code
stringlengths
17
6.64M
class ResidualLayer(nn.Module): def __init__(self, net: nn.Module): super().__init__() self.net = net def forward(self, x): return (x + self.net(x))
class EvalOnlyModel(nn.Module): def __init__(self, eval_only=None, train=False, **kwargs): super().__init__() if (eval_only is None): warnings.warn(f'Model eval_only flag is not set for {type(self)}. Defaulting to True') eval_only = True if train: warnings.warn('Model train flag is deprecated') self.eval_only = eval_only def forward(self, x, cache={}, time_idx: int=(- 1)): pass def train(self, train): if self.eval_only: super().train(False) for p in self.parameters(): p.requires_grad = False if (train and self.eval_only): warnings.warn("Ignoring 'train()' in TaskonomyEncoder since 'eval_only' was set during initialization.", RuntimeWarning) else: return super().train(train)
class EWC(): def __init__(self, loss_fn, model, coef=0.001, avg_tasks=False, n_samples_fisher=1000, **kwargs): self.loss_fn = loss_fn self.model = model self.coef = coef self.avg_tasks = avg_tasks self.weights_anchor_list = [] self.precision_matrices_list = [] self.n_samples_fisher = n_samples_fisher self.n_tasks = 0 def __call__(self, *args, **kwargs): orig_losses = self.loss_fn(*args, **kwargs) regularization_loss = self.compute_penalty(cur_model=self.model) orig_losses.update({'total': (orig_losses['total'] + (self.coef * regularization_loss)), 'weight_tying': regularization_loss}) return orig_losses def compute_penalty(self, cur_model): loss = torch.tensor(0.0).to(next(cur_model.parameters()).device) hits = 0 for (weights_anchor, precision_matrices) in zip(self.weights_anchor_list, self.precision_matrices_list): for (name, param) in cur_model.base.named_parameters(): if (name in precision_matrices): hits += 1 _loss = (precision_matrices[name] * ((weights_anchor[name] - param) ** 2)) loss += _loss.sum() assert ((hits != 0) or (len(self.weights_anchor_list) == 0)), 'No parameters for computing ewc penalty, are you sure the names in model and precision_matrix match?' return loss def post_training_epoch(self, model, dataloader, post_training_cache, **kwargs): if ('weights_anchor' in post_training_cache): weights_anchor = post_training_cache['weights_anchor'] precision_matrices = post_training_cache['precision_matrices'] else: weights_anchor = copy.deepcopy({n: p.detach() for (n, p) in model.base.named_parameters() if p.requires_grad}) precision_matrices = self._diag_fisher(model, dataloader, copy.deepcopy(weights_anchor), kwargs['cfg']) post_training_cache['weights_anchor'] = weights_anchor post_training_cache['precision_matrices'] = precision_matrices if self.avg_tasks: self.n_tasks += 1 if (len(self.weights_anchor_list) == 0): self.weights_anchor_list.append(weights_anchor) self.precision_matrices_list.append(precision_matrices) else: self.weights_anchor_list[0] = self._compute_running_avg(self.weights_anchor_list[0], weights_anchor, self.n_tasks) self.precision_matrices_list[0] = self._compute_running_avg(self.precision_matrices_list[0], precision_matrices, self.n_tasks) else: self.weights_anchor_list.append(weights_anchor) self.precision_matrices_list.append(precision_matrices) def _compute_running_avg(self, running_avg, sample, n): for name in running_avg.keys(): running_avg[name] = (((running_avg[name] * (n - 1)) / n) + (sample[name] / n)) return running_avg def _diag_fisher(self, model, dataloader, precision_matrices, cfg): model.eval() for (name, param) in precision_matrices.items(): param.data.zero_() n_samples = 0 (task_idx, dataloader) = dataloader.get_last_dl() for batch_tuple in tqdm(dataloader, f'Computing fisher matrix for task {task_idx}'): n_samples += len(batch_tuple) if (n_samples > self.n_samples_fisher): break (x, label, masks) = process_batch_tuple(batch_tuple, task_idx, cfg) model.zero_grad() predictions = model(x, task_idx=task_idx) log_p = self.loss_fn(predictions, label, masks) log_p['total'].backward() for (name, param) in model.base.named_parameters(): if (name in precision_matrices): precision_matrices[name].data += ((param.grad.data.detach() ** 2) / len(dataloader)) return precision_matrices
class FCN5MidFeedback(FCN5): def __init__(self, kernel_size=3, *args, **kwargs): super().__init__(*args, **kwargs) if (kernel_size == 3): net_kwargs = {'kernel_size': 3, 'stride': 1, 'padding': 1} elif (kernel_size == 1): net_kwargs = {'kernel_size': 1, 'stride': 1, 'padding': 0} else: assert False, f'kernel size not recognized ({kernel_size})' self.fb_conv1 = _make_layer(8, 64, **net_kwargs) self.fb_conv2 = _make_layer(64, 8, **net_kwargs) self.feedback_net = nn.Sequential(self.fb_conv1, self.fb_conv2) def forward(self, x, task_idx: int=(- 1), cache={}): last_repr = cache['last_repr'] last_repr_tweeked = self.feedback_net(last_repr) last_repr_tweeked = upsampler(last_repr_tweeked) last_repr_tweeked = last_repr_tweeked.repeat(1, (256 // 8), 1, 1) x = self.conv1(x) x = self.conv2(x) x = (x + last_repr_tweeked) x2 = x x = self.conv3(x) x = self.conv4(x) x = self.conv5(x) x = (x + self.skip(x2)) if self.normalize_outputs: x = self.groupnorm(x) return (last_repr + x)
class FCN5LateFeedback(FCN5): def __init__(self, kernel_size=3, *args, **kwargs): super().__init__(*args, **kwargs) if (kernel_size == 3): net_kwargs = {'kernel_size': 3, 'stride': 1, 'padding': 1} elif (kernel_size == 1): net_kwargs = {'kernel_size': 1, 'stride': 1, 'padding': 0} else: assert False, f'kernel size not recognized ({kernel_size})' self.fb_conv1 = _make_layer(8, 64, **net_kwargs) self.fb_conv2 = _make_layer(64, 8, **net_kwargs) self.feedback_net = nn.Sequential(self.fb_conv1, self.fb_conv2) def forward(self, x, task_idx: int=(- 1), cache={}): last_repr = cache['last_repr'] ret_input_only = super().forward(x, task_idx) ret_output_only = self.feedback_net(last_repr) return ((last_repr + ret_input_only) + ret_output_only)
class LifelongNetwork(nn.Module): def forward(self, x, task_idx=None): pass def start_training(self): pass def start_task(self, task_idx, train): pass
class LifelongSidetuneNetwork(LifelongNetwork): def __init__(self, dataset='taskonomy', use_baked_encoding=False, normalize_pre_transfer=True, base_class=None, base_weights_path=None, base_kwargs={}, transfer_class=None, transfer_weights_path=None, transfer_kwargs={}, side_class=None, side_weights_path=None, side_kwargs={}, tasks=[0, 1, 2, 3, 4, 5, 6, 7, 8, 9], task_specific_transfer_kwargs=None, task_specific_side_kwargs=None, dense=False, pnn=False, merge_method='merge_operators.Alpha', base_uses_other_sensors=False): super().__init__() if (side_class is None): self.merge_method = 'merge_operators.BaseOnly' elif (base_class is None): self.merge_method = 'merge_operators.SideOnly' else: self.merge_method = merge_method self.dataset = dataset self.tasks = tasks self.dense = dense self.pnn = pnn self.base = load_submodule(eval(str(base_class)), base_weights_path, base_kwargs, zero_fn) self.sides = nn.ModuleDict() self.transfers = nn.ModuleDict() self.merge_operators = nn.ModuleDict() task_specific_transfer_kwargs = ([{} for _ in self.tasks] if (task_specific_transfer_kwargs is None) else task_specific_transfer_kwargs) task_specific_side_kwargs = ([{} for _ in self.tasks] if (task_specific_side_kwargs is None) else task_specific_side_kwargs) if (self.dense and self.pnn): for (side_kwargs, task_idx) in zip(task_specific_side_kwargs, tasks): side_kwargs['task_idx'] = task_idx side_kwargs['dense'] = True for task_idx in self.tasks: task_id = str(task_idx) if (task_id in self.sides): continue merged_side_kwargs = {**side_kwargs, **task_specific_side_kwargs[task_idx]} merged_transfer_kwargs = {**transfer_kwargs, **task_specific_transfer_kwargs[task_idx]} self.sides[task_id] = load_submodule(eval(str(side_class)), side_weights_path, merged_side_kwargs, ZeroFn()) self.transfers[task_id] = load_submodule(eval(str(transfer_class)), transfer_weights_path, merged_transfer_kwargs, identity_fn) self.merge_operators[task_id] = eval(self.merge_method)(dense=self.dense, task_idx=task_idx, dataset=self.dataset) self.use_baked_encoding = use_baked_encoding self.base_uses_other_sensors = base_uses_other_sensors self.normalize_pre_transfer = normalize_pre_transfer if self.normalize_pre_transfer: self.groupnorm = nn.GroupNorm(8, 8, affine=False) self.cache = {} self.eval() def forward(self, x, task_idx=None, pass_i=0): if (task_idx is None): warnings.warn('No task_idx is passed, are you sure? (only should do this for torchsummary)') task_idx = 0 task_id = str(task_idx) if (pass_i == 0): self.base_encoding = self.forward_base(x, task_idx) self.cache = {'last_repr': self.base_encoding} self.side = self.sides[task_id] self.transfer = self.transfers[task_id] self.merge_operator = self.merge_operators[task_id] if self.pnn: assert (isinstance(self.base, TaskonomyEncoderWithCache) or isinstance(self.base, ResnetiCifar44NoLinearWithCache)), 'PNN needs to have cache!' (self.base_encoding, pnn_base_cache) = self.base_encoding pnn_side_caches = [] prev_side_encodings = [] pnn_full_cache = [pnn_base_cache, pnn_side_caches] if self.dense: for t in range(task_idx): (this_side_encoding, this_side_cache) = self.sides[str(t)](x, pnn_full_cache) pnn_side_caches.append(this_side_cache) prev_side_encodings.append(this_side_encoding.detach()) if self.pnn: (self.side_encoding, _) = self.side(x, pnn_full_cache) else: self.side_encoding = self.side(x, cache=self.cache) self.cache['last_repr'] = self.side_encoding additional_encodings = [] if (self.dense and self.pnn): additional_encodings = prev_side_encodings elif self.dense: additional_encodings = [self.sides[str(t)](x).detach() for t in range(task_idx)] self.merged_encoding = self.merge_operator(self.base_encoding, self.side_encoding, additional_encodings) if self.normalize_pre_transfer: self.normalized_merged_encoding = self.groupnorm(self.merged_encoding) self.transfered_encoding = self.transfer(self.normalized_merged_encoding) else: self.transfered_encoding = self.transfer(self.merged_encoding) return self.transfered_encoding def forward_base(self, x, task_idx): if isinstance(x, dict): x_dict = x assert ('rgb_filled' in x_dict.keys()), 'need input images to work with' x = x_dict['rgb_filled'] if ('taskonomy' in x_dict): base_encoding = x_dict['taskonomy'] else: try: base_encoding = self.base(x, task_idx) except TypeError: base_encoding = self.base(x) elif self.use_baked_encoding: (x, base_encoding) = x else: if self.base_uses_other_sensors: assert (isinstance(x, list) and (len(x) > 1)), 'Must have additional sensors for base!' (x, other_sensors) = (x[0], x[1:]) assert (len(other_sensors) == 1), 'Our system can only take ONE other_sensors' other_sensors = other_sensors[0] base_input = other_sensors else: base_input = x try: base_encoding = self.base(base_input, task_idx) except TypeError as e: base_encoding = self.base(base_input) return base_encoding def forward_transfer(self, x): return self.transfer(x) def start_task(self, task_idx, train, print_alpha=False) -> list: for task in self.tasks: task_id = str(task) if ((task == task_idx) or ((task < task_idx) and self.dense)): self.sides[task_id].cuda() self.transfers[task_id].cuda() self.merge_operators[task_id].cuda() self.sides[task_id].requires_grad_(train) self.transfers[task_id].requires_grad_(train) self.merge_operators[task_id].requires_grad_(train) else: self.sides[task_id].cpu() self.transfers[task_id].cpu() self.merge_operators[task_id].cpu() self.sides[task_id].requires_grad_(False) self.transfers[task_id].requires_grad_(False) self.merge_operators[task_id].requires_grad_(False) self._set_grad_to_none(self.sides[task_id]) self._set_grad_to_none(self.transfers[task_id]) self._set_grad_to_none(self.merge_operators[task_id]) if print_alpha: alphas = [self.merge_operators[str(task_idx)].param for task_idx in self.tasks] print(f'''Setting grad True for task {task_idx} and others False. Alphas: {alphas}''') return [p for p in self.parameters() if p.requires_grad] def _set_grad_to_none(self, vars): if isinstance(vars, nn.parameter.Parameter): vars.grad = None elif isinstance(vars, nn.Module): for p in vars.parameters(): p.grad = None def start_training(self): if hasattr(self.base, 'start_training'): self.base.start_training()
class MergeOperator(nn.Module): def __init__(self, dense, task_idx, dataset): super().__init__() self.dense = dense self.task_idx = task_idx self.dataset = dataset def __call__(self, base_encoding, side_encoding, additional_encodings=[]) -> torch.Tensor: pass @property def weights(self): return [] @property def param(self): return (- 1)
class BaseOnly(MergeOperator): def __call__(self, base_encoding, side_encoding, additional_encodings=[]): return base_encoding
class SideOnly(MergeOperator): def __call__(self, base_encoding, side_encoding, additional_encodings=[]): return side_encoding
class Summation(MergeOperator): def __call__(self, base_encoding, side_encoding, additional_encodings=[]): merged_encoding = ((base_encoding + side_encoding) + sum(additional_encodings)) return merged_encoding
class Product(MergeOperator): def __call__(self, base_encoding, side_encoding, additional_encodings=[]): merged_encoding = (base_encoding * side_encoding) for add_encoding in additional_encodings: merged_encoding *= add_encoding return merged_encoding
class Alpha(MergeOperator): def __init__(self, dense, task_idx, **kwargs): super().__init__(dense, task_idx, **kwargs) if dense: self.alphas = nn.Parameter(torch.tensor(0.0).repeat((task_idx + 2))) else: self.alphas = nn.Parameter(torch.tensor(0.0)) @property def weights(self): if self.dense: weights = torch.softmax(self.alphas, dim=0) else: alpha_squashed = torch.sigmoid(self.alphas) weights = [alpha_squashed, (1 - alpha_squashed)] return weights def __call__(self, base_encoding, side_encoding, additional_encodings=[]): outputs_to_merge = (([base_encoding] + additional_encodings) + [side_encoding]) merged_encoding = (torch.zeros_like(base_encoding) if isinstance(base_encoding, torch.Tensor) else torch.zeros_like(side_encoding)) assert (len(self.weights) == len(outputs_to_merge)), f'# of outputs ({len(outputs_to_merge)}) != # of alphas ({len(weights)})' for (a, out) in zip(self.weights, outputs_to_merge): merged_encoding += (a * out) return merged_encoding @property def param(self): return self.weights[0].item()
class FiLMNet(nn.Module): def __init__(self, n_in, n_out, kernel_size=1): super().__init__() if (kernel_size == 3): net_kwargs = {'kernel_size': 3, 'stride': 1, 'padding': 1} elif (kernel_size == 1): net_kwargs = {'kernel_size': 1, 'stride': 1, 'padding': 0} else: assert False, f'kernel size not recognized ({kernel_size})' self.base_layer = _make_layer(n_in, 64, **net_kwargs) self.mult_head = nn.Conv2d(64, n_out, bias=True, **net_kwargs) self.add_head = nn.Conv2d(64, n_out, bias=True, **net_kwargs) def forward(self, x): x1 = self.base_layer(x) mult_factor = (self.mult_head(x1) + x) add_factor = (self.add_head(x1) + x) return (mult_factor, add_factor)
class FiLM(MergeOperator): def __init__(self, dense, **kwargs): super().__init__(dense, **kwargs) assert (not dense) self.film = FiLMNet(n_in=8, n_out=8, kernel_size=1) def __call__(self, base_encoding, side_encoding, additional_encodings=[]): (mult_factor, add_factor) = self.film(side_encoding) merged_encoding = ((base_encoding * mult_factor) + add_factor) return merged_encoding
class MLP(MergeOperator): def __init__(self, dense, task_idx, dataset): super().__init__(dense, task_idx, dataset) if (dataset == 'icifar'): self.make_layer = make_linear_layer elif (dataset == 'taskonomy'): self.make_layer = make_conv_layer self.base_net = self.make_layer() self.side_net = IdentityFn() if dense: self.dense_side_nets = nn.ModuleList([self.make_layer() for _ in range(task_idx)]) def __call__(self, base_encoding, side_encoding, additional_encodings=[]): merged_encoding = (self.base_net(base_encoding) + self.side_net(side_encoding)) if self.dense: merged_encoding += sum([net(add_encoding) for (net, add_encoding) in zip(self.dense_side_nets, additional_encodings)]) return merged_encoding
class MLP2(MLP): def __init__(self, **kwargs): super().__init__(**kwargs) self.side_net = self.make_layer()
class ResMLP2(MLP): def __init__(self, **kwargs): super().__init__(**kwargs) self.side_net = ResidualLayer(self.make_layer())
class MLPHidden(MLP): def __call__(self, base_encoding, side_encoding, additional_encodings=[]): merged_encoding = (self.base_net(base_encoding) + self.side_net(side_encoding)) if self.dense: merged_encoding += sum([net(add_encoding) for (net, add_encoding) in zip(self.dense_side_nets, additional_encodings)]) return F.ReLU(merged_encoding)
def load_submodule(model_class, model_weights_path, model_kwargs, backup_fn=zero_fn): if (model_class is not None): model = model_class(**model_kwargs) if (model_weights_path is not None): (model, _) = load_state_dict_from_path(model, model_weights_path) else: model = backup_fn assert (model_weights_path is None), 'cannot have weights without model' return model
def _make_layer(in_channels, out_channels, num_groups=2, kernel_size=3, stride=1, padding=0, dilation=1, normalize=True, bsp=False, period=None, debug=False, projected=False, scaling=False, postlinear=False, linear=False): assert (not (bsp and projected)), 'cannot do bsp and projectedconv' if linear: conv = nn.Linear(in_channels, out_channels, bias=False) elif bsp: assert (dilation == 1), 'Dilation is not implemented for binary superposition' assert (period is not None), 'Need to specify period' conv = HashConv2d(in_channels, out_channels, kernel_size=kernel_size, period=period, stride=stride, padding=padding, bias=False, debug=debug) elif projected: assert (dilation == 1), 'Dilation is not implemented for projected conv' conv = ProjectedConv2d(in_channels, out_channels, kernel_size=kernel_size, stride=stride, padding=padding, bias=False) else: conv = nn.Conv2d(in_channels, out_channels, kernel_size=kernel_size, stride=stride, padding=padding, bias=False, dilation=dilation) gn = nn.GroupNorm(num_groups, out_channels) relu = nn.ReLU() layers = [conv, relu] if normalize: layers = [conv, gn, relu] if scaling: layers = ([ScaleLayer(0.9)] + layers) if postlinear: if linear: layers = (layers + [nn.Linear(in_channels, out_channels)]) else: layers = (layers + [nn.Conv2d(out_channels, out_channels, kernel_size=1, bias=False)]) return nn.Sequential(*layers)
class SampleGroupStackModule(nn.Module): def __init__(self, *args, **kwargs): super(SampleGroupStackModule, self).__init__() def forward(self, *args, **kwargs): return downsample_group_stack(*args, **kwargs) def requires_grad_(self, *args, **kwargs): pass
class ConstantModel(): def __init__(self, data): if isinstance(data, str): if ('.png' in data): img = Image.open(data) self.const = RESCALE_0_1_NEG1_POS1(transforms.ToTensor()(img)) else: self.const = torch.load(data) else: self.const = data def forward(self, x): return self.const def to(self, device): self.const = self.const.to(device) def train(self, x): pass def __call__(self, x): return self.const
class EnsembleNet(nn.Module): def __init__(self, n_models, model_class, model_weights_path, **kwargs): super().__init__() self.nets = nn.ModuleList([load_submodule(eval(model_class), model_weights_path, kwargs) for _ in range(n_models)]) def forward(self, x): return sum([net(x) for net in self.nets])
class BoostedNetwork(nn.Module): def __init__(self, use_baked_encoding=False, normalize_pre_transfer=True, encoder_class=None, encoder_weights_path=None, encoder_kwargs={}, transfer_network_class=None, transfer_network_weights_path=None, transfer_network_kwargs={}, sidetuner_network_class=None, sidetuner_network_weights_path=None, sidetuner_kwargs={}, decoder_class=None, decoder_weights_path=None, decoder_kwargs={}, tasks=[0, 1, 2, 3, 4, 5, 6, 7, 8, 9]): super().__init__() self.encoder = load_submodule(eval(encoder_class), encoder_weights_path, encoder_kwargs, zero_fn) self.side_network_args = (eval(sidetuner_network_class), sidetuner_network_weights_path, sidetuner_kwargs, ZeroFn()) self.side_networks = nn.ModuleDict() self.transfer_network = load_submodule(eval(transfer_network_class), transfer_network_weights_path, transfer_network_kwargs, identity_fn) self.alphas = ({} if (sidetuner_network_class is None) else nn.ParameterDict()) for task_idx in tasks: task_id = str(task_idx) if (task_id not in self.side_networks): self.side_networks[task_id] = load_submodule(*self.side_network_args) self.alphas[task_id] = nn.Parameter(torch.tensor(0.0)) self.alphas['base'] = nn.Parameter(torch.tensor(0.0)) assert (decoder_class is None), 'we do not use decoder yet' self.decoder = load_submodule(eval(decoder_class), decoder_weights_path, decoder_kwargs, identity_fn) self.use_baked_encoding = use_baked_encoding self.normalize_pre_transfer = normalize_pre_transfer if self.normalize_pre_transfer: self.groupnorm = nn.GroupNorm(8, 8, affine=False) def forward(self, x, task_idx): task_id = str(task_idx) if isinstance(x, dict): x_dict = x assert ('rgb_filled' in x_dict.keys()), 'need input images to work with' x = x_dict['rgb_filled'] self.base_encoding = (x_dict['taskonomy'] if ('taskonomy' in x_dict.keys()) else self.encoder(x)) elif self.use_baked_encoding: (x, self.base_encoding) = x else: self.base_encoding = self.encoder(x) self.side_output = (([self.base_encoding] + [self.side_networks[str(t)](x).detach() for t in range(task_idx)]) + [self.side_networks[task_id](x)]) self.alpha = (([self.alphas['base'].detach()] + [self.alphas[str(t)].detach() for t in range(task_idx)]) + [self.alphas[task_id]]) alpha_squashed = torch.softmax(torch.tensor(self.alpha), dim=0) self.alpha = alpha_squashed[(- 1)] self.merged_encoding = torch.zeros_like(self.side_output[(- 1)]) for (a, out) in zip(alpha_squashed, self.side_output): self.merged_encoding += (a * out) if self.normalize_pre_transfer: self.normalized_merged_encoding = self.groupnorm(self.merged_encoding) self.transfered_encoding = self.transfer_network(self.normalized_merged_encoding) else: self.transfered_encoding = self.transfer_network(self.merged_encoding) return self.transfered_encoding def transfer(self, x): return self.transfer_network(x) def decode(self, x): return self.decoder(x) def start_task(self, task_idx): pass
class FCN5(EvalOnlyModel): def __init__(self, num_groups=2, img_channels=3, use_residual=False, normalize_outputs=False, bsp=False, period=None, projected=False, final_act=True, **kwargs): super(FCN5, self).__init__(**kwargs) self.conv1 = _make_layer(img_channels, 64, num_groups=num_groups, kernel_size=8, stride=4, padding=2, bsp=bsp, period=period, projected=projected) self.conv2 = _make_layer(64, 256, num_groups=num_groups, kernel_size=3, stride=2, padding=1, bsp=bsp, period=period, projected=projected) self.conv3 = _make_layer(256, 256, num_groups=num_groups, kernel_size=3, stride=2, padding=1, bsp=bsp, period=period, projected=projected) self.conv4 = _make_layer(256, 64, num_groups=num_groups, kernel_size=3, stride=1, padding=1, bsp=bsp, period=period, projected=projected) self.conv5 = _make_layer(64, 8, num_groups=num_groups, kernel_size=3, stride=1, padding=1, bsp=bsp, period=period, projected=projected) self.skip = _make_layer(256, 8, num_groups=num_groups, kernel_size=3, stride=2, padding=1, bsp=bsp, period=period, projected=projected) self.normalize_outputs = normalize_outputs self.final_act = final_act if normalize_outputs: self.groupnorm = nn.GroupNorm(num_groups, 8) self.use_residual = use_residual if use_residual: res1 = nn.Conv2d(img_channels, 64, kernel_size=8, stride=4, padding=2, bias=False, dilation=1) res2 = nn.Conv2d(64, 256, kernel_size=3, stride=2, padding=1, bias=False, dilation=1) self.residual = nn.Sequential(res1, res2) self.bsp = bsp def forward(self, x, task_idx: int=(- 1), cache={}): x0 = x if self.bsp: x = forward_sequential(x, self.conv1, task_idx) x = forward_sequential(x, self.conv2, task_idx) else: x = self.conv1(x) x = self.conv2(x) if self.use_residual: x = (x + self.residual(x0)) x2 = x if self.bsp: x = forward_sequential(x, self.conv3, task_idx) x = forward_sequential(x, self.conv4, task_idx) x = forward_sequential(x, self.conv5, task_idx) x = (x + forward_sequential(x2, self.skip, task_idx)) else: x = self.conv3(x) x = self.conv4(x) if self.final_act: x = self.conv5(x) else: x = self.conv5[0](x) x = (x + self.skip(x2)) if self.normalize_outputs: x = self.groupnorm(x) return x
class FCN8(EvalOnlyModel): def __init__(self, img_channels=3, normalize_outputs=False, **kwargs): super(FCN8, self).__init__(**kwargs) self.conv1 = _make_layer(img_channels, 64, kernel_size=8, stride=4, padding=2) self.conv2 = _make_layer(64, 128, kernel_size=3, stride=2, padding=1) self.conv3 = _make_layer(128, 256, kernel_size=3, stride=2, padding=1) self.conv4 = _make_layer(256, 256, kernel_size=3, stride=1, padding=1) self.conv5 = _make_layer(256, 256, kernel_size=3, stride=1, padding=1) self.conv6 = _make_layer(256, 256, kernel_size=3, stride=1, padding=1) self.conv7 = _make_layer(256, 128, kernel_size=3, stride=1, padding=1) self.conv8 = _make_layer(128, 8, kernel_size=3, stride=1, padding=1) self.skip1 = _make_layer(128, 256, kernel_size=3, stride=2, padding=1) self.skip2 = _make_layer(256, 256, kernel_size=3, stride=1, padding=1) self.skip3 = _make_layer(256, 8, kernel_size=3, stride=1, padding=1) self.normalize_outputs = normalize_outputs if self.normalize_outputs: self.groupnorm = nn.GroupNorm(2, 8) def forward(self, x, task_idx: int=(- 1), cache={}): x = self.conv1(x) x = self.conv2(x) x2 = x x = self.conv3(x) x = self.conv4(x) x = (x + self.skip1(x2)) x4 = x x = self.conv5(x) x = self.conv6(x) x = (x + self.skip2(x4)) x6 = x x = self.conv7(x) x = self.conv8(x) x = (x + self.skip3(x6)) if self.normalize_outputs: x = self.groupnorm(x) return x
class FCN4(EvalOnlyModel): def __init__(self, num_groups=2, img_channels=3, use_residual=False, normalize_outputs=False, bsp=False, period=None, debug=False, projected=False, final_act=True, **kwargs): super(FCN4, self).__init__(**kwargs) self.conv1 = _make_layer(img_channels, 16, num_groups=num_groups, kernel_size=3, stride=1, padding=1, bsp=bsp, period=period, debug=debug, projected=projected) self.conv2 = _make_layer(16, 16, num_groups=num_groups, kernel_size=3, stride=2, padding=0, bsp=bsp, period=period, debug=debug, projected=projected) self.conv3 = _make_layer(16, 32, num_groups=num_groups, kernel_size=3, stride=2, bsp=bsp, period=period, debug=debug, projected=projected) self.conv5 = _make_layer(32, 64, num_groups=num_groups, kernel_size=3, stride=1, normalize=normalize_outputs, bsp=bsp, period=period, debug=debug, projected=projected) self.bsp = bsp self.use_residual = use_residual self.final_act = final_act if use_residual: res1 = nn.Conv2d(img_channels, 8, kernel_size=3, stride=1, padding=0, bias=False, dilation=2) res2 = nn.Conv2d(8, 8, kernel_size=3, stride=2, padding=0, bias=False, dilation=2) res3 = nn.Conv2d(8, 64, kernel_size=3, stride=2, bias=False, dilation=1) self.residual = nn.Sequential(res1, res2, res3) def forward(self, x, task_idx: int=(- 1)): if self.bsp: x = forward_sequential(x, self.conv1, task_idx) x = forward_sequential(x, self.conv2, task_idx) x = forward_sequential(x, self.conv3, task_idx) x = forward_sequential(x, self.conv5, task_idx) else: x = self.conv1(x) x = self.conv2(x) x = self.conv3(x) if self.final_act: x = self.conv5(x) else: x = self.conv5[0](x) if self.use_residual: res = self.residual(x) x = (x + res) return x
class FCN4Reshaped(FCN4): def forward(self, x, cache={}, time_idx: int=(- 1)): x = super().forward(x, time_idx) x = F.avg_pool2d(x, x.size()[3]).view(x.shape[0], 64) return x
class FCN3(EvalOnlyModel): def __init__(self, num_groups=2, img_channels=3, normalize_outputs=False, **kwargs): super(FCN3, self).__init__(**kwargs) self.conv1 = _make_layer(img_channels, 64, num_groups=num_groups, kernel_size=8, stride=4, padding=1) self.conv2 = _make_layer(64, 256, num_groups=num_groups, kernel_size=3, stride=2, padding=2) self.conv3 = _make_layer(256, 8, num_groups=num_groups, kernel_size=3, stride=2, normalize=normalize_outputs) def forward(self, x, task_idx: int=(- 1), cache={}): x = self.conv1(x) x = self.conv2(x) x = self.conv3(x) return x
def get_output_sizes(): base_path = '/root/tlkit/tlkit/taskonomy_data/' decoder_paths = [os.path.join(base_path, f'{task}_decoder.dat') for task in LIST_OF_TASKS] decoder_state_dicts = [torch.load(path) for path in decoder_paths] output_sizes = [decoder['state_dict']['decoder_output.0.bias'].numpy().size for decoder in decoder_state_dicts] print(list(zip(LIST_OF_TASKS, output_sizes)))
class HiddenPrints(): def __enter__(self): self._original_stdout = sys.stdout sys.stdout = open(os.devnull, 'w') def __exit__(self, exc_type, exc_val, exc_tb): sys.stdout.close() sys.stdout = self._original_stdout
def update(d, u): for (k, v) in u.items(): if isinstance(v, collections.Mapping): d[k] = update(d.get(k, {}), v) else: d[k] = v return d
def flatten(d, parent_key='', sep='.'): items = [] for (k, v) in d.items(): new_key = (((parent_key + sep) + k) if parent_key else k) if isinstance(v, collections.MutableMapping): items.extend(flatten(v, new_key, sep=sep).items()) else: items.append((new_key, v)) return dict(items)
def var_to_numpy(encoding): encoding = encoding.detach().cpu().numpy() return encoding
def checkpoint_name(checkpoint_dir, epoch='latest'): return os.path.join(checkpoint_dir, 'ckpt-{}.dat'.format(epoch))
def save_checkpoint(obj, directory, step_num): os.makedirs(directory, exist_ok=True) torch.save(obj, checkpoint_name(directory)) subprocess.call('cp {} {} &'.format(checkpoint_name(directory), checkpoint_name(directory, step_num)), shell=True)
def get_parent_dirname(path): return os.path.basename(os.path.dirname(path))
def get_subdir(training_directory, subdir_name): "\n look through all files/directories in training_directory\n return all files/subdirectories whose basename have subdir_name\n if 0, return none\n if 1, return it\n if more, return list of them\n\n e.g. training_directory: '/path/to/exp'\n subdir_name: 'checkpoints' (directory)\n subdir_name: 'rewards' (files)\n " training_directory = training_directory.strip() subdirectories = os.listdir(training_directory) special_subdirs = [] for subdir in subdirectories: if (subdir_name in subdir): special_subdir = os.path.join(training_directory, subdir) special_subdirs.append(special_subdir) if (len(special_subdirs) == 0): return None elif (len(special_subdirs) == 1): return special_subdirs[0] return special_subdirs
def read_pkl(pkl_name): with open(pkl_name, 'rb') as f: data = pickle.load(f) return data
def get_number(name): '\n use regex to get the first integer in the name\n if none exists, return -1\n ' try: num = int(re.findall('[0-9]+', name)[0]) except: num = (- 1) return num
def unused_dir_name(output_dir): "\n Returns a unique (not taken) output_directory name with similar structure to existing one\n Specifically,\n if dir is not taken, return itself\n if dir is taken, return a new name where\n if dir = base + number, then newdir = base + {number+1}\n ow: newdir = base1\n e.g. if output_dir = '/eval/'\n if empty: return '/eval/'\n if '/eval/' exists: return '/eval1/'\n if '/eval/' and '/eval1/' exists, return '/eval2/'\n\n " existing_output_paths = [] if os.path.exists(output_dir): if (os.path.basename(output_dir) == ''): output_dir = os.path.dirname(output_dir) dirname = os.path.dirname(output_dir) base_name_prefix = re.sub('\\d+$', '', os.path.basename(output_dir)) existing_output_paths = get_subdir(dirname, base_name_prefix) assert (existing_output_paths is not None), f'Bug, cannot find output_dir {output_dir}' if (not isinstance(existing_output_paths, list)): existing_output_paths = [existing_output_paths] numbers = [get_number(os.path.basename(path)[(- 5):]) for path in existing_output_paths] eval_num = (max(max(numbers), 0) + 1) output_dir = os.path.join(dirname, f'{base_name_prefix}{eval_num}', '') print('New output dir', output_dir) return (output_dir, existing_output_paths)
def index_to_image(idxs: torch.Tensor, dictionary: np.ndarray, img_size): imgs = [] for inst_top5 in dictionary[idxs]: inst_top5 = [w.split(' ', 1)[1] for w in inst_top5] to_print = ('Top 5 predictions: \n ' + ' '.join([f'''{w} ''' for w in inst_top5])) img = Image.new('RGB', (img_size, img_size), (255, 255, 255)) d = ImageDraw.Draw(img) d.text((20, 5), to_print, fill=(255, 0, 0)) imgs.append(np.array(img)) ret = np.transpose(np.stack(imgs), (0, 3, 1, 2)).astype(np.float32) ret -= 127.5 ret /= 127.5 return torch.Tensor(ret)
def pil_to_np(img): img_arr = np.frombuffer(img.tobytes(), dtype=np.uint8) img_arr = img_arr.reshape((img.size[1], img.size[0], 3)) return img_arr
def np_to_pil(img_arr): return Image.fromarray(img_arr.astype(np.uint8))
def count_open(): tensor_count = {} var_count = {} np_count = {} for obj in gc.get_objects(): try: if isinstance(obj, np.ndarray): if (obj.shape in np_count): np_count[obj.shape] += 1 else: np_count[obj.shape] = 1 if torch.is_tensor(obj): if (obj.size() in tensor_count): tensor_count[obj.size()] += 1 else: tensor_count[obj.size()] = 1 if (hasattr(obj, 'data') and torch.is_tensor(obj.data)): if (obj.size() in tensor_count): var_count[obj.size()] += 1 else: var_count[obj.size()] = 1 except: pass biggest_hitters = sorted(list(tensor_count.items()), key=(lambda x: x[1]))[(- 3):] biggest_hitters = biggest_hitters[::(- 1)] print('Most frequent tensor shape:', biggest_hitters) biggest_hitters = sorted(list(np_count.items()), key=(lambda x: x[1]))[(- 3):] biggest_hitters = biggest_hitters[::(- 1)] print('Most frequent numpy array shape:', biggest_hitters) return biggest_hitters
def process_batch_tuple(batch_tuple, task_idx, cfg): batch_tuple = [x.to(device, non_blocking=True) for x in batch_tuple] if (task_idx is None): sources = cfg['training']['sources'] targets = cfg['training']['targets'] else: sources = cfg['training']['sources'][task_idx] targets = cfg['training']['targets'][task_idx] x = batch_tuple[:len(sources)] if (len(sources) == 1): x = x[0] if cfg['training']['sources_as_dict']: x = dict(zip(sources, x)) if cfg['training']['suppress_target_and_use_annotator']: labels = [cfg['training']['annotator'](x)] else: labels = batch_tuple[len(sources):(len(sources) + len(targets))] if ((isinstance(cfg['training']['use_masks'], list) and cfg['training']['use_masks'][task_idx]) or (isinstance(cfg['training']['use_masks'], bool) and cfg['training']['use_masks'])): masks = batch_tuple[(- 1)] else: masks = None assert (len(targets) == 1), 'Transferring is only supported for one target task' label = labels[0] return (x, label, masks)
def forward_sequential(x, layers, task_idx): if (isinstance(layers, nn.Sequential) or isinstance(layers, list) or isinstance(layers, nn.ModuleList)): for layer in layers: try: x = layer(x, task_idx) except TypeError: x = layer(x) else: try: x = layers(x, task_idx) except TypeError: x = layers(x) return x
def load_state_dict_from_path(model, path): checkpoint = torch.load(path) if ('state_dict' in checkpoint.keys()): if any([('module' in k) for k in checkpoint['state_dict']]): state_dict = {k.replace('module.', ''): v for (k, v) in checkpoint['state_dict'].items()} else: state_dict = checkpoint['state_dict'] try: model.load_state_dict(state_dict, strict=True) except RuntimeError as e: print(f'''{e}, reloaded with strict=False ''') incompatible = model.load_state_dict(state_dict, strict=False) if (incompatible is not None): print(f'''Num matches: {len([k for k in model.state_dict() if (k in state_dict)])} Num missing: {len(incompatible.missing_keys)} Num unexpected: {len(incompatible.unexpected_keys)}''') else: model.load_state_dict(checkpoint) return (model, checkpoint)
class Mock(MagicMock): @classmethod def __getattr__(cls, name): return MagicMock()
def setup(app): app.add_stylesheet('css/pytorch_theme.css')
def get_iterator(mode): ds = MNIST(root='./', download=True, train=mode) data = getattr(ds, ('train_data' if mode else 'test_data')) labels = getattr(ds, ('train_labels' if mode else 'test_labels')) tds = tnt.dataset.TensorDataset([data, labels]) return tds.parallel(batch_size=128, num_workers=4, shuffle=mode)
def conv_init(ni, no, k): return kaiming_normal(torch.Tensor(no, ni, k, k))
def linear_init(ni, no): return kaiming_normal(torch.Tensor(no, ni))
def f(params, inputs, mode): o = inputs.view(inputs.size(0), 1, 28, 28) o = F.conv2d(o, params['conv0.weight'], params['conv0.bias'], stride=2) o = F.relu(o) o = F.conv2d(o, params['conv1.weight'], params['conv1.bias'], stride=2) o = F.relu(o) o = o.view(o.size(0), (- 1)) o = F.linear(o, params['linear2.weight'], params['linear2.bias']) o = F.relu(o) o = F.linear(o, params['linear3.weight'], params['linear3.bias']) return o
def main(): params = {'conv0.weight': conv_init(1, 50, 5), 'conv0.bias': torch.zeros(50), 'conv1.weight': conv_init(50, 50, 5), 'conv1.bias': torch.zeros(50), 'linear2.weight': linear_init(800, 512), 'linear2.bias': torch.zeros(512), 'linear3.weight': linear_init(512, 10), 'linear3.bias': torch.zeros(10)} params = {k: Variable(v, requires_grad=True) for (k, v) in params.items()} optimizer = torch.optim.SGD(params.values(), lr=0.01, momentum=0.9, weight_decay=0.0005) engine = Engine() meter_loss = tnt.meter.AverageValueMeter() classerr = tnt.meter.ClassErrorMeter(accuracy=True) def h(sample): inputs = Variable((sample[0].float() / 255.0)) targets = Variable(torch.LongTensor(sample[1])) o = f(params, inputs, sample[2]) return (F.cross_entropy(o, targets), o) def reset_meters(): classerr.reset() meter_loss.reset() def on_sample(state): state['sample'].append(state['train']) def on_forward(state): classerr.add(state['output'].data, torch.LongTensor(state['sample'][1])) meter_loss.add(state['loss'].data[0]) def on_start_epoch(state): reset_meters() state['iterator'] = tqdm(state['iterator']) def on_end_epoch(state): print(('Training loss: %.4f, accuracy: %.2f%%' % (meter_loss.value()[0], classerr.value()[0]))) reset_meters() engine.test(h, get_iterator(False)) print(('Testing loss: %.4f, accuracy: %.2f%%' % (meter_loss.value()[0], classerr.value()[0]))) engine.hooks['on_sample'] = on_sample engine.hooks['on_forward'] = on_forward engine.hooks['on_start_epoch'] = on_start_epoch engine.hooks['on_end_epoch'] = on_end_epoch engine.train(h, get_iterator(True), maxepoch=10, optimizer=optimizer)
def get_iterator(mode): ds = MNIST(root='./', download=True, train=mode) data = getattr(ds, ('train_data' if mode else 'test_data')) labels = getattr(ds, ('train_labels' if mode else 'test_labels')) tds = tnt.dataset.TensorDataset([data, labels]) return tds.parallel(batch_size=128, num_workers=4, shuffle=mode)
def conv_init(ni, no, k): return kaiming_normal(torch.Tensor(no, ni, k, k))
def linear_init(ni, no): return kaiming_normal(torch.Tensor(no, ni))
def f(params, inputs, mode): o = inputs.view(inputs.size(0), 1, 28, 28) o = F.conv2d(o, params['conv0.weight'], params['conv0.bias'], stride=2) o = F.relu(o) o = F.conv2d(o, params['conv1.weight'], params['conv1.bias'], stride=2) o = F.relu(o) o = o.view(o.size(0), (- 1)) o = F.linear(o, params['linear2.weight'], params['linear2.bias']) o = F.relu(o) o = F.linear(o, params['linear3.weight'], params['linear3.bias']) return o
def main(): params = {'conv0.weight': conv_init(1, 50, 5), 'conv0.bias': torch.zeros(50), 'conv1.weight': conv_init(50, 50, 5), 'conv1.bias': torch.zeros(50), 'linear2.weight': linear_init(800, 512), 'linear2.bias': torch.zeros(512), 'linear3.weight': linear_init(512, 10), 'linear3.bias': torch.zeros(10)} params = {k: Variable(v, requires_grad=True) for (k, v) in params.items()} optimizer = torch.optim.SGD(params.values(), lr=0.01, momentum=0.9, weight_decay=0.0005) engine = Engine() mlog = MeterLogger(server='10.10.30.91', port=9917, nclass=10, title='mnist_meterlogger') def h(sample): inputs = Variable((sample[0].float() / 255.0)) targets = Variable(torch.LongTensor(sample[1])) o = f(params, inputs, sample[2]) return (F.cross_entropy(o, targets), o) def on_sample(state): state['sample'].append(state['train']) def on_forward(state): loss = state['loss'] output = state['output'] target = state['sample'][1] mlog.update_loss(loss, meter='loss') mlog.update_meter(output, target, meters={'accuracy', 'map', 'confusion'}) def on_start_epoch(state): mlog.timer.reset() state['iterator'] = tqdm(state['iterator']) def on_end_epoch(state): mlog.print_meter(mode='Train', iepoch=state['epoch']) mlog.reset_meter(mode='Train', iepoch=state['epoch']) engine.test(h, get_iterator(False)) mlog.print_meter(mode='Test', iepoch=state['epoch']) mlog.reset_meter(mode='Test', iepoch=state['epoch']) engine.hooks['on_sample'] = on_sample engine.hooks['on_forward'] = on_forward engine.hooks['on_start_epoch'] = on_start_epoch engine.hooks['on_end_epoch'] = on_end_epoch engine.train(h, get_iterator(True), maxepoch=10, optimizer=optimizer)
def get_iterator(mode): ds = MNIST(root='./', download=True, train=mode) data = getattr(ds, ('train_data' if mode else 'test_data')) labels = getattr(ds, ('train_labels' if mode else 'test_labels')) tds = tnt.dataset.TensorDataset([data, labels]) return tds.parallel(batch_size=128, num_workers=4, shuffle=mode)
def conv_init(ni, no, k): return kaiming_normal(torch.Tensor(no, ni, k, k))
def linear_init(ni, no): return kaiming_normal(torch.Tensor(no, ni))
def f(params, inputs, mode): o = inputs.view(inputs.size(0), 1, 28, 28) o = F.conv2d(o, params['conv0.weight'], params['conv0.bias'], stride=2) o = F.relu(o) o = F.conv2d(o, params['conv1.weight'], params['conv1.bias'], stride=2) o = F.relu(o) o = o.view(o.size(0), (- 1)) o = F.linear(o, params['linear2.weight'], params['linear2.bias']) o = F.relu(o) o = F.linear(o, params['linear3.weight'], params['linear3.bias']) return o
def main(): params = {'conv0.weight': conv_init(1, 50, 5), 'conv0.bias': torch.zeros(50), 'conv1.weight': conv_init(50, 50, 5), 'conv1.bias': torch.zeros(50), 'linear2.weight': linear_init(800, 512), 'linear2.bias': torch.zeros(512), 'linear3.weight': linear_init(512, 10), 'linear3.bias': torch.zeros(10)} params = {k: Variable(v, requires_grad=True) for (k, v) in params.items()} optimizer = torch.optim.SGD(params.values(), lr=0.01, momentum=0.9, weight_decay=0.0005) engine = Engine() meter_loss = tnt.meter.AverageValueMeter() classerr = tnt.meter.ClassErrorMeter(accuracy=True) confusion_meter = tnt.meter.ConfusionMeter(10, normalized=True) port = 8097 train_loss_logger = VisdomPlotLogger('line', port=port, opts={'title': 'Train Loss'}) train_err_logger = VisdomPlotLogger('line', port=port, opts={'title': 'Train Class Error'}) test_loss_logger = VisdomPlotLogger('line', port=port, opts={'title': 'Test Loss'}) test_err_logger = VisdomPlotLogger('line', port=port, opts={'title': 'Test Class Error'}) confusion_logger = VisdomLogger('heatmap', port=port, opts={'title': 'Confusion matrix', 'columnnames': list(range(10)), 'rownames': list(range(10))}) def h(sample): inputs = Variable((sample[0].float() / 255.0)) targets = Variable(torch.LongTensor(sample[1])) o = f(params, inputs, sample[2]) return (F.cross_entropy(o, targets), o) def reset_meters(): classerr.reset() meter_loss.reset() confusion_meter.reset() def on_sample(state): state['sample'].append(state['train']) def on_forward(state): classerr.add(state['output'].data, torch.LongTensor(state['sample'][1])) confusion_meter.add(state['output'].data, torch.LongTensor(state['sample'][1])) meter_loss.add(state['loss'].data[0]) def on_start_epoch(state): reset_meters() state['iterator'] = tqdm(state['iterator']) def on_end_epoch(state): print(('Training loss: %.4f, accuracy: %.2f%%' % (meter_loss.value()[0], classerr.value()[0]))) train_loss_logger.log(state['epoch'], meter_loss.value()[0]) train_err_logger.log(state['epoch'], classerr.value()[0]) reset_meters() engine.test(h, get_iterator(False)) test_loss_logger.log(state['epoch'], meter_loss.value()[0]) test_err_logger.log(state['epoch'], classerr.value()[0]) confusion_logger.log(confusion_meter.value()) print(('Testing loss: %.4f, accuracy: %.2f%%' % (meter_loss.value()[0], classerr.value()[0]))) engine.hooks['on_sample'] = on_sample engine.hooks['on_forward'] = on_forward engine.hooks['on_start_epoch'] = on_start_epoch engine.hooks['on_end_epoch'] = on_end_epoch engine.train(h, get_iterator(True), maxepoch=10, optimizer=optimizer)
class TestDatasets(unittest.TestCase): def testListDataset(self): h = [0, 1, 2] d = dataset.ListDataset(elem_list=h, load=(lambda x: x)) self.assertEqual(len(d), 3) self.assertEqual(d[0], 0) t = torch.LongTensor([0, 1, 2]) d = dataset.ListDataset(elem_list=t, load=(lambda x: x)) self.assertEqual(len(d), 3) self.assertEqual(d[0], 0) a = np.asarray([0, 1, 2]) d = dataset.ListDataset(elem_list=a, load=(lambda x: x)) self.assertEqual(len(d), 3) self.assertEqual(d[0], 0) def testListDataset_path(self): tbl = [0, 1, 2] d = dataset.ListDataset(tbl, 'bar/{}'.format, 'foo') self.assertEqual(len(d), 3) self.assertEqual(d[2], 'bar/foo/2') def testListDataset_file(self): (_, filename) = tempfile.mkstemp() with open(filename, 'w') as f: for i in range(0, 50): f.write((str(i) + '\n')) d = dataset.ListDataset(filename, (lambda x: x), 'foo') self.assertEqual(len(d), 50) self.assertEqual(d[15], 'foo/15') os.remove(filename) def testTensorDataset(self): data = {'input': np.arange(0, 8), 'target': np.arange(0, 8)} d = dataset.TensorDataset(data) self.assertEqual(len(d), 8) self.assertEqual(d[2], {'input': 2, 'target': 2}) a = torch.randn(8) d = dataset.TensorDataset(a) self.assertEqual(len(a), len(d)) self.assertEqual(a[1], d[1]) d = dataset.TensorDataset([a]) self.assertEqual(len(a), len(d)) self.assertEqual(a[1], d[1][0]) def testBatchDataset(self): if hasattr(torch, 'arange'): t = torch.arange(0, 16).long() else: t = torch.range(0, 15).long() batchsize = 8 d = dataset.ListDataset(t, (lambda x: {'input': x})) d = dataset.BatchDataset(d, batchsize) ex = d[0]['input'] self.assertEqual(len(ex), batchsize) self.assertEqual(ex[(- 1)], (batchsize - 1)) def testResampleDataset(self): tbl = dataset.TensorDataset(np.asarray([0, 1, 2])) d = dataset.ResampleDataset(tbl, (lambda dataset, i: (i % 2))) self.assertEqual(len(d), 3) self.assertEqual(d[0], 0) self.assertEqual(d[2], 0) def testShuffleDataset(self): tbl = dataset.TensorDataset(np.asarray([0, 1, 2, 3, 4])) d = dataset.ShuffleDataset(tbl) self.assertEqual(len(d), 5) def testSplitDataset(self): h = [0, 1, 2, 3] listdataset = dataset.ListDataset(elem_list=h) splitdataset = dataset.SplitDataset(listdataset, {'train': 3, 'val': 1}) splitdataset.select('train') self.assertEqual(len(splitdataset), 3) self.assertEqual(splitdataset[2], 2) splitdataset.select('val') self.assertEqual(len(splitdataset), 1) self.assertEqual(splitdataset[0], 3) splitdataset = listdataset.split({'train': 3, 'val': 1}) splitdataset.select('train') self.assertEqual(len(splitdataset), 3) self.assertEqual(splitdataset[2], 2) def testSplitDataset_fractions(self): h = [0, 1, 2, 3] listdataset = dataset.ListDataset(elem_list=h) splitdataset = dataset.SplitDataset(listdataset, {'train': 0.75, 'val': 0.25}) splitdataset.select('train') self.assertEqual(len(splitdataset), 3) self.assertEqual(splitdataset[2], 2) splitdataset.select('val') self.assertEqual(len(splitdataset), 1) self.assertEqual(splitdataset[0], 3) def testConcatDataset(self): l1 = dataset.ListDataset(elem_list=[0, 1, 2, 3]) l2 = dataset.ListDataset(elem_list=[10, 11, 13]) concatdataset = dataset.ConcatDataset([l1, l2]) self.assertEqual(len(concatdataset), 7) self.assertEqual(concatdataset[0], 0) self.assertEqual(concatdataset[3], 3) self.assertEqual(concatdataset[4], 10) self.assertEqual(concatdataset[6], 13)
class TestMeters(unittest.TestCase): def testAverageValueMeter(self): m = meter.AverageValueMeter() for i in range(1, 10): m.add(i) (mean, std) = m.value() self.assertEqual(mean, 5.0) m.reset() (mean, std) = m.value() self.assertTrue(np.isnan(mean)) def testAverageValueMeter_np_2d(self): m = meter.AverageValueMeter() for i in range(1, 10): m.add(np.float32([[i, (i + 1)]])) (mean, std) = m.value() self.assertTrue(np.allclose(mean, [[5.0, 6.0]])) self.assertTrue(np.allclose(std, [[2.738613, 2.738613]])) m.reset() (mean, std) = m.value() self.assertTrue(np.isnan(mean)) def testAverageValueMeter_torch_2d(self): m = meter.AverageValueMeter() for i in range(1, 10): m.add(torch.Tensor([[i, (i + 1)]])) (mean, std) = m.value() self.assertTrue(np.allclose(mean, [[5.0, 6.0]])) self.assertTrue(np.allclose(std, [[2.738613, 2.738613]])) m.reset() (mean, std) = m.value() self.assertTrue(np.isnan(mean)) def testAverageValueMeter_n(self): 'Test the case of adding more than 1 value.\n ' m = meter.AverageValueMeter() for i in range(1, 11): m.add((i * i), n=i) (mean, std) = m.value() self.assertEqual(mean, 7.0) m.reset() (mean, std) = m.value() self.assertTrue(np.isnan(mean)) def testAverageValueMeter_stable(self): 'Test the case of near-zero variance.\n\n The test compares the results to numpy, and uses\n isclose() to allow for some small differences in\n the results, which are due to slightly different arithmetic\n operations and order.\n ' def isclose(a, b, rel_tol=1e-09, abs_tol=0.0): return (abs((a - b)) <= max((rel_tol * max(abs(a), abs(b))), abs_tol)) m = meter.AverageValueMeter() samples = ([0.7] * 10) truth = np.array([]) for sample in samples: truth = np.append(truth, sample) m.add(sample) (mean, std) = m.value() self.assertTrue(isclose(truth.mean(), mean)) self.assertTrue(((math.isnan(std) and math.isnan(truth.std(ddof=1))) or (math.isinf(std) and math.isnan(truth.std(ddof=1))) or isclose(std, truth.std(ddof=1), abs_tol=1e-07))) def testClassErrorMeter(self): mtr = meter.ClassErrorMeter(topk=[1]) output = torch.eye(3) if hasattr(torch, 'arange'): target = torch.arange(0, 3) else: target = torch.range(0, 2) mtr.add(output, target) err = mtr.value() self.assertEqual(err, [0], 'All should be correct') target[0] = 1 target[1] = 0 target[2] = 0 mtr.add(output, target) err = mtr.value() self.assertEqual(err, [50.0], 'Half should be correct') def testClassErrorMeteri_batch1(self): mtr = meter.ClassErrorMeter(topk=[1]) output = torch.tensor([1, 0, 0]) if hasattr(torch, 'arange'): target = torch.arange(0, 1) else: target = torch.range(0, 0) mtr.add(output, target) err = mtr.value() self.assertEqual(err, [0], 'All should be correct') def testConfusionMeter(self): mtr = meter.ConfusionMeter(k=3) output = torch.Tensor([[0.8, 0.1, 0.1], [10, 11, 10], [0.2, 0.2, 0.3]]) if hasattr(torch, 'arange'): target = torch.arange(0, 3) else: target = torch.range(0, 2) mtr.add(output, target) conf_mtrx = mtr.value() self.assertEqual(conf_mtrx.sum(), 3, 'All should be correct') self.assertEqual(conf_mtrx.diagonal().sum(), 3, 'All should be correct') target = torch.Tensor([1, 0, 0]) mtr.add(output, target) self.assertEqual(conf_mtrx.sum(), 6, 'Six tests should give six values') self.assertEqual(conf_mtrx.diagonal().sum(), 3, "Shouldn't have changed since all new values were false") self.assertEqual(conf_mtrx[0].sum(), 3, 'All top have gotten one guess') self.assertEqual(conf_mtrx[1].sum(), 2, 'Two first at the 2nd row have a guess') self.assertEqual(conf_mtrx[1][2], 0, 'The last one should be empty') self.assertEqual(conf_mtrx[2].sum(), 1, 'Bottom row has only the first test correct') self.assertEqual(conf_mtrx[2][2], 1, 'Bottom row has only the first test correct') mtr = meter.ConfusionMeter(k=4, normalized=True) output = torch.Tensor([[0.8, 0.1, 0.1, 0], [10, 11, 10, 0], [0.2, 0.2, 0.3, 0], [0, 0, 0, 1]]) target = torch.Tensor([0, 1, 2, 3]) mtr.add(output, target) conf_mtrx = mtr.value() self.assertEqual(conf_mtrx.sum(), output.size(1), 'All should be correct') self.assertEqual(conf_mtrx.diagonal().sum(), output.size(1), 'All should be correct') target[0] = 1 target[1] = 0 target[2] = 0 mtr.add(output, target) conf_mtrx = mtr.value() self.assertEqual(conf_mtrx.sum(), output.size(1), 'The normalization should sum all values to 1') for (i, row) in enumerate(conf_mtrx): self.assertEqual(row.sum(), 1, (('Row no ' + str(i)) + ' fails to sum to one in normalized mode')) def testMSEMeter(self): a = torch.ones(7) b = torch.zeros(7) mtr = meter.MSEMeter() mtr.add(a, b) self.assertEqual(1.0, mtr.value()) def testMovingAverageValueMeter(self): mtr = meter.MovingAverageValueMeter(3) mtr.add(1) (avg, var) = mtr.value() self.assertEqual(avg, 1.0) self.assertEqual(var, 0.0) mtr.add(3) (avg, var) = mtr.value() self.assertEqual(avg, 2.0) self.assertEqual(var, math.sqrt(2)) mtr.add(5) (avg, var) = mtr.value() self.assertEqual(avg, 3.0) self.assertEqual(var, 2.0) mtr.add(4) (avg, var) = mtr.value() self.assertEqual(avg, 4.0) self.assertEqual(var, 1.0) mtr.add(0) (avg, var) = mtr.value() self.assertEqual(avg, 3.0) self.assertEqual(var, math.sqrt(7)) def testAUCMeter(self): mtr = meter.AUCMeter() test_size = 1000 mtr.add(torch.rand(test_size), torch.zeros(test_size)) mtr.add(torch.rand(test_size), torch.Tensor(test_size).fill_(1)) (val, tpr, fpr) = mtr.value() self.assertTrue((math.fabs((val - 0.5)) < 0.1), msg='AUC Meter fails') mtr.reset() mtr.add(torch.Tensor(test_size).fill_(0), torch.zeros(test_size)) mtr.add(torch.Tensor(test_size).fill_(0.1), torch.zeros(test_size)) mtr.add(torch.Tensor(test_size).fill_(0.2), torch.zeros(test_size)) mtr.add(torch.Tensor(test_size).fill_(0.3), torch.zeros(test_size)) mtr.add(torch.Tensor(test_size).fill_(0.4), torch.zeros(test_size)) mtr.add(torch.Tensor(test_size).fill_(1), torch.Tensor(test_size).fill_(1)) (val, tpr, fpr) = mtr.value() self.assertEqual(val, 1.0, msg='AUC Meter fails') def testAPMeter(self): mtr = meter.APMeter() target = torch.Tensor([0, 1, 0, 1]) output = torch.Tensor([0.1, 0.2, 0.3, 4]) weight = torch.Tensor([0.5, 1.0, 2.0, 0.1]) mtr.add(output, target, weight) ap = mtr.value() val = ((((((1 * 0.1) / 0.1) + ((0 * 2.0) / 2.1)) + ((1.1 * 1) / 3.1)) + ((0 * 1) / 4)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test1 failed') mtr.reset() mtr.add(output, target) ap = mtr.value() val = ((((((1 * 1.0) / 1.0) + ((0 * 1.0) / 2.0)) + ((2 * 1.0) / 3.0)) + ((0 * 1.0) / 4.0)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test2 failed') target = torch.Tensor([0, 1, 0, 1]) output = torch.Tensor([4, 3, 2, 1]) weight = torch.Tensor([1, 2, 3, 4]) mtr.reset() mtr.add(output, target, weight) ap = mtr.value() val = ((((((0 * 1.0) / 1.0) + ((1.0 * 2.0) / 3.0)) + ((2.0 * 0) / 6.0)) + ((6.0 * 1.0) / 10.0)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test3 failed') mtr.reset() mtr.add(output, target) ap = mtr.value() val = (((((0 * 1.0) + ((1 * 1.0) / 2.0)) + ((0 * 1.0) / 3.0)) + ((2 * 1.0) / 4.0)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test4 failed') target = torch.Tensor([0, 1, 0, 1]) output = torch.Tensor([1, 4, 2, 3]) weight = torch.Tensor([1, 2, 3, 4]) mtr.reset() mtr.add(output, target, weight) ap = mtr.value() val = ((((((4 * 1.0) / 4.0) + ((6 * 1.0) / 6.0)) + ((0 * 6.0) / 9.0)) + ((0 * 6.0) / 10.0)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test5 failed') mtr.reset() mtr.add(output, target) ap = mtr.value() val = (((((1 * 1.0) + ((2 * 1.0) / 2.0)) + ((0 * 1.0) / 3.0)) + ((0 * 1.0) / 4.0)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test6 failed') target = torch.Tensor([0, 0, 0, 0]) output = torch.Tensor([1, 4, 2, 3]) weight = torch.Tensor([1.0, 0.1, 0.0, 0.5]) mtr.reset() mtr.add(output, target, weight) ap = mtr.value() self.assertEqual(ap[0], 0.0) mtr.reset() mtr.add(output, target) ap = mtr.value() self.assertEqual(ap[0], 0.0) target = torch.Tensor([1, 1, 0]) output = torch.Tensor([3, 1, 2]) weight = torch.Tensor([1, 0.1, 3]) mtr.reset() mtr.add(output, target, weight) ap = mtr.value() val = (((((1 * 1.0) / 1.0) + ((1 * 0.0) / 4.0)) + (1.1 / 4.1)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test7 failed') mtr.reset() mtr.add(output, target) ap = mtr.value() val = ((((1 * 1.0) + ((0 * 1.0) / 2.0)) + ((2 * 1.0) / 3.0)) / 2.0) self.assertTrue((math.fabs((ap[0] - val)) < 0.01), msg='ap test8 failed') target = torch.Tensor([[0, 1, 0, 1], [0, 1, 0, 1]]).transpose(0, 1) output = torch.Tensor([[0.1, 0.2, 0.3, 4], [4, 3, 2, 1]]).transpose(0, 1) weight = torch.Tensor([[1.0, 0.5, 2.0, 3.0]]).transpose(0, 1) mtr.reset() mtr.add(output, target, weight) ap = mtr.value() self.assertTrue((math.fabs((ap.sum() - torch.Tensor([((((((1 * 3.0) / 3.0) + ((0 * 3.0) / 5.0)) + ((3.5 * 1) / 5.5)) + ((0 * 3.5) / 6.5)) / 2.0), ((((((0 * 1.0) / 1.0) + ((1 * 0.5) / 1.5)) + ((0 * 0.5) / 3.5)) + ((1 * 3.5) / 6.5)) / 2.0)]).sum())) < 0.01), msg='ap test9 failed') mtr.reset() mtr.add(output, target) ap = mtr.value() self.assertTrue((math.fabs((ap.sum() - torch.Tensor([(((((1 * 1.0) + ((0 * 1.0) / 2.0)) + ((2 * 1.0) / 3)) + ((0 * 1.0) / 4.0)) / 2.0), (((((0 * 1.0) + ((1 * 1.0) / 2.0)) + ((0 * 1.0) / 3.0)) + ((2.0 * 1.0) / 4.0)) / 2.0)]).sum())) < 0.01), msg='ap test10 failed') mtr.reset() output = torch.Tensor(5, 4).fill_(0.25) target = torch.ones(5, 4) mtr.add(output, target) output = torch.Tensor(1, 4).fill_(0.25) target = torch.ones(1, 4) mtr.add(output, target) self.assertEqual(mtr.value().size(0), 4, msg='ap test11 failed') def testmAPMeter(self): mtr = meter.mAPMeter() target = torch.Tensor([0, 1, 0, 1]) output = torch.Tensor([0.1, 0.2, 0.3, 4]) weight = torch.Tensor([0.5, 1.0, 2.0, 0.1]) mtr.add(output, target) ap = mtr.value() val = ((((((1 * 1.0) / 1.0) + ((0 * 1.0) / 2.0)) + ((2.0 * 1.0) / 3.0)) + ((0 * 1.0) / 4.0)) / 2.0) self.assertTrue((math.fabs((ap - val)) < 0.01), msg='mAP test1 failed') mtr.reset() mtr.add(output, target, weight) ap = mtr.value() val = ((((((1 * 0.1) / 0.1) + ((0 * 2.0) / 2.1)) + ((1.1 * 1) / 3.1)) + ((0 * 1.0) / 4.0)) / 2.0) self.assertTrue((math.fabs((ap - val)) < 0.01), msg='mAP test2 failed') target = torch.Tensor([[0, 1, 0, 1], [0, 1, 0, 1]]).transpose(0, 1) output = torch.Tensor([[0.1, 0.2, 0.3, 4], [4, 3, 2, 1]]).transpose(0, 1) weight = torch.Tensor([[1.0, 0.5, 2.0, 3.0]]).transpose(0, 1) mtr.reset() mtr.add(output, target, weight) ap = mtr.value() self.assertTrue((math.fabs((ap - torch.Tensor([((((((1 * 3.0) / 3.0) + ((0 * 3.0) / 5.0)) + ((3.5 * 1) / 5.5)) + ((0 * 3.5) / 6.5)) / 2.0), ((((((0 * 1.0) / 1.0) + ((1 * 0.5) / 1.5)) + ((0 * 0.5) / 3.5)) + ((1 * 3.5) / 6.5)) / 2.0)]).mean())) < 0.01), msg='mAP test3 failed') mtr.reset() mtr.add(output, target) ap = mtr.value() self.assertTrue((math.fabs((ap - torch.Tensor([(((((1 * 1.0) + ((0 * 1.0) / 2.0)) + ((2 * 1.0) / 3.0)) + ((0 * 1.0) / 4.0)) / 2.0), (((((0 * 1.0) + ((1 * 1.0) / 2.0)) + ((0 * 1.0) / 3.0)) + ((2 * 1.0) / 4.0)) / 2.0)]).mean())) < 0.01), msg='mAP test4 failed')
class TestTransforms(unittest.TestCase): def testCompose(self): self.assertEqual(transform.compose([(lambda x: (x + 1)), (lambda x: (x + 2)), (lambda x: (x / 2))])(1), 2) def testTableMergeKeys(self): x = {'sample1': {'input': 1, 'target': 'a'}, 'sample2': {'input': 2, 'target': 'b', 'flag': 'hard'}} y = transform.tablemergekeys()(x) self.assertEqual(y['input'], {'sample1': 1, 'sample2': 2}) self.assertEqual(y['target'], {'sample1': 'a', 'sample2': 'b'}) self.assertEqual(y['flag'], {'sample2': 'hard'}) def testTableApply(self): x = {1: 1, 2: 2} y = transform.tableapply((lambda x: (x + 1)))(x) self.assertEqual(y, {1: 2, 2: 3}) def testMakeBatch(self): x = [{'input': torch.randn(4), 'target': 'a'}, {'input': torch.randn(4), 'target': 'b'}] y = transform.makebatch()(x) self.assertEqual(y['input'].size(), torch.Size([2, 4])) self.assertEqual(y['target'], ['a', 'b'])
class BatchDataset(Dataset): '\n Dataset which batches the data from a given dataset.\n\n Given a `dataset`, `BatchDataset` merges samples from this dataset to\n form a new sample which can be interpreted as a batch of size `batchsize`.\n\n The `merge` function controls how the batching is performed. By default\n the occurrences are supposed to be tensors, and they aggregated along the\n first dimension.\n\n It is often important to shuffle examples while performing the batch\n operation. `perm(idx, size)` is a function which returns the shuffled index\n of the sample at position `idx` in the underlying dataset. For convenience,\n the `size` of the underlying dataset is also passed to the function. By\n default, the function is the identity.\n\n The underlying dataset size might or might not be always divisible by\n `batchsize`. The optional `policy` string specify how to handle corner\n cases.\n\n Purpose: the concept of batch is problem dependent. In *torchnet*, it is up\n to the user to interpret a sample as a batch or not. When one wants to\n assemble samples from an existing dataset into a batch, then\n `BatchDataset` is suited for the job. Sometimes it is however more\n convenient to write a dataset from scratch providing "batched" samples.\n\n Args:\n dataset (Dataset): Dataset to be batched.\n batchsize (int): Size of the batch.\n perm (function, optional): Function used to shuffle the dataset before\n batching. `perm(idx, size)` should return the shuffled index of\n `idx` th sample. By default, the function is the identity.\n merge (function, optional): Function to control batching behaviour.\n `transform.makebatch(merge)` is used to make the batch. Default is\n None.\n policy (str, optional): Policy to handle the corner cases when the\n underlying dataset size is not divisible by `batchsize`. One of\n (`include-last`, `skip-last`, `divisible-only`).\n\n - `include-last` makes sure all samples of the underlying dataset\n will be seen, batches will be of size equal or inferior to\n `batchsize`.\n - `skip-last` will skip last examples of the underlying dataset if\n its size is not properly divisible. Batches will be always of\n size equal to `batchsize`.\n - `divisible-only` will raise an error if the underlying dataset\n has not a size divisible by `batchsize`.\n filter (function, optional): Function to filter the sample before\n batching. If `filter(sample)` is True, then sample is included for\n batching. Otherwise, it is excluded. By default, `filter(sample)`\n returns True for any `sample`.\n\n ' def __init__(self, dataset, batchsize, perm=(lambda idx, size: idx), merge=None, policy='include-last', filter=(lambda sample: True)): super(BatchDataset, self).__init__() self.dataset = dataset self.perm = perm self.batchsize = batchsize self.policy = policy self.filter = filter self.makebatch = transform.makebatch(merge) len(self) def __len__(self): if (self.policy == 'include-last'): return int(math.ceil(float((len(self.dataset) / self.batchsize)))) elif (self.policy == 'skip-last'): return int(math.floor(float((len(self.dataset) / self.batchsize)))) elif (self.policy == 'divisible-only'): assert ((len(self.dataset) % self.batchsize) == 0), 'dataset size is not divisible by batch size' return (len(self.dataset) / self.batchsize) else: assert False, 'invalid policy (include-last | skip-last | divisible-only expected)' def __getitem__(self, idx): super(BatchDataset, self).__getitem__(idx) maxidx = len(self.dataset) samples = [] for i in range(0, self.batchsize): j = ((idx * self.batchsize) + i) if (j >= maxidx): break j = self.perm(j, maxidx) sample = self.dataset[j] if self.filter(sample): samples.append(sample) samples = self.makebatch(samples) return samples
class ConcatDataset(Dataset): '\n Dataset to concatenate multiple datasets.\n\n Purpose: useful to assemble different existing datasets, possibly\n large-scale datasets as the concatenation operation is done in an\n on-the-fly manner.\n\n Args:\n datasets (iterable): List of datasets to be concatenated\n ' def __init__(self, datasets): super(ConcatDataset, self).__init__() self.datasets = list(datasets) assert (len(datasets) > 0), 'datasets should not be an empty iterable' self.cum_sizes = np.cumsum([len(x) for x in self.datasets]) def __len__(self): return self.cum_sizes[(- 1)] def __getitem__(self, idx): super(ConcatDataset, self).__getitem__(idx) dataset_index = self.cum_sizes.searchsorted(idx, 'right') if (dataset_index == 0): dataset_idx = idx else: dataset_idx = (idx - self.cum_sizes[(dataset_index - 1)]) return self.datasets[dataset_index][dataset_idx]
class Dataset(object): def __init__(self): pass def __len__(self): pass def __getitem__(self, idx): if (idx >= len(self)): raise IndexError('CustomRange index out of range') pass def batch(self, *args, **kwargs): return torchnet.dataset.BatchDataset(self, *args, **kwargs) def transform(self, *args, **kwargs): return torchnet.dataset.TransformDataset(self, *args, **kwargs) def shuffle(self, *args, **kwargs): return torchnet.dataset.ShuffleDataset(self, *args, **kwargs) def parallel(self, *args, **kwargs): return DataLoader(self, *args, **kwargs) def split(self, *args, **kwargs): return torchnet.dataset.SplitDataset(self, *args, **kwargs)
class ListDataset(Dataset): '\n Dataset which loads data from a list using given function.\n\n Considering a `elem_list` (can be an iterable or a `string` ) i-th sample\n of a dataset will be returned by `load(elem_list[i])`, where `load()`\n is a function provided by the user.\n\n If `path` is provided, `elem_list` is assumed to be a list of strings, and\n each element `elem_list[i]` will prefixed by `path/` when fed to `load()`.\n\n Purpose: many low or medium-scale datasets can be seen as a list of files\n (for example representing input samples). For this list of file, a target\n can be often inferred in a simple manner.\n\n Args:\n elem_list (iterable/str): List of arguments which will be passed to\n `load` function. It can also be a path to file with each line\n containing the arguments to `load`\n load (function, optional): Function which loads the data.\n i-th sample is returned by `load(elem_list[i])`. By default `load`\n is identity i.e, `lambda x: x`\n path (str, optional): Defaults to None. If a string is provided,\n `elem_list` is assumed to be a list of strings, and each element\n `elem_list[i]` will prefixed by this string when fed to `load()`.\n\n ' def __init__(self, elem_list, load=(lambda x: x), path=None): super(ListDataset, self).__init__() if isinstance(elem_list, str): with open(elem_list) as f: self.list = [line.replace('\n', '') for line in f] else: self.list = elem_list self.path = path self.load = load def __len__(self): return len(self.list) def __getitem__(self, idx): super(ListDataset, self).__getitem__(idx) if (self.path is not None): return self.load(('%s/%s' % (self.path, self.list[idx]))) else: return self.load(self.list[idx])
class ResampleDataset(Dataset): '\n Dataset which resamples a given dataset.\n\n Given a `dataset`, creates a new dataset which will (re-)sample from this\n underlying dataset using the provided `sampler(dataset, idx)` function.\n\n If `size` is provided, then the newly created dataset will have the\n specified `size`, which might be different than the underlying dataset\n size. If `size` is not provided, then the new dataset will have the same\n size as the underlying one.\n\n Purpose: shuffling data, re-weighting samples, getting a subset of the\n data. Note that an important sub-class `ShuffleDataset` is provided for\n convenience.\n\n Args:\n dataset (Dataset): Dataset to be resampled.\n sampler (function, optional): Function used for sampling. `idx`th\n sample is returned by `dataset[sampler(dataset, idx)]`. By default\n `sampler(dataset, idx)` is the identity, simply returning `idx`.\n `sampler(dataset, idx)` must return an index in the range\n acceptable for the underlying `dataset`.\n size (int, optional): Desired size of the dataset after resampling. By\n default, the new dataset will have the same size as the underlying\n one.\n\n ' def __init__(self, dataset, sampler=(lambda ds, idx: idx), size=None): super(ResampleDataset, self).__init__() self.dataset = dataset self.sampler = sampler self.size = size def __len__(self): return (((self.size and (self.size > 0)) and self.size) or len(self.dataset)) def __getitem__(self, idx): super(ResampleDataset, self).__getitem__(idx) idx = self.sampler(self.dataset, idx) if ((idx < 0) or (idx >= len(self.dataset))): raise IndexError('out of range') return self.dataset[idx]
class ShuffleDataset(ResampleDataset): '\n Dataset which shuffles a given dataset.\n\n `ShuffleDataset` is a sub-class of `ResampleDataset` provided for\n convenience. It samples uniformly from the given `dataset` with, or without\n `replacement`. The chosen partition can be redrawn by calling `resample()`\n\n If `replacement` is `true`, then the specified `size` may be larger than\n the underlying `dataset`.\n If `size` is not provided, then the new dataset size will be equal to the\n underlying `dataset` size.\n\n Purpose: the easiest way to shuffle a dataset!\n\n Args:\n dataset (Dataset): Dataset to be shuffled.\n size (int, optional): Desired size of the shuffled dataset. If\n `replacement` is `true`, then can be larger than the `len(dataset)`.\n By default, the new dataset will have the same size as `dataset`.\n replacement (bool, optional): True if uniform sampling is to be done\n with replacement. False otherwise. Defaults to false.\n\n Raises:\n ValueError: If `size` is larger than the size of the underlying dataset\n and `replacement` is False.\n ' def __init__(self, dataset, size=None, replacement=False): if (size and (not replacement) and (size > len(dataset))): raise ValueError('size cannot be larger than underlying dataset size when sampling without replacement') super(ShuffleDataset, self).__init__(dataset, (lambda dataset, idx: self.perm[idx]), size) self.replacement = replacement self.resample() def resample(self, seed=None): 'Resample the dataset.\n\n Args:\n seed (int, optional): Seed for resampling. By default no seed is\n used.\n ' if (seed is not None): gen = torch.manual_seed(seed) else: gen = torch.default_generator if self.replacement: self.perm = torch.LongTensor(len(self)).random_(len(self.dataset), generator=gen) else: self.perm = torch.randperm(len(self.dataset), generator=gen).narrow(0, 0, len(self))
class SplitDataset(Dataset): '\n Dataset to partition a given dataset.\n\n Partition a given `dataset`, according to the specified `partitions`. Use\n the method `select()` to select the current partition in use.\n\n The `partitions` is a dictionary where a key is a user-chosen string\n naming the partition, and value is a number representing the weight (as a\n number between 0 and 1) or the size (in number of samples) of the\n corresponding partition.\n\n Partioning is achieved linearly (no shuffling). See `ShuffleDataset` if you\n want to shuffle the dataset before partitioning.\n\n Args:\n dataset (Dataset): Dataset to be split.\n partitions (dict): Dictionary where key is a user-chosen string\n naming the partition, and value is a number representing the weight\n (as a number between 0 and 1) or the size (in number of samples)\n of the corresponding partition.\n initial_partition (str, optional): Initial parition to be selected.\n\n ' def __init__(self, dataset, partitions, initial_partition=None): super(SplitDataset, self).__init__() self.dataset = dataset self.partitions = partitions assert isinstance(partitions, dict), 'partitions must be a dict' assert (len(partitions) >= 2), 'SplitDataset should have at least two partitions' assert (min(partitions.values()) >= 0), 'partition sizes cannot be negative' assert (max(partitions.values()) > 0), 'all partitions cannot be empty' self.partition_names = sorted(list(self.partitions.keys())) self.partition_index = {partition: i for (i, partition) in enumerate(self.partition_names)} self.partition_sizes = [self.partitions[parition] for parition in self.partition_names] if (sum(self.partition_sizes) <= 1): self.partition_sizes = [round((x * len(dataset))) for x in self.partition_sizes] else: for x in self.partition_sizes: assert (x == int(x)), 'partition sizes should be integer numbers, or sum up to <= 1 ' self.partition_cum_sizes = np.cumsum(self.partition_sizes) if (initial_partition is not None): self.select(initial_partition) def select(self, partition): '\n Select the parition.\n\n Args:\n partition (str): Partition to be selected.\n ' self.current_partition_idx = self.partition_index[partition] def __len__(self): try: return self.partition_sizes[self.current_partition_idx] except AttributeError: raise ValueError('Select a partition before accessing data.') def __getitem__(self, idx): super(SplitDataset, self).__getitem__(idx) try: if (self.current_partition_idx == 0): return self.dataset[idx] else: offset = self.partition_cum_sizes[(self.current_partition_idx - 1)] return self.dataset[(int(offset) + idx)] except AttributeError: raise ValueError('Select a partition before accessing data.')
class TensorDataset(Dataset): '\n Dataset from a tensor or array or list or dict.\n\n `TensorDataset` provides a way to create a dataset out of the data that is\n already loaded into memory. It accepts data in the following forms:\n\n tensor or numpy array\n `idx`th sample is `data[idx]`\n\n dict of tensors or numpy arrays\n `idx`th sample is `{k: v[idx] for k, v in data.items()}`\n\n list of tensors or numpy arrays\n `idx`th sample is `[v[idx] for v in data]`\n\n Purpose: Easy way to create a dataset out of standard data structures.\n\n Args:\n data (dict/list/tensor/ndarray): Data for the dataset.\n ' def __init__(self, data): super(TensorDataset, self).__init__() if isinstance(data, dict): assert (len(data) > 0), 'Should have at least one element' n_elem = len(list(data.values())[0]) for v in data.values(): assert (len(v) == n_elem), 'All values must have the same size' elif isinstance(data, list): assert (len(data) > 0), 'Should have at least one element' n_elem = len(data[0]) for v in data: assert (len(v) == n_elem), 'All elements must have the same size' self.data = data def __len__(self): if isinstance(self.data, dict): return len(list(self.data.values())[0]) elif isinstance(self.data, list): return len(self.data[0]) elif (torch.is_tensor(self.data) or isinstance(self.data, np.ndarray)): return len(self.data) def __getitem__(self, idx): super(TensorDataset, self).__getitem__(idx) if isinstance(self.data, dict): return {k: v[idx] for (k, v) in self.data.items()} elif isinstance(self.data, list): return [v[idx] for v in self.data] elif (torch.is_tensor(self.data) or isinstance(self.data, np.ndarray)): return self.data[idx]
class TransformDataset(Dataset): '\n Dataset which transforms a given dataset with a given function.\n\n Given a function `transform`, and a `dataset`, `TransformDataset` applies\n the function in an on-the-fly manner when querying a sample with\n `__getitem__(idx)` and therefore returning `transform[dataset[idx]]`.\n\n `transform` can also be a dict with functions as values. In this case, it\n is assumed that `dataset[idx]` is a dict which has all the keys in\n `transform`. Then, `transform[key]` is applied to dataset[idx][key] for\n each key in `transform`\n\n The size of the new dataset is equal to the size of the underlying\n `dataset`.\n\n Purpose: when performing pre-processing operations, it is convenient to be\n able to perform on-the-fly transformations to a dataset.\n\n Args:\n dataset (Dataset): Dataset which has to be transformed.\n transforms (function/dict): Function or dict with function as values.\n These functions will be applied to data.\n ' def __init__(self, dataset, transforms): super(TransformDataset, self).__init__() assert (isinstance(transforms, dict) or callable(transforms)), 'expected a dict of transforms or a function' if isinstance(transforms, dict): for (k, v) in transforms.items(): assert callable(v), (str(k) + ' is not a function') self.dataset = dataset self.transforms = transforms def __len__(self): return len(self.dataset) def __getitem__(self, idx): super(TransformDataset, self).__getitem__(idx) z = self.dataset[idx] if isinstance(self.transforms, dict): for (k, transform) in self.transforms.items(): z[k] = transform(z[k]) else: z = self.transforms(z) return z
class Engine(object): def __init__(self): self.hooks = {} def hook(self, name, state): 'Registers a backward hook.\n\n The hook will be called every time a gradient with respect to the\n Tensor is computed. The hook should have the following signature::\n\n hook (grad) -> Tensor or None\n\n The hook should not modify its argument, but it can optionally return\n a new gradient which will be used in place of :attr:`grad`.\n This function returns a handle with a method ``handle.remove()``\n that removes the hook from the module.\n\n Example:\n >>> v = torch.tensor([0., 0., 0.], requires_grad=True)\n >>> h = v.register_hook(lambda grad: grad * 2) # double the gradient\n >>> v.backward(torch.tensor([1., 2., 3.]))\n >>> v.grad\n 2\n 4\n 6\n [torch.FloatTensor of size (3,)]\n >>> h.remove() # removes the hook\n\n ' if (name in self.hooks): self.hooks[name](state) def train(self, network, iterator, maxepoch, optimizer): state = {'network': network, 'iterator': iterator, 'maxepoch': maxepoch, 'optimizer': optimizer, 'epoch': 0, 't': 0, 'train': True} self.hook('on_start', state) while (state['epoch'] < state['maxepoch']): self.hook('on_start_epoch', state) for sample in state['iterator']: state['sample'] = sample self.hook('on_sample', state) def closure(): (loss, output) = state['network'](state['sample']) state['output'] = output state['loss'] = loss loss.backward() self.hook('on_forward', state) state['output'] = None state['loss'] = None return loss state['optimizer'].zero_grad() state['optimizer'].step(closure) self.hook('on_update', state) state['t'] += 1 state['epoch'] += 1 self.hook('on_end_epoch', state) self.hook('on_end', state) return state def test(self, network, iterator): state = {'network': network, 'iterator': iterator, 't': 0, 'train': False} self.hook('on_start', state) for sample in state['iterator']: state['sample'] = sample self.hook('on_sample', state) def closure(): (loss, output) = state['network'](state['sample']) state['output'] = output state['loss'] = loss self.hook('on_forward', state) state['output'] = None state['loss'] = None closure() state['t'] += 1 self.hook('on_end', state) return state
class FileLogger(object): "Logs results to a file.\n\n The FileLogger provides a convenient interface for periodically writing\n results to a file. It is designed to capture all information for a given\n experiment, which may have a sequence of distinct tasks. Therefore, it writes\n results in the format::\n\n {\n 'tasks': [...]\n 'results': [...]\n }\n\n The FileLogger class chooses to use a top-level list instead of a dictionary\n to preserve temporal order of tasks (by default).\n\n Args:\n filepath (str): Path to write results to\n overwrite (bool): whether to clobber a file if it exists\n\n Example:\n >>> result_writer = ResultWriter(path)\n >>> for task in ['CIFAR-10', 'SVHN']:\n >>> train_results = train_model()\n >>> test_results = test_model()\n >>> result_writer.log(task, {'Train': train_results, 'Test': test_results})\n\n " def __init__(self, filepath, overwrite=False): if (not overwrite): assert (not os.path.exists(filepath)), 'Cannot write results to "{}". Already exists!'.format(filepath) with open(filepath, 'wb') as f: pickle.dump({'tasks': [], 'results': []}, f) self.filepath = filepath self.tasks = set() def _add_task(self, task_name): assert (task_name not in self.tasks), 'Task already added! Use a different name.' self.tasks.add(task_name) def log(self, task_name, result): ' Update the results file with new information.\n\n Args:\n task_name (str): Name of the currently running task. A previously unseen\n ``task_name`` will create a new entry in both :attr:`tasks`\n and :attr:`results`.\n result: This will be appended to the list in :attr:`results` which\n corresponds to the ``task_name`` in ``task_name``:attr:`tasks`.\n\n ' with open(self.filepath, 'rb') as f: existing_results = pickle.load(f) if (task_name not in self.tasks): self._add_task(task_name) existing_results['tasks'].append(task_name) existing_results['results'].append([]) task_name_idx = existing_results['tasks'].index(task_name) results = existing_results['results'][task_name_idx] results.append(result) with open(self.filepath, 'wb') as f: pickle.dump(existing_results, f)
class Logger(object): _fields = None @property def fields(self): assert (self._fields is not None), 'self.fields is not set!' return self._fields @fields.setter def fields(self, value): self._fields def __init__(self, fields=None): " Automatically logs the variables in 'fields' " self.fields = fields def log(self, *args, **kwargs): pass def log_state(self, state_dict): pass
class MeterLogger(object): ' A class to package and print meters. ' def __init__(self, modes=('train', 'val')): self.modes = list(modes) self.meter = {} self.logger = {} for mode in modes: self.meter[mode] = {} self.logger[mode] = {} self.timer = Meter.TimeMeter(None) self.metername_to_ptype = {} def _ver2tensor(self, target): target_mat = torch.zeros(target.shape[0], self.nclass) for (i, j) in enumerate(target): target_mat[i][j] = 1 return target_mat def _to_tensor(self, var): if isinstance(var, torch.autograd.Variable): var = var.data if (not torch.is_tensor(var)): if isinstance(var, np.ndarray): var = torch.from_numpy(var) else: var = torch.Tensor([var]) return var def add_meter(self, meter_name, meter): for mode in self.modes: self.meter[mode][meter_name] = copy.deepcopy(meter) def update_meter(self, output, target=None, meters={'METER_NAME_HERE'}, phase='train'): for meter_name in meters: assert (meter_name in self.meter[phase].keys()), 'Unrecognized meter name {}'.format(meter_name) meter = self.meter[phase][meter_name] if (not isinstance(meter, Meter.SingletonMeter)): output = self._to_tensor(output) if (target is not None): target = self._to_tensor(target) if (isinstance(meter, Meter.APMeter) or isinstance(meter, Meter.mAPMeter) or isinstance(meter, Meter.ConfusionMeter)): assert (target is not None), "Meter '{}' of type {} requires 'target' is not None".format(meter_name, type(meter)) target_th = self._ver2tensor(target) meter.add(output, target_th) elif (target is not None): meter.add(output, target) else: meter.add(output) def peek_meter(self, phase='train'): 'Returns a dict of all meters and their values.' result = {} for key in self.meter[phase].keys(): val = self.meter[phase][key].value() val = (val[0] if isinstance(val, (list, tuple)) else val) result[key] = val return result def reset_meter(self, meterlist=None, phase='train'): self.timer.reset() if (meterlist is None): meterlist = self.meter[phase].keys() for meter_name in meterlist: assert (meter_name in self.meter[phase].keys()), 'Unrecognized meter name {}'.format(meter_name) self.meter[phase][meter_name].reset() def print_meter(self, mode, iepoch, ibatch=1, totalbatch=1, meterlist=None): assert (mode in self.modes), f'{mode} is not any phase' pstr = '%s:\t[%d][%d/%d] \t' tval = [] tval.extend([mode, iepoch, ibatch, totalbatch]) if (meterlist is None): meterlist = self.meter[mode].keys() for meter_name in meterlist: assert (meter_name in self.meter[mode].keys()), 'Unrecognized meter name {}'.format(meter_name) meter = self.meter[mode][meter_name] if isinstance(meter, Meter.ConfusionMeter): continue if isinstance(meter, Meter.ClassErrorMeter): pstr += (('Acc@1 %.2f%% \t Acc@' + str(self.topk)) + ' %.2f%% \t') tval.extend([self.meter[mode][meter_name].value()[0], self.meter[mode][meter_name].value()[1]]) elif isinstance(meter, Meter.mAPMeter): pstr += 'mAP %.3f \t' tval.extend([self.meter[mode][meter_name].value()]) elif isinstance(meter, Meter.AUCMeter): pstr += 'AUC %.3f \t' tval.extend([self.meter[mode][meter_name].value()]) elif (isinstance(meter, Meter.ValueSummaryMeter) or isinstance(meter, Meter.MSEMeter)): pstr += '{}: {}'.format(meter_name, self.meter[mode][meter_name]) elif isinstance(meter, Meter.MultiValueSummaryMeter): pstr += '{}: {}'.format(meter_name, self.meter[mode][meter_name]) else: warnings.warn("Can't print meter '{}' of type {}".format(meter_name, type(meter)), RuntimeWarning) pstr += ' %.2fs/its\t' tval.extend([self.timer.value()]) print((pstr % tuple(tval)), flush=True) def flush(self): warnings.warn('Is flush implemented/necessary for your meterlogger?')
class TensorboardMeterLogger(MeterLogger): " A class to package and visualize meters.\n\n Args:\n log_dir: Directory to write events to (log_dir/env)\n env: Tensorboard environment to log to.\n plotstylecombined: Whether to plot curves in the same window.\n loggers: All modes: defaults to ['train', 'val']. If plotstylecombined, these will be superimposed in one plot.\n " def __init__(self, env, log_dir=None, plotstylecombined=True, loggers=('train', 'val')): super().__init__(modes=loggers) self.env = env self.log_dir = os.path.join(log_dir, env) self.logger = {} self.writer = {} for logger in loggers: self.logger[logger] = {} self.writer[logger] = tensorboardX.SummaryWriter(logdir=(self.log_dir + '-{}'.format(logger))) self.metername_to_ptype = {} self.plotstylecombined = plotstylecombined def __addlogger(self, meter, ptype, kwargs={}): for key in self.writer.keys(): self.metername_to_ptype[meter] = ptype if (ptype == 'stacked_line'): raise NotImplementedError('stacked_line not yet implemented for TensorboardX meter') elif (ptype == 'line'): if self.plotstylecombined: for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_scalar, tag=meter) else: for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_scalar, tag=meter) elif (ptype == 'image'): if self.plotstylecombined: for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_image, tag=meter) else: for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_image, tag=meter) elif (ptype == 'histogram'): if self.plotstylecombined: for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_histogram, tag=meter) else: for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_histogram, tag=meter) elif (ptype == 'heatmap'): raise NotImplementedError('heatmap not yet implemented for TensorboardX meter') elif (ptype == 'text'): for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_text, tag=meter) elif (ptype == 'video'): for key in self.writer.keys(): self.logger[key][meter] = functools.partial(self.writer[key].add_video, tag=meter, **kwargs) def add_meter(self, meter_name, meter, ptype=None, kwargs={}): super().add_meter(meter_name, meter) if ptype: self.__addlogger(meter_name, ptype, kwargs) elif isinstance(meter, Meter.ClassErrorMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.mAPMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.AUCMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.ConfusionMeter): self.__addlogger(meter_name, 'heatmap') elif isinstance(meter, Meter.MSEMeter): self.__addlogger(meter_name, 'line') elif (type(meter) == Meter.ValueSummaryMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.MultiValueSummaryMeter): self.__addlogger(meter_name, 'stacked_line') else: raise NotImplementedError('Unknown meter type (and pytpe): {} ({})'.format(type(meter), ptype)) def reset_meter(self, iepoch, mode='train', meterlist=None): self.timer.reset() for (meter_name, meter) in self.meter[mode].items(): if ((meterlist is not None) and (meter_name not in meterlist)): continue val = self.meter[mode][meter_name].value() val = (val[0] if isinstance(val, (list, tuple)) else val) should_reset_and_continue = False if (isinstance(val, str) or (val is None)): should_reset_and_continue = (val is None) elif isinstance(val, np.ndarray): should_reset_and_continue = np.isnan(val).any() elif isinstance(val, torch.Tensor): should_reset_and_continue = torch.isnan(val).any() else: should_reset_and_continue = np.isnan(val) if should_reset_and_continue: self.meter[mode][meter_name].reset() continue if isinstance(meter, Meter.ConfusionMeter): self.logger[mode][meter_name].log(val, global_step=iepoch) elif ('image' == self.metername_to_ptype[meter_name]): try: self.logger[mode][meter_name](img_tensor=val, global_step=iepoch) except ValueError as e: print(f'trouble logging {meter_name} {e}') print('probably due to fake 0 data the data is all at 0') elif ('histogram' == self.metername_to_ptype[meter_name]): try: self.logger[mode][meter_name](values=val, global_step=iepoch) except ValueError as e: print(f'trouble logging {meter_name} {e}') print('probably due to fake 0 data the data is all at 0') elif ('text' == self.metername_to_ptype[meter_name]): if (val is not None): self.logger[mode][meter_name](text_string=val, global_step=iepoch) elif ('video' == self.metername_to_ptype[meter_name]): if (val is not None): self.logger[mode][meter_name](vid_tensor=val, global_step=iepoch) elif isinstance(self.meter[mode][meter_name], Meter.MultiValueSummaryMeter): self.logger[mode][meter_name](scalar_val=np.array(np.cumsum(val), global_step=iepoch)) else: self.logger[mode][meter_name](scalar_value=val, global_step=iepoch) self.meter[mode][meter_name].reset() def flush(self): for k in self.writer: self.writer[k].flush()
class VisdomConnections(object): '\n Keeps global track of connections to visdom. This prevents us from new connections each time we want to log a value.\n ' def __init__(self): self.connections = {} self.log_connections = {} def add(self, server, port, log_to_filename): if ((server, port) in self.connections): assert (self.log_connections[(server, port)] == log_to_filename), 'Cannot set log for {} to {}. Already set to {}!'.format((server, port), log_to_filename, self.log_connections[(server, port)]) else: self.connections[(server, port)] = visdom.Visdom(server=('http://' + server), port=port, log_to_filename=log_to_filename) self.log_connections[(server, port)] = log_to_filename return self.connections[(server, port)]
class BaseVisdomLogger(Logger): '\n The base class for logging output to Visdom.\n\n ***THIS CLASS IS ABSTRACT AND MUST BE SUBCLASSED***\n\n Note that the Visdom server is designed to also handle a server architecture,\n and therefore the Visdom server must be running at all times. The server can\n be started with\n $ python -m visdom.server\n and you probably want to run it from screen or tmux.\n ' @property def viz(self): return self._viz def __init__(self, fields=None, win=None, env=None, opts={}, port=8097, server='localhost', log_to_filename=None): super(BaseVisdomLogger, self).__init__(fields) self.win = win self.env = env self.opts = opts self._viz = VISDOM_CONNECTIONS.add(server, port, log_to_filename) def log(self, *args, **kwargs): raise NotImplementedError('log not implemented for BaseVisdomLogger, which is an abstract class.') def _viz_prototype(self, vis_fn): ' Outputs a function which will log the arguments to Visdom in an appropriate way.\n\n Args:\n vis_fn: A function, such as self.vis.image\n ' def _viz_logger(*args, **kwargs): self.win = vis_fn(*args, win=self.win, env=self.env, opts=self.opts, **kwargs) return _viz_logger def log_state(self, state): ' Gathers the stats from self.trainer.stats and passes them into\n self.log, as a list ' results = [] for (field_idx, field) in enumerate(self.fields): (parent, stat) = (None, state) for f in field: (parent, stat) = (stat, stat[f]) results.append(stat) self.log(*results)
class VisdomSaver(object): ' Serialize the state of the Visdom server to disk.\n Unless you have a fancy schedule, where different are saved with different frequencies,\n you probably only need one of these.\n ' def __init__(self, envs=None, port=8097, server='localhost', log_to_filename=None): super(VisdomSaver, self).__init__() self.envs = envs self.viz = VISDOM_CONNECTIONS.add(server, port, log_to_filename) def save(self, *args, **kwargs): self.viz.save(self.envs)
class VisdomLogger(BaseVisdomLogger): '\n A generic Visdom class that works with the majority of Visdom plot types.\n ' def __init__(self, plot_type, fields=None, win=None, env=None, opts={}, port=8097, server='localhost', log_to_filename=None): "\n Args:\n fields: Currently unused\n plot_type: The name of the plot type, in Visdom\n\n Examples:\n >>> # Image example\n >>> img_to_use = skimage.data.coffee().swapaxes(0,2).swapaxes(1,2)\n >>> image_logger = VisdomLogger('image')\n >>> image_logger.log(img_to_use)\n\n >>> # Histogram example\n >>> hist_data = np.random.rand(10000)\n >>> hist_logger = VisdomLogger('histogram', , opts=dict(title='Random!', numbins=20))\n >>> hist_logger.log(hist_data)\n " super(VisdomLogger, self).__init__(fields, win, env, opts, port, server, log_to_filename) self.plot_type = plot_type self.chart = getattr(self.viz, plot_type) self.viz_logger = self._viz_prototype(self.chart) def log(self, *args, **kwargs): self.viz_logger(*args, **kwargs)
class VisdomPlotLogger(BaseVisdomLogger): def __init__(self, plot_type, fields=None, win=None, env=None, opts={}, port=8097, server='localhost', name=None, log_to_filename=None): '\n Multiple lines can be added to the same plot with the "name" attribute (see example)\n Args:\n fields: Currently unused\n plot_type: {scatter, line}\n\n Examples:\n >>> scatter_logger = VisdomPlotLogger(\'line\')\n >>> scatter_logger.log(stats[\'epoch\'], loss_meter.value()[0], name="train")\n >>> scatter_logger.log(stats[\'epoch\'], loss_meter.value()[0], name="test")\n ' super(VisdomPlotLogger, self).__init__(fields, win, env, opts, port, server, log_to_filename) valid_plot_types = {'scatter': self.viz.scatter, 'line': self.viz.line, 'stacked_line': self.viz.line} self.plot_type = plot_type if (plot_type not in valid_plot_types.keys()): raise ValueError("plot_type '{}' not found. Must be one of {}".format(plot_type, valid_plot_types.keys())) self.chart = valid_plot_types[plot_type] def log(self, *args, **kwargs): if ((self.win is not None) and self.viz.win_exists(win=self.win, env=self.env)): if (len(args) != 2): raise ValueError('When logging to {}, must pass in x and y values (and optionally z).'.format(type(self))) (x, y) = args (x, y) = ([x], [y]) if (self.plot_type == 'stacked_line'): name = kwargs.pop('name') for (i, (x, y)) in enumerate(zip(*args)): self.chart(X=np.array([x]), Y=np.array([y]), update='append', name=self.opts['legend'][i], win=self.win, env=self.env, opts=self.update_opts, **kwargs) else: self.chart(X=np.array(x), Y=np.array(y), update='append', win=self.win, env=self.env, opts=self.opts, **kwargs) else: if (self.plot_type == 'scatter'): chart_args = {'X': np.array([args])} elif (self.plot_type == 'line'): chart_args = {'X': np.array([args[0]]), 'Y': np.array([args[1]])} elif (self.plot_type == 'stacked_line'): chart_args = {'X': np.array([args[0]]), 'Y': np.array([args[1]])} self.update_opts = {k: v for (k, v) in self.opts.items()} self.update_opts.pop('legend') else: raise NotImplementedError('Plot type: {}'.format(self.plot_type)) self.win = self.chart(win=self.win, env=self.env, opts=self.opts, **chart_args) self.log(*args, **kwargs)
class VisdomTextLogger(BaseVisdomLogger): 'Creates a text window in visdom and logs output to it.\n\n The output can be formatted with fancy HTML, and it new output can\n be set to \'append\' or \'replace\' mode.\n\n Args:\n fields: Currently not used\n update_type: One of {\'REPLACE\', \'APPEND\'}. Default \'REPLACE\'.\n\n For examples, make sure that your visdom server is running.\n\n Example:\n >>> notes_logger = VisdomTextLogger(update_type=\'APPEND\')\n >>> for i in range(10):\n >>> notes_logger.log("Printing: {} of {}".format(i+1, 10))\n # results will be in Visdom environment (default: http://localhost:8097)\n\n ' valid_update_types = ['REPLACE', 'APPEND'] def __init__(self, fields=None, win=None, env=None, opts={}, update_type=valid_update_types[0], port=8097, server='localhost', log_to_filename=None): super(VisdomTextLogger, self).__init__(fields, win, env, opts, port, server, log_to_filename) self.text = '' if (update_type not in self.valid_update_types): raise ValueError("update type '{}' not found. Must be one of {}".format(update_type, self.valid_update_types)) self.update_type = update_type self.viz_logger = self._viz_prototype(self.viz.text) def log(self, msg, *args, **kwargs): text = msg if ((self.update_type == 'APPEND') and self.text): self.text = '<br>'.join([self.text, text]) else: self.text = text self.viz_logger([self.text]) def _log_all(self, stats, log_fields, prefix=None, suffix=None, require_dict=False): results = [] for (field_idx, field) in enumerate(self.fields): (parent, stat) = (None, stats) for f in field: (parent, stat) = (stat, stat[f]) (name, output) = self._gather_outputs(field, log_fields, parent, stat, require_dict) if (not output): continue self._align_output(field_idx, output) results.append((name, output)) if (not results): return output = self._join_results(results) if (prefix is not None): self.log(prefix) self.log(output) if (suffix is not None): self.log(suffix) def _align_output(self, field_idx, output): for (output_idx, o) in enumerate(output): if (len(o) < self.field_widths[field_idx][output_idx]): num_spaces = (self.field_widths[field_idx][output_idx] - len(o)) output[output_idx] += (' ' * num_spaces) else: self.field_widths[field_idx][output_idx] = len(o) def _join_results(self, results): joined_out = map((lambda i: (i[0], ' '.join(i[1]))), results) joined_fields = map((lambda i: '{}: {}'.format(i[0], i[1])), joined_out) return '\t'.join(joined_fields) def _gather_outputs(self, field, log_fields, stat_parent, stat, require_dict=False): output = [] name = '' if isinstance(stat, dict): log_fields = stat.get(log_fields, []) name = stat.get('log_name', '.'.join(field)) for f in log_fields: output.append(f.format(**stat)) elif (not require_dict): name = '.'.join(field) number_format = stat_parent.get('log_format', '') unit = stat_parent.get('log_unit', '') fmt = ((('{' + number_format) + '}') + unit) output.append(fmt.format(stat)) return (name, output)
class VisdomMeterLogger(MeterLogger): ' A class to package and visualize meters.\n\n Args:\n server: The uri of the Visdom server\n env: Visdom environment to log to.\n port: Port of the visdom server.\n title: The title of the MeterLogger. This will be used as a prefix for all plots.\n plotstylecombined: Whether to plot train/test curves in the same window.\n ' def __init__(self, server='localhost', env='main', port=8097, title='DNN', nclass=21, plotstylecombined=True, log_to_filename=None, loggers=('train', 'val')): super(VisdomMeterLogger, self).__init__() self.server = server self.env = env self.port = port self.title = title self.logger = {} for logger in loggers: self.logger[logger] = {} self.plotstylecombined = plotstylecombined self.log_to_filename = log_to_filename self.metername_to_ptype = {} def __addlogger(self, meter, ptype): first_logger = None for (logger_name, logger) in self.logger.items(): if (ptype == 'stacked_line'): opts = {'title': '{} {} ({})'.format(self.title, meter, logger_name), 'fillarea': True, 'legend': self.meter[logger_name][meter].keys} logger[meter] = VisdomPlotLogger(ptype, env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, opts=opts) elif (ptype == 'line'): if self.plotstylecombined: if (first_logger is None): opts = {'title': ((self.title + ' ') + meter)} logger[meter] = VisdomPlotLogger(ptype, env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, opts=opts) else: logger[meter] = self.logger[first_logger][meter] else: opts = {'title': ((self.title + '{} '.format(logger_name)) + meter)} logger[meter] = VisdomPlotLogger(ptype, env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, opts=opts) elif (ptype == 'heatmap'): names = list(range(self.nclass)) opts = {'title': ('{} {} {}'.format(self.title, logger_name, meter) + meter), 'columnnames': names, 'rownames': names} logger[meter] = VisdomLogger('heatmap', env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, opts=opts) elif (ptype == 'image'): opts = {'title': ('{} {} {}'.format(self.title, logger_name, meter) + meter)} logger[meter] = VisdomLogger(ptype, env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, opts=opts) elif (ptype == 'histogram'): opts = {'title': ('{} {} {}'.format(self.title, logger_name, meter) + meter), 'numbins': 20} logger[meter] = VisdomLogger(ptype, env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, opts=opts) elif (ptype == 'text'): opts = {'title': ('{} {} {}'.format(self.title, logger_name, meter) + meter)} logger[meter] = VisdomTextLogger(env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, update_type='APPEND', opts=opts) elif (ptype == 'video'): opts = {'title': ('{} {} {}'.format(self.title, logger_name, meter) + meter)} logger[meter] = VisdomLogger(ptype, env=self.env, server=self.server, port=self.port, log_to_filename=self.log_to_filename, opts=opts) def add_meter(self, meter_name, meter, ptype=None): super(VisdomMeterLogger, self).add_meter(meter_name, meter) self.metername_to_ptype[meter_name] = ptype if ptype: self.__addlogger(meter_name, ptype) elif isinstance(meter, Meter.ClassErrorMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.mAPMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.AUCMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.ConfusionMeter): self.__addlogger(meter_name, 'heatmap') elif isinstance(meter, Meter.MSEMeter): self.__addlogger(meter_name, 'line') elif (type(meter) == Meter.ValueSummaryMeter): self.__addlogger(meter_name, 'line') elif isinstance(meter, Meter.MultiValueSummaryMeter): self.__addlogger(meter_name, 'stacked_line') else: raise NotImplementedError('Unknown meter type (and pytpe): {} ({})'.format(type(meter), ptype)) def reset_meter(self, iepoch, mode='train', meterlist=None): self.timer.reset() for (meter_name, meter) in self.meter[mode].items(): if ((meterlist is not None) and (meter_name not in meterlist)): continue val = self.meter[mode][meter_name].value() val = (val[0] if isinstance(val, (list, tuple)) else val) should_reset_and_continue = False if (isinstance(val, str) or (val is None)): should_reset_and_continue = (val is None) elif isinstance(val, np.ndarray): should_reset_and_continue = np.isnan(val).any() elif isinstance(val, torch.Tensor): should_reset_and_continue = torch.isnan(val).any() else: should_reset_and_continue = np.isnan(val) if should_reset_and_continue: self.meter[mode][meter_name].reset() continue if (isinstance(meter, Meter.ConfusionMeter) or (self.metername_to_ptype[meter_name] in ['histogram', 'image', 'text'])): self.logger[mode][meter_name].log(val) elif isinstance(self.meter[mode][meter_name], Meter.MultiValueSummaryMeter): self.logger[mode][meter_name].log(np.array(([iepoch] * len(val))), np.array(np.cumsum(val)), name=mode) elif ((meter_name in self.metername_to_ptype) and (self.metername_to_ptype[meter_name] == 'video')): self.logger[mode][meter_name].log(videofile=val) else: self.logger[mode][meter_name].log(iepoch, val, name=mode) self.meter[mode][meter_name].reset()
class AUCMeter(meter.Meter): '\n The AUCMeter measures the area under the receiver-operating characteristic\n (ROC) curve for binary classification problems. The area under the curve (AUC)\n can be interpreted as the probability that, given a randomly selected positive\n example and a randomly selected negative example, the positive example is\n assigned a higher score by the classification model than the negative example.\n\n The AUCMeter is designed to operate on one-dimensional Tensors `output`\n and `target`, where (1) the `output` contains model output scores that ought to\n be higher when the model is more convinced that the example should be positively\n labeled, and smaller when the model believes the example should be negatively\n labeled (for instance, the output of a signoid function); and (2) the `target`\n contains only values 0 (for negative examples) and 1 (for positive examples).\n ' def __init__(self): super(AUCMeter, self).__init__() self.reset() def reset(self): self.scores = torch.DoubleTensor(torch.DoubleStorage()).numpy() self.targets = torch.LongTensor(torch.LongStorage()).numpy() def add(self, output, target): if torch.is_tensor(output): output = output.cpu().squeeze().numpy() if torch.is_tensor(target): target = target.cpu().squeeze().numpy() elif isinstance(target, numbers.Number): target = np.asarray([target]) assert (np.ndim(output) == 1), 'wrong output size (1D expected)' assert (np.ndim(target) == 1), 'wrong target size (1D expected)' assert (output.shape[0] == target.shape[0]), 'number of outputs and targets does not match' assert np.all(np.add(np.equal(target, 1), np.equal(target, 0))), 'targets should be binary (0, 1)' self.scores = np.append(self.scores, output) self.targets = np.append(self.targets, target) def value(self): if (self.scores.shape[0] == 0): return 0.5 (scores, sortind) = torch.sort(torch.from_numpy(self.scores), dim=0, descending=True) scores = scores.numpy() sortind = sortind.numpy() tpr = np.zeros(shape=(scores.size + 1), dtype=np.float64) fpr = np.zeros(shape=(scores.size + 1), dtype=np.float64) for i in range(1, (scores.size + 1)): if (self.targets[sortind[(i - 1)]] == 1): tpr[i] = (tpr[(i - 1)] + 1) fpr[i] = fpr[(i - 1)] else: tpr[i] = tpr[(i - 1)] fpr[i] = (fpr[(i - 1)] + 1) tpr /= (self.targets.sum() * 1.0) fpr /= ((self.targets - 1.0).sum() * (- 1.0)) n = tpr.shape[0] h = (fpr[1:n] - fpr[0:(n - 1)]) sum_h = np.zeros(fpr.shape) sum_h[0:(n - 1)] = h sum_h[1:n] += h area = ((sum_h * tpr).sum() / 2.0) return (area, tpr, fpr)
class AverageValueMeter(ValueSummaryMeter): def __init__(self): warnings.warn('AverageValueMeter is deprecated in favor of ValueSummaryMeter and will be removed in a future version', FutureWarning) super(AverageValueMeter, self).__init__()
class mAPMeter(meter.Meter): '\n The mAPMeter measures the mean average precision over all classes.\n\n The mAPMeter is designed to operate on `NxK` Tensors `output` and\n `target`, and optionally a `Nx1` Tensor weight where (1) the `output`\n contains model output scores for `N` examples and `K` classes that ought to\n be higher when the model is more convinced that the example should be\n positively labeled, and smaller when the model believes the example should\n be negatively labeled (for instance, the output of a sigmoid function); (2)\n the `target` contains only values 0 (for negative examples) and 1\n (for positive examples); and (3) the `weight` ( > 0) represents weight for\n each sample.\n ' def __init__(self): super(mAPMeter, self).__init__() self.apmeter = APMeter() def reset(self): self.apmeter.reset() def add(self, output, target, weight=None): self.apmeter.add(output, target, weight) def value(self): return self.apmeter.value().mean()
class Meter(object): 'Meters provide a way to keep track of important statistics in an online manner.\n\n This class is abstract, but provides a standard interface for all meters to follow.\n\n ' def reset(self): 'Resets the meter to default settings.' pass def add(self, value): 'Log a new value to the meter\n\n Args:\n value: Next restult to include.\n\n ' pass def value(self): 'Get the value of the meter in the current state.' pass
class MovingAverageValueMeter(meter.Meter): def __init__(self, windowsize): super(MovingAverageValueMeter, self).__init__() self.windowsize = windowsize self.valuequeue = torch.Tensor(windowsize) self.reset() def reset(self): self.sum = 0.0 self.n = 0 self.var = 0.0 self.valuequeue.fill_(0) def add(self, value): queueid = (self.n % self.windowsize) oldvalue = self.valuequeue[queueid] self.sum += (value - oldvalue) self.var += ((value * value) - (oldvalue * oldvalue)) self.valuequeue[queueid] = value self.n += 1 def value(self): n = min(self.n, self.windowsize) mean = (self.sum / max(1, n)) std = math.sqrt(max(((self.var - ((n * mean) * mean)) / max(1, (n - 1))), 0)) return (mean, std)
class MSEMeter(meter.Meter): def __init__(self, root=False): super(MSEMeter, self).__init__() self.reset() self.root = root def reset(self): self.n = 0 self.sesum = 0.0 def add(self, output, target): if ((not torch.is_tensor(output)) and (not torch.is_tensor(target))): output = torch.from_numpy(output) target = torch.from_numpy(target) self.n += output.numel() self.sesum += torch.sum(((output - target) ** 2)) def value(self): mse = (self.sesum / max(1, self.n)) return (math.sqrt(mse) if self.root else mse) def __str__(self): res = ('RMSE' if self.root else 'MSE') res += ' %.3f\t' tval = [self.value()] return (res % tuple(tval))
class MultiValueSummaryMeter(ValueSummaryMeter): def __init__(self, keys): '\n Args:\n keys: An iterable of keys\n ' super(MultiValueSummaryMeter, self).__init__() self.keys = list(keys)
class SingletonMeter(meter.Meter): 'Stores exactly one value which can be regurgitated' def __init__(self, maxlen=1): super(SingletonMeter, self).__init__() self.__val = None def reset(self): 'Resets the meter to default settings.' old_val = self.__val self.__val = None return old_val def add(self, value): 'Log a new value to the meter\n\n Args:\n value: Next restult to include.\n ' self.__val = value def value(self): 'Get the value of the meter in the current state.' return self.__val
class TimeMeter(meter.Meter): '\n <a name="TimeMeter">\n #### tnt.TimeMeter(@ARGP)\n @ARGT\n\n The `tnt.TimeMeter` is designed to measure the time between events and can be\n used to measure, for instance, the average processing time per batch of data.\n It is different from most other meters in terms of the methods it provides:\n\n The `tnt.TimeMeter` provides the following methods:\n\n * `reset()` resets the timer, setting the timer and unit counter to zero.\n * `value()` returns the time passed since the last `reset()`; divided by the counter value when `unit=true`.\n ' def __init__(self, unit): super(TimeMeter, self).__init__() self.unit = unit self.reset() def reset(self): self.n = 0 self.time = time.time() def value(self): return (time.time() - self.time)
class ValueSummaryMeter(meter.Meter): def __init__(self): super(ValueSummaryMeter, self).__init__() self.reset() self.val = 0 def add(self, value, n=1): self.val = value self.sum += value self.var += (value * value) self.n += n if (self.n == 0): (self.mean, self.std) = (np.nan, np.nan) elif (self.n == 1): self.mean = (self.sum + 0.0) self.min = (self.mean + 0.0) self.max = (self.mean + 0.0) self.std = np.inf self.mean_old = self.mean self.m_s = 0.0 else: self.mean = (self.mean_old + ((value - (n * self.mean_old)) / float(self.n))) self.m_s += ((value - self.mean_old) * (value - self.mean)) self.mean_old = self.mean self.std = np.sqrt((self.m_s / (self.n - 1.0))) self.min = np.minimum(self.min, value) self.max = np.maximum(self.max, value) def value(self): return (self.mean, self.std) def reset(self): self.n = 0 self.sum = 0.0 self.var = 0.0 self.val = 0.0 self.mean = np.nan self.mean_old = 0.0 self.m_s = 0.0 self.std = np.nan self.min = np.nan self.max = np.nan def __str__(self): old_po = np.get_printoptions() np.set_printoptions(precision=3) res = 'mean(std) {} ({}) \tmin/max {}/{}\t'.format(*[np.array(v) for v in [self.mean, self.std, self.min, self.max]]) np.set_printoptions(**old_po) return res