repo stringlengths 7 63 | file_url stringlengths 81 284 | file_path stringlengths 5 200 | content stringlengths 0 32.8k | language stringclasses 1 value | license stringclasses 7 values | commit_sha stringlengths 40 40 | retrieved_at stringdate 2026-01-04 15:02:33 2026-01-05 05:24:06 | truncated bool 2 classes |
|---|---|---|---|---|---|---|---|---|
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Document/Properties.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Document/Properties.php | <?php
namespace PhpOffice\PhpSpreadsheet\Document;
use DateTime;
use PhpOffice\PhpSpreadsheet\Shared\IntOrFloat;
class Properties
{
/** constants */
public const PROPERTY_TYPE_BOOLEAN = 'b';
public const PROPERTY_TYPE_INTEGER = 'i';
public const PROPERTY_TYPE_FLOAT = 'f';
public const PROPERTY_TYPE_DATE = 'd';
public const PROPERTY_TYPE_STRING = 's';
public const PROPERTY_TYPE_UNKNOWN = 'u';
private const VALID_PROPERTY_TYPE_LIST = [
self::PROPERTY_TYPE_BOOLEAN,
self::PROPERTY_TYPE_INTEGER,
self::PROPERTY_TYPE_FLOAT,
self::PROPERTY_TYPE_DATE,
self::PROPERTY_TYPE_STRING,
];
/**
* Creator.
*
* @var string
*/
private $creator = 'Unknown Creator';
/**
* LastModifiedBy.
*
* @var string
*/
private $lastModifiedBy;
/**
* Created.
*
* @var float|int
*/
private $created;
/**
* Modified.
*
* @var float|int
*/
private $modified;
/**
* Title.
*
* @var string
*/
private $title = 'Untitled Spreadsheet';
/**
* Description.
*
* @var string
*/
private $description = '';
/**
* Subject.
*
* @var string
*/
private $subject = '';
/**
* Keywords.
*
* @var string
*/
private $keywords = '';
/**
* Category.
*
* @var string
*/
private $category = '';
/**
* Manager.
*
* @var string
*/
private $manager = '';
/**
* Company.
*
* @var string
*/
private $company = '';
/**
* Custom Properties.
*
* @var array{value: mixed, type: string}[]
*/
private $customProperties = [];
/**
* Create a new Document Properties instance.
*/
public function __construct()
{
// Initialise values
$this->lastModifiedBy = $this->creator;
$this->created = self::intOrFloatTimestamp(null);
$this->modified = self::intOrFloatTimestamp(null);
}
/**
* Get Creator.
*/
public function getCreator(): string
{
return $this->creator;
}
/**
* Set Creator.
*
* @return $this
*/
public function setCreator(string $creator): self
{
$this->creator = $creator;
return $this;
}
/**
* Get Last Modified By.
*/
public function getLastModifiedBy(): string
{
return $this->lastModifiedBy;
}
/**
* Set Last Modified By.
*
* @return $this
*/
public function setLastModifiedBy(string $modifiedBy): self
{
$this->lastModifiedBy = $modifiedBy;
return $this;
}
/**
* @param null|float|int|string $timestamp
*
* @return float|int
*/
private static function intOrFloatTimestamp($timestamp)
{
if ($timestamp === null) {
$timestamp = (float) (new DateTime())->format('U');
} elseif (is_string($timestamp)) {
if (is_numeric($timestamp)) {
$timestamp = (float) $timestamp;
} else {
$timestamp = preg_replace('/[.][0-9]*$/', '', $timestamp) ?? '';
$timestamp = preg_replace('/^(\\d{4})- (\\d)/', '$1-0$2', $timestamp) ?? '';
$timestamp = preg_replace('/^(\\d{4}-\\d{2})- (\\d)/', '$1-0$2', $timestamp) ?? '';
$timestamp = (float) (new DateTime($timestamp))->format('U');
}
}
return IntOrFloat::evaluate($timestamp);
}
/**
* Get Created.
*
* @return float|int
*/
public function getCreated()
{
return $this->created;
}
/**
* Set Created.
*
* @param null|float|int|string $timestamp
*
* @return $this
*/
public function setCreated($timestamp): self
{
$this->created = self::intOrFloatTimestamp($timestamp);
return $this;
}
/**
* Get Modified.
*
* @return float|int
*/
public function getModified()
{
return $this->modified;
}
/**
* Set Modified.
*
* @param null|float|int|string $timestamp
*
* @return $this
*/
public function setModified($timestamp): self
{
$this->modified = self::intOrFloatTimestamp($timestamp);
return $this;
}
/**
* Get Title.
*/
public function getTitle(): string
{
return $this->title;
}
/**
* Set Title.
*
* @return $this
*/
public function setTitle(string $title): self
{
$this->title = $title;
return $this;
}
/**
* Get Description.
*/
public function getDescription(): string
{
return $this->description;
}
/**
* Set Description.
*
* @return $this
*/
public function setDescription(string $description): self
{
$this->description = $description;
return $this;
}
/**
* Get Subject.
*/
public function getSubject(): string
{
return $this->subject;
}
/**
* Set Subject.
*
* @return $this
*/
public function setSubject(string $subject): self
{
$this->subject = $subject;
return $this;
}
/**
* Get Keywords.
*/
public function getKeywords(): string
{
return $this->keywords;
}
/**
* Set Keywords.
*
* @return $this
*/
public function setKeywords(string $keywords): self
{
$this->keywords = $keywords;
return $this;
}
/**
* Get Category.
*/
public function getCategory(): string
{
return $this->category;
}
/**
* Set Category.
*
* @return $this
*/
public function setCategory(string $category): self
{
$this->category = $category;
return $this;
}
/**
* Get Company.
*/
public function getCompany(): string
{
return $this->company;
}
/**
* Set Company.
*
* @return $this
*/
public function setCompany(string $company): self
{
$this->company = $company;
return $this;
}
/**
* Get Manager.
*/
public function getManager(): string
{
return $this->manager;
}
/**
* Set Manager.
*
* @return $this
*/
public function setManager(string $manager): self
{
$this->manager = $manager;
return $this;
}
/**
* Get a List of Custom Property Names.
*
* @return string[]
*/
public function getCustomProperties(): array
{
return array_keys($this->customProperties);
}
/**
* Check if a Custom Property is defined.
*/
public function isCustomPropertySet(string $propertyName): bool
{
return array_key_exists($propertyName, $this->customProperties);
}
/**
* Get a Custom Property Value.
*
* @return mixed
*/
public function getCustomPropertyValue(string $propertyName)
{
if (isset($this->customProperties[$propertyName])) {
return $this->customProperties[$propertyName]['value'];
}
return null;
}
/**
* Get a Custom Property Type.
*
* @return null|string
*/
public function getCustomPropertyType(string $propertyName)
{
return $this->customProperties[$propertyName]['type'] ?? null;
}
/**
* @param mixed $propertyValue
*/
private function identifyPropertyType($propertyValue): string
{
if (is_float($propertyValue)) {
return self::PROPERTY_TYPE_FLOAT;
}
if (is_int($propertyValue)) {
return self::PROPERTY_TYPE_INTEGER;
}
if (is_bool($propertyValue)) {
return self::PROPERTY_TYPE_BOOLEAN;
}
return self::PROPERTY_TYPE_STRING;
}
/**
* Set a Custom Property.
*
* @param mixed $propertyValue
* @param string $propertyType
* 'i' : Integer
* 'f' : Floating Point
* 's' : String
* 'd' : Date/Time
* 'b' : Boolean
*
* @return $this
*/
public function setCustomProperty(string $propertyName, $propertyValue = '', $propertyType = null): self
{
if (($propertyType === null) || (!in_array($propertyType, self::VALID_PROPERTY_TYPE_LIST))) {
$propertyType = $this->identifyPropertyType($propertyValue);
}
if (!is_object($propertyValue)) {
$this->customProperties[$propertyName] = [
'value' => self::convertProperty($propertyValue, $propertyType),
'type' => $propertyType,
];
}
return $this;
}
private const PROPERTY_TYPE_ARRAY = [
'i' => self::PROPERTY_TYPE_INTEGER, // Integer
'i1' => self::PROPERTY_TYPE_INTEGER, // 1-Byte Signed Integer
'i2' => self::PROPERTY_TYPE_INTEGER, // 2-Byte Signed Integer
'i4' => self::PROPERTY_TYPE_INTEGER, // 4-Byte Signed Integer
'i8' => self::PROPERTY_TYPE_INTEGER, // 8-Byte Signed Integer
'int' => self::PROPERTY_TYPE_INTEGER, // Integer
'ui1' => self::PROPERTY_TYPE_INTEGER, // 1-Byte Unsigned Integer
'ui2' => self::PROPERTY_TYPE_INTEGER, // 2-Byte Unsigned Integer
'ui4' => self::PROPERTY_TYPE_INTEGER, // 4-Byte Unsigned Integer
'ui8' => self::PROPERTY_TYPE_INTEGER, // 8-Byte Unsigned Integer
'uint' => self::PROPERTY_TYPE_INTEGER, // Unsigned Integer
'f' => self::PROPERTY_TYPE_FLOAT, // Real Number
'r4' => self::PROPERTY_TYPE_FLOAT, // 4-Byte Real Number
'r8' => self::PROPERTY_TYPE_FLOAT, // 8-Byte Real Number
'decimal' => self::PROPERTY_TYPE_FLOAT, // Decimal
's' => self::PROPERTY_TYPE_STRING, // String
'empty' => self::PROPERTY_TYPE_STRING, // Empty
'null' => self::PROPERTY_TYPE_STRING, // Null
'lpstr' => self::PROPERTY_TYPE_STRING, // LPSTR
'lpwstr' => self::PROPERTY_TYPE_STRING, // LPWSTR
'bstr' => self::PROPERTY_TYPE_STRING, // Basic String
'd' => self::PROPERTY_TYPE_DATE, // Date and Time
'date' => self::PROPERTY_TYPE_DATE, // Date and Time
'filetime' => self::PROPERTY_TYPE_DATE, // File Time
'b' => self::PROPERTY_TYPE_BOOLEAN, // Boolean
'bool' => self::PROPERTY_TYPE_BOOLEAN, // Boolean
];
private const SPECIAL_TYPES = [
'empty' => '',
'null' => null,
];
/**
* Convert property to form desired by Excel.
*
* @param mixed $propertyValue
*
* @return mixed
*/
public static function convertProperty($propertyValue, string $propertyType)
{
return self::SPECIAL_TYPES[$propertyType] ?? self::convertProperty2($propertyValue, $propertyType);
}
/**
* Convert property to form desired by Excel.
*
* @param mixed $propertyValue
*
* @return mixed
*/
private static function convertProperty2($propertyValue, string $type)
{
$propertyType = self::convertPropertyType($type);
switch ($propertyType) {
case self::PROPERTY_TYPE_INTEGER:
$intValue = (int) $propertyValue;
return ($type[0] === 'u') ? abs($intValue) : $intValue;
case self::PROPERTY_TYPE_FLOAT:
return (float) $propertyValue;
case self::PROPERTY_TYPE_DATE:
return self::intOrFloatTimestamp($propertyValue);
case self::PROPERTY_TYPE_BOOLEAN:
return is_bool($propertyValue) ? $propertyValue : ($propertyValue === 'true');
default: // includes string
return $propertyValue;
}
}
public static function convertPropertyType(string $propertyType): string
{
return self::PROPERTY_TYPE_ARRAY[$propertyType] ?? self::PROPERTY_TYPE_UNKNOWN;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Collection/Memory.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Collection/Memory.php | <?php
namespace PhpOffice\PhpSpreadsheet\Collection;
use Psr\SimpleCache\CacheInterface;
/**
* This is the default implementation for in-memory cell collection.
*
* Alternatives implementation should leverage off-memory, non-volatile storage
* to reduce overall memory usage.
*/
class Memory implements CacheInterface
{
private $cache = [];
public function clear()
{
$this->cache = [];
return true;
}
public function delete($key)
{
unset($this->cache[$key]);
return true;
}
public function deleteMultiple($keys)
{
foreach ($keys as $key) {
$this->delete($key);
}
return true;
}
public function get($key, $default = null)
{
if ($this->has($key)) {
return $this->cache[$key];
}
return $default;
}
public function getMultiple($keys, $default = null)
{
$results = [];
foreach ($keys as $key) {
$results[$key] = $this->get($key, $default);
}
return $results;
}
public function has($key)
{
return array_key_exists($key, $this->cache);
}
public function set($key, $value, $ttl = null)
{
$this->cache[$key] = $value;
return true;
}
public function setMultiple($values, $ttl = null)
{
foreach ($values as $key => $value) {
$this->set($key, $value);
}
return true;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Collection/Cells.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Collection/Cells.php | <?php
namespace PhpOffice\PhpSpreadsheet\Collection;
use Generator;
use PhpOffice\PhpSpreadsheet\Cell\Cell;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use Psr\SimpleCache\CacheInterface;
class Cells
{
/**
* @var CacheInterface
*/
private $cache;
/**
* Parent worksheet.
*
* @var null|Worksheet
*/
private $parent;
/**
* The currently active Cell.
*
* @var null|Cell
*/
private $currentCell;
/**
* Coordinate of the currently active Cell.
*
* @var null|string
*/
private $currentCoordinate;
/**
* Flag indicating whether the currently active Cell requires saving.
*
* @var bool
*/
private $currentCellIsDirty = false;
/**
* An index of existing cells. Booleans indexed by their coordinate.
*
* @var bool[]
*/
private $index = [];
/**
* Prefix used to uniquely identify cache data for this worksheet.
*
* @var string
*/
private $cachePrefix;
/**
* Initialise this new cell collection.
*
* @param Worksheet $parent The worksheet for this cell collection
*/
public function __construct(Worksheet $parent, CacheInterface $cache)
{
// Set our parent worksheet.
// This is maintained here to facilitate re-attaching it to Cell objects when
// they are woken from a serialized state
$this->parent = $parent;
$this->cache = $cache;
$this->cachePrefix = $this->getUniqueID();
}
/**
* Return the parent worksheet for this cell collection.
*
* @return null|Worksheet
*/
public function getParent()
{
return $this->parent;
}
/**
* Whether the collection holds a cell for the given coordinate.
*
* @param string $cellCoordinate Coordinate of the cell to check
*
* @return bool
*/
public function has($cellCoordinate)
{
if ($cellCoordinate === $this->currentCoordinate) {
return true;
}
// Check if the requested entry exists in the index
return isset($this->index[$cellCoordinate]);
}
/**
* Add or update a cell in the collection.
*
* @param Cell $cell Cell to update
*
* @return Cell
*/
public function update(Cell $cell)
{
return $this->add($cell->getCoordinate(), $cell);
}
/**
* Delete a cell in cache identified by coordinate.
*
* @param string $cellCoordinate Coordinate of the cell to delete
*/
public function delete($cellCoordinate): void
{
if ($cellCoordinate === $this->currentCoordinate && $this->currentCell !== null) {
$this->currentCell->detach();
$this->currentCoordinate = null;
$this->currentCell = null;
$this->currentCellIsDirty = false;
}
unset($this->index[$cellCoordinate]);
// Delete the entry from cache
$this->cache->delete($this->cachePrefix . $cellCoordinate);
}
/**
* Get a list of all cell coordinates currently held in the collection.
*
* @return string[]
*/
public function getCoordinates()
{
return array_keys($this->index);
}
/**
* Get a sorted list of all cell coordinates currently held in the collection by row and column.
*
* @return string[]
*/
public function getSortedCoordinates()
{
$sortKeys = [];
foreach ($this->getCoordinates() as $coord) {
$column = '';
$row = 0;
sscanf($coord, '%[A-Z]%d', $column, $row);
$sortKeys[sprintf('%09d%3s', $row, $column)] = $coord;
}
ksort($sortKeys);
return array_values($sortKeys);
}
/**
* Get highest worksheet column and highest row that have cell records.
*
* @return array Highest column name and highest row number
*/
public function getHighestRowAndColumn()
{
// Lookup highest column and highest row
$col = ['A' => '1A'];
$row = [1];
foreach ($this->getCoordinates() as $coord) {
$c = '';
$r = 0;
sscanf($coord, '%[A-Z]%d', $c, $r);
$row[$r] = $r;
$col[$c] = strlen($c) . $c;
}
// Determine highest column and row
$highestRow = max($row);
$highestColumn = substr((string) @max($col), 1);
return [
'row' => $highestRow,
'column' => $highestColumn,
];
}
/**
* Return the cell coordinate of the currently active cell object.
*
* @return null|string
*/
public function getCurrentCoordinate()
{
return $this->currentCoordinate;
}
/**
* Return the column coordinate of the currently active cell object.
*
* @return string
*/
public function getCurrentColumn()
{
$column = '';
$row = 0;
sscanf($this->currentCoordinate ?? '', '%[A-Z]%d', $column, $row);
return $column;
}
/**
* Return the row coordinate of the currently active cell object.
*
* @return int
*/
public function getCurrentRow()
{
$column = '';
$row = 0;
sscanf($this->currentCoordinate ?? '', '%[A-Z]%d', $column, $row);
return (int) $row;
}
/**
* Get highest worksheet column.
*
* @param null|int|string $row Return the highest column for the specified row,
* or the highest column of any row if no row number is passed
*
* @return string Highest column name
*/
public function getHighestColumn($row = null)
{
if ($row === null) {
$colRow = $this->getHighestRowAndColumn();
return $colRow['column'];
}
$columnList = [1];
foreach ($this->getCoordinates() as $coord) {
$c = '';
$r = 0;
sscanf($coord, '%[A-Z]%d', $c, $r);
if ($r != $row) {
continue;
}
$columnList[] = Coordinate::columnIndexFromString($c);
}
return Coordinate::stringFromColumnIndex((int) @max($columnList));
}
/**
* Get highest worksheet row.
*
* @param null|string $column Return the highest row for the specified column,
* or the highest row of any column if no column letter is passed
*
* @return int Highest row number
*/
public function getHighestRow($column = null)
{
if ($column === null) {
$colRow = $this->getHighestRowAndColumn();
return $colRow['row'];
}
$rowList = [0];
foreach ($this->getCoordinates() as $coord) {
$c = '';
$r = 0;
sscanf($coord, '%[A-Z]%d', $c, $r);
if ($c != $column) {
continue;
}
$rowList[] = $r;
}
return max($rowList);
}
/**
* Generate a unique ID for cache referencing.
*
* @return string Unique Reference
*/
private function getUniqueID()
{
return uniqid('phpspreadsheet.', true) . '.';
}
/**
* Clone the cell collection.
*
* @return self
*/
public function cloneCellCollection(Worksheet $worksheet)
{
$this->storeCurrentCell();
$newCollection = clone $this;
$newCollection->parent = $worksheet;
if (is_object($newCollection->currentCell)) {
$newCollection->currentCell->attach($this);
}
// Get old values
$oldKeys = $newCollection->getAllCacheKeys();
$oldValues = $newCollection->cache->getMultiple($oldKeys);
$newValues = [];
$oldCachePrefix = $newCollection->cachePrefix;
// Change prefix
$newCollection->cachePrefix = $newCollection->getUniqueID();
foreach ($oldValues as $oldKey => $value) {
/** @var string $newKey */
$newKey = str_replace($oldCachePrefix, $newCollection->cachePrefix, $oldKey);
$newValues[$newKey] = clone $value;
}
// Store new values
$stored = $newCollection->cache->setMultiple($newValues);
$this->destructIfNeeded($stored, $newCollection, 'Failed to copy cells in cache');
return $newCollection;
}
/**
* Remove a row, deleting all cells in that row.
*
* @param string $row Row number to remove
*/
public function removeRow($row): void
{
foreach ($this->getCoordinates() as $coord) {
$c = '';
$r = 0;
sscanf($coord, '%[A-Z]%d', $c, $r);
if ($r == $row) {
$this->delete($coord);
}
}
}
/**
* Remove a column, deleting all cells in that column.
*
* @param string $column Column ID to remove
*/
public function removeColumn($column): void
{
foreach ($this->getCoordinates() as $coord) {
$c = '';
$r = 0;
sscanf($coord, '%[A-Z]%d', $c, $r);
if ($c == $column) {
$this->delete($coord);
}
}
}
/**
* Store cell data in cache for the current cell object if it's "dirty",
* and the 'nullify' the current cell object.
*/
private function storeCurrentCell(): void
{
if ($this->currentCellIsDirty && isset($this->currentCoordinate, $this->currentCell)) {
$this->currentCell->detach();
$stored = $this->cache->set($this->cachePrefix . $this->currentCoordinate, $this->currentCell);
$this->destructIfNeeded($stored, $this, "Failed to store cell {$this->currentCoordinate} in cache");
$this->currentCellIsDirty = false;
}
$this->currentCoordinate = null;
$this->currentCell = null;
}
private function destructIfNeeded(bool $stored, self $cells, string $message): void
{
if (!$stored) {
$cells->__destruct();
throw new PhpSpreadsheetException($message);
}
}
/**
* Add or update a cell identified by its coordinate into the collection.
*
* @param string $cellCoordinate Coordinate of the cell to update
* @param Cell $cell Cell to update
*
* @return Cell
*/
public function add($cellCoordinate, Cell $cell)
{
if ($cellCoordinate !== $this->currentCoordinate) {
$this->storeCurrentCell();
}
$this->index[$cellCoordinate] = true;
$this->currentCoordinate = $cellCoordinate;
$this->currentCell = $cell;
$this->currentCellIsDirty = true;
return $cell;
}
/**
* Get cell at a specific coordinate.
*
* @param string $cellCoordinate Coordinate of the cell
*
* @return null|Cell Cell that was found, or null if not found
*/
public function get($cellCoordinate)
{
if ($cellCoordinate === $this->currentCoordinate) {
return $this->currentCell;
}
$this->storeCurrentCell();
// Return null if requested entry doesn't exist in collection
if (!$this->has($cellCoordinate)) {
return null;
}
// Check if the entry that has been requested actually exists
$cell = $this->cache->get($this->cachePrefix . $cellCoordinate);
if ($cell === null) {
throw new PhpSpreadsheetException("Cell entry {$cellCoordinate} no longer exists in cache. This probably means that the cache was cleared by someone else.");
}
// Set current entry to the requested entry
$this->currentCoordinate = $cellCoordinate;
$this->currentCell = $cell;
// Re-attach this as the cell's parent
$this->currentCell->attach($this);
// Return requested entry
return $this->currentCell;
}
/**
* Clear the cell collection and disconnect from our parent.
*/
public function unsetWorksheetCells(): void
{
if ($this->currentCell !== null) {
$this->currentCell->detach();
$this->currentCell = null;
$this->currentCoordinate = null;
}
// Flush the cache
$this->__destruct();
$this->index = [];
// detach ourself from the worksheet, so that it can then delete this object successfully
$this->parent = null;
}
/**
* Destroy this cell collection.
*/
public function __destruct()
{
$this->cache->deleteMultiple($this->getAllCacheKeys());
}
/**
* Returns all known cache keys.
*
* @return Generator|string[]
*/
private function getAllCacheKeys()
{
foreach ($this->getCoordinates() as $coordinate) {
yield $this->cachePrefix . $coordinate;
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Collection/CellsFactory.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Collection/CellsFactory.php | <?php
namespace PhpOffice\PhpSpreadsheet\Collection;
use PhpOffice\PhpSpreadsheet\Settings;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
abstract class CellsFactory
{
/**
* Initialise the cache storage.
*
* @param Worksheet $worksheet Enable cell caching for this worksheet
*
* @return Cells
* */
public static function getInstance(Worksheet $worksheet)
{
return new Cells($worksheet, Settings::getCache());
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/BaseReader.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/BaseReader.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use PhpOffice\PhpSpreadsheet\Reader\Exception as ReaderException;
use PhpOffice\PhpSpreadsheet\Reader\Security\XmlScanner;
use PhpOffice\PhpSpreadsheet\Shared\File;
abstract class BaseReader implements IReader
{
/**
* Read data only?
* Identifies whether the Reader should only read data values for cells, and ignore any formatting information;
* or whether it should read both data and formatting.
*
* @var bool
*/
protected $readDataOnly = false;
/**
* Read empty cells?
* Identifies whether the Reader should read data values for cells all cells, or should ignore cells containing
* null value or empty string.
*
* @var bool
*/
protected $readEmptyCells = true;
/**
* Read charts that are defined in the workbook?
* Identifies whether the Reader should read the definitions for any charts that exist in the workbook;.
*
* @var bool
*/
protected $includeCharts = false;
/**
* Restrict which sheets should be loaded?
* This property holds an array of worksheet names to be loaded. If null, then all worksheets will be loaded.
*
* @var null|string[]
*/
protected $loadSheetsOnly;
/**
* IReadFilter instance.
*
* @var IReadFilter
*/
protected $readFilter;
protected $fileHandle;
/**
* @var XmlScanner
*/
protected $securityScanner;
public function __construct()
{
$this->readFilter = new DefaultReadFilter();
}
public function getReadDataOnly()
{
return $this->readDataOnly;
}
public function setReadDataOnly($readCellValuesOnly)
{
$this->readDataOnly = (bool) $readCellValuesOnly;
return $this;
}
public function getReadEmptyCells()
{
return $this->readEmptyCells;
}
public function setReadEmptyCells($readEmptyCells)
{
$this->readEmptyCells = (bool) $readEmptyCells;
return $this;
}
public function getIncludeCharts()
{
return $this->includeCharts;
}
public function setIncludeCharts($includeCharts)
{
$this->includeCharts = (bool) $includeCharts;
return $this;
}
public function getLoadSheetsOnly()
{
return $this->loadSheetsOnly;
}
public function setLoadSheetsOnly($sheetList)
{
if ($sheetList === null) {
return $this->setLoadAllSheets();
}
$this->loadSheetsOnly = is_array($sheetList) ? $sheetList : [$sheetList];
return $this;
}
public function setLoadAllSheets()
{
$this->loadSheetsOnly = null;
return $this;
}
public function getReadFilter()
{
return $this->readFilter;
}
public function setReadFilter(IReadFilter $readFilter)
{
$this->readFilter = $readFilter;
return $this;
}
public function getSecurityScanner()
{
return $this->securityScanner;
}
protected function processFlags(int $flags): void
{
if (((bool) ($flags & self::LOAD_WITH_CHARTS)) === true) {
$this->setIncludeCharts(true);
}
}
/**
* Open file for reading.
*
* @param string $filename
*/
protected function openFile($filename): void
{
if ($filename) {
File::assertFile($filename);
// Open file
$fileHandle = fopen($filename, 'rb');
} else {
$fileHandle = false;
}
if ($fileHandle !== false) {
$this->fileHandle = $fileHandle;
} else {
throw new ReaderException('Could not open file ' . $filename . ' for reading.');
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Cell\DataType;
use PhpOffice\PhpSpreadsheet\DefinedName;
use PhpOffice\PhpSpreadsheet\Reader\Gnumeric\PageSetup;
use PhpOffice\PhpSpreadsheet\Reader\Gnumeric\Properties;
use PhpOffice\PhpSpreadsheet\Reader\Gnumeric\Styles;
use PhpOffice\PhpSpreadsheet\Reader\Security\XmlScanner;
use PhpOffice\PhpSpreadsheet\ReferenceHelper;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Settings;
use PhpOffice\PhpSpreadsheet\Shared\File;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
use XMLReader;
class Gnumeric extends BaseReader
{
const NAMESPACE_GNM = 'http://www.gnumeric.org/v10.dtd'; // gmr in old sheets
const NAMESPACE_XSI = 'http://www.w3.org/2001/XMLSchema-instance';
const NAMESPACE_OFFICE = 'urn:oasis:names:tc:opendocument:xmlns:office:1.0';
const NAMESPACE_XLINK = 'http://www.w3.org/1999/xlink';
const NAMESPACE_DC = 'http://purl.org/dc/elements/1.1/';
const NAMESPACE_META = 'urn:oasis:names:tc:opendocument:xmlns:meta:1.0';
const NAMESPACE_OOO = 'http://openoffice.org/2004/office';
/**
* Shared Expressions.
*
* @var array
*/
private $expressions = [];
/**
* Spreadsheet shared across all functions.
*
* @var Spreadsheet
*/
private $spreadsheet;
/** @var ReferenceHelper */
private $referenceHelper;
/** @var array */
public static $mappings = [
'dataType' => [
'10' => DataType::TYPE_NULL,
'20' => DataType::TYPE_BOOL,
'30' => DataType::TYPE_NUMERIC, // Integer doesn't exist in Excel
'40' => DataType::TYPE_NUMERIC, // Float
'50' => DataType::TYPE_ERROR,
'60' => DataType::TYPE_STRING,
//'70': // Cell Range
//'80': // Array
],
];
/**
* Create a new Gnumeric.
*/
public function __construct()
{
parent::__construct();
$this->referenceHelper = ReferenceHelper::getInstance();
$this->securityScanner = XmlScanner::getInstance($this);
}
/**
* Can the current IReader read the file?
*/
public function canRead(string $filename): bool
{
// Check if gzlib functions are available
if (File::testFileNoThrow($filename) && function_exists('gzread')) {
// Read signature data (first 3 bytes)
$fh = fopen($filename, 'rb');
if ($fh !== false) {
$data = fread($fh, 2);
fclose($fh);
}
}
return isset($data) && $data === chr(0x1F) . chr(0x8B);
}
private static function matchXml(XMLReader $xml, string $expectedLocalName): bool
{
return $xml->namespaceURI === self::NAMESPACE_GNM
&& $xml->localName === $expectedLocalName
&& $xml->nodeType === XMLReader::ELEMENT;
}
/**
* Reads names of the worksheets from a file, without parsing the whole file to a Spreadsheet object.
*
* @param string $filename
*
* @return array
*/
public function listWorksheetNames($filename)
{
File::assertFile($filename);
$xml = new XMLReader();
$xml->xml($this->securityScanner->scanFile('compress.zlib://' . realpath($filename)), null, Settings::getLibXmlLoaderOptions());
$xml->setParserProperty(2, true);
$worksheetNames = [];
while ($xml->read()) {
if (self::matchXml($xml, 'SheetName')) {
$xml->read(); // Move onto the value node
$worksheetNames[] = (string) $xml->value;
} elseif (self::matchXml($xml, 'Sheets')) {
// break out of the loop once we've got our sheet names rather than parse the entire file
break;
}
}
return $worksheetNames;
}
/**
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns).
*
* @param string $filename
*
* @return array
*/
public function listWorksheetInfo($filename)
{
File::assertFile($filename);
$xml = new XMLReader();
$xml->xml($this->securityScanner->scanFile('compress.zlib://' . realpath($filename)), null, Settings::getLibXmlLoaderOptions());
$xml->setParserProperty(2, true);
$worksheetInfo = [];
while ($xml->read()) {
if (self::matchXml($xml, 'Sheet')) {
$tmpInfo = [
'worksheetName' => '',
'lastColumnLetter' => 'A',
'lastColumnIndex' => 0,
'totalRows' => 0,
'totalColumns' => 0,
];
while ($xml->read()) {
if (self::matchXml($xml, 'Name')) {
$xml->read(); // Move onto the value node
$tmpInfo['worksheetName'] = (string) $xml->value;
} elseif (self::matchXml($xml, 'MaxCol')) {
$xml->read(); // Move onto the value node
$tmpInfo['lastColumnIndex'] = (int) $xml->value;
$tmpInfo['totalColumns'] = (int) $xml->value + 1;
} elseif (self::matchXml($xml, 'MaxRow')) {
$xml->read(); // Move onto the value node
$tmpInfo['totalRows'] = (int) $xml->value + 1;
break;
}
}
$tmpInfo['lastColumnLetter'] = Coordinate::stringFromColumnIndex($tmpInfo['lastColumnIndex'] + 1);
$worksheetInfo[] = $tmpInfo;
}
}
return $worksheetInfo;
}
/**
* @param string $filename
*
* @return string
*/
private function gzfileGetContents($filename)
{
$file = @gzopen($filename, 'rb');
$data = '';
if ($file !== false) {
while (!gzeof($file)) {
$data .= gzread($file, 1024);
}
gzclose($file);
}
return $data;
}
public static function gnumericMappings(): array
{
return array_merge(self::$mappings, Styles::$mappings);
}
private function processComments(SimpleXMLElement $sheet): void
{
if ((!$this->readDataOnly) && (isset($sheet->Objects))) {
foreach ($sheet->Objects->children(self::NAMESPACE_GNM) as $key => $comment) {
$commentAttributes = $comment->attributes();
// Only comment objects are handled at the moment
if ($commentAttributes && $commentAttributes->Text) {
$this->spreadsheet->getActiveSheet()->getComment((string) $commentAttributes->ObjectBound)
->setAuthor((string) $commentAttributes->Author)
->setText($this->parseRichText((string) $commentAttributes->Text));
}
}
}
}
/**
* @param mixed $value
*/
private static function testSimpleXml($value): SimpleXMLElement
{
return ($value instanceof SimpleXMLElement) ? $value : new SimpleXMLElement('<?xml version="1.0" encoding="UTF-8"?><root></root>');
}
/**
* Loads Spreadsheet from file.
*
* @return Spreadsheet
*/
public function load(string $filename, int $flags = 0)
{
$this->processFlags($flags);
// Create new Spreadsheet
$spreadsheet = new Spreadsheet();
$spreadsheet->removeSheetByIndex(0);
// Load into this instance
return $this->loadIntoExisting($filename, $spreadsheet);
}
/**
* Loads from file into Spreadsheet instance.
*/
public function loadIntoExisting(string $filename, Spreadsheet $spreadsheet): Spreadsheet
{
$this->spreadsheet = $spreadsheet;
File::assertFile($filename);
$gFileData = $this->gzfileGetContents($filename);
$xml2 = simplexml_load_string($this->securityScanner->scan($gFileData), 'SimpleXMLElement', Settings::getLibXmlLoaderOptions());
$xml = self::testSimpleXml($xml2);
$gnmXML = $xml->children(self::NAMESPACE_GNM);
(new Properties($this->spreadsheet))->readProperties($xml, $gnmXML);
$worksheetID = 0;
foreach ($gnmXML->Sheets->Sheet as $sheetOrNull) {
$sheet = self::testSimpleXml($sheetOrNull);
$worksheetName = (string) $sheet->Name;
if (is_array($this->loadSheetsOnly) && !in_array($worksheetName, $this->loadSheetsOnly, true)) {
continue;
}
$maxRow = $maxCol = 0;
// Create new Worksheet
$this->spreadsheet->createSheet();
$this->spreadsheet->setActiveSheetIndex($worksheetID);
// Use false for $updateFormulaCellReferences to prevent adjustment of worksheet references in formula
// cells... during the load, all formulae should be correct, and we're simply bringing the worksheet
// name in line with the formula, not the reverse
$this->spreadsheet->getActiveSheet()->setTitle($worksheetName, false, false);
if (!$this->readDataOnly) {
(new PageSetup($this->spreadsheet))
->printInformation($sheet)
->sheetMargins($sheet);
}
foreach ($sheet->Cells->Cell as $cellOrNull) {
$cell = self::testSimpleXml($cellOrNull);
$cellAttributes = self::testSimpleXml($cell->attributes());
$row = (int) $cellAttributes->Row + 1;
$column = (int) $cellAttributes->Col;
if ($row > $maxRow) {
$maxRow = $row;
}
if ($column > $maxCol) {
$maxCol = $column;
}
$column = Coordinate::stringFromColumnIndex($column + 1);
// Read cell?
if ($this->getReadFilter() !== null) {
if (!$this->getReadFilter()->readCell($column, $row, $worksheetName)) {
continue;
}
}
$ValueType = $cellAttributes->ValueType;
$ExprID = (string) $cellAttributes->ExprID;
$type = DataType::TYPE_FORMULA;
if ($ExprID > '') {
if (((string) $cell) > '') {
$this->expressions[$ExprID] = [
'column' => $cellAttributes->Col,
'row' => $cellAttributes->Row,
'formula' => (string) $cell,
];
} else {
$expression = $this->expressions[$ExprID];
$cell = $this->referenceHelper->updateFormulaReferences(
$expression['formula'],
'A1',
$cellAttributes->Col - $expression['column'],
$cellAttributes->Row - $expression['row'],
$worksheetName
);
}
$type = DataType::TYPE_FORMULA;
} else {
$vtype = (string) $ValueType;
if (array_key_exists($vtype, self::$mappings['dataType'])) {
$type = self::$mappings['dataType'][$vtype];
}
if ($vtype === '20') { // Boolean
$cell = $cell == 'TRUE';
}
}
$this->spreadsheet->getActiveSheet()->getCell($column . $row)->setValueExplicit((string) $cell, $type);
}
if ($sheet->Styles !== null) {
(new Styles($this->spreadsheet, $this->readDataOnly))->read($sheet, $maxRow, $maxCol);
}
$this->processComments($sheet);
$this->processColumnWidths($sheet, $maxCol);
$this->processRowHeights($sheet, $maxRow);
$this->processMergedCells($sheet);
$this->processAutofilter($sheet);
++$worksheetID;
}
$this->processDefinedNames($gnmXML);
// Return
return $this->spreadsheet;
}
private function processMergedCells(?SimpleXMLElement $sheet): void
{
// Handle Merged Cells in this worksheet
if ($sheet !== null && isset($sheet->MergedRegions)) {
foreach ($sheet->MergedRegions->Merge as $mergeCells) {
if (strpos((string) $mergeCells, ':') !== false) {
$this->spreadsheet->getActiveSheet()->mergeCells($mergeCells);
}
}
}
}
private function processAutofilter(?SimpleXMLElement $sheet): void
{
if ($sheet !== null && isset($sheet->Filters)) {
foreach ($sheet->Filters->Filter as $autofilter) {
if ($autofilter !== null) {
$attributes = $autofilter->attributes();
if (isset($attributes['Area'])) {
$this->spreadsheet->getActiveSheet()->setAutoFilter((string) $attributes['Area']);
}
}
}
}
}
private function setColumnWidth(int $whichColumn, float $defaultWidth): void
{
$columnDimension = $this->spreadsheet->getActiveSheet()->getColumnDimension(Coordinate::stringFromColumnIndex($whichColumn + 1));
if ($columnDimension !== null) {
$columnDimension->setWidth($defaultWidth);
}
}
private function setColumnInvisible(int $whichColumn): void
{
$columnDimension = $this->spreadsheet->getActiveSheet()->getColumnDimension(Coordinate::stringFromColumnIndex($whichColumn + 1));
if ($columnDimension !== null) {
$columnDimension->setVisible(false);
}
}
private function processColumnLoop(int $whichColumn, int $maxCol, ?SimpleXMLElement $columnOverride, float $defaultWidth): int
{
$columnOverride = self::testSimpleXml($columnOverride);
$columnAttributes = self::testSimpleXml($columnOverride->attributes());
$column = $columnAttributes['No'];
$columnWidth = ((float) $columnAttributes['Unit']) / 5.4;
$hidden = (isset($columnAttributes['Hidden'])) && ((string) $columnAttributes['Hidden'] == '1');
$columnCount = (int) ($columnAttributes['Count'] ?? 1);
while ($whichColumn < $column) {
$this->setColumnWidth($whichColumn, $defaultWidth);
++$whichColumn;
}
while (($whichColumn < ($column + $columnCount)) && ($whichColumn <= $maxCol)) {
$this->setColumnWidth($whichColumn, $columnWidth);
if ($hidden) {
$this->setColumnInvisible($whichColumn);
}
++$whichColumn;
}
return $whichColumn;
}
private function processColumnWidths(?SimpleXMLElement $sheet, int $maxCol): void
{
if ((!$this->readDataOnly) && $sheet !== null && (isset($sheet->Cols))) {
// Column Widths
$defaultWidth = 0;
$columnAttributes = $sheet->Cols->attributes();
if ($columnAttributes !== null) {
$defaultWidth = $columnAttributes['DefaultSizePts'] / 5.4;
}
$whichColumn = 0;
foreach ($sheet->Cols->ColInfo as $columnOverride) {
$whichColumn = $this->processColumnLoop($whichColumn, $maxCol, $columnOverride, $defaultWidth);
}
while ($whichColumn <= $maxCol) {
$this->setColumnWidth($whichColumn, $defaultWidth);
++$whichColumn;
}
}
}
private function setRowHeight(int $whichRow, float $defaultHeight): void
{
$rowDimension = $this->spreadsheet->getActiveSheet()->getRowDimension($whichRow);
if ($rowDimension !== null) {
$rowDimension->setRowHeight($defaultHeight);
}
}
private function setRowInvisible(int $whichRow): void
{
$rowDimension = $this->spreadsheet->getActiveSheet()->getRowDimension($whichRow);
if ($rowDimension !== null) {
$rowDimension->setVisible(false);
}
}
private function processRowLoop(int $whichRow, int $maxRow, ?SimpleXMLElement $rowOverride, float $defaultHeight): int
{
$rowOverride = self::testSimpleXml($rowOverride);
$rowAttributes = self::testSimpleXml($rowOverride->attributes());
$row = $rowAttributes['No'];
$rowHeight = (float) $rowAttributes['Unit'];
$hidden = (isset($rowAttributes['Hidden'])) && ((string) $rowAttributes['Hidden'] == '1');
$rowCount = (int) ($rowAttributes['Count'] ?? 1);
while ($whichRow < $row) {
++$whichRow;
$this->setRowHeight($whichRow, $defaultHeight);
}
while (($whichRow < ($row + $rowCount)) && ($whichRow < $maxRow)) {
++$whichRow;
$this->setRowHeight($whichRow, $rowHeight);
if ($hidden) {
$this->setRowInvisible($whichRow);
}
}
return $whichRow;
}
private function processRowHeights(?SimpleXMLElement $sheet, int $maxRow): void
{
if ((!$this->readDataOnly) && $sheet !== null && (isset($sheet->Rows))) {
// Row Heights
$defaultHeight = 0;
$rowAttributes = $sheet->Rows->attributes();
if ($rowAttributes !== null) {
$defaultHeight = (float) $rowAttributes['DefaultSizePts'];
}
$whichRow = 0;
foreach ($sheet->Rows->RowInfo as $rowOverride) {
$whichRow = $this->processRowLoop($whichRow, $maxRow, $rowOverride, $defaultHeight);
}
// never executed, I can't figure out any circumstances
// under which it would be executed, and, even if
// such exist, I'm not convinced this is needed.
//while ($whichRow < $maxRow) {
// ++$whichRow;
// $this->spreadsheet->getActiveSheet()->getRowDimension($whichRow)->setRowHeight($defaultHeight);
//}
}
}
private function processDefinedNames(?SimpleXMLElement $gnmXML): void
{
// Loop through definedNames (global named ranges)
if ($gnmXML !== null && isset($gnmXML->Names)) {
foreach ($gnmXML->Names->Name as $definedName) {
$name = (string) $definedName->name;
$value = (string) $definedName->value;
if (stripos($value, '#REF!') !== false) {
continue;
}
[$worksheetName] = Worksheet::extractSheetTitle($value, true);
$worksheetName = trim($worksheetName, "'");
$worksheet = $this->spreadsheet->getSheetByName($worksheetName);
// Worksheet might still be null if we're only loading selected sheets rather than the full spreadsheet
if ($worksheet !== null) {
$this->spreadsheet->addDefinedName(DefinedName::createInstance($name, $worksheet, $value));
}
}
}
}
private function parseRichText(string $is): RichText
{
$value = new RichText();
$value->createText($is);
return $value;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Exception.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Exception.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
class Exception extends PhpSpreadsheetException
{
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Csv.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Csv.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use PhpOffice\PhpSpreadsheet\Cell\Cell;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Reader\Csv\Delimiter;
use PhpOffice\PhpSpreadsheet\Reader\Exception as ReaderException;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
class Csv extends BaseReader
{
const DEFAULT_FALLBACK_ENCODING = 'CP1252';
const GUESS_ENCODING = 'guess';
const UTF8_BOM = "\xEF\xBB\xBF";
const UTF8_BOM_LEN = 3;
const UTF16BE_BOM = "\xfe\xff";
const UTF16BE_BOM_LEN = 2;
const UTF16BE_LF = "\x00\x0a";
const UTF16LE_BOM = "\xff\xfe";
const UTF16LE_BOM_LEN = 2;
const UTF16LE_LF = "\x0a\x00";
const UTF32BE_BOM = "\x00\x00\xfe\xff";
const UTF32BE_BOM_LEN = 4;
const UTF32BE_LF = "\x00\x00\x00\x0a";
const UTF32LE_BOM = "\xff\xfe\x00\x00";
const UTF32LE_BOM_LEN = 4;
const UTF32LE_LF = "\x0a\x00\x00\x00";
/**
* Input encoding.
*
* @var string
*/
private $inputEncoding = 'UTF-8';
/**
* Fallback encoding if guess strikes out.
*
* @var string
*/
private $fallbackEncoding = self::DEFAULT_FALLBACK_ENCODING;
/**
* Delimiter.
*
* @var ?string
*/
private $delimiter;
/**
* Enclosure.
*
* @var string
*/
private $enclosure = '"';
/**
* Sheet index to read.
*
* @var int
*/
private $sheetIndex = 0;
/**
* Load rows contiguously.
*
* @var bool
*/
private $contiguous = false;
/**
* The character that can escape the enclosure.
*
* @var string
*/
private $escapeCharacter = '\\';
/**
* Callback for setting defaults in construction.
*
* @var ?callable
*/
private static $constructorCallback;
/**
* Create a new CSV Reader instance.
*/
public function __construct()
{
parent::__construct();
$callback = self::$constructorCallback;
if ($callback !== null) {
$callback($this);
}
}
/**
* Set a callback to change the defaults.
*
* The callback must accept the Csv Reader object as the first parameter,
* and it should return void.
*/
public static function setConstructorCallback(?callable $callback): void
{
self::$constructorCallback = $callback;
}
public static function getConstructorCallback(): ?callable
{
return self::$constructorCallback;
}
public function setInputEncoding(string $encoding): self
{
$this->inputEncoding = $encoding;
return $this;
}
public function getInputEncoding(): string
{
return $this->inputEncoding;
}
public function setFallbackEncoding(string $fallbackEncoding): self
{
$this->fallbackEncoding = $fallbackEncoding;
return $this;
}
public function getFallbackEncoding(): string
{
return $this->fallbackEncoding;
}
/**
* Move filepointer past any BOM marker.
*/
protected function skipBOM(): void
{
rewind($this->fileHandle);
if (fgets($this->fileHandle, self::UTF8_BOM_LEN + 1) !== self::UTF8_BOM) {
rewind($this->fileHandle);
}
}
/**
* Identify any separator that is explicitly set in the file.
*/
protected function checkSeparator(): void
{
$line = fgets($this->fileHandle);
if ($line === false) {
return;
}
if ((strlen(trim($line, "\r\n")) == 5) && (stripos($line, 'sep=') === 0)) {
$this->delimiter = substr($line, 4, 1);
return;
}
$this->skipBOM();
}
/**
* Infer the separator if it isn't explicitly set in the file or specified by the user.
*/
protected function inferSeparator(): void
{
if ($this->delimiter !== null) {
return;
}
$inferenceEngine = new Delimiter($this->fileHandle, $this->escapeCharacter, $this->enclosure);
// If number of lines is 0, nothing to infer : fall back to the default
if ($inferenceEngine->linesCounted() === 0) {
$this->delimiter = $inferenceEngine->getDefaultDelimiter();
$this->skipBOM();
return;
}
$this->delimiter = $inferenceEngine->infer();
// If no delimiter could be detected, fall back to the default
if ($this->delimiter === null) {
$this->delimiter = $inferenceEngine->getDefaultDelimiter();
}
$this->skipBOM();
}
/**
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns).
*/
public function listWorksheetInfo(string $filename): array
{
// Open file
$this->openFileOrMemory($filename);
$fileHandle = $this->fileHandle;
// Skip BOM, if any
$this->skipBOM();
$this->checkSeparator();
$this->inferSeparator();
$worksheetInfo = [];
$worksheetInfo[0]['worksheetName'] = 'Worksheet';
$worksheetInfo[0]['lastColumnLetter'] = 'A';
$worksheetInfo[0]['lastColumnIndex'] = 0;
$worksheetInfo[0]['totalRows'] = 0;
$worksheetInfo[0]['totalColumns'] = 0;
// Loop through each line of the file in turn
$rowData = fgetcsv($fileHandle, 0, $this->delimiter ?? '', $this->enclosure, $this->escapeCharacter);
while (is_array($rowData)) {
++$worksheetInfo[0]['totalRows'];
$worksheetInfo[0]['lastColumnIndex'] = max($worksheetInfo[0]['lastColumnIndex'], count($rowData) - 1);
$rowData = fgetcsv($fileHandle, 0, $this->delimiter ?? '', $this->enclosure, $this->escapeCharacter);
}
$worksheetInfo[0]['lastColumnLetter'] = Coordinate::stringFromColumnIndex($worksheetInfo[0]['lastColumnIndex'] + 1);
$worksheetInfo[0]['totalColumns'] = $worksheetInfo[0]['lastColumnIndex'] + 1;
// Close file
fclose($fileHandle);
return $worksheetInfo;
}
/**
* Loads Spreadsheet from file.
*
* @return Spreadsheet
*/
public function load(string $filename, int $flags = 0)
{
$this->processFlags($flags);
// Create new Spreadsheet
$spreadsheet = new Spreadsheet();
// Load into this instance
return $this->loadIntoExisting($filename, $spreadsheet);
}
private function openFileOrMemory(string $filename): void
{
// Open file
$fhandle = $this->canRead($filename);
if (!$fhandle) {
throw new Exception($filename . ' is an Invalid Spreadsheet file.');
}
if ($this->inputEncoding === self::GUESS_ENCODING) {
$this->inputEncoding = self::guessEncoding($filename, $this->fallbackEncoding);
}
$this->openFile($filename);
if ($this->inputEncoding !== 'UTF-8') {
fclose($this->fileHandle);
$entireFile = file_get_contents($filename);
$this->fileHandle = fopen('php://memory', 'r+b');
if ($this->fileHandle !== false && $entireFile !== false) {
$data = StringHelper::convertEncoding($entireFile, 'UTF-8', $this->inputEncoding);
fwrite($this->fileHandle, $data);
$this->skipBOM();
}
}
}
private static function setAutoDetect(?string $value): ?string
{
$retVal = null;
if ($value !== null) {
$retVal2 = @ini_set('auto_detect_line_endings', $value);
if (is_string($retVal2)) {
$retVal = $retVal2;
}
}
return $retVal;
}
/**
* Loads PhpSpreadsheet from file into PhpSpreadsheet instance.
*/
public function loadIntoExisting(string $filename, Spreadsheet $spreadsheet): Spreadsheet
{
// Deprecated in Php8.1
$iniset = self::setAutoDetect('1');
// Open file
$this->openFileOrMemory($filename);
$fileHandle = $this->fileHandle;
// Skip BOM, if any
$this->skipBOM();
$this->checkSeparator();
$this->inferSeparator();
// Create new PhpSpreadsheet object
while ($spreadsheet->getSheetCount() <= $this->sheetIndex) {
$spreadsheet->createSheet();
}
$sheet = $spreadsheet->setActiveSheetIndex($this->sheetIndex);
// Set our starting row based on whether we're in contiguous mode or not
$currentRow = 1;
$outRow = 0;
// Loop through each line of the file in turn
$rowData = fgetcsv($fileHandle, 0, $this->delimiter ?? '', $this->enclosure, $this->escapeCharacter);
$valueBinder = Cell::getValueBinder();
$preserveBooleanString = method_exists($valueBinder, 'getBooleanConversion') && $valueBinder->getBooleanConversion();
while (is_array($rowData)) {
$noOutputYet = true;
$columnLetter = 'A';
foreach ($rowData as $rowDatum) {
$this->convertBoolean($rowDatum, $preserveBooleanString);
if ($rowDatum !== '' && $this->readFilter->readCell($columnLetter, $currentRow)) {
if ($this->contiguous) {
if ($noOutputYet) {
$noOutputYet = false;
++$outRow;
}
} else {
$outRow = $currentRow;
}
// Set cell value
$sheet->getCell($columnLetter . $outRow)->setValue($rowDatum);
}
++$columnLetter;
}
$rowData = fgetcsv($fileHandle, 0, $this->delimiter ?? '', $this->enclosure, $this->escapeCharacter);
++$currentRow;
}
// Close file
fclose($fileHandle);
self::setAutoDetect($iniset);
// Return
return $spreadsheet;
}
/**
* Convert string true/false to boolean, and null to null-string.
*
* @param mixed $rowDatum
*/
private function convertBoolean(&$rowDatum, bool $preserveBooleanString): void
{
if (is_string($rowDatum) && !$preserveBooleanString) {
if (strcasecmp('true', $rowDatum) === 0) {
$rowDatum = true;
} elseif (strcasecmp('false', $rowDatum) === 0) {
$rowDatum = false;
}
} elseif ($rowDatum === null) {
$rowDatum = '';
}
}
public function getDelimiter(): ?string
{
return $this->delimiter;
}
public function setDelimiter(?string $delimiter): self
{
$this->delimiter = $delimiter;
return $this;
}
public function getEnclosure(): string
{
return $this->enclosure;
}
public function setEnclosure(string $enclosure): self
{
if ($enclosure == '') {
$enclosure = '"';
}
$this->enclosure = $enclosure;
return $this;
}
public function getSheetIndex(): int
{
return $this->sheetIndex;
}
public function setSheetIndex(int $indexValue): self
{
$this->sheetIndex = $indexValue;
return $this;
}
public function setContiguous(bool $contiguous): self
{
$this->contiguous = $contiguous;
return $this;
}
public function getContiguous(): bool
{
return $this->contiguous;
}
public function setEscapeCharacter(string $escapeCharacter): self
{
$this->escapeCharacter = $escapeCharacter;
return $this;
}
public function getEscapeCharacter(): string
{
return $this->escapeCharacter;
}
/**
* Can the current IReader read the file?
*/
public function canRead(string $filename): bool
{
// Check if file exists
try {
$this->openFile($filename);
} catch (ReaderException $e) {
return false;
}
fclose($this->fileHandle);
// Trust file extension if any
$extension = strtolower(pathinfo($filename, PATHINFO_EXTENSION));
if (in_array($extension, ['csv', 'tsv'])) {
return true;
}
// Attempt to guess mimetype
$type = mime_content_type($filename);
$supportedTypes = [
'application/csv',
'text/csv',
'text/plain',
'inode/x-empty',
];
return in_array($type, $supportedTypes, true);
}
private static function guessEncodingTestNoBom(string &$encoding, string &$contents, string $compare, string $setEncoding): void
{
if ($encoding === '') {
$pos = strpos($contents, $compare);
if ($pos !== false && $pos % strlen($compare) === 0) {
$encoding = $setEncoding;
}
}
}
private static function guessEncodingNoBom(string $filename): string
{
$encoding = '';
$contents = file_get_contents($filename);
self::guessEncodingTestNoBom($encoding, $contents, self::UTF32BE_LF, 'UTF-32BE');
self::guessEncodingTestNoBom($encoding, $contents, self::UTF32LE_LF, 'UTF-32LE');
self::guessEncodingTestNoBom($encoding, $contents, self::UTF16BE_LF, 'UTF-16BE');
self::guessEncodingTestNoBom($encoding, $contents, self::UTF16LE_LF, 'UTF-16LE');
if ($encoding === '' && preg_match('//u', $contents) === 1) {
$encoding = 'UTF-8';
}
return $encoding;
}
private static function guessEncodingTestBom(string &$encoding, string $first4, string $compare, string $setEncoding): void
{
if ($encoding === '') {
if ($compare === substr($first4, 0, strlen($compare))) {
$encoding = $setEncoding;
}
}
}
private static function guessEncodingBom(string $filename): string
{
$encoding = '';
$first4 = file_get_contents($filename, false, null, 0, 4);
if ($first4 !== false) {
self::guessEncodingTestBom($encoding, $first4, self::UTF8_BOM, 'UTF-8');
self::guessEncodingTestBom($encoding, $first4, self::UTF16BE_BOM, 'UTF-16BE');
self::guessEncodingTestBom($encoding, $first4, self::UTF32BE_BOM, 'UTF-32BE');
self::guessEncodingTestBom($encoding, $first4, self::UTF32LE_BOM, 'UTF-32LE');
self::guessEncodingTestBom($encoding, $first4, self::UTF16LE_BOM, 'UTF-16LE');
}
return $encoding;
}
public static function guessEncoding(string $filename, string $dflt = self::DEFAULT_FALLBACK_ENCODING): string
{
$encoding = self::guessEncodingBom($filename);
if ($encoding === '') {
$encoding = self::guessEncodingNoBom($filename);
}
return ($encoding === '') ? $dflt : $encoding;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/DefaultReadFilter.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/DefaultReadFilter.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
class DefaultReadFilter implements IReadFilter
{
/**
* Should this cell be read?
*
* @param string $columnAddress Column address (as a string value like "A", or "IV")
* @param int $row Row number
* @param string $worksheetName Optional worksheet name
*
* @return bool
*/
public function readCell($columnAddress, $row, $worksheetName = '')
{
return true;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Cell\DataType;
use PhpOffice\PhpSpreadsheet\Cell\DataValidation;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\NamedRange;
use PhpOffice\PhpSpreadsheet\Reader\Xls\Style\CellFont;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Shared\CodePage;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Shared\Escher;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer\BstoreContainer\BSE;
use PhpOffice\PhpSpreadsheet\Shared\File;
use PhpOffice\PhpSpreadsheet\Shared\OLE;
use PhpOffice\PhpSpreadsheet\Shared\OLERead;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Shared\Xls as SharedXls;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\Alignment;
use PhpOffice\PhpSpreadsheet\Style\Borders;
use PhpOffice\PhpSpreadsheet\Style\Font;
use PhpOffice\PhpSpreadsheet\Style\NumberFormat;
use PhpOffice\PhpSpreadsheet\Style\Protection;
use PhpOffice\PhpSpreadsheet\Style\Style;
use PhpOffice\PhpSpreadsheet\Worksheet\MemoryDrawing;
use PhpOffice\PhpSpreadsheet\Worksheet\PageSetup;
use PhpOffice\PhpSpreadsheet\Worksheet\SheetView;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
// Original file header of ParseXL (used as the base for this class):
// --------------------------------------------------------------------------------
// Adapted from Excel_Spreadsheet_Reader developed by users bizon153,
// trex005, and mmp11 (SourceForge.net)
// https://sourceforge.net/projects/phpexcelreader/
// Primary changes made by canyoncasa (dvc) for ParseXL 1.00 ...
// Modelled moreso after Perl Excel Parse/Write modules
// Added Parse_Excel_Spreadsheet object
// Reads a whole worksheet or tab as row,column array or as
// associated hash of indexed rows and named column fields
// Added variables for worksheet (tab) indexes and names
// Added an object call for loading individual woorksheets
// Changed default indexing defaults to 0 based arrays
// Fixed date/time and percent formats
// Includes patches found at SourceForge...
// unicode patch by nobody
// unpack("d") machine depedency patch by matchy
// boundsheet utf16 patch by bjaenichen
// Renamed functions for shorter names
// General code cleanup and rigor, including <80 column width
// Included a testcase Excel file and PHP example calls
// Code works for PHP 5.x
// Primary changes made by canyoncasa (dvc) for ParseXL 1.10 ...
// http://sourceforge.net/tracker/index.php?func=detail&aid=1466964&group_id=99160&atid=623334
// Decoding of formula conditions, results, and tokens.
// Support for user-defined named cells added as an array "namedcells"
// Patch code for user-defined named cells supports single cells only.
// NOTE: this patch only works for BIFF8 as BIFF5-7 use a different
// external sheet reference structure
class Xls extends BaseReader
{
// ParseXL definitions
const XLS_BIFF8 = 0x0600;
const XLS_BIFF7 = 0x0500;
const XLS_WORKBOOKGLOBALS = 0x0005;
const XLS_WORKSHEET = 0x0010;
// record identifiers
const XLS_TYPE_FORMULA = 0x0006;
const XLS_TYPE_EOF = 0x000a;
const XLS_TYPE_PROTECT = 0x0012;
const XLS_TYPE_OBJECTPROTECT = 0x0063;
const XLS_TYPE_SCENPROTECT = 0x00dd;
const XLS_TYPE_PASSWORD = 0x0013;
const XLS_TYPE_HEADER = 0x0014;
const XLS_TYPE_FOOTER = 0x0015;
const XLS_TYPE_EXTERNSHEET = 0x0017;
const XLS_TYPE_DEFINEDNAME = 0x0018;
const XLS_TYPE_VERTICALPAGEBREAKS = 0x001a;
const XLS_TYPE_HORIZONTALPAGEBREAKS = 0x001b;
const XLS_TYPE_NOTE = 0x001c;
const XLS_TYPE_SELECTION = 0x001d;
const XLS_TYPE_DATEMODE = 0x0022;
const XLS_TYPE_EXTERNNAME = 0x0023;
const XLS_TYPE_LEFTMARGIN = 0x0026;
const XLS_TYPE_RIGHTMARGIN = 0x0027;
const XLS_TYPE_TOPMARGIN = 0x0028;
const XLS_TYPE_BOTTOMMARGIN = 0x0029;
const XLS_TYPE_PRINTGRIDLINES = 0x002b;
const XLS_TYPE_FILEPASS = 0x002f;
const XLS_TYPE_FONT = 0x0031;
const XLS_TYPE_CONTINUE = 0x003c;
const XLS_TYPE_PANE = 0x0041;
const XLS_TYPE_CODEPAGE = 0x0042;
const XLS_TYPE_DEFCOLWIDTH = 0x0055;
const XLS_TYPE_OBJ = 0x005d;
const XLS_TYPE_COLINFO = 0x007d;
const XLS_TYPE_IMDATA = 0x007f;
const XLS_TYPE_SHEETPR = 0x0081;
const XLS_TYPE_HCENTER = 0x0083;
const XLS_TYPE_VCENTER = 0x0084;
const XLS_TYPE_SHEET = 0x0085;
const XLS_TYPE_PALETTE = 0x0092;
const XLS_TYPE_SCL = 0x00a0;
const XLS_TYPE_PAGESETUP = 0x00a1;
const XLS_TYPE_MULRK = 0x00bd;
const XLS_TYPE_MULBLANK = 0x00be;
const XLS_TYPE_DBCELL = 0x00d7;
const XLS_TYPE_XF = 0x00e0;
const XLS_TYPE_MERGEDCELLS = 0x00e5;
const XLS_TYPE_MSODRAWINGGROUP = 0x00eb;
const XLS_TYPE_MSODRAWING = 0x00ec;
const XLS_TYPE_SST = 0x00fc;
const XLS_TYPE_LABELSST = 0x00fd;
const XLS_TYPE_EXTSST = 0x00ff;
const XLS_TYPE_EXTERNALBOOK = 0x01ae;
const XLS_TYPE_DATAVALIDATIONS = 0x01b2;
const XLS_TYPE_TXO = 0x01b6;
const XLS_TYPE_HYPERLINK = 0x01b8;
const XLS_TYPE_DATAVALIDATION = 0x01be;
const XLS_TYPE_DIMENSION = 0x0200;
const XLS_TYPE_BLANK = 0x0201;
const XLS_TYPE_NUMBER = 0x0203;
const XLS_TYPE_LABEL = 0x0204;
const XLS_TYPE_BOOLERR = 0x0205;
const XLS_TYPE_STRING = 0x0207;
const XLS_TYPE_ROW = 0x0208;
const XLS_TYPE_INDEX = 0x020b;
const XLS_TYPE_ARRAY = 0x0221;
const XLS_TYPE_DEFAULTROWHEIGHT = 0x0225;
const XLS_TYPE_WINDOW2 = 0x023e;
const XLS_TYPE_RK = 0x027e;
const XLS_TYPE_STYLE = 0x0293;
const XLS_TYPE_FORMAT = 0x041e;
const XLS_TYPE_SHAREDFMLA = 0x04bc;
const XLS_TYPE_BOF = 0x0809;
const XLS_TYPE_SHEETPROTECTION = 0x0867;
const XLS_TYPE_RANGEPROTECTION = 0x0868;
const XLS_TYPE_SHEETLAYOUT = 0x0862;
const XLS_TYPE_XFEXT = 0x087d;
const XLS_TYPE_PAGELAYOUTVIEW = 0x088b;
const XLS_TYPE_UNKNOWN = 0xffff;
// Encryption type
const MS_BIFF_CRYPTO_NONE = 0;
const MS_BIFF_CRYPTO_XOR = 1;
const MS_BIFF_CRYPTO_RC4 = 2;
// Size of stream blocks when using RC4 encryption
const REKEY_BLOCK = 0x400;
/**
* Summary Information stream data.
*
* @var string
*/
private $summaryInformation;
/**
* Extended Summary Information stream data.
*
* @var string
*/
private $documentSummaryInformation;
/**
* Workbook stream data. (Includes workbook globals substream as well as sheet substreams).
*
* @var string
*/
private $data;
/**
* Size in bytes of $this->data.
*
* @var int
*/
private $dataSize;
/**
* Current position in stream.
*
* @var int
*/
private $pos;
/**
* Workbook to be returned by the reader.
*
* @var Spreadsheet
*/
private $spreadsheet;
/**
* Worksheet that is currently being built by the reader.
*
* @var Worksheet
*/
private $phpSheet;
/**
* BIFF version.
*
* @var int
*/
private $version;
/**
* Codepage set in the Excel file being read. Only important for BIFF5 (Excel 5.0 - Excel 95)
* For BIFF8 (Excel 97 - Excel 2003) this will always have the value 'UTF-16LE'.
*
* @var string
*/
private $codepage;
/**
* Shared formats.
*
* @var array
*/
private $formats;
/**
* Shared fonts.
*
* @var Font[]
*/
private $objFonts;
/**
* Color palette.
*
* @var array
*/
private $palette;
/**
* Worksheets.
*
* @var array
*/
private $sheets;
/**
* External books.
*
* @var array
*/
private $externalBooks;
/**
* REF structures. Only applies to BIFF8.
*
* @var array
*/
private $ref;
/**
* External names.
*
* @var array
*/
private $externalNames;
/**
* Defined names.
*
* @var array
*/
private $definedname;
/**
* Shared strings. Only applies to BIFF8.
*
* @var array
*/
private $sst;
/**
* Panes are frozen? (in sheet currently being read). See WINDOW2 record.
*
* @var bool
*/
private $frozen;
/**
* Fit printout to number of pages? (in sheet currently being read). See SHEETPR record.
*
* @var bool
*/
private $isFitToPages;
/**
* Objects. One OBJ record contributes with one entry.
*
* @var array
*/
private $objs;
/**
* Text Objects. One TXO record corresponds with one entry.
*
* @var array
*/
private $textObjects;
/**
* Cell Annotations (BIFF8).
*
* @var array
*/
private $cellNotes;
/**
* The combined MSODRAWINGGROUP data.
*
* @var string
*/
private $drawingGroupData;
/**
* The combined MSODRAWING data (per sheet).
*
* @var string
*/
private $drawingData;
/**
* Keep track of XF index.
*
* @var int
*/
private $xfIndex;
/**
* Mapping of XF index (that is a cell XF) to final index in cellXf collection.
*
* @var array
*/
private $mapCellXfIndex;
/**
* Mapping of XF index (that is a style XF) to final index in cellStyleXf collection.
*
* @var array
*/
private $mapCellStyleXfIndex;
/**
* The shared formulas in a sheet. One SHAREDFMLA record contributes with one value.
*
* @var array
*/
private $sharedFormulas;
/**
* The shared formula parts in a sheet. One FORMULA record contributes with one value if it
* refers to a shared formula.
*
* @var array
*/
private $sharedFormulaParts;
/**
* The type of encryption in use.
*
* @var int
*/
private $encryption = 0;
/**
* The position in the stream after which contents are encrypted.
*
* @var int
*/
private $encryptionStartPos = 0;
/**
* The current RC4 decryption object.
*
* @var Xls\RC4
*/
private $rc4Key;
/**
* The position in the stream that the RC4 decryption object was left at.
*
* @var int
*/
private $rc4Pos = 0;
/**
* The current MD5 context state.
*
* @var string
*/
private $md5Ctxt;
/**
* @var int
*/
private $textObjRef;
/**
* @var string
*/
private $baseCell;
/**
* Create a new Xls Reader instance.
*/
public function __construct()
{
parent::__construct();
}
/**
* Can the current IReader read the file?
*/
public function canRead(string $filename): bool
{
if (!File::testFileNoThrow($filename)) {
return false;
}
try {
// Use ParseXL for the hard work.
$ole = new OLERead();
// get excel data
$ole->read($filename);
return true;
} catch (PhpSpreadsheetException $e) {
return false;
}
}
public function setCodepage(string $codepage): void
{
if (!CodePage::validate($codepage)) {
throw new PhpSpreadsheetException('Unknown codepage: ' . $codepage);
}
$this->codepage = $codepage;
}
/**
* Reads names of the worksheets from a file, without parsing the whole file to a PhpSpreadsheet object.
*
* @param string $filename
*
* @return array
*/
public function listWorksheetNames($filename)
{
File::assertFile($filename);
$worksheetNames = [];
// Read the OLE file
$this->loadOLE($filename);
// total byte size of Excel data (workbook global substream + sheet substreams)
$this->dataSize = strlen($this->data);
$this->pos = 0;
$this->sheets = [];
// Parse Workbook Global Substream
while ($this->pos < $this->dataSize) {
$code = self::getUInt2d($this->data, $this->pos);
switch ($code) {
case self::XLS_TYPE_BOF:
$this->readBof();
break;
case self::XLS_TYPE_SHEET:
$this->readSheet();
break;
case self::XLS_TYPE_EOF:
$this->readDefault();
break 2;
default:
$this->readDefault();
break;
}
}
foreach ($this->sheets as $sheet) {
if ($sheet['sheetType'] != 0x00) {
// 0x00: Worksheet, 0x02: Chart, 0x06: Visual Basic module
continue;
}
$worksheetNames[] = $sheet['name'];
}
return $worksheetNames;
}
/**
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns).
*
* @param string $filename
*
* @return array
*/
public function listWorksheetInfo($filename)
{
File::assertFile($filename);
$worksheetInfo = [];
// Read the OLE file
$this->loadOLE($filename);
// total byte size of Excel data (workbook global substream + sheet substreams)
$this->dataSize = strlen($this->data);
// initialize
$this->pos = 0;
$this->sheets = [];
// Parse Workbook Global Substream
while ($this->pos < $this->dataSize) {
$code = self::getUInt2d($this->data, $this->pos);
switch ($code) {
case self::XLS_TYPE_BOF:
$this->readBof();
break;
case self::XLS_TYPE_SHEET:
$this->readSheet();
break;
case self::XLS_TYPE_EOF:
$this->readDefault();
break 2;
default:
$this->readDefault();
break;
}
}
// Parse the individual sheets
foreach ($this->sheets as $sheet) {
if ($sheet['sheetType'] != 0x00) {
// 0x00: Worksheet
// 0x02: Chart
// 0x06: Visual Basic module
continue;
}
$tmpInfo = [];
$tmpInfo['worksheetName'] = $sheet['name'];
$tmpInfo['lastColumnLetter'] = 'A';
$tmpInfo['lastColumnIndex'] = 0;
$tmpInfo['totalRows'] = 0;
$tmpInfo['totalColumns'] = 0;
$this->pos = $sheet['offset'];
while ($this->pos <= $this->dataSize - 4) {
$code = self::getUInt2d($this->data, $this->pos);
switch ($code) {
case self::XLS_TYPE_RK:
case self::XLS_TYPE_LABELSST:
case self::XLS_TYPE_NUMBER:
case self::XLS_TYPE_FORMULA:
case self::XLS_TYPE_BOOLERR:
case self::XLS_TYPE_LABEL:
$length = self::getUInt2d($this->data, $this->pos + 2);
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
// move stream pointer to next record
$this->pos += 4 + $length;
$rowIndex = self::getUInt2d($recordData, 0) + 1;
$columnIndex = self::getUInt2d($recordData, 2);
$tmpInfo['totalRows'] = max($tmpInfo['totalRows'], $rowIndex);
$tmpInfo['lastColumnIndex'] = max($tmpInfo['lastColumnIndex'], $columnIndex);
break;
case self::XLS_TYPE_BOF:
$this->readBof();
break;
case self::XLS_TYPE_EOF:
$this->readDefault();
break 2;
default:
$this->readDefault();
break;
}
}
$tmpInfo['lastColumnLetter'] = Coordinate::stringFromColumnIndex($tmpInfo['lastColumnIndex'] + 1);
$tmpInfo['totalColumns'] = $tmpInfo['lastColumnIndex'] + 1;
$worksheetInfo[] = $tmpInfo;
}
return $worksheetInfo;
}
/**
* Loads PhpSpreadsheet from file.
*
* @return Spreadsheet
*/
public function load(string $filename, int $flags = 0)
{
$this->processFlags($flags);
// Read the OLE file
$this->loadOLE($filename);
// Initialisations
$this->spreadsheet = new Spreadsheet();
$this->spreadsheet->removeSheetByIndex(0); // remove 1st sheet
if (!$this->readDataOnly) {
$this->spreadsheet->removeCellStyleXfByIndex(0); // remove the default style
$this->spreadsheet->removeCellXfByIndex(0); // remove the default style
}
// Read the summary information stream (containing meta data)
$this->readSummaryInformation();
// Read the Additional document summary information stream (containing application-specific meta data)
$this->readDocumentSummaryInformation();
// total byte size of Excel data (workbook global substream + sheet substreams)
$this->dataSize = strlen($this->data);
// initialize
$this->pos = 0;
$this->codepage = $this->codepage ?: CodePage::DEFAULT_CODE_PAGE;
$this->formats = [];
$this->objFonts = [];
$this->palette = [];
$this->sheets = [];
$this->externalBooks = [];
$this->ref = [];
$this->definedname = [];
$this->sst = [];
$this->drawingGroupData = '';
$this->xfIndex = 0;
$this->mapCellXfIndex = [];
$this->mapCellStyleXfIndex = [];
// Parse Workbook Global Substream
while ($this->pos < $this->dataSize) {
$code = self::getUInt2d($this->data, $this->pos);
switch ($code) {
case self::XLS_TYPE_BOF:
$this->readBof();
break;
case self::XLS_TYPE_FILEPASS:
$this->readFilepass();
break;
case self::XLS_TYPE_CODEPAGE:
$this->readCodepage();
break;
case self::XLS_TYPE_DATEMODE:
$this->readDateMode();
break;
case self::XLS_TYPE_FONT:
$this->readFont();
break;
case self::XLS_TYPE_FORMAT:
$this->readFormat();
break;
case self::XLS_TYPE_XF:
$this->readXf();
break;
case self::XLS_TYPE_XFEXT:
$this->readXfExt();
break;
case self::XLS_TYPE_STYLE:
$this->readStyle();
break;
case self::XLS_TYPE_PALETTE:
$this->readPalette();
break;
case self::XLS_TYPE_SHEET:
$this->readSheet();
break;
case self::XLS_TYPE_EXTERNALBOOK:
$this->readExternalBook();
break;
case self::XLS_TYPE_EXTERNNAME:
$this->readExternName();
break;
case self::XLS_TYPE_EXTERNSHEET:
$this->readExternSheet();
break;
case self::XLS_TYPE_DEFINEDNAME:
$this->readDefinedName();
break;
case self::XLS_TYPE_MSODRAWINGGROUP:
$this->readMsoDrawingGroup();
break;
case self::XLS_TYPE_SST:
$this->readSst();
break;
case self::XLS_TYPE_EOF:
$this->readDefault();
break 2;
default:
$this->readDefault();
break;
}
}
// Resolve indexed colors for font, fill, and border colors
// Cannot be resolved already in XF record, because PALETTE record comes afterwards
if (!$this->readDataOnly) {
foreach ($this->objFonts as $objFont) {
if (isset($objFont->colorIndex)) {
$color = Xls\Color::map($objFont->colorIndex, $this->palette, $this->version);
$objFont->getColor()->setRGB($color['rgb']);
}
}
foreach ($this->spreadsheet->getCellXfCollection() as $objStyle) {
// fill start and end color
$fill = $objStyle->getFill();
if (isset($fill->startcolorIndex)) {
$startColor = Xls\Color::map($fill->startcolorIndex, $this->palette, $this->version);
$fill->getStartColor()->setRGB($startColor['rgb']);
}
if (isset($fill->endcolorIndex)) {
$endColor = Xls\Color::map($fill->endcolorIndex, $this->palette, $this->version);
$fill->getEndColor()->setRGB($endColor['rgb']);
}
// border colors
$top = $objStyle->getBorders()->getTop();
$right = $objStyle->getBorders()->getRight();
$bottom = $objStyle->getBorders()->getBottom();
$left = $objStyle->getBorders()->getLeft();
$diagonal = $objStyle->getBorders()->getDiagonal();
if (isset($top->colorIndex)) {
$borderTopColor = Xls\Color::map($top->colorIndex, $this->palette, $this->version);
$top->getColor()->setRGB($borderTopColor['rgb']);
}
if (isset($right->colorIndex)) {
$borderRightColor = Xls\Color::map($right->colorIndex, $this->palette, $this->version);
$right->getColor()->setRGB($borderRightColor['rgb']);
}
if (isset($bottom->colorIndex)) {
$borderBottomColor = Xls\Color::map($bottom->colorIndex, $this->palette, $this->version);
$bottom->getColor()->setRGB($borderBottomColor['rgb']);
}
if (isset($left->colorIndex)) {
$borderLeftColor = Xls\Color::map($left->colorIndex, $this->palette, $this->version);
$left->getColor()->setRGB($borderLeftColor['rgb']);
}
if (isset($diagonal->colorIndex)) {
$borderDiagonalColor = Xls\Color::map($diagonal->colorIndex, $this->palette, $this->version);
$diagonal->getColor()->setRGB($borderDiagonalColor['rgb']);
}
}
}
// treat MSODRAWINGGROUP records, workbook-level Escher
$escherWorkbook = null;
if (!$this->readDataOnly && $this->drawingGroupData) {
$escher = new Escher();
$reader = new Xls\Escher($escher);
$escherWorkbook = $reader->load($this->drawingGroupData);
}
// Parse the individual sheets
foreach ($this->sheets as $sheet) {
if ($sheet['sheetType'] != 0x00) {
// 0x00: Worksheet, 0x02: Chart, 0x06: Visual Basic module
continue;
}
// check if sheet should be skipped
if (isset($this->loadSheetsOnly) && !in_array($sheet['name'], $this->loadSheetsOnly)) {
continue;
}
// add sheet to PhpSpreadsheet object
$this->phpSheet = $this->spreadsheet->createSheet();
// Use false for $updateFormulaCellReferences to prevent adjustment of worksheet references in formula
// cells... during the load, all formulae should be correct, and we're simply bringing the worksheet
// name in line with the formula, not the reverse
$this->phpSheet->setTitle($sheet['name'], false, false);
$this->phpSheet->setSheetState($sheet['sheetState']);
$this->pos = $sheet['offset'];
// Initialize isFitToPages. May change after reading SHEETPR record.
$this->isFitToPages = false;
// Initialize drawingData
$this->drawingData = '';
// Initialize objs
$this->objs = [];
// Initialize shared formula parts
$this->sharedFormulaParts = [];
// Initialize shared formulas
$this->sharedFormulas = [];
// Initialize text objs
$this->textObjects = [];
// Initialize cell annotations
$this->cellNotes = [];
$this->textObjRef = -1;
while ($this->pos <= $this->dataSize - 4) {
$code = self::getUInt2d($this->data, $this->pos);
switch ($code) {
case self::XLS_TYPE_BOF:
$this->readBof();
break;
case self::XLS_TYPE_PRINTGRIDLINES:
$this->readPrintGridlines();
break;
case self::XLS_TYPE_DEFAULTROWHEIGHT:
$this->readDefaultRowHeight();
break;
case self::XLS_TYPE_SHEETPR:
$this->readSheetPr();
break;
case self::XLS_TYPE_HORIZONTALPAGEBREAKS:
$this->readHorizontalPageBreaks();
break;
case self::XLS_TYPE_VERTICALPAGEBREAKS:
$this->readVerticalPageBreaks();
break;
case self::XLS_TYPE_HEADER:
$this->readHeader();
break;
case self::XLS_TYPE_FOOTER:
$this->readFooter();
break;
case self::XLS_TYPE_HCENTER:
$this->readHcenter();
break;
case self::XLS_TYPE_VCENTER:
$this->readVcenter();
break;
case self::XLS_TYPE_LEFTMARGIN:
$this->readLeftMargin();
break;
case self::XLS_TYPE_RIGHTMARGIN:
$this->readRightMargin();
break;
case self::XLS_TYPE_TOPMARGIN:
$this->readTopMargin();
break;
case self::XLS_TYPE_BOTTOMMARGIN:
$this->readBottomMargin();
break;
case self::XLS_TYPE_PAGESETUP:
$this->readPageSetup();
break;
case self::XLS_TYPE_PROTECT:
$this->readProtect();
break;
case self::XLS_TYPE_SCENPROTECT:
$this->readScenProtect();
break;
case self::XLS_TYPE_OBJECTPROTECT:
$this->readObjectProtect();
break;
case self::XLS_TYPE_PASSWORD:
$this->readPassword();
break;
case self::XLS_TYPE_DEFCOLWIDTH:
$this->readDefColWidth();
break;
case self::XLS_TYPE_COLINFO:
$this->readColInfo();
break;
case self::XLS_TYPE_DIMENSION:
$this->readDefault();
break;
case self::XLS_TYPE_ROW:
$this->readRow();
break;
case self::XLS_TYPE_DBCELL:
$this->readDefault();
break;
case self::XLS_TYPE_RK:
$this->readRk();
break;
case self::XLS_TYPE_LABELSST:
$this->readLabelSst();
break;
case self::XLS_TYPE_MULRK:
$this->readMulRk();
break;
case self::XLS_TYPE_NUMBER:
$this->readNumber();
break;
case self::XLS_TYPE_FORMULA:
$this->readFormula();
break;
case self::XLS_TYPE_SHAREDFMLA:
$this->readSharedFmla();
break;
case self::XLS_TYPE_BOOLERR:
$this->readBoolErr();
break;
case self::XLS_TYPE_MULBLANK:
$this->readMulBlank();
break;
case self::XLS_TYPE_LABEL:
$this->readLabel();
break;
case self::XLS_TYPE_BLANK:
$this->readBlank();
break;
case self::XLS_TYPE_MSODRAWING:
$this->readMsoDrawing();
break;
case self::XLS_TYPE_OBJ:
$this->readObj();
break;
case self::XLS_TYPE_WINDOW2:
$this->readWindow2();
break;
case self::XLS_TYPE_PAGELAYOUTVIEW:
$this->readPageLayoutView();
break;
case self::XLS_TYPE_SCL:
$this->readScl();
break;
case self::XLS_TYPE_PANE:
$this->readPane();
break;
case self::XLS_TYPE_SELECTION:
$this->readSelection();
break;
case self::XLS_TYPE_MERGEDCELLS:
$this->readMergedCells();
break;
case self::XLS_TYPE_HYPERLINK:
$this->readHyperLink();
break;
case self::XLS_TYPE_DATAVALIDATIONS:
$this->readDataValidations();
break;
case self::XLS_TYPE_DATAVALIDATION:
$this->readDataValidation();
break;
case self::XLS_TYPE_SHEETLAYOUT:
$this->readSheetLayout();
break;
case self::XLS_TYPE_SHEETPROTECTION:
$this->readSheetProtection();
break;
case self::XLS_TYPE_RANGEPROTECTION:
$this->readRangeProtection();
break;
case self::XLS_TYPE_NOTE:
$this->readNote();
break;
case self::XLS_TYPE_TXO:
$this->readTextObject();
break;
case self::XLS_TYPE_CONTINUE:
$this->readContinue();
break;
case self::XLS_TYPE_EOF:
$this->readDefault();
break 2;
default:
$this->readDefault();
break;
}
}
// treat MSODRAWING records, sheet-level Escher
if (!$this->readDataOnly && $this->drawingData) {
$escherWorksheet = new Escher();
$reader = new Xls\Escher($escherWorksheet);
$escherWorksheet = $reader->load($this->drawingData);
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | true |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use DateTime;
use DateTimeZone;
use PhpOffice\PhpSpreadsheet\Cell\AddressHelper;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Cell\DataType;
use PhpOffice\PhpSpreadsheet\DefinedName;
use PhpOffice\PhpSpreadsheet\Reader\Security\XmlScanner;
use PhpOffice\PhpSpreadsheet\Reader\Xml\PageSettings;
use PhpOffice\PhpSpreadsheet\Reader\Xml\Properties;
use PhpOffice\PhpSpreadsheet\Reader\Xml\Style;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Settings;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Shared\File;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use SimpleXMLElement;
/**
* Reader for SpreadsheetML, the XML schema for Microsoft Office Excel 2003.
*/
class Xml extends BaseReader
{
/**
* Formats.
*
* @var array
*/
protected $styles = [];
/**
* Create a new Excel2003XML Reader instance.
*/
public function __construct()
{
parent::__construct();
$this->securityScanner = XmlScanner::getInstance($this);
}
private $fileContents = '';
public static function xmlMappings(): array
{
return array_merge(
Style\Fill::FILL_MAPPINGS,
Style\Border::BORDER_MAPPINGS
);
}
/**
* Can the current IReader read the file?
*/
public function canRead(string $filename): bool
{
// Office xmlns:o="urn:schemas-microsoft-com:office:office"
// Excel xmlns:x="urn:schemas-microsoft-com:office:excel"
// XML Spreadsheet xmlns:ss="urn:schemas-microsoft-com:office:spreadsheet"
// Spreadsheet component xmlns:c="urn:schemas-microsoft-com:office:component:spreadsheet"
// XML schema xmlns:s="uuid:BDC6E3F0-6DA3-11d1-A2A3-00AA00C14882"
// XML data type xmlns:dt="uuid:C2F41010-65B3-11d1-A29F-00AA00C14882"
// MS-persist recordset xmlns:rs="urn:schemas-microsoft-com:rowset"
// Rowset xmlns:z="#RowsetSchema"
//
$signature = [
'<?xml version="1.0"',
'xmlns:ss="urn:schemas-microsoft-com:office:spreadsheet',
];
// Open file
$data = file_get_contents($filename);
// Why?
//$data = str_replace("'", '"', $data); // fix headers with single quote
$valid = true;
foreach ($signature as $match) {
// every part of the signature must be present
if (strpos($data, $match) === false) {
$valid = false;
break;
}
}
// Retrieve charset encoding
if (preg_match('/<?xml.*encoding=[\'"](.*?)[\'"].*?>/m', $data, $matches)) {
$charSet = strtoupper($matches[1]);
if (1 == preg_match('/^ISO-8859-\d[\dL]?$/i', $charSet)) {
$data = StringHelper::convertEncoding($data, 'UTF-8', $charSet);
$data = preg_replace('/(<?xml.*encoding=[\'"]).*?([\'"].*?>)/um', '$1' . 'UTF-8' . '$2', $data, 1);
}
}
$this->fileContents = $data;
return $valid;
}
/**
* Check if the file is a valid SimpleXML.
*
* @param string $filename
*
* @return false|SimpleXMLElement
*/
public function trySimpleXMLLoadString($filename)
{
try {
$xml = simplexml_load_string(
$this->securityScanner->scan($this->fileContents ?: file_get_contents($filename)),
'SimpleXMLElement',
Settings::getLibXmlLoaderOptions()
);
} catch (\Exception $e) {
throw new Exception('Cannot load invalid XML file: ' . $filename, 0, $e);
}
$this->fileContents = '';
return $xml;
}
/**
* Reads names of the worksheets from a file, without parsing the whole file to a Spreadsheet object.
*
* @param string $filename
*
* @return array
*/
public function listWorksheetNames($filename)
{
File::assertFile($filename);
if (!$this->canRead($filename)) {
throw new Exception($filename . ' is an Invalid Spreadsheet file.');
}
$worksheetNames = [];
$xml = $this->trySimpleXMLLoadString($filename);
if ($xml === false) {
throw new Exception("Problem reading {$filename}");
}
$namespaces = $xml->getNamespaces(true);
$xml_ss = $xml->children($namespaces['ss']);
foreach ($xml_ss->Worksheet as $worksheet) {
$worksheet_ss = self::getAttributes($worksheet, $namespaces['ss']);
$worksheetNames[] = (string) $worksheet_ss['Name'];
}
return $worksheetNames;
}
/**
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns).
*
* @param string $filename
*
* @return array
*/
public function listWorksheetInfo($filename)
{
File::assertFile($filename);
if (!$this->canRead($filename)) {
throw new Exception($filename . ' is an Invalid Spreadsheet file.');
}
$worksheetInfo = [];
$xml = $this->trySimpleXMLLoadString($filename);
if ($xml === false) {
throw new Exception("Problem reading {$filename}");
}
$namespaces = $xml->getNamespaces(true);
$worksheetID = 1;
$xml_ss = $xml->children($namespaces['ss']);
foreach ($xml_ss->Worksheet as $worksheet) {
$worksheet_ss = self::getAttributes($worksheet, $namespaces['ss']);
$tmpInfo = [];
$tmpInfo['worksheetName'] = '';
$tmpInfo['lastColumnLetter'] = 'A';
$tmpInfo['lastColumnIndex'] = 0;
$tmpInfo['totalRows'] = 0;
$tmpInfo['totalColumns'] = 0;
$tmpInfo['worksheetName'] = "Worksheet_{$worksheetID}";
if (isset($worksheet_ss['Name'])) {
$tmpInfo['worksheetName'] = (string) $worksheet_ss['Name'];
}
if (isset($worksheet->Table->Row)) {
$rowIndex = 0;
foreach ($worksheet->Table->Row as $rowData) {
$columnIndex = 0;
$rowHasData = false;
foreach ($rowData->Cell as $cell) {
if (isset($cell->Data)) {
$tmpInfo['lastColumnIndex'] = max($tmpInfo['lastColumnIndex'], $columnIndex);
$rowHasData = true;
}
++$columnIndex;
}
++$rowIndex;
if ($rowHasData) {
$tmpInfo['totalRows'] = max($tmpInfo['totalRows'], $rowIndex);
}
}
}
$tmpInfo['lastColumnLetter'] = Coordinate::stringFromColumnIndex($tmpInfo['lastColumnIndex'] + 1);
$tmpInfo['totalColumns'] = $tmpInfo['lastColumnIndex'] + 1;
$worksheetInfo[] = $tmpInfo;
++$worksheetID;
}
return $worksheetInfo;
}
/**
* Loads Spreadsheet from file.
*
* @return Spreadsheet
*/
public function load(string $filename, int $flags = 0)
{
$this->processFlags($flags);
// Create new Spreadsheet
$spreadsheet = new Spreadsheet();
$spreadsheet->removeSheetByIndex(0);
// Load into this instance
return $this->loadIntoExisting($filename, $spreadsheet);
}
/**
* Loads from file into Spreadsheet instance.
*
* @param string $filename
*
* @return Spreadsheet
*/
public function loadIntoExisting($filename, Spreadsheet $spreadsheet)
{
File::assertFile($filename);
if (!$this->canRead($filename)) {
throw new Exception($filename . ' is an Invalid Spreadsheet file.');
}
$xml = $this->trySimpleXMLLoadString($filename);
if ($xml === false) {
throw new Exception("Problem reading {$filename}");
}
$namespaces = $xml->getNamespaces(true);
(new Properties($spreadsheet))->readProperties($xml, $namespaces);
$this->styles = (new Style())->parseStyles($xml, $namespaces);
$worksheetID = 0;
$xml_ss = $xml->children($namespaces['ss']);
/** @var null|SimpleXMLElement $worksheetx */
foreach ($xml_ss->Worksheet as $worksheetx) {
$worksheet = $worksheetx ?? new SimpleXMLElement('<xml></xml>');
$worksheet_ss = self::getAttributes($worksheet, $namespaces['ss']);
if (
isset($this->loadSheetsOnly, $worksheet_ss['Name']) &&
(!in_array($worksheet_ss['Name'], $this->loadSheetsOnly))
) {
continue;
}
// Create new Worksheet
$spreadsheet->createSheet();
$spreadsheet->setActiveSheetIndex($worksheetID);
$worksheetName = '';
if (isset($worksheet_ss['Name'])) {
$worksheetName = (string) $worksheet_ss['Name'];
// Use false for $updateFormulaCellReferences to prevent adjustment of worksheet references in
// formula cells... during the load, all formulae should be correct, and we're simply bringing
// the worksheet name in line with the formula, not the reverse
$spreadsheet->getActiveSheet()->setTitle($worksheetName, false, false);
}
// locally scoped defined names
if (isset($worksheet->Names[0])) {
foreach ($worksheet->Names[0] as $definedName) {
$definedName_ss = self::getAttributes($definedName, $namespaces['ss']);
$name = (string) $definedName_ss['Name'];
$definedValue = (string) $definedName_ss['RefersTo'];
$convertedValue = AddressHelper::convertFormulaToA1($definedValue);
if ($convertedValue[0] === '=') {
$convertedValue = substr($convertedValue, 1);
}
$spreadsheet->addDefinedName(DefinedName::createInstance($name, $spreadsheet->getActiveSheet(), $convertedValue, true));
}
}
$columnID = 'A';
if (isset($worksheet->Table->Column)) {
foreach ($worksheet->Table->Column as $columnData) {
$columnData_ss = self::getAttributes($columnData, $namespaces['ss']);
if (isset($columnData_ss['Index'])) {
$columnID = Coordinate::stringFromColumnIndex((int) $columnData_ss['Index']);
}
if (isset($columnData_ss['Width'])) {
$columnWidth = $columnData_ss['Width'];
$spreadsheet->getActiveSheet()->getColumnDimension($columnID)->setWidth($columnWidth / 5.4);
}
++$columnID;
}
}
$rowID = 1;
if (isset($worksheet->Table->Row)) {
$additionalMergedCells = 0;
foreach ($worksheet->Table->Row as $rowData) {
$rowHasData = false;
$row_ss = self::getAttributes($rowData, $namespaces['ss']);
if (isset($row_ss['Index'])) {
$rowID = (int) $row_ss['Index'];
}
$columnID = 'A';
foreach ($rowData->Cell as $cell) {
$cell_ss = self::getAttributes($cell, $namespaces['ss']);
if (isset($cell_ss['Index'])) {
$columnID = Coordinate::stringFromColumnIndex((int) $cell_ss['Index']);
}
$cellRange = $columnID . $rowID;
if ($this->getReadFilter() !== null) {
if (!$this->getReadFilter()->readCell($columnID, $rowID, $worksheetName)) {
++$columnID;
continue;
}
}
if (isset($cell_ss['HRef'])) {
$spreadsheet->getActiveSheet()->getCell($cellRange)->getHyperlink()->setUrl((string) $cell_ss['HRef']);
}
if ((isset($cell_ss['MergeAcross'])) || (isset($cell_ss['MergeDown']))) {
$columnTo = $columnID;
if (isset($cell_ss['MergeAcross'])) {
$additionalMergedCells += (int) $cell_ss['MergeAcross'];
$columnTo = Coordinate::stringFromColumnIndex((int) (Coordinate::columnIndexFromString($columnID) + $cell_ss['MergeAcross']));
}
$rowTo = $rowID;
if (isset($cell_ss['MergeDown'])) {
$rowTo = $rowTo + $cell_ss['MergeDown'];
}
$cellRange .= ':' . $columnTo . $rowTo;
$spreadsheet->getActiveSheet()->mergeCells($cellRange);
}
$hasCalculatedValue = false;
$cellDataFormula = '';
if (isset($cell_ss['Formula'])) {
$cellDataFormula = $cell_ss['Formula'];
$hasCalculatedValue = true;
}
if (isset($cell->Data)) {
$cellData = $cell->Data;
$cellValue = (string) $cellData;
$type = DataType::TYPE_NULL;
$cellData_ss = self::getAttributes($cellData, $namespaces['ss']);
if (isset($cellData_ss['Type'])) {
$cellDataType = $cellData_ss['Type'];
switch ($cellDataType) {
/*
const TYPE_STRING = 's';
const TYPE_FORMULA = 'f';
const TYPE_NUMERIC = 'n';
const TYPE_BOOL = 'b';
const TYPE_NULL = 'null';
const TYPE_INLINE = 'inlineStr';
const TYPE_ERROR = 'e';
*/
case 'String':
$type = DataType::TYPE_STRING;
break;
case 'Number':
$type = DataType::TYPE_NUMERIC;
$cellValue = (float) $cellValue;
if (floor($cellValue) == $cellValue) {
$cellValue = (int) $cellValue;
}
break;
case 'Boolean':
$type = DataType::TYPE_BOOL;
$cellValue = ($cellValue != 0);
break;
case 'DateTime':
$type = DataType::TYPE_NUMERIC;
$dateTime = new DateTime($cellValue, new DateTimeZone('UTC'));
$cellValue = Date::PHPToExcel($dateTime);
break;
case 'Error':
$type = DataType::TYPE_ERROR;
$hasCalculatedValue = false;
break;
}
}
if ($hasCalculatedValue) {
$type = DataType::TYPE_FORMULA;
$columnNumber = Coordinate::columnIndexFromString($columnID);
$cellDataFormula = AddressHelper::convertFormulaToA1($cellDataFormula, $rowID, $columnNumber);
}
$spreadsheet->getActiveSheet()->getCell($columnID . $rowID)->setValueExplicit((($hasCalculatedValue) ? $cellDataFormula : $cellValue), $type);
if ($hasCalculatedValue) {
$spreadsheet->getActiveSheet()->getCell($columnID . $rowID)->setCalculatedValue($cellValue);
}
$rowHasData = true;
}
if (isset($cell->Comment)) {
$this->parseCellComment($cell->Comment, $namespaces, $spreadsheet, $columnID, $rowID);
}
if (isset($cell_ss['StyleID'])) {
$style = (string) $cell_ss['StyleID'];
if ((isset($this->styles[$style])) && (!empty($this->styles[$style]))) {
//if (!$spreadsheet->getActiveSheet()->cellExists($columnID . $rowID)) {
// $spreadsheet->getActiveSheet()->getCell($columnID . $rowID)->setValue(null);
//}
$spreadsheet->getActiveSheet()->getStyle($cellRange)
->applyFromArray($this->styles[$style]);
}
}
++$columnID;
while ($additionalMergedCells > 0) {
++$columnID;
--$additionalMergedCells;
}
}
if ($rowHasData) {
if (isset($row_ss['Height'])) {
$rowHeight = $row_ss['Height'];
$spreadsheet->getActiveSheet()->getRowDimension($rowID)->setRowHeight((float) $rowHeight);
}
}
++$rowID;
}
if (isset($namespaces['x'])) {
$xmlX = $worksheet->children($namespaces['x']);
if (isset($xmlX->WorksheetOptions)) {
(new PageSettings($xmlX, $namespaces))->loadPageSettings($spreadsheet);
}
}
}
++$worksheetID;
}
// Globally scoped defined names
$activeWorksheet = $spreadsheet->setActiveSheetIndex(0);
if (isset($xml->Names[0])) {
foreach ($xml->Names[0] as $definedName) {
$definedName_ss = self::getAttributes($definedName, $namespaces['ss']);
$name = (string) $definedName_ss['Name'];
$definedValue = (string) $definedName_ss['RefersTo'];
$convertedValue = AddressHelper::convertFormulaToA1($definedValue);
if ($convertedValue[0] === '=') {
$convertedValue = substr($convertedValue, 1);
}
$spreadsheet->addDefinedName(DefinedName::createInstance($name, $activeWorksheet, $convertedValue));
}
}
// Return
return $spreadsheet;
}
protected function parseCellComment(
SimpleXMLElement $comment,
array $namespaces,
Spreadsheet $spreadsheet,
string $columnID,
int $rowID
): void {
$commentAttributes = $comment->attributes($namespaces['ss']);
$author = 'unknown';
if (isset($commentAttributes->Author)) {
$author = (string) $commentAttributes->Author;
}
$node = $comment->Data->asXML();
$annotation = strip_tags((string) $node);
$spreadsheet->getActiveSheet()->getComment($columnID . $rowID)
->setAuthor($author)
->setText($this->parseRichText($annotation));
}
protected function parseRichText(string $annotation): RichText
{
$value = new RichText();
$value->createText($annotation);
return $value;
}
private static function getAttributes(?SimpleXMLElement $simple, string $node): SimpleXMLElement
{
return ($simple === null)
? new SimpleXMLElement('<xml></xml>')
: ($simple->attributes($node) ?? new SimpleXMLElement('<xml></xml>'));
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/IReader.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/IReader.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
interface IReader
{
public const LOAD_WITH_CHARTS = 1;
/**
* IReader constructor.
*/
public function __construct();
/**
* Can the current IReader read the file?
*/
public function canRead(string $filename): bool;
/**
* Read data only?
* If this is true, then the Reader will only read data values for cells, it will not read any formatting information.
* If false (the default) it will read data and formatting.
*
* @return bool
*/
public function getReadDataOnly();
/**
* Set read data only
* Set to true, to advise the Reader only to read data values for cells, and to ignore any formatting information.
* Set to false (the default) to advise the Reader to read both data and formatting for cells.
*
* @param bool $readDataOnly
*
* @return IReader
*/
public function setReadDataOnly($readDataOnly);
/**
* Read empty cells?
* If this is true (the default), then the Reader will read data values for all cells, irrespective of value.
* If false it will not read data for cells containing a null value or an empty string.
*
* @return bool
*/
public function getReadEmptyCells();
/**
* Set read empty cells
* Set to true (the default) to advise the Reader read data values for all cells, irrespective of value.
* Set to false to advise the Reader to ignore cells containing a null value or an empty string.
*
* @param bool $readEmptyCells
*
* @return IReader
*/
public function setReadEmptyCells($readEmptyCells);
/**
* Read charts in workbook?
* If this is true, then the Reader will include any charts that exist in the workbook.
* Note that a ReadDataOnly value of false overrides, and charts won't be read regardless of the IncludeCharts value.
* If false (the default) it will ignore any charts defined in the workbook file.
*
* @return bool
*/
public function getIncludeCharts();
/**
* Set read charts in workbook
* Set to true, to advise the Reader to include any charts that exist in the workbook.
* Note that a ReadDataOnly value of false overrides, and charts won't be read regardless of the IncludeCharts value.
* Set to false (the default) to discard charts.
*
* @param bool $includeCharts
*
* @return IReader
*/
public function setIncludeCharts($includeCharts);
/**
* Get which sheets to load
* Returns either an array of worksheet names (the list of worksheets that should be loaded), or a null
* indicating that all worksheets in the workbook should be loaded.
*
* @return mixed
*/
public function getLoadSheetsOnly();
/**
* Set which sheets to load.
*
* @param mixed $value
* This should be either an array of worksheet names to be loaded, or a string containing a single worksheet name.
* If NULL, then it tells the Reader to read all worksheets in the workbook
*
* @return IReader
*/
public function setLoadSheetsOnly($value);
/**
* Set all sheets to load
* Tells the Reader to load all worksheets from the workbook.
*
* @return IReader
*/
public function setLoadAllSheets();
/**
* Read filter.
*
* @return IReadFilter
*/
public function getReadFilter();
/**
* Set read filter.
*
* @return IReader
*/
public function setReadFilter(IReadFilter $readFilter);
/**
* Loads PhpSpreadsheet from file.
*
* @return \PhpOffice\PhpSpreadsheet\Spreadsheet
*/
public function load(string $filename, int $flags = 0);
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Html.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Html.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use DOMDocument;
use DOMElement;
use DOMNode;
use DOMText;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Helper\Dimension as CssDimension;
use PhpOffice\PhpSpreadsheet\Reader\Security\XmlScanner;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\Border;
use PhpOffice\PhpSpreadsheet\Style\Color;
use PhpOffice\PhpSpreadsheet\Style\Fill;
use PhpOffice\PhpSpreadsheet\Style\Font;
use PhpOffice\PhpSpreadsheet\Style\Style;
use PhpOffice\PhpSpreadsheet\Worksheet\Drawing;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use Throwable;
/** PhpSpreadsheet root directory */
class Html extends BaseReader
{
/**
* Sample size to read to determine if it's HTML or not.
*/
const TEST_SAMPLE_SIZE = 2048;
/**
* Input encoding.
*
* @var string
*/
protected $inputEncoding = 'ANSI';
/**
* Sheet index to read.
*
* @var int
*/
protected $sheetIndex = 0;
/**
* Formats.
*
* @var array
*/
protected $formats = [
'h1' => [
'font' => [
'bold' => true,
'size' => 24,
],
], // Bold, 24pt
'h2' => [
'font' => [
'bold' => true,
'size' => 18,
],
], // Bold, 18pt
'h3' => [
'font' => [
'bold' => true,
'size' => 13.5,
],
], // Bold, 13.5pt
'h4' => [
'font' => [
'bold' => true,
'size' => 12,
],
], // Bold, 12pt
'h5' => [
'font' => [
'bold' => true,
'size' => 10,
],
], // Bold, 10pt
'h6' => [
'font' => [
'bold' => true,
'size' => 7.5,
],
], // Bold, 7.5pt
'a' => [
'font' => [
'underline' => true,
'color' => [
'argb' => Color::COLOR_BLUE,
],
],
], // Blue underlined
'hr' => [
'borders' => [
'bottom' => [
'borderStyle' => Border::BORDER_THIN,
'color' => [
Color::COLOR_BLACK,
],
],
],
], // Bottom border
'strong' => [
'font' => [
'bold' => true,
],
], // Bold
'b' => [
'font' => [
'bold' => true,
],
], // Bold
'i' => [
'font' => [
'italic' => true,
],
], // Italic
'em' => [
'font' => [
'italic' => true,
],
], // Italic
];
/** @var array */
protected $rowspan = [];
/**
* Create a new HTML Reader instance.
*/
public function __construct()
{
parent::__construct();
$this->securityScanner = XmlScanner::getInstance($this);
}
/**
* Validate that the current file is an HTML file.
*/
public function canRead(string $filename): bool
{
// Check if file exists
try {
$this->openFile($filename);
} catch (Exception $e) {
return false;
}
$beginning = $this->readBeginning();
$startWithTag = self::startsWithTag($beginning);
$containsTags = self::containsTags($beginning);
$endsWithTag = self::endsWithTag($this->readEnding());
fclose($this->fileHandle);
return $startWithTag && $containsTags && $endsWithTag;
}
private function readBeginning(): string
{
fseek($this->fileHandle, 0);
return (string) fread($this->fileHandle, self::TEST_SAMPLE_SIZE);
}
private function readEnding(): string
{
$meta = stream_get_meta_data($this->fileHandle);
$filename = $meta['uri'];
$size = (int) filesize($filename);
if ($size === 0) {
return '';
}
$blockSize = self::TEST_SAMPLE_SIZE;
if ($size < $blockSize) {
$blockSize = $size;
}
fseek($this->fileHandle, $size - $blockSize);
return (string) fread($this->fileHandle, $blockSize);
}
private static function startsWithTag(string $data): bool
{
return '<' === substr(trim($data), 0, 1);
}
private static function endsWithTag(string $data): bool
{
return '>' === substr(trim($data), -1, 1);
}
private static function containsTags(string $data): bool
{
return strlen($data) !== strlen(strip_tags($data));
}
/**
* Loads Spreadsheet from file.
*
* @return Spreadsheet
*/
public function load(string $filename, int $flags = 0)
{
$this->processFlags($flags);
// Create new Spreadsheet
$spreadsheet = new Spreadsheet();
// Load into this instance
return $this->loadIntoExisting($filename, $spreadsheet);
}
/**
* Set input encoding.
*
* @param string $inputEncoding Input encoding, eg: 'ANSI'
*
* @return $this
*
* @codeCoverageIgnore
*
* @deprecated no use is made of this property
*/
public function setInputEncoding($inputEncoding)
{
$this->inputEncoding = $inputEncoding;
return $this;
}
/**
* Get input encoding.
*
* @return string
*
* @codeCoverageIgnore
*
* @deprecated no use is made of this property
*/
public function getInputEncoding()
{
return $this->inputEncoding;
}
// Data Array used for testing only, should write to Spreadsheet object on completion of tests
/** @var array */
protected $dataArray = [];
/** @var int */
protected $tableLevel = 0;
/** @var array */
protected $nestedColumn = ['A'];
protected function setTableStartColumn(string $column): string
{
if ($this->tableLevel == 0) {
$column = 'A';
}
++$this->tableLevel;
$this->nestedColumn[$this->tableLevel] = $column;
return $this->nestedColumn[$this->tableLevel];
}
protected function getTableStartColumn(): string
{
return $this->nestedColumn[$this->tableLevel];
}
protected function releaseTableStartColumn(): string
{
--$this->tableLevel;
return array_pop($this->nestedColumn);
}
/**
* Flush cell.
*
* @param string $column
* @param int|string $row
* @param mixed $cellContent
*/
protected function flushCell(Worksheet $sheet, $column, $row, &$cellContent): void
{
if (is_string($cellContent)) {
// Simple String content
if (trim($cellContent) > '') {
// Only actually write it if there's content in the string
// Write to worksheet to be done here...
// ... we return the cell so we can mess about with styles more easily
$sheet->setCellValue($column . $row, $cellContent);
$this->dataArray[$row][$column] = $cellContent;
}
} else {
// We have a Rich Text run
// TODO
$this->dataArray[$row][$column] = 'RICH TEXT: ' . $cellContent;
}
$cellContent = (string) '';
}
private function processDomElementBody(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child): void
{
$attributeArray = [];
foreach (($child->attributes ?? []) as $attribute) {
$attributeArray[$attribute->name] = $attribute->value;
}
if ($child->nodeName === 'body') {
$row = 1;
$column = 'A';
$cellContent = '';
$this->tableLevel = 0;
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
} else {
$this->processDomElementTitle($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementTitle(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'title') {
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
$sheet->setTitle($cellContent, true, true);
$cellContent = '';
} else {
$this->processDomElementSpanEtc($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private const SPAN_ETC = ['span', 'div', 'font', 'i', 'em', 'strong', 'b'];
private function processDomElementSpanEtc(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if (in_array((string) $child->nodeName, self::SPAN_ETC, true)) {
if (isset($attributeArray['class']) && $attributeArray['class'] === 'comment') {
$sheet->getComment($column . $row)
->getText()
->createTextRun($child->textContent);
} else {
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
}
if (isset($this->formats[$child->nodeName])) {
$sheet->getStyle($column . $row)->applyFromArray($this->formats[$child->nodeName]);
}
} else {
$this->processDomElementHr($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementHr(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'hr') {
$this->flushCell($sheet, $column, $row, $cellContent);
++$row;
if (isset($this->formats[$child->nodeName])) {
$sheet->getStyle($column . $row)->applyFromArray($this->formats[$child->nodeName]);
}
++$row;
}
// fall through to br
$this->processDomElementBr($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
private function processDomElementBr(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'br' || $child->nodeName === 'hr') {
if ($this->tableLevel > 0) {
// If we're inside a table, replace with a \n and set the cell to wrap
$cellContent .= "\n";
$sheet->getStyle($column . $row)->getAlignment()->setWrapText(true);
} else {
// Otherwise flush our existing content and move the row cursor on
$this->flushCell($sheet, $column, $row, $cellContent);
++$row;
}
} else {
$this->processDomElementA($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementA(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'a') {
foreach ($attributeArray as $attributeName => $attributeValue) {
switch ($attributeName) {
case 'href':
$sheet->getCell($column . $row)->getHyperlink()->setUrl($attributeValue);
if (isset($this->formats[$child->nodeName])) {
$sheet->getStyle($column . $row)->applyFromArray($this->formats[$child->nodeName]);
}
break;
case 'class':
if ($attributeValue === 'comment-indicator') {
break; // Ignore - it's just a red square.
}
}
}
// no idea why this should be needed
//$cellContent .= ' ';
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
} else {
$this->processDomElementH1Etc($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private const H1_ETC = ['h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'ol', 'ul', 'p'];
private function processDomElementH1Etc(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if (in_array((string) $child->nodeName, self::H1_ETC, true)) {
if ($this->tableLevel > 0) {
// If we're inside a table, replace with a \n
$cellContent .= $cellContent ? "\n" : '';
$sheet->getStyle($column . $row)->getAlignment()->setWrapText(true);
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
} else {
if ($cellContent > '') {
$this->flushCell($sheet, $column, $row, $cellContent);
++$row;
}
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
$this->flushCell($sheet, $column, $row, $cellContent);
if (isset($this->formats[$child->nodeName])) {
$sheet->getStyle($column . $row)->applyFromArray($this->formats[$child->nodeName]);
}
++$row;
$column = 'A';
}
} else {
$this->processDomElementLi($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementLi(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'li') {
if ($this->tableLevel > 0) {
// If we're inside a table, replace with a \n
$cellContent .= $cellContent ? "\n" : '';
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
} else {
if ($cellContent > '') {
$this->flushCell($sheet, $column, $row, $cellContent);
}
++$row;
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
$this->flushCell($sheet, $column, $row, $cellContent);
$column = 'A';
}
} else {
$this->processDomElementImg($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementImg(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'img') {
$this->insertImage($sheet, $column, $row, $attributeArray);
} else {
$this->processDomElementTable($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementTable(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'table') {
$this->flushCell($sheet, $column, $row, $cellContent);
$column = $this->setTableStartColumn($column);
if ($this->tableLevel > 1 && $row > 1) {
--$row;
}
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
$column = $this->releaseTableStartColumn();
if ($this->tableLevel > 1) {
++$column;
} else {
++$row;
}
} else {
$this->processDomElementTr($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementTr(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName === 'tr') {
$column = $this->getTableStartColumn();
$cellContent = '';
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
if (isset($attributeArray['height'])) {
$sheet->getRowDimension($row)->setRowHeight($attributeArray['height']);
}
++$row;
} else {
$this->processDomElementThTdOther($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementThTdOther(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
if ($child->nodeName !== 'td' && $child->nodeName !== 'th') {
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
} else {
$this->processDomElementThTd($sheet, $row, $column, $cellContent, $child, $attributeArray);
}
}
private function processDomElementBgcolor(Worksheet $sheet, int $row, string $column, array $attributeArray): void
{
if (isset($attributeArray['bgcolor'])) {
$sheet->getStyle("$column$row")->applyFromArray(
[
'fill' => [
'fillType' => Fill::FILL_SOLID,
'color' => ['rgb' => $this->getStyleColor($attributeArray['bgcolor'])],
],
]
);
}
}
private function processDomElementWidth(Worksheet $sheet, string $column, array $attributeArray): void
{
if (isset($attributeArray['width'])) {
$sheet->getColumnDimension($column)->setWidth((new CssDimension($attributeArray['width']))->width());
}
}
private function processDomElementHeight(Worksheet $sheet, int $row, array $attributeArray): void
{
if (isset($attributeArray['height'])) {
$sheet->getRowDimension($row)->setRowHeight((new CssDimension($attributeArray['height']))->height());
}
}
private function processDomElementAlign(Worksheet $sheet, int $row, string $column, array $attributeArray): void
{
if (isset($attributeArray['align'])) {
$sheet->getStyle($column . $row)->getAlignment()->setHorizontal($attributeArray['align']);
}
}
private function processDomElementVAlign(Worksheet $sheet, int $row, string $column, array $attributeArray): void
{
if (isset($attributeArray['valign'])) {
$sheet->getStyle($column . $row)->getAlignment()->setVertical($attributeArray['valign']);
}
}
private function processDomElementDataFormat(Worksheet $sheet, int $row, string $column, array $attributeArray): void
{
if (isset($attributeArray['data-format'])) {
$sheet->getStyle($column . $row)->getNumberFormat()->setFormatCode($attributeArray['data-format']);
}
}
private function processDomElementThTd(Worksheet $sheet, int &$row, string &$column, string &$cellContent, DOMElement $child, array &$attributeArray): void
{
while (isset($this->rowspan[$column . $row])) {
++$column;
}
$this->processDomElement($child, $sheet, $row, $column, $cellContent);
// apply inline style
$this->applyInlineStyle($sheet, $row, $column, $attributeArray);
$this->flushCell($sheet, $column, $row, $cellContent);
$this->processDomElementBgcolor($sheet, $row, $column, $attributeArray);
$this->processDomElementWidth($sheet, $column, $attributeArray);
$this->processDomElementHeight($sheet, $row, $attributeArray);
$this->processDomElementAlign($sheet, $row, $column, $attributeArray);
$this->processDomElementVAlign($sheet, $row, $column, $attributeArray);
$this->processDomElementDataFormat($sheet, $row, $column, $attributeArray);
if (isset($attributeArray['rowspan'], $attributeArray['colspan'])) {
//create merging rowspan and colspan
$columnTo = $column;
for ($i = 0; $i < (int) $attributeArray['colspan'] - 1; ++$i) {
++$columnTo;
}
$range = $column . $row . ':' . $columnTo . ($row + (int) $attributeArray['rowspan'] - 1);
foreach (Coordinate::extractAllCellReferencesInRange($range) as $value) {
$this->rowspan[$value] = true;
}
$sheet->mergeCells($range);
$column = $columnTo;
} elseif (isset($attributeArray['rowspan'])) {
//create merging rowspan
$range = $column . $row . ':' . $column . ($row + (int) $attributeArray['rowspan'] - 1);
foreach (Coordinate::extractAllCellReferencesInRange($range) as $value) {
$this->rowspan[$value] = true;
}
$sheet->mergeCells($range);
} elseif (isset($attributeArray['colspan'])) {
//create merging colspan
$columnTo = $column;
for ($i = 0; $i < (int) $attributeArray['colspan'] - 1; ++$i) {
++$columnTo;
}
$sheet->mergeCells($column . $row . ':' . $columnTo . $row);
$column = $columnTo;
}
++$column;
}
protected function processDomElement(DOMNode $element, Worksheet $sheet, int &$row, string &$column, string &$cellContent): void
{
foreach ($element->childNodes as $child) {
if ($child instanceof DOMText) {
$domText = preg_replace('/\s+/u', ' ', trim($child->nodeValue));
if (is_string($cellContent)) {
// simply append the text if the cell content is a plain text string
$cellContent .= $domText;
}
// but if we have a rich text run instead, we need to append it correctly
// TODO
} elseif ($child instanceof DOMElement) {
$this->processDomElementBody($sheet, $row, $column, $cellContent, $child);
}
}
}
/**
* Make sure mb_convert_encoding returns string.
*
* @param mixed $result
*/
private static function ensureString($result): string
{
return is_string($result) ? $result : '';
}
/**
* Loads PhpSpreadsheet from file into PhpSpreadsheet instance.
*
* @param string $filename
*
* @return Spreadsheet
*/
public function loadIntoExisting($filename, Spreadsheet $spreadsheet)
{
// Validate
if (!$this->canRead($filename)) {
throw new Exception($filename . ' is an Invalid HTML file.');
}
// Create a new DOM object
$dom = new DOMDocument();
// Reload the HTML file into the DOM object
try {
$convert = mb_convert_encoding($this->securityScanner->scanFile($filename), 'HTML-ENTITIES', 'UTF-8');
$loaded = $dom->loadHTML(self::ensureString($convert));
} catch (Throwable $e) {
$loaded = false;
}
if ($loaded === false) {
throw new Exception('Failed to load ' . $filename . ' as a DOM Document', 0, $e ?? null);
}
return $this->loadDocument($dom, $spreadsheet);
}
/**
* Spreadsheet from content.
*
* @param string $content
*/
public function loadFromString($content, ?Spreadsheet $spreadsheet = null): Spreadsheet
{
// Create a new DOM object
$dom = new DOMDocument();
// Reload the HTML file into the DOM object
try {
$convert = mb_convert_encoding($this->securityScanner->scan($content), 'HTML-ENTITIES', 'UTF-8');
$loaded = $dom->loadHTML(self::ensureString($convert));
} catch (Throwable $e) {
$loaded = false;
}
if ($loaded === false) {
throw new Exception('Failed to load content as a DOM Document', 0, $e ?? null);
}
return $this->loadDocument($dom, $spreadsheet ?? new Spreadsheet());
}
/**
* Loads PhpSpreadsheet from DOMDocument into PhpSpreadsheet instance.
*/
private function loadDocument(DOMDocument $document, Spreadsheet $spreadsheet): Spreadsheet
{
while ($spreadsheet->getSheetCount() <= $this->sheetIndex) {
$spreadsheet->createSheet();
}
$spreadsheet->setActiveSheetIndex($this->sheetIndex);
// Discard white space
$document->preserveWhiteSpace = false;
$row = 0;
$column = 'A';
$content = '';
$this->rowspan = [];
$this->processDomElement($document, $spreadsheet->getActiveSheet(), $row, $column, $content);
// Return
return $spreadsheet;
}
/**
* Get sheet index.
*
* @return int
*/
public function getSheetIndex()
{
return $this->sheetIndex;
}
/**
* Set sheet index.
*
* @param int $sheetIndex Sheet index
*
* @return $this
*/
public function setSheetIndex($sheetIndex)
{
$this->sheetIndex = $sheetIndex;
return $this;
}
/**
* Apply inline css inline style.
*
* NOTES :
* Currently only intended for td & th element,
* and only takes 'background-color' and 'color'; property with HEX color
*
* TODO :
* - Implement to other propertie, such as border
*
* @param int $row
* @param string $column
* @param array $attributeArray
*/
private function applyInlineStyle(Worksheet &$sheet, $row, $column, $attributeArray): void
{
if (!isset($attributeArray['style'])) {
return;
}
if (isset($attributeArray['rowspan'], $attributeArray['colspan'])) {
$columnTo = $column;
for ($i = 0; $i < (int) $attributeArray['colspan'] - 1; ++$i) {
++$columnTo;
}
$range = $column . $row . ':' . $columnTo . ($row + (int) $attributeArray['rowspan'] - 1);
$cellStyle = $sheet->getStyle($range);
} elseif (isset($attributeArray['rowspan'])) {
$range = $column . $row . ':' . $column . ($row + (int) $attributeArray['rowspan'] - 1);
$cellStyle = $sheet->getStyle($range);
} elseif (isset($attributeArray['colspan'])) {
$columnTo = $column;
for ($i = 0; $i < (int) $attributeArray['colspan'] - 1; ++$i) {
++$columnTo;
}
$range = $column . $row . ':' . $columnTo . $row;
$cellStyle = $sheet->getStyle($range);
} else {
$cellStyle = $sheet->getStyle($column . $row);
}
// add color styles (background & text) from dom element,currently support : td & th, using ONLY inline css style with RGB color
$styles = explode(';', $attributeArray['style']);
foreach ($styles as $st) {
$value = explode(':', $st);
$styleName = isset($value[0]) ? trim($value[0]) : null;
$styleValue = isset($value[1]) ? trim($value[1]) : null;
$styleValueString = (string) $styleValue;
if (!$styleName) {
continue;
}
switch ($styleName) {
case 'background':
case 'background-color':
$styleColor = $this->getStyleColor($styleValueString);
if (!$styleColor) {
continue 2;
}
$cellStyle->applyFromArray(['fill' => ['fillType' => Fill::FILL_SOLID, 'color' => ['rgb' => $styleColor]]]);
break;
case 'color':
$styleColor = $this->getStyleColor($styleValueString);
if (!$styleColor) {
continue 2;
}
$cellStyle->applyFromArray(['font' => ['color' => ['rgb' => $styleColor]]]);
break;
case 'border':
$this->setBorderStyle($cellStyle, $styleValueString, 'allBorders');
break;
case 'border-top':
$this->setBorderStyle($cellStyle, $styleValueString, 'top');
break;
case 'border-bottom':
$this->setBorderStyle($cellStyle, $styleValueString, 'bottom');
break;
case 'border-left':
$this->setBorderStyle($cellStyle, $styleValueString, 'left');
break;
case 'border-right':
$this->setBorderStyle($cellStyle, $styleValueString, 'right');
break;
case 'font-size':
$cellStyle->getFont()->setSize(
(float) $styleValue
);
break;
case 'font-weight':
if ($styleValue === 'bold' || $styleValue >= 500) {
$cellStyle->getFont()->setBold(true);
}
break;
case 'font-style':
if ($styleValue === 'italic') {
$cellStyle->getFont()->setItalic(true);
}
break;
case 'font-family':
$cellStyle->getFont()->setName(str_replace('\'', '', $styleValueString));
break;
case 'text-decoration':
switch ($styleValue) {
case 'underline':
$cellStyle->getFont()->setUnderline(Font::UNDERLINE_SINGLE);
break;
case 'line-through':
$cellStyle->getFont()->setStrikethrough(true);
break;
}
break;
case 'text-align':
$cellStyle->getAlignment()->setHorizontal($styleValueString);
break;
case 'vertical-align':
$cellStyle->getAlignment()->setVertical($styleValueString);
break;
case 'width':
$sheet->getColumnDimension($column)->setWidth(
(new CssDimension($styleValue ?? ''))->width()
);
break;
case 'height':
$sheet->getRowDimension($row)->setRowHeight(
(new CssDimension($styleValue ?? ''))->height()
);
break;
case 'word-wrap':
$cellStyle->getAlignment()->setWrapText(
$styleValue === 'break-word'
);
break;
case 'text-indent':
$cellStyle->getAlignment()->setIndent(
(int) str_replace(['px'], '', $styleValueString)
);
break;
}
}
}
/**
* Check if has #, so we can get clean hex.
*
* @param mixed $value
*
* @return null|string
*/
public function getStyleColor($value)
{
$value = (string) $value;
if (strpos($value ?? '', '#') === 0) {
return substr($value, 1);
}
return \PhpOffice\PhpSpreadsheet\Helper\Html::colourNameLookup($value);
}
/**
* @param string $column
* @param int $row
*/
private function insertImage(Worksheet $sheet, $column, $row, array $attributes): void
{
if (!isset($attributes['src'])) {
return;
}
$src = urldecode($attributes['src']);
$width = isset($attributes['width']) ? (float) $attributes['width'] : null;
$height = isset($attributes['height']) ? (float) $attributes['height'] : null;
$name = $attributes['alt'] ?? null;
$drawing = new Drawing();
$drawing->setPath($src);
$drawing->setWorksheet($sheet);
$drawing->setCoordinates($column . $row);
$drawing->setOffsetX(0);
$drawing->setOffsetY(10);
$drawing->setResizeProportional(true);
if ($name) {
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | true |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Cell\DataType;
use PhpOffice\PhpSpreadsheet\Cell\Hyperlink;
use PhpOffice\PhpSpreadsheet\DefinedName;
use PhpOffice\PhpSpreadsheet\Reader\Security\XmlScanner;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\AutoFilter;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\Chart;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\ColumnAndRowAttributes;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\ConditionalStyles;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\DataValidations;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\Hyperlinks;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\Namespaces;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\PageSetup;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\Properties as PropertyReader;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\SheetViewOptions;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\SheetViews;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx\Styles;
use PhpOffice\PhpSpreadsheet\ReferenceHelper;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Settings;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Shared\Drawing;
use PhpOffice\PhpSpreadsheet\Shared\File;
use PhpOffice\PhpSpreadsheet\Shared\Font;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\Color;
use PhpOffice\PhpSpreadsheet\Style\NumberFormat;
use PhpOffice\PhpSpreadsheet\Style\Style;
use PhpOffice\PhpSpreadsheet\Worksheet\HeaderFooterDrawing;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
use stdClass;
use Throwable;
use XMLReader;
use ZipArchive;
class Xlsx extends BaseReader
{
const INITIAL_FILE = '_rels/.rels';
/**
* ReferenceHelper instance.
*
* @var ReferenceHelper
*/
private $referenceHelper;
/**
* Xlsx\Theme instance.
*
* @var Xlsx\Theme
*/
private static $theme;
/**
* @var ZipArchive
*/
private $zip;
/**
* Create a new Xlsx Reader instance.
*/
public function __construct()
{
parent::__construct();
$this->referenceHelper = ReferenceHelper::getInstance();
$this->securityScanner = XmlScanner::getInstance($this);
}
/**
* Can the current IReader read the file?
*/
public function canRead(string $filename): bool
{
if (!File::testFileNoThrow($filename, self::INITIAL_FILE)) {
return false;
}
$result = false;
$this->zip = $zip = new ZipArchive();
if ($zip->open($filename) === true) {
[$workbookBasename] = $this->getWorkbookBaseName();
$result = !empty($workbookBasename);
$zip->close();
}
return $result;
}
/**
* @param mixed $value
*/
public static function testSimpleXml($value): SimpleXMLElement
{
return ($value instanceof SimpleXMLElement) ? $value : new SimpleXMLElement('<?xml version="1.0" encoding="UTF-8"?><root></root>');
}
public static function getAttributes(?SimpleXMLElement $value, string $ns = ''): SimpleXMLElement
{
return self::testSimpleXml($value === null ? $value : $value->attributes($ns));
}
// Phpstan thinks, correctly, that xpath can return false.
// Scrutinizer thinks it can't.
// Sigh.
private static function xpathNoFalse(SimpleXmlElement $sxml, string $path): array
{
return self::falseToArray($sxml->xpath($path));
}
/**
* @param mixed $value
*/
public static function falseToArray($value): array
{
return is_array($value) ? $value : [];
}
private function loadZip(string $filename, string $ns = ''): SimpleXMLElement
{
$contents = $this->getFromZipArchive($this->zip, $filename);
$rels = simplexml_load_string(
$this->securityScanner->scan($contents),
'SimpleXMLElement',
Settings::getLibXmlLoaderOptions(),
$ns
);
return self::testSimpleXml($rels);
}
// This function is just to identify cases where I'm not sure
// why empty namespace is required.
private function loadZipNonamespace(string $filename, string $ns): SimpleXMLElement
{
$contents = $this->getFromZipArchive($this->zip, $filename);
$rels = simplexml_load_string(
$this->securityScanner->scan($contents),
'SimpleXMLElement',
Settings::getLibXmlLoaderOptions(),
($ns === '' ? $ns : '')
);
return self::testSimpleXml($rels);
}
private const REL_TO_MAIN = [
Namespaces::PURL_OFFICE_DOCUMENT => Namespaces::PURL_MAIN,
];
private const REL_TO_DRAWING = [
Namespaces::PURL_RELATIONSHIPS => Namespaces::PURL_DRAWING,
];
/**
* Reads names of the worksheets from a file, without parsing the whole file to a Spreadsheet object.
*
* @param string $filename
*
* @return array
*/
public function listWorksheetNames($filename)
{
File::assertFile($filename, self::INITIAL_FILE);
$worksheetNames = [];
$this->zip = $zip = new ZipArchive();
$zip->open($filename);
// The files we're looking at here are small enough that simpleXML is more efficient than XMLReader
$rels = $this->loadZip(self::INITIAL_FILE, Namespaces::RELATIONSHIPS);
foreach ($rels->Relationship as $relx) {
$rel = self::getAttributes($relx);
$relType = (string) $rel['Type'];
$mainNS = self::REL_TO_MAIN[$relType] ?? Namespaces::MAIN;
if ($mainNS !== '') {
$xmlWorkbook = $this->loadZip((string) $rel['Target'], $mainNS);
if ($xmlWorkbook->sheets) {
foreach ($xmlWorkbook->sheets->sheet as $eleSheet) {
// Check if sheet should be skipped
$worksheetNames[] = (string) self::getAttributes($eleSheet)['name'];
}
}
}
}
$zip->close();
return $worksheetNames;
}
/**
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns).
*
* @param string $filename
*
* @return array
*/
public function listWorksheetInfo($filename)
{
File::assertFile($filename, self::INITIAL_FILE);
$worksheetInfo = [];
$this->zip = $zip = new ZipArchive();
$zip->open($filename);
$rels = $this->loadZip(self::INITIAL_FILE, Namespaces::RELATIONSHIPS);
foreach ($rels->Relationship as $relx) {
$rel = self::getAttributes($relx);
$relType = (string) $rel['Type'];
$mainNS = self::REL_TO_MAIN[$relType] ?? Namespaces::MAIN;
if ($mainNS !== '') {
$relTarget = (string) $rel['Target'];
$dir = dirname($relTarget);
$namespace = dirname($relType);
$relsWorkbook = $this->loadZip("$dir/_rels/" . basename($relTarget) . '.rels', '');
$worksheets = [];
foreach ($relsWorkbook->Relationship as $elex) {
$ele = self::getAttributes($elex);
if ((string) $ele['Type'] === "$namespace/worksheet") {
$worksheets[(string) $ele['Id']] = $ele['Target'];
}
}
$xmlWorkbook = $this->loadZip($relTarget, $mainNS);
if ($xmlWorkbook->sheets) {
$dir = dirname($relTarget);
/** @var SimpleXMLElement $eleSheet */
foreach ($xmlWorkbook->sheets->sheet as $eleSheet) {
$tmpInfo = [
'worksheetName' => (string) self::getAttributes($eleSheet)['name'],
'lastColumnLetter' => 'A',
'lastColumnIndex' => 0,
'totalRows' => 0,
'totalColumns' => 0,
];
$fileWorksheet = (string) $worksheets[(string) self::getArrayItem(self::getAttributes($eleSheet, $namespace), 'id')];
$fileWorksheetPath = strpos($fileWorksheet, '/') === 0 ? substr($fileWorksheet, 1) : "$dir/$fileWorksheet";
$xml = new XMLReader();
$xml->xml(
$this->securityScanner->scanFile(
'zip://' . File::realpath($filename) . '#' . $fileWorksheetPath
),
null,
Settings::getLibXmlLoaderOptions()
);
$xml->setParserProperty(2, true);
$currCells = 0;
while ($xml->read()) {
if ($xml->localName == 'row' && $xml->nodeType == XMLReader::ELEMENT && $xml->namespaceURI === $mainNS) {
$row = $xml->getAttribute('r');
$tmpInfo['totalRows'] = $row;
$tmpInfo['totalColumns'] = max($tmpInfo['totalColumns'], $currCells);
$currCells = 0;
} elseif ($xml->localName == 'c' && $xml->nodeType == XMLReader::ELEMENT && $xml->namespaceURI === $mainNS) {
$cell = $xml->getAttribute('r');
$currCells = $cell ? max($currCells, Coordinate::indexesFromString($cell)[0]) : ($currCells + 1);
}
}
$tmpInfo['totalColumns'] = max($tmpInfo['totalColumns'], $currCells);
$xml->close();
$tmpInfo['lastColumnIndex'] = $tmpInfo['totalColumns'] - 1;
$tmpInfo['lastColumnLetter'] = Coordinate::stringFromColumnIndex($tmpInfo['lastColumnIndex'] + 1);
$worksheetInfo[] = $tmpInfo;
}
}
}
}
$zip->close();
return $worksheetInfo;
}
private static function castToBoolean($c)
{
$value = isset($c->v) ? (string) $c->v : null;
if ($value == '0') {
return false;
} elseif ($value == '1') {
return true;
}
return (bool) $c->v;
}
private static function castToError($c)
{
return isset($c->v) ? (string) $c->v : null;
}
private static function castToString($c)
{
return isset($c->v) ? (string) $c->v : null;
}
private function castToFormula($c, $r, &$cellDataType, &$value, &$calculatedValue, &$sharedFormulas, $castBaseType): void
{
$attr = $c->f->attributes();
$cellDataType = 'f';
$value = "={$c->f}";
$calculatedValue = self::$castBaseType($c);
// Shared formula?
if (isset($attr['t']) && strtolower((string) $attr['t']) == 'shared') {
$instance = (string) $attr['si'];
if (!isset($sharedFormulas[(string) $attr['si']])) {
$sharedFormulas[$instance] = ['master' => $r, 'formula' => $value];
} else {
$master = Coordinate::indexesFromString($sharedFormulas[$instance]['master']);
$current = Coordinate::indexesFromString($r);
$difference = [0, 0];
$difference[0] = $current[0] - $master[0];
$difference[1] = $current[1] - $master[1];
$value = $this->referenceHelper->updateFormulaReferences($sharedFormulas[$instance]['formula'], 'A1', $difference[0], $difference[1]);
}
}
}
/**
* @param string $fileName
*/
private function fileExistsInArchive(ZipArchive $archive, $fileName = ''): bool
{
// Root-relative paths
if (strpos($fileName, '//') !== false) {
$fileName = substr($fileName, strpos($fileName, '//') + 1);
}
$fileName = File::realpath($fileName);
// Sadly, some 3rd party xlsx generators don't use consistent case for filenaming
// so we need to load case-insensitively from the zip file
// Apache POI fixes
$contents = $archive->locateName($fileName, ZipArchive::FL_NOCASE);
if ($contents === false) {
$contents = $archive->locateName(substr($fileName, 1), ZipArchive::FL_NOCASE);
}
return $contents !== false;
}
/**
* @param string $fileName
*
* @return string
*/
private function getFromZipArchive(ZipArchive $archive, $fileName = '')
{
// Root-relative paths
if (strpos($fileName, '//') !== false) {
$fileName = substr($fileName, strpos($fileName, '//') + 1);
}
$fileName = File::realpath($fileName);
// Sadly, some 3rd party xlsx generators don't use consistent case for filenaming
// so we need to load case-insensitively from the zip file
// Apache POI fixes
$contents = $archive->getFromName($fileName, 0, ZipArchive::FL_NOCASE);
if ($contents === false) {
$contents = $archive->getFromName(substr($fileName, 1), 0, ZipArchive::FL_NOCASE);
}
return $contents;
}
/**
* Loads Spreadsheet from file.
*/
public function load(string $filename, int $flags = 0): Spreadsheet
{
File::assertFile($filename, self::INITIAL_FILE);
$this->processFlags($flags);
// Initialisations
$excel = new Spreadsheet();
$excel->removeSheetByIndex(0);
$addingFirstCellStyleXf = true;
$addingFirstCellXf = true;
$unparsedLoadedData = [];
$this->zip = $zip = new ZipArchive();
$zip->open($filename);
// Read the theme first, because we need the colour scheme when reading the styles
[$workbookBasename, $xmlNamespaceBase] = $this->getWorkbookBaseName();
$wbRels = $this->loadZip("xl/_rels/${workbookBasename}.rels", Namespaces::RELATIONSHIPS);
foreach ($wbRels->Relationship as $relx) {
$rel = self::getAttributes($relx);
$relTarget = (string) $rel['Target'];
switch ($rel['Type']) {
case "$xmlNamespaceBase/theme":
$themeOrderArray = ['lt1', 'dk1', 'lt2', 'dk2'];
$themeOrderAdditional = count($themeOrderArray);
$drawingNS = self::REL_TO_DRAWING[$xmlNamespaceBase] ?? Namespaces::DRAWINGML;
$xmlTheme = $this->loadZip("xl/{$relTarget}", $drawingNS);
$xmlThemeName = self::getAttributes($xmlTheme);
$xmlTheme = $xmlTheme->children($drawingNS);
$themeName = (string) $xmlThemeName['name'];
$colourScheme = self::getAttributes($xmlTheme->themeElements->clrScheme);
$colourSchemeName = (string) $colourScheme['name'];
$colourScheme = $xmlTheme->themeElements->clrScheme->children($drawingNS);
$themeColours = [];
foreach ($colourScheme as $k => $xmlColour) {
$themePos = array_search($k, $themeOrderArray);
if ($themePos === false) {
$themePos = $themeOrderAdditional++;
}
if (isset($xmlColour->sysClr)) {
$xmlColourData = self::getAttributes($xmlColour->sysClr);
$themeColours[$themePos] = (string) $xmlColourData['lastClr'];
} elseif (isset($xmlColour->srgbClr)) {
$xmlColourData = self::getAttributes($xmlColour->srgbClr);
$themeColours[$themePos] = (string) $xmlColourData['val'];
}
}
self::$theme = new Xlsx\Theme($themeName, $colourSchemeName, $themeColours);
break;
}
}
$rels = $this->loadZip(self::INITIAL_FILE, Namespaces::RELATIONSHIPS);
$propertyReader = new PropertyReader($this->securityScanner, $excel->getProperties());
foreach ($rels->Relationship as $relx) {
$rel = self::getAttributes($relx);
$relTarget = (string) $rel['Target'];
$relType = (string) $rel['Type'];
$mainNS = self::REL_TO_MAIN[$relType] ?? Namespaces::MAIN;
switch ($relType) {
case Namespaces::CORE_PROPERTIES:
$propertyReader->readCoreProperties($this->getFromZipArchive($zip, $relTarget));
break;
case "$xmlNamespaceBase/extended-properties":
$propertyReader->readExtendedProperties($this->getFromZipArchive($zip, $relTarget));
break;
case "$xmlNamespaceBase/custom-properties":
$propertyReader->readCustomProperties($this->getFromZipArchive($zip, $relTarget));
break;
//Ribbon
case Namespaces::EXTENSIBILITY:
$customUI = $relTarget;
if ($customUI) {
$this->readRibbon($excel, $customUI, $zip);
}
break;
case "$xmlNamespaceBase/officeDocument":
$dir = dirname($relTarget);
// Do not specify namespace in next stmt - do it in Xpath
$relsWorkbook = $this->loadZip("$dir/_rels/" . basename($relTarget) . '.rels', '');
$relsWorkbook->registerXPathNamespace('rel', Namespaces::RELATIONSHIPS);
$sharedStrings = [];
$relType = "rel:Relationship[@Type='"
//. Namespaces::SHARED_STRINGS
. "$xmlNamespaceBase/sharedStrings"
. "']";
$xpath = self::getArrayItem($relsWorkbook->xpath($relType));
if ($xpath) {
$xmlStrings = $this->loadZip("$dir/$xpath[Target]", $mainNS);
if (isset($xmlStrings->si)) {
foreach ($xmlStrings->si as $val) {
if (isset($val->t)) {
$sharedStrings[] = StringHelper::controlCharacterOOXML2PHP((string) $val->t);
} elseif (isset($val->r)) {
$sharedStrings[] = $this->parseRichText($val);
}
}
}
}
$worksheets = [];
$macros = $customUI = null;
foreach ($relsWorkbook->Relationship as $elex) {
$ele = self::getAttributes($elex);
switch ($ele['Type']) {
case Namespaces::WORKSHEET:
case Namespaces::PURL_WORKSHEET:
$worksheets[(string) $ele['Id']] = $ele['Target'];
break;
// a vbaProject ? (: some macros)
case Namespaces::VBA:
$macros = $ele['Target'];
break;
}
}
if ($macros !== null) {
$macrosCode = $this->getFromZipArchive($zip, 'xl/vbaProject.bin'); //vbaProject.bin always in 'xl' dir and always named vbaProject.bin
if ($macrosCode !== false) {
$excel->setMacrosCode($macrosCode);
$excel->setHasMacros(true);
//short-circuit : not reading vbaProject.bin.rel to get Signature =>allways vbaProjectSignature.bin in 'xl' dir
$Certificate = $this->getFromZipArchive($zip, 'xl/vbaProjectSignature.bin');
if ($Certificate !== false) {
$excel->setMacrosCertificate($Certificate);
}
}
}
$relType = "rel:Relationship[@Type='"
. "$xmlNamespaceBase/styles"
. "']";
$xpath = self::getArrayItem(self::xpathNoFalse($relsWorkbook, $relType));
if ($xpath === null) {
$xmlStyles = self::testSimpleXml(null);
} else {
// I think Nonamespace is okay because I'm using xpath.
$xmlStyles = $this->loadZipNonamespace("$dir/$xpath[Target]", $mainNS);
}
$xmlStyles->registerXPathNamespace('smm', Namespaces::MAIN);
$fills = self::xpathNoFalse($xmlStyles, 'smm:fills/smm:fill');
$fonts = self::xpathNoFalse($xmlStyles, 'smm:fonts/smm:font');
$borders = self::xpathNoFalse($xmlStyles, 'smm:borders/smm:border');
$xfTags = self::xpathNoFalse($xmlStyles, 'smm:cellXfs/smm:xf');
$cellXfTags = self::xpathNoFalse($xmlStyles, 'smm:cellStyleXfs/smm:xf');
$styles = [];
$cellStyles = [];
$numFmts = null;
if (/*$xmlStyles && */ $xmlStyles->numFmts[0]) {
$numFmts = $xmlStyles->numFmts[0];
}
if (isset($numFmts) && ($numFmts !== null)) {
$numFmts->registerXPathNamespace('sml', $mainNS);
}
if (!$this->readDataOnly/* && $xmlStyles*/) {
foreach ($xfTags as $xfTag) {
$xf = self::getAttributes($xfTag);
$numFmt = null;
if ($xf['numFmtId']) {
if (isset($numFmts)) {
$tmpNumFmt = self::getArrayItem($numFmts->xpath("sml:numFmt[@numFmtId=$xf[numFmtId]]"));
if (isset($tmpNumFmt['formatCode'])) {
$numFmt = (string) $tmpNumFmt['formatCode'];
}
}
// We shouldn't override any of the built-in MS Excel values (values below id 164)
// But there's a lot of naughty homebrew xlsx writers that do use "reserved" id values that aren't actually used
// So we make allowance for them rather than lose formatting masks
if (
$numFmt === null &&
(int) $xf['numFmtId'] < 164 &&
NumberFormat::builtInFormatCode((int) $xf['numFmtId']) !== ''
) {
$numFmt = NumberFormat::builtInFormatCode((int) $xf['numFmtId']);
}
}
$quotePrefix = (bool) ($xf['quotePrefix'] ?? false);
$style = (object) [
'numFmt' => $numFmt ?? NumberFormat::FORMAT_GENERAL,
'font' => $fonts[(int) ($xf['fontId'])],
'fill' => $fills[(int) ($xf['fillId'])],
'border' => $borders[(int) ($xf['borderId'])],
'alignment' => $xfTag->alignment,
'protection' => $xfTag->protection,
'quotePrefix' => $quotePrefix,
];
$styles[] = $style;
// add style to cellXf collection
$objStyle = new Style();
self::readStyle($objStyle, $style);
if ($addingFirstCellXf) {
$excel->removeCellXfByIndex(0); // remove the default style
$addingFirstCellXf = false;
}
$excel->addCellXf($objStyle);
}
foreach ($cellXfTags as $xfTag) {
$xf = self::getAttributes($xfTag);
$numFmt = NumberFormat::FORMAT_GENERAL;
if ($numFmts && $xf['numFmtId']) {
$tmpNumFmt = self::getArrayItem($numFmts->xpath("sml:numFmt[@numFmtId=$xf[numFmtId]]"));
if (isset($tmpNumFmt['formatCode'])) {
$numFmt = (string) $tmpNumFmt['formatCode'];
} elseif ((int) $xf['numFmtId'] < 165) {
$numFmt = NumberFormat::builtInFormatCode((int) $xf['numFmtId']);
}
}
$quotePrefix = (bool) ($xf['quotePrefix'] ?? false);
$cellStyle = (object) [
'numFmt' => $numFmt,
'font' => $fonts[(int) ($xf['fontId'])],
'fill' => $fills[((int) $xf['fillId'])],
'border' => $borders[(int) ($xf['borderId'])],
'alignment' => $xfTag->alignment,
'protection' => $xfTag->protection,
'quotePrefix' => $quotePrefix,
];
$cellStyles[] = $cellStyle;
// add style to cellStyleXf collection
$objStyle = new Style();
self::readStyle($objStyle, $cellStyle);
if ($addingFirstCellStyleXf) {
$excel->removeCellStyleXfByIndex(0); // remove the default style
$addingFirstCellStyleXf = false;
}
$excel->addCellStyleXf($objStyle);
}
}
$styleReader = new Styles($xmlStyles);
$styleReader->setStyleBaseData(self::$theme, $styles, $cellStyles);
$dxfs = $styleReader->dxfs($this->readDataOnly);
$styles = $styleReader->styles();
$xmlWorkbook = $this->loadZipNoNamespace($relTarget, $mainNS);
$xmlWorkbookNS = $this->loadZip($relTarget, $mainNS);
// Set base date
if ($xmlWorkbookNS->workbookPr) {
Date::setExcelCalendar(Date::CALENDAR_WINDOWS_1900);
$attrs1904 = self::getAttributes($xmlWorkbookNS->workbookPr);
if (isset($attrs1904['date1904'])) {
if (self::boolean((string) $attrs1904['date1904'])) {
Date::setExcelCalendar(Date::CALENDAR_MAC_1904);
}
}
}
// Set protection
$this->readProtection($excel, $xmlWorkbook);
$sheetId = 0; // keep track of new sheet id in final workbook
$oldSheetId = -1; // keep track of old sheet id in final workbook
$countSkippedSheets = 0; // keep track of number of skipped sheets
$mapSheetId = []; // mapping of sheet ids from old to new
$charts = $chartDetails = [];
if ($xmlWorkbookNS->sheets) {
/** @var SimpleXMLElement $eleSheet */
foreach ($xmlWorkbookNS->sheets->sheet as $eleSheet) {
$eleSheetAttr = self::getAttributes($eleSheet);
++$oldSheetId;
// Check if sheet should be skipped
if (is_array($this->loadSheetsOnly) && !in_array((string) $eleSheetAttr['name'], $this->loadSheetsOnly)) {
++$countSkippedSheets;
$mapSheetId[$oldSheetId] = null;
continue;
}
// Map old sheet id in original workbook to new sheet id.
// They will differ if loadSheetsOnly() is being used
$mapSheetId[$oldSheetId] = $oldSheetId - $countSkippedSheets;
// Load sheet
$docSheet = $excel->createSheet();
// Use false for $updateFormulaCellReferences to prevent adjustment of worksheet
// references in formula cells... during the load, all formulae should be correct,
// and we're simply bringing the worksheet name in line with the formula, not the
// reverse
$docSheet->setTitle((string) $eleSheetAttr['name'], false, false);
$fileWorksheet = (string) $worksheets[(string) self::getArrayItem(self::getAttributes($eleSheet, $xmlNamespaceBase), 'id')];
$xmlSheet = $this->loadZipNoNamespace("$dir/$fileWorksheet", $mainNS);
$xmlSheetNS = $this->loadZip("$dir/$fileWorksheet", $mainNS);
$sharedFormulas = [];
if (isset($eleSheetAttr['state']) && (string) $eleSheetAttr['state'] != '') {
$docSheet->setSheetState((string) $eleSheetAttr['state']);
}
if ($xmlSheetNS) {
$xmlSheetMain = $xmlSheetNS->children($mainNS);
// Setting Conditional Styles adjusts selected cells, so we need to execute this
// before reading the sheet view data to get the actual selected cells
if (!$this->readDataOnly && $xmlSheet->conditionalFormatting) {
(new ConditionalStyles($docSheet, $xmlSheet, $dxfs))->load();
}
if (isset($xmlSheetMain->sheetViews, $xmlSheetMain->sheetViews->sheetView)) {
$sheetViews = new SheetViews($xmlSheetMain->sheetViews->sheetView, $docSheet);
$sheetViews->load();
}
$sheetViewOptions = new SheetViewOptions($docSheet, $xmlSheet);
$sheetViewOptions->load($this->getReadDataOnly());
(new ColumnAndRowAttributes($docSheet, $xmlSheet))
->load($this->getReadFilter(), $this->getReadDataOnly());
}
if ($xmlSheetNS && $xmlSheetNS->sheetData && $xmlSheetNS->sheetData->row) {
$cIndex = 1; // Cell Start from 1
foreach ($xmlSheetNS->sheetData->row as $row) {
$rowIndex = 1;
foreach ($row->c as $c) {
$cAttr = self::getAttributes($c);
$r = (string) $cAttr['r'];
if ($r == '') {
$r = Coordinate::stringFromColumnIndex($rowIndex) . $cIndex;
}
$cellDataType = (string) $cAttr['t'];
$value = null;
$calculatedValue = null;
// Read cell?
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | true |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/IReadFilter.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/IReadFilter.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
interface IReadFilter
{
/**
* Should this cell be read?
*
* @param string $columnAddress Column address (as a string value like "A", or "IV")
* @param int $row Row number
* @param string $worksheetName Optional worksheet name
*
* @return bool
*/
public function readCell($columnAddress, $row, $worksheetName = '');
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Slk.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Slk.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Reader\Exception as ReaderException;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\Border;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
class Slk extends BaseReader
{
/**
* Input encoding.
*
* @var string
*/
private $inputEncoding = 'ANSI';
/**
* Sheet index to read.
*
* @var int
*/
private $sheetIndex = 0;
/**
* Formats.
*
* @var array
*/
private $formats = [];
/**
* Format Count.
*
* @var int
*/
private $format = 0;
/**
* Fonts.
*
* @var array
*/
private $fonts = [];
/**
* Font Count.
*
* @var int
*/
private $fontcount = 0;
/**
* Create a new SYLK Reader instance.
*/
public function __construct()
{
parent::__construct();
}
/**
* Validate that the current file is a SYLK file.
*/
public function canRead(string $filename): bool
{
try {
$this->openFile($filename);
} catch (ReaderException $e) {
return false;
}
// Read sample data (first 2 KB will do)
$data = (string) fread($this->fileHandle, 2048);
// Count delimiters in file
$delimiterCount = substr_count($data, ';');
$hasDelimiter = $delimiterCount > 0;
// Analyze first line looking for ID; signature
$lines = explode("\n", $data);
$hasId = substr($lines[0], 0, 4) === 'ID;P';
fclose($this->fileHandle);
return $hasDelimiter && $hasId;
}
private function canReadOrBust(string $filename): void
{
if (!$this->canRead($filename)) {
throw new ReaderException($filename . ' is an Invalid SYLK file.');
}
$this->openFile($filename);
}
/**
* Set input encoding.
*
* @deprecated no use is made of this property
*
* @param string $inputEncoding Input encoding, eg: 'ANSI'
*
* @return $this
*
* @codeCoverageIgnore
*/
public function setInputEncoding($inputEncoding)
{
$this->inputEncoding = $inputEncoding;
return $this;
}
/**
* Get input encoding.
*
* @deprecated no use is made of this property
*
* @return string
*
* @codeCoverageIgnore
*/
public function getInputEncoding()
{
return $this->inputEncoding;
}
/**
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns).
*
* @param string $filename
*
* @return array
*/
public function listWorksheetInfo($filename)
{
// Open file
$this->canReadOrBust($filename);
$fileHandle = $this->fileHandle;
rewind($fileHandle);
$worksheetInfo = [];
$worksheetInfo[0]['worksheetName'] = basename($filename, '.slk');
// loop through one row (line) at a time in the file
$rowIndex = 0;
$columnIndex = 0;
while (($rowData = fgets($fileHandle)) !== false) {
$columnIndex = 0;
// convert SYLK encoded $rowData to UTF-8
$rowData = StringHelper::SYLKtoUTF8($rowData);
// explode each row at semicolons while taking into account that literal semicolon (;)
// is escaped like this (;;)
$rowData = explode("\t", str_replace('¤', ';', str_replace(';', "\t", str_replace(';;', '¤', rtrim($rowData)))));
$dataType = array_shift($rowData);
if ($dataType == 'B') {
foreach ($rowData as $rowDatum) {
switch ($rowDatum[0]) {
case 'X':
$columnIndex = (int) substr($rowDatum, 1) - 1;
break;
case 'Y':
$rowIndex = substr($rowDatum, 1);
break;
}
}
break;
}
}
$worksheetInfo[0]['lastColumnIndex'] = $columnIndex;
$worksheetInfo[0]['totalRows'] = $rowIndex;
$worksheetInfo[0]['lastColumnLetter'] = Coordinate::stringFromColumnIndex($worksheetInfo[0]['lastColumnIndex'] + 1);
$worksheetInfo[0]['totalColumns'] = $worksheetInfo[0]['lastColumnIndex'] + 1;
// Close file
fclose($fileHandle);
return $worksheetInfo;
}
/**
* Loads PhpSpreadsheet from file.
*
* @return Spreadsheet
*/
public function load(string $filename, int $flags = 0)
{
$this->processFlags($flags);
// Create new Spreadsheet
$spreadsheet = new Spreadsheet();
// Load into this instance
return $this->loadIntoExisting($filename, $spreadsheet);
}
private const COLOR_ARRAY = [
'FF00FFFF', // 0 - cyan
'FF000000', // 1 - black
'FFFFFFFF', // 2 - white
'FFFF0000', // 3 - red
'FF00FF00', // 4 - green
'FF0000FF', // 5 - blue
'FFFFFF00', // 6 - yellow
'FFFF00FF', // 7 - magenta
];
private const FONT_STYLE_MAPPINGS = [
'B' => 'bold',
'I' => 'italic',
'U' => 'underline',
];
private function processFormula(string $rowDatum, bool &$hasCalculatedValue, string &$cellDataFormula, string $row, string $column): void
{
$cellDataFormula = '=' . substr($rowDatum, 1);
// Convert R1C1 style references to A1 style references (but only when not quoted)
$temp = explode('"', $cellDataFormula);
$key = false;
foreach ($temp as &$value) {
// Only count/replace in alternate array entries
$key = !$key;
if ($key) {
preg_match_all('/(R(\[?-?\d*\]?))(C(\[?-?\d*\]?))/', $value, $cellReferences, PREG_SET_ORDER + PREG_OFFSET_CAPTURE);
// Reverse the matches array, otherwise all our offsets will become incorrect if we modify our way
// through the formula from left to right. Reversing means that we work right to left.through
// the formula
$cellReferences = array_reverse($cellReferences);
// Loop through each R1C1 style reference in turn, converting it to its A1 style equivalent,
// then modify the formula to use that new reference
foreach ($cellReferences as $cellReference) {
$rowReference = $cellReference[2][0];
// Empty R reference is the current row
if ($rowReference == '') {
$rowReference = $row;
}
// Bracketed R references are relative to the current row
if ($rowReference[0] == '[') {
$rowReference = (int) $row + (int) trim($rowReference, '[]');
}
$columnReference = $cellReference[4][0];
// Empty C reference is the current column
if ($columnReference == '') {
$columnReference = $column;
}
// Bracketed C references are relative to the current column
if ($columnReference[0] == '[') {
$columnReference = (int) $column + (int) trim($columnReference, '[]');
}
$A1CellReference = Coordinate::stringFromColumnIndex($columnReference) . $rowReference;
$value = substr_replace($value, $A1CellReference, $cellReference[0][1], strlen($cellReference[0][0]));
}
}
}
unset($value);
// Then rebuild the formula string
$cellDataFormula = implode('"', $temp);
$hasCalculatedValue = true;
}
private function processCRecord(array $rowData, Spreadsheet &$spreadsheet, string &$row, string &$column): void
{
// Read cell value data
$hasCalculatedValue = false;
$cellDataFormula = $cellData = '';
foreach ($rowData as $rowDatum) {
switch ($rowDatum[0]) {
case 'C':
case 'X':
$column = substr($rowDatum, 1);
break;
case 'R':
case 'Y':
$row = substr($rowDatum, 1);
break;
case 'K':
$cellData = substr($rowDatum, 1);
break;
case 'E':
$this->processFormula($rowDatum, $hasCalculatedValue, $cellDataFormula, $row, $column);
break;
case 'A':
$comment = substr($rowDatum, 1);
$columnLetter = Coordinate::stringFromColumnIndex((int) $column);
$spreadsheet->getActiveSheet()
->getComment("$columnLetter$row")
->getText()
->createText($comment);
break;
}
}
$columnLetter = Coordinate::stringFromColumnIndex((int) $column);
$cellData = Calculation::unwrapResult($cellData);
// Set cell value
$this->processCFinal($spreadsheet, $hasCalculatedValue, $cellDataFormula, $cellData, "$columnLetter$row");
}
private function processCFinal(Spreadsheet &$spreadsheet, bool $hasCalculatedValue, string $cellDataFormula, string $cellData, string $coordinate): void
{
// Set cell value
$spreadsheet->getActiveSheet()->getCell($coordinate)->setValue(($hasCalculatedValue) ? $cellDataFormula : $cellData);
if ($hasCalculatedValue) {
$cellData = Calculation::unwrapResult($cellData);
$spreadsheet->getActiveSheet()->getCell($coordinate)->setCalculatedValue($cellData);
}
}
private function processFRecord(array $rowData, Spreadsheet &$spreadsheet, string &$row, string &$column): void
{
// Read cell formatting
$formatStyle = $columnWidth = '';
$startCol = $endCol = '';
$fontStyle = '';
$styleData = [];
foreach ($rowData as $rowDatum) {
switch ($rowDatum[0]) {
case 'C':
case 'X':
$column = substr($rowDatum, 1);
break;
case 'R':
case 'Y':
$row = substr($rowDatum, 1);
break;
case 'P':
$formatStyle = $rowDatum;
break;
case 'W':
[$startCol, $endCol, $columnWidth] = explode(' ', substr($rowDatum, 1));
break;
case 'S':
$this->styleSettings($rowDatum, $styleData, $fontStyle);
break;
}
}
$this->addFormats($spreadsheet, $formatStyle, $row, $column);
$this->addFonts($spreadsheet, $fontStyle, $row, $column);
$this->addStyle($spreadsheet, $styleData, $row, $column);
$this->addWidth($spreadsheet, $columnWidth, $startCol, $endCol);
}
private const STYLE_SETTINGS_FONT = ['D' => 'bold', 'I' => 'italic'];
private const STYLE_SETTINGS_BORDER = [
'B' => 'bottom',
'L' => 'left',
'R' => 'right',
'T' => 'top',
];
private function styleSettings(string $rowDatum, array &$styleData, string &$fontStyle): void
{
$styleSettings = substr($rowDatum, 1);
$iMax = strlen($styleSettings);
for ($i = 0; $i < $iMax; ++$i) {
$char = $styleSettings[$i];
if (array_key_exists($char, self::STYLE_SETTINGS_FONT)) {
$styleData['font'][self::STYLE_SETTINGS_FONT[$char]] = true;
} elseif (array_key_exists($char, self::STYLE_SETTINGS_BORDER)) {
$styleData['borders'][self::STYLE_SETTINGS_BORDER[$char]]['borderStyle'] = Border::BORDER_THIN;
} elseif ($char == 'S') {
$styleData['fill']['fillType'] = \PhpOffice\PhpSpreadsheet\Style\Fill::FILL_PATTERN_GRAY125;
} elseif ($char == 'M') {
if (preg_match('/M([1-9]\\d*)/', $styleSettings, $matches)) {
$fontStyle = $matches[1];
}
}
}
}
private function addFormats(Spreadsheet &$spreadsheet, string $formatStyle, string $row, string $column): void
{
if ($formatStyle && $column > '' && $row > '') {
$columnLetter = Coordinate::stringFromColumnIndex((int) $column);
if (isset($this->formats[$formatStyle])) {
$spreadsheet->getActiveSheet()->getStyle($columnLetter . $row)->applyFromArray($this->formats[$formatStyle]);
}
}
}
private function addFonts(Spreadsheet &$spreadsheet, string $fontStyle, string $row, string $column): void
{
if ($fontStyle && $column > '' && $row > '') {
$columnLetter = Coordinate::stringFromColumnIndex((int) $column);
if (isset($this->fonts[$fontStyle])) {
$spreadsheet->getActiveSheet()->getStyle($columnLetter . $row)->applyFromArray($this->fonts[$fontStyle]);
}
}
}
private function addStyle(Spreadsheet &$spreadsheet, array $styleData, string $row, string $column): void
{
if ((!empty($styleData)) && $column > '' && $row > '') {
$columnLetter = Coordinate::stringFromColumnIndex((int) $column);
$spreadsheet->getActiveSheet()->getStyle($columnLetter . $row)->applyFromArray($styleData);
}
}
private function addWidth(Spreadsheet $spreadsheet, string $columnWidth, string $startCol, string $endCol): void
{
if ($columnWidth > '') {
if ($startCol == $endCol) {
$startCol = Coordinate::stringFromColumnIndex((int) $startCol);
$spreadsheet->getActiveSheet()->getColumnDimension($startCol)->setWidth((float) $columnWidth);
} else {
$startCol = Coordinate::stringFromColumnIndex((int) $startCol);
$endCol = Coordinate::stringFromColumnIndex((int) $endCol);
$spreadsheet->getActiveSheet()->getColumnDimension($startCol)->setWidth((float) $columnWidth);
do {
$spreadsheet->getActiveSheet()->getColumnDimension(++$startCol)->setWidth((float) $columnWidth);
} while ($startCol !== $endCol);
}
}
}
private function processPRecord(array $rowData, Spreadsheet &$spreadsheet): void
{
// Read shared styles
$formatArray = [];
$fromFormats = ['\-', '\ '];
$toFormats = ['-', ' '];
foreach ($rowData as $rowDatum) {
switch ($rowDatum[0]) {
case 'P':
$formatArray['numberFormat']['formatCode'] = str_replace($fromFormats, $toFormats, substr($rowDatum, 1));
break;
case 'E':
case 'F':
$formatArray['font']['name'] = substr($rowDatum, 1);
break;
case 'M':
$formatArray['font']['size'] = substr($rowDatum, 1) / 20;
break;
case 'L':
$this->processPColors($rowDatum, $formatArray);
break;
case 'S':
$this->processPFontStyles($rowDatum, $formatArray);
break;
}
}
$this->processPFinal($spreadsheet, $formatArray);
}
private function processPColors(string $rowDatum, array &$formatArray): void
{
if (preg_match('/L([1-9]\\d*)/', $rowDatum, $matches)) {
$fontColor = $matches[1] % 8;
$formatArray['font']['color']['argb'] = self::COLOR_ARRAY[$fontColor];
}
}
private function processPFontStyles(string $rowDatum, array &$formatArray): void
{
$styleSettings = substr($rowDatum, 1);
$iMax = strlen($styleSettings);
for ($i = 0; $i < $iMax; ++$i) {
if (array_key_exists($styleSettings[$i], self::FONT_STYLE_MAPPINGS)) {
$formatArray['font'][self::FONT_STYLE_MAPPINGS[$styleSettings[$i]]] = true;
}
}
}
private function processPFinal(Spreadsheet &$spreadsheet, array $formatArray): void
{
if (array_key_exists('numberFormat', $formatArray)) {
$this->formats['P' . $this->format] = $formatArray;
++$this->format;
} elseif (array_key_exists('font', $formatArray)) {
++$this->fontcount;
$this->fonts[$this->fontcount] = $formatArray;
if ($this->fontcount === 1) {
$spreadsheet->getDefaultStyle()->applyFromArray($formatArray);
}
}
}
/**
* Loads PhpSpreadsheet from file into PhpSpreadsheet instance.
*
* @param string $filename
*
* @return Spreadsheet
*/
public function loadIntoExisting($filename, Spreadsheet $spreadsheet)
{
// Open file
$this->canReadOrBust($filename);
$fileHandle = $this->fileHandle;
rewind($fileHandle);
// Create new Worksheets
while ($spreadsheet->getSheetCount() <= $this->sheetIndex) {
$spreadsheet->createSheet();
}
$spreadsheet->setActiveSheetIndex($this->sheetIndex);
$spreadsheet->getActiveSheet()->setTitle(substr(basename($filename, '.slk'), 0, Worksheet::SHEET_TITLE_MAXIMUM_LENGTH));
// Loop through file
$column = $row = '';
// loop through one row (line) at a time in the file
while (($rowDataTxt = fgets($fileHandle)) !== false) {
// convert SYLK encoded $rowData to UTF-8
$rowDataTxt = StringHelper::SYLKtoUTF8($rowDataTxt);
// explode each row at semicolons while taking into account that literal semicolon (;)
// is escaped like this (;;)
$rowData = explode("\t", str_replace('¤', ';', str_replace(';', "\t", str_replace(';;', '¤', rtrim($rowDataTxt)))));
$dataType = array_shift($rowData);
if ($dataType == 'P') {
// Read shared styles
$this->processPRecord($rowData, $spreadsheet);
} elseif ($dataType == 'C') {
// Read cell value data
$this->processCRecord($rowData, $spreadsheet, $row, $column);
} elseif ($dataType == 'F') {
// Read cell formatting
$this->processFRecord($rowData, $spreadsheet, $row, $column);
} else {
$this->columnRowFromRowData($rowData, $column, $row);
}
}
// Close file
fclose($fileHandle);
// Return
return $spreadsheet;
}
private function columnRowFromRowData(array $rowData, string &$column, string &$row): void
{
foreach ($rowData as $rowDatum) {
$char0 = $rowDatum[0];
if ($char0 === 'X' || $char0 == 'C') {
$column = substr($rowDatum, 1);
} elseif ($char0 === 'Y' || $char0 == 'R') {
$row = substr($rowDatum, 1);
}
}
}
/**
* Get sheet index.
*
* @return int
*/
public function getSheetIndex()
{
return $this->sheetIndex;
}
/**
* Set sheet index.
*
* @param int $sheetIndex Sheet index
*
* @return $this
*/
public function setSheetIndex($sheetIndex)
{
$this->sheetIndex = $sheetIndex;
return $this;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader;
use DateTime;
use DOMAttr;
use DOMDocument;
use DOMElement;
use DOMNode;
use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Cell\DataType;
use PhpOffice\PhpSpreadsheet\Reader\Ods\AutoFilter;
use PhpOffice\PhpSpreadsheet\Reader\Ods\DefinedNames;
use PhpOffice\PhpSpreadsheet\Reader\Ods\PageSettings;
use PhpOffice\PhpSpreadsheet\Reader\Ods\Properties as DocumentProperties;
use PhpOffice\PhpSpreadsheet\Reader\Security\XmlScanner;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Settings;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Shared\File;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\NumberFormat;
use Throwable;
use XMLReader;
use ZipArchive;
class Ods extends BaseReader
{
const INITIAL_FILE = 'content.xml';
/**
* Create a new Ods Reader instance.
*/
public function __construct()
{
parent::__construct();
$this->securityScanner = XmlScanner::getInstance($this);
}
/**
* Can the current IReader read the file?
*/
public function canRead(string $filename): bool
{
$mimeType = 'UNKNOWN';
// Load file
if (File::testFileNoThrow($filename, '')) {
$zip = new ZipArchive();
if ($zip->open($filename) === true) {
// check if it is an OOXML archive
$stat = $zip->statName('mimetype');
if ($stat && ($stat['size'] <= 255)) {
$mimeType = $zip->getFromName($stat['name']);
} elseif ($zip->statName('META-INF/manifest.xml')) {
$xml = simplexml_load_string(
$this->securityScanner->scan($zip->getFromName('META-INF/manifest.xml')),
'SimpleXMLElement',
Settings::getLibXmlLoaderOptions()
);
$namespacesContent = $xml->getNamespaces(true);
if (isset($namespacesContent['manifest'])) {
$manifest = $xml->children($namespacesContent['manifest']);
foreach ($manifest as $manifestDataSet) {
$manifestAttributes = $manifestDataSet->attributes($namespacesContent['manifest']);
if ($manifestAttributes && $manifestAttributes->{'full-path'} == '/') {
$mimeType = (string) $manifestAttributes->{'media-type'};
break;
}
}
}
}
$zip->close();
}
}
return $mimeType === 'application/vnd.oasis.opendocument.spreadsheet';
}
/**
* Reads names of the worksheets from a file, without parsing the whole file to a PhpSpreadsheet object.
*
* @param string $filename
*
* @return string[]
*/
public function listWorksheetNames($filename)
{
File::assertFile($filename, self::INITIAL_FILE);
$worksheetNames = [];
$xml = new XMLReader();
$xml->xml(
$this->securityScanner->scanFile('zip://' . realpath($filename) . '#' . self::INITIAL_FILE),
null,
Settings::getLibXmlLoaderOptions()
);
$xml->setParserProperty(2, true);
// Step into the first level of content of the XML
$xml->read();
while ($xml->read()) {
// Quickly jump through to the office:body node
while ($xml->name !== 'office:body') {
if ($xml->isEmptyElement) {
$xml->read();
} else {
$xml->next();
}
}
// Now read each node until we find our first table:table node
while ($xml->read()) {
if ($xml->name == 'table:table' && $xml->nodeType == XMLReader::ELEMENT) {
// Loop through each table:table node reading the table:name attribute for each worksheet name
do {
$worksheetNames[] = $xml->getAttribute('table:name');
$xml->next();
} while ($xml->name == 'table:table' && $xml->nodeType == XMLReader::ELEMENT);
}
}
}
return $worksheetNames;
}
/**
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns).
*
* @param string $filename
*
* @return array
*/
public function listWorksheetInfo($filename)
{
File::assertFile($filename, self::INITIAL_FILE);
$worksheetInfo = [];
$xml = new XMLReader();
$xml->xml(
$this->securityScanner->scanFile('zip://' . realpath($filename) . '#' . self::INITIAL_FILE),
null,
Settings::getLibXmlLoaderOptions()
);
$xml->setParserProperty(2, true);
// Step into the first level of content of the XML
$xml->read();
while ($xml->read()) {
// Quickly jump through to the office:body node
while ($xml->name !== 'office:body') {
if ($xml->isEmptyElement) {
$xml->read();
} else {
$xml->next();
}
}
// Now read each node until we find our first table:table node
while ($xml->read()) {
if ($xml->name == 'table:table' && $xml->nodeType == XMLReader::ELEMENT) {
$worksheetNames[] = $xml->getAttribute('table:name');
$tmpInfo = [
'worksheetName' => $xml->getAttribute('table:name'),
'lastColumnLetter' => 'A',
'lastColumnIndex' => 0,
'totalRows' => 0,
'totalColumns' => 0,
];
// Loop through each child node of the table:table element reading
$currCells = 0;
do {
$xml->read();
if ($xml->name == 'table:table-row' && $xml->nodeType == XMLReader::ELEMENT) {
$rowspan = $xml->getAttribute('table:number-rows-repeated');
$rowspan = empty($rowspan) ? 1 : $rowspan;
$tmpInfo['totalRows'] += $rowspan;
$tmpInfo['totalColumns'] = max($tmpInfo['totalColumns'], $currCells);
$currCells = 0;
// Step into the row
$xml->read();
do {
$doread = true;
if ($xml->name == 'table:table-cell' && $xml->nodeType == XMLReader::ELEMENT) {
if (!$xml->isEmptyElement) {
++$currCells;
$xml->next();
$doread = false;
}
} elseif ($xml->name == 'table:covered-table-cell' && $xml->nodeType == XMLReader::ELEMENT) {
$mergeSize = $xml->getAttribute('table:number-columns-repeated');
$currCells += (int) $mergeSize;
}
if ($doread) {
$xml->read();
}
} while ($xml->name != 'table:table-row');
}
} while ($xml->name != 'table:table');
$tmpInfo['totalColumns'] = max($tmpInfo['totalColumns'], $currCells);
$tmpInfo['lastColumnIndex'] = $tmpInfo['totalColumns'] - 1;
$tmpInfo['lastColumnLetter'] = Coordinate::stringFromColumnIndex($tmpInfo['lastColumnIndex'] + 1);
$worksheetInfo[] = $tmpInfo;
}
}
}
return $worksheetInfo;
}
/**
* Loads PhpSpreadsheet from file.
*
* @return Spreadsheet
*/
public function load(string $filename, int $flags = 0)
{
$this->processFlags($flags);
// Create new Spreadsheet
$spreadsheet = new Spreadsheet();
// Load into this instance
return $this->loadIntoExisting($filename, $spreadsheet);
}
/**
* Loads PhpSpreadsheet from file into PhpSpreadsheet instance.
*
* @param string $filename
*
* @return Spreadsheet
*/
public function loadIntoExisting($filename, Spreadsheet $spreadsheet)
{
File::assertFile($filename, self::INITIAL_FILE);
$zip = new ZipArchive();
$zip->open($filename);
// Meta
$xml = @simplexml_load_string(
$this->securityScanner->scan($zip->getFromName('meta.xml')),
'SimpleXMLElement',
Settings::getLibXmlLoaderOptions()
);
if ($xml === false) {
throw new Exception('Unable to read data from {$pFilename}');
}
$namespacesMeta = $xml->getNamespaces(true);
(new DocumentProperties($spreadsheet))->load($xml, $namespacesMeta);
// Styles
$dom = new DOMDocument('1.01', 'UTF-8');
$dom->loadXML(
$this->securityScanner->scan($zip->getFromName('styles.xml')),
Settings::getLibXmlLoaderOptions()
);
$pageSettings = new PageSettings($dom);
// Main Content
$dom = new DOMDocument('1.01', 'UTF-8');
$dom->loadXML(
$this->securityScanner->scan($zip->getFromName(self::INITIAL_FILE)),
Settings::getLibXmlLoaderOptions()
);
$officeNs = $dom->lookupNamespaceUri('office');
$tableNs = $dom->lookupNamespaceUri('table');
$textNs = $dom->lookupNamespaceUri('text');
$xlinkNs = $dom->lookupNamespaceUri('xlink');
$pageSettings->readStyleCrossReferences($dom);
$autoFilterReader = new AutoFilter($spreadsheet, $tableNs);
$definedNameReader = new DefinedNames($spreadsheet, $tableNs);
// Content
$spreadsheets = $dom->getElementsByTagNameNS($officeNs, 'body')
->item(0)
->getElementsByTagNameNS($officeNs, 'spreadsheet');
foreach ($spreadsheets as $workbookData) {
/** @var DOMElement $workbookData */
$tables = $workbookData->getElementsByTagNameNS($tableNs, 'table');
$worksheetID = 0;
foreach ($tables as $worksheetDataSet) {
/** @var DOMElement $worksheetDataSet */
$worksheetName = $worksheetDataSet->getAttributeNS($tableNs, 'name');
// Check loadSheetsOnly
if (
isset($this->loadSheetsOnly)
&& $worksheetName
&& !in_array($worksheetName, $this->loadSheetsOnly)
) {
continue;
}
$worksheetStyleName = $worksheetDataSet->getAttributeNS($tableNs, 'style-name');
// Create sheet
if ($worksheetID > 0) {
$spreadsheet->createSheet(); // First sheet is added by default
}
$spreadsheet->setActiveSheetIndex($worksheetID);
if ($worksheetName) {
// Use false for $updateFormulaCellReferences to prevent adjustment of worksheet references in
// formula cells... during the load, all formulae should be correct, and we're simply
// bringing the worksheet name in line with the formula, not the reverse
$spreadsheet->getActiveSheet()->setTitle((string) $worksheetName, false, false);
}
// Go through every child of table element
$rowID = 1;
foreach ($worksheetDataSet->childNodes as $childNode) {
/** @var DOMElement $childNode */
// Filter elements which are not under the "table" ns
if ($childNode->namespaceURI != $tableNs) {
continue;
}
$key = $childNode->nodeName;
// Remove ns from node name
if (strpos($key, ':') !== false) {
$keyChunks = explode(':', $key);
$key = array_pop($keyChunks);
}
switch ($key) {
case 'table-header-rows':
/// TODO :: Figure this out. This is only a partial implementation I guess.
// ($rowData it's not used at all and I'm not sure that PHPExcel
// has an API for this)
// foreach ($rowData as $keyRowData => $cellData) {
// $rowData = $cellData;
// break;
// }
break;
case 'table-row':
if ($childNode->hasAttributeNS($tableNs, 'number-rows-repeated')) {
$rowRepeats = (int) $childNode->getAttributeNS($tableNs, 'number-rows-repeated');
} else {
$rowRepeats = 1;
}
$columnID = 'A';
/** @var DOMElement $cellData */
foreach ($childNode->childNodes as $cellData) {
if ($this->getReadFilter() !== null) {
if (!$this->getReadFilter()->readCell($columnID, $rowID, $worksheetName)) {
++$columnID;
continue;
}
}
// Initialize variables
$formatting = $hyperlink = null;
$hasCalculatedValue = false;
$cellDataFormula = '';
if ($cellData->hasAttributeNS($tableNs, 'formula')) {
$cellDataFormula = $cellData->getAttributeNS($tableNs, 'formula');
$hasCalculatedValue = true;
}
// Annotations
$annotation = $cellData->getElementsByTagNameNS($officeNs, 'annotation');
if ($annotation->length > 0) {
$textNode = $annotation->item(0)->getElementsByTagNameNS($textNs, 'p');
if ($textNode->length > 0) {
$text = $this->scanElementForText($textNode->item(0));
$spreadsheet->getActiveSheet()
->getComment($columnID . $rowID)
->setText($this->parseRichText($text));
// ->setAuthor( $author )
}
}
// Content
/** @var DOMElement[] $paragraphs */
$paragraphs = [];
foreach ($cellData->childNodes as $item) {
/** @var DOMElement $item */
// Filter text:p elements
if ($item->nodeName == 'text:p') {
$paragraphs[] = $item;
}
}
if (count($paragraphs) > 0) {
// Consolidate if there are multiple p records (maybe with spans as well)
$dataArray = [];
// Text can have multiple text:p and within those, multiple text:span.
// text:p newlines, but text:span does not.
// Also, here we assume there is no text data is span fields are specified, since
// we have no way of knowing proper positioning anyway.
foreach ($paragraphs as $pData) {
$dataArray[] = $this->scanElementForText($pData);
}
$allCellDataText = implode("\n", $dataArray);
$type = $cellData->getAttributeNS($officeNs, 'value-type');
switch ($type) {
case 'string':
$type = DataType::TYPE_STRING;
$dataValue = $allCellDataText;
foreach ($paragraphs as $paragraph) {
$link = $paragraph->getElementsByTagNameNS($textNs, 'a');
if ($link->length > 0) {
$hyperlink = $link->item(0)->getAttributeNS($xlinkNs, 'href');
}
}
break;
case 'boolean':
$type = DataType::TYPE_BOOL;
$dataValue = ($allCellDataText == 'TRUE') ? true : false;
break;
case 'percentage':
$type = DataType::TYPE_NUMERIC;
$dataValue = (float) $cellData->getAttributeNS($officeNs, 'value');
// percentage should always be float
//if (floor($dataValue) == $dataValue) {
// $dataValue = (int) $dataValue;
//}
$formatting = NumberFormat::FORMAT_PERCENTAGE_00;
break;
case 'currency':
$type = DataType::TYPE_NUMERIC;
$dataValue = (float) $cellData->getAttributeNS($officeNs, 'value');
if (floor($dataValue) == $dataValue) {
$dataValue = (int) $dataValue;
}
$formatting = NumberFormat::FORMAT_CURRENCY_USD_SIMPLE;
break;
case 'float':
$type = DataType::TYPE_NUMERIC;
$dataValue = (float) $cellData->getAttributeNS($officeNs, 'value');
if (floor($dataValue) == $dataValue) {
if ($dataValue == (int) $dataValue) {
$dataValue = (int) $dataValue;
}
}
break;
case 'date':
$type = DataType::TYPE_NUMERIC;
$value = $cellData->getAttributeNS($officeNs, 'date-value');
$dateObj = new DateTime($value);
[$year, $month, $day, $hour, $minute, $second] = explode(
' ',
$dateObj->format('Y m d H i s')
);
$dataValue = Date::formattedPHPToExcel(
(int) $year,
(int) $month,
(int) $day,
(int) $hour,
(int) $minute,
(int) $second
);
if ($dataValue != floor($dataValue)) {
$formatting = NumberFormat::FORMAT_DATE_XLSX15
. ' '
. NumberFormat::FORMAT_DATE_TIME4;
} else {
$formatting = NumberFormat::FORMAT_DATE_XLSX15;
}
break;
case 'time':
$type = DataType::TYPE_NUMERIC;
$timeValue = $cellData->getAttributeNS($officeNs, 'time-value');
$dataValue = Date::PHPToExcel(
strtotime(
'01-01-1970 ' . implode(':', sscanf($timeValue, 'PT%dH%dM%dS') ?? [])
)
);
$formatting = NumberFormat::FORMAT_DATE_TIME4;
break;
default:
$dataValue = null;
}
} else {
$type = DataType::TYPE_NULL;
$dataValue = null;
}
if ($hasCalculatedValue) {
$type = DataType::TYPE_FORMULA;
$cellDataFormula = substr($cellDataFormula, strpos($cellDataFormula, ':=') + 1);
$cellDataFormula = $this->convertToExcelFormulaValue($cellDataFormula);
}
if ($cellData->hasAttributeNS($tableNs, 'number-columns-repeated')) {
$colRepeats = (int) $cellData->getAttributeNS($tableNs, 'number-columns-repeated');
} else {
$colRepeats = 1;
}
if ($type !== null) {
for ($i = 0; $i < $colRepeats; ++$i) {
if ($i > 0) {
++$columnID;
}
if ($type !== DataType::TYPE_NULL) {
for ($rowAdjust = 0; $rowAdjust < $rowRepeats; ++$rowAdjust) {
$rID = $rowID + $rowAdjust;
$cell = $spreadsheet->getActiveSheet()
->getCell($columnID . $rID);
// Set value
if ($hasCalculatedValue) {
$cell->setValueExplicit($cellDataFormula, $type);
} else {
$cell->setValueExplicit($dataValue, $type);
}
if ($hasCalculatedValue) {
$cell->setCalculatedValue($dataValue);
}
// Set other properties
if ($formatting !== null) {
$spreadsheet->getActiveSheet()
->getStyle($columnID . $rID)
->getNumberFormat()
->setFormatCode($formatting);
} else {
$spreadsheet->getActiveSheet()
->getStyle($columnID . $rID)
->getNumberFormat()
->setFormatCode(NumberFormat::FORMAT_GENERAL);
}
if ($hyperlink !== null) {
$cell->getHyperlink()
->setUrl($hyperlink);
}
}
}
}
}
// Merged cells
if (
$cellData->hasAttributeNS($tableNs, 'number-columns-spanned')
|| $cellData->hasAttributeNS($tableNs, 'number-rows-spanned')
) {
if (($type !== DataType::TYPE_NULL) || (!$this->readDataOnly)) {
$columnTo = $columnID;
if ($cellData->hasAttributeNS($tableNs, 'number-columns-spanned')) {
$columnIndex = Coordinate::columnIndexFromString($columnID);
$columnIndex += (int) $cellData->getAttributeNS($tableNs, 'number-columns-spanned');
$columnIndex -= 2;
$columnTo = Coordinate::stringFromColumnIndex($columnIndex + 1);
}
$rowTo = $rowID;
if ($cellData->hasAttributeNS($tableNs, 'number-rows-spanned')) {
$rowTo = $rowTo + (int) $cellData->getAttributeNS($tableNs, 'number-rows-spanned') - 1;
}
$cellRange = $columnID . $rowID . ':' . $columnTo . $rowTo;
$spreadsheet->getActiveSheet()->mergeCells($cellRange);
}
}
++$columnID;
}
$rowID += $rowRepeats;
break;
}
}
$pageSettings->setPrintSettingsForWorksheet($spreadsheet->getActiveSheet(), $worksheetStyleName);
++$worksheetID;
}
$autoFilterReader->read($workbookData);
$definedNameReader->read($workbookData);
}
$spreadsheet->setActiveSheetIndex(0);
if ($zip->locateName('settings.xml') !== false) {
$this->processSettings($zip, $spreadsheet);
}
// Return
return $spreadsheet;
}
private function processSettings(ZipArchive $zip, Spreadsheet $spreadsheet): void
{
$dom = new DOMDocument('1.01', 'UTF-8');
$dom->loadXML(
$this->securityScanner->scan($zip->getFromName('settings.xml')),
Settings::getLibXmlLoaderOptions()
);
//$xlinkNs = $dom->lookupNamespaceUri('xlink');
$configNs = $dom->lookupNamespaceUri('config');
//$oooNs = $dom->lookupNamespaceUri('ooo');
$officeNs = $dom->lookupNamespaceUri('office');
$settings = $dom->getElementsByTagNameNS($officeNs, 'settings')
->item(0);
$this->lookForActiveSheet($settings, $spreadsheet, $configNs);
$this->lookForSelectedCells($settings, $spreadsheet, $configNs);
}
private function lookForActiveSheet(DOMElement $settings, Spreadsheet $spreadsheet, string $configNs): void
{
/** @var DOMElement $t */
foreach ($settings->getElementsByTagNameNS($configNs, 'config-item') as $t) {
if ($t->getAttributeNs($configNs, 'name') === 'ActiveTable') {
try {
$spreadsheet->setActiveSheetIndexByName($t->nodeValue);
} catch (Throwable $e) {
// do nothing
}
break;
}
}
}
private function lookForSelectedCells(DOMElement $settings, Spreadsheet $spreadsheet, string $configNs): void
{
/** @var DOMElement $t */
foreach ($settings->getElementsByTagNameNS($configNs, 'config-item-map-named') as $t) {
if ($t->getAttributeNs($configNs, 'name') === 'Tables') {
foreach ($t->getElementsByTagNameNS($configNs, 'config-item-map-entry') as $ws) {
$setRow = $setCol = '';
$wsname = $ws->getAttributeNs($configNs, 'name');
foreach ($ws->getElementsByTagNameNS($configNs, 'config-item') as $configItem) {
$attrName = $configItem->getAttributeNs($configNs, 'name');
if ($attrName === 'CursorPositionX') {
$setCol = $configItem->nodeValue;
}
if ($attrName === 'CursorPositionY') {
$setRow = $configItem->nodeValue;
}
}
$this->setSelected($spreadsheet, $wsname, $setCol, $setRow);
}
break;
}
}
}
private function setSelected(Spreadsheet $spreadsheet, string $wsname, string $setCol, string $setRow): void
{
if (is_numeric($setCol) && is_numeric($setRow)) {
try {
$spreadsheet->getSheetByName($wsname)->setSelectedCellByColumnAndRow($setCol + 1, $setRow + 1);
} catch (Throwable $e) {
// do nothing
}
}
}
/**
* Recursively scan element.
*
* @return string
*/
protected function scanElementForText(DOMNode $element)
{
$str = '';
foreach ($element->childNodes as $child) {
/** @var DOMNode $child */
if ($child->nodeType == XML_TEXT_NODE) {
$str .= $child->nodeValue;
} elseif ($child->nodeType == XML_ELEMENT_NODE && $child->nodeName == 'text:s') {
// It's a space
// Multiple spaces?
/** @var DOMAttr $cAttr */
$cAttr = $child->attributes->getNamedItem('c');
if ($cAttr) {
$multiplier = (int) $cAttr->nodeValue;
} else {
$multiplier = 1;
}
$str .= str_repeat(' ', $multiplier);
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | true |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/MD5.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/MD5.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls;
class MD5
{
// Context
/**
* @var int
*/
private $a;
/**
* @var int
*/
private $b;
/**
* @var int
*/
private $c;
/**
* @var int
*/
private $d;
/**
* MD5 stream constructor.
*/
public function __construct()
{
$this->reset();
}
/**
* Reset the MD5 stream context.
*/
public function reset(): void
{
$this->a = 0x67452301;
$this->b = 0xEFCDAB89;
$this->c = 0x98BADCFE;
$this->d = 0x10325476;
}
/**
* Get MD5 stream context.
*
* @return string
*/
public function getContext()
{
$s = '';
foreach (['a', 'b', 'c', 'd'] as $i) {
$v = $this->{$i};
$s .= chr($v & 0xff);
$s .= chr(($v >> 8) & 0xff);
$s .= chr(($v >> 16) & 0xff);
$s .= chr(($v >> 24) & 0xff);
}
return $s;
}
/**
* Add data to context.
*
* @param string $data Data to add
*/
public function add(string $data): void
{
$words = array_values(unpack('V16', $data));
$A = $this->a;
$B = $this->b;
$C = $this->c;
$D = $this->d;
$F = ['self', 'f'];
$G = ['self', 'g'];
$H = ['self', 'h'];
$I = ['self', 'i'];
// ROUND 1
self::step($F, $A, $B, $C, $D, $words[0], 7, 0xd76aa478);
self::step($F, $D, $A, $B, $C, $words[1], 12, 0xe8c7b756);
self::step($F, $C, $D, $A, $B, $words[2], 17, 0x242070db);
self::step($F, $B, $C, $D, $A, $words[3], 22, 0xc1bdceee);
self::step($F, $A, $B, $C, $D, $words[4], 7, 0xf57c0faf);
self::step($F, $D, $A, $B, $C, $words[5], 12, 0x4787c62a);
self::step($F, $C, $D, $A, $B, $words[6], 17, 0xa8304613);
self::step($F, $B, $C, $D, $A, $words[7], 22, 0xfd469501);
self::step($F, $A, $B, $C, $D, $words[8], 7, 0x698098d8);
self::step($F, $D, $A, $B, $C, $words[9], 12, 0x8b44f7af);
self::step($F, $C, $D, $A, $B, $words[10], 17, 0xffff5bb1);
self::step($F, $B, $C, $D, $A, $words[11], 22, 0x895cd7be);
self::step($F, $A, $B, $C, $D, $words[12], 7, 0x6b901122);
self::step($F, $D, $A, $B, $C, $words[13], 12, 0xfd987193);
self::step($F, $C, $D, $A, $B, $words[14], 17, 0xa679438e);
self::step($F, $B, $C, $D, $A, $words[15], 22, 0x49b40821);
// ROUND 2
self::step($G, $A, $B, $C, $D, $words[1], 5, 0xf61e2562);
self::step($G, $D, $A, $B, $C, $words[6], 9, 0xc040b340);
self::step($G, $C, $D, $A, $B, $words[11], 14, 0x265e5a51);
self::step($G, $B, $C, $D, $A, $words[0], 20, 0xe9b6c7aa);
self::step($G, $A, $B, $C, $D, $words[5], 5, 0xd62f105d);
self::step($G, $D, $A, $B, $C, $words[10], 9, 0x02441453);
self::step($G, $C, $D, $A, $B, $words[15], 14, 0xd8a1e681);
self::step($G, $B, $C, $D, $A, $words[4], 20, 0xe7d3fbc8);
self::step($G, $A, $B, $C, $D, $words[9], 5, 0x21e1cde6);
self::step($G, $D, $A, $B, $C, $words[14], 9, 0xc33707d6);
self::step($G, $C, $D, $A, $B, $words[3], 14, 0xf4d50d87);
self::step($G, $B, $C, $D, $A, $words[8], 20, 0x455a14ed);
self::step($G, $A, $B, $C, $D, $words[13], 5, 0xa9e3e905);
self::step($G, $D, $A, $B, $C, $words[2], 9, 0xfcefa3f8);
self::step($G, $C, $D, $A, $B, $words[7], 14, 0x676f02d9);
self::step($G, $B, $C, $D, $A, $words[12], 20, 0x8d2a4c8a);
// ROUND 3
self::step($H, $A, $B, $C, $D, $words[5], 4, 0xfffa3942);
self::step($H, $D, $A, $B, $C, $words[8], 11, 0x8771f681);
self::step($H, $C, $D, $A, $B, $words[11], 16, 0x6d9d6122);
self::step($H, $B, $C, $D, $A, $words[14], 23, 0xfde5380c);
self::step($H, $A, $B, $C, $D, $words[1], 4, 0xa4beea44);
self::step($H, $D, $A, $B, $C, $words[4], 11, 0x4bdecfa9);
self::step($H, $C, $D, $A, $B, $words[7], 16, 0xf6bb4b60);
self::step($H, $B, $C, $D, $A, $words[10], 23, 0xbebfbc70);
self::step($H, $A, $B, $C, $D, $words[13], 4, 0x289b7ec6);
self::step($H, $D, $A, $B, $C, $words[0], 11, 0xeaa127fa);
self::step($H, $C, $D, $A, $B, $words[3], 16, 0xd4ef3085);
self::step($H, $B, $C, $D, $A, $words[6], 23, 0x04881d05);
self::step($H, $A, $B, $C, $D, $words[9], 4, 0xd9d4d039);
self::step($H, $D, $A, $B, $C, $words[12], 11, 0xe6db99e5);
self::step($H, $C, $D, $A, $B, $words[15], 16, 0x1fa27cf8);
self::step($H, $B, $C, $D, $A, $words[2], 23, 0xc4ac5665);
// ROUND 4
self::step($I, $A, $B, $C, $D, $words[0], 6, 0xf4292244);
self::step($I, $D, $A, $B, $C, $words[7], 10, 0x432aff97);
self::step($I, $C, $D, $A, $B, $words[14], 15, 0xab9423a7);
self::step($I, $B, $C, $D, $A, $words[5], 21, 0xfc93a039);
self::step($I, $A, $B, $C, $D, $words[12], 6, 0x655b59c3);
self::step($I, $D, $A, $B, $C, $words[3], 10, 0x8f0ccc92);
self::step($I, $C, $D, $A, $B, $words[10], 15, 0xffeff47d);
self::step($I, $B, $C, $D, $A, $words[1], 21, 0x85845dd1);
self::step($I, $A, $B, $C, $D, $words[8], 6, 0x6fa87e4f);
self::step($I, $D, $A, $B, $C, $words[15], 10, 0xfe2ce6e0);
self::step($I, $C, $D, $A, $B, $words[6], 15, 0xa3014314);
self::step($I, $B, $C, $D, $A, $words[13], 21, 0x4e0811a1);
self::step($I, $A, $B, $C, $D, $words[4], 6, 0xf7537e82);
self::step($I, $D, $A, $B, $C, $words[11], 10, 0xbd3af235);
self::step($I, $C, $D, $A, $B, $words[2], 15, 0x2ad7d2bb);
self::step($I, $B, $C, $D, $A, $words[9], 21, 0xeb86d391);
$this->a = ($this->a + $A) & 0xffffffff;
$this->b = ($this->b + $B) & 0xffffffff;
$this->c = ($this->c + $C) & 0xffffffff;
$this->d = ($this->d + $D) & 0xffffffff;
}
private static function f(int $X, int $Y, int $Z)
{
return ($X & $Y) | ((~$X) & $Z); // X AND Y OR NOT X AND Z
}
private static function g(int $X, int $Y, int $Z)
{
return ($X & $Z) | ($Y & (~$Z)); // X AND Z OR Y AND NOT Z
}
private static function h(int $X, int $Y, int $Z)
{
return $X ^ $Y ^ $Z; // X XOR Y XOR Z
}
private static function i(int $X, int $Y, int $Z)
{
return $Y ^ ($X | (~$Z)); // Y XOR (X OR NOT Z)
}
private static function step($func, int &$A, int $B, int $C, int $D, int $M, int $s, int $t): void
{
$A = ($A + call_user_func($func, $B, $C, $D) + $M + $t) & 0xffffffff;
$A = self::rotate($A, $s);
$A = ($B + $A) & 0xffffffff;
}
private static function rotate(int $decimal, int $bits)
{
$binary = str_pad(decbin($decimal), 32, '0', STR_PAD_LEFT);
return bindec(substr($binary, $bits) . substr($binary, 0, $bits));
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Escher.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Escher.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Reader\Xls;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DgContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DgContainer\SpgrContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DgContainer\SpgrContainer\SpContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer\BstoreContainer;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer\BstoreContainer\BSE;
use PhpOffice\PhpSpreadsheet\Shared\Escher\DggContainer\BstoreContainer\BSE\Blip;
class Escher
{
const DGGCONTAINER = 0xF000;
const BSTORECONTAINER = 0xF001;
const DGCONTAINER = 0xF002;
const SPGRCONTAINER = 0xF003;
const SPCONTAINER = 0xF004;
const DGG = 0xF006;
const BSE = 0xF007;
const DG = 0xF008;
const SPGR = 0xF009;
const SP = 0xF00A;
const OPT = 0xF00B;
const CLIENTTEXTBOX = 0xF00D;
const CLIENTANCHOR = 0xF010;
const CLIENTDATA = 0xF011;
const BLIPJPEG = 0xF01D;
const BLIPPNG = 0xF01E;
const SPLITMENUCOLORS = 0xF11E;
const TERTIARYOPT = 0xF122;
/**
* Escher stream data (binary).
*
* @var string
*/
private $data;
/**
* Size in bytes of the Escher stream data.
*
* @var int
*/
private $dataSize;
/**
* Current position of stream pointer in Escher stream data.
*
* @var int
*/
private $pos;
/**
* The object to be returned by the reader. Modified during load.
*
* @var BSE|BstoreContainer|DgContainer|DggContainer|\PhpOffice\PhpSpreadsheet\Shared\Escher|SpContainer|SpgrContainer
*/
private $object;
/**
* Create a new Escher instance.
*
* @param mixed $object
*/
public function __construct($object)
{
$this->object = $object;
}
private const WHICH_ROUTINE = [
self::DGGCONTAINER => 'readDggContainer',
self::DGG => 'readDgg',
self::BSTORECONTAINER => 'readBstoreContainer',
self::BSE => 'readBSE',
self::BLIPJPEG => 'readBlipJPEG',
self::BLIPPNG => 'readBlipPNG',
self::OPT => 'readOPT',
self::TERTIARYOPT => 'readTertiaryOPT',
self::SPLITMENUCOLORS => 'readSplitMenuColors',
self::DGCONTAINER => 'readDgContainer',
self::DG => 'readDg',
self::SPGRCONTAINER => 'readSpgrContainer',
self::SPCONTAINER => 'readSpContainer',
self::SPGR => 'readSpgr',
self::SP => 'readSp',
self::CLIENTTEXTBOX => 'readClientTextbox',
self::CLIENTANCHOR => 'readClientAnchor',
self::CLIENTDATA => 'readClientData',
];
/**
* Load Escher stream data. May be a partial Escher stream.
*
* @param string $data
*
* @return BSE|BstoreContainer|DgContainer|DggContainer|\PhpOffice\PhpSpreadsheet\Shared\Escher|SpContainer|SpgrContainer
*/
public function load($data)
{
$this->data = $data;
// total byte size of Excel data (workbook global substream + sheet substreams)
$this->dataSize = strlen($this->data);
$this->pos = 0;
// Parse Escher stream
while ($this->pos < $this->dataSize) {
// offset: 2; size: 2: Record Type
$fbt = Xls::getUInt2d($this->data, $this->pos + 2);
$routine = self::WHICH_ROUTINE[$fbt] ?? 'readDefault';
if (method_exists($this, $routine)) {
$this->$routine();
}
}
return $this->object;
}
/**
* Read a generic record.
*/
private function readDefault(): void
{
// offset 0; size: 2; recVer and recInstance
//$verInstance = Xls::getUInt2d($this->data, $this->pos);
// offset: 2; size: 2: Record Type
//$fbt = Xls::getUInt2d($this->data, $this->pos + 2);
// bit: 0-3; mask: 0x000F; recVer
//$recVer = (0x000F & $verInstance) >> 0;
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read DggContainer record (Drawing Group Container).
*/
private function readDggContainer(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
// record is a container, read contents
$dggContainer = new DggContainer();
$this->applyAttribute('setDggContainer', $dggContainer);
$reader = new self($dggContainer);
$reader->load($recordData);
}
/**
* Read Dgg record (Drawing Group).
*/
private function readDgg(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read BstoreContainer record (Blip Store Container).
*/
private function readBstoreContainer(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
// record is a container, read contents
$bstoreContainer = new BstoreContainer();
$this->applyAttribute('setBstoreContainer', $bstoreContainer);
$reader = new self($bstoreContainer);
$reader->load($recordData);
}
/**
* Read BSE record.
*/
private function readBSE(): void
{
// offset: 0; size: 2; recVer and recInstance
// bit: 4-15; mask: 0xFFF0; recInstance
$recInstance = (0xFFF0 & Xls::getUInt2d($this->data, $this->pos)) >> 4;
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
// add BSE to BstoreContainer
$BSE = new BSE();
$this->applyAttribute('addBSE', $BSE);
$BSE->setBLIPType($recInstance);
// offset: 0; size: 1; btWin32 (MSOBLIPTYPE)
//$btWin32 = ord($recordData[0]);
// offset: 1; size: 1; btWin32 (MSOBLIPTYPE)
//$btMacOS = ord($recordData[1]);
// offset: 2; size: 16; MD4 digest
//$rgbUid = substr($recordData, 2, 16);
// offset: 18; size: 2; tag
//$tag = Xls::getUInt2d($recordData, 18);
// offset: 20; size: 4; size of BLIP in bytes
//$size = Xls::getInt4d($recordData, 20);
// offset: 24; size: 4; number of references to this BLIP
//$cRef = Xls::getInt4d($recordData, 24);
// offset: 28; size: 4; MSOFO file offset
//$foDelay = Xls::getInt4d($recordData, 28);
// offset: 32; size: 1; unused1
//$unused1 = ord($recordData[32]);
// offset: 33; size: 1; size of nameData in bytes (including null terminator)
$cbName = ord($recordData[33]);
// offset: 34; size: 1; unused2
//$unused2 = ord($recordData[34]);
// offset: 35; size: 1; unused3
//$unused3 = ord($recordData[35]);
// offset: 36; size: $cbName; nameData
//$nameData = substr($recordData, 36, $cbName);
// offset: 36 + $cbName, size: var; the BLIP data
$blipData = substr($recordData, 36 + $cbName);
// record is a container, read contents
$reader = new self($BSE);
$reader->load($blipData);
}
/**
* Read BlipJPEG record. Holds raw JPEG image data.
*/
private function readBlipJPEG(): void
{
// offset: 0; size: 2; recVer and recInstance
// bit: 4-15; mask: 0xFFF0; recInstance
$recInstance = (0xFFF0 & Xls::getUInt2d($this->data, $this->pos)) >> 4;
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
$pos = 0;
// offset: 0; size: 16; rgbUid1 (MD4 digest of)
//$rgbUid1 = substr($recordData, 0, 16);
$pos += 16;
// offset: 16; size: 16; rgbUid2 (MD4 digest), only if $recInstance = 0x46B or 0x6E3
if (in_array($recInstance, [0x046B, 0x06E3])) {
//$rgbUid2 = substr($recordData, 16, 16);
$pos += 16;
}
// offset: var; size: 1; tag
//$tag = ord($recordData[$pos]);
++$pos;
// offset: var; size: var; the raw image data
$data = substr($recordData, $pos);
$blip = new Blip();
$blip->setData($data);
$this->applyAttribute('setBlip', $blip);
}
/**
* Read BlipPNG record. Holds raw PNG image data.
*/
private function readBlipPNG(): void
{
// offset: 0; size: 2; recVer and recInstance
// bit: 4-15; mask: 0xFFF0; recInstance
$recInstance = (0xFFF0 & Xls::getUInt2d($this->data, $this->pos)) >> 4;
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
$pos = 0;
// offset: 0; size: 16; rgbUid1 (MD4 digest of)
//$rgbUid1 = substr($recordData, 0, 16);
$pos += 16;
// offset: 16; size: 16; rgbUid2 (MD4 digest), only if $recInstance = 0x46B or 0x6E3
if ($recInstance == 0x06E1) {
//$rgbUid2 = substr($recordData, 16, 16);
$pos += 16;
}
// offset: var; size: 1; tag
//$tag = ord($recordData[$pos]);
++$pos;
// offset: var; size: var; the raw image data
$data = substr($recordData, $pos);
$blip = new Blip();
$blip->setData($data);
$this->applyAttribute('setBlip', $blip);
}
/**
* Read OPT record. This record may occur within DggContainer record or SpContainer.
*/
private function readOPT(): void
{
// offset: 0; size: 2; recVer and recInstance
// bit: 4-15; mask: 0xFFF0; recInstance
$recInstance = (0xFFF0 & Xls::getUInt2d($this->data, $this->pos)) >> 4;
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
$this->readOfficeArtRGFOPTE($recordData, $recInstance);
}
/**
* Read TertiaryOPT record.
*/
private function readTertiaryOPT(): void
{
// offset: 0; size: 2; recVer and recInstance
// bit: 4-15; mask: 0xFFF0; recInstance
//$recInstance = (0xFFF0 & Xls::getUInt2d($this->data, $this->pos)) >> 4;
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read SplitMenuColors record.
*/
private function readSplitMenuColors(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read DgContainer record (Drawing Container).
*/
private function readDgContainer(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
// record is a container, read contents
$dgContainer = new DgContainer();
$this->applyAttribute('setDgContainer', $dgContainer);
$reader = new self($dgContainer);
$reader->load($recordData);
}
/**
* Read Dg record (Drawing).
*/
private function readDg(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read SpgrContainer record (Shape Group Container).
*/
private function readSpgrContainer(): void
{
// context is either context DgContainer or SpgrContainer
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
// record is a container, read contents
$spgrContainer = new SpgrContainer();
if ($this->object instanceof DgContainer) {
// DgContainer
$this->object->setSpgrContainer($spgrContainer);
} elseif ($this->object instanceof SpgrContainer) {
// SpgrContainer
$this->object->addChild($spgrContainer);
}
$reader = new self($spgrContainer);
$reader->load($recordData);
}
/**
* Read SpContainer record (Shape Container).
*/
private function readSpContainer(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// add spContainer to spgrContainer
$spContainer = new SpContainer();
$this->applyAttribute('addChild', $spContainer);
// move stream pointer to next record
$this->pos += 8 + $length;
// record is a container, read contents
$reader = new self($spContainer);
$reader->load($recordData);
}
/**
* Read Spgr record (Shape Group).
*/
private function readSpgr(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read Sp record (Shape).
*/
private function readSp(): void
{
// offset: 0; size: 2; recVer and recInstance
// bit: 4-15; mask: 0xFFF0; recInstance
//$recInstance = (0xFFF0 & Xls::getUInt2d($this->data, $this->pos)) >> 4;
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read ClientTextbox record.
*/
private function readClientTextbox(): void
{
// offset: 0; size: 2; recVer and recInstance
// bit: 4-15; mask: 0xFFF0; recInstance
//$recInstance = (0xFFF0 & Xls::getUInt2d($this->data, $this->pos)) >> 4;
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read ClientAnchor record. This record holds information about where the shape is anchored in worksheet.
*/
private function readClientAnchor(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
// offset: 2; size: 2; upper-left corner column index (0-based)
$c1 = Xls::getUInt2d($recordData, 2);
// offset: 4; size: 2; upper-left corner horizontal offset in 1/1024 of column width
$startOffsetX = Xls::getUInt2d($recordData, 4);
// offset: 6; size: 2; upper-left corner row index (0-based)
$r1 = Xls::getUInt2d($recordData, 6);
// offset: 8; size: 2; upper-left corner vertical offset in 1/256 of row height
$startOffsetY = Xls::getUInt2d($recordData, 8);
// offset: 10; size: 2; bottom-right corner column index (0-based)
$c2 = Xls::getUInt2d($recordData, 10);
// offset: 12; size: 2; bottom-right corner horizontal offset in 1/1024 of column width
$endOffsetX = Xls::getUInt2d($recordData, 12);
// offset: 14; size: 2; bottom-right corner row index (0-based)
$r2 = Xls::getUInt2d($recordData, 14);
// offset: 16; size: 2; bottom-right corner vertical offset in 1/256 of row height
$endOffsetY = Xls::getUInt2d($recordData, 16);
$this->applyAttribute('setStartCoordinates', Coordinate::stringFromColumnIndex($c1 + 1) . ($r1 + 1));
$this->applyAttribute('setStartOffsetX', $startOffsetX);
$this->applyAttribute('setStartOffsetY', $startOffsetY);
$this->applyAttribute('setEndCoordinates', Coordinate::stringFromColumnIndex($c2 + 1) . ($r2 + 1));
$this->applyAttribute('setEndOffsetX', $endOffsetX);
$this->applyAttribute('setEndOffsetY', $endOffsetY);
}
/**
* @param mixed $value
*/
private function applyAttribute(string $name, $value): void
{
if (method_exists($this->object, $name)) {
$this->object->$name($value);
}
}
/**
* Read ClientData record.
*/
private function readClientData(): void
{
$length = Xls::getInt4d($this->data, $this->pos + 4);
//$recordData = substr($this->data, $this->pos + 8, $length);
// move stream pointer to next record
$this->pos += 8 + $length;
}
/**
* Read OfficeArtRGFOPTE table of property-value pairs.
*
* @param string $data Binary data
* @param int $n Number of properties
*/
private function readOfficeArtRGFOPTE($data, $n): void
{
$splicedComplexData = substr($data, 6 * $n);
// loop through property-value pairs
for ($i = 0; $i < $n; ++$i) {
// read 6 bytes at a time
$fopte = substr($data, 6 * $i, 6);
// offset: 0; size: 2; opid
$opid = Xls::getUInt2d($fopte, 0);
// bit: 0-13; mask: 0x3FFF; opid.opid
$opidOpid = (0x3FFF & $opid) >> 0;
// bit: 14; mask 0x4000; 1 = value in op field is BLIP identifier
//$opidFBid = (0x4000 & $opid) >> 14;
// bit: 15; mask 0x8000; 1 = this is a complex property, op field specifies size of complex data
$opidFComplex = (0x8000 & $opid) >> 15;
// offset: 2; size: 4; the value for this property
$op = Xls::getInt4d($fopte, 2);
if ($opidFComplex) {
$complexData = substr($splicedComplexData, 0, $op);
$splicedComplexData = substr($splicedComplexData, $op);
// we store string value with complex data
$value = $complexData;
} else {
// we store integer value
$value = $op;
}
if (method_exists($this->object, 'setOPT')) {
$this->object->setOPT($opidOpid, $value);
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/ErrorCode.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/ErrorCode.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls;
class ErrorCode
{
protected static $map = [
0x00 => '#NULL!',
0x07 => '#DIV/0!',
0x0F => '#VALUE!',
0x17 => '#REF!',
0x1D => '#NAME?',
0x24 => '#NUM!',
0x2A => '#N/A',
];
/**
* Map error code, e.g. '#N/A'.
*
* @param int $code
*
* @return bool|string
*/
public static function lookup($code)
{
if (isset(self::$map[$code])) {
return self::$map[$code];
}
return false;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls;
use PhpOffice\PhpSpreadsheet\Reader\Xls;
class Color
{
/**
* Read color.
*
* @param int $color Indexed color
* @param array $palette Color palette
* @param int $version
*
* @return array RGB color value, example: ['rgb' => 'FF0000']
*/
public static function map($color, $palette, $version)
{
if ($color <= 0x07 || $color >= 0x40) {
// special built-in color
return Color\BuiltIn::lookup($color);
} elseif (isset($palette[$color - 8])) {
// palette color, color index 0x08 maps to pallete index 0
return $palette[$color - 8];
}
// default color table
if ($version == Xls::XLS_BIFF8) {
return Color\BIFF8::lookup($color);
}
// BIFF5
return Color\BIFF5::lookup($color);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/RC4.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/RC4.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls;
class RC4
{
// Context
protected $s = [];
protected $i = 0;
protected $j = 0;
/**
* RC4 stream decryption/encryption constrcutor.
*
* @param string $key Encryption key/passphrase
*/
public function __construct($key)
{
$len = strlen($key);
for ($this->i = 0; $this->i < 256; ++$this->i) {
$this->s[$this->i] = $this->i;
}
$this->j = 0;
for ($this->i = 0; $this->i < 256; ++$this->i) {
$this->j = ($this->j + $this->s[$this->i] + ord($key[$this->i % $len])) % 256;
$t = $this->s[$this->i];
$this->s[$this->i] = $this->s[$this->j];
$this->s[$this->j] = $t;
}
$this->i = $this->j = 0;
}
/**
* Symmetric decryption/encryption function.
*
* @param string $data Data to encrypt/decrypt
*
* @return string
*/
public function RC4($data)
{
$len = strlen($data);
for ($c = 0; $c < $len; ++$c) {
$this->i = ($this->i + 1) % 256;
$this->j = ($this->j + $this->s[$this->i]) % 256;
$t = $this->s[$this->i];
$this->s[$this->i] = $this->s[$this->j];
$this->s[$this->j] = $t;
$t = ($this->s[$this->i] + $this->s[$this->j]) % 256;
$data[$c] = chr(ord($data[$c]) ^ $this->s[$t]);
}
return $data;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/FillPattern.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/FillPattern.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Style;
use PhpOffice\PhpSpreadsheet\Style\Fill;
class FillPattern
{
/**
* @var array<int, string>
*/
protected static $fillPatternMap = [
0x00 => Fill::FILL_NONE,
0x01 => Fill::FILL_SOLID,
0x02 => Fill::FILL_PATTERN_MEDIUMGRAY,
0x03 => Fill::FILL_PATTERN_DARKGRAY,
0x04 => Fill::FILL_PATTERN_LIGHTGRAY,
0x05 => Fill::FILL_PATTERN_DARKHORIZONTAL,
0x06 => Fill::FILL_PATTERN_DARKVERTICAL,
0x07 => Fill::FILL_PATTERN_DARKDOWN,
0x08 => Fill::FILL_PATTERN_DARKUP,
0x09 => Fill::FILL_PATTERN_DARKGRID,
0x0A => Fill::FILL_PATTERN_DARKTRELLIS,
0x0B => Fill::FILL_PATTERN_LIGHTHORIZONTAL,
0x0C => Fill::FILL_PATTERN_LIGHTVERTICAL,
0x0D => Fill::FILL_PATTERN_LIGHTDOWN,
0x0E => Fill::FILL_PATTERN_LIGHTUP,
0x0F => Fill::FILL_PATTERN_LIGHTGRID,
0x10 => Fill::FILL_PATTERN_LIGHTTRELLIS,
0x11 => Fill::FILL_PATTERN_GRAY125,
0x12 => Fill::FILL_PATTERN_GRAY0625,
];
/**
* Get fill pattern from index
* OpenOffice documentation: 2.5.12.
*
* @param int $index
*
* @return string
*/
public static function lookup($index)
{
if (isset(self::$fillPatternMap[$index])) {
return self::$fillPatternMap[$index];
}
return Fill::FILL_NONE;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/Border.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/Border.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Style;
use PhpOffice\PhpSpreadsheet\Style\Border as StyleBorder;
class Border
{
/**
* @var array<int, string>
*/
protected static $borderStyleMap = [
0x00 => StyleBorder::BORDER_NONE,
0x01 => StyleBorder::BORDER_THIN,
0x02 => StyleBorder::BORDER_MEDIUM,
0x03 => StyleBorder::BORDER_DASHED,
0x04 => StyleBorder::BORDER_DOTTED,
0x05 => StyleBorder::BORDER_THICK,
0x06 => StyleBorder::BORDER_DOUBLE,
0x07 => StyleBorder::BORDER_HAIR,
0x08 => StyleBorder::BORDER_MEDIUMDASHED,
0x09 => StyleBorder::BORDER_DASHDOT,
0x0A => StyleBorder::BORDER_MEDIUMDASHDOT,
0x0B => StyleBorder::BORDER_DASHDOTDOT,
0x0C => StyleBorder::BORDER_MEDIUMDASHDOTDOT,
0x0D => StyleBorder::BORDER_SLANTDASHDOT,
];
public static function lookup(int $index): string
{
if (isset(self::$borderStyleMap[$index])) {
return self::$borderStyleMap[$index];
}
return StyleBorder::BORDER_NONE;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/CellFont.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/CellFont.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Style;
use PhpOffice\PhpSpreadsheet\Style\Font;
class CellFont
{
public static function escapement(Font $font, int $escapement): void
{
switch ($escapement) {
case 0x0001:
$font->setSuperscript(true);
break;
case 0x0002:
$font->setSubscript(true);
break;
}
}
/**
* @var array<int, string>
*/
protected static $underlineMap = [
0x01 => Font::UNDERLINE_SINGLE,
0x02 => Font::UNDERLINE_DOUBLE,
0x21 => Font::UNDERLINE_SINGLEACCOUNTING,
0x22 => Font::UNDERLINE_DOUBLEACCOUNTING,
];
public static function underline(Font $font, int $underline): void
{
if (array_key_exists($underline, self::$underlineMap)) {
$font->setUnderline(self::$underlineMap[$underline]);
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/CellAlignment.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Style/CellAlignment.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Style;
use PhpOffice\PhpSpreadsheet\Style\Alignment;
class CellAlignment
{
/**
* @var array<int, string>
*/
protected static $horizontalAlignmentMap = [
0 => Alignment::HORIZONTAL_GENERAL,
1 => Alignment::HORIZONTAL_LEFT,
2 => Alignment::HORIZONTAL_CENTER,
3 => Alignment::HORIZONTAL_RIGHT,
4 => Alignment::HORIZONTAL_FILL,
5 => Alignment::HORIZONTAL_JUSTIFY,
6 => Alignment::HORIZONTAL_CENTER_CONTINUOUS,
];
/**
* @var array<int, string>
*/
protected static $verticalAlignmentMap = [
0 => Alignment::VERTICAL_TOP,
1 => Alignment::VERTICAL_CENTER,
2 => Alignment::VERTICAL_BOTTOM,
3 => Alignment::VERTICAL_JUSTIFY,
];
public static function horizontal(Alignment $alignment, int $horizontal): void
{
if (array_key_exists($horizontal, self::$horizontalAlignmentMap)) {
$alignment->setHorizontal(self::$horizontalAlignmentMap[$horizontal]);
}
}
public static function vertical(Alignment $alignment, int $vertical): void
{
if (array_key_exists($vertical, self::$verticalAlignmentMap)) {
$alignment->setVertical(self::$verticalAlignmentMap[$vertical]);
}
}
public static function wrap(Alignment $alignment, int $wrap): void
{
$alignment->setWrapText((bool) $wrap);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color/BIFF8.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color/BIFF8.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Color;
class BIFF8
{
protected static $map = [
0x08 => '000000',
0x09 => 'FFFFFF',
0x0A => 'FF0000',
0x0B => '00FF00',
0x0C => '0000FF',
0x0D => 'FFFF00',
0x0E => 'FF00FF',
0x0F => '00FFFF',
0x10 => '800000',
0x11 => '008000',
0x12 => '000080',
0x13 => '808000',
0x14 => '800080',
0x15 => '008080',
0x16 => 'C0C0C0',
0x17 => '808080',
0x18 => '9999FF',
0x19 => '993366',
0x1A => 'FFFFCC',
0x1B => 'CCFFFF',
0x1C => '660066',
0x1D => 'FF8080',
0x1E => '0066CC',
0x1F => 'CCCCFF',
0x20 => '000080',
0x21 => 'FF00FF',
0x22 => 'FFFF00',
0x23 => '00FFFF',
0x24 => '800080',
0x25 => '800000',
0x26 => '008080',
0x27 => '0000FF',
0x28 => '00CCFF',
0x29 => 'CCFFFF',
0x2A => 'CCFFCC',
0x2B => 'FFFF99',
0x2C => '99CCFF',
0x2D => 'FF99CC',
0x2E => 'CC99FF',
0x2F => 'FFCC99',
0x30 => '3366FF',
0x31 => '33CCCC',
0x32 => '99CC00',
0x33 => 'FFCC00',
0x34 => 'FF9900',
0x35 => 'FF6600',
0x36 => '666699',
0x37 => '969696',
0x38 => '003366',
0x39 => '339966',
0x3A => '003300',
0x3B => '333300',
0x3C => '993300',
0x3D => '993366',
0x3E => '333399',
0x3F => '333333',
];
/**
* Map color array from BIFF8 built-in color index.
*
* @param int $color
*
* @return array
*/
public static function lookup($color)
{
if (isset(self::$map[$color])) {
return ['rgb' => self::$map[$color]];
}
return ['rgb' => '000000'];
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color/BuiltIn.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color/BuiltIn.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Color;
class BuiltIn
{
protected static $map = [
0x00 => '000000',
0x01 => 'FFFFFF',
0x02 => 'FF0000',
0x03 => '00FF00',
0x04 => '0000FF',
0x05 => 'FFFF00',
0x06 => 'FF00FF',
0x07 => '00FFFF',
0x40 => '000000', // system window text color
0x41 => 'FFFFFF', // system window background color
];
/**
* Map built-in color to RGB value.
*
* @param int $color Indexed color
*
* @return array
*/
public static function lookup($color)
{
if (isset(self::$map[$color])) {
return ['rgb' => self::$map[$color]];
}
return ['rgb' => '000000'];
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color/BIFF5.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xls/Color/BIFF5.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xls\Color;
class BIFF5
{
protected static $map = [
0x08 => '000000',
0x09 => 'FFFFFF',
0x0A => 'FF0000',
0x0B => '00FF00',
0x0C => '0000FF',
0x0D => 'FFFF00',
0x0E => 'FF00FF',
0x0F => '00FFFF',
0x10 => '800000',
0x11 => '008000',
0x12 => '000080',
0x13 => '808000',
0x14 => '800080',
0x15 => '008080',
0x16 => 'C0C0C0',
0x17 => '808080',
0x18 => '8080FF',
0x19 => '802060',
0x1A => 'FFFFC0',
0x1B => 'A0E0F0',
0x1C => '600080',
0x1D => 'FF8080',
0x1E => '0080C0',
0x1F => 'C0C0FF',
0x20 => '000080',
0x21 => 'FF00FF',
0x22 => 'FFFF00',
0x23 => '00FFFF',
0x24 => '800080',
0x25 => '800000',
0x26 => '008080',
0x27 => '0000FF',
0x28 => '00CFFF',
0x29 => '69FFFF',
0x2A => 'E0FFE0',
0x2B => 'FFFF80',
0x2C => 'A6CAF0',
0x2D => 'DD9CB3',
0x2E => 'B38FEE',
0x2F => 'E3E3E3',
0x30 => '2A6FF9',
0x31 => '3FB8CD',
0x32 => '488436',
0x33 => '958C41',
0x34 => '8E5E42',
0x35 => 'A0627A',
0x36 => '624FAC',
0x37 => '969696',
0x38 => '1D2FBE',
0x39 => '286676',
0x3A => '004500',
0x3B => '453E01',
0x3C => '6A2813',
0x3D => '85396A',
0x3E => '4A3285',
0x3F => '424242',
];
/**
* Map color array from BIFF5 built-in color index.
*
* @param int $color
*
* @return array
*/
public static function lookup($color)
{
if (isset(self::$map[$color])) {
return ['rgb' => self::$map[$color]];
}
return ['rgb' => '000000'];
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/PageSettings.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/PageSettings.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Worksheet\PageSetup;
use SimpleXMLElement;
use stdClass;
class PageSettings
{
/**
* @var stdClass
*/
private $printSettings;
public function __construct(SimpleXMLElement $xmlX, array $namespaces)
{
$printSettings = $this->pageSetup($xmlX, $namespaces, $this->getPrintDefaults());
$this->printSettings = $this->printSetup($xmlX, $printSettings);
}
public function loadPageSettings(Spreadsheet $spreadsheet): void
{
$spreadsheet->getActiveSheet()->getPageSetup()
->setPaperSize($this->printSettings->paperSize)
->setOrientation($this->printSettings->orientation)
->setScale($this->printSettings->scale)
->setVerticalCentered($this->printSettings->verticalCentered)
->setHorizontalCentered($this->printSettings->horizontalCentered)
->setPageOrder($this->printSettings->printOrder);
$spreadsheet->getActiveSheet()->getPageMargins()
->setTop($this->printSettings->topMargin)
->setHeader($this->printSettings->headerMargin)
->setLeft($this->printSettings->leftMargin)
->setRight($this->printSettings->rightMargin)
->setBottom($this->printSettings->bottomMargin)
->setFooter($this->printSettings->footerMargin);
}
private function getPrintDefaults(): stdClass
{
return (object) [
'paperSize' => 9,
'orientation' => PageSetup::ORIENTATION_DEFAULT,
'scale' => 100,
'horizontalCentered' => false,
'verticalCentered' => false,
'printOrder' => PageSetup::PAGEORDER_DOWN_THEN_OVER,
'topMargin' => 0.75,
'headerMargin' => 0.3,
'leftMargin' => 0.7,
'rightMargin' => 0.7,
'bottomMargin' => 0.75,
'footerMargin' => 0.3,
];
}
private function pageSetup(SimpleXMLElement $xmlX, array $namespaces, stdClass $printDefaults): stdClass
{
if (isset($xmlX->WorksheetOptions->PageSetup)) {
foreach ($xmlX->WorksheetOptions->PageSetup as $pageSetupData) {
foreach ($pageSetupData as $pageSetupKey => $pageSetupValue) {
$pageSetupAttributes = $pageSetupValue->attributes($namespaces['x']);
if (!$pageSetupAttributes) {
continue;
}
switch ($pageSetupKey) {
case 'Layout':
$this->setLayout($printDefaults, $pageSetupAttributes);
break;
case 'Header':
$printDefaults->headerMargin = (float) $pageSetupAttributes->Margin ?: 1.0;
break;
case 'Footer':
$printDefaults->footerMargin = (float) $pageSetupAttributes->Margin ?: 1.0;
break;
case 'PageMargins':
$this->setMargins($printDefaults, $pageSetupAttributes);
break;
}
}
}
}
return $printDefaults;
}
private function printSetup(SimpleXMLElement $xmlX, stdClass $printDefaults): stdClass
{
if (isset($xmlX->WorksheetOptions->Print)) {
foreach ($xmlX->WorksheetOptions->Print as $printData) {
foreach ($printData as $printKey => $printValue) {
switch ($printKey) {
case 'LeftToRight':
$printDefaults->printOrder = PageSetup::PAGEORDER_OVER_THEN_DOWN;
break;
case 'PaperSizeIndex':
$printDefaults->paperSize = (int) $printValue ?: 9;
break;
case 'Scale':
$printDefaults->scale = (int) $printValue ?: 100;
break;
}
}
}
}
return $printDefaults;
}
private function setLayout(stdClass $printDefaults, SimpleXMLElement $pageSetupAttributes): void
{
$printDefaults->orientation = (string) strtolower($pageSetupAttributes->Orientation ?? '') ?: PageSetup::ORIENTATION_PORTRAIT;
$printDefaults->horizontalCentered = (bool) $pageSetupAttributes->CenterHorizontal ?: false;
$printDefaults->verticalCentered = (bool) $pageSetupAttributes->CenterVertical ?: false;
}
private function setMargins(stdClass $printDefaults, SimpleXMLElement $pageSetupAttributes): void
{
$printDefaults->leftMargin = (float) $pageSetupAttributes->Left ?: 1.0;
$printDefaults->rightMargin = (float) $pageSetupAttributes->Right ?: 1.0;
$printDefaults->topMargin = (float) $pageSetupAttributes->Top ?: 1.0;
$printDefaults->bottomMargin = (float) $pageSetupAttributes->Bottom ?: 1.0;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Properties.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Properties.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml;
use PhpOffice\PhpSpreadsheet\Document\Properties as DocumentProperties;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use SimpleXMLElement;
class Properties
{
/**
* @var Spreadsheet
*/
protected $spreadsheet;
public function __construct(Spreadsheet $spreadsheet)
{
$this->spreadsheet = $spreadsheet;
}
public function readProperties(SimpleXMLElement $xml, array $namespaces): void
{
$this->readStandardProperties($xml);
$this->readCustomProperties($xml, $namespaces);
}
protected function readStandardProperties(SimpleXMLElement $xml): void
{
if (isset($xml->DocumentProperties[0])) {
$docProps = $this->spreadsheet->getProperties();
foreach ($xml->DocumentProperties[0] as $propertyName => $propertyValue) {
$propertyValue = (string) $propertyValue;
$this->processStandardProperty($docProps, $propertyName, $propertyValue);
}
}
}
protected function readCustomProperties(SimpleXMLElement $xml, array $namespaces): void
{
if (isset($xml->CustomDocumentProperties)) {
$docProps = $this->spreadsheet->getProperties();
foreach ($xml->CustomDocumentProperties[0] as $propertyName => $propertyValue) {
$propertyAttributes = self::getAttributes($propertyValue, $namespaces['dt']);
$propertyName = preg_replace_callback('/_x([0-9a-f]{4})_/i', [$this, 'hex2str'], $propertyName);
$this->processCustomProperty($docProps, $propertyName, $propertyValue, $propertyAttributes);
}
}
}
protected function processStandardProperty(
DocumentProperties $docProps,
string $propertyName,
string $stringValue
): void {
switch ($propertyName) {
case 'Title':
$docProps->setTitle($stringValue);
break;
case 'Subject':
$docProps->setSubject($stringValue);
break;
case 'Author':
$docProps->setCreator($stringValue);
break;
case 'Created':
$docProps->setCreated($stringValue);
break;
case 'LastAuthor':
$docProps->setLastModifiedBy($stringValue);
break;
case 'LastSaved':
$docProps->setModified($stringValue);
break;
case 'Company':
$docProps->setCompany($stringValue);
break;
case 'Category':
$docProps->setCategory($stringValue);
break;
case 'Manager':
$docProps->setManager($stringValue);
break;
case 'Keywords':
$docProps->setKeywords($stringValue);
break;
case 'Description':
$docProps->setDescription($stringValue);
break;
}
}
protected function processCustomProperty(
DocumentProperties $docProps,
string $propertyName,
?SimpleXMLElement $propertyValue,
SimpleXMLElement $propertyAttributes
): void {
$propertyType = DocumentProperties::PROPERTY_TYPE_UNKNOWN;
switch ((string) $propertyAttributes) {
case 'string':
$propertyType = DocumentProperties::PROPERTY_TYPE_STRING;
$propertyValue = trim((string) $propertyValue);
break;
case 'boolean':
$propertyType = DocumentProperties::PROPERTY_TYPE_BOOLEAN;
$propertyValue = (bool) $propertyValue;
break;
case 'integer':
$propertyType = DocumentProperties::PROPERTY_TYPE_INTEGER;
$propertyValue = (int) $propertyValue;
break;
case 'float':
$propertyType = DocumentProperties::PROPERTY_TYPE_FLOAT;
$propertyValue = (float) $propertyValue;
break;
case 'dateTime.tz':
$propertyType = DocumentProperties::PROPERTY_TYPE_DATE;
$propertyValue = trim((string) $propertyValue);
break;
}
$docProps->setCustomProperty($propertyName, $propertyValue, $propertyType);
}
protected function hex2str(array $hex): string
{
return mb_chr((int) hexdec($hex[1]), 'UTF-8');
}
private static function getAttributes(?SimpleXMLElement $simple, string $node): SimpleXMLElement
{
return ($simple === null)
? new SimpleXMLElement('<xml></xml>')
: ($simple->attributes($node) ?? new SimpleXMLElement('<xml></xml>'));
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml;
use SimpleXMLElement;
class Style
{
/**
* Formats.
*
* @var array
*/
protected $styles = [];
public function parseStyles(SimpleXMLElement $xml, array $namespaces): array
{
if (!isset($xml->Styles)) {
return [];
}
$alignmentStyleParser = new Style\Alignment();
$borderStyleParser = new Style\Border();
$fontStyleParser = new Style\Font();
$fillStyleParser = new Style\Fill();
$numberFormatStyleParser = new Style\NumberFormat();
foreach ($xml->Styles[0] as $style) {
$style_ss = self::getAttributes($style, $namespaces['ss']);
$styleID = (string) $style_ss['ID'];
$this->styles[$styleID] = $this->styles['Default'] ?? [];
$alignment = $border = $font = $fill = $numberFormat = [];
foreach ($style as $styleType => $styleDatax) {
$styleData = $styleDatax ?? new SimpleXMLElement('<xml></xml>');
$styleAttributes = $styleData->attributes($namespaces['ss']);
switch ($styleType) {
case 'Alignment':
if ($styleAttributes) {
$alignment = $alignmentStyleParser->parseStyle($styleAttributes);
}
break;
case 'Borders':
$border = $borderStyleParser->parseStyle($styleData, $namespaces);
break;
case 'Font':
if ($styleAttributes) {
$font = $fontStyleParser->parseStyle($styleAttributes);
}
break;
case 'Interior':
if ($styleAttributes) {
$fill = $fillStyleParser->parseStyle($styleAttributes);
}
break;
case 'NumberFormat':
if ($styleAttributes) {
$numberFormat = $numberFormatStyleParser->parseStyle($styleAttributes);
}
break;
}
}
$this->styles[$styleID] = array_merge($alignment, $border, $font, $fill, $numberFormat);
}
return $this->styles;
}
protected static function getAttributes(?SimpleXMLElement $simple, string $node): SimpleXMLElement
{
return ($simple === null)
? new SimpleXMLElement('<xml></xml>')
: ($simple->attributes($node) ?? new SimpleXMLElement('<xml></xml>'));
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Font.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Font.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml\Style;
use PhpOffice\PhpSpreadsheet\Style\Font as FontUnderline;
use SimpleXMLElement;
class Font extends StyleBase
{
protected const UNDERLINE_STYLES = [
FontUnderline::UNDERLINE_NONE,
FontUnderline::UNDERLINE_DOUBLE,
FontUnderline::UNDERLINE_DOUBLEACCOUNTING,
FontUnderline::UNDERLINE_SINGLE,
FontUnderline::UNDERLINE_SINGLEACCOUNTING,
];
protected function parseUnderline(array $style, string $styleAttributeValue): array
{
if (self::identifyFixedStyleValue(self::UNDERLINE_STYLES, $styleAttributeValue)) {
$style['font']['underline'] = $styleAttributeValue;
}
return $style;
}
protected function parseVerticalAlign(array $style, string $styleAttributeValue): array
{
if ($styleAttributeValue == 'Superscript') {
$style['font']['superscript'] = true;
}
if ($styleAttributeValue == 'Subscript') {
$style['font']['subscript'] = true;
}
return $style;
}
public function parseStyle(SimpleXMLElement $styleAttributes): array
{
$style = [];
foreach ($styleAttributes as $styleAttributeKey => $styleAttributeValue) {
$styleAttributeValue = (string) $styleAttributeValue;
switch ($styleAttributeKey) {
case 'FontName':
$style['font']['name'] = $styleAttributeValue;
break;
case 'Size':
$style['font']['size'] = $styleAttributeValue;
break;
case 'Color':
$style['font']['color']['rgb'] = substr($styleAttributeValue, 1);
break;
case 'Bold':
$style['font']['bold'] = true;
break;
case 'Italic':
$style['font']['italic'] = true;
break;
case 'Underline':
$style = $this->parseUnderline($style, $styleAttributeValue);
break;
case 'VerticalAlign':
$style = $this->parseVerticalAlign($style, $styleAttributeValue);
break;
}
}
return $style;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/StyleBase.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/StyleBase.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml\Style;
use SimpleXMLElement;
abstract class StyleBase
{
protected static function identifyFixedStyleValue(array $styleList, string &$styleAttributeValue): bool
{
$returnValue = false;
$styleAttributeValue = strtolower($styleAttributeValue);
foreach ($styleList as $style) {
if ($styleAttributeValue == strtolower($style)) {
$styleAttributeValue = $style;
$returnValue = true;
break;
}
}
return $returnValue;
}
protected static function getAttributes(?SimpleXMLElement $simple, string $node): SimpleXMLElement
{
return ($simple === null)
? new SimpleXMLElement('<xml></xml>')
: ($simple->attributes($node) ?? new SimpleXMLElement('<xml></xml>'));
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Fill.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Fill.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml\Style;
use PhpOffice\PhpSpreadsheet\Style\Fill as FillStyles;
use SimpleXMLElement;
class Fill extends StyleBase
{
/**
* @var array
*/
public const FILL_MAPPINGS = [
'fillType' => [
'solid' => FillStyles::FILL_SOLID,
'gray75' => FillStyles::FILL_PATTERN_DARKGRAY,
'gray50' => FillStyles::FILL_PATTERN_MEDIUMGRAY,
'gray25' => FillStyles::FILL_PATTERN_LIGHTGRAY,
'gray125' => FillStyles::FILL_PATTERN_GRAY125,
'gray0625' => FillStyles::FILL_PATTERN_GRAY0625,
'horzstripe' => FillStyles::FILL_PATTERN_DARKHORIZONTAL, // horizontal stripe
'vertstripe' => FillStyles::FILL_PATTERN_DARKVERTICAL, // vertical stripe
'reversediagstripe' => FillStyles::FILL_PATTERN_DARKUP, // reverse diagonal stripe
'diagstripe' => FillStyles::FILL_PATTERN_DARKDOWN, // diagonal stripe
'diagcross' => FillStyles::FILL_PATTERN_DARKGRID, // diagoanl crosshatch
'thickdiagcross' => FillStyles::FILL_PATTERN_DARKTRELLIS, // thick diagonal crosshatch
'thinhorzstripe' => FillStyles::FILL_PATTERN_LIGHTHORIZONTAL,
'thinvertstripe' => FillStyles::FILL_PATTERN_LIGHTVERTICAL,
'thinreversediagstripe' => FillStyles::FILL_PATTERN_LIGHTUP,
'thindiagstripe' => FillStyles::FILL_PATTERN_LIGHTDOWN,
'thinhorzcross' => FillStyles::FILL_PATTERN_LIGHTGRID, // thin horizontal crosshatch
'thindiagcross' => FillStyles::FILL_PATTERN_LIGHTTRELLIS, // thin diagonal crosshatch
],
];
public function parseStyle(SimpleXMLElement $styleAttributes): array
{
$style = [];
foreach ($styleAttributes as $styleAttributeKey => $styleAttributeValuex) {
$styleAttributeValue = (string) $styleAttributeValuex;
switch ($styleAttributeKey) {
case 'Color':
$style['fill']['endColor']['rgb'] = substr($styleAttributeValue, 1);
$style['fill']['startColor']['rgb'] = substr($styleAttributeValue, 1);
break;
case 'PatternColor':
$style['fill']['startColor']['rgb'] = substr($styleAttributeValue, 1);
break;
case 'Pattern':
$lcStyleAttributeValue = strtolower((string) $styleAttributeValue);
$style['fill']['fillType']
= self::FILL_MAPPINGS['fillType'][$lcStyleAttributeValue] ?? FillStyles::FILL_NONE;
break;
}
}
return $style;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Border.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Border.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml\Style;
use PhpOffice\PhpSpreadsheet\Style\Border as BorderStyle;
use PhpOffice\PhpSpreadsheet\Style\Borders;
use SimpleXMLElement;
class Border extends StyleBase
{
protected const BORDER_POSITIONS = [
'top',
'left',
'bottom',
'right',
];
/**
* @var array
*/
public const BORDER_MAPPINGS = [
'borderStyle' => [
'1continuous' => BorderStyle::BORDER_THIN,
'1dash' => BorderStyle::BORDER_DASHED,
'1dashdot' => BorderStyle::BORDER_DASHDOT,
'1dashdotdot' => BorderStyle::BORDER_DASHDOTDOT,
'1dot' => BorderStyle::BORDER_DOTTED,
'1double' => BorderStyle::BORDER_DOUBLE,
'2continuous' => BorderStyle::BORDER_MEDIUM,
'2dash' => BorderStyle::BORDER_MEDIUMDASHED,
'2dashdot' => BorderStyle::BORDER_MEDIUMDASHDOT,
'2dashdotdot' => BorderStyle::BORDER_MEDIUMDASHDOTDOT,
'2dot' => BorderStyle::BORDER_DOTTED,
'2double' => BorderStyle::BORDER_DOUBLE,
'3continuous' => BorderStyle::BORDER_THICK,
'3dash' => BorderStyle::BORDER_MEDIUMDASHED,
'3dashdot' => BorderStyle::BORDER_MEDIUMDASHDOT,
'3dashdotdot' => BorderStyle::BORDER_MEDIUMDASHDOTDOT,
'3dot' => BorderStyle::BORDER_DOTTED,
'3double' => BorderStyle::BORDER_DOUBLE,
],
];
public function parseStyle(SimpleXMLElement $styleData, array $namespaces): array
{
$style = [];
$diagonalDirection = '';
$borderPosition = '';
foreach ($styleData->Border as $borderStyle) {
$borderAttributes = self::getAttributes($borderStyle, $namespaces['ss']);
$thisBorder = [];
$styleType = (string) $borderAttributes->Weight;
$styleType .= strtolower((string) $borderAttributes->LineStyle);
$thisBorder['borderStyle'] = self::BORDER_MAPPINGS['borderStyle'][$styleType] ?? BorderStyle::BORDER_NONE;
foreach ($borderAttributes as $borderStyleKey => $borderStyleValuex) {
$borderStyleValue = (string) $borderStyleValuex;
switch ($borderStyleKey) {
case 'Position':
[$borderPosition, $diagonalDirection] =
$this->parsePosition($borderStyleValue, $diagonalDirection);
break;
case 'Color':
$borderColour = substr($borderStyleValue, 1);
$thisBorder['color']['rgb'] = $borderColour;
break;
}
}
if ($borderPosition) {
$style['borders'][$borderPosition] = $thisBorder;
} elseif ($diagonalDirection) {
$style['borders']['diagonalDirection'] = $diagonalDirection;
$style['borders']['diagonal'] = $thisBorder;
}
}
return $style;
}
protected function parsePosition(string $borderStyleValue, string $diagonalDirection): array
{
$borderStyleValue = strtolower($borderStyleValue);
if (in_array($borderStyleValue, self::BORDER_POSITIONS)) {
$borderPosition = $borderStyleValue;
} elseif ($borderStyleValue === 'diagonalleft') {
$diagonalDirection = $diagonalDirection ? Borders::DIAGONAL_BOTH : Borders::DIAGONAL_DOWN;
} elseif ($borderStyleValue === 'diagonalright') {
$diagonalDirection = $diagonalDirection ? Borders::DIAGONAL_BOTH : Borders::DIAGONAL_UP;
}
return [$borderPosition ?? null, $diagonalDirection];
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Alignment.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/Alignment.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml\Style;
use PhpOffice\PhpSpreadsheet\Style\Alignment as AlignmentStyles;
use SimpleXMLElement;
class Alignment extends StyleBase
{
protected const VERTICAL_ALIGNMENT_STYLES = [
AlignmentStyles::VERTICAL_BOTTOM,
AlignmentStyles::VERTICAL_TOP,
AlignmentStyles::VERTICAL_CENTER,
AlignmentStyles::VERTICAL_JUSTIFY,
];
protected const HORIZONTAL_ALIGNMENT_STYLES = [
AlignmentStyles::HORIZONTAL_GENERAL,
AlignmentStyles::HORIZONTAL_LEFT,
AlignmentStyles::HORIZONTAL_RIGHT,
AlignmentStyles::HORIZONTAL_CENTER,
AlignmentStyles::HORIZONTAL_CENTER_CONTINUOUS,
AlignmentStyles::HORIZONTAL_JUSTIFY,
];
public function parseStyle(SimpleXMLElement $styleAttributes): array
{
$style = [];
foreach ($styleAttributes as $styleAttributeKey => $styleAttributeValue) {
$styleAttributeValue = (string) $styleAttributeValue;
switch ($styleAttributeKey) {
case 'Vertical':
if (self::identifyFixedStyleValue(self::VERTICAL_ALIGNMENT_STYLES, $styleAttributeValue)) {
$style['alignment']['vertical'] = $styleAttributeValue;
}
break;
case 'Horizontal':
if (self::identifyFixedStyleValue(self::HORIZONTAL_ALIGNMENT_STYLES, $styleAttributeValue)) {
$style['alignment']['horizontal'] = $styleAttributeValue;
}
break;
case 'WrapText':
$style['alignment']['wrapText'] = true;
break;
case 'Rotate':
$style['alignment']['textRotation'] = $styleAttributeValue;
break;
}
}
return $style;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/NumberFormat.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xml/Style/NumberFormat.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xml\Style;
use SimpleXMLElement;
class NumberFormat extends StyleBase
{
public function parseStyle(SimpleXMLElement $styleAttributes): array
{
$style = [];
$fromFormats = ['\-', '\ '];
$toFormats = ['-', ' '];
foreach ($styleAttributes as $styleAttributeKey => $styleAttributeValue) {
$styleAttributeValue = str_replace($fromFormats, $toFormats, $styleAttributeValue);
switch ($styleAttributeValue) {
case 'Short Date':
$styleAttributeValue = 'dd/mm/yyyy';
break;
}
if ($styleAttributeValue > '') {
$style['numberFormat']['formatCode'] = $styleAttributeValue;
}
}
return $style;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/BaseReader.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/BaseReader.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Ods;
use DOMElement;
use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
abstract class BaseReader
{
/**
* @var Spreadsheet
*/
protected $spreadsheet;
/**
* @var string
*/
protected $tableNs;
public function __construct(Spreadsheet $spreadsheet, string $tableNs)
{
$this->spreadsheet = $spreadsheet;
$this->tableNs = $tableNs;
}
abstract public function read(DOMElement $workbookData): void;
protected function convertToExcelAddressValue(string $openOfficeAddress): string
{
$excelAddress = $openOfficeAddress;
// Cell range 3-d reference
// As we don't support 3-d ranges, we're just going to take a quick and dirty approach
// and assume that the second worksheet reference is the same as the first
$excelAddress = preg_replace('/\$?([^\.]+)\.([^\.]+):\$?([^\.]+)\.([^\.]+)/miu', '$1!$2:$4', $excelAddress);
// Cell range reference in another sheet
$excelAddress = preg_replace('/\$?([^\.]+)\.([^\.]+):\.([^\.]+)/miu', '$1!$2:$3', $excelAddress ?? '');
// Cell reference in another sheet
$excelAddress = preg_replace('/\$?([^\.]+)\.([^\.]+)/miu', '$1!$2', $excelAddress ?? '');
// Cell range reference
$excelAddress = preg_replace('/\.([^\.]+):\.([^\.]+)/miu', '$1:$2', $excelAddress ?? '');
// Simple cell reference
$excelAddress = preg_replace('/\.([^\.]+)/miu', '$1', $excelAddress ?? '');
return $excelAddress ?? '';
}
protected function convertToExcelFormulaValue(string $openOfficeFormula): string
{
$temp = explode('"', $openOfficeFormula);
$tKey = false;
foreach ($temp as &$value) {
// @var string $value
// Only replace in alternate array entries (i.e. non-quoted blocks)
if ($tKey = !$tKey) {
// Cell range reference in another sheet
$value = preg_replace('/\[\$?([^\.]+)\.([^\.]+):\.([^\.]+)\]/miu', '$1!$2:$3', $value);
// Cell reference in another sheet
$value = preg_replace('/\[\$?([^\.]+)\.([^\.]+)\]/miu', '$1!$2', $value ?? '');
// Cell range reference
$value = preg_replace('/\[\.([^\.]+):\.([^\.]+)\]/miu', '$1:$2', $value ?? '');
// Simple cell reference
$value = preg_replace('/\[\.([^\.]+)\]/miu', '$1', $value ?? '');
// Convert references to defined names/formulae
$value = str_replace('$$', '', $value ?? '');
$value = Calculation::translateSeparator(';', ',', $value, $inBraces);
}
}
// Then rebuild the formula string
$excelFormula = implode('"', $temp);
return $excelFormula;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/PageSettings.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/PageSettings.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Ods;
use DOMDocument;
use PhpOffice\PhpSpreadsheet\Worksheet\PageSetup;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
class PageSettings
{
private $officeNs;
private $stylesNs;
private $stylesFo;
private $pageLayoutStyles = [];
private $masterStylesCrossReference = [];
private $masterPrintStylesCrossReference = [];
public function __construct(DOMDocument $styleDom)
{
$this->setDomNameSpaces($styleDom);
$this->readPageSettingStyles($styleDom);
$this->readStyleMasterLookup($styleDom);
}
private function setDomNameSpaces(DOMDocument $styleDom): void
{
$this->officeNs = $styleDom->lookupNamespaceUri('office');
$this->stylesNs = $styleDom->lookupNamespaceUri('style');
$this->stylesFo = $styleDom->lookupNamespaceUri('fo');
}
private function readPageSettingStyles(DOMDocument $styleDom): void
{
$styles = $styleDom->getElementsByTagNameNS($this->officeNs, 'automatic-styles')
->item(0)
->getElementsByTagNameNS($this->stylesNs, 'page-layout');
foreach ($styles as $styleSet) {
$styleName = $styleSet->getAttributeNS($this->stylesNs, 'name');
$pageLayoutProperties = $styleSet->getElementsByTagNameNS($this->stylesNs, 'page-layout-properties')[0];
$styleOrientation = $pageLayoutProperties->getAttributeNS($this->stylesNs, 'print-orientation');
$styleScale = $pageLayoutProperties->getAttributeNS($this->stylesNs, 'scale-to');
$stylePrintOrder = $pageLayoutProperties->getAttributeNS($this->stylesNs, 'print-page-order');
$centered = $pageLayoutProperties->getAttributeNS($this->stylesNs, 'table-centering');
$marginLeft = $pageLayoutProperties->getAttributeNS($this->stylesFo, 'margin-left');
$marginRight = $pageLayoutProperties->getAttributeNS($this->stylesFo, 'margin-right');
$marginTop = $pageLayoutProperties->getAttributeNS($this->stylesFo, 'margin-top');
$marginBottom = $pageLayoutProperties->getAttributeNS($this->stylesFo, 'margin-bottom');
$header = $styleSet->getElementsByTagNameNS($this->stylesNs, 'header-style')[0];
$headerProperties = $header->getElementsByTagNameNS($this->stylesNs, 'header-footer-properties')[0];
$marginHeader = isset($headerProperties) ? $headerProperties->getAttributeNS($this->stylesFo, 'min-height') : null;
$footer = $styleSet->getElementsByTagNameNS($this->stylesNs, 'footer-style')[0];
$footerProperties = $footer->getElementsByTagNameNS($this->stylesNs, 'header-footer-properties')[0];
$marginFooter = isset($footerProperties) ? $footerProperties->getAttributeNS($this->stylesFo, 'min-height') : null;
$this->pageLayoutStyles[$styleName] = (object) [
'orientation' => $styleOrientation ?: PageSetup::ORIENTATION_DEFAULT,
'scale' => $styleScale ?: 100,
'printOrder' => $stylePrintOrder,
'horizontalCentered' => $centered === 'horizontal' || $centered === 'both',
'verticalCentered' => $centered === 'vertical' || $centered === 'both',
// margin size is already stored in inches, so no UOM conversion is required
'marginLeft' => (float) $marginLeft ?? 0.7,
'marginRight' => (float) $marginRight ?? 0.7,
'marginTop' => (float) $marginTop ?? 0.3,
'marginBottom' => (float) $marginBottom ?? 0.3,
'marginHeader' => (float) $marginHeader ?? 0.45,
'marginFooter' => (float) $marginFooter ?? 0.45,
];
}
}
private function readStyleMasterLookup(DOMDocument $styleDom): void
{
$styleMasterLookup = $styleDom->getElementsByTagNameNS($this->officeNs, 'master-styles')
->item(0)
->getElementsByTagNameNS($this->stylesNs, 'master-page');
foreach ($styleMasterLookup as $styleMasterSet) {
$styleMasterName = $styleMasterSet->getAttributeNS($this->stylesNs, 'name');
$pageLayoutName = $styleMasterSet->getAttributeNS($this->stylesNs, 'page-layout-name');
$this->masterPrintStylesCrossReference[$styleMasterName] = $pageLayoutName;
}
}
public function readStyleCrossReferences(DOMDocument $contentDom): void
{
$styleXReferences = $contentDom->getElementsByTagNameNS($this->officeNs, 'automatic-styles')
->item(0)
->getElementsByTagNameNS($this->stylesNs, 'style');
foreach ($styleXReferences as $styleXreferenceSet) {
$styleXRefName = $styleXreferenceSet->getAttributeNS($this->stylesNs, 'name');
$stylePageLayoutName = $styleXreferenceSet->getAttributeNS($this->stylesNs, 'master-page-name');
if (!empty($stylePageLayoutName)) {
$this->masterStylesCrossReference[$styleXRefName] = $stylePageLayoutName;
}
}
}
public function setPrintSettingsForWorksheet(Worksheet $worksheet, string $styleName): void
{
if (!array_key_exists($styleName, $this->masterStylesCrossReference)) {
return;
}
$masterStyleName = $this->masterStylesCrossReference[$styleName];
if (!array_key_exists($masterStyleName, $this->masterPrintStylesCrossReference)) {
return;
}
$printSettingsIndex = $this->masterPrintStylesCrossReference[$masterStyleName];
if (!array_key_exists($printSettingsIndex, $this->pageLayoutStyles)) {
return;
}
$printSettings = $this->pageLayoutStyles[$printSettingsIndex];
$worksheet->getPageSetup()
->setOrientation($printSettings->orientation ?? PageSetup::ORIENTATION_DEFAULT)
->setPageOrder($printSettings->printOrder === 'ltr' ? PageSetup::PAGEORDER_OVER_THEN_DOWN : PageSetup::PAGEORDER_DOWN_THEN_OVER)
->setScale((int) trim($printSettings->scale, '%'))
->setHorizontalCentered($printSettings->horizontalCentered)
->setVerticalCentered($printSettings->verticalCentered);
$worksheet->getPageMargins()
->setLeft($printSettings->marginLeft)
->setRight($printSettings->marginRight)
->setTop($printSettings->marginTop)
->setBottom($printSettings->marginBottom)
->setHeader($printSettings->marginHeader)
->setFooter($printSettings->marginFooter);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/Properties.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/Properties.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Ods;
use PhpOffice\PhpSpreadsheet\Document\Properties as DocumentProperties;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use SimpleXMLElement;
class Properties
{
private $spreadsheet;
public function __construct(Spreadsheet $spreadsheet)
{
$this->spreadsheet = $spreadsheet;
}
public function load(SimpleXMLElement $xml, $namespacesMeta): void
{
$docProps = $this->spreadsheet->getProperties();
$officeProperty = $xml->children($namespacesMeta['office']);
foreach ($officeProperty as $officePropertyData) {
// @var \SimpleXMLElement $officePropertyData
if (isset($namespacesMeta['dc'])) {
$officePropertiesDC = $officePropertyData->children($namespacesMeta['dc']);
$this->setCoreProperties($docProps, $officePropertiesDC);
}
$officePropertyMeta = [];
if (isset($namespacesMeta['dc'])) {
$officePropertyMeta = $officePropertyData->children($namespacesMeta['meta']);
}
foreach ($officePropertyMeta as $propertyName => $propertyValue) {
$this->setMetaProperties($namespacesMeta, $propertyValue, $propertyName, $docProps);
}
}
}
private function setCoreProperties(DocumentProperties $docProps, SimpleXMLElement $officePropertyDC): void
{
foreach ($officePropertyDC as $propertyName => $propertyValue) {
$propertyValue = (string) $propertyValue;
switch ($propertyName) {
case 'title':
$docProps->setTitle($propertyValue);
break;
case 'subject':
$docProps->setSubject($propertyValue);
break;
case 'creator':
$docProps->setCreator($propertyValue);
$docProps->setLastModifiedBy($propertyValue);
break;
case 'date':
$docProps->setModified($propertyValue);
break;
case 'description':
$docProps->setDescription($propertyValue);
break;
}
}
}
private function setMetaProperties(
$namespacesMeta,
SimpleXMLElement $propertyValue,
$propertyName,
DocumentProperties $docProps
): void {
$propertyValueAttributes = $propertyValue->attributes($namespacesMeta['meta']);
$propertyValue = (string) $propertyValue;
switch ($propertyName) {
case 'initial-creator':
$docProps->setCreator($propertyValue);
break;
case 'keyword':
$docProps->setKeywords($propertyValue);
break;
case 'creation-date':
$docProps->setCreated($propertyValue);
break;
case 'user-defined':
$this->setUserDefinedProperty($propertyValueAttributes, $propertyValue, $docProps);
break;
}
}
private function setUserDefinedProperty($propertyValueAttributes, $propertyValue, DocumentProperties $docProps): void
{
$propertyValueName = '';
$propertyValueType = DocumentProperties::PROPERTY_TYPE_STRING;
foreach ($propertyValueAttributes as $key => $value) {
if ($key == 'name') {
$propertyValueName = (string) $value;
} elseif ($key == 'value-type') {
switch ($value) {
case 'date':
$propertyValue = DocumentProperties::convertProperty($propertyValue, 'date');
$propertyValueType = DocumentProperties::PROPERTY_TYPE_DATE;
break;
case 'boolean':
$propertyValue = DocumentProperties::convertProperty($propertyValue, 'bool');
$propertyValueType = DocumentProperties::PROPERTY_TYPE_BOOLEAN;
break;
case 'float':
$propertyValue = DocumentProperties::convertProperty($propertyValue, 'r4');
$propertyValueType = DocumentProperties::PROPERTY_TYPE_FLOAT;
break;
default:
$propertyValueType = DocumentProperties::PROPERTY_TYPE_STRING;
}
}
}
$docProps->setCustomProperty($propertyValueName, $propertyValue, $propertyValueType);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/AutoFilter.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/AutoFilter.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Ods;
use DOMElement;
use DOMNode;
class AutoFilter extends BaseReader
{
public function read(DOMElement $workbookData): void
{
$this->readAutoFilters($workbookData);
}
protected function readAutoFilters(DOMElement $workbookData): void
{
$databases = $workbookData->getElementsByTagNameNS($this->tableNs, 'database-ranges');
foreach ($databases as $autofilters) {
foreach ($autofilters->childNodes as $autofilter) {
$autofilterRange = $this->getAttributeValue($autofilter, 'target-range-address');
if ($autofilterRange !== null) {
$baseAddress = $this->convertToExcelAddressValue($autofilterRange);
$this->spreadsheet->getActiveSheet()->setAutoFilter($baseAddress);
}
}
}
}
protected function getAttributeValue(?DOMNode $node, string $attributeName): ?string
{
if ($node !== null && $node->attributes !== null) {
$attribute = $node->attributes->getNamedItemNS(
$this->tableNs,
$attributeName
);
if ($attribute !== null) {
return $attribute->nodeValue;
}
}
return null;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/DefinedNames.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Ods/DefinedNames.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Ods;
use DOMElement;
use PhpOffice\PhpSpreadsheet\DefinedName;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
class DefinedNames extends BaseReader
{
public function read(DOMElement $workbookData): void
{
$this->readDefinedRanges($workbookData);
$this->readDefinedExpressions($workbookData);
}
/**
* Read any Named Ranges that are defined in this spreadsheet.
*/
protected function readDefinedRanges(DOMElement $workbookData): void
{
$namedRanges = $workbookData->getElementsByTagNameNS($this->tableNs, 'named-range');
foreach ($namedRanges as $definedNameElement) {
$definedName = $definedNameElement->getAttributeNS($this->tableNs, 'name');
$baseAddress = $definedNameElement->getAttributeNS($this->tableNs, 'base-cell-address');
$range = $definedNameElement->getAttributeNS($this->tableNs, 'cell-range-address');
$baseAddress = $this->convertToExcelAddressValue($baseAddress);
$range = $this->convertToExcelAddressValue($range);
$this->addDefinedName($baseAddress, $definedName, $range);
}
}
/**
* Read any Named Formulae that are defined in this spreadsheet.
*/
protected function readDefinedExpressions(DOMElement $workbookData): void
{
$namedExpressions = $workbookData->getElementsByTagNameNS($this->tableNs, 'named-expression');
foreach ($namedExpressions as $definedNameElement) {
$definedName = $definedNameElement->getAttributeNS($this->tableNs, 'name');
$baseAddress = $definedNameElement->getAttributeNS($this->tableNs, 'base-cell-address');
$expression = $definedNameElement->getAttributeNS($this->tableNs, 'expression');
$baseAddress = $this->convertToExcelAddressValue($baseAddress);
$expression = substr($expression, strpos($expression, ':=') + 1);
$expression = $this->convertToExcelFormulaValue($expression);
$this->addDefinedName($baseAddress, $definedName, $expression);
}
}
/**
* Assess scope and store the Defined Name.
*/
private function addDefinedName(string $baseAddress, string $definedName, string $value): void
{
[$sheetReference] = Worksheet::extractSheetTitle($baseAddress, true);
$worksheet = $this->spreadsheet->getSheetByName($sheetReference);
// Worksheet might still be null if we're only loading selected sheets rather than the full spreadsheet
if ($worksheet !== null) {
$this->spreadsheet->addDefinedName(DefinedName::createInstance((string) $definedName, $worksheet, $value));
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Csv/Delimiter.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Csv/Delimiter.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Csv;
class Delimiter
{
protected const POTENTIAL_DELIMETERS = [',', ';', "\t", '|', ':', ' ', '~'];
/** @var resource */
protected $fileHandle;
/** @var string */
protected $escapeCharacter;
/** @var string */
protected $enclosure;
/** @var array */
protected $counts = [];
/** @var int */
protected $numberLines = 0;
/** @var ?string */
protected $delimiter;
/**
* @param resource $fileHandle
*/
public function __construct($fileHandle, string $escapeCharacter, string $enclosure)
{
$this->fileHandle = $fileHandle;
$this->escapeCharacter = $escapeCharacter;
$this->enclosure = $enclosure;
$this->countPotentialDelimiters();
}
public function getDefaultDelimiter(): string
{
return self::POTENTIAL_DELIMETERS[0];
}
public function linesCounted(): int
{
return $this->numberLines;
}
protected function countPotentialDelimiters(): void
{
$this->counts = array_fill_keys(self::POTENTIAL_DELIMETERS, []);
$delimiterKeys = array_flip(self::POTENTIAL_DELIMETERS);
// Count how many times each of the potential delimiters appears in each line
$this->numberLines = 0;
while (($line = $this->getNextLine()) !== false && (++$this->numberLines < 1000)) {
$this->countDelimiterValues($line, $delimiterKeys);
}
}
protected function countDelimiterValues(string $line, array $delimiterKeys): void
{
$splitString = str_split($line, 1);
if (is_array($splitString)) {
$distribution = array_count_values($splitString);
$countLine = array_intersect_key($distribution, $delimiterKeys);
foreach (self::POTENTIAL_DELIMETERS as $delimiter) {
$this->counts[$delimiter][] = $countLine[$delimiter] ?? 0;
}
}
}
public function infer(): ?string
{
// Calculate the mean square deviations for each delimiter
// (ignoring delimiters that haven't been found consistently)
$meanSquareDeviations = [];
$middleIdx = floor(($this->numberLines - 1) / 2);
foreach (self::POTENTIAL_DELIMETERS as $delimiter) {
$series = $this->counts[$delimiter];
sort($series);
$median = ($this->numberLines % 2)
? $series[$middleIdx]
: ($series[$middleIdx] + $series[$middleIdx + 1]) / 2;
if ($median === 0) {
continue;
}
$meanSquareDeviations[$delimiter] = array_reduce(
$series,
function ($sum, $value) use ($median) {
return $sum + ($value - $median) ** 2;
}
) / count($series);
}
// ... and pick the delimiter with the smallest mean square deviation
// (in case of ties, the order in potentialDelimiters is respected)
$min = INF;
foreach (self::POTENTIAL_DELIMETERS as $delimiter) {
if (!isset($meanSquareDeviations[$delimiter])) {
continue;
}
if ($meanSquareDeviations[$delimiter] < $min) {
$min = $meanSquareDeviations[$delimiter];
$this->delimiter = $delimiter;
}
}
return $this->delimiter;
}
/**
* Get the next full line from the file.
*
* @return false|string
*/
public function getNextLine()
{
$line = '';
$enclosure = ($this->escapeCharacter === '' ? ''
: ('(?<!' . preg_quote($this->escapeCharacter, '/') . ')'))
. preg_quote($this->enclosure, '/');
do {
// Get the next line in the file
$newLine = fgets($this->fileHandle);
// Return false if there is no next line
if ($newLine === false) {
return false;
}
// Add the new line to the line passed in
$line = $line . $newLine;
// Drop everything that is enclosed to avoid counting false positives in enclosures
$line = preg_replace('/(' . $enclosure . '.*' . $enclosure . ')/Us', '', $line);
// See if we have any enclosures left in the line
// if we still have an enclosure then we need to read the next line as well
} while (preg_match('/(' . $enclosure . ')/', $line ?? '') > 0);
return $line ?? false;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric/Styles.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric/Styles.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Gnumeric;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\Alignment;
use PhpOffice\PhpSpreadsheet\Style\Border;
use PhpOffice\PhpSpreadsheet\Style\Borders;
use PhpOffice\PhpSpreadsheet\Style\Fill;
use PhpOffice\PhpSpreadsheet\Style\Font;
use SimpleXMLElement;
class Styles
{
/**
* @var Spreadsheet
*/
private $spreadsheet;
/**
* @var bool
*/
protected $readDataOnly = false;
/** @var array */
public static $mappings = [
'borderStyle' => [
'0' => Border::BORDER_NONE,
'1' => Border::BORDER_THIN,
'2' => Border::BORDER_MEDIUM,
'3' => Border::BORDER_SLANTDASHDOT,
'4' => Border::BORDER_DASHED,
'5' => Border::BORDER_THICK,
'6' => Border::BORDER_DOUBLE,
'7' => Border::BORDER_DOTTED,
'8' => Border::BORDER_MEDIUMDASHED,
'9' => Border::BORDER_DASHDOT,
'10' => Border::BORDER_MEDIUMDASHDOT,
'11' => Border::BORDER_DASHDOTDOT,
'12' => Border::BORDER_MEDIUMDASHDOTDOT,
'13' => Border::BORDER_MEDIUMDASHDOTDOT,
],
'fillType' => [
'1' => Fill::FILL_SOLID,
'2' => Fill::FILL_PATTERN_DARKGRAY,
'3' => Fill::FILL_PATTERN_MEDIUMGRAY,
'4' => Fill::FILL_PATTERN_LIGHTGRAY,
'5' => Fill::FILL_PATTERN_GRAY125,
'6' => Fill::FILL_PATTERN_GRAY0625,
'7' => Fill::FILL_PATTERN_DARKHORIZONTAL, // horizontal stripe
'8' => Fill::FILL_PATTERN_DARKVERTICAL, // vertical stripe
'9' => Fill::FILL_PATTERN_DARKDOWN, // diagonal stripe
'10' => Fill::FILL_PATTERN_DARKUP, // reverse diagonal stripe
'11' => Fill::FILL_PATTERN_DARKGRID, // diagoanl crosshatch
'12' => Fill::FILL_PATTERN_DARKTRELLIS, // thick diagonal crosshatch
'13' => Fill::FILL_PATTERN_LIGHTHORIZONTAL,
'14' => Fill::FILL_PATTERN_LIGHTVERTICAL,
'15' => Fill::FILL_PATTERN_LIGHTUP,
'16' => Fill::FILL_PATTERN_LIGHTDOWN,
'17' => Fill::FILL_PATTERN_LIGHTGRID, // thin horizontal crosshatch
'18' => Fill::FILL_PATTERN_LIGHTTRELLIS, // thin diagonal crosshatch
],
'horizontal' => [
'1' => Alignment::HORIZONTAL_GENERAL,
'2' => Alignment::HORIZONTAL_LEFT,
'4' => Alignment::HORIZONTAL_RIGHT,
'8' => Alignment::HORIZONTAL_CENTER,
'16' => Alignment::HORIZONTAL_CENTER_CONTINUOUS,
'32' => Alignment::HORIZONTAL_JUSTIFY,
'64' => Alignment::HORIZONTAL_CENTER_CONTINUOUS,
],
'underline' => [
'1' => Font::UNDERLINE_SINGLE,
'2' => Font::UNDERLINE_DOUBLE,
'3' => Font::UNDERLINE_SINGLEACCOUNTING,
'4' => Font::UNDERLINE_DOUBLEACCOUNTING,
],
'vertical' => [
'1' => Alignment::VERTICAL_TOP,
'2' => Alignment::VERTICAL_BOTTOM,
'4' => Alignment::VERTICAL_CENTER,
'8' => Alignment::VERTICAL_JUSTIFY,
],
];
public function __construct(Spreadsheet $spreadsheet, bool $readDataOnly)
{
$this->spreadsheet = $spreadsheet;
$this->readDataOnly = $readDataOnly;
}
public function read(SimpleXMLElement $sheet, int $maxRow, int $maxCol): void
{
if ($sheet->Styles->StyleRegion !== null) {
$this->readStyles($sheet->Styles->StyleRegion, $maxRow, $maxCol);
}
}
private function readStyles(SimpleXMLElement $styleRegion, int $maxRow, int $maxCol): void
{
foreach ($styleRegion as $style) {
$styleAttributes = $style->attributes();
if ($styleAttributes !== null && ($styleAttributes['startRow'] <= $maxRow) && ($styleAttributes['startCol'] <= $maxCol)) {
$cellRange = $this->readStyleRange($styleAttributes, $maxCol, $maxRow);
$styleAttributes = $style->Style->attributes();
$styleArray = [];
// We still set the number format mask for date/time values, even if readDataOnly is true
// so that we can identify whether a float is a float or a date value
$formatCode = $styleAttributes ? (string) $styleAttributes['Format'] : null;
if ($formatCode && Date::isDateTimeFormatCode($formatCode)) {
$styleArray['numberFormat']['formatCode'] = $formatCode;
}
if ($this->readDataOnly === false && $styleAttributes !== null) {
// If readDataOnly is false, we set all formatting information
$styleArray['numberFormat']['formatCode'] = $formatCode;
$styleArray = $this->readStyle($styleArray, $styleAttributes, $style);
}
$this->spreadsheet->getActiveSheet()->getStyle($cellRange)->applyFromArray($styleArray);
}
}
}
private function addBorderDiagonal(SimpleXMLElement $srssb, array &$styleArray): void
{
if (isset($srssb->Diagonal, $srssb->{'Rev-Diagonal'})) {
$styleArray['borders']['diagonal'] = self::parseBorderAttributes($srssb->Diagonal->attributes());
$styleArray['borders']['diagonalDirection'] = Borders::DIAGONAL_BOTH;
} elseif (isset($srssb->Diagonal)) {
$styleArray['borders']['diagonal'] = self::parseBorderAttributes($srssb->Diagonal->attributes());
$styleArray['borders']['diagonalDirection'] = Borders::DIAGONAL_UP;
} elseif (isset($srssb->{'Rev-Diagonal'})) {
$styleArray['borders']['diagonal'] = self::parseBorderAttributes($srssb->{'Rev-Diagonal'}->attributes());
$styleArray['borders']['diagonalDirection'] = Borders::DIAGONAL_DOWN;
}
}
private function addBorderStyle(SimpleXMLElement $srssb, array &$styleArray, string $direction): void
{
$ucDirection = ucfirst($direction);
if (isset($srssb->$ucDirection)) {
$styleArray['borders'][$direction] = self::parseBorderAttributes($srssb->$ucDirection->attributes());
}
}
private function calcRotation(SimpleXMLElement $styleAttributes): int
{
$rotation = (int) $styleAttributes->Rotation;
if ($rotation >= 270 && $rotation <= 360) {
$rotation -= 360;
}
$rotation = (abs($rotation) > 90) ? 0 : $rotation;
return $rotation;
}
private static function addStyle(array &$styleArray, string $key, string $value): void
{
if (array_key_exists($value, self::$mappings[$key])) {
$styleArray[$key] = self::$mappings[$key][$value];
}
}
private static function addStyle2(array &$styleArray, string $key1, string $key, string $value): void
{
if (array_key_exists($value, self::$mappings[$key])) {
$styleArray[$key1][$key] = self::$mappings[$key][$value];
}
}
private static function parseBorderAttributes(?SimpleXMLElement $borderAttributes): array
{
$styleArray = [];
if ($borderAttributes !== null) {
if (isset($borderAttributes['Color'])) {
$styleArray['color']['rgb'] = self::parseGnumericColour($borderAttributes['Color']);
}
self::addStyle($styleArray, 'borderStyle', (string) $borderAttributes['Style']);
}
return $styleArray;
}
private static function parseGnumericColour(string $gnmColour): string
{
[$gnmR, $gnmG, $gnmB] = explode(':', $gnmColour);
$gnmR = substr(str_pad($gnmR, 4, '0', STR_PAD_RIGHT), 0, 2);
$gnmG = substr(str_pad($gnmG, 4, '0', STR_PAD_RIGHT), 0, 2);
$gnmB = substr(str_pad($gnmB, 4, '0', STR_PAD_RIGHT), 0, 2);
return $gnmR . $gnmG . $gnmB;
}
private function addColors(array &$styleArray, SimpleXMLElement $styleAttributes): void
{
$RGB = self::parseGnumericColour((string) $styleAttributes['Fore']);
$styleArray['font']['color']['rgb'] = $RGB;
$RGB = self::parseGnumericColour((string) $styleAttributes['Back']);
$shade = (string) $styleAttributes['Shade'];
if (($RGB !== '000000') || ($shade !== '0')) {
$RGB2 = self::parseGnumericColour((string) $styleAttributes['PatternColor']);
if ($shade === '1') {
$styleArray['fill']['startColor']['rgb'] = $RGB;
$styleArray['fill']['endColor']['rgb'] = $RGB2;
} else {
$styleArray['fill']['endColor']['rgb'] = $RGB;
$styleArray['fill']['startColor']['rgb'] = $RGB2;
}
self::addStyle2($styleArray, 'fill', 'fillType', $shade);
}
}
private function readStyleRange(SimpleXMLElement $styleAttributes, int $maxCol, int $maxRow): string
{
$startColumn = Coordinate::stringFromColumnIndex((int) $styleAttributes['startCol'] + 1);
$startRow = $styleAttributes['startRow'] + 1;
$endColumn = ($styleAttributes['endCol'] > $maxCol) ? $maxCol : (int) $styleAttributes['endCol'];
$endColumn = Coordinate::stringFromColumnIndex($endColumn + 1);
$endRow = 1 + (($styleAttributes['endRow'] > $maxRow) ? $maxRow : (int) $styleAttributes['endRow']);
$cellRange = $startColumn . $startRow . ':' . $endColumn . $endRow;
return $cellRange;
}
private function readStyle(array $styleArray, SimpleXMLElement $styleAttributes, SimpleXMLElement $style): array
{
self::addStyle2($styleArray, 'alignment', 'horizontal', (string) $styleAttributes['HAlign']);
self::addStyle2($styleArray, 'alignment', 'vertical', (string) $styleAttributes['VAlign']);
$styleArray['alignment']['wrapText'] = $styleAttributes['WrapText'] == '1';
$styleArray['alignment']['textRotation'] = $this->calcRotation($styleAttributes);
$styleArray['alignment']['shrinkToFit'] = $styleAttributes['ShrinkToFit'] == '1';
$styleArray['alignment']['indent'] = ((int) ($styleAttributes['Indent']) > 0) ? $styleAttributes['indent'] : 0;
$this->addColors($styleArray, $styleAttributes);
$fontAttributes = $style->Style->Font->attributes();
if ($fontAttributes !== null) {
$styleArray['font']['name'] = (string) $style->Style->Font;
$styleArray['font']['size'] = (int) ($fontAttributes['Unit']);
$styleArray['font']['bold'] = $fontAttributes['Bold'] == '1';
$styleArray['font']['italic'] = $fontAttributes['Italic'] == '1';
$styleArray['font']['strikethrough'] = $fontAttributes['StrikeThrough'] == '1';
self::addStyle2($styleArray, 'font', 'underline', (string) $fontAttributes['Underline']);
switch ($fontAttributes['Script']) {
case '1':
$styleArray['font']['superscript'] = true;
break;
case '-1':
$styleArray['font']['subscript'] = true;
break;
}
}
if (isset($style->Style->StyleBorder)) {
$srssb = $style->Style->StyleBorder;
$this->addBorderStyle($srssb, $styleArray, 'top');
$this->addBorderStyle($srssb, $styleArray, 'bottom');
$this->addBorderStyle($srssb, $styleArray, 'left');
$this->addBorderStyle($srssb, $styleArray, 'right');
$this->addBorderDiagonal($srssb, $styleArray);
}
if (isset($style->Style->HyperLink)) {
// TO DO
$hyperlink = $style->Style->HyperLink->attributes();
}
return $styleArray;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric/PageSetup.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric/PageSetup.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Gnumeric;
use PhpOffice\PhpSpreadsheet\Reader\Gnumeric;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Worksheet\PageMargins;
use PhpOffice\PhpSpreadsheet\Worksheet\PageSetup as WorksheetPageSetup;
use SimpleXMLElement;
class PageSetup
{
/**
* @var Spreadsheet
*/
private $spreadsheet;
public function __construct(Spreadsheet $spreadsheet)
{
$this->spreadsheet = $spreadsheet;
}
public function printInformation(SimpleXMLElement $sheet): self
{
if (isset($sheet->PrintInformation)) {
$printInformation = $sheet->PrintInformation[0];
if (!$printInformation) {
return $this;
}
$scale = (string) $printInformation->Scale->attributes()['percentage'];
$pageOrder = (string) $printInformation->order;
$orientation = (string) $printInformation->orientation;
$horizontalCentered = (string) $printInformation->hcenter->attributes()['value'];
$verticalCentered = (string) $printInformation->vcenter->attributes()['value'];
$this->spreadsheet->getActiveSheet()->getPageSetup()
->setPageOrder($pageOrder === 'r_then_d' ? WorksheetPageSetup::PAGEORDER_OVER_THEN_DOWN : WorksheetPageSetup::PAGEORDER_DOWN_THEN_OVER)
->setScale((int) $scale)
->setOrientation($orientation ?? WorksheetPageSetup::ORIENTATION_DEFAULT)
->setHorizontalCentered((bool) $horizontalCentered)
->setVerticalCentered((bool) $verticalCentered);
}
return $this;
}
public function sheetMargins(SimpleXMLElement $sheet): self
{
if (isset($sheet->PrintInformation, $sheet->PrintInformation->Margins)) {
$marginSet = [
// Default Settings
'top' => 0.75,
'header' => 0.3,
'left' => 0.7,
'right' => 0.7,
'bottom' => 0.75,
'footer' => 0.3,
];
$marginSet = $this->buildMarginSet($sheet, $marginSet);
$this->adjustMargins($marginSet);
}
return $this;
}
private function buildMarginSet(SimpleXMLElement $sheet, array $marginSet): array
{
foreach ($sheet->PrintInformation->Margins->children(Gnumeric::NAMESPACE_GNM) as $key => $margin) {
$marginAttributes = $margin->attributes();
$marginSize = ($marginAttributes['Points']) ?? 72; // Default is 72pt
// Convert value in points to inches
$marginSize = PageMargins::fromPoints((float) $marginSize);
$marginSet[$key] = $marginSize;
}
return $marginSet;
}
private function adjustMargins(array $marginSet): void
{
foreach ($marginSet as $key => $marginSize) {
// Gnumeric is quirky in the way it displays the header/footer values:
// header is actually the sum of top and header; footer is actually the sum of bottom and footer
// then top is actually the header value, and bottom is actually the footer value
switch ($key) {
case 'left':
case 'right':
$this->sheetMargin($key, $marginSize);
break;
case 'top':
$this->sheetMargin($key, $marginSet['header'] ?? 0);
break;
case 'bottom':
$this->sheetMargin($key, $marginSet['footer'] ?? 0);
break;
case 'header':
$this->sheetMargin($key, ($marginSet['top'] ?? 0) - $marginSize);
break;
case 'footer':
$this->sheetMargin($key, ($marginSet['bottom'] ?? 0) - $marginSize);
break;
}
}
}
private function sheetMargin(string $key, float $marginSize): void
{
switch ($key) {
case 'top':
$this->spreadsheet->getActiveSheet()->getPageMargins()->setTop($marginSize);
break;
case 'bottom':
$this->spreadsheet->getActiveSheet()->getPageMargins()->setBottom($marginSize);
break;
case 'left':
$this->spreadsheet->getActiveSheet()->getPageMargins()->setLeft($marginSize);
break;
case 'right':
$this->spreadsheet->getActiveSheet()->getPageMargins()->setRight($marginSize);
break;
case 'header':
$this->spreadsheet->getActiveSheet()->getPageMargins()->setHeader($marginSize);
break;
case 'footer':
$this->spreadsheet->getActiveSheet()->getPageMargins()->setFooter($marginSize);
break;
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric/Properties.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Gnumeric/Properties.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Gnumeric;
use PhpOffice\PhpSpreadsheet\Reader\Gnumeric;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use SimpleXMLElement;
class Properties
{
/**
* @var Spreadsheet
*/
protected $spreadsheet;
public function __construct(Spreadsheet $spreadsheet)
{
$this->spreadsheet = $spreadsheet;
}
private function docPropertiesOld(SimpleXMLElement $gnmXML): void
{
$docProps = $this->spreadsheet->getProperties();
foreach ($gnmXML->Summary->Item as $summaryItem) {
$propertyName = $summaryItem->name;
$propertyValue = $summaryItem->{'val-string'};
switch ($propertyName) {
case 'title':
$docProps->setTitle(trim($propertyValue));
break;
case 'comments':
$docProps->setDescription(trim($propertyValue));
break;
case 'keywords':
$docProps->setKeywords(trim($propertyValue));
break;
case 'category':
$docProps->setCategory(trim($propertyValue));
break;
case 'manager':
$docProps->setManager(trim($propertyValue));
break;
case 'author':
$docProps->setCreator(trim($propertyValue));
$docProps->setLastModifiedBy(trim($propertyValue));
break;
case 'company':
$docProps->setCompany(trim($propertyValue));
break;
}
}
}
private function docPropertiesDC(SimpleXMLElement $officePropertyDC): void
{
$docProps = $this->spreadsheet->getProperties();
foreach ($officePropertyDC as $propertyName => $propertyValue) {
$propertyValue = trim((string) $propertyValue);
switch ($propertyName) {
case 'title':
$docProps->setTitle($propertyValue);
break;
case 'subject':
$docProps->setSubject($propertyValue);
break;
case 'creator':
$docProps->setCreator($propertyValue);
$docProps->setLastModifiedBy($propertyValue);
break;
case 'date':
$creationDate = $propertyValue;
$docProps->setModified($creationDate);
break;
case 'description':
$docProps->setDescription($propertyValue);
break;
}
}
}
private function docPropertiesMeta(SimpleXMLElement $officePropertyMeta): void
{
$docProps = $this->spreadsheet->getProperties();
foreach ($officePropertyMeta as $propertyName => $propertyValue) {
if ($propertyValue !== null) {
$attributes = $propertyValue->attributes(Gnumeric::NAMESPACE_META);
$propertyValue = trim((string) $propertyValue);
switch ($propertyName) {
case 'keyword':
$docProps->setKeywords($propertyValue);
break;
case 'initial-creator':
$docProps->setCreator($propertyValue);
$docProps->setLastModifiedBy($propertyValue);
break;
case 'creation-date':
$creationDate = $propertyValue;
$docProps->setCreated($creationDate);
break;
case 'user-defined':
if ($attributes) {
[, $attrName] = explode(':', (string) $attributes['name']);
$this->userDefinedProperties($attrName, $propertyValue);
}
break;
}
}
}
}
private function userDefinedProperties(string $attrName, string $propertyValue): void
{
$docProps = $this->spreadsheet->getProperties();
switch ($attrName) {
case 'publisher':
$docProps->setCompany($propertyValue);
break;
case 'category':
$docProps->setCategory($propertyValue);
break;
case 'manager':
$docProps->setManager($propertyValue);
break;
}
}
public function readProperties(SimpleXMLElement $xml, SimpleXMLElement $gnmXML): void
{
$officeXML = $xml->children(Gnumeric::NAMESPACE_OFFICE);
if (!empty($officeXML)) {
$officeDocXML = $officeXML->{'document-meta'};
$officeDocMetaXML = $officeDocXML->meta;
foreach ($officeDocMetaXML as $officePropertyData) {
$officePropertyDC = $officePropertyData->children(Gnumeric::NAMESPACE_DC);
$this->docPropertiesDC($officePropertyDC);
$officePropertyMeta = $officePropertyData->children(Gnumeric::NAMESPACE_META);
$this->docPropertiesMeta($officePropertyMeta);
}
} elseif (isset($gnmXML->Summary)) {
$this->docPropertiesOld($gnmXML);
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Styles.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Styles.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Style\Alignment;
use PhpOffice\PhpSpreadsheet\Style\Border;
use PhpOffice\PhpSpreadsheet\Style\Borders;
use PhpOffice\PhpSpreadsheet\Style\Color;
use PhpOffice\PhpSpreadsheet\Style\Fill;
use PhpOffice\PhpSpreadsheet\Style\Font;
use PhpOffice\PhpSpreadsheet\Style\NumberFormat;
use PhpOffice\PhpSpreadsheet\Style\Protection;
use PhpOffice\PhpSpreadsheet\Style\Style;
use SimpleXMLElement;
class Styles extends BaseParserClass
{
/**
* Theme instance.
*
* @var Theme
*/
private static $theme;
private $styles = [];
private $cellStyles = [];
private $styleXml;
public function __construct(SimpleXMLElement $styleXml)
{
$this->styleXml = $styleXml;
}
public function setStyleBaseData(?Theme $theme = null, $styles = [], $cellStyles = []): void
{
self::$theme = $theme;
$this->styles = $styles;
$this->cellStyles = $cellStyles;
}
public static function readFontStyle(Font $fontStyle, SimpleXMLElement $fontStyleXml): void
{
if (isset($fontStyleXml->name, $fontStyleXml->name['val'])) {
$fontStyle->setName((string) $fontStyleXml->name['val']);
}
if (isset($fontStyleXml->sz, $fontStyleXml->sz['val'])) {
$fontStyle->setSize((float) $fontStyleXml->sz['val']);
}
if (isset($fontStyleXml->b)) {
$fontStyle->setBold(!isset($fontStyleXml->b['val']) || self::boolean((string) $fontStyleXml->b['val']));
}
if (isset($fontStyleXml->i)) {
$fontStyle->setItalic(!isset($fontStyleXml->i['val']) || self::boolean((string) $fontStyleXml->i['val']));
}
if (isset($fontStyleXml->strike)) {
$fontStyle->setStrikethrough(
!isset($fontStyleXml->strike['val']) || self::boolean((string) $fontStyleXml->strike['val'])
);
}
$fontStyle->getColor()->setARGB(self::readColor($fontStyleXml->color));
if (isset($fontStyleXml->u) && !isset($fontStyleXml->u['val'])) {
$fontStyle->setUnderline(Font::UNDERLINE_SINGLE);
} elseif (isset($fontStyleXml->u, $fontStyleXml->u['val'])) {
$fontStyle->setUnderline((string) $fontStyleXml->u['val']);
}
if (isset($fontStyleXml->vertAlign, $fontStyleXml->vertAlign['val'])) {
$verticalAlign = strtolower((string) $fontStyleXml->vertAlign['val']);
if ($verticalAlign === 'superscript') {
$fontStyle->setSuperscript(true);
} elseif ($verticalAlign === 'subscript') {
$fontStyle->setSubscript(true);
}
}
}
private static function readNumberFormat(NumberFormat $numfmtStyle, SimpleXMLElement $numfmtStyleXml): void
{
if ($numfmtStyleXml->count() === 0) {
return;
}
$numfmt = Xlsx::getAttributes($numfmtStyleXml);
if ($numfmt->count() > 0 && isset($numfmt['formatCode'])) {
$numfmtStyle->setFormatCode((string) $numfmt['formatCode']);
}
}
public static function readFillStyle(Fill $fillStyle, SimpleXMLElement $fillStyleXml): void
{
if ($fillStyleXml->gradientFill) {
/** @var SimpleXMLElement $gradientFill */
$gradientFill = $fillStyleXml->gradientFill[0];
if (!empty($gradientFill['type'])) {
$fillStyle->setFillType((string) $gradientFill['type']);
}
$fillStyle->setRotation((float) ($gradientFill['degree']));
$gradientFill->registerXPathNamespace('sml', Namespaces::MAIN);
$fillStyle->getStartColor()->setARGB(self::readColor(self::getArrayItem($gradientFill->xpath('sml:stop[@position=0]'))->color));
$fillStyle->getEndColor()->setARGB(self::readColor(self::getArrayItem($gradientFill->xpath('sml:stop[@position=1]'))->color));
} elseif ($fillStyleXml->patternFill) {
$defaultFillStyle = Fill::FILL_NONE;
if ($fillStyleXml->patternFill->fgColor) {
$fillStyle->getStartColor()->setARGB(self::readColor($fillStyleXml->patternFill->fgColor, true));
$defaultFillStyle = Fill::FILL_SOLID;
}
if ($fillStyleXml->patternFill->bgColor) {
$fillStyle->getEndColor()->setARGB(self::readColor($fillStyleXml->patternFill->bgColor, true));
$defaultFillStyle = Fill::FILL_SOLID;
}
$patternType = (string) $fillStyleXml->patternFill['patternType'] != ''
? (string) $fillStyleXml->patternFill['patternType']
: $defaultFillStyle;
$fillStyle->setFillType($patternType);
}
}
public static function readBorderStyle(Borders $borderStyle, SimpleXMLElement $borderStyleXml): void
{
$diagonalUp = self::boolean((string) $borderStyleXml['diagonalUp']);
$diagonalDown = self::boolean((string) $borderStyleXml['diagonalDown']);
if (!$diagonalUp && !$diagonalDown) {
$borderStyle->setDiagonalDirection(Borders::DIAGONAL_NONE);
} elseif ($diagonalUp && !$diagonalDown) {
$borderStyle->setDiagonalDirection(Borders::DIAGONAL_UP);
} elseif (!$diagonalUp && $diagonalDown) {
$borderStyle->setDiagonalDirection(Borders::DIAGONAL_DOWN);
} else {
$borderStyle->setDiagonalDirection(Borders::DIAGONAL_BOTH);
}
self::readBorder($borderStyle->getLeft(), $borderStyleXml->left);
self::readBorder($borderStyle->getRight(), $borderStyleXml->right);
self::readBorder($borderStyle->getTop(), $borderStyleXml->top);
self::readBorder($borderStyle->getBottom(), $borderStyleXml->bottom);
self::readBorder($borderStyle->getDiagonal(), $borderStyleXml->diagonal);
}
private static function readBorder(Border $border, SimpleXMLElement $borderXml): void
{
if (isset($borderXml['style'])) {
$border->setBorderStyle((string) $borderXml['style']);
}
if (isset($borderXml->color)) {
$border->getColor()->setARGB(self::readColor($borderXml->color));
}
}
public static function readAlignmentStyle(Alignment $alignment, SimpleXMLElement $alignmentXml): void
{
$alignment->setHorizontal((string) $alignmentXml['horizontal']);
$alignment->setVertical((string) $alignmentXml['vertical']);
$textRotation = 0;
if ((int) $alignmentXml['textRotation'] <= 90) {
$textRotation = (int) $alignmentXml['textRotation'];
} elseif ((int) $alignmentXml['textRotation'] > 90) {
$textRotation = 90 - (int) $alignmentXml['textRotation'];
}
$alignment->setTextRotation((int) $textRotation);
$alignment->setWrapText(self::boolean((string) $alignmentXml['wrapText']));
$alignment->setShrinkToFit(self::boolean((string) $alignmentXml['shrinkToFit']));
$alignment->setIndent(
(int) ((string) $alignmentXml['indent']) > 0 ? (int) ((string) $alignmentXml['indent']) : 0
);
$alignment->setReadOrder(
(int) ((string) $alignmentXml['readingOrder']) > 0 ? (int) ((string) $alignmentXml['readingOrder']) : 0
);
}
private function readStyle(Style $docStyle, $style): void
{
if ($style->numFmt instanceof SimpleXMLElement) {
self::readNumberFormat($docStyle->getNumberFormat(), $style->numFmt);
} else {
$docStyle->getNumberFormat()->setFormatCode($style->numFmt);
}
if (isset($style->font)) {
self::readFontStyle($docStyle->getFont(), $style->font);
}
if (isset($style->fill)) {
self::readFillStyle($docStyle->getFill(), $style->fill);
}
if (isset($style->border)) {
self::readBorderStyle($docStyle->getBorders(), $style->border);
}
if (isset($style->alignment->alignment)) {
self::readAlignmentStyle($docStyle->getAlignment(), $style->alignment);
}
// protection
if (isset($style->protection)) {
self::readProtectionLocked($docStyle, $style);
self::readProtectionHidden($docStyle, $style);
}
// top-level style settings
if (isset($style->quotePrefix)) {
$docStyle->setQuotePrefix(true);
}
}
public static function readProtectionLocked(Style $docStyle, $style): void
{
if (isset($style->protection['locked'])) {
if (self::boolean((string) $style->protection['locked'])) {
$docStyle->getProtection()->setLocked(Protection::PROTECTION_PROTECTED);
} else {
$docStyle->getProtection()->setLocked(Protection::PROTECTION_UNPROTECTED);
}
}
}
public static function readProtectionHidden(Style $docStyle, $style): void
{
if (isset($style->protection['hidden'])) {
if (self::boolean((string) $style->protection['hidden'])) {
$docStyle->getProtection()->setHidden(Protection::PROTECTION_PROTECTED);
} else {
$docStyle->getProtection()->setHidden(Protection::PROTECTION_UNPROTECTED);
}
}
}
public static function readColor($color, $background = false)
{
if (isset($color['rgb'])) {
return (string) $color['rgb'];
} elseif (isset($color['indexed'])) {
return Color::indexedColor($color['indexed'] - 7, $background)->getARGB();
} elseif (isset($color['theme'])) {
if (self::$theme !== null) {
$returnColour = self::$theme->getColourByIndex((int) $color['theme']);
if (isset($color['tint'])) {
$tintAdjust = (float) $color['tint'];
$returnColour = Color::changeBrightness($returnColour, $tintAdjust);
}
return 'FF' . $returnColour;
}
}
return ($background) ? 'FFFFFFFF' : 'FF000000';
}
public function dxfs($readDataOnly = false)
{
$dxfs = [];
if (!$readDataOnly && $this->styleXml) {
// Conditional Styles
if ($this->styleXml->dxfs) {
foreach ($this->styleXml->dxfs->dxf as $dxf) {
$style = new Style(false, true);
$this->readStyle($style, $dxf);
$dxfs[] = $style;
}
}
// Cell Styles
if ($this->styleXml->cellStyles) {
foreach ($this->styleXml->cellStyles->cellStyle as $cellStylex) {
$cellStyle = Xlsx::getAttributes($cellStylex);
if ((int) ($cellStyle['builtinId']) == 0) {
if (isset($this->cellStyles[(int) ($cellStyle['xfId'])])) {
// Set default style
$style = new Style();
$this->readStyle($style, $this->cellStyles[(int) ($cellStyle['xfId'])]);
// normal style, currently not using it for anything
}
}
}
}
}
return $dxfs;
}
public function styles()
{
return $this->styles;
}
private static function getArrayItem($array, $key = 0)
{
return $array[$key] ?? null;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/BaseParserClass.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/BaseParserClass.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
class BaseParserClass
{
protected static function boolean($value)
{
if (is_object($value)) {
$value = (string) $value;
}
if (is_numeric($value)) {
return (bool) $value;
}
return $value === strtolower('true');
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/DataValidations.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/DataValidations.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class DataValidations
{
private $worksheet;
private $worksheetXml;
public function __construct(Worksheet $workSheet, SimpleXMLElement $worksheetXml)
{
$this->worksheet = $workSheet;
$this->worksheetXml = $worksheetXml;
}
public function load(): void
{
foreach ($this->worksheetXml->dataValidations->dataValidation as $dataValidation) {
// Uppercase coordinate
$range = strtoupper($dataValidation['sqref']);
$rangeSet = explode(' ', $range);
foreach ($rangeSet as $range) {
$stRange = $this->worksheet->shrinkRangeToFit($range);
// Extract all cell references in $range
foreach (Coordinate::extractAllCellReferencesInRange($stRange) as $reference) {
// Create validation
$docValidation = $this->worksheet->getCell($reference)->getDataValidation();
$docValidation->setType((string) $dataValidation['type']);
$docValidation->setErrorStyle((string) $dataValidation['errorStyle']);
$docValidation->setOperator((string) $dataValidation['operator']);
$docValidation->setAllowBlank(filter_var($dataValidation['allowBlank'], FILTER_VALIDATE_BOOLEAN));
// showDropDown is inverted (works as hideDropDown if true)
$docValidation->setShowDropDown(!filter_var($dataValidation['showDropDown'], FILTER_VALIDATE_BOOLEAN));
$docValidation->setShowInputMessage(filter_var($dataValidation['showInputMessage'], FILTER_VALIDATE_BOOLEAN));
$docValidation->setShowErrorMessage(filter_var($dataValidation['showErrorMessage'], FILTER_VALIDATE_BOOLEAN));
$docValidation->setErrorTitle((string) $dataValidation['errorTitle']);
$docValidation->setError((string) $dataValidation['error']);
$docValidation->setPromptTitle((string) $dataValidation['promptTitle']);
$docValidation->setPrompt((string) $dataValidation['prompt']);
$docValidation->setFormula1((string) $dataValidation->formula1);
$docValidation->setFormula2((string) $dataValidation->formula2);
$docValidation->setSqref($range);
}
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Hyperlinks.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Hyperlinks.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class Hyperlinks
{
private $worksheet;
private $hyperlinks = [];
public function __construct(Worksheet $workSheet)
{
$this->worksheet = $workSheet;
}
public function readHyperlinks(SimpleXMLElement $relsWorksheet): void
{
foreach ($relsWorksheet->children(Namespaces::RELATIONSHIPS)->Relationship as $elementx) {
$element = Xlsx::getAttributes($elementx);
if ($element->Type == Namespaces::HYPERLINK) {
$this->hyperlinks[(string) $element->Id] = (string) $element->Target;
}
}
}
public function setHyperlinks(SimpleXMLElement $worksheetXml): void
{
foreach ($worksheetXml->children(Namespaces::MAIN)->hyperlink as $hyperlink) {
if ($hyperlink !== null) {
$this->setHyperlink($hyperlink, $this->worksheet);
}
}
}
private function setHyperlink(SimpleXMLElement $hyperlink, Worksheet $worksheet): void
{
// Link url
$linkRel = Xlsx::getAttributes($hyperlink, Namespaces::SCHEMA_OFFICE_DOCUMENT);
$attributes = Xlsx::getAttributes($hyperlink);
foreach (Coordinate::extractAllCellReferencesInRange($attributes->ref) as $cellReference) {
$cell = $worksheet->getCell($cellReference);
if (isset($linkRel['id'])) {
$hyperlinkUrl = $this->hyperlinks[(string) $linkRel['id']] ?? null;
if (isset($attributes['location'])) {
$hyperlinkUrl .= '#' . (string) $attributes['location'];
}
$cell->getHyperlink()->setUrl($hyperlinkUrl);
} elseif (isset($attributes['location'])) {
$cell->getHyperlink()->setUrl('sheet://' . (string) $attributes['location']);
}
// Tooltip
if (isset($attributes['tooltip'])) {
$cell->getHyperlink()->setTooltip((string) $attributes['tooltip']);
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/PageSetup.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/PageSetup.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class PageSetup extends BaseParserClass
{
private $worksheet;
private $worksheetXml;
public function __construct(Worksheet $workSheet, ?SimpleXMLElement $worksheetXml = null)
{
$this->worksheet = $workSheet;
$this->worksheetXml = $worksheetXml;
}
public function load(array $unparsedLoadedData)
{
if (!$this->worksheetXml) {
return $unparsedLoadedData;
}
$this->margins($this->worksheetXml, $this->worksheet);
$unparsedLoadedData = $this->pageSetup($this->worksheetXml, $this->worksheet, $unparsedLoadedData);
$this->headerFooter($this->worksheetXml, $this->worksheet);
$this->pageBreaks($this->worksheetXml, $this->worksheet);
return $unparsedLoadedData;
}
private function margins(SimpleXMLElement $xmlSheet, Worksheet $worksheet): void
{
if ($xmlSheet->pageMargins) {
$docPageMargins = $worksheet->getPageMargins();
$docPageMargins->setLeft((float) ($xmlSheet->pageMargins['left']));
$docPageMargins->setRight((float) ($xmlSheet->pageMargins['right']));
$docPageMargins->setTop((float) ($xmlSheet->pageMargins['top']));
$docPageMargins->setBottom((float) ($xmlSheet->pageMargins['bottom']));
$docPageMargins->setHeader((float) ($xmlSheet->pageMargins['header']));
$docPageMargins->setFooter((float) ($xmlSheet->pageMargins['footer']));
}
}
private function pageSetup(SimpleXMLElement $xmlSheet, Worksheet $worksheet, array $unparsedLoadedData)
{
if ($xmlSheet->pageSetup) {
$docPageSetup = $worksheet->getPageSetup();
if (isset($xmlSheet->pageSetup['orientation'])) {
$docPageSetup->setOrientation((string) $xmlSheet->pageSetup['orientation']);
}
if (isset($xmlSheet->pageSetup['paperSize'])) {
$docPageSetup->setPaperSize((int) ($xmlSheet->pageSetup['paperSize']));
}
if (isset($xmlSheet->pageSetup['scale'])) {
$docPageSetup->setScale((int) ($xmlSheet->pageSetup['scale']), false);
}
if (isset($xmlSheet->pageSetup['fitToHeight']) && (int) ($xmlSheet->pageSetup['fitToHeight']) >= 0) {
$docPageSetup->setFitToHeight((int) ($xmlSheet->pageSetup['fitToHeight']), false);
}
if (isset($xmlSheet->pageSetup['fitToWidth']) && (int) ($xmlSheet->pageSetup['fitToWidth']) >= 0) {
$docPageSetup->setFitToWidth((int) ($xmlSheet->pageSetup['fitToWidth']), false);
}
if (
isset($xmlSheet->pageSetup['firstPageNumber'], $xmlSheet->pageSetup['useFirstPageNumber']) &&
self::boolean((string) $xmlSheet->pageSetup['useFirstPageNumber'])
) {
$docPageSetup->setFirstPageNumber((int) ($xmlSheet->pageSetup['firstPageNumber']));
}
if (isset($xmlSheet->pageSetup['pageOrder'])) {
$docPageSetup->setPageOrder((string) $xmlSheet->pageSetup['pageOrder']);
}
$relAttributes = $xmlSheet->pageSetup->attributes(Namespaces::SCHEMA_OFFICE_DOCUMENT);
if (isset($relAttributes['id'])) {
$unparsedLoadedData['sheets'][$worksheet->getCodeName()]['pageSetupRelId'] = (string) $relAttributes['id'];
}
}
return $unparsedLoadedData;
}
private function headerFooter(SimpleXMLElement $xmlSheet, Worksheet $worksheet): void
{
if ($xmlSheet->headerFooter) {
$docHeaderFooter = $worksheet->getHeaderFooter();
if (
isset($xmlSheet->headerFooter['differentOddEven']) &&
self::boolean((string) $xmlSheet->headerFooter['differentOddEven'])
) {
$docHeaderFooter->setDifferentOddEven(true);
} else {
$docHeaderFooter->setDifferentOddEven(false);
}
if (
isset($xmlSheet->headerFooter['differentFirst']) &&
self::boolean((string) $xmlSheet->headerFooter['differentFirst'])
) {
$docHeaderFooter->setDifferentFirst(true);
} else {
$docHeaderFooter->setDifferentFirst(false);
}
if (
isset($xmlSheet->headerFooter['scaleWithDoc']) &&
!self::boolean((string) $xmlSheet->headerFooter['scaleWithDoc'])
) {
$docHeaderFooter->setScaleWithDocument(false);
} else {
$docHeaderFooter->setScaleWithDocument(true);
}
if (
isset($xmlSheet->headerFooter['alignWithMargins']) &&
!self::boolean((string) $xmlSheet->headerFooter['alignWithMargins'])
) {
$docHeaderFooter->setAlignWithMargins(false);
} else {
$docHeaderFooter->setAlignWithMargins(true);
}
$docHeaderFooter->setOddHeader((string) $xmlSheet->headerFooter->oddHeader);
$docHeaderFooter->setOddFooter((string) $xmlSheet->headerFooter->oddFooter);
$docHeaderFooter->setEvenHeader((string) $xmlSheet->headerFooter->evenHeader);
$docHeaderFooter->setEvenFooter((string) $xmlSheet->headerFooter->evenFooter);
$docHeaderFooter->setFirstHeader((string) $xmlSheet->headerFooter->firstHeader);
$docHeaderFooter->setFirstFooter((string) $xmlSheet->headerFooter->firstFooter);
}
}
private function pageBreaks(SimpleXMLElement $xmlSheet, Worksheet $worksheet): void
{
if ($xmlSheet->rowBreaks && $xmlSheet->rowBreaks->brk) {
$this->rowBreaks($xmlSheet, $worksheet);
}
if ($xmlSheet->colBreaks && $xmlSheet->colBreaks->brk) {
$this->columnBreaks($xmlSheet, $worksheet);
}
}
private function rowBreaks(SimpleXMLElement $xmlSheet, Worksheet $worksheet): void
{
foreach ($xmlSheet->rowBreaks->brk as $brk) {
if ($brk['man']) {
$worksheet->setBreak("A{$brk['id']}", Worksheet::BREAK_ROW);
}
}
}
private function columnBreaks(SimpleXMLElement $xmlSheet, Worksheet $worksheet): void
{
foreach ($xmlSheet->colBreaks->brk as $brk) {
if ($brk['man']) {
$worksheet->setBreak(
Coordinate::stringFromColumnIndex(((int) $brk['id']) + 1) . '1',
Worksheet::BREAK_COLUMN
);
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Theme.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Theme.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
class Theme
{
/**
* Theme Name.
*
* @var string
*/
private $themeName;
/**
* Colour Scheme Name.
*
* @var string
*/
private $colourSchemeName;
/**
* Colour Map.
*
* @var string[]
*/
private $colourMap;
/**
* Create a new Theme.
*
* @param string $themeName
* @param string $colourSchemeName
* @param string[] $colourMap
*/
public function __construct($themeName, $colourSchemeName, $colourMap)
{
// Initialise values
$this->themeName = $themeName;
$this->colourSchemeName = $colourSchemeName;
$this->colourMap = $colourMap;
}
/**
* Get Theme Name.
*
* @return string
*/
public function getThemeName()
{
return $this->themeName;
}
/**
* Get colour Scheme Name.
*
* @return string
*/
public function getColourSchemeName()
{
return $this->colourSchemeName;
}
/**
* Get colour Map Value by Position.
*
* @param int $index
*
* @return null|string
*/
public function getColourByIndex($index)
{
if (isset($this->colourMap[$index])) {
return $this->colourMap[$index];
}
return null;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if ((is_object($value)) && ($key != '_parent')) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Namespaces.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Namespaces.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
class Namespaces
{
const SCHEMAS = 'http://schemas.openxmlformats.org';
const RELATIONSHIPS = 'http://schemas.openxmlformats.org/package/2006/relationships';
// This one used in Reader\Xlsx
const CORE_PROPERTIES = 'http://schemas.openxmlformats.org/package/2006/relationships/metadata/core-properties';
// This one used in Reader\Xlsx\Properties
const CORE_PROPERTIES2 = 'http://schemas.openxmlformats.org/package/2006/metadata/core-properties';
const THEME = 'http://schemas.openxmlformats.org/package/2006/relationships/theme';
const COMPATIBILITY = 'http://schemas.openxmlformats.org/markup-compatibility/2006';
const MAIN = 'http://schemas.openxmlformats.org/spreadsheetml/2006/main';
const DRAWINGML = 'http://schemas.openxmlformats.org/drawingml/2006/main';
const CHART = 'http://schemas.openxmlformats.org/drawingml/2006/chart';
const SPREADSHEET_DRAWING = 'http://schemas.openxmlformats.org/drawingml/2006/spreadsheetDrawing';
const SCHEMA_OFFICE_DOCUMENT = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships';
const COMMENTS = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/comments';
//const CUSTOM_PROPERTIES = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/custom-properties';
//const EXTENDED_PROPERTIES = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/extended-properties';
const HYPERLINK = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/hyperlink';
const OFFICE_DOCUMENT = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/officeDocument';
const SHARED_STRINGS = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/sharedStrings';
const STYLES = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/styles';
const IMAGE = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/image';
const VML = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/vmlDrawing';
const WORKSHEET = 'http://schemas.openxmlformats.org/officeDocument/2006/relationships/worksheet';
const SCHEMA_MICROSOFT = 'http://schemas.microsoft.com/office/2006/relationships';
const EXTENSIBILITY = 'http://schemas.microsoft.com/office/2006/relationships/ui/extensibility';
const VBA = 'http://schemas.microsoft.com/office/2006/relationships/vbaProject';
const DC_ELEMENTS = 'http://purl.org/dc/elements/1.1/';
const DC_TERMS = 'http://purl.org/dc/terms';
const URN_MSOFFICE = 'urn:schemas-microsoft-com:office:office';
const URN_VML = 'urn:schemas-microsoft-com:vml';
const SCHEMA_PURL = 'http://purl.oclc.org/ooxml';
const PURL_OFFICE_DOCUMENT = 'http://purl.oclc.org/ooxml/officeDocument/relationships/officeDocument';
const PURL_RELATIONSHIPS = 'http://purl.oclc.org/ooxml/officeDocument/relationships';
const PURL_MAIN = 'http://purl.oclc.org/ooxml/spreadsheetml/main';
const PURL_DRAWING = 'http://purl.oclc.org/ooxml/drawingml/main';
const PURL_WORKSHEET = 'http://purl.oclc.org/ooxml/officeDocument/relationships/worksheet';
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Properties.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Properties.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Document\Properties as DocumentProperties;
use PhpOffice\PhpSpreadsheet\Reader\Security\XmlScanner;
use PhpOffice\PhpSpreadsheet\Settings;
use SimpleXMLElement;
class Properties
{
/** @var XmlScanner */
private $securityScanner;
/** @var DocumentProperties */
private $docProps;
public function __construct(XmlScanner $securityScanner, DocumentProperties $docProps)
{
$this->securityScanner = $securityScanner;
$this->docProps = $docProps;
}
/**
* @param mixed $obj
*/
private static function nullOrSimple($obj): ?SimpleXMLElement
{
return ($obj instanceof SimpleXMLElement) ? $obj : null;
}
private function extractPropertyData(string $propertyData): ?SimpleXMLElement
{
// okay to omit namespace because everything will be processed by xpath
$obj = simplexml_load_string(
$this->securityScanner->scan($propertyData),
'SimpleXMLElement',
Settings::getLibXmlLoaderOptions()
);
return self::nullOrSimple($obj);
}
public function readCoreProperties(string $propertyData): void
{
$xmlCore = $this->extractPropertyData($propertyData);
if (is_object($xmlCore)) {
$xmlCore->registerXPathNamespace('dc', Namespaces::DC_ELEMENTS);
$xmlCore->registerXPathNamespace('dcterms', Namespaces::DC_TERMS);
$xmlCore->registerXPathNamespace('cp', Namespaces::CORE_PROPERTIES2);
$this->docProps->setCreator((string) self::getArrayItem($xmlCore->xpath('dc:creator')));
$this->docProps->setLastModifiedBy((string) self::getArrayItem($xmlCore->xpath('cp:lastModifiedBy')));
$this->docProps->setCreated((string) self::getArrayItem($xmlCore->xpath('dcterms:created'))); //! respect xsi:type
$this->docProps->setModified((string) self::getArrayItem($xmlCore->xpath('dcterms:modified'))); //! respect xsi:type
$this->docProps->setTitle((string) self::getArrayItem($xmlCore->xpath('dc:title')));
$this->docProps->setDescription((string) self::getArrayItem($xmlCore->xpath('dc:description')));
$this->docProps->setSubject((string) self::getArrayItem($xmlCore->xpath('dc:subject')));
$this->docProps->setKeywords((string) self::getArrayItem($xmlCore->xpath('cp:keywords')));
$this->docProps->setCategory((string) self::getArrayItem($xmlCore->xpath('cp:category')));
}
}
public function readExtendedProperties(string $propertyData): void
{
$xmlCore = $this->extractPropertyData($propertyData);
if (is_object($xmlCore)) {
if (isset($xmlCore->Company)) {
$this->docProps->setCompany((string) $xmlCore->Company);
}
if (isset($xmlCore->Manager)) {
$this->docProps->setManager((string) $xmlCore->Manager);
}
}
}
public function readCustomProperties(string $propertyData): void
{
$xmlCore = $this->extractPropertyData($propertyData);
if (is_object($xmlCore)) {
foreach ($xmlCore as $xmlProperty) {
/** @var SimpleXMLElement $xmlProperty */
$cellDataOfficeAttributes = $xmlProperty->attributes();
if (isset($cellDataOfficeAttributes['name'])) {
$propertyName = (string) $cellDataOfficeAttributes['name'];
$cellDataOfficeChildren = $xmlProperty->children('http://schemas.openxmlformats.org/officeDocument/2006/docPropsVTypes');
$attributeType = $cellDataOfficeChildren->getName();
$attributeValue = (string) $cellDataOfficeChildren->{$attributeType};
$attributeValue = DocumentProperties::convertProperty($attributeValue, $attributeType);
$attributeType = DocumentProperties::convertPropertyType($attributeType);
$this->docProps->setCustomProperty($propertyName, $attributeValue, $attributeType);
}
}
}
}
/**
* @param array|false $array
* @param mixed $key
*/
private static function getArrayItem($array, $key = 0): ?SimpleXMLElement
{
return is_array($array) ? ($array[$key] ?? null) : null;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/AutoFilter.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/AutoFilter.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Worksheet\AutoFilter\Column;
use PhpOffice\PhpSpreadsheet\Worksheet\AutoFilter\Column\Rule;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class AutoFilter
{
private $worksheet;
private $worksheetXml;
public function __construct(Worksheet $workSheet, SimpleXMLElement $worksheetXml)
{
$this->worksheet = $workSheet;
$this->worksheetXml = $worksheetXml;
}
public function load(): void
{
// Remove all "$" in the auto filter range
$autoFilterRange = preg_replace('/\$/', '', $this->worksheetXml->autoFilter['ref']);
if (strpos($autoFilterRange, ':') !== false) {
$this->readAutoFilter($autoFilterRange, $this->worksheetXml);
}
}
private function readAutoFilter($autoFilterRange, $xmlSheet): void
{
$autoFilter = $this->worksheet->getAutoFilter();
$autoFilter->setRange($autoFilterRange);
foreach ($xmlSheet->autoFilter->filterColumn as $filterColumn) {
$column = $autoFilter->getColumnByOffset((int) $filterColumn['colId']);
// Check for standard filters
if ($filterColumn->filters) {
$column->setFilterType(Column::AUTOFILTER_FILTERTYPE_FILTER);
$filters = $filterColumn->filters;
if ((isset($filters['blank'])) && ($filters['blank'] == 1)) {
// Operator is undefined, but always treated as EQUAL
$column->createRule()->setRule(null, '')->setRuleType(Rule::AUTOFILTER_RULETYPE_FILTER);
}
// Standard filters are always an OR join, so no join rule needs to be set
// Entries can be either filter elements
foreach ($filters->filter as $filterRule) {
// Operator is undefined, but always treated as EQUAL
$column->createRule()->setRule(null, (string) $filterRule['val'])->setRuleType(Rule::AUTOFILTER_RULETYPE_FILTER);
}
// Or Date Group elements
$this->readDateRangeAutoFilter($filters, $column);
}
// Check for custom filters
$this->readCustomAutoFilter($filterColumn, $column);
// Check for dynamic filters
$this->readDynamicAutoFilter($filterColumn, $column);
// Check for dynamic filters
$this->readTopTenAutoFilter($filterColumn, $column);
}
}
private function readDateRangeAutoFilter(SimpleXMLElement $filters, Column $column): void
{
foreach ($filters->dateGroupItem as $dateGroupItem) {
// Operator is undefined, but always treated as EQUAL
$column->createRule()->setRule(
null,
[
'year' => (string) $dateGroupItem['year'],
'month' => (string) $dateGroupItem['month'],
'day' => (string) $dateGroupItem['day'],
'hour' => (string) $dateGroupItem['hour'],
'minute' => (string) $dateGroupItem['minute'],
'second' => (string) $dateGroupItem['second'],
],
(string) $dateGroupItem['dateTimeGrouping']
)->setRuleType(Rule::AUTOFILTER_RULETYPE_DATEGROUP);
}
}
private function readCustomAutoFilter(SimpleXMLElement $filterColumn, Column $column): void
{
if ($filterColumn->customFilters) {
$column->setFilterType(Column::AUTOFILTER_FILTERTYPE_CUSTOMFILTER);
$customFilters = $filterColumn->customFilters;
// Custom filters can an AND or an OR join;
// and there should only ever be one or two entries
if ((isset($customFilters['and'])) && ((string) $customFilters['and'] === '1')) {
$column->setJoin(Column::AUTOFILTER_COLUMN_JOIN_AND);
}
foreach ($customFilters->customFilter as $filterRule) {
$column->createRule()->setRule(
(string) $filterRule['operator'],
(string) $filterRule['val']
)->setRuleType(Rule::AUTOFILTER_RULETYPE_CUSTOMFILTER);
}
}
}
private function readDynamicAutoFilter(SimpleXMLElement $filterColumn, Column $column): void
{
if ($filterColumn->dynamicFilter) {
$column->setFilterType(Column::AUTOFILTER_FILTERTYPE_DYNAMICFILTER);
// We should only ever have one dynamic filter
foreach ($filterColumn->dynamicFilter as $filterRule) {
// Operator is undefined, but always treated as EQUAL
$column->createRule()->setRule(
null,
(string) $filterRule['val'],
(string) $filterRule['type']
)->setRuleType(Rule::AUTOFILTER_RULETYPE_DYNAMICFILTER);
if (isset($filterRule['val'])) {
$column->setAttribute('val', (string) $filterRule['val']);
}
if (isset($filterRule['maxVal'])) {
$column->setAttribute('maxVal', (string) $filterRule['maxVal']);
}
}
}
}
private function readTopTenAutoFilter(SimpleXMLElement $filterColumn, Column $column): void
{
if ($filterColumn->top10) {
$column->setFilterType(Column::AUTOFILTER_FILTERTYPE_TOPTENFILTER);
// We should only ever have one top10 filter
foreach ($filterColumn->top10 as $filterRule) {
$column->createRule()->setRule(
(
((isset($filterRule['percent'])) && ((string) $filterRule['percent'] === '1'))
? Rule::AUTOFILTER_COLUMN_RULE_TOPTEN_PERCENT
: Rule::AUTOFILTER_COLUMN_RULE_TOPTEN_BY_VALUE
),
(string) $filterRule['val'],
(
((isset($filterRule['top'])) && ((string) $filterRule['top'] === '1'))
? Rule::AUTOFILTER_COLUMN_RULE_TOPTEN_TOP
: Rule::AUTOFILTER_COLUMN_RULE_TOPTEN_BOTTOM
)
)->setRuleType(Rule::AUTOFILTER_RULETYPE_TOPTENFILTER);
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Chart.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/Chart.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Calculation\Functions;
use PhpOffice\PhpSpreadsheet\Chart\DataSeries;
use PhpOffice\PhpSpreadsheet\Chart\DataSeriesValues;
use PhpOffice\PhpSpreadsheet\Chart\Layout;
use PhpOffice\PhpSpreadsheet\Chart\Legend;
use PhpOffice\PhpSpreadsheet\Chart\PlotArea;
use PhpOffice\PhpSpreadsheet\Chart\Title;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Style\Color;
use PhpOffice\PhpSpreadsheet\Style\Font;
use SimpleXMLElement;
class Chart
{
/**
* @param string $name
* @param string $format
*
* @return null|bool|float|int|string
*/
private static function getAttribute(SimpleXMLElement $component, $name, $format)
{
$attributes = $component->attributes();
if (isset($attributes[$name])) {
if ($format == 'string') {
return (string) $attributes[$name];
} elseif ($format == 'integer') {
return (int) $attributes[$name];
} elseif ($format == 'boolean') {
$value = (string) $attributes[$name];
return $value === 'true' || $value === '1';
}
return (float) $attributes[$name];
}
return null;
}
private static function readColor($color, $background = false)
{
if (isset($color['rgb'])) {
return (string) $color['rgb'];
} elseif (isset($color['indexed'])) {
return Color::indexedColor($color['indexed'] - 7, $background)->getARGB();
}
}
/**
* @param string $chartName
*
* @return \PhpOffice\PhpSpreadsheet\Chart\Chart
*/
public static function readChart(SimpleXMLElement $chartElements, $chartName)
{
$namespacesChartMeta = $chartElements->getNamespaces(true);
$chartElementsC = $chartElements->children($namespacesChartMeta['c']);
$XaxisLabel = $YaxisLabel = $legend = $title = null;
$dispBlanksAs = $plotVisOnly = null;
$plotArea = null;
foreach ($chartElementsC as $chartElementKey => $chartElement) {
switch ($chartElementKey) {
case 'chart':
foreach ($chartElement as $chartDetailsKey => $chartDetails) {
$chartDetailsC = $chartDetails->children($namespacesChartMeta['c']);
switch ($chartDetailsKey) {
case 'plotArea':
$plotAreaLayout = $XaxisLable = $YaxisLable = null;
$plotSeries = $plotAttributes = [];
foreach ($chartDetails as $chartDetailKey => $chartDetail) {
switch ($chartDetailKey) {
case 'layout':
$plotAreaLayout = self::chartLayoutDetails($chartDetail, $namespacesChartMeta);
break;
case 'catAx':
if (isset($chartDetail->title)) {
$XaxisLabel = self::chartTitle($chartDetail->title->children($namespacesChartMeta['c']), $namespacesChartMeta);
}
break;
case 'dateAx':
if (isset($chartDetail->title)) {
$XaxisLabel = self::chartTitle($chartDetail->title->children($namespacesChartMeta['c']), $namespacesChartMeta);
}
break;
case 'valAx':
if (isset($chartDetail->title, $chartDetail->axPos)) {
$axisLabel = self::chartTitle($chartDetail->title->children($namespacesChartMeta['c']), $namespacesChartMeta);
$axPos = self::getAttribute($chartDetail->axPos, 'val', 'string');
switch ($axPos) {
case 't':
case 'b':
$XaxisLabel = $axisLabel;
break;
case 'r':
case 'l':
$YaxisLabel = $axisLabel;
break;
}
}
break;
case 'barChart':
case 'bar3DChart':
$barDirection = self::getAttribute($chartDetail->barDir, 'val', 'string');
$plotSer = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotSer->setPlotDirection($barDirection);
$plotSeries[] = $plotSer;
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'lineChart':
case 'line3DChart':
$plotSeries[] = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'areaChart':
case 'area3DChart':
$plotSeries[] = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'doughnutChart':
case 'pieChart':
case 'pie3DChart':
$explosion = isset($chartDetail->ser->explosion);
$plotSer = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotSer->setPlotStyle($explosion);
$plotSeries[] = $plotSer;
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'scatterChart':
$scatterStyle = self::getAttribute($chartDetail->scatterStyle, 'val', 'string');
$plotSer = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotSer->setPlotStyle($scatterStyle);
$plotSeries[] = $plotSer;
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'bubbleChart':
$bubbleScale = self::getAttribute($chartDetail->bubbleScale, 'val', 'integer');
$plotSer = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotSer->setPlotStyle($bubbleScale);
$plotSeries[] = $plotSer;
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'radarChart':
$radarStyle = self::getAttribute($chartDetail->radarStyle, 'val', 'string');
$plotSer = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotSer->setPlotStyle($radarStyle);
$plotSeries[] = $plotSer;
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'surfaceChart':
case 'surface3DChart':
$wireFrame = self::getAttribute($chartDetail->wireframe, 'val', 'boolean');
$plotSer = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotSer->setPlotStyle($wireFrame);
$plotSeries[] = $plotSer;
$plotAttributes = self::readChartAttributes($chartDetail);
break;
case 'stockChart':
$plotSeries[] = self::chartDataSeries($chartDetail, $namespacesChartMeta, $chartDetailKey);
$plotAttributes = self::readChartAttributes($plotAreaLayout);
break;
}
}
if ($plotAreaLayout == null) {
$plotAreaLayout = new Layout();
}
$plotArea = new PlotArea($plotAreaLayout, $plotSeries);
self::setChartAttributes($plotAreaLayout, $plotAttributes);
break;
case 'plotVisOnly':
$plotVisOnly = self::getAttribute($chartDetails, 'val', 'string');
break;
case 'dispBlanksAs':
$dispBlanksAs = self::getAttribute($chartDetails, 'val', 'string');
break;
case 'title':
$title = self::chartTitle($chartDetails, $namespacesChartMeta);
break;
case 'legend':
$legendPos = 'r';
$legendLayout = null;
$legendOverlay = false;
foreach ($chartDetails as $chartDetailKey => $chartDetail) {
switch ($chartDetailKey) {
case 'legendPos':
$legendPos = self::getAttribute($chartDetail, 'val', 'string');
break;
case 'overlay':
$legendOverlay = self::getAttribute($chartDetail, 'val', 'boolean');
break;
case 'layout':
$legendLayout = self::chartLayoutDetails($chartDetail, $namespacesChartMeta);
break;
}
}
$legend = new Legend($legendPos, $legendLayout, $legendOverlay);
break;
}
}
}
}
$chart = new \PhpOffice\PhpSpreadsheet\Chart\Chart($chartName, $title, $legend, $plotArea, $plotVisOnly, $dispBlanksAs, $XaxisLabel, $YaxisLabel);
return $chart;
}
private static function chartTitle(SimpleXMLElement $titleDetails, array $namespacesChartMeta)
{
$caption = [];
$titleLayout = null;
foreach ($titleDetails as $titleDetailKey => $chartDetail) {
switch ($titleDetailKey) {
case 'tx':
$titleDetails = $chartDetail->rich->children($namespacesChartMeta['a']);
foreach ($titleDetails as $titleKey => $titleDetail) {
switch ($titleKey) {
case 'p':
$titleDetailPart = $titleDetail->children($namespacesChartMeta['a']);
$caption[] = self::parseRichText($titleDetailPart);
}
}
break;
case 'layout':
$titleLayout = self::chartLayoutDetails($chartDetail, $namespacesChartMeta);
break;
}
}
return new Title($caption, $titleLayout);
}
private static function chartLayoutDetails($chartDetail, $namespacesChartMeta)
{
if (!isset($chartDetail->manualLayout)) {
return null;
}
$details = $chartDetail->manualLayout->children($namespacesChartMeta['c']);
if ($details === null) {
return null;
}
$layout = [];
foreach ($details as $detailKey => $detail) {
$layout[$detailKey] = self::getAttribute($detail, 'val', 'string');
}
return new Layout($layout);
}
private static function chartDataSeries($chartDetail, $namespacesChartMeta, $plotType)
{
$multiSeriesType = null;
$smoothLine = false;
$seriesLabel = $seriesCategory = $seriesValues = $plotOrder = [];
$seriesDetailSet = $chartDetail->children($namespacesChartMeta['c']);
foreach ($seriesDetailSet as $seriesDetailKey => $seriesDetails) {
switch ($seriesDetailKey) {
case 'grouping':
$multiSeriesType = self::getAttribute($chartDetail->grouping, 'val', 'string');
break;
case 'ser':
$marker = null;
$seriesIndex = '';
foreach ($seriesDetails as $seriesKey => $seriesDetail) {
switch ($seriesKey) {
case 'idx':
$seriesIndex = self::getAttribute($seriesDetail, 'val', 'integer');
break;
case 'order':
$seriesOrder = self::getAttribute($seriesDetail, 'val', 'integer');
$plotOrder[$seriesIndex] = $seriesOrder;
break;
case 'tx':
$seriesLabel[$seriesIndex] = self::chartDataSeriesValueSet($seriesDetail, $namespacesChartMeta);
break;
case 'marker':
$marker = self::getAttribute($seriesDetail->symbol, 'val', 'string');
break;
case 'smooth':
$smoothLine = self::getAttribute($seriesDetail, 'val', 'boolean');
break;
case 'cat':
$seriesCategory[$seriesIndex] = self::chartDataSeriesValueSet($seriesDetail, $namespacesChartMeta);
break;
case 'val':
$seriesValues[$seriesIndex] = self::chartDataSeriesValueSet($seriesDetail, $namespacesChartMeta, $marker);
break;
case 'xVal':
$seriesCategory[$seriesIndex] = self::chartDataSeriesValueSet($seriesDetail, $namespacesChartMeta, $marker);
break;
case 'yVal':
$seriesValues[$seriesIndex] = self::chartDataSeriesValueSet($seriesDetail, $namespacesChartMeta, $marker);
break;
}
}
}
}
return new DataSeries($plotType, $multiSeriesType, $plotOrder, $seriesLabel, $seriesCategory, $seriesValues, $smoothLine);
}
private static function chartDataSeriesValueSet($seriesDetail, $namespacesChartMeta, $marker = null)
{
if (isset($seriesDetail->strRef)) {
$seriesSource = (string) $seriesDetail->strRef->f;
$seriesValues = new DataSeriesValues(DataSeriesValues::DATASERIES_TYPE_STRING, $seriesSource, null, null, null, $marker);
if (isset($seriesDetail->strRef->strCache)) {
$seriesData = self::chartDataSeriesValues($seriesDetail->strRef->strCache->children($namespacesChartMeta['c']), 's');
$seriesValues
->setFormatCode($seriesData['formatCode'])
->setDataValues($seriesData['dataValues']);
}
return $seriesValues;
} elseif (isset($seriesDetail->numRef)) {
$seriesSource = (string) $seriesDetail->numRef->f;
$seriesValues = new DataSeriesValues(DataSeriesValues::DATASERIES_TYPE_NUMBER, $seriesSource, null, null, null, $marker);
if (isset($seriesDetail->numRef->numCache)) {
$seriesData = self::chartDataSeriesValues($seriesDetail->numRef->numCache->children($namespacesChartMeta['c']));
$seriesValues
->setFormatCode($seriesData['formatCode'])
->setDataValues($seriesData['dataValues']);
}
return $seriesValues;
} elseif (isset($seriesDetail->multiLvlStrRef)) {
$seriesSource = (string) $seriesDetail->multiLvlStrRef->f;
$seriesValues = new DataSeriesValues(DataSeriesValues::DATASERIES_TYPE_STRING, $seriesSource, null, null, null, $marker);
if (isset($seriesDetail->multiLvlStrRef->multiLvlStrCache)) {
$seriesData = self::chartDataSeriesValuesMultiLevel($seriesDetail->multiLvlStrRef->multiLvlStrCache->children($namespacesChartMeta['c']), 's');
$seriesValues
->setFormatCode($seriesData['formatCode'])
->setDataValues($seriesData['dataValues']);
}
return $seriesValues;
} elseif (isset($seriesDetail->multiLvlNumRef)) {
$seriesSource = (string) $seriesDetail->multiLvlNumRef->f;
$seriesValues = new DataSeriesValues(DataSeriesValues::DATASERIES_TYPE_STRING, $seriesSource, null, null, null, $marker);
if (isset($seriesDetail->multiLvlNumRef->multiLvlNumCache)) {
$seriesData = self::chartDataSeriesValuesMultiLevel($seriesDetail->multiLvlNumRef->multiLvlNumCache->children($namespacesChartMeta['c']), 's');
$seriesValues
->setFormatCode($seriesData['formatCode'])
->setDataValues($seriesData['dataValues']);
}
return $seriesValues;
}
return null;
}
private static function chartDataSeriesValues($seriesValueSet, $dataType = 'n')
{
$seriesVal = [];
$formatCode = '';
$pointCount = 0;
foreach ($seriesValueSet as $seriesValueIdx => $seriesValue) {
switch ($seriesValueIdx) {
case 'ptCount':
$pointCount = self::getAttribute($seriesValue, 'val', 'integer');
break;
case 'formatCode':
$formatCode = (string) $seriesValue;
break;
case 'pt':
$pointVal = self::getAttribute($seriesValue, 'idx', 'integer');
if ($dataType == 's') {
$seriesVal[$pointVal] = (string) $seriesValue->v;
} elseif ($seriesValue->v === Functions::NA()) {
$seriesVal[$pointVal] = null;
} else {
$seriesVal[$pointVal] = (float) $seriesValue->v;
}
break;
}
}
return [
'formatCode' => $formatCode,
'pointCount' => $pointCount,
'dataValues' => $seriesVal,
];
}
private static function chartDataSeriesValuesMultiLevel($seriesValueSet, $dataType = 'n')
{
$seriesVal = [];
$formatCode = '';
$pointCount = 0;
foreach ($seriesValueSet->lvl as $seriesLevelIdx => $seriesLevel) {
foreach ($seriesLevel as $seriesValueIdx => $seriesValue) {
switch ($seriesValueIdx) {
case 'ptCount':
$pointCount = self::getAttribute($seriesValue, 'val', 'integer');
break;
case 'formatCode':
$formatCode = (string) $seriesValue;
break;
case 'pt':
$pointVal = self::getAttribute($seriesValue, 'idx', 'integer');
if ($dataType == 's') {
$seriesVal[$pointVal][] = (string) $seriesValue->v;
} elseif ($seriesValue->v === Functions::NA()) {
$seriesVal[$pointVal] = null;
} else {
$seriesVal[$pointVal][] = (float) $seriesValue->v;
}
break;
}
}
}
return [
'formatCode' => $formatCode,
'pointCount' => $pointCount,
'dataValues' => $seriesVal,
];
}
private static function parseRichText(SimpleXMLElement $titleDetailPart)
{
$value = new RichText();
$objText = null;
foreach ($titleDetailPart as $titleDetailElementKey => $titleDetailElement) {
if (isset($titleDetailElement->t)) {
$objText = $value->createTextRun((string) $titleDetailElement->t);
}
if (isset($titleDetailElement->rPr)) {
if (isset($titleDetailElement->rPr->rFont['val'])) {
$objText->getFont()->setName((string) $titleDetailElement->rPr->rFont['val']);
}
$fontSize = (self::getAttribute($titleDetailElement->rPr, 'sz', 'integer'));
if (is_int($fontSize)) {
$objText->getFont()->setSize(floor($fontSize / 100));
}
$fontColor = (self::getAttribute($titleDetailElement->rPr, 'color', 'string'));
if ($fontColor !== null) {
$objText->getFont()->setColor(new Color(self::readColor($fontColor)));
}
$bold = self::getAttribute($titleDetailElement->rPr, 'b', 'boolean');
if ($bold !== null) {
$objText->getFont()->setBold($bold);
}
$italic = self::getAttribute($titleDetailElement->rPr, 'i', 'boolean');
if ($italic !== null) {
$objText->getFont()->setItalic($italic);
}
$baseline = self::getAttribute($titleDetailElement->rPr, 'baseline', 'integer');
if ($baseline !== null) {
if ($baseline > 0) {
$objText->getFont()->setSuperscript(true);
} elseif ($baseline < 0) {
$objText->getFont()->setSubscript(true);
}
}
$underscore = (self::getAttribute($titleDetailElement->rPr, 'u', 'string'));
if ($underscore !== null) {
if ($underscore == 'sng') {
$objText->getFont()->setUnderline(Font::UNDERLINE_SINGLE);
} elseif ($underscore == 'dbl') {
$objText->getFont()->setUnderline(Font::UNDERLINE_DOUBLE);
} else {
$objText->getFont()->setUnderline(Font::UNDERLINE_NONE);
}
}
$strikethrough = (self::getAttribute($titleDetailElement->rPr, 's', 'string'));
if ($strikethrough !== null) {
if ($strikethrough == 'noStrike') {
$objText->getFont()->setStrikethrough(false);
} else {
$objText->getFont()->setStrikethrough(true);
}
}
}
}
return $value;
}
private static function readChartAttributes($chartDetail)
{
$plotAttributes = [];
if (isset($chartDetail->dLbls)) {
if (isset($chartDetail->dLbls->showLegendKey)) {
$plotAttributes['showLegendKey'] = self::getAttribute($chartDetail->dLbls->showLegendKey, 'val', 'string');
}
if (isset($chartDetail->dLbls->showVal)) {
$plotAttributes['showVal'] = self::getAttribute($chartDetail->dLbls->showVal, 'val', 'string');
}
if (isset($chartDetail->dLbls->showCatName)) {
$plotAttributes['showCatName'] = self::getAttribute($chartDetail->dLbls->showCatName, 'val', 'string');
}
if (isset($chartDetail->dLbls->showSerName)) {
$plotAttributes['showSerName'] = self::getAttribute($chartDetail->dLbls->showSerName, 'val', 'string');
}
if (isset($chartDetail->dLbls->showPercent)) {
$plotAttributes['showPercent'] = self::getAttribute($chartDetail->dLbls->showPercent, 'val', 'string');
}
if (isset($chartDetail->dLbls->showBubbleSize)) {
$plotAttributes['showBubbleSize'] = self::getAttribute($chartDetail->dLbls->showBubbleSize, 'val', 'string');
}
if (isset($chartDetail->dLbls->showLeaderLines)) {
$plotAttributes['showLeaderLines'] = self::getAttribute($chartDetail->dLbls->showLeaderLines, 'val', 'string');
}
}
return $plotAttributes;
}
/**
* @param mixed $plotAttributes
*/
private static function setChartAttributes(Layout $plotArea, $plotAttributes): void
{
foreach ($plotAttributes as $plotAttributeKey => $plotAttributeValue) {
switch ($plotAttributeKey) {
case 'showLegendKey':
$plotArea->setShowLegendKey($plotAttributeValue);
break;
case 'showVal':
$plotArea->setShowVal($plotAttributeValue);
break;
case 'showCatName':
$plotArea->setShowCatName($plotAttributeValue);
break;
case 'showSerName':
$plotArea->setShowSerName($plotAttributeValue);
break;
case 'showPercent':
$plotArea->setShowPercent($plotAttributeValue);
break;
case 'showBubbleSize':
$plotArea->setShowBubbleSize($plotAttributeValue);
break;
case 'showLeaderLines':
$plotArea->setShowLeaderLines($plotAttributeValue);
break;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/SheetViewOptions.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/SheetViewOptions.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class SheetViewOptions extends BaseParserClass
{
private $worksheet;
private $worksheetXml;
public function __construct(Worksheet $workSheet, ?SimpleXMLElement $worksheetXml = null)
{
$this->worksheet = $workSheet;
$this->worksheetXml = $worksheetXml;
}
/**
* @param bool $readDataOnly
*/
public function load($readDataOnly = false): void
{
if ($this->worksheetXml === null) {
return;
}
if (isset($this->worksheetXml->sheetPr)) {
$this->tabColor($this->worksheetXml->sheetPr);
$this->codeName($this->worksheetXml->sheetPr);
$this->outlines($this->worksheetXml->sheetPr);
$this->pageSetup($this->worksheetXml->sheetPr);
}
if (isset($this->worksheetXml->sheetFormatPr)) {
$this->sheetFormat($this->worksheetXml->sheetFormatPr);
}
if (!$readDataOnly && isset($this->worksheetXml->printOptions)) {
$this->printOptions($this->worksheetXml->printOptions);
}
}
private function tabColor(SimpleXMLElement $sheetPr): void
{
if (isset($sheetPr->tabColor, $sheetPr->tabColor['rgb'])) {
$this->worksheet->getTabColor()->setARGB((string) $sheetPr->tabColor['rgb']);
}
}
private function codeName(SimpleXMLElement $sheetPr): void
{
if (isset($sheetPr['codeName'])) {
$this->worksheet->setCodeName((string) $sheetPr['codeName'], false);
}
}
private function outlines(SimpleXMLElement $sheetPr): void
{
if (isset($sheetPr->outlinePr)) {
if (
isset($sheetPr->outlinePr['summaryRight']) &&
!self::boolean((string) $sheetPr->outlinePr['summaryRight'])
) {
$this->worksheet->setShowSummaryRight(false);
} else {
$this->worksheet->setShowSummaryRight(true);
}
if (
isset($sheetPr->outlinePr['summaryBelow']) &&
!self::boolean((string) $sheetPr->outlinePr['summaryBelow'])
) {
$this->worksheet->setShowSummaryBelow(false);
} else {
$this->worksheet->setShowSummaryBelow(true);
}
}
}
private function pageSetup(SimpleXMLElement $sheetPr): void
{
if (isset($sheetPr->pageSetUpPr)) {
if (
isset($sheetPr->pageSetUpPr['fitToPage']) &&
!self::boolean((string) $sheetPr->pageSetUpPr['fitToPage'])
) {
$this->worksheet->getPageSetup()->setFitToPage(false);
} else {
$this->worksheet->getPageSetup()->setFitToPage(true);
}
}
}
private function sheetFormat(SimpleXMLElement $sheetFormatPr): void
{
if (
isset($sheetFormatPr['customHeight']) &&
self::boolean((string) $sheetFormatPr['customHeight']) &&
isset($sheetFormatPr['defaultRowHeight'])
) {
$this->worksheet->getDefaultRowDimension()
->setRowHeight((float) $sheetFormatPr['defaultRowHeight']);
}
if (isset($sheetFormatPr['defaultColWidth'])) {
$this->worksheet->getDefaultColumnDimension()
->setWidth((float) $sheetFormatPr['defaultColWidth']);
}
if (
isset($sheetFormatPr['zeroHeight']) &&
((string) $sheetFormatPr['zeroHeight'] === '1')
) {
$this->worksheet->getDefaultRowDimension()->setZeroHeight(true);
}
}
private function printOptions(SimpleXMLElement $printOptions): void
{
if (self::boolean((string) $printOptions['gridLinesSet'])) {
$this->worksheet->setShowGridlines(true);
}
if (self::boolean((string) $printOptions['gridLines'])) {
$this->worksheet->setPrintGridlines(true);
}
if (self::boolean((string) $printOptions['horizontalCentered'])) {
$this->worksheet->getPageSetup()->setHorizontalCentered(true);
}
if (self::boolean((string) $printOptions['verticalCentered'])) {
$this->worksheet->getPageSetup()->setVerticalCentered(true);
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/ColumnAndRowAttributes.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/ColumnAndRowAttributes.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Reader\DefaultReadFilter;
use PhpOffice\PhpSpreadsheet\Reader\IReadFilter;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class ColumnAndRowAttributes extends BaseParserClass
{
private $worksheet;
private $worksheetXml;
public function __construct(Worksheet $workSheet, ?SimpleXMLElement $worksheetXml = null)
{
$this->worksheet = $workSheet;
$this->worksheetXml = $worksheetXml;
}
/**
* Set Worksheet column attributes by attributes array passed.
*
* @param string $columnAddress A, B, ... DX, ...
* @param array $columnAttributes array of attributes (indexes are attribute name, values are value)
* 'xfIndex', 'visible', 'collapsed', 'outlineLevel', 'width', ... ?
*/
private function setColumnAttributes($columnAddress, array $columnAttributes): void
{
if (isset($columnAttributes['xfIndex'])) {
$this->worksheet->getColumnDimension($columnAddress)->setXfIndex($columnAttributes['xfIndex']);
}
if (isset($columnAttributes['visible'])) {
$this->worksheet->getColumnDimension($columnAddress)->setVisible($columnAttributes['visible']);
}
if (isset($columnAttributes['collapsed'])) {
$this->worksheet->getColumnDimension($columnAddress)->setCollapsed($columnAttributes['collapsed']);
}
if (isset($columnAttributes['outlineLevel'])) {
$this->worksheet->getColumnDimension($columnAddress)->setOutlineLevel($columnAttributes['outlineLevel']);
}
if (isset($columnAttributes['width'])) {
$this->worksheet->getColumnDimension($columnAddress)->setWidth($columnAttributes['width']);
}
}
/**
* Set Worksheet row attributes by attributes array passed.
*
* @param int $rowNumber 1, 2, 3, ... 99, ...
* @param array $rowAttributes array of attributes (indexes are attribute name, values are value)
* 'xfIndex', 'visible', 'collapsed', 'outlineLevel', 'rowHeight', ... ?
*/
private function setRowAttributes($rowNumber, array $rowAttributes): void
{
if (isset($rowAttributes['xfIndex'])) {
$this->worksheet->getRowDimension($rowNumber)->setXfIndex($rowAttributes['xfIndex']);
}
if (isset($rowAttributes['visible'])) {
$this->worksheet->getRowDimension($rowNumber)->setVisible($rowAttributes['visible']);
}
if (isset($rowAttributes['collapsed'])) {
$this->worksheet->getRowDimension($rowNumber)->setCollapsed($rowAttributes['collapsed']);
}
if (isset($rowAttributes['outlineLevel'])) {
$this->worksheet->getRowDimension($rowNumber)->setOutlineLevel($rowAttributes['outlineLevel']);
}
if (isset($rowAttributes['rowHeight'])) {
$this->worksheet->getRowDimension($rowNumber)->setRowHeight($rowAttributes['rowHeight']);
}
}
public function load(?IReadFilter $readFilter = null, bool $readDataOnly = false): void
{
if ($this->worksheetXml === null) {
return;
}
$columnsAttributes = [];
$rowsAttributes = [];
if (isset($this->worksheetXml->cols)) {
$columnsAttributes = $this->readColumnAttributes($this->worksheetXml->cols, $readDataOnly);
}
if ($this->worksheetXml->sheetData && $this->worksheetXml->sheetData->row) {
$rowsAttributes = $this->readRowAttributes($this->worksheetXml->sheetData->row, $readDataOnly);
}
if ($readFilter !== null && get_class($readFilter) === DefaultReadFilter::class) {
$readFilter = null;
}
// set columns/rows attributes
$columnsAttributesAreSet = [];
foreach ($columnsAttributes as $columnCoordinate => $columnAttributes) {
if (
$readFilter === null ||
!$this->isFilteredColumn($readFilter, $columnCoordinate, $rowsAttributes)
) {
if (!isset($columnsAttributesAreSet[$columnCoordinate])) {
$this->setColumnAttributes($columnCoordinate, $columnAttributes);
$columnsAttributesAreSet[$columnCoordinate] = true;
}
}
}
$rowsAttributesAreSet = [];
foreach ($rowsAttributes as $rowCoordinate => $rowAttributes) {
if (
$readFilter === null ||
!$this->isFilteredRow($readFilter, $rowCoordinate, $columnsAttributes)
) {
if (!isset($rowsAttributesAreSet[$rowCoordinate])) {
$this->setRowAttributes($rowCoordinate, $rowAttributes);
$rowsAttributesAreSet[$rowCoordinate] = true;
}
}
}
}
private function isFilteredColumn(IReadFilter $readFilter, $columnCoordinate, array $rowsAttributes)
{
foreach ($rowsAttributes as $rowCoordinate => $rowAttributes) {
if (!$readFilter->readCell($columnCoordinate, $rowCoordinate, $this->worksheet->getTitle())) {
return true;
}
}
return false;
}
private function readColumnAttributes(SimpleXMLElement $worksheetCols, $readDataOnly)
{
$columnAttributes = [];
foreach ($worksheetCols->col as $column) {
$startColumn = Coordinate::stringFromColumnIndex((int) $column['min']);
$endColumn = Coordinate::stringFromColumnIndex((int) $column['max']);
++$endColumn;
for ($columnAddress = $startColumn; $columnAddress !== $endColumn; ++$columnAddress) {
$columnAttributes[$columnAddress] = $this->readColumnRangeAttributes($column, $readDataOnly);
if ((int) ($column['max']) == 16384) {
break;
}
}
}
return $columnAttributes;
}
private function readColumnRangeAttributes(SimpleXMLElement $column, $readDataOnly)
{
$columnAttributes = [];
if ($column['style'] && !$readDataOnly) {
$columnAttributes['xfIndex'] = (int) $column['style'];
}
if (self::boolean($column['hidden'])) {
$columnAttributes['visible'] = false;
}
if (self::boolean($column['collapsed'])) {
$columnAttributes['collapsed'] = true;
}
if (((int) $column['outlineLevel']) > 0) {
$columnAttributes['outlineLevel'] = (int) $column['outlineLevel'];
}
$columnAttributes['width'] = (float) $column['width'];
return $columnAttributes;
}
private function isFilteredRow(IReadFilter $readFilter, $rowCoordinate, array $columnsAttributes)
{
foreach ($columnsAttributes as $columnCoordinate => $columnAttributes) {
if (!$readFilter->readCell($columnCoordinate, $rowCoordinate, $this->worksheet->getTitle())) {
return true;
}
}
return false;
}
private function readRowAttributes(SimpleXMLElement $worksheetRow, $readDataOnly)
{
$rowAttributes = [];
foreach ($worksheetRow as $row) {
if ($row['ht'] && !$readDataOnly) {
$rowAttributes[(int) $row['r']]['rowHeight'] = (float) $row['ht'];
}
if (self::boolean($row['hidden'])) {
$rowAttributes[(int) $row['r']]['visible'] = false;
}
if (self::boolean($row['collapsed'])) {
$rowAttributes[(int) $row['r']]['collapsed'] = true;
}
if ((int) $row['outlineLevel'] > 0) {
$rowAttributes[(int) $row['r']]['outlineLevel'] = (int) $row['outlineLevel'];
}
if ($row['s'] && !$readDataOnly) {
$rowAttributes[(int) $row['r']]['xfIndex'] = (int) $row['s'];
}
}
return $rowAttributes;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/ConditionalStyles.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/ConditionalStyles.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Style\Conditional;
use PhpOffice\PhpSpreadsheet\Style\ConditionalFormatting\ConditionalDataBar;
use PhpOffice\PhpSpreadsheet\Style\ConditionalFormatting\ConditionalFormattingRuleExtension;
use PhpOffice\PhpSpreadsheet\Style\ConditionalFormatting\ConditionalFormatValueObject;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class ConditionalStyles
{
private $worksheet;
private $worksheetXml;
private $dxfs;
public function __construct(Worksheet $workSheet, SimpleXMLElement $worksheetXml, array $dxfs = [])
{
$this->worksheet = $workSheet;
$this->worksheetXml = $worksheetXml;
$this->dxfs = $dxfs;
}
public function load(): void
{
$this->setConditionalStyles(
$this->worksheet,
$this->readConditionalStyles($this->worksheetXml),
$this->worksheetXml->extLst
);
}
private function readConditionalStyles($xmlSheet)
{
$conditionals = [];
foreach ($xmlSheet->conditionalFormatting as $conditional) {
foreach ($conditional->cfRule as $cfRule) {
if (Conditional::isValidConditionType((string) $cfRule['type']) && isset($this->dxfs[(int) ($cfRule['dxfId'])])) {
$conditionals[(string) $conditional['sqref']][(int) ($cfRule['priority'])] = $cfRule;
} elseif ((string) $cfRule['type'] == Conditional::CONDITION_DATABAR) {
$conditionals[(string) $conditional['sqref']][(int) ($cfRule['priority'])] = $cfRule;
}
}
}
return $conditionals;
}
private function setConditionalStyles(Worksheet $worksheet, array $conditionals, $xmlExtLst): void
{
foreach ($conditionals as $ref => $cfRules) {
ksort($cfRules);
$conditionalStyles = $this->readStyleRules($cfRules, $xmlExtLst);
// Extract all cell references in $ref
$cellBlocks = explode(' ', str_replace('$', '', strtoupper($ref)));
foreach ($cellBlocks as $cellBlock) {
$worksheet->getStyle($cellBlock)->setConditionalStyles($conditionalStyles);
}
}
}
private function readStyleRules($cfRules, $extLst)
{
$conditionalFormattingRuleExtensions = ConditionalFormattingRuleExtension::parseExtLstXml($extLst);
$conditionalStyles = [];
foreach ($cfRules as $cfRule) {
$objConditional = new Conditional();
$objConditional->setConditionType((string) $cfRule['type']);
$objConditional->setOperatorType((string) $cfRule['operator']);
if ((string) $cfRule['text'] != '') {
$objConditional->setText((string) $cfRule['text']);
}
if (isset($cfRule['stopIfTrue']) && (int) $cfRule['stopIfTrue'] === 1) {
$objConditional->setStopIfTrue(true);
}
if (count($cfRule->formula) > 1) {
foreach ($cfRule->formula as $formula) {
$objConditional->addCondition((string) $formula);
}
} else {
$objConditional->addCondition((string) $cfRule->formula);
}
if (isset($cfRule->dataBar)) {
$objConditional->setDataBar(
$this->readDataBarOfConditionalRule($cfRule, $conditionalFormattingRuleExtensions)
);
} else {
$objConditional->setStyle(clone $this->dxfs[(int) ($cfRule['dxfId'])]);
}
$conditionalStyles[] = $objConditional;
}
return $conditionalStyles;
}
private function readDataBarOfConditionalRule($cfRule, $conditionalFormattingRuleExtensions): ConditionalDataBar
{
$dataBar = new ConditionalDataBar();
//dataBar attribute
if (isset($cfRule->dataBar['showValue'])) {
$dataBar->setShowValue((bool) $cfRule->dataBar['showValue']);
}
//dataBar children
//conditionalFormatValueObjects
$cfvoXml = $cfRule->dataBar->cfvo;
$cfvoIndex = 0;
foreach ((count($cfvoXml) > 1 ? $cfvoXml : [$cfvoXml]) as $cfvo) {
if ($cfvoIndex === 0) {
$dataBar->setMinimumConditionalFormatValueObject(new ConditionalFormatValueObject((string) $cfvo['type'], (string) $cfvo['val']));
}
if ($cfvoIndex === 1) {
$dataBar->setMaximumConditionalFormatValueObject(new ConditionalFormatValueObject((string) $cfvo['type'], (string) $cfvo['val']));
}
++$cfvoIndex;
}
//color
if (isset($cfRule->dataBar->color)) {
$dataBar->setColor((string) $cfRule->dataBar->color['rgb']);
}
//extLst
$this->readDataBarExtLstOfConditionalRule($dataBar, $cfRule, $conditionalFormattingRuleExtensions);
return $dataBar;
}
private function readDataBarExtLstOfConditionalRule(ConditionalDataBar $dataBar, $cfRule, $conditionalFormattingRuleExtensions): void
{
if (isset($cfRule->extLst)) {
$ns = $cfRule->extLst->getNamespaces(true);
foreach ((count($cfRule->extLst) > 0 ? $cfRule->extLst->ext : [$cfRule->extLst->ext]) as $ext) {
$extId = (string) $ext->children($ns['x14'])->id;
if (isset($conditionalFormattingRuleExtensions[$extId]) && (string) $ext['uri'] === '{B025F937-C7B1-47D3-B67F-A62EFF666E3E}') {
$dataBar->setConditionalFormattingRuleExt($conditionalFormattingRuleExtensions[$extId]);
}
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/SheetViews.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Xlsx/SheetViews.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Reader\Xlsx;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use SimpleXMLElement;
class SheetViews extends BaseParserClass
{
/** @var SimpleXMLElement */
private $sheetViewXml;
/** @var SimpleXMLElement */
private $sheetViewAttributes;
/** @var Worksheet */
private $worksheet;
public function __construct(SimpleXMLElement $sheetViewXml, Worksheet $workSheet)
{
$this->sheetViewXml = $sheetViewXml;
$this->sheetViewAttributes = Xlsx::testSimpleXml($sheetViewXml->attributes());
$this->worksheet = $workSheet;
}
public function load(): void
{
$this->topLeft();
$this->zoomScale();
$this->view();
$this->gridLines();
$this->headers();
$this->direction();
$this->showZeros();
if (isset($this->sheetViewXml->pane)) {
$this->pane();
}
if (isset($this->sheetViewXml->selection, $this->sheetViewXml->selection->attributes()->sqref)) {
$this->selection();
}
}
private function zoomScale(): void
{
if (isset($this->sheetViewAttributes->zoomScale)) {
$zoomScale = (int) ($this->sheetViewAttributes->zoomScale);
if ($zoomScale <= 0) {
// setZoomScale will throw an Exception if the scale is less than or equals 0
// that is OK when manually creating documents, but we should be able to read all documents
$zoomScale = 100;
}
$this->worksheet->getSheetView()->setZoomScale($zoomScale);
}
if (isset($this->sheetViewAttributes->zoomScaleNormal)) {
$zoomScaleNormal = (int) ($this->sheetViewAttributes->zoomScaleNormal);
if ($zoomScaleNormal <= 0) {
// setZoomScaleNormal will throw an Exception if the scale is less than or equals 0
// that is OK when manually creating documents, but we should be able to read all documents
$zoomScaleNormal = 100;
}
$this->worksheet->getSheetView()->setZoomScaleNormal($zoomScaleNormal);
}
}
private function view(): void
{
if (isset($this->sheetViewAttributes->view)) {
$this->worksheet->getSheetView()->setView((string) $this->sheetViewAttributes->view);
}
}
private function topLeft(): void
{
if (isset($this->sheetViewAttributes->topLeftCell)) {
$this->worksheet->setTopLeftCell($this->sheetViewAttributes->topLeftCell);
}
}
private function gridLines(): void
{
if (isset($this->sheetViewAttributes->showGridLines)) {
$this->worksheet->setShowGridLines(
self::boolean((string) $this->sheetViewAttributes->showGridLines)
);
}
}
private function headers(): void
{
if (isset($this->sheetViewAttributes->showRowColHeaders)) {
$this->worksheet->setShowRowColHeaders(
self::boolean((string) $this->sheetViewAttributes->showRowColHeaders)
);
}
}
private function direction(): void
{
if (isset($this->sheetViewAttributes->rightToLeft)) {
$this->worksheet->setRightToLeft(
self::boolean((string) $this->sheetViewAttributes->rightToLeft)
);
}
}
private function showZeros(): void
{
if (isset($this->sheetViewAttributes->showZeros)) {
$this->worksheet->getSheetView()->setShowZeros(
self::boolean((string) $this->sheetViewAttributes->showZeros)
);
}
}
private function pane(): void
{
$xSplit = 0;
$ySplit = 0;
$topLeftCell = null;
$paneAttributes = $this->sheetViewXml->pane->attributes();
if (isset($paneAttributes->xSplit)) {
$xSplit = (int) ($paneAttributes->xSplit);
}
if (isset($paneAttributes->ySplit)) {
$ySplit = (int) ($paneAttributes->ySplit);
}
if (isset($paneAttributes->topLeftCell)) {
$topLeftCell = (string) $paneAttributes->topLeftCell;
}
$this->worksheet->freezePane(
Coordinate::stringFromColumnIndex($xSplit + 1) . ($ySplit + 1),
$topLeftCell
);
}
private function selection(): void
{
$attributes = $this->sheetViewXml->selection->attributes();
if ($attributes !== null) {
$sqref = (string) $attributes->sqref;
$sqref = explode(' ', $sqref);
$sqref = $sqref[0];
$this->worksheet->setSelectedCells($sqref);
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Security/XmlScanner.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Reader/Security/XmlScanner.php | <?php
namespace PhpOffice\PhpSpreadsheet\Reader\Security;
use PhpOffice\PhpSpreadsheet\Reader;
class XmlScanner
{
/**
* String used to identify risky xml elements.
*
* @var string
*/
private $pattern;
private $callback;
private static $libxmlDisableEntityLoaderValue;
/**
* @var bool
*/
private static $shutdownRegistered = false;
public function __construct($pattern = '<!DOCTYPE')
{
$this->pattern = $pattern;
$this->disableEntityLoaderCheck();
// A fatal error will bypass the destructor, so we register a shutdown here
if (!self::$shutdownRegistered) {
self::$shutdownRegistered = true;
register_shutdown_function([__CLASS__, 'shutdown']);
}
}
public static function getInstance(Reader\IReader $reader)
{
switch (true) {
case $reader instanceof Reader\Html:
return new self('<!ENTITY');
case $reader instanceof Reader\Xlsx:
case $reader instanceof Reader\Xml:
case $reader instanceof Reader\Ods:
case $reader instanceof Reader\Gnumeric:
return new self('<!DOCTYPE');
default:
return new self('<!DOCTYPE');
}
}
public static function threadSafeLibxmlDisableEntityLoaderAvailability()
{
if (PHP_MAJOR_VERSION == 7) {
switch (PHP_MINOR_VERSION) {
case 2:
return PHP_RELEASE_VERSION >= 1;
case 1:
return PHP_RELEASE_VERSION >= 13;
case 0:
return PHP_RELEASE_VERSION >= 27;
}
return true;
}
return false;
}
private function disableEntityLoaderCheck(): void
{
if (\PHP_VERSION_ID < 80000) {
$libxmlDisableEntityLoaderValue = libxml_disable_entity_loader(true);
if (self::$libxmlDisableEntityLoaderValue === null) {
self::$libxmlDisableEntityLoaderValue = $libxmlDisableEntityLoaderValue;
}
}
}
public static function shutdown(): void
{
if (self::$libxmlDisableEntityLoaderValue !== null && \PHP_VERSION_ID < 80000) {
libxml_disable_entity_loader(self::$libxmlDisableEntityLoaderValue);
self::$libxmlDisableEntityLoaderValue = null;
}
}
public function __destruct()
{
self::shutdown();
}
public function setAdditionalCallback(callable $callback): void
{
$this->callback = $callback;
}
private function toUtf8($xml)
{
$pattern = '/encoding="(.*?)"/';
$result = preg_match($pattern, $xml, $matches);
$charset = strtoupper($result ? $matches[1] : 'UTF-8');
if ($charset !== 'UTF-8') {
$xml = mb_convert_encoding($xml, 'UTF-8', $charset);
$result = preg_match($pattern, $xml, $matches);
$charset = strtoupper($result ? $matches[1] : 'UTF-8');
if ($charset !== 'UTF-8') {
throw new Reader\Exception('Suspicious Double-encoded XML, spreadsheet file load() aborted to prevent XXE/XEE attacks');
}
}
return $xml;
}
/**
* Scan the XML for use of <!ENTITY to prevent XXE/XEE attacks.
*
* @param mixed $xml
*
* @return string
*/
public function scan($xml)
{
$this->disableEntityLoaderCheck();
$xml = $this->toUtf8($xml);
// Don't rely purely on libxml_disable_entity_loader()
$pattern = '/\\0?' . implode('\\0?', str_split($this->pattern)) . '\\0?/';
if (preg_match($pattern, $xml)) {
throw new Reader\Exception('Detected use of ENTITY in XML, spreadsheet file load() aborted to prevent XXE/XEE attacks');
}
if ($this->callback !== null && is_callable($this->callback)) {
$xml = call_user_func($this->callback, $xml);
}
return $xml;
}
/**
* Scan theXML for use of <!ENTITY to prevent XXE/XEE attacks.
*
* @param string $filestream
*
* @return string
*/
public function scanFile($filestream)
{
return $this->scan(file_get_contents($filestream));
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/RowCellIterator.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/RowCellIterator.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Cell\Cell;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
/**
* @extends CellIterator<string>
*/
class RowCellIterator extends CellIterator
{
/**
* Current iterator position.
*
* @var int
*/
private $currentColumnIndex;
/**
* Row index.
*
* @var int
*/
private $rowIndex = 1;
/**
* Start position.
*
* @var int
*/
private $startColumnIndex = 1;
/**
* End position.
*
* @var int
*/
private $endColumnIndex = 1;
/**
* Create a new column iterator.
*
* @param Worksheet $worksheet The worksheet to iterate over
* @param int $rowIndex The row that we want to iterate
* @param string $startColumn The column address at which to start iterating
* @param string $endColumn Optionally, the column address at which to stop iterating
*/
public function __construct(Worksheet $worksheet, $rowIndex = 1, $startColumn = 'A', $endColumn = null)
{
// Set subject and row index
$this->worksheet = $worksheet;
$this->rowIndex = $rowIndex;
$this->resetEnd($endColumn);
$this->resetStart($startColumn);
}
/**
* (Re)Set the start column and the current column pointer.
*
* @param string $startColumn The column address at which to start iterating
*
* @return $this
*/
public function resetStart(string $startColumn = 'A')
{
$this->startColumnIndex = Coordinate::columnIndexFromString($startColumn);
$this->adjustForExistingOnlyRange();
$this->seek(Coordinate::stringFromColumnIndex($this->startColumnIndex));
return $this;
}
/**
* (Re)Set the end column.
*
* @param string $endColumn The column address at which to stop iterating
*
* @return $this
*/
public function resetEnd($endColumn = null)
{
$endColumn = $endColumn ?: $this->worksheet->getHighestColumn();
$this->endColumnIndex = Coordinate::columnIndexFromString($endColumn);
$this->adjustForExistingOnlyRange();
return $this;
}
/**
* Set the column pointer to the selected column.
*
* @param string $column The column address to set the current pointer at
*
* @return $this
*/
public function seek(string $column = 'A')
{
$columnx = $column;
$column = Coordinate::columnIndexFromString($column);
if ($this->onlyExistingCells && !($this->worksheet->cellExistsByColumnAndRow($column, $this->rowIndex))) {
throw new PhpSpreadsheetException('In "IterateOnlyExistingCells" mode and Cell does not exist');
}
if (($column < $this->startColumnIndex) || ($column > $this->endColumnIndex)) {
throw new PhpSpreadsheetException("Column $columnx is out of range ({$this->startColumnIndex} - {$this->endColumnIndex})");
}
$this->currentColumnIndex = $column;
return $this;
}
/**
* Rewind the iterator to the starting column.
*/
public function rewind(): void
{
$this->currentColumnIndex = $this->startColumnIndex;
}
/**
* Return the current cell in this worksheet row.
*/
public function current(): ?Cell
{
return $this->worksheet->getCellByColumnAndRow($this->currentColumnIndex, $this->rowIndex);
}
/**
* Return the current iterator key.
*/
public function key(): string
{
return Coordinate::stringFromColumnIndex($this->currentColumnIndex);
}
/**
* Set the iterator to its next value.
*/
public function next(): void
{
do {
++$this->currentColumnIndex;
} while (($this->onlyExistingCells) && (!$this->worksheet->cellExistsByColumnAndRow($this->currentColumnIndex, $this->rowIndex)) && ($this->currentColumnIndex <= $this->endColumnIndex));
}
/**
* Set the iterator to its previous value.
*/
public function prev(): void
{
do {
--$this->currentColumnIndex;
} while (($this->onlyExistingCells) && (!$this->worksheet->cellExistsByColumnAndRow($this->currentColumnIndex, $this->rowIndex)) && ($this->currentColumnIndex >= $this->startColumnIndex));
}
/**
* Indicate if more columns exist in the worksheet range of columns that we're iterating.
*/
public function valid(): bool
{
return $this->currentColumnIndex <= $this->endColumnIndex && $this->currentColumnIndex >= $this->startColumnIndex;
}
/**
* Return the current iterator position.
*/
public function getCurrentColumnIndex(): int
{
return $this->currentColumnIndex;
}
/**
* Validate start/end values for "IterateOnlyExistingCells" mode, and adjust if necessary.
*/
protected function adjustForExistingOnlyRange(): void
{
if ($this->onlyExistingCells) {
while ((!$this->worksheet->cellExistsByColumnAndRow($this->startColumnIndex, $this->rowIndex)) && ($this->startColumnIndex <= $this->endColumnIndex)) {
++$this->startColumnIndex;
}
while ((!$this->worksheet->cellExistsByColumnAndRow($this->endColumnIndex, $this->rowIndex)) && ($this->endColumnIndex >= $this->startColumnIndex)) {
--$this->endColumnIndex;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Drawing.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Drawing.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
class Drawing extends BaseDrawing
{
/**
* Path.
*
* @var string
*/
private $path;
/**
* Whether or not we are dealing with a URL.
*
* @var bool
*/
private $isUrl;
/**
* Create a new Drawing.
*/
public function __construct()
{
// Initialise values
$this->path = '';
$this->isUrl = false;
// Initialize parent
parent::__construct();
}
/**
* Get Filename.
*
* @return string
*/
public function getFilename()
{
return basename($this->path);
}
/**
* Get indexed filename (using image index).
*/
public function getIndexedFilename(): string
{
$fileName = $this->getFilename();
$fileName = str_replace(' ', '_', $fileName);
return str_replace('.' . $this->getExtension(), '', $fileName) . $this->getImageIndex() . '.' . $this->getExtension();
}
/**
* Get Extension.
*
* @return string
*/
public function getExtension()
{
$exploded = explode('.', basename($this->path));
return $exploded[count($exploded) - 1];
}
/**
* Get Path.
*
* @return string
*/
public function getPath()
{
return $this->path;
}
/**
* Set Path.
*
* @param string $path File path
* @param bool $verifyFile Verify file
*
* @return $this
*/
public function setPath($path, $verifyFile = true)
{
if ($verifyFile) {
// Check if a URL has been passed. https://stackoverflow.com/a/2058596/1252979
if (filter_var($path, FILTER_VALIDATE_URL)) {
$this->path = $path;
// Implicit that it is a URL, rather store info than running check above on value in other places.
$this->isUrl = true;
$imageContents = file_get_contents($path);
$filePath = tempnam(sys_get_temp_dir(), 'Drawing');
if ($filePath) {
file_put_contents($filePath, $imageContents);
if (file_exists($filePath)) {
if ($this->width == 0 && $this->height == 0) {
// Get width/height
[$this->width, $this->height] = getimagesize($filePath);
}
unlink($filePath);
}
}
} elseif (file_exists($path)) {
$this->path = $path;
if ($this->width == 0 && $this->height == 0) {
// Get width/height
[$this->width, $this->height] = getimagesize($path);
}
} else {
throw new PhpSpreadsheetException("File $path not found!");
}
} else {
$this->path = $path;
}
return $this;
}
/**
* Get isURL.
*/
public function getIsURL(): bool
{
return $this->isUrl;
}
/**
* Set isURL.
*
* @return $this
*/
public function setIsURL(bool $isUrl): self
{
$this->isUrl = $isUrl;
return $this;
}
/**
* Get hash code.
*
* @return string Hash code
*/
public function getHashCode()
{
return md5(
$this->path .
parent::getHashCode() .
__CLASS__
);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/ColumnCellIterator.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/ColumnCellIterator.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Cell\Cell;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
/**
* @extends CellIterator<int>
*/
class ColumnCellIterator extends CellIterator
{
/**
* Current iterator position.
*
* @var int
*/
private $currentRow;
/**
* Column index.
*
* @var int
*/
private $columnIndex;
/**
* Start position.
*
* @var int
*/
private $startRow = 1;
/**
* End position.
*
* @var int
*/
private $endRow = 1;
/**
* Create a new row iterator.
*
* @param Worksheet $subject The worksheet to iterate over
* @param string $columnIndex The column that we want to iterate
* @param int $startRow The row number at which to start iterating
* @param int $endRow Optionally, the row number at which to stop iterating
*/
public function __construct(Worksheet $subject, $columnIndex = 'A', $startRow = 1, $endRow = null)
{
// Set subject
$this->worksheet = $subject;
$this->columnIndex = Coordinate::columnIndexFromString($columnIndex);
$this->resetEnd($endRow);
$this->resetStart($startRow);
}
/**
* (Re)Set the start row and the current row pointer.
*
* @param int $startRow The row number at which to start iterating
*
* @return $this
*/
public function resetStart(int $startRow = 1)
{
$this->startRow = $startRow;
$this->adjustForExistingOnlyRange();
$this->seek($startRow);
return $this;
}
/**
* (Re)Set the end row.
*
* @param int $endRow The row number at which to stop iterating
*
* @return $this
*/
public function resetEnd($endRow = null)
{
$this->endRow = $endRow ?: $this->worksheet->getHighestRow();
$this->adjustForExistingOnlyRange();
return $this;
}
/**
* Set the row pointer to the selected row.
*
* @param int $row The row number to set the current pointer at
*
* @return $this
*/
public function seek(int $row = 1)
{
if ($this->onlyExistingCells && !($this->worksheet->cellExistsByColumnAndRow($this->columnIndex, $row))) {
throw new PhpSpreadsheetException('In "IterateOnlyExistingCells" mode and Cell does not exist');
}
if (($row < $this->startRow) || ($row > $this->endRow)) {
throw new PhpSpreadsheetException("Row $row is out of range ({$this->startRow} - {$this->endRow})");
}
$this->currentRow = $row;
return $this;
}
/**
* Rewind the iterator to the starting row.
*/
public function rewind(): void
{
$this->currentRow = $this->startRow;
}
/**
* Return the current cell in this worksheet column.
*/
public function current(): ?Cell
{
return $this->worksheet->getCellByColumnAndRow($this->columnIndex, $this->currentRow);
}
/**
* Return the current iterator key.
*/
public function key(): int
{
return $this->currentRow;
}
/**
* Set the iterator to its next value.
*/
public function next(): void
{
do {
++$this->currentRow;
} while (
($this->onlyExistingCells) &&
(!$this->worksheet->cellExistsByColumnAndRow($this->columnIndex, $this->currentRow)) &&
($this->currentRow <= $this->endRow)
);
}
/**
* Set the iterator to its previous value.
*/
public function prev(): void
{
do {
--$this->currentRow;
} while (
($this->onlyExistingCells) &&
(!$this->worksheet->cellExistsByColumnAndRow($this->columnIndex, $this->currentRow)) &&
($this->currentRow >= $this->startRow)
);
}
/**
* Indicate if more rows exist in the worksheet range of rows that we're iterating.
*/
public function valid(): bool
{
return $this->currentRow <= $this->endRow && $this->currentRow >= $this->startRow;
}
/**
* Validate start/end values for "IterateOnlyExistingCells" mode, and adjust if necessary.
*/
protected function adjustForExistingOnlyRange(): void
{
if ($this->onlyExistingCells) {
while (
(!$this->worksheet->cellExistsByColumnAndRow($this->columnIndex, $this->startRow)) &&
($this->startRow <= $this->endRow)
) {
++$this->startRow;
}
while (
(!$this->worksheet->cellExistsByColumnAndRow($this->columnIndex, $this->endRow)) &&
($this->endRow >= $this->startRow)
) {
--$this->endRow;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Dimension.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Dimension.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
abstract class Dimension
{
/**
* Visible?
*
* @var bool
*/
private $visible = true;
/**
* Outline level.
*
* @var int
*/
private $outlineLevel = 0;
/**
* Collapsed.
*
* @var bool
*/
private $collapsed = false;
/**
* Index to cellXf. Null value means row has no explicit cellXf format.
*
* @var null|int
*/
private $xfIndex;
/**
* Create a new Dimension.
*
* @param int $initialValue Numeric row index
*/
public function __construct($initialValue = null)
{
// set dimension as unformatted by default
$this->xfIndex = $initialValue;
}
/**
* Get Visible.
*/
public function getVisible(): bool
{
return $this->visible;
}
/**
* Set Visible.
*
* @return $this
*/
public function setVisible(bool $visible)
{
$this->visible = $visible;
return $this;
}
/**
* Get Outline Level.
*/
public function getOutlineLevel(): int
{
return $this->outlineLevel;
}
/**
* Set Outline Level.
* Value must be between 0 and 7.
*
* @return $this
*/
public function setOutlineLevel(int $level)
{
if ($level < 0 || $level > 7) {
throw new PhpSpreadsheetException('Outline level must range between 0 and 7.');
}
$this->outlineLevel = $level;
return $this;
}
/**
* Get Collapsed.
*/
public function getCollapsed(): bool
{
return $this->collapsed;
}
/**
* Set Collapsed.
*
* @return $this
*/
public function setCollapsed(bool $collapsed)
{
$this->collapsed = $collapsed;
return $this;
}
/**
* Get index to cellXf.
*
* @return int
*/
public function getXfIndex(): ?int
{
return $this->xfIndex;
}
/**
* Set index to cellXf.
*
* @return $this
*/
public function setXfIndex(int $XfIndex)
{
$this->xfIndex = $XfIndex;
return $this;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/PageSetup.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/PageSetup.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
/**
* <code>
* Paper size taken from Office Open XML Part 4 - Markup Language Reference, page 1988:.
*
* 1 = Letter paper (8.5 in. by 11 in.)
* 2 = Letter small paper (8.5 in. by 11 in.)
* 3 = Tabloid paper (11 in. by 17 in.)
* 4 = Ledger paper (17 in. by 11 in.)
* 5 = Legal paper (8.5 in. by 14 in.)
* 6 = Statement paper (5.5 in. by 8.5 in.)
* 7 = Executive paper (7.25 in. by 10.5 in.)
* 8 = A3 paper (297 mm by 420 mm)
* 9 = A4 paper (210 mm by 297 mm)
* 10 = A4 small paper (210 mm by 297 mm)
* 11 = A5 paper (148 mm by 210 mm)
* 12 = B4 paper (250 mm by 353 mm)
* 13 = B5 paper (176 mm by 250 mm)
* 14 = Folio paper (8.5 in. by 13 in.)
* 15 = Quarto paper (215 mm by 275 mm)
* 16 = Standard paper (10 in. by 14 in.)
* 17 = Standard paper (11 in. by 17 in.)
* 18 = Note paper (8.5 in. by 11 in.)
* 19 = #9 envelope (3.875 in. by 8.875 in.)
* 20 = #10 envelope (4.125 in. by 9.5 in.)
* 21 = #11 envelope (4.5 in. by 10.375 in.)
* 22 = #12 envelope (4.75 in. by 11 in.)
* 23 = #14 envelope (5 in. by 11.5 in.)
* 24 = C paper (17 in. by 22 in.)
* 25 = D paper (22 in. by 34 in.)
* 26 = E paper (34 in. by 44 in.)
* 27 = DL envelope (110 mm by 220 mm)
* 28 = C5 envelope (162 mm by 229 mm)
* 29 = C3 envelope (324 mm by 458 mm)
* 30 = C4 envelope (229 mm by 324 mm)
* 31 = C6 envelope (114 mm by 162 mm)
* 32 = C65 envelope (114 mm by 229 mm)
* 33 = B4 envelope (250 mm by 353 mm)
* 34 = B5 envelope (176 mm by 250 mm)
* 35 = B6 envelope (176 mm by 125 mm)
* 36 = Italy envelope (110 mm by 230 mm)
* 37 = Monarch envelope (3.875 in. by 7.5 in.).
* 38 = 6 3/4 envelope (3.625 in. by 6.5 in.)
* 39 = US standard fanfold (14.875 in. by 11 in.)
* 40 = German standard fanfold (8.5 in. by 12 in.)
* 41 = German legal fanfold (8.5 in. by 13 in.)
* 42 = ISO B4 (250 mm by 353 mm)
* 43 = Japanese double postcard (200 mm by 148 mm)
* 44 = Standard paper (9 in. by 11 in.)
* 45 = Standard paper (10 in. by 11 in.)
* 46 = Standard paper (15 in. by 11 in.)
* 47 = Invite envelope (220 mm by 220 mm)
* 50 = Letter extra paper (9.275 in. by 12 in.)
* 51 = Legal extra paper (9.275 in. by 15 in.)
* 52 = Tabloid extra paper (11.69 in. by 18 in.)
* 53 = A4 extra paper (236 mm by 322 mm)
* 54 = Letter transverse paper (8.275 in. by 11 in.)
* 55 = A4 transverse paper (210 mm by 297 mm)
* 56 = Letter extra transverse paper (9.275 in. by 12 in.)
* 57 = SuperA/SuperA/A4 paper (227 mm by 356 mm)
* 58 = SuperB/SuperB/A3 paper (305 mm by 487 mm)
* 59 = Letter plus paper (8.5 in. by 12.69 in.)
* 60 = A4 plus paper (210 mm by 330 mm)
* 61 = A5 transverse paper (148 mm by 210 mm)
* 62 = JIS B5 transverse paper (182 mm by 257 mm)
* 63 = A3 extra paper (322 mm by 445 mm)
* 64 = A5 extra paper (174 mm by 235 mm)
* 65 = ISO B5 extra paper (201 mm by 276 mm)
* 66 = A2 paper (420 mm by 594 mm)
* 67 = A3 transverse paper (297 mm by 420 mm)
* 68 = A3 extra transverse paper (322 mm by 445 mm)
* </code>
*/
class PageSetup
{
// Paper size
const PAPERSIZE_LETTER = 1;
const PAPERSIZE_LETTER_SMALL = 2;
const PAPERSIZE_TABLOID = 3;
const PAPERSIZE_LEDGER = 4;
const PAPERSIZE_LEGAL = 5;
const PAPERSIZE_STATEMENT = 6;
const PAPERSIZE_EXECUTIVE = 7;
const PAPERSIZE_A3 = 8;
const PAPERSIZE_A4 = 9;
const PAPERSIZE_A4_SMALL = 10;
const PAPERSIZE_A5 = 11;
const PAPERSIZE_B4 = 12;
const PAPERSIZE_B5 = 13;
const PAPERSIZE_FOLIO = 14;
const PAPERSIZE_QUARTO = 15;
const PAPERSIZE_STANDARD_1 = 16;
const PAPERSIZE_STANDARD_2 = 17;
const PAPERSIZE_NOTE = 18;
const PAPERSIZE_NO9_ENVELOPE = 19;
const PAPERSIZE_NO10_ENVELOPE = 20;
const PAPERSIZE_NO11_ENVELOPE = 21;
const PAPERSIZE_NO12_ENVELOPE = 22;
const PAPERSIZE_NO14_ENVELOPE = 23;
const PAPERSIZE_C = 24;
const PAPERSIZE_D = 25;
const PAPERSIZE_E = 26;
const PAPERSIZE_DL_ENVELOPE = 27;
const PAPERSIZE_C5_ENVELOPE = 28;
const PAPERSIZE_C3_ENVELOPE = 29;
const PAPERSIZE_C4_ENVELOPE = 30;
const PAPERSIZE_C6_ENVELOPE = 31;
const PAPERSIZE_C65_ENVELOPE = 32;
const PAPERSIZE_B4_ENVELOPE = 33;
const PAPERSIZE_B5_ENVELOPE = 34;
const PAPERSIZE_B6_ENVELOPE = 35;
const PAPERSIZE_ITALY_ENVELOPE = 36;
const PAPERSIZE_MONARCH_ENVELOPE = 37;
const PAPERSIZE_6_3_4_ENVELOPE = 38;
const PAPERSIZE_US_STANDARD_FANFOLD = 39;
const PAPERSIZE_GERMAN_STANDARD_FANFOLD = 40;
const PAPERSIZE_GERMAN_LEGAL_FANFOLD = 41;
const PAPERSIZE_ISO_B4 = 42;
const PAPERSIZE_JAPANESE_DOUBLE_POSTCARD = 43;
const PAPERSIZE_STANDARD_PAPER_1 = 44;
const PAPERSIZE_STANDARD_PAPER_2 = 45;
const PAPERSIZE_STANDARD_PAPER_3 = 46;
const PAPERSIZE_INVITE_ENVELOPE = 47;
const PAPERSIZE_LETTER_EXTRA_PAPER = 48;
const PAPERSIZE_LEGAL_EXTRA_PAPER = 49;
const PAPERSIZE_TABLOID_EXTRA_PAPER = 50;
const PAPERSIZE_A4_EXTRA_PAPER = 51;
const PAPERSIZE_LETTER_TRANSVERSE_PAPER = 52;
const PAPERSIZE_A4_TRANSVERSE_PAPER = 53;
const PAPERSIZE_LETTER_EXTRA_TRANSVERSE_PAPER = 54;
const PAPERSIZE_SUPERA_SUPERA_A4_PAPER = 55;
const PAPERSIZE_SUPERB_SUPERB_A3_PAPER = 56;
const PAPERSIZE_LETTER_PLUS_PAPER = 57;
const PAPERSIZE_A4_PLUS_PAPER = 58;
const PAPERSIZE_A5_TRANSVERSE_PAPER = 59;
const PAPERSIZE_JIS_B5_TRANSVERSE_PAPER = 60;
const PAPERSIZE_A3_EXTRA_PAPER = 61;
const PAPERSIZE_A5_EXTRA_PAPER = 62;
const PAPERSIZE_ISO_B5_EXTRA_PAPER = 63;
const PAPERSIZE_A2_PAPER = 64;
const PAPERSIZE_A3_TRANSVERSE_PAPER = 65;
const PAPERSIZE_A3_EXTRA_TRANSVERSE_PAPER = 66;
// Page orientation
const ORIENTATION_DEFAULT = 'default';
const ORIENTATION_LANDSCAPE = 'landscape';
const ORIENTATION_PORTRAIT = 'portrait';
// Print Range Set Method
const SETPRINTRANGE_OVERWRITE = 'O';
const SETPRINTRANGE_INSERT = 'I';
const PAGEORDER_OVER_THEN_DOWN = 'overThenDown';
const PAGEORDER_DOWN_THEN_OVER = 'downThenOver';
/**
* Paper size.
*
* @var int
*/
private $paperSize = self::PAPERSIZE_LETTER;
/**
* Orientation.
*
* @var string
*/
private $orientation = self::ORIENTATION_DEFAULT;
/**
* Scale (Print Scale).
*
* Print scaling. Valid values range from 10 to 400
* This setting is overridden when fitToWidth and/or fitToHeight are in use
*
* @var null|int
*/
private $scale = 100;
/**
* Fit To Page
* Whether scale or fitToWith / fitToHeight applies.
*
* @var bool
*/
private $fitToPage = false;
/**
* Fit To Height
* Number of vertical pages to fit on.
*
* @var null|int
*/
private $fitToHeight = 1;
/**
* Fit To Width
* Number of horizontal pages to fit on.
*
* @var null|int
*/
private $fitToWidth = 1;
/**
* Columns to repeat at left.
*
* @var array Containing start column and end column, empty array if option unset
*/
private $columnsToRepeatAtLeft = ['', ''];
/**
* Rows to repeat at top.
*
* @var array Containing start row number and end row number, empty array if option unset
*/
private $rowsToRepeatAtTop = [0, 0];
/**
* Center page horizontally.
*
* @var bool
*/
private $horizontalCentered = false;
/**
* Center page vertically.
*
* @var bool
*/
private $verticalCentered = false;
/**
* Print area.
*
* @var null|string
*/
private $printArea;
/**
* First page number.
*
* @var int
*/
private $firstPageNumber;
private $pageOrder = self::PAGEORDER_DOWN_THEN_OVER;
/**
* Create a new PageSetup.
*/
public function __construct()
{
}
/**
* Get Paper Size.
*
* @return int
*/
public function getPaperSize()
{
return $this->paperSize;
}
/**
* Set Paper Size.
*
* @param int $paperSize see self::PAPERSIZE_*
*
* @return $this
*/
public function setPaperSize($paperSize)
{
$this->paperSize = $paperSize;
return $this;
}
/**
* Get Orientation.
*
* @return string
*/
public function getOrientation()
{
return $this->orientation;
}
/**
* Set Orientation.
*
* @param string $orientation see self::ORIENTATION_*
*
* @return $this
*/
public function setOrientation($orientation)
{
$this->orientation = $orientation;
return $this;
}
/**
* Get Scale.
*
* @return null|int
*/
public function getScale()
{
return $this->scale;
}
/**
* Set Scale.
* Print scaling. Valid values range from 10 to 400
* This setting is overridden when fitToWidth and/or fitToHeight are in use.
*
* @param null|int $scale
* @param bool $update Update fitToPage so scaling applies rather than fitToHeight / fitToWidth
*
* @return $this
*/
public function setScale($scale, $update = true)
{
// Microsoft Office Excel 2007 only allows setting a scale between 10 and 400 via the user interface,
// but it is apparently still able to handle any scale >= 0, where 0 results in 100
if (($scale >= 0) || $scale === null) {
$this->scale = $scale;
if ($update) {
$this->fitToPage = false;
}
} else {
throw new PhpSpreadsheetException('Scale must not be negative');
}
return $this;
}
/**
* Get Fit To Page.
*
* @return bool
*/
public function getFitToPage()
{
return $this->fitToPage;
}
/**
* Set Fit To Page.
*
* @param bool $fitToPage
*
* @return $this
*/
public function setFitToPage($fitToPage)
{
$this->fitToPage = $fitToPage;
return $this;
}
/**
* Get Fit To Height.
*
* @return null|int
*/
public function getFitToHeight()
{
return $this->fitToHeight;
}
/**
* Set Fit To Height.
*
* @param null|int $fitToHeight
* @param bool $update Update fitToPage so it applies rather than scaling
*
* @return $this
*/
public function setFitToHeight($fitToHeight, $update = true)
{
$this->fitToHeight = $fitToHeight;
if ($update) {
$this->fitToPage = true;
}
return $this;
}
/**
* Get Fit To Width.
*
* @return null|int
*/
public function getFitToWidth()
{
return $this->fitToWidth;
}
/**
* Set Fit To Width.
*
* @param null|int $value
* @param bool $update Update fitToPage so it applies rather than scaling
*
* @return $this
*/
public function setFitToWidth($value, $update = true)
{
$this->fitToWidth = $value;
if ($update) {
$this->fitToPage = true;
}
return $this;
}
/**
* Is Columns to repeat at left set?
*
* @return bool
*/
public function isColumnsToRepeatAtLeftSet()
{
if (is_array($this->columnsToRepeatAtLeft)) {
if ($this->columnsToRepeatAtLeft[0] != '' && $this->columnsToRepeatAtLeft[1] != '') {
return true;
}
}
return false;
}
/**
* Get Columns to repeat at left.
*
* @return array Containing start column and end column, empty array if option unset
*/
public function getColumnsToRepeatAtLeft()
{
return $this->columnsToRepeatAtLeft;
}
/**
* Set Columns to repeat at left.
*
* @param array $columnsToRepeatAtLeft Containing start column and end column, empty array if option unset
*
* @return $this
*/
public function setColumnsToRepeatAtLeft(array $columnsToRepeatAtLeft)
{
$this->columnsToRepeatAtLeft = $columnsToRepeatAtLeft;
return $this;
}
/**
* Set Columns to repeat at left by start and end.
*
* @param string $start eg: 'A'
* @param string $end eg: 'B'
*
* @return $this
*/
public function setColumnsToRepeatAtLeftByStartAndEnd($start, $end)
{
$this->columnsToRepeatAtLeft = [$start, $end];
return $this;
}
/**
* Is Rows to repeat at top set?
*
* @return bool
*/
public function isRowsToRepeatAtTopSet()
{
if (is_array($this->rowsToRepeatAtTop)) {
if ($this->rowsToRepeatAtTop[0] != 0 && $this->rowsToRepeatAtTop[1] != 0) {
return true;
}
}
return false;
}
/**
* Get Rows to repeat at top.
*
* @return array Containing start column and end column, empty array if option unset
*/
public function getRowsToRepeatAtTop()
{
return $this->rowsToRepeatAtTop;
}
/**
* Set Rows to repeat at top.
*
* @param array $rowsToRepeatAtTop Containing start column and end column, empty array if option unset
*
* @return $this
*/
public function setRowsToRepeatAtTop(array $rowsToRepeatAtTop)
{
$this->rowsToRepeatAtTop = $rowsToRepeatAtTop;
return $this;
}
/**
* Set Rows to repeat at top by start and end.
*
* @param int $start eg: 1
* @param int $end eg: 1
*
* @return $this
*/
public function setRowsToRepeatAtTopByStartAndEnd($start, $end)
{
$this->rowsToRepeatAtTop = [$start, $end];
return $this;
}
/**
* Get center page horizontally.
*
* @return bool
*/
public function getHorizontalCentered()
{
return $this->horizontalCentered;
}
/**
* Set center page horizontally.
*
* @param bool $value
*
* @return $this
*/
public function setHorizontalCentered($value)
{
$this->horizontalCentered = $value;
return $this;
}
/**
* Get center page vertically.
*
* @return bool
*/
public function getVerticalCentered()
{
return $this->verticalCentered;
}
/**
* Set center page vertically.
*
* @param bool $value
*
* @return $this
*/
public function setVerticalCentered($value)
{
$this->verticalCentered = $value;
return $this;
}
/**
* Get print area.
*
* @param int $index Identifier for a specific print area range if several ranges have been set
* Default behaviour, or a index value of 0, will return all ranges as a comma-separated string
* Otherwise, the specific range identified by the value of $index will be returned
* Print areas are numbered from 1
*
* @return string
*/
public function getPrintArea($index = 0)
{
if ($index == 0) {
return $this->printArea;
}
$printAreas = explode(',', $this->printArea);
if (isset($printAreas[$index - 1])) {
return $printAreas[$index - 1];
}
throw new PhpSpreadsheetException('Requested Print Area does not exist');
}
/**
* Is print area set?
*
* @param int $index Identifier for a specific print area range if several ranges have been set
* Default behaviour, or an index value of 0, will identify whether any print range is set
* Otherwise, existence of the range identified by the value of $index will be returned
* Print areas are numbered from 1
*
* @return bool
*/
public function isPrintAreaSet($index = 0)
{
if ($index == 0) {
return $this->printArea !== null;
}
$printAreas = explode(',', $this->printArea);
return isset($printAreas[$index - 1]);
}
/**
* Clear a print area.
*
* @param int $index Identifier for a specific print area range if several ranges have been set
* Default behaviour, or an index value of 0, will clear all print ranges that are set
* Otherwise, the range identified by the value of $index will be removed from the series
* Print areas are numbered from 1
*
* @return $this
*/
public function clearPrintArea($index = 0)
{
if ($index == 0) {
$this->printArea = null;
} else {
$printAreas = explode(',', $this->printArea);
if (isset($printAreas[$index - 1])) {
unset($printAreas[$index - 1]);
$this->printArea = implode(',', $printAreas);
}
}
return $this;
}
/**
* Set print area. e.g. 'A1:D10' or 'A1:D10,G5:M20'.
*
* @param string $value
* @param int $index Identifier for a specific print area range allowing several ranges to be set
* When the method is "O"verwrite, then a positive integer index will overwrite that indexed
* entry in the print areas list; a negative index value will identify which entry to
* overwrite working bacward through the print area to the list, with the last entry as -1.
* Specifying an index value of 0, will overwrite <b>all</b> existing print ranges.
* When the method is "I"nsert, then a positive index will insert after that indexed entry in
* the print areas list, while a negative index will insert before the indexed entry.
* Specifying an index value of 0, will always append the new print range at the end of the
* list.
* Print areas are numbered from 1
* @param string $method Determines the method used when setting multiple print areas
* Default behaviour, or the "O" method, overwrites existing print area
* The "I" method, inserts the new print area before any specified index, or at the end of the list
*
* @return $this
*/
public function setPrintArea($value, $index = 0, $method = self::SETPRINTRANGE_OVERWRITE)
{
if (strpos($value, '!') !== false) {
throw new PhpSpreadsheetException('Cell coordinate must not specify a worksheet.');
} elseif (strpos($value, ':') === false) {
throw new PhpSpreadsheetException('Cell coordinate must be a range of cells.');
} elseif (strpos($value, '$') !== false) {
throw new PhpSpreadsheetException('Cell coordinate must not be absolute.');
}
$value = strtoupper($value);
if (!$this->printArea) {
$index = 0;
}
if ($method == self::SETPRINTRANGE_OVERWRITE) {
if ($index == 0) {
$this->printArea = $value;
} else {
$printAreas = explode(',', $this->printArea);
if ($index < 0) {
$index = count($printAreas) - abs($index) + 1;
}
if (($index <= 0) || ($index > count($printAreas))) {
throw new PhpSpreadsheetException('Invalid index for setting print range.');
}
$printAreas[$index - 1] = $value;
$this->printArea = implode(',', $printAreas);
}
} elseif ($method == self::SETPRINTRANGE_INSERT) {
if ($index == 0) {
$this->printArea = $this->printArea ? ($this->printArea . ',' . $value) : $value;
} else {
$printAreas = explode(',', $this->printArea);
if ($index < 0) {
$index = abs($index) - 1;
}
if ($index > count($printAreas)) {
throw new PhpSpreadsheetException('Invalid index for setting print range.');
}
$printAreas = array_merge(array_slice($printAreas, 0, $index), [$value], array_slice($printAreas, $index));
$this->printArea = implode(',', $printAreas);
}
} else {
throw new PhpSpreadsheetException('Invalid method for setting print range.');
}
return $this;
}
/**
* Add a new print area (e.g. 'A1:D10' or 'A1:D10,G5:M20') to the list of print areas.
*
* @param string $value
* @param int $index Identifier for a specific print area range allowing several ranges to be set
* A positive index will insert after that indexed entry in the print areas list, while a
* negative index will insert before the indexed entry.
* Specifying an index value of 0, will always append the new print range at the end of the
* list.
* Print areas are numbered from 1
*
* @return $this
*/
public function addPrintArea($value, $index = -1)
{
return $this->setPrintArea($value, $index, self::SETPRINTRANGE_INSERT);
}
/**
* Set print area.
*
* @param int $column1 Column 1
* @param int $row1 Row 1
* @param int $column2 Column 2
* @param int $row2 Row 2
* @param int $index Identifier for a specific print area range allowing several ranges to be set
* When the method is "O"verwrite, then a positive integer index will overwrite that indexed
* entry in the print areas list; a negative index value will identify which entry to
* overwrite working backward through the print area to the list, with the last entry as -1.
* Specifying an index value of 0, will overwrite <b>all</b> existing print ranges.
* When the method is "I"nsert, then a positive index will insert after that indexed entry in
* the print areas list, while a negative index will insert before the indexed entry.
* Specifying an index value of 0, will always append the new print range at the end of the
* list.
* Print areas are numbered from 1
* @param string $method Determines the method used when setting multiple print areas
* Default behaviour, or the "O" method, overwrites existing print area
* The "I" method, inserts the new print area before any specified index, or at the end of the list
*
* @return $this
*/
public function setPrintAreaByColumnAndRow($column1, $row1, $column2, $row2, $index = 0, $method = self::SETPRINTRANGE_OVERWRITE)
{
return $this->setPrintArea(
Coordinate::stringFromColumnIndex($column1) . $row1 . ':' . Coordinate::stringFromColumnIndex($column2) . $row2,
$index,
$method
);
}
/**
* Add a new print area to the list of print areas.
*
* @param int $column1 Start Column for the print area
* @param int $row1 Start Row for the print area
* @param int $column2 End Column for the print area
* @param int $row2 End Row for the print area
* @param int $index Identifier for a specific print area range allowing several ranges to be set
* A positive index will insert after that indexed entry in the print areas list, while a
* negative index will insert before the indexed entry.
* Specifying an index value of 0, will always append the new print range at the end of the
* list.
* Print areas are numbered from 1
*
* @return $this
*/
public function addPrintAreaByColumnAndRow($column1, $row1, $column2, $row2, $index = -1)
{
return $this->setPrintArea(
Coordinate::stringFromColumnIndex($column1) . $row1 . ':' . Coordinate::stringFromColumnIndex($column2) . $row2,
$index,
self::SETPRINTRANGE_INSERT
);
}
/**
* Get first page number.
*
* @return int
*/
public function getFirstPageNumber()
{
return $this->firstPageNumber;
}
/**
* Set first page number.
*
* @param int $value
*
* @return $this
*/
public function setFirstPageNumber($value)
{
$this->firstPageNumber = $value;
return $this;
}
/**
* Reset first page number.
*
* @return $this
*/
public function resetFirstPageNumber()
{
return $this->setFirstPageNumber(null);
}
public function getPageOrder(): string
{
return $this->pageOrder;
}
public function setPageOrder(?string $pageOrder): self
{
if ($pageOrder === null || $pageOrder === self::PAGEORDER_DOWN_THEN_OVER || $pageOrder === self::PAGEORDER_OVER_THEN_DOWN) {
$this->pageOrder = $pageOrder ?? self::PAGEORDER_DOWN_THEN_OVER;
}
return $this;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Row.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Row.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
class Row
{
/**
* \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet.
*
* @var Worksheet
*/
private $worksheet;
/**
* Row index.
*
* @var int
*/
private $rowIndex = 0;
/**
* Create a new row.
*
* @param int $rowIndex
*/
public function __construct(?Worksheet $worksheet = null, $rowIndex = 1)
{
// Set parent and row index
$this->worksheet = $worksheet;
$this->rowIndex = $rowIndex;
}
/**
* Destructor.
*/
public function __destruct()
{
// @phpstan-ignore-next-line
$this->worksheet = null;
}
/**
* Get row index.
*/
public function getRowIndex(): int
{
return $this->rowIndex;
}
/**
* Get cell iterator.
*
* @param string $startColumn The column address at which to start iterating
* @param string $endColumn Optionally, the column address at which to stop iterating
*
* @return RowCellIterator
*/
public function getCellIterator($startColumn = 'A', $endColumn = null)
{
return new RowCellIterator($this->worksheet, $this->rowIndex, $startColumn, $endColumn);
}
/**
* Returns bound worksheet.
*/
public function getWorksheet(): Worksheet
{
return $this->worksheet;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/ColumnIterator.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/ColumnIterator.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use Iterator;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Exception;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
/**
* @implements Iterator<string, Column>
*/
class ColumnIterator implements Iterator
{
/**
* Worksheet to iterate.
*
* @var Worksheet
*/
private $worksheet;
/**
* Current iterator position.
*
* @var int
*/
private $currentColumnIndex = 1;
/**
* Start position.
*
* @var int
*/
private $startColumnIndex = 1;
/**
* End position.
*
* @var int
*/
private $endColumnIndex = 1;
/**
* Create a new column iterator.
*
* @param Worksheet $worksheet The worksheet to iterate over
* @param string $startColumn The column address at which to start iterating
* @param string $endColumn Optionally, the column address at which to stop iterating
*/
public function __construct(Worksheet $worksheet, $startColumn = 'A', $endColumn = null)
{
// Set subject
$this->worksheet = $worksheet;
$this->resetEnd($endColumn);
$this->resetStart($startColumn);
}
/**
* Destructor.
*/
public function __destruct()
{
// @phpstan-ignore-next-line
$this->worksheet = null;
}
/**
* (Re)Set the start column and the current column pointer.
*
* @param string $startColumn The column address at which to start iterating
*
* @return $this
*/
public function resetStart(string $startColumn = 'A')
{
$startColumnIndex = Coordinate::columnIndexFromString($startColumn);
if ($startColumnIndex > Coordinate::columnIndexFromString($this->worksheet->getHighestColumn())) {
throw new Exception(
"Start column ({$startColumn}) is beyond highest column ({$this->worksheet->getHighestColumn()})"
);
}
$this->startColumnIndex = $startColumnIndex;
if ($this->endColumnIndex < $this->startColumnIndex) {
$this->endColumnIndex = $this->startColumnIndex;
}
$this->seek($startColumn);
return $this;
}
/**
* (Re)Set the end column.
*
* @param string $endColumn The column address at which to stop iterating
*
* @return $this
*/
public function resetEnd($endColumn = null)
{
$endColumn = $endColumn ?: $this->worksheet->getHighestColumn();
$this->endColumnIndex = Coordinate::columnIndexFromString($endColumn);
return $this;
}
/**
* Set the column pointer to the selected column.
*
* @param string $column The column address to set the current pointer at
*
* @return $this
*/
public function seek(string $column = 'A')
{
$column = Coordinate::columnIndexFromString($column);
if (($column < $this->startColumnIndex) || ($column > $this->endColumnIndex)) {
throw new PhpSpreadsheetException(
"Column $column is out of range ({$this->startColumnIndex} - {$this->endColumnIndex})"
);
}
$this->currentColumnIndex = $column;
return $this;
}
/**
* Rewind the iterator to the starting column.
*/
public function rewind(): void
{
$this->currentColumnIndex = $this->startColumnIndex;
}
/**
* Return the current column in this worksheet.
*/
public function current(): Column
{
return new Column($this->worksheet, Coordinate::stringFromColumnIndex($this->currentColumnIndex));
}
/**
* Return the current iterator key.
*/
public function key(): string
{
return Coordinate::stringFromColumnIndex($this->currentColumnIndex);
}
/**
* Set the iterator to its next value.
*/
public function next(): void
{
++$this->currentColumnIndex;
}
/**
* Set the iterator to its previous value.
*/
public function prev(): void
{
--$this->currentColumnIndex;
}
/**
* Indicate if more columns exist in the worksheet range of columns that we're iterating.
*/
public function valid(): bool
{
return $this->currentColumnIndex <= $this->endColumnIndex && $this->currentColumnIndex >= $this->startColumnIndex;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/MemoryDrawing.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/MemoryDrawing.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use GdImage;
use PhpOffice\PhpSpreadsheet\Exception;
class MemoryDrawing extends BaseDrawing
{
// Rendering functions
const RENDERING_DEFAULT = 'imagepng';
const RENDERING_PNG = 'imagepng';
const RENDERING_GIF = 'imagegif';
const RENDERING_JPEG = 'imagejpeg';
// MIME types
const MIMETYPE_DEFAULT = 'image/png';
const MIMETYPE_PNG = 'image/png';
const MIMETYPE_GIF = 'image/gif';
const MIMETYPE_JPEG = 'image/jpeg';
/**
* Image resource.
*
* @var null|GdImage|resource
*/
private $imageResource;
/**
* Rendering function.
*
* @var string
*/
private $renderingFunction;
/**
* Mime type.
*
* @var string
*/
private $mimeType;
/**
* Unique name.
*
* @var string
*/
private $uniqueName;
/**
* Create a new MemoryDrawing.
*/
public function __construct()
{
// Initialise values
$this->renderingFunction = self::RENDERING_DEFAULT;
$this->mimeType = self::MIMETYPE_DEFAULT;
$this->uniqueName = md5(mt_rand(0, 9999) . time() . mt_rand(0, 9999));
// Initialize parent
parent::__construct();
}
public function __destruct()
{
if ($this->imageResource) {
imagedestroy($this->imageResource);
$this->imageResource = null;
}
}
public function __clone()
{
parent::__clone();
$this->cloneResource();
}
private function cloneResource(): void
{
if (!$this->imageResource) {
return;
}
$width = imagesx($this->imageResource);
$height = imagesy($this->imageResource);
if (imageistruecolor($this->imageResource)) {
$clone = imagecreatetruecolor($width, $height);
if (!$clone) {
throw new Exception('Could not clone image resource');
}
imagealphablending($clone, false);
imagesavealpha($clone, true);
} else {
$clone = imagecreate($width, $height);
if (!$clone) {
throw new Exception('Could not clone image resource');
}
// If the image has transparency...
$transparent = imagecolortransparent($this->imageResource);
if ($transparent >= 0) {
$rgb = imagecolorsforindex($this->imageResource, $transparent);
if ($rgb === false) {
throw new Exception('Could not get image colors');
}
imagesavealpha($clone, true);
$color = imagecolorallocatealpha($clone, $rgb['red'], $rgb['green'], $rgb['blue'], $rgb['alpha']);
if ($color === false) {
throw new Exception('Could not get image alpha color');
}
imagefill($clone, 0, 0, $color);
}
}
//Create the Clone!!
imagecopy($clone, $this->imageResource, 0, 0, 0, 0, $width, $height);
$this->imageResource = $clone;
}
/**
* Get image resource.
*
* @return null|GdImage|resource
*/
public function getImageResource()
{
return $this->imageResource;
}
/**
* Set image resource.
*
* @param GdImage|resource $value
*
* @return $this
*/
public function setImageResource($value)
{
$this->imageResource = $value;
if ($this->imageResource !== null) {
// Get width/height
$this->width = imagesx($this->imageResource);
$this->height = imagesy($this->imageResource);
}
return $this;
}
/**
* Get rendering function.
*
* @return string
*/
public function getRenderingFunction()
{
return $this->renderingFunction;
}
/**
* Set rendering function.
*
* @param string $value see self::RENDERING_*
*
* @return $this
*/
public function setRenderingFunction($value)
{
$this->renderingFunction = $value;
return $this;
}
/**
* Get mime type.
*
* @return string
*/
public function getMimeType()
{
return $this->mimeType;
}
/**
* Set mime type.
*
* @param string $value see self::MIMETYPE_*
*
* @return $this
*/
public function setMimeType($value)
{
$this->mimeType = $value;
return $this;
}
/**
* Get indexed filename (using image index).
*/
public function getIndexedFilename(): string
{
$extension = strtolower($this->getMimeType());
$extension = explode('/', $extension);
$extension = $extension[1];
return $this->uniqueName . $this->getImageIndex() . '.' . $extension;
}
/**
* Get hash code.
*
* @return string Hash code
*/
public function getHashCode()
{
return md5(
$this->renderingFunction .
$this->mimeType .
$this->uniqueName .
parent::getHashCode() .
__CLASS__
);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/CellIterator.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/CellIterator.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use Iterator;
use PhpOffice\PhpSpreadsheet\Cell\Cell;
/**
* @template TKey
* @implements Iterator<TKey, Cell>
*/
abstract class CellIterator implements Iterator
{
/**
* Worksheet to iterate.
*
* @var Worksheet
*/
protected $worksheet;
/**
* Iterate only existing cells.
*
* @var bool
*/
protected $onlyExistingCells = false;
/**
* Destructor.
*/
public function __destruct()
{
// @phpstan-ignore-next-line
$this->worksheet = null;
}
/**
* Get loop only existing cells.
*/
public function getIterateOnlyExistingCells(): bool
{
return $this->onlyExistingCells;
}
/**
* Validate start/end values for "IterateOnlyExistingCells" mode, and adjust if necessary.
*/
abstract protected function adjustForExistingOnlyRange();
/**
* Set the iterator to loop only existing cells.
*/
public function setIterateOnlyExistingCells(bool $value): void
{
$this->onlyExistingCells = (bool) $value;
$this->adjustForExistingOnlyRange();
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Worksheet.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Worksheet.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use ArrayObject;
use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Cell\Cell;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Cell\DataType;
use PhpOffice\PhpSpreadsheet\Cell\DataValidation;
use PhpOffice\PhpSpreadsheet\Cell\Hyperlink;
use PhpOffice\PhpSpreadsheet\Chart\Chart;
use PhpOffice\PhpSpreadsheet\Collection\Cells;
use PhpOffice\PhpSpreadsheet\Collection\CellsFactory;
use PhpOffice\PhpSpreadsheet\Comment;
use PhpOffice\PhpSpreadsheet\DefinedName;
use PhpOffice\PhpSpreadsheet\Exception;
use PhpOffice\PhpSpreadsheet\IComparable;
use PhpOffice\PhpSpreadsheet\ReferenceHelper;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Shared;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Style\Color;
use PhpOffice\PhpSpreadsheet\Style\Conditional;
use PhpOffice\PhpSpreadsheet\Style\NumberFormat;
use PhpOffice\PhpSpreadsheet\Style\Style;
class Worksheet implements IComparable
{
// Break types
const BREAK_NONE = 0;
const BREAK_ROW = 1;
const BREAK_COLUMN = 2;
// Sheet state
const SHEETSTATE_VISIBLE = 'visible';
const SHEETSTATE_HIDDEN = 'hidden';
const SHEETSTATE_VERYHIDDEN = 'veryHidden';
/**
* Maximum 31 characters allowed for sheet title.
*
* @var int
*/
const SHEET_TITLE_MAXIMUM_LENGTH = 31;
/**
* Invalid characters in sheet title.
*
* @var array
*/
private static $invalidCharacters = ['*', ':', '/', '\\', '?', '[', ']'];
/**
* Parent spreadsheet.
*
* @var Spreadsheet
*/
private $parent;
/**
* Collection of cells.
*
* @var Cells
*/
private $cellCollection;
/**
* Collection of row dimensions.
*
* @var RowDimension[]
*/
private $rowDimensions = [];
/**
* Default row dimension.
*
* @var RowDimension
*/
private $defaultRowDimension;
/**
* Collection of column dimensions.
*
* @var ColumnDimension[]
*/
private $columnDimensions = [];
/**
* Default column dimension.
*
* @var ColumnDimension
*/
private $defaultColumnDimension;
/**
* Collection of drawings.
*
* @var ArrayObject<int, BaseDrawing>
*/
private $drawingCollection;
/**
* Collection of Chart objects.
*
* @var ArrayObject<int, Chart>
*/
private $chartCollection;
/**
* Worksheet title.
*
* @var string
*/
private $title;
/**
* Sheet state.
*
* @var string
*/
private $sheetState;
/**
* Page setup.
*
* @var PageSetup
*/
private $pageSetup;
/**
* Page margins.
*
* @var PageMargins
*/
private $pageMargins;
/**
* Page header/footer.
*
* @var HeaderFooter
*/
private $headerFooter;
/**
* Sheet view.
*
* @var SheetView
*/
private $sheetView;
/**
* Protection.
*
* @var Protection
*/
private $protection;
/**
* Collection of styles.
*
* @var Style[]
*/
private $styles = [];
/**
* Conditional styles. Indexed by cell coordinate, e.g. 'A1'.
*
* @var array
*/
private $conditionalStylesCollection = [];
/**
* Is the current cell collection sorted already?
*
* @var bool
*/
private $cellCollectionIsSorted = false;
/**
* Collection of breaks.
*
* @var int[]
*/
private $breaks = [];
/**
* Collection of merged cell ranges.
*
* @var string[]
*/
private $mergeCells = [];
/**
* Collection of protected cell ranges.
*
* @var string[]
*/
private $protectedCells = [];
/**
* Autofilter Range and selection.
*
* @var AutoFilter
*/
private $autoFilter;
/**
* Freeze pane.
*
* @var null|string
*/
private $freezePane;
/**
* Default position of the right bottom pane.
*
* @var null|string
*/
private $topLeftCell;
/**
* Show gridlines?
*
* @var bool
*/
private $showGridlines = true;
/**
* Print gridlines?
*
* @var bool
*/
private $printGridlines = false;
/**
* Show row and column headers?
*
* @var bool
*/
private $showRowColHeaders = true;
/**
* Show summary below? (Row/Column outline).
*
* @var bool
*/
private $showSummaryBelow = true;
/**
* Show summary right? (Row/Column outline).
*
* @var bool
*/
private $showSummaryRight = true;
/**
* Collection of comments.
*
* @var Comment[]
*/
private $comments = [];
/**
* Active cell. (Only one!).
*
* @var string
*/
private $activeCell = 'A1';
/**
* Selected cells.
*
* @var string
*/
private $selectedCells = 'A1';
/**
* Cached highest column.
*
* @var int
*/
private $cachedHighestColumn = 1;
/**
* Cached highest row.
*
* @var int
*/
private $cachedHighestRow = 1;
/**
* Right-to-left?
*
* @var bool
*/
private $rightToLeft = false;
/**
* Hyperlinks. Indexed by cell coordinate, e.g. 'A1'.
*
* @var array
*/
private $hyperlinkCollection = [];
/**
* Data validation objects. Indexed by cell coordinate, e.g. 'A1'.
*
* @var array
*/
private $dataValidationCollection = [];
/**
* Tab color.
*
* @var null|Color
*/
private $tabColor;
/**
* Dirty flag.
*
* @var bool
*/
private $dirty = true;
/**
* Hash.
*
* @var string
*/
private $hash;
/**
* CodeName.
*
* @var string
*/
private $codeName;
/**
* Create a new worksheet.
*
* @param string $title
*/
public function __construct(?Spreadsheet $parent = null, $title = 'Worksheet')
{
// Set parent and title
$this->parent = $parent;
$this->setTitle($title, false);
// setTitle can change $pTitle
$this->setCodeName($this->getTitle());
$this->setSheetState(self::SHEETSTATE_VISIBLE);
$this->cellCollection = CellsFactory::getInstance($this);
// Set page setup
$this->pageSetup = new PageSetup();
// Set page margins
$this->pageMargins = new PageMargins();
// Set page header/footer
$this->headerFooter = new HeaderFooter();
// Set sheet view
$this->sheetView = new SheetView();
// Drawing collection
$this->drawingCollection = new ArrayObject();
// Chart collection
$this->chartCollection = new ArrayObject();
// Protection
$this->protection = new Protection();
// Default row dimension
$this->defaultRowDimension = new RowDimension(null);
// Default column dimension
$this->defaultColumnDimension = new ColumnDimension(null);
$this->autoFilter = new AutoFilter(null, $this);
}
/**
* Disconnect all cells from this Worksheet object,
* typically so that the worksheet object can be unset.
*/
public function disconnectCells(): void
{
if ($this->cellCollection !== null) {
$this->cellCollection->unsetWorksheetCells();
// @phpstan-ignore-next-line
$this->cellCollection = null;
}
// detach ourself from the workbook, so that it can then delete this worksheet successfully
// @phpstan-ignore-next-line
$this->parent = null;
}
/**
* Code to execute when this worksheet is unset().
*/
public function __destruct()
{
Calculation::getInstance($this->parent)->clearCalculationCacheForWorksheet($this->title);
$this->disconnectCells();
$this->rowDimensions = [];
}
/**
* Return the cell collection.
*
* @return Cells
*/
public function getCellCollection()
{
return $this->cellCollection;
}
/**
* Get array of invalid characters for sheet title.
*
* @return array
*/
public static function getInvalidCharacters()
{
return self::$invalidCharacters;
}
/**
* Check sheet code name for valid Excel syntax.
*
* @param string $sheetCodeName The string to check
*
* @return string The valid string
*/
private static function checkSheetCodeName($sheetCodeName)
{
$charCount = Shared\StringHelper::countCharacters($sheetCodeName);
if ($charCount == 0) {
throw new Exception('Sheet code name cannot be empty.');
}
// Some of the printable ASCII characters are invalid: * : / \ ? [ ] and first and last characters cannot be a "'"
if (
(str_replace(self::$invalidCharacters, '', $sheetCodeName) !== $sheetCodeName) ||
(Shared\StringHelper::substring($sheetCodeName, -1, 1) == '\'') ||
(Shared\StringHelper::substring($sheetCodeName, 0, 1) == '\'')
) {
throw new Exception('Invalid character found in sheet code name');
}
// Enforce maximum characters allowed for sheet title
if ($charCount > self::SHEET_TITLE_MAXIMUM_LENGTH) {
throw new Exception('Maximum ' . self::SHEET_TITLE_MAXIMUM_LENGTH . ' characters allowed in sheet code name.');
}
return $sheetCodeName;
}
/**
* Check sheet title for valid Excel syntax.
*
* @param string $sheetTitle The string to check
*
* @return string The valid string
*/
private static function checkSheetTitle($sheetTitle)
{
// Some of the printable ASCII characters are invalid: * : / \ ? [ ]
if (str_replace(self::$invalidCharacters, '', $sheetTitle) !== $sheetTitle) {
throw new Exception('Invalid character found in sheet title');
}
// Enforce maximum characters allowed for sheet title
if (Shared\StringHelper::countCharacters($sheetTitle) > self::SHEET_TITLE_MAXIMUM_LENGTH) {
throw new Exception('Maximum ' . self::SHEET_TITLE_MAXIMUM_LENGTH . ' characters allowed in sheet title.');
}
return $sheetTitle;
}
/**
* Get a sorted list of all cell coordinates currently held in the collection by row and column.
*
* @param bool $sorted Also sort the cell collection?
*
* @return string[]
*/
public function getCoordinates($sorted = true)
{
if ($this->cellCollection == null) {
return [];
}
if ($sorted) {
return $this->cellCollection->getSortedCoordinates();
}
return $this->cellCollection->getCoordinates();
}
/**
* Get collection of row dimensions.
*
* @return RowDimension[]
*/
public function getRowDimensions()
{
return $this->rowDimensions;
}
/**
* Get default row dimension.
*
* @return RowDimension
*/
public function getDefaultRowDimension()
{
return $this->defaultRowDimension;
}
/**
* Get collection of column dimensions.
*
* @return ColumnDimension[]
*/
public function getColumnDimensions()
{
return $this->columnDimensions;
}
/**
* Get default column dimension.
*
* @return ColumnDimension
*/
public function getDefaultColumnDimension()
{
return $this->defaultColumnDimension;
}
/**
* Get collection of drawings.
*
* @return ArrayObject<int, BaseDrawing>
*/
public function getDrawingCollection()
{
return $this->drawingCollection;
}
/**
* Get collection of charts.
*
* @return ArrayObject<int, Chart>
*/
public function getChartCollection()
{
return $this->chartCollection;
}
/**
* Add chart.
*
* @param null|int $chartIndex Index where chart should go (0,1,..., or null for last)
*
* @return Chart
*/
public function addChart(Chart $chart, $chartIndex = null)
{
$chart->setWorksheet($this);
if ($chartIndex === null) {
$this->chartCollection[] = $chart;
} else {
// Insert the chart at the requested index
array_splice($this->chartCollection, $chartIndex, 0, [$chart]);
}
return $chart;
}
/**
* Return the count of charts on this worksheet.
*
* @return int The number of charts
*/
public function getChartCount()
{
return count($this->chartCollection);
}
/**
* Get a chart by its index position.
*
* @param string $index Chart index position
*
* @return Chart|false
*/
public function getChartByIndex($index)
{
$chartCount = count($this->chartCollection);
if ($chartCount == 0) {
return false;
}
if ($index === null) {
$index = --$chartCount;
}
if (!isset($this->chartCollection[$index])) {
return false;
}
return $this->chartCollection[$index];
}
/**
* Return an array of the names of charts on this worksheet.
*
* @return string[] The names of charts
*/
public function getChartNames()
{
$chartNames = [];
foreach ($this->chartCollection as $chart) {
$chartNames[] = $chart->getName();
}
return $chartNames;
}
/**
* Get a chart by name.
*
* @param string $chartName Chart name
*
* @return Chart|false
*/
public function getChartByName($chartName)
{
$chartCount = count($this->chartCollection);
if ($chartCount == 0) {
return false;
}
foreach ($this->chartCollection as $index => $chart) {
if ($chart->getName() == $chartName) {
return $this->chartCollection[$index];
}
}
return false;
}
/**
* Refresh column dimensions.
*
* @return $this
*/
public function refreshColumnDimensions()
{
$currentColumnDimensions = $this->getColumnDimensions();
$newColumnDimensions = [];
foreach ($currentColumnDimensions as $objColumnDimension) {
$newColumnDimensions[$objColumnDimension->getColumnIndex()] = $objColumnDimension;
}
$this->columnDimensions = $newColumnDimensions;
return $this;
}
/**
* Refresh row dimensions.
*
* @return $this
*/
public function refreshRowDimensions()
{
$currentRowDimensions = $this->getRowDimensions();
$newRowDimensions = [];
foreach ($currentRowDimensions as $objRowDimension) {
$newRowDimensions[$objRowDimension->getRowIndex()] = $objRowDimension;
}
$this->rowDimensions = $newRowDimensions;
return $this;
}
/**
* Calculate worksheet dimension.
*
* @return string String containing the dimension of this worksheet
*/
public function calculateWorksheetDimension()
{
// Return
return 'A1:' . $this->getHighestColumn() . $this->getHighestRow();
}
/**
* Calculate worksheet data dimension.
*
* @return string String containing the dimension of this worksheet that actually contain data
*/
public function calculateWorksheetDataDimension()
{
// Return
return 'A1:' . $this->getHighestDataColumn() . $this->getHighestDataRow();
}
/**
* Calculate widths for auto-size columns.
*
* @return $this
*/
public function calculateColumnWidths()
{
// initialize $autoSizes array
$autoSizes = [];
foreach ($this->getColumnDimensions() as $colDimension) {
if ($colDimension->getAutoSize()) {
$autoSizes[$colDimension->getColumnIndex()] = -1;
}
}
// There is only something to do if there are some auto-size columns
if (!empty($autoSizes)) {
// build list of cells references that participate in a merge
$isMergeCell = [];
foreach ($this->getMergeCells() as $cells) {
foreach (Coordinate::extractAllCellReferencesInRange($cells) as $cellReference) {
$isMergeCell[$cellReference] = true;
}
}
// loop through all cells in the worksheet
foreach ($this->getCoordinates(false) as $coordinate) {
$cell = $this->getCellOrNull($coordinate);
if ($cell !== null && isset($autoSizes[$this->cellCollection->getCurrentColumn()])) {
//Determine if cell is in merge range
$isMerged = isset($isMergeCell[$this->cellCollection->getCurrentCoordinate()]);
//By default merged cells should be ignored
$isMergedButProceed = false;
//The only exception is if it's a merge range value cell of a 'vertical' randge (1 column wide)
if ($isMerged && $cell->isMergeRangeValueCell()) {
$range = $cell->getMergeRange();
$rangeBoundaries = Coordinate::rangeDimension($range);
if ($rangeBoundaries[0] == 1) {
$isMergedButProceed = true;
}
}
// Determine width if cell does not participate in a merge or does and is a value cell of 1-column wide range
if (!$isMerged || $isMergedButProceed) {
// Calculated value
// To formatted string
$cellValue = NumberFormat::toFormattedString(
$cell->getCalculatedValue(),
$this->getParent()->getCellXfByIndex($cell->getXfIndex())->getNumberFormat()->getFormatCode()
);
if ($cellValue !== null && $cellValue !== '') {
$autoSizes[$this->cellCollection->getCurrentColumn()] = max(
(float) $autoSizes[$this->cellCollection->getCurrentColumn()],
(float) Shared\Font::calculateColumnWidth(
$this->getParent()->getCellXfByIndex($cell->getXfIndex())->getFont(),
$cellValue,
$this->getParent()->getCellXfByIndex($cell->getXfIndex())->getAlignment()->getTextRotation(),
$this->getParent()->getDefaultStyle()->getFont()
)
);
}
}
}
}
// adjust column widths
foreach ($autoSizes as $columnIndex => $width) {
if ($width == -1) {
$width = $this->getDefaultColumnDimension()->getWidth();
}
$this->getColumnDimension($columnIndex)->setWidth($width);
}
}
return $this;
}
/**
* Get parent.
*
* @return Spreadsheet
*/
public function getParent()
{
return $this->parent;
}
/**
* Re-bind parent.
*
* @return $this
*/
public function rebindParent(Spreadsheet $parent)
{
if ($this->parent !== null) {
$definedNames = $this->parent->getDefinedNames();
foreach ($definedNames as $definedName) {
$parent->addDefinedName($definedName);
}
$this->parent->removeSheetByIndex(
$this->parent->getIndex($this)
);
}
$this->parent = $parent;
return $this;
}
/**
* Get title.
*
* @return string
*/
public function getTitle()
{
return $this->title;
}
/**
* Set title.
*
* @param string $title String containing the dimension of this worksheet
* @param bool $updateFormulaCellReferences Flag indicating whether cell references in formulae should
* be updated to reflect the new sheet name.
* This should be left as the default true, unless you are
* certain that no formula cells on any worksheet contain
* references to this worksheet
* @param bool $validate False to skip validation of new title. WARNING: This should only be set
* at parse time (by Readers), where titles can be assumed to be valid.
*
* @return $this
*/
public function setTitle($title, $updateFormulaCellReferences = true, $validate = true)
{
// Is this a 'rename' or not?
if ($this->getTitle() == $title) {
return $this;
}
// Old title
$oldTitle = $this->getTitle();
if ($validate) {
// Syntax check
self::checkSheetTitle($title);
if ($this->parent) {
// Is there already such sheet name?
if ($this->parent->sheetNameExists($title)) {
// Use name, but append with lowest possible integer
if (Shared\StringHelper::countCharacters($title) > 29) {
$title = Shared\StringHelper::substring($title, 0, 29);
}
$i = 1;
while ($this->parent->sheetNameExists($title . ' ' . $i)) {
++$i;
if ($i == 10) {
if (Shared\StringHelper::countCharacters($title) > 28) {
$title = Shared\StringHelper::substring($title, 0, 28);
}
} elseif ($i == 100) {
if (Shared\StringHelper::countCharacters($title) > 27) {
$title = Shared\StringHelper::substring($title, 0, 27);
}
}
}
$title .= " $i";
}
}
}
// Set title
$this->title = $title;
$this->dirty = true;
if ($this->parent && $this->parent->getCalculationEngine()) {
// New title
$newTitle = $this->getTitle();
$this->parent->getCalculationEngine()
->renameCalculationCacheForWorksheet($oldTitle, $newTitle);
if ($updateFormulaCellReferences) {
ReferenceHelper::getInstance()->updateNamedFormulas($this->parent, $oldTitle, $newTitle);
}
}
return $this;
}
/**
* Get sheet state.
*
* @return string Sheet state (visible, hidden, veryHidden)
*/
public function getSheetState()
{
return $this->sheetState;
}
/**
* Set sheet state.
*
* @param string $value Sheet state (visible, hidden, veryHidden)
*
* @return $this
*/
public function setSheetState($value)
{
$this->sheetState = $value;
return $this;
}
/**
* Get page setup.
*
* @return PageSetup
*/
public function getPageSetup()
{
return $this->pageSetup;
}
/**
* Set page setup.
*
* @return $this
*/
public function setPageSetup(PageSetup $pageSetup)
{
$this->pageSetup = $pageSetup;
return $this;
}
/**
* Get page margins.
*
* @return PageMargins
*/
public function getPageMargins()
{
return $this->pageMargins;
}
/**
* Set page margins.
*
* @return $this
*/
public function setPageMargins(PageMargins $pageMargins)
{
$this->pageMargins = $pageMargins;
return $this;
}
/**
* Get page header/footer.
*
* @return HeaderFooter
*/
public function getHeaderFooter()
{
return $this->headerFooter;
}
/**
* Set page header/footer.
*
* @return $this
*/
public function setHeaderFooter(HeaderFooter $headerFooter)
{
$this->headerFooter = $headerFooter;
return $this;
}
/**
* Get sheet view.
*
* @return SheetView
*/
public function getSheetView()
{
return $this->sheetView;
}
/**
* Set sheet view.
*
* @return $this
*/
public function setSheetView(SheetView $sheetView)
{
$this->sheetView = $sheetView;
return $this;
}
/**
* Get Protection.
*
* @return Protection
*/
public function getProtection()
{
return $this->protection;
}
/**
* Set Protection.
*
* @return $this
*/
public function setProtection(Protection $protection)
{
$this->protection = $protection;
$this->dirty = true;
return $this;
}
/**
* Get highest worksheet column.
*
* @param null|int|string $row Return the data highest column for the specified row,
* or the highest column of any row if no row number is passed
*
* @return string Highest column name
*/
public function getHighestColumn($row = null)
{
if (empty($row)) {
return Coordinate::stringFromColumnIndex($this->cachedHighestColumn);
}
return $this->getHighestDataColumn($row);
}
/**
* Get highest worksheet column that contains data.
*
* @param null|int|string $row Return the highest data column for the specified row,
* or the highest data column of any row if no row number is passed
*
* @return string Highest column name that contains data
*/
public function getHighestDataColumn($row = null)
{
return $this->cellCollection->getHighestColumn($row);
}
/**
* Get highest worksheet row.
*
* @param null|string $column Return the highest data row for the specified column,
* or the highest row of any column if no column letter is passed
*
* @return int Highest row number
*/
public function getHighestRow($column = null)
{
if ($column == null) {
return $this->cachedHighestRow;
}
return $this->getHighestDataRow($column);
}
/**
* Get highest worksheet row that contains data.
*
* @param null|string $column Return the highest data row for the specified column,
* or the highest data row of any column if no column letter is passed
*
* @return int Highest row number that contains data
*/
public function getHighestDataRow($column = null)
{
return $this->cellCollection->getHighestRow($column);
}
/**
* Get highest worksheet column and highest row that have cell records.
*
* @return array Highest column name and highest row number
*/
public function getHighestRowAndColumn()
{
return $this->cellCollection->getHighestRowAndColumn();
}
/**
* Set a cell value.
*
* @param string $coordinate Coordinate of the cell, eg: 'A1'
* @param mixed $value Value of the cell
*
* @return $this
*/
public function setCellValue($coordinate, $value)
{
$this->getCell($coordinate)->setValue($value);
return $this;
}
/**
* Set a cell value by using numeric cell coordinates.
*
* @param int $columnIndex Numeric column coordinate of the cell
* @param int $row Numeric row coordinate of the cell
* @param mixed $value Value of the cell
*
* @return $this
*/
public function setCellValueByColumnAndRow($columnIndex, $row, $value)
{
$this->getCellByColumnAndRow($columnIndex, $row)->setValue($value);
return $this;
}
/**
* Set a cell value.
*
* @param string $coordinate Coordinate of the cell, eg: 'A1'
* @param mixed $value Value of the cell
* @param string $dataType Explicit data type, see DataType::TYPE_*
*
* @return $this
*/
public function setCellValueExplicit($coordinate, $value, $dataType)
{
// Set value
$this->getCell($coordinate)->setValueExplicit($value, $dataType);
return $this;
}
/**
* Set a cell value by using numeric cell coordinates.
*
* @param int $columnIndex Numeric column coordinate of the cell
* @param int $row Numeric row coordinate of the cell
* @param mixed $value Value of the cell
* @param string $dataType Explicit data type, see DataType::TYPE_*
*
* @return $this
*/
public function setCellValueExplicitByColumnAndRow($columnIndex, $row, $value, $dataType)
{
$this->getCellByColumnAndRow($columnIndex, $row)->setValueExplicit($value, $dataType);
return $this;
}
/**
* Get cell at a specific coordinate.
*
* @param string $coordinate Coordinate of the cell, eg: 'A1'
*
* @return Cell Cell that was found or created
*/
public function getCell(string $coordinate): Cell
{
// Shortcut for increased performance for the vast majority of simple cases
if ($this->cellCollection->has($coordinate)) {
/** @var Cell $cell */
$cell = $this->cellCollection->get($coordinate);
return $cell;
}
/** @var Worksheet $sheet */
[$sheet, $finalCoordinate] = $this->getWorksheetAndCoordinate($coordinate);
$cell = $sheet->cellCollection->get($finalCoordinate);
return $cell ?? $sheet->createNewCell($finalCoordinate);
}
/**
* Get the correct Worksheet and coordinate from a coordinate that may
* contains reference to another sheet or a named range.
*
* @return array{0: Worksheet, 1: string}
*/
private function getWorksheetAndCoordinate(string $coordinate): array
{
$sheet = null;
$finalCoordinate = null;
// Worksheet reference?
if (strpos($coordinate, '!') !== false) {
$worksheetReference = self::extractSheetTitle($coordinate, true);
$sheet = $this->parent->getSheetByName($worksheetReference[0]);
$finalCoordinate = strtoupper($worksheetReference[1]);
if (!$sheet) {
throw new Exception('Sheet not found for name: ' . $worksheetReference[0]);
}
} elseif (
!preg_match('/^' . Calculation::CALCULATION_REGEXP_CELLREF . '$/i', $coordinate) &&
preg_match('/^' . Calculation::CALCULATION_REGEXP_DEFINEDNAME . '$/i', $coordinate)
) {
// Named range?
$namedRange = $this->validateNamedRange($coordinate, true);
if ($namedRange !== null) {
$sheet = $namedRange->getWorksheet();
if (!$sheet) {
throw new Exception('Sheet not found for named range: ' . $namedRange->getName());
}
$cellCoordinate = ltrim(substr($namedRange->getValue(), strrpos($namedRange->getValue(), '!')), '!');
$finalCoordinate = str_replace('$', '', $cellCoordinate);
}
}
if (!$sheet || !$finalCoordinate) {
$sheet = $this;
$finalCoordinate = strtoupper($coordinate);
}
if (Coordinate::coordinateIsRange($finalCoordinate)) {
throw new Exception('Cell coordinate string can not be a range of cells.');
} elseif (strpos($finalCoordinate, '$') !== false) {
throw new Exception('Cell coordinate must not be absolute.');
}
return [$sheet, $finalCoordinate];
}
/**
* Get an existing cell at a specific coordinate, or null.
*
* @param string $coordinate Coordinate of the cell, eg: 'A1'
*
* @return null|Cell Cell that was found or null
*/
private function getCellOrNull($coordinate): ?Cell
{
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | true |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/PageMargins.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/PageMargins.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
class PageMargins
{
/**
* Left.
*
* @var float
*/
private $left = 0.7;
/**
* Right.
*
* @var float
*/
private $right = 0.7;
/**
* Top.
*
* @var float
*/
private $top = 0.75;
/**
* Bottom.
*
* @var float
*/
private $bottom = 0.75;
/**
* Header.
*
* @var float
*/
private $header = 0.3;
/**
* Footer.
*
* @var float
*/
private $footer = 0.3;
/**
* Create a new PageMargins.
*/
public function __construct()
{
}
/**
* Get Left.
*
* @return float
*/
public function getLeft()
{
return $this->left;
}
/**
* Set Left.
*
* @param float $left
*
* @return $this
*/
public function setLeft($left)
{
$this->left = $left;
return $this;
}
/**
* Get Right.
*
* @return float
*/
public function getRight()
{
return $this->right;
}
/**
* Set Right.
*
* @param float $right
*
* @return $this
*/
public function setRight($right)
{
$this->right = $right;
return $this;
}
/**
* Get Top.
*
* @return float
*/
public function getTop()
{
return $this->top;
}
/**
* Set Top.
*
* @param float $top
*
* @return $this
*/
public function setTop($top)
{
$this->top = $top;
return $this;
}
/**
* Get Bottom.
*
* @return float
*/
public function getBottom()
{
return $this->bottom;
}
/**
* Set Bottom.
*
* @param float $bottom
*
* @return $this
*/
public function setBottom($bottom)
{
$this->bottom = $bottom;
return $this;
}
/**
* Get Header.
*
* @return float
*/
public function getHeader()
{
return $this->header;
}
/**
* Set Header.
*
* @param float $header
*
* @return $this
*/
public function setHeader($header)
{
$this->header = $header;
return $this;
}
/**
* Get Footer.
*
* @return float
*/
public function getFooter()
{
return $this->footer;
}
/**
* Set Footer.
*
* @param float $footer
*
* @return $this
*/
public function setFooter($footer)
{
$this->footer = $footer;
return $this;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
public static function fromCentimeters(float $value): float
{
return $value / 2.54;
}
public static function toCentimeters(float $value): float
{
return $value * 2.54;
}
public static function fromMillimeters(float $value): float
{
return $value / 25.4;
}
public static function toMillimeters(float $value): float
{
return $value * 25.4;
}
public static function fromPoints(float $value): float
{
return $value / 72;
}
public static function toPoints(float $value): float
{
return $value * 72;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/BaseDrawing.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/BaseDrawing.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Cell\Hyperlink;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\IComparable;
class BaseDrawing implements IComparable
{
/**
* Image counter.
*
* @var int
*/
private static $imageCounter = 0;
/**
* Image index.
*
* @var int
*/
private $imageIndex = 0;
/**
* Name.
*
* @var string
*/
protected $name;
/**
* Description.
*
* @var string
*/
protected $description;
/**
* Worksheet.
*
* @var null|Worksheet
*/
protected $worksheet;
/**
* Coordinates.
*
* @var string
*/
protected $coordinates;
/**
* Offset X.
*
* @var int
*/
protected $offsetX;
/**
* Offset Y.
*
* @var int
*/
protected $offsetY;
/**
* Width.
*
* @var int
*/
protected $width;
/**
* Height.
*
* @var int
*/
protected $height;
/**
* Proportional resize.
*
* @var bool
*/
protected $resizeProportional;
/**
* Rotation.
*
* @var int
*/
protected $rotation;
/**
* Shadow.
*
* @var Drawing\Shadow
*/
protected $shadow;
/**
* Image hyperlink.
*
* @var null|Hyperlink
*/
private $hyperlink;
/**
* Create a new BaseDrawing.
*/
public function __construct()
{
// Initialise values
$this->name = '';
$this->description = '';
$this->worksheet = null;
$this->coordinates = 'A1';
$this->offsetX = 0;
$this->offsetY = 0;
$this->width = 0;
$this->height = 0;
$this->resizeProportional = true;
$this->rotation = 0;
$this->shadow = new Drawing\Shadow();
// Set image index
++self::$imageCounter;
$this->imageIndex = self::$imageCounter;
}
/**
* Get image index.
*
* @return int
*/
public function getImageIndex()
{
return $this->imageIndex;
}
/**
* Get Name.
*
* @return string
*/
public function getName()
{
return $this->name;
}
/**
* Set Name.
*
* @param string $name
*
* @return $this
*/
public function setName($name)
{
$this->name = $name;
return $this;
}
/**
* Get Description.
*
* @return string
*/
public function getDescription()
{
return $this->description;
}
/**
* Set Description.
*
* @param string $description
*
* @return $this
*/
public function setDescription($description)
{
$this->description = $description;
return $this;
}
/**
* Get Worksheet.
*
* @return null|Worksheet
*/
public function getWorksheet()
{
return $this->worksheet;
}
/**
* Set Worksheet.
*
* @param bool $overrideOld If a Worksheet has already been assigned, overwrite it and remove image from old Worksheet?
*
* @return $this
*/
public function setWorksheet(?Worksheet $worksheet = null, $overrideOld = false)
{
if ($this->worksheet === null) {
// Add drawing to \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet
$this->worksheet = $worksheet;
$this->worksheet->getCell($this->coordinates);
$this->worksheet->getDrawingCollection()->append($this);
} else {
if ($overrideOld) {
// Remove drawing from old \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet
$iterator = $this->worksheet->getDrawingCollection()->getIterator();
while ($iterator->valid()) {
if ($iterator->current()->getHashCode() === $this->getHashCode()) {
$this->worksheet->getDrawingCollection()->offsetUnset($iterator->key());
$this->worksheet = null;
break;
}
}
// Set new \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet
$this->setWorksheet($worksheet);
} else {
throw new PhpSpreadsheetException('A Worksheet has already been assigned. Drawings can only exist on one \\PhpOffice\\PhpSpreadsheet\\Worksheet.');
}
}
return $this;
}
/**
* Get Coordinates.
*
* @return string
*/
public function getCoordinates()
{
return $this->coordinates;
}
/**
* Set Coordinates.
*
* @param string $coordinates eg: 'A1'
*
* @return $this
*/
public function setCoordinates($coordinates)
{
$this->coordinates = $coordinates;
return $this;
}
/**
* Get OffsetX.
*
* @return int
*/
public function getOffsetX()
{
return $this->offsetX;
}
/**
* Set OffsetX.
*
* @param int $offsetX
*
* @return $this
*/
public function setOffsetX($offsetX)
{
$this->offsetX = $offsetX;
return $this;
}
/**
* Get OffsetY.
*
* @return int
*/
public function getOffsetY()
{
return $this->offsetY;
}
/**
* Set OffsetY.
*
* @param int $offsetY
*
* @return $this
*/
public function setOffsetY($offsetY)
{
$this->offsetY = $offsetY;
return $this;
}
/**
* Get Width.
*
* @return int
*/
public function getWidth()
{
return $this->width;
}
/**
* Set Width.
*
* @param int $width
*
* @return $this
*/
public function setWidth($width)
{
// Resize proportional?
if ($this->resizeProportional && $width != 0) {
$ratio = $this->height / ($this->width != 0 ? $this->width : 1);
$this->height = (int) round($ratio * $width);
}
// Set width
$this->width = $width;
return $this;
}
/**
* Get Height.
*
* @return int
*/
public function getHeight()
{
return $this->height;
}
/**
* Set Height.
*
* @param int $height
*
* @return $this
*/
public function setHeight($height)
{
// Resize proportional?
if ($this->resizeProportional && $height != 0) {
$ratio = $this->width / ($this->height != 0 ? $this->height : 1);
$this->width = (int) round($ratio * $height);
}
// Set height
$this->height = $height;
return $this;
}
/**
* Set width and height with proportional resize.
*
* Example:
* <code>
* $objDrawing->setResizeProportional(true);
* $objDrawing->setWidthAndHeight(160,120);
* </code>
*
* @param int $width
* @param int $height
*
* @return $this
*
* @author Vincent@luo MSN:kele_100@hotmail.com
*/
public function setWidthAndHeight($width, $height)
{
$xratio = $width / ($this->width != 0 ? $this->width : 1);
$yratio = $height / ($this->height != 0 ? $this->height : 1);
if ($this->resizeProportional && !($width == 0 || $height == 0)) {
if (($xratio * $this->height) < $height) {
$this->height = (int) ceil($xratio * $this->height);
$this->width = $width;
} else {
$this->width = (int) ceil($yratio * $this->width);
$this->height = $height;
}
} else {
$this->width = $width;
$this->height = $height;
}
return $this;
}
/**
* Get ResizeProportional.
*
* @return bool
*/
public function getResizeProportional()
{
return $this->resizeProportional;
}
/**
* Set ResizeProportional.
*
* @param bool $resizeProportional
*
* @return $this
*/
public function setResizeProportional($resizeProportional)
{
$this->resizeProportional = $resizeProportional;
return $this;
}
/**
* Get Rotation.
*
* @return int
*/
public function getRotation()
{
return $this->rotation;
}
/**
* Set Rotation.
*
* @param int $rotation
*
* @return $this
*/
public function setRotation($rotation)
{
$this->rotation = $rotation;
return $this;
}
/**
* Get Shadow.
*
* @return Drawing\Shadow
*/
public function getShadow()
{
return $this->shadow;
}
/**
* Set Shadow.
*
* @return $this
*/
public function setShadow(?Drawing\Shadow $shadow = null)
{
$this->shadow = $shadow;
return $this;
}
/**
* Get hash code.
*
* @return string Hash code
*/
public function getHashCode()
{
return md5(
$this->name .
$this->description .
$this->worksheet->getHashCode() .
$this->coordinates .
$this->offsetX .
$this->offsetY .
$this->width .
$this->height .
$this->rotation .
$this->shadow->getHashCode() .
__CLASS__
);
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if ($key == 'worksheet') {
$this->worksheet = null;
} elseif (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
public function setHyperlink(?Hyperlink $hyperlink = null): void
{
$this->hyperlink = $hyperlink;
}
/**
* @return null|Hyperlink
*/
public function getHyperlink()
{
return $this->hyperlink;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/RowIterator.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/RowIterator.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use Iterator;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
/**
* @implements Iterator<int, Row>
*/
class RowIterator implements Iterator
{
/**
* Worksheet to iterate.
*
* @var Worksheet
*/
private $subject;
/**
* Current iterator position.
*
* @var int
*/
private $position = 1;
/**
* Start position.
*
* @var int
*/
private $startRow = 1;
/**
* End position.
*
* @var int
*/
private $endRow = 1;
/**
* Create a new row iterator.
*
* @param Worksheet $subject The worksheet to iterate over
* @param int $startRow The row number at which to start iterating
* @param int $endRow Optionally, the row number at which to stop iterating
*/
public function __construct(Worksheet $subject, $startRow = 1, $endRow = null)
{
// Set subject
$this->subject = $subject;
$this->resetEnd($endRow);
$this->resetStart($startRow);
}
/**
* (Re)Set the start row and the current row pointer.
*
* @param int $startRow The row number at which to start iterating
*
* @return $this
*/
public function resetStart(int $startRow = 1)
{
if ($startRow > $this->subject->getHighestRow()) {
throw new PhpSpreadsheetException(
"Start row ({$startRow}) is beyond highest row ({$this->subject->getHighestRow()})"
);
}
$this->startRow = $startRow;
if ($this->endRow < $this->startRow) {
$this->endRow = $this->startRow;
}
$this->seek($startRow);
return $this;
}
/**
* (Re)Set the end row.
*
* @param int $endRow The row number at which to stop iterating
*
* @return $this
*/
public function resetEnd($endRow = null)
{
$this->endRow = $endRow ?: $this->subject->getHighestRow();
return $this;
}
/**
* Set the row pointer to the selected row.
*
* @param int $row The row number to set the current pointer at
*
* @return $this
*/
public function seek(int $row = 1)
{
if (($row < $this->startRow) || ($row > $this->endRow)) {
throw new PhpSpreadsheetException("Row $row is out of range ({$this->startRow} - {$this->endRow})");
}
$this->position = $row;
return $this;
}
/**
* Rewind the iterator to the starting row.
*/
public function rewind(): void
{
$this->position = $this->startRow;
}
/**
* Return the current row in this worksheet.
*/
public function current(): Row
{
return new Row($this->subject, $this->position);
}
/**
* Return the current iterator key.
*/
public function key(): int
{
return $this->position;
}
/**
* Set the iterator to its next value.
*/
public function next(): void
{
++$this->position;
}
/**
* Set the iterator to its previous value.
*/
public function prev(): void
{
--$this->position;
}
/**
* Indicate if more rows exist in the worksheet range of rows that we're iterating.
*/
public function valid(): bool
{
return $this->position <= $this->endRow && $this->position >= $this->startRow;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Protection.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Protection.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Shared\PasswordHasher;
class Protection
{
const ALGORITHM_MD2 = 'MD2';
const ALGORITHM_MD4 = 'MD4';
const ALGORITHM_MD5 = 'MD5';
const ALGORITHM_SHA_1 = 'SHA-1';
const ALGORITHM_SHA_256 = 'SHA-256';
const ALGORITHM_SHA_384 = 'SHA-384';
const ALGORITHM_SHA_512 = 'SHA-512';
const ALGORITHM_RIPEMD_128 = 'RIPEMD-128';
const ALGORITHM_RIPEMD_160 = 'RIPEMD-160';
const ALGORITHM_WHIRLPOOL = 'WHIRLPOOL';
/**
* Sheet.
*
* @var bool
*/
private $sheet = false;
/**
* Objects.
*
* @var bool
*/
private $objects = false;
/**
* Scenarios.
*
* @var bool
*/
private $scenarios = false;
/**
* Format cells.
*
* @var bool
*/
private $formatCells = false;
/**
* Format columns.
*
* @var bool
*/
private $formatColumns = false;
/**
* Format rows.
*
* @var bool
*/
private $formatRows = false;
/**
* Insert columns.
*
* @var bool
*/
private $insertColumns = false;
/**
* Insert rows.
*
* @var bool
*/
private $insertRows = false;
/**
* Insert hyperlinks.
*
* @var bool
*/
private $insertHyperlinks = false;
/**
* Delete columns.
*
* @var bool
*/
private $deleteColumns = false;
/**
* Delete rows.
*
* @var bool
*/
private $deleteRows = false;
/**
* Select locked cells.
*
* @var bool
*/
private $selectLockedCells = false;
/**
* Sort.
*
* @var bool
*/
private $sort = false;
/**
* AutoFilter.
*
* @var bool
*/
private $autoFilter = false;
/**
* Pivot tables.
*
* @var bool
*/
private $pivotTables = false;
/**
* Select unlocked cells.
*
* @var bool
*/
private $selectUnlockedCells = false;
/**
* Hashed password.
*
* @var string
*/
private $password = '';
/**
* Algorithm name.
*
* @var string
*/
private $algorithm = '';
/**
* Salt value.
*
* @var string
*/
private $salt = '';
/**
* Spin count.
*
* @var int
*/
private $spinCount = 10000;
/**
* Create a new Protection.
*/
public function __construct()
{
}
/**
* Is some sort of protection enabled?
*
* @return bool
*/
public function isProtectionEnabled()
{
return $this->sheet ||
$this->objects ||
$this->scenarios ||
$this->formatCells ||
$this->formatColumns ||
$this->formatRows ||
$this->insertColumns ||
$this->insertRows ||
$this->insertHyperlinks ||
$this->deleteColumns ||
$this->deleteRows ||
$this->selectLockedCells ||
$this->sort ||
$this->autoFilter ||
$this->pivotTables ||
$this->selectUnlockedCells;
}
/**
* Get Sheet.
*
* @return bool
*/
public function getSheet()
{
return $this->sheet;
}
/**
* Set Sheet.
*
* @param bool $sheet
*
* @return $this
*/
public function setSheet($sheet)
{
$this->sheet = $sheet;
return $this;
}
/**
* Get Objects.
*
* @return bool
*/
public function getObjects()
{
return $this->objects;
}
/**
* Set Objects.
*
* @param bool $objects
*
* @return $this
*/
public function setObjects($objects)
{
$this->objects = $objects;
return $this;
}
/**
* Get Scenarios.
*
* @return bool
*/
public function getScenarios()
{
return $this->scenarios;
}
/**
* Set Scenarios.
*
* @param bool $scenarios
*
* @return $this
*/
public function setScenarios($scenarios)
{
$this->scenarios = $scenarios;
return $this;
}
/**
* Get FormatCells.
*
* @return bool
*/
public function getFormatCells()
{
return $this->formatCells;
}
/**
* Set FormatCells.
*
* @param bool $formatCells
*
* @return $this
*/
public function setFormatCells($formatCells)
{
$this->formatCells = $formatCells;
return $this;
}
/**
* Get FormatColumns.
*
* @return bool
*/
public function getFormatColumns()
{
return $this->formatColumns;
}
/**
* Set FormatColumns.
*
* @param bool $formatColumns
*
* @return $this
*/
public function setFormatColumns($formatColumns)
{
$this->formatColumns = $formatColumns;
return $this;
}
/**
* Get FormatRows.
*
* @return bool
*/
public function getFormatRows()
{
return $this->formatRows;
}
/**
* Set FormatRows.
*
* @param bool $formatRows
*
* @return $this
*/
public function setFormatRows($formatRows)
{
$this->formatRows = $formatRows;
return $this;
}
/**
* Get InsertColumns.
*
* @return bool
*/
public function getInsertColumns()
{
return $this->insertColumns;
}
/**
* Set InsertColumns.
*
* @param bool $insertColumns
*
* @return $this
*/
public function setInsertColumns($insertColumns)
{
$this->insertColumns = $insertColumns;
return $this;
}
/**
* Get InsertRows.
*
* @return bool
*/
public function getInsertRows()
{
return $this->insertRows;
}
/**
* Set InsertRows.
*
* @param bool $insertRows
*
* @return $this
*/
public function setInsertRows($insertRows)
{
$this->insertRows = $insertRows;
return $this;
}
/**
* Get InsertHyperlinks.
*
* @return bool
*/
public function getInsertHyperlinks()
{
return $this->insertHyperlinks;
}
/**
* Set InsertHyperlinks.
*
* @param bool $insertHyperLinks
*
* @return $this
*/
public function setInsertHyperlinks($insertHyperLinks)
{
$this->insertHyperlinks = $insertHyperLinks;
return $this;
}
/**
* Get DeleteColumns.
*
* @return bool
*/
public function getDeleteColumns()
{
return $this->deleteColumns;
}
/**
* Set DeleteColumns.
*
* @param bool $deleteColumns
*
* @return $this
*/
public function setDeleteColumns($deleteColumns)
{
$this->deleteColumns = $deleteColumns;
return $this;
}
/**
* Get DeleteRows.
*
* @return bool
*/
public function getDeleteRows()
{
return $this->deleteRows;
}
/**
* Set DeleteRows.
*
* @param bool $deleteRows
*
* @return $this
*/
public function setDeleteRows($deleteRows)
{
$this->deleteRows = $deleteRows;
return $this;
}
/**
* Get SelectLockedCells.
*
* @return bool
*/
public function getSelectLockedCells()
{
return $this->selectLockedCells;
}
/**
* Set SelectLockedCells.
*
* @param bool $selectLockedCells
*
* @return $this
*/
public function setSelectLockedCells($selectLockedCells)
{
$this->selectLockedCells = $selectLockedCells;
return $this;
}
/**
* Get Sort.
*
* @return bool
*/
public function getSort()
{
return $this->sort;
}
/**
* Set Sort.
*
* @param bool $sort
*
* @return $this
*/
public function setSort($sort)
{
$this->sort = $sort;
return $this;
}
/**
* Get AutoFilter.
*
* @return bool
*/
public function getAutoFilter()
{
return $this->autoFilter;
}
/**
* Set AutoFilter.
*
* @param bool $autoFilter
*
* @return $this
*/
public function setAutoFilter($autoFilter)
{
$this->autoFilter = $autoFilter;
return $this;
}
/**
* Get PivotTables.
*
* @return bool
*/
public function getPivotTables()
{
return $this->pivotTables;
}
/**
* Set PivotTables.
*
* @param bool $pivotTables
*
* @return $this
*/
public function setPivotTables($pivotTables)
{
$this->pivotTables = $pivotTables;
return $this;
}
/**
* Get SelectUnlockedCells.
*
* @return bool
*/
public function getSelectUnlockedCells()
{
return $this->selectUnlockedCells;
}
/**
* Set SelectUnlockedCells.
*
* @param bool $selectUnlockedCells
*
* @return $this
*/
public function setSelectUnlockedCells($selectUnlockedCells)
{
$this->selectUnlockedCells = $selectUnlockedCells;
return $this;
}
/**
* Get hashed password.
*
* @return string
*/
public function getPassword()
{
return $this->password;
}
/**
* Set Password.
*
* @param string $password
* @param bool $alreadyHashed If the password has already been hashed, set this to true
*
* @return $this
*/
public function setPassword($password, $alreadyHashed = false)
{
if (!$alreadyHashed) {
$salt = $this->generateSalt();
$this->setSalt($salt);
$password = PasswordHasher::hashPassword($password, $this->getAlgorithm(), $this->getSalt(), $this->getSpinCount());
}
$this->password = $password;
return $this;
}
/**
* Create a pseudorandom string.
*/
private function generateSalt(): string
{
return base64_encode(random_bytes(16));
}
/**
* Get algorithm name.
*/
public function getAlgorithm(): string
{
return $this->algorithm;
}
/**
* Set algorithm name.
*/
public function setAlgorithm(string $algorithm): void
{
$this->algorithm = $algorithm;
}
/**
* Get salt value.
*/
public function getSalt(): string
{
return $this->salt;
}
/**
* Set salt value.
*/
public function setSalt(string $salt): void
{
$this->salt = $salt;
}
/**
* Get spin count.
*/
public function getSpinCount(): int
{
return $this->spinCount;
}
/**
* Set spin count.
*/
public function setSpinCount(int $spinCount): void
{
$this->spinCount = $spinCount;
}
/**
* Verify that the given non-hashed password can "unlock" the protection.
*/
public function verify(string $password): bool
{
if (!$this->isProtectionEnabled()) {
return true;
}
$hash = PasswordHasher::hashPassword($password, $this->getAlgorithm(), $this->getSalt(), $this->getSpinCount());
return $this->getPassword() === $hash;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/RowDimension.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/RowDimension.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Helper\Dimension as CssDimension;
class RowDimension extends Dimension
{
/**
* Row index.
*
* @var int
*/
private $rowIndex;
/**
* Row height (in pt).
*
* When this is set to a negative value, the row height should be ignored by IWriter
*
* @var float
*/
private $height = -1;
/**
* ZeroHeight for Row?
*
* @var bool
*/
private $zeroHeight = false;
/**
* Create a new RowDimension.
*
* @param int $index Numeric row index
*/
public function __construct($index = 0)
{
// Initialise values
$this->rowIndex = $index;
// set dimension as unformatted by default
parent::__construct(null);
}
/**
* Get Row Index.
*/
public function getRowIndex(): int
{
return $this->rowIndex;
}
/**
* Set Row Index.
*
* @return $this
*/
public function setRowIndex(int $index)
{
$this->rowIndex = $index;
return $this;
}
/**
* Get Row Height.
* By default, this will be in points; but this method accepts a unit of measure
* argument, and will convert the value to the specified UoM.
*
* @return float
*/
public function getRowHeight(?string $unitOfMeasure = null)
{
return ($unitOfMeasure === null || $this->height < 0)
? $this->height
: (new CssDimension($this->height . CssDimension::UOM_POINTS))->toUnit($unitOfMeasure);
}
/**
* Set Row Height.
*
* @param float $height in points
* By default, this will be the passed argument value; but this method accepts a unit of measure
* argument, and will convert the passed argument value to points from the specified UoM
*
* @return $this
*/
public function setRowHeight($height, ?string $unitOfMeasure = null)
{
$this->height = ($unitOfMeasure === null || $height < 0)
? $height
: (new CssDimension("{$height}{$unitOfMeasure}"))->height();
return $this;
}
/**
* Get ZeroHeight.
*/
public function getZeroHeight(): bool
{
return $this->zeroHeight;
}
/**
* Set ZeroHeight.
*
* @return $this
*/
public function setZeroHeight(bool $zeroHeight)
{
$this->zeroHeight = $zeroHeight;
return $this;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/ColumnDimension.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/ColumnDimension.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Helper\Dimension as CssDimension;
class ColumnDimension extends Dimension
{
/**
* Column index.
*
* @var string
*/
private $columnIndex;
/**
* Column width.
*
* When this is set to a negative value, the column width should be ignored by IWriter
*
* @var float
*/
private $width = -1;
/**
* Auto size?
*
* @var bool
*/
private $autoSize = false;
/**
* Create a new ColumnDimension.
*
* @param string $index Character column index
*/
public function __construct($index = 'A')
{
// Initialise values
$this->columnIndex = $index;
// set dimension as unformatted by default
parent::__construct(0);
}
/**
* Get column index as string eg: 'A'.
*/
public function getColumnIndex(): string
{
return $this->columnIndex;
}
/**
* Set column index as string eg: 'A'.
*
* @return $this
*/
public function setColumnIndex(string $index)
{
$this->columnIndex = $index;
return $this;
}
/**
* Get Width.
*
* Each unit of column width is equal to the width of one character in the default font size.
* By default, this will be the return value; but this method also accepts a unit of measure argument and will
* return the value converted to the specified UoM using an approximation method.
*/
public function getWidth(?string $unitOfMeasure = null): float
{
return ($unitOfMeasure === null || $this->width < 0)
? $this->width
: (new CssDimension((string) $this->width))->toUnit($unitOfMeasure);
}
/**
* Set Width.
*
* Each unit of column width is equal to the width of one character in the default font size.
* By default, this will be the unit of measure for the passed value; but this method accepts a unit of measure
* argument, and will convert the value from the specified UoM using an approximation method.
*
* @return $this
*/
public function setWidth(float $width, ?string $unitOfMeasure = null)
{
$this->width = ($unitOfMeasure === null || $width < 0)
? $width
: (new CssDimension("{$width}{$unitOfMeasure}"))->width();
return $this;
}
/**
* Get Auto Size.
*/
public function getAutoSize(): bool
{
return $this->autoSize;
}
/**
* Set Auto Size.
*
* @return $this
*/
public function setAutoSize(bool $autosizeEnabled)
{
$this->autoSize = $autosizeEnabled;
return $this;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/AutoFilter.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/AutoFilter.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use DateTime;
use DateTimeZone;
use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Calculation\Functions;
use PhpOffice\PhpSpreadsheet\Calculation\Internal\WildcardMatch;
use PhpOffice\PhpSpreadsheet\Cell\Coordinate;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Worksheet\AutoFilter\Column\Rule;
class AutoFilter
{
/**
* Autofilter Worksheet.
*
* @var null|Worksheet
*/
private $workSheet;
/**
* Autofilter Range.
*
* @var string
*/
private $range = '';
/**
* Autofilter Column Ruleset.
*
* @var AutoFilter\Column[]
*/
private $columns = [];
/**
* Create a new AutoFilter.
*
* @param string $range Cell range (i.e. A1:E10)
*/
public function __construct($range = '', ?Worksheet $worksheet = null)
{
$this->range = $range;
$this->workSheet = $worksheet;
}
/**
* Get AutoFilter Parent Worksheet.
*
* @return null|Worksheet
*/
public function getParent()
{
return $this->workSheet;
}
/**
* Set AutoFilter Parent Worksheet.
*
* @return $this
*/
public function setParent(?Worksheet $worksheet = null)
{
$this->workSheet = $worksheet;
return $this;
}
/**
* Get AutoFilter Range.
*
* @return string
*/
public function getRange()
{
return $this->range;
}
/**
* Set AutoFilter Range.
*
* @param string $range Cell range (i.e. A1:E10)
*
* @return $this
*/
public function setRange($range)
{
// extract coordinate
[$worksheet, $range] = Worksheet::extractSheetTitle($range, true);
if (empty($range)) {
// Discard all column rules
$this->columns = [];
$this->range = '';
return $this;
}
if (strpos($range, ':') === false) {
throw new PhpSpreadsheetException('Autofilter must be set on a range of cells.');
}
$this->range = $range;
// Discard any column rules that are no longer valid within this range
[$rangeStart, $rangeEnd] = Coordinate::rangeBoundaries($this->range);
foreach ($this->columns as $key => $value) {
$colIndex = Coordinate::columnIndexFromString($key);
if (($rangeStart[0] > $colIndex) || ($rangeEnd[0] < $colIndex)) {
unset($this->columns[$key]);
}
}
return $this;
}
/**
* Get all AutoFilter Columns.
*
* @return AutoFilter\Column[]
*/
public function getColumns()
{
return $this->columns;
}
/**
* Validate that the specified column is in the AutoFilter range.
*
* @param string $column Column name (e.g. A)
*
* @return int The column offset within the autofilter range
*/
public function testColumnInRange($column)
{
if (empty($this->range)) {
throw new PhpSpreadsheetException('No autofilter range is defined.');
}
$columnIndex = Coordinate::columnIndexFromString($column);
[$rangeStart, $rangeEnd] = Coordinate::rangeBoundaries($this->range);
if (($rangeStart[0] > $columnIndex) || ($rangeEnd[0] < $columnIndex)) {
throw new PhpSpreadsheetException('Column is outside of current autofilter range.');
}
return $columnIndex - $rangeStart[0];
}
/**
* Get a specified AutoFilter Column Offset within the defined AutoFilter range.
*
* @param string $column Column name (e.g. A)
*
* @return int The offset of the specified column within the autofilter range
*/
public function getColumnOffset($column)
{
return $this->testColumnInRange($column);
}
/**
* Get a specified AutoFilter Column.
*
* @param string $column Column name (e.g. A)
*
* @return AutoFilter\Column
*/
public function getColumn($column)
{
$this->testColumnInRange($column);
if (!isset($this->columns[$column])) {
$this->columns[$column] = new AutoFilter\Column($column, $this);
}
return $this->columns[$column];
}
/**
* Get a specified AutoFilter Column by it's offset.
*
* @param int $columnOffset Column offset within range (starting from 0)
*
* @return AutoFilter\Column
*/
public function getColumnByOffset($columnOffset)
{
[$rangeStart, $rangeEnd] = Coordinate::rangeBoundaries($this->range);
$pColumn = Coordinate::stringFromColumnIndex($rangeStart[0] + $columnOffset);
return $this->getColumn($pColumn);
}
/**
* Set AutoFilter.
*
* @param AutoFilter\Column|string $columnObjectOrString
* A simple string containing a Column ID like 'A' is permitted
*
* @return $this
*/
public function setColumn($columnObjectOrString)
{
if ((is_string($columnObjectOrString)) && (!empty($columnObjectOrString))) {
$column = $columnObjectOrString;
} elseif (is_object($columnObjectOrString) && ($columnObjectOrString instanceof AutoFilter\Column)) {
$column = $columnObjectOrString->getColumnIndex();
} else {
throw new PhpSpreadsheetException('Column is not within the autofilter range.');
}
$this->testColumnInRange($column);
if (is_string($columnObjectOrString)) {
$this->columns[$columnObjectOrString] = new AutoFilter\Column($columnObjectOrString, $this);
} else {
$columnObjectOrString->setParent($this);
$this->columns[$column] = $columnObjectOrString;
}
ksort($this->columns);
return $this;
}
/**
* Clear a specified AutoFilter Column.
*
* @param string $column Column name (e.g. A)
*
* @return $this
*/
public function clearColumn($column)
{
$this->testColumnInRange($column);
if (isset($this->columns[$column])) {
unset($this->columns[$column]);
}
return $this;
}
/**
* Shift an AutoFilter Column Rule to a different column.
*
* Note: This method bypasses validation of the destination column to ensure it is within this AutoFilter range.
* Nor does it verify whether any column rule already exists at $toColumn, but will simply override any existing value.
* Use with caution.
*
* @param string $fromColumn Column name (e.g. A)
* @param string $toColumn Column name (e.g. B)
*
* @return $this
*/
public function shiftColumn($fromColumn, $toColumn)
{
$fromColumn = strtoupper($fromColumn);
$toColumn = strtoupper($toColumn);
if (($fromColumn !== null) && (isset($this->columns[$fromColumn])) && ($toColumn !== null)) {
$this->columns[$fromColumn]->setParent();
$this->columns[$fromColumn]->setColumnIndex($toColumn);
$this->columns[$toColumn] = $this->columns[$fromColumn];
$this->columns[$toColumn]->setParent($this);
unset($this->columns[$fromColumn]);
ksort($this->columns);
}
return $this;
}
/**
* Test if cell value is in the defined set of values.
*
* @param mixed $cellValue
* @param mixed[] $dataSet
*
* @return bool
*/
private static function filterTestInSimpleDataSet($cellValue, $dataSet)
{
$dataSetValues = $dataSet['filterValues'];
$blanks = $dataSet['blanks'];
if (($cellValue == '') || ($cellValue === null)) {
return $blanks;
}
return in_array($cellValue, $dataSetValues);
}
/**
* Test if cell value is in the defined set of Excel date values.
*
* @param mixed $cellValue
* @param mixed[] $dataSet
*
* @return bool
*/
private static function filterTestInDateGroupSet($cellValue, $dataSet)
{
$dateSet = $dataSet['filterValues'];
$blanks = $dataSet['blanks'];
if (($cellValue == '') || ($cellValue === null)) {
return $blanks;
}
$timeZone = new DateTimeZone('UTC');
if (is_numeric($cellValue)) {
$dateTime = Date::excelToDateTimeObject((float) $cellValue, $timeZone);
$cellValue = (float) $cellValue;
if ($cellValue < 1) {
// Just the time part
$dtVal = $dateTime->format('His');
$dateSet = $dateSet['time'];
} elseif ($cellValue == floor($cellValue)) {
// Just the date part
$dtVal = $dateTime->format('Ymd');
$dateSet = $dateSet['date'];
} else {
// date and time parts
$dtVal = $dateTime->format('YmdHis');
$dateSet = $dateSet['dateTime'];
}
foreach ($dateSet as $dateValue) {
// Use of substr to extract value at the appropriate group level
if (substr($dtVal, 0, strlen($dateValue)) == $dateValue) {
return true;
}
}
}
return false;
}
/**
* Test if cell value is within a set of values defined by a ruleset.
*
* @param mixed $cellValue
* @param mixed[] $ruleSet
*
* @return bool
*/
private static function filterTestInCustomDataSet($cellValue, $ruleSet)
{
/** @var array[] */
$dataSet = $ruleSet['filterRules'];
$join = $ruleSet['join'];
$customRuleForBlanks = $ruleSet['customRuleForBlanks'] ?? false;
if (!$customRuleForBlanks) {
// Blank cells are always ignored, so return a FALSE
if (($cellValue == '') || ($cellValue === null)) {
return false;
}
}
$returnVal = ($join == AutoFilter\Column::AUTOFILTER_COLUMN_JOIN_AND);
foreach ($dataSet as $rule) {
/** @var string */
$ruleValue = $rule['value'];
/** @var string */
$ruleOperator = $rule['operator'];
/** @var string */
$cellValueString = $cellValue;
$retVal = false;
if (is_numeric($ruleValue)) {
// Numeric values are tested using the appropriate operator
$numericTest = is_numeric($cellValue);
switch ($ruleOperator) {
case Rule::AUTOFILTER_COLUMN_RULE_EQUAL:
$retVal = $numericTest && ($cellValue == $ruleValue);
break;
case Rule::AUTOFILTER_COLUMN_RULE_NOTEQUAL:
$retVal = !$numericTest || ($cellValue != $ruleValue);
break;
case Rule::AUTOFILTER_COLUMN_RULE_GREATERTHAN:
$retVal = $numericTest && ($cellValue > $ruleValue);
break;
case Rule::AUTOFILTER_COLUMN_RULE_GREATERTHANOREQUAL:
$retVal = $numericTest && ($cellValue >= $ruleValue);
break;
case Rule::AUTOFILTER_COLUMN_RULE_LESSTHAN:
$retVal = $numericTest && ($cellValue < $ruleValue);
break;
case Rule::AUTOFILTER_COLUMN_RULE_LESSTHANOREQUAL:
$retVal = $numericTest && ($cellValue <= $ruleValue);
break;
}
} elseif ($ruleValue == '') {
switch ($ruleOperator) {
case Rule::AUTOFILTER_COLUMN_RULE_EQUAL:
$retVal = (($cellValue == '') || ($cellValue === null));
break;
case Rule::AUTOFILTER_COLUMN_RULE_NOTEQUAL:
$retVal = (($cellValue != '') && ($cellValue !== null));
break;
default:
$retVal = true;
break;
}
} else {
// String values are always tested for equality, factoring in for wildcards (hence a regexp test)
switch ($ruleOperator) {
case Rule::AUTOFILTER_COLUMN_RULE_EQUAL:
$retVal = (bool) preg_match('/^' . $ruleValue . '$/i', $cellValueString);
break;
case Rule::AUTOFILTER_COLUMN_RULE_NOTEQUAL:
$retVal = !((bool) preg_match('/^' . $ruleValue . '$/i', $cellValueString));
break;
case Rule::AUTOFILTER_COLUMN_RULE_GREATERTHAN:
$retVal = strcasecmp($cellValueString, $ruleValue) > 0;
break;
case Rule::AUTOFILTER_COLUMN_RULE_GREATERTHANOREQUAL:
$retVal = strcasecmp($cellValueString, $ruleValue) >= 0;
break;
case Rule::AUTOFILTER_COLUMN_RULE_LESSTHAN:
$retVal = strcasecmp($cellValueString, $ruleValue) < 0;
break;
case Rule::AUTOFILTER_COLUMN_RULE_LESSTHANOREQUAL:
$retVal = strcasecmp($cellValueString, $ruleValue) <= 0;
break;
}
}
// If there are multiple conditions, then we need to test both using the appropriate join operator
switch ($join) {
case AutoFilter\Column::AUTOFILTER_COLUMN_JOIN_OR:
$returnVal = $returnVal || $retVal;
// Break as soon as we have a TRUE match for OR joins,
// to avoid unnecessary additional code execution
if ($returnVal) {
return $returnVal;
}
break;
case AutoFilter\Column::AUTOFILTER_COLUMN_JOIN_AND:
$returnVal = $returnVal && $retVal;
break;
}
}
return $returnVal;
}
/**
* Test if cell date value is matches a set of values defined by a set of months.
*
* @param mixed $cellValue
* @param mixed[] $monthSet
*
* @return bool
*/
private static function filterTestInPeriodDateSet($cellValue, $monthSet)
{
// Blank cells are always ignored, so return a FALSE
if (($cellValue == '') || ($cellValue === null)) {
return false;
}
if (is_numeric($cellValue)) {
$dateObject = Date::excelToDateTimeObject((float) $cellValue, new DateTimeZone('UTC'));
$dateValue = (int) $dateObject->format('m');
if (in_array($dateValue, $monthSet)) {
return true;
}
}
return false;
}
private static function makeDateObject(int $year, int $month, int $day, int $hour = 0, int $minute = 0, int $second = 0): DateTime
{
$baseDate = new DateTime();
$baseDate->setDate($year, $month, $day);
$baseDate->setTime($hour, $minute, $second);
return $baseDate;
}
private const DATE_FUNCTIONS = [
Rule::AUTOFILTER_RULETYPE_DYNAMIC_LASTMONTH => 'dynamicLastMonth',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_LASTQUARTER => 'dynamicLastQuarter',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_LASTWEEK => 'dynamicLastWeek',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_LASTYEAR => 'dynamicLastYear',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_NEXTMONTH => 'dynamicNextMonth',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_NEXTQUARTER => 'dynamicNextQuarter',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_NEXTWEEK => 'dynamicNextWeek',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_NEXTYEAR => 'dynamicNextYear',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_THISMONTH => 'dynamicThisMonth',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_THISQUARTER => 'dynamicThisQuarter',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_THISWEEK => 'dynamicThisWeek',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_THISYEAR => 'dynamicThisYear',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_TODAY => 'dynamicToday',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_TOMORROW => 'dynamicTomorrow',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_YEARTODATE => 'dynamicYearToDate',
Rule::AUTOFILTER_RULETYPE_DYNAMIC_YESTERDAY => 'dynamicYesterday',
];
private static function dynamicLastMonth(): array
{
$maxval = new DateTime();
$year = (int) $maxval->format('Y');
$month = (int) $maxval->format('m');
$maxval->setDate($year, $month, 1);
$maxval->setTime(0, 0, 0);
$val = clone $maxval;
$val->modify('-1 month');
return [$val, $maxval];
}
private static function firstDayOfQuarter(): DateTime
{
$val = new DateTime();
$year = (int) $val->format('Y');
$month = (int) $val->format('m');
$month = 3 * intdiv($month - 1, 3) + 1;
$val->setDate($year, $month, 1);
$val->setTime(0, 0, 0);
return $val;
}
private static function dynamicLastQuarter(): array
{
$maxval = self::firstDayOfQuarter();
$val = clone $maxval;
$val->modify('-3 months');
return [$val, $maxval];
}
private static function dynamicLastWeek(): array
{
$val = new DateTime();
$val->setTime(0, 0, 0);
$dayOfWeek = (int) $val->format('w'); // Sunday is 0
$subtract = $dayOfWeek + 7; // revert to prior Sunday
$val->modify("-$subtract days");
$maxval = clone $val;
$maxval->modify('+7 days');
return [$val, $maxval];
}
private static function dynamicLastYear(): array
{
$val = new DateTime();
$year = (int) $val->format('Y');
$val = self::makeDateObject($year - 1, 1, 1);
$maxval = self::makeDateObject($year, 1, 1);
return [$val, $maxval];
}
private static function dynamicNextMonth(): array
{
$val = new DateTime();
$year = (int) $val->format('Y');
$month = (int) $val->format('m');
$val->setDate($year, $month, 1);
$val->setTime(0, 0, 0);
$val->modify('+1 month');
$maxval = clone $val;
$maxval->modify('+1 month');
return [$val, $maxval];
}
private static function dynamicNextQuarter(): array
{
$val = self::firstDayOfQuarter();
$val->modify('+3 months');
$maxval = clone $val;
$maxval->modify('+3 months');
return [$val, $maxval];
}
private static function dynamicNextWeek(): array
{
$val = new DateTime();
$val->setTime(0, 0, 0);
$dayOfWeek = (int) $val->format('w'); // Sunday is 0
$add = 7 - $dayOfWeek; // move to next Sunday
$val->modify("+$add days");
$maxval = clone $val;
$maxval->modify('+7 days');
return [$val, $maxval];
}
private static function dynamicNextYear(): array
{
$val = new DateTime();
$year = (int) $val->format('Y');
$val = self::makeDateObject($year + 1, 1, 1);
$maxval = self::makeDateObject($year + 2, 1, 1);
return [$val, $maxval];
}
private static function dynamicThisMonth(): array
{
$baseDate = new DateTime();
$baseDate->setTime(0, 0, 0);
$year = (int) $baseDate->format('Y');
$month = (int) $baseDate->format('m');
$val = self::makeDateObject($year, $month, 1);
$maxval = clone $val;
$maxval->modify('+1 month');
return [$val, $maxval];
}
private static function dynamicThisQuarter(): array
{
$val = self::firstDayOfQuarter();
$maxval = clone $val;
$maxval->modify('+3 months');
return [$val, $maxval];
}
private static function dynamicThisWeek(): array
{
$val = new DateTime();
$val->setTime(0, 0, 0);
$dayOfWeek = (int) $val->format('w'); // Sunday is 0
$subtract = $dayOfWeek; // revert to Sunday
$val->modify("-$subtract days");
$maxval = clone $val;
$maxval->modify('+7 days');
return [$val, $maxval];
}
private static function dynamicThisYear(): array
{
$val = new DateTime();
$year = (int) $val->format('Y');
$val = self::makeDateObject($year, 1, 1);
$maxval = self::makeDateObject($year + 1, 1, 1);
return [$val, $maxval];
}
private static function dynamicToday(): array
{
$val = new DateTime();
$val->setTime(0, 0, 0);
$maxval = clone $val;
$maxval->modify('+1 day');
return [$val, $maxval];
}
private static function dynamicTomorrow(): array
{
$val = new DateTime();
$val->setTime(0, 0, 0);
$val->modify('+1 day');
$maxval = clone $val;
$maxval->modify('+1 day');
return [$val, $maxval];
}
private static function dynamicYearToDate(): array
{
$maxval = new DateTime();
$maxval->setTime(0, 0, 0);
$val = self::makeDateObject((int) $maxval->format('Y'), 1, 1);
$maxval->modify('+1 day');
return [$val, $maxval];
}
private static function dynamicYesterday(): array
{
$maxval = new DateTime();
$maxval->setTime(0, 0, 0);
$val = clone $maxval;
$val->modify('-1 day');
return [$val, $maxval];
}
/**
* Convert a dynamic rule daterange to a custom filter range expression for ease of calculation.
*
* @param string $dynamicRuleType
*
* @return mixed[]
*/
private function dynamicFilterDateRange($dynamicRuleType, AutoFilter\Column &$filterColumn)
{
$ruleValues = [];
$callBack = [__CLASS__, self::DATE_FUNCTIONS[$dynamicRuleType]]; // What if not found?
// Calculate start/end dates for the required date range based on current date
// Val is lowest permitted value.
// Maxval is greater than highest permitted value
$val = $maxval = 0;
if (is_callable($callBack)) {
[$val, $maxval] = $callBack();
}
$val = Date::dateTimeToExcel($val);
$maxval = Date::dateTimeToExcel($maxval);
// Set the filter column rule attributes ready for writing
$filterColumn->setAttributes(['val' => $val, 'maxVal' => $maxval]);
// Set the rules for identifying rows for hide/show
$ruleValues[] = ['operator' => Rule::AUTOFILTER_COLUMN_RULE_GREATERTHANOREQUAL, 'value' => $val];
$ruleValues[] = ['operator' => Rule::AUTOFILTER_COLUMN_RULE_LESSTHAN, 'value' => $maxval];
return ['method' => 'filterTestInCustomDataSet', 'arguments' => ['filterRules' => $ruleValues, 'join' => AutoFilter\Column::AUTOFILTER_COLUMN_JOIN_AND]];
}
/**
* Apply the AutoFilter rules to the AutoFilter Range.
*
* @param string $columnID
* @param int $startRow
* @param int $endRow
* @param ?string $ruleType
* @param mixed $ruleValue
*
* @return mixed
*/
private function calculateTopTenValue($columnID, $startRow, $endRow, $ruleType, $ruleValue)
{
$range = $columnID . $startRow . ':' . $columnID . $endRow;
$retVal = null;
if ($this->workSheet !== null) {
$dataValues = Functions::flattenArray($this->workSheet->rangeToArray($range, null, true, false));
$dataValues = array_filter($dataValues);
if ($ruleType == Rule::AUTOFILTER_COLUMN_RULE_TOPTEN_TOP) {
rsort($dataValues);
} else {
sort($dataValues);
}
$slice = array_slice($dataValues, 0, $ruleValue);
$retVal = array_pop($slice);
}
return $retVal;
}
/**
* Apply the AutoFilter rules to the AutoFilter Range.
*
* @return $this
*/
public function showHideRows()
{
if ($this->workSheet === null) {
return $this;
}
[$rangeStart, $rangeEnd] = Coordinate::rangeBoundaries($this->range);
// The heading row should always be visible
$this->workSheet->getRowDimension($rangeStart[1])->setVisible(true);
$columnFilterTests = [];
foreach ($this->columns as $columnID => $filterColumn) {
$rules = $filterColumn->getRules();
switch ($filterColumn->getFilterType()) {
case AutoFilter\Column::AUTOFILTER_FILTERTYPE_FILTER:
$ruleType = null;
$ruleValues = [];
// Build a list of the filter value selections
foreach ($rules as $rule) {
$ruleType = $rule->getRuleType();
$ruleValues[] = $rule->getValue();
}
// Test if we want to include blanks in our filter criteria
$blanks = false;
$ruleDataSet = array_filter($ruleValues);
if (count($ruleValues) != count($ruleDataSet)) {
$blanks = true;
}
if ($ruleType == Rule::AUTOFILTER_RULETYPE_FILTER) {
// Filter on absolute values
$columnFilterTests[$columnID] = [
'method' => 'filterTestInSimpleDataSet',
'arguments' => ['filterValues' => $ruleDataSet, 'blanks' => $blanks],
];
} else {
// Filter on date group values
$arguments = [
'date' => [],
'time' => [],
'dateTime' => [],
];
foreach ($ruleDataSet as $ruleValue) {
if (!is_array($ruleValue)) {
continue;
}
$date = $time = '';
if (
(isset($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_YEAR])) &&
($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_YEAR] !== '')
) {
$date .= sprintf('%04d', $ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_YEAR]);
}
if (
(isset($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_MONTH])) &&
($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_MONTH] != '')
) {
$date .= sprintf('%02d', $ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_MONTH]);
}
if (
(isset($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_DAY])) &&
($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_DAY] !== '')
) {
$date .= sprintf('%02d', $ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_DAY]);
}
if (
(isset($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_HOUR])) &&
($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_HOUR] !== '')
) {
$time .= sprintf('%02d', $ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_HOUR]);
}
if (
(isset($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_MINUTE])) &&
($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_MINUTE] !== '')
) {
$time .= sprintf('%02d', $ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_MINUTE]);
}
if (
(isset($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_SECOND])) &&
($ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_SECOND] !== '')
) {
$time .= sprintf('%02d', $ruleValue[Rule::AUTOFILTER_RULETYPE_DATEGROUP_SECOND]);
}
$dateTime = $date . $time;
$arguments['date'][] = $date;
$arguments['time'][] = $time;
$arguments['dateTime'][] = $dateTime;
}
// Remove empty elements
$arguments['date'] = array_filter($arguments['date']);
$arguments['time'] = array_filter($arguments['time']);
$arguments['dateTime'] = array_filter($arguments['dateTime']);
$columnFilterTests[$columnID] = [
'method' => 'filterTestInDateGroupSet',
'arguments' => ['filterValues' => $arguments, 'blanks' => $blanks],
];
}
break;
case AutoFilter\Column::AUTOFILTER_FILTERTYPE_CUSTOMFILTER:
$customRuleForBlanks = true;
$ruleValues = [];
// Build a list of the filter value selections
foreach ($rules as $rule) {
$ruleValue = $rule->getValue();
if (!is_array($ruleValue) && !is_numeric($ruleValue)) {
// Convert to a regexp allowing for regexp reserved characters, wildcards and escaped wildcards
$ruleValue = WildcardMatch::wildcard($ruleValue);
if (trim($ruleValue) == '') {
$customRuleForBlanks = true;
$ruleValue = trim($ruleValue);
}
}
$ruleValues[] = ['operator' => $rule->getOperator(), 'value' => $ruleValue];
}
$join = $filterColumn->getJoin();
$columnFilterTests[$columnID] = [
'method' => 'filterTestInCustomDataSet',
'arguments' => ['filterRules' => $ruleValues, 'join' => $join, 'customRuleForBlanks' => $customRuleForBlanks],
];
break;
case AutoFilter\Column::AUTOFILTER_FILTERTYPE_DYNAMICFILTER:
$ruleValues = [];
foreach ($rules as $rule) {
// We should only ever have one Dynamic Filter Rule anyway
$dynamicRuleType = $rule->getGrouping();
if (
($dynamicRuleType == Rule::AUTOFILTER_RULETYPE_DYNAMIC_ABOVEAVERAGE) ||
($dynamicRuleType == Rule::AUTOFILTER_RULETYPE_DYNAMIC_BELOWAVERAGE)
) {
// Number (Average) based
// Calculate the average
$averageFormula = '=AVERAGE(' . $columnID . ($rangeStart[1] + 1) . ':' . $columnID . $rangeEnd[1] . ')';
$spreadsheet = ($this->workSheet === null) ? null : $this->workSheet->getParent();
$average = Calculation::getInstance($spreadsheet)->calculateFormula($averageFormula, null, $this->workSheet->getCell('A1'));
// Set above/below rule based on greaterThan or LessTan
$operator = ($dynamicRuleType === Rule::AUTOFILTER_RULETYPE_DYNAMIC_ABOVEAVERAGE)
? Rule::AUTOFILTER_COLUMN_RULE_GREATERTHAN
: Rule::AUTOFILTER_COLUMN_RULE_LESSTHAN;
$ruleValues[] = [
'operator' => $operator,
'value' => $average,
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | true |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/SheetView.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/SheetView.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
class SheetView
{
// Sheet View types
const SHEETVIEW_NORMAL = 'normal';
const SHEETVIEW_PAGE_LAYOUT = 'pageLayout';
const SHEETVIEW_PAGE_BREAK_PREVIEW = 'pageBreakPreview';
private static $sheetViewTypes = [
self::SHEETVIEW_NORMAL,
self::SHEETVIEW_PAGE_LAYOUT,
self::SHEETVIEW_PAGE_BREAK_PREVIEW,
];
/**
* ZoomScale.
*
* Valid values range from 10 to 400.
*
* @var int
*/
private $zoomScale = 100;
/**
* ZoomScaleNormal.
*
* Valid values range from 10 to 400.
*
* @var int
*/
private $zoomScaleNormal = 100;
/**
* ShowZeros.
*
* If true, "null" values from a calculation will be shown as "0". This is the default Excel behaviour and can be changed
* with the advanced worksheet option "Show a zero in cells that have zero value"
*
* @var bool
*/
private $showZeros = true;
/**
* View.
*
* Valid values range from 10 to 400.
*
* @var string
*/
private $sheetviewType = self::SHEETVIEW_NORMAL;
/**
* Create a new SheetView.
*/
public function __construct()
{
}
/**
* Get ZoomScale.
*
* @return int
*/
public function getZoomScale()
{
return $this->zoomScale;
}
/**
* Set ZoomScale.
* Valid values range from 10 to 400.
*
* @param int $zoomScale
*
* @return $this
*/
public function setZoomScale($zoomScale)
{
// Microsoft Office Excel 2007 only allows setting a scale between 10 and 400 via the user interface,
// but it is apparently still able to handle any scale >= 1
if (($zoomScale >= 1) || $zoomScale === null) {
$this->zoomScale = $zoomScale;
} else {
throw new PhpSpreadsheetException('Scale must be greater than or equal to 1.');
}
return $this;
}
/**
* Get ZoomScaleNormal.
*
* @return int
*/
public function getZoomScaleNormal()
{
return $this->zoomScaleNormal;
}
/**
* Set ZoomScale.
* Valid values range from 10 to 400.
*
* @param int $zoomScaleNormal
*
* @return $this
*/
public function setZoomScaleNormal($zoomScaleNormal)
{
if (($zoomScaleNormal >= 1) || $zoomScaleNormal === null) {
$this->zoomScaleNormal = $zoomScaleNormal;
} else {
throw new PhpSpreadsheetException('Scale must be greater than or equal to 1.');
}
return $this;
}
/**
* Set ShowZeroes setting.
*
* @param bool $showZeros
*/
public function setShowZeros($showZeros): void
{
$this->showZeros = $showZeros;
}
/**
* @return bool
*/
public function getShowZeros()
{
return $this->showZeros;
}
/**
* Get View.
*
* @return string
*/
public function getView()
{
return $this->sheetviewType;
}
/**
* Set View.
*
* Valid values are
* 'normal' self::SHEETVIEW_NORMAL
* 'pageLayout' self::SHEETVIEW_PAGE_LAYOUT
* 'pageBreakPreview' self::SHEETVIEW_PAGE_BREAK_PREVIEW
*
* @param string $sheetViewType
*
* @return $this
*/
public function setView($sheetViewType)
{
// MS Excel 2007 allows setting the view to 'normal', 'pageLayout' or 'pageBreakPreview' via the user interface
if ($sheetViewType === null) {
$sheetViewType = self::SHEETVIEW_NORMAL;
}
if (in_array($sheetViewType, self::$sheetViewTypes)) {
$this->sheetviewType = $sheetViewType;
} else {
throw new PhpSpreadsheetException('Invalid sheetview layout type.');
}
return $this;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Iterator.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Iterator.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
/**
* @implements \Iterator<int, Worksheet>
*/
class Iterator implements \Iterator
{
/**
* Spreadsheet to iterate.
*
* @var Spreadsheet
*/
private $subject;
/**
* Current iterator position.
*
* @var int
*/
private $position = 0;
/**
* Create a new worksheet iterator.
*/
public function __construct(Spreadsheet $subject)
{
// Set subject
$this->subject = $subject;
}
/**
* Rewind iterator.
*/
public function rewind(): void
{
$this->position = 0;
}
/**
* Current Worksheet.
*/
public function current(): Worksheet
{
return $this->subject->getSheet($this->position);
}
/**
* Current key.
*/
public function key(): int
{
return $this->position;
}
/**
* Next value.
*/
public function next(): void
{
++$this->position;
}
/**
* Are there more Worksheet instances available?
*/
public function valid(): bool
{
return $this->position < $this->subject->getSheetCount() && $this->position >= 0;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/HeaderFooterDrawing.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/HeaderFooterDrawing.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
class HeaderFooterDrawing extends Drawing
{
/**
* Get hash code.
*
* @return string Hash code
*/
public function getHashCode()
{
return md5(
$this->getPath() .
$this->name .
$this->offsetX .
$this->offsetY .
$this->width .
$this->height .
__CLASS__
);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Column.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Column.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
class Column
{
/**
* \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet.
*
* @var Worksheet
*/
private $parent;
/**
* Column index.
*
* @var string
*/
private $columnIndex;
/**
* Create a new column.
*
* @param string $columnIndex
*/
public function __construct(?Worksheet $parent = null, $columnIndex = 'A')
{
// Set parent and column index
$this->parent = $parent;
$this->columnIndex = $columnIndex;
}
/**
* Destructor.
*/
public function __destruct()
{
// @phpstan-ignore-next-line
$this->parent = null;
}
/**
* Get column index as string eg: 'A'.
*/
public function getColumnIndex(): string
{
return $this->columnIndex;
}
/**
* Get cell iterator.
*
* @param int $startRow The row number at which to start iterating
* @param int $endRow Optionally, the row number at which to stop iterating
*
* @return ColumnCellIterator
*/
public function getCellIterator($startRow = 1, $endRow = null)
{
return new ColumnCellIterator($this->parent, $this->columnIndex, $startRow, $endRow);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/HeaderFooter.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/HeaderFooter.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet;
/**
* <code>
* Header/Footer Formatting Syntax taken from Office Open XML Part 4 - Markup Language Reference, page 1970:.
*
* There are a number of formatting codes that can be written inline with the actual header / footer text, which
* affect the formatting in the header or footer.
*
* Example: This example shows the text "Center Bold Header" on the first line (center section), and the date on
* the second line (center section).
* &CCenter &"-,Bold"Bold&"-,Regular"Header_x000A_&D
*
* General Rules:
* There is no required order in which these codes must appear.
*
* The first occurrence of the following codes turns the formatting ON, the second occurrence turns it OFF again:
* - strikethrough
* - superscript
* - subscript
* Superscript and subscript cannot both be ON at same time. Whichever comes first wins and the other is ignored,
* while the first is ON.
* &L - code for "left section" (there are three header / footer locations, "left", "center", and "right"). When
* two or more occurrences of this section marker exist, the contents from all markers are concatenated, in the
* order of appearance, and placed into the left section.
* &P - code for "current page #"
* &N - code for "total pages"
* &font size - code for "text font size", where font size is a font size in points.
* &K - code for "text font color"
* RGB Color is specified as RRGGBB
* Theme Color is specifed as TTSNN where TT is the theme color Id, S is either "+" or "-" of the tint/shade
* value, NN is the tint/shade value.
* &S - code for "text strikethrough" on / off
* &X - code for "text super script" on / off
* &Y - code for "text subscript" on / off
* &C - code for "center section". When two or more occurrences of this section marker exist, the contents
* from all markers are concatenated, in the order of appearance, and placed into the center section.
*
* &D - code for "date"
* &T - code for "time"
* &G - code for "picture as background"
* &U - code for "text single underline"
* &E - code for "double underline"
* &R - code for "right section". When two or more occurrences of this section marker exist, the contents
* from all markers are concatenated, in the order of appearance, and placed into the right section.
* &Z - code for "this workbook's file path"
* &F - code for "this workbook's file name"
* &A - code for "sheet tab name"
* &+ - code for add to page #.
* &- - code for subtract from page #.
* &"font name,font type" - code for "text font name" and "text font type", where font name and font type
* are strings specifying the name and type of the font, separated by a comma. When a hyphen appears in font
* name, it means "none specified". Both of font name and font type can be localized values.
* &"-,Bold" - code for "bold font style"
* &B - also means "bold font style".
* &"-,Regular" - code for "regular font style"
* &"-,Italic" - code for "italic font style"
* &I - also means "italic font style"
* &"-,Bold Italic" code for "bold italic font style"
* &O - code for "outline style"
* &H - code for "shadow style"
* </code>
*/
class HeaderFooter
{
// Header/footer image location
const IMAGE_HEADER_LEFT = 'LH';
const IMAGE_HEADER_CENTER = 'CH';
const IMAGE_HEADER_RIGHT = 'RH';
const IMAGE_FOOTER_LEFT = 'LF';
const IMAGE_FOOTER_CENTER = 'CF';
const IMAGE_FOOTER_RIGHT = 'RF';
/**
* OddHeader.
*
* @var string
*/
private $oddHeader = '';
/**
* OddFooter.
*
* @var string
*/
private $oddFooter = '';
/**
* EvenHeader.
*
* @var string
*/
private $evenHeader = '';
/**
* EvenFooter.
*
* @var string
*/
private $evenFooter = '';
/**
* FirstHeader.
*
* @var string
*/
private $firstHeader = '';
/**
* FirstFooter.
*
* @var string
*/
private $firstFooter = '';
/**
* Different header for Odd/Even, defaults to false.
*
* @var bool
*/
private $differentOddEven = false;
/**
* Different header for first page, defaults to false.
*
* @var bool
*/
private $differentFirst = false;
/**
* Scale with document, defaults to true.
*
* @var bool
*/
private $scaleWithDocument = true;
/**
* Align with margins, defaults to true.
*
* @var bool
*/
private $alignWithMargins = true;
/**
* Header/footer images.
*
* @var HeaderFooterDrawing[]
*/
private $headerFooterImages = [];
/**
* Create a new HeaderFooter.
*/
public function __construct()
{
}
/**
* Get OddHeader.
*
* @return string
*/
public function getOddHeader()
{
return $this->oddHeader;
}
/**
* Set OddHeader.
*
* @param string $oddHeader
*
* @return $this
*/
public function setOddHeader($oddHeader)
{
$this->oddHeader = $oddHeader;
return $this;
}
/**
* Get OddFooter.
*
* @return string
*/
public function getOddFooter()
{
return $this->oddFooter;
}
/**
* Set OddFooter.
*
* @param string $oddFooter
*
* @return $this
*/
public function setOddFooter($oddFooter)
{
$this->oddFooter = $oddFooter;
return $this;
}
/**
* Get EvenHeader.
*
* @return string
*/
public function getEvenHeader()
{
return $this->evenHeader;
}
/**
* Set EvenHeader.
*
* @param string $eventHeader
*
* @return $this
*/
public function setEvenHeader($eventHeader)
{
$this->evenHeader = $eventHeader;
return $this;
}
/**
* Get EvenFooter.
*
* @return string
*/
public function getEvenFooter()
{
return $this->evenFooter;
}
/**
* Set EvenFooter.
*
* @param string $evenFooter
*
* @return $this
*/
public function setEvenFooter($evenFooter)
{
$this->evenFooter = $evenFooter;
return $this;
}
/**
* Get FirstHeader.
*
* @return string
*/
public function getFirstHeader()
{
return $this->firstHeader;
}
/**
* Set FirstHeader.
*
* @param string $firstHeader
*
* @return $this
*/
public function setFirstHeader($firstHeader)
{
$this->firstHeader = $firstHeader;
return $this;
}
/**
* Get FirstFooter.
*
* @return string
*/
public function getFirstFooter()
{
return $this->firstFooter;
}
/**
* Set FirstFooter.
*
* @param string $firstFooter
*
* @return $this
*/
public function setFirstFooter($firstFooter)
{
$this->firstFooter = $firstFooter;
return $this;
}
/**
* Get DifferentOddEven.
*
* @return bool
*/
public function getDifferentOddEven()
{
return $this->differentOddEven;
}
/**
* Set DifferentOddEven.
*
* @param bool $differentOddEvent
*
* @return $this
*/
public function setDifferentOddEven($differentOddEvent)
{
$this->differentOddEven = $differentOddEvent;
return $this;
}
/**
* Get DifferentFirst.
*
* @return bool
*/
public function getDifferentFirst()
{
return $this->differentFirst;
}
/**
* Set DifferentFirst.
*
* @param bool $differentFirst
*
* @return $this
*/
public function setDifferentFirst($differentFirst)
{
$this->differentFirst = $differentFirst;
return $this;
}
/**
* Get ScaleWithDocument.
*
* @return bool
*/
public function getScaleWithDocument()
{
return $this->scaleWithDocument;
}
/**
* Set ScaleWithDocument.
*
* @param bool $scaleWithDocument
*
* @return $this
*/
public function setScaleWithDocument($scaleWithDocument)
{
$this->scaleWithDocument = $scaleWithDocument;
return $this;
}
/**
* Get AlignWithMargins.
*
* @return bool
*/
public function getAlignWithMargins()
{
return $this->alignWithMargins;
}
/**
* Set AlignWithMargins.
*
* @param bool $alignWithMargins
*
* @return $this
*/
public function setAlignWithMargins($alignWithMargins)
{
$this->alignWithMargins = $alignWithMargins;
return $this;
}
/**
* Add header/footer image.
*
* @param string $location
*
* @return $this
*/
public function addImage(HeaderFooterDrawing $image, $location = self::IMAGE_HEADER_LEFT)
{
$this->headerFooterImages[$location] = $image;
return $this;
}
/**
* Remove header/footer image.
*
* @param string $location
*
* @return $this
*/
public function removeImage($location = self::IMAGE_HEADER_LEFT)
{
if (isset($this->headerFooterImages[$location])) {
unset($this->headerFooterImages[$location]);
}
return $this;
}
/**
* Set header/footer images.
*
* @param HeaderFooterDrawing[] $images
*
* @return $this
*/
public function setImages(array $images)
{
$this->headerFooterImages = $images;
return $this;
}
/**
* Get header/footer images.
*
* @return HeaderFooterDrawing[]
*/
public function getImages()
{
// Sort array
$images = [];
if (isset($this->headerFooterImages[self::IMAGE_HEADER_LEFT])) {
$images[self::IMAGE_HEADER_LEFT] = $this->headerFooterImages[self::IMAGE_HEADER_LEFT];
}
if (isset($this->headerFooterImages[self::IMAGE_HEADER_CENTER])) {
$images[self::IMAGE_HEADER_CENTER] = $this->headerFooterImages[self::IMAGE_HEADER_CENTER];
}
if (isset($this->headerFooterImages[self::IMAGE_HEADER_RIGHT])) {
$images[self::IMAGE_HEADER_RIGHT] = $this->headerFooterImages[self::IMAGE_HEADER_RIGHT];
}
if (isset($this->headerFooterImages[self::IMAGE_FOOTER_LEFT])) {
$images[self::IMAGE_FOOTER_LEFT] = $this->headerFooterImages[self::IMAGE_FOOTER_LEFT];
}
if (isset($this->headerFooterImages[self::IMAGE_FOOTER_CENTER])) {
$images[self::IMAGE_FOOTER_CENTER] = $this->headerFooterImages[self::IMAGE_FOOTER_CENTER];
}
if (isset($this->headerFooterImages[self::IMAGE_FOOTER_RIGHT])) {
$images[self::IMAGE_FOOTER_RIGHT] = $this->headerFooterImages[self::IMAGE_FOOTER_RIGHT];
}
$this->headerFooterImages = $images;
return $this->headerFooterImages;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/AutoFilter/Column.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/AutoFilter/Column.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet\AutoFilter;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\Worksheet\AutoFilter;
class Column
{
const AUTOFILTER_FILTERTYPE_FILTER = 'filters';
const AUTOFILTER_FILTERTYPE_CUSTOMFILTER = 'customFilters';
// Supports no more than 2 rules, with an And/Or join criteria
// if more than 1 rule is defined
const AUTOFILTER_FILTERTYPE_DYNAMICFILTER = 'dynamicFilter';
// Even though the filter rule is constant, the filtered data can vary
// e.g. filtered by date = TODAY
const AUTOFILTER_FILTERTYPE_TOPTENFILTER = 'top10';
/**
* Types of autofilter rules.
*
* @var string[]
*/
private static $filterTypes = [
// Currently we're not handling
// colorFilter
// extLst
// iconFilter
self::AUTOFILTER_FILTERTYPE_FILTER,
self::AUTOFILTER_FILTERTYPE_CUSTOMFILTER,
self::AUTOFILTER_FILTERTYPE_DYNAMICFILTER,
self::AUTOFILTER_FILTERTYPE_TOPTENFILTER,
];
// Multiple Rule Connections
const AUTOFILTER_COLUMN_JOIN_AND = 'and';
const AUTOFILTER_COLUMN_JOIN_OR = 'or';
/**
* Join options for autofilter rules.
*
* @var string[]
*/
private static $ruleJoins = [
self::AUTOFILTER_COLUMN_JOIN_AND,
self::AUTOFILTER_COLUMN_JOIN_OR,
];
/**
* Autofilter.
*
* @var null|AutoFilter
*/
private $parent;
/**
* Autofilter Column Index.
*
* @var string
*/
private $columnIndex = '';
/**
* Autofilter Column Filter Type.
*
* @var string
*/
private $filterType = self::AUTOFILTER_FILTERTYPE_FILTER;
/**
* Autofilter Multiple Rules And/Or.
*
* @var string
*/
private $join = self::AUTOFILTER_COLUMN_JOIN_OR;
/**
* Autofilter Column Rules.
*
* @var Column\Rule[]
*/
private $ruleset = [];
/**
* Autofilter Column Dynamic Attributes.
*
* @var mixed[]
*/
private $attributes = [];
/**
* Create a new Column.
*
* @param string $column Column (e.g. A)
* @param AutoFilter $parent Autofilter for this column
*/
public function __construct($column, ?AutoFilter $parent = null)
{
$this->columnIndex = $column;
$this->parent = $parent;
}
/**
* Get AutoFilter column index as string eg: 'A'.
*
* @return string
*/
public function getColumnIndex()
{
return $this->columnIndex;
}
/**
* Set AutoFilter column index as string eg: 'A'.
*
* @param string $column Column (e.g. A)
*
* @return $this
*/
public function setColumnIndex($column)
{
// Uppercase coordinate
$column = strtoupper($column);
if ($this->parent !== null) {
$this->parent->testColumnInRange($column);
}
$this->columnIndex = $column;
return $this;
}
/**
* Get this Column's AutoFilter Parent.
*
* @return null|AutoFilter
*/
public function getParent()
{
return $this->parent;
}
/**
* Set this Column's AutoFilter Parent.
*
* @return $this
*/
public function setParent(?AutoFilter $parent = null)
{
$this->parent = $parent;
return $this;
}
/**
* Get AutoFilter Type.
*
* @return string
*/
public function getFilterType()
{
return $this->filterType;
}
/**
* Set AutoFilter Type.
*
* @param string $filterType
*
* @return $this
*/
public function setFilterType($filterType)
{
if (!in_array($filterType, self::$filterTypes)) {
throw new PhpSpreadsheetException('Invalid filter type for column AutoFilter.');
}
if ($filterType === self::AUTOFILTER_FILTERTYPE_CUSTOMFILTER && count($this->ruleset) > 2) {
throw new PhpSpreadsheetException('No more than 2 rules are allowed in a Custom Filter');
}
$this->filterType = $filterType;
return $this;
}
/**
* Get AutoFilter Multiple Rules And/Or Join.
*
* @return string
*/
public function getJoin()
{
return $this->join;
}
/**
* Set AutoFilter Multiple Rules And/Or.
*
* @param string $join And/Or
*
* @return $this
*/
public function setJoin($join)
{
// Lowercase And/Or
$join = strtolower($join);
if (!in_array($join, self::$ruleJoins)) {
throw new PhpSpreadsheetException('Invalid rule connection for column AutoFilter.');
}
$this->join = $join;
return $this;
}
/**
* Set AutoFilter Attributes.
*
* @param mixed[] $attributes
*
* @return $this
*/
public function setAttributes($attributes)
{
$this->attributes = $attributes;
return $this;
}
/**
* Set An AutoFilter Attribute.
*
* @param string $name Attribute Name
* @param string $value Attribute Value
*
* @return $this
*/
public function setAttribute($name, $value)
{
$this->attributes[$name] = $value;
return $this;
}
/**
* Get AutoFilter Column Attributes.
*
* @return int[]|string[]
*/
public function getAttributes()
{
return $this->attributes;
}
/**
* Get specific AutoFilter Column Attribute.
*
* @param string $name Attribute Name
*
* @return null|int|string
*/
public function getAttribute($name)
{
if (isset($this->attributes[$name])) {
return $this->attributes[$name];
}
return null;
}
public function ruleCount(): int
{
return count($this->ruleset);
}
/**
* Get all AutoFilter Column Rules.
*
* @return Column\Rule[]
*/
public function getRules()
{
return $this->ruleset;
}
/**
* Get a specified AutoFilter Column Rule.
*
* @param int $index Rule index in the ruleset array
*
* @return Column\Rule
*/
public function getRule($index)
{
if (!isset($this->ruleset[$index])) {
$this->ruleset[$index] = new Column\Rule($this);
}
return $this->ruleset[$index];
}
/**
* Create a new AutoFilter Column Rule in the ruleset.
*
* @return Column\Rule
*/
public function createRule()
{
if ($this->filterType === self::AUTOFILTER_FILTERTYPE_CUSTOMFILTER && count($this->ruleset) >= 2) {
throw new PhpSpreadsheetException('No more than 2 rules are allowed in a Custom Filter');
}
$this->ruleset[] = new Column\Rule($this);
return end($this->ruleset);
}
/**
* Add a new AutoFilter Column Rule to the ruleset.
*
* @return $this
*/
public function addRule(Column\Rule $rule)
{
$rule->setParent($this);
$this->ruleset[] = $rule;
return $this;
}
/**
* Delete a specified AutoFilter Column Rule
* If the number of rules is reduced to 1, then we reset And/Or logic to Or.
*
* @param int $index Rule index in the ruleset array
*
* @return $this
*/
public function deleteRule($index)
{
if (isset($this->ruleset[$index])) {
unset($this->ruleset[$index]);
// If we've just deleted down to a single rule, then reset And/Or joining to Or
if (count($this->ruleset) <= 1) {
$this->setJoin(self::AUTOFILTER_COLUMN_JOIN_OR);
}
}
return $this;
}
/**
* Delete all AutoFilter Column Rules.
*
* @return $this
*/
public function clearRules()
{
$this->ruleset = [];
$this->setJoin(self::AUTOFILTER_COLUMN_JOIN_OR);
return $this;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if ($key === 'parent') {
// Detach from autofilter parent
$this->parent = null;
} elseif ($key === 'ruleset') {
// The columns array of \PhpOffice\PhpSpreadsheet\Worksheet\Worksheet\AutoFilter objects
$this->ruleset = [];
foreach ($value as $k => $v) {
$cloned = clone $v;
$cloned->setParent($this); // attach the new cloned Rule to this new cloned Autofilter Cloned object
$this->ruleset[$k] = $cloned;
}
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/AutoFilter/Column/Rule.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/AutoFilter/Column/Rule.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet\AutoFilter\Column;
use PhpOffice\PhpSpreadsheet\Exception as PhpSpreadsheetException;
use PhpOffice\PhpSpreadsheet\Worksheet\AutoFilter\Column;
class Rule
{
const AUTOFILTER_RULETYPE_FILTER = 'filter';
const AUTOFILTER_RULETYPE_DATEGROUP = 'dateGroupItem';
const AUTOFILTER_RULETYPE_CUSTOMFILTER = 'customFilter';
const AUTOFILTER_RULETYPE_DYNAMICFILTER = 'dynamicFilter';
const AUTOFILTER_RULETYPE_TOPTENFILTER = 'top10Filter';
private const RULE_TYPES = [
// Currently we're not handling
// colorFilter
// extLst
// iconFilter
self::AUTOFILTER_RULETYPE_FILTER,
self::AUTOFILTER_RULETYPE_DATEGROUP,
self::AUTOFILTER_RULETYPE_CUSTOMFILTER,
self::AUTOFILTER_RULETYPE_DYNAMICFILTER,
self::AUTOFILTER_RULETYPE_TOPTENFILTER,
];
const AUTOFILTER_RULETYPE_DATEGROUP_YEAR = 'year';
const AUTOFILTER_RULETYPE_DATEGROUP_MONTH = 'month';
const AUTOFILTER_RULETYPE_DATEGROUP_DAY = 'day';
const AUTOFILTER_RULETYPE_DATEGROUP_HOUR = 'hour';
const AUTOFILTER_RULETYPE_DATEGROUP_MINUTE = 'minute';
const AUTOFILTER_RULETYPE_DATEGROUP_SECOND = 'second';
private const DATE_TIME_GROUPS = [
self::AUTOFILTER_RULETYPE_DATEGROUP_YEAR,
self::AUTOFILTER_RULETYPE_DATEGROUP_MONTH,
self::AUTOFILTER_RULETYPE_DATEGROUP_DAY,
self::AUTOFILTER_RULETYPE_DATEGROUP_HOUR,
self::AUTOFILTER_RULETYPE_DATEGROUP_MINUTE,
self::AUTOFILTER_RULETYPE_DATEGROUP_SECOND,
];
const AUTOFILTER_RULETYPE_DYNAMIC_YESTERDAY = 'yesterday';
const AUTOFILTER_RULETYPE_DYNAMIC_TODAY = 'today';
const AUTOFILTER_RULETYPE_DYNAMIC_TOMORROW = 'tomorrow';
const AUTOFILTER_RULETYPE_DYNAMIC_YEARTODATE = 'yearToDate';
const AUTOFILTER_RULETYPE_DYNAMIC_THISYEAR = 'thisYear';
const AUTOFILTER_RULETYPE_DYNAMIC_THISQUARTER = 'thisQuarter';
const AUTOFILTER_RULETYPE_DYNAMIC_THISMONTH = 'thisMonth';
const AUTOFILTER_RULETYPE_DYNAMIC_THISWEEK = 'thisWeek';
const AUTOFILTER_RULETYPE_DYNAMIC_LASTYEAR = 'lastYear';
const AUTOFILTER_RULETYPE_DYNAMIC_LASTQUARTER = 'lastQuarter';
const AUTOFILTER_RULETYPE_DYNAMIC_LASTMONTH = 'lastMonth';
const AUTOFILTER_RULETYPE_DYNAMIC_LASTWEEK = 'lastWeek';
const AUTOFILTER_RULETYPE_DYNAMIC_NEXTYEAR = 'nextYear';
const AUTOFILTER_RULETYPE_DYNAMIC_NEXTQUARTER = 'nextQuarter';
const AUTOFILTER_RULETYPE_DYNAMIC_NEXTMONTH = 'nextMonth';
const AUTOFILTER_RULETYPE_DYNAMIC_NEXTWEEK = 'nextWeek';
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_1 = 'M1';
const AUTOFILTER_RULETYPE_DYNAMIC_JANUARY = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_1;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_2 = 'M2';
const AUTOFILTER_RULETYPE_DYNAMIC_FEBRUARY = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_2;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_3 = 'M3';
const AUTOFILTER_RULETYPE_DYNAMIC_MARCH = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_3;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_4 = 'M4';
const AUTOFILTER_RULETYPE_DYNAMIC_APRIL = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_4;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_5 = 'M5';
const AUTOFILTER_RULETYPE_DYNAMIC_MAY = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_5;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_6 = 'M6';
const AUTOFILTER_RULETYPE_DYNAMIC_JUNE = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_6;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_7 = 'M7';
const AUTOFILTER_RULETYPE_DYNAMIC_JULY = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_7;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_8 = 'M8';
const AUTOFILTER_RULETYPE_DYNAMIC_AUGUST = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_8;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_9 = 'M9';
const AUTOFILTER_RULETYPE_DYNAMIC_SEPTEMBER = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_9;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_10 = 'M10';
const AUTOFILTER_RULETYPE_DYNAMIC_OCTOBER = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_10;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_11 = 'M11';
const AUTOFILTER_RULETYPE_DYNAMIC_NOVEMBER = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_11;
const AUTOFILTER_RULETYPE_DYNAMIC_MONTH_12 = 'M12';
const AUTOFILTER_RULETYPE_DYNAMIC_DECEMBER = self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_12;
const AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_1 = 'Q1';
const AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_2 = 'Q2';
const AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_3 = 'Q3';
const AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_4 = 'Q4';
const AUTOFILTER_RULETYPE_DYNAMIC_ABOVEAVERAGE = 'aboveAverage';
const AUTOFILTER_RULETYPE_DYNAMIC_BELOWAVERAGE = 'belowAverage';
private const DYNAMIC_TYPES = [
self::AUTOFILTER_RULETYPE_DYNAMIC_YESTERDAY,
self::AUTOFILTER_RULETYPE_DYNAMIC_TODAY,
self::AUTOFILTER_RULETYPE_DYNAMIC_TOMORROW,
self::AUTOFILTER_RULETYPE_DYNAMIC_YEARTODATE,
self::AUTOFILTER_RULETYPE_DYNAMIC_THISYEAR,
self::AUTOFILTER_RULETYPE_DYNAMIC_THISQUARTER,
self::AUTOFILTER_RULETYPE_DYNAMIC_THISMONTH,
self::AUTOFILTER_RULETYPE_DYNAMIC_THISWEEK,
self::AUTOFILTER_RULETYPE_DYNAMIC_LASTYEAR,
self::AUTOFILTER_RULETYPE_DYNAMIC_LASTQUARTER,
self::AUTOFILTER_RULETYPE_DYNAMIC_LASTMONTH,
self::AUTOFILTER_RULETYPE_DYNAMIC_LASTWEEK,
self::AUTOFILTER_RULETYPE_DYNAMIC_NEXTYEAR,
self::AUTOFILTER_RULETYPE_DYNAMIC_NEXTQUARTER,
self::AUTOFILTER_RULETYPE_DYNAMIC_NEXTMONTH,
self::AUTOFILTER_RULETYPE_DYNAMIC_NEXTWEEK,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_1,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_2,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_3,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_4,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_5,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_6,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_7,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_8,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_9,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_10,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_11,
self::AUTOFILTER_RULETYPE_DYNAMIC_MONTH_12,
self::AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_1,
self::AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_2,
self::AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_3,
self::AUTOFILTER_RULETYPE_DYNAMIC_QUARTER_4,
self::AUTOFILTER_RULETYPE_DYNAMIC_ABOVEAVERAGE,
self::AUTOFILTER_RULETYPE_DYNAMIC_BELOWAVERAGE,
];
// Filter rule operators for filter and customFilter types.
const AUTOFILTER_COLUMN_RULE_EQUAL = 'equal';
const AUTOFILTER_COLUMN_RULE_NOTEQUAL = 'notEqual';
const AUTOFILTER_COLUMN_RULE_GREATERTHAN = 'greaterThan';
const AUTOFILTER_COLUMN_RULE_GREATERTHANOREQUAL = 'greaterThanOrEqual';
const AUTOFILTER_COLUMN_RULE_LESSTHAN = 'lessThan';
const AUTOFILTER_COLUMN_RULE_LESSTHANOREQUAL = 'lessThanOrEqual';
private const OPERATORS = [
self::AUTOFILTER_COLUMN_RULE_EQUAL,
self::AUTOFILTER_COLUMN_RULE_NOTEQUAL,
self::AUTOFILTER_COLUMN_RULE_GREATERTHAN,
self::AUTOFILTER_COLUMN_RULE_GREATERTHANOREQUAL,
self::AUTOFILTER_COLUMN_RULE_LESSTHAN,
self::AUTOFILTER_COLUMN_RULE_LESSTHANOREQUAL,
];
const AUTOFILTER_COLUMN_RULE_TOPTEN_BY_VALUE = 'byValue';
const AUTOFILTER_COLUMN_RULE_TOPTEN_PERCENT = 'byPercent';
private const TOP_TEN_VALUE = [
self::AUTOFILTER_COLUMN_RULE_TOPTEN_BY_VALUE,
self::AUTOFILTER_COLUMN_RULE_TOPTEN_PERCENT,
];
const AUTOFILTER_COLUMN_RULE_TOPTEN_TOP = 'top';
const AUTOFILTER_COLUMN_RULE_TOPTEN_BOTTOM = 'bottom';
private const TOP_TEN_TYPE = [
self::AUTOFILTER_COLUMN_RULE_TOPTEN_TOP,
self::AUTOFILTER_COLUMN_RULE_TOPTEN_BOTTOM,
];
// Unimplented Rule Operators (Numeric, Boolean etc)
// const AUTOFILTER_COLUMN_RULE_BETWEEN = 'between'; // greaterThanOrEqual 1 && lessThanOrEqual 2
// Rule Operators (Numeric Special) which are translated to standard numeric operators with calculated values
// Rule Operators (String) which are set as wild-carded values
// const AUTOFILTER_COLUMN_RULE_BEGINSWITH = 'beginsWith'; // A*
// const AUTOFILTER_COLUMN_RULE_ENDSWITH = 'endsWith'; // *Z
// const AUTOFILTER_COLUMN_RULE_CONTAINS = 'contains'; // *B*
// const AUTOFILTER_COLUMN_RULE_DOESNTCONTAIN = 'notEqual'; // notEqual *B*
// Rule Operators (Date Special) which are translated to standard numeric operators with calculated values
// const AUTOFILTER_COLUMN_RULE_BEFORE = 'lessThan';
// const AUTOFILTER_COLUMN_RULE_AFTER = 'greaterThan';
/**
* Autofilter Column.
*
* @var ?Column
*/
private $parent;
/**
* Autofilter Rule Type.
*
* @var string
*/
private $ruleType = self::AUTOFILTER_RULETYPE_FILTER;
/**
* Autofilter Rule Value.
*
* @var int|int[]|string|string[]
*/
private $value = '';
/**
* Autofilter Rule Operator.
*
* @var string
*/
private $operator = self::AUTOFILTER_COLUMN_RULE_EQUAL;
/**
* DateTimeGrouping Group Value.
*
* @var string
*/
private $grouping = '';
/**
* Create a new Rule.
*/
public function __construct(?Column $parent = null)
{
$this->parent = $parent;
}
/**
* Get AutoFilter Rule Type.
*
* @return string
*/
public function getRuleType()
{
return $this->ruleType;
}
/**
* Set AutoFilter Rule Type.
*
* @param string $ruleType see self::AUTOFILTER_RULETYPE_*
*
* @return $this
*/
public function setRuleType($ruleType)
{
if (!in_array($ruleType, self::RULE_TYPES)) {
throw new PhpSpreadsheetException('Invalid rule type for column AutoFilter Rule.');
}
$this->ruleType = $ruleType;
return $this;
}
/**
* Get AutoFilter Rule Value.
*
* @return int|int[]|string|string[]
*/
public function getValue()
{
return $this->value;
}
/**
* Set AutoFilter Rule Value.
*
* @param int|int[]|string|string[] $value
*
* @return $this
*/
public function setValue($value)
{
if (is_array($value)) {
$grouping = -1;
foreach ($value as $key => $v) {
// Validate array entries
if (!in_array($key, self::DATE_TIME_GROUPS)) {
// Remove any invalid entries from the value array
unset($value[$key]);
} else {
// Work out what the dateTime grouping will be
$grouping = max($grouping, array_search($key, self::DATE_TIME_GROUPS));
}
}
if (count($value) == 0) {
throw new PhpSpreadsheetException('Invalid rule value for column AutoFilter Rule.');
}
// Set the dateTime grouping that we've anticipated
$this->setGrouping(self::DATE_TIME_GROUPS[$grouping]);
}
$this->value = $value;
return $this;
}
/**
* Get AutoFilter Rule Operator.
*
* @return string
*/
public function getOperator()
{
return $this->operator;
}
/**
* Set AutoFilter Rule Operator.
*
* @param string $operator see self::AUTOFILTER_COLUMN_RULE_*
*
* @return $this
*/
public function setOperator($operator)
{
if (empty($operator)) {
$operator = self::AUTOFILTER_COLUMN_RULE_EQUAL;
}
if (
(!in_array($operator, self::OPERATORS)) &&
(!in_array($operator, self::TOP_TEN_VALUE))
) {
throw new PhpSpreadsheetException('Invalid operator for column AutoFilter Rule.');
}
$this->operator = $operator;
return $this;
}
/**
* Get AutoFilter Rule Grouping.
*
* @return string
*/
public function getGrouping()
{
return $this->grouping;
}
/**
* Set AutoFilter Rule Grouping.
*
* @param string $grouping
*
* @return $this
*/
public function setGrouping($grouping)
{
if (
($grouping !== null) &&
(!in_array($grouping, self::DATE_TIME_GROUPS)) &&
(!in_array($grouping, self::DYNAMIC_TYPES)) &&
(!in_array($grouping, self::TOP_TEN_TYPE))
) {
throw new PhpSpreadsheetException('Invalid grouping for column AutoFilter Rule.');
}
$this->grouping = $grouping;
return $this;
}
/**
* Set AutoFilter Rule.
*
* @param string $operator see self::AUTOFILTER_COLUMN_RULE_*
* @param int|int[]|string|string[] $value
* @param string $grouping
*
* @return $this
*/
public function setRule($operator, $value, $grouping = null)
{
$this->setOperator($operator);
$this->setValue($value);
// Only set grouping if it's been passed in as a user-supplied argument,
// otherwise we're calculating it when we setValue() and don't want to overwrite that
// If the user supplies an argumnet for grouping, then on their own head be it
if ($grouping !== null) {
$this->setGrouping($grouping);
}
return $this;
}
/**
* Get this Rule's AutoFilter Column Parent.
*
* @return ?Column
*/
public function getParent()
{
return $this->parent;
}
/**
* Set this Rule's AutoFilter Column Parent.
*
* @return $this
*/
public function setParent(?Column $parent = null)
{
$this->parent = $parent;
return $this;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
if ($key == 'parent') { // this is only object
// Detach from autofilter column parent
$this->$key = null;
}
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Drawing/Shadow.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Worksheet/Drawing/Shadow.php | <?php
namespace PhpOffice\PhpSpreadsheet\Worksheet\Drawing;
use PhpOffice\PhpSpreadsheet\IComparable;
use PhpOffice\PhpSpreadsheet\Style\Color;
class Shadow implements IComparable
{
// Shadow alignment
const SHADOW_BOTTOM = 'b';
const SHADOW_BOTTOM_LEFT = 'bl';
const SHADOW_BOTTOM_RIGHT = 'br';
const SHADOW_CENTER = 'ctr';
const SHADOW_LEFT = 'l';
const SHADOW_TOP = 't';
const SHADOW_TOP_LEFT = 'tl';
const SHADOW_TOP_RIGHT = 'tr';
/**
* Visible.
*
* @var bool
*/
private $visible;
/**
* Blur radius.
*
* Defaults to 6
*
* @var int
*/
private $blurRadius;
/**
* Shadow distance.
*
* Defaults to 2
*
* @var int
*/
private $distance;
/**
* Shadow direction (in degrees).
*
* @var int
*/
private $direction;
/**
* Shadow alignment.
*
* @var string
*/
private $alignment;
/**
* Color.
*
* @var Color
*/
private $color;
/**
* Alpha.
*
* @var int
*/
private $alpha;
/**
* Create a new Shadow.
*/
public function __construct()
{
// Initialise values
$this->visible = false;
$this->blurRadius = 6;
$this->distance = 2;
$this->direction = 0;
$this->alignment = self::SHADOW_BOTTOM_RIGHT;
$this->color = new Color(Color::COLOR_BLACK);
$this->alpha = 50;
}
/**
* Get Visible.
*
* @return bool
*/
public function getVisible()
{
return $this->visible;
}
/**
* Set Visible.
*
* @param bool $visible
*
* @return $this
*/
public function setVisible($visible)
{
$this->visible = $visible;
return $this;
}
/**
* Get Blur radius.
*
* @return int
*/
public function getBlurRadius()
{
return $this->blurRadius;
}
/**
* Set Blur radius.
*
* @param int $blurRadius
*
* @return $this
*/
public function setBlurRadius($blurRadius)
{
$this->blurRadius = $blurRadius;
return $this;
}
/**
* Get Shadow distance.
*
* @return int
*/
public function getDistance()
{
return $this->distance;
}
/**
* Set Shadow distance.
*
* @param int $distance
*
* @return $this
*/
public function setDistance($distance)
{
$this->distance = $distance;
return $this;
}
/**
* Get Shadow direction (in degrees).
*
* @return int
*/
public function getDirection()
{
return $this->direction;
}
/**
* Set Shadow direction (in degrees).
*
* @param int $direction
*
* @return $this
*/
public function setDirection($direction)
{
$this->direction = $direction;
return $this;
}
/**
* Get Shadow alignment.
*
* @return string
*/
public function getAlignment()
{
return $this->alignment;
}
/**
* Set Shadow alignment.
*
* @param string $alignment
*
* @return $this
*/
public function setAlignment($alignment)
{
$this->alignment = $alignment;
return $this;
}
/**
* Get Color.
*
* @return Color
*/
public function getColor()
{
return $this->color;
}
/**
* Set Color.
*
* @return $this
*/
public function setColor(?Color $color = null)
{
$this->color = $color;
return $this;
}
/**
* Get Alpha.
*
* @return int
*/
public function getAlpha()
{
return $this->alpha;
}
/**
* Set Alpha.
*
* @param int $alpha
*
* @return $this
*/
public function setAlpha($alpha)
{
$this->alpha = $alpha;
return $this;
}
/**
* Get hash code.
*
* @return string Hash code
*/
public function getHashCode()
{
return md5(
($this->visible ? 't' : 'f') .
$this->blurRadius .
$this->distance .
$this->direction .
$this->alignment .
$this->color->getHashCode() .
$this->alpha .
__CLASS__
);
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Dimension.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Dimension.php | <?php
namespace PhpOffice\PhpSpreadsheet\Helper;
use PhpOffice\PhpSpreadsheet\Exception;
use PhpOffice\PhpSpreadsheet\Shared\Drawing;
use PhpOffice\PhpSpreadsheet\Style\Font;
class Dimension
{
public const UOM_CENTIMETERS = 'cm';
public const UOM_MILLIMETERS = 'mm';
public const UOM_INCHES = 'in';
public const UOM_PIXELS = 'px';
public const UOM_POINTS = 'pt';
public const UOM_PICA = 'pc';
/**
* Based on 96 dpi.
*/
const ABSOLUTE_UNITS = [
self::UOM_CENTIMETERS => 96.0 / 2.54,
self::UOM_MILLIMETERS => 96.0 / 25.4,
self::UOM_INCHES => 96.0,
self::UOM_PIXELS => 1.0,
self::UOM_POINTS => 96.0 / 72,
self::UOM_PICA => 96.0 * 12 / 72,
];
/**
* Based on a standard column width of 8.54 units in MS Excel.
*/
const RELATIVE_UNITS = [
'em' => 10.0 / 8.54,
'ex' => 10.0 / 8.54,
'ch' => 10.0 / 8.54,
'rem' => 10.0 / 8.54,
'vw' => 8.54,
'vh' => 8.54,
'vmin' => 8.54,
'vmax' => 8.54,
'%' => 8.54 / 100,
];
/**
* @var float|int If this is a width, then size is measured in pixels (if is set)
* or in Excel's default column width units if $unit is null.
* If this is a height, then size is measured in pixels ()
* or in points () if $unit is null.
*/
protected $size;
/**
* @var null|string
*/
protected $unit;
public function __construct(string $dimension)
{
[$size, $unit] = sscanf($dimension, '%[1234567890.]%s');
$unit = strtolower(trim($unit));
// If a UoM is specified, then convert the size to pixels for internal storage
if (isset(self::ABSOLUTE_UNITS[$unit])) {
$size *= self::ABSOLUTE_UNITS[$unit];
$this->unit = self::UOM_PIXELS;
} elseif (isset(self::RELATIVE_UNITS[$unit])) {
$size *= self::RELATIVE_UNITS[$unit];
$size = round($size, 4);
}
$this->size = $size;
}
public function width(): float
{
return (float) ($this->unit === null)
? $this->size
: round(Drawing::pixelsToCellDimension((int) $this->size, new Font(false)), 4);
}
public function height(): float
{
return (float) ($this->unit === null)
? $this->size
: $this->toUnit(self::UOM_POINTS);
}
public function toUnit(string $unitOfMeasure): float
{
$unitOfMeasure = strtolower($unitOfMeasure);
if (!array_key_exists($unitOfMeasure, self::ABSOLUTE_UNITS)) {
throw new Exception("{$unitOfMeasure} is not a vaid unit of measure");
}
$size = $this->size;
if ($this->unit === null) {
$size = Drawing::cellDimensionToPixels($size, new Font(false));
}
return $size / self::ABSOLUTE_UNITS[$unitOfMeasure];
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Size.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Size.php | <?php
namespace PhpOffice\PhpSpreadsheet\Helper;
class Size
{
const REGEXP_SIZE_VALIDATION = '/^(?P<size>\d*\.?\d+)(?P<unit>pt|px|em)?$/i';
/**
* @var bool
*/
protected $valid;
/**
* @var string
*/
protected $size = '';
/**
* @var string
*/
protected $unit = '';
public function __construct(string $size)
{
$this->valid = (bool) preg_match(self::REGEXP_SIZE_VALIDATION, $size, $matches);
if ($this->valid) {
$this->size = $matches['size'];
$this->unit = $matches['unit'] ?? 'pt';
}
}
public function valid(): bool
{
return $this->valid;
}
public function size(): string
{
return $this->size;
}
public function unit(): string
{
return $this->unit;
}
public function __toString()
{
return $this->size . $this->unit;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Sample.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Sample.php | <?php
namespace PhpOffice\PhpSpreadsheet\Helper;
use PhpOffice\PhpSpreadsheet\IOFactory;
use PhpOffice\PhpSpreadsheet\Spreadsheet;
use PhpOffice\PhpSpreadsheet\Writer\IWriter;
use RecursiveDirectoryIterator;
use RecursiveIteratorIterator;
use RecursiveRegexIterator;
use ReflectionClass;
use RegexIterator;
use RuntimeException;
/**
* Helper class to be used in sample code.
*/
class Sample
{
/**
* Returns whether we run on CLI or browser.
*
* @return bool
*/
public function isCli()
{
return PHP_SAPI === 'cli';
}
/**
* Return the filename currently being executed.
*
* @return string
*/
public function getScriptFilename()
{
return basename($_SERVER['SCRIPT_FILENAME'], '.php');
}
/**
* Whether we are executing the index page.
*
* @return bool
*/
public function isIndex()
{
return $this->getScriptFilename() === 'index';
}
/**
* Return the page title.
*
* @return string
*/
public function getPageTitle()
{
return $this->isIndex() ? 'PHPSpreadsheet' : $this->getScriptFilename();
}
/**
* Return the page heading.
*
* @return string
*/
public function getPageHeading()
{
return $this->isIndex() ? '' : '<h1>' . str_replace('_', ' ', $this->getScriptFilename()) . '</h1>';
}
/**
* Returns an array of all known samples.
*
* @return string[][] [$name => $path]
*/
public function getSamples()
{
// Populate samples
$baseDir = realpath(__DIR__ . '/../../../samples');
$directory = new RecursiveDirectoryIterator($baseDir);
$iterator = new RecursiveIteratorIterator($directory);
$regex = new RegexIterator($iterator, '/^.+\.php$/', RecursiveRegexIterator::GET_MATCH);
$files = [];
foreach ($regex as $file) {
$file = str_replace(str_replace('\\', '/', $baseDir) . '/', '', str_replace('\\', '/', $file[0]));
$info = pathinfo($file);
$category = str_replace('_', ' ', $info['dirname']);
$name = str_replace('_', ' ', preg_replace('/(|\.php)/', '', $info['filename']));
if (!in_array($category, ['.', 'boostrap', 'templates'])) {
if (!isset($files[$category])) {
$files[$category] = [];
}
$files[$category][$name] = $file;
}
}
// Sort everything
ksort($files);
foreach ($files as &$f) {
asort($f);
}
return $files;
}
/**
* Write documents.
*
* @param string $filename
* @param string[] $writers
*/
public function write(Spreadsheet $spreadsheet, $filename, array $writers = ['Xlsx', 'Xls']): void
{
// Set active sheet index to the first sheet, so Excel opens this as the first sheet
$spreadsheet->setActiveSheetIndex(0);
// Write documents
foreach ($writers as $writerType) {
$path = $this->getFilename($filename, mb_strtolower($writerType));
$writer = IOFactory::createWriter($spreadsheet, $writerType);
$callStartTime = microtime(true);
$writer->save($path);
$this->logWrite($writer, $path, $callStartTime);
}
$this->logEndingNotes();
}
protected function isDirOrMkdir(string $folder): bool
{
return \is_dir($folder) || \mkdir($folder);
}
/**
* Returns the temporary directory and make sure it exists.
*
* @return string
*/
private function getTemporaryFolder()
{
$tempFolder = sys_get_temp_dir() . '/phpspreadsheet';
if (!$this->isDirOrMkdir($tempFolder)) {
throw new RuntimeException(sprintf('Directory "%s" was not created', $tempFolder));
}
return $tempFolder;
}
/**
* Returns the filename that should be used for sample output.
*
* @param string $filename
* @param string $extension
*
* @return string
*/
public function getFilename($filename, $extension = 'xlsx')
{
$originalExtension = pathinfo($filename, PATHINFO_EXTENSION);
return $this->getTemporaryFolder() . '/' . str_replace('.' . $originalExtension, '.' . $extension, basename($filename));
}
/**
* Return a random temporary file name.
*
* @param string $extension
*
* @return string
*/
public function getTemporaryFilename($extension = 'xlsx')
{
$temporaryFilename = tempnam($this->getTemporaryFolder(), 'phpspreadsheet-');
unlink($temporaryFilename);
return $temporaryFilename . '.' . $extension;
}
public function log($message): void
{
$eol = $this->isCli() ? PHP_EOL : '<br />';
echo date('H:i:s ') . $message . $eol;
}
/**
* Log ending notes.
*/
public function logEndingNotes(): void
{
// Do not show execution time for index
$this->log('Peak memory usage: ' . (memory_get_peak_usage(true) / 1024 / 1024) . 'MB');
}
/**
* Log a line about the write operation.
*
* @param string $path
* @param float $callStartTime
*/
public function logWrite(IWriter $writer, $path, $callStartTime): void
{
$callEndTime = microtime(true);
$callTime = $callEndTime - $callStartTime;
$reflection = new ReflectionClass($writer);
$format = $reflection->getShortName();
$message = "Write {$format} format to <code>{$path}</code> in " . sprintf('%.4f', $callTime) . ' seconds';
$this->log($message);
}
/**
* Log a line about the read operation.
*
* @param string $format
* @param string $path
* @param float $callStartTime
*/
public function logRead($format, $path, $callStartTime): void
{
$callEndTime = microtime(true);
$callTime = $callEndTime - $callStartTime;
$message = "Read {$format} format from <code>{$path}</code> in " . sprintf('%.4f', $callTime) . ' seconds';
$this->log($message);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Html.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Helper/Html.php | <?php
namespace PhpOffice\PhpSpreadsheet\Helper;
use DOMDocument;
use DOMElement;
use DOMNode;
use DOMText;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Style\Color;
use PhpOffice\PhpSpreadsheet\Style\Font;
class Html
{
protected static $colourMap = [
'aliceblue' => 'f0f8ff',
'antiquewhite' => 'faebd7',
'antiquewhite1' => 'ffefdb',
'antiquewhite2' => 'eedfcc',
'antiquewhite3' => 'cdc0b0',
'antiquewhite4' => '8b8378',
'aqua' => '00ffff',
'aquamarine1' => '7fffd4',
'aquamarine2' => '76eec6',
'aquamarine4' => '458b74',
'azure1' => 'f0ffff',
'azure2' => 'e0eeee',
'azure3' => 'c1cdcd',
'azure4' => '838b8b',
'beige' => 'f5f5dc',
'bisque1' => 'ffe4c4',
'bisque2' => 'eed5b7',
'bisque3' => 'cdb79e',
'bisque4' => '8b7d6b',
'black' => '000000',
'blanchedalmond' => 'ffebcd',
'blue' => '0000ff',
'blue1' => '0000ff',
'blue2' => '0000ee',
'blue4' => '00008b',
'blueviolet' => '8a2be2',
'brown' => 'a52a2a',
'brown1' => 'ff4040',
'brown2' => 'ee3b3b',
'brown3' => 'cd3333',
'brown4' => '8b2323',
'burlywood' => 'deb887',
'burlywood1' => 'ffd39b',
'burlywood2' => 'eec591',
'burlywood3' => 'cdaa7d',
'burlywood4' => '8b7355',
'cadetblue' => '5f9ea0',
'cadetblue1' => '98f5ff',
'cadetblue2' => '8ee5ee',
'cadetblue3' => '7ac5cd',
'cadetblue4' => '53868b',
'chartreuse1' => '7fff00',
'chartreuse2' => '76ee00',
'chartreuse3' => '66cd00',
'chartreuse4' => '458b00',
'chocolate' => 'd2691e',
'chocolate1' => 'ff7f24',
'chocolate2' => 'ee7621',
'chocolate3' => 'cd661d',
'coral' => 'ff7f50',
'coral1' => 'ff7256',
'coral2' => 'ee6a50',
'coral3' => 'cd5b45',
'coral4' => '8b3e2f',
'cornflowerblue' => '6495ed',
'cornsilk1' => 'fff8dc',
'cornsilk2' => 'eee8cd',
'cornsilk3' => 'cdc8b1',
'cornsilk4' => '8b8878',
'cyan1' => '00ffff',
'cyan2' => '00eeee',
'cyan3' => '00cdcd',
'cyan4' => '008b8b',
'darkgoldenrod' => 'b8860b',
'darkgoldenrod1' => 'ffb90f',
'darkgoldenrod2' => 'eead0e',
'darkgoldenrod3' => 'cd950c',
'darkgoldenrod4' => '8b6508',
'darkgreen' => '006400',
'darkkhaki' => 'bdb76b',
'darkolivegreen' => '556b2f',
'darkolivegreen1' => 'caff70',
'darkolivegreen2' => 'bcee68',
'darkolivegreen3' => 'a2cd5a',
'darkolivegreen4' => '6e8b3d',
'darkorange' => 'ff8c00',
'darkorange1' => 'ff7f00',
'darkorange2' => 'ee7600',
'darkorange3' => 'cd6600',
'darkorange4' => '8b4500',
'darkorchid' => '9932cc',
'darkorchid1' => 'bf3eff',
'darkorchid2' => 'b23aee',
'darkorchid3' => '9a32cd',
'darkorchid4' => '68228b',
'darksalmon' => 'e9967a',
'darkseagreen' => '8fbc8f',
'darkseagreen1' => 'c1ffc1',
'darkseagreen2' => 'b4eeb4',
'darkseagreen3' => '9bcd9b',
'darkseagreen4' => '698b69',
'darkslateblue' => '483d8b',
'darkslategray' => '2f4f4f',
'darkslategray1' => '97ffff',
'darkslategray2' => '8deeee',
'darkslategray3' => '79cdcd',
'darkslategray4' => '528b8b',
'darkturquoise' => '00ced1',
'darkviolet' => '9400d3',
'deeppink1' => 'ff1493',
'deeppink2' => 'ee1289',
'deeppink3' => 'cd1076',
'deeppink4' => '8b0a50',
'deepskyblue1' => '00bfff',
'deepskyblue2' => '00b2ee',
'deepskyblue3' => '009acd',
'deepskyblue4' => '00688b',
'dimgray' => '696969',
'dodgerblue1' => '1e90ff',
'dodgerblue2' => '1c86ee',
'dodgerblue3' => '1874cd',
'dodgerblue4' => '104e8b',
'firebrick' => 'b22222',
'firebrick1' => 'ff3030',
'firebrick2' => 'ee2c2c',
'firebrick3' => 'cd2626',
'firebrick4' => '8b1a1a',
'floralwhite' => 'fffaf0',
'forestgreen' => '228b22',
'fuchsia' => 'ff00ff',
'gainsboro' => 'dcdcdc',
'ghostwhite' => 'f8f8ff',
'gold1' => 'ffd700',
'gold2' => 'eec900',
'gold3' => 'cdad00',
'gold4' => '8b7500',
'goldenrod' => 'daa520',
'goldenrod1' => 'ffc125',
'goldenrod2' => 'eeb422',
'goldenrod3' => 'cd9b1d',
'goldenrod4' => '8b6914',
'gray' => 'bebebe',
'gray1' => '030303',
'gray10' => '1a1a1a',
'gray11' => '1c1c1c',
'gray12' => '1f1f1f',
'gray13' => '212121',
'gray14' => '242424',
'gray15' => '262626',
'gray16' => '292929',
'gray17' => '2b2b2b',
'gray18' => '2e2e2e',
'gray19' => '303030',
'gray2' => '050505',
'gray20' => '333333',
'gray21' => '363636',
'gray22' => '383838',
'gray23' => '3b3b3b',
'gray24' => '3d3d3d',
'gray25' => '404040',
'gray26' => '424242',
'gray27' => '454545',
'gray28' => '474747',
'gray29' => '4a4a4a',
'gray3' => '080808',
'gray30' => '4d4d4d',
'gray31' => '4f4f4f',
'gray32' => '525252',
'gray33' => '545454',
'gray34' => '575757',
'gray35' => '595959',
'gray36' => '5c5c5c',
'gray37' => '5e5e5e',
'gray38' => '616161',
'gray39' => '636363',
'gray4' => '0a0a0a',
'gray40' => '666666',
'gray41' => '696969',
'gray42' => '6b6b6b',
'gray43' => '6e6e6e',
'gray44' => '707070',
'gray45' => '737373',
'gray46' => '757575',
'gray47' => '787878',
'gray48' => '7a7a7a',
'gray49' => '7d7d7d',
'gray5' => '0d0d0d',
'gray50' => '7f7f7f',
'gray51' => '828282',
'gray52' => '858585',
'gray53' => '878787',
'gray54' => '8a8a8a',
'gray55' => '8c8c8c',
'gray56' => '8f8f8f',
'gray57' => '919191',
'gray58' => '949494',
'gray59' => '969696',
'gray6' => '0f0f0f',
'gray60' => '999999',
'gray61' => '9c9c9c',
'gray62' => '9e9e9e',
'gray63' => 'a1a1a1',
'gray64' => 'a3a3a3',
'gray65' => 'a6a6a6',
'gray66' => 'a8a8a8',
'gray67' => 'ababab',
'gray68' => 'adadad',
'gray69' => 'b0b0b0',
'gray7' => '121212',
'gray70' => 'b3b3b3',
'gray71' => 'b5b5b5',
'gray72' => 'b8b8b8',
'gray73' => 'bababa',
'gray74' => 'bdbdbd',
'gray75' => 'bfbfbf',
'gray76' => 'c2c2c2',
'gray77' => 'c4c4c4',
'gray78' => 'c7c7c7',
'gray79' => 'c9c9c9',
'gray8' => '141414',
'gray80' => 'cccccc',
'gray81' => 'cfcfcf',
'gray82' => 'd1d1d1',
'gray83' => 'd4d4d4',
'gray84' => 'd6d6d6',
'gray85' => 'd9d9d9',
'gray86' => 'dbdbdb',
'gray87' => 'dedede',
'gray88' => 'e0e0e0',
'gray89' => 'e3e3e3',
'gray9' => '171717',
'gray90' => 'e5e5e5',
'gray91' => 'e8e8e8',
'gray92' => 'ebebeb',
'gray93' => 'ededed',
'gray94' => 'f0f0f0',
'gray95' => 'f2f2f2',
'gray97' => 'f7f7f7',
'gray98' => 'fafafa',
'gray99' => 'fcfcfc',
'green' => '00ff00',
'green1' => '00ff00',
'green2' => '00ee00',
'green3' => '00cd00',
'green4' => '008b00',
'greenyellow' => 'adff2f',
'honeydew1' => 'f0fff0',
'honeydew2' => 'e0eee0',
'honeydew3' => 'c1cdc1',
'honeydew4' => '838b83',
'hotpink' => 'ff69b4',
'hotpink1' => 'ff6eb4',
'hotpink2' => 'ee6aa7',
'hotpink3' => 'cd6090',
'hotpink4' => '8b3a62',
'indianred' => 'cd5c5c',
'indianred1' => 'ff6a6a',
'indianred2' => 'ee6363',
'indianred3' => 'cd5555',
'indianred4' => '8b3a3a',
'ivory1' => 'fffff0',
'ivory2' => 'eeeee0',
'ivory3' => 'cdcdc1',
'ivory4' => '8b8b83',
'khaki' => 'f0e68c',
'khaki1' => 'fff68f',
'khaki2' => 'eee685',
'khaki3' => 'cdc673',
'khaki4' => '8b864e',
'lavender' => 'e6e6fa',
'lavenderblush1' => 'fff0f5',
'lavenderblush2' => 'eee0e5',
'lavenderblush3' => 'cdc1c5',
'lavenderblush4' => '8b8386',
'lawngreen' => '7cfc00',
'lemonchiffon1' => 'fffacd',
'lemonchiffon2' => 'eee9bf',
'lemonchiffon3' => 'cdc9a5',
'lemonchiffon4' => '8b8970',
'light' => 'eedd82',
'lightblue' => 'add8e6',
'lightblue1' => 'bfefff',
'lightblue2' => 'b2dfee',
'lightblue3' => '9ac0cd',
'lightblue4' => '68838b',
'lightcoral' => 'f08080',
'lightcyan1' => 'e0ffff',
'lightcyan2' => 'd1eeee',
'lightcyan3' => 'b4cdcd',
'lightcyan4' => '7a8b8b',
'lightgoldenrod1' => 'ffec8b',
'lightgoldenrod2' => 'eedc82',
'lightgoldenrod3' => 'cdbe70',
'lightgoldenrod4' => '8b814c',
'lightgoldenrodyellow' => 'fafad2',
'lightgray' => 'd3d3d3',
'lightpink' => 'ffb6c1',
'lightpink1' => 'ffaeb9',
'lightpink2' => 'eea2ad',
'lightpink3' => 'cd8c95',
'lightpink4' => '8b5f65',
'lightsalmon1' => 'ffa07a',
'lightsalmon2' => 'ee9572',
'lightsalmon3' => 'cd8162',
'lightsalmon4' => '8b5742',
'lightseagreen' => '20b2aa',
'lightskyblue' => '87cefa',
'lightskyblue1' => 'b0e2ff',
'lightskyblue2' => 'a4d3ee',
'lightskyblue3' => '8db6cd',
'lightskyblue4' => '607b8b',
'lightslateblue' => '8470ff',
'lightslategray' => '778899',
'lightsteelblue' => 'b0c4de',
'lightsteelblue1' => 'cae1ff',
'lightsteelblue2' => 'bcd2ee',
'lightsteelblue3' => 'a2b5cd',
'lightsteelblue4' => '6e7b8b',
'lightyellow1' => 'ffffe0',
'lightyellow2' => 'eeeed1',
'lightyellow3' => 'cdcdb4',
'lightyellow4' => '8b8b7a',
'lime' => '00ff00',
'limegreen' => '32cd32',
'linen' => 'faf0e6',
'magenta' => 'ff00ff',
'magenta2' => 'ee00ee',
'magenta3' => 'cd00cd',
'magenta4' => '8b008b',
'maroon' => 'b03060',
'maroon1' => 'ff34b3',
'maroon2' => 'ee30a7',
'maroon3' => 'cd2990',
'maroon4' => '8b1c62',
'medium' => '66cdaa',
'mediumaquamarine' => '66cdaa',
'mediumblue' => '0000cd',
'mediumorchid' => 'ba55d3',
'mediumorchid1' => 'e066ff',
'mediumorchid2' => 'd15fee',
'mediumorchid3' => 'b452cd',
'mediumorchid4' => '7a378b',
'mediumpurple' => '9370db',
'mediumpurple1' => 'ab82ff',
'mediumpurple2' => '9f79ee',
'mediumpurple3' => '8968cd',
'mediumpurple4' => '5d478b',
'mediumseagreen' => '3cb371',
'mediumslateblue' => '7b68ee',
'mediumspringgreen' => '00fa9a',
'mediumturquoise' => '48d1cc',
'mediumvioletred' => 'c71585',
'midnightblue' => '191970',
'mintcream' => 'f5fffa',
'mistyrose1' => 'ffe4e1',
'mistyrose2' => 'eed5d2',
'mistyrose3' => 'cdb7b5',
'mistyrose4' => '8b7d7b',
'moccasin' => 'ffe4b5',
'navajowhite1' => 'ffdead',
'navajowhite2' => 'eecfa1',
'navajowhite3' => 'cdb38b',
'navajowhite4' => '8b795e',
'navy' => '000080',
'navyblue' => '000080',
'oldlace' => 'fdf5e6',
'olive' => '808000',
'olivedrab' => '6b8e23',
'olivedrab1' => 'c0ff3e',
'olivedrab2' => 'b3ee3a',
'olivedrab4' => '698b22',
'orange' => 'ffa500',
'orange1' => 'ffa500',
'orange2' => 'ee9a00',
'orange3' => 'cd8500',
'orange4' => '8b5a00',
'orangered1' => 'ff4500',
'orangered2' => 'ee4000',
'orangered3' => 'cd3700',
'orangered4' => '8b2500',
'orchid' => 'da70d6',
'orchid1' => 'ff83fa',
'orchid2' => 'ee7ae9',
'orchid3' => 'cd69c9',
'orchid4' => '8b4789',
'pale' => 'db7093',
'palegoldenrod' => 'eee8aa',
'palegreen' => '98fb98',
'palegreen1' => '9aff9a',
'palegreen2' => '90ee90',
'palegreen3' => '7ccd7c',
'palegreen4' => '548b54',
'paleturquoise' => 'afeeee',
'paleturquoise1' => 'bbffff',
'paleturquoise2' => 'aeeeee',
'paleturquoise3' => '96cdcd',
'paleturquoise4' => '668b8b',
'palevioletred' => 'db7093',
'palevioletred1' => 'ff82ab',
'palevioletred2' => 'ee799f',
'palevioletred3' => 'cd6889',
'palevioletred4' => '8b475d',
'papayawhip' => 'ffefd5',
'peachpuff1' => 'ffdab9',
'peachpuff2' => 'eecbad',
'peachpuff3' => 'cdaf95',
'peachpuff4' => '8b7765',
'pink' => 'ffc0cb',
'pink1' => 'ffb5c5',
'pink2' => 'eea9b8',
'pink3' => 'cd919e',
'pink4' => '8b636c',
'plum' => 'dda0dd',
'plum1' => 'ffbbff',
'plum2' => 'eeaeee',
'plum3' => 'cd96cd',
'plum4' => '8b668b',
'powderblue' => 'b0e0e6',
'purple' => 'a020f0',
'rebeccapurple' => '663399',
'purple1' => '9b30ff',
'purple2' => '912cee',
'purple3' => '7d26cd',
'purple4' => '551a8b',
'red' => 'ff0000',
'red1' => 'ff0000',
'red2' => 'ee0000',
'red3' => 'cd0000',
'red4' => '8b0000',
'rosybrown' => 'bc8f8f',
'rosybrown1' => 'ffc1c1',
'rosybrown2' => 'eeb4b4',
'rosybrown3' => 'cd9b9b',
'rosybrown4' => '8b6969',
'royalblue' => '4169e1',
'royalblue1' => '4876ff',
'royalblue2' => '436eee',
'royalblue3' => '3a5fcd',
'royalblue4' => '27408b',
'saddlebrown' => '8b4513',
'salmon' => 'fa8072',
'salmon1' => 'ff8c69',
'salmon2' => 'ee8262',
'salmon3' => 'cd7054',
'salmon4' => '8b4c39',
'sandybrown' => 'f4a460',
'seagreen1' => '54ff9f',
'seagreen2' => '4eee94',
'seagreen3' => '43cd80',
'seagreen4' => '2e8b57',
'seashell1' => 'fff5ee',
'seashell2' => 'eee5de',
'seashell3' => 'cdc5bf',
'seashell4' => '8b8682',
'sienna' => 'a0522d',
'sienna1' => 'ff8247',
'sienna2' => 'ee7942',
'sienna3' => 'cd6839',
'sienna4' => '8b4726',
'silver' => 'c0c0c0',
'skyblue' => '87ceeb',
'skyblue1' => '87ceff',
'skyblue2' => '7ec0ee',
'skyblue3' => '6ca6cd',
'skyblue4' => '4a708b',
'slateblue' => '6a5acd',
'slateblue1' => '836fff',
'slateblue2' => '7a67ee',
'slateblue3' => '6959cd',
'slateblue4' => '473c8b',
'slategray' => '708090',
'slategray1' => 'c6e2ff',
'slategray2' => 'b9d3ee',
'slategray3' => '9fb6cd',
'slategray4' => '6c7b8b',
'snow1' => 'fffafa',
'snow2' => 'eee9e9',
'snow3' => 'cdc9c9',
'snow4' => '8b8989',
'springgreen1' => '00ff7f',
'springgreen2' => '00ee76',
'springgreen3' => '00cd66',
'springgreen4' => '008b45',
'steelblue' => '4682b4',
'steelblue1' => '63b8ff',
'steelblue2' => '5cacee',
'steelblue3' => '4f94cd',
'steelblue4' => '36648b',
'tan' => 'd2b48c',
'tan1' => 'ffa54f',
'tan2' => 'ee9a49',
'tan3' => 'cd853f',
'tan4' => '8b5a2b',
'teal' => '008080',
'thistle' => 'd8bfd8',
'thistle1' => 'ffe1ff',
'thistle2' => 'eed2ee',
'thistle3' => 'cdb5cd',
'thistle4' => '8b7b8b',
'tomato1' => 'ff6347',
'tomato2' => 'ee5c42',
'tomato3' => 'cd4f39',
'tomato4' => '8b3626',
'turquoise' => '40e0d0',
'turquoise1' => '00f5ff',
'turquoise2' => '00e5ee',
'turquoise3' => '00c5cd',
'turquoise4' => '00868b',
'violet' => 'ee82ee',
'violetred' => 'd02090',
'violetred1' => 'ff3e96',
'violetred2' => 'ee3a8c',
'violetred3' => 'cd3278',
'violetred4' => '8b2252',
'wheat' => 'f5deb3',
'wheat1' => 'ffe7ba',
'wheat2' => 'eed8ae',
'wheat3' => 'cdba96',
'wheat4' => '8b7e66',
'white' => 'ffffff',
'whitesmoke' => 'f5f5f5',
'yellow' => 'ffff00',
'yellow1' => 'ffff00',
'yellow2' => 'eeee00',
'yellow3' => 'cdcd00',
'yellow4' => '8b8b00',
'yellowgreen' => '9acd32',
];
protected $face;
protected $size;
protected $color;
protected $bold = false;
protected $italic = false;
protected $underline = false;
protected $superscript = false;
protected $subscript = false;
protected $strikethrough = false;
protected $startTagCallbacks = [
'font' => 'startFontTag',
'b' => 'startBoldTag',
'strong' => 'startBoldTag',
'i' => 'startItalicTag',
'em' => 'startItalicTag',
'u' => 'startUnderlineTag',
'ins' => 'startUnderlineTag',
'del' => 'startStrikethruTag',
'sup' => 'startSuperscriptTag',
'sub' => 'startSubscriptTag',
];
protected $endTagCallbacks = [
'font' => 'endFontTag',
'b' => 'endBoldTag',
'strong' => 'endBoldTag',
'i' => 'endItalicTag',
'em' => 'endItalicTag',
'u' => 'endUnderlineTag',
'ins' => 'endUnderlineTag',
'del' => 'endStrikethruTag',
'sup' => 'endSuperscriptTag',
'sub' => 'endSubscriptTag',
'br' => 'breakTag',
'p' => 'breakTag',
'h1' => 'breakTag',
'h2' => 'breakTag',
'h3' => 'breakTag',
'h4' => 'breakTag',
'h5' => 'breakTag',
'h6' => 'breakTag',
];
protected $stack = [];
protected $stringData = '';
/**
* @var RichText
*/
protected $richTextObject;
protected function initialise(): void
{
$this->face = $this->size = $this->color = null;
$this->bold = $this->italic = $this->underline = $this->superscript = $this->subscript = $this->strikethrough = false;
$this->stack = [];
$this->stringData = '';
}
/**
* Parse HTML formatting and return the resulting RichText.
*
* @param string $html
*
* @return RichText
*/
public function toRichTextObject($html)
{
$this->initialise();
// Create a new DOM object
$dom = new DOMDocument();
// Load the HTML file into the DOM object
// Note the use of error suppression, because typically this will be an html fragment, so not fully valid markup
$prefix = '<?xml encoding="UTF-8">';
@$dom->loadHTML($prefix . $html, LIBXML_HTML_NOIMPLIED | LIBXML_HTML_NODEFDTD);
// Discard excess white space
$dom->preserveWhiteSpace = false;
$this->richTextObject = new RichText();
$this->parseElements($dom);
// Clean any further spurious whitespace
$this->cleanWhitespace();
return $this->richTextObject;
}
protected function cleanWhitespace(): void
{
foreach ($this->richTextObject->getRichTextElements() as $key => $element) {
$text = $element->getText();
// Trim any leading spaces on the first run
if ($key == 0) {
$text = ltrim($text);
}
// Trim any spaces immediately after a line break
$text = preg_replace('/\n */mu', "\n", $text);
$element->setText($text);
}
}
protected function buildTextRun(): void
{
$text = $this->stringData;
if (trim($text) === '') {
return;
}
$richtextRun = $this->richTextObject->createTextRun($this->stringData);
if ($this->face) {
$richtextRun->getFont()->setName($this->face);
}
if ($this->size) {
$richtextRun->getFont()->setSize($this->size);
}
if ($this->color) {
$richtextRun->getFont()->setColor(new Color('ff' . $this->color));
}
if ($this->bold) {
$richtextRun->getFont()->setBold(true);
}
if ($this->italic) {
$richtextRun->getFont()->setItalic(true);
}
if ($this->underline) {
$richtextRun->getFont()->setUnderline(Font::UNDERLINE_SINGLE);
}
if ($this->superscript) {
$richtextRun->getFont()->setSuperscript(true);
}
if ($this->subscript) {
$richtextRun->getFont()->setSubscript(true);
}
if ($this->strikethrough) {
$richtextRun->getFont()->setStrikethrough(true);
}
$this->stringData = '';
}
protected function rgbToColour(string $rgbValue): string
{
preg_match_all('/\d+/', $rgbValue, $values);
foreach ($values[0] as &$value) {
$value = str_pad(dechex($value), 2, '0', STR_PAD_LEFT);
}
return implode('', $values[0]);
}
public static function colourNameLookup(string $colorName): string
{
return self::$colourMap[$colorName] ?? '';
}
protected function startFontTag($tag): void
{
foreach ($tag->attributes as $attribute) {
$attributeName = strtolower($attribute->name);
$attributeValue = $attribute->value;
if ($attributeName == 'color') {
if (preg_match('/rgb\s*\(/', $attributeValue)) {
$this->$attributeName = $this->rgbToColour($attributeValue);
} elseif (strpos(trim($attributeValue), '#') === 0) {
$this->$attributeName = ltrim($attributeValue, '#');
} else {
$this->$attributeName = static::colourNameLookup($attributeValue);
}
} else {
$this->$attributeName = $attributeValue;
}
}
}
protected function endFontTag(): void
{
$this->face = $this->size = $this->color = null;
}
protected function startBoldTag(): void
{
$this->bold = true;
}
protected function endBoldTag(): void
{
$this->bold = false;
}
protected function startItalicTag(): void
{
$this->italic = true;
}
protected function endItalicTag(): void
{
$this->italic = false;
}
protected function startUnderlineTag(): void
{
$this->underline = true;
}
protected function endUnderlineTag(): void
{
$this->underline = false;
}
protected function startSubscriptTag(): void
{
$this->subscript = true;
}
protected function endSubscriptTag(): void
{
$this->subscript = false;
}
protected function startSuperscriptTag(): void
{
$this->superscript = true;
}
protected function endSuperscriptTag(): void
{
$this->superscript = false;
}
protected function startStrikethruTag(): void
{
$this->strikethrough = true;
}
protected function endStrikethruTag(): void
{
$this->strikethrough = false;
}
protected function breakTag(): void
{
$this->stringData .= "\n";
}
protected function parseTextNode(DOMText $textNode): void
{
$domText = preg_replace(
'/\s+/u',
' ',
str_replace(["\r", "\n"], ' ', $textNode->nodeValue)
);
$this->stringData .= $domText;
$this->buildTextRun();
}
/**
* @param string $callbackTag
*/
protected function handleCallback(DOMElement $element, $callbackTag, array $callbacks): void
{
if (isset($callbacks[$callbackTag])) {
$elementHandler = $callbacks[$callbackTag];
if (method_exists($this, $elementHandler)) {
call_user_func([$this, $elementHandler], $element);
}
}
}
protected function parseElementNode(DOMElement $element): void
{
$callbackTag = strtolower($element->nodeName);
$this->stack[] = $callbackTag;
$this->handleCallback($element, $callbackTag, $this->startTagCallbacks);
$this->parseElements($element);
array_pop($this->stack);
$this->handleCallback($element, $callbackTag, $this->endTagCallbacks);
}
protected function parseElements(DOMNode $element): void
{
foreach ($element->childNodes as $child) {
if ($child instanceof DOMText) {
$this->parseTextNode($child);
} elseif ($child instanceof DOMElement) {
$this->parseElementNode($child);
}
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/Cell.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/Cell.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\Collection\Cells;
use PhpOffice\PhpSpreadsheet\Exception;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Style\NumberFormat;
use PhpOffice\PhpSpreadsheet\Style\Style;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
use Throwable;
class Cell
{
/**
* Value binder to use.
*
* @var IValueBinder
*/
private static $valueBinder;
/**
* Value of the cell.
*
* @var mixed
*/
private $value;
/**
* Calculated value of the cell (used for caching)
* This returns the value last calculated by MS Excel or whichever spreadsheet program was used to
* create the original spreadsheet file.
* Note that this value is not guaranteed to reflect the actual calculated value because it is
* possible that auto-calculation was disabled in the original spreadsheet, and underlying data
* values used by the formula have changed since it was last calculated.
*
* @var mixed
*/
private $calculatedValue;
/**
* Type of the cell data.
*
* @var string
*/
private $dataType;
/**
* Collection of cells.
*
* @var Cells
*/
private $parent;
/**
* Index to cellXf.
*
* @var int
*/
private $xfIndex = 0;
/**
* Attributes of the formula.
*/
private $formulaAttributes;
/**
* Update the cell into the cell collection.
*
* @return $this
*/
public function updateInCollection(): self
{
$this->parent->update($this);
return $this;
}
public function detach(): void
{
// @phpstan-ignore-next-line
$this->parent = null;
}
public function attach(Cells $parent): void
{
$this->parent = $parent;
}
/**
* Create a new Cell.
*
* @param mixed $value
* @param string $dataType
*/
public function __construct($value, $dataType, Worksheet $worksheet)
{
// Initialise cell value
$this->value = $value;
// Set worksheet cache
$this->parent = $worksheet->getCellCollection();
// Set datatype?
if ($dataType !== null) {
if ($dataType == DataType::TYPE_STRING2) {
$dataType = DataType::TYPE_STRING;
}
$this->dataType = $dataType;
} elseif (!self::getValueBinder()->bindValue($this, $value)) {
throw new Exception('Value could not be bound to cell.');
}
}
/**
* Get cell coordinate column.
*
* @return string
*/
public function getColumn()
{
return $this->parent->getCurrentColumn();
}
/**
* Get cell coordinate row.
*
* @return int
*/
public function getRow()
{
return $this->parent->getCurrentRow();
}
/**
* Get cell coordinate.
*
* @return string
*/
public function getCoordinate()
{
try {
$coordinate = $this->parent->getCurrentCoordinate();
} catch (Throwable $e) {
$coordinate = null;
}
if ($coordinate === null) {
throw new Exception('Coordinate no longer exists');
}
return $coordinate;
}
/**
* Get cell value.
*
* @return mixed
*/
public function getValue()
{
return $this->value;
}
/**
* Get cell value with formatting.
*
* @return string
*/
public function getFormattedValue()
{
return (string) NumberFormat::toFormattedString(
$this->getCalculatedValue(),
$this->getStyle()
->getNumberFormat()->getFormatCode()
);
}
/**
* Set cell value.
*
* Sets the value for a cell, automatically determining the datatype using the value binder
*
* @param mixed $value Value
*
* @return $this
*/
public function setValue($value)
{
if (!self::getValueBinder()->bindValue($this, $value)) {
throw new Exception('Value could not be bound to cell.');
}
return $this;
}
/**
* Set the value for a cell, with the explicit data type passed to the method (bypassing any use of the value binder).
*
* @param mixed $value Value
* @param string $dataType Explicit data type, see DataType::TYPE_*
*
* @return Cell
*/
public function setValueExplicit($value, $dataType)
{
// set the value according to data type
switch ($dataType) {
case DataType::TYPE_NULL:
$this->value = $value;
break;
case DataType::TYPE_STRING2:
$dataType = DataType::TYPE_STRING;
// no break
case DataType::TYPE_STRING:
// Synonym for string
case DataType::TYPE_INLINE:
// Rich text
$this->value = DataType::checkString($value);
break;
case DataType::TYPE_NUMERIC:
if (is_string($value) && !is_numeric($value)) {
throw new Exception('Invalid numeric value for datatype Numeric');
}
$this->value = 0 + $value;
break;
case DataType::TYPE_FORMULA:
$this->value = (string) $value;
break;
case DataType::TYPE_BOOL:
$this->value = (bool) $value;
break;
case DataType::TYPE_ERROR:
$this->value = DataType::checkErrorCode($value);
break;
default:
throw new Exception('Invalid datatype: ' . $dataType);
break;
}
// set the datatype
$this->dataType = $dataType;
return $this->updateInCollection();
}
/**
* Get calculated cell value.
*
* @param bool $resetLog Whether the calculation engine logger should be reset or not
*
* @return mixed
*/
public function getCalculatedValue($resetLog = true)
{
if ($this->dataType == DataType::TYPE_FORMULA) {
try {
$index = $this->getWorksheet()->getParent()->getActiveSheetIndex();
$selected = $this->getWorksheet()->getSelectedCells();
$result = Calculation::getInstance(
$this->getWorksheet()->getParent()
)->calculateCellValue($this, $resetLog);
$this->getWorksheet()->setSelectedCells($selected);
$this->getWorksheet()->getParent()->setActiveSheetIndex($index);
// We don't yet handle array returns
if (is_array($result)) {
while (is_array($result)) {
$result = array_shift($result);
}
}
} catch (Exception $ex) {
if (($ex->getMessage() === 'Unable to access External Workbook') && ($this->calculatedValue !== null)) {
return $this->calculatedValue; // Fallback for calculations referencing external files.
} elseif (preg_match('/[Uu]ndefined (name|offset: 2|array key 2)/', $ex->getMessage()) === 1) {
return \PhpOffice\PhpSpreadsheet\Calculation\Functions::NAME();
}
throw new \PhpOffice\PhpSpreadsheet\Calculation\Exception(
$this->getWorksheet()->getTitle() . '!' . $this->getCoordinate() . ' -> ' . $ex->getMessage()
);
}
if ($result === '#Not Yet Implemented') {
return $this->calculatedValue; // Fallback if calculation engine does not support the formula.
}
return $result;
} elseif ($this->value instanceof RichText) {
return $this->value->getPlainText();
}
return $this->value;
}
/**
* Set old calculated value (cached).
*
* @param mixed $originalValue Value
*
* @return Cell
*/
public function setCalculatedValue($originalValue)
{
if ($originalValue !== null) {
$this->calculatedValue = (is_numeric($originalValue)) ? (float) $originalValue : $originalValue;
}
return $this->updateInCollection();
}
/**
* Get old calculated value (cached)
* This returns the value last calculated by MS Excel or whichever spreadsheet program was used to
* create the original spreadsheet file.
* Note that this value is not guaranteed to reflect the actual calculated value because it is
* possible that auto-calculation was disabled in the original spreadsheet, and underlying data
* values used by the formula have changed since it was last calculated.
*
* @return mixed
*/
public function getOldCalculatedValue()
{
return $this->calculatedValue;
}
/**
* Get cell data type.
*
* @return string
*/
public function getDataType()
{
return $this->dataType;
}
/**
* Set cell data type.
*
* @param string $dataType see DataType::TYPE_*
*
* @return Cell
*/
public function setDataType($dataType)
{
if ($dataType == DataType::TYPE_STRING2) {
$dataType = DataType::TYPE_STRING;
}
$this->dataType = $dataType;
return $this->updateInCollection();
}
/**
* Identify if the cell contains a formula.
*
* @return bool
*/
public function isFormula()
{
return $this->dataType == DataType::TYPE_FORMULA;
}
/**
* Does this cell contain Data validation rules?
*
* @return bool
*/
public function hasDataValidation()
{
if (!isset($this->parent)) {
throw new Exception('Cannot check for data validation when cell is not bound to a worksheet');
}
return $this->getWorksheet()->dataValidationExists($this->getCoordinate());
}
/**
* Get Data validation rules.
*
* @return DataValidation
*/
public function getDataValidation()
{
if (!isset($this->parent)) {
throw new Exception('Cannot get data validation for cell that is not bound to a worksheet');
}
return $this->getWorksheet()->getDataValidation($this->getCoordinate());
}
/**
* Set Data validation rules.
*/
public function setDataValidation(?DataValidation $dataValidation = null): self
{
if (!isset($this->parent)) {
throw new Exception('Cannot set data validation for cell that is not bound to a worksheet');
}
$this->getWorksheet()->setDataValidation($this->getCoordinate(), $dataValidation);
return $this->updateInCollection();
}
/**
* Does this cell contain valid value?
*
* @return bool
*/
public function hasValidValue()
{
$validator = new DataValidator();
return $validator->isValid($this);
}
/**
* Does this cell contain a Hyperlink?
*
* @return bool
*/
public function hasHyperlink()
{
if (!isset($this->parent)) {
throw new Exception('Cannot check for hyperlink when cell is not bound to a worksheet');
}
return $this->getWorksheet()->hyperlinkExists($this->getCoordinate());
}
/**
* Get Hyperlink.
*
* @return Hyperlink
*/
public function getHyperlink()
{
if (!isset($this->parent)) {
throw new Exception('Cannot get hyperlink for cell that is not bound to a worksheet');
}
return $this->getWorksheet()->getHyperlink($this->getCoordinate());
}
/**
* Set Hyperlink.
*
* @return Cell
*/
public function setHyperlink(?Hyperlink $hyperlink = null)
{
if (!isset($this->parent)) {
throw new Exception('Cannot set hyperlink for cell that is not bound to a worksheet');
}
$this->getWorksheet()->setHyperlink($this->getCoordinate(), $hyperlink);
return $this->updateInCollection();
}
/**
* Get cell collection.
*
* @return Cells
*/
public function getParent()
{
return $this->parent;
}
/**
* Get parent worksheet.
*
* @return Worksheet
*/
public function getWorksheet()
{
try {
$worksheet = $this->parent->getParent();
} catch (Throwable $e) {
$worksheet = null;
}
if ($worksheet === null) {
throw new Exception('Worksheet no longer exists');
}
return $worksheet;
}
/**
* Is this cell in a merge range.
*
* @return bool
*/
public function isInMergeRange()
{
return (bool) $this->getMergeRange();
}
/**
* Is this cell the master (top left cell) in a merge range (that holds the actual data value).
*
* @return bool
*/
public function isMergeRangeValueCell()
{
if ($mergeRange = $this->getMergeRange()) {
$mergeRange = Coordinate::splitRange($mergeRange);
[$startCell] = $mergeRange[0];
if ($this->getCoordinate() === $startCell) {
return true;
}
}
return false;
}
/**
* If this cell is in a merge range, then return the range.
*
* @return false|string
*/
public function getMergeRange()
{
foreach ($this->getWorksheet()->getMergeCells() as $mergeRange) {
if ($this->isInRange($mergeRange)) {
return $mergeRange;
}
}
return false;
}
/**
* Get cell style.
*
* @return Style
*/
public function getStyle()
{
return $this->getWorksheet()->getStyle($this->getCoordinate());
}
/**
* Re-bind parent.
*
* @return Cell
*/
public function rebindParent(Worksheet $parent)
{
$this->parent = $parent->getCellCollection();
return $this->updateInCollection();
}
/**
* Is cell in a specific range?
*
* @param string $range Cell range (e.g. A1:A1)
*
* @return bool
*/
public function isInRange($range)
{
[$rangeStart, $rangeEnd] = Coordinate::rangeBoundaries($range);
// Translate properties
$myColumn = Coordinate::columnIndexFromString($this->getColumn());
$myRow = $this->getRow();
// Verify if cell is in range
return ($rangeStart[0] <= $myColumn) && ($rangeEnd[0] >= $myColumn) &&
($rangeStart[1] <= $myRow) && ($rangeEnd[1] >= $myRow);
}
/**
* Compare 2 cells.
*
* @param Cell $a Cell a
* @param Cell $b Cell b
*
* @return int Result of comparison (always -1 or 1, never zero!)
*/
public static function compareCells(self $a, self $b)
{
if ($a->getRow() < $b->getRow()) {
return -1;
} elseif ($a->getRow() > $b->getRow()) {
return 1;
} elseif (Coordinate::columnIndexFromString($a->getColumn()) < Coordinate::columnIndexFromString($b->getColumn())) {
return -1;
}
return 1;
}
/**
* Get value binder to use.
*
* @return IValueBinder
*/
public static function getValueBinder()
{
if (self::$valueBinder === null) {
self::$valueBinder = new DefaultValueBinder();
}
return self::$valueBinder;
}
/**
* Set value binder to use.
*/
public static function setValueBinder(IValueBinder $binder): void
{
self::$valueBinder = $binder;
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if ((is_object($value)) && ($key != 'parent')) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
/**
* Get index to cellXf.
*
* @return int
*/
public function getXfIndex()
{
return $this->xfIndex;
}
/**
* Set index to cellXf.
*
* @param int $indexValue
*
* @return Cell
*/
public function setXfIndex($indexValue)
{
$this->xfIndex = $indexValue;
return $this->updateInCollection();
}
/**
* Set the formula attributes.
*
* @param mixed $attributes
*
* @return $this
*/
public function setFormulaAttributes($attributes)
{
$this->formulaAttributes = $attributes;
return $this;
}
/**
* Get the formula attributes.
*/
public function getFormulaAttributes()
{
return $this->formulaAttributes;
}
/**
* Convert to string.
*
* @return string
*/
public function __toString()
{
return (string) $this->getValue();
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/StringValueBinder.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/StringValueBinder.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
use DateTimeInterface;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
class StringValueBinder implements IValueBinder
{
/**
* @var bool
*/
protected $convertNull = true;
/**
* @var bool
*/
protected $convertBoolean = true;
/**
* @var bool
*/
protected $convertNumeric = true;
/**
* @var bool
*/
protected $convertFormula = true;
public function setNullConversion(bool $suppressConversion = false): self
{
$this->convertNull = $suppressConversion;
return $this;
}
public function setBooleanConversion(bool $suppressConversion = false): self
{
$this->convertBoolean = $suppressConversion;
return $this;
}
public function getBooleanConversion(): bool
{
return $this->convertBoolean;
}
public function setNumericConversion(bool $suppressConversion = false): self
{
$this->convertNumeric = $suppressConversion;
return $this;
}
public function setFormulaConversion(bool $suppressConversion = false): self
{
$this->convertFormula = $suppressConversion;
return $this;
}
public function setConversionForAllValueTypes(bool $suppressConversion = false): self
{
$this->convertNull = $suppressConversion;
$this->convertBoolean = $suppressConversion;
$this->convertNumeric = $suppressConversion;
$this->convertFormula = $suppressConversion;
return $this;
}
/**
* Bind value to a cell.
*
* @param Cell $cell Cell to bind value to
* @param mixed $value Value to bind in cell
*/
public function bindValue(Cell $cell, $value)
{
if (is_object($value)) {
return $this->bindObjectValue($cell, $value);
}
// sanitize UTF-8 strings
if (is_string($value)) {
$value = StringHelper::sanitizeUTF8($value);
}
if ($value === null && $this->convertNull === false) {
$cell->setValueExplicit($value, DataType::TYPE_NULL);
} elseif (is_bool($value) && $this->convertBoolean === false) {
$cell->setValueExplicit($value, DataType::TYPE_BOOL);
} elseif ((is_int($value) || is_float($value)) && $this->convertNumeric === false) {
$cell->setValueExplicit($value, DataType::TYPE_NUMERIC);
} elseif (is_string($value) && strlen($value) > 1 && $value[0] === '=' && $this->convertFormula === false) {
$cell->setValueExplicit($value, DataType::TYPE_FORMULA);
} else {
if (is_string($value) && strlen($value) > 1 && $value[0] === '=') {
$cell->getStyle()->setQuotePrefix(true);
}
$cell->setValueExplicit((string) $value, DataType::TYPE_STRING);
}
return true;
}
protected function bindObjectValue(Cell $cell, object $value): bool
{
// Handle any objects that might be injected
if ($value instanceof DateTimeInterface) {
$value = $value->format('Y-m-d H:i:s');
} elseif ($value instanceof RichText) {
$cell->setValueExplicit($value, DataType::TYPE_INLINE);
return true;
}
$cell->setValueExplicit((string) $value, DataType::TYPE_STRING);
return true;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/DataValidation.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/DataValidation.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
class DataValidation
{
// Data validation types
const TYPE_NONE = 'none';
const TYPE_CUSTOM = 'custom';
const TYPE_DATE = 'date';
const TYPE_DECIMAL = 'decimal';
const TYPE_LIST = 'list';
const TYPE_TEXTLENGTH = 'textLength';
const TYPE_TIME = 'time';
const TYPE_WHOLE = 'whole';
// Data validation error styles
const STYLE_STOP = 'stop';
const STYLE_WARNING = 'warning';
const STYLE_INFORMATION = 'information';
// Data validation operators
const OPERATOR_BETWEEN = 'between';
const OPERATOR_EQUAL = 'equal';
const OPERATOR_GREATERTHAN = 'greaterThan';
const OPERATOR_GREATERTHANOREQUAL = 'greaterThanOrEqual';
const OPERATOR_LESSTHAN = 'lessThan';
const OPERATOR_LESSTHANOREQUAL = 'lessThanOrEqual';
const OPERATOR_NOTBETWEEN = 'notBetween';
const OPERATOR_NOTEQUAL = 'notEqual';
/**
* Formula 1.
*
* @var string
*/
private $formula1 = '';
/**
* Formula 2.
*
* @var string
*/
private $formula2 = '';
/**
* Type.
*
* @var string
*/
private $type = self::TYPE_NONE;
/**
* Error style.
*
* @var string
*/
private $errorStyle = self::STYLE_STOP;
/**
* Operator.
*
* @var string
*/
private $operator = self::OPERATOR_BETWEEN;
/**
* Allow Blank.
*
* @var bool
*/
private $allowBlank = false;
/**
* Show DropDown.
*
* @var bool
*/
private $showDropDown = false;
/**
* Show InputMessage.
*
* @var bool
*/
private $showInputMessage = false;
/**
* Show ErrorMessage.
*
* @var bool
*/
private $showErrorMessage = false;
/**
* Error title.
*
* @var string
*/
private $errorTitle = '';
/**
* Error.
*
* @var string
*/
private $error = '';
/**
* Prompt title.
*
* @var string
*/
private $promptTitle = '';
/**
* Prompt.
*
* @var string
*/
private $prompt = '';
/**
* Create a new DataValidation.
*/
public function __construct()
{
}
/**
* Get Formula 1.
*
* @return string
*/
public function getFormula1()
{
return $this->formula1;
}
/**
* Set Formula 1.
*
* @param string $formula
*
* @return $this
*/
public function setFormula1($formula)
{
$this->formula1 = $formula;
return $this;
}
/**
* Get Formula 2.
*
* @return string
*/
public function getFormula2()
{
return $this->formula2;
}
/**
* Set Formula 2.
*
* @param string $formula
*
* @return $this
*/
public function setFormula2($formula)
{
$this->formula2 = $formula;
return $this;
}
/**
* Get Type.
*
* @return string
*/
public function getType()
{
return $this->type;
}
/**
* Set Type.
*
* @param string $type
*
* @return $this
*/
public function setType($type)
{
$this->type = $type;
return $this;
}
/**
* Get Error style.
*
* @return string
*/
public function getErrorStyle()
{
return $this->errorStyle;
}
/**
* Set Error style.
*
* @param string $errorStyle see self::STYLE_*
*
* @return $this
*/
public function setErrorStyle($errorStyle)
{
$this->errorStyle = $errorStyle;
return $this;
}
/**
* Get Operator.
*
* @return string
*/
public function getOperator()
{
return $this->operator;
}
/**
* Set Operator.
*
* @param string $operator
*
* @return $this
*/
public function setOperator($operator)
{
$this->operator = $operator;
return $this;
}
/**
* Get Allow Blank.
*
* @return bool
*/
public function getAllowBlank()
{
return $this->allowBlank;
}
/**
* Set Allow Blank.
*
* @param bool $allowBlank
*
* @return $this
*/
public function setAllowBlank($allowBlank)
{
$this->allowBlank = $allowBlank;
return $this;
}
/**
* Get Show DropDown.
*
* @return bool
*/
public function getShowDropDown()
{
return $this->showDropDown;
}
/**
* Set Show DropDown.
*
* @param bool $showDropDown
*
* @return $this
*/
public function setShowDropDown($showDropDown)
{
$this->showDropDown = $showDropDown;
return $this;
}
/**
* Get Show InputMessage.
*
* @return bool
*/
public function getShowInputMessage()
{
return $this->showInputMessage;
}
/**
* Set Show InputMessage.
*
* @param bool $showInputMessage
*
* @return $this
*/
public function setShowInputMessage($showInputMessage)
{
$this->showInputMessage = $showInputMessage;
return $this;
}
/**
* Get Show ErrorMessage.
*
* @return bool
*/
public function getShowErrorMessage()
{
return $this->showErrorMessage;
}
/**
* Set Show ErrorMessage.
*
* @param bool $showErrorMessage
*
* @return $this
*/
public function setShowErrorMessage($showErrorMessage)
{
$this->showErrorMessage = $showErrorMessage;
return $this;
}
/**
* Get Error title.
*
* @return string
*/
public function getErrorTitle()
{
return $this->errorTitle;
}
/**
* Set Error title.
*
* @param string $errorTitle
*
* @return $this
*/
public function setErrorTitle($errorTitle)
{
$this->errorTitle = $errorTitle;
return $this;
}
/**
* Get Error.
*
* @return string
*/
public function getError()
{
return $this->error;
}
/**
* Set Error.
*
* @param string $error
*
* @return $this
*/
public function setError($error)
{
$this->error = $error;
return $this;
}
/**
* Get Prompt title.
*
* @return string
*/
public function getPromptTitle()
{
return $this->promptTitle;
}
/**
* Set Prompt title.
*
* @param string $promptTitle
*
* @return $this
*/
public function setPromptTitle($promptTitle)
{
$this->promptTitle = $promptTitle;
return $this;
}
/**
* Get Prompt.
*
* @return string
*/
public function getPrompt()
{
return $this->prompt;
}
/**
* Set Prompt.
*
* @param string $prompt
*
* @return $this
*/
public function setPrompt($prompt)
{
$this->prompt = $prompt;
return $this;
}
/**
* Get hash code.
*
* @return string Hash code
*/
public function getHashCode()
{
return md5(
$this->formula1 .
$this->formula2 .
$this->type .
$this->errorStyle .
$this->operator .
($this->allowBlank ? 't' : 'f') .
($this->showDropDown ? 't' : 'f') .
($this->showInputMessage ? 't' : 'f') .
($this->showErrorMessage ? 't' : 'f') .
$this->errorTitle .
$this->error .
$this->promptTitle .
$this->prompt .
$this->sqref .
__CLASS__
);
}
/**
* Implement PHP __clone to create a deep clone, not just a shallow copy.
*/
public function __clone()
{
$vars = get_object_vars($this);
foreach ($vars as $key => $value) {
if (is_object($value)) {
$this->$key = clone $value;
} else {
$this->$key = $value;
}
}
}
/** @var ?string */
private $sqref;
public function getSqref(): ?string
{
return $this->sqref;
}
public function setSqref(?string $str): self
{
$this->sqref = $str;
return $this;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/IValueBinder.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/IValueBinder.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
interface IValueBinder
{
/**
* Bind value to a cell.
*
* @param Cell $cell Cell to bind value to
* @param mixed $value Value to bind in cell
*
* @return bool
*/
public function bindValue(Cell $cell, $value);
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/DefaultValueBinder.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/DefaultValueBinder.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
use DateTimeInterface;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
class DefaultValueBinder implements IValueBinder
{
/**
* Bind value to a cell.
*
* @param Cell $cell Cell to bind value to
* @param mixed $value Value to bind in cell
*
* @return bool
*/
public function bindValue(Cell $cell, $value)
{
// sanitize UTF-8 strings
if (is_string($value)) {
$value = StringHelper::sanitizeUTF8($value);
} elseif (is_object($value)) {
// Handle any objects that might be injected
if ($value instanceof DateTimeInterface) {
$value = $value->format('Y-m-d H:i:s');
} elseif (!($value instanceof RichText)) {
// Attempt to cast any unexpected objects to string
$value = (string) $value;
}
}
// Set value explicit
$cell->setValueExplicit($value, static::dataTypeForValue($value));
// Done!
return true;
}
/**
* DataType for value.
*
* @param mixed $value
*
* @return string
*/
public static function dataTypeForValue($value)
{
// Match the value against a few data types
if ($value === null) {
return DataType::TYPE_NULL;
} elseif (is_float($value) || is_int($value)) {
return DataType::TYPE_NUMERIC;
} elseif (is_bool($value)) {
return DataType::TYPE_BOOL;
} elseif ($value === '') {
return DataType::TYPE_STRING;
} elseif ($value instanceof RichText) {
return DataType::TYPE_INLINE;
} elseif (is_string($value) && strlen($value) > 1 && $value[0] === '=') {
return DataType::TYPE_FORMULA;
} elseif (preg_match('/^[\+\-]?(\d+\\.?\d*|\d*\\.?\d+)([Ee][\-\+]?[0-2]?\d{1,3})?$/', $value)) {
$tValue = ltrim($value, '+-');
if (is_string($value) && strlen($tValue) > 1 && $tValue[0] === '0' && $tValue[1] !== '.') {
return DataType::TYPE_STRING;
} elseif ((strpos($value, '.') === false) && ($value > PHP_INT_MAX)) {
return DataType::TYPE_STRING;
} elseif (!is_numeric($value)) {
return DataType::TYPE_STRING;
}
return DataType::TYPE_NUMERIC;
} elseif (is_string($value)) {
$errorCodes = DataType::getErrorCodes();
if (isset($errorCodes[$value])) {
return DataType::TYPE_ERROR;
}
}
return DataType::TYPE_STRING;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/Hyperlink.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/Hyperlink.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
class Hyperlink
{
/**
* URL to link the cell to.
*
* @var string
*/
private $url;
/**
* Tooltip to display on the hyperlink.
*
* @var string
*/
private $tooltip;
/**
* Create a new Hyperlink.
*
* @param string $url Url to link the cell to
* @param string $tooltip Tooltip to display on the hyperlink
*/
public function __construct($url = '', $tooltip = '')
{
// Initialise member variables
$this->url = $url;
$this->tooltip = $tooltip;
}
/**
* Get URL.
*
* @return string
*/
public function getUrl()
{
return $this->url;
}
/**
* Set URL.
*
* @param string $url
*
* @return $this
*/
public function setUrl($url)
{
$this->url = $url;
return $this;
}
/**
* Get tooltip.
*
* @return string
*/
public function getTooltip()
{
return $this->tooltip;
}
/**
* Set tooltip.
*
* @param string $tooltip
*
* @return $this
*/
public function setTooltip($tooltip)
{
$this->tooltip = $tooltip;
return $this;
}
/**
* Is this hyperlink internal? (to another worksheet).
*
* @return bool
*/
public function isInternal()
{
return strpos($this->url, 'sheet://') !== false;
}
/**
* @return string
*/
public function getTypeHyperlink()
{
return $this->isInternal() ? '' : 'External';
}
/**
* Get hash code.
*
* @return string Hash code
*/
public function getHashCode()
{
return md5(
$this->url .
$this->tooltip .
__CLASS__
);
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/AddressHelper.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/AddressHelper.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
use PhpOffice\PhpSpreadsheet\Exception;
class AddressHelper
{
public const R1C1_COORDINATE_REGEX = '/(R((?:\[-?\d*\])|(?:\d*))?)(C((?:\[-?\d*\])|(?:\d*))?)/i';
/**
* Converts an R1C1 format cell address to an A1 format cell address.
*/
public static function convertToA1(
string $address,
int $currentRowNumber = 1,
int $currentColumnNumber = 1
): string {
$validityCheck = preg_match('/^(R(\[?-?\d*\]?))(C(\[?-?\d*\]?))$/i', $address, $cellReference);
if ($validityCheck === 0) {
throw new Exception('Invalid R1C1-format Cell Reference');
}
$rowReference = $cellReference[2];
// Empty R reference is the current row
if ($rowReference === '') {
$rowReference = (string) $currentRowNumber;
}
// Bracketed R references are relative to the current row
if ($rowReference[0] === '[') {
$rowReference = $currentRowNumber + (int) trim($rowReference, '[]');
}
$columnReference = $cellReference[4];
// Empty C reference is the current column
if ($columnReference === '') {
$columnReference = (string) $currentColumnNumber;
}
// Bracketed C references are relative to the current column
if (is_string($columnReference) && $columnReference[0] === '[') {
$columnReference = $currentColumnNumber + (int) trim($columnReference, '[]');
}
if ($columnReference <= 0 || $rowReference <= 0) {
throw new Exception('Invalid R1C1-format Cell Reference, Value out of range');
}
$A1CellReference = Coordinate::stringFromColumnIndex($columnReference) . $rowReference;
return $A1CellReference;
}
protected static function convertSpreadsheetMLFormula(string $formula): string
{
$formula = substr($formula, 3);
$temp = explode('"', $formula);
$key = false;
foreach ($temp as &$value) {
// Only replace in alternate array entries (i.e. non-quoted blocks)
if ($key = !$key) {
$value = str_replace(['[.', ':.', ']'], ['', ':', ''], $value);
}
}
unset($value);
return implode('"', $temp);
}
/**
* Converts a formula that uses R1C1/SpreadsheetXML format cell address to an A1 format cell address.
*/
public static function convertFormulaToA1(
string $formula,
int $currentRowNumber = 1,
int $currentColumnNumber = 1
): string {
if (substr($formula, 0, 3) == 'of:') {
// We have an old-style SpreadsheetML Formula
return self::convertSpreadsheetMLFormula($formula);
}
// Convert R1C1 style references to A1 style references (but only when not quoted)
$temp = explode('"', $formula);
$key = false;
foreach ($temp as &$value) {
// Only replace in alternate array entries (i.e. non-quoted blocks)
if ($key = !$key) {
preg_match_all(self::R1C1_COORDINATE_REGEX, $value, $cellReferences, PREG_SET_ORDER + PREG_OFFSET_CAPTURE);
// Reverse the matches array, otherwise all our offsets will become incorrect if we modify our way
// through the formula from left to right. Reversing means that we work right to left.through
// the formula
$cellReferences = array_reverse($cellReferences);
// Loop through each R1C1 style reference in turn, converting it to its A1 style equivalent,
// then modify the formula to use that new reference
foreach ($cellReferences as $cellReference) {
$A1CellReference = self::convertToA1($cellReference[0][0], $currentRowNumber, $currentColumnNumber);
$value = substr_replace($value, $A1CellReference, $cellReference[0][1], strlen($cellReference[0][0]));
}
}
}
unset($value);
// Then rebuild the formula string
return implode('"', $temp);
}
/**
* Converts an A1 format cell address to an R1C1 format cell address.
* If $currentRowNumber or $currentColumnNumber are provided, then the R1C1 address will be formatted as a relative address.
*/
public static function convertToR1C1(
string $address,
?int $currentRowNumber = null,
?int $currentColumnNumber = null
): string {
$validityCheck = preg_match(Coordinate::A1_COORDINATE_REGEX, $address, $cellReference);
if ($validityCheck === 0) {
throw new Exception('Invalid A1-format Cell Reference');
}
$columnId = Coordinate::columnIndexFromString($cellReference['col_ref']);
if ($cellReference['absolute_col'] === '$') {
// Column must be absolute address
$currentColumnNumber = null;
}
$rowId = (int) $cellReference['row_ref'];
if ($cellReference['absolute_row'] === '$') {
// Row must be absolute address
$currentRowNumber = null;
}
if ($currentRowNumber !== null) {
if ($rowId === $currentRowNumber) {
$rowId = '';
} else {
$rowId = '[' . ($rowId - $currentRowNumber) . ']';
}
}
if ($currentColumnNumber !== null) {
if ($columnId === $currentColumnNumber) {
$columnId = '';
} else {
$columnId = '[' . ($columnId - $currentColumnNumber) . ']';
}
}
$R1C1Address = "R{$rowId}C{$columnId}";
return $R1C1Address;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/Coordinate.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/Coordinate.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
use PhpOffice\PhpSpreadsheet\Exception;
use PhpOffice\PhpSpreadsheet\Worksheet\Worksheet;
/**
* Helper class to manipulate cell coordinates.
*
* Columns indexes and rows are always based on 1, **not** on 0. This match the behavior
* that Excel users are used to, and also match the Excel functions `COLUMN()` and `ROW()`.
*/
abstract class Coordinate
{
public const A1_COORDINATE_REGEX = '/^(?<absolute_col>\$?)(?<col_ref>[A-Z]{1,3})(?<absolute_row>\$?)(?<row_ref>\d{1,7})$/i';
/**
* Default range variable constant.
*
* @var string
*/
const DEFAULT_RANGE = 'A1:A1';
/**
* Coordinate from string.
*
* @param string $cellAddress eg: 'A1'
*
* @return array{0: string, 1: string} Array containing column and row (indexes 0 and 1)
*/
public static function coordinateFromString($cellAddress)
{
if (preg_match(self::A1_COORDINATE_REGEX, $cellAddress, $matches)) {
return [$matches['absolute_col'] . $matches['col_ref'], $matches['absolute_row'] . $matches['row_ref']];
} elseif (self::coordinateIsRange($cellAddress)) {
throw new Exception('Cell coordinate string can not be a range of cells');
} elseif ($cellAddress == '') {
throw new Exception('Cell coordinate can not be zero-length string');
}
throw new Exception('Invalid cell coordinate ' . $cellAddress);
}
/**
* Get indexes from a string coordinates.
*
* @param string $coordinates eg: 'A1', '$B$12'
*
* @return array{0: int, 1: int} Array containing column index and row index (indexes 0 and 1)
*/
public static function indexesFromString(string $coordinates): array
{
[$col, $row] = self::coordinateFromString($coordinates);
return [
self::columnIndexFromString(ltrim($col, '$')),
(int) ltrim($row, '$'),
];
}
/**
* Checks if a Cell Address represents a range of cells.
*
* @param string $cellAddress eg: 'A1' or 'A1:A2' or 'A1:A2,C1:C2'
*
* @return bool Whether the coordinate represents a range of cells
*/
public static function coordinateIsRange($cellAddress)
{
return (strpos($cellAddress, ':') !== false) || (strpos($cellAddress, ',') !== false);
}
/**
* Make string row, column or cell coordinate absolute.
*
* @param string $cellAddress e.g. 'A' or '1' or 'A1'
* Note that this value can be a row or column reference as well as a cell reference
*
* @return string Absolute coordinate e.g. '$A' or '$1' or '$A$1'
*/
public static function absoluteReference($cellAddress)
{
if (self::coordinateIsRange($cellAddress)) {
throw new Exception('Cell coordinate string can not be a range of cells');
}
// Split out any worksheet name from the reference
[$worksheet, $cellAddress] = Worksheet::extractSheetTitle($cellAddress, true);
if ($worksheet > '') {
$worksheet .= '!';
}
// Create absolute coordinate
if (ctype_digit($cellAddress)) {
return $worksheet . '$' . $cellAddress;
} elseif (ctype_alpha($cellAddress)) {
return $worksheet . '$' . strtoupper($cellAddress);
}
return $worksheet . self::absoluteCoordinate($cellAddress);
}
/**
* Make string coordinate absolute.
*
* @param string $cellAddress e.g. 'A1'
*
* @return string Absolute coordinate e.g. '$A$1'
*/
public static function absoluteCoordinate($cellAddress)
{
if (self::coordinateIsRange($cellAddress)) {
throw new Exception('Cell coordinate string can not be a range of cells');
}
// Split out any worksheet name from the coordinate
[$worksheet, $cellAddress] = Worksheet::extractSheetTitle($cellAddress, true);
if ($worksheet > '') {
$worksheet .= '!';
}
// Create absolute coordinate
[$column, $row] = self::coordinateFromString($cellAddress);
$column = ltrim($column, '$');
$row = ltrim($row, '$');
return $worksheet . '$' . $column . '$' . $row;
}
/**
* Split range into coordinate strings.
*
* @param string $range e.g. 'B4:D9' or 'B4:D9,H2:O11' or 'B4'
*
* @return array Array containing one or more arrays containing one or two coordinate strings
* e.g. ['B4','D9'] or [['B4','D9'], ['H2','O11']]
* or ['B4']
*/
public static function splitRange($range)
{
// Ensure $pRange is a valid range
if (empty($range)) {
$range = self::DEFAULT_RANGE;
}
$exploded = explode(',', $range);
$counter = count($exploded);
for ($i = 0; $i < $counter; ++$i) {
$exploded[$i] = explode(':', $exploded[$i]);
}
return $exploded;
}
/**
* Build range from coordinate strings.
*
* @param array $range Array containing one or more arrays containing one or two coordinate strings
*
* @return string String representation of $pRange
*/
public static function buildRange(array $range)
{
// Verify range
if (empty($range) || !is_array($range[0])) {
throw new Exception('Range does not contain any information');
}
// Build range
$counter = count($range);
for ($i = 0; $i < $counter; ++$i) {
$range[$i] = implode(':', $range[$i]);
}
return implode(',', $range);
}
/**
* Calculate range boundaries.
*
* @param string $range Cell range (e.g. A1:A1)
*
* @return array Range coordinates [Start Cell, End Cell]
* where Start Cell and End Cell are arrays (Column Number, Row Number)
*/
public static function rangeBoundaries($range)
{
// Ensure $pRange is a valid range
if (empty($range)) {
$range = self::DEFAULT_RANGE;
}
// Uppercase coordinate
$range = strtoupper($range);
// Extract range
if (strpos($range, ':') === false) {
$rangeA = $rangeB = $range;
} else {
[$rangeA, $rangeB] = explode(':', $range);
}
// Calculate range outer borders
$rangeStart = self::coordinateFromString($rangeA);
$rangeEnd = self::coordinateFromString($rangeB);
// Translate column into index
$rangeStart[0] = self::columnIndexFromString($rangeStart[0]);
$rangeEnd[0] = self::columnIndexFromString($rangeEnd[0]);
return [$rangeStart, $rangeEnd];
}
/**
* Calculate range dimension.
*
* @param string $range Cell range (e.g. A1:A1)
*
* @return array Range dimension (width, height)
*/
public static function rangeDimension($range)
{
// Calculate range outer borders
[$rangeStart, $rangeEnd] = self::rangeBoundaries($range);
return [($rangeEnd[0] - $rangeStart[0] + 1), ($rangeEnd[1] - $rangeStart[1] + 1)];
}
/**
* Calculate range boundaries.
*
* @param string $range Cell range (e.g. A1:A1)
*
* @return array Range coordinates [Start Cell, End Cell]
* where Start Cell and End Cell are arrays [Column ID, Row Number]
*/
public static function getRangeBoundaries($range)
{
// Ensure $pRange is a valid range
if (empty($range)) {
$range = self::DEFAULT_RANGE;
}
// Uppercase coordinate
$range = strtoupper($range);
// Extract range
if (strpos($range, ':') === false) {
$rangeA = $rangeB = $range;
} else {
[$rangeA, $rangeB] = explode(':', $range);
}
return [self::coordinateFromString($rangeA), self::coordinateFromString($rangeB)];
}
/**
* Column index from string.
*
* @param string $columnAddress eg 'A'
*
* @return int Column index (A = 1)
*/
public static function columnIndexFromString($columnAddress)
{
// Using a lookup cache adds a slight memory overhead, but boosts speed
// caching using a static within the method is faster than a class static,
// though it's additional memory overhead
static $indexCache = [];
if (isset($indexCache[$columnAddress])) {
return $indexCache[$columnAddress];
}
// It's surprising how costly the strtoupper() and ord() calls actually are, so we use a lookup array rather than use ord()
// and make it case insensitive to get rid of the strtoupper() as well. Because it's a static, there's no significant
// memory overhead either
static $columnLookup = [
'A' => 1, 'B' => 2, 'C' => 3, 'D' => 4, 'E' => 5, 'F' => 6, 'G' => 7, 'H' => 8, 'I' => 9, 'J' => 10, 'K' => 11, 'L' => 12, 'M' => 13,
'N' => 14, 'O' => 15, 'P' => 16, 'Q' => 17, 'R' => 18, 'S' => 19, 'T' => 20, 'U' => 21, 'V' => 22, 'W' => 23, 'X' => 24, 'Y' => 25, 'Z' => 26,
'a' => 1, 'b' => 2, 'c' => 3, 'd' => 4, 'e' => 5, 'f' => 6, 'g' => 7, 'h' => 8, 'i' => 9, 'j' => 10, 'k' => 11, 'l' => 12, 'm' => 13,
'n' => 14, 'o' => 15, 'p' => 16, 'q' => 17, 'r' => 18, 's' => 19, 't' => 20, 'u' => 21, 'v' => 22, 'w' => 23, 'x' => 24, 'y' => 25, 'z' => 26,
];
// We also use the language construct isset() rather than the more costly strlen() function to match the length of $columnAddress
// for improved performance
if (isset($columnAddress[0])) {
if (!isset($columnAddress[1])) {
$indexCache[$columnAddress] = $columnLookup[$columnAddress];
return $indexCache[$columnAddress];
} elseif (!isset($columnAddress[2])) {
$indexCache[$columnAddress] = $columnLookup[$columnAddress[0]] * 26 + $columnLookup[$columnAddress[1]];
return $indexCache[$columnAddress];
} elseif (!isset($columnAddress[3])) {
$indexCache[$columnAddress] = $columnLookup[$columnAddress[0]] * 676 + $columnLookup[$columnAddress[1]] * 26 + $columnLookup[$columnAddress[2]];
return $indexCache[$columnAddress];
}
}
throw new Exception('Column string index can not be ' . ((isset($columnAddress[0])) ? 'longer than 3 characters' : 'empty'));
}
/**
* String from column index.
*
* @param int $columnIndex Column index (A = 1)
*
* @return string
*/
public static function stringFromColumnIndex($columnIndex)
{
static $indexCache = [];
if (!isset($indexCache[$columnIndex])) {
$indexValue = $columnIndex;
$base26 = null;
do {
$characterValue = ($indexValue % 26) ?: 26;
$indexValue = ($indexValue - $characterValue) / 26;
$base26 = chr($characterValue + 64) . ($base26 ?: '');
} while ($indexValue > 0);
$indexCache[$columnIndex] = $base26;
}
return $indexCache[$columnIndex];
}
/**
* Extract all cell references in range, which may be comprised of multiple cell ranges.
*
* @param string $cellRange Range: e.g. 'A1' or 'A1:C10' or 'A1:E10,A20:E25' or 'A1:E5 C3:G7' or 'A1:C1,A3:C3 B1:C3'
*
* @return array Array containing single cell references
*/
public static function extractAllCellReferencesInRange($cellRange): array
{
[$ranges, $operators] = self::getCellBlocksFromRangeString($cellRange);
$cells = [];
foreach ($ranges as $range) {
$cells[] = self::getReferencesForCellBlock($range);
}
$cells = self::processRangeSetOperators($operators, $cells);
if (empty($cells)) {
return [];
}
$cellList = array_merge(...$cells);
$cellList = self::sortCellReferenceArray($cellList);
return $cellList;
}
private static function processRangeSetOperators(array $operators, array $cells): array
{
$operatorCount = count($operators);
for ($offset = 0; $offset < $operatorCount; ++$offset) {
$operator = $operators[$offset];
if ($operator !== ' ') {
continue;
}
$cells[$offset] = array_intersect($cells[$offset], $cells[$offset + 1]);
unset($operators[$offset], $cells[$offset + 1]);
$operators = array_values($operators);
$cells = array_values($cells);
--$offset;
--$operatorCount;
}
return $cells;
}
private static function sortCellReferenceArray(array $cellList): array
{
// Sort the result by column and row
$sortKeys = [];
foreach ($cellList as $coord) {
[$column, $row] = sscanf($coord, '%[A-Z]%d');
$sortKeys[sprintf('%3s%09d', $column, $row)] = $coord;
}
ksort($sortKeys);
return array_values($sortKeys);
}
/**
* Get all cell references for an individual cell block.
*
* @param string $cellBlock A cell range e.g. A4:B5
*
* @return array All individual cells in that range
*/
private static function getReferencesForCellBlock($cellBlock)
{
$returnValue = [];
// Single cell?
if (!self::coordinateIsRange($cellBlock)) {
return (array) $cellBlock;
}
// Range...
$ranges = self::splitRange($cellBlock);
foreach ($ranges as $range) {
// Single cell?
if (!isset($range[1])) {
$returnValue[] = $range[0];
continue;
}
// Range...
[$rangeStart, $rangeEnd] = $range;
[$startColumn, $startRow] = self::coordinateFromString($rangeStart);
[$endColumn, $endRow] = self::coordinateFromString($rangeEnd);
$startColumnIndex = self::columnIndexFromString($startColumn);
$endColumnIndex = self::columnIndexFromString($endColumn);
++$endColumnIndex;
// Current data
$currentColumnIndex = $startColumnIndex;
$currentRow = $startRow;
self::validateRange($cellBlock, $startColumnIndex, $endColumnIndex, $currentRow, $endRow);
// Loop cells
while ($currentColumnIndex < $endColumnIndex) {
while ($currentRow <= $endRow) {
$returnValue[] = self::stringFromColumnIndex($currentColumnIndex) . $currentRow;
++$currentRow;
}
++$currentColumnIndex;
$currentRow = $startRow;
}
}
return $returnValue;
}
/**
* Convert an associative array of single cell coordinates to values to an associative array
* of cell ranges to values. Only adjacent cell coordinates with the same
* value will be merged. If the value is an object, it must implement the method getHashCode().
*
* For example, this function converts:
*
* [ 'A1' => 'x', 'A2' => 'x', 'A3' => 'x', 'A4' => 'y' ]
*
* to:
*
* [ 'A1:A3' => 'x', 'A4' => 'y' ]
*
* @param array $coordinateCollection associative array mapping coordinates to values
*
* @return array associative array mapping coordinate ranges to valuea
*/
public static function mergeRangesInCollection(array $coordinateCollection)
{
$hashedValues = [];
$mergedCoordCollection = [];
foreach ($coordinateCollection as $coord => $value) {
if (self::coordinateIsRange($coord)) {
$mergedCoordCollection[$coord] = $value;
continue;
}
[$column, $row] = self::coordinateFromString($coord);
$row = (int) (ltrim($row, '$'));
$hashCode = $column . '-' . (is_object($value) ? $value->getHashCode() : $value);
if (!isset($hashedValues[$hashCode])) {
$hashedValues[$hashCode] = (object) [
'value' => $value,
'col' => $column,
'rows' => [$row],
];
} else {
$hashedValues[$hashCode]->rows[] = $row;
}
}
ksort($hashedValues);
foreach ($hashedValues as $hashedValue) {
sort($hashedValue->rows);
$rowStart = null;
$rowEnd = null;
$ranges = [];
foreach ($hashedValue->rows as $row) {
if ($rowStart === null) {
$rowStart = $row;
$rowEnd = $row;
} elseif ($rowEnd === $row - 1) {
$rowEnd = $row;
} else {
if ($rowStart == $rowEnd) {
$ranges[] = $hashedValue->col . $rowStart;
} else {
$ranges[] = $hashedValue->col . $rowStart . ':' . $hashedValue->col . $rowEnd;
}
$rowStart = $row;
$rowEnd = $row;
}
}
if ($rowStart !== null) {
if ($rowStart == $rowEnd) {
$ranges[] = $hashedValue->col . $rowStart;
} else {
$ranges[] = $hashedValue->col . $rowStart . ':' . $hashedValue->col . $rowEnd;
}
}
foreach ($ranges as $range) {
$mergedCoordCollection[$range] = $hashedValue->value;
}
}
return $mergedCoordCollection;
}
/**
* Get the individual cell blocks from a range string, removing any $ characters.
* then splitting by operators and returning an array with ranges and operators.
*
* @param string $rangeString
*
* @return array[]
*/
private static function getCellBlocksFromRangeString($rangeString)
{
$rangeString = str_replace('$', '', strtoupper($rangeString));
// split range sets on intersection (space) or union (,) operators
$tokens = preg_split('/([ ,])/', $rangeString, -1, PREG_SPLIT_DELIM_CAPTURE);
// separate the range sets and the operators into arrays
$split = array_chunk($tokens, 2);
$ranges = array_column($split, 0);
$operators = array_column($split, 1);
return [$ranges, $operators];
}
/**
* Check that the given range is valid, i.e. that the start column and row are not greater than the end column and
* row.
*
* @param string $cellBlock The original range, for displaying a meaningful error message
* @param int $startColumnIndex
* @param int $endColumnIndex
* @param int $currentRow
* @param int $endRow
*/
private static function validateRange($cellBlock, $startColumnIndex, $endColumnIndex, $currentRow, $endRow): void
{
if ($startColumnIndex >= $endColumnIndex || $currentRow > $endRow) {
throw new Exception('Invalid range: "' . $cellBlock . '"');
}
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
kiang/pharmacies | https://github.com/kiang/pharmacies/blob/0c425bab53cc1db30b2adadc50fb2ea112d5f414/vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/AdvancedValueBinder.php | vendor/phpoffice/phpspreadsheet/src/PhpSpreadsheet/Cell/AdvancedValueBinder.php | <?php
namespace PhpOffice\PhpSpreadsheet\Cell;
use PhpOffice\PhpSpreadsheet\Calculation\Calculation;
use PhpOffice\PhpSpreadsheet\RichText\RichText;
use PhpOffice\PhpSpreadsheet\Shared\Date;
use PhpOffice\PhpSpreadsheet\Shared\StringHelper;
use PhpOffice\PhpSpreadsheet\Style\NumberFormat;
class AdvancedValueBinder extends DefaultValueBinder implements IValueBinder
{
/**
* Bind value to a cell.
*
* @param Cell $cell Cell to bind value to
* @param mixed $value Value to bind in cell
*
* @return bool
*/
public function bindValue(Cell $cell, $value = null)
{
if ($value === null) {
return parent::bindValue($cell, $value);
} elseif (is_string($value)) {
// sanitize UTF-8 strings
$value = StringHelper::sanitizeUTF8($value);
}
// Find out data type
$dataType = parent::dataTypeForValue($value);
// Style logic - strings
if ($dataType === DataType::TYPE_STRING && !$value instanceof RichText) {
// Test for booleans using locale-setting
if ($value == Calculation::getTRUE()) {
$cell->setValueExplicit(true, DataType::TYPE_BOOL);
return true;
} elseif ($value == Calculation::getFALSE()) {
$cell->setValueExplicit(false, DataType::TYPE_BOOL);
return true;
}
// Check for fractions
if (preg_match('/^([+-]?)\s*(\d+)\s?\/\s*(\d+)$/', $value, $matches)) {
return $this->setProperFraction($matches, $cell);
} elseif (preg_match('/^([+-]?)(\d*) +(\d*)\s?\/\s*(\d*)$/', $value, $matches)) {
return $this->setImproperFraction($matches, $cell);
}
// Check for percentage
if (preg_match('/^\-?\d*\.?\d*\s?\%$/', $value)) {
return $this->setPercentage($value, $cell);
}
// Check for currency
$currencyCode = StringHelper::getCurrencyCode();
$decimalSeparator = StringHelper::getDecimalSeparator();
$thousandsSeparator = StringHelper::getThousandsSeparator();
if (preg_match('/^' . preg_quote($currencyCode, '/') . ' *(\d{1,3}(' . preg_quote($thousandsSeparator, '/') . '\d{3})*|(\d+))(' . preg_quote($decimalSeparator, '/') . '\d{2})?$/', $value)) {
// Convert value to number
$value = (float) trim(str_replace([$currencyCode, $thousandsSeparator, $decimalSeparator], ['', '', '.'], $value));
$cell->setValueExplicit($value, DataType::TYPE_NUMERIC);
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode(
str_replace('$', $currencyCode, NumberFormat::FORMAT_CURRENCY_USD_SIMPLE)
);
return true;
} elseif (preg_match('/^\$ *(\d{1,3}(\,\d{3})*|(\d+))(\.\d{2})?$/', $value)) {
// Convert value to number
$value = (float) trim(str_replace(['$', ','], '', $value));
$cell->setValueExplicit($value, DataType::TYPE_NUMERIC);
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode(NumberFormat::FORMAT_CURRENCY_USD_SIMPLE);
return true;
}
// Check for time without seconds e.g. '9:45', '09:45'
if (preg_match('/^(\d|[0-1]\d|2[0-3]):[0-5]\d$/', $value)) {
return $this->setTimeHoursMinutes($value, $cell);
}
// Check for time with seconds '9:45:59', '09:45:59'
if (preg_match('/^(\d|[0-1]\d|2[0-3]):[0-5]\d:[0-5]\d$/', $value)) {
return $this->setTimeHoursMinutesSeconds($value, $cell);
}
// Check for datetime, e.g. '2008-12-31', '2008-12-31 15:59', '2008-12-31 15:59:10'
if (($d = Date::stringToExcel($value)) !== false) {
// Convert value to number
$cell->setValueExplicit($d, DataType::TYPE_NUMERIC);
// Determine style. Either there is a time part or not. Look for ':'
if (strpos($value, ':') !== false) {
$formatCode = 'yyyy-mm-dd h:mm';
} else {
$formatCode = 'yyyy-mm-dd';
}
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode($formatCode);
return true;
}
// Check for newline character "\n"
if (strpos($value, "\n") !== false) {
$cell->setValueExplicit($value, DataType::TYPE_STRING);
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getAlignment()->setWrapText(true);
return true;
}
}
// Not bound yet? Use parent...
return parent::bindValue($cell, $value);
}
protected function setImproperFraction(array $matches, Cell $cell): bool
{
// Convert value to number
$value = $matches[2] + ($matches[3] / $matches[4]);
if ($matches[1] === '-') {
$value = 0 - $value;
}
$cell->setValueExplicit((float) $value, DataType::TYPE_NUMERIC);
// Build the number format mask based on the size of the matched values
$dividend = str_repeat('?', strlen($matches[3]));
$divisor = str_repeat('?', strlen($matches[4]));
$fractionMask = "# {$dividend}/{$divisor}";
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode($fractionMask);
return true;
}
protected function setProperFraction(array $matches, Cell $cell): bool
{
// Convert value to number
$value = $matches[2] / $matches[3];
if ($matches[1] === '-') {
$value = 0 - $value;
}
$cell->setValueExplicit((float) $value, DataType::TYPE_NUMERIC);
// Build the number format mask based on the size of the matched values
$dividend = str_repeat('?', strlen($matches[2]));
$divisor = str_repeat('?', strlen($matches[3]));
$fractionMask = "{$dividend}/{$divisor}";
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode($fractionMask);
return true;
}
protected function setPercentage(string $value, Cell $cell): bool
{
// Convert value to number
$value = ((float) str_replace('%', '', $value)) / 100;
$cell->setValueExplicit($value, DataType::TYPE_NUMERIC);
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode(NumberFormat::FORMAT_PERCENTAGE_00);
return true;
}
protected function setTimeHoursMinutes(string $value, Cell $cell): bool
{
// Convert value to number
[$hours, $minutes] = explode(':', $value);
$days = ($hours / 24) + ($minutes / 1440);
$cell->setValueExplicit($days, DataType::TYPE_NUMERIC);
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode(NumberFormat::FORMAT_DATE_TIME3);
return true;
}
protected function setTimeHoursMinutesSeconds(string $value, Cell $cell): bool
{
// Convert value to number
[$hours, $minutes, $seconds] = explode(':', $value);
$days = ($hours / 24) + ($minutes / 1440) + ($seconds / 86400);
$cell->setValueExplicit($days, DataType::TYPE_NUMERIC);
// Set style
$cell->getWorksheet()->getStyle($cell->getCoordinate())
->getNumberFormat()->setFormatCode(NumberFormat::FORMAT_DATE_TIME4);
return true;
}
}
| php | MIT | 0c425bab53cc1db30b2adadc50fb2ea112d5f414 | 2026-01-05T03:37:52.991734Z | false |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.