in c: dow[dow_possible.index(x)] = True return dow def decode_monthly_criteria(criteria): c = criteria.split(",") specificdays = [] daystocalculate = [] dow_possible = ('mo','tu','we','th','fr','sa','su') for x in c: if x.isdigit(): # Specific numbered day (same every month) specificdays.append(int(x)) else: # A code to represent a day. We'll convert from strings to integers for later. if x == 'last': # Last day of the month (must be calculated later) daystocalculate.append( (99, -1) ) else: y,z = x.split("-") if y == 'last': # Last DOW of the month (must be calculated later) daystocalculate.append( (99, dow_possible.index(z)) ) else: # Specified DOW of the month (must be calculated later) daystocalculate.append( (int(y), dow_possible.index(z)) ) return specificdays,daystocalculate class RecurringEvent(models.Model): DAILY = 100 WEEKLY = 200 MONTHLY = 300 rule_type_choices = ( (DAILY, 'Daily'), (WEEKLY, 'Weekly'), (MONTHLY, 'Monthly'), ) id = models.AutoField( primary_key=True) # Range starts_on = models.DateField('Starts on') ends_on = models.DateField('Ends on') # Rule rule_type = models.IntegerField('Recurring rule', choices=rule_type_choices, default=WEEKLY) repeat_each = models.IntegerField('Repeat each', default=1, validators=[MinValueValidator(1)]) criteria = models.CharField('Criteria', max_length=200, null=True, # Blank is stored as Null blank=True) # Field is optional class Meta: verbose_name = 'Recurring Event' verbose_name_plural = 'Recurring Events' def __unicode__(self): #Python 3.3 is __str__ rt = self.rule_type for t in self.rule_type_choices: if t[0] == rt: rt = t[1] break return "%s Event, %s to %s, Criteria=\"%s\"" % (rt, self.starts_on, self.ends_on, self.criteria) def dates_per_rule_iter(self): if self.rule_type == self.WEEKLY: # criteria = Must be a comma-separated list of lowercase 2-letter abbreviations for the days # of the week. Ex: mo,we,fr,su # repeat_each = If this is 2, then every other week will be skipped. If it is 3, # then two weeks will be skipped between each filled week. etc... # Deconstruct the criteria criteria = decode_weekly_criteria(self.criteria) # Generate a list of dates that match if self.repeat_each == 1: # If repeat_each is 1, then our calculation is much simpler for x in range_date_inclusive(self.starts_on, self.ends_on): if criteria[x.weekday()]: yield x else: # Special handling because we're not doing every week r = 2 # Set this to 2 so the first iteration will set it to 1 dow_begin = self.starts_on.weekday() for x in range_date_inclusive(self.starts_on, self.ends_on): wd = x.weekday() if wd == dow_begin: # It's the beginning of a new week (rather than assuming the user considers Monday to be # the first day of the week, we use the DOW of the start of the range for this purpose. if r == 1: # Reset the counter r = self.repeat_each else: # Decrease the counter r -= 1 if r == 1: # If counter is 1, then this week should be included if criteria[wd]: yield x elif self.rule_type == self.MONTHLY: # criteria = Must be a comma-separated list of the following types of codes: # * 1,2,3,4, etc specific days of the month # * 1-mo, 3-fr, last-we, etc first Monday, third Friday, last Wednesday, etc. # * last last day of the month # repeat_each = If this is 2, then every other month will be skipped. If it is 3, then two # months will be skipped between each filled month. etc... # Deconstruct the criteria specificdays,daystocalculate = decode_monthly_criteria(self.criteria) # Generate a list of dates that match calcdays = None oneday = timedelta(days=1) r = 2 # Set this to 2 so the first iteration will set it to 1 for x in range_date_inclusive(self.starts_on, self.ends_on): xday = x.day if (xday == 1) or (calcdays is None): # It's the first day of the month (or first iteration of this loop) if r == 1: # Reset the counter r = self.repeat_each else: # Decrease the counter r -= 1 if r == 1: # Putting this within the above 'else' will malfunction if repeat_each is 1 # Since this month is included, we must turn those vague days into specific numbered days # for this current month (each month is different, so they couldn't have been calculated earlier. calcdays = [] for y in daystocalculate: if y[0] == 99: if y[1] == -1: # Calculate the last day of the month calcdays.append(num_days_in_month(x)) else: # Calculate the last DOW of the month end_date = last_day_in_month(x) for z in range(end_date.day): d = end_date - timedelta(z) if d.weekday() == y[1]: calcdays.append(d.day) break else: # Calculate the specified DOW of the month start_date = date(x.year, x.month, 1) found_count = 0
for z in range(num_days_in_month(start_date)): d = start_date + timedelta(z) if d.weekday() == y[1]: found_count += 1 if found_count == y[0]:
calcdays.append(z+1) break print(calcdays) # Check if this month is included (not a skipped month per the repeat_each rule) if r == 1: if (xday in specificdays) or (xday in calcdays): # Assuming the daystocalculate have been calculated (above), simply check if the day is # in one of the two lists yield x elif self.rule_type == self.DAILY: # criteria = Not used # repeat_each = If this is 2, then every other day will be skipped. If it is 3, only every # third day will be chosen. etc... # Generate a list of dates that match if self.repeat_each == 1: # If repeat_each is 1, then our calculation is much simpler for x in range_date_inclusive(self.starts_on, self.ends_on): yield x else: # Use the repeat value. r = self.repeat_each # Include the first day of the range, and then start counting from there for x in range_date_inclusive(self.starts_on, self.ends_on): if r == self.repeat_each: yield x r = 1
from django.core.checks.compatibility.django_1_10 import ( check_duplicate_middleware_settings, ) from django.test import SimpleTestCase from django.test.utils import override_settings class CheckDuplicateMiddlwareSettingsTest(SimpleTestCase): @override_settings(MIDDLEWARE=[], MIDDLEWARE_CLASSES=['django.middleware.common.CommonMiddleware']) def test_duplicate_setting(self): result = check_duplicate_middleware_settings(None) self.assertEqual(re
sult[0].id, '1_10.W001') @override_settings(MIDDLEWARE=None) def test_middleware_not_defined(self): result = check_duplicate
_middleware_settings(None) self.assertEqual(len(result), 0)
from django
.core.management.base import BaseCommand from migrate_dns.import_utils import do_import class Command(
BaseCommand): args = '' def handle(self, *args, **options): do_import()
# Copyright 2018 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). import os from pants.binaries.binary_tool import BinaryToolBase from pants.binaries.binary_util import ( BinaryToolFetcher, Bi
naryToolUrlGenerator, BinaryUtil, HostPlatform, ) from pants.option.scope import GLOBAL_SCOPE from pants.testutil.test_base import TestBase from pants.util.contextutil import temporary_dir from pants.util.dirutil import safe_file_dump class DefaultVersion(BinaryToolBase): options_scope = "default-version-test
" name = "default_version_test_tool" default_version = "XXX" class AnotherTool(BinaryToolBase): options_scope = "another-tool" name = "another_tool" default_version = "0.0.1" class ReplacingLegacyOptionsTool(BinaryToolBase): # TODO: check scope? options_scope = "replacing-legacy-options-tool" name = "replacing_legacy_options_tool" default_version = "a2f4ab23a4c" replaces_scope = "old_tool_scope" replaces_name = "old_tool_version" class BinaryUtilFakeUname(BinaryUtil): def host_platform(self): return HostPlatform("xxx", "yyy") class CustomUrlGenerator(BinaryToolUrlGenerator): _DIST_URL_FMT = "https://custom-url.example.org/files/custom_urls_tool-{version}-{system_id}" _SYSTEM_ID = { "xxx": "zzz", } def generate_urls(self, version, host_platform): base = self._DIST_URL_FMT.format( version=version, system_id=self._SYSTEM_ID[host_platform.os_name] ) return [ base, f"{base}-alternate", ] class CustomUrls(BinaryToolBase): options_scope = "custom-urls" name = "custom_urls_tool" default_version = "v2.1" def get_external_url_generator(self): return CustomUrlGenerator() def _select_for_version(self, version): binary_request = self.make_binary_request(version) return BinaryUtilFakeUname.Factory._create_for_cls(BinaryUtilFakeUname).select( binary_request ) # TODO: these should have integration tests which use BinaryTool subclasses overriding archive_type. class BinaryToolBaseTest(TestBase): def setUp(self): super().setUp() self._context = self.context( for_subsystems=[DefaultVersion, AnotherTool, ReplacingLegacyOptionsTool, CustomUrls], options={ GLOBAL_SCOPE: { "binaries_baseurls": ["https://binaries.example.org"], "pants_bootstrapdir": str(temporary_dir()), }, "another-tool": {"version": "0.0.2",}, "default-version-test.another-tool": {"version": "YYY",}, "custom-urls": {"version": "v2.3",}, "old_tool_scope": {"old_tool_version": "3",}, }, ) def test_base_options(self): # TODO: using extra_version_option_kwargs! default_version_tool = DefaultVersion.global_instance() self.assertEqual(default_version_tool.version(), "XXX") another_tool = AnotherTool.global_instance() self.assertEqual(another_tool.version(), "0.0.2") another_default_version_tool = DefaultVersion.scoped_instance(AnotherTool) self.assertEqual(another_default_version_tool.version(), "YYY") def test_replacing_legacy_options(self): replacing_legacy_options_tool = ReplacingLegacyOptionsTool.global_instance() self.assertEqual(replacing_legacy_options_tool.version(), "a2f4ab23a4c") self.assertEqual(replacing_legacy_options_tool.version(self._context), "3") def test_urls(self): default_version_tool = DefaultVersion.global_instance() self.assertIsNone(default_version_tool.get_external_url_generator()) with self.assertRaises(BinaryUtil.BinaryResolutionError) as cm: default_version_tool.select() err_msg = str(cm.exception) self.assertIn(BinaryToolFetcher.BinaryNotFound.__name__, err_msg) self.assertIn("Failed to fetch default_version_test_tool binary from any source:", err_msg) self.assertIn( "Failed to fetch binary from https://binaries.example.org/bin/default_version_test_tool/XXX/default_version_test_tool:", err_msg, ) custom_urls_tool = CustomUrls.global_instance() self.assertEqual(custom_urls_tool.version(), "v2.3") with self.assertRaises(BinaryUtil.BinaryResolutionError) as cm: custom_urls_tool.select() err_msg = str(cm.exception) self.assertIn(BinaryToolFetcher.BinaryNotFound.__name__, err_msg) self.assertIn("Failed to fetch custom_urls_tool binary from any source:", err_msg) self.assertIn( "Failed to fetch binary from https://custom-url.example.org/files/custom_urls_tool-v2.3-zzz:", err_msg, ) self.assertIn( "Failed to fetch binary from https://custom-url.example.org/files/custom_urls_tool-v2.3-zzz-alternate:", err_msg, ) def test_hackily_snapshot(self): with temporary_dir() as temp_dir: safe_file_dump( os.path.join( temp_dir, "bin", DefaultVersion.name, DefaultVersion.default_version, DefaultVersion.name, ), "content!", ) context = self.context( for_subsystems=[DefaultVersion], options={GLOBAL_SCOPE: {"binaries_baseurls": [f"file:///{temp_dir}"],},}, ) self.maxDiff = None default_version_tool = DefaultVersion.global_instance() _, snapshot = default_version_tool.hackily_snapshot(context) self.assertEqual( "51a98706ab7458069aabe01856cb352ca97686e3edd3bf9ebd3205c2b38b2974", snapshot.directory_digest.fingerprint, )
#! /usr/bin/env python3 with open('x.c',
'w') as f: print('int main(void) { return 0; }', file=f) with open('y', 'w'):
pass
._finish_pending_requests() # In theory, we shouldn't have to do this because curl will # call _set_timeout whenever the timeout changes. However, # sometimes after _handle_timeout we will need to reschedule # immediately even though nothing has changed from curl's # perspective. This is because when socket_action is # called with SOCKET_TIMEOUT, libcurl decides internally which # timeouts need to be processed by using a monotonic clock # (where available) while tornado uses python's time.time() # to decide when timeouts have occurred. When those clocks # disagree on elapsed time (as they will whenever there is an # NTP adjustment), tornado might call _handle_timeout before # libcurl is ready. After each timeout, resync the scheduled # timeout with libcurl's current state. new_timeout = self._multi.timeout() if new_timeout != -1: self._set_timeout(new_timeout) def _handle_force_timeout(self): """Called by IOLoop periodically to ask libcurl to process any events it may have forgotten about. """ with stack_context.NullContext(): while True: try: ret, num_handles = self._multi.socket_all() except pycurl.error as e: ret = e.args[0] if ret != pycurl.E_CALL_MULTI_PERFORM: break self._finish_pending_requests() def _finish_pending_requests(self): """Process any requests that were completed by the last call to multi.socket_action. """ while True: num_q, ok_list, err_list = self._multi.info_read() for curl in ok_list: self._finish(curl) for curl, errnum, errmsg in err_list: self._finish(curl, errnum, errmsg) if num_q == 0: break self._process_queue() def _process_queue(self): with stack_context.NullContext(): while True: started = 0 while self._free_list and self._requests: started += 1 curl = self._free_list.pop() (request, callback) = self._requests.popleft() curl.info = { "headers": httputil.HTTPHeaders(), "buffer": io.StringIO(), "request": request, "callback": callback, "curl_start_time": time.time(), } # Disable IPv6 to mitigate the effects of this bug # on curl versions <= 7.21.0 # http://sourceforge.net/tracker/?func=detail&aid=3017819&group_id=976&atid=100976 if pycurl.version_info()[2] <= 0x71500: # 7.21.0 curl.setopt(pycurl.IPRESOLVE, pycurl.IPRESOLVE_V4) _curl_setup_request(curl, request, curl.info["buffer"], curl.info["headers"]) self._multi.add_handle(curl) if not started: break def _finish(self, curl, curl_error=None, curl_message=None): info = curl.info curl.info = None self._multi.remove_handle(curl) self._free_list.append(curl) buffer = info["buffer"] if curl_error: error = CurlError(curl_error, curl_message) code = error.code effective_url = None buffer.close() buffer = None else: error = None code = curl.getinfo(pycurl.HTTP_CODE) effective_url = curl.getinfo(pycurl.EFFECTIVE_URL) buffer.seek(0) # the various curl timings are documented at # http://curl.haxx.se/libcurl/c/curl_easy_getinfo.html time_info = dict( queue=info["curl_start_time"] - info["request"].start_time, namelookup=curl.getinfo(pycurl.NAMELOOKUP_TIME), connect=curl.getinfo(pycurl.CONNECT_TIME), pretransfer=curl.getinfo(pycurl.PRETRANSFER_TIME), starttransfer=curl.getinfo(pycurl.STARTTRANSFER_TIME), total=curl.getinfo(pycurl.TOTAL_TIME), redirect=curl.getinfo(pycurl.REDIRECT_TIME), ) try: info["callback"](HTTPResponse( request=info["request"], code=code, headers=info["headers"], buffer=buffer, effective_url=effective_url, error=error, request_time=time.time() - info["curl_start_time"], time_info=time_info)) except Exception: self.handle_callback_exception(info["callback"]) def handle_callback_exception(self, callback): self.io_loop.handle_callback_exception(callback) class CurlError(HTTPError): def __init__(self, errno, message): HTTPError.__init__(self, 599, message) self.errno = errno def _curl_create(max_simultaneous_connections=None): curl = pycurl.Curl() if logging.getLogger().isEnabledFor(logging.DEBUG): curl.setopt(pycurl.VERBOSE, 1) curl.setopt(pycurl.DEBUGFUNCTION, _curl_debug) curl.setopt(pycurl.MAXCONNECTS, max_simultaneous_connections or 5) return curl def _curl_setup_request(curl, request, buffer, headers): curl.setopt(pycurl.URL, utf8(request.url)) # libcurl's magic "Expect: 100-continue" behavior causes delays # with servers that don't support it (which include, among others, # Google's OpenID endpoint). Additionally, this behavior has # a bug in conjunction with the curl_multi_socket_action API # (https://sourceforge.net/tracker/?func=detail&atid=100976&aid=3039744&group_id=976), # which increases the delays. It's more trouble than it's worth, # so just turn off the feature (yes, setting Expect: to an empty # value is the official way to disable this) if "Expect" not in request.headers: request.headers["Expect"] = "" # libcurl adds Pragma: no-cache by default; disable that too if "Pragma" not in request.headers: request.headers["Pragma"] = "" # Request headers may be either a regular dict or HTTPHeaders object if isinstance(request.headers, httputil.HTTPHeaders): curl.setopt(pycurl.HTTPHEADER, [utf8("%s: %s" % i) for i in request.headers.get_all()]) else: curl.setopt(pycurl.HTTPHEADER, [utf8("%s: %s" % i) for i in request.headers.items()]) if request.header_callback: curl.setopt(pycurl.HEADERFUNCTION, request.header_callback) else: curl.setopt(pycurl.HEADERFUNCTION, lamb
da line: _curl_header_callback(headers, line)) if request.streaming_callback: curl.setopt(pycurl.WRITEFUNCTION, request.streaming_callback) else: curl.setopt(pycurl.WRITEFUNCTION, buffer.write) curl.setopt(pycurl.FOLLOWLOCATION, request.follow_redirects) curl.setopt(pycurl.MAXREDIRS, request.max_redirects) curl.setopt(pycurl.CONNE
CTTIMEOUT_MS, int(1000 * request.connect_timeout)) curl.setopt(pycurl.TIMEOUT_MS, int(1000 * request.request_timeout)) if request.user_agent: curl.setopt(pycurl.USERAGENT, utf8(request.user_agent)) else: curl.setopt(pycurl.USERAGENT, "Mozilla/5.0 (compatible; pycurl)") if request.network_interface: curl.setopt(pycurl.INTERFACE, request.network_interface) if request.use_gzip: curl.setopt(pycurl.ENCODING, "gzip,deflate") else: curl.setopt(pycurl.ENCODING, "none") if request.proxy_host and request.proxy_port: curl.setopt(pycurl.PROXY, request.proxy_host) curl.setopt(pycurl.PROXYPORT, request.proxy_port) if request.proxy_username: credentials = '%s:%s' % (request.proxy_username, request.proxy_password) curl.setopt(pycurl.PROXYUSERPWD, credentials) else: curl.setopt(pycurl.PROXY, '') if request.validate
from canvas i
mport MappingCanvas from viewport import MappingViewport try: from geojson_overlay import GeoJSONOverlay except ImportError: # No geojson pass # Tile managers from mbtile_manager import MBTileManager from http_tile_manager import HTTPTile
Manager
"""Ensures that account.identifier is unique. Revision ID: ea2739ecd874 Revises: 5bd631a1b748 Create Date: 2017-09
-29 09:16:09.436339 """ # revision identifiers, used by Alembic. revision = 'ea2739ecd874' down_revision = '5bd631a1b748' from alembic import op import sqla
lchemy as sa def upgrade(): # ### commands auto generated by Alembic - please adjust! ### op.create_unique_constraint(None, 'account', ['identifier']) # ### end Alembic commands ### def downgrade(): # ### commands auto generated by Alembic - please adjust! ### op.drop_constraint(None, 'account', type_='unique') # ### end Alembic commands ###
from model.flyweight import Flyweight from model.static.database import database class Service(Flyweight): def __init__(self,service_id): #prevents reinitializing if "_inited" in self.__dict__: return self._inited = None #prevents reinitial
izing self.service_id = service_id cursor = database.get_cursor( "select * from staServices where serviceID={};".format( self.service_id)) row = cursor.fetchone() self.service_name = row["serviceName"] self.description = row["description"]
cursor.close()
import numpy as np def test_prepare_abi_connectivity_maps(): from samri.fetch.local import prepare_abi_connectivity_maps pre
pare_abi_connectivity_maps('Ventral_tegmental_area', invert_lr_experiments=[ "127651139", "127796728", "127798146", "127867804", "156314762", "160539283", "160540751", "165975096", "166054222", "171021829", "175736945", "2781783
82", "292958638", "301062306", "304337288", ], ) def test_prepare_feature_map(): from samri.fetch.local import prepare_feature_map prepare_feature_map('/usr/share/ABI-connectivity-data/Ventral_tegmental_area-127651139/', invert_lr=True, save_as='/var/tmp/samri_testing/pytest/vta_127651139.nii.gz', ) def test_summary_atlas(): from samri.fetch.local import summary_atlas mapping='/usr/share/mouse-brain-templates/dsurqe_labels.csv' atlas='/usr/share/mouse-brain-templates/dsurqec_40micron_labels.nii' summary={ 1:{ 'structure':'Hippocampus', 'summarize':['CA'], 'laterality':'right', }, 2:{ 'structure':'Hippocampus', 'summarize':['CA'], 'laterality':'left', }, 3:{ 'structure':'Cortex', 'summarize':['cortex'], 'laterality':'right', }, 4:{ 'structure':'Cortex', 'summarize':['cortex'], 'laterality':'left', }, } new_atlas, new_mapping = summary_atlas(atlas,mapping, summary=summary, ) new_atlas_data = new_atlas.get_data() output_labels = np.unique(new_atlas_data).tolist() target_labels = [0,] target_labels.extend([i for i in summary.keys()]) assert output_labels == target_labels def test_roi_from_atlaslabel(): from samri.fetch.local import roi_from_atlaslabel mapping='/usr/share/mouse-brain-templates/dsurqe_labels.csv' atlas='/usr/share/mouse-brain-templates/dsurqec_40micron_labels.nii' my_roi = roi_from_atlaslabel(atlas, mapping=mapping, label_names=['cortex'], ) roi_data = my_roi.get_data() output_labels = np.unique(roi_data).tolist() assert output_labels == [0, 1] my_roi = roi_from_atlaslabel(atlas, mapping=mapping, label_names=['cortex'], output_label=3, ) roi_data = my_roi.get_data() output_labels = np.unique(roi_data).tolist() assert output_labels == [0, 3]
#!/usr/bin/env python # # Copyright (c) 2016 Intel Corporation. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # * Redistributions of works must retain the original copyright notice, this # list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the original copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # * Neither the name of Intel Corporation nor the names of its contributors # may be used to endorse or promote products derived from this work without # specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY INTEL CORPORATION "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL INTEL CORPORATION BE LIABLE FOR ANY DIRECT, # INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, # BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY # OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING # NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, # EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # # Authors: # Liu, Yun <yunx.liu@intel.com> import unittest import os import comm class TestCrosswalkApptoolsFunctions(unittest.TestCase): def test_setting_value(self): comm.setUp() os.chdir(comm.XwalkPath) comm.clear("org.xwalk.test") os.mkdir("org.xwalk.test") os.chdir('org.xwalk.test') cmd = comm.HOST_PREFIX + comm.PackTools + \ "crosswalk-pkg --platforms=android --android=" + comm.ANDROID_MODE + " --crosswalk=" + comm.crosswalkzip + " ../../testapp/manifest_xwalk_target_platforms/windows_platform/" (return_code, output) = comm.getstatusoutput(cmd) apks = os.listdir(os.getcwd()) apkLength = 0 if comm.MODE != " --android-shared": for i in range(len(apks)): if apks[i].endswith(".apk") and "x86" in apks[i]: if comm.BIT == "64":
self.assertIn("64", apks[i]) apkLength = apkLength + 1 if apks[i].endswith(".apk") and "arm" in apks[i]: if comm.BIT == "64": self.assertIn("64", apks[i])
apkLength = apkLength + 1 self.assertEquals(apkLength, 2) else: for i in range(len(apks)): if apks[i].endswith(".apk") and "shared" in apks[i]: apkLength = apkLength + 1 appVersion = apks[i].split('-')[1] self.assertEquals(apkLength, 1) comm.run(self) comm.clear("org.xwalk.test") self.assertEquals(return_code, 0) self.assertIn("Loading 'android' platform backend", output[0]) self.assertNotIn("Loading 'windows' platform backend", output[0]) def test_without_platforms(self): comm.setUp() os.chdir(comm.XwalkPath) comm.clear("org.xwalk.test") os.mkdir("org.xwalk.test") os.chdir('org.xwalk.test') cmd = comm.HOST_PREFIX + comm.PackTools + \ "crosswalk-pkg --android=" + comm.ANDROID_MODE + " --crosswalk=" + comm.crosswalkzip + " ../../testapp/create_package_basic/" (return_code, output) = comm.getstatusoutput(cmd) apks = os.listdir(os.getcwd()) apkLength = 0 if comm.MODE != " --android-shared": for i in range(len(apks)): if apks[i].endswith(".apk") and "x86" in apks[i]: if comm.BIT == "64": self.assertIn("64", apks[i]) apkLength = apkLength + 1 if apks[i].endswith(".apk") and "arm" in apks[i]: if comm.BIT == "64": self.assertIn("64", apks[i]) apkLength = apkLength + 1 self.assertEquals(apkLength, 2) else: for i in range(len(apks)): if apks[i].endswith(".apk") and "shared" in apks[i]: apkLength = apkLength + 1 appVersion = apks[i].split('-')[1] self.assertEquals(apkLength, 1) comm.run(self) comm.clear("org.xwalk.test") self.assertEquals(return_code, 0) self.assertIn("Loading 'android' platform backend", output[0]) def test_with_target_platforms(self): comm.setUp() os.chdir(comm.XwalkPath) comm.clear("org.xwalk.test") os.mkdir("org.xwalk.test") os.chdir('org.xwalk.test') cmd = comm.HOST_PREFIX + comm.PackTools + \ "crosswalk-pkg --android=" + comm.ANDROID_MODE + " --crosswalk=" + comm.crosswalkzip + " ../../testapp/manifest_xwalk_target_platforms/android_platform/" (return_code, output) = comm.getstatusoutput(cmd) apks = os.listdir(os.getcwd()) apkLength = 0 if comm.MODE != " --android-shared": for i in range(len(apks)): if apks[i].endswith(".apk") and "x86" in apks[i]: if comm.BIT == "64": self.assertIn("64", apks[i]) apkLength = apkLength + 1 if apks[i].endswith(".apk") and "arm" in apks[i]: if comm.BIT == "64": self.assertIn("64", apks[i]) apkLength = apkLength + 1 self.assertEquals(apkLength, 2) else: for i in range(len(apks)): if apks[i].endswith(".apk") and "shared" in apks[i]: apkLength = apkLength + 1 appVersion = apks[i].split('-')[1] self.assertEquals(apkLength, 1) comm.run(self) comm.clear("org.xwalk.test") self.assertEquals(return_code, 0) self.assertIn("Loading 'android' platform backend", output[0]) if __name__ == '__main__': unittest.main()
from nodetraq.tests import * class Tes
tPoolsController(TestController): def test_index(self): response = self.app.get(url(controller=
'pools', action='index')) # Test response...
# this example shows how to append new calculated results to an already # existing cmr file, illustrated for calculation of PBE energy on LDA density import os import cmr # set True in order to use cmr in parallel jobs! cmr.set_ase_parallel(enable=True) from ase.structure import molecule from ase.io import read, write from ase.parallel import barrier, rank from gpaw import GPAW, restart from gpaw.test import equal # define the project in order to find it in the database! project_id = 'modify cmr file after gpw restart' formula = 'H2' vacuum = 2.0 xc = 'LDA' mode = 'lcao' h = 0.20 cmr_params = { 'db_keywords': [project_id], # add project_id also as a field to support search across projects 'project_id': project_id, # user's tags: xc tag will be set later for illustration purpose! 'formula': formula, 'vacuum': vacuum, 'mode': mode, 'h': h, } cmrfile = formula + '.cmr' system1 = molecule(formula) system1.center(vacuum=vacuum) # first calculation: LDA lcao calc = GPAW(mode=mode, xc=xc, h=h, txt=None) system1.set_calculator(calc) e = system1.get_potential_energy() calc.write(formula) # read gpw file system2, calc2 = restart(formula, txt=None) # write the information 'as in' gpw file into db file # (called *db to avoid conflict with the *cmr file below) if 1: # not used in this example calc2.write(formula + '.db', cmr_params=cmr_params) # write the information 'as in' corresponding trajectory file into cmr file write(cmrfile, system2, cmr_params=cmr_params) # add the xc tag to the cmrfile assert os.path.exists(cmrfile) data = cmr.read(cmrfile) data.set_user_variable('xc', xc) data.write(cmrfile) # peform PBE calculation on LDA density ediff = calc2.get_xc_difference('PBE') # add new results to the cmrfile assert os.path.exists(cmrfile) data = cmr.read(cmrfile) data.set_user_variable('PBE', data['ase_potential_energy'] + ediff) data.write(cmrfile) # analyse the results with CMR # cmr readers work only in serial! from cmr.ui import DirectoryReader if rank == 0: reader = DirectoryRea
der(directory='.', ext='.cmr') # read all compounds in the project with lcao all = reader.find(name_value_list=[('mode', 'lcao')], keyword_list=[project_id]) results = all.get('formula', formula) print results['formula'], results['xc'], results['ase_potential_energy'] # column_le
ngth=0 aligns data in the table (-1 : data unaligned is default) all.print_table(column_length=0, columns=['formula', 'xc', 'h', 'ase_potential_energy', 'PBE']) if rank == 0: equal(results['PBE'], e + ediff, 1e-6) if rank == 0: for file in [formula + '.gpw', formula + '.db', cmrfile]: if os.path.exists(file): os.unlink(file)
# -*- coding: utf-8 -*- # Generated by Django 1.9.8 on 2016-08-22 16:03 from __future__ import unicode_literals from django.db import migrations, models import django.db.models.deletion def forwards_func(apps, schema_editor): # We get the model from the versioned app registry; # if we directly import it, it'll be the wrong version m_model = apps.get_model("guidedmodules", "Module") mq_model = apps.get_model("guidedmodules", "ModuleQuestion") db_alias = schema_editor.connection.alias for obj in mq_model.objects.all(): if obj.spec.get("module-id"): mq_model.objects\ .filter(id=obj.id)\ .update(answer_type_module=m_model.objects.get(id=obj.spec["module-id"])) class Migration(migrations.Migration): dependencies = [ ('guidedmodules', '0010_auto_20160809_1500'), ] operations = [ migrations.AddField( model_name='modulequestion', name='answer_type_module', field=models.ForeignKey( blank=True, h
elp_text=( 'For module and module-set typed questions, this is the Module that'
' Tasks that answer this question must be for.' ), null=True, on_delete=django.db.models.deletion.PROTECT, related_name='is_type_of_answer_to', to='guidedmodules.Module', ), ), migrations.RunPython(forwards_func, migrations.RunPython.noop), ]
# coding=utf-
8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt
in the project root for # license information. # # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- from msrest.authentication import ( BasicAuthentication, BasicTokenAuthentication, OAuthTokenAuthentication) from msrestazure.azure_active_directory import ( InteractiveCredentials, ServicePrincipalCredentials, UserPassCredentials)
sr/bin/env python # -*- coding: utf-8 -*- # Copyright (C) 2011 ~ 2012 Deepin, Inc. # 2011 ~ 2012 Hou Shaohui # # Author: Hou Shaohui <houshao55@gmail.com> # Maintainer: Hou Shaohui <houshao55@gmail.com> # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. import gtk import gobject from dtk.ui.menu import Menu from dtk.ui.draw import draw_pixbuf from dtk.ui.label import Label from dtk.ui.utils import propagate_expose from dtk.ui.constant import BUTTON_PRESS, BUTTON_NORMAL, BUTTON_HOVER import dtk.ui.tooltip as Tooltip from widget.skin import app_theme from nls import _ class ComboItem(gtk.Button): def __init__(self, bg_image_group, icon_group, index, set_index, get_index): gtk.Button.__init__(self) # Init. self.index = index self.set_index = set_index self.get_index = get_index self.icon_group = icon_group self.bg_image_group = bg_image_group self.resize_button() # connect self.connect("clicked", self.update_button_index) self.connect("expose-event", self.expose_button_cb) def expose_button_cb(self, widget, event): # Init. rect = widget.allocation bg_normal_dpixbuf, bg_hover_dpixbuf, bg_press_dpixbuf = self.bg_image_group fg_normal_dpixbuf, fg_hover_dpixbuf,
fg_press_dpixbuf = self.icon_group select_index = self.get_index() bg_image = bg_normal_dpixbuf.get_pixbuf() fg_image = fg_normal_dpixbuf.get_pixbuf() if widget.state == gtk.STATE_NORMAL: if select_index == self.index: select_status = BUTTON_PRESS else: select_status = BUTTON_NORMAL elif widget.state == gtk.STATE_PRELIGHT:
if select_index == self.index: select_status = BUTTON_PRESS else: select_status = BUTTON_HOVER elif widget.state == gtk.STATE_ACTIVE: select_status = BUTTON_PRESS if select_status == BUTTON_NORMAL: bg_image = bg_normal_dpixbuf.get_pixbuf() fg_image = fg_normal_dpixbuf.get_pixbuf() elif select_status == BUTTON_HOVER: bg_image = bg_hover_dpixbuf.get_pixbuf() fg_image = fg_hover_dpixbuf.get_pixbuf() elif select_status == BUTTON_PRESS: bg_image = bg_press_dpixbuf.get_pixbuf() fg_image = fg_press_dpixbuf.get_pixbuf() image_width = bg_image.get_width() image_height = bg_image.get_height() fg_rect_x = rect.x + (image_width - fg_image.get_width()) / 2 fg_rect_y = rect.y + (image_height - fg_image.get_height()) / 2 cr = widget.window.cairo_create() draw_pixbuf(cr, bg_image, rect.x, rect.y) draw_pixbuf(cr, fg_image, fg_rect_x, fg_rect_y) propagate_expose(widget, event) return True def resize_button(self): normal_dpixbuf = self.bg_image_group[0] request_width = normal_dpixbuf.get_pixbuf().get_width() request_height = normal_dpixbuf.get_pixbuf().get_height() self.set_size_request(request_width, request_height) def update_icon_group(self, new_group): self.icon_group = new_group def update_button_index(self, widget): self.set_index(self.index) class ComboButton(gtk.Button): def __init__(self, bg_image_group, icon_group): gtk.Button.__init__(self) # Init. self.icon_group = icon_group self.bg_image_group = bg_image_group self.resize_button() # connect self.connect("expose-event", self.expose_button_cb) def expose_button_cb(self, widget, event): # Init. rect = widget.allocation bg_normal_dpixbuf, bg_hover_dpixbuf, bg_press_dpixbuf = self.bg_image_group fg_normal_dpixbuf, fg_hover_dpixbuf, fg_press_dpixbuf = self.icon_group if widget.state == gtk.STATE_NORMAL: bg_image = bg_normal_dpixbuf.get_pixbuf() fg_image = fg_normal_dpixbuf.get_pixbuf() elif widget.state == gtk.STATE_PRELIGHT: bg_image = bg_hover_dpixbuf.get_pixbuf() fg_image = fg_hover_dpixbuf.get_pixbuf() elif widget.state == gtk.STATE_ACTIVE: bg_image = bg_press_dpixbuf.get_pixbuf() fg_image = fg_press_dpixbuf.get_pixbuf() image_width = bg_image.get_width() image_height = bg_image.get_height() fg_rect_x = rect.x + (image_width - fg_image.get_width()) / 2 fg_rect_y = rect.y + (image_height - fg_image.get_height()) / 2 cr = widget.window.cairo_create() draw_pixbuf(cr, bg_image, rect.x, rect.y) draw_pixbuf(cr, fg_image, fg_rect_x, fg_rect_y) propagate_expose(widget, event) return True def resize_button(self): normal_dpixbuf = self.bg_image_group[0] request_width = normal_dpixbuf.get_pixbuf().get_width() request_height = normal_dpixbuf.get_pixbuf().get_height() self.set_size_request(request_width, request_height) def update_icon_group(self, new_group): self.icon_group = new_group class ComboMenuButton(gtk.HBox): __gsignals__ = { "list-actived" : (gobject.SIGNAL_RUN_LAST, gobject.TYPE_NONE, ()), "combo-actived" : (gobject.SIGNAL_RUN_LAST, gobject.TYPE_NONE, (gobject.TYPE_STRING,)) } def __init__(self, init_index=0): super(ComboMenuButton, self).__init__() self.current_index = init_index self.current_status = "artist" self.set_spacing(0) self.msg_content = _("By artist") self.list_button = ComboItem( (app_theme.get_pixbuf("combo/left_normal.png"), app_theme.get_pixbuf("combo/left_hover.png"), app_theme.get_pixbuf("combo/left_press.png")), (app_theme.get_pixbuf("combo/list_normal.png"), app_theme.get_pixbuf("combo/list_normal.png"), app_theme.get_pixbuf("combo/list_press.png") ), 0, self.set_index, self.get_index) Tooltip.text(self.list_button, _("List view")) # draw left_button. self.left_button = gtk.Button() self.left_button = ComboItem( (app_theme.get_pixbuf("combo/left_normal.png"), app_theme.get_pixbuf("combo/left_hover.png"), app_theme.get_pixbuf("combo/left_press.png")), (app_theme.get_pixbuf("combo/artist_normal.png"), app_theme.get_pixbuf("combo/artist_normal.png"), app_theme.get_pixbuf("combo/artist_press.png") ), 1, self.set_index, self.get_index) Tooltip.custom(self.left_button, self.get_msg_label).always_update(self.left_button, True) # draw right_button. self.right_button = ComboButton( (app_theme.get_pixbuf("combo/right_normal.png"), app_theme.get_pixbuf("combo/right_hover.png"), app_theme.get_pixbuf("combo/right_hover.png")), (app_theme.get_pixbuf("combo/triangle_normal.png"), app_theme.get_pixbuf("combo/triangle_normal.png"), app_theme.get_pixbuf("combo/triangle_press.png") ))
from builtins import range import sys import unittest import re import os.path sys.path.insert(0, os.path.join(os.path.dirname(__file__), '..', '..')) from Exscript import Account from Exscript.account import AccountPool from Exscript.util.file import get_accounts_from_file class AccountPoolTest(unittest.TestCase): CORRELATE = AccountPool def setUp(self): self.user1 = 'testuser1' self.password1 = 'test1' self.account1 = Account(self.user1, self.password1) self.user2 = 'testuser2' self.password2 = 'test2' self.account2 = Account(self.user2, self.password2) self.accm = AccountPool() def testConstructor(self): accm = AccountPool() self.assertEqual(accm.n_accounts(), 0) accm = AccountPool([self.account1, self.account2]) self.assertEqual(accm.n_accounts(), 2) def testAddAccount(self): self.assertEqual(self.accm.n_accounts(), 0) self.accm.add_account(self.account1) self.assertEqual(self.accm.n_accounts(), 1) self.accm.add_account(self.account2) self.assertEqual(self.accm.n_accounts(), 2) def testReset(self): self.testAddAccount() self.accm.reset() self.assertEqual(self.accm.n_accounts(), 0) def testHasAccount(self): self.assertEqual(self.accm.has_account(self.account1), False) self.accm.add_account(self.account1) self.assertEqual(self.accm.has_account(self.account1), True) def testGetAccountFromHash(self): account = Account('user', 'test') thehash = account.__hash__() self.accm.add_account(account) self.assertEqual(self.accm.get_account_from_hash(thehash), account) def testGetAccountFromName(self): self.testAddAccount() self.assertEqual(self.account2, self.accm.get_account_from_name(self.user2)) def testNAccounts(self): self.testAddAccount() def testAcquireAccount(self): self.testAddAccount() self.accm.acquire_account(self.account1) self.account1.release() self.accm.acquire_account(self.account1) self.account1.release() # Add three more accounts. filename = os.path.join(os.path.dirname(__file__), 'account_pool.cfg') self.accm.add_account(get_accounts_from_file(filename)) self.assertEqual(self.accm.n_accounts(), 5) for i in range(0, 2000): # Each time an account is acquired a different one should be # returned. acquired = {} for n in range(0, 5): account = self.accm.acquire_account() self.assertTrue(account is not None) self.assertNotIn(account.get_name(), acquired) acquired[account.get_name()] = account # Release one account. acquired['abc'].release() # Acquire one account. account = self.accm.acquire_account() self.assertEqual(account.get_name(), 'abc') # Release all accounts. for account in list(acquired.values()): account.release() def testReleaseAccounts(self): account1 = Account('foo') account2 = Account('bar') pool = AccountPool() pool.add_account(account1) pool.add_account(account2) pool.acquire_account(account1, 'one') pool.acquire_account(account2, 'two') self.assertNotIn(account1, pool.unlocked_accounts) self.assertNotIn(account2, pool.unlocked_accounts) pool.release_accounts('one') self.assertIn(account1, pool.unlocked_accounts) self.assertNotIn(account2, pool.unlocked_accounts) pool.release_accounts('one') self.assertIn(account1, pool.unlocked_accounts) self.
assertNotIn(account2, pool.unlocked_accounts) pool.release_accounts('two') self.assertIn(account1,
pool.unlocked_accounts) self.assertIn(account2, pool.unlocked_accounts) def suite(): return unittest.TestLoader().loadTestsFromTestCase(AccountPoolTest) if __name__ == '__main__': unittest.TextTestRunner(verbosity=2).run(suite())
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # lice
nse information. # # Code generated by Microsoft (R) A
utoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- from .linked_service import LinkedService class SapHanaLinkedService(LinkedService): """SAP HANA Linked Service. :param additional_properties: Unmatched properties from the message are deserialized this collection :type additional_properties: dict[str, object] :param connect_via: The integration runtime reference. :type connect_via: ~azure.mgmt.datafactory.models.IntegrationRuntimeReference :param description: Linked service description. :type description: str :param type: Constant filled by server. :type type: str :param server: Host name of the SAP HANA server. Type: string (or Expression with resultType string). :type server: object :param authentication_type: The authentication type to be used to connect to the SAP HANA server. Possible values include: 'Basic', 'Windows' :type authentication_type: str or ~azure.mgmt.datafactory.models.SapHanaAuthenticationType :param user_name: Username to access the SAP HANA server. Type: string (or Expression with resultType string). :type user_name: object :param password: Password to access the SAP HANA server. :type password: ~azure.mgmt.datafactory.models.SecureString :param encrypted_credential: The encrypted credential used for authentication. Credentials are encrypted using the integration runtime credential manager. Type: string (or Expression with resultType string). :type encrypted_credential: object """ _validation = { 'type': {'required': True}, 'server': {'required': True}, } _attribute_map = { 'additional_properties': {'key': '', 'type': '{object}'}, 'connect_via': {'key': 'connectVia', 'type': 'IntegrationRuntimeReference'}, 'description': {'key': 'description', 'type': 'str'}, 'type': {'key': 'type', 'type': 'str'}, 'server': {'key': 'typeProperties.server', 'type': 'object'}, 'authentication_type': {'key': 'typeProperties.authenticationType', 'type': 'str'}, 'user_name': {'key': 'typeProperties.userName', 'type': 'object'}, 'password': {'key': 'typeProperties.password', 'type': 'SecureString'}, 'encrypted_credential': {'key': 'typeProperties.encryptedCredential', 'type': 'object'}, } def __init__(self, server, additional_properties=None, connect_via=None, description=None, authentication_type=None, user_name=None, password=None, encrypted_credential=None): super(SapHanaLinkedService, self).__init__(additional_properties=additional_properties, connect_via=connect_via, description=description) self.server = server self.authentication_type = authentication_type self.user_name = user_name self.password = password self.encrypted_credential = encrypted_credential self.type = 'SapHana'
j = j + 2 # reformatting "{{Discussion|...}}" elif string[j:j+13] == '{{Discussion|': string = string[:j] + '\\fI' + string[j+13:] nr = 1 j = j + 2 # reformatting "{{Filename|...}}" elif string[j:j+11] == '{{Filename|': string = string[:j] + '\\fI' + string[j+11:] nr = 1 j = j + 2 # reformatting "[mailto:...]" elif string[j:j+8] == '[mailto:': a = j + 8 while string[a] <> ' ': a = a + 1 b = a + 1 while string[b] <> ']': b = b + 1 string = string[:j] + string[a+1:b] + ' <' + string[j+8:a] + '>' # reformatting "{{Box File|...|...}}" elif string[j:j+11] == '{{Box File|': a = j + 11 while string[a] <> '|': a = a + 1 string = string[:j] + '\n.TP\n.B ' + string[j+11:a] + '\n.RS\n' + string[a+1:] nr = 2 if nf == 0: # reformatting boolean text 2 if string[j:j+3] == '<b>': string = string[:j] + '\\fB' + string[j+3:] j = j + 2 elif string[j:j+4] == '</b>': string = string[:j] + '\\fR' + string[j+4:] j = j + 2 # reformatting italic text 2 elif string[j:j+3] == '<i>': string = string[:j] + '\\fI' + string[j+3:] j = j + 2 elif string[j:j+4] == '</i>': string = string[:j] + '\\fR' + string[j+4:] j = j + 2 # format underlined text elif string[j:j+3] == '<u>': U = j elif string[j:j+4] == '</u>' and U != -1: string = string[:U] + '\\fB\\fI' + string[U+3:j] + '\\fB\\fR' + string[j+4:] j = j + 7 U =- 1 # brake line 1 elif string[j:j+4] == '<br>': string = string[0:j] + '\n.br\n' + string[j+4:] j = j + 2 # brake line 2 elif string[j:j+6] == '<br />': string = string[0:j] + '\n.PP\n' + string[j+6:] j = j + 2 # format tables 1 elif string[j:j+6] == '<table': tab = j while len(string) > j and string[j] != '>': j = j + 1 if string[j] == '>': string = string[:tab] + string[j+1:] j = tab - 1 tab = 1 else: j = tab tab = 0 elif string[j:j+3] == '<tr': Ktab = j while len(string) > j and string[j] != '>': j = j + 1 if string[j] == '>': tabacc = 0 string = string[:Ktab] + '\n.SS ' + string[j+1:] j = Ktab + 4 else: j = Ktab elif string[j:j+4] == '</tr': Ktab = j while len(string) > j and string[j] != '>': j = j + 1 if string[j] == '>': tabacc =- 1 string = string[:Ktab] + string[j+1:] j = Ktab - 1 else: j = Ktab elif string[j:j+3] == '<td': Ktab = j while len(string) > j and string[j] != '>': j = j + 1 if string[j] == '>': tabacc = tabacc + 1 if tabacc == 1: string = string[:Ktab] + string[j+1:] j = Ktab - 1 else: string = string[:Ktab] + '\n.PP\n' + string[j+1:] j = Ktab + 3 else: j = Ktab elif string[j:j+4] == '</td': Ktab = j while len(string) > j and string[j] != '>': j = j + 1 if string[j] == '>': string = string[:Ktab] + string[j+1:] j = Ktab - 1 else: j = Ktab
elif string[j:j+7] == '</table': tab = j while len(string) > j and string[j] != '>': j = j + 1
if string[j] == '>': string = string[:tab] + string[j+1:] j = tab - 1 tab = 0 else: j = tab tab = 1 # format table 2 {| |- | || |} elif string[j:j+2] == '||' and tab2 > 0 and col > 0: string = string[:j] + '\n' + string[j+2:] col = col + 1 # format div???? elif string[j:j+4] == '<div': div = j while len(string) > j and string[j] != '>': j = j + 1 if string[j] == '>': string = string[:div] + string[j+1:] j = div - 1 else: j = div elif string[j:j+5] == '</div': div = j while len(string) > j and string[j] != '>': j = j + 1
#!/usr/bin/env python3 # Copyright 2019 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import kf
p from kfp import dsl def random_num_op(low, high): """Generate a random number between low and
high.""" return dsl.ContainerOp( name='Generate random number', image='python:alpine3.6', command=['sh', '-c'], arguments=['python -c "import random; print(random.randint($0, $1))" | tee $2', str(low), str(high), '/tmp/output'], file_outputs={'output': '/tmp/output'} ) def flip_coin_op(): """Flip a coin and output heads or tails randomly.""" return dsl.ContainerOp( name='Flip coin', image='python:alpine3.6', command=['sh', '-c'], arguments=['python -c "import random; result = \'heads\' if random.randint(0,1) == 0 ' 'else \'tails\'; print(result)" | tee /tmp/output'], file_outputs={'output': '/tmp/output'} ) def print_op(msg): """Print a message.""" return dsl.ContainerOp( name='Print', image='alpine:3.6', command=['echo', msg], ) @dsl.pipeline( name='Conditional execution pipeline', description='Shows how to use dsl.Condition().' ) def flipcoin_pipeline(): flip = flip_coin_op() with dsl.Condition(flip.output == 'heads'): random_num_head = random_num_op(0, 9) with dsl.Condition(random_num_head.output > 5): print_op('heads and %s > 5!' % random_num_head.output) with dsl.Condition(random_num_head.output <= 5): print_op('heads and %s <= 5!' % random_num_head.output) with dsl.Condition(flip.output == 'tails'): random_num_tail = random_num_op(10, 19) with dsl.Condition(random_num_tail.output > 15): print_op('tails and %s > 15!' % random_num_tail.output) with dsl.Condition(random_num_tail.output <= 15): print_op('tails and %s <= 15!' % random_num_tail.output) if __name__ == '__main__': kfp.compiler.Compiler().compile(flipcoin_pipeline, __file__ + '.yaml')
import pandas as pd from sklearn import model_selection from sklearn.ensemble import RandomForestClassifier url = "https://archive.ics.uci.edu/ml/machine-learning-databases/pima-indians-diabet
es/pima-indians-diabetes.data" names = ['preg', 'plas', 'pres', 'skin', 'test', 'mass', 'pedi', 'age', 'class'] df = pd.read_csv(url, names=names) array = df.values X = array[:,0:8] y = array[:,8] seed = 21 num_trees = 100 max_features = 3 kfold = model_selection.KFold(n_splits=10, random_state=seed) model = RandomForestClassifier(n_estimators=num_trees, max_features=max_features) results = model_selection.cross_val_score(model, X, y, cv=kfold) print('results: ') print(results) print() print('mean: ' +
str(results.mean()))
from resource_media_types import * from ClientFile import ClientFile from ClientFolder import ClientFolder from queryResource import ClientQuery class ResourcesTypeResolverUtil(object): classes = {} #classes[ClientAdhocDataView.__name__] = ResourceMediaType.ADHOC_DATA_VIEW_MIME #classes[ClientAwsDataSource.__name__] = ResourceMediaType.AWS_DATA_SOURCE_MIME #classes[ClientBeanDataSource.__name__] = ResourceMediaType.BEAN_DATA_SOURCE_MIME #classes[ClientCustomDataSource.__name__] = ResourceMediaType.CUSTOM_DATA_SOURCE_MIME #classes[ClientDataType.__name__] = ResourceMediaType.DATA_TYPE_MIME classes[ClientFile.__name__] = TYPE_FILE classes[ClientFolder.__name__] = TYPE_FOLDER #classes[ClientInputControl.__name__] = ResourceMediaType.INPUT_CONTROL_MIME #classes[ClientJdbcDataSource.__name__] = ResourceMediaType.JDBC_DATA_SOURCE_MIME #classes[ClientJndiJdbcDataSource.__name__] = ResourceMediaType.JNDI_JDBC_DATA_SOURCE_MIME #classes[ClientListOfValues.__name__] = ResourceMediaType.LIST_OF_VALUES_MIME #put(ClientMondrianConnection.class, Resour
ceMediaType.MONDRIAN_CONNECTION_MIME); #put(ClientMondrianXmlaDefinition.class, ResourceMediaType.MONDRIAN_XMLA_DEFINITION_MIME); #put(ClientOlapUnit.class, ResourceMediaType.OLAP_UNIT_MIME); classes[ClientQuery.__name__] = TYPE_QUERY #put(ClientReportUnit.class, ResourceMediaType.REPORT_UNIT_MIME); #put(ClientSecureMondrianConnection.class, ResourceMediaType.SECURE_MONDRIAN_CONNECTIO
N_MIME); #put(ClientSemanticLayerDataSource.class, ResourceMediaType.SEMANTIC_LAYER_DATA_SOURCE_MIME); #put(ClientVirtualDataSource.class, ResourceMediaType.VIRTUAL_DATA_SOURCE_MIME); #put(ClientXmlaConnection.class, ResourceMediaType.XMLA_CONNECTION_MIME); #put(ClientResourceLookup.class, ResourceMediaType.RESOURCE_LOOKUP_MIME); #put(ClientDashboard.class, ResourceMediaType.DASHBOARD_MIME); #put(ClientDomainTopic.class, ResourceMediaType.DOMAIN_TOPIC_MIME); @staticmethod def getMimeType(resource): if isinstance(resource, basestring): #return resource as default in the case resource to be of direct type from resource_media_types ret = ResourcesTypeResolverUtil.classes.get(resource, resource) else: ret = ResourcesTypeResolverUtil.classes.get(resource.__class__.__name__, None) return ret
from __future__ import absolute_import from __future__ import division from __future__ import print_function from caffe2.proto import caffe2_pb2 from caffe2.python import core, workspace import caffe2.python.hypothesis_test_util as hu import caffe2.python.serialized_test.serialized_test_util as serial from hypothesis import given import hypothesis.strategies as st import numpy as np import unittest class TestONNXWhile(serial.SerializedTestCase): @serial.given( condition=st.booleans(), max_trip_count=st.integers(0, 100), save_scopes=st.booleans(), disable_scopes=st.booleans(), seed=st.integers(0, 65535), **hu.gcs_cpu_only) def test_onnx_while_fibb( self, condition, max_trip_count, save_scopes, disable_scopes, seed, gc, dc): np.random.seed(seed) if disable_scopes: save_scopes = False # Create body net body_net = caffe2_pb2.NetDef() # Two loop carried dependencies: first and second body_net.external_input.extend(['i', 'cond', 'first', 'second']) body_net.external_output.extend(['cond_new', 'second', 'third', 'third']) add_op = core.CreateOperator( 'Add', ['first', 'second'], ['third'], ) print3 = core.CreateOperator( 'Print', ['third'], [], ) limit_const = core.CreateOperator( 'ConstantFill', [], ['limit_const'], shape=[1], dtype=caffe2_pb2.TensorProto.FLOAT, value=100.0, ) cond = core.CreateOperator( 'LT', ['third', 'limit_const'], ['cond_new'], ) body_net.op.extend([add_op, print3, limit_const, cond]) while_op = core.CreateOperator( 'ONNXWhile', ['max_trip_count', 'condition', 'first_init', 'second_init'], ['first_a', 'second_a', 'third_a'], body=body_net, has_cond=True, has_trip_count=True, save_scopes=save_scopes, disable_scopes=disable_scopes, ) condition_arr = np.array(condition).astype(np.bool) max_trip_count_arr = np.array(max_trip_count).astype(np.int64) first_init = np.array([1]).astype(np.float32) second_init = np.array([1]).astype(np.float32) def ref(max_trip_count, condition, first_init, second_init): first = 1 sec
ond = 1 results = [] if condition: for _ in range(max_trip_count): third = first + second
first = second second = third results.append(third) if third > 100: break return (first, second, np.array(results).astype(np.float32)) self.assertReferenceChecks( gc, while_op, [max_trip_count_arr, condition_arr, first_init, second_init], ref, ) if __name__ == "__main__": unittest.main()
# -*- coding: utf-8 -*- import sys def get_skeleton(N, strings): skeletons = [] for i in range(N): skeleton = [strings[i][0]] skeleton += [strings[i][j] for j in range(1, len(strings[i])) if strings[i][j] != strings[i][j-1]] skeletons.append(skeleton) for i in range(1, N): if skeletons[i] != skeletons[i-1]: skeletons[0] = [] break return skeletons[0] def solve(): N = int(input()) strings = [input() for _ in range(N)] ans = 0 skeleton = get_skeleton(N, strings) if len(skeleton) == 0: return 'Fegla Won' lengths = [] for c in skeleton: length = dict() for i in range(N): for j in range(len(strings[i])): if strings[i][j] != c: break length[j] = length.get(j, 0) + 1 strings[i] = strings[i][j:] if j < len(strings[i]) else '' lengths.append(length) for length in lengths: ans += min(sum
(abs(k - l) *
length[l] for l in length) for k in length) return ans def main(): T = int(input()) for i in range(1, T + 1): print('Case #{}: {}'.format(i, solve())) if __name__ == '__main__': sys.exit(main())
nd #12121. defers = [] pk_val = None if self._deferred: from django.db.models.query_utils import deferred_class_factory factory = deferred_class_factory for field in self._meta.fields: if isinstance(self.__class__.__dict__.get(field.attname), DeferredAttribute): defers.append(field.attname) if pk_val is None: # The pk_val and model values are the same for all # DeferredAttribute classes, so we only need to do this # once. obj = self.__class__.__dict__[field.attname] model = obj.model_ref() else: factory = simple_class_factory return (model_unpickle, (model, defers, factory), data) def _get_pk_val(self, meta=None): if not meta: meta = self._meta return getattr(self, meta.pk.attname) def _set_pk_val(self, value): return setattr(self, self._meta.pk.attname, value) pk = property(_get_pk_val, _set_pk_val) def serializable_value(self, field_name): """ Returns the value of the field name for this instance. If the field is a foreign key, returns the id value, instead of the object. If there's no Field object with this name on the model, the model attribute's value is returned directly. Used to serialize a field's value (in the serializer, or form output, for example). Normally, you would just access the attribute directly and not use this method. """ try: field = self._meta.get_field_by_name(field_name)[0] except FieldDoesNotExist: return getattr(self, field_name) return getattr(self, field.attname) def save(self, force_insert=False, force_update=False, using=None): """ Saves the current instance. Override this in a subclass if you want to control the saving process. The 'force_insert' and 'force_update' parameters can be used to insist that the "save" must be an SQL insert or update (or equivalent for non-SQL backends), respectively. Normally, they should not be set. """ if force_insert and force_update: raise ValueError("Cannot force both insert and updating in model saving.") self.save_base(using=using, force_insert=force_insert, force_update=force_update) save.alters
_data = True def save_base(self, raw=False, cls=None, origin=None, force_insert=False, force_update=False, using=None): """
Does the heavy-lifting involved in saving. Subclasses shouldn't need to override this method. It's separate from save() in order to hide the need for overrides of save() to pass around internal-only parameters ('raw', 'cls', and 'origin'). """ using = using or router.db_for_write(self.__class__, instance=self) assert not (force_insert and force_update) if cls is None: cls = self.__class__ meta = cls._meta if not meta.proxy: origin = cls else: meta = cls._meta if origin and not meta.auto_created: signals.pre_save.send(sender=origin, instance=self, raw=raw, using=using) # If we are in a raw save, save the object exactly as presented. # That means that we don't try to be smart about saving attributes # that might have come from the parent class - we just save the # attributes we have been given to the class we have been given. # We also go through this process to defer the save of proxy objects # to their actual underlying model. if not raw or meta.proxy: if meta.proxy: org = cls else: org = None for parent, field in meta.parents.items(): # At this point, parent's primary key field may be unknown # (for example, from administration form which doesn't fill # this field). If so, fill it. if field and getattr(self, parent._meta.pk.attname) is None and getattr(self, field.attname) is not None: setattr(self, parent._meta.pk.attname, getattr(self, field.attname)) self.save_base(cls=parent, origin=org, using=using) if field: setattr(self, field.attname, self._get_pk_val(parent._meta)) if meta.proxy: return if not meta.proxy: non_pks = [f for f in meta.local_fields if not f.primary_key] # First, try an UPDATE. If that doesn't update anything, do an INSERT. pk_val = self._get_pk_val(meta) pk_set = pk_val is not None record_exists = True manager = cls._base_manager if pk_set: # Determine whether a record with the primary key already exists. if (force_update or (not force_insert and manager.using(using).filter(pk=pk_val).exists())): # It does already exist, so do an UPDATE. if force_update or non_pks: values = [(f, None, (raw and getattr(self, f.attname) or f.pre_save(self, False))) for f in non_pks] if values: rows = manager.using(using).filter(pk=pk_val)._update(values) if force_update and not rows: raise DatabaseError("Forced update did not affect any rows.") else: record_exists = False if not pk_set or not record_exists: if meta.order_with_respect_to: # If this is a model with an order_with_respect_to # autopopulate the _order field field = meta.order_with_respect_to order_value = manager.using(using).filter(**{field.name: getattr(self, field.attname)}).count() self._order = order_value fields = meta.local_fields if not pk_set: if force_update: raise ValueError("Cannot force an update in save() with no primary key.") fields = [f for f in fields if not isinstance(f, AutoField)] record_exists = False update_pk = bool(meta.has_auto_field and not pk_set) result = manager._insert([self], fields=fields, return_id=update_pk, using=using, raw=raw) if update_pk: setattr(self, meta.pk.attname, result) transaction.commit_unless_managed(using=using) # Store the database on which the object was saved self._state.db = using # Once saved, this is no longer a to-be-added instance. self._state.adding = False # Signal that the save is complete if origin and not meta.auto_created: signals.post_save.send(sender=origin, instance=self, created=(not record_exists), raw=raw, using=using) save_base.alters_data = True def delete(self, using=None): using = using or router.db_for_write(self.__class__, instance=self) assert self._get_pk_val() is not None, "%s object can't be deleted because its %s attribute is set to None." % (self._meta.object_name, self._meta.pk.attname) collector = Collector(using=using) collector.collect([self]) collector.delete() delete.alters_data = True def _get_FIELD_display(self, field): value = getattr(self, field.attname) return force_unicode(dict(field.flatchoices).get(value, value), strings_only=True) def _get_next_or_previous_by_FIELD(self, field, is_next, **kwargs): if not self.pk: raise ValueError("get_next/get_previous cannot be used on unsaved objects.") op = is_next and 'gt' or
tailData">')[1].split('</td>')[0] # Pull out values from summary stuff AppraisedSplit = lambda data: data.split('Appraised:</td><td class="ssDetailData" width="125px" align="right">')[1].split('&nbsp')[0] LandHSSplit = lambda data: data.split('Land HS:</td><td class="ssDetailData" width="125px" align="right">')[1].split('&nbsp')[0] ImprovementHSSplit = lambda data: data.split('Improvement HS:</td><td class="ssDetailData" width="125px" align="right">')[1].split('&nbsp')[0] HomeSteadCapSplit = lambda data: data.split('Homestead Cap:</td><td class="ssDetailData" width="125px" align="right">')[1].split('&nbsp')[0] AssessedSplit = lambda data: data.split('Assessed:</td><td class="ssDetailData" width="125px" align="right">')[1].split('&nbsp')[0] OwnerIdSplit = lambda data: data.split('Owner ID:</td><td class="ssDetailData">')[1].split('</td>')[0] # Pull out values and areas of floors split_str = '<td class="ssDetailPageLabel" nowrap="1">%s</td><td class="ssDetailPageData" nowrap="1">' split_field = lambda sstr, data: data.split(split_str %sstr)[1].split('</td>')[0] MainFlrSqSplit = lambda data: split_field("Area", data) MainFlrVaSplit = lambda data: split_field("Value", data) SecondFlrSqSplit = lambda data: split_field("Area", data) SecondFlrVaSplit = lambda data: split_field("Value", data) PorchFlrSqSplit = lambda data: split_field("Area", data) PorchFlrVaSplit = lambda data: split_field("Value", data) GarageFlrSqSplit = lambda data: split_field("Area", data) GarageFlrVaSplit = lambda data: split_field("Value", data) main_url = 'http://.org/appraisal/publicaccess/PropertyDetail.aspx?PropertyID=%s&dbKeyAuth=Appraisal&TaxYear=%s&NodeID=11&PropertyOwnerID=%s' get_main_page = lambda propId,cyear,ownerId: urllib.urlopen(main_url%(propId, cyear,ownerId), proxies=proxies).read() THREADS = [] main_search = "http://.org/appraisal/publicaccess/PropertySearch.aspx?PropertySearchType=1&SelectedItem=10&PropertyID=&PropertyOwnerID=&NodeID=11" search_data = lambda prop_value,cyear: "PropertyID=%s&PropertySearchType=1&NodeID=11&dbKeyAuth=Appraisal&TaxYear=%s&SearchSubmit=Search"%(prop_value, cyear) get_property = lambda data: urllib.urlopen("http://.org/appraisal/publicaccess/PropertySearchResults.aspx",data=data).read() def get_propId(property,cyear): d = search_data(property,cyear) #print d page = get_property(d) #print page print page.split("ViewPropertyOrOwners(")[1].split(")")[0].replace(",","").split() propId = page.split("ViewPropertyOrOwners(")[1].split(")")[0].replace(",","").split()[-1].strip() ownerId = page.split("ViewPropertyOrOwners(")[1].split(")")[0].replace(",","").split()[-2].strip() print "Identified PropertyId: ", propId, "OwnerId: ", ownerId return propId, ownerId imp_url = 'http://.org/appraisal/publicaccess/PropertyImpDetail.aspx?CurrPosition=%d&LastPosition=4&PropertyID=%s&PropertyOwnerID=%s&NodeID=11' def get_rland_sf(propId,ownerId): url_str = 'http://.org/appraisal/publicaccess/PropertyLandDetail.aspx?CurrPosition=2&LastPosition=2&PropertyID=%s&PropertyOwnerID=%s&NodeID=11' pdata = urllib.urlopen(url_str%(propId,ownerId)).read() sz_str = 'Size - Square Feet</td><td class="ssDetailPageData" nowrap="1">' value = pdata.split(sz_str)[1].split("</td>")[0] return value def get_land_sf(propId,ownerId): url_str = 'http://.org/appraisal/publicaccess/PropertyLandDetail.aspx?CurrPosition=1&LastPosition=2&PropertyID=%s&PropertyOwnerID=%s&NodeID=11' pdata = urllib.urlopen(url_str%(propId,ownerId)).read() sz_str = 'Size - Square Feet</td><td class="ssDetailPageData" nowrap="1">' value = pdata.split(sz_str)[1].split("</td>")[0] return value def get_improvements(propId, ownerId, pdata): x = pdata.split(' class="ssPropertyLink" style="color:#194274; font-weight:bolder;">Imp') imp = {} value_str = '''class="ssPropertyLink" style="color:#194274; font-weight:bolder;">Imp''' if x > 1: value = pdata.split(value_str)[1].split("$")[1].split("</td>")[0].strip() imp["Improvements 1"] = "$"+value if x > 2: # url = imp_url%(2,propId, ownerId) # data = urllib.urlopen(url).read() # print data.split(value_str) # value = data.split(value_str)[1].split("</td>")[0].strip() # value = "$"+value.replace("$","").strip() # imp["Improvements 2"] = value value = pdata.split(value_str)[2].split("$")[1].split("</td>")[0].strip() imp["Improvements 2"] = "$"+value elif x > 3: # url = imp_url%(3,propId, ownerId) # data = urllib.urlopen(url).read() # value = data.split(value_str)[1].split("</td>")[0].strip() # value = "$"+value.replace("$","").strip() # imp["Improvements 3"] = value value = pdata.split(value_str)[3].split("$")[1].split("</td>")[0].strip() imp["Improvements 3"] = "$"+value elif x > 4: # url = imp_url%(4,propId, ownerId) # data = urllib.urlopen(url).read() # value = data.split(value_str)[1].split("</td>")[0].strip() # value = "$"+value.replace("$","").strip() # imp["Improvements 4"] = value pass return imp PrimarySite = 'S1 (Primary Site)</td><td align="left" nowrap="true" style="overflow-x:hidden;" class="ssDataColumn">A1 (A1 - Residential Single Family)</td><td align="left" nowrap="true" class="ssDataColumn"></td><td align="right" nowrap="true" class="ssDataColumn">' ResidualLand = 'S3 (Residual Land)</td><td align="left" nowrap="true" style="overflow-x:hidden;" class="ssDataColumn">A1 (A1 - Residential Single Family)</td><td
align="left" nowrap="true" class="ssDataColumn"></td><td align="right" nowrap="true" class="ssDataColumn">' def parse_main_page(main_store, property, cyear='2010'): propId,ownerId_sql = get_propId(property,cyear) page_data = get_main_page(propId,cyear, ownerId_sql) #page_data = open("
page.txt").read() addr = AddrSplit(page_data) ownerName = NameSplit(page_data) print "Owner Name:", ownerName g = threading.Thread(target=get_pdf_listing, args=(propId,ownerId_sql,ownerName)) g.start() THREADS.append(g) ownerid = OwnerIdSplit(page_data) print "Owner Id:", ownerid #property = PropID(page_data) #print property ldesc = LDescSplit(page_data) # Pull out values from summary stuff print "Legal Desc: ",ldesc appraised = AppraisedSplit(page_data).strip() landHS = LandHSSplit(page_data).strip() improveHS = ImprovementHSSplit(page_data).strip() hsCap = HomeSteadCapSplit(page_data).strip() assessed = AssessedSplit(page_data).strip() exemptions = Exemptions(page_data) residual = '$'+page_data.split(ResidualLand)[1].split("</td></tr>")[0].split("$")[1].strip() primary = '$'+page_data.split(PrimarySite)[1].split("</td></tr>")[0].split("$")[1].strip() primarySiteSq = get_land_sf(propId, ownerId_sql) residualSq = get_rland_sf(propId, ownerId_sql) if property not in main_store: main_store[property] = {} if not cyear in main_store[property]: main_store[property][cyear] = {} # get the properties history of values previous_years = process_history(propId, ownerId_sql, int(cyear),2006) for year in previous_years: main_store[property][year] = previous_years[year] # add in the prop values for this year main_store[property][cyear]['AppraisedValue'] = appraised main_store[property][cyear]['Land HS'] = landHS main_store[property][cyear]['Improvement HS'] = improveHS main_store[property][cyear]['HSCapAdj'] = hsCap main_store[property][cyear]['Assessed'] = assessed main_store[property][cyear]['Primary Site Value'] = primary main_store[property][cyear]['Primary Site SQ'] = primarySiteSq main_store[property][cyear]['Residual Land Value'] = residual main_store[property][cyear]['Residual Land SQ'] = residualSq main_store[property][cyear]['Exemptions'] = exemptions # Get various floor SQ footage segments = get_segments(propId) improvements = traverse_segments(1, segments, propId) #improvements = {} imp = get_improvements(propId, ownerId_sql, page_data) if len(imp) > 0: for i in imp: main_store[property][cyear][i] = imp[i] for year in main_store[property].keys(): main_store[property][year]['Year'] = year main_store[property][year]['Prop
from setuptools import set
up from setuptools import find_packages setup(name='Keras-layers', version='0.0.1', description='Collection of useful non-standard layers for keras', author='Atanas Mirchev', author_email='taimir93@gmail.com', url='https://github.com/taimir/keras-layers', license='MIT',
packages=find_packages())
nb_epoch = 100 batch_size = 64 optimizer = 'adam' hidden_units = 3000 nb_val_samples = 462
embedding_size = 10 dropout_percentage = 0.3
embedding_GRU_size = 100 maximum_line_length = 500 samples_per_epoch = 4127 * maximum_line_length loss = 'categorical_crossentropy'
#!/usr/bin/env python # Original code was created by Nadeem Douba as part of the Canari Framework from collections import OrderedDict from xml.etree.cElementTree import XML from zipfile import ZipFile def mtgx2json(graph): zipfile = ZipFile(graph) graphs = filter(lambda x: x.endswith('.graphml'), zipfile.namelist()) for f in graphs: multikeys = [] xml = XML(zipfile.open(f).read()) links = {} for edge in xml.findall('{http://graphml.graphdrawing.org/xmlns}graph/' '{http://graphml.graphdrawing.org/xmlns}edge'): src = edge.get('source') dst = edge.get('target') if src not in links: links[src] = dict(in_=[], out=[]) if dst not in links: links[dst] = dict(in_=[], out=[]) links[src]['out'].append(dst) links[dst]['in_'].append(src) for node in xml.findall('{http://graphml.graphdrawing.org/xmlns}graph/' '{http://graphml.graphdrawing.org/xmlns}node'): node_id = node.get('id') node = node.find('{http://graphml.graphdrawing.org/xmlns}data/' '{http://maltego.paterva.com/xml/mtgx}MaltegoEntity') record = OrderedDict({'NodeID': node_id, 'EntityType': node.get('type').strip()}) props = {'Data': {}} for prop in node.findall('{http://maltego.paterva.com/xml/mtgx}Properties
/' '{http://maltego.paterva.com/xml/mtgx}Property'): value = prop.find('{http://maltego.paterva.com/xml/mtgx}Value').text or '' entity_prop = {prop.get('displayName'): value.strip()} props['Data'].update(entity_prop) record.update(props) s = ' - '.join(['%s: %s' % (key, value) for (key, value) in record['Data'].items()]) record.pop('Data') data = {'Data': s}
record.update(data) link = {'Links': {}} i_link = {'Incoming': links.get(node_id, {}).get('in_', 0)} link['Links'].update(i_link) o_link = {'Outgoing': links.get(node_id, {}).get('out', 0)} link['Links'].update(o_link) record.update(link) multikeys.append(record) return multikeys
from io import StringIO from coaster.logger import RepeatValueIndicator, filtered_value, pprint_with_indent def test_filtered_value(): """Test for filtered values.""" # Doesn't touch normal key/value pairs assert filtered_value('normal', 'value') == 'value' assert filtered_value('also_normal', 123) == 123 # But does redact sensitive keys assert filtered_value('password', '123pass') != '123pass' # The returned value is an object that renders via repr and str as '[Filtered]' assert repr(filtered_value('password', '123pass')) == '[Filtered]' assert str(filtered_value('password', '123pass')) == '[Filtered]' # Also works on partial matches in the keys assert repr(filtered_value('confirm_password', '123pass')) == '[Filtered]' # The filter uses a verbose regex. Words in the middle of the regex also work assert repr(filtered_value('access_token', 'secret-here')) == '[Filtered]' # Filters are case insensitive assert repr(filtered_value('TELEGRAM_ERROR_APIKEY', 'api:key')) == '[Filtered]' # Keys with 'token' as a word are also filtered assert repr(filtered_value('SMS_TWILIO_TOKEN', 'api:key')) == '[Filtered]' # Numbers that look like card numbers are filtered assert ( filtered_value('anything', 'My number is 1234 5678 9012 3456') == 'My number is [Filtered]' ) # This works with any combination of spaces and dashes within the number assert ( filtered_value('anything', 'My numbe
r is 1234 5678-90123456') == 'My number is [Filtered]' ) def test_pprint_with_indent(): """Test pprint_with_indent does indentation.""" out = StringIO() data = { 12: 34, 'confirm_password': '12345qwerty', 'credentials': ['abc', 'def'], 'key'
: 'value', 'nested_dict': {'password': 'not_filtered'}, 'password': '12345qwerty', } pprint_with_indent(data, out) assert ( out.getvalue() == '''\ {12: 34, 'confirm_password': [Filtered], 'credentials': [Filtered], 'key': 'value', 'nested_dict': {'password': 'not_filtered'}, 'password': [Filtered]} ''' ) def test_repeat_value_indicator(): """Test RepeatValueIndicator class.""" assert repr(RepeatValueIndicator('key')) == "<same as prior 'key'>" assert str(RepeatValueIndicator('key')) == "<same as prior 'key'>"
# Copyright 2015 Google Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.
0 (the "Li
cense"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for tf.bitcast.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import numpy as np import tensorflow as tf class BitcastTest(tf.test.TestCase): def _testBitcast(self, x, datatype, shape): with self.test_session(): tf_ans = tf.bitcast(x, datatype) out = tf_ans.eval() buff_after = memoryview(out).tobytes() buff_before = memoryview(x).tobytes() self.assertEqual(buff_before, buff_after) self.assertEqual(tf_ans.get_shape(), shape) self.assertEqual(tf_ans.dtype, datatype) def testSmaller(self): x = np.random.rand(3, 2) datatype = tf.int8 shape = [3, 2, 8] self._testBitcast(x, datatype, shape) def testLarger(self): x = np.arange(16, dtype=np.int8).reshape([4, 4]) datatype = tf.int32 shape = [4] self._testBitcast(x, datatype, shape) def testSameDtype(self): x = np.random.rand(3, 4) shape = [3, 4] self._testBitcast(x, x.dtype, shape) def testSameSize(self): x = np.random.rand(3, 4) shape = [3, 4] self._testBitcast(x, tf.int64, shape) def testErrors(self): x = np.zeros([1, 1], np.int8) datatype = tf.int32 with self.assertRaisesRegexp(ValueError, "Cannot bitcast due to shape"): tf.bitcast(x, datatype, None) def testEmpty(self): x = np.ones([], np.int32) datatype = tf.int8 shape = [4] self._testBitcast(x, datatype, shape) def testUnknown(self): x = tf.placeholder(tf.float32) datatype = tf.int8 tf.bitcast(x, datatype, None) if __name__ == "__main__": tf.test.main()