Q_Id int64 337 49.3M | CreationDate stringlengths 23 23 | Users Score int64 -42 1.15k | Other int64 0 1 | Python Basics and Environment int64 0 1 | System Administration and DevOps int64 0 1 | Tags stringlengths 6 105 | A_Id int64 518 72.5M | AnswerCount int64 1 64 | is_accepted bool 2
classes | Web Development int64 0 1 | GUI and Desktop Applications int64 0 1 | Answer stringlengths 6 11.6k | Available Count int64 1 31 | Q_Score int64 0 6.79k | Data Science and Machine Learning int64 0 1 | Question stringlengths 15 29k | Title stringlengths 11 150 | Score float64 -1 1.2 | Database and SQL int64 0 1 | Networking and APIs int64 0 1 | ViewCount int64 8 6.81M |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
28,741,590 | 2015-02-26T11:44:00.000 | 2 | 1 | 0 | 0 | python-2.7,sentiment-analysis,textblob | 30,297,074 | 1 | false | 0 | 0 | TextBlob used a classifier to predict the polarity of a sentence. By default it uses the Movie-Review data set. You can train it using your own training model. | 1 | 2 | 0 | How does textblob calculate polarity in sentiment analysis? What logic does it follow and can we change the logic?
Thank you. | Logic behind the polarity score calculated by TEXTBLOB? | 0.379949 | 0 | 0 | 650 |
28,741,731 | 2015-02-26T11:51:00.000 | 0 | 1 | 1 | 0 | python,events,rabbitmq,amqp | 28,864,448 | 1 | false | 0 | 0 | The right answer to your question depends on your architecture. If you're adopting a microservices-style architecture, it might make sense to use AMQP for all your event communication. If you're adopting more of a monolithic architecture, you may want to use PyDispatcher + AMQP.
Note that AMQP and RabbitMQ shouldn't be... | 1 | 1 | 0 | I am developing a trading/position management system in Python. It is therefore going to interact with external software, database events, and also on timed events as well.
Is it efficient enough to use a AMQP like RabbitMQ to handle everything? Or should I use a PyDispatcher for local events and AMQP for external even... | Pydispatcher or AMQP/RabbitMQ for local event driven processing written in python? | 0 | 0 | 0 | 285 |
28,749,243 | 2015-02-26T17:45:00.000 | 3 | 0 | 0 | 0 | python,qt,squish | 30,211,284 | 2 | false | 0 | 1 | ... but I have noticed when I copy and paste tests from a suite
I have and move them to another suite or computer with Squish the file
will run, but when it runs anytime it sees an object name it does not
recognize it and throws an exception ...
For your test script, Squish creates this suite folder you mention.... | 1 | 0 | 0 | I'm using a combination of Python and Squish for Qt to write tests on a Qt GUI, but I have noticed when I copy and paste tests from a suite I have and move them to another suite or computer with Squish the file will run, but when it runs anytime it sees an object name it does not recognize it and throws an exception. M... | Has anyone seen Squish that you must re-record after moving? | 0.291313 | 0 | 0 | 246 |
28,751,764 | 2015-02-26T20:06:00.000 | 1 | 1 | 1 | 1 | python,installation,anaconda,packages,pydicom | 28,770,249 | 1 | true | 0 | 0 | You shouldn't copy the source to site-packages directly. Rather, use python setup.py install in the source directory, or use pip install .. Make sure your Python is indeed the one in /usr/local/anaconda, especially if you use sudo (which in general is not necessary and not recommended with Anaconda). | 1 | 2 | 0 | I'm installing some additional packages to anaconda and I can't get them to work. One such package is pydicom which I downloaded, unziped, and moved to /usr/local/anaconda/lib/python2.7/site-package/pydicom. In the pydicom folder the is a subfolder called source which contains both ez_setup.py and setup.py. I ran sudo ... | How do I get python to recognize a module from any directory? | 1.2 | 0 | 0 | 1,420 |
28,752,126 | 2015-02-26T20:28:00.000 | 7 | 0 | 0 | 0 | python,numpy,fft,fftw | 28,753,451 | 3 | true | 0 | 0 | If you are implementing the DFFT entirely within Python, your code will run orders of magnitude slower than either package you mentioned. Not just because those libraries are written in much lower-level languages, but also (FFTW in particular) they are written so heavily optimized, taking advantage of cache locality, v... | 1 | 0 | 1 | I am currently need to run FFT on 1024 sample points signal. So far I have implementing my own DFT algorithm in python, but it is very slow. If I use the NUMPY fftpack, or even move to C++ and use FFTW, do you guys think it would be better? | Numpy fft.pack vs FFTW vs Implement DFT on your own | 1.2 | 0 | 0 | 4,655 |
28,752,446 | 2015-02-26T20:46:00.000 | 2 | 0 | 0 | 0 | python,tkinter | 28,753,245 | 2 | true | 0 | 1 | If you plan on literally destroying everything in the root window, my recommendation is to make a single frame be a child of the root window, and then put everything inside that frame. Then, when you need to clear the root window you only have to delete this one widget, and it will take care of deleting all of the othe... | 1 | 1 | 0 | I am new to tkinter and I was wondering if there is a way to clear whole root (window). I tried with root.destroy() , but I want to have a chance to undo(to callback some widgets). I also tried .pack_forget() and .grid_forget() , but it takes a lot of time and later may cause many bugs in program.
Thank you for help. | Clear whole root | 1.2 | 0 | 0 | 4,266 |
28,753,061 | 2015-02-26T21:26:00.000 | 1 | 0 | 0 | 1 | google-app-engine,google-cloud-storage,google-app-engine-python | 28,754,390 | 1 | false | 0 | 0 | Unfortunately you only have two good options here:
Have a service which authenticates the individial app according to whatever scheme you like (some installation license, a random GUID assigned at creation time, whatever) and vends GCS signed URLs, which the end user could then use for a single operation, like uploadi... | 1 | 1 | 0 | I'd like to give to each of my customers access to their own bucket under my GCS enabled app.
I also need to make sure that a user's bucket is safe from other users' actions.
Last but not least, the customer will be a client application, so the whole process needs to be done transparently without asking the user to l... | Can I have GCS private isolated buckets with a unique api key per bucket? | 0.197375 | 0 | 1 | 56 |
28,756,204 | 2015-02-27T01:50:00.000 | 0 | 0 | 1 | 0 | python,multiprocessing | 61,904,891 | 1 | false | 0 | 0 | It seems like Beep function couldn't play several notes at the same time. You can record the sound of 'Beep' through sounddevice library, save the sound in wav files. Then, use subprocess.Popen to achieve multiprocess. The subprocess would play the wav files. | 1 | 0 | 0 | I am writing a basic piano style program that uses functions with winsound.Beep to play different note. I am new to multi-processing, and was wondering how I would be able to play two notes at once. If that is not possible, perhaps there is a way to combine frequencies that I do not know. Thanks for reading
~Jimnebob | How do I use the multiprocess library with winsound in python? | 0 | 0 | 0 | 142 |
28,756,362 | 2015-02-27T02:09:00.000 | -2 | 0 | 0 | 1 | python,process | 28,756,912 | 6 | false | 0 | 0 | popen works great because you can run things through grep, cut, etc. So you can tailor the info to exactly what you want. | 1 | 3 | 0 | I know it has something to do with /proc but I'm not really familiar with it. | How do I show a list of processes for the current user using python? | -0.066568 | 0 | 0 | 4,574 |
28,757,736 | 2015-02-27T04:49:00.000 | 1 | 0 | 0 | 0 | python,django | 28,760,572 | 1 | true | 1 | 0 | I would recommend using Celery processes in the background and perhaps use the awesome Twisted library for handling your network requirements. | 1 | 1 | 0 | I have a django framework that receives user form. Thi input is used to create a TCP connection with a backhand process and send and receive json on it.
How do I handle several TCP connections using django framework? | how to handle tcp connections on django | 1.2 | 0 | 0 | 143 |
28,765,243 | 2015-02-27T12:33:00.000 | 2 | 1 | 0 | 0 | python,api,automation,web-api-testing | 38,866,398 | 1 | false | 0 | 0 | I have done API Automation framework using JAVA - TestNG - HTTP Client.
It's a Hybrid framework consist of,
Data Driven Model : Reads data from JSON/ XML file.
Method-Driven : I have written POJO for JSON Objects and Arrays reading and writing.
Report : I will be getting the Report using TestNG customized report forma... | 1 | 3 | 0 | I am planning to have API Automation Framework built on the top pf Python + Request Library
Expected flow:
1) Read Request Specification From input file "csv/xml"
2) Make API Request & get Response & analyse the same
3) Store Test Results
4) Communicate the same
Initial 'smoke test' to be performed with basic cases th... | API Test Automation Framework Structure | 0.379949 | 0 | 1 | 1,451 |
28,765,398 | 2015-02-27T12:42:00.000 | 1 | 0 | 0 | 0 | javascript,python,html,web-scraping,beautifulsoup | 28,852,463 | 2 | false | 1 | 0 | The Python binding for Selenium and phantomjs (if you want to use a headless browser as backend) are the appropriate tools for this job. | 2 | 0 | 0 | I want to fetch few data/values from a website. I have used beautifulsoup for this and the fields are blank when I try to fetch them from my Python script, whereas when I am inspecting elements of the webpage I can clearly see the values are available in the table row data.
When i saw the HTML Source I noticed its bla... | How to fetch data from a website using Python that is being populated by Javascript? | 0.099668 | 0 | 1 | 272 |
28,765,398 | 2015-02-27T12:42:00.000 | 0 | 0 | 0 | 0 | javascript,python,html,web-scraping,beautifulsoup | 28,850,142 | 2 | false | 1 | 0 | Yes, you can scrape JS data, it just takes a bit more hacking. Anything a browser can do, python can do.
If you're using firebug, look at the network tab to see from which particular request your data is coming from. In chrome element inspection, you can find this information in a tab named network, too. Just hit ctrl-... | 2 | 0 | 0 | I want to fetch few data/values from a website. I have used beautifulsoup for this and the fields are blank when I try to fetch them from my Python script, whereas when I am inspecting elements of the webpage I can clearly see the values are available in the table row data.
When i saw the HTML Source I noticed its bla... | How to fetch data from a website using Python that is being populated by Javascript? | 0 | 0 | 1 | 272 |
28,775,534 | 2015-02-27T22:37:00.000 | 0 | 0 | 0 | 0 | python-3.x,gtk,glade | 28,878,731 | 1 | true | 0 | 0 | After a lot of searching for a Glade-only solution, I think that Gtk.Menuitem doesn't have a URL-open option. I now just defined on_menuitem_clicked-function that uses:
webbrowser.open_new_tab()
from the standard library. | 1 | 0 | 0 | What is the best way to create a menuitem (for the Gtk.MenuBar) that should open the default browser with a new tab and loading an URL?
Is it possible to do that in Glade directly or do I need to create that function in the program code itself? Is there a preferred way in Python 3 to do that? | Link to website in Gtk.MenuBar using Glade | 1.2 | 0 | 1 | 178 |
28,777,006 | 2015-02-28T01:25:00.000 | 5 | 0 | 1 | 0 | python,python-2.7,pdb,spyder | 54,999,358 | 2 | false | 0 | 0 | You can use ipdb. put ipdb.set_trace() wherever you want to debug. Then press s to step into the function. | 1 | 5 | 0 | Note: To explain this quickly I'm going to talk about this from the perspective of working in Spyder.
If the a function is called in my code, I can put a break point next to where it's called and then when my code gets to that point I can click the "Step into function.." button to see what happens inside this function.... | python pdb: step into a function called from console | 0.462117 | 0 | 0 | 3,082 |
28,777,882 | 2015-02-28T03:45:00.000 | 0 | 0 | 0 | 0 | python,objectlistview | 28,974,102 | 1 | true | 0 | 1 | There is no real getter.
Use ObjectListView.sortColumnIndex for that.
It will be '-1' if none of the columns are used for sorting.
btw: How can I add code here? The "code snipped" symbol just come up with a ugly un-understandable dialog. | 1 | 0 | 0 | I want to ask a ObjectListView object if and which of its columns
(index would be enough) are sorted and in which direction (asc or desc).
I know
ObjectListView.GetSortColumn()
which return a ColumnDef object.
But I can not see a way how to ask about the index of the ColumnDef.
In wx.ListCtrl I can not found anything... | How to ask a ObjectListView which column is ordered and in which direction? | 1.2 | 0 | 0 | 81 |
28,780,611 | 2015-02-28T10:20:00.000 | 0 | 0 | 0 | 0 | python,pygame,joystick | 28,937,815 | 1 | false | 0 | 1 | I was not able to figure out why get_axis(1) did not get the position of the left paddle.
However, I was able to use evdev to get all the information I need from the steering wheel. It's not very high level, unlike Pygame, but it does work. | 1 | 0 | 0 | I am using Pygame to get values from a Simraceway steering wheel, which is just seen as a joystick. There are three axes on the joystick -- one for steering, one for the left paddle, and one for the right paddle.
When I do the Pygame command get_numaxes(), I correctly get back 3 axes. But when I do the command get_axi... | Pygame.not getting value for one of axes on the joystick | 0 | 0 | 0 | 542 |
28,786,932 | 2015-02-28T21:09:00.000 | 0 | 0 | 0 | 0 | python,html,css,python-3.x | 28,787,299 | 2 | false | 1 | 0 | To achieve your goal, you need good knowledge of javascript, the language for dynamic web pages. You should be familiar with dynamic web techniques, AJAX, DOM, JSON. So the main part is on the browser side. Practically any python web server fits. To "bridge the gap" the keyword is templates. There are quite a few for p... | 1 | 1 | 0 | I am working on making a GUI front end for a Python program using HTML and CSS (sort of similar to how a router is configured using a web browser). The program assigns values given by the user to variables and performs calculations with those variables, outputting the results. I have a few snags to work out:
How do I ... | How to make a webpage display dynamic data in real time using Python? | 0 | 0 | 0 | 6,330 |
28,787,814 | 2015-02-28T22:40:00.000 | 1 | 0 | 0 | 0 | python,mysql,sql | 28,787,981 | 2 | false | 1 | 0 | The latter one you need to do and handle in any case, thus I do not see there is much value in querying for duplicates, except to show the user information beforehand - e.g. report "This username has been taken already, please choose another" when the user is still filling in the form. | 2 | 1 | 0 | Python application, standard web app.
If a particular request gets executed twice by error the second request will try to insert a row with an already existing primary key.
What is the most sensible way to deal with it.
a) Execute a query to check if the primary key already exists and do the checking and error handli... | Let the SQL engine do the constraint check or execute a query to check the constraint beforehand | 0.099668 | 1 | 0 | 61 |
28,787,814 | 2015-02-28T22:40:00.000 | 2 | 0 | 0 | 0 | python,mysql,sql | 28,788,000 | 2 | true | 1 | 0 | The best option is (b), from almost any perspective. As mentioned in a comment, there is a multi-threading issue. That means that option (a) doesn't even protect data integrity. And that is a primary reason why you want data integrity checks inside the database, not outside it.
There are other reasons. Consider per... | 2 | 1 | 0 | Python application, standard web app.
If a particular request gets executed twice by error the second request will try to insert a row with an already existing primary key.
What is the most sensible way to deal with it.
a) Execute a query to check if the primary key already exists and do the checking and error handli... | Let the SQL engine do the constraint check or execute a query to check the constraint beforehand | 1.2 | 1 | 0 | 61 |
28,790,032 | 2015-03-01T04:17:00.000 | 0 | 0 | 0 | 0 | python,scikit-learn | 28,871,022 | 1 | true | 0 | 0 | Currently there is no way to directly get the optimum number of estimators from GradientBoostingClassifier. If you also pass n_estimators in the parameter grid to GridSearchCV it will only try the exact values you give it, and return one of these.
We are looking to improve this, by searching over the number of estimato... | 1 | 0 | 1 | With GradientBoostingClassifier suppose I set n_estimators to 2000 and use GridSearchCV to search across learning_rate in [0.01, 0.05, 0.10] - how do I know the number of boosting iterations that produced the optimal result - is the model always going to fit 2000 trees for each value of learning_rate or is it going to ... | Obtain optimal number of boosting iterations in GradientBoostingClassifier using grid search | 1.2 | 0 | 0 | 1,119 |
28,791,278 | 2015-03-01T07:41:00.000 | 0 | 0 | 1 | 0 | python-3.x | 28,791,357 | 1 | false | 0 | 0 | What you describe is what was a very popular type of game a long time ago. The most difficult portion of this type of game is interpreting user input. You can start with a list of possible commands, iterating through each token of the user's input. If I type
look left
the game can begin by calling a method or functio... | 1 | 0 | 0 | Metaphorically speaking, I'm learning python in a community college for game programming; and our second assignment is to make a text based game. I'm stuck trying to figure out how to get the code to run if the player has something in their inventory, then display these options or print these options if they don't have... | Key and lock code [game programming]? | 0 | 0 | 0 | 117 |
28,791,639 | 2015-03-01T08:42:00.000 | 2 | 0 | 1 | 0 | python,constructor,initializer | 28,791,729 | 3 | false | 0 | 0 | __init__ is called with an already built up instance of the object as first parameter (normally called self, but that's just a parameter name).
__new__ instead is called passing the class as first parameter and is expected to return an instance (that will be later passed to __init__).
This allows for example __new__ to... | 1 | 14 | 0 | I have heard that the __init__ function in python is not a Constructor, It's an Initializer and actually the __new__ function is the Constructor and the difference is that the __init__ function is called after the creation of the object and the __new__ called before. Am I right? Can you explain the difference better an... | Initializer vs Constructor | 0.132549 | 0 | 0 | 17,678 |
28,793,857 | 2015-03-01T13:04:00.000 | 2 | 0 | 0 | 1 | python,google-app-engine | 28,804,617 | 1 | true | 1 | 0 | Actually two different App Engine apps cannot see the same items in memcache. Their memcache spaces are totally isolated from each other.
However two different modules of the same app use the same memcache space and can read and write the same items. Modules act like sub-apps. Is that what you meant?
It is also possib... | 1 | 1 | 0 | I have 2 Google App Engine applications which share memcache items, one app writes the items and the other apps reads them. This works in production. however - locally using the SDK, items written by one app are not available to the other. Is there a way to make this work? | How to share memcache items across 2 apps locally using google app eninge sdk | 1.2 | 0 | 0 | 63 |
28,794,872 | 2015-03-01T14:49:00.000 | 0 | 0 | 0 | 0 | java,python,xml,linux,groovy | 28,805,524 | 1 | false | 0 | 0 | Looking deeper into the problem and after scanning other posts I found out that inst2xsd is the tool for this kind of tasks. | 1 | 0 | 0 | I have 46000 xml files that all share a common structure but there are variations and the number of files makes it impossible to figure out a common xml schema for all of them. Is there a tool that may help me to extract a schema from all these files or at least something that may give me a close enough idea of what is... | extract an XML schema (or equivalent) from a large set of xml files | 0 | 0 | 1 | 76 |
28,798,079 | 2015-03-01T19:32:00.000 | -1 | 0 | 0 | 0 | python,django,cookies,django-rest-framework,django-testing | 28,808,418 | 1 | true | 1 | 0 | I have found my solution. It was rather straightforward actually.
I tried to set my cookie on my request for the test, which made sense since the cookie should be sent in the request. A better way of testing it is to just GET a resource first (which sets te cookie, which would happen in a normal web-situation as well) ... | 1 | 2 | 0 | I'm using get_signed_cookie in one of my views, and it works. The problem is in testing it, i'm manually signing my cookie in my test using Django's django.core.signing module with the same salt as my actual code (i'm using a salt that's in my settings).
When i do non-automated tests, all is well. I've compared the coo... | Django get_signed_cookie on manually signed cookie | 1.2 | 0 | 0 | 820 |
28,799,663 | 2015-03-01T22:02:00.000 | 2 | 1 | 1 | 1 | python,multithreading | 28,799,878 | 2 | true | 0 | 0 | To me, this looks like a pristine application for the subprocess module.
I.e. do not run the test-scripts from within the same python interpreter, rather spawn a new process for each test-script. Do you have any particular reason why you would not want to spawn a new process and run them in the same interpreter instead... | 1 | 0 | 0 | I have a python program run_tests.py that executes test scripts (also written in python) one by one. Each test script may use threading.
The problem is that when a test script unexpectedly crashes, it may not have a chance to tidy up all open threads (if any), hence the test script cannot actually complete due to the t... | Best way to stop a Python script even if there are Threads running in the script | 1.2 | 0 | 0 | 238 |
28,804,395 | 2015-03-02T07:11:00.000 | 0 | 0 | 1 | 0 | python,differential-equations | 28,998,382 | 2 | false | 0 | 0 | RK4 or the classical Runge-Kutta method is one specific integration method. As an explicit method, it is imminently unsuitable for stiff problems. As a one-method method, it has no intrinsic features for step size control.
For stiff problems, you want implicit RK methods with step size control. | 1 | 1 | 0 | I need a solver of stiff Inital-Value Problems (IVP) in python exploiting RK4 preferably explicit. I have been searching for past few days but could not find it. Following are my queries:
Does the solver, i.e. any module, exist?
If no, will it be reasonable to code one? I am asking this because I can't find any refere... | Runge-Kutta(RK4) for stiff IVP | 0 | 0 | 0 | 331 |
28,804,802 | 2015-03-02T07:44:00.000 | 0 | 0 | 0 | 0 | python,django,apache | 33,037,343 | 1 | true | 1 | 0 | The problem for slow response was with the custom views which did not have pagination. After implementing this feature, response became fast :) | 1 | 1 | 0 | I have used django-adminplus to register custom views with django-filters in the admin site. This is slowing down the performance of my django project. I am using Apache as my http webserver as also my static file renderer as I 'HAVE' to do it so. I cannot use gninx nor gunicorn. The views render several 100k records. ... | Does django adminplus effects performance? | 1.2 | 0 | 0 | 83 |
28,805,401 | 2015-03-02T08:30:00.000 | 0 | 0 | 1 | 0 | python,pycxx | 28,805,402 | 1 | false | 0 | 1 | If NDEBUG is defined you have to use the Debug version of the interpreter python_d.exe.
Furthermore if the name of the extension is myextension the name of the Dll in Release must be myextension.pyd but in Debug the name of the Dll must be myextension_d.pyd | 1 | 0 | 0 | When I Debug my Python C extension using Visual Studio the program abort with the message: "PyThreadState_Get: no current thread".
In Release the program works fine and if I add debugging information it still works fine.
How to solve the problem? | Debugging my Python C extension lead to "PyThreadState_Get: no current thread" | 0 | 0 | 0 | 304 |
28,807,448 | 2015-03-02T10:25:00.000 | 0 | 0 | 0 | 0 | python,wxpython | 28,818,633 | 1 | false | 0 | 1 | You can use focus events. Either catch wx.EVT_KILL_FOCUS which fires when you leave the grid widget or catch wx.EVT_SET_FOCUS when you enter a new widget. Then you can do something in your event handler to update grid1. | 1 | 0 | 0 | I have a window with two grids in it. Example for using:
Making some operations on grid1. When making operations on another object in this window(like the other grid) I want to do final operation on grid1. What is the right event for this? | wxpython event on deactivating a grid | 0 | 0 | 0 | 18 |
28,807,894 | 2015-03-02T10:48:00.000 | 0 | 0 | 1 | 0 | python | 28,809,702 | 1 | false | 0 | 0 | My guess is you have multiple versions of python, and Pycharm is using a different one than the version of IDLE you're using. It could also be that some packages like Pygame only work in 32 bit versions... | 1 | 0 | 0 | I primarily use PyCharm but when I try to develop using IDLE it doesn't recognise any of my packages / folders. Even though they have a __init__.py file in them, any reason why and how can I fix it?
Thanks for any help, I can provide more information as and when it is needed. | IDLE doesn't recognise packages | 0 | 0 | 0 | 99 |
28,811,104 | 2015-03-02T13:34:00.000 | 0 | 0 | 0 | 0 | python,gtk,pygtk | 34,956,262 | 1 | false | 0 | 1 | Assuming you want five pixels of spacing, if you would like to have space between the different cells of your table, you can try table.set_row_spacings(5); table.set_col_spacings(5); If you would like to have space around the entire table, you can do table.set_padding(5). | 1 | 1 | 0 | I am trying to use gtk table in one of my projects(GUI based) to show a pair of columns and its values. Since gtk table doesn't have borders by default, my GUI is not coming up well.
So,
Is there anyway I can add borders to gtk table and its cells?
If no can I create a customized widget with borders by extending gtk Ta... | Add border to table in pygtk | 0 | 0 | 0 | 1,159 |
28,811,202 | 2015-03-02T13:39:00.000 | 0 | 0 | 0 | 0 | python,tkinter,ttk | 28,813,514 | 1 | false | 0 | 1 | No, it is likely not possible, depending on what you mean by "everything" and what you mean by "scaled". Any widget can be made to stretch to fill its allotted space. Text widgets and canvas widgets, for example, scale nicely. A button or label will fill the space it's in, but the text inside the widget won't change (t... | 1 | 0 | 0 | Is it possible that when a Tkinter window is made bigger or larger, everyhting in the window is scaled?
So all the proportions stay the same but their sizes vary.
Now when the window is resized all the buttons etc stay the same so I disabled resize because there is no point, it just looks bad. | Tkinter - scale all components on resize? | 0 | 0 | 0 | 569 |
28,811,688 | 2015-03-02T14:02:00.000 | 0 | 0 | 0 | 0 | python,django,movie,imdb | 28,812,266 | 1 | false | 1 | 0 | If you have a server which is frequently used, you could think about caching the information locally. I suppose it's very likely that most queries will be clustered around a reduced set of movies, so that would speed up your search. | 1 | 0 | 0 | I've tried using OMDb, it gives all the things I need and has a very simple working too, but it is very very slow. I looped about 200 queries and it took about 3 minutes to complete.
Is there any faster API out there that can give me similar results on querying an movie. The details i'm looking for in particular are ge... | API for fetching movie details from IMDB or similar sites? | 0 | 0 | 0 | 1,396 |
28,813,409 | 2015-03-02T15:27:00.000 | -2 | 0 | 0 | 0 | python,postgresql,unicode | 28,813,836 | 3 | false | 0 | 0 | Since a string is basically just data and a pointer, you can save null in it. However, since null represents the end of the string ("null terminator "), there is no way to read beyond the null without knowing the size ahead of reading.
Therefore, seems that you ought to store your data in binary and read it as a buffe... | 2 | 5 | 0 | Are null bytes allowed in unicode strings?
I don't ask about utf8, I mean the high level object representation of a unicode string.
Background
We store unicode strings containing null bytes via Python in PostgreSQL.
The strings cut at the null byte if we read it again. | Are null bytes allowed in unicode strings in PostgreSQL via Python? | -0.132549 | 1 | 0 | 8,634 |
28,813,409 | 2015-03-02T15:27:00.000 | 1 | 0 | 0 | 0 | python,postgresql,unicode | 28,814,135 | 3 | false | 0 | 0 | Python itself is perfectly capable of having both byte strings and Unicode strings with null characters having a value of zero. However if you call out to a library implemented in C, that library may use the C convention of stopping at the first null character. | 2 | 5 | 0 | Are null bytes allowed in unicode strings?
I don't ask about utf8, I mean the high level object representation of a unicode string.
Background
We store unicode strings containing null bytes via Python in PostgreSQL.
The strings cut at the null byte if we read it again. | Are null bytes allowed in unicode strings in PostgreSQL via Python? | 0.066568 | 1 | 0 | 8,634 |
28,813,775 | 2015-03-02T15:44:00.000 | 0 | 1 | 0 | 1 | python,bash,scripting,path,packing | 28,828,064 | 2 | false | 0 | 0 | Thanks for the answers!
Of course this is not a good approach for providing a published code! Sorry if it was confusing. But this is a good approach if you are developing some e.g. scientific idea, and you wish to obtain a proof of concept result fast and you wish to do similar tasks several times but replacing fast so... | 1 | 0 | 0 | For some routine work I found that combining different scripting languages can be the fastest way to do. Like I have some main bash script which calles some awk, pyton and bash scripts or even some compiled fortran executables.
I can put all the files into a folder that is in the paths, but it makes modification is a b... | Multiple executables as a single file | 0 | 0 | 0 | 202 |
28,814,845 | 2015-03-02T16:34:00.000 | 1 | 1 | 1 | 1 | python,git | 28,814,943 | 2 | true | 0 | 0 | You could consider running your script from a separate checkout to where you do your development. That way you would need to commit, push locally, and pull in the 'deployment' location before you could run the updated script. You could probably automate those steps with a shell script or even a git commit hook. | 1 | 1 | 0 | I have a slightly unusually situation: I have scripts that I make small changes to frequently, and that take hours to execute.
I save output logs, but more importantly I need to make sure that the code which produced a given log will not be lost.
Committing changes before each run will work, but I'd like to enforce thi... | only run python script if it is git committed | 1.2 | 0 | 0 | 132 |
28,817,249 | 2015-03-02T18:49:00.000 | 2 | 0 | 1 | 0 | python,python-c-api | 28,817,512 | 1 | true | 0 | 1 | PyEval_SetTrace() is exactly the API that you need to use. Not sure why you need some additional way to "pause" the execution; when your callback has been called, the execution is already paused and will not resume until you return from the callback. | 1 | 1 | 0 | I am using Python C Api to embed a python in our application. Currently when users execute their scripts, we call PyRun_SimpleString(). Which runs fine.
I would like to extend this functionality to allow users to run scripts in "Debug" mode, where like in a typical IDE, they would be allowed to set breakpointsm "watche... | How to implement breakpoint functionality in a embedding of Python | 1.2 | 0 | 0 | 179 |
28,817,558 | 2015-03-02T19:07:00.000 | 0 | 1 | 0 | 0 | python,django,mercurial | 28,817,753 | 2 | false | 1 | 0 | You can use hg id -i to see the currently checked out revision on your server, and hg status to check if the file has been modified relative to that revision. | 1 | 0 | 0 | I'm using mercurial and I think I may have an older revision of a python file running on my server. How can I tell which revision, of a particular file, is currently being ran on in my web application?
I suspect an older revision because I currently have an error being thrown in sentry that refers to a line of code th... | HG - Find current running revision of a code file | 0 | 0 | 0 | 119 |
28,818,394 | 2015-03-02T19:56:00.000 | 2 | 0 | 0 | 0 | python,amazon-web-services,amazon-dynamodb,boto | 28,890,074 | 1 | true | 1 | 0 | You can create 2 GSIs: 1 with date as hashKey, 1 with month as hashKey.
Those GSIs will point you to the rows of that month / of that day.
Then you can just query the GSI, get all the rows of that month/day, and do the aggregation on your own.
Does that work for you?
Thanks!
Erben | 1 | 0 | 0 | For a project I have to use DynamoDB(aws) and python(with boto).
I have items with a date and I need to display the count grouped by date or by month.
Something like
by date of the month [1/2: 5, 2/2: 10, 3/2: 7, 4/2: 30, 5/2: 25, ...]
or
by month of the year [January: 5, February: 10, March: 7, ...] | Using group by in DynamoDB | 1.2 | 1 | 0 | 3,106 |
28,818,559 | 2015-03-02T20:06:00.000 | 0 | 0 | 0 | 0 | python,urllib,urlparse | 30,655,631 | 1 | false | 1 | 0 | Two dots (..) means go back once in the hierarchy, change the second link to ./v2/meila07a/meila07a.pdf and it should be working fine.
Or you can also change the root one to http://www.jmlr.org/proceedings/papers/v2/, thanks to this change it will no longer dispose of v2 at the end because the root was not set to a pro... | 1 | 0 | 0 | I am trying to do some web scraping but I have some problems in joining relative and root urls
for example the root url is: http://www.jmlr.org/proceedings/papers/v2
and the relative url is: ../v2/meila07a/meila07a.pdf
As I use urljoin in urlparse: the result is odd:
http://www.jmlr.org/proceedings/v2/meila07a/meila07a... | joining urls with urljoin in python | 0 | 0 | 1 | 399 |
28,819,758 | 2015-03-02T21:27:00.000 | 0 | 0 | 0 | 0 | python,opencv,ffmpeg,video-processing | 40,351,890 | 1 | false | 0 | 0 | Had the same problem using opencv2.4 also when using other codec than MJPG. After upgrading to version 3.1.0 the error doesn't occur anymore. | 1 | 1 | 0 | I am new to opencv and I am trying to create a video file with frame size 56x72 using opencv-python. I am using 'MJPG' to encode the video with a frame rate of 20. I get an error which says - [mjpeg @ 0x27ee9e0] buffer smaller than minimum size.
I checked the avcodec.h file and it says that the FF_MIN_BUFFER_SIZE = 163... | mjpeg @ 0x27ee9e0 buffer smaller than minimum size: How to create a video file with size less than the minimum buffer size? | 0 | 0 | 0 | 822 |
28,823,172 | 2015-03-03T02:40:00.000 | 1 | 1 | 0 | 0 | java,python,amazon-s3,thumbnails,aws-lambda | 56,451,012 | 2 | false | 1 | 0 | You can add a SQS queue as an event source/trigger for the Lambda, make the slight changes in the Lambda to correctly process a SQS event as opposed to a S3 event, and then using a local script loop through a list of all objects in the S3 bucket (with pagination given the 2MM files) and add them as messages into SQS. T... | 1 | 4 | 0 | I'm planning to migrate existing image processing logic to AWS lambda. Lambda thumbnail generator is better than my previous code so I want to re-process all the files in an existing bucket using lamdba.
Lambda seems to be only event driven, this means that my lamdba function will only be called via a PUT event. Since ... | Running aws-lambda function in a existing bucket with files | 0.099668 | 0 | 0 | 2,230 |
28,824,286 | 2015-03-03T04:47:00.000 | 0 | 0 | 0 | 0 | python,wxpython | 28,824,375 | 1 | false | 0 | 1 | Worked on it for an hour without success before posting, then solved it myself five minutes later...
Here's my solution, creating a ClientDC if the event doesn't have its own DC:
import wx
class Foo(wx.Frame):
def __init__(self, parent, title):
wx.Frame.__init__ (self, parent, -1, title, size=(500,300))
... | 1 | 0 | 0 | I am having trouble posting an erase background event to draw to the screen. In my full code, I want to draw a bitmap (DC.DrawBitmap()) when a button is clicked. I do that by posting an EVT_ERASE_BACKGROUND event which is caught by a custom bound method. However, once it is in that method, the event.GetDC() method that... | wxpython Post Erase Background with DC | 0 | 0 | 0 | 499 |
28,829,805 | 2015-03-03T10:46:00.000 | -1 | 0 | 0 | 0 | python,scikit-learn | 28,948,827 | 1 | false | 0 | 0 | As Andreas said above, splitting criteria are coded in cython. | 1 | 0 | 1 | I need other splitting criteria for a Desicion tree than the provided 'gini' and 'entropy. I want to use the wonderful sklearn package as base though. Is there a way to go around the C-implementation of the tree building process? As in implementing the criterion in Python and let the TreeBuilder work with it? | Create splitting criterion for sklearn trees | -0.197375 | 0 | 0 | 601 |
28,839,976 | 2015-03-03T19:10:00.000 | 2 | 0 | 0 | 0 | python,pandas,xlsxwriter | 28,862,593 | 1 | false | 0 | 0 | I found xlwings. It's intuitive and does all the things I want to do. Also, it does well with all pandas data types. | 1 | 1 | 1 | Is it possible to write nice-formatted excel files with dataframe.to_excel-xlsxwriter combo?
I am aware that it is possible to format cells when writing with pure xlsxwriter. But dataframe.to_excel takes so much less space.
I would like to adjust cell width and add some colors to column names.
What other alternatives w... | How to do formmating with combination of pandas dataframe.to_excel and xlsxwriter? | 0.379949 | 1 | 0 | 100 |
28,840,855 | 2015-03-03T19:58:00.000 | 0 | 0 | 1 | 0 | python,terminal,bioinformatics | 28,840,911 | 1 | false | 0 | 0 | Assuming you are running Ubuntu, run sudo apt-get -yinstall python-cairo python-gobject python-gtk2 to ensure that the packages are installed, as your error seems to indicate that the packages are not installed. Now try running that program again. | 1 | 0 | 0 | I really don't know what I'm doing. I'm trying to run a bioinformatics program that I know is written in python, which I have one class worth of experience in a while ago. It requires installing a few things (Python 2.5.1, GTK+ 2.12.9 with glade support, pycairo-1.2.6-1, pygobject-2.12.3-1, pygtk-2.10.4-1, PIL-1.1.6), ... | Probably obvious - ImportError: No module named gtk | 0 | 0 | 0 | 1,105 |
28,843,234 | 2015-03-03T22:27:00.000 | 0 | 0 | 0 | 1 | python,google-app-engine,flask,blobstore,flask-wtforms | 28,857,208 | 2 | false | 1 | 0 | Okey, so the real problem was that I was giving an absolute url to the successpath argument (i.e. the first) of blobstore.create_upload_url(), causing the request notifying about the success caused a csrf error when loading the root path (/). I changed it to a path relative to the root and now just using @csrf.exempt ... | 1 | 0 | 0 | I'm running flask on app engine. I need to let users upload some files. For security reasons I have csrf = CsrfProtect(app) on the whole app, with specific url's exempted using the @csrf.exempt decorator in flask_wtf. (Better to implicitly deny than to implicitly allow.)
Getting an upload url from blobstore with blobst... | GAE blobstore upload fails with CSRF token missing | 0 | 0 | 0 | 228 |
28,846,059 | 2015-03-04T03:12:00.000 | 0 | 0 | 0 | 0 | python,sockets,namespaces | 67,091,745 | 2 | false | 0 | 0 | I just came across this post while looking into network namespaces and using python to interact with them. In regards to your question about non-root users running the setns(), or similar functions, I believe that is achievable. In a small script that creates the red and blue namespaces mentioned in this post, you coul... | 1 | 8 | 0 | I am running some application in multiple network namespace. And I need to create socket connection to the loopback address + a specific port in each of the name space. Note that the "specific port" is the same across all network namespaces. Is there a way I can create a socket connection like this in python?
Appreciat... | Can I open sockets in multiple network namespaces from my Python code? | 0 | 0 | 1 | 6,844 |
28,848,106 | 2015-03-04T06:42:00.000 | 1 | 0 | 1 | 0 | python,python-2.7,argparse | 28,848,239 | 2 | false | 0 | 0 | argparse allows you to specify that certain args have their own args, like so:
parser.add_argument("--snap", nargs=1)
or use a + to allow for an arbitrary number of "subargs"
After you call parse_args(), the values will be in a list:
filename = args.snap[0] | 1 | 1 | 0 | I want to write a python code in which, based on some arguments passed from command line I want to make positional argument optional.
For example,
My python program is test.py, and with it I can give --init, --snap, --check options. Now if I have given --snap and --check option, then file name is compulsory i.e.
test.... | How to make positional argument optional in argparser based on some condition in python | 0.099668 | 0 | 0 | 480 |
28,848,740 | 2015-03-04T07:27:00.000 | 1 | 0 | 0 | 1 | python,google-app-engine,task-queue | 28,849,410 | 1 | false | 1 | 0 | You can specify as many queues as you like in queue.yaml rather than just using the default push queue. If you feel that no more than, say, five users at once are likely to contest for simultaneous use of them then simply define five queues. Have a global counter that increases by one and wraps back to 1 when it exceed... | 1 | 2 | 0 | In my application, I need to allow only one task at a time per user. I have seen that we can set max_concurrent_requests: 1 in queue.yaml. but this will allows only one task at a time in a queue.
When a user click a button, a task will be initiated and it will add 50 task to the queue. If 2 user click the button in alm... | Task queue: Allow only one task at a time per user | 0.197375 | 0 | 0 | 406 |
28,850,205 | 2015-03-04T08:57:00.000 | 0 | 0 | 0 | 0 | python,windows,visual-studio,opencv,login | 28,854,271 | 1 | false | 0 | 0 | You can store the snapshots in an array, run your recognition on each image and see if the user is recognized as one of the users you have trained your model on.
If not then prompt the user for their name, if the name matches one of the users you trained your model on, add these snapshots to their training set and re-t... | 1 | 0 | 1 | maybe some of you can point me in the right direction.
I've been playing around with OpenCV FaceRecognition for some time with Eigenfaces to let it learn to recognize faces. Now I would like to let it run during windows logon.
Precisely, I want to make Snapshots of Faces when I log into a user so after the software ha... | opencv FaceRecognition during login | 0 | 0 | 0 | 211 |
28,850,653 | 2015-03-04T09:20:00.000 | 0 | 0 | 0 | 0 | python,plone | 28,862,411 | 2 | false | 1 | 0 | You could override Products/CMFPlone/skins/plone_login/require_login.py and add any logic that you want there to give a custom response.
Or bypass require_login completely and use an own browser view to handle this. In your Plone Site go to acl_users/credentials_cookie_auth/manage_propertiesForm and for the Login Form... | 1 | 1 | 0 | Upon unauthorized access, Plone by default provides a redirect to login form. I need to prevent this for certain subpaths (ie. not globally), and instead return 403 Forbidden, with a custom (short) HTML page, after the (otherwise) normal Plone authentication & authorization has taken place.
I looked into ITraversable b... | how to generate custom 403 HTTP responses in Plone (prevent redirect) | 0 | 0 | 0 | 172 |
28,853,923 | 2015-03-04T11:59:00.000 | 0 | 0 | 1 | 1 | python,subprocess,popen,notepad | 28,854,681 | 3 | false | 0 | 0 | Found the exact solution from Alex K's comment. I used pywinauto to perform this task. | 1 | 2 | 0 | I am trying to open Notepad using popen and write something into it. I can't get my head around it. I can open Notepad using command:
notepadprocess=subprocess.Popen('notepad.exe')
I am trying to identify how can I write anything in the text file using python. Any help is appreciated. | Python Subprocess for Notepad | 0 | 0 | 0 | 1,546 |
28,854,821 | 2015-03-04T12:42:00.000 | 0 | 0 | 0 | 0 | python,pandas,binary,hex | 28,858,326 | 1 | false | 0 | 0 | If I understood, in column 1 you have 00, column 2 : 55, ...
If I am right, you first need to concat three columns in a string value = str(col1)+str(col2)+str(col3) and then use the method to convert it in binary. | 1 | 1 | 1 | I am pretty new to Python and pandas library, i just learned how to read a csv file using pandas.
my data is actually raw packets i captured from sensor networks, to analyze corrupt packets.
what i have now is, thousands of rows and hundreds of columns, literally, and the values are all in Hex. i need to convert all t... | converting dataframe from Hex to binary in using python | 0 | 0 | 0 | 778 |
28,856,501 | 2015-03-04T14:06:00.000 | 2 | 0 | 0 | 0 | python,macos,oop,tkinter | 28,856,654 | 1 | true | 0 | 1 | No, there is no built-in way to do it. It's your code doing the packing, so you can store a flag in a dictionary, or create your own pack function to do that automatically. | 1 | 0 | 0 | I'm making a GUI with Tkinter, and I need to find a way to know if a widget (let's call it l = Label(root, text="test")) is packed or not. I know I can do if l in Tk.pack_slaves(root):..., but this seems inefficient.
Is there any way of adding a "line" to the widget.pack() method, such as telling it to set an attribute... | Tkinter "on-pack" method or "is-packed" attribute | 1.2 | 0 | 0 | 473 |
28,856,908 | 2015-03-04T14:25:00.000 | 0 | 0 | 1 | 0 | python,import,subdirectory | 28,859,755 | 1 | false | 0 | 0 | I did not get any response, so my solution was to make a class in my main directory that stores the variables and replace all references to those variables. I guess the way I designed this code was bad practice anyway. It is working now. | 1 | 0 | 0 | I have a main folder, with a a main method.
This is the structure:
A main directory
subdirectory A
subdirectory B
Now from the B subdirectory, I would like to access the static variables from a class in A. However, they always end up being 0 (initialization value). When I print from the Main method, the values are corr... | Variables in other folder are not the same (Python) | 0 | 0 | 0 | 32 |
28,860,799 | 2015-03-04T17:20:00.000 | 2 | 0 | 1 | 0 | python,encryption,data-manipulation | 28,861,578 | 1 | true | 0 | 0 | This is impossible to solve. You should use some kind of encryption or signature scheme to make sure the data is not tampered with in combination with obfuscation so that the secret algorithm or secret key cannot be easily extracted from the ciphertext.
Since this is about tamper protection and not data confidentiality... | 1 | 0 | 0 | I'm fairly new to Python and as a project I'm working on a little game. I'd like to make sure my data is stored in a format that I won't run into problems moving forward.
The data I'll need to store will be integral to generating some in-game elements through procedural generation—essentially storing names, properties... | How Can I store data so users can't easily tamper with it? | 1.2 | 0 | 0 | 102 |
28,864,152 | 2015-03-04T20:22:00.000 | 2 | 1 | 0 | 0 | python,django,testing,python-unittest | 28,864,271 | 1 | true | 1 | 0 | This most likely means you've got some component installed which is trying to make network connections. Possibly something that does monitoring or statistics gathering?
The simplest way to figure out what's going on is to use tcpdump to capture your network traffic and see what's going on. To do that:
Run tcpdump -i a... | 1 | 2 | 0 | I have a django test suite that builds a DB from a 400 line fixture file. It runs unfortunately slow. Several seconds per test.
I was on the train yesterday developing without internet access, with my wifi turned off, and I noticed my tests ran literally 10x faster without internet. And they are definitely running cor... | Django Tests run faster with no internet connection | 1.2 | 0 | 0 | 523 |
28,865,200 | 2015-03-04T21:20:00.000 | 2 | 1 | 1 | 0 | python,algorithm,math | 28,866,275 | 1 | false | 0 | 0 | Floating point numbers are stored in binary in python. Accuracy and precision have totally different implications in binary, especially given that computers are constrained to fixed-length representations. You can demonstrate that to yourself simply by noting that the code 1e16+1 == 1e16 returns True.
You linked to Wol... | 1 | 0 | 0 | Given a double, what is the most efficient way to calculate the precision and accuracy of the number? Ideally, I'd like to avoid for loops. | Precision and Accuracy | 0.379949 | 0 | 0 | 458 |
28,874,356 | 2015-03-05T09:32:00.000 | 7 | 0 | 0 | 1 | python,c++,macos,installation,blpapi | 29,039,670 | 1 | false | 0 | 0 | There is a missing step in the Python SDK README file; it instructs you to set BLPAPI_ROOT in order to build the API wrapper, but this doesn't provide the information needed at runtime to be able to load it.
If you unpacked the C/C++ SDK into '/home/foo/blpapi-sdk' (for example), you will need to set DYLD_LIBRARY_PATH ... | 1 | 3 | 0 | I am trying to install and run successfully Bloomberg API Python 3.5.5 and I have also downloaded and unpacked C++ library 3.8.1.1., both for the Mac OS X. I'm running Mac OS X 10.10.2. I am using the Python native to Mac OS X, Python 2.7.6 and I had already installed, via Xcode, the Command line gcc compiler, GCC 4.... | Bloomberg API Python 3.5.5 with C++ 3.8.1.1. on Mac OS X import blpapi referencing | 1 | 0 | 0 | 3,384 |
28,877,499 | 2015-03-05T12:05:00.000 | 0 | 0 | 0 | 0 | python,django,pagination | 28,939,075 | 2 | true | 1 | 0 | You've all been really helpful. However the my confusion came from the fact that paginator was being added to the context, yet there was a statement {% load paginator %} at the top of the template. I thought they were the same, but no. The paginator from the context was unused, and the load statement pulled in the bad... | 1 | 0 | 0 | My code imports Paginator from django.core.paginator. (Django 1.6.7)
However, when run, somehow it is calling a custom paginator. I don't want it to do this, as the custom paginator template has been removed in an upgrade. I just want Django's Paginator to be used, but I can't find how to workout where it's overriding... | Django keeps calling another package to paginate -- how? | 1.2 | 0 | 0 | 36 |
28,877,646 | 2015-03-05T12:14:00.000 | 0 | 0 | 0 | 1 | python,python-2.7,celery,py2exe | 28,878,537 | 1 | false | 0 | 0 | if __name__ == '__main__':
app.start()
should be added to the entry point of the script. | 1 | 0 | 0 | Is it possible to use Celery to run an already compiled (py2exe) python script, if yes, how I can invoke it ? | Is it possible to use Celery to run an already compiled (py2exe) python script | 0 | 0 | 0 | 94 |
28,879,391 | 2015-03-05T13:50:00.000 | 3 | 0 | 1 | 0 | python,excel,xlsx | 28,879,986 | 1 | false | 0 | 0 | It depends on the application you are using to view the file. You will have to check the features available in the tools you are using.
For instance, in Excel, this is impossible. When you open an Excel document, it actually creates an invisible copy. You are not editing the original. It is only when the file is saved ... | 1 | 2 | 0 | Is it possible to add or remove entries to an excel file or a text file while it is still open (viewing live update of values from python output) instead of seeing the output in terminal? | Editing an open document with python | 0.53705 | 1 | 0 | 2,289 |
28,882,541 | 2015-03-05T16:16:00.000 | 8 | 0 | 1 | 0 | python,spyder | 43,925,127 | 6 | false | 0 | 0 | For Spyder IDE just go to View -> Reset window layout | 3 | 28 | 0 | New to Python and Spyder. How do I reposition the panes in Spyder. I had them set with the editor in the upper left, the object inspector in the upper right, and the ipython console in the lower left. Somehow I messed it up, and can't figure out how to reposition them. Have crawled all over the web, but no joy.
Thank... | repositioning panes in Spyder panes | 1 | 0 | 0 | 42,169 |
28,882,541 | 2015-03-05T16:16:00.000 | 2 | 0 | 1 | 0 | python,spyder | 46,728,994 | 6 | false | 0 | 0 | just go to view->click on spyder default layout
that should work | 3 | 28 | 0 | New to Python and Spyder. How do I reposition the panes in Spyder. I had them set with the editor in the upper left, the object inspector in the upper right, and the ipython console in the lower left. Somehow I messed it up, and can't figure out how to reposition them. Have crawled all over the web, but no joy.
Thank... | repositioning panes in Spyder panes | 0.066568 | 0 | 0 | 42,169 |
28,882,541 | 2015-03-05T16:16:00.000 | 1 | 0 | 1 | 0 | python,spyder | 60,206,028 | 6 | false | 0 | 0 | On windows click on the 3 bars at the upright corner of the pane, undock and move the pane where you want. On Linux unselect View > lock panes and toolbars and move your pane. | 3 | 28 | 0 | New to Python and Spyder. How do I reposition the panes in Spyder. I had them set with the editor in the upper left, the object inspector in the upper right, and the ipython console in the lower left. Somehow I messed it up, and can't figure out how to reposition them. Have crawled all over the web, but no joy.
Thank... | repositioning panes in Spyder panes | 0.033321 | 0 | 0 | 42,169 |
28,882,759 | 2015-03-05T16:27:00.000 | 0 | 0 | 1 | 0 | python,environment-variables,virtualenv | 28,882,976 | 2 | false | 0 | 0 | Depending on what operating system you are using you could edit the activate file and set an environment variable there. For example, a Windows virtualenv folder has a sub-folder called Scripts. Inside scripts is the activate.bat file. Edit activate.bat and alter the path variable. One thing to consider though, is ... | 2 | 0 | 0 | I'd like to alter my $PATH only in a Python virtual environment. Is it possible to have the $PATH change when I activate a virtual environment? | python virtualenv -- possible to augment $PATH or add other environment variables? | 0 | 0 | 0 | 155 |
28,882,759 | 2015-03-05T16:27:00.000 | 1 | 0 | 1 | 0 | python,environment-variables,virtualenv | 28,882,980 | 2 | true | 0 | 0 | You can write an activation script that sources virtualenv's activate (on linux, or calls the bat file on windows) and then updates PATH, PYTHONPATH and other environment variables. Use the virtualenv bootstrap hooks to install the script when the virtualenv is created and call it instead of activate. | 2 | 0 | 0 | I'd like to alter my $PATH only in a Python virtual environment. Is it possible to have the $PATH change when I activate a virtual environment? | python virtualenv -- possible to augment $PATH or add other environment variables? | 1.2 | 0 | 0 | 155 |
28,885,814 | 2015-03-05T19:13:00.000 | 1 | 0 | 0 | 0 | python-2.7,igraph | 28,891,088 | 2 | false | 0 | 0 | Pickle is a serializer from the standard library in Python. These guesses seem quite likely to me:
When igraph was started they did not want to create an own file format so they used pickle. Now the default behavior for saving graphs is not pickle but the own format.
When saving objects with igraph in graphml, the libr... | 2 | 1 | 1 | I am a beginner in igraph.
I have a graph data of 60000 nodes and 900K edges. I could successfully create the graph using python-igraph and write to disk. My machine has 3G memory.
When I wrote the graph to disk in graphml format, the memory usage was around 19%; with write_pickle, the usage went up to 50% and took si... | python-igraph pickling efficiency | 0.099668 | 0 | 0 | 650 |
28,885,814 | 2015-03-05T19:13:00.000 | 1 | 0 | 0 | 0 | python-2.7,igraph | 28,895,245 | 2 | true | 0 | 0 | Pickling is a generic format to store arbitrary objects, which may reference other objects, which may in turn also reference other objects. Therefore, when Python is pickling an object, it must keep track of all the objects that it has "seen" and serialized previously to avoid getting stuck in an infinite loop. That's ... | 2 | 1 | 1 | I am a beginner in igraph.
I have a graph data of 60000 nodes and 900K edges. I could successfully create the graph using python-igraph and write to disk. My machine has 3G memory.
When I wrote the graph to disk in graphml format, the memory usage was around 19%; with write_pickle, the usage went up to 50% and took si... | python-igraph pickling efficiency | 1.2 | 0 | 0 | 650 |
28,888,290 | 2015-03-05T21:40:00.000 | 0 | 0 | 1 | 0 | python,import,python-import | 28,888,521 | 1 | false | 0 | 0 | I needed to add import conda to the script above the other imports because I have tables installed in anaconda | 1 | 0 | 0 | If I start python and input import tables it works fine but when I run python m_BlackrockLib.py (which has import os, struct, tables, pickle, re, shutil as it's first line) I get the error ImportError: No module named tables. I can see that tables is present in /usr/local/anaconda/lib/python2.7/site-package so I'm not ... | Python failing to import module from script | 0 | 0 | 0 | 74 |
28,891,305 | 2015-03-06T02:13:00.000 | 0 | 1 | 0 | 1 | python,linux,ssh,terminal | 28,891,431 | 2 | false | 0 | 0 | Things to try:
nohup, or
screen | 1 | 1 | 0 | From my home pc using putty, I ssh'ed into a remote server, and I ran a python program that takes hours to complete, and as it runs it prints stuff. Now after a while, my internet disconnected, and I had to close and re-open putty and ssh back in. If I type 'top' I can see the python program running in the background w... | How to open process again in linux terminal? | 0 | 0 | 0 | 1,139 |
28,892,506 | 2015-03-06T04:47:00.000 | 2 | 0 | 1 | 0 | python,travis-ci,anaconda,conda | 28,909,473 | 2 | true | 0 | 0 | The requirements in the meta.yaml can be any conda package (which doesn't have to just be Python packages). If you have a conda package for your dependency, you can specify it. | 1 | 3 | 0 | I am writing a meta.yaml file for a python package to be used in conda packages in a way that works with CI systems. how can i specify external software requirements for the package? meaning software that is not a python library but is required for the package unit tests to pass? to clarify: the required module is not ... | how to specify external software requirements with conda/meta.yaml in Python? | 1.2 | 0 | 0 | 1,203 |
28,894,339 | 2015-03-06T07:53:00.000 | 1 | 0 | 0 | 0 | python,django,django-forms,django-formwizard | 28,894,444 | 2 | false | 1 | 0 | One approach that you could consider is splitting up your model into semantic slices, each one being a model on its own with a more digestable number of fields.
Then map these "slice-models" back to your main object using a one-to-one relationship (implemented by OneToOneField).
In your wizard you could start a transac... | 1 | 0 | 0 | I'm new to django and would like to hear your opinion on how to create a form for
a table with 540 fields. What would be the best approach? Is it best to split the modelform into multiple components or create a template that collects the input in parts (multiple inputs per page) and proceeds through all fields? It woul... | create input form for 540 fields in django. Best approach? | 0.099668 | 0 | 0 | 50 |
28,894,741 | 2015-03-06T08:22:00.000 | 2 | 0 | 1 | 0 | python,code-generation,abstract-syntax-tree,grako | 28,953,859 | 1 | false | 0 | 0 | Grako-style code generation is done through in-line templates using string.Formatter.
Look into the grako.codegen and grako.model modules/packages, and take a look at the examples/antlr2grako example.
Code generation is one of the least documented parts of Grako (in the README), but it is all there. | 1 | 3 | 0 | I am using grako utility of python to parse my OIL file to AST. but i want to re generate the source code back from the AST after modifying the AST. Is grako is having feature to do this or else any other utility in python is available for this source code re generation. | Source code generation | 0.379949 | 0 | 0 | 157 |
28,896,055 | 2015-03-06T09:43:00.000 | 1 | 0 | 1 | 0 | python,multiprocessing | 28,896,285 | 2 | false | 0 | 0 | The Queue has no way of knowing when it does not have any possible writers anymore. You could pass the object to any number of subprocesses, and it does not know if you passed it to any given subprocess. So it will have to wait, even if a subprocess dies. A queue is not a file descriptor that is automatically closed wh... | 1 | 4 | 0 | I have a subprocess via multiprocessing.Process and a queue via multiprocessing.Queue.
The main process is using multiprocessing.Queue.get() to get some new data. I don't want to have a timeout there and I want it to be blocking.
However, when the child process dies for whatever reason (manually killed by user via kill... | multiprocessing.Queue hanging when Process dies | 0.099668 | 0 | 0 | 1,360 |
28,898,827 | 2015-03-06T12:29:00.000 | 1 | 0 | 0 | 1 | python,google-app-engine,google-cloud-datastore | 29,608,781 | 1 | true | 1 | 0 | It's not recommended to dynamically create a new table. You need to redesign your database relation structure.
For example in a user messaging app instead of making a new table for every new message [ which contains message and user name] , you should rather create a User table and Messagestable separately and impleme... | 1 | 0 | 0 | I wish to implement this:
There should be an entity A with column 1 having values a,b,c...[dynamically increases by user's input]
There should be another entity B for each values of a , b , c..
How should I approach this problem?
Should I dynamically generate other entities as user creates more [a,b,c,d... ] ?
If yes ... | How to create multiple entities dynamically in google app engine using google data storage(python) | 1.2 | 0 | 0 | 165 |
28,900,091 | 2015-03-06T13:43:00.000 | 1 | 0 | 0 | 0 | python,python-2.7,caching,flask,gunicorn | 50,258,834 | 2 | false | 1 | 0 | For your use case with gunicorn, there is no multi-threading issue since each service run single-threadedly in its own process. But a potential problem would be "dirty" read of the data.
Think about the following case:
process1 read from db and populate its own cache, cache1
process2 read from the same table using the... | 1 | 8 | 0 | We are using the following setup: NGINX+Gunicorn+Flask. We need to add just a little bit of caching, no more than 5Mb per Flask worker. SimpleCache seems to be simplest possible solution - it uses memory locally, inside the Python process itself.
Unfortunately, the documentation states the following:
"Simple memory ... | What can go wrong if I use SimpleCache in my Flask app | 0.099668 | 0 | 0 | 3,322 |
28,903,187 | 2015-03-06T16:28:00.000 | 0 | 0 | 0 | 0 | django,facebook,rest,django-rest-framework,python-social-auth | 38,586,945 | 1 | false | 1 | 0 | i didn't unerstand the first case, when you are using facebook login it does the authentication and we will register the user with the access token provided by facebook. When ever user log in we are not worried about the password, authentication is not done on our end. so when ever user tries to login it contacts faceb... | 1 | 1 | 0 | I have to implement a REST backend for mobile applications.
I will have to use Django REST Framework.
Among the features that I need to implement there will be the registration user and login.
Through the mobile application the user can create an account using ONLY the Facebook login.
Then, the application will take t... | Django REST Backend for mobile app with Facebook login | 0 | 0 | 0 | 779 |
28,903,499 | 2015-03-06T16:44:00.000 | 1 | 0 | 0 | 1 | python,ubuntu,networking,hostname,mininet | 29,895,418 | 2 | false | 0 | 0 | I don't think you can get different names by running the "hostname" on each host. Only networking-related commands will produce different results on different hosts because the hosts run on separated namespaces.
So perhaps one way to get the hostname is to run ifconfig and intepret the hostname from the interfaces' nam... | 2 | 2 | 0 | I need to emulate a network with n hosts connected by a switch. The perfect tool for this seems to be mininet. The problem is that I need to run a python script in every host that makes use of the hostname. The skript acts different depending on the hostname, so this is very important for me :)
But the hostname seems t... | Change hostname in mininet host | 0.099668 | 0 | 0 | 1,568 |
28,903,499 | 2015-03-06T16:44:00.000 | 1 | 0 | 0 | 1 | python,ubuntu,networking,hostname,mininet | 43,475,651 | 2 | false | 0 | 0 | I finally figure out how to do it , first you need to run the "ifconfig" command from inside the program and storing it in a variable , second you use regular expressions 're' to grab the text , I use it to grab the addressees of my hosts...you can do the same for the hostname
code:
getip():
ifconfig_output=... | 2 | 2 | 0 | I need to emulate a network with n hosts connected by a switch. The perfect tool for this seems to be mininet. The problem is that I need to run a python script in every host that makes use of the hostname. The skript acts different depending on the hostname, so this is very important for me :)
But the hostname seems t... | Change hostname in mininet host | 0.099668 | 0 | 0 | 1,568 |
28,904,066 | 2015-03-06T17:15:00.000 | 4 | 0 | 1 | 1 | python,api,anaconda,blpapi | 28,947,897 | 1 | false | 0 | 0 | This is not true. The Anaconda Python and Python extension modules are built using Visual Studio (2008 for Python 2 and 2010 for Python 3, the same as the Python installers from python.org). | 1 | 1 | 0 | I spent hours yesterday trying to get the blapi up and running and finally gave in and emailed their support, this is the response:
"Unfortunately our BLPAPI SDKs are not compatible with the Anaconda
distribution of Python. That Python is built using GCC, and it is not
capable of loading DLLs that were built using... | Bloomberg API SDK not compatible with Anaconda Python | 0.664037 | 0 | 0 | 1,122 |
28,904,565 | 2015-03-06T17:44:00.000 | 0 | 1 | 1 | 0 | php,python,matlab,import | 28,905,871 | 2 | false | 0 | 0 | I'm not sure about your question, but maybe your IDE can help you to get rid of those imports. For example, in Spyder you can execute a startup script that will run when a new console is launched. Placing your imports there would provide direct access to those files. | 1 | 1 | 0 | As I've mentioned before I originally came from a Matlab background and then moved onto PHP before discovering Python. In both Matlab and PHP there were ways to create a scripts that when run all the variables got dumped into your current workspace. That workspace in Matlab being the interpreter when called from there ... | Python module variables into current workspace | 0 | 0 | 0 | 1,278 |
28,908,468 | 2015-03-06T22:04:00.000 | 1 | 0 | 0 | 0 | python,scikit-learn | 28,910,572 | 1 | true | 0 | 0 | Not with anything built into scikit-learn, as removing rows is something that is not easily done in the current API.
It should be quite easy to write a custom function / class that does that based on the output of DictVectorizer. | 1 | 0 | 1 | I am setting up a classification system using scikit-learn. After training a classifier I would like to save it for reuse along with the necessary transforms such as the DictVectorizer.
I am looking for a way to filter the incoming stream of unclassified data that will feed into the feature transforms and classifier... | Identify Data Vectors with New Attributes and/or Values | 1.2 | 0 | 0 | 34 |
28,909,360 | 2015-03-06T23:26:00.000 | 0 | 0 | 1 | 0 | python,xlsxwriter | 28,909,616 | 2 | false | 0 | 0 | Instead of assigning the variable worksheet to workbook.add_worksheet(thename), have a list called worksheets. When you normally do worksheet = workbook.add_worksheet(thename), do worksheets.append(workbook.add_worksheet(thename)). Then access your latest worksheet with worksheets[-1]. | 1 | 1 | 0 | I've written some code that iterates through a flat file. After a certain section is completed reading, I take the data and put it into a spreadsheet. Then, I go back and continue reading the flat file for the next section and write to a new worksheet...and so on and so forth.
When looping through the python code, I cr... | python xlsxwriter worksheet object reuse | 0 | 1 | 0 | 1,050 |
28,909,929 | 2015-03-07T00:27:00.000 | 0 | 0 | 1 | 0 | python,pandas,datanitro | 28,910,528 | 1 | false | 0 | 0 | Right click in the shell, click "mark", highlight the region you want to copy, and press enter. It'll then be in your clipboard and you can paste it into an editor.
(This is the way to copy things from a windows command prompt in general, which is where the shell is running.) | 1 | 2 | 0 | I'm using DataNitro and would like to be able to copy output from the Excel Shell and paste into my editor. However, I can't find a way to do that. Any idea how I might do that? | DataNitro - copying from the shell into an editor | 0 | 0 | 0 | 110 |
28,911,280 | 2015-03-07T04:12:00.000 | -2 | 0 | 1 | 0 | python,list,sorting | 28,911,603 | 3 | false | 0 | 0 | For the range command you have to put two exclusive integers as parameters for example range(0,11) will pick a number between 1 and 10. This is probably why you can use range(). Also you need to use a column to follow range():. | 1 | 1 | 0 | I have to alphabetically sort a text file where each new word is on a new line. I currently have the whitespace stripped and my program prints the first letter attaching it to a integer with the ord function. I cannot use sort and I know I have to put it into a list just not sure how. This is what i wrote for the list... | How to alphabetically sort a text file in python without sort function? | -0.132549 | 0 | 0 | 1,361 |
28,913,310 | 2015-03-07T09:23:00.000 | 3 | 0 | 1 | 0 | python,string,eof | 28,913,362 | 1 | false | 0 | 0 | There is no EOF character.... Usually it is just when you run out of data. If you really want one, you could just make some arbitrary string combination up, but you are probably better off just reading each line until the file is out of data. | 1 | 6 | 0 | how can I store in a variable, a string containing the EOF character? In other words, how can I represent EOF in a python string?
Thanks in advance | String with EOF in python | 0.53705 | 0 | 0 | 16,285 |
28,915,681 | 2015-03-07T14:04:00.000 | 1 | 0 | 0 | 0 | python,qt,pyqt | 28,923,741 | 3 | true | 0 | 1 | QWidget.sizeHint holds the recommended size for the widget. It's default implementation returns the layout's preferred size if the widget has a layout. So if your dialog has a layout, just use sizeHint to get the recommended size which is the default one. | 1 | 0 | 0 | When I create a QMainWindow without explicitly specifying its dimensions, PyQt will give it a -let's say- "standard size" which is not the minimum that the window can get.
Can I set this size at will in any way?
My goal is to get this "standard size" according to the currently visible widgets, when I set the visibility... | how to get the default size of a window in pyqt4 | 1.2 | 0 | 0 | 1,830 |
28,915,998 | 2015-03-07T14:38:00.000 | 0 | 0 | 1 | 0 | python,pyscripter,abaqus | 29,386,384 | 2 | false | 0 | 0 | I don't think its possible. You can only import abaqus modules when python is run from the abaqus executable, i.e. by issuing the 'abaqus python' command. I don't know why this is, perhaps someone else can enlighten us.
I didn't want to use the abaqus PDE either and spent ages trying to get around it. I have resorted ... | 1 | 1 | 0 | How to install Pyscripter for using with Abaqus finite element program? I don't want to use Abaqus PDE. The pyscripter works ok on it's own, but it shows Import Error "only" for modules related to Abaqus finite element software. I have directed the Python path to Abaqus Python executable, however it doesn't help. | Pyscripter doesn't work with Abaqus Python | 0 | 0 | 0 | 234 |
28,921,545 | 2015-03-07T23:58:00.000 | 17 | 0 | 1 | 1 | python,pyinstaller | 35,067,170 | 1 | false | 0 | 0 | PyInstaller 3.0 includes the --uac-admin option! | 1 | 5 | 0 | I need to create an executable for windows 8.1 and lower, so I tried Py2Exe (no success) and then PyInstaller, and damn it, it worked.
Now I need to run it as admin (everytime since that uses admin tasks).
My actual compiling script looks like this :
python pyinstaller.py --onefile --noconsole --icon=C:\Python27\my_di... | Create executable that uses admin rights with Pyinstaller | 1 | 0 | 0 | 7,070 |
28,921,711 | 2015-03-05T18:15:00.000 | 1 | 0 | 1 | 0 | python | 28,921,713 | 2 | false | 0 | 0 | In Python, the append method mutates the list it was called on but does not return it. There's not much reason to either, since you already have a reference to the list. | 1 | 0 | 0 | A=['1']
C=A.append('1')
print C
Why is the above code return None but not ['1', '1'] in Python ? | Why C=A.append('1') doesn't work in Python | 0.099668 | 0 | 0 | 85 |
28,921,997 | 2015-03-08T01:11:00.000 | 1 | 0 | 0 | 0 | python,android,pygame,renpy | 28,922,150 | 1 | false | 0 | 1 | I e-mailed PyTom, the creator of Ren'py, and he responded back instantly:
"Edit the rapt/blacklist.txt file, and delete the line that says **.py. "
It worked! Thanks, PyTom. | 1 | 0 | 0 | I have this game which I have coded in python with pygame.
When I launch my game through the renpy launcher, it works just fine.
When I emulate my game through the renpy android emulator, it works just fine.
When I go through each of the build steps (install sdk, configure, build package, install package) it completes... | Ren'Py with Renpygame for Android | 0.197375 | 0 | 0 | 1,556 |
28,923,393 | 2015-03-08T05:24:00.000 | -1 | 1 | 0 | 1 | python,linux,centos | 37,664,878 | 5 | false | 0 | 0 | -bash: /usr/bin/yum: /usr/bin/python: bad interpreter: Permission denied then
first remove python follow command line
-- sudo rpm -e python
second check which package install this command line
-- sudo rpm -q python
then install package
-- sudo yum install python*
i think this problem solve | 3 | 5 | 0 | I am new in centos.I am try to do an application on it.For my application I need to install python 2.7.But the default one on server was python 2.6. So tried to upgrade the version .And accidentally I deleted the folder /usr/bin/python.After that I Installed python 2.7 through make install.I created the folder again /u... | -bash: /usr/bin/yum: /usr/bin/python: bad interpreter: Permission denied | -0.039979 | 0 | 0 | 45,325 |
28,923,393 | 2015-03-08T05:24:00.000 | 3 | 1 | 0 | 1 | python,linux,centos | 40,200,244 | 5 | false | 0 | 0 | yum doesn't work with python2.7.
You should do the following
vim /usr/bin/yum
change
#!/usr/bin/python
to
#!/usr/bin/python2.6
If your python2.6 was deleted, then reinstall them and point the directory in /usr/bin/yum to your python2.6 directory. | 3 | 5 | 0 | I am new in centos.I am try to do an application on it.For my application I need to install python 2.7.But the default one on server was python 2.6. So tried to upgrade the version .And accidentally I deleted the folder /usr/bin/python.After that I Installed python 2.7 through make install.I created the folder again /u... | -bash: /usr/bin/yum: /usr/bin/python: bad interpreter: Permission denied | 0.119427 | 0 | 0 | 45,325 |
28,923,393 | 2015-03-08T05:24:00.000 | 0 | 1 | 0 | 1 | python,linux,centos | 62,297,081 | 5 | false | 0 | 0 | this problem is that yum file start head write #!/usr/local/bin/python2.6， write binary file， is not dir， is python binary file | 3 | 5 | 0 | I am new in centos.I am try to do an application on it.For my application I need to install python 2.7.But the default one on server was python 2.6. So tried to upgrade the version .And accidentally I deleted the folder /usr/bin/python.After that I Installed python 2.7 through make install.I created the folder again /u... | -bash: /usr/bin/yum: /usr/bin/python: bad interpreter: Permission denied | 0 | 0 | 0 | 45,325 |
28,927,247 | 2015-03-08T13:57:00.000 | 0 | 0 | 0 | 0 | python,django,python-3.4,django-1.7,photologue | 31,394,483 | 3 | false | 1 | 0 | I had exactly the same problem. I suspected some problem with django-sortedm2m package. To associate photo to gallery, it was using SortedManyToMany() from sortedm2m package. For some reason, the admin widget associated with this package did not function well. (I tried Firefox, Chrome and safari browser).
I actually ... | 2 | 0 | 0 | after I put the photologue on the server, I have no issue with uploading photos.
the issue is when I am creating a Gallery from the admin site, I can choose only one photo to be attached to the Gallery. even if I selected many photos, one of them will be linked to the Gallery only.
The only way to add photos to a galle... | Gallery in Photologue can have only one Photo | 0 | 1 | 0 | 184 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.