repo
stringlengths
6
65
file_url
stringlengths
81
311
file_path
stringlengths
6
227
content
stringlengths
0
32.8k
language
stringclasses
1 value
license
stringclasses
7 values
commit_sha
stringlengths
40
40
retrieved_at
stringdate
2026-01-04 15:31:58
2026-01-04 20:25:31
truncated
bool
2 classes
rust-mcp-stack/rust-mcp-sdk
https://github.com/rust-mcp-stack/rust-mcp-sdk/blob/c25994d3d800242c1413b7401432f2a5bef3c23f/crates/rust-mcp-transport/src/event_store/in_memory_event_store.rs
crates/rust-mcp-transport/src/event_store/in_memory_event_store.rs
use crate::event_store::EventStoreResult; use crate::{ event_store::{EventStore, EventStoreEntry}, EventId, SessionId, StreamId, }; use async_trait::async_trait; use std::collections::HashMap; use std::collections::VecDeque; use tokio::sync::RwLock; const MAX_EVENTS_PER_SESSION: usize = 64; const ID_SEPARATOR: &str = "-.-"; #[derive(Debug, Clone)] struct EventEntry { pub stream_id: StreamId, pub time_stamp: u128, pub message: String, } #[derive(Debug)] pub struct InMemoryEventStore { max_events_per_session: usize, storage_map: RwLock<HashMap<SessionId, VecDeque<EventEntry>>>, } impl Default for InMemoryEventStore { fn default() -> Self { Self { max_events_per_session: MAX_EVENTS_PER_SESSION, storage_map: Default::default(), } } } /// In-memory implementation of the `EventStore` trait for MCP's Streamable HTTP transport. /// /// Stores events in a `HashMap` of session IDs to `VecDeque`s of events, with a per-session limit. /// Events are identified by `event_id` (format: `session-.-stream-.-timestamp`) and used for SSE resumption. /// Thread-safe via `RwLock` for concurrent access. impl InMemoryEventStore { /// Creates a new `InMemoryEventStore` with an optional maximum events per session. /// /// # Arguments /// - `max_events_per_session`: Maximum number of events per session. Defaults to `MAX_EVENTS_PER_SESSION` (32) if `None`. /// /// # Returns /// A new `InMemoryEventStore` instance with an empty `HashMap` wrapped in a `RwLock`. /// /// # Example /// ``` /// let store = InMemoryEventStore::new(Some(10)); /// assert_eq!(store.max_events_per_session, 10); /// ``` pub fn new(max_events_per_session: Option<usize>) -> Self { Self { max_events_per_session: max_events_per_session.unwrap_or(MAX_EVENTS_PER_SESSION), storage_map: RwLock::new(HashMap::new()), } } /// Generates an `event_id` string from session, stream, and timestamp components. /// /// Format: `session-.-stream-.-timestamp`, used as a resumption cursor in SSE (`Last-Event-ID`). /// /// # Arguments /// - `session_id`: The session identifier. /// - `stream_id`: The stream identifier. /// - `time_stamp`: The event timestamp (u128). /// /// # Returns /// A `String` in the format `session-.-stream-.-timestamp`. fn generate_event_id( &self, session_id: &SessionId, stream_id: &StreamId, time_stamp: u128, ) -> String { format!("{session_id}{ID_SEPARATOR}{stream_id}{ID_SEPARATOR}{time_stamp}") } /// Parses an event ID into its session, stream, and timestamp components. /// /// The event ID must follow the format `session-.-stream-.-timestamp`. /// Returns `None` if the format is invalid, empty, or contains invalid characters (e.g., NULL). /// /// # Arguments /// - `event_id`: The event ID string to parse. /// /// # Returns /// An `Option` containing a tuple of `(session_id, stream_id, time_stamp)` as string slices, /// or `None` if the format is invalid. /// /// # Example /// ``` /// let store = InMemoryEventStore::new(None); /// let event_id = "session1-.-stream1-.-12345"; /// assert_eq!( /// store.parse_event_id(event_id), /// Some(("session1", "stream1", "12345")) /// ); /// assert_eq!(store.parse_event_id("invalid"), None); /// ``` pub fn parse_event_id<'a>( &self, event_id: &'a str, ) -> EventStoreResult<(&'a str, &'a str, u128)> { // Check for empty input or invalid characters (e.g., NULL) if event_id.is_empty() || event_id.contains('\0') { return Err("Event ID is empty!".into()); } // Split into exactly three parts let parts: Vec<&'a str> = event_id.split(ID_SEPARATOR).collect(); if parts.len() != 3 { return Err("Invalid Event ID format.".into()); } let session_id = parts[0]; let stream_id = parts[1]; let time_stamp = parts[2]; // Ensure no part is empty if session_id.is_empty() || stream_id.is_empty() || time_stamp.is_empty() { return Err("Invalid Event ID format.".into()); } let time_stamp: u128 = time_stamp .parse() .map_err(|err| format!("Error parsing timestamp: {err}"))?; Ok((session_id, stream_id, time_stamp)) } } #[async_trait] impl EventStore for InMemoryEventStore { /// Stores an event for a given session and stream, returning its `event_id`. /// /// Adds the event to the session’s `VecDeque`, removing the oldest event if the session /// reaches `max_events_per_session`. /// /// # Arguments /// - `session_id`: The session identifier. /// - `stream_id`: The stream identifier. /// - `time_stamp`: The event timestamp (u128). /// - `message`: The `ServerMessages` payload. /// /// # Returns /// The generated `EventId` for the stored event. async fn store_event( &self, session_id: SessionId, stream_id: StreamId, time_stamp: u128, message: String, ) -> EventStoreResult<EventId> { let event_id = self.generate_event_id(&session_id, &stream_id, time_stamp); let mut storage_map = self.storage_map.write().await; tracing::trace!( "Storing event for session: {session_id}, stream_id: {stream_id}, message: '{message}', {time_stamp} ", ); let session_map = storage_map .entry(session_id) .or_insert_with(|| VecDeque::with_capacity(self.max_events_per_session)); if session_map.len() == self.max_events_per_session { session_map.pop_front(); // remove the oldest if full } let entry = EventEntry { stream_id, time_stamp, message, }; session_map.push_back(entry); Ok(event_id) } /// Removes all events associated with a given stream ID within a specific session. /// /// Removes events matching `stream_id` from the specified `session_id`’s event queue. /// If the session’s queue becomes empty, it is removed from the store. /// Idempotent if `session_id` or `stream_id` doesn’t exist. /// /// # Arguments /// - `session_id`: The session identifier to target. /// - `stream_id`: The stream identifier to remove. async fn remove_stream_in_session( &self, session_id: SessionId, stream_id: StreamId, ) -> EventStoreResult<()> { let mut storage_map = self.storage_map.write().await; // Check if session exists if let Some(events) = storage_map.get_mut(&session_id) { // Remove events with the given stream_id events.retain(|event| event.stream_id != stream_id); // Remove session if empty if events.is_empty() { storage_map.remove(&session_id); }; } // No action if session_id doesn’t exist (idempotent) Ok(()) } /// Removes all events associated with a given session ID. /// /// Removes the entire session from the store. Idempotent if `session_id` doesn’t exist. /// /// # Arguments /// - `session_id`: The session identifier to remove. async fn remove_by_session_id(&self, session_id: SessionId) -> EventStoreResult<()> { let mut storage_map = self.storage_map.write().await; storage_map.remove(&session_id); Ok(()) } /// Retrieves events after a given `event_id` for a specific session and stream. /// /// Parses `last_event_id` to extract `session_id`, `stream_id`, and `time_stamp`. /// Returns events after the matching event in the session’s stream, sorted by timestamp /// in ascending order (earliest to latest). Returns `None` if the `event_id` is invalid, /// the session doesn’t exist, or the timestamp is non-numeric. /// /// # Arguments /// - `last_event_id`: The event ID (format: `session-.-stream-.-timestamp`) to start after. /// /// # Returns /// An `Option` containing `EventStoreEntry` with the session ID, stream ID, and sorted messages, /// or `None` if no events are found or the input is invalid. async fn events_after( &self, last_event_id: EventId, ) -> EventStoreResult<Option<EventStoreEntry>> { let (session_id, stream_id, time_stamp) = self.parse_event_id(&last_event_id)?; let storage_map = self.storage_map.read().await; // fail silently if session id does not exists let Some(events) = storage_map.get(session_id) else { tracing::warn!("could not find the session_id in the store : '{session_id}'"); return Ok(None); }; let events = match events .iter() .position(|e| e.stream_id == stream_id && e.time_stamp == time_stamp) { Some(index) if index + 1 < events.len() => { // Collect subsequent events that match the stream_id let mut subsequent: Vec<_> = events .range(index + 1..) .filter(|e| e.stream_id == stream_id) .cloned() .collect(); subsequent.sort_by(|a, b| a.time_stamp.cmp(&b.time_stamp)); subsequent.iter().map(|e| e.message.clone()).collect() } _ => vec![], }; tracing::trace!("{} messages after '{last_event_id}'", events.len()); Ok(Some(EventStoreEntry { session_id: session_id.to_string(), stream_id: stream_id.to_string(), messages: events, })) } async fn clear(&self) -> EventStoreResult<()> { let mut storage_map = self.storage_map.write().await; storage_map.clear(); Ok(()) } async fn count(&self) -> EventStoreResult<usize> { let storage_map = self.storage_map.read().await; Ok(storage_map.len()) } }
rust
MIT
c25994d3d800242c1413b7401432f2a5bef3c23f
2026-01-04T20:25:10.242745Z
false
rust-mcp-stack/rust-mcp-sdk
https://github.com/rust-mcp-stack/rust-mcp-sdk/blob/c25994d3d800242c1413b7401432f2a5bef3c23f/crates/rust-mcp-transport/tests/check_imports.rs
crates/rust-mcp-transport/tests/check_imports.rs
#[cfg(test)] mod tests { use std::fs::File; use std::io::{self, Read}; use std::path::{Path, MAIN_SEPARATOR_STR}; // List of files to exclude from the check const EXCLUDED_FILES: &[&str] = &["src/schema.rs"]; // Check all .rs files for incorrect `use rust_mcp_schema` imports #[test] fn check_no_rust_mcp_schema_imports() { let mut errors = Vec::new(); // Walk through the src directory for entry in walk_src_dir("src").expect("Failed to read src directory") { let entry = entry.unwrap(); let path = entry.path(); // only check files with .rs extension if path.is_file() && path.extension().and_then(|s| s.to_str()) == Some("rs") { let abs_path = path.to_string_lossy(); let relative_path = path.strip_prefix("src").unwrap_or(&path); let path_str = relative_path.to_string_lossy(); // Skip excluded files if EXCLUDED_FILES .iter() .any(|&excluded| abs_path.replace(MAIN_SEPARATOR_STR, "/") == excluded) { continue; } // Read the file content match read_file(&path) { Ok(content) => { // Check for `use rust_mcp_schema` if content.contains("use rust_mcp_schema") { errors.push(format!( "File {abs_path} contains `use rust_mcp_schema`. Use `use crate::schema` instead." )); } } Err(e) => { errors.push(format!("Failed to read file `{path_str}`: {e}")); } } } } // If there are any errors, fail the test with all error messages if !errors.is_empty() { panic!( "Found {} incorrect imports:\n{}\n\n", errors.len(), errors.join("\n") ); } } // Helper function to walk the src directory fn walk_src_dir<P: AsRef<Path>>( path: P, ) -> io::Result<impl Iterator<Item = io::Result<std::fs::DirEntry>>> { Ok(std::fs::read_dir(path)?.flat_map(|entry| { let entry = entry.unwrap(); let path = entry.path(); if path.is_dir() { // Recursively walk subdirectories walk_src_dir(&path) .into_iter() .flatten() .collect::<Vec<_>>() } else { vec![Ok(entry)] } })) } // Helper function to read file content fn read_file(path: &Path) -> io::Result<String> { let mut file = File::open(path)?; let mut content = String::new(); file.read_to_string(&mut content)?; Ok(content) } }
rust
MIT
c25994d3d800242c1413b7401432f2a5bef3c23f
2026-01-04T20:25:10.242745Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/display_list.rs
renderer/src/display_list.rs
use std::{ collections::HashMap, fmt::{Debug, Display}, hash::Hash, mem, ops::{Range, RangeInclusive}, sync::Mutex, }; use cgmath::SquareMatrix; use ldraw::{ color::{Color, ColorCatalog, ColorReference}, Matrix4, PartAlias, Vector4, }; use ldraw_ir::model::{GroupId, Model, Object, ObjectGroup, ObjectId, ObjectInstance}; use uuid::Uuid; use wgpu::util::DeviceExt; use crate::{Entity, GpuUpdate, GpuUpdateResult}; #[repr(C)] #[derive(Copy, Clone, Debug, bytemuck::Pod, bytemuck::Zeroable)] struct InstanceData { model_matrix: [[f32; 4]; 4], color: [f32; 4], edge_color: [f32; 4], } impl InstanceData { pub fn get_matrix(&self) -> Matrix4 { self.model_matrix.into() } pub fn get_color(&self) -> Vector4 { self.color.into() } pub fn get_edge_color(&self) -> Vector4 { self.edge_color.into() } } #[derive(Debug)] struct InstanceTransaction<K> { rows_to_insert: HashMap<K, (Matrix4, Vector4, Vector4)>, rows_to_remove: Vec<K>, changed_indices: Vec<usize>, } impl<K> Default for InstanceTransaction<K> { fn default() -> Self { Self { rows_to_insert: HashMap::new(), rows_to_remove: Vec::new(), changed_indices: Vec::new(), } } } #[derive(Debug)] pub struct Instances<K, G> { group: G, index: HashMap<K, usize>, instance_data: Vec<InstanceData>, pub instance_buffer: Option<wgpu::Buffer>, transaction: Mutex<Option<InstanceTransaction<K>>>, } impl<K, G> Instances<K, G> { pub fn count(&self) -> usize { self.instance_data.len() } pub fn range(&self) -> Range<u32> { 0..self.count() as u32 } pub fn is_empty(&self) -> bool { self.count() == 0 } fn update_buffer_partial(&self, queue: &wgpu::Queue, range: RangeInclusive<usize>) { if let Some(buffer) = &self.instance_buffer { queue.write_buffer( buffer, (range.start() * mem::size_of::<InstanceData>()) as wgpu::BufferAddress, bytemuck::cast_slice(&self.instance_data[range]), ) } } pub fn desc() -> wgpu::VertexBufferLayout<'static> { wgpu::VertexBufferLayout { array_stride: mem::size_of::<InstanceData>() as wgpu::BufferAddress, step_mode: wgpu::VertexStepMode::Instance, attributes: &[ wgpu::VertexAttribute { offset: 0, shader_location: 10, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 4]>() as wgpu::BufferAddress, shader_location: 11, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 8]>() as wgpu::BufferAddress, shader_location: 12, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 12]>() as wgpu::BufferAddress, shader_location: 13, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 16]>() as wgpu::BufferAddress, shader_location: 14, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 20]>() as wgpu::BufferAddress, shader_location: 15, format: wgpu::VertexFormat::Float32x4, }, ], } } } impl<K, G: Display> Instances<K, G> { fn rebuild_buffer(&mut self, device: &wgpu::Device) { self.instance_buffer = Some( device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!("Instance buffer for {}", self.group)), contents: bytemuck::cast_slice(&self.instance_data), usage: wgpu::BufferUsages::VERTEX | wgpu::BufferUsages::COPY_DST, }), ); } } impl< K: Clone + Debug + Eq + PartialEq + Hash + Display, G: Clone + Eq + PartialEq + Hash + Display, > Instances<K, G> { pub fn new(group: G) -> Self { Self { group, index: HashMap::new(), instance_data: Vec::new(), instance_buffer: None, transaction: Mutex::new(None), } } } #[derive(Debug)] pub enum InstanceOps<K> { Insert { key: K, matrix: Matrix4, color: Vector4, edge_color: Vector4, }, Update { key: K, matrix: Matrix4, color: Vector4, edge_color: Vector4, }, UpdateMatrix { key: K, matrix: Matrix4, }, UpdateColor { key: K, color: Vector4, edge_color: Vector4, }, UpdateAlpha { key: K, alpha: f32, }, Remove(K), } impl<K: Clone + Eq + PartialEq + Hash + Debug, G: Display> GpuUpdate for Instances<K, G> { type Mutator = InstanceOps<K>; fn mutate(&mut self, mutator: Self::Mutator) -> GpuUpdateResult<Self::Mutator> { let mut tr_lock = self.transaction.lock().unwrap(); let tr = tr_lock.get_or_insert_with(Default::default); match mutator { InstanceOps::Insert { key, matrix, color, edge_color, } => { tr.rows_to_insert.insert(key, (matrix, color, edge_color)); } InstanceOps::Remove(key) => { tr.rows_to_insert.remove(&key); tr.rows_to_remove.push(key); } InstanceOps::Update { key, matrix, color, edge_color, } => { if let Some(entry_idx) = self.index.get(&key).cloned() { let data = &mut self.instance_data[entry_idx]; data.model_matrix = matrix.into(); data.color = color.into(); data.edge_color = edge_color.into(); tr.changed_indices.push(entry_idx); } else if let Some(entry) = tr.rows_to_insert.get_mut(&key) { entry.0 = matrix; entry.1 = color; entry.2 = edge_color; } } InstanceOps::UpdateMatrix { key, matrix } => { if let Some(entry_idx) = self.index.get(&key).cloned() { let data = &mut self.instance_data[entry_idx]; data.model_matrix = matrix.into(); tr.changed_indices.push(entry_idx); } else if let Some(entry) = tr.rows_to_insert.get_mut(&key) { entry.0 = matrix; } } InstanceOps::UpdateColor { key, color, edge_color, } => { if let Some(entry_idx) = self.index.get(&key).cloned() { let data = &mut self.instance_data[entry_idx]; data.color = color.into(); data.edge_color = edge_color.into(); tr.changed_indices.push(entry_idx); } else if let Some(entry) = tr.rows_to_insert.get_mut(&key) { entry.1 = color; entry.2 = edge_color; } } InstanceOps::UpdateAlpha { key, alpha } => { if let Some(entry_idx) = self.index.get(&key).cloned() { let data = &mut self.instance_data[entry_idx]; data.color[3] = alpha; data.edge_color[3] = alpha; tr.changed_indices.push(entry_idx); } else if let Some(entry) = tr.rows_to_insert.get_mut(&key) { entry.1.w = alpha; entry.2.w = alpha; } } } GpuUpdateResult::Modified } fn handle_gpu_update(&mut self, device: &wgpu::Device, queue: &wgpu::Queue) { let Some(mut tr) = self.transaction.lock().unwrap().take() else { return; }; let mut layout_changed = false; let mut rows_to_remove = tr .rows_to_remove .into_iter() .filter_map(|key| self.index.get(&key).map(|v| (key, *v))) .collect::<Vec<_>>(); rows_to_remove.sort_by_key(|v| std::cmp::Reverse(v.1)); for (key, (matrix, color, edge_color)) in tr.rows_to_insert.into_iter() { if let Some((old_key, idx_to_reuse)) = rows_to_remove.pop() { // Take over removed rows and fill with inserted ones if available let data = &mut self.instance_data[idx_to_reuse]; data.model_matrix = matrix.into(); data.color = color.into(); data.edge_color = edge_color.into(); self.index.remove(&old_key); self.index.insert(key, idx_to_reuse); tr.changed_indices.push(idx_to_reuse); } else { // Insert new rows layout_changed = true; self.instance_data.push(InstanceData { model_matrix: matrix.into(), color: color.into(), edge_color: edge_color.into(), }); self.index.insert(key, self.instance_data.len() - 1); } } // Remove rows if !rows_to_remove.is_empty() { let mut reverse_lookup = self .index .clone() .into_iter() .map(|(k, v)| (v, k)) .collect::<HashMap<_, _>>(); for (key, index) in rows_to_remove.iter() { let last = self.instance_data.len() - 1; if let Some(last_key) = reverse_lookup.get(&last) { self.index.insert(last_key.clone(), *index); reverse_lookup.insert(*index, last_key.clone()); } self.index.remove(key); reverse_lookup.remove(&last); self.instance_data.swap_remove(*index); layout_changed = true; } } if layout_changed || self.instance_buffer.is_none() { self.rebuild_buffer(device); } else if !tr.changed_indices.is_empty() { tr.changed_indices.sort(); let mut start = tr.changed_indices[0]; let mut end = start; for index in tr.changed_indices { if index > end + 1 { self.update_buffer_partial(queue, start..=end); start = index; end = index; } else { end = index; } } self.update_buffer_partial(queue, start..=end); } } } #[derive(Clone, Debug, Eq, PartialEq, Hash)] enum GroupKind { Opaque, Translucent, } impl GroupKind { pub fn is_translucent(&self) -> bool { matches!(self, GroupKind::Translucent) } } #[derive(Clone, Debug, Eq, PartialEq, Hash)] struct Group<G>(GroupKind, G); #[derive(Debug, Default)] pub struct DisplayList<K, G> { map: HashMap<Group<G>, Entity<Instances<K, G>>>, lookup_table: HashMap<K, Group<G>>, } impl<K, G> DisplayList<K, G> { pub fn new() -> Self { Self { map: HashMap::new(), lookup_table: HashMap::new(), } } pub fn iter(&self) -> impl Iterator<Item = (&G, bool, &Entity<Instances<K, G>>)> { self.map .iter() .map(|(k, v)| (&k.1, matches!(k.0, GroupKind::Translucent), v)) } pub fn iter_opaque(&self) -> impl Iterator<Item = (&G, &Entity<Instances<K, G>>)> { self.map.iter().filter_map(|(k, v)| { if matches!(k.0, GroupKind::Opaque) { Some((&k.1, v)) } else { None } }) } pub fn iter_translucent(&self) -> impl Iterator<Item = (&G, &Entity<Instances<K, G>>)> { self.map.iter().filter_map(|(k, v)| { if matches!(k.0, GroupKind::Translucent) { Some((&k.1, v)) } else { None } }) } } impl< K: Clone + Debug + Eq + PartialEq + Hash + Display, G: Clone + Eq + PartialEq + Hash + Display, > DisplayList<K, G> { fn get_or_create(&mut self, group: Group<G>) -> &mut Entity<Instances<K, G>> { self.map .entry(group.clone()) .or_insert_with(|| Instances::new(group.1).into()) } pub fn get_by_key(&self, k: &K) -> Option<&Entity<Instances<K, G>>> { if let Some(group) = self.lookup_table.get(k) { self.map.get(group) } else { None } } } fn uuid_xor(a: ObjectId, b: ObjectId) -> ObjectId { let ba = Uuid::from(a).to_bytes_le(); let bb = Uuid::from(b).to_bytes_le(); let bc: Vec<_> = ba.iter().zip(bb).map(|(x, y)| x ^ y).collect(); Uuid::from_slice(&bc).unwrap().into() } impl<P: Clone + Eq + PartialEq + Hash + From<PartAlias> + Display> DisplayList<ObjectId, P> { fn expand_object_group( ops: &mut Vec<DisplayListOps<ObjectId, P>>, color_catalog: &ColorCatalog, parent_id: ObjectId, groups: &HashMap<GroupId, ObjectGroup<P>>, objects: &[Object<P>], matrix: Matrix4, color: ColorReference, ) { for object in objects.iter() { match &object.data { ObjectInstance::Part(p) => { let local_matrix = matrix * p.matrix; let color_ref = if p.color.is_current() { &color } else { &p.color }; let color = match color_ref { ColorReference::Color(c) => c, _ => color_catalog.get(&0).unwrap(), }; ops.push(DisplayListOps::Insert { group: p.part.clone(), key: uuid_xor(parent_id, object.id), matrix: local_matrix, color: color.clone(), alpha: None, }); } ObjectInstance::PartGroup(g) => { if let Some(group) = groups.get(&g.group_id) { let color = if g.color.is_current() { &color } else { &g.color } .clone(); Self::expand_object_group( ops, color_catalog, uuid_xor(parent_id, object.id), groups, &group.objects, matrix * g.matrix, color, ); } } _ => {} } } } pub fn from_model( model: &Model<P>, group_id: Option<GroupId>, color_catalog: &ColorCatalog, ) -> Entity<Self> { let mut display_list = Entity::new(Self::new()); let objects = match group_id { Some(group_id) => model.object_groups.get(&group_id).map(|v| &v.objects), None => Some(&model.objects), }; let mut ops = vec![]; if let Some(objects) = objects { Self::expand_object_group( &mut ops, color_catalog, Uuid::nil().into(), &model.object_groups, objects, Matrix4::identity(), ColorReference::Color(color_catalog.get(&0).cloned().unwrap()), ) } display_list.mutate_all(ops.into_iter()); display_list } } pub struct DisplayListOpsReinstantiate<G, K> { group: Group<G>, key: K, matrix: Matrix4, color: Vector4, edge_color: Vector4, } pub enum DisplayListOps<K, G> { Insert { group: G, key: K, matrix: Matrix4, color: Color, alpha: Option<f32>, }, Update { key: K, matrix: Matrix4, color: Color, }, UpdateMatrix { key: K, matrix: Matrix4, }, UpdateColor { key: K, color: Color, }, UpdateAlpha { key: K, alpha: f32, }, Remove { key: K, }, _Reinstantiate(DisplayListOpsReinstantiate<G, K>), } impl< K: Clone + Debug + Eq + PartialEq + Hash + Display, G: Clone + Eq + PartialEq + Hash + Display, > GpuUpdate for DisplayList<K, G> { type Mutator = DisplayListOps<K, G>; fn mutate(&mut self, mutator: Self::Mutator) -> GpuUpdateResult<Self::Mutator> { match mutator { DisplayListOps::Insert { group, key, matrix, color, alpha, } => { let mut main_color: Vector4 = color.color.into(); let mut edge_color: Vector4 = color.edge.into(); if self.lookup_table.contains_key(&key) { GpuUpdateResult::NotModified } else { let is_translucent = main_color.w < 1.0 || alpha.unwrap_or(1.0) < 1.0; let group = if is_translucent { Group(GroupKind::Translucent, group) } else { Group(GroupKind::Opaque, group) }; self.lookup_table.insert(key.clone(), group.clone()); if let Some(alpha) = alpha { main_color.w = alpha; edge_color.w = alpha; } self.lookup_table.insert(key.clone(), group.clone()); let entity = self.get_or_create(group); entity .mutate(InstanceOps::Insert { key, matrix, color: main_color, edge_color, }) .into() } } DisplayListOps::Update { key, matrix, color } => { if let Some(group) = self.lookup_table.get(&key) { if group.0.is_translucent() != color.is_translucent() { let id = group.1.clone(); let new_group = if color.is_translucent() { Group(GroupKind::Translucent, id) } else { Group(GroupKind::Opaque, id) }; GpuUpdateResult::AdditionalMutations { modified: false, mutations: vec![DisplayListOps::_Reinstantiate( DisplayListOpsReinstantiate { group: new_group, key, matrix, color: color.color.into(), edge_color: color.edge.into(), }, )], } } else if let Some(instances) = self.map.get_mut(group) { instances .mutate(InstanceOps::Update { key, matrix, color: color.color.into(), edge_color: color.edge.into(), }) .into() } else { GpuUpdateResult::NotModified } } else { GpuUpdateResult::NotModified } } DisplayListOps::UpdateAlpha { key, alpha } => { let is_translucent = alpha < 1.0; if let Some((group, instances)) = self .lookup_table .get(&key) .and_then(|g| self.map.get_mut(g).map(|v| (g.clone(), v))) { if group.0.is_translucent() != is_translucent { let id = group.1.clone(); let group = if is_translucent { Group(GroupKind::Translucent, id) } else { Group(GroupKind::Opaque, id) }; let Some(index) = instances.get().index.get(&key) else { return GpuUpdateResult::NotModified; }; let instance = instances.get().instance_data[*index]; let mut color = instance.get_color(); color.w = alpha; let mut edge_color = instance.get_edge_color(); edge_color.w = alpha; GpuUpdateResult::AdditionalMutations { modified: false, mutations: vec![DisplayListOps::_Reinstantiate( DisplayListOpsReinstantiate { group, key, matrix: instance.get_matrix(), color, edge_color, }, )], } } else if let Some(entity) = self.map.get_mut(&group) { entity .mutate(InstanceOps::UpdateAlpha { key, alpha }) .into() } else { GpuUpdateResult::NotModified } } else { GpuUpdateResult::NotModified } } DisplayListOps::UpdateColor { key, color } => { if let Some((group, instances)) = self .lookup_table .get(&key) .and_then(|g| self.map.get_mut(g).map(|v| (g.clone(), v))) { if group.0.is_translucent() != color.is_translucent() { let id = group.1.clone(); let group = if color.is_translucent() { Group(GroupKind::Translucent, id) } else { Group(GroupKind::Opaque, id) }; let Some(index) = instances.get().index.get(&key) else { return GpuUpdateResult::NotModified; }; let instance = instances.get().instance_data[*index]; GpuUpdateResult::AdditionalMutations { modified: false, mutations: vec![DisplayListOps::_Reinstantiate( DisplayListOpsReinstantiate { group, key, matrix: instance.get_matrix(), color: color.color.into(), edge_color: color.edge.into(), }, )], } } else if let Some(entity) = self.map.get_mut(&group) { entity .mutate(InstanceOps::UpdateColor { key, color: color.color.into(), edge_color: color.edge.into(), }) .into() } else { GpuUpdateResult::NotModified } } else { GpuUpdateResult::NotModified } } DisplayListOps::UpdateMatrix { key, matrix } => { let Some(group) = self.lookup_table.get(&key) else { return GpuUpdateResult::NotModified; }; if let Some(entity) = self.map.get_mut(group) { entity .mutate(InstanceOps::UpdateMatrix { key, matrix }) .into() } else { GpuUpdateResult::NotModified } } DisplayListOps::Remove { key } => { let Some(group) = self.lookup_table.remove(&key) else { return GpuUpdateResult::NotModified; }; let Some(entity) = self.map.get_mut(&group) else { return GpuUpdateResult::NotModified; }; if entity.mutate(InstanceOps::Remove(key.clone())) { self.lookup_table.remove(&key); if (*entity).count() == 0 { self.map.remove(&group); } GpuUpdateResult::Modified } else { GpuUpdateResult::NotModified } } DisplayListOps::_Reinstantiate(DisplayListOpsReinstantiate { group, key, matrix, color, edge_color, }) => { let Some(prev_group) = self.lookup_table.remove(&key) else { return GpuUpdateResult::NotModified; }; let Some(entity) = self.map.get_mut(&prev_group) else { return GpuUpdateResult::NotModified; }; entity.mutate(InstanceOps::Remove(key.clone())); if self .get_or_create(group.clone()) .mutate(InstanceOps::Insert { key: key.clone(), matrix, color, edge_color, }) { self.lookup_table.insert(key.clone(), group); GpuUpdateResult::Modified } else { GpuUpdateResult::NotModified } } } } fn handle_gpu_update(&mut self, device: &wgpu::Device, queue: &wgpu::Queue) { for entity in self.map.values_mut() { entity.update(device, queue); } } } #[repr(C)] #[derive(Copy, Clone, Debug, bytemuck::Pod, bytemuck::Zeroable)] pub struct SelectionInstanceData { model_matrix: [[f32; 4]; 4], instance_id: u32, _padding: [u32; 3], } #[derive(Debug)] pub struct SelectionInstances { instance_data: Vec<SelectionInstanceData>, pub instance_buffer: wgpu::Buffer, } impl SelectionInstances { pub fn new(device: &wgpu::Device, instance_data: Vec<SelectionInstanceData>) -> Self { let instance_buffer = device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some("Instance buffer for object selections"), contents: bytemuck::cast_slice(&instance_data), usage: wgpu::BufferUsages::VERTEX | wgpu::BufferUsages::COPY_DST, }); Self { instance_data, instance_buffer, } } pub fn count(&self) -> usize { self.instance_data.len() } pub fn range(&self) -> Range<u32> { 0..self.count() as u32 } pub fn desc() -> wgpu::VertexBufferLayout<'static> { wgpu::VertexBufferLayout { array_stride: mem::size_of::<SelectionInstanceData>() as wgpu::BufferAddress, step_mode: wgpu::VertexStepMode::Instance, attributes: &[ wgpu::VertexAttribute { offset: 0, shader_location: 10, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 4]>() as wgpu::BufferAddress, shader_location: 11, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 8]>() as wgpu::BufferAddress, shader_location: 12, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 12]>() as wgpu::BufferAddress, shader_location: 13, format: wgpu::VertexFormat::Float32x4, }, wgpu::VertexAttribute { offset: mem::size_of::<[f32; 16]>() as wgpu::BufferAddress, shader_location: 14, format: wgpu::VertexFormat::Uint32, }, ], } } } #[derive(Debug, Default)] pub struct SelectionDisplayList<G, K> { map: HashMap<G, SelectionInstances>, lookup_table: HashMap<u32, K>, } impl<G, K: Clone> SelectionDisplayList<G, K> { pub fn new(map: HashMap<G, SelectionInstances>, lookup_table: HashMap<u32, K>) -> Self { Self { map, lookup_table } } pub fn iter(&self) -> impl Iterator<Item = (&G, &SelectionInstances)> { self.map.iter() } pub fn get_matches( &self, result: impl Iterator<Item = u32> + 'static, ) -> impl Iterator<Item = K> + '_ { result.filter_map(|v| self.lookup_table.get(&v).cloned()) } } impl<G: Clone + Eq + PartialEq + Hash + From<PartAlias> + Display> SelectionDisplayList<G, ObjectId> { #[allow(clippy::too_many_arguments)] fn expand_object_group( data: &mut HashMap<G, Vec<SelectionInstanceData>>, lookup_table: &mut HashMap<u32, ObjectId>, cur_instance_id: &mut u32, use_parent_object_id: bool, parent_id: ObjectId, groups: &HashMap<GroupId, ObjectGroup<G>>, objects: &[Object<G>], matrix: Matrix4, depth: u32, ) { for object in objects.iter() { match &object.data { ObjectInstance::Part(p) => { let id = if depth == 0 { object.id } else if use_parent_object_id { parent_id } else { uuid_xor(parent_id, object.id) }; lookup_table.insert(*cur_instance_id, id); data.entry(p.part.clone()) .or_default() .push(SelectionInstanceData { model_matrix: (matrix * p.matrix).into(), instance_id: *cur_instance_id, _padding: [0; 3], }); *cur_instance_id += 1; } ObjectInstance::PartGroup(g) => { if let Some(group) = groups.get(&g.group_id) { Self::expand_object_group( data, lookup_table, cur_instance_id, use_parent_object_id, object.id, groups, &group.objects, matrix * g.matrix, depth + 1, ); } } _ => {} } } } pub fn from_model( model: &Model<G>, group_id: Option<GroupId>, device: &wgpu::Device,
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
true
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/lib.rs
renderer/src/lib.rs
pub mod display_list; mod entity; pub mod error; pub mod part; pub mod pipeline; pub mod projection; pub mod util; pub use entity::{Entity, GpuUpdate, GpuUpdateResult}; #[derive(Copy, Clone, Debug, PartialEq, PartialOrd)] pub struct AspectRatio(f32); impl From<(u32, u32)> for AspectRatio { fn from((width, height): (u32, u32)) -> Self { Self(width as f32 / height as f32) } } impl From<AspectRatio> for f32 { fn from(value: AspectRatio) -> f32 { value.0 } } impl From<f32> for AspectRatio { fn from(value: f32) -> Self { Self(value) } } #[derive(Clone, Debug)] pub enum ObjectSelection { Point(cgmath::Point2<f32>), Range(ldraw_ir::geometry::BoundingBox2), }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/entity.rs
renderer/src/entity.rs
const MAX_ITERATIONS: i32 = 10; pub enum GpuUpdateResult<M> { Modified, NotModified, AdditionalMutations { modified: bool, mutations: Vec<M> }, } impl<M> From<bool> for GpuUpdateResult<M> { fn from(value: bool) -> Self { if value { Self::Modified } else { Self::NotModified } } } pub trait GpuUpdate { type Mutator; fn mutate(&mut self, mutator: Self::Mutator) -> GpuUpdateResult<Self::Mutator>; fn handle_gpu_update(&mut self, device: &wgpu::Device, queue: &wgpu::Queue); } #[derive(Debug)] pub struct Entity<I> { inner: I, modified: bool, } impl<I> std::ops::Deref for Entity<I> { type Target = I; fn deref(&self) -> &Self::Target { &self.inner } } impl<I: GpuUpdate> Entity<I> { pub fn new(inner: I) -> Self { Self { inner, modified: true, } } pub fn get(&self) -> &I { &self.inner } fn mutate_inner(&mut self, mutator: I::Mutator, iteration: i32) -> bool { if iteration >= MAX_ITERATIONS { println!("Nested mutations more than {MAX_ITERATIONS} depths are not allowed"); false } else { match self.inner.mutate(mutator) { GpuUpdateResult::Modified => true, GpuUpdateResult::NotModified => false, GpuUpdateResult::AdditionalMutations { mut modified, mutations, } => { for mutator in mutations { if self.mutate_inner(mutator, iteration + 1) { modified = true; } } modified } } } } pub fn mutate(&mut self, mutator: I::Mutator) -> bool { if self.mutate_inner(mutator, 0) { self.modified = true; true } else { false } } pub fn mutate_all<T: Iterator<Item = I::Mutator>>(&mut self, mutators: T) -> bool { let mut modified = false; for mutator in mutators { if self.mutate_inner(mutator, 0) { modified = true; } } if modified { self.modified = true; } modified } pub fn update(&mut self, device: &wgpu::Device, queue: &wgpu::Queue) -> bool { if self.modified { self.inner.handle_gpu_update(device, queue); self.modified = false; true } else { false } } } impl<I: GpuUpdate> From<I> for Entity<I> { fn from(value: I) -> Self { Self { inner: value, modified: true, } } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/error.rs
renderer/src/error.rs
#[derive(thiserror::Error, Debug)] pub enum ObjectSelectionError { #[error("Selection coordinate is out of range: {0:?}")] OutOfRange(crate::ObjectSelection), #[error("Async buffer read error: {0}")] AsyncBufferReadError(#[from] wgpu::BufferAsyncError), }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/util.rs
renderer/src/util.rs
use std::hash::Hash; use cgmath::SquareMatrix; use ldraw::Matrix4; use ldraw_ir::{ geometry::BoundingBox3, model::{self, GroupId}, }; use crate::part::PartQuerier; pub async fn request_device( adapter: &wgpu::Adapter, label: Option<&str>, ) -> Result<(wgpu::Device, wgpu::Queue, u32), wgpu::RequestDeviceError> { let texture_sizes = vec![8192, 4096, 2048]; let mut error = None; for texture_size in texture_sizes { let required_limits = wgpu::Limits { max_texture_dimension_2d: texture_size, ..wgpu::Limits::downlevel_webgl2_defaults() }; match adapter .request_device(&wgpu::DeviceDescriptor { label, required_features: wgpu::Features::default(), required_limits, memory_hints: Default::default(), trace: wgpu::Trace::Off, }) .await { Ok((device, queue)) => return Ok((device, queue, texture_size)), Err(e) => { error = Some(e); } } } Err(error.unwrap()) } fn calculate_bounding_box_recursive<K: Clone + Eq + PartialEq + Hash, Q: PartQuerier<K>>( bb: &mut BoundingBox3, parts: &Q, matrix: Matrix4, items: &[model::Object<K>], model: &model::Model<K>, ) { for item in items.iter() { match &item.data { model::ObjectInstance::Part(p) => { if let Some(embedded_part) = model.embedded_parts.get(&p.part) { bb.update(&embedded_part.bounding_box.transform(&(matrix * p.matrix))); } else if let Some(part) = parts.get(&p.part) { bb.update(&part.bounding_box.transform(&(matrix * p.matrix))); } } model::ObjectInstance::PartGroup(pg) => { if let Some(group) = model.object_groups.get(&pg.group_id) { calculate_bounding_box_recursive( bb, parts, matrix * pg.matrix, &group.objects, model, ); } } _ => {} } } } pub fn calculate_model_bounding_box<K: Clone + Eq + PartialEq + Hash, Q: PartQuerier<K>>( model: &model::Model<K>, group_id: Option<GroupId>, parts: &Q, ) -> BoundingBox3 { let mut bb = BoundingBox3::nil(); if let Some(group_id) = group_id { if let Some(subpart) = model.object_groups.get(&group_id) { calculate_bounding_box_recursive( &mut bb, parts, Matrix4::identity(), &subpart.objects, model, ); } } else { calculate_bounding_box_recursive( &mut bb, parts, Matrix4::identity(), &model.objects, model, ); } bb }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/projection.rs
renderer/src/projection.rs
use std::{collections::HashSet, hash::Hash}; use cgmath::{prelude::*, Deg, Matrix, Ortho, PerspectiveFov, Point3, SquareMatrix}; use ldraw::{Matrix3, Matrix4, Vector2, Vector3}; use ldraw_ir::geometry::{BoundingBox2, BoundingBox3}; use wgpu::util::DeviceExt; use crate::{AspectRatio, GpuUpdate, GpuUpdateResult}; struct ProjectionData { model_matrix_stack: Vec<Matrix4>, projection_matrix: Matrix4, view_matrix: Matrix4, is_orthographic: bool, } pub enum ProjectionMutator { PushModelMatrix(Matrix4), PopModelMatrix, SetProjectionMatrix { matrix: Matrix4, is_orthographic: bool, }, SetViewMatrix(Matrix4), } impl ProjectionData { fn push_model_matrix(&mut self, mat: Matrix4) -> Matrix4 { let multiplied = self.model_matrix_stack.last().cloned().unwrap() * mat; self.model_matrix_stack.push(multiplied); multiplied } fn pop_model_matrix(&mut self) -> Option<Matrix4> { if self.model_matrix_stack.len() > 1 { self.model_matrix_stack.pop(); self.model_matrix_stack.last().cloned() } else { None } } } impl Default for ProjectionData { fn default() -> Self { Self { model_matrix_stack: vec![Matrix4::identity()], projection_matrix: Matrix4::identity(), view_matrix: Matrix4::identity(), is_orthographic: false, } } } #[repr(C)] #[derive(Copy, Clone, bytemuck::Pod, bytemuck::Zeroable)] struct RawProjectionData { model_matrix: [[f32; 4]; 4], projection_matrix: [[f32; 4]; 4], view_matrix: [[f32; 4]; 4], normal_matrix_0: [f32; 3], _padding0: [u8; 4], normal_matrix_1: [f32; 3], _padding1: [u8; 4], normal_matrix_2: [f32; 3], _padding2: [u8; 4], is_orthographic: i32, _padding3: [u8; 12], } impl Default for RawProjectionData { fn default() -> Self { Self { model_matrix: Matrix4::identity().into(), projection_matrix: Matrix4::identity().into(), view_matrix: Matrix4::identity().into(), normal_matrix_0: [1.0, 0.0, 0.0], _padding0: [0; 4], normal_matrix_1: [0.0, 1.0, 0.0], _padding1: [0; 4], normal_matrix_2: [0.0, 0.0, 1.0], _padding2: [0; 4], is_orthographic: 0, _padding3: [0; 12], } } } impl RawProjectionData { #[rustfmt::skip] fn truncate_matrix4(m: Matrix4) -> Matrix3 { Matrix3::new( m[0][0], m[0][1], m[0][2], m[1][0], m[1][1], m[1][2], m[2][0], m[2][1], m[2][2], ) } fn derive_normal_matrix(m: Matrix4) -> Option<Matrix3> { Self::truncate_matrix4(m).invert().map(|v| v.transpose()) } fn update_normal_matrix(&mut self, model_view: Matrix4) { let normal_matrix = Self::derive_normal_matrix(model_view).unwrap_or_else(Matrix3::identity); self.normal_matrix_0 = normal_matrix.x.into(); self.normal_matrix_1 = normal_matrix.y.into(); self.normal_matrix_2 = normal_matrix.z.into(); } } pub struct Projection { pub bind_group: Option<wgpu::BindGroup>, uniform_buffer: Option<wgpu::Buffer>, data: ProjectionData, raw: RawProjectionData, } impl GpuUpdate for Projection { type Mutator = ProjectionMutator; fn mutate(&mut self, mutator: Self::Mutator) -> GpuUpdateResult<Self::Mutator> { match mutator { ProjectionMutator::PushModelMatrix(matrix) => { let mat = self.data.push_model_matrix(matrix); self.raw.model_matrix = mat.into(); self.raw.update_normal_matrix(self.data.view_matrix * mat); GpuUpdateResult::Modified } ProjectionMutator::PopModelMatrix => { if let Some(mat) = self.data.pop_model_matrix() { self.raw.model_matrix = mat.into(); self.raw.update_normal_matrix(self.data.view_matrix * mat); GpuUpdateResult::Modified } else { GpuUpdateResult::NotModified } } ProjectionMutator::SetProjectionMatrix { matrix, is_orthographic, } => { if self.data.projection_matrix != matrix || self.data.is_orthographic != is_orthographic { self.data.projection_matrix = matrix; self.data.is_orthographic = is_orthographic; self.raw.projection_matrix = matrix.into(); self.raw.is_orthographic = if is_orthographic { 1 } else { 0 }; GpuUpdateResult::Modified } else { GpuUpdateResult::NotModified } } ProjectionMutator::SetViewMatrix(matrix) => { if self.data.view_matrix != matrix { self.data.view_matrix = matrix; self.raw.view_matrix = matrix.into(); self.raw.update_normal_matrix(self.get_model_view_matrix()); GpuUpdateResult::Modified } else { GpuUpdateResult::NotModified } } } } fn handle_gpu_update(&mut self, device: &wgpu::Device, queue: &wgpu::Queue) { let uniform_buffer = self.uniform_buffer.get_or_insert_with(|| { device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some("Uniform buffer for projection"), contents: bytemuck::cast_slice(&[self.raw]), usage: wgpu::BufferUsages::UNIFORM | wgpu::BufferUsages::COPY_DST, }) }); if self.bind_group.is_none() { self.bind_group = Some(device.create_bind_group(&wgpu::BindGroupDescriptor { label: Some("Bind group for projection"), layout: &device.create_bind_group_layout(&Self::desc()), entries: &[wgpu::BindGroupEntry { binding: 0, resource: uniform_buffer.as_entire_binding(), }], })); } queue.write_buffer( uniform_buffer, 0 as wgpu::BufferAddress, bytemuck::cast_slice(&[self.raw]), ); } } impl Projection { pub fn new() -> Self { let data = ProjectionData::default(); let raw = RawProjectionData::default(); Self { uniform_buffer: None, bind_group: None, data, raw, } } pub fn get_model_view_matrix(&self) -> Matrix4 { self.data.view_matrix * self.data.model_matrix_stack.last().unwrap() } pub fn select_objects<T: Eq + PartialEq + Hash>( &self, area: &BoundingBox2, objects: impl Iterator<Item = (T, Matrix4, BoundingBox3)>, ) -> HashSet<T> { let mvp = self.data.projection_matrix * self.get_model_view_matrix(); objects .filter_map(|(id, matrix, bb)| { if bb.project(&(mvp * matrix)).intersects(area) { Some(id) } else { None } }) .collect::<HashSet<_>>() } pub fn desc() -> wgpu::BindGroupLayoutDescriptor<'static> { wgpu::BindGroupLayoutDescriptor { label: Some("Bind group descriptor for projection"), entries: &[wgpu::BindGroupLayoutEntry { binding: 0, visibility: wgpu::ShaderStages::VERTEX_FRAGMENT, ty: wgpu::BindingType::Buffer { ty: wgpu::BufferBindingType::Uniform, has_dynamic_offset: false, min_binding_size: None, }, count: None, }], } } } impl Default for Projection { fn default() -> Self { Self::new() } } pub trait ProjectionModifier { fn update_projections(&self, aspect_ratio: AspectRatio) -> Vec<ProjectionMutator>; } #[derive(Clone, Debug)] pub enum ViewBounds { BoundingBox3(BoundingBox3), BoundingBox2(BoundingBox2), Radius(f32), Unbounded, } impl ViewBounds { pub fn fraction(&self, model_view: &Matrix4) -> Option<BoundingBox2> { match self { Self::BoundingBox3(bb) => { let transformed_bb = { let mut pbb = BoundingBox2::nil(); for point in bb.points() { let p = model_view * point.extend(1.0); pbb.update_point(&Vector2::new(p.x, p.y)); } pbb }; if transformed_bb.len_x() >= transformed_bb.len_y() { let d = (transformed_bb.len_x() - transformed_bb.len_y()) * 0.5; let fd = d / transformed_bb.len_x(); Some(BoundingBox2::new( &Vector2::new(0.0, fd), &Vector2::new(1.0, 1.0 - fd), )) } else { let d = (transformed_bb.len_y() - transformed_bb.len_x()) * 0.5; let fd = d / transformed_bb.len_y(); Some(BoundingBox2::new( &Vector2::new(fd, 0.0), &Vector2::new(1.0 - fd, 1.0), )) } } _ => None, } } pub fn project(&self, model_view: &Matrix4, aspect_ratio: AspectRatio) -> BoundingBox2 { let aspect_ratio: f32 = aspect_ratio.into(); match self { Self::BoundingBox3(bb) => { let transformed_bb = { let mut pbb = BoundingBox2::nil(); for point in bb.points() { let p = model_view * point.extend(1.0); pbb.update_point(&Vector2::new(p.x, p.y)); } pbb }; if transformed_bb.len_x() >= transformed_bb.len_y() { let margin = transformed_bb.len_x() * 0.05; let d = (transformed_bb.len_x() - transformed_bb.len_y()) * 0.5; BoundingBox2::new( &Vector2::new( transformed_bb.min.x - margin, transformed_bb.min.y - d - margin, ), &Vector2::new( transformed_bb.max.x + margin, transformed_bb.max.y + d + margin, ), ) } else { let margin = transformed_bb.len_x() * 0.05; let d = (transformed_bb.len_y() - transformed_bb.len_x()) * 0.5; BoundingBox2::new( &Vector2::new( transformed_bb.min.x - d - margin, transformed_bb.min.y - margin, ), &Vector2::new( transformed_bb.max.x + d + margin, transformed_bb.max.y + margin, ), ) } } Self::BoundingBox2(bb) => bb.clone(), Self::Radius(r) => BoundingBox2::new( &Vector2::new(-r * aspect_ratio, -r / aspect_ratio), &Vector2::new(r * aspect_ratio, r / aspect_ratio), ), Self::Unbounded => BoundingBox2::new( &Vector2::new(-300.0 * aspect_ratio, -300.0 / aspect_ratio), &Vector2::new(300.0 * aspect_ratio, 300.0 / aspect_ratio), ), } } } pub struct PerspectiveCamera { pub position: Point3<f32>, pub look_at: Point3<f32>, pub up: Vector3, pub fov: Deg<f32>, } impl PerspectiveCamera { pub fn new(position: Point3<f32>, look_at: Point3<f32>, fov: Deg<f32>) -> Self { Self { position, look_at, up: Vector3::new(0.0, -1.0, 0.0), fov, } } } impl ProjectionModifier for PerspectiveCamera { fn update_projections(&self, aspect_ratio: AspectRatio) -> Vec<ProjectionMutator> { let projection_matrix = Matrix4::from(PerspectiveFov { fovy: cgmath::Rad::from(self.fov), aspect: aspect_ratio.into(), near: 10.0, far: 100000.0, }); let view_matrix = Matrix4::look_at_rh(self.position, self.look_at, self.up); vec![ ProjectionMutator::SetProjectionMatrix { matrix: projection_matrix, is_orthographic: false, }, ProjectionMutator::SetViewMatrix(view_matrix), ] } } #[derive(Clone, Debug)] pub struct OrthographicCamera { pub position: Point3<f32>, pub look_at: Point3<f32>, pub up: Vector3, pub view_bounds: ViewBounds, } impl OrthographicCamera { pub fn new(position: Point3<f32>, look_at: Point3<f32>, view_bounds: ViewBounds) -> Self { Self { position, look_at, up: Vector3::new(0.0, -1.0, 0.0), view_bounds, } } pub fn new_isometric(center: Point3<f32>, view_bounds: ViewBounds) -> Self { let sin = Deg(45.0).sin() * 1000.0; let siny = Deg(35.264).sin() * 1000.0; let position = Point3::new(center.x + sin, center.y - siny, center.z - sin); Self { position, look_at: center, up: Vector3::new(0.0, -1.0, 0.0), view_bounds, } } } impl ProjectionModifier for OrthographicCamera { fn update_projections(&self, aspect_ratio: AspectRatio) -> Vec<ProjectionMutator> { let view_matrix = Matrix4::look_at_rh(self.position, self.look_at, self.up); let view_bounds = self.view_bounds.project(&view_matrix, aspect_ratio); let projection_matrix = Matrix4::from(Ortho { left: view_bounds.min.x, right: view_bounds.max.x, top: view_bounds.max.y, bottom: view_bounds.min.y, near: -10000.0, far: 10000.0, }); vec![ ProjectionMutator::SetProjectionMatrix { matrix: projection_matrix, is_orthographic: true, }, ProjectionMutator::SetViewMatrix(view_matrix), ] } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/pipeline.rs
renderer/src/pipeline.rs
use std::{collections::HashSet, fmt::Display, hash::Hash, ops::Range}; use cgmath::SquareMatrix; use image::GenericImageView; use ldraw::{color::Color, Matrix4, Vector3, Vector4}; use wgpu::{util::DeviceExt, TextureViewDescriptor}; use crate::display_list::InstanceOps; use super::{ display_list::{DisplayList, Instances, SelectionDisplayList, SelectionInstances}, error, part::{EdgeBuffer, MeshBuffer, OptionalEdgeBuffer, Part, PartQuerier}, projection::Projection, Entity, ObjectSelection, }; const DEFAULT_OBJECT_SELECTION_FRAMEBUFFER_SIZE: u32 = 1024; pub struct MaterialUniformData { diffuse: Vector3, emissive: Vector3, roughness: f32, metalness: f32, } impl Default for MaterialUniformData { fn default() -> Self { Self { diffuse: Vector3::new(1.0, 1.0, 1.0), emissive: Vector3::new(0.0, 0.0, 0.0), roughness: 0.3, metalness: 0.0, } } } #[repr(C)] #[derive(Clone, Copy, bytemuck::Pod, bytemuck::Zeroable)] struct RawMaterialUniformData { diffuse: [f32; 3], _padding0: [u8; 4], emissive: [f32; 3], roughness: f32, metalness: f32, _padding1: [u8; 12], } impl From<&MaterialUniformData> for RawMaterialUniformData { fn from(v: &MaterialUniformData) -> Self { Self { diffuse: [v.diffuse.x, v.diffuse.y, v.diffuse.z], _padding0: [0; 4], emissive: [v.emissive.x, v.emissive.y, v.emissive.z], roughness: v.roughness, metalness: v.metalness, _padding1: [0; 12], } } } impl RawMaterialUniformData { fn update(&mut self, data: &MaterialUniformData) { self.diffuse = data.diffuse.into(); self.emissive = data.emissive.into(); self.roughness = data.roughness; self.metalness = data.metalness; } } pub struct ShadingUniforms { pub bind_group: wgpu::BindGroup, pub material_data: MaterialUniformData, material_buffer: wgpu::Buffer, material_raw: RawMaterialUniformData, _env_map_texture_view: wgpu::TextureView, _env_map_sampler: wgpu::Sampler, } impl ShadingUniforms { pub fn new( device: &wgpu::Device, env_map_texture_view: wgpu::TextureView, env_map_sampler: wgpu::Sampler, ) -> Self { let material_data = MaterialUniformData::default(); let material_raw = RawMaterialUniformData::from(&material_data); let material_buffer = device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some("Uniform buffer for materials"), contents: bytemuck::cast_slice(&[material_raw]), usage: wgpu::BufferUsages::UNIFORM | wgpu::BufferUsages::COPY_DST, }); let bind_group = device.create_bind_group(&wgpu::BindGroupDescriptor { label: Some("Bind group for shading"), layout: &device.create_bind_group_layout(&Self::desc()), entries: &[ wgpu::BindGroupEntry { binding: 0, resource: material_buffer.as_entire_binding(), }, wgpu::BindGroupEntry { binding: 1, resource: wgpu::BindingResource::TextureView(&env_map_texture_view), }, wgpu::BindGroupEntry { binding: 2, resource: wgpu::BindingResource::Sampler(&env_map_sampler), }, ], }); Self { bind_group, material_data, material_buffer, material_raw, _env_map_texture_view: env_map_texture_view, _env_map_sampler: env_map_sampler, } } pub fn update_materials(&mut self, queue: &wgpu::Queue) { self.material_raw.update(&self.material_data); queue.write_buffer( &self.material_buffer, 0 as wgpu::BufferAddress, bytemuck::cast_slice(&[self.material_raw]), ); } pub fn desc() -> wgpu::BindGroupLayoutDescriptor<'static> { wgpu::BindGroupLayoutDescriptor { label: Some("Bind group descriptor for shading"), entries: &[ wgpu::BindGroupLayoutEntry { binding: 0, visibility: wgpu::ShaderStages::FRAGMENT, ty: wgpu::BindingType::Buffer { ty: wgpu::BufferBindingType::Uniform, has_dynamic_offset: false, min_binding_size: None, }, count: None, }, wgpu::BindGroupLayoutEntry { binding: 1, visibility: wgpu::ShaderStages::FRAGMENT, ty: wgpu::BindingType::Texture { multisampled: false, view_dimension: wgpu::TextureViewDimension::D2, sample_type: wgpu::TextureSampleType::Float { filterable: true }, }, count: None, }, wgpu::BindGroupLayoutEntry { binding: 2, visibility: wgpu::ShaderStages::FRAGMENT, ty: wgpu::BindingType::Sampler(wgpu::SamplerBindingType::Filtering), count: None, }, ], } } } pub struct DefaultMeshRenderingPipeline { pipeline: wgpu::RenderPipeline, pub shading_uniforms: ShadingUniforms, } impl DefaultMeshRenderingPipeline { fn load_envmap(device: &wgpu::Device, queue: &wgpu::Queue) -> (wgpu::Texture, wgpu::Sampler) { let image = image::load_from_memory_with_format( include_bytes!("../assets/env_cubemap.png"), image::ImageFormat::Png, ) .unwrap(); let rgba = image.to_rgba8(); let (width, height) = image.dimensions(); let size = wgpu::Extent3d { width, height, depth_or_array_layers: 1, }; let texture = device.create_texture(&wgpu::TextureDescriptor { label: Some("Environment map"), size, mip_level_count: 1, sample_count: 1, dimension: wgpu::TextureDimension::D2, format: wgpu::TextureFormat::Rgba8Unorm, usage: wgpu::TextureUsages::TEXTURE_BINDING | wgpu::TextureUsages::COPY_DST, view_formats: &[], }); let sampler = device.create_sampler(&wgpu::SamplerDescriptor { min_filter: wgpu::FilterMode::Linear, mag_filter: wgpu::FilterMode::Linear, mipmap_filter: wgpu::FilterMode::Nearest, address_mode_u: wgpu::AddressMode::ClampToEdge, address_mode_v: wgpu::AddressMode::ClampToEdge, address_mode_w: wgpu::AddressMode::ClampToEdge, ..Default::default() }); queue.write_texture( wgpu::TexelCopyTextureInfo { aspect: wgpu::TextureAspect::All, texture: &texture, mip_level: 0, origin: wgpu::Origin3d::ZERO, }, &rgba, wgpu::TexelCopyBufferLayout { offset: 0, bytes_per_row: Some(4 * width), rows_per_image: Some(height), }, size, ); (texture, sampler) } fn new( device: &wgpu::Device, queue: &wgpu::Queue, texture_format: wgpu::TextureFormat, sample_count: u32, ) -> Self { let vertex_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Vertex shader for default mesh"), source: wgpu::ShaderSource::Wgsl(include_str!("../shaders/model_vertex.wgsl").into()), }); let fragment_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Fragment shader for default mesh"), source: wgpu::ShaderSource::Wgsl( include_str!("../shaders/model_fragment_base.wgsl").into(), ), }); let projection_bind_group_layout = device.create_bind_group_layout(&Projection::desc()); let (env_map_texture, env_map_sampler) = Self::load_envmap(device, queue); let env_map_texture_view = env_map_texture.create_view(&wgpu::TextureViewDescriptor::default()); let shading_uniforms = ShadingUniforms::new(device, env_map_texture_view, env_map_sampler); let shading_bind_group_layout = device.create_bind_group_layout(&ShadingUniforms::desc()); let render_pipeline_layout = device.create_pipeline_layout(&wgpu::PipelineLayoutDescriptor { label: Some("Render pipeline layout for default mesh"), bind_group_layouts: &[&projection_bind_group_layout, &shading_bind_group_layout], push_constant_ranges: &[], }); let render_pipeline = device.create_render_pipeline(&wgpu::RenderPipelineDescriptor { label: Some("Render pipeline for default meshes"), layout: Some(&render_pipeline_layout), vertex: wgpu::VertexState { module: &vertex_shader, entry_point: Some("vs"), buffers: &[MeshBuffer::desc(), Instances::<i32, i32>::desc()], compilation_options: Default::default(), }, fragment: Some(wgpu::FragmentState { module: &fragment_shader, entry_point: Some("fs"), targets: &[Some(wgpu::ColorTargetState { format: texture_format, blend: Some(wgpu::BlendState { color: wgpu::BlendComponent::OVER, alpha: wgpu::BlendComponent::OVER, }), write_mask: wgpu::ColorWrites::ALL, })], compilation_options: Default::default(), }), primitive: wgpu::PrimitiveState { topology: wgpu::PrimitiveTopology::TriangleList, strip_index_format: None, front_face: wgpu::FrontFace::Ccw, cull_mode: Some(wgpu::Face::Back), polygon_mode: wgpu::PolygonMode::Fill, unclipped_depth: false, conservative: false, }, depth_stencil: Some(wgpu::DepthStencilState { format: wgpu::TextureFormat::Depth32Float, depth_write_enabled: true, depth_compare: wgpu::CompareFunction::LessEqual, stencil: wgpu::StencilState::default(), bias: wgpu::DepthBiasState::default(), }), multisample: wgpu::MultisampleState { count: sample_count, mask: !0, alpha_to_coverage_enabled: false, }, multiview: None, cache: None, }); Self { pipeline: render_pipeline, shading_uniforms, } } fn render<K, G>( &self, pass: &mut wgpu::RenderPass<'static>, projection: &Projection, part: &Part, instances: &Instances<K, G>, range: Range<u32>, ) { let Some(buffer) = &instances.instance_buffer else { return; }; let Some(projection) = &projection.bind_group else { return; }; pass.set_vertex_buffer(0, part.mesh.vertices.slice(..)); pass.set_pipeline(&self.pipeline); pass.set_bind_group(0, projection, &[]); pass.set_bind_group(1, &self.shading_uniforms.bind_group, &[]); pass.set_vertex_buffer(1, buffer.slice(..)); pass.set_index_buffer(part.mesh.indices.slice(..), part.mesh.index_format); pass.draw_indexed(range, 0, instances.range()); } } pub struct NoShadingMeshRenderingPipeline { pipeline: wgpu::RenderPipeline, } impl NoShadingMeshRenderingPipeline { pub fn new( device: &wgpu::Device, texture_format: wgpu::TextureFormat, sample_count: u32, ) -> Self { let vertex_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Vertex shader for default mesh without shading"), source: wgpu::ShaderSource::Wgsl(include_str!("../shaders/model_vertex.wgsl").into()), }); let fragment_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Fragment shader for default mesh"), source: wgpu::ShaderSource::Wgsl( include_str!("../shaders/model_fragment_no_shading.wgsl").into(), ), }); let projection_bind_group_layout = device.create_bind_group_layout(&Projection::desc()); let render_pipeline_layout = device.create_pipeline_layout(&wgpu::PipelineLayoutDescriptor { label: Some("Render pipeline layout for default mesh without shading"), bind_group_layouts: &[&projection_bind_group_layout], push_constant_ranges: &[], }); let render_pipeline = device.create_render_pipeline(&wgpu::RenderPipelineDescriptor { label: Some("Render pipeline for default mesh without shading"), layout: Some(&render_pipeline_layout), vertex: wgpu::VertexState { module: &vertex_shader, entry_point: Some("vs"), buffers: &[MeshBuffer::desc(), Instances::<i32, i32>::desc()], compilation_options: Default::default(), }, fragment: Some(wgpu::FragmentState { module: &fragment_shader, entry_point: Some("fs"), targets: &[Some(wgpu::ColorTargetState { format: texture_format, blend: Some(wgpu::BlendState { color: wgpu::BlendComponent::OVER, alpha: wgpu::BlendComponent::OVER, }), write_mask: wgpu::ColorWrites::ALL, })], compilation_options: Default::default(), }), primitive: wgpu::PrimitiveState { topology: wgpu::PrimitiveTopology::TriangleList, strip_index_format: None, front_face: wgpu::FrontFace::Ccw, cull_mode: None, polygon_mode: wgpu::PolygonMode::Fill, unclipped_depth: false, conservative: false, }, depth_stencil: Some(wgpu::DepthStencilState { format: wgpu::TextureFormat::Depth32Float, depth_write_enabled: true, depth_compare: wgpu::CompareFunction::LessEqual, stencil: wgpu::StencilState::default(), bias: wgpu::DepthBiasState::default(), }), multisample: wgpu::MultisampleState { count: sample_count, mask: !0, alpha_to_coverage_enabled: false, }, multiview: None, cache: None, }); Self { pipeline: render_pipeline, } } fn render<K, G>( &self, pass: &mut wgpu::RenderPass<'static>, projection: &Projection, part: &Part, instances: &Instances<K, G>, range: Range<u32>, ) { let Some(buffer) = &instances.instance_buffer else { return; }; let Some(projection) = &projection.bind_group else { return; }; pass.set_vertex_buffer(0, part.mesh.vertices.slice(..)); pass.set_pipeline(&self.pipeline); pass.set_bind_group(0, projection, &[]); pass.set_vertex_buffer(1, buffer.slice(..)); pass.set_index_buffer(part.mesh.indices.slice(..), part.mesh.index_format); pass.draw_indexed(range, 0, instances.range()); } } pub struct EdgeRenderingPipeline { pipeline: wgpu::RenderPipeline, } impl EdgeRenderingPipeline { pub fn new( device: &wgpu::Device, texture_format: wgpu::TextureFormat, sample_count: u32, ) -> Self { let vertex_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Vertex shader for edges"), source: wgpu::ShaderSource::Wgsl(include_str!("../shaders/edge_vertex.wgsl").into()), }); let fragment_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Fragment shader for edges"), source: wgpu::ShaderSource::Wgsl(include_str!("../shaders/edge_fragment.wgsl").into()), }); let projection_bind_group_layout = device.create_bind_group_layout(&Projection::desc()); let render_pipeline_layout = device.create_pipeline_layout(&wgpu::PipelineLayoutDescriptor { label: Some("Render pipeline layout for edges"), bind_group_layouts: &[&projection_bind_group_layout], push_constant_ranges: &[], }); let render_pipeline = device.create_render_pipeline(&wgpu::RenderPipelineDescriptor { label: Some("Render pipeline for edges"), layout: Some(&render_pipeline_layout), vertex: wgpu::VertexState { module: &vertex_shader, entry_point: Some("vs"), buffers: &[EdgeBuffer::desc(), Instances::<i32, i32>::desc()], compilation_options: Default::default(), }, fragment: Some(wgpu::FragmentState { module: &fragment_shader, entry_point: Some("fs"), targets: &[Some(wgpu::ColorTargetState { format: texture_format, blend: Some(wgpu::BlendState { color: wgpu::BlendComponent::REPLACE, alpha: wgpu::BlendComponent::REPLACE, }), write_mask: wgpu::ColorWrites::ALL, })], compilation_options: Default::default(), }), primitive: wgpu::PrimitiveState { topology: wgpu::PrimitiveTopology::LineList, strip_index_format: None, front_face: wgpu::FrontFace::Ccw, cull_mode: None, polygon_mode: wgpu::PolygonMode::Fill, unclipped_depth: false, conservative: false, }, depth_stencil: Some(wgpu::DepthStencilState { format: wgpu::TextureFormat::Depth32Float, depth_write_enabled: true, depth_compare: wgpu::CompareFunction::LessEqual, stencil: wgpu::StencilState::default(), bias: wgpu::DepthBiasState::default(), }), multisample: wgpu::MultisampleState { count: sample_count, mask: !0, alpha_to_coverage_enabled: false, }, multiview: None, cache: None, }); Self { pipeline: render_pipeline, } } fn render<K, G>( &self, pass: &mut wgpu::RenderPass<'static>, projection: &Projection, part: &Part, instances: &Instances<K, G>, ) -> bool { let Some(projection) = &projection.bind_group else { return false; }; let Some(instance_buffer) = &instances.instance_buffer else { return false; }; let Some(edges) = &part.edges else { return false; }; pass.set_vertex_buffer(0, edges.vertices.slice(..)); pass.set_pipeline(&self.pipeline); pass.set_bind_group(0, projection, &[]); pass.set_vertex_buffer(1, instance_buffer.slice(..)); pass.set_index_buffer(edges.indices.slice(..), edges.index_format); pass.draw_indexed(edges.range.clone(), 0, instances.range()); true } } pub struct OptionalEdgeRenderingPipeline { pipeline: wgpu::RenderPipeline, } impl OptionalEdgeRenderingPipeline { pub fn new( device: &wgpu::Device, texture_format: wgpu::TextureFormat, sample_count: u32, ) -> Self { let vertex_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Vertex shader for optional edges"), source: wgpu::ShaderSource::Wgsl( include_str!("../shaders/optional_edge_vertex.wgsl").into(), ), }); let fragment_shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Fragment shader for optional edges"), source: wgpu::ShaderSource::Wgsl( include_str!("../shaders/optional_edge_fragment.wgsl").into(), ), }); let projection_bind_group_layout = device.create_bind_group_layout(&Projection::desc()); let render_pipeline_layout = device.create_pipeline_layout(&wgpu::PipelineLayoutDescriptor { label: Some("Render pipeline layout for optional edges"), bind_group_layouts: &[&projection_bind_group_layout], push_constant_ranges: &[], }); let render_pipeline = device.create_render_pipeline(&wgpu::RenderPipelineDescriptor { label: Some("Render pipeline for optional edges"), layout: Some(&render_pipeline_layout), vertex: wgpu::VertexState { module: &vertex_shader, entry_point: Some("vs"), buffers: &[OptionalEdgeBuffer::desc(), Instances::<i32, i32>::desc()], compilation_options: Default::default(), }, fragment: Some(wgpu::FragmentState { module: &fragment_shader, entry_point: Some("fs"), targets: &[Some(wgpu::ColorTargetState { format: texture_format, blend: Some(wgpu::BlendState { color: wgpu::BlendComponent::REPLACE, alpha: wgpu::BlendComponent::REPLACE, }), write_mask: wgpu::ColorWrites::ALL, })], compilation_options: Default::default(), }), primitive: wgpu::PrimitiveState { topology: wgpu::PrimitiveTopology::LineList, strip_index_format: None, front_face: wgpu::FrontFace::Ccw, cull_mode: None, polygon_mode: wgpu::PolygonMode::Fill, unclipped_depth: false, conservative: false, }, depth_stencil: Some(wgpu::DepthStencilState { format: wgpu::TextureFormat::Depth32Float, depth_write_enabled: true, depth_compare: wgpu::CompareFunction::LessEqual, stencil: wgpu::StencilState::default(), bias: wgpu::DepthBiasState::default(), }), multisample: wgpu::MultisampleState { count: sample_count, mask: !0, alpha_to_coverage_enabled: false, }, multiview: None, cache: None, }); Self { pipeline: render_pipeline, } } fn render<K, G>( &self, pass: &mut wgpu::RenderPass<'static>, projection: &Projection, part: &Part, instances: &Instances<K, G>, ) -> bool { let Some(projection) = &projection.bind_group else { return false; }; let Some(optional_edges) = &part.optional_edges else { return false; }; let Some(instance_buffer) = &instances.instance_buffer else { return false; }; pass.set_vertex_buffer(0, optional_edges.vertices.slice(..)); pass.set_pipeline(&self.pipeline); pass.set_bind_group(0, projection, &[]); pass.set_vertex_buffer(1, instance_buffer.slice(..)); pass.draw(optional_edges.range.clone(), instances.range()); true } } pub struct ObjectSelectionRenderingPipeline { pipeline: wgpu::RenderPipeline, framebuffer_size: u32, framebuffer_texture: wgpu::Texture, framebuffer_texture_view: wgpu::TextureView, _depth_texture: wgpu::Texture, depth_texture_view: wgpu::TextureView, output_buffer: wgpu::Buffer, } impl ObjectSelectionRenderingPipeline { pub fn new(device: &wgpu::Device, framebuffer_size: u32) -> Self { let shader = device.create_shader_module(wgpu::ShaderModuleDescriptor { label: Some("Vertex shader for object selection"), source: wgpu::ShaderSource::Wgsl(include_str!("../shaders/selection.wgsl").into()), }); let projection_bind_group_layout = device.create_bind_group_layout(&Projection::desc()); let render_pipeline_layout = device.create_pipeline_layout(&wgpu::PipelineLayoutDescriptor { label: Some("Render pipeline layout for object selection"), bind_group_layouts: &[&projection_bind_group_layout], push_constant_ranges: &[], }); let render_pipeline = device.create_render_pipeline(&wgpu::RenderPipelineDescriptor { label: Some("Render pipeline for object selection"), layout: Some(&render_pipeline_layout), vertex: wgpu::VertexState { module: &shader, entry_point: Some("vs"), buffers: &[MeshBuffer::desc(), SelectionInstances::desc()], compilation_options: Default::default(), }, fragment: Some(wgpu::FragmentState { module: &shader, entry_point: Some("fs"), targets: &[Some(wgpu::ColorTargetState { format: wgpu::TextureFormat::R32Uint, blend: None, write_mask: wgpu::ColorWrites::ALL, })], compilation_options: Default::default(), }), primitive: wgpu::PrimitiveState { topology: wgpu::PrimitiveTopology::TriangleList, strip_index_format: None, front_face: wgpu::FrontFace::Ccw, cull_mode: None, polygon_mode: wgpu::PolygonMode::Fill, unclipped_depth: false, conservative: false, }, depth_stencil: Some(wgpu::DepthStencilState { format: wgpu::TextureFormat::Depth32Float, depth_write_enabled: true, depth_compare: wgpu::CompareFunction::LessEqual, stencil: wgpu::StencilState::default(), bias: wgpu::DepthBiasState::default(), }), multisample: wgpu::MultisampleState { count: 1, mask: !0, alpha_to_coverage_enabled: false, }, multiview: None, cache: None, }); let framebuffer_texture = device.create_texture(&wgpu::TextureDescriptor { label: Some("Framebuffer texture for object selection"), format: wgpu::TextureFormat::R32Uint, dimension: wgpu::TextureDimension::D2, size: wgpu::Extent3d { width: framebuffer_size, height: framebuffer_size, depth_or_array_layers: 1, }, mip_level_count: 1, sample_count: 1, usage: wgpu::TextureUsages::COPY_SRC | wgpu::TextureUsages::RENDER_ATTACHMENT, view_formats: &[], }); let framebuffer_texture_view = framebuffer_texture.create_view(&TextureViewDescriptor::default()); let depth_texture = device.create_texture(&wgpu::TextureDescriptor { label: Some("Depth texture for object selection"), format: wgpu::TextureFormat::Depth32Float, dimension: wgpu::TextureDimension::D2, size: wgpu::Extent3d { width: framebuffer_size, height: framebuffer_size, depth_or_array_layers: 1, }, mip_level_count: 1, sample_count: 1, usage: wgpu::TextureUsages::COPY_SRC | wgpu::TextureUsages::RENDER_ATTACHMENT, view_formats: &[], }); let depth_texture_view = depth_texture.create_view(&TextureViewDescriptor::default()); let output_buffer_size = (std::mem::size_of::<u32>() as u32 * framebuffer_size * framebuffer_size) as wgpu::BufferAddress; let output_buffer = device.create_buffer(&wgpu::BufferDescriptor { label: Some("Object selection buffer"), size: output_buffer_size, usage: wgpu::BufferUsages::COPY_DST | wgpu::BufferUsages::MAP_READ, mapped_at_creation: false, }); Self { pipeline: render_pipeline, framebuffer_size, framebuffer_texture, framebuffer_texture_view, _depth_texture: depth_texture, depth_texture_view, output_buffer, } } pub fn render_part( &self, pass: &mut wgpu::RenderPass<'static>, projection: &Projection, part: &Part, instances: &SelectionInstances, range: Range<u32>, ) { if instances.range().is_empty() { return; } let Some(projection) = &projection.bind_group else { return; }; pass.set_vertex_buffer(0, part.mesh.vertices.slice(..)); pass.set_pipeline(&self.pipeline); pass.set_bind_group(0, projection, &[]); pass.set_vertex_buffer(1, instances.instance_buffer.slice(..)); pass.set_index_buffer(part.mesh.indices.slice(..), part.mesh.index_format); pass.draw_indexed(range, 0, instances.range()); } pub fn render_display_list<G, K: Clone>( &self, pass: &mut wgpu::RenderPass<'static>, projection: &Projection, part_querier: &dyn PartQuerier<G>, display_list: &SelectionDisplayList<G, K>, ) -> u32 { let mut draws = 0; for (group, instances) in display_list.iter() { if let Some(part) = part_querier.get(group) { self.render_part(pass, projection, part, instances, 0..part.mesh.index_length); draws += 1; } } draws } } pub trait ObjectSelectionRenderingOp { fn render(&self, projection: &Projection, pass: &mut wgpu::RenderPass<'static>); } pub trait ObjectSelectionTestOp { type Result; fn test(&self, ids: impl Iterator<Item = u32> + 'static) -> Option<Self::Result>; } pub trait ObjectSelectionOp: ObjectSelectionRenderingOp + ObjectSelectionTestOp {} impl<T> ObjectSelectionOp for T where T: ObjectSelectionRenderingOp + ObjectSelectionTestOp {} pub struct DisplayListObjectSelectionOp<'ctx, G, K> { pipeline: &'ctx ObjectSelectionRenderingPipeline, part_querier: &'ctx dyn PartQuerier<G>, display_list: SelectionDisplayList<G, K>, } impl<'ctx, G, K> DisplayListObjectSelectionOp<'ctx, G, K> { pub fn new( pipeline_manager: &'ctx RenderingPipelineManager, part_querier: &'ctx impl PartQuerier<G>, display_list: SelectionDisplayList<G, K>, ) -> Self { Self { pipeline: &pipeline_manager.object_selection, part_querier, display_list, } } } impl<'ctx, G, K: Clone + Eq + PartialEq + Hash> ObjectSelectionRenderingOp for DisplayListObjectSelectionOp<'ctx, G, K> { fn render(&self, projection: &Projection, pass: &mut wgpu::RenderPass<'static>) { self.pipeline .render_display_list(pass, projection, self.part_querier, &self.display_list); } } impl<'ctx, G, K: Clone + Eq + PartialEq + Hash> ObjectSelectionTestOp for DisplayListObjectSelectionOp<'ctx, G, K> { type Result = HashSet<K>; fn test(&self, ids: impl Iterator<Item = u32> + 'static) -> Option<Self::Result> { let result: HashSet<K> = self.display_list.get_matches(ids).collect(); Some(result) } } pub struct RenderingPipelineManager { mesh_default: DefaultMeshRenderingPipeline,
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
true
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/renderer/src/part.rs
renderer/src/part.rs
use std::{collections::HashMap, ops::Range}; use ldraw::{ color::{ColorCatalog, ColorReference}, Vector4, }; use ldraw_ir::{geometry::BoundingBox3, part as part_ir}; use wgpu::util::DeviceExt; pub struct MeshBuffer { pub vertices: wgpu::Buffer, pub indices: wgpu::Buffer, pub index_format: wgpu::IndexFormat, pub uncolored_range: Option<Range<u32>>, pub uncolored_without_bfc_range: Option<Range<u32>>, pub colored_opaque_range: Option<Range<u32>>, pub colored_opaque_without_bfc_range: Option<Range<u32>>, pub colored_translucent_range: Option<Range<u32>>, pub colored_translucent_without_bfc_range: Option<Range<u32>>, pub index_length: u32, } #[derive(Eq, PartialEq, Hash)] struct MeshVertexIndex { vertex: usize, normal: usize, color: ColorReference, } impl MeshBuffer { fn expand( metadata: &part_ir::PartMetadata, vertices: &mut Vec<f32>, index: &mut Vec<u32>, index_table: &mut HashMap<MeshVertexIndex, u32>, vertex_buffer: &part_ir::VertexBuffer, index_buffers: Vec<(ColorReference, &part_ir::MeshBuffer)>, ) -> Option<Range<u32>> { if index_buffers.is_empty() { return None; } let start = index.len() as u32; let mut end = start; for (color, buffer) in index_buffers { if !buffer.is_valid() { eprintln!( "{}: Corrupted mesh vertex buffer. skipping...", metadata.name ); return None; } end += buffer.len() as u32; let color_array = match &color { ColorReference::Current => vec![-1.0; 4], ColorReference::Complement => vec![-2.0; 4], ColorReference::Color(c) => { let color: Vector4 = c.color.into(); vec![color.x, color.y, color.z, color.w] } ColorReference::Unknown(_) | ColorReference::Unresolved(_) => { vec![0.0, 0.0, 0.0, 1.0] } }; for (vertex_idx, normal_idx) in buffer .vertex_indices .iter() .zip(buffer.normal_indices.iter()) { let vertex_idx = *vertex_idx as usize; let normal_idx = *normal_idx as usize; let vertex_range = vertex_idx * 3..vertex_idx * 3 + 3; let normal_range = normal_idx * 3..normal_idx * 3 + 3; if !vertex_buffer.check_range(&vertex_range) || !vertex_buffer.check_range(&normal_range) { eprintln!( "{}: Corrupted mesh vertex buffer. skipping...", metadata.name ); return None; } let idx_key = MeshVertexIndex { vertex: vertex_idx, normal: normal_idx, color: color.clone(), }; if let Some(idx) = index_table.get(&idx_key) { index.push(*idx); } else { let idx_val = index_table.len() as u32; index_table.insert(idx_key, idx_val); vertices.extend(&vertex_buffer.0[vertex_range]); vertices.extend(&vertex_buffer.0[normal_range]); vertices.extend(&color_array); index.push(idx_val); } } } if start == end { None } else { Some(start..end) } } pub fn new(device: &wgpu::Device, part: &part_ir::Part) -> Self { let mut data = Vec::new(); let mut index = Vec::new(); let mut index_lut = HashMap::new(); let uncolored_range = Self::expand( &part.metadata, &mut data, &mut index, &mut index_lut, &part.geometry.vertex_buffer, vec![(ColorReference::Current, &part.geometry.uncolored_mesh)], ); let uncolored_without_bfc_range = Self::expand( &part.metadata, &mut data, &mut index, &mut index_lut, &part.geometry.vertex_buffer, vec![( ColorReference::Current, &part.geometry.uncolored_without_bfc_mesh, )], ); let colored_opaque_range = Self::expand( &part.metadata, &mut data, &mut index, &mut index_lut, &part.geometry.vertex_buffer, part.geometry .colored_meshes .iter() .filter_map(|(k, v)| { if let ColorReference::Color(c) = &k.color_ref { if !c.is_translucent() && k.bfc { Some((k.color_ref.clone(), v)) } else { None } } else { None } }) .collect(), ); let colored_opaque_without_bfc_range = Self::expand( &part.metadata, &mut data, &mut index, &mut index_lut, &part.geometry.vertex_buffer, part.geometry .colored_meshes .iter() .filter_map(|(k, v)| { if let ColorReference::Color(c) = &k.color_ref { if !c.is_translucent() && !k.bfc { Some((k.color_ref.clone(), v)) } else { None } } else { None } }) .collect(), ); let colored_translucent_range = Self::expand( &part.metadata, &mut data, &mut index, &mut index_lut, &part.geometry.vertex_buffer, part.geometry .colored_meshes .iter() .filter_map(|(k, v)| { if let ColorReference::Color(c) = &k.color_ref { if c.is_translucent() && k.bfc { Some((k.color_ref.clone(), v)) } else { None } } else { None } }) .collect(), ); let colored_translucent_without_bfc_range = Self::expand( &part.metadata, &mut data, &mut index, &mut index_lut, &part.geometry.vertex_buffer, part.geometry .colored_meshes .iter() .filter_map(|(k, v)| { if let ColorReference::Color(c) = &k.color_ref { if c.is_translucent() && !k.bfc { Some((k.color_ref.clone(), v)) } else { None } } else { None } }) .collect(), ); let vertices = device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!( "Vertex buffer for mesh data at {}", part.metadata.name )), contents: bytemuck::cast_slice(&data), usage: wgpu::BufferUsages::VERTEX, }); let index_length = index.len() as u32; let (indices, index_format) = if data.len() / (3 * 10) < 2 << 16 { let mut shrunk_data = vec![]; for item in index { shrunk_data.push(item as u16); } ( device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!( "Index buffer for mesh data at {}", part.metadata.name )), contents: bytemuck::cast_slice(&shrunk_data), usage: wgpu::BufferUsages::INDEX, }), wgpu::IndexFormat::Uint16, ) } else { ( device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!( "Index buffer for mesh data at {}", part.metadata.name )), contents: bytemuck::cast_slice(&index), usage: wgpu::BufferUsages::INDEX, }), wgpu::IndexFormat::Uint32, ) }; MeshBuffer { vertices, indices, uncolored_range, uncolored_without_bfc_range, colored_opaque_range, colored_opaque_without_bfc_range, colored_translucent_range, colored_translucent_without_bfc_range, index_format, index_length, } } pub fn desc() -> wgpu::VertexBufferLayout<'static> { wgpu::VertexBufferLayout { array_stride: std::mem::size_of::<[f32; 10]>() as wgpu::BufferAddress, step_mode: wgpu::VertexStepMode::Vertex, attributes: &[ wgpu::VertexAttribute { offset: 0, shader_location: 0, format: wgpu::VertexFormat::Float32x3, }, wgpu::VertexAttribute { offset: std::mem::size_of::<[f32; 3]>() as wgpu::BufferAddress, shader_location: 1, format: wgpu::VertexFormat::Float32x3, }, wgpu::VertexAttribute { offset: std::mem::size_of::<[f32; 6]>() as wgpu::BufferAddress, shader_location: 2, format: wgpu::VertexFormat::Float32x4, }, ], } } } #[derive(Eq, PartialEq, Hash)] struct EdgeVertexIndex { vertex: usize, color: u32, } pub struct EdgeBuffer { pub vertices: wgpu::Buffer, pub indices: wgpu::Buffer, pub range: Range<u32>, pub index_format: wgpu::IndexFormat, } impl EdgeBuffer { fn expand( metadata: &part_ir::PartMetadata, vertices: &mut Vec<f32>, index: &mut Vec<u32>, index_table: &mut HashMap<EdgeVertexIndex, u32>, colors: &ColorCatalog, vertex_buffer: &part_ir::VertexBuffer, index_buffer: &part_ir::EdgeBuffer, ) -> Option<Range<u32>> { if index_buffer.is_empty() { None } else if !index_buffer.is_valid() { eprintln!("{}: Corrupted edge buffer. skipping...", metadata.name); None } else { let start = index.len() as u32; let end = start + index_buffer.len() as u32; for (vertex_idx, color_id) in index_buffer .vertex_indices .iter() .zip(index_buffer.colors.iter()) { let vertex_idx = *vertex_idx as usize; let vertex_range = vertex_idx * 3..vertex_idx * 3 + 3; if !vertex_buffer.check_range(&vertex_range) { eprintln!("{}: Corrupted edge buffer. skipping...", metadata.name); return None; } let idx_key = EdgeVertexIndex { vertex: vertex_idx, color: *color_id, }; if let Some(idx) = index_table.get(&idx_key) { index.push(*idx); } else { let color = if *color_id == 2u32 << 30 { [-1.0, -1.0, -1.0] } else if *color_id == 2u32 << 29 { [-2.0, -2.0, -2.0] } else { match colors.get(&(color_id & 0x7fffffffu32)) { Some(color) => { let buf = if *color_id & 0x8000_0000 != 0 { &color.edge } else { &color.color }; let r = buf.red() as f32 / 255.0; let g = buf.green() as f32 / 255.0; let b = buf.blue() as f32 / 255.0; [r, g, b] } None => [0.0, 0.0, 0.0], } }; let idx_val = index_table.len() as u32; index_table.insert(idx_key, idx_val); vertices.extend(&vertex_buffer.0[vertex_range]); vertices.extend(&color); index.push(idx_val); } } if start == end { None } else { Some(start..end) } } } pub fn new(device: &wgpu::Device, colors: &ColorCatalog, part: &part_ir::Part) -> Option<Self> { let mut data = Vec::new(); let mut index = Vec::new(); let mut index_lut = HashMap::new(); if let Some(range) = Self::expand( &part.metadata, &mut data, &mut index, &mut index_lut, colors, &part.geometry.vertex_buffer, &part.geometry.edges, ) { let vertices = device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!( "Vertex buffer for edge data at {}", part.metadata.name )), contents: bytemuck::cast_slice(&data), usage: wgpu::BufferUsages::VERTEX, }); let (indices, index_format) = if data.len() / (3 * 6) < 2 << 16 { let mut shrunk_data = vec![]; for item in index { shrunk_data.push(item as u16); } ( device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!( "Index buffer for edge data at {}", part.metadata.name )), contents: bytemuck::cast_slice(&shrunk_data), usage: wgpu::BufferUsages::INDEX, }), wgpu::IndexFormat::Uint16, ) } else { ( device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!( "Index buffer for edge data at {}", part.metadata.name )), contents: bytemuck::cast_slice(&index), usage: wgpu::BufferUsages::INDEX, }), wgpu::IndexFormat::Uint32, ) }; Some(Self { vertices, indices, range, index_format, }) } else { None } } pub fn desc() -> wgpu::VertexBufferLayout<'static> { wgpu::VertexBufferLayout { array_stride: std::mem::size_of::<[f32; 6]>() as wgpu::BufferAddress, step_mode: wgpu::VertexStepMode::Vertex, attributes: &[ wgpu::VertexAttribute { offset: 0, shader_location: 0, format: wgpu::VertexFormat::Float32x3, }, wgpu::VertexAttribute { offset: std::mem::size_of::<[f32; 3]>() as wgpu::BufferAddress, shader_location: 1, format: wgpu::VertexFormat::Float32x3, }, ], } } } pub struct OptionalEdgeBuffer { pub vertices: wgpu::Buffer, pub range: Range<u32>, } impl OptionalEdgeBuffer { fn expand( metadata: &part_ir::PartMetadata, vertices: &mut Vec<f32>, colors: &ColorCatalog, vertex_buffer: &part_ir::VertexBuffer, index_buffer: &part_ir::OptionalEdgeBuffer, ) -> Option<Range<u32>> { if index_buffer.is_empty() { None } else if !index_buffer.is_valid() { eprintln!( "{}: Corrupted optional edge buffer. skipping...", metadata.name ); None } else { let start = vertices.len() as u32 / 3; let end = start + index_buffer.len() as u32; for i in 0..index_buffer.vertex_indices.len() { let vertex_idx = index_buffer.vertex_indices[i] as usize; let control_1_idx = index_buffer.control_1_indices[i] as usize; let control_2_idx = index_buffer.control_2_indices[i] as usize; let direction_idx = index_buffer.direction_indices[i] as usize; let color_id = index_buffer.colors[i]; let vertex_range = vertex_idx * 3..vertex_idx * 3 + 3; let control_1_range = control_1_idx * 3..control_1_idx * 3 + 3; let control_2_range = control_2_idx * 3..control_2_idx * 3 + 3; let direction_range = direction_idx * 3..direction_idx * 3 + 3; if !vertex_buffer.check_range(&vertex_range) || !vertex_buffer.check_range(&control_1_range) || !vertex_buffer.check_range(&control_2_range) || !vertex_buffer.check_range(&direction_range) { eprintln!( "{}: Corrupted optional edge buffer. skipping...", metadata.name ); return None; } let color = if color_id == 2u32 << 30 { [-1.0, -1.0, -1.0] } else if color_id == 2u32 << 29 { [-2.0, -2.0, -2.0] } else { match colors.get(&(color_id & 0x7fffffffu32)) { Some(color) => { let buf = if color_id & 0x8000_0000 != 0 { &color.edge } else { &color.color }; let r = buf.red() as f32 / 255.0; let g = buf.green() as f32 / 255.0; let b = buf.blue() as f32 / 255.0; [r, g, b] } None => [0.0, 0.0, 0.0], } }; vertices.extend(&vertex_buffer.0[vertex_range]); vertices.extend(&vertex_buffer.0[control_1_range]); vertices.extend(&vertex_buffer.0[control_2_range]); vertices.extend(&vertex_buffer.0[direction_range]); vertices.extend(&color); } if start == end { None } else { Some(start..end) } } } pub fn new(device: &wgpu::Device, colors: &ColorCatalog, part: &part_ir::Part) -> Option<Self> { let mut data = Vec::new(); if let Some(range) = Self::expand( &part.metadata, &mut data, colors, &part.geometry.vertex_buffer, &part.geometry.optional_edges, ) { let vertices = device.create_buffer_init(&wgpu::util::BufferInitDescriptor { label: Some(&format!( "Vertex buffer for optional edge data at {}", part.metadata.name )), contents: bytemuck::cast_slice(&data), usage: wgpu::BufferUsages::VERTEX, }); Some(Self { vertices, range }) } else { None } } pub fn desc() -> wgpu::VertexBufferLayout<'static> { wgpu::VertexBufferLayout { array_stride: std::mem::size_of::<[f32; 15]>() as wgpu::BufferAddress, step_mode: wgpu::VertexStepMode::Vertex, attributes: &[ wgpu::VertexAttribute { offset: 0, shader_location: 0, format: wgpu::VertexFormat::Float32x3, }, wgpu::VertexAttribute { offset: std::mem::size_of::<[f32; 3]>() as wgpu::BufferAddress, shader_location: 1, format: wgpu::VertexFormat::Float32x3, }, wgpu::VertexAttribute { offset: std::mem::size_of::<[f32; 6]>() as wgpu::BufferAddress, shader_location: 2, format: wgpu::VertexFormat::Float32x3, }, wgpu::VertexAttribute { offset: std::mem::size_of::<[f32; 9]>() as wgpu::BufferAddress, shader_location: 3, format: wgpu::VertexFormat::Float32x3, }, wgpu::VertexAttribute { offset: std::mem::size_of::<[f32; 12]>() as wgpu::BufferAddress, shader_location: 4, format: wgpu::VertexFormat::Float32x3, }, ], } } } pub struct Part { pub metadata: part_ir::PartMetadata, pub mesh: MeshBuffer, pub edges: Option<EdgeBuffer>, pub optional_edges: Option<OptionalEdgeBuffer>, pub bounding_box: BoundingBox3, } impl Part { pub fn new(part: &part_ir::Part, device: &wgpu::Device, colors: &ColorCatalog) -> Self { Self { metadata: part.metadata.clone(), mesh: MeshBuffer::new(device, part), edges: EdgeBuffer::new(device, colors, part), optional_edges: OptionalEdgeBuffer::new(device, colors, part), bounding_box: part.bounding_box.clone(), } } } pub trait PartQuerier<K> { fn get(&self, key: &K) -> Option<&Part>; }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/tools/viewer/native/src/main.rs
tools/viewer/native/src/main.rs
#![cfg(not(target_arch = "wasm32"))] use std::{ env, path::PathBuf, rc::Rc, sync::{Arc, RwLock}, time::{Duration, Instant}, }; use clap::{App as ClapApp, Arg}; use ldraw::{ color::ColorCatalog, document::MultipartDocument, library::{DocumentLoader, LibraryLoader, PartCache}, resolvers::local::LocalLoader, }; use viewer_common::App; use winit::{event, event_loop::EventLoop, window::WindowBuilder}; async fn main_loop<L: LibraryLoader + 'static>( document: MultipartDocument, colors: ColorCatalog, dependency_loader: Rc<L>, ) { let evloop = EventLoop::new().unwrap(); let window = WindowBuilder::new() .with_title("ldraw.rs demo") .build(&evloop) .unwrap(); let main_window_id = window.id(); let mut app = match App::new(Arc::new(window), dependency_loader, Rc::new(colors), true).await { Ok(v) => v, Err(e) => { panic!("Could not initialize app: {e}"); } }; let cache = Arc::new(RwLock::new(PartCache::new())); app.set_document(cache, &document, &|alias, result| { match result { Ok(()) => { println!("Loaded part {}.", alias); } Err(e) => { println!("Could not load part {}: {}", alias, e); } }; }) .await .unwrap(); let started = Instant::now(); let mut total_duration = 0; let mut frames = 0; let mut now = started; let _ = evloop.run(move |event, target| match event { event::Event::WindowEvent { window_id, event } if window_id == main_window_id => { match event { event::WindowEvent::CloseRequested => { target.exit(); } event::WindowEvent::RedrawRequested => { app.animate(started.elapsed().as_millis() as f32 / 1000.0); match app.render() { Ok(duration) => { total_duration += duration.as_millis(); frames += 1; if now.elapsed() > Duration::from_secs(1) { println!( "{} frames per second. {} msecs per frame.", frames, total_duration as f32 / frames as f32 ); now = Instant::now(); frames = 0; total_duration = 0; } } Err(wgpu::SurfaceError::Lost | wgpu::SurfaceError::Outdated) => { app.resize(app.size); } Err(wgpu::SurfaceError::OutOfMemory) => { target.exit(); } Err(wgpu::SurfaceError::Timeout) => { println!("Surface timeout"); } Err(wgpu::SurfaceError::Other) => { println!("Unrecognized surface error"); } } } event => { app.handle_window_event(event, started.elapsed().as_millis() as f32 / 1000.0); } } } event::Event::AboutToWait => { app.request_redraw(); } _ => (), }); } #[tokio::main] async fn main() { let matches = ClapApp::new("viewer") .about("LDraw Model Viewer") .arg( Arg::with_name("ldraw_dir") .long("ldraw-dir") .value_name("PATH_OR_URL") .takes_value(true) .help("Path or URL to LDraw directory"), ) .arg( Arg::with_name("file") .takes_value(true) .required(true) .value_name("PATH_OR_URL") .help("Path or URL to model file"), ) .get_matches(); let ldrawdir = match matches.value_of("ldraw_dir") { Some(v) => v.to_string(), None => match env::var("LDRAWDIR") { Ok(v) => v, Err(_) => { panic!("--ldraw-dir option or LDRAWDIR environment variable is required."); } }, }; let path = String::from(matches.value_of("file").expect("Path is required")); // FIXME: There should be better ways than this let ldraw_path = PathBuf::from(&ldrawdir); let document_base_path = PathBuf::from(&path).parent().map(PathBuf::from); let loader = LocalLoader::new(Some(ldraw_path), document_base_path); let colors = loader.load_colors().await.unwrap(); let path_local = PathBuf::from(&path); let document = loader.load_document(&path_local, &colors).await.unwrap(); main_loop(document, colors, Rc::new(loader)).await; }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/tools/viewer/common/src/lib.rs
tools/viewer/common/src/lib.rs
mod error; mod texture; use std::{ cell::RefCell, cmp::min, collections::{HashMap, HashSet}, f32, rc::Rc, sync::{Arc, RwLock}, vec::Vec, }; use cgmath::{Deg, SquareMatrix}; use instant::{Duration, Instant}; use ldraw::{ color::{Color, ColorCatalog}, document::MultipartDocument, error::ResolutionError, library::{resolve_dependencies_multipart, LibraryLoader, PartCache}, Matrix4, PartAlias, Point2, Point3, Vector2, }; use ldraw_ir::{ model::{self, GroupId, ObjectId}, part::bake_part_from_multipart_document, }; use ldraw_renderer::{ display_list::{DisplayList, DisplayListOps}, part::{Part, PartQuerier}, pipeline::RenderingPipelineManager, projection::{PerspectiveCamera, Projection, ProjectionModifier, ProjectionMutator}, util::calculate_model_bounding_box, Entity, }; use uuid::Uuid; use winit::{ event, keyboard::{Key, NamedKey}, window::Window, }; use self::texture::Texture; pub struct OrbitController { last_pos: Option<Point2>, pressing: bool, latitude: f32, longitude: f32, pub radius: f32, tick: Option<f32>, velocity: Vector2, camera: PerspectiveCamera, } impl OrbitController { pub fn new() -> Self { let camera = PerspectiveCamera::new( Point3::new(0.0, 0.0, 0.0), Point3::new(0.0, 0.0, 0.0), Deg(45.0), ); OrbitController { last_pos: None, pressing: false, latitude: 0.785, longitude: 0.262, radius: 300.0, velocity: Vector2::new(0.1, 0.0), tick: None, camera, } } pub fn on_mouse_press(&mut self, pressed: bool) { self.pressing = pressed; if !pressed { self.last_pos = None; } } pub fn on_mouse_move(&mut self, x: f32, y: f32) { if self.pressing { if let Some(last_pos) = self.last_pos { self.latitude -= (x - last_pos.x) * 0.01; self.longitude = (self.longitude + (y - last_pos.y) * 0.01).clamp( -f32::consts::FRAC_PI_2 + 0.017, f32::consts::FRAC_PI_2 - 0.017, ); } self.last_pos = Some(Point2::new(x, y)); } } pub fn zoom(&mut self, delta: f32) { if self.radius - delta > 0.0 { self.radius -= delta; } } pub fn update(&mut self, width: u32, height: u32, tick: Option<f32>) -> Vec<ProjectionMutator> { if let (Some(p), Some(n)) = (self.tick, tick) { let delta = n - p; self.latitude += self.velocity.x * delta; self.longitude = (self.longitude + self.velocity.y * delta).clamp( -f32::consts::FRAC_PI_2 + 0.017, f32::consts::FRAC_PI_2 - 0.017, ); } self.tick = tick; self.camera.position = self.derive_coordinate(); self.camera.update_projections((width, height).into()) } fn derive_coordinate(&self) -> Point3 { let look_at = &self.camera.look_at; let x = self.latitude.sin() * self.longitude.cos() * self.radius + look_at.x; let y = -self.longitude.sin() * self.radius + look_at.y; let z = -self.latitude.cos() * self.longitude.cos() * self.radius + look_at.z; Point3::new(x, y, z) } } impl Default for OrbitController { fn default() -> Self { Self::new() } } #[derive(Copy, Clone, Eq, PartialEq)] pub enum State { Playing, Step, Finished, } #[derive(Default)] struct SimplePartsPool(pub HashMap<PartAlias, Part>); impl PartQuerier<PartAlias> for SimplePartsPool { fn get(&self, alias: &PartAlias) -> Option<&Part> { self.0.get(alias) } } const FALL_INTERVAL: f32 = 0.2; const FALL_INTERVAL_UPPER_BOUND: f32 = 10.0; const FALL_DURATION: f32 = 0.5; #[derive(Clone, Debug)] struct RenderingItem { id: ObjectId, alias: PartAlias, matrix: Matrix4, color: Color, } enum RenderingStep { Item(RenderingItem), Step, } #[derive(Debug)] struct AnimatingRenderingItem { item: RenderingItem, started_at: f32, progress: f32, } struct AnimatedModel { display_list: Entity<DisplayList<ObjectId, PartAlias>>, items: Vec<RenderingStep>, animating: RefCell<Vec<AnimatingRenderingItem>>, state: State, pointer: Option<usize>, fall_interval: f32, last_time: Option<f32>, } impl Default for AnimatedModel { fn default() -> Self { Self { display_list: DisplayList::new().into(), items: Vec::new(), animating: RefCell::new(Vec::new()), state: State::Finished, pointer: None, fall_interval: FALL_INTERVAL, last_time: None, } } } impl AnimatedModel { fn uuid_xor(a: ObjectId, b: ObjectId) -> ObjectId { let ba = Uuid::from(a).to_bytes_le(); let bb = Uuid::from(b).to_bytes_le(); let bc: Vec<_> = ba.iter().zip(bb).map(|(x, y)| x ^ y).collect(); Uuid::from_slice(&bc).unwrap().into() } fn build_item_recursive( items: &mut Vec<RenderingStep>, model: &model::Model<PartAlias>, objects: &[model::Object<PartAlias>], parent_id: ObjectId, matrix: Matrix4, ) { for object in objects { match &object.data { model::ObjectInstance::Step => items.push(RenderingStep::Step), model::ObjectInstance::Part(p) => items.push(RenderingStep::Item(RenderingItem { id: Self::uuid_xor(parent_id, object.id), alias: p.part.clone(), matrix: matrix * p.matrix, color: p.color.get_color().cloned().unwrap_or_default(), })), model::ObjectInstance::PartGroup(pg) => { if let Some(group) = model.object_groups.get(&pg.group_id) { Self::build_item_recursive( items, model, &group.objects, object.id, matrix * pg.matrix, ); } } _ => {} } } } pub fn from_model( model: &model::Model<PartAlias>, group_id: Option<GroupId>, color_catalog: &ColorCatalog, animated: bool, ) -> Self { if animated { let objects = if let Some(group_id) = group_id { model .object_groups .get(&group_id) .map(|group| &group.objects) } else { Some(&model.objects) }; let mut items = Vec::new(); if let Some(objects) = objects { Self::build_item_recursive( &mut items, model, objects, uuid::Uuid::nil().into(), Matrix4::identity(), ); } let items_len = items.len(); Self { display_list: DisplayList::new().into(), items, animating: RefCell::new(Vec::new()), state: State::Playing, pointer: None, fall_interval: if items_len as f32 * FALL_INTERVAL >= FALL_INTERVAL_UPPER_BOUND { FALL_INTERVAL_UPPER_BOUND / items_len as f32 } else { FALL_INTERVAL }, last_time: None, } } else { let display_list = DisplayList::from_model(model, group_id, color_catalog); Self { display_list, items: Vec::new(), animating: RefCell::new(Vec::new()), state: State::Finished, pointer: None, fall_interval: 0.0, last_time: None, } } } pub fn advance(&mut self, time: f32) { if self.state == State::Step || self.pointer.is_none() { let start = self.pointer.unwrap_or(0); let mut count = 0; for i in start..self.items.len() { if let RenderingStep::Step = self.items[i] { break; } count += 1; } self.fall_interval = if count as f32 * FALL_INTERVAL >= FALL_INTERVAL_UPPER_BOUND { FALL_INTERVAL_UPPER_BOUND / count as f32 } else { FALL_INTERVAL }; } let next = if self.pointer.is_none() && self.last_time.is_none() { 0 } else if time - self.last_time.unwrap() >= self.fall_interval { self.pointer.unwrap() + 1 } else { return; }; if next >= self.items.len() { self.state = State::Finished; return; } self.pointer = Some(next); match &self.items[next] { RenderingStep::Item(item) => { self.animating.borrow_mut().push(AnimatingRenderingItem { item: item.clone(), started_at: time, progress: 0.0, }); self.display_list.mutate(DisplayListOps::Insert { group: item.alias.clone(), key: item.id, matrix: item.matrix, color: item.color.clone(), alpha: Some(0.0), }); self.state = State::Playing; self.last_time = Some(time); } RenderingStep::Step => { self.state = State::Step; } } } pub fn animate(&mut self, time: f32) { if self.state == State::Playing { self.advance(time); } let mut animating = self.animating.borrow_mut(); for item in animating.iter_mut() { let elapsed = (time - item.started_at).clamp(0.0, FALL_DURATION) / FALL_DURATION; let ease = -(f32::consts::FRAC_PI_2 + elapsed * f32::consts::FRAC_PI_2).cos(); let alpha = ease * (item.item.color.color.alpha() as f32 / 255.0); let mut matrix = item.item.matrix; matrix[3][1] = item.item.matrix[3][1] + (-(1.0 - ease) * 300.0); self.display_list.mutate_all( vec![ DisplayListOps::UpdateMatrix { key: item.item.id, matrix, }, DisplayListOps::UpdateAlpha { key: item.item.id, alpha, }, ] .into_iter(), ); item.progress = elapsed; } animating.retain(|v| time - v.started_at < FALL_DURATION); } } pub struct App<L: LibraryLoader> { window: Arc<Window>, surface: wgpu::Surface<'static>, device: wgpu::Device, queue: wgpu::Queue, config: wgpu::SurfaceConfiguration, pub size: winit::dpi::PhysicalSize<u32>, pub adapter_info: wgpu::AdapterInfo, max_texture_size: u32, framebuffer_texture: Option<Texture>, depth_texture: Texture, sample_count: u32, projection: Entity<Projection>, pipelines: RenderingPipelineManager, loader: Rc<L>, colors: Rc<ColorCatalog>, parts: Rc<RefCell<SimplePartsPool>>, model: Option<model::Model<PartAlias>>, animated_model: AnimatedModel, orbit_controller: RefCell<OrbitController>, } impl<L: LibraryLoader> App<L> { pub async fn new( window: Arc<Window>, loader: Rc<L>, colors: Rc<ColorCatalog>, supports_antialiasing: bool, ) -> Result<Self, error::AppCreationError> { let window_size = window.inner_size(); let instance = wgpu::Instance::new(&wgpu::InstanceDescriptor { backends: wgpu::Backends::all(), backend_options: Default::default(), flags: if cfg!(debug_assertions) { wgpu::InstanceFlags::DEBUG | wgpu::InstanceFlags::VALIDATION } else { Default::default() }, memory_budget_thresholds: Default::default(), }); let sample_count = if supports_antialiasing { 4 } else { 1 }; let surface = instance.create_surface(Arc::clone(&window))?; let adapter = wgpu::util::initialize_adapter_from_env_or_default(&instance, Some(&surface)) .await .map_err(|_| error::AppCreationError::NoAdapterFound)?; let adapter_info = adapter.get_info(); let (device, queue, max_texture_size) = ldraw_renderer::util::request_device(&adapter, None).await?; let size = winit::dpi::PhysicalSize { width: min(window_size.width, max_texture_size), height: min(window_size.height, max_texture_size), }; let surface_caps = surface.get_capabilities(&adapter); let surface_format = surface_caps .formats .iter() .copied() .find(|f| f.is_srgb()) .unwrap_or(surface_caps.formats[0]); let config = wgpu::SurfaceConfiguration { usage: wgpu::TextureUsages::RENDER_ATTACHMENT, format: surface_format, width: size.width, height: size.height, present_mode: surface_caps.present_modes[0], alpha_mode: surface_caps.alpha_modes[0], view_formats: vec![surface_format], desired_maximum_frame_latency: 2, }; surface.configure(&device, &config); let framebuffer_texture = if sample_count > 1 { Some(Texture::create_framebuffer( &device, &config, sample_count, Some("Multisample framebuffer"), )) } else { None }; let depth_texture = Texture::create_depth_texture(&device, &config, sample_count, Some("Depth texture")); let mut projection: Entity<Projection> = Projection::new().into(); let orbit_controller = RefCell::new(OrbitController::default()); projection.mutate_all( orbit_controller .borrow_mut() .update(size.width, size.height, None) .into_iter(), ); let pipelines = RenderingPipelineManager::new(&device, &queue, config.format, sample_count); Ok(App { window, surface, device, queue, config, size, adapter_info, max_texture_size, framebuffer_texture, depth_texture, sample_count, projection, pipelines, loader, colors, parts: Rc::new(RefCell::new(SimplePartsPool::default())), model: None, animated_model: AnimatedModel::default(), orbit_controller, }) } pub fn loaded_parts(&self) -> HashSet<PartAlias> { let mut result = HashSet::new(); result.extend(self.parts.borrow().0.keys().cloned()); result } pub async fn set_document<F: Fn(PartAlias, Result<(), ResolutionError>)>( &mut self, cache: Arc<RwLock<PartCache>>, document: &MultipartDocument, on_update: &F, ) -> Result<(), ResolutionError> { let resolution_result = resolve_dependencies_multipart( document, Arc::clone(&cache), &self.colors, &*self.loader, on_update, ) .await; let model = model::Model::from_ldraw_multipart_document( document, &self.colors, Some((&*self.loader, cache)), ) .await; self.parts .borrow_mut() .0 .extend( document .list_dependencies() .into_iter() .filter_map(|alias| { resolution_result.query(&alias, true).map(|(part, local)| { ( alias.clone(), Part::new( &bake_part_from_multipart_document( part, &resolution_result, local, ), &self.device, &self.colors, ), ) }) }), ); let bounding_box = calculate_model_bounding_box(&model, None, &*self.parts.borrow()); let center = bounding_box.center(); self.animated_model = AnimatedModel::from_model(&model, None, &self.colors, true); self.model = Some(model); let mut orbit_controller = self.orbit_controller.borrow_mut(); orbit_controller.camera.look_at = Point3::new(center.x, center.y, center.z); orbit_controller.radius = (bounding_box.len_x() * bounding_box.len_x() + bounding_box.len_y() * bounding_box.len_y() + bounding_box.len_z() * bounding_box.len_z()) .sqrt() * 2.0; Ok(()) } pub fn advance(&mut self, time: f32) { self.animated_model.advance(time); } pub fn animate(&mut self, time: f32) { self.projection.mutate_all( self.orbit_controller .borrow_mut() .update(self.size.width, self.size.height, Some(time)) .into_iter(), ); self.animated_model.animate(time); } pub fn resize(&mut self, new_size: winit::dpi::PhysicalSize<u32>) { if new_size.width > 0 && new_size.height > 0 { let new_size = winit::dpi::PhysicalSize { width: min(new_size.width, self.max_texture_size), height: min(new_size.height, self.max_texture_size), }; self.config.width = new_size.width; self.config.height = new_size.height; self.surface.configure(&self.device, &self.config); self.size = new_size; self.projection.mutate_all( self.orbit_controller .borrow_mut() .update(self.size.width, self.size.height, None) .into_iter(), ); self.framebuffer_texture = if self.sample_count > 1 { Some(Texture::create_framebuffer( &self.device, &self.config, self.sample_count, Some("Multisample framebuffer"), )) } else { None }; self.depth_texture = Texture::create_depth_texture( &self.device, &self.config, self.sample_count, Some("Depth texture"), ); } } pub fn render(&mut self) -> Result<Duration, wgpu::SurfaceError> { let now = Instant::now(); self.projection.update(&self.device, &self.queue); self.animated_model .display_list .update(&self.device, &self.queue); let part_querier = self.parts.borrow(); let output = self.surface.get_current_texture()?; let view = output .texture .create_view(&wgpu::TextureViewDescriptor::default()); let (target_view, resolve_target) = if let Some(texture) = self.framebuffer_texture.as_ref() { (&texture.view, Some(&view)) } else { (&view, None) }; let mut encoder = self .device .create_command_encoder(&wgpu::CommandEncoderDescriptor { label: Some("Command Encoder"), }); { let mut pass = encoder .begin_render_pass(&wgpu::RenderPassDescriptor { label: Some("Main render pass"), color_attachments: &[Some(wgpu::RenderPassColorAttachment { view: target_view, resolve_target, ops: wgpu::Operations { load: wgpu::LoadOp::Clear(wgpu::Color { r: 1.0, g: 1.0, b: 1.0, a: 0.0, }), store: wgpu::StoreOp::Store, }, depth_slice: None, })], depth_stencil_attachment: Some(wgpu::RenderPassDepthStencilAttachment { view: &self.depth_texture.view, depth_ops: Some(wgpu::Operations { load: wgpu::LoadOp::Clear(1.0), store: wgpu::StoreOp::Store, }), stencil_ops: None, }), occlusion_query_set: None, timestamp_writes: None, }) .forget_lifetime(); self.pipelines.render::<_, _>( &mut pass, self.projection.get(), &*part_querier, &self.animated_model.display_list, ); } self.queue.submit(std::iter::once(encoder.finish())); output.present(); Ok(now.elapsed()) } pub fn get_subparts(&self) -> Vec<(GroupId, String)> { if let Some(model) = &self.model { let mut result = model .object_groups .iter() .map(|(k, v)| (*k, v.name.clone())) .collect::<Vec<_>>(); result.sort_by(|a, b| a.1.cmp(&b.1)); result } else { Vec::new() } } pub fn set_render_target(&mut self, group_id: Option<GroupId>) { if let Some(model) = &mut self.model { self.animated_model = AnimatedModel::from_model(model, group_id, &self.colors, false); let bounding_box = calculate_model_bounding_box(model, group_id, &*self.parts.borrow()); let center = bounding_box.center(); let mut orbit_controller = self.orbit_controller.borrow_mut(); orbit_controller.camera.look_at = Point3::new(center.x, center.y, center.z); orbit_controller.radius = (bounding_box.len_x() * bounding_box.len_x() + bounding_box.len_y() * bounding_box.len_y() + bounding_box.len_z() * bounding_box.len_z()) .sqrt() * 2.0; } } pub fn state(&self) -> State { self.animated_model.state } pub fn handle_window_event(&mut self, event: event::WindowEvent, current_time: f32) -> bool { match event { event::WindowEvent::Resized(size) => { self.resize(size); } event::WindowEvent::KeyboardInput { event, .. } => { if event.logical_key == Key::Named(NamedKey::Space) && event.state == event::ElementState::Pressed { self.advance(current_time); } } event::WindowEvent::MouseInput { state, button, .. } => { if button == event::MouseButton::Left { self.orbit_controller .borrow_mut() .on_mouse_press(state == event::ElementState::Pressed); } } event::WindowEvent::MouseWheel { delta, .. } => match delta { event::MouseScrollDelta::LineDelta(_x, y) => { self.orbit_controller.borrow_mut().zoom(y); } event::MouseScrollDelta::PixelDelta(d) => { self.orbit_controller.borrow_mut().zoom(d.y as f32 * 0.5); } }, event::WindowEvent::Touch(touch) => match touch.phase { event::TouchPhase::Started => { self.orbit_controller.borrow_mut().on_mouse_press(true) } event::TouchPhase::Ended | event::TouchPhase::Cancelled => { self.orbit_controller.borrow_mut().on_mouse_press(false) } event::TouchPhase::Moved => self .orbit_controller .borrow_mut() .on_mouse_move(touch.location.x as f32, touch.location.y as f32), }, event::WindowEvent::TouchpadMagnify { delta, .. } => { self.orbit_controller.borrow_mut().zoom(delta as f32); } event::WindowEvent::CursorMoved { position, .. } => { self.orbit_controller .borrow_mut() .on_mouse_move(position.x as f32, position.y as f32); } _ => return false, } true } pub fn request_redraw(&self) { self.window.request_redraw(); } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/tools/viewer/common/src/texture.rs
tools/viewer/common/src/texture.rs
pub struct Texture { _texture: wgpu::Texture, pub view: wgpu::TextureView, _sampler: wgpu::Sampler, } impl Texture { pub const DEPTH_FORMAT: wgpu::TextureFormat = wgpu::TextureFormat::Depth32Float; pub fn create_framebuffer( device: &wgpu::Device, config: &wgpu::SurfaceConfiguration, sample_count: u32, label: Option<&str>, ) -> Self { let extent = wgpu::Extent3d { width: config.width, height: config.height, depth_or_array_layers: 1, }; let texture = device.create_texture(&wgpu::TextureDescriptor { size: extent, mip_level_count: 1, sample_count, dimension: wgpu::TextureDimension::D2, format: config.view_formats[0], usage: wgpu::TextureUsages::RENDER_ATTACHMENT, label, view_formats: &[], }); let view = texture.create_view(&wgpu::TextureViewDescriptor::default()); let sampler = device.create_sampler(&wgpu::SamplerDescriptor { address_mode_u: wgpu::AddressMode::ClampToEdge, address_mode_v: wgpu::AddressMode::ClampToEdge, address_mode_w: wgpu::AddressMode::ClampToEdge, mag_filter: wgpu::FilterMode::Linear, min_filter: wgpu::FilterMode::Linear, mipmap_filter: wgpu::FilterMode::Nearest, compare: Some(wgpu::CompareFunction::LessEqual), lod_min_clamp: 0.0, lod_max_clamp: 100.0, ..Default::default() }); Self { _texture: texture, view, _sampler: sampler, } } pub fn create_depth_texture( device: &wgpu::Device, config: &wgpu::SurfaceConfiguration, sample_count: u32, label: Option<&str>, ) -> Self { let size = wgpu::Extent3d { width: config.width, height: config.height, depth_or_array_layers: 1, }; let texture = device.create_texture(&wgpu::TextureDescriptor { label, size, mip_level_count: 1, sample_count, dimension: wgpu::TextureDimension::D2, format: Self::DEPTH_FORMAT, usage: wgpu::TextureUsages::RENDER_ATTACHMENT, view_formats: &[Self::DEPTH_FORMAT], }); let view = texture.create_view(&wgpu::TextureViewDescriptor::default()); let sampler = device.create_sampler(&wgpu::SamplerDescriptor { address_mode_u: wgpu::AddressMode::ClampToEdge, address_mode_v: wgpu::AddressMode::ClampToEdge, address_mode_w: wgpu::AddressMode::ClampToEdge, mag_filter: wgpu::FilterMode::Linear, min_filter: wgpu::FilterMode::Linear, mipmap_filter: wgpu::FilterMode::Nearest, compare: Some(wgpu::CompareFunction::LessEqual), lod_min_clamp: 0.0, lod_max_clamp: 100.0, ..Default::default() }); Self { _texture: texture, view, _sampler: sampler, } } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/tools/viewer/common/src/error.rs
tools/viewer/common/src/error.rs
use std::{ error::Error, fmt::{Display, Formatter, Result as FmtResult}, }; #[derive(Debug)] pub enum AppCreationError { NoAdapterFound, RequestDeviceError(wgpu::RequestDeviceError), CreateSurfaceError(wgpu::CreateSurfaceError), } impl Display for AppCreationError { fn fmt(&self, f: &mut Formatter) -> FmtResult { match self { Self::NoAdapterFound => { write!(f, "No adapter found.") } Self::RequestDeviceError(e) => { write!(f, "Error requesting device: {}", e) } Self::CreateSurfaceError(e) => { write!(f, "Error creating surface: {}", e) } } } } impl Error for AppCreationError { fn cause(&self) -> Option<&(dyn Error)> { match *self { Self::NoAdapterFound => None, Self::RequestDeviceError(ref e) => Some(e), Self::CreateSurfaceError(ref e) => Some(e), } } } impl From<wgpu::RequestDeviceError> for AppCreationError { fn from(e: wgpu::RequestDeviceError) -> Self { Self::RequestDeviceError(e) } } impl From<wgpu::CreateSurfaceError> for AppCreationError { fn from(e: wgpu::CreateSurfaceError) -> Self { Self::CreateSurfaceError(e) } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/tools/viewer/web/src/lib.rs
tools/viewer/web/src/lib.rs
#![cfg(target_arch = "wasm32")] extern crate console_error_panic_hook; use std::{ cell::RefCell, panic, rc::Rc, sync::{Arc, RwLock}, }; use gloo::events::EventListener; use ldraw::{ document::MultipartDocument, error::ResolutionError, library::{CacheCollectionStrategy, LibraryLoader, PartCache}, parser::parse_multipart_document, resolvers::http::HttpLoader, PartAlias, }; use reqwest::{Client, Url}; use tokio::io::BufReader; use uuid::Uuid; use viewer_common::{App, State}; use wasm_bindgen::{prelude::*, JsCast}; use wasm_bindgen_futures::spawn_local; use web_sys::{ HtmlButtonElement, HtmlCanvasElement, HtmlDivElement, HtmlSelectElement, HtmlTextAreaElement, }; use winit::{ event, event_loop::EventLoop, platform::web::WindowBuilderExtWebSys, window::WindowBuilder, }; // A huge mess. Needs refactoring. const ANTIALIAS: bool = true; fn log(s: &str, error: bool) { let window = web_sys::window().unwrap(); let document = window.document().unwrap(); let console = document.get_element_by_id("console-pane").unwrap(); let node = document.create_element("p").unwrap(); node.set_attribute( "class", match error { false => "log", true => "error", }, ) .unwrap(); node.set_inner_html(s); console.prepend_with_node_1(&node).unwrap(); } fn alert(s: &str) { let window = web_sys::window().unwrap(); window.alert_with_message(s).unwrap(); } macro_rules! console_log { ($($t:tt)*) => (log(&format_args!($($t)*).to_string(), false)) } macro_rules! console_error { ($($t:tt)*) => (alert(&format_args!($($t)*).to_string())) } async fn fetch_raw_data(base_url: &Url, path: &String) -> Option<String> { let client = Client::new(); let url = if path.starts_with("http://") || path.starts_with("https://") { Url::parse(path) } else { base_url.join(path) }; let url = match url { Ok(e) => e, Err(err) => { alert(&format!("Could not build url {}: {}", path, err)); return None; } }; match client.get(url.clone()).send().await { Ok(e) => match e.text().await { Ok(e) => Some(e), Err(err) => { alert(&format!("Could not fetch from url {}: {}", url, err)); None } }, Err(err) => { alert(&format!("Could not make request to {}: {}", url, err)); None } } } fn log_part_resolution(alias: PartAlias, result: Result<(), ResolutionError>) { match result { Ok(_) => { console_log!("Part {} loaded", alias); } Err(err) => { console_error!("Could not load part {}: {}", alias, err); } } } #[wasm_bindgen] #[allow(clippy::await_holding_refcell_ref)] pub async fn run(path: JsValue) -> JsValue { panic::set_hook(Box::new(console_error_panic_hook::hook)); let web_window = web_sys::window().expect("No window exists."); let web_document = web_window.document().expect("No document exists."); let body = web_document.get_element_by_id("body").unwrap(); let canvas = web_document .get_element_by_id("main_canvas") .unwrap() .dyn_into::<HtmlCanvasElement>() .unwrap(); canvas.set_width(body.client_width() as u32); canvas.set_height(body.client_height() as u32); let event_loop = EventLoop::new().unwrap(); let builder = WindowBuilder::new() .with_title("ldraw.rs demo") .with_inner_size(winit::dpi::LogicalSize { width: body.client_width() as u32, height: body.client_height() as u32, }) .with_canvas(Some(canvas)); let window = builder.build(&event_loop).unwrap(); let canvas = web_document .get_element_by_id("main_canvas") .unwrap() .dyn_into::<HtmlCanvasElement>() .unwrap(); let document_view = web_document .get_element_by_id("document") .unwrap() .dyn_into::<HtmlTextAreaElement>() .unwrap(); let mut location = Url::parse(&web_window.location().href().unwrap()).unwrap(); location.set_fragment(None); let loader = Rc::new(HttpLoader::new( Some(location.join("ldraw/").unwrap()), Some(location.clone()), )); let colors = match loader.load_colors().await { Ok(e) => Rc::new(e), Err(err) => { console_error!("Could not open color definitions: {}", err); return JsValue::undefined(); } }; let main_window_id = window.id(); let window = Arc::new(window); let app = match App::new( Arc::clone(&window), Rc::clone(&loader), Rc::clone(&colors), ANTIALIAS, ) .await { Ok(v) => v, Err(e) => { console_error!("Could not initialize the app: {e}"); return JsValue::undefined(); } }; let app = Rc::new(RefCell::new(app)); console_log!("Rendering context initialization done."); let cache = Arc::new(RwLock::new(PartCache::default())); app.borrow_mut().resize(winit::dpi::PhysicalSize { width: canvas.width(), height: canvas.height(), }); let window = web_sys::window().unwrap(); let perf = window.performance().unwrap(); let start_time = perf.now(); { let document_view = document_view.clone(); if path.is_string() { let path = path.as_string().unwrap(); let document_text = match fetch_raw_data(&location, &path).await { Some(v) => v, None => { return JsValue::undefined(); } }; let document = match parse_multipart_document( &mut BufReader::new(document_text.as_bytes()), &colors, ) .await { Ok(v) => v, Err(err) => { console_error!("Could not parse document: {}", err); return JsValue::undefined(); } }; if let Err(err) = app .borrow_mut() .set_document(Arc::clone(&cache), &document, &log_part_resolution) .await { console_error!("Could not load model: {}", err); } cache .write() .unwrap() .collect(CacheCollectionStrategy::Parts); let subparts = web_document.get_element_by_id("subparts").unwrap(); subparts.set_inner_html(""); let body = web_document.create_element("option").unwrap(); body.set_attribute("value", "").unwrap(); body.set_inner_html("Base Model"); subparts.append_child(&body).unwrap(); for (id, name) in app.borrow().get_subparts() { let subpart = web_document.create_element("option").unwrap(); subpart.set_attribute("value", &format!("{}", id)).unwrap(); subpart.set_inner_html(&format!("Subpart {} ({})", name, id)); subparts.append_child(&subpart).unwrap(); } let web_document = web_document.clone(); let app = Rc::clone(&app); let closure = Closure::wrap(Box::new(move |_event: web_sys::Event| { let subparts = web_document.get_element_by_id("subparts").unwrap(); let subparts = JsCast::dyn_ref::<HtmlSelectElement>(&subparts).unwrap(); let value = subparts.value(); app.borrow_mut().set_render_target(if value.is_empty() { None } else { Some(value.parse::<Uuid>().unwrap().into()) }); }) as Box<dyn FnMut(_)>); subparts .add_event_listener_with_callback("change", closure.as_ref().unchecked_ref()) .unwrap(); closure.forget(); document_view.set_value(&document_text); } } let new_doc = Rc::new(RefCell::new(None)); { let document_view = document_view.clone(); let new_doc = Rc::clone(&new_doc); let colors = Rc::clone(&colors); let closure = Closure::wrap(Box::new(move |_event: web_sys::Event| { let document_view = document_view.clone(); let new_doc = Rc::clone(&new_doc); let colors = Rc::clone(&colors); spawn_local(async move { let document_text = document_view.value(); let document = match parse_multipart_document( &mut BufReader::new(document_text.as_bytes()), &colors, ) .await { Ok(v) => v, Err(err) => { console_error!("Could not parse document: {}", err); return; } }; *new_doc.borrow_mut() = Some(document); }); }) as Box<dyn FnMut(_)>); let submit_button = web_document.get_element_by_id("submit").unwrap(); let submit_button = JsCast::dyn_ref::<HtmlButtonElement>(&submit_button).unwrap(); submit_button .add_event_listener_with_callback("click", closure.as_ref().unchecked_ref()) .unwrap(); closure.forget(); } { let window = web_sys::window().unwrap(); let app = Rc::clone(&app); let closure = Closure::wrap(Box::new(move |_event: web_sys::UiEvent| { let app = &mut app.borrow_mut(); canvas.set_width(canvas.client_width() as _); canvas.set_height(canvas.client_height() as _); app.resize(winit::dpi::PhysicalSize { width: canvas.client_width() as _, height: canvas.client_height() as _, }); }) as Box<dyn FnMut(_)>); window .add_event_listener_with_callback("resize", closure.as_ref().unchecked_ref()) .unwrap(); closure.forget(); } { let next_button = web_document.get_element_by_id("next-button").unwrap(); let next_button = JsCast::dyn_ref::<HtmlDivElement>(&next_button).unwrap(); let a = Rc::clone(&app); let closure = EventListener::new(next_button, "click", move |_event| { let window = web_sys::window().unwrap(); let perf = window.performance().unwrap(); a.borrow_mut() .advance(((perf.now() - start_time) / 1000.0) as f32); }); closure.forget(); } { let app = Rc::clone(&app); let new_doc = Rc::clone(&new_doc); let web_document = web_document.clone(); let cache = Arc::clone(&cache); event_loop .run(move |event, target| match event { event::Event::AboutToWait => { app.borrow().request_redraw(); } event::Event::WindowEvent { event, window_id } if window_id == main_window_id => { match event { event::WindowEvent::RedrawRequested => { let mut app_ = app.borrow_mut(); app_.animate(((perf.now() - start_time) / 1000.0) as f32); match app_.render() { Ok(duration) => { let next_button = web_document.get_element_by_id("next-button").unwrap(); let next_button = JsCast::dyn_ref::<HtmlDivElement>(&next_button).unwrap(); if app_.state() == State::Step { next_button.set_class_name("active"); } else { next_button.set_class_name(""); } let stats = web_document.get_element_by_id("stats").unwrap(); let stats = JsCast::dyn_ref::<HtmlDivElement>(&stats).unwrap(); stats.set_inner_html(&format!( "Rendering backend: {}<br />{} msecs", app_.adapter_info.backend.to_str(), duration.as_millis(), )); } Err(wgpu::SurfaceError::Lost | wgpu::SurfaceError::Outdated) => { //app.resize(app.size); } Err(wgpu::SurfaceError::OutOfMemory) => { target.exit(); } Err(wgpu::SurfaceError::Timeout) => { println!("Surface timeout"); } Err(wgpu::SurfaceError::Other) => { println!("Unrecognized surface error"); } } if new_doc.borrow().is_some() { let document = MultipartDocument::clone(new_doc.borrow().as_ref().unwrap()); *new_doc.borrow_mut() = None; let app = Rc::clone(&app); let cache = Arc::clone(&cache); let web_document = web_document.clone(); spawn_local(async move { if let Err(err) = app .borrow_mut() .set_document( Arc::clone(&cache), &document, &log_part_resolution, ) .await { console_error!("Could not reload model: {}", err); }; cache .write() .unwrap() .collect(CacheCollectionStrategy::Parts); let subparts = web_document.get_element_by_id("subparts").unwrap(); subparts.set_inner_html(""); let body = web_document.create_element("option").unwrap(); body.set_attribute("value", "").unwrap(); body.set_inner_html("Base Model"); subparts.append_child(&body).unwrap(); console_log!("{:?}", body); for (id, name) in app.borrow().get_subparts() { let subpart = web_document.create_element("option").unwrap(); subpart.set_attribute("value", &format!("{}", id)).unwrap(); subpart .set_inner_html(&format!("Subpart {} ({})", name, id)); subparts.append_child(&subpart).unwrap(); } }); } } event::WindowEvent::CloseRequested => {} event => { if let Ok(mut app) = app.try_borrow_mut() { app.handle_window_event( event, ((perf.now() - start_time) / 1000.0) as f32, ); } } } } _ => (), }) .unwrap(); } JsValue::undefined() }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/tools/baker/src/main.rs
tools/baker/src/main.rs
use std::{ env, path::{Path, PathBuf}, sync::{Arc, RwLock}, }; use bincode::serialize; use clap::{App, Arg}; use futures::{future::join_all, StreamExt}; use itertools::Itertools; use ldraw::{ color::ColorCatalog, library::{resolve_dependencies_multipart, CacheCollectionStrategy, LibraryLoader, PartCache}, parser::{parse_color_definitions, parse_multipart_document}, resolvers::local::LocalLoader, }; use ldraw_ir::part::bake_part_from_multipart_document; use tokio::{ fs::{self, File}, io::{AsyncWriteExt, BufReader, BufWriter}, task::spawn_blocking, }; use tokio_stream::wrappers::ReadDirStream; #[tokio::main] async fn main() { let matches = App::new("baker") .about("Postprocess LDraw model files") .arg( Arg::with_name("ldraw_dir") .long("ldraw-dir") .value_name("PATH") .takes_value(true) .help("Path to LDraw directory"), ) .arg( Arg::with_name("files") .multiple(true) .takes_value(true) .required(true) .help("Files to process"), ) .arg( Arg::with_name("output_path") .short("o") .long("output-path") .takes_value(true) .help("Output path"), ) .get_matches(); let ldrawdir = match matches.value_of("ldraw_dir") { Some(v) => v.to_string(), None => match env::var("LDRAWDIR") { Ok(v) => v, Err(_) => { panic!("--ldraw-dir option or LDRAWDIR environment variable is required."); } }, }; let output_path = match matches.value_of("output_path") { Some(v) => { let path = Path::new(v); if !path.is_dir() { panic!("{} is not a proper output directory", v); } Some(path) } None => None, }; let ldrawpath = PathBuf::from(&ldrawdir); let colors = parse_color_definitions(&mut BufReader::new( File::open(ldrawpath.join("LDConfig.ldr")) .await .expect("Could not load color definition."), )) .await .expect("Could not parse color definition"); let loader = LocalLoader::new(Some(ldrawpath), None); let mut tasks = vec![]; let cache = Arc::new(RwLock::new(PartCache::new())); if let Some(files) = matches.values_of("files") { for file in files { let path = PathBuf::from(&file); if !fs::try_exists(&path).await.unwrap_or(false) { panic!("Path {} does not exists.", file); } else if path.is_dir() { let mut dir = ReadDirStream::new( fs::read_dir(&path) .await .expect("Could not read directory."), ); while let Some(entry) = dir.next().await { let entry = entry.unwrap(); let path = entry.path(); let ext = path.extension(); if ext.is_none() { continue; } let ext = ext.unwrap().to_str().unwrap().to_string().to_lowercase(); if ext == "dat" || ext == "ldr" { tasks.push(bake( &loader, &colors, Arc::clone(&cache), path, &output_path, )); } } } else { tasks.push(bake( &loader, &colors, Arc::clone(&cache), path, &output_path, )); } } } else { panic!("Required input files are missing."); } let cpus = num_cpus::get(); let tasks = tasks .into_iter() .chunks(cpus) .into_iter() .map(|chunk| chunk.collect()) .collect::<Vec<Vec<_>>>(); for items in tasks { join_all(items).await; } let collected = cache .write() .unwrap() .collect(CacheCollectionStrategy::PartsAndPrimitives); println!("Collected {} entries.", collected); } async fn bake<L: LibraryLoader>( loader: &L, colors: &ColorCatalog, cache: Arc<RwLock<PartCache>>, path: PathBuf, output_path: &Option<&Path>, ) { println!("{}", path.to_str().unwrap()); let file = match File::open(path.clone()).await { Ok(v) => v, Err(err) => { println!( "Could not open document {}: {}", path.to_str().unwrap(), err ); return; } }; let document = match parse_multipart_document(&mut BufReader::new(file), colors).await { Ok(v) => v, Err(err) => { println!( "Could not parse document {}: {}", path.to_str().unwrap(), err ); return; } }; let resolution_result = resolve_dependencies_multipart( &document, Arc::clone(&cache), colors, loader, &|alias, result| { if let Err(err) = result { println!("Could not open file {}: {}", alias, err); } }, ) .await; let part = spawn_blocking(move || { bake_part_from_multipart_document(&document, &resolution_result, false) }) .await .unwrap(); let outpath = match output_path { Some(e) => e.to_path_buf().join(format!( "{}.part", path.file_name().unwrap().to_str().unwrap() )), None => { let mut path_buf = path.to_path_buf(); path_buf.set_extension(match path.extension() { Some(e) => format!("{}.part", e.to_str().unwrap()), None => String::from("part"), }); path_buf } }; match serialize(&part) { Ok(serialized) => match File::create(&outpath).await { Ok(file) => { let mut writer = BufWriter::new(file); writer.write_all(&serialized).await.unwrap(); writer.shutdown().await.unwrap(); } Err(err) => { println!("Could not create {}: {}", outpath.to_str().unwrap(), err); } }, Err(err) => { println!("Could not bake part {}: {}", path.to_str().unwrap(), err); } }; cache .write() .unwrap() .collect(CacheCollectionStrategy::Parts); }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/tools/ldr2img/src/main.rs
tools/ldr2img/src/main.rs
use std::{ collections::HashMap, env, path::{Path, PathBuf}, sync::{Arc, RwLock}, }; use clap::{App, Arg}; use ldraw::{ library::{resolve_dependencies_multipart, PartCache}, parser::{parse_color_definitions, parse_multipart_document}, resolvers::local::LocalLoader, PartAlias, }; use ldraw_ir::{model::Model, part::bake_part_from_multipart_document}; use ldraw_olr::{context::Context, ops::Ops}; use ldraw_renderer::part::{Part, PartQuerier}; use tokio::{fs::File, io::BufReader}; #[tokio::main] async fn main() { let matches = App::new("ldr2img") .about("Render LDraw model into still image") .arg( Arg::with_name("ldraw_dir") .long("ldraw-dir") .value_name("PATH") .takes_value(true) .help("Path to LDraw directory"), ) .arg( Arg::with_name("output") .short("o") .takes_value(true) .help("Output file name"), ) .arg( Arg::with_name("input") .takes_value(true) .required(true) .index(1) .help("Input file name"), ) .arg( Arg::with_name("size") .short("s") .default_value("1024") .takes_value(true) .help("Maximum width/height pixel size"), ) .arg( Arg::with_name("without-multisample") .short("m") .help("Number of samples"), ) .get_matches(); let ldrawdir = match matches.value_of("ldraw_dir") { Some(v) => v.to_string(), None => match env::var("LDRAWDIR") { Ok(v) => v, Err(_) => { panic!("--ldraw-dir option or LDRAWDIR environment variable is required."); } }, }; let ldraw_path = PathBuf::from(&ldrawdir); let size = matches.value_of("size").unwrap().parse::<u32>().unwrap(); let sample_count = if matches.is_present("without-multisample") { 1 } else { 4 }; let mut context = Context::new(size, size, sample_count).await.unwrap(); let colors = parse_color_definitions(&mut BufReader::new( File::open(ldraw_path.join("LDConfig.ldr")).await.unwrap(), )) .await .unwrap(); let input = matches.value_of("input").unwrap(); let output = matches.value_of("output").unwrap_or("image.png"); let document = parse_multipart_document( &mut BufReader::new(File::open(&input).await.unwrap()), &colors, ) .await .unwrap(); let input_path = PathBuf::from(input); let loader = LocalLoader::new( Some(ldraw_path), Some(PathBuf::from(input_path.parent().unwrap())), ); let cache = Arc::new(RwLock::new(PartCache::new())); let resolution_result = resolve_dependencies_multipart(&document, Arc::clone(&cache), &colors, &loader, &|_, _| {}) .await; struct PartsPoolImpl(HashMap<PartAlias, Part>); impl PartQuerier<PartAlias> for PartsPoolImpl { fn get(&self, key: &PartAlias) -> Option<&Part> { self.0.get(key) } } let parts = document .list_dependencies() .into_iter() .filter_map(|alias| { resolution_result.query(&alias, true).map(|(part, local)| { ( alias.clone(), Part::new( &bake_part_from_multipart_document(part, &resolution_result, local), &context.device, &colors, ), ) }) }) .collect::<HashMap<_, _>>(); let parts = PartsPoolImpl(parts); let model = Model::from_ldraw_multipart_document(&document, &colors, Some((&loader, cache))).await; let image = { let ops = Ops::new(&mut context); ops.render_model(&model, None, &parts, &colors).await }; image.save(&Path::new(output)).unwrap(); }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ir/src/lib.rs
ir/src/lib.rs
use std::{ cmp::Ordering, fmt, hash::{Hash, Hasher}, }; use ldraw::color::{ColorCatalog, ColorReference}; use serde::{ de::{Deserializer, Error as DeError, Unexpected, Visitor}, ser::Serializer, Deserialize, Serialize, }; pub mod constraints; pub mod geometry; pub mod model; pub mod part; #[derive(Clone, Debug)] pub struct MeshGroupKey { pub color_ref: ColorReference, pub bfc: bool, } impl Serialize for MeshGroupKey { fn serialize<S: Serializer>(&self, serializer: S) -> Result<S::Ok, S::Error> { if self.bfc { serializer.serialize_str(&self.color_ref.code().to_string()) } else { serializer.serialize_str(&format!("!{}", self.color_ref.code())) } } } impl<'de> Deserialize<'de> for MeshGroupKey { fn deserialize<D: Deserializer<'de>>(deserializer: D) -> Result<Self, D::Error> { struct MeshGroupVisitor; impl<'de> Visitor<'de> for MeshGroupVisitor { type Value = MeshGroupKey; fn expecting(&self, formatter: &mut fmt::Formatter) -> fmt::Result { formatter.write_str( "a string with number in it and optional exclamation mark preceding to it", ) } fn visit_str<E: DeError>(self, value: &str) -> Result<Self::Value, E> { let (slice, bfc) = if let Some(stripped) = value.strip_prefix('!') { (stripped, false) } else { (value, true) }; match slice.parse::<u32>() { Ok(v) => Ok(MeshGroupKey { color_ref: ColorReference::Unknown(v), bfc, }), Err(_) => Err(DeError::invalid_value( Unexpected::Str(value), &"a string with number in it and optional exclamation mark preceding to it", )), } } } deserializer.deserialize_str(MeshGroupVisitor) } } impl MeshGroupKey { pub fn resolve_color(&mut self, colors: &ColorCatalog) { self.color_ref.resolve_self(colors); } } impl Hash for MeshGroupKey { fn hash<H: Hasher>(&self, state: &mut H) { self.color_ref.code().hash(state); self.bfc.hash(state); } } impl PartialOrd for MeshGroupKey { fn partial_cmp(&self, other: &MeshGroupKey) -> Option<Ordering> { Some(self.cmp(other)) } } impl Ord for MeshGroupKey { fn cmp(&self, other: &MeshGroupKey) -> Ordering { let lhs_translucent = match &self.color_ref { ColorReference::Color(c) => c.is_translucent(), _ => false, }; let rhs_translucent = match &other.color_ref { ColorReference::Color(c) => c.is_translucent(), _ => false, }; match (lhs_translucent, rhs_translucent) { (true, false) => return Ordering::Greater, (false, true) => return Ordering::Less, (_, _) => (), }; match self.color_ref.code().cmp(&other.color_ref.code()) { Ordering::Equal => self.bfc.cmp(&other.bfc), e => e, } } } impl Eq for MeshGroupKey {} impl PartialEq for MeshGroupKey { fn eq(&self, other: &MeshGroupKey) -> bool { self.color_ref.code() == other.color_ref.code() && self.bfc == other.bfc } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ir/src/geometry.rs
ir/src/geometry.rs
use ldraw::{Matrix4, Vector2, Vector3}; use serde::{Deserialize, Serialize}; #[derive(Clone, Debug, Deserialize, Serialize)] pub struct BoundingBox2 { pub min: Vector2, pub max: Vector2, } impl BoundingBox2 { pub fn nil() -> Self { BoundingBox2 { min: Vector2::new(0.0, 0.0), max: Vector2::new(0.0, 0.0), } } pub fn new(a: &Vector2, b: &Vector2) -> Self { let (min_x, max_x) = if a.x > b.x { (b.x, a.x) } else { (a.x, b.x) }; let (min_y, max_y) = if a.y > b.y { (b.y, a.y) } else { (a.y, b.y) }; Self { min: Vector2::new(min_x, min_y), max: Vector2::new(max_x, max_y), } } pub fn new_xywh(x: f32, y: f32, w: f32, h: f32) -> Self { Self { min: Vector2::new(x, y), max: Vector2::new(x + w, y + h), } } pub fn len_x(&self) -> f32 { self.max.x - self.min.x } pub fn len_y(&self) -> f32 { self.max.y - self.min.y } pub fn is_null(&self) -> bool { self.min.x == 0.0 && self.min.y == 0.0 && self.max.x == 0.0 && self.max.y == 0.0 } pub fn update_point(&mut self, v: &Vector2) { if self.is_null() { self.min = *v; self.max = *v; } else { if self.min.x > v.x { self.min.x = v.x; } if self.min.y > v.y { self.min.y = v.y; } if self.max.x < v.x { self.max.x = v.x; } if self.max.y < v.y { self.max.y = v.y; } } } pub fn update(&mut self, bb: &BoundingBox2) { self.update_point(&bb.min); self.update_point(&bb.max); } pub fn center(&self) -> Vector2 { (self.min + self.max) * 0.5 } pub fn points(&self) -> [Vector2; 4] { [ Vector2::new(self.min.x, self.min.y), Vector2::new(self.min.x, self.max.y), Vector2::new(self.max.x, self.min.y), Vector2::new(self.max.x, self.max.y), ] } pub fn intersects(&self, other: &Self) -> bool { self.min.x < other.max.x && self.max.x > other.min.x && self.min.y < other.max.y && self.max.y > other.min.y } } impl Default for BoundingBox2 { fn default() -> Self { Self::nil() } } #[derive(Clone, Debug, Deserialize, Serialize)] pub struct BoundingBox3 { pub min: Vector3, pub max: Vector3, null: bool, } impl BoundingBox3 { pub fn nil() -> Self { BoundingBox3 { min: Vector3::new(0.0, 0.0, 0.0), max: Vector3::new(0.0, 0.0, 0.0), null: true, } } pub fn new(a: &Vector3, b: &Vector3) -> Self { let (min_x, max_x) = if a.x > b.x { (b.x, a.x) } else { (a.x, b.x) }; let (min_y, max_y) = if a.y > b.y { (b.y, a.y) } else { (a.y, b.y) }; let (min_z, max_z) = if a.z > b.z { (b.z, a.z) } else { (a.z, b.z) }; BoundingBox3 { min: Vector3::new(min_x, min_y, min_z), max: Vector3::new(max_x, max_y, max_z), null: false, } } pub fn transform(&self, matrix: &Matrix4) -> Self { let mut bb = BoundingBox3::nil(); for vertex in self.points() { let translated = matrix * vertex.extend(1.0); bb.update_point(&translated.truncate()) } bb } pub fn project(&self, matrix: &Matrix4) -> BoundingBox2 { let mut bb = BoundingBox2::nil(); for vertex in self.points() { let translated = matrix * vertex.extend(1.0); bb.update_point(&Vector2::new( translated.x / translated.w, translated.y / translated.w, )); } bb } pub fn len_x(&self) -> f32 { if self.null { 0.0 } else { self.max.x - self.min.x } } pub fn len_y(&self) -> f32 { if self.null { 0.0 } else { self.max.y - self.min.y } } pub fn len_z(&self) -> f32 { if self.null { 0.0 } else { self.max.z - self.min.z } } pub fn len(&self) -> f32 { (self.len_x().powi(2) + self.len_y().powi(2) + self.len_z().powi(2)).sqrt() } pub fn is_null(&self) -> bool { self.null } pub fn update_point(&mut self, v: &Vector3) { if self.null { self.min = *v; self.max = *v; self.null = false; } else { if self.min.x > v.x { self.min.x = v.x; } if self.min.y > v.y { self.min.y = v.y; } if self.min.z > v.z { self.min.z = v.z; } if self.max.x < v.x { self.max.x = v.x; } if self.max.y < v.y { self.max.y = v.y; } if self.max.z < v.z { self.max.z = v.z; } } } pub fn update(&mut self, bb: &BoundingBox3) { self.update_point(&bb.min); self.update_point(&bb.max); } pub fn center(&self) -> Vector3 { if self.null { Vector3::new(0.0, 0.0, 0.0) } else { (self.min + self.max) * 0.5 } } pub fn points(&self) -> [Vector3; 8] { [ Vector3::new(self.min.x, self.min.y, self.min.z), Vector3::new(self.min.x, self.min.y, self.max.z), Vector3::new(self.min.x, self.max.y, self.min.z), Vector3::new(self.min.x, self.max.y, self.max.z), Vector3::new(self.max.x, self.min.y, self.min.z), Vector3::new(self.max.x, self.min.y, self.max.z), Vector3::new(self.max.x, self.max.y, self.min.z), Vector3::new(self.max.x, self.max.y, self.max.z), ] } } impl Default for BoundingBox3 { fn default() -> Self { Self::nil() } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ir/src/model.rs
ir/src/model.rs
use std::{ collections::{HashMap, HashSet}, fmt, hash::Hash, sync::{Arc, RwLock}, vec::Vec, }; use cgmath::SquareMatrix; use ldraw::{ color::{ColorCatalog, ColorReference}, document::{Document as LdrawDocument, MultipartDocument as LdrawMultipartDocument}, elements::{Command, Meta}, library::{resolve_dependencies, LibraryLoader, PartCache, ResolutionResult}, Matrix4, PartAlias, Vector3, }; use serde::{Deserialize, Serialize}; use uuid::Uuid; use crate::{ geometry::BoundingBox3, part::{ bake_part_from_document, bake_part_from_multipart_document, Part, PartDimensionQuerier, }, }; #[derive(Copy, Clone, Debug, Hash, Eq, PartialEq, Deserialize, Serialize)] pub struct ObjectId(Uuid); impl From<Uuid> for ObjectId { fn from(value: Uuid) -> Self { Self(value) } } impl From<ObjectId> for Uuid { fn from(value: ObjectId) -> Self { value.0 } } impl fmt::Display for ObjectId { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { write!(f, "{}", self.0) } } #[derive(Copy, Clone, Debug, Hash, Eq, PartialEq, Deserialize, Serialize)] pub struct GroupId(Uuid); impl From<Uuid> for GroupId { fn from(value: Uuid) -> Self { Self(value) } } impl From<GroupId> for Uuid { fn from(value: GroupId) -> Self { value.0 } } impl fmt::Display for GroupId { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { write!(f, "{}", self.0) } } #[derive(Clone, Debug, Deserialize, Serialize)] pub enum ObjectInstance<P> { Part(PartInstance<P>), PartGroup(PartGroupInstance), Step, Annotation(Annotation), } #[derive(Clone, Debug, Deserialize, Serialize)] pub struct Object<P> { pub id: ObjectId, pub data: ObjectInstance<P>, } #[derive(Clone, Debug, Deserialize, Serialize)] pub struct PartInstance<P> { pub matrix: Matrix4, pub color: ColorReference, pub part: P, } #[derive(Clone, Debug, Deserialize, Serialize)] pub struct PartGroupInstance { pub matrix: Matrix4, pub color: ColorReference, pub group_id: GroupId, } #[derive(Clone, Debug, Deserialize, Serialize)] pub struct Annotation { pub position: Vector3, pub body: String, } #[derive(Clone, Debug, Deserialize, Serialize)] pub struct ObjectGroup<P> { pub id: GroupId, pub name: String, pub objects: Vec<Object<P>>, pub pivot: Vector3, } impl<P> ObjectGroup<P> { pub fn new(id: GroupId, name: String, pivot: Option<Vector3>) -> Self { Self { id, name, objects: Vec::new(), pivot: pivot.unwrap_or_else(|| Vector3::new(0.0, 0.0, 0.0)), } } } #[derive(Clone, Debug, Serialize, Deserialize)] pub struct Model<P: Clone + Eq + PartialEq + Hash> { pub object_groups: HashMap<GroupId, ObjectGroup<P>>, pub objects: Vec<Object<P>>, pub embedded_parts: HashMap<P, Part>, } impl<P: Clone + Eq + PartialEq + Hash> Default for Model<P> { fn default() -> Self { Self { object_groups: HashMap::new(), objects: Vec::new(), embedded_parts: HashMap::new(), } } } fn build_objects<P: Clone + Eq + PartialEq + Hash + From<PartAlias>>( document: &LdrawDocument, subparts: Option<&HashMap<P, GroupId>>, ) -> Vec<Object<P>> { document .commands .iter() .filter_map(|cmd| { let data = match cmd { Command::PartReference(r) => match subparts { Some(subparts) => match subparts.get(&r.name.clone().into()) { Some(e) => Some(ObjectInstance::PartGroup(PartGroupInstance { matrix: r.matrix, color: r.color.clone(), group_id: *e, })), None => Some(ObjectInstance::Part(PartInstance { matrix: r.matrix, color: r.color.clone(), part: r.name.clone().into(), })), }, None => Some(ObjectInstance::Part(PartInstance { matrix: r.matrix, color: r.color.clone(), part: r.name.clone().into(), })), }, Command::Meta(Meta::Step) => Some(ObjectInstance::Step), _ => None, }; data.map(|v| Object { id: Uuid::new_v4().into(), data: v, }) }) .collect::<Vec<_>>() } fn resolve_colors<P>(objects: &mut [Object<P>], colors: &ColorCatalog) { for object in objects.iter_mut() { match &mut object.data { ObjectInstance::Part(ref mut p) => { p.color.resolve_self(colors); } ObjectInstance::PartGroup(ref mut pg) => { pg.color.resolve_self(colors); } _ => {} } } } fn extract_document_primitives<P: From<PartAlias>>( document: &LdrawDocument, ) -> Option<(P, Part, Object<P>)> { if document.has_primitives() { let name = &document.name; let prims = LdrawDocument { name: name.clone(), description: document.description.clone(), author: document.author.clone(), bfc: document.bfc.clone(), headers: document.headers.clone(), commands: document .commands .iter() .filter_map(|e| match e { Command::Line(_) | Command::Triangle(_) | Command::Quad(_) | Command::OptionalLine(_) => Some(e.clone()), _ => None, }) .collect::<Vec<_>>(), }; let prims = LdrawMultipartDocument { body: prims, subparts: HashMap::new(), }; let part = bake_part_from_multipart_document(&prims, &ResolutionResult::default(), true); let object = Object { id: Uuid::new_v4().into(), data: ObjectInstance::Part(PartInstance { matrix: Matrix4::identity(), color: ColorReference::Current, part: PartAlias::from(name.clone()).into(), }), }; Some((PartAlias::from(name.clone()).into(), part, object)) } else { None } } impl<P: Eq + PartialEq + Hash + Clone + From<PartAlias>> Model<P> { pub fn from_ldraw_multipart_document_sync(document: &LdrawMultipartDocument) -> Self { let subparts = document .subparts .keys() .map(|alias| (alias.clone().into(), Uuid::new_v4().into())) .collect::<HashMap<_, _>>(); let mut embedded_parts: HashMap<P, Part> = HashMap::new(); let mut object_groups = HashMap::new(); for (alias, subpart) in document.subparts.iter() { let converted_alias = alias.clone().into(); if !embedded_parts.contains_key(&converted_alias) { let id = *subparts.get(&converted_alias).unwrap(); object_groups.insert( id, ObjectGroup { id, name: subpart.name.clone(), objects: build_objects::<P>(subpart, Some(&subparts)), pivot: Vector3::new(0.0, 0.0, 0.0), }, ); } } let mut objects = build_objects::<P>(&document.body, Some(&subparts)); if let Some((alias, part, object)) = extract_document_primitives::<P>(&document.body) { embedded_parts.insert(alias.clone(), part); objects.push(object); } Model { object_groups, objects, embedded_parts: HashMap::new(), } } pub async fn from_ldraw_multipart_document<L: LibraryLoader>( document: &LdrawMultipartDocument, colors: &ColorCatalog, inline_loader: Option<(&L, Arc<RwLock<PartCache>>)>, ) -> Self { let subparts = document .subparts .keys() .map(|alias| (alias.clone().into(), GroupId::from(Uuid::new_v4()))) .collect::<HashMap<_, _>>(); let mut embedded_parts: HashMap<P, Part> = HashMap::new(); if let Some((loader, cache)) = inline_loader { for (alias, subpart) in document.subparts.iter() { if subpart.has_primitives() { let resolution_result = resolve_dependencies( subpart, Arc::clone(&cache), colors, loader, &|_, _| {}, ) .await; let part = bake_part_from_document(subpart, &resolution_result, true); embedded_parts.insert(alias.clone().into(), part); } } } let mut object_groups = HashMap::new(); for (alias, subpart) in document.subparts.iter() { let converted_alias = alias.clone().into(); if !embedded_parts.contains_key(&converted_alias) { let id = *subparts.get(&converted_alias).unwrap(); object_groups.insert( id, ObjectGroup { id, name: subpart.name.clone(), objects: build_objects::<P>(subpart, Some(&subparts)), pivot: Vector3::new(0.0, 0.0, 0.0), }, ); } } let mut objects = build_objects::<P>(&document.body, Some(&subparts)); if let Some((alias, part, object)) = extract_document_primitives::<P>(&document.body) { embedded_parts.insert(alias.clone(), part); objects.push(object); } Model { object_groups, objects, embedded_parts, } } pub fn from_ldraw_document(document: &LdrawDocument) -> Self { let mut embedded_parts = HashMap::new(); let mut objects = build_objects(document, None); if let Some((alias, part, object)) = extract_document_primitives::<P>(document) { embedded_parts.insert(alias.clone(), part); objects.push(object); } Model { object_groups: HashMap::new(), objects, embedded_parts, } } pub fn resolve_colors(&mut self, colors: &ColorCatalog) { resolve_colors(&mut self.objects, colors); for group in self.object_groups.values_mut() { resolve_colors(&mut group.objects, colors); } } fn build_dependencies(&self, deps: &mut HashSet<P>, objects: &[Object<P>]) { for object in objects.iter() { match &object.data { ObjectInstance::Part(p) => { if !deps.contains(&p.part) { deps.insert(p.part.clone()); } } ObjectInstance::PartGroup(pg) => { if let Some(pg) = self.object_groups.get(&pg.group_id) { self.build_dependencies(deps, &pg.objects); } } _ => {} } } } pub fn list_dependencies(&self) -> HashSet<P> { let mut dependencies = HashSet::new(); self.build_dependencies(&mut dependencies, &self.objects); dependencies } fn calculate_bounding_box_recursive( &self, bounding_box: &mut BoundingBox3, matrix: Matrix4, objects: &[Object<P>], mut complete: bool, querier: &impl PartDimensionQuerier<P>, ) -> bool { for item in objects.iter() { match &item.data { ObjectInstance::Part(part) => { if let Some(dim) = querier.query_part_dimension(&part.part) { bounding_box.update(&dim.transform(&(matrix * part.matrix))); } else { complete = false; } } ObjectInstance::PartGroup(pg) => { if let Some(group) = self.object_groups.get(&pg.group_id) { self.calculate_bounding_box_recursive( bounding_box, matrix * pg.matrix, &group.objects, complete, querier, ); } } _ => {} } } complete } pub fn calculate_bounding_box( &self, group_id: Option<GroupId>, querier: &impl PartDimensionQuerier<P>, ) -> Option<(BoundingBox3, bool)> { let objects = if let Some(group_id) = group_id { &self.object_groups.get(&group_id)?.objects } else { &self.objects }; let matrix = Matrix4::identity(); let mut bounding_box = BoundingBox3::nil(); let complete = self.calculate_bounding_box_recursive( &mut bounding_box, matrix, objects, true, querier, ); Some((bounding_box, complete)) } pub fn get_objects( &self, group_id: Option<GroupId>, ) -> Option<impl Iterator<Item = &Object<P>>> { match group_id { Some(group_id) => self .object_groups .get(&group_id) .map(|groups| groups.objects.iter()), None => Some(self.objects.iter()), } } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ir/src/part.rs
ir/src/part.rs
use std::{ cell::RefCell, collections::HashMap, f32, fmt::Debug, ops::Deref, rc::Rc, sync::Arc, vec::Vec, }; use cgmath::{AbsDiffEq, InnerSpace, Rad, SquareMatrix}; use kdtree::{distance::squared_euclidean, KdTree}; use ldraw::{ color::{ColorCatalog, ColorReference}, document::{Document, MultipartDocument}, elements::{BfcStatement, Command, Meta}, library::ResolutionResult, Matrix4, Vector3, Winding, }; use serde::{Deserialize, Serialize}; use crate::{geometry::BoundingBox3, MeshGroupKey}; const NORMAL_BLEND_THRESHOLD: Rad<f32> = Rad(f32::consts::FRAC_PI_6); #[derive(Clone, Debug, Default, Serialize, Deserialize)] pub struct VertexBuffer(pub Vec<f32>); impl VertexBuffer { pub fn check_range(&self, range: &std::ops::Range<usize>) -> bool { self.0.len() >= range.end } } pub struct VertexBufferBuilder { vertices: Vec<Vector3>, index_table: KdTree<f32, u32, [f32; 3]>, current_index: u32, } impl Default for VertexBufferBuilder { fn default() -> Self { Self { vertices: Default::default(), index_table: KdTree::new(3), current_index: 0, } } } impl VertexBufferBuilder { pub fn add(&mut self, vertex: Vector3) -> u32 { let vertex_ref: &[f32; 3] = vertex.as_ref(); if let Ok(entries) = self.index_table.nearest(vertex_ref, 1, &squared_euclidean) { if let Some((dist, index)) = entries.first() { if dist < &f32::default_epsilon() { return **index; } } } let index = self.current_index; match self.index_table.add(*vertex_ref, index) { Ok(_) => { self.vertices.push(vertex); self.current_index += 1; index } Err(e) => { panic!("Error adding vertex to vertex buffer: {vertex_ref:?} {e}"); } } } pub fn add_all(&mut self, vertices: impl Iterator<Item = Vector3>) -> Vec<u32> { let mut result = vec![]; for vertex in vertices { result.push(self.add(vertex)); } result } pub fn build(self) -> VertexBuffer { let mut result = Vec::new(); for vertex in self.vertices.iter() { let vertex: &[f32; 3] = vertex.as_ref(); result.extend(vertex); } VertexBuffer(result) } } #[derive(Clone, Debug, Default, Serialize, Deserialize)] pub struct MeshBuffer { pub vertex_indices: Vec<u32>, pub normal_indices: Vec<u32>, } impl MeshBuffer { pub fn len(&self) -> usize { self.vertex_indices.len() } pub fn is_empty(&self) -> bool { self.vertex_indices.is_empty() } pub fn is_valid(&self) -> bool { self.vertex_indices.len() == self.normal_indices.len() } pub fn add( &mut self, vertex_buffer: &mut VertexBufferBuilder, vertex: Vector3, normal: Vector3, ) { self.vertex_indices.push(vertex_buffer.add(vertex)); self.normal_indices.push(vertex_buffer.add(normal)); } pub fn add_indices(&mut self, vertex_indices: Vec<u32>, normal_indices: Vec<u32>) { self.vertex_indices.extend(vertex_indices); self.normal_indices.extend(normal_indices); } } #[derive(Clone, Debug, Default, Serialize, Deserialize)] pub struct EdgeBuffer { pub vertex_indices: Vec<u32>, pub colors: Vec<u32>, } impl EdgeBuffer { pub fn add( &mut self, vertex_buffer: &mut VertexBufferBuilder, vec: Vector3, color: &ColorReference, top: &ColorReference, ) { self.vertex_indices.push(vertex_buffer.add(vec)); let code = if color.is_current() { if let Some(c) = top.get_color() { 2 << 31 | c.code } else { 2 << 30 } } else if color.is_complement() { if let Some(c) = top.get_color() { c.code } else { 2 << 29 } } else if let Some(c) = color.get_color() { 2 << 31 | c.code } else { 0 }; self.colors.push(code); } pub fn len(&self) -> usize { self.vertex_indices.len() } pub fn is_empty(&self) -> bool { self.vertex_indices.is_empty() } pub fn is_valid(&self) -> bool { self.vertex_indices.len() == self.colors.len() } } #[derive(Clone, Debug, Default, Serialize, Deserialize)] pub struct OptionalEdgeBuffer { pub vertex_indices: Vec<u32>, pub control_1_indices: Vec<u32>, pub control_2_indices: Vec<u32>, pub direction_indices: Vec<u32>, pub colors: Vec<u32>, } impl OptionalEdgeBuffer { #[allow(clippy::too_many_arguments)] pub fn add( &mut self, vertex_buffer: &mut VertexBufferBuilder, v1: Vector3, v2: Vector3, c1: Vector3, c2: Vector3, color: &ColorReference, top: &ColorReference, ) { let d = v2 - v1; self.vertex_indices.push(vertex_buffer.add(v1)); self.vertex_indices.push(vertex_buffer.add(v2)); self.control_1_indices.push(vertex_buffer.add(c1)); self.control_1_indices.push(vertex_buffer.add(c1)); self.control_2_indices.push(vertex_buffer.add(c2)); self.control_2_indices.push(vertex_buffer.add(c2)); self.direction_indices.push(vertex_buffer.add(d)); self.direction_indices.push(vertex_buffer.add(d)); let code = if color.is_current() { if let Some(c) = top.get_color() { 2 << 31 | c.code } else { 2 << 30 } } else if color.is_complement() { if let Some(c) = top.get_color() { c.code } else { 2 << 29 } } else if let Some(c) = color.get_color() { 2 << 31 | c.code } else { 0 }; self.colors.push(code); self.colors.push(code); } pub fn len(&self) -> usize { self.vertex_indices.len() } pub fn is_empty(&self) -> bool { self.vertex_indices.is_empty() } pub fn is_valid(&self) -> bool { self.vertex_indices.len() == self.control_1_indices.len() && self.vertex_indices.len() == self.control_2_indices.len() && self.vertex_indices.len() == self.direction_indices.len() && self.vertex_indices.len() == self.colors.len() } } #[derive(Clone, Debug, Default, Serialize, Deserialize)] pub struct PartBufferBundle { pub vertex_buffer: VertexBuffer, pub uncolored_mesh: MeshBuffer, pub uncolored_without_bfc_mesh: MeshBuffer, pub colored_meshes: HashMap<MeshGroupKey, MeshBuffer>, pub edges: EdgeBuffer, pub optional_edges: OptionalEdgeBuffer, } #[derive(Default)] pub struct PartBufferBundleBuilder { pub vertex_buffer_builder: VertexBufferBuilder, uncolored_mesh: MeshBuffer, uncolored_without_bfc_mesh: MeshBuffer, colored_meshes: HashMap<MeshGroupKey, MeshBuffer>, edges: EdgeBuffer, optional_edges: OptionalEdgeBuffer, } impl PartBufferBundleBuilder { fn query_mesh<'a>(&'a mut self, group: &MeshGroupKey) -> Option<&'a mut MeshBuffer> { match (&group.color_ref, group.bfc) { (ColorReference::Current | ColorReference::Complement, true) => { Some(&mut self.uncolored_mesh) } (ColorReference::Current | ColorReference::Complement, false) => { Some(&mut self.uncolored_without_bfc_mesh) } (ColorReference::Color(_), _) => { Some(self.colored_meshes.entry(group.clone()).or_default()) } _ => None, } } pub fn build(self) -> PartBufferBundle { PartBufferBundle { vertex_buffer: self.vertex_buffer_builder.build(), uncolored_mesh: self.uncolored_mesh, uncolored_without_bfc_mesh: self.uncolored_without_bfc_mesh, colored_meshes: self.colored_meshes, edges: self.edges, optional_edges: self.optional_edges, } } } #[derive(Clone, Debug, Serialize, Deserialize)] pub struct PartMetadata { pub name: String, pub description: String, pub author: String, pub extras: HashMap<String, String>, } impl From<&Document> for PartMetadata { fn from(document: &Document) -> PartMetadata { PartMetadata { name: document.name.clone(), description: document.description.clone(), author: document.author.clone(), extras: HashMap::new(), } } } #[derive(Clone, Debug, Serialize, Deserialize)] pub struct Part { pub metadata: PartMetadata, pub geometry: PartBufferBundle, pub bounding_box: BoundingBox3, pub rotation_center: Vector3, } impl Part { pub fn new( metadata: PartMetadata, geometry: PartBufferBundle, bounding_box: BoundingBox3, rotation_center: Vector3, ) -> Self { Part { metadata, geometry, bounding_box, rotation_center, } } // FIXME: deprecate this pub fn resolve_colors(&mut self, colors: &ColorCatalog) { let colored_meshes = std::mem::take(&mut self.geometry.colored_meshes); self.geometry.colored_meshes = colored_meshes .into_iter() .map(|(k, v)| { let color_ref = match k.color_ref { ColorReference::Unresolved(v) => ColorReference::resolve(v, colors), ColorReference::Unknown(v) => ColorReference::resolve(v, colors), _ => k.color_ref.clone(), }; ( MeshGroupKey { color_ref, bfc: k.bfc, }, v, ) }) .collect(); } } #[derive(Clone, Debug, PartialEq)] struct FaceVertex { position: Vector3, normal: Vector3, } #[derive(Clone, Debug, PartialEq)] enum FaceVertices { Triangle([FaceVertex; 3]), Quad([FaceVertex; 4]), } impl AbsDiffEq for FaceVertices { type Epsilon = f32; fn default_epsilon() -> Self::Epsilon { f32::default_epsilon() } fn abs_diff_eq(&self, other: &Self, epsilon: Self::Epsilon) -> bool { match (self, other) { (FaceVertices::Triangle(lhs), FaceVertices::Triangle(rhs)) => { lhs[0].position.abs_diff_eq(&rhs[0].position, epsilon) && lhs[1].position.abs_diff_eq(&rhs[1].position, epsilon) && lhs[2].position.abs_diff_eq(&rhs[2].position, epsilon) } (FaceVertices::Quad(lhs), FaceVertices::Quad(rhs)) => { lhs[0].position.abs_diff_eq(&rhs[0].position, epsilon) && lhs[1].position.abs_diff_eq(&rhs[1].position, epsilon) && lhs[2].position.abs_diff_eq(&rhs[2].position, epsilon) && lhs[3].position.abs_diff_eq(&rhs[3].position, epsilon) } (_, _) => false, } } } const TRIANGLE_INDEX_ORDER: &[usize] = &[0, 1, 2]; const QUAD_INDEX_ORDER: &[usize] = &[0, 1, 2, 2, 3, 0]; struct FaceIterator<'a> { face: &'a FaceVertices, iterator: Box<dyn Iterator<Item = &'static usize>>, } impl<'a> Iterator for FaceIterator<'a> { type Item = &'a FaceVertex; fn next(&mut self) -> Option<Self::Item> { match self.iterator.next() { Some(e) => Some(match self.face { FaceVertices::Triangle(v) => &v[*e], FaceVertices::Quad(v) => &v[*e], }), None => None, } } } impl FaceVertices { pub fn triangles(&self, reverse: bool) -> FaceIterator { let order = match self { FaceVertices::Triangle(_) => TRIANGLE_INDEX_ORDER, FaceVertices::Quad(_) => QUAD_INDEX_ORDER, }; let iterator: Box<dyn Iterator<Item = &'static usize>> = if reverse { Box::new(order.iter().rev()) } else { Box::new(order.iter()) }; FaceIterator { face: self, iterator, } } pub fn query(&self, index: usize) -> &FaceVertex { match self { FaceVertices::Triangle(a) => &a[TRIANGLE_INDEX_ORDER[index]], FaceVertices::Quad(a) => &a[QUAD_INDEX_ORDER[index]], } } pub fn query_mut(&mut self, index: usize) -> &mut FaceVertex { match self { FaceVertices::Triangle(a) => a.get_mut(TRIANGLE_INDEX_ORDER[index]).unwrap(), FaceVertices::Quad(a) => a.get_mut(QUAD_INDEX_ORDER[index]).unwrap(), } } } #[derive(Clone, Debug, PartialEq)] struct Face { vertices: FaceVertices, winding: Winding, } #[derive(Debug)] struct Adjacency { pub faces: Vec<(Rc<RefCell<Face>>, usize)>, } impl Adjacency { pub fn new() -> Adjacency { Adjacency { faces: Vec::new() } } pub fn add(&mut self, face: Rc<RefCell<Face>>, index: usize) { self.faces.push((Rc::clone(&face), index)); } } fn calculate_normal(v1: &Vector3, v2: &Vector3, v3: &Vector3) -> Vector3 { let normal = (v2 - v3).cross(v2 - v1).normalize(); if normal.x.is_nan() || normal.y.is_nan() || normal.z.is_nan() { Vector3::new(0.0, 0.0, 0.0) } else { normal } } #[derive(Debug)] struct MeshBuilder { pub faces: HashMap<MeshGroupKey, Vec<Rc<RefCell<Face>>>>, adjacencies: Vec<Rc<RefCell<Adjacency>>>, point_cloud: KdTree<f32, Rc<RefCell<Adjacency>>, [f32; 3]>, } impl MeshBuilder { pub fn new() -> MeshBuilder { MeshBuilder { faces: HashMap::new(), adjacencies: Vec::new(), point_cloud: KdTree::new(3), } } pub fn add(&mut self, group_key: &MeshGroupKey, face: Rc<RefCell<Face>>) { let list = self.faces.entry(group_key.clone()).or_default(); list.push(face.clone()); for (index, vertex) in face.borrow().vertices.triangles(false).enumerate() { let r: &[f32; 3] = vertex.position.as_ref(); let nearest = match self.point_cloud.iter_nearest_mut(r, &squared_euclidean) { Ok(mut v) => match v.next() { Some(vv) => { if vv.0 < f32::default_epsilon() { Some(vv.1) } else { None } } None => None, }, Err(_) => None, }; match nearest { Some(e) => { e.borrow_mut().add(Rc::clone(&face), index); } None => { let adjacency = Rc::new(RefCell::new(Adjacency::new())); adjacency.borrow_mut().add(Rc::clone(&face), index); self.adjacencies.push(Rc::clone(&adjacency)); self.point_cloud .add(*vertex.position.as_ref(), adjacency) .unwrap(); } }; } } pub fn smooth_normals(&mut self) { for adjacency in self.adjacencies.iter() { let adjacency = adjacency.borrow_mut(); let length = adjacency.faces.len(); let mut flags = vec![false; length]; let mut marked = Vec::with_capacity(length); loop { let mut ops = 0; for i in 0..length { if !flags[i] { marked.clear(); marked.push(i); flags[i] = true; let (face, index) = &adjacency.faces[i]; let base_normal = face.borrow().vertices.query(*index).normal; let mut smoothed_normal = base_normal; for (j, flag) in flags.iter_mut().enumerate() { if i != j { let (face, index) = &adjacency.faces[j]; let c_normal = face.borrow().vertices.query(*index).normal; let angle = base_normal.angle(c_normal); if angle.0 < f32::default_epsilon() { *flag = true; } if angle < NORMAL_BLEND_THRESHOLD { ops += 1; *flag = true; marked.push(j); smoothed_normal += c_normal; } } } if !marked.is_empty() { smoothed_normal /= marked.len() as f32; } for j in marked.iter() { let (face, index) = &adjacency.faces[*j]; face.borrow_mut().vertices.query_mut(*index).normal = smoothed_normal; } } } if ops == 0 { break; } } } } pub fn bake(&self, builder: &mut PartBufferBundleBuilder, bounding_box: &mut BoundingBox3) { let mut bounding_box_min = None; let mut bounding_box_max = None; for (group_key, faces) in self.faces.iter() { let mut vertex_indices = vec![]; let mut normal_indices = vec![]; for face in faces.iter() { for vertex in face.borrow().vertices.triangles(false) { match bounding_box_min { None => { bounding_box_min = Some(vertex.position); } Some(ref mut e) => { if e.x > vertex.position.x { e.x = vertex.position.x; } if e.y > vertex.position.y { e.y = vertex.position.y; } if e.z > vertex.position.z { e.z = vertex.position.z; } } } match bounding_box_max { None => { bounding_box_max = Some(vertex.position); } Some(ref mut e) => { if e.x < vertex.position.x { e.x = vertex.position.x; } if e.y < vertex.position.y { e.y = vertex.position.y; } if e.z < vertex.position.z { e.z = vertex.position.z; } } } vertex_indices.push(builder.vertex_buffer_builder.add(vertex.position)); normal_indices.push(builder.vertex_buffer_builder.add(vertex.normal)); } } if let Some(mesh_buffer) = builder.query_mesh(group_key) { mesh_buffer.add_indices(vertex_indices, normal_indices); } else { println!("Skipping unknown color group_key {:?}", group_key); } } if let Some(bounding_box_min) = bounding_box_min { if let Some(bounding_box_max) = bounding_box_max { bounding_box.update_point(&bounding_box_min); bounding_box.update_point(&bounding_box_max); } } } } struct PartBaker<'a> { resolutions: &'a ResolutionResult, metadata: PartMetadata, builder: PartBufferBundleBuilder, mesh_builder: MeshBuilder, color_stack: Vec<ColorReference>, } impl<'a> PartBaker<'a> { pub fn traverse<M: Deref<Target = MultipartDocument>>( &mut self, document: &Document, parent: M, matrix: Matrix4, cull: bool, invert: bool, local: bool, ) { let mut local_cull = true; let mut winding = Winding::Ccw; let bfc_certified = document.bfc.is_certified().unwrap_or(true); let mut invert_next = false; if bfc_certified { winding = match document.bfc.get_winding() { Some(e) => e, None => Winding::Ccw, } ^ invert; } for cmd in document.commands.iter() { match cmd { Command::PartReference(cmd) => { let matrix = matrix * cmd.matrix; let invert_child = if cmd.matrix.determinant() < -f32::default_epsilon() { invert == invert_next } else { invert != invert_next }; let cull_next = if bfc_certified { cull && local_cull } else { false }; let color: ColorReference = match &cmd.color { ColorReference::Current => self.color_stack.last().unwrap().clone(), e => e.clone(), }; if let Some(part) = parent.get_subpart(&cmd.name) { self.color_stack.push(color); self.traverse(part, &*parent, matrix, cull_next, invert_child, local); self.color_stack.pop(); } else if let Some((document, local)) = self.resolutions.query(&cmd.name, local) { self.color_stack.push(color); self.traverse( &document.body, Arc::clone(&document), matrix, cull_next, invert_child, local, ); self.color_stack.pop(); } invert_next = false; } Command::Line(cmd) => { let top = self.color_stack.last().unwrap(); self.builder.edges.add( &mut self.builder.vertex_buffer_builder, (matrix * cmd.a).truncate(), &cmd.color, top, ); self.builder.edges.add( &mut self.builder.vertex_buffer_builder, (matrix * cmd.b).truncate(), &cmd.color, top, ); } Command::OptionalLine(cmd) => { let top = self.color_stack.last().unwrap(); self.builder.optional_edges.add( &mut self.builder.vertex_buffer_builder, (matrix * cmd.a).truncate(), (matrix * cmd.b).truncate(), (matrix * cmd.c).truncate(), (matrix * cmd.d).truncate(), &cmd.color, top, ); } Command::Triangle(cmd) => { let color = match &cmd.color { ColorReference::Current => self.color_stack.last().unwrap(), e => e, }; let face = match winding { Winding::Ccw => { let v1 = (matrix * cmd.a).truncate(); let v2 = (matrix * cmd.b).truncate(); let v3 = (matrix * cmd.c).truncate(); let normal = calculate_normal(&v1, &v2, &v3); Face { vertices: FaceVertices::Triangle([ FaceVertex { position: v1, normal, }, FaceVertex { position: v2, normal, }, FaceVertex { position: v3, normal, }, ]), winding: Winding::Ccw, } } Winding::Cw => { let v1 = (matrix * cmd.c).truncate(); let v2 = (matrix * cmd.b).truncate(); let v3 = (matrix * cmd.a).truncate(); let normal = calculate_normal(&v1, &v2, &v3); Face { vertices: FaceVertices::Triangle([ FaceVertex { position: v1, normal, }, FaceVertex { position: v2, normal, }, FaceVertex { position: v3, normal, }, ]), winding: Winding::Cw, } } }; let category = MeshGroupKey { color_ref: color.clone(), bfc: if bfc_certified { cull && local_cull } else { false }, }; self.mesh_builder .add(&category, Rc::new(RefCell::new(face))); } Command::Quad(cmd) => { let color = match &cmd.color { ColorReference::Current => self.color_stack.last().unwrap(), e => e, }; let face = match winding { Winding::Ccw => { let v1 = (matrix * cmd.a).truncate(); let v2 = (matrix * cmd.b).truncate(); let v3 = (matrix * cmd.c).truncate(); let v4 = (matrix * cmd.d).truncate(); let normal = calculate_normal(&v1, &v2, &v3); Face { vertices: FaceVertices::Quad([ FaceVertex { position: v1, normal, }, FaceVertex { position: v2, normal, }, FaceVertex { position: v3, normal, }, FaceVertex { position: v4, normal, }, ]), winding: Winding::Ccw, } } Winding::Cw => { let v1 = (matrix * cmd.d).truncate(); let v2 = (matrix * cmd.c).truncate(); let v3 = (matrix * cmd.b).truncate(); let v4 = (matrix * cmd.a).truncate(); let normal = calculate_normal(&v1, &v2, &v3); Face { vertices: FaceVertices::Quad([ FaceVertex { position: v1, normal, }, FaceVertex { position: v2, normal, }, FaceVertex { position: v3, normal, }, FaceVertex { position: v4, normal, }, ]), winding: Winding::Cw, } } }; let category = MeshGroupKey { color_ref: color.clone(), bfc: if bfc_certified { cull && local_cull } else { false }, }; self.mesh_builder .add(&category, Rc::new(RefCell::new(face))); } Command::Meta(cmd) => { if let Meta::Bfc(statement) = cmd { match statement { BfcStatement::InvertNext => { invert_next = true; } BfcStatement::NoClip => { local_cull = false; } BfcStatement::Clip(w) => { local_cull = true; if let Some(w) = w { winding = w ^ invert; } } BfcStatement::Winding(w) => { winding = w ^ invert; } } } } }; } } pub fn bake(mut self) -> Part { let mut bounding_box = BoundingBox3::nil(); self.mesh_builder.smooth_normals(); self.mesh_builder.bake(&mut self.builder, &mut bounding_box); Part::new( self.metadata, self.builder.build(), bounding_box, Vector3::new(0.0, 0.0, 0.0), ) } pub fn new(metadata: PartMetadata, resolutions: &'a ResolutionResult) -> Self { let mut mb = PartBaker { resolutions, metadata, builder: PartBufferBundleBuilder::default(), mesh_builder: MeshBuilder::new(), color_stack: Vec::new(), }; mb.color_stack.push(ColorReference::Current); mb } } pub fn bake_part_from_multipart_document<D: Deref<Target = MultipartDocument>>( document: D, resolutions: &ResolutionResult, local: bool, ) -> Part { let mut baker = PartBaker::new(PartMetadata::from(&document.body), resolutions); baker.traverse( &document.body, &*document, Matrix4::identity(), true, false, local, ); baker.bake() } pub fn bake_part_from_document( document: &Document, resolutions: &ResolutionResult, local: bool, ) -> Part { let mut baker = PartBaker::new(document.into(), resolutions); baker.traverse( document,
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
true
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ir/src/constraints.rs
ir/src/constraints.rs
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/olr/src/lib.rs
olr/src/lib.rs
pub mod context; pub mod error; pub mod ops;
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/olr/src/error.rs
olr/src/error.rs
use std::{ error::Error, fmt::{Display, Formatter, Result as FmtResult}, }; #[derive(Debug)] pub enum ContextCreationError { NoAdapterFound, RequestDeviceError(wgpu::RequestDeviceError), } impl Display for ContextCreationError { fn fmt(&self, f: &mut Formatter) -> FmtResult { match self { ContextCreationError::NoAdapterFound => { write!(f, "No adapter found.") } ContextCreationError::RequestDeviceError(e) => { write!(f, "Error requesting device: {}", e) } } } } impl Error for ContextCreationError { fn cause(&self) -> Option<&(dyn Error)> { match *self { ContextCreationError::NoAdapterFound => None, ContextCreationError::RequestDeviceError(ref e) => Some(e), } } } impl From<wgpu::RequestDeviceError> for ContextCreationError { fn from(e: wgpu::RequestDeviceError) -> Self { Self::RequestDeviceError(e) } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/olr/src/context.rs
olr/src/context.rs
use image::RgbaImage; use ldraw::Vector2; use ldraw_ir::geometry::BoundingBox2; use ldraw_renderer::{pipeline::RenderingPipelineManager, projection::Projection, Entity}; use crate::error::ContextCreationError; pub struct Context { pub width: u32, pub height: u32, pub device: wgpu::Device, pub queue: wgpu::Queue, pub(super) pipelines: RenderingPipelineManager, pub(super) projection: Entity<Projection>, pub(super) framebuffer_texture: wgpu::Texture, pub(super) framebuffer_texture_view: wgpu::TextureView, pub(super) _multisampled_framebuffer_texture: Option<wgpu::Texture>, pub(super) multisampled_framebuffer_texture_view: Option<wgpu::TextureView>, pub(super) _depth_texture: wgpu::Texture, pub(super) depth_texture_view: wgpu::TextureView, output_buffer: wgpu::Buffer, } impl Context { pub async fn new( width: u32, height: u32, sample_count: u32, ) -> Result<Self, ContextCreationError> { let instance = wgpu::Instance::new(&wgpu::InstanceDescriptor { backends: wgpu::Backends::all(), backend_options: Default::default(), flags: wgpu::InstanceFlags::default(), memory_budget_thresholds: Default::default(), }); let adapter = instance .request_adapter(&wgpu::RequestAdapterOptionsBase { power_preference: wgpu::PowerPreference::default(), force_fallback_adapter: false, compatible_surface: None, }) .await .map_err(|_| ContextCreationError::NoAdapterFound)?; let (device, queue) = adapter .request_device(&wgpu::DeviceDescriptor { label: Some("Device Descriptor"), required_features: wgpu::Features::POLYGON_MODE_LINE, required_limits: wgpu::Limits::default(), memory_hints: Default::default(), trace: wgpu::Trace::Off, }) .await?; let framebuffer_format = wgpu::TextureFormat::Rgba8UnormSrgb; let framebuffer_texture = device.create_texture(&wgpu::TextureDescriptor { size: wgpu::Extent3d { width, height, depth_or_array_layers: 1, }, mip_level_count: 1, sample_count: 1, dimension: wgpu::TextureDimension::D2, format: framebuffer_format, usage: wgpu::TextureUsages::COPY_SRC | wgpu::TextureUsages::RENDER_ATTACHMENT, label: Some("Render framebuffer"), view_formats: &[], }); let framebuffer_texture_view = framebuffer_texture.create_view(&Default::default()); let (multisampled_framebuffer_texture, multisampled_framebuffer_texture_view) = if sample_count > 1 { let texture = device.create_texture(&wgpu::TextureDescriptor { size: wgpu::Extent3d { width, height, depth_or_array_layers: 1, }, mip_level_count: 1, sample_count, dimension: wgpu::TextureDimension::D2, format: framebuffer_format, usage: wgpu::TextureUsages::COPY_SRC | wgpu::TextureUsages::RENDER_ATTACHMENT, label: Some("Render framebuffer (w/o multisample)"), view_formats: &[], }); let view = texture.create_view(&Default::default()); (Some(texture), Some(view)) } else { (None, None) }; let pipelines = RenderingPipelineManager::new(&device, &queue, framebuffer_format, sample_count); let projection = Projection::new().into(); let depth_texture = device.create_texture(&wgpu::TextureDescriptor { size: wgpu::Extent3d { width, height, depth_or_array_layers: 1, }, mip_level_count: 1, sample_count, dimension: wgpu::TextureDimension::D2, format: wgpu::TextureFormat::Depth32Float, usage: wgpu::TextureUsages::RENDER_ATTACHMENT, label: Some("Depth buffer"), view_formats: &[], }); let depth_texture_view = depth_texture.create_view(&Default::default()); let output_buffer_size = (std::mem::size_of::<u32>() as u32 * width * height) as wgpu::BufferAddress; let output_buffer = device.create_buffer(&wgpu::BufferDescriptor { size: output_buffer_size, usage: wgpu::BufferUsages::COPY_DST | wgpu::BufferUsages::MAP_READ, label: Some("Output buffer"), mapped_at_creation: false, }); Ok(Self { width, height, device, queue, pipelines, projection, framebuffer_texture, framebuffer_texture_view, _multisampled_framebuffer_texture: multisampled_framebuffer_texture, multisampled_framebuffer_texture_view, _depth_texture: depth_texture, depth_texture_view, output_buffer, }) } pub async fn finish( &self, mut encoder: wgpu::CommandEncoder, bounds: Option<BoundingBox2>, ) -> RgbaImage { encoder.copy_texture_to_buffer( wgpu::TexelCopyTextureInfo { aspect: wgpu::TextureAspect::All, texture: &self.framebuffer_texture, mip_level: 0, origin: wgpu::Origin3d::ZERO, }, wgpu::TexelCopyBufferInfo { buffer: &self.output_buffer, layout: wgpu::TexelCopyBufferLayout { offset: 0, bytes_per_row: Some(std::mem::size_of::<u32>() as u32 * self.width), rows_per_image: Some(self.height), }, }, wgpu::Extent3d { width: self.width, height: self.height, depth_or_array_layers: 1, }, ); self.queue.submit(Some(encoder.finish())); let pixels = { let buffer_slice = self.output_buffer.slice(..); let (tx, rx) = futures_intrusive::channel::shared::oneshot_channel(); buffer_slice.map_async(wgpu::MapMode::Read, move |result| { tx.send(result).unwrap(); }); self.device .poll(wgpu::PollType::Wait) .expect("Polling from GPU failed"); rx.receive().await.unwrap().unwrap(); buffer_slice.get_mapped_range() }; let bounds = bounds .unwrap_or_else(|| BoundingBox2::new(&Vector2::new(0.0, 0.0), &Vector2::new(1.0, 1.0))); let x1 = (bounds.min.x * self.width as f32) as usize; let y1 = (bounds.min.y * self.height as f32) as usize; let x2 = (bounds.max.x * self.width as f32) as usize; let y2 = (bounds.max.y * self.height as f32) as usize; let cw = x2 - x1; let ch = y2 - y1; let mut pixels_rearranged: Vec<u8> = Vec::new(); for v in y1..y2 { let s = 4 * v * self.width as usize + x1 * 4; pixels_rearranged.extend_from_slice(&pixels[s..(s + (cw * 4))]); } drop(pixels); self.output_buffer.unmap(); RgbaImage::from_raw(cw as _, ch as _, pixels_rearranged).unwrap() } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/olr/src/ops.rs
olr/src/ops.rs
use cgmath::SquareMatrix; use image::RgbaImage; use ldraw::{ color::{Color, ColorCatalog}, Matrix4, PartAlias, Point3, }; use ldraw_ir::{ geometry::BoundingBox2, model::{GroupId, Model}, }; use ldraw_renderer::{ display_list::DisplayList, part::{Part, PartQuerier}, projection::{OrthographicCamera, ProjectionModifier, ViewBounds}, util::calculate_model_bounding_box, }; use crate::context::Context; pub struct Ops<'a> { context: &'a mut Context, encoder: wgpu::CommandEncoder, } impl<'a> Ops<'a> { pub fn new(context: &'a mut Context) -> Self { let encoder = context .device .create_command_encoder(&wgpu::CommandEncoderDescriptor { label: Some("Command Encoder for Offscreen"), }); Self { context, encoder } } pub async fn render_single_part(mut self, part: &Part, color: &Color) -> RgbaImage { let camera = OrthographicCamera::new_isometric( Point3::new(0.0, 0.0, 0.0), ViewBounds::BoundingBox3(part.bounding_box.clone()), ); self.context.projection.mutate_all( camera .update_projections((self.context.width, self.context.height).into()) .into_iter(), ); self.context .projection .update(&self.context.device, &self.context.queue); let (view, resolve_target) = if let Some(t) = self.context.multisampled_framebuffer_texture_view.as_ref() { (t, Some(&self.context.framebuffer_texture_view)) } else { (&self.context.framebuffer_texture_view, None) }; let mut render_pass = self .encoder .begin_render_pass(&wgpu::RenderPassDescriptor { label: Some("Offscreen Render Pass"), color_attachments: &[Some(wgpu::RenderPassColorAttachment { view, resolve_target, ops: wgpu::Operations { load: wgpu::LoadOp::Clear(wgpu::Color { r: 1.0, g: 1.0, b: 1.0, a: 0.0, }), store: wgpu::StoreOp::Store, }, depth_slice: None, })], depth_stencil_attachment: Some(wgpu::RenderPassDepthStencilAttachment { view: &self.context.depth_texture_view, depth_ops: Some(wgpu::Operations { load: wgpu::LoadOp::Clear(1.0), store: wgpu::StoreOp::Store, }), stencil_ops: None, }), occlusion_query_set: None, timestamp_writes: None, }) .forget_lifetime(); self.context.pipelines.render_single_part( &self.context.device, &self.context.queue, &mut render_pass, &self.context.projection, part, Matrix4::identity(), color, ); drop(render_pass); let bounds = camera .view_bounds .fraction(&self.context.projection.get_model_view_matrix()); self.finish(bounds).await } pub async fn render_model( mut self, model: &Model<PartAlias>, group_id: Option<GroupId>, parts: &impl PartQuerier<PartAlias>, colors: &ColorCatalog, ) -> RgbaImage { let bounding_box = calculate_model_bounding_box(model, group_id, parts); let center = bounding_box.center(); let camera = OrthographicCamera::new_isometric( Point3::new(center.x, center.y, center.z), ViewBounds::BoundingBox3(bounding_box), ); self.context.projection.mutate_all( camera .update_projections((self.context.width, self.context.height).into()) .into_iter(), ); self.context .projection .update(&self.context.device, &self.context.queue); let mut display_list = DisplayList::from_model(model, group_id, colors); display_list.update(&self.context.device, &self.context.queue); let (view, resolve_target) = if let Some(t) = self.context.multisampled_framebuffer_texture_view.as_ref() { (t, Some(&self.context.framebuffer_texture_view)) } else { (&self.context.framebuffer_texture_view, None) }; let mut render_pass = self .encoder .begin_render_pass(&wgpu::RenderPassDescriptor { label: Some("Offscreen Render Pass"), color_attachments: &[Some(wgpu::RenderPassColorAttachment { view, resolve_target, ops: wgpu::Operations { load: wgpu::LoadOp::Clear(wgpu::Color { r: 1.0, g: 1.0, b: 1.0, a: 0.0, }), store: wgpu::StoreOp::Store, }, depth_slice: None, })], depth_stencil_attachment: Some(wgpu::RenderPassDepthStencilAttachment { view: &self.context.depth_texture_view, depth_ops: Some(wgpu::Operations { load: wgpu::LoadOp::Clear(1.0), store: wgpu::StoreOp::Store, }), stencil_ops: None, }), occlusion_query_set: None, timestamp_writes: None, }) .forget_lifetime(); self.context.pipelines.render( &mut render_pass, &self.context.projection, parts, &display_list, ); drop(render_pass); let bounds = camera .view_bounds .fraction(&self.context.projection.get_model_view_matrix()); self.finish(bounds).await } async fn finish(self, bounds: Option<BoundingBox2>) -> RgbaImage { self.context.finish(self.encoder, bounds).await } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/lib.rs
ldraw/src/lib.rs
use std::cmp; use std::fmt::{Debug, Display, Formatter, Result as FmtResult}; use std::hash::{Hash, Hasher}; use std::ops::BitXor; use cgmath::{ Matrix3 as Matrix3_, Matrix4 as Matrix4_, Point2 as Point2_, Point3 as Point3_, Vector2 as Vector2_, Vector3 as Vector3_, Vector4 as Vector4_, }; use serde::de::{Error as DeserializeError, Visitor}; use serde::{Deserialize, Deserializer, Serialize, Serializer}; pub mod color; pub mod document; pub mod elements; pub mod error; pub mod library; pub mod parser; pub mod resolvers; pub mod writer; pub type Matrix3 = Matrix3_<f32>; pub type Matrix4 = Matrix4_<f32>; pub type Vector2 = Vector2_<f32>; pub type Vector3 = Vector3_<f32>; pub type Vector4 = Vector4_<f32>; pub type Point2 = Point2_<f32>; pub type Point3 = Point3_<f32>; #[derive(Clone, Debug)] pub struct PartAlias { pub normalized: String, pub original: String, } impl PartAlias { pub fn set(&mut self, alias: String) { self.normalized = Self::normalize(&alias); self.original = alias; } pub fn normalize(alias: &str) -> String { alias.trim().to_lowercase().replace('\\', "/") } } impl From<String> for PartAlias { fn from(alias: String) -> PartAlias { PartAlias { normalized: Self::normalize(&alias), original: alias, } } } impl From<&String> for PartAlias { fn from(alias: &String) -> PartAlias { PartAlias { normalized: Self::normalize(alias), original: alias.clone(), } } } impl From<&str> for PartAlias { fn from(alias: &str) -> PartAlias { let string = alias.to_string(); PartAlias { normalized: Self::normalize(&string), original: string, } } } impl Display for PartAlias { fn fmt(&self, f: &mut Formatter) -> FmtResult { Display::fmt(&self.original, f) } } struct StringVisitor; impl<'a> Visitor<'a> for StringVisitor { type Value = String; fn expecting(&self, formatter: &mut Formatter) -> FmtResult { write!(formatter, "a string") } fn visit_str<E: DeserializeError>(self, v: &str) -> Result<Self::Value, E> { Ok(String::from(v)) } } impl Serialize for PartAlias { fn serialize<S: Serializer>(&self, serializer: S) -> Result<S::Ok, S::Error> { serializer.serialize_str(self.original.as_str()) } } impl<'a> Deserialize<'a> for PartAlias { fn deserialize<D: Deserializer<'a>>(deserializer: D) -> Result<Self, D::Error> { Ok(PartAlias::from( &deserializer.deserialize_str(StringVisitor)?, )) } } impl cmp::Eq for PartAlias {} impl cmp::PartialEq for PartAlias { fn eq(&self, other: &PartAlias) -> bool { self.normalized.eq(&other.normalized) } } impl Hash for PartAlias { fn hash<H: Hasher>(&self, state: &mut H) { self.normalized.hash(state) } } #[derive(Copy, Clone, Debug, PartialEq)] pub enum Winding { Ccw, Cw, } impl Winding { pub fn invert(self) -> Self { match self { Winding::Ccw => Winding::Cw, Winding::Cw => Winding::Ccw, } } } impl BitXor<bool> for Winding { type Output = Self; fn bitxor(self, rhs: bool) -> Self::Output { match (self, rhs) { (Winding::Ccw, false) => Winding::Ccw, (Winding::Ccw, true) => Winding::Cw, (Winding::Cw, false) => Winding::Cw, (Winding::Cw, true) => Winding::Ccw, } } } impl BitXor<bool> for &Winding { type Output = Winding; fn bitxor(self, rhs: bool) -> Self::Output { match (self, rhs) { (Winding::Ccw, false) => Winding::Ccw, (Winding::Ccw, true) => Winding::Cw, (Winding::Cw, false) => Winding::Cw, (Winding::Cw, true) => Winding::Ccw, } } } #[cfg(test)] mod tests { use crate::PartAlias; #[test] fn test_part_alias_directory_sep_normalization() { let alias = PartAlias::from("test\\directory\\disc.dat".to_string()); assert_eq!(alias.normalized, "test/directory/disc.dat"); assert_eq!(alias.original, "test\\directory\\disc.dat"); } #[test] fn test_part_alias_case_normalization() { let alias = PartAlias::from("Disc.dat".to_string()); assert_eq!(alias.normalized, "disc.dat"); assert_eq!(alias.original, "Disc.dat"); } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/parser.rs
ldraw/src/parser.rs
use std::{collections::HashMap, marker::Unpin, str::Chars}; use cgmath::Matrix; use futures::{stream::Enumerate, StreamExt}; use tokio::io::{AsyncBufRead, AsyncBufReadExt}; use tokio_stream::wrappers::LinesStream; use crate::{ color::{ Color, ColorCatalog, ColorReference, CustomizedMaterial, Material, MaterialGlitter, MaterialSpeckle, Rgba, }, document::{BfcCertification, Document, MultipartDocument}, elements::{ BfcStatement, Command, Header, Line, Meta, OptionalLine, PartReference, Quad, Triangle, }, error::{ColorDefinitionParseError, DocumentParseError, ParseError}, {Matrix4, PartAlias, Vector4, Winding}, }; #[derive(Debug, PartialEq)] enum Line0 { Header(Header), Meta(Meta), File(String), Name(String), Author(String), BfcCertification(BfcCertification), } fn is_whitespace(ch: char) -> bool { matches!(ch, ' ' | '\t' | '\r' | '\n') } fn next_token(iterator: &mut Chars, glob_remaining: bool) -> Result<String, ParseError> { let mut buffer = String::new(); for v in iterator { if !is_whitespace(v) { buffer.push(v); } else if !buffer.is_empty() { if !glob_remaining { break; } else { buffer.push(v); } } } match buffer.len() { 0 => Err(ParseError::EndOfLine), _ => Ok(buffer.trim_end().to_string()), } } fn next_token_u32(iterator: &mut Chars) -> Result<u32, ParseError> { let token = next_token(iterator, false)?; if token.starts_with("0x") { let trimmed = token.chars().skip(2).collect::<String>(); return match u32::from_str_radix(trimmed.as_str(), 16) { Ok(v) => Ok(v), Err(_) => Err(ParseError::TypeMismatch("u32", token)), }; } match token.parse::<u32>() { Ok(v) => Ok(v), Err(_) => Err(ParseError::TypeMismatch("u32", token)), } } fn next_token_f32(iterator: &mut Chars) -> Result<f32, ParseError> { let token = next_token(iterator, false)?; match token.parse::<f32>() { Ok(v) => Ok(v), Err(_) => Err(ParseError::TypeMismatch("f32", token)), } } fn next_token_rgb(iterator: &mut Chars) -> Result<(u8, u8, u8), ParseError> { match iterator.next() { Some(v) => { if v != '#' { return Err(ParseError::InvalidToken(v.to_string())); } } None => { return Err(ParseError::EndOfLine); } } let rs = iterator.take(2).collect::<String>(); let gs = iterator.take(2).collect::<String>(); let bs = iterator.take(2).collect::<String>(); let r = match u8::from_str_radix(rs.as_str(), 16) { Ok(v) => v, Err(_) => return Err(ParseError::TypeMismatch("u8", rs)), }; let g = match u8::from_str_radix(gs.as_str(), 16) { Ok(v) => v, Err(_) => return Err(ParseError::TypeMismatch("u8", gs)), }; let b = match u8::from_str_radix(bs.as_str(), 16) { Ok(v) => v, Err(_) => return Err(ParseError::TypeMismatch("u8", bs)), }; Ok((r, g, b)) } fn parse_bfc_statement(iterator: &mut Chars) -> Result<Line0, ParseError> { let stmt = next_token(iterator, true)?; match stmt.as_str() { "NOCERTIFY" => Ok(Line0::BfcCertification(BfcCertification::NoCertify)), "CERTIFY" | "CERTIFY CCW" => Ok(Line0::BfcCertification(BfcCertification::Certify( Winding::Ccw, ))), "CERTIFY CW" => Ok(Line0::BfcCertification(BfcCertification::Certify( Winding::Cw, ))), "CW" => Ok(Line0::Meta(Meta::Bfc(BfcStatement::Winding(Winding::Cw)))), "CCW" => Ok(Line0::Meta(Meta::Bfc(BfcStatement::Winding(Winding::Ccw)))), "CLIP" => Ok(Line0::Meta(Meta::Bfc(BfcStatement::Clip(None)))), "CLIP CW" | "CW CLIP" => Ok(Line0::Meta(Meta::Bfc(BfcStatement::Clip(Some( Winding::Cw, ))))), "CLIP CCW" | "CCW CLIP" => Ok(Line0::Meta(Meta::Bfc(BfcStatement::Clip(Some( Winding::Ccw, ))))), "NOCLIP" => Ok(Line0::Meta(Meta::Bfc(BfcStatement::NoClip))), "INVERTNEXT" => Ok(Line0::Meta(Meta::Bfc(BfcStatement::InvertNext))), _ => Err(ParseError::InvalidBfcStatement(stmt)), } } fn parse_line_0(iterator: &mut Chars) -> Result<Line0, ParseError> { let text = match next_token(iterator, true) { Ok(v) => v, Err(ParseError::EndOfLine) => return Ok(Line0::Meta(Meta::Comment(String::new()))), Err(e) => return Err(e), }; let mut inner_iterator = text.chars(); let cmd = next_token(&mut inner_iterator, false)?; if cmd.starts_with('!') { let key: String = cmd.chars().skip(1).collect(); let value = next_token(&mut inner_iterator, true).unwrap_or_default(); return Ok(Line0::Header(Header(key, value))); } match cmd.as_str() { "BFC" => parse_bfc_statement(&mut inner_iterator), "Name:" => match next_token(&mut inner_iterator, true) { Ok(msg) => Ok(Line0::Name(msg)), Err(_) => Ok(Line0::Name(String::from(""))), }, "Author:" => match next_token(&mut inner_iterator, true) { Ok(msg) => Ok(Line0::Author(msg)), Err(_) => Ok(Line0::Author(String::from(""))), }, "FILE" => match next_token(&mut inner_iterator, true) { Ok(msg) => Ok(Line0::File(msg)), Err(e) => Err(e), }, "STEP" => Ok(Line0::Meta(Meta::Step)), "WRITE" => match next_token(&mut inner_iterator, true) { Ok(msg) => Ok(Line0::Meta(Meta::Write(msg))), Err(e) => Err(e), }, "PRINT" => match next_token(&mut inner_iterator, true) { Ok(msg) => Ok(Line0::Meta(Meta::Print(msg))), Err(e) => Err(e), }, "CLEAR" => Ok(Line0::Meta(Meta::Clear)), "PAUSE" => Ok(Line0::Meta(Meta::Pause)), "SAVE" => Ok(Line0::Meta(Meta::Save)), _ => { let comment = match text.strip_prefix("//") { Some(e) => e.trim(), None => &text, }; Ok(Line0::Meta(Meta::Comment(comment.to_string()))) } } } fn parse_line_1(colors: &ColorCatalog, iterator: &mut Chars) -> Result<PartReference, ParseError> { let color = next_token_u32(iterator)?; let x = next_token_f32(iterator)?; let y = next_token_f32(iterator)?; let z = next_token_f32(iterator)?; let matrix = Matrix4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, x, next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, y, next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, z, 0.0, 0.0, 0.0, 1.0, ) .transpose(); let name = next_token(iterator, true)?; Ok(PartReference { color: ColorReference::resolve(color, colors), matrix, name: PartAlias::from(name), }) } fn parse_line_2(colors: &ColorCatalog, iterator: &mut Chars) -> Result<Line, ParseError> { let color = next_token_u32(iterator)?; let a = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let b = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); Ok(Line { color: ColorReference::resolve(color, colors), a, b, }) } fn parse_line_3(colors: &ColorCatalog, iterator: &mut Chars) -> Result<Triangle, ParseError> { let color = next_token_u32(iterator)?; let a = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let b = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let c = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); Ok(Triangle { color: ColorReference::resolve(color, colors), a, b, c, }) } fn parse_line_4(colors: &ColorCatalog, iterator: &mut Chars) -> Result<Quad, ParseError> { let color = next_token_u32(iterator)?; let a = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let b = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let c = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let d = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); Ok(Quad { color: ColorReference::resolve(color, colors), a, b, c, d, }) } fn parse_line_5(colors: &ColorCatalog, iterator: &mut Chars) -> Result<OptionalLine, ParseError> { let color = next_token_u32(iterator)?; let a = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let b = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let c = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); let d = Vector4::new( next_token_f32(iterator)?, next_token_f32(iterator)?, next_token_f32(iterator)?, 1.0, ); Ok(OptionalLine { color: ColorReference::resolve(color, colors), a, b, c, d, }) } async fn parse_inner<T: AsyncBufRead + Unpin>( colors: &ColorCatalog, iterator: &mut Enumerate<LinesStream<T>>, multipart: bool, ) -> Result<(Document, Option<String>), DocumentParseError> { let mut next: Option<String> = None; let mut name = String::new(); let mut author = String::new(); let mut description = String::new(); let mut bfc = BfcCertification::NotApplicable; let mut commands = Vec::new(); let mut headers = Vec::new(); 'read_loop: while let Some((index, line_)) = iterator.next().await { let line = match line_ { Ok(v) => v, Err(e) => { return Err(DocumentParseError { line: index + 1, error: ParseError::from(e), }); } }; let mut it = line.chars(); match next_token(&mut it, false) { Ok(token) => match token.as_str() { "0" => match parse_line_0(&mut it) { Ok(val) => match val { Line0::BfcCertification(bfc_) => { bfc = bfc_; } Line0::File(file_) => { if multipart { if !description.is_empty() { next = Some(file_); break 'read_loop; } } else { return Err(DocumentParseError { line: index + 1, error: ParseError::MultipartDocument, }); } } Line0::Name(name_) => { name = name_; } Line0::Author(author_) => { author = author_; } Line0::Meta(meta) => { if let Meta::Comment(comment) = meta { if description.is_empty() { description = comment; } else { commands.push(Command::Meta(Meta::Comment(comment))); } } else { commands.push(Command::Meta(meta)); } } Line0::Header(header) => { headers.push(header); } }, Err(e) => { return Err(DocumentParseError { line: index + 1, error: e, }); } }, "1" => match parse_line_1(colors, &mut it) { Ok(val) => commands.push(Command::PartReference(val)), Err(e) => { return Err(DocumentParseError { line: index + 1, error: e, }); } }, "2" => match parse_line_2(colors, &mut it) { Ok(val) => commands.push(Command::Line(val)), Err(e) => { return Err(DocumentParseError { line: index + 1, error: e, }); } }, "3" => match parse_line_3(colors, &mut it) { Ok(val) => commands.push(Command::Triangle(val)), Err(e) => { return Err(DocumentParseError { line: index + 1, error: e, }); } }, "4" => match parse_line_4(colors, &mut it) { Ok(val) => commands.push(Command::Quad(val)), Err(e) => { return Err(DocumentParseError { line: index + 1, error: e, }); } }, "5" => match parse_line_5(colors, &mut it) { Ok(val) => commands.push(Command::OptionalLine(val)), Err(e) => { return Err(DocumentParseError { line: index + 1, error: e, }); } }, _ => { return Err(DocumentParseError { line: index + 1, error: ParseError::UnexpectedCommand(token), }); } }, Err(ParseError::EndOfLine) => {} Err(e) => { return Err(DocumentParseError { line: index + 1, error: e, }); } } } Ok(( Document { name, description, author, bfc, headers, commands, }, next, )) } pub async fn parse_single_document<T: AsyncBufRead + Unpin>( reader: &mut T, colors: &ColorCatalog, ) -> Result<Document, DocumentParseError> { let mut it = LinesStream::new(reader.lines()).enumerate(); let (document, _) = parse_inner(colors, &mut it, false).await?; Ok(document) } pub async fn parse_multipart_document<T: AsyncBufRead + Unpin>( reader: &mut T, colors: &ColorCatalog, ) -> Result<MultipartDocument, DocumentParseError> { let mut it = LinesStream::new(reader.lines()).enumerate(); let (document, mut next) = parse_inner(colors, &mut it, true).await?; let mut subparts = HashMap::new(); while next.is_some() { let (part, next_) = parse_inner(colors, &mut it, true).await?; subparts.insert(PartAlias::from(&next.unwrap()), part); next = next_; } Ok(MultipartDocument { body: document, subparts, }) } fn parse_customized_material( iterator: &mut Chars, ) -> Result<CustomizedMaterial, ColorDefinitionParseError> { match next_token(iterator, false)?.as_str() { "GLITTER" => { let mut alpha = 255u8; let mut luminance = 0u8; let mut fraction = 0.0; let mut vfraction = 0.0; let mut size = 0u32; let mut minsize = 0.0; let mut maxsize = 0.0; match next_token(iterator, false)?.as_str() { "VALUE" => (), e => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(e.to_string()), )); } }; let (vr, vg, vb) = next_token_rgb(iterator)?; loop { let token = match next_token(iterator, false) { Ok(v) => v, Err(ParseError::EndOfLine) => break, Err(e) => return Err(ColorDefinitionParseError::ParseError(e)), }; match token.as_str() { "ALPHA" => { alpha = next_token_u32(iterator)? as u8; } "LUMINANCE" => { luminance = next_token_u32(iterator)? as u8; } "FRACTION" => { fraction = next_token_f32(iterator)?; } "VFRACTION" => { vfraction = next_token_f32(iterator)?; } "SIZE" => { size = next_token_u32(iterator)?; } "MINSIZE" => { minsize = next_token_f32(iterator)?; } "MAXSIZE" => { maxsize = next_token_f32(iterator)?; } _ => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(token.clone()), )); } } } Ok(CustomizedMaterial::Glitter(MaterialGlitter { value: Rgba::new(vr, vg, vb, alpha), luminance, fraction, vfraction, size, minsize, maxsize, })) } "SPECKLE" => { let mut alpha = 255u8; let mut luminance = 0u8; let mut fraction = 0.0; let mut size = 0u32; let mut minsize = 0.0; let mut maxsize = 0.0; match next_token(iterator, false)?.as_str() { "VALUE" => (), e => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(e.to_string()), )); } }; let (vr, vg, vb) = next_token_rgb(iterator)?; loop { let token = match next_token(iterator, false) { Ok(v) => v, Err(ParseError::EndOfLine) => break, Err(e) => return Err(ColorDefinitionParseError::ParseError(e)), }; match token.as_str() { "ALPHA" => { alpha = next_token_u32(iterator)? as u8; } "LUMINANCE" => { luminance = next_token_u32(iterator)? as u8; } "FRACTION" => { fraction = next_token_f32(iterator)?; } "SIZE" => { size = next_token_u32(iterator)?; } "MINSIZE" => { minsize = next_token_f32(iterator)?; } "MAXSIZE" => { maxsize = next_token_f32(iterator)?; } _ => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(token.clone()), )); } } } Ok(CustomizedMaterial::Speckle(MaterialSpeckle { value: Rgba::new(vr, vg, vb, alpha), luminance, fraction, size, minsize, maxsize, })) } e => Err(ColorDefinitionParseError::UnknownMaterial(e.to_string())), } } pub async fn parse_color_definitions<T: AsyncBufRead + Unpin>( reader: &mut T, ) -> Result<ColorCatalog, ColorDefinitionParseError> { // Use an empty context here let colors = ColorCatalog::new(); let document = parse_single_document(reader, &colors).await?; let mut colors = ColorCatalog::new(); for Header(_, value) in document.headers.iter().filter(|s| s.0 == "COLOUR") { let mut material = Material::Plastic; let mut alpha = 255u8; let mut luminance = 0u8; let mut it = value.chars(); let name = next_token(&mut it, false)?; match next_token(&mut it, false)?.as_str() { "CODE" => (), e => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(e.to_string()), )); } }; let code = next_token_u32(&mut it)?; match next_token(&mut it, false)?.as_str() { "VALUE" => (), e => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(e.to_string()), )); } }; let (cr, cg, cb) = next_token_rgb(&mut it)?; match next_token(&mut it, false)?.as_str() { "EDGE" => (), e => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(e.to_string()), )); } }; let (er, eg, eb) = next_token_rgb(&mut it)?; loop { let token = match next_token(&mut it, false) { Ok(v) => v, Err(ParseError::EndOfLine) => break, Err(e) => return Err(ColorDefinitionParseError::ParseError(e)), }; match token.as_str() { "ALPHA" => { alpha = next_token_u32(&mut it)? as u8; } "LUMINANCE" => { luminance = next_token_u32(&mut it)? as u8; } "CHROME" => { material = Material::Chrome; } "PEARLESCENT" => { material = Material::Pearlescent; } "METAL" => { material = Material::Metal; } "RUBBER" => { material = Material::Rubber; } "MATTE_METALLIC" => { material = Material::MatteMetallic; } "MATERIAL" => { material = Material::Custom(parse_customized_material(&mut it)?); } _ => { return Err(ColorDefinitionParseError::ParseError( ParseError::InvalidToken(token.clone()), )); } } } colors.insert( code, Color { code, name, color: Rgba::new(cr, cg, cb, alpha), edge: Rgba::new(er, eg, eb, 255), luminance, material, }, ); } Ok(colors) } #[cfg(test)] mod tests { use super::*; fn parse_line_0_or_panic(input: &str) -> Line0 { match parse_line_0(&mut input.chars()) { Ok(line0) => line0, Err(e) => { panic!("cannot parse {}: {}", input, e); } } } #[test] fn parse_line_0_parses_comment() { let cases = [ ("// This is a comment", "This is a comment"), ("This is also a comment", "This is also a comment"), ]; for (input, output) in cases { let parsed = parse_line_0_or_panic(input); match parsed { Line0::Meta(Meta::Comment(comment)) => assert_eq!(comment, output), _ => panic!("expected Line0::Meta(Meta::Comment(...)), got {:?}", parsed), } } } #[test] fn parse_line_0_parses_offical_meta_commands_without_bfc() { let cases = [ ("STEP", Meta::Step), ( "WRITE any length of string", Meta::Write("any length of string".into()), ), ( "PRINT also any length of string", Meta::Print("also any length of string".into()), ), ("CLEAR", Meta::Clear), ("PAUSE", Meta::Pause), ("SAVE", Meta::Save), ]; for (input, output) in cases { let parsed = parse_line_0_or_panic(input); match parsed { Line0::Meta(meta) => assert_eq!(meta, output), _ => panic!("expected Line0::Meta(...), got {:?}", parsed), } } } #[test] fn parse_line_0_parses_bfc_statements() { let cases = [ ("BFC CW", BfcStatement::Winding(Winding::Cw)), ("BFC CCW", BfcStatement::Winding(Winding::Ccw)), ("BFC CLIP", BfcStatement::Clip(None)), ("BFC CLIP CW", BfcStatement::Clip(Some(Winding::Cw))), ("BFC CLIP CCW", BfcStatement::Clip(Some(Winding::Ccw))), ("BFC CW CLIP", BfcStatement::Clip(Some(Winding::Cw))), ("BFC CCW CLIP", BfcStatement::Clip(Some(Winding::Ccw))), ("BFC NOCLIP", BfcStatement::NoClip), ("BFC INVERTNEXT", BfcStatement::InvertNext), ]; for (input, output) in cases { let parsed = parse_line_0_or_panic(input); match parsed { Line0::Meta(Meta::Bfc(bfc)) => assert_eq!(bfc, output), _ => panic!("expected Line0::Meta(Meta::Bfc(...)) got {:?}", parsed), } } } #[test] fn parse_line_0_parses_bfc_certificates() { let cases = [ ("BFC NOCERTIFY", BfcCertification::NoCertify), ("BFC CERTIFY CW", BfcCertification::Certify(Winding::Cw)), ("BFC CERTIFY", BfcCertification::Certify(Winding::Ccw)), ("BFC CERTIFY CCW", BfcCertification::Certify(Winding::Ccw)), ]; for (input, output) in cases { let parsed = parse_line_0_or_panic(input); match parsed { Line0::BfcCertification(certification) => assert_eq!(certification, output), _ => panic!("expected Line0::BfsCertification(...), got {:?}", parsed), } } } #[test] fn parse_line_0_parses_headers() { let cases = [ ( "!LDRAW_ORG Part UPDATE 2006-01", Header("LDRAW_ORG".into(), "Part UPDATE 2006-01".into()), ), ( "!LICENSE Redistributable under CCAL version 2.: see CAreadme.txt", Header( "LICENSE".into(), "Redistributable under CCAL version 2.: see CAreadme.txt".into(), ), ), ( "!HELP Obviously there is no need for additional", Header( "HELP".into(), "Obviously there is no need for additional".into(), ), ), ("!HELP", Header("HELP".into(), "".into())), ( "!CATEGORY Animal", Header("CATEGORY".into(), "Animal".into()), ), ( "!KEYWORDS Sting, Poison, Adventurers, Egypt", Header( "KEYWORDS".into(), "Sting, Poison, Adventurers, Egypt".into(), ), ), ("!CMDLINE -c1", Header("CMDLINE".into(), "-c1".into())), ( "!HISTORY 2000-08-?? {Axel Poque} fixes to resolve L3P error messages", Header( "HISTORY".into(), "2000-08-?? {Axel Poque} fixes to resolve L3P error messages".into(), ), ), ( "!HISTORY 2002-04-25 [PTadmin] Official update 2002-02", Header( "HISTORY".into(), "2002-04-25 [PTadmin] Official update 2002-02".into(), ), ), ]; for (input, output) in cases { let parsed = parse_line_0_or_panic(input); match parsed { Line0::Header(header) => assert_eq!(header, output), _ => panic!("expected Line0::Header(...), got {:?}", parsed), } } } #[test] fn parse_line_0_parses_name_author() { let name = "Name: 193a.dat"; let parsed_name = parse_line_0_or_panic(name); assert_eq!(parsed_name, Line0::Name("193a.dat".into())); let author = "Author: Chris Dee [cwdee]"; let parsed_author = parse_line_0_or_panic(author); assert_eq!(parsed_author, Line0::Author("Chris Dee [cwdee]".into())); } #[test] fn parse_line_0_parses_file() { let file = "FILE main.ldr"; let parsed_file = parse_line_0_or_panic(file); assert_eq!(parsed_file, Line0::File("main.ldr".into())); } #[test] fn parse_customized_material_parses_glitter() { let cases = [ ("GLITTER VALUE #122334 FRACTION 0.3 VFRACTION 2.4 SIZE 1", MaterialGlitter { value: Rgba::new(0x12, 0x23, 0x34, 255), luminance: 0, fraction: 0.3, vfraction: 2.4, size: 1, minsize: 0., maxsize: 0., }), ("GLITTER VALUE #00DEAD LUMINANCE 128 FRACTION 0.5 VFRACTION 0.4 MINSIZE 2 MAXSIZE 3", MaterialGlitter { value: Rgba::new(0x00, 0xde, 0xad, 255), luminance: 128, fraction: 0.5, vfraction: 0.4, size: 0, minsize: 2., maxsize: 3., }), ("GLITTER VALUE #BEEF00 ALPHA 240 FRACTION 0.1 VFRACTION 0.12 SIZE 7", MaterialGlitter { value: Rgba::new(0xbe, 0xef, 0x00, 240), luminance: 0, fraction: 0.1, vfraction: 0.12, size: 7, minsize: 0., maxsize: 0., }), ("GLITTER VALUE #677889 ALPHA 5 LUMINANCE 10 FRACTION 1 VFRACTION 2 MINSIZE 1.1 MAXSIZE 4.3", MaterialGlitter { value: Rgba::new(0x67, 0x78, 0x89, 5), luminance: 10, fraction: 1., vfraction: 2., size: 0, minsize: 1.1, maxsize: 4.3, }), ]; for (input, output) in cases { let parsed = parse_customized_material(&mut input.chars()).unwrap(); match parsed { CustomizedMaterial::Glitter(glitter) => assert_eq!(glitter, output), _ => panic!( "expected CustomizedMaterial::Glitter(...), got: {:?}", parsed ), } } } #[test] fn parse_customized_material_parses_speckle() { let cases = [ ( "SPECKLE VALUE #122334 FRACTION 0.3 SIZE 1", MaterialSpeckle { value: Rgba::new(0x12, 0x23, 0x34, 255),
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
true
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/document.rs
ldraw/src/document.rs
use std::{ collections::{HashMap, HashSet}, iter::Iterator, vec::Vec, }; use crate::{ elements::{Command, Header, Line, Meta, OptionalLine, PartReference, Quad, Triangle}, PartAlias, Winding, }; #[derive(Clone, Debug, PartialEq)] pub enum BfcCertification { NotApplicable, NoCertify, Certify(Winding), } impl BfcCertification { pub fn is_certified(&self) -> Option<bool> { match self { BfcCertification::Certify(_) => Some(true), BfcCertification::NoCertify => Some(false), BfcCertification::NotApplicable => None, } } pub fn get_winding(&self) -> Option<Winding> { match self { BfcCertification::Certify(w) => Some(*w), _ => None, } } } #[derive(Clone, Debug, PartialEq)] pub struct Document { pub name: String, pub description: String, pub author: String, pub bfc: BfcCertification, pub headers: Vec<Header>, pub commands: Vec<Command>, } impl Default for Document { fn default() -> Self { Document { name: String::new(), description: String::new(), author: String::new(), bfc: BfcCertification::NotApplicable, headers: Vec::new(), commands: Vec::new(), } } } fn traverse_dependencies( document: &Document, parent: Option<&MultipartDocument>, list: &mut HashSet<PartAlias>, ) { for part_ref in document.iter_refs() { if let Some(parent) = parent { if parent.subparts.contains_key(&part_ref.name) { traverse_dependencies( parent.subparts.get(&part_ref.name).unwrap(), Some(parent), list, ); continue; } } list.insert(part_ref.name.clone()); } } impl Document { pub fn has_primitives(&self) -> bool { for item in self.commands.iter() { match item { Command::Line(_) | Command::Triangle(_) | Command::Quad(_) | Command::OptionalLine(_) => { return true; } _ => (), } } false } pub fn list_dependencies(&self) -> HashSet<PartAlias> { let mut result = HashSet::new(); traverse_dependencies(self, None, &mut result); result } } macro_rules! define_iterator( ($fn:ident, $fn_mut:ident, $cmdval:path, $type:ty) => ( impl<'a> Document { pub fn $fn(&'a self) -> impl Iterator<Item = &'a $type> { self.commands.iter().filter_map(|value| match value { $cmdval(m) => Some(m), _ => None, }) } pub fn $fn_mut(&'a mut self) -> impl Iterator<Item = &'a mut $type> + 'a { self.commands.iter_mut().filter_map(|value| match value { $cmdval(m) => Some(m), _ => None, }) } } ) ); define_iterator!(iter_meta, iter_meta_mut, Command::Meta, Meta); define_iterator!( iter_refs, iter_refs_mut, Command::PartReference, PartReference ); define_iterator!(iter_lines, iter_lines_mut, Command::Line, Line); define_iterator!( iter_triangles, iter_triangles_mut, Command::Triangle, Triangle ); define_iterator!(iter_quads, iter_quads_mut, Command::Quad, Quad); define_iterator!( iter_optional_lines, iter_optioanl_lines_mut, Command::OptionalLine, OptionalLine ); #[derive(Clone, Debug, PartialEq)] pub struct MultipartDocument { pub body: Document, pub subparts: HashMap<PartAlias, Document>, } impl MultipartDocument { pub fn get_subpart(&self, alias: &PartAlias) -> Option<&Document> { self.subparts.get(alias) } pub fn list_dependencies(&self) -> HashSet<PartAlias> { let mut result = HashSet::new(); traverse_dependencies(&self.body, Some(self), &mut result); result } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/error.rs
ldraw/src/error.rs
use std::{error::Error, fmt, io::Error as IoError}; #[cfg(any(target_arch = "wasm32", feature = "http"))] use reqwest::Error as ReqwestError; #[cfg(not(any(target_arch = "wasm32", feature = "http")))] mod stub { use super::{fmt, Error}; #[derive(Debug)] pub struct ReqwestError; impl fmt::Display for ReqwestError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "") } } impl Error for ReqwestError { fn source(&self) -> Option<&(dyn Error + 'static)> { None } } } #[cfg(not(any(target_arch = "wasm32", feature = "http")))] use stub::ReqwestError; #[derive(Debug)] pub enum ParseError { TypeMismatch(&'static str, String), IoError(Box<IoError>), EndOfLine, InvalidBfcStatement(String), InvalidDocumentStructure, UnexpectedCommand(String), InvalidToken(String), MultipartDocument, } impl From<IoError> for ParseError { fn from(e: IoError) -> ParseError { ParseError::IoError(Box::new(e)) } } impl fmt::Display for ParseError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { match self { ParseError::TypeMismatch(type_, val) => { write!(f, "Error reading value '{}' into {}", val, type_) } ParseError::IoError(err) => write!(f, "{}", err), ParseError::EndOfLine => write!(f, "End of line"), ParseError::InvalidBfcStatement(stmt) => write!(f, "Invalid BFC statement: {}", stmt), ParseError::InvalidDocumentStructure => write!(f, "Invalid document structure."), ParseError::UnexpectedCommand(cmd) => write!(f, "Unexpected command: {}", cmd), ParseError::InvalidToken(token) => write!(f, "Invalid token: {}", token), ParseError::MultipartDocument => write!(f, "Unexpected multipart document."), } } } impl Error for ParseError { fn source(&self) -> Option<&(dyn Error + 'static)> { match self { ParseError::IoError(e) => Some(e), _ => None, } } } #[derive(Debug)] pub struct DocumentParseError { pub line: usize, pub error: ParseError, } impl From<DocumentParseError> for ColorDefinitionParseError { fn from(e: DocumentParseError) -> ColorDefinitionParseError { ColorDefinitionParseError::DocumentParseError(e) } } impl fmt::Display for DocumentParseError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "{} (at line {})", self.error, self.line) } } impl Error for DocumentParseError { fn source(&self) -> Option<&(dyn Error + 'static)> { Some(&self.error) } } #[derive(Debug)] pub enum ColorDefinitionParseError { ParseError(ParseError), DocumentParseError(DocumentParseError), UnknownMaterial(String), } impl From<ParseError> for ColorDefinitionParseError { fn from(e: ParseError) -> ColorDefinitionParseError { ColorDefinitionParseError::ParseError(e) } } impl fmt::Display for ColorDefinitionParseError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { match self { ColorDefinitionParseError::ParseError(e) => write!(f, "{}", e), ColorDefinitionParseError::DocumentParseError(e) => write!(f, "{}", e), ColorDefinitionParseError::UnknownMaterial(e) => write!(f, "Unknown material: {}", e), } } } impl Error for ColorDefinitionParseError { fn source(&self) -> Option<&(dyn Error + 'static)> { match self { ColorDefinitionParseError::ParseError(e) => Some(e), ColorDefinitionParseError::DocumentParseError(e) => Some(e), _ => None, } } } #[derive(Debug)] pub enum SerializeError { NoSerializable, IoError(Box<IoError>), } impl From<IoError> for SerializeError { fn from(e: IoError) -> SerializeError { SerializeError::IoError(Box::new(e)) } } impl fmt::Display for SerializeError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { match self { SerializeError::NoSerializable => write!(f, "Statement is not serializable."), SerializeError::IoError(err) => write!(f, "{}", err), } } } impl Error for SerializeError { fn source(&self) -> Option<&(dyn Error + 'static)> { match self { SerializeError::IoError(e) => Some(e), _ => None, } } } #[derive(Debug)] pub enum ResolutionError { NoLDrawDir, FileNotFound, IoError(Box<IoError>), DocumentParseError(DocumentParseError), ColorDefinitionParseError(ColorDefinitionParseError), RemoteError(ReqwestError), } impl From<IoError> for ResolutionError { fn from(e: IoError) -> ResolutionError { ResolutionError::IoError(Box::new(e)) } } impl From<DocumentParseError> for ResolutionError { fn from(e: DocumentParseError) -> ResolutionError { ResolutionError::DocumentParseError(e) } } impl From<ColorDefinitionParseError> for ResolutionError { fn from(e: ColorDefinitionParseError) -> ResolutionError { ResolutionError::ColorDefinitionParseError(e) } } impl From<ReqwestError> for ResolutionError { fn from(e: ReqwestError) -> ResolutionError { ResolutionError::RemoteError(e) } } impl fmt::Display for ResolutionError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { match self { ResolutionError::NoLDrawDir => write!(f, "No LDraw library found."), ResolutionError::FileNotFound => write!(f, "File not found."), ResolutionError::IoError(err) => write!(f, "{}", err), ResolutionError::DocumentParseError(err) => write!(f, "{}", err), ResolutionError::ColorDefinitionParseError(err) => write!(f, "{}", err), ResolutionError::RemoteError(err) => write!(f, "{}", err), } } } impl Error for ResolutionError { fn source(&self) -> Option<&(dyn Error + 'static)> { match self { ResolutionError::IoError(e) => Some(e), ResolutionError::DocumentParseError(e) => Some(e), ResolutionError::ColorDefinitionParseError(e) => Some(e), ResolutionError::RemoteError(e) => Some(e), _ => None, } } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/library.rs
ldraw/src/library.rs
use std::{ collections::{HashMap, HashSet}, ops::Deref, sync::{Arc, RwLock}, }; use async_trait::async_trait; use futures::future::join_all; use serde::{Deserialize, Serialize}; use crate::{ color::ColorCatalog, document::{Document, MultipartDocument}, error::ResolutionError, PartAlias, }; #[derive(Serialize, Deserialize, Clone, Copy, Debug, Hash)] pub enum PartKind { Primitive, Part, } #[derive(Serialize, Deserialize, Clone, Copy, Debug, Hash)] pub enum FileLocation { Library(PartKind), Local, } #[async_trait(?Send)] pub trait DocumentLoader<T> { async fn load_document( &self, locator: &T, colors: &ColorCatalog, ) -> Result<MultipartDocument, ResolutionError>; } #[async_trait(?Send)] pub trait LibraryLoader { async fn load_colors(&self) -> Result<ColorCatalog, ResolutionError>; async fn load_ref( &self, alias: PartAlias, local: bool, colors: &ColorCatalog, ) -> Result<(FileLocation, MultipartDocument), ResolutionError>; } #[derive(Debug, Default)] pub struct PartCache { primitives: HashMap<PartAlias, Arc<MultipartDocument>>, parts: HashMap<PartAlias, Arc<MultipartDocument>>, } #[derive(Copy, Clone, Debug)] pub enum CacheCollectionStrategy { Parts, Primitives, PartsAndPrimitives, } impl Drop for PartCache { fn drop(&mut self) { self.collect(CacheCollectionStrategy::PartsAndPrimitives); } } impl PartCache { pub fn new() -> Self { Self::default() } pub fn register(&mut self, kind: PartKind, alias: PartAlias, document: Arc<MultipartDocument>) { match kind { PartKind::Part => self.parts.insert(alias, document), PartKind::Primitive => self.primitives.insert(alias, document), }; } pub fn query(&self, alias: &PartAlias) -> Option<Arc<MultipartDocument>> { match self.parts.get(alias) { Some(part) => Some(Arc::clone(part)), None => self.primitives.get(alias).cloned(), } } fn collect_round(&mut self, collection_strategy: CacheCollectionStrategy) -> usize { let prev_size = self.parts.len() + self.primitives.len(); match collection_strategy { CacheCollectionStrategy::Parts => { self.parts .retain(|_, v| Arc::strong_count(v) > 1 || Arc::weak_count(v) > 0); } CacheCollectionStrategy::Primitives => { self.primitives .retain(|_, v| Arc::strong_count(v) > 1 || Arc::weak_count(v) > 0); } CacheCollectionStrategy::PartsAndPrimitives => { self.parts .retain(|_, v| Arc::strong_count(v) > 1 || Arc::weak_count(v) > 0); self.primitives .retain(|_, v| Arc::strong_count(v) > 1 || Arc::weak_count(v) > 0); } }; prev_size - self.parts.len() - self.primitives.len() } pub fn collect(&mut self, collection_strategy: CacheCollectionStrategy) -> usize { let mut total_collected = 0; loop { let collected = self.collect_round(collection_strategy); if collected == 0 { break; } total_collected += collected; } total_collected } } #[derive(Debug, Default)] struct TransientDocumentCache { documents: HashMap<PartAlias, Arc<MultipartDocument>>, } impl TransientDocumentCache { pub fn register(&mut self, alias: PartAlias, document: Arc<MultipartDocument>) { self.documents.insert(alias, document); } pub fn query(&self, alias: &PartAlias) -> Option<Arc<MultipartDocument>> { self.documents.get(alias).cloned() } } #[derive(Clone, Debug)] pub enum ResolutionState { Missing, Pending, Subpart, Associated(Arc<MultipartDocument>), } struct DependencyResolver<'a, F, L> { colors: &'a ColorCatalog, cache: Arc<RwLock<PartCache>>, local_cache: TransientDocumentCache, on_update: &'a F, loader: &'a L, pub map: HashMap<PartAlias, ResolutionState>, pub local_map: HashMap<PartAlias, ResolutionState>, } impl<'a, F: Fn(PartAlias, Result<(), ResolutionError>), L: LibraryLoader> DependencyResolver<'a, F, L> { pub fn new( colors: &'a ColorCatalog, cache: Arc<RwLock<PartCache>>, on_update: &'a F, loader: &'a L, ) -> DependencyResolver<'a, F, L> { DependencyResolver { colors, cache, local_cache: TransientDocumentCache::default(), on_update, loader, map: HashMap::new(), local_map: HashMap::new(), } } pub fn contains_state(&self, alias: &PartAlias, local: bool) -> bool { if local { self.local_map.contains_key(alias) } else { self.map.contains_key(alias) } } pub fn put_state(&mut self, alias: PartAlias, local: bool, state: ResolutionState) { if local { self.local_map.insert(alias, state); } else { self.map.insert(alias, state); } } pub fn clear_state(&mut self, alias: &PartAlias, local: bool) { if local { self.local_map.remove(alias); } else { self.map.remove(alias); } } pub fn scan_dependencies(&mut self, document: &Document, local: bool) { for r in document.iter_refs() { let alias = &r.name; if self.contains_state(alias, local) { continue; } if local { if let Some(cached) = self.local_cache.query(alias) { self.scan_dependencies_with_parent(None, Arc::clone(&cached), true); self.put_state( alias.clone(), true, ResolutionState::Associated(Arc::clone(&cached)), ); continue; } } let cached = self.cache.read().unwrap().query(alias); if let Some(cached) = cached { self.scan_dependencies_with_parent(None, Arc::clone(&cached), false); self.put_state( alias.clone(), false, ResolutionState::Associated(Arc::clone(&cached)), ); continue; } self.put_state(alias.clone(), local, ResolutionState::Pending); } } pub fn scan_dependencies_with_parent<D: Deref<Target = MultipartDocument> + Clone>( &mut self, alias: Option<&PartAlias>, parent: D, local: bool, ) { let document = match alias { Some(e) => match parent.subparts.get(e) { Some(e) => e, None => return, }, None => &parent.body, }; for r in document.iter_refs() { let alias = &r.name; if self.contains_state(alias, local) { continue; } if parent.subparts.contains_key(alias) { self.put_state(alias.clone(), local, ResolutionState::Subpart); self.scan_dependencies_with_parent(Some(alias), parent.clone(), local); continue; } if local { if let Some(cached) = self.local_cache.query(alias) { self.scan_dependencies_with_parent(None, Arc::clone(&cached), true); self.put_state( alias.clone(), true, ResolutionState::Associated(Arc::clone(&cached)), ); continue; } } let cached = self.cache.read().unwrap().query(alias); if let Some(cached) = cached { self.scan_dependencies_with_parent(None, Arc::clone(&cached), false); self.put_state( alias.clone(), false, ResolutionState::Associated(Arc::clone(&cached)), ); continue; } self.put_state(alias.clone(), local, ResolutionState::Pending); } } pub async fn resolve_pending_dependencies(&mut self) -> bool { let mut pending = self .local_map .iter() .filter_map(|(k, v)| match v { ResolutionState::Pending => Some((k.clone(), true)), _ => None, }) .collect::<Vec<_>>(); pending.extend(self.map.iter().filter_map(|(k, v)| match v { ResolutionState::Pending => Some((k.clone(), false)), _ => None, })); if pending.is_empty() { return false; } let futs = pending .iter() .map(|(alias, local)| self.loader.load_ref(alias.clone(), *local, self.colors)) .collect::<Vec<_>>(); let result = join_all(futs).await; for ((alias, mut local), result) in pending.iter().zip(result) { let state = match result { Ok((location, document)) => { (self.on_update)(alias.clone(), Ok(())); let document = Arc::new(document); match location { FileLocation::Library(kind) => { if local { self.clear_state(alias, true); } local = false; self.cache.write().unwrap().register( kind, alias.clone(), Arc::clone(&document), ); } FileLocation::Local => { self.local_cache .register(alias.clone(), Arc::clone(&document)); } }; self.scan_dependencies_with_parent(None, Arc::clone(&document), local); ResolutionState::Associated(document) } Err(err) => { (self.on_update)(alias.clone(), Err(err)); ResolutionState::Missing } }; self.put_state(alias.clone(), local, state); } true } } #[derive(Debug, Default)] pub struct ResolutionResult { library_entries: HashMap<PartAlias, Arc<MultipartDocument>>, local_entries: HashMap<PartAlias, Arc<MultipartDocument>>, } impl ResolutionResult { pub fn new() -> Self { Self::default() } pub fn query(&self, alias: &PartAlias, local: bool) -> Option<(Arc<MultipartDocument>, bool)> { if local { let local_entry = self.local_entries.get(alias); if let Some(e) = local_entry { return Some((Arc::clone(e), true)); } } self.library_entries .get(alias) .map(|e| (Arc::clone(e), false)) } pub fn list_dependencies(&self) -> HashSet<PartAlias> { let mut result = HashSet::new(); result.extend(self.library_entries.keys().cloned()); result.extend(self.local_entries.keys().cloned()); result } } pub async fn resolve_dependencies_multipart<F, L>( document: &MultipartDocument, cache: Arc<RwLock<PartCache>>, colors: &ColorCatalog, loader: &L, on_update: &F, ) -> ResolutionResult where F: Fn(PartAlias, Result<(), ResolutionError>), L: LibraryLoader, { let mut resolver = DependencyResolver::new(colors, cache, on_update, loader); resolver.scan_dependencies_with_parent(None, document, true); while resolver.resolve_pending_dependencies().await {} ResolutionResult { library_entries: resolver .map .into_iter() .filter_map(|(k, v)| match v { ResolutionState::Associated(e) => Some((k, e)), _ => None, }) .collect::<HashMap<_, _>>(), local_entries: resolver .local_map .into_iter() .filter_map(|(k, v)| match v { ResolutionState::Associated(e) => Some((k, e)), _ => None, }) .collect::<HashMap<_, _>>(), } } pub async fn resolve_dependencies<F, L>( document: &Document, cache: Arc<RwLock<PartCache>>, colors: &ColorCatalog, loader: &L, on_update: &F, ) -> ResolutionResult where F: Fn(PartAlias, Result<(), ResolutionError>), L: LibraryLoader, { let mut resolver = DependencyResolver::new(colors, cache, on_update, loader); resolver.scan_dependencies(document, true); while resolver.resolve_pending_dependencies().await {} ResolutionResult { library_entries: resolver .map .into_iter() .filter_map(|(k, v)| match v { ResolutionState::Associated(e) => Some((k, e)), _ => None, }) .collect::<HashMap<_, _>>(), local_entries: resolver .local_map .into_iter() .filter_map(|(k, v)| match v { ResolutionState::Associated(e) => Some((k, e)), _ => None, }) .collect::<HashMap<_, _>>(), } } #[cfg(test)] mod tests { use std::{collections::HashMap, sync::Arc}; use super::{PartCache, PartKind}; use crate::{ document::{BfcCertification, Document, MultipartDocument}, PartAlias, }; #[test] fn test_part_cache_query_existing() { let document = MultipartDocument { body: Document { name: "Doc".to_string(), author: "Author".to_string(), description: "Description".to_string(), bfc: BfcCertification::NoCertify, headers: vec![], commands: vec![], }, subparts: HashMap::new(), }; let mut cache = PartCache::new(); let existing_key = PartAlias::from("existing".to_string()); let document = Arc::new(document); cache.register(PartKind::Primitive, existing_key.clone(), document.clone()); assert_eq!(cache.query(&existing_key).unwrap(), document); } #[test] fn test_part_cache_query_missing() { let cache = PartCache::new(); let missing_key = PartAlias::from("missing".to_string()); assert!(cache.query(&missing_key).is_none()); } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/elements.rs
ldraw/src/elements.rs
use crate::color::ColorReference; use crate::{Matrix4, PartAlias, Vector4, Winding}; #[derive(Clone, Debug, PartialEq)] pub struct Header(pub String, pub String); #[derive(Clone, Debug, PartialEq)] pub enum BfcStatement { Winding(Winding), Clip(Option<Winding>), NoClip, InvertNext, } #[derive(Clone, Debug, PartialEq)] pub enum Meta { Comment(String), Step, Write(String), Print(String), Clear, Pause, Save, Bfc(BfcStatement), } #[derive(Clone, Debug, PartialEq)] pub struct PartReference { pub color: ColorReference, pub matrix: Matrix4, pub name: PartAlias, } #[derive(Clone, Debug, PartialEq)] pub struct Line { pub color: ColorReference, pub a: Vector4, pub b: Vector4, } #[derive(Clone, Debug, PartialEq)] pub struct Triangle { pub color: ColorReference, pub a: Vector4, pub b: Vector4, pub c: Vector4, } #[derive(Clone, Debug, PartialEq)] pub struct Quad { pub color: ColorReference, pub a: Vector4, pub b: Vector4, pub c: Vector4, pub d: Vector4, } #[derive(Clone, Debug, PartialEq)] pub struct OptionalLine { pub color: ColorReference, pub a: Vector4, pub b: Vector4, pub c: Vector4, pub d: Vector4, } #[derive(Clone, Debug, PartialEq)] pub enum Command { Meta(Meta), PartReference(PartReference), Line(Line), Triangle(Triangle), Quad(Quad), OptionalLine(OptionalLine), }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/writer.rs
ldraw/src/writer.rs
use std::fmt; use async_trait::async_trait; use cgmath::{Matrix, Vector4}; use tokio::io::{AsyncWrite, AsyncWriteExt}; use crate::color::ColorReference; use crate::document::{BfcCertification, Document, MultipartDocument}; use crate::elements::{ BfcStatement, Command, Header, Line, Meta, OptionalLine, PartReference, Quad, Triangle, }; use crate::error::SerializeError; use crate::Winding; fn serialize_vec3(vec: &Vector4<f32>) -> String { format!("{} {} {}", vec.x, vec.y, vec.z) } impl fmt::Display for ColorReference { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { let code = match self { ColorReference::Unknown(code) => code, ColorReference::Current => &16u32, ColorReference::Complement => &24u32, ColorReference::Color(color) => &color.code, ColorReference::Unresolved(code) => code, }; write!(f, "{}", code) } } #[async_trait] pub trait LDrawWriter { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError>; } #[async_trait] impl LDrawWriter for Header { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { writer .write_all(format!("0 !{} {}\n", self.0, self.1).as_bytes()) .await?; Ok(()) } } #[async_trait] impl LDrawWriter for BfcCertification { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { match self { BfcCertification::NoCertify => writer.write_all(b"0 BFC NOCERTIFY\n").await?, BfcCertification::Certify(Winding::Ccw) => { writer.write_all(b"0 BFC CERTIFY CCW\n").await? } BfcCertification::Certify(Winding::Cw) => { writer.write_all(b"0 BFC CERTIFY CW\n").await? } _ => return Err(SerializeError::NoSerializable), }; Ok(()) } } #[async_trait] impl LDrawWriter for BfcStatement { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { match self { BfcStatement::Winding(Winding::Cw) => writer.write_all(b"0 BFC CW\n").await?, BfcStatement::Winding(Winding::Ccw) => writer.write_all(b"0 BFC CCW\n").await?, BfcStatement::Clip(None) => writer.write_all(b"0 BFC CLIP\n").await?, BfcStatement::Clip(Some(Winding::Cw)) => writer.write_all(b"0 BFC CLIP CW\n").await?, BfcStatement::Clip(Some(Winding::Ccw)) => writer.write_all(b"0 BFC CLIP CW\n").await?, BfcStatement::NoClip => writer.write_all(b"0 BFC NOCLIP\n").await?, BfcStatement::InvertNext => writer.write_all(b"0 BFC INVERTNEXT\n").await?, }; Ok(()) } } #[async_trait] impl LDrawWriter for Document { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { writer .write_all(format!("0 {}\n", self.description).as_bytes()) .await?; writer .write_all(format!("0 Name: {}\n", self.name).as_bytes()) .await?; writer .write_all(format!("0 Author: {}\n", self.author).as_bytes()) .await?; for header in &self.headers { header.write(writer).await?; } writer.write_all(b"\n").await?; match self.bfc.write(writer).await { Ok(()) => { writer.write_all(b"\n").await?; } Err(SerializeError::NoSerializable) => {} Err(e) => return Err(e), }; for command in &self.commands { command.write(writer).await?; } writer.write_all(b"0\n\n").await?; Ok(()) } } #[async_trait] impl LDrawWriter for MultipartDocument { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { self.body.write(writer).await?; for subpart in self.subparts.values() { writer .write_all(format!("0 FILE {}\n", subpart.name).as_bytes()) .await?; subpart.write(writer).await?; } Ok(()) } } #[async_trait] impl LDrawWriter for Meta { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { match self { Meta::Comment(message) => { for line in message.lines() { writer .write_all(format!("0 // {}\n", line).as_bytes()) .await?; } } Meta::Step => { writer.write_all(b"0 STEP\n").await?; } Meta::Write(message) => { for line in message.lines() { writer .write_all(format!("0 WRITE {}\n", line).as_bytes()) .await?; } } Meta::Print(message) => { for line in message.lines() { writer .write_all(format!("0 PRINT {}\n", line).as_bytes()) .await?; } } Meta::Clear => { writer.write_all(b"0 CLEAR\n").await?; } Meta::Pause => { writer.write_all(b"0 PAUSE\n").await?; } Meta::Save => { writer.write_all(b"0 SAVE\n").await?; } Meta::Bfc(bfc) => { bfc.write(writer).await?; } }; Ok(()) } } #[async_trait] impl LDrawWriter for PartReference { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { let m = self.matrix.transpose(); writer .write_all( format!( "1 {} {} {} {} {} {} {} {} {} {} {} {} {}\n", self.color, m.x.w, m.y.w, m.z.w, m.x.x, m.x.y, m.x.z, m.y.x, m.y.y, m.y.z, m.z.x, m.z.y, m.z.z ) .as_bytes(), ) .await?; Ok(()) } } #[async_trait] impl LDrawWriter for Line { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { writer .write_all( format!( "2 {} {} {}\n", self.color, serialize_vec3(&self.a), serialize_vec3(&self.b) ) .as_bytes(), ) .await?; Ok(()) } } #[async_trait] impl LDrawWriter for Triangle { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { writer .write_all( format!( "2 {} {} {} {}\n", self.color, serialize_vec3(&self.a), serialize_vec3(&self.b), serialize_vec3(&self.c) ) .as_bytes(), ) .await?; Ok(()) } } #[async_trait] impl LDrawWriter for Quad { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { writer .write_all( format!( "2 {} {} {} {} {}\n", self.color, serialize_vec3(&self.a), serialize_vec3(&self.b), serialize_vec3(&self.c), serialize_vec3(&self.d) ) .as_bytes(), ) .await?; Ok(()) } } #[async_trait] impl LDrawWriter for OptionalLine { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { writer .write_all( format!( "2 {} {} {} {} {}\n", self.color, serialize_vec3(&self.a), serialize_vec3(&self.b), serialize_vec3(&self.c), serialize_vec3(&self.d) ) .as_bytes(), ) .await?; Ok(()) } } #[async_trait] impl LDrawWriter for Command { async fn write( &self, writer: &mut (dyn AsyncWrite + Unpin + Send), ) -> Result<(), SerializeError> { match self { Command::Meta(meta) => meta.write(writer).await, Command::PartReference(ref_) => ref_.write(writer).await, Command::Line(line) => line.write(writer).await, Command::Triangle(triangle) => triangle.write(writer).await, Command::Quad(quad) => quad.write(writer).await, Command::OptionalLine(optional_line) => optional_line.write(writer).await, } } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/color.rs
ldraw/src/color.rs
use std::collections::HashMap; use std::hash::{Hash, Hasher}; use serde::de::Deserializer; use serde::ser::Serializer; use serde::{Deserialize, Serialize}; use crate::Vector4; #[derive(Clone, Copy, Debug, PartialEq)] pub struct Rgba { value: [u8; 4], } impl Rgba { pub fn new(r: u8, g: u8, b: u8, a: u8) -> Rgba { Rgba { value: [r, g, b, a], } } pub fn from_value(value: u32) -> Rgba { let r = ((value & 0x00ff_0000) >> 16) as u8; let g = ((value & 0x0000_ff00) >> 8) as u8; let b = (value & 0x0000_00ff) as u8; let a = ((value & 0xff00_0000) >> 24) as u8; Rgba { value: [r, g, b, a], } } pub fn red(self) -> u8 { self.value[0] } pub fn green(self) -> u8 { self.value[1] } pub fn blue(self) -> u8 { self.value[2] } pub fn alpha(self) -> u8 { self.value[3] } } impl From<&Rgba> for Vector4 { fn from(src: &Rgba) -> Vector4 { Vector4::new( f32::from(src.red()) / 255.0, f32::from(src.green()) / 255.0, f32::from(src.blue()) / 255.0, f32::from(src.alpha()) / 255.0, ) } } impl From<Rgba> for Vector4 { fn from(src: Rgba) -> Vector4 { Vector4::new( f32::from(src.red()) / 255.0, f32::from(src.green()) / 255.0, f32::from(src.blue()) / 255.0, f32::from(src.alpha()) / 255.0, ) } } #[derive(Clone, Debug, PartialEq)] pub struct MaterialGlitter { pub value: Rgba, pub luminance: u8, pub fraction: f32, pub vfraction: f32, pub size: u32, pub minsize: f32, pub maxsize: f32, } #[derive(Clone, Debug, PartialEq)] pub struct MaterialSpeckle { pub value: Rgba, pub luminance: u8, pub fraction: f32, pub size: u32, pub minsize: f32, pub maxsize: f32, } #[derive(Clone, Debug, PartialEq)] pub enum CustomizedMaterial { Glitter(MaterialGlitter), Speckle(MaterialSpeckle), } #[derive(Clone, Debug, PartialEq)] pub enum Material { Plastic, Chrome, Pearlescent, Rubber, MatteMetallic, Metal, Custom(CustomizedMaterial), } #[derive(Clone, Debug, PartialEq)] pub struct Color { pub code: u32, pub name: String, pub color: Rgba, pub edge: Rgba, pub luminance: u8, pub material: Material, } impl Default for Color { fn default() -> Self { Color { code: 0, name: String::from("Black"), color: Rgba::new(0x05, 0x13, 0x1d, 0xff), edge: Rgba::new(0x59, 0x59, 0x59, 0xff), luminance: 0x00, material: Material::Plastic, } } } impl Color { pub fn is_translucent(&self) -> bool { self.color.alpha() < 255u8 } } pub type ColorCatalog = HashMap<u32, Color>; #[derive(Clone, Debug)] pub enum ColorReference { Unknown(u32), Current, Complement, Color(Color), Unresolved(u32), } impl Eq for ColorReference {} impl PartialEq for ColorReference { fn eq(&self, other: &Self) -> bool { self.code() == other.code() } } impl Hash for ColorReference { fn hash<H: Hasher>(&self, state: &mut H) { self.code().hash(state) } } impl ColorReference { pub fn code(&self) -> u32 { match self { ColorReference::Unknown(c) => *c, ColorReference::Current => 16, ColorReference::Complement => 24, ColorReference::Color(m) => m.code, ColorReference::Unresolved(c) => *c, } } pub fn is_current(&self) -> bool { matches!(self, ColorReference::Current) } pub fn is_complement(&self) -> bool { matches!(self, ColorReference::Complement) } pub fn is_color(&self) -> bool { matches!(self, ColorReference::Color(_)) } pub fn get_color(&self) -> Option<&Color> { match self { ColorReference::Color(m) => Some(m), _ => None, } } fn resolve_blended(code: u32, colors: &ColorCatalog) -> Option<Color> { let code1 = code / 16; let code2 = code % 16; let color1 = match colors.get(&code1) { Some(c) => c, None => return None, }; let color2 = match colors.get(&code2) { Some(c) => c, None => return None, }; let new_color = Rgba::new( color1.color.red() / 2 + color2.color.red() / 2, color1.color.green() / 2 + color2.color.green() / 2, color1.color.blue() / 2 + color2.color.blue() / 2, 255, ); Some(Color { code, name: format!("Blended Color ({} and {})", code1, code2), color: new_color, edge: Rgba::from_value(0xff59_5959), luminance: 0, material: Material::Plastic, }) } fn resolve_rgb_4(code: u32) -> Color { let red = (((code & 0xf00) >> 8) * 16) as u8; let green = (((code & 0x0f0) >> 4) * 16) as u8; let blue = ((code & 0x00f) * 16) as u8; let edge_red = (((code & 0xf0_0000) >> 20) * 16) as u8; let edge_green = (((code & 0x0f_0000) >> 16) * 16) as u8; let edge_blue = (((code & 0x00_f000) >> 12) * 16) as u8; Color { code, name: format!("RGB Color ({:03x})", code & 0xfff), color: Rgba::new(red, green, blue, 255), edge: Rgba::new(edge_red, edge_green, edge_blue, 255), luminance: 0, material: Material::Plastic, } } fn resolve_rgb_2(code: u32) -> Color { Color { code, name: format!("RGB Color ({:06x})", code & 0xff_ffff), color: Rgba::from_value(0xff00_0000 | (code & 0xff_ffff)), edge: Rgba::from_value(0xff59_5959), luminance: 0, material: Material::Plastic, } } pub fn resolve(code: u32, colors: &ColorCatalog) -> ColorReference { match code { 16 => return ColorReference::Current, 24 => return ColorReference::Complement, _ => (), } if let Some(c) = colors.get(&code) { return ColorReference::Color(c.clone()); } if (256..=512).contains(&code) { if let Some(c) = ColorReference::resolve_blended(code, colors) { return ColorReference::Color(c); } } if (code & 0xff00_0000) == 0x0200_0000 { return ColorReference::Color(ColorReference::resolve_rgb_2(code)); } else if (code & 0xff00_0000) == 0x0400_0000 { return ColorReference::Color(ColorReference::resolve_rgb_4(code)); } ColorReference::Unknown(code) } pub fn resolve_self(&mut self, colors: &ColorCatalog) { if let ColorReference::Unresolved(code) = self { *self = ColorReference::resolve(*code, colors); } } pub fn get_color_rgba(&self) -> Option<Vector4> { match self { ColorReference::Color(c) => Some(c.color.into()), _ => None, } } pub fn get_edge_color_rgba(&self) -> Option<Vector4> { match self { ColorReference::Color(m) => Some(m.edge.into()), _ => None, } } } impl<'de> Deserialize<'de> for ColorReference { fn deserialize<D>(_deserializer: D) -> Result<Self, D::Error> where D: Deserializer<'de>, { panic!("Deserializing ColorReference is not supported"); } } impl Serialize for ColorReference { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: Serializer, { serializer.serialize_u32(self.code()) } } impl From<ColorReference> for u32 { fn from(value: ColorReference) -> Self { value.code() } } #[derive(Clone, Copy, Debug, Eq, PartialEq, Hash, Deserialize, Serialize)] pub struct ColorCode(u32); impl From<ColorReference> for ColorCode { fn from(value: ColorReference) -> Self { Self(value.code()) } } impl From<ColorCode> for u32 { fn from(value: ColorCode) -> Self { value.0 } } impl From<u32> for ColorCode { fn from(value: u32) -> Self { Self(value) } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/resolvers/local.rs
ldraw/src/resolvers/local.rs
use std::path::PathBuf; use async_trait::async_trait; use tokio::{ fs::{try_exists, File}, io::BufReader, }; use crate::{ color::ColorCatalog, document::MultipartDocument, error::ResolutionError, library::{DocumentLoader, FileLocation, LibraryLoader, PartKind}, parser::{parse_color_definitions, parse_multipart_document}, PartAlias, }; pub struct LocalLoader { ldrawdir: Option<PathBuf>, cwd: Option<PathBuf>, } impl LocalLoader { pub fn new(ldrawdir: Option<PathBuf>, cwd: Option<PathBuf>) -> Self { LocalLoader { ldrawdir, cwd } } } #[async_trait(?Send)] impl DocumentLoader<PathBuf> for LocalLoader { async fn load_document( &self, locator: &PathBuf, colors: &ColorCatalog, ) -> Result<MultipartDocument, ResolutionError> { if !try_exists(&locator).await? { return Err(ResolutionError::FileNotFound); } Ok( parse_multipart_document(&mut BufReader::new(File::open(locator).await?), colors) .await?, ) } } #[async_trait(?Send)] impl LibraryLoader for LocalLoader { async fn load_colors(&self) -> Result<ColorCatalog, ResolutionError> { let ldrawdir = match self.ldrawdir.clone() { Some(e) => e, None => return Err(ResolutionError::NoLDrawDir), }; let path = { let mut path = ldrawdir.clone(); path.push("LDConfig.ldr"); path }; if !try_exists(&path).await? { return Err(ResolutionError::FileNotFound); } Ok(parse_color_definitions(&mut BufReader::new(File::open(&*path).await?)).await?) } async fn load_ref( &self, alias: PartAlias, local: bool, colors: &ColorCatalog, ) -> Result<(FileLocation, MultipartDocument), ResolutionError> { let ldrawdir = match self.ldrawdir.clone() { Some(e) => e, None => return Err(ResolutionError::NoLDrawDir), }; let cwd_path = self.cwd.as_ref().map(|v| { let mut path = v.clone(); path.push(alias.normalized.clone()); path }); let parts_path = { let mut path = ldrawdir.clone(); path.push("parts"); path.push(alias.normalized.clone()); path }; let p_path = { let mut path = ldrawdir.clone(); path.push("p"); path.push(alias.normalized.clone()); path }; let (kind, path) = if local && cwd_path.is_some() && try_exists(&cwd_path.as_ref().unwrap()).await? { (FileLocation::Local, cwd_path.as_ref().unwrap()) } else if try_exists(&parts_path).await? { (FileLocation::Library(PartKind::Part), &parts_path) } else if try_exists(&p_path).await? { (FileLocation::Library(PartKind::Primitive), &p_path) } else { return Err(ResolutionError::FileNotFound); }; let document = parse_multipart_document(&mut BufReader::new(File::open(&**path).await?), colors) .await?; Ok((kind, document)) } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/resolvers/http.rs
ldraw/src/resolvers/http.rs
use async_trait::async_trait; use futures::join; use reqwest::{Client, Error, Response, StatusCode, Url}; use tokio::io::BufReader; use crate::{ color::ColorCatalog, document::MultipartDocument, error::ResolutionError, library::{DocumentLoader, FileLocation, LibraryLoader, PartKind}, parser::{parse_color_definitions, parse_multipart_document}, PartAlias, }; pub struct HttpLoader { ldraw_url_base: Option<Url>, document_url_base: Option<Url>, client: Client, } impl HttpLoader { pub fn new(ldraw_url_base: Option<Url>, document_url_base: Option<Url>) -> Self { HttpLoader { ldraw_url_base, document_url_base, client: Client::new(), } } } #[async_trait(?Send)] impl DocumentLoader<String> for HttpLoader { async fn load_document( &self, locator: &String, colors: &ColorCatalog, ) -> Result<MultipartDocument, ResolutionError> { let url = match Url::parse(locator) { Ok(e) => e, Err(_) => return Err(ResolutionError::FileNotFound), }; let bytes = self.client.get(url).send().await?.bytes().await?; Ok(parse_multipart_document(&mut BufReader::new(&*bytes), colors).await?) } } #[async_trait(?Send)] impl LibraryLoader for HttpLoader { async fn load_colors(&self) -> Result<ColorCatalog, ResolutionError> { let ldraw_url_base = self.ldraw_url_base.as_ref(); let ldraw_url_base = match ldraw_url_base { Some(ref e) => e, None => return Err(ResolutionError::NoLDrawDir), }; let url = ldraw_url_base.join("LDConfig.ldr").unwrap(); let response = self.client.get(url).send().await?; if response.status() == StatusCode::NOT_FOUND { Err(ResolutionError::FileNotFound) } else { let bytes = response.bytes().await?; Ok(parse_color_definitions(&mut BufReader::new(&*bytes)).await?) } } async fn load_ref( &self, alias: PartAlias, local: bool, colors: &ColorCatalog, ) -> Result<(FileLocation, MultipartDocument), ResolutionError> { let ldraw_url_base = self.ldraw_url_base.as_ref(); let ldraw_url_base = match ldraw_url_base { Some(ref e) => e, None => return Err(ResolutionError::NoLDrawDir), }; let parts_url = ldraw_url_base .join(&format!("parts/{}", alias.normalized)) .unwrap(); let p_url = ldraw_url_base .join(&format!("p/{}", alias.normalized)) .unwrap(); let parts_fut = self.client.get(parts_url).send(); let p_fut = self.client.get(p_url).send(); let (location, res) = if local && self.document_url_base.is_some() { let document_url_base = self.document_url_base.as_ref().unwrap(); let local_url = document_url_base.join(&alias.normalized).unwrap(); let local_fut = self.client.get(local_url).send(); let (local, parts, p) = join!(local_fut, parts_fut, p_fut); if let Some(v) = select_response(local) { (FileLocation::Local, v) } else if let Some(v) = select_response(parts) { (FileLocation::Library(PartKind::Part), v) } else if let Some(v) = select_response(p) { (FileLocation::Library(PartKind::Primitive), v) } else { return Err(ResolutionError::FileNotFound); } } else { let (parts, p) = join!(parts_fut, p_fut); if let Some(v) = select_response(parts) { (FileLocation::Library(PartKind::Part), v) } else if let Some(v) = select_response(p) { (FileLocation::Library(PartKind::Primitive), v) } else { return Err(ResolutionError::FileNotFound); } }; let bytes = res.bytes().await?; Ok(( location, parse_multipart_document(&mut BufReader::new(&*bytes), colors).await?, )) } } fn select_response(response: Result<Response, Error>) -> Option<Response> { match response { Ok(r) => { if r.status() == StatusCode::OK { Some(r) } else { None } } Err(_) => None, } }
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
segfault87/ldraw.rs
https://github.com/segfault87/ldraw.rs/blob/50691a378e23210183a0ebbc84760d5cf5819b1b/ldraw/src/resolvers/mod.rs
ldraw/src/resolvers/mod.rs
#[cfg(any(target_arch = "wasm32", feature = "http"))] pub mod http; #[cfg(not(target_arch = "wasm32"))] pub mod local;
rust
MIT
50691a378e23210183a0ebbc84760d5cf5819b1b
2026-01-04T20:25:16.216619Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/lib.rs
crates/hwp-core/src/lib.rs
/// HWP Core Library /// /// This library provides core functionality for parsing HWP files. /// It accepts byte arrays as input to support cross-platform usage. pub mod cfb; pub mod decompress; pub mod document; pub mod error; pub mod types; pub mod viewer; use ::cfb::CompoundFile; use std::io::Cursor; pub use cfb::CfbParser; pub use decompress::{decompress_deflate, decompress_zlib}; pub use document::{ BinData, BinDataRecord, BodyText, BorderFill, Bullet, CharShape, DocInfo, DocumentProperties, FaceName, FileHeader, HwpDocument, IdMappings, Numbering, ParaShape, Section, SummaryInformation, TabDef, }; pub use error::{CompressionFormat, HwpError}; pub use types::{ RecordHeader, BYTE, COLORREF, DWORD, HWPUNIT, HWPUNIT16, INT16, INT32, INT8, SHWPUNIT, UINT, UINT16, UINT32, UINT8, WCHAR, WORD, }; /// Main HWP parser structure pub struct HwpParser { // Placeholder for future implementation } impl HwpParser { /// Create a new HWP parser pub fn new() -> Self { Self {} } /// Parse HWP file from byte array /// /// # Arguments /// * `data` - Byte array containing the HWP file data /// /// # Returns /// Parsed HWP document structure pub fn parse(&self, data: &[u8]) -> Result<HwpDocument, HwpError> { // Parse CFB structure let mut cfb = CfbParser::parse(data)?; // Parse required streams let fileheader = self.parse_fileheader(&mut cfb)?; let mut document = HwpDocument::new(fileheader.clone()); document.doc_info = self.parse_docinfo(&mut cfb, &fileheader)?; document.body_text = self.parse_bodytext(&mut cfb, &fileheader, &document.doc_info)?; document.bin_data = self.parse_bindata(&mut cfb, &document.doc_info)?; // Parse optional streams self.parse_optional_streams(&mut cfb, &fileheader, &mut document, data); // Resolve derived display texts (e.g., AUTO_NUMBER in captions) for JSON/viewers. document.resolve_display_texts(); Ok(document) } // ===== Required parsing methods ===== /// Parse FileHeader stream fn parse_fileheader( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, ) -> Result<FileHeader, HwpError> { let fileheader_data = CfbParser::read_stream(cfb, "FileHeader")?; FileHeader::parse(&fileheader_data).map_err(|e| error::HwpError::from(e)) } /// Parse DocInfo stream fn parse_docinfo( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, fileheader: &FileHeader, ) -> Result<DocInfo, HwpError> { let docinfo_data = CfbParser::read_stream(cfb, "DocInfo")?; DocInfo::parse(&docinfo_data, fileheader).map_err(|e| error::HwpError::from(e)) } /// Parse BodyText storage /// 구역 개수는 DocumentProperties의 area_count에서 가져옵니다 / Get section count from DocumentProperties.area_count fn parse_bodytext( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, fileheader: &FileHeader, doc_info: &DocInfo, ) -> Result<BodyText, HwpError> { let section_count = doc_info .document_properties .as_ref() .map(|props| props.area_count) .unwrap_or(1); // 기본값은 1 / Default is 1 BodyText::parse(cfb, fileheader, section_count).map_err(|e| error::HwpError::from(e)) } /// Parse BinData storage /// 표 17의 bin_data_records를 사용하여 스트림을 찾습니다 (EMBEDDING/STORAGE 타입의 binary_data_id와 extension 사용) /// Use bin_data_records from Table 17 to find streams (use binary_data_id and extension for EMBEDDING/STORAGE types) fn parse_bindata( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, doc_info: &DocInfo, ) -> Result<BinData, HwpError> { use crate::document::BinaryDataFormat; BinData::parse(cfb, BinaryDataFormat::Base64, &doc_info.bin_data) .map_err(|e| error::HwpError::from(e)) } // ===== Optional parsing methods ===== /// Parse all optional streams (failures are logged but don't stop parsing) fn parse_optional_streams( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, fileheader: &FileHeader, document: &mut HwpDocument, data: &[u8], ) { self.parse_preview_text(cfb, document); self.parse_preview_image(cfb, document); self.parse_scripts(cfb, document); self.parse_xml_template(cfb, fileheader, document); self.parse_summary_information(cfb, document, data); } /// Parse PreviewText stream (optional) /// 미리보기 텍스트 스트림 파싱 / Parse preview text stream /// 스펙 문서 3.2.6: PrvText 스트림에는 미리보기 텍스트가 유니코드 문자열로 저장됩니다. /// Spec 3.2.6: PrvText stream contains preview text stored as Unicode string. fn parse_preview_text( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, document: &mut HwpDocument, ) { if let Ok(prvtext_data) = CfbParser::read_stream(cfb, "PrvText") { match crate::document::PreviewText::parse(&prvtext_data) { Ok(preview_text) => { document.preview_text = Some(preview_text); } Err(e) => { #[cfg(debug_assertions)] eprintln!("Warning: Failed to parse PrvText stream: {}", e); } } } } /// Parse PreviewImage stream (optional) /// 미리보기 이미지 스트림 파싱 / Parse preview image stream /// 스펙 문서 3.2.7: PrvImage 스트림에는 미리보기 이미지가 BMP 또는 GIF 형식으로 저장됩니다. /// Spec 3.2.7: PrvImage stream contains preview image stored as BMP or GIF format. fn parse_preview_image( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, document: &mut HwpDocument, ) { if let Ok(prvimage_data) = CfbParser::read_stream(cfb, "PrvImage") { match crate::document::PreviewImage::parse(&prvimage_data, None) { Ok(preview_image) => { document.preview_image = Some(preview_image); } Err(e) => { #[cfg(debug_assertions)] eprintln!("Warning: Failed to parse PrvImage stream: {}", e); } } } } /// Parse Scripts storage (optional) /// 스크립트 스토리지 파싱 / Parse scripts storage /// 스펙 문서 3.2.9: Scripts 스토리지에는 Script 코드가 저장됩니다. /// Spec 3.2.9: Scripts storage contains Script code. fn parse_scripts(&self, cfb: &mut CompoundFile<Cursor<&[u8]>>, document: &mut HwpDocument) { match crate::document::Scripts::parse(cfb) { Ok(scripts) => { document.scripts = Some(scripts); } Err(e) => { #[cfg(debug_assertions)] eprintln!("Warning: Failed to parse Scripts storage: {}", e); } } } /// Parse XMLTemplate storage (optional) /// XML 템플릿 스토리지 파싱 / Parse XML template storage /// 스펙 문서 3.2.10: XMLTemplate 스토리지에는 XML Template 정보가 저장됩니다. /// Spec 3.2.10: XMLTemplate storage contains XML Template information. /// FileHeader의 document_flags Bit 5를 확인하여 XMLTemplate 스토리지 존재 여부 확인 /// Check FileHeader document_flags Bit 5 to determine if XMLTemplate storage exists fn parse_xml_template( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, fileheader: &FileHeader, document: &mut HwpDocument, ) { if fileheader.has_xml_template() { match crate::document::XmlTemplate::parse(cfb) { Ok(xml_template) => { // 모든 필드가 None이 아닌 경우에만 설정 / Only set if at least one field is not None if xml_template.schema_name.is_some() || xml_template.schema.is_some() || xml_template.instance.is_some() { document.xml_template = Some(xml_template); } } Err(e) => { #[cfg(debug_assertions)] eprintln!("Warning: Failed to parse XMLTemplate storage: {}", e); } } } } /// Parse SummaryInformation stream (optional) /// 문서 요약 스트림 파싱 / Parse summary information stream /// 스펙 문서 3.2.4: \005HwpSummaryInformation 스트림에는 문서 요약 정보가 MSDN Property Set 형식으로 저장됩니다. /// Spec 3.2.4: \005HwpSummaryInformation stream contains document summary information stored in MSDN Property Set format. /// 스트림 이름은 "\005HwpSummaryInformation" (바이트: 0x05 + "HwpSummaryInformation") /// Stream name is "\005HwpSummaryInformation" (bytes: 0x05 + "HwpSummaryInformation") fn parse_summary_information( &self, cfb: &mut CompoundFile<Cursor<&[u8]>>, document: &mut HwpDocument, data: &[u8], ) { match Self::read_summary_information_stream(cfb, data) { Ok(summary_bytes) => { #[cfg(debug_assertions)] { eprintln!( "Debug: Successfully read SummaryInformation stream, size: {} bytes", summary_bytes.len() ); if summary_bytes.len() >= 2 { eprintln!( "Debug: Byte order: 0x{:02X}{:02X}", summary_bytes[0], summary_bytes[1] ); } } match crate::document::SummaryInformation::parse(&summary_bytes) { Ok(summary_information) => { #[cfg(debug_assertions)] eprintln!("Debug: Successfully parsed SummaryInformation"); document.summary_information = Some(summary_information); } Err(e) => { #[cfg(debug_assertions)] { eprintln!("Warning: Failed to parse SummaryInformation stream: {}", e); eprintln!(" Stream size: {} bytes", summary_bytes.len()); if summary_bytes.len() >= 40 { eprintln!(" First 40 bytes: {:?}", &summary_bytes[..40]); eprintln!( " Byte order: 0x{:02X}{:02X}", summary_bytes[0], summary_bytes[1] ); eprintln!( " Version: 0x{:02X}{:02X}", summary_bytes[2], summary_bytes[3] ); } } // 파싱 실패 시 None으로 유지 (raw_data 저장 안 함) / Keep None on parse failure (don't store raw_data) } } } Err(e) => { #[cfg(debug_assertions)] { eprintln!("Warning: Failed to read SummaryInformation stream: {}", e); eprintln!(" Tried: \\u{{0005}}HwpSummaryInformation, \\x05HwpSummaryInformation, HwpSummaryInformation"); } // 스트림이 없으면 None으로 유지 (정상) / Keep None if stream doesn't exist (normal) } } } /// Try to read SummaryInformation stream with multiple name variations /// 여러 가능한 스트림 이름 시도 / Try multiple possible stream names /// CFB 라이브러리는 특수 문자를 포함한 스트림 이름을 처리할 수 있도록 바이트 배열로 변환 필요 /// CFB library may need byte array conversion for stream names with special characters fn read_summary_information_stream( cfb: &mut CompoundFile<Cursor<&[u8]>>, data: &[u8], ) -> Result<Vec<u8>, HwpError> { const STREAM_NAMES: &[&str] = &[ "\u{0005}HwpSummaryInformation", "\x05HwpSummaryInformation", "HwpSummaryInformation", ]; // Try string-based names first for name in STREAM_NAMES { match CfbParser::read_stream(cfb, name) { Ok(stream_data) => return Ok(stream_data), Err(e) => { #[cfg(debug_assertions)] eprintln!("Debug: Failed to read with {}: {}", name, e); } } } // If all string-based attempts fail, try parsing CFB bytes directly // 모든 문자열 기반 시도가 실패하면 CFB 바이트를 직접 파싱 시도 #[cfg(debug_assertions)] eprintln!("Debug: All string-based attempts failed, trying direct byte parsing for \\005HwpSummaryInformation"); let stream_name_bytes = b"\x05HwpSummaryInformation"; CfbParser::read_stream_by_bytes(data, stream_name_bytes) } /// Parse HWP file and return FileHeader as JSON /// /// # Arguments /// * `data` - Byte array containing the HWP file data /// /// # Returns /// FileHeader as JSON string pub fn parse_fileheader_json(&self, data: &[u8]) -> Result<String, HwpError> { // Parse CFB structure let mut cfb = CfbParser::parse(data)?; // Read and parse FileHeader let fileheader_data = CfbParser::read_stream(&mut cfb, "FileHeader")?; let fileheader = FileHeader::parse(&fileheader_data).map_err(|e| error::HwpError::from(e))?; // Convert to JSON fileheader.to_json().map_err(|e| error::HwpError::from(e)) } /// Parse HWP file and return SummaryInformation as JSON /// /// # Arguments /// * `data` - Byte array containing the HWP file data /// /// # Returns /// SummaryInformation as JSON string, or empty JSON object if not found pub fn parse_summary_information_json(&self, data: &[u8]) -> Result<String, HwpError> { // Parse CFB structure let mut cfb = CfbParser::parse(data)?; // Use the shared helper method to read the stream match Self::read_summary_information_stream(&mut cfb, data) { Ok(summary_bytes) => { let summary_information = crate::document::SummaryInformation::parse(&summary_bytes) .map_err(|e| error::HwpError::from(e))?; // Convert to JSON serde_json::to_string_pretty(&summary_information).map_err(error::HwpError::from) } Err(_) => { // 스트림이 없으면 빈 SummaryInformation을 JSON으로 반환 // If stream doesn't exist, return empty SummaryInformation as JSON let empty_summary = crate::document::SummaryInformation::default(); serde_json::to_string_pretty(&empty_summary).map_err(error::HwpError::from) } } } } impl Default for HwpParser { fn default() -> Self { Self::new() } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/cfb.rs
crates/hwp-core/src/cfb.rs
/// CFB (Compound File Binary) parsing module /// /// This module handles parsing of CFB structures used in HWP files. /// HWP 파일은 CFB 형식을 사용하여 여러 스토리지와 스트림을 포함합니다. /// /// 스펙 문서 매핑: 표 2 - 파일 구조 (CFB 구조) use crate::error::HwpError; use cfb::CompoundFile; use std::io::{Cursor, Read}; /// CFB parser for HWP files /// HWP 파일용 CFB 파서 pub struct CfbParser; impl CfbParser { /// Parse CFB structure from byte array /// 바이트 배열에서 CFB 구조를 파싱합니다. /// /// # Arguments /// * `data` - Byte array containing CFB file data / CFB 파일 데이터를 포함하는 바이트 배열 /// /// # Returns /// Parsed CompoundFile structure / 파싱된 CompoundFile 구조체 pub fn parse(data: &[u8]) -> Result<CompoundFile<Cursor<&[u8]>>, HwpError> { let cursor = Cursor::new(data); CompoundFile::open(cursor).map_err(|e| HwpError::CfbParse(e.to_string())) } /// Read a stream from CFB structure (root level) /// CFB 구조에서 스트림을 읽습니다 (루트 레벨). /// /// # Arguments /// * `cfb` - CompoundFile structure (mutable reference required) / CompoundFile 구조체 (가변 참조 필요) /// * `stream_name` - Name of the stream to read / 읽을 스트림 이름 /// /// # Returns /// Stream content as byte vector / 바이트 벡터로 된 스트림 내용 pub fn read_stream( cfb: &mut CompoundFile<Cursor<&[u8]>>, stream_name: &str, ) -> Result<Vec<u8>, HwpError> { // Try to open stream with the given name // 주어진 이름으로 스트림 열기 시도 match cfb.open_stream(stream_name) { Ok(mut stream) => { let mut buffer = Vec::new(); stream .read_to_end(&mut buffer) .map_err(|e| HwpError::stream_read_error(stream_name, e.to_string()))?; Ok(buffer) } Err(_) => { // If the stream name contains special characters (like \x05), // cfb crate's open_stream may not handle it correctly. // We need to parse CFB file bytes directly to find the stream. // 스트림 이름에 특수 문자가 포함된 경우 (예: \x05), // cfb crate의 open_stream이 이를 올바르게 처리하지 못할 수 있습니다. // CFB 파일의 바이트를 직접 파싱하여 스트림을 찾아야 합니다. Err(HwpError::stream_not_found(stream_name, "root")) } } } /// Read a stream by parsing CFB directory entries directly (for streams with special characters) /// CFB 디렉토리 엔트리를 직접 파싱하여 스트림 읽기 (특수 문자가 포함된 스트림용) /// /// # Arguments /// * `data` - Original CFB file data / 원본 CFB 파일 데이터 /// * `stream_name_bytes` - Stream name as bytes (UTF-16LE encoded) / 바이트로 된 스트림 이름 (UTF-16LE 인코딩) /// /// # Returns /// Stream content as byte vector / 바이트 벡터로 된 스트림 내용 pub fn read_stream_by_bytes( data: &[u8], stream_name_bytes: &[u8], ) -> Result<Vec<u8>, HwpError> { #[cfg(debug_assertions)] eprintln!( "Debug: read_stream_by_bytes called, data len: {}, stream_name: {:?}", data.len(), stream_name_bytes ); if data.len() < 512 { return Err(HwpError::CfbFileTooSmall { expected: 512, actual: data.len(), }); } // CFB Header structure (first 512 bytes) // CFB 헤더 구조 (처음 512 바이트) // Sector size is usually 512 bytes, but can be different // 섹터 크기는 보통 512 바이트이지만 다를 수 있음 // Read sector size from header (offset 0x1E, 2 bytes) // 헤더에서 섹터 크기 읽기 (오프셋 0x1E, 2 바이트) let sector_size = if data.len() >= 0x20 { let sector_size_shift = u16::from_le_bytes([data[0x1E], data[0x1F]]) as u32; if sector_size_shift > 12 { return Err(HwpError::InvalidSectorSize { value: sector_size_shift, }); } 1 << sector_size_shift // Usually 512 (2^9) } else { 512 // Default }; // Read directory sector location (offset 0x30, 4 bytes) // 디렉토리 섹터 위치 읽기 (오프셋 0x30, 4 바이트) let dir_sector = if data.len() >= 0x34 { u32::from_le_bytes([data[0x30], data[0x31], data[0x32], data[0x33]]) } else { return Err(HwpError::CfbFileTooSmall { expected: 0x34, actual: data.len(), }); }; // Convert stream name to UTF-16LE bytes for comparison // 스트림 이름을 UTF-16LE 바이트로 변환하여 비교 // CFB directory entries store names as UTF-16LE (2 bytes per character) // CFB 디렉토리 엔트리는 이름을 UTF-16LE로 저장 (문자당 2 바이트) // The name length field stores the UTF-16LE character count (including null terminator) // 이름 길이 필드는 UTF-16LE 문자 개수를 저장 (null 종료 문자 포함) let mut stream_name_utf16 = Vec::new(); for &b in stream_name_bytes { stream_name_utf16.push(b); stream_name_utf16.push(0); // UTF-16LE: each ASCII char is 2 bytes (low byte, high byte=0) } // Null terminator (2 bytes for UTF-16LE) // 널 종료 문자 (UTF-16LE는 2 바이트) stream_name_utf16.push(0); stream_name_utf16.push(0); // Expected name length in UTF-16LE characters (including null terminator) // 예상되는 UTF-16LE 문자 개수 (null 종료 문자 포함) let expected_name_length = (stream_name_utf16.len() / 2) as u16; #[cfg(debug_assertions)] eprintln!( "Debug: Stream name UTF-16LE: {:?} (first 20 bytes)", &stream_name_utf16[..20.min(stream_name_utf16.len())] ); // Read directory entries // 디렉토리 엔트리 읽기 // Each directory entry is 128 bytes // 각 디렉토리 엔트리는 128 바이트 // Directory entries are stored in sectors // 디렉토리 엔트리는 섹터에 저장됨 // CFB structure: Header (512 bytes) + Sectors // CFB 구조: 헤더 (512 바이트) + 섹터들 // First sector starts at offset = sector_size (usually 512) // 첫 번째 섹터는 오프셋 = sector_size (보통 512)부터 시작 // Directory sector number is 0-indexed, so: // 디렉토리 섹터 번호는 0부터 시작하므로: // dir_start = sector_size + (dir_sector * sector_size) // But if dir_sector is -1 (ENDOFCHAIN), it means no directory // 하지만 dir_sector가 -1 (ENDOFCHAIN)이면 디렉토리가 없음 let dir_entry_size = 128; let dir_start = if dir_sector == 0xFFFFFFFF { return Err(HwpError::InvalidDirectorySector { reason: "ENDOFCHAIN marker found".to_string(), }); } else { (sector_size as usize) + (dir_sector as usize * sector_size as usize) }; #[cfg(debug_assertions)] eprintln!( "Debug: dir_sector: {}, sector_size: {}, dir_start: {}", dir_sector, sector_size, dir_start ); if dir_start >= data.len() { return Err(HwpError::InvalidDirectorySector { reason: format!( "Directory sector offset {} is beyond file size {}", dir_start, data.len() ), }); } #[cfg(debug_assertions)] eprintln!( "Debug: Searching directory entries, dir_start: {}, sector_size: {}", dir_start, sector_size ); // Search through directory entries (max 128 entries per sector) // 디렉토리 엔트리 검색 (섹터당 최대 128 엔트리) for i in 0..128 { let entry_offset = dir_start + (i * dir_entry_size); if entry_offset + dir_entry_size > data.len() { break; } // Read entry name length (first 2 bytes, UTF-16LE character count) // 엔트리 이름 길이 읽기 (처음 2 바이트, UTF-16LE 문자 개수) let name_length = u16::from_le_bytes([data[entry_offset], data[entry_offset + 1]]) as usize; // Check if entry is empty (name_length == 0 or invalid) // 엔트리가 비어있는지 확인 (name_length == 0 또는 유효하지 않음) if name_length == 0 || name_length > 32 { continue; // Skip empty or invalid entries } // Read entry name (UTF-16LE, up to 64 bytes = 32 characters) // 엔트리 이름 읽기 (UTF-16LE, 최대 64 바이트 = 32 문자) // Name is stored as UTF-16LE, so actual byte length is name_length * 2 // 이름은 UTF-16LE로 저장되므로 실제 바이트 길이는 name_length * 2 let name_byte_length = name_length * 2; let name_start = entry_offset + 2; // Skip length field let name_end = name_start + name_byte_length.min(64); let entry_name_bytes = &data[name_start..name_end]; // Pad entry_name_bytes to 64 bytes for comparison // 비교를 위해 entry_name_bytes를 64 바이트로 패딩 let mut entry_name = [0u8; 64]; entry_name[..entry_name_bytes.len().min(64)] .copy_from_slice(&entry_name_bytes[..entry_name_bytes.len().min(64)]); // Check entry type (offset 66 from entry start, 1 byte) // 엔트리 타입 확인 (엔트리 시작부터 오프셋 66, 1 바이트) let entry_type = data[entry_offset + 66]; // Check if entry name starts with our stream name (for debugging) // 디버깅을 위해 엔트리 이름이 스트림 이름으로 시작하는지 확인 #[cfg(debug_assertions)] if i < 20 || entry_type == 2 { let name_str = String::from_utf16_lossy( &entry_name_bytes .chunks(2) .take_while(|chunk| chunk.len() == 2 && (chunk[0] != 0 || chunk[1] != 0)) .map(|chunk| u16::from_le_bytes([chunk[0], chunk[1]])) .collect::<Vec<_>>(), ); eprintln!( "Debug: Entry {} type: {}, name_length: {}, name: {:?} (bytes: {:?})", i, entry_type, name_length, name_str, &entry_name_bytes[..20.min(entry_name_bytes.len())] ); } // Compare names byte-by-byte // 바이트 단위로 이름 비교 // Compare the actual name bytes // 실제 이름 바이트 비교 // Check if name length matches and bytes match // 이름 길이가 일치하고 바이트가 일치하는지 확인 let name_matches = name_length == expected_name_length as usize && entry_name_bytes.len() >= stream_name_utf16.len() && entry_name_bytes[..stream_name_utf16.len()] == stream_name_utf16[..]; if name_matches { #[cfg(debug_assertions)] eprintln!( "Debug: Found matching entry at index {} (type: {})", i, entry_type ); // Found matching entry, check if it's a stream (type = 2) // 일치하는 엔트리를 찾았으므로 스트림인지 확인 (타입 = 2) if entry_type != 2 { #[cfg(debug_assertions)] eprintln!( "Debug: Entry is not a stream (type: {}), continuing...", entry_type ); // Not a stream continue; } // Read starting sector (offset 116, 4 bytes) // 시작 섹터 읽기 (오프셋 116, 4 바이트) let start_sector = u32::from_le_bytes([ data[entry_offset + 116], data[entry_offset + 117], data[entry_offset + 118], data[entry_offset + 119], ]); // Read stream size (offset 120, 4 bytes for small streams, 8 bytes for large) // 스트림 크기 읽기 (오프셋 120, 작은 스트림은 4 바이트, 큰 스트림은 8 바이트) let stream_size = u32::from_le_bytes([ data[entry_offset + 120], data[entry_offset + 121], data[entry_offset + 122], data[entry_offset + 123], ]) as usize; if stream_size == 0 { return Ok(Vec::new()); } // Read stream data // 스트림 데이터 읽기 let stream_start = (start_sector as usize + 1) * (sector_size as usize); if stream_start + stream_size > data.len() { return Err(HwpError::InvalidDirectorySector { reason: format!( "Stream data offset {} + size {} is beyond file size {}", stream_start, stream_size, data.len() ), }); } return Ok(data[stream_start..stream_start + stream_size].to_vec()); } } Err(HwpError::stream_not_found( String::from_utf8_lossy(stream_name_bytes), "root (byte search)", )) } /// Read a stream from nested storage (e.g., BodyText/Section0) /// 중첩된 스토리지에서 스트림을 읽습니다 (예: BodyText/Section0). /// /// # Arguments /// * `cfb` - CompoundFile structure (mutable reference required) / CompoundFile 구조체 (가변 참조 필요) /// * `storage_name` - Name of the storage (e.g., "BodyText") / 스토리지 이름 (예: "BodyText") /// * `stream_name` - Name of the stream within the storage (e.g., "Section0") / 스토리지 내 스트림 이름 (예: "Section0") /// /// # Returns /// Stream content as byte vector / 바이트 벡터로 된 스트림 내용 pub fn read_nested_stream( cfb: &mut CompoundFile<Cursor<&[u8]>>, storage_name: &str, stream_name: &str, ) -> Result<Vec<u8>, HwpError> { // First, try to open the storage and then the stream // If open_storage is not available, fall back to path-based approach // 먼저 스토리지를 열고 그 안에서 스트림을 열려고 시도합니다. // open_storage를 사용할 수 없는 경우 경로 기반 접근 방식으로 폴백합니다. let path = format!("{}/{}", storage_name, stream_name); // Try path-based approach first (most CFB libraries support this) // 먼저 경로 기반 접근 방식을 시도합니다 (대부분의 CFB 라이브러리가 이를 지원합니다). match cfb.open_stream(&path) { Ok(mut stream) => { let mut buffer = Vec::new(); stream .read_to_end(&mut buffer) .map_err(|e| HwpError::stream_read_error(&path, e.to_string()))?; Ok(buffer) } Err(_) => { // Fallback: try with "Root Entry/" prefix (hwp.js style) // 폴백: "Root Entry/" 접두사를 사용하여 시도합니다 (hwp.js 스타일). let root_path = format!("Root Entry/{}/{}", storage_name, stream_name); match cfb.open_stream(&root_path) { Ok(mut stream) => { let mut buffer = Vec::new(); stream .read_to_end(&mut buffer) .map_err(|e| HwpError::stream_read_error(&root_path, e.to_string()))?; Ok(buffer) } Err(e) => Err(HwpError::stream_not_found( format!("{}/{}", storage_name, stream_name), format!("Tried '{}' and '{}', last error: {}", path, root_path, e), )), } } } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/error.rs
crates/hwp-core/src/error.rs
/// Error types for HWP file parsing /// /// This module defines all error types that can occur during HWP file parsing. use thiserror::Error; /// Main error type for HWP parsing operations #[derive(Debug, Clone, Error)] pub enum HwpError { // ===== CFB related errors ===== /// Failed to parse CFB structure #[error("Failed to parse CFB structure: {0}")] CfbParse(String), /// Stream not found in CFB structure #[error("Stream not found: '{stream_name}' (path: {path})")] StreamNotFound { stream_name: String, path: String }, /// Failed to read stream from CFB #[error("Failed to read stream '{stream_name}': {reason}")] StreamReadError { stream_name: String, reason: String }, /// CFB file is too small #[error("CFB file too small: expected at least {expected} bytes, got {actual} bytes")] CfbFileTooSmall { expected: usize, actual: usize }, /// Invalid directory sector in CFB #[error("Invalid CFB directory sector: {reason}")] InvalidDirectorySector { reason: String }, /// Invalid sector size in CFB header #[error("Invalid sector size shift: {value} (must be <= 12)")] InvalidSectorSize { value: u32 }, // ===== Decompression errors ===== /// Failed to decompress data #[error("Failed to decompress {format} data: {reason}")] DecompressError { format: CompressionFormat, reason: String, }, // ===== Parsing errors ===== /// Insufficient data for parsing #[error("Insufficient data for field '{field}': expected at least {expected} bytes, got {actual} bytes")] InsufficientData { field: String, expected: usize, actual: usize, }, /// Unexpected value encountered during parsing #[error("Unexpected value for field '{field}': expected '{expected}', got '{found}'")] UnexpectedValue { field: String, expected: String, found: String, }, /// Failed to parse a record #[error("Failed to parse record '{record_type}': {reason}")] RecordParseError { record_type: String, reason: String }, /// Failed to parse record tree structure #[error("Failed to parse record tree: {reason}")] RecordTreeParseError { reason: String }, // ===== Document structure errors ===== /// Required stream is missing #[error("Required stream missing: '{stream_name}'")] RequiredStreamMissing { stream_name: String }, /// Unsupported document version #[error("Unsupported document version: {version} (supported versions: {supported_versions})")] UnsupportedVersion { version: String, supported_versions: String, }, /// Invalid document signature #[error("Invalid HWP document signature: expected 'HWP Document File', got '{found}'")] InvalidSignature { found: String }, // ===== Other errors ===== /// IO error #[error("IO error: {0}")] Io(String), /// Encoding/decoding error #[error("Encoding error: {reason}")] EncodingError { reason: String }, /// JSON serialization error #[error("JSON serialization error: {0}")] JsonError(String), /// Internal error (unexpected situation) #[error("Internal error: {message}")] InternalError { message: String }, } /// Compression format type #[derive(Debug, Clone, Copy)] pub enum CompressionFormat { Zlib, Deflate, } impl std::fmt::Display for CompressionFormat { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { match self { CompressionFormat::Zlib => write!(f, "zlib"), CompressionFormat::Deflate => write!(f, "deflate"), } } } /// Type alias for `Result<T, HwpError>` /// /// Note: For better clarity in function signatures, consider using `Result<T, HwpError>` directly /// to make the error type explicit. This type alias is kept for backward compatibility. pub type HwpResult<T> = Result<T, HwpError>; impl HwpError { /// Create an `InsufficientData` error with field name pub fn insufficient_data(field: impl Into<String>, expected: usize, actual: usize) -> Self { Self::InsufficientData { field: field.into(), expected, actual, } } /// Create a `StreamNotFound` error pub fn stream_not_found(stream_name: impl Into<String>, path: impl Into<String>) -> Self { Self::StreamNotFound { stream_name: stream_name.into(), path: path.into(), } } /// Create a `StreamReadError` error pub fn stream_read_error(stream_name: impl Into<String>, reason: impl Into<String>) -> Self { Self::StreamReadError { stream_name: stream_name.into(), reason: reason.into(), } } /// Create a `RecordParseError` error pub fn record_parse(record_type: impl Into<String>, reason: impl Into<String>) -> Self { Self::RecordParseError { record_type: record_type.into(), reason: reason.into(), } } /// Create a `DecompressError` error pub fn decompress_error(format: CompressionFormat, reason: impl Into<String>) -> Self { Self::DecompressError { format, reason: reason.into(), } } } /// Conversion from String to HwpError for backward compatibility impl From<String> for HwpError { fn from(s: String) -> Self { HwpError::InternalError { message: s } } } /// Conversion from &str to HwpError for backward compatibility impl From<&str> for HwpError { fn from(s: &str) -> Self { HwpError::InternalError { message: s.to_string(), } } } /// Conversion from std::io::Error to HwpError impl From<std::io::Error> for HwpError { fn from(err: std::io::Error) -> Self { HwpError::Io(err.to_string()) } } /// Conversion from serde_json::Error to HwpError impl From<serde_json::Error> for HwpError { fn from(err: serde_json::Error) -> Self { HwpError::JsonError(err.to_string()) } } /// Conversion from HwpError to String for NAPI and other integrations /// This allows HwpError to be used with napi::Error::from_reason impl From<HwpError> for String { fn from(err: HwpError) -> Self { err.to_string() } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/types.rs
crates/hwp-core/src/types.rs
/// HWP 5.0 자료형 정의 /// /// 표 1: 자료형에 따른 타입 정의 /// 스펙 문서와 1:1 매핑을 위해 모든 자료형을 명시적으로 정의합니다. use crate::error::HwpError; use serde::{Deserialize, Serialize}; /// 소수점 2자리로 반올림하는 trait pub trait RoundTo2dp { /// 소수점 2자리로 반올림 fn round_to_2dp(self) -> f64; } impl RoundTo2dp for f64 { fn round_to_2dp(self) -> f64 { (self * 100.0).round() / 100.0 } } /// BYTE: 부호 없는 한 바이트(0~255) pub type BYTE = u8; /// WORD: 16비트 unsigned int pub type WORD = u16; /// DWORD: 32비트 unsigned long pub type DWORD = u32; /// WCHAR: 유니코드 기반 문자 (2바이트) /// 한글의 내부 코드로 표현된 문자 한 글자 pub type WCHAR = u16; /// HWPUNIT: 1/7200인치 단위 (unsigned) /// 문자의 크기, 그림의 크기, 용지 여백 등 문서 구성 요소의 크기를 표현 #[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, Serialize, Deserialize)] pub struct HWPUNIT(pub u32); impl HWPUNIT { /// 인치 단위로 변환 pub fn to_inches(self) -> f64 { self.0 as f64 / 7200.0 } /// 밀리미터 단위로 변환 pub fn to_mm(self) -> f64 { self.to_inches() * 25.4 } /// 인치 단위에서 생성 pub fn from_inches(inches: f64) -> Self { Self((inches * 7200.0) as u32) } /// 밀리미터 단위에서 생성 pub fn from_mm(mm: f64) -> Self { Self::from_inches(mm / 25.4) } /// 내부 값 반환 pub fn value(self) -> u32 { self.0 } } impl From<u32> for HWPUNIT { fn from(value: u32) -> Self { Self(value) } } impl From<HWPUNIT> for u32 { fn from(value: HWPUNIT) -> Self { value.0 } } /// SHWPUNIT: 1/7200인치 단위 (signed) /// HWPUNIT의 부호 있는 버전 #[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, Serialize, Deserialize)] pub struct SHWPUNIT(pub i32); impl SHWPUNIT { /// 인치 단위로 변환 pub fn to_inches(self) -> f64 { self.0 as f64 / 7200.0 } /// 밀리미터 단위로 변환 pub fn to_mm(self) -> f64 { self.to_inches() * 25.4 } /// 인치 단위에서 생성 pub fn from_inches(inches: f64) -> Self { Self((inches * 7200.0) as i32) } /// 밀리미터 단위에서 생성 pub fn from_mm(mm: f64) -> Self { Self::from_inches(mm / 25.4) } /// 내부 값 반환 pub fn value(self) -> i32 { self.0 } } impl From<i32> for SHWPUNIT { fn from(value: i32) -> Self { Self(value) } } impl From<SHWPUNIT> for i32 { fn from(value: SHWPUNIT) -> Self { value.0 } } /// HWPUNIT16 (i16)에 대한 변환 메서드 제공 / Conversion methods for HWPUNIT16 (i16) pub trait Hwpunit16ToMm { /// 밀리미터 단위로 변환 / Convert to millimeters fn to_mm(self) -> f64; } impl Hwpunit16ToMm for i16 { fn to_mm(self) -> f64 { (self as f64 / 7200.0) * 25.4 } } /// COLORREF: BGR 형식 (0x00bbggrr) /// 스펙 문서: RGB값(0x00bbggrr) - 실제로는 BGR 순서로 저장됨 /// Spec: RGB value (0x00bbggrr) - actually stored in BGR order /// rr: red 1 byte (하위 바이트), gg: green 1 byte (중간 바이트), bb: blue 1 byte (상위 바이트) #[derive(Debug, Clone, Copy, PartialEq, Eq)] pub struct COLORREF(pub u32); impl COLORREF { /// RGB 값으로 생성 pub fn rgb(r: u8, g: u8, b: u8) -> Self { Self((b as u32) << 16 | (g as u32) << 8 | r as u32) } /// Red 값 추출 pub fn r(self) -> u8 { (self.0 & 0xFF) as u8 } /// Green 값 추출 pub fn g(self) -> u8 { ((self.0 >> 8) & 0xFF) as u8 } /// Blue 값 추출 pub fn b(self) -> u8 { ((self.0 >> 16) & 0xFF) as u8 } /// 내부 값 반환 pub fn value(self) -> u32 { self.0 } } impl From<u32> for COLORREF { fn from(value: u32) -> Self { Self(value) } } impl From<COLORREF> for u32 { fn from(value: COLORREF) -> Self { value.0 } } // COLORREF를 RGB 형태로 JSON 직렬화 / Serialize COLORREF as RGB object in JSON impl Serialize for COLORREF { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { use serde::ser::SerializeStruct; let mut state = serializer.serialize_struct("COLORREF", 3)?; state.serialize_field("r", &self.r())?; state.serialize_field("g", &self.g())?; state.serialize_field("b", &self.b())?; state.end() } } // JSON에서 RGB 형태로 역직렬화 / Deserialize COLORREF from RGB object in JSON impl<'de> Deserialize<'de> for COLORREF { fn deserialize<D>(deserializer: D) -> Result<Self, D::Error> where D: serde::Deserializer<'de>, { use serde::de::{self, MapAccess, Visitor}; use std::fmt; #[derive(Deserialize)] #[serde(field_identifier, rename_all = "lowercase")] enum Field { R, G, B, } struct COLORREFVisitor; impl<'de> Visitor<'de> for COLORREFVisitor { type Value = COLORREF; fn expecting(&self, formatter: &mut fmt::Formatter) -> fmt::Result { formatter.write_str("struct COLORREF with r, g, b fields") } fn visit_map<V>(self, mut map: V) -> Result<COLORREF, V::Error> where V: MapAccess<'de>, { let mut r = None; let mut g = None; let mut b = None; while let Some(key) = map.next_key()? { match key { Field::R => { if r.is_some() { return Err(de::Error::duplicate_field("r")); } r = Some(map.next_value()?); } Field::G => { if g.is_some() { return Err(de::Error::duplicate_field("g")); } g = Some(map.next_value()?); } Field::B => { if b.is_some() { return Err(de::Error::duplicate_field("b")); } b = Some(map.next_value()?); } } } let r = r.ok_or_else(|| de::Error::missing_field("r"))?; let g = g.ok_or_else(|| de::Error::missing_field("g"))?; let b = b.ok_or_else(|| de::Error::missing_field("b"))?; Ok(COLORREF::rgb(r, g, b)) } } deserializer.deserialize_map(COLORREFVisitor) } } /// UINT8: unsigned int8 pub type UINT8 = u8; /// UINT16: unsigned int16 pub type UINT16 = u16; /// UINT32: unsigned int32 pub type UINT32 = u32; /// UINT: UINT32와 동일 pub type UINT = UINT32; /// INT8: signed int8 pub type INT8 = i8; /// INT16: signed int16 pub type INT16 = i16; /// INT32: signed int32 pub type INT32 = i32; /// HWPUNIT16: INT16과 같음 pub type HWPUNIT16 = i16; /// 레코드 헤더 파싱 결과 / Record header parsing result /// /// 스펙 문서 매핑: 그림 45 - 레코드 구조 / Spec mapping: Figure 45 - Record structure /// 레코드 헤더는 32비트로 구성되며 Tag ID (10 bits), Level (10 bits), Size (12 bits)를 포함합니다. /// Record header is 32 bits consisting of Tag ID (10 bits), Level (10 bits), Size (12 bits). #[derive(Debug, Clone, Copy, PartialEq, Eq)] pub struct RecordHeader { /// Tag ID (10 bits, 0x000-0x3FF) pub tag_id: u16, /// Level (10 bits) pub level: u16, /// Size (12 bits, 또는 확장 길이) / Size (12 bits, or extended length) pub size: u32, /// 확장 길이를 사용하는지 여부 (Size가 0xFFF인 경우) / Whether extended size is used (when Size is 0xFFF) pub has_extended_size: bool, } impl RecordHeader { /// 레코드 헤더를 파싱합니다. / Parse record header. /// /// # Arguments /// * `data` - 최소 4바이트의 데이터 (레코드 헤더) / At least 4 bytes of data (record header) /// /// # Returns /// 파싱된 RecordHeader와 다음 데이터 위치로 이동할 바이트 수 (헤더 크기) / Parsed RecordHeader and number of bytes to advance (header size) pub fn parse(data: &[u8]) -> Result<(Self, usize), HwpError> { if data.len() < 4 { return Err(HwpError::insufficient_data("RecordHeader", 4, data.len())); } // DWORD를 little-endian으로 읽기 / Read DWORD as little-endian let header_value = DWORD::from_le_bytes([data[0], data[1], data[2], data[3]]); // Tag ID: bits 0-9 (10 bits) let tag_id = (header_value & 0x3FF) as u16; // Level: bits 10-19 (10 bits) let level = ((header_value >> 10) & 0x3FF) as u16; // Size: bits 20-31 (12 bits) let size = (header_value >> 20) & 0xFFF; let (size, has_extended_size, header_size) = if size == 0xFFF { // 확장 길이 사용: 다음 DWORD가 실제 길이 / Extended size: next DWORD is actual length if data.len() < 8 { return Err(HwpError::insufficient_data( "RecordHeader (extended)", 8, data.len(), )); } let extended_size = DWORD::from_le_bytes([data[4], data[5], data[6], data[7]]); (extended_size, true, 8) } else { (size, false, 4) }; Ok(( RecordHeader { tag_id, level, size, has_extended_size, }, header_size, )) } } /// UTF-16LE 바이트 배열을 String으로 디코딩 / Decode UTF-16LE byte array to String pub fn decode_utf16le(bytes: &[u8]) -> Result<String, HwpError> { use crate::error::HwpError; if bytes.len() % 2 != 0 { return Err(HwpError::EncodingError { reason: "UTF-16LE bytes must be even length".to_string(), }); } let u16_chars: Vec<u16> = bytes .chunks_exact(2) .map(|chunk| u16::from_le_bytes([chunk[0], chunk[1]])) .collect(); String::from_utf16(&u16_chars).map_err(|e| HwpError::EncodingError { reason: format!("Failed to decode UTF-16LE string: {}", e), }) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/decompress.rs
crates/hwp-core/src/decompress.rs
/// Decompression module for HWP files /// /// This module handles zlib/deflate decompression used in HWP 5.0 files. /// HWP files use raw deflate format (windowBits: -15) for DocInfo and BodyText streams. use crate::error::{CompressionFormat, HwpError}; use flate2::read::{DeflateDecoder, ZlibDecoder}; use std::io::Read; /// Decompress zlib-compressed data (with zlib header) /// /// # Arguments /// * `compressed_data` - Compressed byte array in zlib format (RFC 1950) /// /// # Returns /// Decompressed byte vector pub fn decompress_zlib(compressed_data: &[u8]) -> Result<Vec<u8>, HwpError> { let mut decoder = ZlibDecoder::new(compressed_data); let mut decompressed = Vec::new(); decoder .read_to_end(&mut decompressed) .map_err(|e| HwpError::decompress_error(CompressionFormat::Zlib, e.to_string()))?; Ok(decompressed) } /// Decompress raw deflate data (without zlib header, windowBits: -15) /// /// HWP DocInfo and BodyText streams use raw deflate format. /// This is equivalent to pako's inflate with windowBits: -15. /// /// # Arguments /// * `compressed_data` - Compressed byte array in raw deflate format /// /// # Returns /// Decompressed byte vector pub fn decompress_deflate(compressed_data: &[u8]) -> Result<Vec<u8>, HwpError> { let mut decoder = DeflateDecoder::new(compressed_data); let mut decompressed = Vec::new(); decoder .read_to_end(&mut decompressed) .map_err(|e| HwpError::decompress_error(CompressionFormat::Deflate, e.to_string()))?; Ok(decompressed) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/mod.rs
crates/hwp-core/src/viewer/mod.rs
/// Viewer module for converting HWP documents to various formats /// HWP 문서를 다양한 형식으로 변환하는 뷰어 모듈 /// /// This module provides functionality to convert parsed HWP documents /// into different output formats like Markdown, HTML, Canvas, PDF, etc. /// 이 모듈은 파싱된 HWP 문서를 마크다운, HTML, Canvas, PDF 등 다양한 출력 형식으로 변환하는 기능을 제공합니다. pub mod core; pub mod markdown; pub mod html; #[allow(missing_docs)] // TODO: Implement Canvas viewer pub mod canvas; #[allow(missing_docs)] // TODO: Implement PDF viewer pub mod pdf; pub use markdown::{to_markdown, MarkdownOptions}; pub use html::{to_html, HtmlOptions}; pub use core::renderer::{DocumentParts, Renderer, TextStyles};
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/pdf/mod.rs
crates/hwp-core/src/viewer/pdf/mod.rs
//! PDF converter for HWP documents //! HWP 문서를 PDF로 변환하는 모듈 //! //! This module provides functionality to convert HWP documents to PDF format. //! PDF output can be used for printing, archiving, or document distribution. //! 이 모듈은 HWP 문서를 PDF 형식으로 변환하는 기능을 제공합니다. //! PDF 출력은 인쇄, 보관, 문서 배포에 사용할 수 있습니다. //! //! # Status / 상태 //! This module is planned for future implementation. //! 이 모듈은 향후 구현 예정입니다. // TODO: Implement PDF viewer // TODO: PDF 뷰어 구현
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/canvas/mod.rs
crates/hwp-core/src/viewer/canvas/mod.rs
//! Canvas converter for HWP documents //! HWP 문서를 Canvas로 변환하는 모듈 //! //! This module provides functionality to convert HWP documents to Canvas format. //! Canvas output can be used for rendering in web browsers or exporting as images. //! 이 모듈은 HWP 문서를 Canvas 형식으로 변환하는 기능을 제공합니다. //! Canvas 출력은 웹 브라우저에서 렌더링하거나 이미지로 내보내는 데 사용할 수 있습니다. //! //! # Status / 상태 //! This module is planned for future implementation. //! 이 모듈은 향후 구현 예정입니다. // TODO: Implement Canvas viewer // TODO: Canvas 뷰어 구현
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/page.rs
crates/hwp-core/src/viewer/html/page.rs
use crate::document::bodytext::ctrl_header::{CtrlHeaderData, PageNumberPosition}; use crate::document::HwpDocument; use crate::types::RoundTo2dp; use crate::{document::bodytext::PageDef, INT32}; /// 페이지 렌더링 모듈 / Page rendering module /// 페이지를 HTML로 렌더링 / Render page to HTML pub fn render_page( page_number: usize, content: &str, tables: &[String], page_def: Option<&PageDef>, _first_segment_pos: Option<(INT32, INT32)>, hcd_position: Option<(f64, f64)>, page_number_position: Option<&CtrlHeaderData>, page_start_number: u16, document: &HwpDocument, ) -> String { let width_mm = page_def .map(|pd| pd.paper_width.to_mm().round_to_2dp()) .unwrap_or(210.0); // A4 기본값 / A4 default let height_mm = page_def .map(|pd| pd.paper_height.to_mm().round_to_2dp()) .unwrap_or(297.0); // A4 기본값 / A4 default // hcD 위치: PageDef 여백을 직접 사용 / hcD position: use PageDef margins directly let (left_mm, top_mm) = if let Some((left, top)) = hcd_position { (left.round_to_2dp(), top.round_to_2dp()) } else { // hcd_position이 없으면 PageDef 여백 사용 / Use PageDef margins if hcd_position not available let left = page_def .map(|pd| (pd.left_margin.to_mm() + pd.binding_margin.to_mm()).round_to_2dp()) .unwrap_or(20.0); let top = page_def .map(|pd| (pd.top_margin.to_mm() + pd.header_margin.to_mm()).round_to_2dp()) .unwrap_or(24.99); (left, top) }; // 일반 내용은 hcD > hcI 안에 배치 / Place regular content in hcD > hcI let mut html = format!( r#"<div class="hpa" style="width:{}mm;height:{}mm;">"#, width_mm, height_mm ); if !content.is_empty() { html.push_str(&format!( r#"<div class="hcD" style="left:{}mm;top:{}mm;"><div class="hcI">{}</div></div>"#, left_mm, top_mm, content )); } // 테이블은 hpa 레벨에 직접 배치 / Place tables directly at hpa level for table_html in tables { html.push_str(table_html); } // 쪽번호 렌더링 / Render page number if let Some(CtrlHeaderData::PageNumberPosition { flags, prefix, suffix, .. }) = page_number_position { if flags.position != PageNumberPosition::None { let actual_page_number = (page_start_number as usize + page_number - 1).to_string(); // prefix/suffix에서 null 문자 제거 (null 문자는 빈 문자열로 처리) / Remove null characters from prefix/suffix (treat null as empty string) let prefix_clean: String = prefix.chars().filter(|c| *c != '\0').collect(); let suffix_clean: String = suffix.chars().filter(|c| *c != '\0').collect(); let page_number_text = format!("{}{}{}", prefix_clean, actual_page_number, suffix_clean); // 페이지 크기 계산 / Calculate page size let page_width_mm = page_def .map(|pd| pd.paper_width.to_mm().round_to_2dp()) .unwrap_or(210.0); let page_height_mm = page_def .map(|pd| pd.paper_height.to_mm().round_to_2dp()) .unwrap_or(297.0); // 쪽번호 위치 계산 (PageDef의 여백 정보 사용) / Calculate page number position (using PageDef margin information) let (left_mm, top_mm) = match flags.position { PageNumberPosition::BottomCenter => { // 하단 중앙: 페이지 너비의 중앙, 하단 여백 기준 / Bottom center: center of page width, based on bottom margin let left = (page_width_mm / 2.0).round_to_2dp(); let top = page_def .map(|pd| { // 페이지 높이 - 아래 여백 / Page height - bottom margin (page_height_mm - pd.bottom_margin.to_mm()).round_to_2dp() }) .unwrap_or_else(|| (page_height_mm - 10.0).round_to_2dp()); (left, top) } PageNumberPosition::BottomLeft => { // 하단 왼쪽 / Bottom left let left = page_def .map(|pd| { (pd.left_margin.to_mm() + pd.binding_margin.to_mm()).round_to_2dp() }) .unwrap_or(20.0); let top = page_def .map(|pd| (page_height_mm - pd.bottom_margin.to_mm()).round_to_2dp()) .unwrap_or_else(|| (page_height_mm - 10.0).round_to_2dp()); (left, top) } PageNumberPosition::BottomRight => { // 하단 오른쪽 / Bottom right let left = page_def .map(|pd| { (page_width_mm - pd.right_margin.to_mm() - pd.binding_margin.to_mm()) .round_to_2dp() }) .unwrap_or(190.0); let top = page_def .map(|pd| (page_height_mm - pd.bottom_margin.to_mm()).round_to_2dp()) .unwrap_or_else(|| (page_height_mm - 10.0).round_to_2dp()); (left, top) } PageNumberPosition::TopCenter => { // 상단 중앙 / Top center let left = (page_width_mm / 2.0).round_to_2dp(); let top = page_def .map(|pd| pd.top_margin.to_mm().round_to_2dp()) .unwrap_or(10.0); (left, top) } PageNumberPosition::TopLeft => { // 상단 왼쪽 / Top left let left = page_def .map(|pd| { (pd.left_margin.to_mm() + pd.binding_margin.to_mm()).round_to_2dp() }) .unwrap_or(20.0); let top = page_def .map(|pd| pd.top_margin.to_mm().round_to_2dp()) .unwrap_or(10.0); (left, top) } PageNumberPosition::TopRight => { // 상단 오른쪽 / Top right let left = page_def .map(|pd| { (page_width_mm - pd.right_margin.to_mm() - pd.binding_margin.to_mm()) .round_to_2dp() }) .unwrap_or(190.0); let top = page_def .map(|pd| pd.top_margin.to_mm().round_to_2dp()) .unwrap_or(10.0); (left, top) } _ => { // 기타 위치는 기본값 사용 (하단 중앙) / Use default for other positions (bottom center) let left = (page_width_mm / 2.0).round_to_2dp(); let top = page_def .map(|pd| (page_height_mm - pd.bottom_margin.to_mm()).round_to_2dp()) .unwrap_or_else(|| (page_height_mm - 10.0).round_to_2dp()); (left, top) } }; // CharShape 정보로 텍스트 크기 계산 / Calculate text size from CharShape // 원본 HTML에서 cs1 클래스를 사용하므로 shape_id 1 (0-based) 사용 / Use shape_id 1 (0-based) since original HTML uses cs1 class let char_shape_id = 1; let (width_mm, height_mm) = if char_shape_id < document.doc_info.char_shapes.len() { if let Some(char_shape) = document.doc_info.char_shapes.get(char_shape_id) { // 폰트 크기 계산 (base_size는 1/100 pt 단위) / Calculate font size (base_size is in 1/100 pt units) let font_size_pt = char_shape.base_size as f64 / 100.0; let font_size_mm = font_size_pt * 0.352778; // 1pt = 0.352778mm // 텍스트 너비 계산: 문자 수 * 폰트 크기 * 평균 문자 폭 비율 (약 0.6) / Calculate text width: char count * font size * average char width ratio (approx 0.6) let char_count = page_number_text.chars().count() as f64; let text_width_mm = (char_count * font_size_mm * 0.6).round_to_2dp(); // 텍스트 높이 계산: 폰트 크기 * line-height (약 1.2) / Calculate text height: font size * line-height (approx 1.2) let text_height_mm = (font_size_mm * 1.2).round_to_2dp(); (text_width_mm, text_height_mm) } else { // CharShape를 찾을 수 없는 경우 기본값 사용 / Use default if CharShape not found (1.95, 3.53) } } else { // CharShape ID가 범위를 벗어난 경우 기본값 사용 / Use default if CharShape ID out of range (1.95, 3.53) }; html.push_str(&format!( r#"<div class="hpN" style="left:{}mm;top:{}mm;width:{}mm;height:{}mm;"><span class="hrt cs1">{}</span></div>"#, left_mm, top_mm, width_mm, height_mm, page_number_text )); } } html.push_str("</div>"); html }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/image.rs
crates/hwp-core/src/viewer/html/image.rs
/// 이미지 렌더링 모듈 / Image rendering module use crate::types::INT32; use crate::viewer::html::styles::{int32_to_mm, round_to_2dp}; /// 이미지를 HTML로 렌더링 / Render image to HTML pub fn render_image( image_url: &str, left: INT32, top: INT32, width: INT32, height: INT32, ) -> String { let left_mm = round_to_2dp(int32_to_mm(left)); let top_mm = round_to_2dp(int32_to_mm(top)); let width_mm = round_to_2dp(int32_to_mm(width)); let height_mm = round_to_2dp(int32_to_mm(height)); format!( r#"<div class="hsR" style="top:{}mm;left:{}mm;width:{}mm;height:{}mm;background-repeat:no-repeat;background-size:contain;background-image:url('{}');"></div>"#, top_mm, left_mm, width_mm, height_mm, image_url ) } /// 이미지를 배경 이미지로 렌더링 (인라인 스타일 포함) / Render image as background image (with inline styles) pub fn render_image_with_style( image_url: &str, left: INT32, top: INT32, width: INT32, height: INT32, margin_bottom: INT32, margin_right: INT32, ) -> String { let left_mm = round_to_2dp(int32_to_mm(left)); let top_mm = round_to_2dp(int32_to_mm(top)); let width_mm = round_to_2dp(int32_to_mm(width)); let height_mm = round_to_2dp(int32_to_mm(height)); let margin_bottom_mm = round_to_2dp(int32_to_mm(margin_bottom)); let margin_right_mm = round_to_2dp(int32_to_mm(margin_right)); format!( r#"<div class="hsR" style="top:{}mm;left:{}mm;margin-bottom:{}mm;margin-right:{}mm;width:{}mm;height:{}mm;display:inline-block;position:relative;vertical-align:middle;background-repeat:no-repeat;background-size:contain;background-image:url('{}');"></div>"#, top_mm, left_mm, margin_bottom_mm, margin_right_mm, width_mm, height_mm, image_url ) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/document.rs
crates/hwp-core/src/viewer/html/document.rs
use super::page; use super::pagination::{PageBreakReason, PaginationContext}; use super::paragraph::{ render_paragraph, ParagraphPosition, ParagraphRenderContext, ParagraphRenderState, }; use super::styles; use super::styles::round_to_2dp; use super::HtmlOptions; use crate::document::bodytext::ctrl_header::{CtrlHeaderData, CtrlId}; use crate::document::bodytext::{PageDef, ParagraphRecord}; use crate::document::HwpDocument; use crate::types::RoundTo2dp; use crate::INT32; /// 문서에서 첫 번째 PageDef 찾기 / Find first PageDef in document fn find_page_def(document: &HwpDocument) -> Option<&PageDef> { for section in &document.body_text.sections { for paragraph in &section.paragraphs { for record in &paragraph.records { // 직접 PageDef인 경우 / Direct PageDef if let ParagraphRecord::PageDef { page_def } = record { return Some(page_def); } // CtrlHeader의 children에서 PageDef 찾기 / Find PageDef in CtrlHeader's children if let ParagraphRecord::CtrlHeader { children, .. } = record { for child in children { if let ParagraphRecord::PageDef { page_def } = child { return Some(page_def); } } } } } } None } /// 문서에서 첫 번째 PageNumberPosition 찾기 / Find first PageNumberPosition in document fn find_page_number_position(document: &HwpDocument) -> Option<&CtrlHeaderData> { for section in &document.body_text.sections { for paragraph in &section.paragraphs { for record in &paragraph.records { if let ParagraphRecord::CtrlHeader { header, .. } = record { if header.ctrl_id == CtrlId::PAGE_NUMBER || header.ctrl_id == CtrlId::PAGE_NUMBER_POS { if let CtrlHeaderData::PageNumberPosition { .. } = &header.data { return Some(&header.data); } } } } } } None } /// Convert HWP document to HTML format /// HWP 문서를 HTML 형식으로 변환 /// /// # Arguments / 매개변수 /// * `document` - The HWP document to convert / 변환할 HWP 문서 /// * `options` - HTML conversion options / HTML 변환 옵션 /// /// # Returns / 반환값 /// HTML string representation of the document / 문서의 HTML 문자열 표현 pub fn to_html(document: &HwpDocument, options: &HtmlOptions) -> String { let mut html = String::new(); // HTML 문서 시작 / Start HTML document html.push_str("<!DOCTYPE html>\n"); html.push_str("<html>\n"); html.push_str("<meta http-equiv=\"X-UA-Compatible\" content=\"IE=edge,chrome=1\">\n"); html.push_str("\n"); html.push_str("<head>\n"); html.push_str(" <title></title>\n"); html.push_str(" <meta http_quiv=\"content-type\" content=\"text/html; charset=utf-8\">\n"); // CSS 스타일 생성 / Generate CSS styles html.push_str(" <style>\n"); html.push_str(&styles::generate_css_styles(document)); html.push_str(" </style>\n"); html.push_str("</head>\n"); html.push_str("\n"); html.push_str("\n"); html.push_str("<body>\n"); // PageDef 찾기 / Find PageDef let page_def = find_page_def(document); // PageNumberPosition 찾기 / Find PageNumberPosition let page_number_position = find_page_number_position(document); // 페이지 시작 번호 가져오기 / Get page start number let page_start_number = document .doc_info .document_properties .as_ref() .map(|p| p.page_start_number) .unwrap_or(1); // 페이지별로 렌더링 / Render by page let mut page_number = 1; let mut page_content = String::new(); let mut page_tables = Vec::new(); // 테이블을 별도로 저장 / Store tables separately let mut first_segment_pos: Option<(INT32, INT32)> = None; // 첫 번째 LineSegment 위치 저장 / Store first LineSegment position let mut hcd_position: Option<(f64, f64)> = None; // hcD 위치 저장 (mm 단위) / Store hcD position (in mm) // 문서 레벨에서 table_counter 관리 (문서 전체에서 테이블 번호 연속 유지) / Manage table_counter at document level (maintain sequential table numbers across document) let mut table_counter = document .doc_info .document_properties .as_ref() .map(|p| p.table_start_number as u32) .unwrap_or(1); // 문서 레벨에서 pattern_counter와 color_to_pattern 관리 (문서 전체에서 패턴 ID 공유) / Manage pattern_counter and color_to_pattern at document level (share pattern IDs across document) use std::collections::HashMap; let mut pattern_counter = 0; let mut color_to_pattern: HashMap<u32, String> = HashMap::new(); // 페이지 높이 계산 (mm 단위) / Calculate page height (in mm) let page_height_mm = page_def.map(|pd| pd.paper_height.to_mm()).unwrap_or(297.0); let top_margin_mm = page_def.map(|pd| pd.top_margin.to_mm()).unwrap_or(24.99); let bottom_margin_mm = page_def.map(|pd| pd.bottom_margin.to_mm()).unwrap_or(10.0); let header_margin_mm = page_def.map(|pd| pd.header_margin.to_mm()).unwrap_or(0.0); let footer_margin_mm = page_def.map(|pd| pd.footer_margin.to_mm()).unwrap_or(0.0); // 실제 콘텐츠 영역 높이 / Actual content area height let content_height_mm = page_height_mm - top_margin_mm - bottom_margin_mm - header_margin_mm - footer_margin_mm; // 페이지네이션 컨텍스트 초기화 / Initialize pagination context let mut pagination_context = PaginationContext { prev_vertical_mm: None, current_max_vertical_mm: 0.0, content_height_mm, }; let mut current_page_def = page_def; // 현재 페이지의 PageDef 추적 / Track current page's PageDef // 현재 페이지의 최대 vertical_position (mm 단위) / Maximum vertical_position of current page (in mm) let mut current_max_vertical_mm = 0.0; // 이전 문단의 마지막 vertical_position (mm 단위) / Last vertical_position of previous paragraph (in mm) let mut prev_vertical_mm: Option<f64> = None; let mut first_para_vertical_mm: Option<f64> = None; // 첫 번째 문단의 vertical_position (가설 O) / First paragraph's vertical_position (Hypothesis O) // 각 문단의 vertical_position을 저장 (vert_rel_to: "para"일 때 참조 문단 찾기 위해) / Store each paragraph's vertical_position (to find reference paragraph when vert_rel_to: "para") // 먼저 모든 문단의 vertical_position을 수집 / First collect all paragraphs' vertical_positions let mut para_vertical_positions: Vec<f64> = Vec::new(); for section in &document.body_text.sections { for paragraph in &section.paragraphs { let control_mask = &paragraph.para_header.control_mask; let has_header_footer = control_mask.has_header_footer(); let has_footnote_endnote = control_mask.has_footnote_endnote(); if !has_header_footer && !has_footnote_endnote { let vertical_mm = paragraph.records.iter().find_map(|record| { if let ParagraphRecord::ParaLineSeg { segments } = record { segments .first() .map(|seg| seg.vertical_position as f64 * 25.4 / 7200.0) } else { None } }); if let Some(vertical_mm) = vertical_mm { para_vertical_positions.push(vertical_mm); } } } } // 문단 인덱스 추적 (vertical_position이 있는 문단만 카운트) / Track paragraph index (only count paragraphs with vertical_position) let mut para_index = 0; for section in &document.body_text.sections { for paragraph in &section.paragraphs { // 페이지네이션 컨텍스트는 아래에서 업데이트됨 / Pagination context will be updated below // 1. 문단 페이지 나누기 확인 (렌더링 전) / Check paragraph page break (before rendering) let para_result = super::pagination::check_paragraph_page_break( paragraph, &pagination_context, current_page_def, ); // LineSegment의 vertical_position 추출 (기존 로직 유지) / Extract vertical_position from LineSegment (keep existing logic) let mut first_vertical_mm: Option<f64> = None; for record in &paragraph.records { if let ParagraphRecord::ParaLineSeg { segments } = record { if let Some(first_segment) = segments.first() { first_vertical_mm = Some(first_segment.vertical_position as f64 * 25.4 / 7200.0); } break; } } let has_page_break = para_result.has_page_break; // 페이지 나누기가 있고 페이지 내용이 있으면 페이지 출력 (문단 렌더링 전) / Output page if page break and page content exists (before rendering paragraph) if has_page_break && (!page_content.is_empty() || !page_tables.is_empty()) { // PageDef 업데이트 (PageDefChange인 경우) / Update PageDef (if PageDefChange) if para_result.reason == Some(PageBreakReason::PageDefChange) { // 문단에서 PageDef 찾기 / Find PageDef in paragraph for record in &paragraph.records { if let ParagraphRecord::PageDef { page_def } = record { current_page_def = Some(page_def); break; } if let ParagraphRecord::CtrlHeader { children, .. } = record { for child in children { if let ParagraphRecord::PageDef { page_def } = child { current_page_def = Some(page_def); break; } } } } } // hcD 위치: PageDef 여백을 직접 사용 / hcD position: use PageDef margins directly use crate::types::RoundTo2dp; let hcd_pos = if let Some((left, top)) = hcd_position { Some((left.round_to_2dp(), top.round_to_2dp())) } else { // hcd_position이 없으면 PageDef 여백 사용 / Use PageDef margins if hcd_position not available let left = page_def .map(|pd| { (pd.left_margin.to_mm() + pd.binding_margin.to_mm()).round_to_2dp() }) .unwrap_or(20.0); let top = page_def .map(|pd| (pd.top_margin.to_mm() + pd.header_margin.to_mm()).round_to_2dp()) .unwrap_or(24.99); Some((left, top)) }; html.push_str(&page::render_page( page_number, &page_content, &page_tables, current_page_def, first_segment_pos, hcd_pos, page_number_position, page_start_number, document, )); page_number += 1; page_content.clear(); page_tables.clear(); current_max_vertical_mm = 0.0; pagination_context.current_max_vertical_mm = 0.0; pagination_context.prev_vertical_mm = None; first_segment_pos = None; // 새 페이지에서는 첫 번째 세그먼트 위치 리셋 / Reset first segment position for new page hcd_position = None; // 페이지네이션 발생 시 para_index와 para_vertical_positions 리셋 / Reset para_index and para_vertical_positions on pagination para_index = 0; para_vertical_positions.clear(); first_para_vertical_mm = None; // 새 페이지의 첫 번째 문단 추적을 위해 리셋 / Reset to track first paragraph of new page } // 문단 렌더링 (일반 본문 문단만) / Render paragraph (only regular body paragraphs) let control_mask = &paragraph.para_header.control_mask; let has_header_footer = control_mask.has_header_footer(); let has_footnote_endnote = control_mask.has_footnote_endnote(); if !has_header_footer && !has_footnote_endnote { // 첫 번째 LineSegment 위치 저장 / Store first LineSegment position // PageDef 여백을 직접 사용 / Use PageDef margins directly if first_segment_pos.is_none() { // hcD 위치는 left_margin + binding_margin, top_margin + header_margin을 직접 사용 // hcD position uses left_margin + binding_margin, top_margin + header_margin directly let left_margin_mm = page_def .map(|pd| { (pd.left_margin.to_mm() + pd.binding_margin.to_mm()).round_to_2dp() }) .unwrap_or(20.0); let top_margin_mm = page_def .map(|pd| (pd.top_margin.to_mm() + pd.header_margin.to_mm()).round_to_2dp()) .unwrap_or(24.99); hcd_position = Some((left_margin_mm, top_margin_mm)); // LineSegment 위치 저장 (참고용) / Store LineSegment position (for reference) for record in &paragraph.records { if let ParagraphRecord::ParaLineSeg { segments } = record { if let Some(first_segment) = segments.first() { first_segment_pos = Some(( first_segment.column_start_position, first_segment.vertical_position, )); break; } } } } // 첫 번째 문단의 vertical_position 추적 (가설 O) / Track first paragraph's vertical_position (Hypothesis O) if first_para_vertical_mm.is_none() { for record in &paragraph.records { if let ParagraphRecord::ParaLineSeg { segments } = record { if let Some(first_segment) = segments.first() { first_para_vertical_mm = Some(first_segment.vertical_position as f64 * 25.4 / 7200.0); break; } } } } // 현재 문단의 vertical_position 계산 / Calculate current paragraph's vertical_position let current_para_vertical_mm = paragraph.records.iter().find_map(|record| { if let ParagraphRecord::ParaLineSeg { segments } = record { segments .first() .map(|seg| seg.vertical_position as f64 * 25.4 / 7200.0) } else { None } }); // 현재 문단 인덱스 (vertical_position이 있는 문단만 카운트) / Current paragraph index (only count paragraphs with vertical_position) let current_para_index = if current_para_vertical_mm.is_some() { Some(para_index) } else { None }; let position = ParagraphPosition { hcd_position, page_def: current_page_def, // 현재 페이지의 PageDef 사용 / Use current page's PageDef first_para_vertical_mm, current_para_vertical_mm, para_vertical_positions: &para_vertical_positions, // 모든 문단의 vertical_position 전달 / Pass all paragraphs' vertical_positions current_para_index, // 현재 문단 인덱스 전달 / Pass current paragraph index }; let context = ParagraphRenderContext { document, options, position, }; let mut state = ParagraphRenderState { table_counter: &mut table_counter, // 문서 레벨 table_counter 전달 / Pass document-level table_counter pattern_counter: &mut pattern_counter, // 문서 레벨 pattern_counter 전달 / Pass document-level pattern_counter color_to_pattern: &mut color_to_pattern, // 문서 레벨 color_to_pattern 전달 / Pass document-level color_to_pattern }; // 2. 문단 렌더링 (내부에서 테이블/이미지 페이지네이션 체크) / Render paragraph (check table/image pagination inside) let (para_html, table_htmls, obj_pagination_result) = render_paragraph( paragraph, &context, &mut state, &mut pagination_context, // 페이지네이션 컨텍스트 전달 / Pass pagination context 0, // 처음 렌더링이므로 건너뛸 테이블 없음 / No tables to skip on first render ); // 3. 객체 페이지네이션 결과 처리 / Handle object pagination result let has_obj_page_break = obj_pagination_result .as_ref() .map(|r| { r.has_page_break && (!page_content.is_empty() || !page_tables.is_empty()) }) .unwrap_or(false); if let Some(obj_result) = obj_pagination_result { if obj_result.has_page_break && (!page_content.is_empty() || !page_tables.is_empty()) { // 페이지 출력 / Output page let hcd_pos = if let Some((left, top)) = hcd_position { Some((left.round_to_2dp(), top.round_to_2dp())) } else { let left = page_def .map(|pd| { (pd.left_margin.to_mm() + pd.binding_margin.to_mm()) .round_to_2dp() }) .unwrap_or(20.0); let top = page_def .map(|pd| { (pd.top_margin.to_mm() + pd.header_margin.to_mm()) .round_to_2dp() }) .unwrap_or(24.99); Some((left, top)) }; html.push_str(&page::render_page( page_number, &page_content, &page_tables, page_def, first_segment_pos, hcd_pos, page_number_position, page_start_number, document, )); page_number += 1; page_content.clear(); page_tables.clear(); current_max_vertical_mm = 0.0; pagination_context.current_max_vertical_mm = 0.0; pagination_context.prev_vertical_mm = None; first_segment_pos = None; hcd_position = None; // 페이지네이션 발생 시 para_index와 para_vertical_positions 리셋 / Reset para_index and para_vertical_positions on pagination para_index = 0; para_vertical_positions.clear(); first_para_vertical_mm = None; // 새 페이지의 첫 번째 문단 추적을 위해 리셋 / Reset to track first paragraph of new page // 페이지네이션 후 새 페이지의 첫 문단은 vertical_position이 0이어야 함 / After pagination, first paragraph of new page should have vertical_position 0 // 현재 문단의 vertical_position을 0으로 리셋 (새 페이지 시작) / Reset current paragraph's vertical_position to 0 (new page start) // 새 페이지의 첫 번째 문단(현재 문단)의 vertical_position 추가 (0으로 리셋) / Add first paragraph's vertical_position of new page (reset to 0) para_vertical_positions.push(0.0); // 페이지네이션 후 같은 문단의 후속 테이블들을 새 페이지에 배치하기 위해 문단을 다시 렌더링 // Re-render paragraph to place subsequent tables on new page after pagination if !table_htmls.is_empty() { // 현재 문단의 vertical_position을 0으로 설정하여 새 페이지의 첫 문단으로 처리 // Set current paragraph's vertical_position to 0 to treat it as first paragraph of new page let current_para_vertical_mm_for_next = if current_para_vertical_mm.is_some() { Some(0.0) } else { current_para_vertical_mm }; let current_para_index_for_next = Some(0); let position_next = ParagraphPosition { hcd_position, page_def: current_page_def, first_para_vertical_mm: Some(0.0), current_para_vertical_mm: current_para_vertical_mm_for_next, para_vertical_positions: &para_vertical_positions, current_para_index: current_para_index_for_next, }; let context_next = ParagraphRenderContext { document, options, position: position_next, }; let skip_tables_count = table_htmls.len(); // 이미 처리된 테이블 수 건너뛰기 / Skip already processed tables let (_para_html_next, table_htmls_next, _obj_pagination_result_next) = render_paragraph( paragraph, &context_next, &mut state, &mut pagination_context, skip_tables_count, ); // 후속 테이블들을 새 페이지에 추가 // Add subsequent tables to new page for table_html in table_htmls_next { page_tables.push(table_html); } } } } // 현재 문단의 vertical_position을 para_vertical_positions에 추가 (페이지별로 관리) / Add current paragraph's vertical_position to para_vertical_positions (managed per page) // 페이지네이션이 발생하지 않은 경우에만 추가 (페이지네이션 발생 시에는 이미 위에서 추가됨) / Only add if pagination did not occur (already added above if pagination occurred) if !has_obj_page_break { if let Some(vertical_mm) = current_para_vertical_mm { para_vertical_positions.push(vertical_mm); } } // 인덱스 증가 (vertical_position이 있는 문단만) / Increment index (only for paragraphs with vertical_position) // 페이지네이션이 발생한 경우에는 인덱스를 증가시키지 않음 (이미 0으로 리셋됨) / Don't increment index if pagination occurred (already reset to 0) if !has_obj_page_break && current_para_vertical_mm.is_some() { para_index += 1; } if !para_html.is_empty() { page_content.push_str(&para_html); } // 테이블은 hpa 레벨에 배치 (table.html 샘플 구조에 맞춤) / Tables are placed at hpa level (matching table.html sample structure) // 페이지네이션 체크는 render_paragraph 내부에서 이미 수행되었으므로, 여기서는 바로 추가 // Pagination check is already performed in render_paragraph, so just add tables here for table_html in table_htmls { page_tables.push(table_html); } // vertical_position 업데이트 (문단의 모든 LineSegment 확인) / Update vertical_position (check all LineSegments in paragraph) for record in &paragraph.records { if let ParagraphRecord::ParaLineSeg { segments } = record { for segment in segments { let vertical_mm = segment.vertical_position as f64 * 25.4 / 7200.0; if vertical_mm > current_max_vertical_mm { current_max_vertical_mm = vertical_mm; } } break; } } // 첫 번째 세그먼트의 vertical_position을 prev_vertical_mm으로 저장 / Store first segment's vertical_position as prev_vertical_mm if let Some(vertical) = first_vertical_mm { prev_vertical_mm = Some(vertical); } // 페이지네이션 컨텍스트 업데이트 / Update pagination context pagination_context.current_max_vertical_mm = current_max_vertical_mm; pagination_context.prev_vertical_mm = prev_vertical_mm; } } } // 마지막 페이지 출력 / Output last page if !page_content.is_empty() || !page_tables.is_empty() { // hcD 위치: PageDef 여백을 직접 사용 / hcD position: use PageDef margins directly let hcd_pos = if let Some((left, top)) = hcd_position { Some((round_to_2dp(left), round_to_2dp(top))) } else { // hcd_position이 없으면 PageDef 여백 사용 / Use PageDef margins if hcd_position not available let left = current_page_def .map(|pd| round_to_2dp(pd.left_margin.to_mm() + pd.binding_margin.to_mm())) .unwrap_or(20.0); let top = current_page_def .map(|pd| round_to_2dp(pd.top_margin.to_mm() + pd.header_margin.to_mm())) .unwrap_or(24.99); Some((left, top)) }; html.push_str(&page::render_page( page_number, &page_content, &page_tables, current_page_def, first_segment_pos, hcd_pos, page_number_position, page_start_number, document, )); } html.push_str("</body>"); html.push('\n'); html.push('\n'); html.push_str("</html>"); html.push('\n'); html }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/styles.rs
crates/hwp-core/src/viewer/html/styles.rs
use crate::document::docinfo::para_shape::ParagraphAlignment; /// CSS 스타일 생성 모듈 / CSS style generation module /// noori_style.css 기반으로 CSS 생성 use crate::document::HwpDocument; use crate::types::{COLORREF, INT32}; /// CSS 스타일 생성 / Generate CSS styles /// 문서에 정의된 모든 스타일을 미리 생성하여 누락 방지 / Pre-generate all styles defined in document to prevent missing styles pub fn generate_css_styles(document: &HwpDocument) -> String { let mut css = String::new(); // 기본 스타일 (noori_style.css 기반) / Base styles (based on noori_style.css) css.push_str( "body {margin:0;padding-left:0;padding-right:0;padding-bottom:0;padding-top:2mm;}\n", ); css.push_str(".hce {margin:0;padding:0;position:absolute;overflow:hidden;}\n"); css.push_str(".hme {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hhe {margin:0;padding:0;position:relative;}\n"); css.push_str(".hhi {display:inline-block;margin:0;padding:0;position:relative;background-size:contain;}\n"); css.push_str(".hls {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfS {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hcD {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hcI {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hcS {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfN {margin:0;padding:0;position:relative;}\n"); css.push_str(".hmB {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hmO {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hmT {margin:0;padding:0;position:absolute;}\n"); css.push_str( ".hpN {display:inline-block;margin:0;padding:0;position:relative;white-space:nowrap;}\n", ); css.push_str(".htC {display:inline-block;margin:0;padding:0;position:relative;vertical-align:top;overflow:hidden;}\n"); css.push_str(".haN {display:inline-block;margin:0;padding:0;position:relative;}\n"); css.push_str(".hdu {margin:0;padding:0;position:relative;}\n"); css.push_str(".hdS {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hsC {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hsR {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hsG {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hsL {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hsT {margin:0;padding:0;position:absolute;overflow:hidden;}\n"); css.push_str(".hsE {margin:0;padding:0;position:absolute;overflow:hidden;}\n"); css.push_str(".hsA {margin:0;padding:0;position:absolute;overflow:hidden;}\n"); css.push_str(".hsP {margin:0;padding:0;position:absolute;overflow:hidden;}\n"); css.push_str(".hsV {margin:0;padding:0;position:absolute;overflow:hidden;}\n"); css.push_str(".hsO {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hsU {margin:0;padding:0;position:absolute;overflow:hidden;}\n"); css.push_str(".hpi {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hch {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hcG {margin:0;padding:0;position:absolute;}\n"); css.push_str(".heq {margin:0;padding:0;position:absolute;}\n"); css.push_str(".heG {margin:0;padding:0;position:absolute;}\n"); css.push_str(".htA {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hvi {margin:0;padding:0;position:absolute;}\n"); css.push_str(".htb {margin:0;padding:0;position:absolute;}\n"); css.push_str(".htG {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfJ {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfG {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfB {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfR {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfC {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfO {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfL {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfM {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hfE {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hpl {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hs {margin:0;padding:0;position:absolute;overflow:visible;}\n"); css.push_str(".hpa {position:relative;padding:0;overflow:hidden;margin-left:2mm;margin-right:0mm;margin-bottom:2mm;margin-top:0mm;border:1px black solid;box-shadow:1mm 1mm 0 #AAAAAA;}\n"); css.push_str(".hpa::after {content:'';position:absolute;margin:0;padding:0;left:0;right:0;top:0;bottom:0;background-color:white;z-index:-2;}\n"); css.push_str(".hrt {display:inline-block;margin:0;padding:0;position:relative;white-space:inherit;vertical-align:middle;line-height:1.1;}\n"); css.push_str( ".hco {display:inline-block;margin:0;padding:0;position:relative;white-space:inherit;}\n", ); css.push_str(".hcc {margin:0;padding:0;position:absolute;}\n"); css.push_str(".hls {clear:both;}\n"); css.push_str("[onclick] {cursor:pointer;}\n"); // 모든 CharShape 스타일 생성 (cs0, cs1, cs2, ...) / Generate all CharShape styles (cs0, cs1, cs2, ...) // 문서에 정의된 모든 char_shape를 미리 정의하여 누락 방지 / Pre-define all char_shapes in document to prevent missing styles for (shape_id, char_shape) in document.doc_info.char_shapes.iter().enumerate() { // Use 0-based shape_id for class name to match XSL/XML format (cs0, cs1, cs2, ...) let class_name = format!("cs{}", shape_id); css.push_str(&format!(".{} {{\n", class_name)); // 폰트 크기 / Font size let size_pt = char_shape.base_size as f64 / 100.0; css.push_str(&format!(" font-size:{}pt;", size_pt)); // 텍스트 색상 / Text color let color = &char_shape.text_color; css.push_str(&format!( "color:rgb({},{},{});", color.r(), color.g(), color.b() )); // 폰트 패밀리 / Font family // CharShape의 font_ids에서 한글 폰트 ID를 가져와서 face_names에서 폰트 이름 찾기 // Get Korean font ID from CharShape's font_ids and find font name from face_names // HWP 파일의 font_id는 0-based indexing을 사용합니다 / HWP file uses 0-based indexing for font_id let font_id = char_shape.font_ids.korean as usize; let font_name = if font_id < document.doc_info.face_names.len() { &document.doc_info.face_names[font_id].name } else { "함초롬바탕" // 기본값 / Default }; css.push_str(&format!("font-family:\"{}\";", font_name)); // 속성 / Attributes if char_shape.attributes.bold { css.push_str("font-weight:bold;"); } if char_shape.attributes.italic { css.push_str("font-style:italic;"); } // 자간 (letter-spacing) / Letter spacing // 스펙 문서 표 33: letter_spacing은 -50%~50% 범위의 INT8 값 // Spec Table 33: letter_spacing is INT8 value in range -50%~50% // CSS의 letter-spacing은 텍스트 전체에 적용되므로 하나의 값만 사용 // CSS letter-spacing applies to entire text, so use only one value // 한글 우선, 없으면 다른 언어 중 0이 아닌 첫 번째 값 사용 // Prefer Korean, otherwise use first non-zero value from other languages let letter_spacing = if char_shape.letter_spacing.korean != 0 { char_shape.letter_spacing.korean } else if char_shape.letter_spacing.english != 0 { char_shape.letter_spacing.english } else if char_shape.letter_spacing.chinese != 0 { char_shape.letter_spacing.chinese } else if char_shape.letter_spacing.japanese != 0 { char_shape.letter_spacing.japanese } else if char_shape.letter_spacing.other != 0 { char_shape.letter_spacing.other } else if char_shape.letter_spacing.symbol != 0 { char_shape.letter_spacing.symbol } else if char_shape.letter_spacing.user != 0 { char_shape.letter_spacing.user } else { 0 }; if letter_spacing != 0 { // INT8 값을 %로 변환하여 em 단위로 적용 / Convert INT8 to % and apply as em unit // 실제 HWP 파일에서는 값이 2배로 저장되어 있으므로 2로 나눔 // In actual HWP files, values are stored as 2x, so divide by 2 // 예: -5 → -2.5 → -0.025em (반올림하면 -0.03em), 2 → 1 → 0.01em // Example: -5 → -2.5 → -0.025em (rounded to -0.03em), 2 → 1 → 0.01em let letter_spacing_em = (letter_spacing as f64 / 2.0) / 100.0; css.push_str(&format!("letter-spacing:{:.2}em;", letter_spacing_em)); } css.push_str("\n}\n"); } // 모든 ParaShape 스타일 생성 (ps0, ps1, ...) / Generate all ParaShape styles (ps0, ps1, ...) // 문서에 정의된 모든 para_shape를 미리 정의하여 누락 방지 / Pre-define all para_shapes in document to prevent missing styles for (idx, para_shape) in document.doc_info.para_shapes.iter().enumerate() { let class_name = format!("ps{}", idx); css.push_str(&format!(".{} {{\n", class_name)); // 정렬 / Alignment match para_shape.attributes1.align { ParagraphAlignment::Left => { css.push_str(" text-align:left;"); } ParagraphAlignment::Right => { css.push_str(" text-align:right;"); } ParagraphAlignment::Center => { css.push_str(" text-align:center;"); } ParagraphAlignment::Justify => { css.push_str(" text-align:justify;"); } _ => { css.push_str(" text-align:justify;"); } } css.push_str("\n}\n"); } // Print media query / Print media query css.push_str("@media print {\n"); css.push_str(".hpa {margin:0;border:0 black none;box-shadow:none;}\n"); css.push_str("body {padding:0;}\n"); css.push_str("}\n"); css } /// INT32를 mm 단위로 변환 / Convert INT32 to millimeters /// 값을 소수점 2자리로 반올림 / Round value to 2 decimal places pub fn round_to_2dp(value: f64) -> f64 { (value * 100.0).round() / 100.0 } pub fn int32_to_mm(value: INT32) -> f64 { // INT32는 1/7200인치 단위 (SHWPUNIT와 동일) (value as f64 / 7200.0) * 25.4 } /// mm를 INT32 단위로 변환 / Convert millimeters to INT32 pub fn mm_to_int32(value_mm: f64) -> INT32 { // INT32는 1/7200인치 단위 (SHWPUNIT와 동일) // 1 inch = 25.4 mm, 따라서 1 mm = 7200 / 25.4 INT32 ((value_mm / 25.4) * 7200.0) as INT32 } /// COLORREF를 RGB 문자열로 변환 / Convert COLORREF to RGB string pub fn colorref_to_rgb(color: COLORREF) -> String { format!("rgb({},{},{})", color.r(), color.g(), color.b()) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/text.rs
crates/hwp-core/src/viewer/html/text.rs
/// 텍스트 렌더링 모듈 / Text rendering module use crate::document::{ bodytext::{CharShapeInfo, ParagraphRecord}, HwpDocument, }; /// 텍스트를 HTML로 렌더링 / Render text to HTML pub fn render_text( text: &str, char_shapes: &[CharShapeInfo], document: &HwpDocument, _css_prefix: &str, ) -> String { if text.is_empty() { return String::new(); } let text_chars: Vec<char> = text.chars().collect(); let text_len = text_chars.len(); // CharShape 구간 계산 / Calculate CharShape segments let mut segments: Vec<(usize, usize, Option<usize>)> = Vec::new(); // CharShape 정보를 position 기준으로 정렬 / Sort CharShape info by position let mut sorted_shapes: Vec<_> = char_shapes.iter().collect(); sorted_shapes.sort_by_key(|shape| shape.position); // 구간 정의 / Define segments let mut positions = vec![0]; for shape_info in &sorted_shapes { let pos = shape_info.position as usize; if pos <= text_len { positions.push(pos); } } positions.push(text_len); positions.sort(); positions.dedup(); // 각 구간에 대한 CharShape 찾기 / Find CharShape for each segment for i in 0..positions.len() - 1 { let start = positions[i]; let end = positions[i + 1]; // 이 구간에 해당하는 CharShape 찾기 / Find CharShape for this segment let char_shape_id = sorted_shapes .iter() .rev() .find(|shape| (shape.position as usize) <= start) .map(|shape| shape.shape_id as usize); segments.push((start, end, char_shape_id)); } // 각 구간을 HTML로 렌더링 / Render each segment to HTML let mut result = String::new(); for (start, end, char_shape_id_opt) in segments { if start >= end { continue; } let segment_text: String = text_chars[start..end].iter().collect(); if segment_text.is_empty() { continue; } // CharShape 가져오기 / Get CharShape // HWP 파일의 shape_id는 0-based indexing을 사용합니다 / HWP file uses 0-based indexing for shape_id let char_shape_opt = char_shape_id_opt.and_then(|id| { if id < document.doc_info.char_shapes.len() { document.doc_info.char_shapes.get(id) } else { None } }); // 텍스트 스타일 적용 / Apply text styles // 첫 공백과 마지막 공백을 &nbsp;로 변환 (HTML 태그 적용 전에 처리) / Convert leading and trailing spaces to &nbsp; (process before applying HTML tags) let mut text_for_styling = segment_text.to_string(); // 첫 공백을 &nbsp;로 변환 / Convert leading space to &nbsp; if text_for_styling.starts_with(' ') { text_for_styling = text_for_styling.replacen(' ', "&nbsp;", 1); } // 마지막 공백을 &nbsp;로 변환 / Convert trailing space to &nbsp; if text_for_styling.ends_with(' ') { text_for_styling.pop(); text_for_styling.push_str("&nbsp;"); } if let Some(char_shape) = char_shape_opt { // CharShape 클래스 적용 / Apply CharShape class (0-based indexing to match XSL/XML format) let class_name = format!("cs{}", char_shape_id_opt.unwrap()); // 인라인 스타일 추가 / Add inline styles let mut inline_style = String::new(); // 폰트 크기 / Font size let size_pt = char_shape.base_size as f64 / 100.0; inline_style.push_str(&format!("font-size:{}pt;", size_pt)); // 텍스트 색상 / Text color let color = &char_shape.text_color; inline_style.push_str(&format!( "color:rgb({},{},{});", color.r(), color.g(), color.b() )); // 속성 / Attributes // bold는 CSS의 font-weight:bold로 처리되므로 <strong> 태그 사용하지 않음 // Bold is handled by CSS font-weight:bold, so don't use <strong> tag let mut styled_text = text_for_styling; if char_shape.attributes.italic { styled_text = format!("<em>{}</em>", styled_text); } if char_shape.attributes.underline_type > 0 { styled_text = format!("<u>{}</u>", styled_text); } if char_shape.attributes.strikethrough > 0 { styled_text = format!("<s>{}</s>", styled_text); } if char_shape.attributes.superscript { styled_text = format!("<sup>{}</sup>", styled_text); } if char_shape.attributes.subscript { styled_text = format!("<sub>{}</sub>", styled_text); } // .hrt span으로 래핑 / Wrap with .hrt span if !inline_style.is_empty() { result.push_str(&format!( r#"<span class="hrt {}" style="{}">{}</span>"#, class_name, inline_style, styled_text )); } else { result.push_str(&format!( r#"<span class="hrt {}">{}</span>"#, class_name, styled_text )); } } else { // CharShape가 없는 경우 기본 스타일 / Default style when no CharShape result.push_str(&format!(r#"<span class="hrt">{}</span>"#, text_for_styling)); } } result } /// 문단에서 텍스트와 CharShape 추출 / Extract text and CharShape from paragraph pub fn extract_text_and_shapes( paragraph: &crate::document::bodytext::Paragraph, ) -> (String, Vec<CharShapeInfo>) { let mut text = String::new(); let mut char_shapes = Vec::new(); for record in &paragraph.records { match record { ParagraphRecord::ParaText { text: para_text, .. } => { text.push_str(para_text); } ParagraphRecord::ParaCharShape { shapes } => { char_shapes.extend(shapes.iter().cloned()); } _ => {} } } (text, char_shapes) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/options.rs
crates/hwp-core/src/viewer/html/options.rs
/// HTML 변환 옵션 / HTML conversion options #[derive(Debug, Clone)] pub struct HtmlOptions { /// 이미지를 파일로 저장할 디렉토리 경로 (None이면 base64 데이터 URI로 임베드) /// Optional directory path to save images as files. If None, images are embedded as base64 data URIs. pub image_output_dir: Option<String>, /// HTML 파일이 저장되는 디렉토리 경로 (이미지 상대 경로 계산에 사용) /// Directory path where HTML file is saved (used for calculating relative image paths) pub html_output_dir: Option<String>, /// 버전 정보 포함 여부 / Whether to include version information pub include_version: Option<bool>, /// 페이지 정보 포함 여부 / Whether to include page information pub include_page_info: Option<bool>, /// CSS 클래스 접두사 (기본값: "" - noori.html 스타일) /// CSS class prefix (default: "" - noori.html style) pub css_class_prefix: String, } impl Default for HtmlOptions { fn default() -> Self { Self { image_output_dir: None, html_output_dir: None, include_version: Some(true), include_page_info: Some(false), css_class_prefix: String::new(), // noori.html 스타일은 접두사 없음 } } } impl HtmlOptions { /// 이미지 출력 디렉토리 설정 / Set image output directory pub fn with_image_output_dir(mut self, dir: Option<&str>) -> Self { self.image_output_dir = dir.map(|s| s.to_string()); self } /// 버전 정보 포함 설정 / Set version information inclusion pub fn with_include_version(mut self, include: Option<bool>) -> Self { self.include_version = include; self } /// 페이지 정보 포함 설정 / Set page information inclusion pub fn with_include_page_info(mut self, include: Option<bool>) -> Self { self.include_page_info = include; self } /// CSS 클래스 접두사 설정 / Set CSS class prefix pub fn with_css_class_prefix(mut self, prefix: &str) -> Self { self.css_class_prefix = prefix.to_string(); self } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/mod.rs
crates/hwp-core/src/viewer/html/mod.rs
/// HTML converter for HWP documents /// HWP 문서를 HTML로 변환하는 모듈 /// /// This module provides functionality to convert HWP documents to HTML format. /// 이 모듈은 HWP 문서를 HTML 형식으로 변환하는 기능을 제공합니다. /// /// noori.html 스타일의 정확한 레이아웃 HTML 뷰어 mod common; mod ctrl_header; mod document; mod image; mod line_segment; mod options; mod page; mod pagination; mod paragraph; mod styles; mod text; // Re-export public API pub use document::to_html; pub use options::HtmlOptions;
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/common.rs
crates/hwp-core/src/viewer/html/common.rs
/// HTML 뷰어 공통 유틸리티 함수 / HTML viewer common utility functions use crate::document::{BinDataRecord, HwpDocument}; use crate::{HwpError, WORD}; use base64::{engine::general_purpose::STANDARD, Engine as _}; use std::fs; use std::path::Path; /// Get file extension from BinData ID /// BinData ID에서 파일 확장자 가져오기 pub fn get_extension_from_bindata_id(document: &HwpDocument, bindata_id: WORD) -> String { for record in &document.doc_info.bin_data { if let BinDataRecord::Embedding { embedding, .. } = record { if embedding.binary_data_id == bindata_id { return embedding.extension.clone(); } } } "jpg".to_string() } /// Get MIME type from BinData ID /// BinData ID에서 MIME 타입 가져오기 pub fn get_mime_type_from_bindata_id(document: &HwpDocument, bindata_id: WORD) -> String { for record in &document.doc_info.bin_data { if let BinDataRecord::Embedding { embedding, .. } = record { if embedding.binary_data_id == bindata_id { return match embedding.extension.to_lowercase().as_str() { "jpg" | "jpeg" => "image/jpeg", "png" => "image/png", "gif" => "image/gif", "bmp" => "image/bmp", _ => "image/jpeg", } .to_string(); } } } "image/jpeg".to_string() } /// Save image to file and return file path /// 이미지를 파일로 저장하고 파일 경로 반환 pub fn save_image_to_file( document: &HwpDocument, bindata_id: crate::types::WORD, base64_data: &str, dir_path: &str, ) -> Result<String, HwpError> { // base64 디코딩 / Decode base64 let image_data = STANDARD .decode(base64_data) .map_err(|e| HwpError::InternalError { message: format!("Failed to decode base64: {}", e), })?; // 파일명 생성 / Generate filename let extension = get_extension_from_bindata_id(document, bindata_id); let file_name = format!("BIN{:04X}.{}", bindata_id, extension); let file_path = Path::new(dir_path).join(&file_name); // 디렉토리 생성 / Create directory fs::create_dir_all(dir_path) .map_err(|e| HwpError::Io(format!("Failed to create directory '{}': {}", dir_path, e)))?; // 파일 저장 / Save file fs::write(&file_path, &image_data).map_err(|e| { HwpError::Io(format!( "Failed to write file '{}': {}", file_path.display(), e )) })?; Ok(file_path.to_string_lossy().to_string()) } /// Get image URL (file path or base64 data URI) /// 이미지 URL 가져오기 (파일 경로 또는 base64 데이터 URI) pub fn get_image_url( document: &HwpDocument, bindata_id: WORD, image_output_dir: Option<&str>, html_output_dir: Option<&str>, ) -> String { // BinData에서 이미지 데이터 찾기 / Find image data from BinData let base64_data = document .bin_data .items .iter() .find(|item| item.index == bindata_id) .map(|item| item.data.as_str()) .unwrap_or(""); if base64_data.is_empty() { return String::new(); } match image_output_dir { Some(dir_path) => { // 이미지를 파일로 저장 / Save image as file match save_image_to_file(document, bindata_id, base64_data, dir_path) { Ok(file_path) => { // HTML 출력 디렉토리가 있으면 상대 경로 계산 / Calculate relative path if HTML output directory is provided if let Some(html_dir) = html_output_dir { let image_path = Path::new(&file_path); let html_path = Path::new(html_dir); // 상대 경로 계산 / Calculate relative path match pathdiff::diff_paths(image_path, html_path) { Some(relative_path) => { // 경로 구분자를 슬래시로 통일 / Normalize path separators to forward slashes relative_path.to_string_lossy().replace('\\', "/") } None => { // 상대 경로 계산 실패 시 파일명만 반환 / Return filename only if relative path calculation fails image_path .file_name() .and_then(|n| n.to_str()) .map(|s| s.to_string()) .unwrap_or_else(|| file_path) } } } else { // HTML 출력 디렉토리가 없으면 파일명만 반환 / Return filename only if HTML output directory is not provided let file_path_obj = Path::new(&file_path); file_path_obj .file_name() .and_then(|n| n.to_str()) .unwrap_or(&file_path) .to_string() } } Err(_) => { // 실패 시 base64로 폴백 / Fallback to base64 on failure let mime_type = get_mime_type_from_bindata_id(document, bindata_id); format!("data:{};base64,{}", mime_type, base64_data) } } } None => { // base64 데이터 URI로 임베드 / Embed as base64 data URI let mime_type = get_mime_type_from_bindata_id(document, bindata_id); format!("data:{};base64,{}", mime_type, base64_data) } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/pagination.rs
crates/hwp-core/src/viewer/html/pagination.rs
/// 페이지네이션 모듈 / Pagination module /// /// HTML 뷰어의 페이지 나누기 로직을 담당합니다. /// Handles page break logic for HTML viewer. use crate::document::bodytext::{ColumnDivideType, PageDef, ParagraphRecord}; use crate::document::Paragraph; /// 페이지네이션 컨텍스트 / Pagination context pub struct PaginationContext { /// 이전 문단의 vertical_position (mm) pub prev_vertical_mm: Option<f64>, /// 현재 페이지의 최대 vertical_position (mm) pub current_max_vertical_mm: f64, /// 콘텐츠 영역 높이 (mm) pub content_height_mm: f64, } /// 페이지네이션 결과 / Pagination result pub struct PaginationResult { /// 페이지 나누기 여부 pub has_page_break: bool, /// 페이지 나누기 원인 pub reason: Option<PageBreakReason>, } /// 페이지 나누기 원인 / Page break reason #[derive(Debug, Clone, Copy, PartialEq, Eq)] pub enum PageBreakReason { /// 명시적 페이지 나누기 (column_divide_type) Explicit, /// PageDef 변경 (새 페이지 설정) PageDefChange, /// vertical_position 리셋 VerticalReset, /// vertical_position 오버플로우 VerticalOverflow, /// 테이블 오버플로우 (테이블이 페이지 높이를 초과) TableOverflow, /// 이미지/모양 객체 오버플로우 (객체가 페이지 높이를 초과) ObjectOverflow, } /// 페이지 나누기 여부 확인 (문단) / Check if page break is needed (paragraph) /// 모든 전략을 조합하여 확인: explicit > page_def_change > vertical_reset > vertical_overflow /// Checks all strategies combined: explicit > page_def_change > vertical_reset > vertical_overflow pub fn check_paragraph_page_break( paragraph: &Paragraph, context: &PaginationContext, current_page_def: Option<&PageDef>, ) -> PaginationResult { // 1. 첫 번째 LineSegment의 vertical_position 추출 let first_vertical_mm = extract_first_vertical_position(paragraph); // 2. PageDef 변경 확인 let has_page_def_change = check_page_def_change(paragraph, current_page_def); // 3. 모든 전략 확인 (우선순위: explicit > page_def_change > vertical_reset > vertical_overflow) let has_explicit = check_explicit_page_break(paragraph); let has_vertical_reset = check_vertical_reset(context.prev_vertical_mm, first_vertical_mm); let has_vertical_overflow = check_vertical_overflow( first_vertical_mm, context.content_height_mm, context.current_max_vertical_mm, ); // 우선순위에 따라 첫 번째 true인 원인을 반환 if has_explicit { PaginationResult { has_page_break: true, reason: Some(PageBreakReason::Explicit), } } else if has_page_def_change { PaginationResult { has_page_break: true, reason: Some(PageBreakReason::PageDefChange), } } else if has_vertical_reset { PaginationResult { has_page_break: true, reason: Some(PageBreakReason::VerticalReset), } } else if has_vertical_overflow { PaginationResult { has_page_break: true, reason: Some(PageBreakReason::VerticalOverflow), } } else { PaginationResult { has_page_break: false, reason: None, } } } /// 테이블 페이지 나누기 확인 / Check if table causes page break /// 테이블의 top과 height를 받아서 페이지를 넘어가는지 확인 /// current_max_vertical_mm을 고려하여 테이블이 페이지를 넘어가는지 확인 pub fn check_table_page_break( table_top_mm: f64, table_height_mm: f64, context: &PaginationContext, ) -> PaginationResult { let table_bottom_mm = table_top_mm + table_height_mm; // 테이블이 페이지를 넘어가는지 확인 // 1. 테이블의 bottom이 content_height_mm을 넘어가는 경우 // 2. 또는 테이블의 top이 current_max_vertical_mm보다 크고, 테이블의 bottom이 content_height_mm에 매우 가까운 경우 (95% 이상) // Check if table overflows page // 1. Table bottom exceeds content_height_mm // 2. Or table top is greater than current_max_vertical_mm and table bottom is very close to content_height_mm (95% or more) if table_bottom_mm > context.content_height_mm { // 테이블이 페이지를 넘어가는 경우, current_max_vertical_mm이 0보다 크면 페이지네이션 발생 // If table overflows, pagination occurs if current_max_vertical_mm > 0 if context.current_max_vertical_mm > 0.0 { PaginationResult { has_page_break: true, reason: Some(PageBreakReason::TableOverflow), } } else { // 첫 페이지이지만 테이블이 페이지를 넘어가는 경우, 페이지네이션 발생 // Even on first page, if table overflows, pagination occurs PaginationResult { has_page_break: true, reason: Some(PageBreakReason::TableOverflow), } } } else if table_top_mm > context.current_max_vertical_mm && table_bottom_mm > context.content_height_mm && context.current_max_vertical_mm > 0.0 { // 테이블이 페이지를 넘어가는 경우 (table_bottom_mm > content_height_mm) // Table overflows page (table_bottom_mm > content_height_mm) // 테이블의 top이 current_max_vertical_mm보다 크고, 테이블의 bottom이 content_height_mm을 넘어가는 경우 // If table top is greater than current_max_vertical_mm and table bottom exceeds content_height_mm PaginationResult { has_page_break: true, reason: Some(PageBreakReason::TableOverflow), } } else { PaginationResult { has_page_break: false, reason: None, } } } /// 이미지/모양 객체 페이지 나누기 확인 / Check if image/shape object causes page break pub fn check_object_page_break( object_top_mm: f64, object_height_mm: f64, context: &PaginationContext, ) -> PaginationResult { let object_bottom_mm = object_top_mm + object_height_mm; if object_bottom_mm > context.content_height_mm && context.current_max_vertical_mm > 0.0 { PaginationResult { has_page_break: true, reason: Some(PageBreakReason::ObjectOverflow), } } else { PaginationResult { has_page_break: false, reason: None, } } } /// 첫 번째 LineSegment의 vertical_position 추출 / Extract first LineSegment's vertical_position fn extract_first_vertical_position(paragraph: &Paragraph) -> Option<f64> { for record in &paragraph.records { if let ParagraphRecord::ParaLineSeg { segments } = record { if let Some(first_segment) = segments.first() { return Some(first_segment.vertical_position as f64 * 25.4 / 7200.0); } } } None } /// 명시적 페이지 나누기 확인 / Check explicit page break fn check_explicit_page_break(paragraph: &Paragraph) -> bool { paragraph .para_header .column_divide_type .iter() .any(|t| matches!(t, ColumnDivideType::Page | ColumnDivideType::Section)) } /// vertical_position 리셋 확인 / Check vertical_position reset fn check_vertical_reset(prev_vertical_mm: Option<f64>, current_vertical_mm: Option<f64>) -> bool { if let (Some(prev), Some(current)) = (prev_vertical_mm, current_vertical_mm) { current < 0.1 || (prev > 0.1 && current < prev - 0.1) } else if let Some(current) = current_vertical_mm { current < 0.1 && prev_vertical_mm.is_some() } else { false } } /// vertical_position 오버플로우 확인 / Check vertical_position overflow fn check_vertical_overflow( current_vertical_mm: Option<f64>, content_height_mm: f64, current_max_vertical_mm: f64, ) -> bool { if let Some(current) = current_vertical_mm { current > content_height_mm && current_max_vertical_mm > 0.0 } else { false } } /// PageDef 변경 확인 / Check if PageDef changed fn check_page_def_change(paragraph: &Paragraph, current_page_def: Option<&PageDef>) -> bool { // 문단의 레코드에서 PageDef 찾기 / Find PageDef in paragraph records for record in &paragraph.records { if let ParagraphRecord::PageDef { page_def } = record { // PageDef가 있고, 현재 PageDef와 다르면 새 페이지 / If PageDef exists and differs from current, new page // 포인터 비교로 변경 여부 확인 / Check change by pointer comparison return current_page_def .map(|pd| !std::ptr::eq(pd as *const _, page_def as *const _)) .unwrap_or(true); } // CtrlHeader의 children에서도 확인 / Also check in CtrlHeader's children if let ParagraphRecord::CtrlHeader { children, .. } = record { for child in children { if let ParagraphRecord::PageDef { page_def } = child { return current_page_def .map(|pd| !std::ptr::eq(pd as *const _, page_def as *const _)) .unwrap_or(true); } } } } false } #[cfg(test)] mod tests { use super::*; use crate::document::bodytext::ParaHeader; fn create_test_paragraph() -> Paragraph { let mut para_header = ParaHeader::default(); para_header.para_shape_id = 0; para_header.column_divide_type = vec![]; para_header.control_mask = crate::document::bodytext::ControlMask::new(0); para_header.text_char_count = 0; Paragraph { para_header, records: vec![], } } #[test] fn test_check_explicit_page_break() { let mut para = create_test_paragraph(); para.para_header.column_divide_type = vec![ColumnDivideType::Page]; assert!(check_explicit_page_break(&para)); para.para_header.column_divide_type = vec![ColumnDivideType::Section]; assert!(check_explicit_page_break(&para)); para.para_header.column_divide_type = vec![]; assert!(!check_explicit_page_break(&para)); } #[test] fn test_check_vertical_reset() { // prev가 있고 current가 0이면 리셋 assert!(check_vertical_reset(Some(10.0), Some(0.05))); // prev가 있고 current가 prev보다 작으면 리셋 assert!(check_vertical_reset(Some(10.0), Some(9.8))); // prev가 없고 current가 0이면 리셋 아님 (첫 문단) assert!(!check_vertical_reset(None, Some(0.05))); // prev가 있고 current가 prev보다 크면 리셋 아님 assert!(!check_vertical_reset(Some(10.0), Some(10.5))); } #[test] fn test_check_vertical_overflow() { let content_height = 250.0; // current가 content_height를 초과하고 current_max가 있으면 오버플로우 assert!(check_vertical_overflow(Some(260.0), content_height, 10.0)); // current가 content_height를 초과하지만 current_max가 0이면 오버플로우 아님 assert!(!check_vertical_overflow(Some(260.0), content_height, 0.0)); // current가 content_height를 초과하지 않으면 오버플로우 아님 assert!(!check_vertical_overflow(Some(240.0), content_height, 10.0)); } #[test] fn test_check_table_page_break() { let context = PaginationContext { prev_vertical_mm: None, current_max_vertical_mm: 10.0, content_height_mm: 250.0, }; // 테이블이 페이지를 넘어가면 페이지 나누기 let result = check_table_page_break(240.0, 20.0, &context); assert!(result.has_page_break); assert_eq!(result.reason, Some(PageBreakReason::TableOverflow)); // 테이블이 페이지를 넘어가지 않으면 페이지 나누기 아님 let result = check_table_page_break(240.0, 5.0, &context); assert!(!result.has_page_break); // current_max_vertical_mm이 0이면 페이지 나누기 아님 let context_empty = PaginationContext { prev_vertical_mm: None, current_max_vertical_mm: 0.0, content_height_mm: 250.0, }; let result = check_table_page_break(240.0, 20.0, &context_empty); assert!(!result.has_page_break); } #[test] fn test_check_object_page_break() { let context = PaginationContext { prev_vertical_mm: None, current_max_vertical_mm: 10.0, content_height_mm: 250.0, }; // 객체가 페이지를 넘어가면 페이지 나누기 let result = check_object_page_break(240.0, 20.0, &context); assert!(result.has_page_break); assert_eq!(result.reason, Some(PageBreakReason::ObjectOverflow)); // 객체가 페이지를 넘어가지 않으면 페이지 나누기 아님 let result = check_object_page_break(240.0, 5.0, &context); assert!(!result.has_page_break); } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/line_segment.rs
crates/hwp-core/src/viewer/html/line_segment.rs
use crate::document::bodytext::ctrl_header::VertRelTo; /// 라인 세그먼트 렌더링 모듈 / Line segment rendering module use crate::document::bodytext::{ control_char::{ControlChar, ControlCharPosition}, CharShapeInfo, LineSegmentInfo, PageDef, Table, }; use crate::document::CtrlHeaderData; use crate::viewer::html::ctrl_header::table::{CaptionData, TablePosition, TableRenderContext}; use crate::viewer::html::styles::{int32_to_mm, round_to_2dp}; use crate::viewer::HtmlOptions; use crate::{HwpDocument, ParaShape}; use std::collections::HashMap; /// 라인 세그먼트 렌더링 콘텐츠 / Line segment rendering content pub struct LineSegmentContent<'a> { pub segments: &'a [LineSegmentInfo], pub text: &'a str, pub char_shapes: &'a [CharShapeInfo], pub control_char_positions: &'a [ControlCharPosition], pub original_text_len: usize, pub images: &'a [ImageInfo], pub tables: &'a [TableInfo<'a>], } /// 라인 세그먼트 렌더링 컨텍스트 / Line segment rendering context pub struct LineSegmentRenderContext<'a> { pub document: &'a HwpDocument, pub para_shape_class: &'a str, pub options: &'a HtmlOptions, pub para_shape_indent: Option<i32>, pub hcd_position: Option<(f64, f64)>, pub page_def: Option<&'a PageDef>, } /// 문서 레벨 렌더링 상태 / Document-level rendering state pub struct DocumentRenderState<'a> { pub table_counter_start: u32, pub pattern_counter: &'a mut usize, pub color_to_pattern: &'a mut HashMap<u32, String>, } /// 테이블 정보 구조체 / Table info struct #[derive(Debug, Clone)] pub struct TableInfo<'a> { pub table: &'a Table, pub ctrl_header: Option<&'a CtrlHeaderData>, /// 문단 텍스트 내 컨트롤 문자(Shape/Table) 앵커 위치 (UTF-16 WCHAR 인덱스 기준) /// Anchor position of the control char in paragraph text (UTF-16 WCHAR index) pub anchor_char_pos: Option<usize>, pub caption: Option<CaptionData<'a>>, // 캡션 데이터 / Caption data } /// 이미지 정보 구조체 / Image info struct #[derive(Debug, Clone)] pub struct ImageInfo { pub width: u32, pub height: u32, pub url: String, /// object_common 속성: 글자처럼 취급 여부 / object_common attribute: treat as letters pub like_letters: bool, /// object_common 속성: 줄 간격에 영향 여부 / object_common attribute: affect line spacing pub affect_line_spacing: bool, /// object_common 속성: 세로 기준 위치 / object_common attribute: vertical reference position pub vert_rel_to: Option<VertRelTo>, } /// 라인 세그먼트를 HTML로 렌더링 / Render line segment to HTML pub fn render_line_segment( segment: &LineSegmentInfo, content: &str, para_shape_class: &str, para_shape_indent: Option<i32>, // ParaShape의 indent 값 (옵션) / ParaShape indent value (optional) para_shape: Option<&ParaShape>, // ParaShape 정보 (옵션) / ParaShape info (optional) is_text_segment: bool, // 텍스트 세그먼트 여부 (테이블/이미지 like_letters 등은 false) override_size_mm: Option<(f64, f64)>, // 비텍스트 세그먼트(이미지 등)에서 hls box 크기 override ) -> String { let left_mm = round_to_2dp(int32_to_mm(segment.column_start_position)); let vertical_pos_mm = int32_to_mm(segment.vertical_position); let (width_mm, height_mm) = if let Some((w, h)) = override_size_mm { (round_to_2dp(w), round_to_2dp(h)) } else { ( round_to_2dp(int32_to_mm(segment.segment_width)), round_to_2dp(int32_to_mm(segment.line_height)), ) }; let text_height_mm = round_to_2dp(int32_to_mm(segment.text_height)); let _line_spacing_mm = round_to_2dp(int32_to_mm(segment.line_spacing)); // baseline_distance_mm는 fixture 매칭 계산에서 직접 사용하지 않지만, // 필요 시 디버깅을 위해 남겨둘 수 있습니다. // NOTE (HWP 데이터 기반 + 스펙 기반 추론): // - 스펙(표 44 bit8): use_line_grid=true 인 문단은 "편집 용지의 줄 격자"를 사용합니다. // 이 경우 줄 높이는 격자에 의해 고정되며(=LineSegmentInfo.line_height가 의미를 갖는다고 보는 게 자연스럽고), // baseline_distance는 "줄의 세로 위치에서 베이스라인까지 거리"(표 62)로서 CSS line-height 그 자체가 아닙니다. // // 따라서: // - use_line_grid=false: 기존처럼 line-height=baseline_distance, top은 baseline 중심 보정 // - use_line_grid=true : line-height=line_height, top은 (line_height - text_height)/2 로 중앙 정렬 let use_line_grid = para_shape .map(|ps| ps.attributes1.use_line_grid) .unwrap_or(false); let line_height_value = if is_text_segment { if use_line_grid { // 줄 격자 사용: "줄의 높이"를 사용 round_to_2dp(int32_to_mm(segment.line_height)) } else { // 일반: baseline_distance를 사용 round_to_2dp(int32_to_mm(segment.baseline_distance)) } } else { height_mm }; let top_mm = if is_text_segment { if use_line_grid { // 줄 격자 사용: 줄 높이 안에서 텍스트를 중앙 정렬 let offset_mm = (line_height_value - text_height_mm) / 2.0; round_to_2dp(vertical_pos_mm + offset_mm) } else { // 일반: baseline 보정 let baseline_offset_mm = (line_height_value - text_height_mm) / 2.0; round_to_2dp(vertical_pos_mm + baseline_offset_mm) } } else { round_to_2dp(vertical_pos_mm) }; let mut style = format!( "line-height:{:.2}mm;white-space:nowrap;left:{:.2}mm;top:{:.2}mm;height:{:.2}mm;width:{:.2}mm;", line_height_value, left_mm, top_mm, height_mm, width_mm ); // padding-left 처리 (들여쓰기) / Handle padding-left (indentation) if segment.tag.has_indentation { // NOTE: // HWP ParaShape의 `indent`는 첫 줄 들여쓰기(음수 가능; 내어쓰기/행잉 인덴트 표현)이고, // `outdent`는 다음 줄(들여쓰기 적용 라인)의 오프셋으로 사용하는 값입니다. // fixture(noori.html)에서 line_segment.tag.has_indentation=true인 라인은 // padding-left가 양수로 적용되는데, 이는 `indent`가 아니라 `outdent`에 해당합니다. // // 우선순위: ParaShape.outdent → (fallback) 전달받은 para_shape_indent if let Some(ps) = para_shape { let outdent_mm = round_to_2dp(int32_to_mm(ps.outdent)); style.push_str(&format!("padding-left:{:.2}mm;", outdent_mm)); } else if let Some(indent) = para_shape_indent { let indent_mm = round_to_2dp(int32_to_mm(indent)); style.push_str(&format!("padding-left:{:.2}mm;", indent_mm)); } } format!( r#"<div class="hls {}" style="{}">{}</div>"#, para_shape_class, style, content ) } /// 라인 세그먼트를 HTML로 렌더링 (ParaShape indent 포함) / Render line segment to HTML (with ParaShape indent) pub fn render_line_segment_with_indent( segment: &LineSegmentInfo, content: &str, para_shape_class: &str, para_shape_indent: Option<i32>, ) -> String { render_line_segment( segment, content, para_shape_class, para_shape_indent, None, true, None, ) } /// 라인 세그먼트 그룹을 HTML로 렌더링 / Render line segment group to HTML pub fn render_line_segments( segments: &[LineSegmentInfo], text: &str, char_shapes: &[CharShapeInfo], document: &HwpDocument, para_shape_class: &str, ) -> String { // 이 함수는 레거시 호환성을 위해 유지되지만, 내부적으로는 독립적인 pattern_counter를 사용합니다. // This function is kept for legacy compatibility but uses an independent pattern_counter internally. use std::collections::HashMap; let mut pattern_counter = 0; let mut color_to_pattern: HashMap<u32, String> = HashMap::new(); let content = LineSegmentContent { segments, text, char_shapes, control_char_positions: &[], original_text_len: text.chars().count(), images: &[], tables: &[], }; let context = LineSegmentRenderContext { document, para_shape_class, options: &HtmlOptions::default(), para_shape_indent: None, hcd_position: None, page_def: None, }; let mut state = DocumentRenderState { table_counter_start: 1, pattern_counter: &mut pattern_counter, color_to_pattern: &mut color_to_pattern, }; render_line_segments_with_content(&content, &context, &mut state) } /// 라인 세그먼트 그룹을 HTML로 렌더링 (이미지와 테이블 포함) / Render line segment group to HTML (with images and tables) pub fn render_line_segments_with_content( content: &LineSegmentContent, context: &LineSegmentRenderContext, state: &mut DocumentRenderState, ) -> String { // 구조체에서 개별 값 추출 / Extract individual values from structs let segments = content.segments; let text = content.text; let char_shapes = content.char_shapes; let control_char_positions = content.control_char_positions; let original_text_len = content.original_text_len; let images = content.images; let tables = content.tables; let document = context.document; let para_shape_class = context.para_shape_class; let options = context.options; let para_shape_indent = context.para_shape_indent; let hcd_position = context.hcd_position; let page_def = context.page_def; let table_counter_start = state.table_counter_start; // pattern_counter와 color_to_pattern은 이미 &mut이므로 직접 사용 / pattern_counter and color_to_pattern are already &mut, so use directly let mut result = String::new(); // 원본 WCHAR 인덱스(original) -> cleaned_text 인덱스(cleaned) 매핑 // Map original WCHAR index -> cleaned_text index. // // control_char_positions.position은 "원본 WCHAR 인덱스" 기준입니다. // text(여기 인자)는 제어 문자를 대부분 제거한 cleaned_text 입니다. fn original_to_cleaned_index(pos: usize, control_chars: &[ControlCharPosition]) -> isize { let mut delta: isize = 0; // cleaned = original + delta for cc in control_chars.iter() { if cc.position >= pos { break; } let size = ControlChar::get_size_by_code(cc.code) as isize; let contributes = if ControlChar::is_convertible(cc.code) && cc.code != ControlChar::PARA_BREAK && cc.code != ControlChar::LINE_BREAK { 1 } else { 0 } as isize; delta += contributes - size; } delta } fn slice_cleaned_by_original_range( cleaned: &str, control_chars: &[ControlCharPosition], start_original: usize, end_original: usize, ) -> String { let start_delta = original_to_cleaned_index(start_original, control_chars); let end_delta = original_to_cleaned_index(end_original, control_chars); let start_cleaned = (start_original as isize + start_delta).max(0) as usize; let end_cleaned = (end_original as isize + end_delta).max(0) as usize; let cleaned_chars: Vec<char> = cleaned.chars().collect(); let s = start_cleaned.min(cleaned_chars.len()); let e = end_cleaned.min(cleaned_chars.len()); if s >= e { return String::new(); } cleaned_chars[s..e].iter().collect() } for segment in segments { let mut content = String::new(); let mut override_size_mm: Option<(f64, f64)> = None; // 이 세그먼트에 해당하는 텍스트 추출 (원본 WCHAR 인덱스 기준) / Extract text for this segment (based on original WCHAR indices) let start_pos = segment.text_start_position as usize; let end_pos = if let Some(next_segment) = segments .iter() .find(|s| s.text_start_position > segment.text_start_position) { next_segment.text_start_position as usize } else { original_text_len }; let segment_text = slice_cleaned_by_original_range(text, control_char_positions, start_pos, end_pos); // 이 세그먼트에 해당하는 CharShape 필터링 / Filter CharShape for this segment // // IMPORTANT: // CharShapeInfo.position은 "문단 전체 텍스트(원본 WCHAR) 기준" 인덱스입니다. // 여기서는 원본(start_pos..end_pos) 범위를 기준으로 segment_char_shapes를 보정해야 합니다. // position을 세그먼트 기준(0부터)으로 보정하지 않으면 스타일(csXX)이 누락되어 // `<span class="hrt">...</span>`로 떨어질 수 있습니다. (noori.html에서 재현) // // Strategy: // - 세그먼트 시작 위치(start_pos)에 해당하는 CharShape가 있으면 그것을 0으로 이동 // - 없으면 start_pos 이전의 마지막 CharShape를 기본으로 0 위치에 추가 // - 세그먼트 범위 내 CharShape는 position -= start_pos 로 이동 let mut segment_char_shapes: Vec<CharShapeInfo> = Vec::new(); // 세그먼트 시작점에 정확히 CharShape 변화가 있는지 확인 / Check if there's a shape change exactly at start_pos let has_shape_at_start = char_shapes .iter() .any(|shape| shape.position as usize == start_pos); // start_pos 이전의 마지막 CharShape를 기본으로 포함 / Include the last shape before start_pos as the default if !has_shape_at_start { if let Some(prev_shape) = char_shapes .iter() .filter(|shape| (shape.position as usize) < start_pos) .max_by_key(|shape| shape.position) { segment_char_shapes.push(CharShapeInfo { position: 0, shape_id: prev_shape.shape_id, }); } } // 세그먼트 범위 내 CharShape를 보정해서 추가 / Add in-range shapes with adjusted positions for shape in char_shapes.iter() { let pos = shape.position as usize; if pos >= start_pos && pos < end_pos { segment_char_shapes.push(CharShapeInfo { position: (pos - start_pos) as u32, shape_id: shape.shape_id, }); } } // position 기준 정렬 (render_text에서 다시 정렬하지만, 여기서도 정렬해두면 안정적) / Sort by position segment_char_shapes.sort_by_key(|s| s.position); // 세그먼트 인덱스 계산 / Calculate segment index let segment_index = segments .iter() .position(|s| std::ptr::eq(s, segment)) .unwrap_or(0); // 텍스트가 비어있는지 확인 / Check if text is empty let is_text_empty = segment_text.trim().is_empty(); // is_empty_segment 플래그 확인 / Check is_empty_segment flag let is_empty_segment = segment.tag.is_empty_segment; // 빈 세그먼트 카운터 (is_empty_segment 플래그를 사용) / Empty segment counter (using is_empty_segment flag) let mut empty_count = 0; for (idx, seg) in segments.iter().enumerate() { if idx >= segment_index { break; } if seg.tag.is_empty_segment { empty_count += 1; } } // 이미지와 테이블 렌더링 / Render images and tables // // 정확도 최우선: // - 테이블(like_letters=true)은 "빈 세그먼트 순서"가 아니라 ParaText control_char_positions(앵커) 기반으로 // 어떤 LineSegment에 속하는지 결정해서 딱 한 번만 렌더링합니다. // - 이미지는 기존 empty_count 방식 유지 (향후 필요 시 동일 방식으로 개선 가능) // 이 세그먼트 범위에 속하는 테이블 찾기 (앵커 기반; 원본 인덱스 기준) / Find tables for this segment (anchor-based; original indices) let mut tables_for_segment: Vec<&TableInfo> = Vec::new(); for t in tables.iter() { if let Some(anchor) = t.anchor_char_pos { if anchor >= start_pos && anchor < end_pos { tables_for_segment.push(t); } } } if !tables_for_segment.is_empty() { // 테이블 렌더링 (앵커 기반) / Render tables (anchor-based) use crate::viewer::html::ctrl_header::table::render_table; for (idx_in_seg, table_info) in tables_for_segment.iter().enumerate() { let current_table_number = table_counter_start + idx_in_seg as u32; let segment_position = Some((segment.column_start_position, segment.vertical_position)); let mut context = TableRenderContext { document, ctrl_header: table_info.ctrl_header, page_def, options, table_number: Some(current_table_number), pattern_counter: state.pattern_counter, color_to_pattern: state.color_to_pattern, }; let position = TablePosition { hcd_position, segment_position, para_start_vertical_mm: None, para_start_column_mm: None, para_segment_width_mm: None, first_para_vertical_mm: None, }; let table_html = render_table( table_info.table, &mut context, position, table_info.caption.as_ref(), ); content.push_str(&table_html); } } else if (is_empty_segment || is_text_empty) && !images.is_empty() && empty_count < images.len() { // 이미지 렌더링 (빈 세그먼트에 이미지) / Render images (images in empty segments) let image = &images[empty_count]; use crate::viewer::html::image::render_image_with_style; let image_html = render_image_with_style( &image.url, 0, 0, image.width as crate::types::INT32, image.height as crate::types::INT32, 0, 0, ); content.push_str(&image_html); // IMPORTANT: 일부 파일(noori 'BIN0002.bmp')에서 LineSegment의 segment_width/line_height가 0에 가깝게 나와 // hls 박스가 0폭/작은 높이로 생성되며 이미지 중앙정렬이 깨집니다. // fixture(noori.html) 기준으로는 이미지가 셀에 별도 배치되는 케이스가 있어 // hls width는 원래 segment_width(0일 수 있음)를 유지하고, height만 이미지 높이에 맞춥니다. override_size_mm = Some(( round_to_2dp(int32_to_mm(segment.segment_width)), round_to_2dp(int32_to_mm(image.height as crate::types::INT32)), )); } else if !is_text_empty { // 텍스트 렌더링 / Render text use crate::viewer::html::text::render_text; let rendered_text = render_text(&segment_text, &segment_char_shapes, document, ""); content.push_str(&rendered_text); } // 라인 세그먼트 렌더링 / Render line segment // ParaShape 정보 가져오기 (para_shape_class에서 ID 추출) / Get ParaShape info (extract ID from para_shape_class) let para_shape = if para_shape_class.starts_with("ps") { if let Ok(para_shape_id) = para_shape_class[2..].parse::<usize>() { if para_shape_id < document.doc_info.para_shapes.len() { Some(&document.doc_info.para_shapes[para_shape_id]) } else { None } } else { None } } else { None }; result.push_str(&render_line_segment( segment, &content, para_shape_class, para_shape_indent, para_shape, // 텍스트 렌더링 경로일 때만 true. (이미지/테이블 like_letters를 배치한 세그먼트는 false) !(!tables_for_segment.is_empty() || ((is_empty_segment || is_text_empty) && !images.is_empty())), override_size_mm, )); } result }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/paragraph.rs
crates/hwp-core/src/viewer/html/paragraph.rs
use super::common; use super::ctrl_header; use super::line_segment::{ DocumentRenderState, ImageInfo, LineSegmentContent, LineSegmentRenderContext, TableInfo, }; use super::pagination::{self, PaginationContext, PaginationResult}; use super::text; use super::HtmlOptions; use crate::document::bodytext::{ control_char::ControlChar, ctrl_header::{CtrlHeaderData, VertRelTo}, PageDef, ParagraphRecord, }; use crate::document::{HwpDocument, Paragraph}; use crate::viewer::html::ctrl_header::table::{render_table, TablePosition, TableRenderContext}; use crate::INT32; use std::collections::HashMap; /// 문단 위치 정보 / Paragraph position information pub struct ParagraphPosition<'a> { pub hcd_position: Option<(f64, f64)>, pub page_def: Option<&'a PageDef>, pub first_para_vertical_mm: Option<f64>, pub current_para_vertical_mm: Option<f64>, pub para_vertical_positions: &'a [f64], pub current_para_index: Option<usize>, } /// 문단 렌더링 컨텍스트 / Paragraph rendering context pub struct ParagraphRenderContext<'a> { pub document: &'a HwpDocument, pub options: &'a HtmlOptions, pub position: ParagraphPosition<'a>, } /// 문단 렌더링 상태 / Paragraph rendering state pub struct ParagraphRenderState<'a> { pub table_counter: &'a mut u32, pub pattern_counter: &'a mut usize, pub color_to_pattern: &'a mut HashMap<u32, String>, } /// 문단을 HTML로 렌더링 / Render paragraph to HTML /// 반환값: (문단 HTML, 테이블 HTML 리스트, 페이지네이션 결과) / Returns: (paragraph HTML, table HTML list, pagination result) /// skip_tables_count: 페이지네이션 후 같은 문단을 다시 렌더링할 때 이미 처리된 테이블 수를 건너뛰기 위한 파라미터 /// skip_tables_count: Parameter to skip already processed tables when re-rendering paragraph after pagination pub fn render_paragraph( paragraph: &Paragraph, context: &ParagraphRenderContext, state: &mut ParagraphRenderState, pagination_context: &mut PaginationContext, skip_tables_count: usize, ) -> (String, Vec<String>, Option<PaginationResult>) { // 구조체에서 개별 값 추출 / Extract individual values from structs let document = context.document; let options = context.options; let hcd_position = context.position.hcd_position; let page_def = context.position.page_def; let first_para_vertical_mm = context.position.first_para_vertical_mm; let current_para_vertical_mm = context.position.current_para_vertical_mm; let para_vertical_positions = context.position.para_vertical_positions; let current_para_index = context.position.current_para_index; // table_counter, pattern_counter, color_to_pattern은 이미 &mut이므로 직접 사용 / table_counter, pattern_counter, color_to_pattern are already &mut, so use directly let mut result = String::new(); // ParaShape 클래스 가져오기 / Get ParaShape class let para_shape_id = paragraph.para_header.para_shape_id; // HWP 파일의 para_shape_id는 0-based indexing을 사용합니다 / HWP file uses 0-based indexing for para_shape_id let para_shape_class = if (para_shape_id as usize) < document.doc_info.para_shapes.len() { format!("ps{}", para_shape_id) } else { String::new() }; // 텍스트와 CharShape 추출 / Extract text and CharShape let (text, char_shapes) = text::extract_text_and_shapes(paragraph); // ParaText의 control_char_positions 수집 (원본 WCHAR 인덱스 기준) / Collect control_char_positions (based on original WCHAR indices) let mut control_char_positions = Vec::new(); for record in &paragraph.records { if let ParagraphRecord::ParaText { control_char_positions: ccp, .. } = record { control_char_positions = ccp.clone(); break; } } // LineSegment 찾기 / Find LineSegment let mut line_segments = Vec::new(); for record in &paragraph.records { if let ParagraphRecord::ParaLineSeg { segments } = record { line_segments = segments.clone(); break; } } // 이미지와 테이블 수집 / Collect images and tables let mut images = Vec::new(); let mut tables: Vec<TableInfo> = Vec::new(); // ParaText의 control_char_positions에서 SHAPE_OBJECT(표/그리기 개체) 앵커 위치 수집 // Collect SHAPE_OBJECT anchor positions from ParaText control_char_positions let mut shape_object_anchor_positions: Vec<usize> = Vec::new(); for record in &paragraph.records { if let ParagraphRecord::ParaText { control_char_positions, .. } = record { for pos in control_char_positions.iter() { if pos.code == ControlChar::SHAPE_OBJECT { shape_object_anchor_positions.push(pos.position); } } } } let mut shape_object_anchor_cursor: usize = 0; for record in &paragraph.records { match record { ParagraphRecord::ShapeComponent { shape_component, children, } => { // ShapeComponent의 children에서 이미지 찾기 / Find images in ShapeComponent's children for child in children { if let ParagraphRecord::ShapeComponentPicture { shape_component_picture, } = child { let bindata_id = shape_component_picture.picture_info.bindata_id; let image_url = common::get_image_url( document, bindata_id, options.image_output_dir.as_deref(), options.html_output_dir.as_deref(), ); if !image_url.is_empty() { // shape_component.width/height를 직접 사용 / Use shape_component.width/height directly images.push(ImageInfo { width: shape_component.width, height: shape_component.height, url: image_url, like_letters: false, // ShapeComponent에서 직접 온 이미지는 ctrl_header 정보 없음 / Images from ShapeComponent directly have no ctrl_header info affect_line_spacing: false, vert_rel_to: None, }); } } } } ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { let bindata_id = shape_component_picture.picture_info.bindata_id; let image_url = common::get_image_url( document, bindata_id, options.image_output_dir.as_deref(), options.html_output_dir.as_deref(), ); if !image_url.is_empty() { // ShapeComponentPicture가 직접 올 때는 border_rectangle 사용 (부모 ShapeComponent가 없음) // When ShapeComponentPicture comes directly, use border_rectangle (no parent ShapeComponent) let width = (shape_component_picture.border_rectangle_x.right - shape_component_picture.border_rectangle_x.left) as u32; let mut height = (shape_component_picture.border_rectangle_y.bottom - shape_component_picture.border_rectangle_y.top) as u32; // border_rectangle_y의 top과 bottom이 같으면 crop_rectangle 사용 // If border_rectangle_y's top and bottom are the same, use crop_rectangle if height == 0 { height = (shape_component_picture.crop_rectangle.bottom - shape_component_picture.crop_rectangle.top) as u32; } images.push(ImageInfo { width, height, url: image_url, like_letters: false, // ShapeComponentPicture에서 직접 온 이미지는 ctrl_header 정보 없음 / Images from ShapeComponentPicture directly have no ctrl_header info affect_line_spacing: false, vert_rel_to: None, }); } } ParagraphRecord::Table { table } => { tables.push(TableInfo { table: &table, ctrl_header: None, anchor_char_pos: None, caption: None, }); } ParagraphRecord::CtrlHeader { header, children, paragraphs, .. } => { // CtrlHeader 처리 / Process CtrlHeader let ctrl_result = ctrl_header::process_ctrl_header( &header, &children, &paragraphs, document, options, ); // SHAPE_OBJECT(11)는 "표/그리기 개체" 공통 제어문자이므로, ctrl_id가 "tbl "인 경우에만 // ParaText의 SHAPE_OBJECT 위치를 순서대로 매칭하여 anchor를 부여합니다. if header.ctrl_id == "tbl " { let anchor = shape_object_anchor_positions .get(shape_object_anchor_cursor) .copied(); shape_object_anchor_cursor = shape_object_anchor_cursor.saturating_add(1); for t in ctrl_result.tables.iter() { let mut tt = t.clone(); tt.anchor_char_pos = anchor; tables.push(tt); } } else { tables.extend(ctrl_result.tables); } images.extend(ctrl_result.images); } _ => {} } } // 테이블 HTML 리스트 생성 / Create table HTML list let mut table_htmls = Vec::new(); // inline_tables는 owned TableInfo를 저장 / inline_tables stores owned TableInfo let mut inline_tables: Vec<TableInfo> = Vec::new(); // like_letters=true인 테이블들 / Tables with like_letters=true // 문단의 첫 번째 LineSegment의 vertical_position 계산 (vert_rel_to: "para"일 때 사용) / Calculate first LineSegment's vertical_position (used when vert_rel_to: "para") // current_para_vertical_mm이 전달되면 사용하고, 없으면 현재 문단의 첫 번째 LineSegment 사용 // If current_para_vertical_mm is provided, use it; otherwise use first LineSegment of current paragraph // table_position 함수는 para_start_vertical_mm을 절대 위치(페이지 기준)로 기대하므로, // 상대 위치일 때는 base_top을 더해서 절대 위치로 변환해야 함 // table_position function expects para_start_vertical_mm as absolute position (relative to page), // so if it's relative position, add base_top to convert to absolute position // base_top 계산 (나중에 사용) / Calculate base_top (used later) let base_top_for_calc = if let Some((_, top)) = context.position.hcd_position { top } else if let Some(pd) = context.position.page_def { pd.top_margin.to_mm() + pd.header_margin.to_mm() } else { 24.99 }; let para_start_vertical_mm = if let Some(0) = current_para_index { // 새 페이지의 첫 문단이므로 base_top을 사용 / First paragraph of new page, so use base_top Some(base_top_for_calc) } else { // 상대 위치를 절대 위치로 변환 / Convert relative position to absolute position let relative_mm = current_para_vertical_mm.or_else(|| { line_segments .first() .map(|seg| seg.vertical_position as f64 * 25.4 / 7200.0) }); relative_mm.map(|rel| rel + base_top_for_calc) }; let para_start_column_mm = line_segments .first() .map(|seg| seg.column_start_position as f64 * 25.4 / 7200.0); let para_segment_width_mm = line_segments .first() .map(|seg| seg.segment_width as f64 * 25.4 / 7200.0); // base_top(mm): hcD의 top 위치. like_letters=false 테이블(=hpa 레벨로 빠지는 객체)의 vert_rel_to=para 계산에 // 페이지 기준(절대) y 좌표가 필요하므로, paragraph 기준 y(vertical_position)에 base_top을 더해 절대값으로 전달한다. let base_top_mm = if let Some((_hcd_left, hcd_top)) = hcd_position { hcd_top } else if let Some(pd) = page_def { pd.top_margin.to_mm() + pd.header_margin.to_mm() } else { 24.99 }; // LineSegment가 있으면 사용 / Use LineSegment if available if !line_segments.is_empty() { // like_letters=true인 테이블과 false인 테이블 분리 / Separate tables with like_letters=true and false let mut absolute_tables = Vec::new(); for table_info in tables.iter() { let like_letters = table_info .ctrl_header .and_then(|h| match h { CtrlHeaderData::ObjectCommon { attribute, .. } => Some(attribute.like_letters), _ => None, }) .unwrap_or(false); if like_letters { inline_tables.push(TableInfo { table: table_info.table, ctrl_header: table_info.ctrl_header, anchor_char_pos: table_info.anchor_char_pos, caption: table_info.caption.clone(), }); } else { absolute_tables.push(TableInfo { table: table_info.table, ctrl_header: table_info.ctrl_header, anchor_char_pos: table_info.anchor_char_pos, caption: table_info.caption.clone(), }); } } // like_letters=true인 이미지와 false인 이미지 분리 / Separate images with like_letters=true and false let mut inline_images = Vec::new(); let mut absolute_images = Vec::new(); for image_info in images.iter() { if image_info.like_letters { inline_images.push(image_info.clone()); } else { absolute_images.push(image_info.clone()); } } // ParaShape indent 값 가져오기 / Get ParaShape indent value // HWP 파일의 para_shape_id는 0-based indexing을 사용합니다 / HWP file uses 0-based indexing for para_shape_id let para_shape_indent = if (para_shape_id as usize) < document.doc_info.para_shapes.len() { Some(document.doc_info.para_shapes[para_shape_id as usize].indent) } else { None }; // like_letters=true인 테이블을 line_segment에 포함 / Include tables with like_letters=true in line_segment // inline_tables는 이미 TableInfo이므로 그대로 사용 / inline_tables is already TableInfo, so use as is let inline_table_infos: Vec<TableInfo> = inline_tables .iter() .map(|table_info| TableInfo { table: table_info.table, ctrl_header: table_info.ctrl_header, anchor_char_pos: table_info.anchor_char_pos, caption: table_info.caption.clone(), }) .collect(); // 테이블 번호 시작값: 현재 table_counter 사용 (문서 레벨에서 관리) / Table number start value: use current table_counter (managed at document level) let table_counter_start = *state.table_counter; let content = LineSegmentContent { segments: &line_segments, text: &text, char_shapes: &char_shapes, control_char_positions: &control_char_positions, original_text_len: paragraph.para_header.text_char_count as usize, images: &inline_images, // like_letters=true인 이미지만 line_segment에 포함 / Include only images with like_letters=true in line_segment tables: inline_table_infos.as_slice(), // like_letters=true인 테이블 포함 / Include tables with like_letters=true }; let context = LineSegmentRenderContext { document, para_shape_class: &para_shape_class, options, para_shape_indent, hcd_position, page_def, }; let mut line_segment_state = DocumentRenderState { table_counter_start, pattern_counter: state.pattern_counter, color_to_pattern: state.color_to_pattern, }; result.push_str(&super::line_segment::render_line_segments_with_content( &content, &context, &mut line_segment_state, )); // inline_tables의 개수만큼 table_counter 증가 (이미 line_segment에 포함되었으므로) / Increment table_counter by inline_tables count (already included in line_segment) *state.table_counter += inline_table_infos.len() as u32; // like_letters=true인 테이블은 이미 line_segment에 포함되었으므로 여기서는 처리하지 않음 // Tables with like_letters=true are already included in line_segment, so don't process them here // like_letters=false인 이미지를 별도로 렌더링 (hpa 레벨에 배치) / Render images with like_letters=false separately (placed at hpa level) for image_info in absolute_images.iter() { use crate::viewer::html::image::render_image; // vert_rel_to에 따라 위치 계산 / Calculate position based on vert_rel_to let (left_mm, top_mm) = match image_info.vert_rel_to { Some(VertRelTo::Para) => { // para 기준: hcd_position 사용 / Use hcd_position for para reference if let Some((hcd_left, hcd_top)) = hcd_position { // offset_x, offset_y는 현재 image_info에 없으므로 0으로 설정 // offset_x, offset_y are not in image_info currently, so set to 0 (hcd_left, hcd_top) } else { // hcd_position이 없으면 para_start_vertical_mm 사용 / Use para_start_vertical_mm if hcd_position not available (0.0, para_start_vertical_mm.unwrap_or(0.0)) } } Some(VertRelTo::Page) | Some(VertRelTo::Paper) | None => { // page/paper 기준: 절대 위치 (현재는 0,0으로 설정, 나중에 object_common의 offset_x, offset_y 사용) // page/paper reference: absolute position (currently set to 0,0, later use object_common's offset_x, offset_y) (0.0, 0.0) } }; // 이미지 크기 계산 (mm 단위) / Calculate image size (in mm) let height_mm = image_info.height as f64 * 25.4 / 7200.0; // 페이지네이션 체크 (렌더링 직전) / Check pagination (before rendering) let image_result = pagination::check_object_page_break(top_mm, height_mm, pagination_context); if image_result.has_page_break { // 페이지네이션 결과 반환 (document.rs에서 처리) / Return pagination result (handled in document.rs) return (result, table_htmls, Some(image_result)); } let image_html = render_image( &image_info.url, (left_mm * 7200.0 / 25.4) as INT32, (top_mm * 7200.0 / 25.4) as INT32, image_info.width as INT32, image_info.height as INT32, ); result.push_str(&image_html); } // like_letters=false인 테이블을 별도로 렌더링 (hpa 레벨에 배치) / Render tables with like_letters=false separately (placed at hpa level) // 페이지네이션 후 같은 문단을 다시 렌더링할 때 이미 처리된 테이블을 건너뛰기 / Skip already processed tables when re-rendering paragraph after pagination for table_info in absolute_tables.iter().skip(skip_tables_count) { // vert_rel_to: "para"일 때 다음 문단을 참조 / When vert_rel_to: "para", reference next paragraph // vert_rel_to=para인 객체의 기준 문단은 "현재 문단"의 vertical_position입니다. // para_start_vertical_mm은 이미 현재 문단의 vertical_position이므로 이를 직접 사용 // For vert_rel_to=para objects, the reference paragraph is the "current paragraph"'s vertical_position. // para_start_vertical_mm is already the current paragraph's vertical_position, so use it directly let ref_para_vertical_mm = para_start_vertical_mm; // table_position 함수는 para_start_vertical_mm을 상대 위치로 기대하므로, // 절대 위치로 변환하지 않고 상대 위치 그대로 전달 // table_position function expects para_start_vertical_mm as relative position, // so pass relative position as-is without converting to absolute let ref_para_vertical_for_table = ref_para_vertical_mm; let first_para_vertical_for_table = first_para_vertical_mm; // 테이블 크기 계산 (mm 단위) / Calculate table size (in mm) // size 모듈은 pub(crate)이므로 같은 크레이트 내에서 접근 가능 // size module is pub(crate), so accessible within the same crate use crate::viewer::html::ctrl_header::table; use table::size::{content_size, htb_size, resolve_container_size}; let container_size = htb_size(table_info.ctrl_header); let content_size = content_size(table_info.table, table_info.ctrl_header); let resolved_size = resolve_container_size(container_size, content_size); let height_mm = resolved_size.height; // 테이블 위치 계산 (정확한 위치) / Calculate table position (exact position) // table_position은 pub(crate)이므로 같은 크레이트 내에서 접근 가능 // table_position is pub(crate), so accessible within the same crate use crate::viewer::html::ctrl_header::table::position::table_position; let (_left_mm, top_mm) = table_position( hcd_position, page_def, None, // like_letters=false인 테이블은 segment_position 없음 / No segment_position for like_letters=false tables table_info.ctrl_header, Some(resolved_size.width), // obj_outer_width_mm: 테이블 너비 사용 / Use table width ref_para_vertical_for_table, // 상대 위치로 전달 / Pass as relative position para_start_column_mm, para_segment_width_mm, first_para_vertical_for_table, // 상대 위치로 전달 / Pass as relative position ); // 페이지네이션 체크 (렌더링 직전) / Check pagination (before rendering) let table_result = pagination::check_table_page_break(top_mm, height_mm, pagination_context); // 페이지네이션이 발생하더라도 테이블을 렌더링하여 table_htmls에 포함시킴 // 이렇게 하면 페이지네이션 후 같은 문단을 다시 렌더링할 때 이미 처리된 테이블 수를 올바르게 계산할 수 있음 // Render table even if pagination occurs, so it's included in table_htmls // This allows correct calculation of already processed tables when re-rendering paragraph after pagination let mut context = TableRenderContext { document, ctrl_header: table_info.ctrl_header, page_def, options, table_number: Some(*state.table_counter), pattern_counter: state.pattern_counter, color_to_pattern: state.color_to_pattern, }; let position = TablePosition { hcd_position, segment_position: None, // like_letters=false인 테이블은 segment_position 없음 / No segment_position for like_letters=false tables para_start_vertical_mm: ref_para_vertical_for_table, // 상대 위치로 전달 / Pass as relative position para_start_column_mm, para_segment_width_mm, first_para_vertical_mm: first_para_vertical_for_table, // 상대 위치로 전달 / Pass as relative position }; let table_html = render_table( table_info.table, &mut context, position, table_info.caption.as_ref(), ); table_htmls.push(table_html); *state.table_counter += 1; // table_counter 증가 / Increment table_counter if table_result.has_page_break { // 페이지네이션 결과 반환 (document.rs에서 처리) / Return pagination result (handled in document.rs) return (result, table_htmls, Some(table_result)); } } } else if !text.is_empty() { // LineSegment가 없으면 텍스트만 렌더링 / Render text only if no LineSegment let rendered_text = text::render_text(&text, &char_shapes, document, &options.css_class_prefix); result.push_str(&format!( r#"<div class="hls {}">{}</div>"#, para_shape_class, rendered_text )); } (result, table_htmls, None) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/endnote.rs
crates/hwp-core/src/viewer/html/ctrl_header/endnote.rs
use crate::document::bodytext::ParagraphRecord; use crate::document::{CtrlHeader, Paragraph}; use super::CtrlHeaderResult; /// 미주 처리 / Process endnote pub fn process_endnote<'a>( _header: &'a CtrlHeader, _children: &'a [ParagraphRecord], _paragraphs: &[Paragraph], ) -> CtrlHeaderResult<'a> { // TODO: 미주 처리 로직 추가 / Add endnote processing logic CtrlHeaderResult::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/shape_object.rs
crates/hwp-core/src/viewer/html/ctrl_header/shape_object.rs
use super::CtrlHeaderResult; use crate::document::bodytext::ctrl_header::VertRelTo; use crate::document::bodytext::ParagraphRecord; use crate::document::{CtrlHeader, CtrlHeaderData, Paragraph}; use crate::viewer::html::common; use crate::viewer::html::line_segment::ImageInfo; use crate::viewer::HtmlOptions; use crate::HwpDocument; /// 그리기 개체 처리 / Process shape object pub fn process_shape_object<'a>( header: &'a CtrlHeader, children: &'a [ParagraphRecord], paragraphs: &'a [Paragraph], document: &'a HwpDocument, options: &'a HtmlOptions, ) -> CtrlHeaderResult<'a> { let mut result = CtrlHeaderResult::new(); // object_common 속성 추출 / Extract object_common attributes let (like_letters, affect_line_spacing, vert_rel_to) = match &header.data { CtrlHeaderData::ObjectCommon { attribute, .. } => ( attribute.like_letters, attribute.affect_line_spacing, Some(attribute.vert_rel_to), ), _ => (false, false, None), }; // children과 paragraphs에서 첫 번째 ShapeComponent 찾기 (크기 정보 추출용) / Find first ShapeComponent in children and paragraphs (for size extraction) let mut initial_width = None; let mut initial_height = None; // children에서 찾기 / Search in children for record in children { if let ParagraphRecord::ShapeComponent { shape_component, .. } = record { initial_width = Some(shape_component.width); initial_height = Some(shape_component.height); break; } } // children에서 찾지 못했으면 paragraphs에서 찾기 / If not found in children, search in paragraphs if initial_width.is_none() { for para in paragraphs { for record in &para.records { match record { ParagraphRecord::ShapeComponent { shape_component, .. } => { initial_width = Some(shape_component.width); initial_height = Some(shape_component.height); break; } ParagraphRecord::CtrlHeader { children: nested_children, .. } => { // 중첩된 CtrlHeader의 children에서도 찾기 / Also search in nested CtrlHeader's children for nested_record in nested_children { if let ParagraphRecord::ShapeComponent { shape_component, .. } = nested_record { initial_width = Some(shape_component.width); initial_height = Some(shape_component.height); break; } } if initial_width.is_some() { break; } } _ => {} } } if initial_width.is_some() { break; } } } // children과 paragraphs에서 재귀적으로 이미지 수집 / Recursively collect images from children and paragraphs // JSON 구조: CtrlHeader의 children에 ShapeComponent가 있고, 그 children에 ShapeComponentPicture가 있음 // JSON structure: CtrlHeader's children contains ShapeComponent, and its children contains ShapeComponentPicture // 1. children이 있으면 children을 먼저 처리 (가장 일반적인 경우) / If children exists, process children first (most common case) if !children.is_empty() { collect_images_from_records( children, document, options, like_letters, affect_line_spacing, vert_rel_to, initial_width, // parent_shape_component_width initial_height, // parent_shape_component_height &mut result.images, ); } else if initial_width.is_some() && initial_height.is_some() { // 2. children이 비어있고 paragraphs에 ShapeComponent가 있으면, paragraphs의 records에서 ShapeComponent를 찾아서 처리 // If children is empty and paragraphs has ShapeComponent, find ShapeComponent in paragraphs' records and process for para in paragraphs { // paragraphs의 records를 재귀적으로 탐색하여 이미지 수집 // Recursively search paragraphs' records to collect images collect_images_from_records( &para.records, document, options, like_letters, affect_line_spacing, vert_rel_to, initial_width, initial_height, &mut result.images, ); } } result } /// ParagraphRecord 배열에서 재귀적으로 이미지 수집 / Recursively collect images from ParagraphRecord array fn collect_images_from_records( records: &[ParagraphRecord], document: &HwpDocument, options: &HtmlOptions, like_letters: bool, affect_line_spacing: bool, vert_rel_to: Option<VertRelTo>, parent_shape_component_width: Option<u32>, parent_shape_component_height: Option<u32>, images: &mut Vec<ImageInfo>, ) { for record in records { match record { ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { let bindata_id = shape_component_picture.picture_info.bindata_id; let image_url = common::get_image_url( document, bindata_id, options.image_output_dir.as_deref(), options.html_output_dir.as_deref(), ); if !image_url.is_empty() { // shape_component.width/height를 우선 사용 / Prioritize shape_component.width/height let width = parent_shape_component_width.unwrap_or(0); let height = parent_shape_component_height.unwrap_or(0); if width > 0 && height > 0 { images.push(ImageInfo { width, height, url: image_url, like_letters, affect_line_spacing, vert_rel_to, }); } } } ParagraphRecord::ShapeComponent { shape_component, children, } => { // 재귀적으로 children에서 이미지 찾기 (shape_component.width/height 전달) collect_images_from_records( children, document, options, like_letters, affect_line_spacing, vert_rel_to, Some(shape_component.width), Some(shape_component.height), images, ); } ParagraphRecord::CtrlHeader { children, .. } => { // 중첩된 CtrlHeader도 처리 (속성은 상위에서 상속, shape_component 크기는 유지) // Process nested CtrlHeader (attributes inherited from parent, shape_component size maintained) collect_images_from_records( children, document, options, like_letters, affect_line_spacing, vert_rel_to, parent_shape_component_width, parent_shape_component_height, images, ); } _ => {} } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/footer.rs
crates/hwp-core/src/viewer/html/ctrl_header/footer.rs
use crate::document::bodytext::ParagraphRecord; use crate::document::{CtrlHeader, Paragraph}; use super::CtrlHeaderResult; /// 꼬리말 처리 / Process footer pub fn process_footer<'a>( _header: &'a CtrlHeader, _children: &'a [ParagraphRecord], _paragraphs: &[Paragraph], ) -> CtrlHeaderResult<'a> { // TODO: 꼬리말 처리 로직 추가 / Add footer processing logic CtrlHeaderResult::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/column_def.rs
crates/hwp-core/src/viewer/html/ctrl_header/column_def.rs
use super::CtrlHeaderResult; use crate::document::bodytext::ParagraphRecord; use crate::document::{CtrlHeader, Paragraph}; /// 단 정의 처리 / Process column definition pub fn process_column_def<'a>( _header: &'a CtrlHeader, _children: &'a [ParagraphRecord], _paragraphs: &[Paragraph], ) -> CtrlHeaderResult<'a> { // TODO: 단 정의 처리 로직 추가 / Add column definition processing logic CtrlHeaderResult::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/footnote.rs
crates/hwp-core/src/viewer/html/ctrl_header/footnote.rs
use crate::document::bodytext::ParagraphRecord; use crate::document::{CtrlHeader, Paragraph}; use super::CtrlHeaderResult; /// 각주 처리 / Process footnote pub fn process_footnote<'a>( _header: &'a CtrlHeader, _children: &'a [ParagraphRecord], _paragraphs: &[Paragraph], ) -> CtrlHeaderResult<'a> { // TODO: 각주 처리 로직 추가 / Add footnote processing logic CtrlHeaderResult::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/header.rs
crates/hwp-core/src/viewer/html/ctrl_header/header.rs
use crate::document::bodytext::ParagraphRecord; use crate::document::{CtrlHeader, Paragraph}; use super::CtrlHeaderResult; /// 머리말 처리 / Process header pub fn process_header<'a>( _header: &'a CtrlHeader, _children: &'a [ParagraphRecord], _paragraphs: &[Paragraph], ) -> CtrlHeaderResult<'a> { // TODO: 머리말 처리 로직 추가 / Add header processing logic CtrlHeaderResult::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/mod.rs
crates/hwp-core/src/viewer/html/ctrl_header/mod.rs
mod column_def; mod endnote; mod footer; mod footnote; mod header; mod section_def; /// CtrlHeader 처리 모듈 / CtrlHeader processing module /// /// 각 ctrl_id 타입별로 독립적인 모듈로 처리합니다. /// Each ctrl_id type is processed in its own independent module. mod shape_object; // table 모듈은 폴더로 분리되어 있음 / table module is separated into a folder pub mod table; use crate::document::{CtrlHeader, CtrlId, Paragraph, ParagraphRecord}; use crate::viewer::html::line_segment::{ImageInfo, TableInfo}; use crate::viewer::HtmlOptions; use crate::HwpDocument; /// CtrlHeader 처리 결과 / CtrlHeader processing result #[derive(Debug, Default)] pub struct CtrlHeaderResult<'a> { /// 추출된 테이블들 / Extracted tables pub tables: Vec<TableInfo<'a>>, /// 추출된 이미지들 / Extracted images pub images: Vec<ImageInfo>, } impl<'a> CtrlHeaderResult<'a> { pub fn new() -> Self { Self { tables: Vec::new(), images: Vec::new(), } } } /// CtrlHeader 처리 / Process CtrlHeader /// /// ctrl_id에 따라 적절한 모듈의 처리 함수를 호출합니다. /// Calls the appropriate module's processing function according to ctrl_id. pub fn process_ctrl_header<'a>( header: &'a CtrlHeader, children: &'a [ParagraphRecord], paragraphs: &'a [Paragraph], document: &'a HwpDocument, options: &'a HtmlOptions, ) -> CtrlHeaderResult<'a> { match header.ctrl_id.as_str() { CtrlId::TABLE => { // 테이블 컨트롤 처리 / Process table control table::process_table(header, children, paragraphs) } CtrlId::SHAPE_OBJECT => { // 그리기 개체 처리 / Process shape object shape_object::process_shape_object(header, children, paragraphs, document, options) } CtrlId::SECTION_DEF => { // 구역 정의 처리 / Process section definition section_def::process_section_def(header, children, paragraphs) } CtrlId::COLUMN_DEF => { // 단 정의 처리 / Process column definition column_def::process_column_def(header, children, paragraphs) } CtrlId::HEADER => { // 머리말 처리 / Process header header::process_header(header, children, paragraphs) } CtrlId::FOOTER => { // 꼬리말 처리 / Process footer footer::process_footer(header, children, paragraphs) } CtrlId::FOOTNOTE => { // 각주 처리 / Process footnote footnote::process_footnote(header, children, paragraphs) } CtrlId::ENDNOTE => { // 미주 처리 / Process endnote endnote::process_endnote(header, children, paragraphs) } _ => { // 기타 CtrlHeader 처리 / Process other CtrlHeader types CtrlHeaderResult::new() } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/section_def.rs
crates/hwp-core/src/viewer/html/ctrl_header/section_def.rs
use super::CtrlHeaderResult; use crate::document::bodytext::ParagraphRecord; use crate::document::{CtrlHeader, Paragraph}; /// 구역 정의 처리 / Process section definition pub fn process_section_def<'a>( _header: &'a CtrlHeader, _children: &'a [ParagraphRecord], _paragraphs: &[Paragraph], ) -> CtrlHeaderResult<'a> { // TODO: 구역 정의 처리 로직 추가 / Add section definition processing logic CtrlHeaderResult::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/svg.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/svg.rs
/// SVG 렌더링 모듈 / SVG rendering module use crate::document::bodytext::Table; use crate::HwpDocument; use crate::viewer::html::ctrl_header::table::constants::BORDER_OFFSET_MM; use crate::viewer::html::ctrl_header::table::geometry::{column_positions, row_positions}; use crate::viewer::html::ctrl_header::table::position::ViewBox; use crate::viewer::html::ctrl_header::table::size::Size; mod borders; mod fills; pub(crate) fn render_svg( table: &Table, document: &HwpDocument, view_box: &ViewBox, content: Size, ctrl_header_height_mm: Option<f64>, pattern_counter: &mut usize, // 문서 레벨 pattern_counter (문서 전체에서 패턴 ID 공유) / Document-level pattern_counter (share pattern IDs across document) color_to_pattern: &mut std::collections::HashMap<u32, String>, // 문서 레벨 color_to_pattern (문서 전체에서 패턴 ID 공유) / Document-level color_to_pattern (share pattern IDs across document) ) -> String { let (pattern_defs, fills) = fills::render_fills( table, document, ctrl_header_height_mm, pattern_counter, color_to_pattern, ); let mut cols = column_positions(table); // 테이블의 오른쪽 끝을 명시적으로 추가 (가장 오른쪽 셀의 오른쪽 경계가 content.width와 일치하지 않을 수 있음) // Explicitly add table's right edge (rightmost cell's right boundary may not match content.width) if let Some(&last_col) = cols.last() { if (last_col - content.width).abs() > 0.01 { cols.push(content.width); cols.sort_by(|a, b| a.partial_cmp(b).unwrap()); } } else { cols.push(content.width); } let rows = row_positions(table, content.height, document, ctrl_header_height_mm); let vertical = borders::render_vertical_borders(table, document, &cols, content, ctrl_header_height_mm); let horizontal = borders::render_horizontal_borders( table, document, &rows, content, BORDER_OFFSET_MM, ctrl_header_height_mm, ); format!( r#"<svg class="hs" viewBox="{} {} {} {}" style="left:{}mm;top:{}mm;width:{}mm;height:{}mm;"><defs>{}</defs>{}</svg>"#, view_box.left, view_box.top, view_box.width, view_box.height, view_box.left, view_box.top, view_box.width, view_box.height, pattern_defs, format!("{fills}{vertical}{horizontal}") ) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/process.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/process.rs
use crate::document::bodytext::ctrl_header::{CaptionAlign, CtrlHeaderData}; use crate::document::bodytext::{ ControlChar, ControlCharPosition, LineSegmentInfo, ParaTextRun, Paragraph, ParagraphRecord, }; use crate::document::CtrlHeader; use crate::viewer::html::ctrl_header::CtrlHeaderResult; use crate::viewer::html::line_segment::TableInfo; use super::render::{CaptionData, CaptionInfo, CaptionParagraph, CaptionText}; /// 캡션 텍스트를 구조적으로 분해 / Parse caption text into structured components /// /// 실제 HWP 데이터 구조: /// - 텍스트: "표 오른쪽" /// - AUTO_NUMBER 컨트롤 문자가 position 2에 있음 /// - 따라서: label="표", number는 AUTO_NUMBER에서 생성, body="오른쪽" /// /// Actual HWP data structure: /// - Text: "표 오른쪽" /// - AUTO_NUMBER control character at position 2 /// - Therefore: label="표", number generated from AUTO_NUMBER, body="오른쪽" fn parse_caption_text( text: &str, control_char_positions: &[ControlCharPosition], table_number: Option<u32>, auto_number_display_text: Option<&str>, ) -> CaptionText { // AUTO_NUMBER 컨트롤 문자 위치 찾기 / Find AUTO_NUMBER control character position let auto_number_pos = control_char_positions .iter() .find(|cp| cp.code == ControlChar::AUTO_NUMBER) .map(|cp| cp.position); if let Some(auto_pos) = auto_number_pos { // AUTO_NUMBER가 있으면 그 위치를 기준으로 분리 / If AUTO_NUMBER exists, split based on its position let label = text .chars() .take(auto_pos) .collect::<String>() .trim() .to_string(); let body = text .chars() .skip(auto_pos + 1) // AUTO_NUMBER 컨트롤 문자 건너뛰기 / Skip AUTO_NUMBER control character .collect::<String>() .trim() .to_string(); CaptionText { label: if label.is_empty() { "표".to_string() } else { label }, number: auto_number_display_text .map(|s| s.to_string()) .or_else(|| table_number.map(|n| n.to_string())) .unwrap_or_default(), body, } } else { // AUTO_NUMBER가 없으면 기존 방식으로 파싱 / If no AUTO_NUMBER, parse using existing method let trimmed = text.trim(); // "표"로 시작하는지 확인 / Check if starts with "표" if trimmed.starts_with("표") { // "표" + 공백 제거 / Remove "표" and space let after_label = trimmed.strip_prefix("표 ").unwrap_or(trimmed); // 숫자 추출 / Extract number let number_end = after_label .char_indices() .find(|(_, c)| !c.is_ascii_digit() && !c.is_whitespace()) .map(|(i, _)| i) .unwrap_or(after_label.len()); let number = if number_end > 0 { after_label[..number_end].trim().to_string() } else { table_number.map(|n| n.to_string()).unwrap_or_default() }; // 본문 추출 / Extract body let body = if number_end < after_label.len() { after_label[number_end..].trim().to_string() } else { String::new() }; CaptionText { label: "표".to_string(), number, body, } } else { // "표"로 시작하지 않으면 전체를 본문으로 처리 / If doesn't start with "표", treat entire text as body CaptionText { label: String::new(), number: auto_number_display_text .map(|s| s.to_string()) .or_else(|| table_number.map(|n| n.to_string())) .unwrap_or_default(), body: trimmed.to_string(), } } } } /// 테이블 컨트롤 처리 / Process table control /// /// CtrlHeader에서 테이블을 추출하고 캡션을 수집합니다. /// Extracts tables from CtrlHeader and collects captions. pub fn process_table<'a>( header: &'a CtrlHeader, children: &'a [ParagraphRecord], paragraphs: &'a [Paragraph], ) -> CtrlHeaderResult<'a> { let mut result = CtrlHeaderResult::new(); // CtrlHeader 객체를 직접 전달 / Pass CtrlHeader object directly let (ctrl_header, caption_info) = match &header.data { CtrlHeaderData::ObjectCommon { caption, .. } => { let info = caption.as_ref().map(|cap| { CaptionInfo { align: cap.align, // 캡션 정렬 방향 / Caption alignment direction is_above: matches!(cap.align, CaptionAlign::Top), gap: Some(cap.gap), // HWPUNIT16은 i16이므로 직접 사용 / HWPUNIT16 is i16, so use directly height_mm: None, // 캡션 높이는 별도로 계산 필요 / Caption height needs separate calculation width: Some(cap.width.into()), // 캡션 폭 / Caption width include_margin: Some(cap.include_margin), // 마진 포함 여부 / Whether to include margin last_width: Some(cap.last_width.into()), // 텍스트 최대 길이 / Maximum text length vertical_align: cap.vertical_align, // 캡션 수직 정렬 전달 / Pass caption vertical alignment } }); (Some(&header.data), info) } _ => (None, None), }; // 캡션 텍스트 추출: paragraphs 필드에서 모든 캡션 수집 / Extract caption text: collect all captions from paragraphs field // 여러 paragraph를 하나의 캡션으로 묶기 위해 paragraph 그룹화 / Group paragraphs to combine multiple paragraphs into one caption let mut caption_paragraph_groups: Vec<Vec<CaptionParagraph>> = Vec::new(); let mut caption_texts: Vec<CaptionText> = Vec::new(); let mut caption_char_shape_ids: Vec<Option<usize>> = Vec::new(); let mut caption_para_shape_ids: Vec<Option<usize>> = Vec::new(); // paragraphs 필드에서 모든 캡션 수집 / Collect all captions from paragraphs field // 여러 paragraph를 하나의 캡션으로 묶기: 첫 번째 paragraph를 메인으로 사용하고, 연속된 paragraph들도 같은 캡션에 포함 // Group multiple paragraphs into one caption: use first paragraph as main, include consecutive paragraphs in same caption let mut current_para_group: Vec<CaptionParagraph> = Vec::new(); for para in paragraphs { let mut caption_text_opt: Option<String> = None; let mut caption_control_chars: Vec<ControlCharPosition> = Vec::new(); let mut caption_auto_number_display_text_opt: Option<String> = None; let mut caption_auto_number_position_opt: Option<usize> = None; let mut caption_char_shape_id_opt: Option<usize> = None; let mut caption_line_segments_vec: Vec<&LineSegmentInfo> = Vec::new(); // para_shape_id 추출 / Extract para_shape_id let para_shape_id = para.para_header.para_shape_id as usize; for record in &para.records { if let ParagraphRecord::ParaText { text, control_char_positions, runs, .. } = record { if !text.trim().is_empty() { caption_text_opt = Some(text.clone()); caption_control_chars = control_char_positions.clone(); // AUTO_NUMBER 위치 찾기 / Find AUTO_NUMBER position caption_auto_number_position_opt = control_char_positions .iter() .find(|cp| cp.code == ControlChar::AUTO_NUMBER) .map(|cp| cp.position); caption_auto_number_display_text_opt = runs.iter().find_map(|run| { if let ParaTextRun::Control { code, display_text, .. } = run { if *code == ControlChar::AUTO_NUMBER { return display_text.clone(); } } None }); } } else if let ParagraphRecord::ParaCharShape { shapes } = record { // 첫 번째 char_shape_id 찾기 / Find first char_shape_id if let Some(shape_info) = shapes.first() { caption_char_shape_id_opt = Some(shape_info.shape_id as usize); } } else if let ParagraphRecord::ParaLineSeg { segments } = record { // 모든 LineSegmentInfo 수집 / Collect all LineSegmentInfo caption_line_segments_vec = segments.iter().collect(); } } if let Some(text) = caption_text_opt { let has_auto_number = caption_auto_number_position_opt.is_some(); // CaptionParagraph 생성 / Create CaptionParagraph let caption_para = CaptionParagraph { original_text: text.clone(), line_segments: caption_line_segments_vec, control_char_positions: caption_control_chars.clone(), auto_number_position: caption_auto_number_position_opt, auto_number_display_text: caption_auto_number_display_text_opt.clone(), char_shape_id: caption_char_shape_id_opt, para_shape_id, }; if has_auto_number { // AUTO_NUMBER가 있는 paragraph: 새로운 캡션 그룹 시작 / Paragraph with AUTO_NUMBER: start new caption group // 이전 그룹이 있으면 저장 / Save previous group if exists if !current_para_group.is_empty() { caption_paragraph_groups.push(current_para_group); current_para_group = Vec::new(); } // 캡션 텍스트를 구조적으로 분해 (control_char_positions 포함) / Parse caption text into structured components (including control_char_positions) let parsed = parse_caption_text( &text, &caption_control_chars, None, caption_auto_number_display_text_opt.as_deref(), ); caption_texts.push(parsed); caption_char_shape_ids.push(caption_char_shape_id_opt); caption_para_shape_ids.push(Some(para_shape_id)); } // 현재 paragraph를 그룹에 추가 / Add current paragraph to group current_para_group.push(caption_para); } else if !current_para_group.is_empty() { // 텍스트가 없는 paragraph: 현재 그룹 종료 / Paragraph without text: end current group caption_paragraph_groups.push(current_para_group); current_para_group = Vec::new(); } } // 마지막 그룹 저장 / Save last group if !current_para_group.is_empty() { caption_paragraph_groups.push(current_para_group); } // 먼저 children을 순회하여 필요한 모든 캡션을 caption_texts에 추가 // First, iterate through children to add all necessary captions to caption_texts let mut caption_text: Option<CaptionText> = None; let mut found_table = false; for child in children.iter() { if let ParagraphRecord::Table { .. } = child { found_table = true; // caption_text가 있으면 caption_texts에 추가 / If caption_text exists, add to caption_texts if let Some(caption) = caption_text.take() { caption_texts.push(caption); } } else if found_table { // 테이블 다음에 오는 문단에서 텍스트 추출 / Extract text from paragraph after table if let ParagraphRecord::ParaText { text, control_char_positions, runs, .. } = child { let auto_disp = runs.iter().find_map(|run| { if let ParaTextRun::Control { code, display_text, .. } = run { if *code == ControlChar::AUTO_NUMBER { return display_text.as_deref(); } } None }); caption_text = Some(parse_caption_text( text, control_char_positions, None, auto_disp, )); break; } else if let ParagraphRecord::ListHeader { paragraphs, .. } = child { // ListHeader의 paragraphs에서 텍스트 추출 / Extract text from ListHeader's paragraphs for para in paragraphs { for record in &para.records { if let ParagraphRecord::ParaText { text, control_char_positions, runs, .. } = record { let auto_disp = runs.iter().find_map(|run| { if let ParaTextRun::Control { code, display_text, .. } = run { if *code == ControlChar::AUTO_NUMBER { return display_text.as_deref(); } } None }); caption_text = Some(parse_caption_text( text, control_char_positions, None, auto_disp, )); break; } } if caption_text.is_some() { break; } } if caption_text.is_some() { break; } } } else { // 테이블 이전에 오는 문단에서 텍스트 추출 (첫 번째 테이블의 캡션) / Extract text from paragraph before table (caption for first table) if let ParagraphRecord::ParaText { text, control_char_positions, runs, .. } = child { let auto_disp = runs.iter().find_map(|run| { if let ParaTextRun::Control { code, display_text, .. } = run { if *code == ControlChar::AUTO_NUMBER { return display_text.as_deref(); } } None }); caption_text = Some(parse_caption_text( text, control_char_positions, None, auto_disp, )); } else if let ParagraphRecord::ListHeader { paragraphs, .. } = child { // ListHeader의 paragraphs에서 텍스트 추출 / Extract text from ListHeader's paragraphs for para in paragraphs { for record in &para.records { if let ParagraphRecord::ParaText { text, control_char_positions, runs, .. } = record { let auto_disp = runs.iter().find_map(|run| { if let ParaTextRun::Control { code, display_text, .. } = run { if *code == ControlChar::AUTO_NUMBER { return display_text.as_deref(); } } None }); caption_text = Some(parse_caption_text( text, control_char_positions, None, auto_disp, )); break; } } if caption_text.is_some() { break; } } } } } // 마지막 caption_text도 추가 / Add last caption_text as well if let Some(caption) = caption_text { caption_texts.push(caption); } // 이제 children을 다시 순회하여 테이블에 캡션 할당 // Now iterate through children again to assign captions to tables let mut caption_index = 0; for child in children.iter() { if let ParagraphRecord::Table { table } = child { // 캡션 텍스트 가져오기 / Get caption text let current_caption = if caption_index < caption_texts.len() { Some(caption_texts[caption_index].clone()) } else { None }; // 캡션 paragraph 그룹 가져오기 / Get caption paragraph group let current_caption_paragraphs = if caption_index < caption_paragraph_groups.len() { caption_paragraph_groups[caption_index].clone() } else { Vec::new() }; // CaptionData 생성 / Create CaptionData let caption_data = if let (Some(text), Some(info)) = (current_caption, caption_info) { Some(CaptionData { text, info, paragraphs: current_caption_paragraphs, }) } else { None }; caption_index += 1; result.tables.push(TableInfo { table, ctrl_header, anchor_char_pos: None, caption: caption_data, }); } } result }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/geometry.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/geometry.rs
use crate::document::bodytext::{ParagraphRecord, Table, TableCell}; use crate::viewer::html::styles::{int32_to_mm, round_to_2dp}; use crate::HwpDocument; /// 셀의 왼쪽 위치 계산 / Calculate cell left position pub(crate) fn calculate_cell_left(table: &Table, cell: &TableCell) -> f64 { // 해당 행의 셀들을 사용하여 정확한 열 위치 계산 / Use cells from the same row to calculate accurate column positions // 이렇게 하면 각 행의 실제 열 구조를 반영할 수 있음 / This way we can reflect the actual column structure of each row let row_address = cell.cell_attributes.row_address; let target_col = cell.cell_attributes.col_address; // 같은 행의 셀들을 찾아서 정렬 / Find and sort cells from the same row let mut row_cells: Vec<_> = table .cells .iter() .filter(|c| c.cell_attributes.row_address == row_address) .collect(); row_cells.sort_by_key(|c| c.cell_attributes.col_address); let mut left = 0.0; // target_col 이전의 모든 열 너비를 누적 / Accumulate width of all columns before target_col for row_cell in &row_cells { if row_cell.cell_attributes.col_address < target_col { left += row_cell.cell_attributes.width.to_mm(); } else { break; } } left } /// 셀의 위쪽 위치 계산 / Calculate cell top position pub(crate) fn calculate_cell_top( table: &Table, cell: &TableCell, ctrl_header_height_mm: Option<f64>, ) -> f64 { let mut top = 0.0; for row_idx in 0..(cell.cell_attributes.row_address as usize) { top += get_row_height(table, row_idx, ctrl_header_height_mm); } top } /// 행 높이 가져오기 / Get row height pub(crate) fn get_row_height( table: &Table, row_index: usize, ctrl_header_height_mm: Option<f64>, ) -> f64 { // 먼저 해당 행의 셀 height 속성을 확인 (가장 정확한 방법) / First check cell height attributes for this row (most accurate method) let mut max_cell_height: f64 = 0.0; if !table.cells.is_empty() { for cell in &table.cells { if cell.cell_attributes.row_address as usize == row_index && cell.cell_attributes.row_span == 1 { let cell_height = cell.cell_attributes.height.to_mm(); max_cell_height = max_cell_height.max(cell_height); } } } // row_sizes가 있으면 사용 (셀 height보다 우선순위 낮음) / Use row_sizes if available (lower priority than cell height) if !table.attributes.row_sizes.is_empty() && row_index < table.attributes.row_sizes.len() { if let Some(&row_size) = table.attributes.row_sizes.get(row_index) { // row_size가 0이거나 매우 작은 값(< 100)일 때는 셀 height 사용 // When row_size is 0 or very small (< 100), use cell height if row_size >= 100 { let row_height = (row_size as f64 / 7200.0) * 25.4; // row_size와 셀 height 중 더 큰 값 사용 / Use larger of row_size and cell height return max_cell_height.max(row_height); } } } // 셀 height가 있으면 사용 / Use cell height if available if max_cell_height > 0.0 { return max_cell_height; } // 셀 height도 없으면 CtrlHeader height를 행 개수로 나눈 값 사용 (fallback) // If no cell height, use CtrlHeader height divided by row count (fallback) if let Some(ctrl_height) = ctrl_header_height_mm { if table.attributes.row_count > 0 { return ctrl_height / table.attributes.row_count as f64; } } 0.0 } /// 셀의 실제 높이 가져오기 (rowspan 고려) / Get cell height considering rowspan pub(crate) fn get_cell_height( table: &Table, cell: &TableCell, ctrl_header_height_mm: Option<f64>, ) -> f64 { let row_address = cell.cell_attributes.row_address as usize; let row_span = if cell.cell_attributes.row_span == 0 { 1 } else { cell.cell_attributes.row_span as usize }; // 셀의 height 속성은 실제 셀 높이가 아니라 내부 여백이나 다른 의미일 수 있음 // 실제 셀 높이는 행 높이를 사용해야 함 // Cell's height attribute may not be the actual cell height but internal margin or other meaning // Actual cell height should use row height let mut height = 0.0; for i in 0..row_span { let row_h = get_row_height(table, row_address + i, ctrl_header_height_mm); height += row_h; } // 행 높이가 0이면 셀 속성의 높이를 사용 (fallback) // Use cell attribute height if row height is 0 (fallback) if height < 0.1 { let cell_height_attr = cell.cell_attributes.height.to_mm(); if cell_height_attr > 0.1 { height = cell_height_attr; } } height } /// 열 경계선 위치 계산 / Calculate column boundary positions pub(crate) fn column_positions(table: &Table) -> Vec<f64> { // 모든 행의 셀들을 고려하여 모든 열 경계선 위치 계산 / Calculate all column boundary positions considering cells from all rows // 각 셀의 왼쪽과 오른쪽 경계를 수집하여 고유한 위치만 추출 / Collect left and right boundaries of each cell and extract unique positions // f64는 Hash와 Ord를 구현하지 않으므로 Vec을 사용하고 수동으로 중복 제거 / Use Vec and manually remove duplicates since f64 doesn't implement Hash or Ord let mut boundary_positions = Vec::new(); boundary_positions.push(0.0); // 항상 0부터 시작 / Always start from 0 // 모든 셀의 왼쪽과 오른쪽 경계를 수집 / Collect left and right boundaries of all cells for cell in &table.cells { let cell_left = calculate_cell_left(table, cell); let cell_width = cell.cell_attributes.width.to_mm(); let cell_right = cell_left + cell_width; boundary_positions.push(cell_left); boundary_positions.push(cell_right); } // 정렬 / Sort boundary_positions.sort_by(|a, b| a.partial_cmp(b).unwrap()); // 중복 제거 (부동소수점 비교는 작은 오차를 허용) / Remove duplicates (floating point comparison allows small errors) let mut unique_positions = Vec::new(); let epsilon = 0.01; // 0.01mm 이내는 같은 위치로 간주 / Positions within 0.01mm are considered the same for &pos in &boundary_positions { if unique_positions.is_empty() { unique_positions.push(pos); } else { let last_pos = unique_positions.last().unwrap(); if (pos - *last_pos).abs() > epsilon { unique_positions.push(pos); } } } unique_positions } /// 셀 마진을 mm 단위로 변환 / Convert cell margin to mm fn cell_margin_to_mm(margin_hwpunit: i16) -> f64 { round_to_2dp(int32_to_mm(margin_hwpunit as i32)) } /// 행 경계선 위치 계산 (shape component 높이 고려) / Calculate row boundary positions (considering shape component height) pub(crate) fn row_positions( table: &Table, _content_height: f64, document: &HwpDocument, ctrl_header_height_mm: Option<f64>, ) -> Vec<f64> { let mut positions = vec![0.0]; let mut current_y = 0.0; if table.attributes.row_count > 0 { // object_common.height를 행 개수로 나눈 기본 행 높이 계산 / Calculate base row height from object_common.height divided by row count let base_row_height_mm = if let Some(ctrl_height) = ctrl_header_height_mm { if table.attributes.row_count > 0 { ctrl_height / table.attributes.row_count as f64 } else { 0.0 } } else { 0.0 }; let mut max_row_heights_with_shapes: std::collections::HashMap<usize, f64> = std::collections::HashMap::new(); // 재귀적으로 모든 ShapeComponent의 높이를 찾는 헬퍼 함수 / Helper function to recursively find height of all ShapeComponents fn find_shape_component_height( children: &[ParagraphRecord], shape_component_height: u32, ) -> Option<f64> { let mut max_height_mm: Option<f64> = None; let mut has_paraline_seg = false; let mut paraline_seg_height_mm: Option<f64> = None; let _ = shape_component_height; // 먼저 children을 순회하여 ParaLineSeg와 다른 shape component들을 찾기 / First iterate through children to find ParaLineSeg and other shape components for child in children { match child { // ShapeComponentPicture: shape_component.height 사용 ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { let _ = shape_component_picture; let height_hwpunit = shape_component_height as i32; let height_mm = round_to_2dp(int32_to_mm(height_hwpunit)); if max_height_mm.is_none() || height_mm > max_height_mm.unwrap() { max_height_mm = Some(height_mm); } } // 중첩된 ShapeComponent: 재귀적으로 탐색 ParagraphRecord::ShapeComponent { shape_component, children: nested_children, } => { if let Some(height) = find_shape_component_height(nested_children, shape_component.height) { if max_height_mm.is_none() || height > max_height_mm.unwrap() { max_height_mm = Some(height); } } } // 다른 shape component 타입들: shape_component.height 사용 ParagraphRecord::ShapeComponentLine { .. } | ParagraphRecord::ShapeComponentRectangle { .. } | ParagraphRecord::ShapeComponentEllipse { .. } | ParagraphRecord::ShapeComponentArc { .. } | ParagraphRecord::ShapeComponentPolygon { .. } | ParagraphRecord::ShapeComponentCurve { .. } | ParagraphRecord::ShapeComponentOle { .. } | ParagraphRecord::ShapeComponentContainer { .. } | ParagraphRecord::ShapeComponentTextArt { .. } | ParagraphRecord::ShapeComponentUnknown { .. } => { // shape_component.height 사용 / Use shape_component.height let height_mm = round_to_2dp(int32_to_mm(shape_component_height as i32)); if max_height_mm.is_none() || height_mm > max_height_mm.unwrap() { max_height_mm = Some(height_mm); } } // ParaLineSeg: line_height 합산하여 높이 계산 (나중에 shape_component.height와 비교) // ParaLineSeg: calculate height by summing line_height (compare with shape_component.height later) ParagraphRecord::ParaLineSeg { segments } => { has_paraline_seg = true; let total_height_hwpunit: i32 = segments.iter().map(|seg| seg.line_height).sum(); let height_mm = round_to_2dp(int32_to_mm(total_height_hwpunit)); if paraline_seg_height_mm.is_none() || height_mm > paraline_seg_height_mm.unwrap() { paraline_seg_height_mm = Some(height_mm); } } _ => {} } } // ParaLineSeg가 있으면 shape_component.height와 비교하여 더 큰 값 사용 // If ParaLineSeg exists, compare with shape_component.height and use the larger value if has_paraline_seg { let shape_component_height_mm = round_to_2dp(int32_to_mm(shape_component_height as i32)); let paraline_seg_height = paraline_seg_height_mm.unwrap_or(0.0); // shape_component.height와 ParaLineSeg 높이 중 더 큰 값 사용 / Use the larger value between shape_component.height and ParaLineSeg height let final_height = shape_component_height_mm.max(paraline_seg_height); if max_height_mm.is_none() || final_height > max_height_mm.unwrap() { max_height_mm = Some(final_height); } } else if max_height_mm.is_none() { // ParaLineSeg가 없고 다른 shape component도 없으면 shape_component.height 사용 // If no ParaLineSeg and no other shape components, use shape_component.height let height_mm = round_to_2dp(int32_to_mm(shape_component_height as i32)); max_height_mm = Some(height_mm); } max_height_mm } for cell in &table.cells { if cell.cell_attributes.row_span == 1 { let row_idx = cell.cell_attributes.row_address as usize; // 먼저 실제 셀 높이를 가져옴 (cell.cell_attributes.height 우선) / First get actual cell height (cell.cell_attributes.height has priority) let mut cell_height = cell.cell_attributes.height.to_mm(); // shape component가 있는 셀의 경우 shape 높이 + 마진을 고려 / For cells with shape components, consider shape height + margin let mut max_shape_height_mm: Option<f64> = None; for para in &cell.paragraphs { // ShapeComponent의 children에서 모든 shape 높이 찾기 (재귀적으로) / Find all shape heights in ShapeComponent's children (recursively) for record in &para.records { match record { ParagraphRecord::ShapeComponent { shape_component, children, } => { if let Some(shape_height_mm) = find_shape_component_height(children, shape_component.height) { if max_shape_height_mm.is_none() || shape_height_mm > max_shape_height_mm.unwrap() { max_shape_height_mm = Some(shape_height_mm); } } break; // ShapeComponent는 하나만 있음 / Only one ShapeComponent per paragraph } // ParaLineSeg가 paragraph records에 직접 있는 경우도 처리 / Also handle ParaLineSeg directly in paragraph records ParagraphRecord::ParaLineSeg { segments } => { let total_height_hwpunit: i32 = segments.iter().map(|seg| seg.line_height).sum(); let height_mm = round_to_2dp(int32_to_mm(total_height_hwpunit)); if max_shape_height_mm.is_none() || height_mm > max_shape_height_mm.unwrap() { max_shape_height_mm = Some(height_mm); } } _ => {} } } } // shape component가 있으면 셀 높이 = shape 높이 + 마진 / If shape component exists, cell height = shape height + margin if let Some(shape_height_mm) = max_shape_height_mm { let top_margin_mm = cell_margin_to_mm(cell.cell_attributes.top_margin); let bottom_margin_mm = cell_margin_to_mm(cell.cell_attributes.bottom_margin); let shape_height_with_margin = shape_height_mm + top_margin_mm + bottom_margin_mm; // shape 높이 + 마진이 기존 셀 높이보다 크면 사용 / Use shape height + margin if larger than existing cell height if shape_height_with_margin > cell_height { cell_height = shape_height_with_margin; } } // shape component가 없고 셀 높이가 매우 작으면 object_common.height를 베이스로 사용 (fallback) // If no shape component and cell height is very small, use object_common.height as base (fallback) if max_shape_height_mm.is_none() && cell_height < 0.1 && base_row_height_mm > 0.0 { cell_height = base_row_height_mm; } let entry = max_row_heights_with_shapes.entry(row_idx).or_insert(0.0f64); *entry = (*entry).max(cell_height); } } for row_idx in 0..table.attributes.row_count as usize { if let Some(&height) = max_row_heights_with_shapes.get(&row_idx) { current_y += height; } else if base_row_height_mm > 0.0 { // max_row_heights_with_shapes에 없으면 object_common.height를 행 개수로 나눈 값 사용 / If not in max_row_heights_with_shapes, use object_common.height divided by row count current_y += base_row_height_mm; } else if let Some(&row_size) = table.attributes.row_sizes.get(row_idx) { current_y += (row_size as f64 / 7200.0) * 25.4; } positions.push(current_y); } } positions }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/render.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/render.rs
use crate::document::bodytext::ctrl_header::{CaptionAlign, CaptionVAlign, CtrlHeaderData}; use crate::document::bodytext::{ ControlChar, ControlCharPosition, LineSegmentInfo, PageDef, Table, }; use crate::types::{Hwpunit16ToMm, HWPUNIT}; use crate::viewer::html::styles::{int32_to_mm, round_to_2dp}; use crate::viewer::HtmlOptions; use crate::{HwpDocument, INT32}; use super::constants::SVG_PADDING_MM; use super::position::{table_position, view_box}; use super::size::{content_size, htb_size, resolve_container_size}; use super::{cells, svg}; /// 캡션 정보 / Caption information #[derive(Debug, Clone, Copy)] pub struct CaptionInfo { /// 캡션 정렬 방향 / Caption alignment direction pub align: CaptionAlign, /// 캡션 위치 (true = 위, false = 아래) / Caption position (true = above, false = below) pub is_above: bool, /// 캡션과 개체 사이 간격 (hwpunit) / Spacing between caption and object (hwpunit) pub gap: Option<i16>, /// 캡션 높이 (mm) / Caption height (mm) pub height_mm: Option<f64>, /// 캡션 폭(세로 방향일 때만 사용) / Caption width (only for vertical direction) pub width: Option<u32>, /// 캡션 폭에 마진을 포함할 지 여부 (가로 방향일 때만 사용) / Whether to include margin in caption width (only for horizontal direction) pub include_margin: Option<bool>, /// 텍스트의 최대 길이(=개체의 폭) / Maximum text length (= object width) pub last_width: Option<u32>, /// 캡션 수직 정렬 (조합 캡션 구분용) / Caption vertical alignment (for combination caption detection) pub vertical_align: Option<CaptionVAlign>, } /// 캡션 텍스트 구조 / Caption text structure #[derive(Debug, Clone)] pub struct CaptionText { /// 캡션 라벨 (예: "표") / Caption label (e.g., "표") pub label: String, /// 캡션 번호 (예: "1", "2") / Caption number (e.g., "1", "2") pub number: String, /// 캡션 본문 (예: "위 캡션", "왼쪽") / Caption body (e.g., "위 캡션", "왼쪽") pub body: String, } /// 캡션 단일 paragraph 정보 / Caption single paragraph info #[derive(Debug, Clone)] pub struct CaptionParagraph<'a> { /// 원본 텍스트 (control characters 제거된 cleaned 텍스트) / Original text (cleaned text with control characters removed) pub original_text: String, /// 모든 LineSegment를 저장 / Store all LineSegments pub line_segments: Vec<&'a LineSegmentInfo>, /// 컨트롤 문자 위치 (원본 WCHAR 인덱스 기준) / Control character positions (original WCHAR index) pub control_char_positions: Vec<ControlCharPosition>, /// AUTO_NUMBER 위치 (이 paragraph 내에서의 위치) / AUTO_NUMBER position (within this paragraph) pub auto_number_position: Option<usize>, /// AUTO_NUMBER 표시 텍스트 / AUTO_NUMBER display text pub auto_number_display_text: Option<String>, /// 첫 번째 char_shape_id / First char_shape_id pub char_shape_id: Option<usize>, /// para_shape_id / Para shape ID pub para_shape_id: usize, } /// 캡션 데이터 구조체 / Caption data struct /// 캡션과 관련된 모든 정보를 하나로 묶음 / Bundles all caption-related information #[derive(Debug, Clone)] pub struct CaptionData<'a> { /// 첫 번째 paragraph에서 파싱한 텍스트 (label, number, body) / Parsed text from first paragraph (label, number, body) pub text: CaptionText, /// 캡션 정보 / Caption info pub info: CaptionInfo, /// 모든 캡션 paragraph 배열 / Array of all caption paragraphs pub paragraphs: Vec<CaptionParagraph<'a>>, } /// 테이블 렌더링 컨텍스트 / Table rendering context pub struct TableRenderContext<'a> { pub document: &'a HwpDocument, pub ctrl_header: Option<&'a CtrlHeaderData>, pub page_def: Option<&'a PageDef>, pub options: &'a HtmlOptions, pub table_number: Option<u32>, pub pattern_counter: &'a mut usize, pub color_to_pattern: &'a mut std::collections::HashMap<u32, String>, } /// 테이블 위치 정보 / Table position information #[derive(Debug, Clone, Copy)] pub struct TablePosition { pub hcd_position: Option<(f64, f64)>, pub segment_position: Option<(INT32, INT32)>, pub para_start_vertical_mm: Option<f64>, pub para_start_column_mm: Option<f64>, pub para_segment_width_mm: Option<f64>, pub first_para_vertical_mm: Option<f64>, } /// 테이블을 HTML로 렌더링 / Render table to HTML pub fn render_table( table: &Table, context: &mut TableRenderContext, position: TablePosition, caption: Option<&CaptionData>, ) -> String { // 구조체에서 개별 값 추출 / Extract individual values from structs let document = context.document; let ctrl_header = context.ctrl_header; let page_def = context.page_def; let _options = context.options; let table_number = context.table_number; // pattern_counter와 color_to_pattern은 이미 &mut이므로 직접 사용 / pattern_counter and color_to_pattern are already &mut, so use directly let hcd_position = position.hcd_position; let segment_position = position.segment_position; let para_start_vertical_mm = position.para_start_vertical_mm; let para_start_column_mm = position.para_start_column_mm; let para_segment_width_mm = position.para_segment_width_mm; let first_para_vertical_mm = position.first_para_vertical_mm; // 캡션 데이터에서 개별 필드 추출 / Extract individual fields from caption data let caption_text = caption.as_ref().map(|c| &c.text); let caption_info = caption.as_ref().map(|c| c.info); let caption_paragraphs = caption.as_ref().map(|c| &c.paragraphs); // 첫 번째 paragraph에서 기본 정보 추출 / Extract basic info from first paragraph let caption_char_shape_id = caption_paragraphs .and_then(|paras| paras.first()) .and_then(|p| p.char_shape_id); let caption_para_shape_id = caption_paragraphs .and_then(|paras| paras.first()) .map(|p| p.para_shape_id); let caption_auto_number_position = caption_paragraphs .and_then(|paras| paras.first()) .and_then(|p| p.auto_number_position); let caption_auto_number_display_text = caption_paragraphs .and_then(|paras| paras.first()) .and_then(|p| p.auto_number_display_text.clone()); if table.cells.is_empty() || table.attributes.row_count == 0 { return r#"<div class="htb" style="left:0mm;width:0mm;top:0mm;height:0mm;"></div>"# .to_string(); } // CtrlHeader에서 필요한 정보 추출 / Extract necessary information from CtrlHeader // CtrlHeader height를 mm로 변환 / Convert CtrlHeader height to mm let ctrl_header_height_mm = if let Some(CtrlHeaderData::ObjectCommon { height, .. }) = ctrl_header { Some(height.to_mm()) } else { None }; let container_size = htb_size(ctrl_header); let content_size = content_size(table, ctrl_header); let resolved_size = resolve_container_size(container_size, content_size); // margin 값 미리 계산 (SVG viewBox 계산에 필요) / Pre-calculate margin values (needed for SVG viewBox calculation) let margin_left_mm = if let Some(CtrlHeaderData::ObjectCommon { margin, .. }) = ctrl_header { margin.left.to_mm() } else { 0.0 }; let margin_left_mm = round_to_2dp(margin_left_mm); let margin_right_mm = if let Some(CtrlHeaderData::ObjectCommon { margin, .. }) = ctrl_header { margin.right.to_mm() } else { 0.0 }; let margin_right_mm = round_to_2dp(margin_right_mm); // SVG viewBox는 실제 테이블 콘텐츠 크기를 기준으로 계산해야 함 (margin 제외) // SVG viewBox should be calculated based on actual table content size (excluding margin) // resolved_size.width는 margin을 포함할 수 있으므로, margin을 제외한 실제 테이블 width를 사용 // resolved_size.width may include margin, so use actual table width excluding margin let svg_width = resolved_size.width - margin_left_mm - margin_right_mm; let svg_height = content_size.height; let view_box = view_box(svg_width, svg_height, SVG_PADDING_MM); let svg = svg::render_svg( table, document, &view_box, content_size, ctrl_header_height_mm, context.pattern_counter, // 문서 레벨 pattern_counter 전달 / Pass document-level pattern_counter context.color_to_pattern, // 문서 레벨 color_to_pattern 전달 / Pass document-level color_to_pattern ); let cells_html = cells::render_cells( table, ctrl_header_height_mm, document, _options, context.pattern_counter, context.color_to_pattern, ); let (mut left_mm, mut top_mm) = table_position( hcd_position, page_def, segment_position, ctrl_header, Some(resolved_size.width), para_start_vertical_mm, para_start_column_mm, para_segment_width_mm, first_para_vertical_mm, ); // htG 래퍼 생성 (캡션이 있거나 ctrl_header가 있는 경우) / Create htG wrapper (if caption exists or ctrl_header exists) // 캡션 유무는 caption_info 존재 여부로 판단 / Determine caption existence by caption_info presence let has_caption = caption_info.is_some(); // LineSegment(=글자처럼 취급/인라인) 테이블 처리 // - 일부 fixture(noori 등)에서는 htG 없이 htb만 존재하지만, // - table-position 처럼 "캡션이 있는 인라인 테이블"은 htG 래퍼가 필요(캡션 블록이 htG 하위로 들어감) // 따라서: LineSegment 내부라도 캡션이 있으면 htG를 생성한다. let is_inline_table = segment_position.is_some(); let needs_htg = if is_inline_table { has_caption } else { has_caption || ctrl_header.is_some() }; // 인라인 테이블은 문단(line segment) 내부에서 상대 위치로 렌더링되므로, // htG의 left/top은 0으로 고정해야 fixture와 일치한다. if is_inline_table && needs_htg { left_mm = 0.0; top_mm = 0.0; } // margin 값 미리 계산 (margin_left_mm, margin_right_mm은 이미 위에서 계산됨) / Pre-calculate margin values (margin_left_mm, margin_right_mm already calculated above) let margin_top_mm = if let Some(CtrlHeaderData::ObjectCommon { margin, .. }) = ctrl_header { margin.top.to_mm() } else { 0.0 }; let margin_top_mm = round_to_2dp(margin_top_mm); let margin_bottom_mm = if let Some(CtrlHeaderData::ObjectCommon { margin, .. }) = ctrl_header { margin.bottom.to_mm() } else { 0.0 }; let margin_bottom_mm = round_to_2dp(margin_bottom_mm); // resolved_size.height가 margin을 포함하지 않는 경우를 대비하여 명시적으로 계산 // Calculate explicitly in case resolved_size.height doesn't include margin let resolved_height_with_margin = if container_size.height == 0.0 { // container가 없으면 content.height + margin.top + margin.bottom // If no container, use content.height + margin.top + margin.bottom content_size.height + margin_top_mm + margin_bottom_mm } else { // container가 있으면 이미 margin이 포함되어 있음 // If container exists, margin is already included resolved_size.height }; // 캡션 정보 미리 계산 / Pre-calculate caption information let is_caption_above = caption_info.map(|info| info.is_above).unwrap_or(false); // 캡션 방향 확인 (가로/세로) / Check caption direction (horizontal/vertical) // Top/Bottom: 가로 방향 (horizontal), Left/Right: 세로 방향 (vertical) let caption_align = caption_info.map(|info| info.align); let is_horizontal = matches!( caption_align, Some(CaptionAlign::Top) | Some(CaptionAlign::Bottom) ); let is_vertical = matches!( caption_align, Some(CaptionAlign::Left) | Some(CaptionAlign::Right) ); let is_left = matches!(caption_align, Some(CaptionAlign::Left)); let is_right = matches!(caption_align, Some(CaptionAlign::Right)); // 캡션 간격: gap 속성을 사용하여 계산 / Caption spacing: calculate using gap property let caption_margin_mm = if let Some(info) = caption_info { if let Some(gap_hwpunit) = info.gap { // HWPUNIT16을 mm로 변환 / Convert HWPUNIT16 to mm (gap_hwpunit as f64 / 7200.0) * 25.4 } else { // gap이 없으면 기본값 사용 / Use default if gap not provided if is_caption_above { 5.0 } else { 3.0 } } } else { // 캡션 정보가 없으면 기본값 / Default if no caption info if is_caption_above { 5.0 } else { 3.0 } }; // 캡션 크기 미리 계산 (htb 위치 및 htG 크기 계산에 필요) / Pre-calculate caption size (needed for htb position and htG size calculation) let (caption_width_mm, caption_height_mm) = if has_caption { let width = if let Some(info) = caption_info { if is_horizontal { // 가로 방향(Top/Bottom): last_width만 사용, include_margin으로 마진 포함 여부 결정 // Horizontal direction: use last_width only, determine margin inclusion with include_margin if let Some(last_width_hwpunit) = info.last_width { let width_mm = HWPUNIT::from(last_width_hwpunit).to_mm(); if let Some(include_margin) = info.include_margin { if include_margin { // include_margin이 true이면 마진을 포함한 전체 폭 사용 // If include_margin is true, use full width including margin width_mm } else { // include_margin이 false이면 last_width는 이미 마진을 제외한 값이므로 그대로 사용 // If include_margin is false, last_width is already without margin, so use as is width_mm } } else { // include_margin이 없으면 기본적으로 마진 제외한 값으로 간주 // If include_margin is not present, assume value without margin by default width_mm } } else { resolved_size.width - (margin_left_mm * 2.0) } } else { // 세로 방향(Left/Right): width만 사용 // Vertical direction: use width only if let Some(width_hwpunit) = info.width { HWPUNIT::from(width_hwpunit).to_mm() } else { 30.0 // 기본값: fixture에서 확인한 값 / Default: value from fixture } } } else { resolved_size.width - (margin_left_mm * 2.0) }; let height = if is_vertical { // 세로 방향: 테이블 높이와 같거나 더 큼 / Vertical direction: same or greater than table height content_size.height } else { // 가로 방향: 모든 paragraph의 LineSegment를 고려하여 전체 높이 계산 / Horizontal direction: calculate total height considering all paragraphs' LineSegments if let Some(paragraphs) = caption_paragraphs { // 모든 paragraph의 LineSegment를 수집 / Collect LineSegments from all paragraphs let mut all_segments = Vec::new(); let mut cumulative_text_len = 0; for para in paragraphs.iter() { for segment in para.line_segments.iter() { all_segments.push((segment, cumulative_text_len)); } // 다음 paragraph를 위해 누적 길이 업데이트 / Update cumulative length for next paragraph cumulative_text_len += para.original_text.chars().count() + para .control_char_positions .iter() .map(|cc| ControlChar::get_size_by_code(cc.code) as usize) .sum::<usize>(); } if all_segments.len() > 1 { // 마지막 LineSegment의 vertical_position + line_height를 사용 / Use last segment's vertical_position + line_height if let Some((last_segment, _)) = all_segments.last() { let last_vertical_mm = round_to_2dp(int32_to_mm(last_segment.vertical_position)); let last_line_height_mm = round_to_2dp(int32_to_mm(last_segment.line_height)); round_to_2dp(last_vertical_mm + last_line_height_mm) } else { caption_info.and_then(|info| info.height_mm).unwrap_or(3.53) } } else if let Some((segment, _)) = all_segments.first() { // 단일 LineSegment: line_height 사용 / Single LineSegment: use line_height round_to_2dp(int32_to_mm(segment.line_height)) } else { caption_info.and_then(|info| info.height_mm).unwrap_or(3.53) } } else { // LineSegment 정보가 없으면 기본 높이 / Default height if no LineSegment info caption_info.and_then(|info| info.height_mm).unwrap_or(3.53) } }; (round_to_2dp(width), round_to_2dp(height)) } else { (0.0, 0.0) }; // 캡션 렌더링 / Render caption // 캡션 유무는 caption_info 존재 여부로 판단 / Determine caption existence by caption_info presence let caption_html = if let Some(caption) = caption_text { if !has_caption { String::new() } else { // 분해된 캡션 텍스트 사용 / Use parsed caption text let caption_label = if !caption.label.is_empty() { caption.label.clone() } else { "표".to_string() // 기본값 / Default }; let table_num_text = if !caption.number.is_empty() { caption.number.clone() } else { table_number.map(|n| n.to_string()).unwrap_or_default() }; let caption_body = caption.body.clone(); // 캡션 HTML 생성 / Generate caption HTML let caption_base_left_mm = if let Some(CtrlHeaderData::ObjectCommon { margin, .. }) = ctrl_header { margin.left.to_mm() } else { 0.0 }; // htb width 미리 계산 (캡션 위치 계산에 필요) / Pre-calculate htb width (needed for caption position calculation) // resolved_size.width는 이미 margin.left + margin.right가 포함되어 있을 수 있으므로, // resolved_size.width already may include margin.left + margin.right, so // 실제 테이블 width는 resolved_size.width - margin.left - margin.right // actual table width is resolved_size.width - margin.left - margin.right let htb_width_mm_for_caption = resolved_size.width - margin_left_mm - margin_right_mm; // 캡션 위치 계산 (left, top) / Calculate caption position (left, top) let (mut caption_left_mm, mut caption_top_mm) = if is_vertical { // 세로 방향 (Left/Right): 캡션이 세로로 배치됨 / Vertical direction: caption placed vertically if is_left { // 왼쪽 캡션: 캡션이 왼쪽에, 테이블이 오른쪽에 / Left caption: caption on left, table on right (margin_left_mm, margin_top_mm) } else if is_right { // 오른쪽 캡션: 테이블이 왼쪽에, 캡션이 오른쪽에 / Right caption: table on left, caption on right // 캡션 left = margin.left + htb width + gap // Caption left = margin.left + htb width + gap ( margin_left_mm + htb_width_mm_for_caption + caption_margin_mm, margin_top_mm, ) } else { // 기본값 (발생하지 않아야 함) / Default (should not occur) (margin_left_mm, margin_top_mm) } } else { // 가로 방향 (Top/Bottom): 캡션이 가로로 배치됨 / Horizontal direction: caption placed horizontally // include_margin이 true이면 left는 0mm (last_width가 마진을 포함한 전체 폭이므로) // If include_margin is true, left should be 0mm (last_width includes full width with margin) let left = if let Some(info) = caption_info { if let Some(include_margin) = info.include_margin { if include_margin { // include_margin이 true이면 last_width가 마진을 포함한 전체 폭이므로 left는 0mm // If include_margin is true, last_width includes full width with margin, so left is 0mm 0.0 } else { caption_base_left_mm } } else { caption_base_left_mm } } else { caption_base_left_mm }; let top = if is_caption_above { // 위 캡션: htG 내부에서의 상대 위치는 margin.top // Top caption: relative position within htG is margin.top // Fixture 기준: 위 캡션은 htG 내부에서 top:10mm (margin.top 값) // Based on fixture: top caption is at top:10mm within htG (margin.top value) margin_top_mm } else { // 아래 캡션: htG 내부에서 htb 아래에 배치 // Bottom caption: placed below htb within htG // Fixture 기준: 아래 캡션은 htG 내부에서 top:17.52mm = margin.top(10mm) + content.height(4.52mm) + gap(3mm) // Based on fixture: bottom caption is at top:17.52mm = margin.top(10mm) + content.height(4.52mm) + gap(3mm) // 아래 캡션이 있을 때 htb_top_mm은 margin_top_mm이므로, margin_top_mm + content_size.height + caption_margin_mm 사용 // When bottom caption exists, htb_top_mm equals margin_top_mm, so use margin_top_mm + content_size.height + caption_margin_mm margin_top_mm + content_size.height + caption_margin_mm }; (left, top) }; // 캡션 위치를 mm 2자리까지 반올림 / Round caption position to 2 decimal places caption_left_mm = round_to_2dp(caption_left_mm); caption_top_mm = round_to_2dp(caption_top_mm); // 캡션 문단의 첫 번째 char_shape_id 사용 / Use first char_shape_id from caption paragraph let caption_char_shape_id_value = caption_char_shape_id.unwrap_or(0); // 기본값: 0 / Default: 0 let cs_class = format!("cs{}", caption_char_shape_id_value); // 캡션 문단의 para_shape_id 사용 / Use para_shape_id from caption paragraph // document.doc_info.para_shapes에서 실제 ParaShape를 확인하여 ID로 추출 // Extract ID by checking actual ParaShape from document.doc_info.para_shapes let ps_class = if let Some(para_shape_id) = caption_para_shape_id { // HWP 파일의 para_shape_id는 0-based indexing을 사용합니다 / HWP file uses 0-based indexing for para_shape_id if para_shape_id < document.doc_info.para_shapes.len() { format!("ps{}", para_shape_id) } else { String::new() } } else { String::new() }; // 세로 방향 캡션의 경우 hcI에 top 스타일 추가 / Add top style to hcI for vertical captions let hci_style = if is_vertical { // fixture에서 확인: 왼쪽/오른쪽 캡션은 hcI에 top:0.50mm 또는 top:0.99mm 추가 // From fixture: left/right captions have top:0.50mm or top:0.99mm in hcI if is_right { "style=\"top:0.99mm;\"" } else { "style=\"top:0.50mm;\"" } } else { "" }; // 모든 paragraph의 LineSegment를 별도의 hls div로 렌더링 / Render each LineSegment from all paragraphs as separate hls div let hls_divs = if let Some(paragraphs) = caption_paragraphs { // 모든 paragraph의 LineSegment를 수집 / Collect LineSegments from all paragraphs let mut all_segments_with_info = Vec::new(); let mut cumulative_text_len = 0; for (para_idx, para) in paragraphs.iter().enumerate() { if para.line_segments.is_empty() { // LineSegment가 없으면 다음 paragraph로 / Skip if no LineSegments cumulative_text_len += para.original_text.chars().count() + para .control_char_positions .iter() .map(|cc| ControlChar::get_size_by_code(cc.code) as usize) .sum::<usize>(); continue; } for segment in para.line_segments.iter() { all_segments_with_info.push((segment, para_idx, para, cumulative_text_len)); } // 다음 paragraph를 위해 누적 길이 업데이트 / Update cumulative length for next paragraph cumulative_text_len += para.original_text.chars().count() + para .control_char_positions .iter() .map(|cc| ControlChar::get_size_by_code(cc.code) as usize) .sum::<usize>(); } if all_segments_with_info.is_empty() { // LineSegment가 없으면 fallback / Fallback if no LineSegments let (line_height_mm, top_offset_mm, caption_hls_left_mm, caption_hls_width_mm) = (2.79, -0.18, 0.0, caption_width_mm); vec![format!( r#"<div class="hls {ps_class}" style="line-height:{line_height_mm}mm;white-space:nowrap;left:{caption_hls_left_mm}mm;top:{top_offset_mm}mm;height:{caption_height_mm}mm;width:{caption_hls_width_mm}mm;"><span class="hrt {cs_class}">{caption_label}&nbsp;</span><div class="haN" style="left:0mm;top:0mm;height:{caption_height_mm}mm;"><span class="hrt {cs_class}">{table_num_text}</span></div><span class="hrt {cs_class}">&nbsp;{caption_body}</span></div>"#, ps_class = ps_class, line_height_mm = line_height_mm, top_offset_mm = top_offset_mm, caption_hls_left_mm = caption_hls_left_mm, caption_height_mm = caption_height_mm, caption_hls_width_mm = caption_hls_width_mm, cs_class = cs_class, caption_label = caption_label, table_num_text = table_num_text, caption_body = caption_body )] } else { // 각 LineSegment에 대해 텍스트 분할 및 렌더링 / Split text and render for each LineSegment let mut hls_htmls = Vec::new(); // line_segment.rs의 함수와 동일한 로직 사용 / Use same logic as line_segment.rs fn original_to_cleaned_index( pos: usize, control_chars: &[ControlCharPosition], ) -> isize { let mut delta: isize = 0; for cc in control_chars.iter() { if cc.position >= pos { break; } let size = ControlChar::get_size_by_code(cc.code) as isize; let contributes = if ControlChar::is_convertible(cc.code) && cc.code != ControlChar::PARA_BREAK && cc.code != ControlChar::LINE_BREAK { 1 } else { 0 } as isize; delta += contributes - size; } delta } fn slice_cleaned_by_original_range( cleaned: &str, control_chars: &[ControlCharPosition], start_original: usize, end_original: usize, ) -> String { let start_delta = original_to_cleaned_index(start_original, control_chars); let end_delta = original_to_cleaned_index(end_original, control_chars); let start_cleaned = (start_original as isize + start_delta).max(0) as usize; let end_cleaned = (end_original as isize + end_delta).max(0) as usize; let cleaned_chars: Vec<char> = cleaned.chars().collect(); let s = start_cleaned.min(cleaned_chars.len()); let e = end_cleaned.min(cleaned_chars.len()); if s >= e { return String::new(); } cleaned_chars[s..e].iter().collect() } for (global_idx, (segment, para_idx, para, para_cumulative_len)) in all_segments_with_info.iter().enumerate() { let lh = round_to_2dp(int32_to_mm(segment.baseline_distance)); let text_height_mm = round_to_2dp(int32_to_mm(segment.text_height)); let top_off = round_to_2dp((lh - text_height_mm) / 2.0); let left_mm = round_to_2dp(int32_to_mm(segment.column_start_position)); let width_mm = round_to_2dp(int32_to_mm(segment.segment_width)); // para_shape_id 가져오기 / Get para_shape_id let para_ps_class = if para.para_shape_id < document.doc_info.para_shapes.len() { format!("ps{}", para.para_shape_id) } else { String::new() }; // vertical_position을 mm로 변환 / Convert vertical_position to mm // 첫 번째 LineSegment는 top_off만 사용, 이후는 vertical_position을 직접 사용 // First LineSegment uses only top_off, others use vertical_position directly let segment_top_mm = if global_idx == 0 { round_to_2dp(top_off) } else { // 이후 LineSegment는 vertical_position을 mm로 변환하여 사용 // Subsequent LineSegments use vertical_position converted to mm round_to_2dp(int32_to_mm(segment.vertical_position)) };
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
true
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/mod.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/mod.rs
/// 테이블 컨트롤 처리 및 렌더링 모듈 / Table control processing and rendering module /// /// 이 모듈은 실제 구현을 `render`와 `process` 서브모듈에 위임하고, /// 외부에서는 동일한 API(`render_table`, `process_table`, `CaptionInfo`)만 노출합니다. pub mod cells; pub mod constants; pub mod geometry; pub mod position; pub mod process; pub mod render; pub mod size; pub mod svg; pub use process::process_table; pub use render::{render_table, CaptionData, TablePosition, TableRenderContext};
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/cells.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/cells.rs
use std::collections::HashMap; use crate::document::bodytext::list_header::VerticalAlign; use crate::document::bodytext::{LineSegmentInfo, ParagraphRecord, Table}; use crate::document::CtrlHeaderData; use crate::viewer::html::line_segment::{ render_line_segments_with_content, DocumentRenderState, ImageInfo, LineSegmentContent, LineSegmentRenderContext, }; use crate::viewer::html::styles::{int32_to_mm, round_to_2dp}; use crate::viewer::html::{common, ctrl_header}; use crate::viewer::html::{image, text}; use crate::viewer::HtmlOptions; use crate::{HwpDocument, INT32}; use super::geometry::{calculate_cell_left, get_cell_height, get_row_height}; /// 셀 마진을 mm 단위로 변환 / Convert cell margin to mm fn cell_margin_to_mm(margin_hwpunit: i16) -> f64 { round_to_2dp(int32_to_mm(margin_hwpunit as i32)) } pub(crate) fn render_cells( table: &Table, ctrl_header_height_mm: Option<f64>, document: &HwpDocument, options: &HtmlOptions, pattern_counter: &mut usize, // 문서 레벨 pattern_counter (문서 전체에서 패턴 ID 공유) / Document-level pattern_counter (share pattern IDs across document) color_to_pattern: &mut HashMap<u32, String>, // 문서 레벨 color_to_pattern (문서 전체에서 패턴 ID 공유) / Document-level color_to_pattern (share pattern IDs across document) ) -> String { // 각 행의 최대 셀 높이 계산 (실제 셀 높이만 사용) / Calculate max cell height for each row (use only actual cell height) let mut max_row_heights: HashMap<usize, f64> = HashMap::new(); for cell in &table.cells { let row_idx = cell.cell_attributes.row_address as usize; let col_idx = cell.cell_attributes.col_address as usize; // 실제 셀 높이 가져오기 / Get actual cell height let mut cell_height = get_cell_height(table, cell, ctrl_header_height_mm); // shape component 높이 찾기 (재귀적으로) / Find shape component height (recursively) let mut max_shape_height_mm: Option<f64> = None; // 재귀적으로 모든 ShapeComponent의 높이를 찾는 헬퍼 함수 / Helper function to recursively find height of all ShapeComponents fn find_shape_component_height( children: &[ParagraphRecord], shape_component_height: u32, ) -> Option<f64> { let mut max_height_mm: Option<f64> = None; let mut has_paraline_seg = false; let mut paraline_seg_height_mm: Option<f64> = None; // 먼저 children을 순회하여 ParaLineSeg와 다른 shape component들을 찾기 / First iterate through children to find ParaLineSeg and other shape components for child in children { match child { // ShapeComponentPicture: shape_component.height 사용 ParagraphRecord::ShapeComponentPicture { .. } => { let height_hwpunit = shape_component_height as i32; let height_mm = round_to_2dp(int32_to_mm(height_hwpunit)); if max_height_mm.is_none() || height_mm > max_height_mm.unwrap() { max_height_mm = Some(height_mm); } } // 중첩된 ShapeComponent: 재귀적으로 탐색 ParagraphRecord::ShapeComponent { shape_component, children: nested_children, } => { if let Some(height) = find_shape_component_height(nested_children, shape_component.height) { if max_height_mm.is_none() || height > max_height_mm.unwrap() { max_height_mm = Some(height); } } } // 다른 shape component 타입들: shape_component.height 사용 ParagraphRecord::ShapeComponentLine { .. } | ParagraphRecord::ShapeComponentRectangle { .. } | ParagraphRecord::ShapeComponentEllipse { .. } | ParagraphRecord::ShapeComponentArc { .. } | ParagraphRecord::ShapeComponentPolygon { .. } | ParagraphRecord::ShapeComponentCurve { .. } | ParagraphRecord::ShapeComponentOle { .. } | ParagraphRecord::ShapeComponentContainer { .. } | ParagraphRecord::ShapeComponentTextArt { .. } | ParagraphRecord::ShapeComponentUnknown { .. } => { // shape_component.height 사용 / Use shape_component.height let height_mm = round_to_2dp(int32_to_mm(shape_component_height as i32)); if max_height_mm.is_none() || height_mm > max_height_mm.unwrap() { max_height_mm = Some(height_mm); } } // ParaLineSeg: line_height 합산하여 높이 계산 (나중에 shape_component.height와 비교) // ParaLineSeg: calculate height by summing line_height (compare with shape_component.height later) ParagraphRecord::ParaLineSeg { segments } => { has_paraline_seg = true; let total_height_hwpunit: i32 = segments.iter().map(|seg| seg.line_height).sum(); let height_mm = round_to_2dp(int32_to_mm(total_height_hwpunit)); if paraline_seg_height_mm.is_none() || height_mm > paraline_seg_height_mm.unwrap() { paraline_seg_height_mm = Some(height_mm); } } _ => {} } } // ParaLineSeg가 있으면 shape_component.height와 비교하여 더 큰 값 사용 // If ParaLineSeg exists, compare with shape_component.height and use the larger value if has_paraline_seg { let shape_component_height_mm = round_to_2dp(int32_to_mm(shape_component_height as i32)); let paraline_seg_height = paraline_seg_height_mm.unwrap_or(0.0); // shape_component.height와 ParaLineSeg 높이 중 더 큰 값 사용 / Use the larger value between shape_component.height and ParaLineSeg height let final_height = shape_component_height_mm.max(paraline_seg_height); if max_height_mm.is_none() || final_height > max_height_mm.unwrap() { max_height_mm = Some(final_height); } } else if max_height_mm.is_none() { // ParaLineSeg가 없고 다른 shape component도 없으면 shape_component.height 사용 // If no ParaLineSeg and no other shape components, use shape_component.height let height_mm = round_to_2dp(int32_to_mm(shape_component_height as i32)); max_height_mm = Some(height_mm); } max_height_mm } for para in &cell.paragraphs { // ShapeComponent의 children에서 모든 shape 높이 찾기 (재귀적으로) / Find all shape heights in ShapeComponent's children (recursively) for record in &para.records { match record { ParagraphRecord::ShapeComponent { shape_component, children, } => { if let Some(shape_height_mm) = find_shape_component_height(children, shape_component.height) { if max_shape_height_mm.is_none() || shape_height_mm > max_shape_height_mm.unwrap() { max_shape_height_mm = Some(shape_height_mm); } } break; // ShapeComponent는 하나만 있음 / Only one ShapeComponent per paragraph } // ParaLineSeg가 paragraph records에 직접 있는 경우도 처리 / Also handle ParaLineSeg directly in paragraph records ParagraphRecord::ParaLineSeg { segments } => { let total_height_hwpunit: i32 = segments.iter().map(|seg| seg.line_height).sum(); let height_mm = round_to_2dp(int32_to_mm(total_height_hwpunit)); if max_shape_height_mm.is_none() || height_mm > max_shape_height_mm.unwrap() { max_shape_height_mm = Some(height_mm); } } _ => {} } } } // shape component 높이 + 마진이 셀 높이보다 크면 사용 / Use shape height + margin if larger than cell height if let Some(shape_height_mm) = max_shape_height_mm { let top_margin_mm = cell_margin_to_mm(cell.cell_attributes.top_margin); let bottom_margin_mm = cell_margin_to_mm(cell.cell_attributes.bottom_margin); let shape_height_with_margin = shape_height_mm + top_margin_mm + bottom_margin_mm; if shape_height_with_margin > cell_height { cell_height = shape_height_with_margin; } } let entry = max_row_heights.entry(row_idx).or_insert(0.0f64); *entry = (*entry).max(cell_height); } let mut cells_html = String::new(); for cell in &table.cells { let cell_left = calculate_cell_left(table, cell); // max_row_heights를 사용하여 cell_top 계산 (shape 높이 반영) / Calculate cell_top using max_row_heights (reflecting shape height) let row_address = cell.cell_attributes.row_address as usize; let mut cell_top = 0.0; for row_idx in 0..row_address { if let Some(&row_height) = max_row_heights.get(&row_idx) { cell_top += row_height; } else { // max_row_heights에 없으면 기존 방식 사용 / Use existing method if not in max_row_heights cell_top += get_row_height(table, row_idx, ctrl_header_height_mm); } } let cell_width = cell.cell_attributes.width.to_mm(); // 같은 행의 모든 셀은 같은 높이를 가져야 함 (행의 최대 높이 사용, shape component 높이 포함) / All cells in the same row should have the same height (use row's max height, including shape component height) let row_idx = cell.cell_attributes.row_address as usize; let cell_height = if let Some(&row_max_height) = max_row_heights.get(&row_idx) { // max_row_heights는 이미 shape component 높이를 포함하여 계산됨 / max_row_heights already includes shape component height row_max_height } else { // max_row_heights가 없으면 실제 셀 높이 사용 (object_common.height는 fallback) / If max_row_heights not available, use actual cell height (object_common.height is fallback) get_cell_height(table, cell, ctrl_header_height_mm) }; // 셀 마진(mm) 계산은 렌더링 전반(특히 special-case)에서 필요하므로 먼저 계산합니다. let left_margin_mm = cell_margin_to_mm(cell.cell_attributes.left_margin); let right_margin_mm = cell_margin_to_mm(cell.cell_attributes.right_margin); let top_margin_mm = cell_margin_to_mm(cell.cell_attributes.top_margin); // 셀 내부 문단 렌더링 / Render paragraphs inside cell let mut cell_content = String::new(); // fixture처럼 hce 바로 아래에 추가로 붙일 HTML(예: 이미지 hsR)을 모읍니다. let mut cell_outside_html = String::new(); // 이미지-only 셀 보정용: 이미지가 크고(셀 높이에 근접) 텍스트가 없으면 hcI를 아래로 밀지 않음 let mut cell_has_text = false; let mut image_only_max_height_mm: Option<f64> = None; // hcI의 top 위치 계산을 위한 첫 번째 LineSegment 정보 저장 / Store first LineSegment info for hcI top position calculation let mut first_line_segment: Option<&LineSegmentInfo> = None; for para in &cell.paragraphs { // ParaShape 클래스 가져오기 / Get ParaShape class let para_shape_id = para.para_header.para_shape_id; let para_shape_class = if (para_shape_id as usize) < document.doc_info.para_shapes.len() { format!("ps{}", para_shape_id) } else { String::new() }; // 텍스트와 CharShape 추출 / Extract text and CharShape let (text, char_shapes) = text::extract_text_and_shapes(para); // LineSegment 찾기 / Find LineSegment let mut line_segments = Vec::new(); for record in &para.records { if let ParagraphRecord::ParaLineSeg { segments } = record { line_segments = segments.clone(); // 첫 번째 LineSegment 저장 (hcI top 계산용) / Store first LineSegment (for hcI top calculation) if first_line_segment.is_none() && !segments.is_empty() { first_line_segment = segments.first(); } break; } } // 이미지 수집 (셀 내부에서는 테이블은 렌더링하지 않음) / Collect images (tables are not rendered inside cells) let mut images = Vec::new(); // para.records에서 직접 ShapeComponentPicture 찾기 (CtrlHeader 내부가 아닌 경우만) / Find ShapeComponentPicture directly in para.records (only if not inside CtrlHeader) // CtrlHeader가 있는지 먼저 확인 / Check if CtrlHeader exists first let has_ctrl_header = para .records .iter() .any(|r| matches!(r, ParagraphRecord::CtrlHeader { .. })); if !has_ctrl_header { // CtrlHeader가 없을 때만 직접 처리 / Only process directly if no CtrlHeader for record in &para.records { match record { ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { let bindata_id = shape_component_picture.picture_info.bindata_id; let image_url = common::get_image_url( document, bindata_id, options.image_output_dir.as_deref(), options.html_output_dir.as_deref(), ); if !image_url.is_empty() { // ShapeComponentPicture가 직접 올 때는 border_rectangle 사용 (부모 ShapeComponent가 없음) // When ShapeComponentPicture comes directly, use border_rectangle (no parent ShapeComponent) let width_hwpunit = shape_component_picture.border_rectangle_x.right - shape_component_picture.border_rectangle_x.left; let mut height_hwpunit = (shape_component_picture.border_rectangle_y.bottom - shape_component_picture.border_rectangle_y.top) as i32; // border_rectangle_y의 top과 bottom이 같으면 crop_rectangle 사용 // If border_rectangle_y's top and bottom are the same, use crop_rectangle if height_hwpunit == 0 { height_hwpunit = (shape_component_picture.crop_rectangle.bottom - shape_component_picture.crop_rectangle.top) as i32; } let width = width_hwpunit.max(0) as u32; let height = height_hwpunit.max(0) as u32; if width > 0 && height > 0 { images.push(ImageInfo { width, height, url: image_url, like_letters: false, // 셀 내부 이미지는 ctrl_header 정보 없음 / Images inside cells have no ctrl_header info affect_line_spacing: false, vert_rel_to: None, }); } } } _ => {} } } } // 재귀적으로 ShapeComponentPicture를 찾는 헬퍼 함수 / Helper function to recursively find ShapeComponentPicture fn collect_images_from_shape_component( children: &[ParagraphRecord], shape_component_width: u32, shape_component_height: u32, document: &HwpDocument, options: &HtmlOptions, images: &mut Vec<ImageInfo>, ) { for child in children { match child { ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { let bindata_id = shape_component_picture.picture_info.bindata_id; let image_url = common::get_image_url( document, bindata_id, options.image_output_dir.as_deref(), options.html_output_dir.as_deref(), ); if !image_url.is_empty() { // shape_component.width/height를 직접 사용 / Use shape_component.width/height directly if shape_component_width > 0 && shape_component_height > 0 { images.push(ImageInfo { width: shape_component_width, height: shape_component_height, url: image_url, like_letters: false, // 셀 내부 이미지는 ctrl_header 정보 없음 / Images inside cells have no ctrl_header info affect_line_spacing: false, vert_rel_to: None, }); } } } ParagraphRecord::ShapeComponent { shape_component, children: nested_children, } => { // 중첩된 ShapeComponent 재귀적으로 탐색 / Recursively search nested ShapeComponent collect_images_from_shape_component( nested_children, shape_component.width, shape_component.height, document, options, images, ); } ParagraphRecord::ShapeComponentLine { .. } | ParagraphRecord::ShapeComponentRectangle { .. } | ParagraphRecord::ShapeComponentEllipse { .. } | ParagraphRecord::ShapeComponentArc { .. } | ParagraphRecord::ShapeComponentPolygon { .. } | ParagraphRecord::ShapeComponentCurve { .. } | ParagraphRecord::ShapeComponentOle { .. } | ParagraphRecord::ShapeComponentContainer { .. } | ParagraphRecord::ShapeComponentTextArt { .. } => { // 다른 shape component 타입들은 children이 없으므로 무시 / Other shape component types have no children, so ignore } _ => {} } } } for record in &para.records { match record { ParagraphRecord::ShapeComponent { shape_component, children, } => { // ShapeComponent의 children에서 이미지 찾기 (재귀적으로) / Find images in ShapeComponent's children (recursively) collect_images_from_shape_component( children, shape_component.width, shape_component.height, document, options, &mut images, ); } ParagraphRecord::CtrlHeader { header, children, paragraphs: ctrl_paragraphs, .. } => { // CtrlHeader 처리 (그림 개체 등) / Process CtrlHeader (shape objects, etc.) // process_ctrl_header를 호출하여 이미지 수집 (paragraph.rs와 동일한 방식) / Call process_ctrl_header to collect images (same way as paragraph.rs) // children이 비어있으면 cell.paragraphs도 확인 / If children is empty, also check cell.paragraphs let paragraphs_to_use = if children.is_empty() && !cell.paragraphs.is_empty() { &cell.paragraphs } else { ctrl_paragraphs }; let ctrl_result = ctrl_header::process_ctrl_header( header, children, paragraphs_to_use, document, options, ); images.extend(ctrl_result.images); } _ => {} } } // 이미지-only 셀 판단을 위해, 이 문단에서 수집된 이미지의 최대 높이를 기록합니다. // (LineSegment 경로로 렌더링되는 경우에도 images는 존재할 수 있으므로 여기서 누적) if !images.is_empty() { for image in &images { let h_mm = round_to_2dp(int32_to_mm(image.height as INT32)); image_only_max_height_mm = Some( image_only_max_height_mm .map(|cur| cur.max(h_mm)) .unwrap_or(h_mm), ); } } // ParaShape indent 값 가져오기 / Get ParaShape indent value let para_shape_indent = if (para_shape_id as usize) < document.doc_info.para_shapes.len() { Some(document.doc_info.para_shapes[para_shape_id as usize].indent) } else { None }; // LineSegment가 있으면 사용 / Use LineSegment if available if !line_segments.is_empty() { // SPECIAL CASE (noori BIN0002 등): // 텍스트가 없고 이미지가 있는데, LineSegment.segment_width가 0에 가까우면 hls width가 0으로 출력되어 // 이미지 정렬이 깨집니다. 이 경우에도 hce>hcD>hcI>hls 구조는 유지하되, // hls 박스 width를 '셀의 콘텐츠 폭'으로 강제하고 이미지(hsR)를 그 안에서 가운데 배치합니다. let has_only_images = text.trim().is_empty() && !images.is_empty(); let seg_width_mm = line_segments .first() .map(|s| round_to_2dp(int32_to_mm(s.segment_width))) .unwrap_or(0.0); if has_only_images && seg_width_mm.abs() < 0.01 { // FIXTURE(noori.html) 구조 재현: // - hcI에는 "빈 문단(hls width=0)"만 남김 // - 실제 이미지는 hce 바로 아래에 hsR로 배치(top/left는 cell margin + ObjectCommon offset) // // fixture 예: // <div class="hcI"><div class="hls ... width:0mm;"></div></div> // <div class="hsR" style="top:0.50mm;left:24.42mm;... background-image:url(...);"></div> let image = &images[0]; let img_h_mm = round_to_2dp(int32_to_mm(image.height as INT32)); // 기본값: margin만 (offset 못 찾으면 0으로) let mut obj_off_x_mm = 0.0; let mut obj_off_y_mm = 0.0; for record in &para.records { if let ParagraphRecord::CtrlHeader { header, .. } = record { if let CtrlHeaderData::ObjectCommon { offset_x, offset_y, .. } = &header.data { obj_off_x_mm = round_to_2dp(int32_to_mm((*offset_x).into())); obj_off_y_mm = round_to_2dp(int32_to_mm((*offset_y).into())); break; } } } // 1) hcI 안에는 빈 hls만 cell_content.push_str(&format!( r#"<div class="hls {}" style="line-height:{:.2}mm;white-space:nowrap;left:0mm;top:-0.18mm;height:3.53mm;width:0mm;"></div>"#, para_shape_class, img_h_mm )); // 2) 실제 이미지는 cell_outside_html로 (hce 바로 아래) // 좌표는 fixture처럼: top = top_margin_mm + offset_y, left = left_margin_mm + offset_x let abs_left_mm = round_to_2dp(left_margin_mm + obj_off_x_mm); let abs_top_mm = round_to_2dp(top_margin_mm + obj_off_y_mm); cell_outside_html.push_str(&format!( r#"<div class="hsR" style="top:{:.2}mm;left:{:.2}mm;width:{:.2}mm;height:{:.2}mm;background-repeat:no-repeat;background-size:contain;background-image:url('{}');"></div>"#, abs_top_mm, abs_left_mm, round_to_2dp(int32_to_mm(image.width as INT32)), round_to_2dp(int32_to_mm(image.height as INT32)), image.url )); } else { // ParaText의 control_char_positions 수집 (원본 WCHAR 인덱스 기준) let mut control_char_positions = Vec::new(); for record in &para.records { if let ParagraphRecord::ParaText { control_char_positions: ccp, .. } = record { control_char_positions = ccp.clone(); break; } } let content = LineSegmentContent { segments: &line_segments, text: &text, char_shapes: &char_shapes, control_char_positions: &control_char_positions, original_text_len: para.para_header.text_char_count as usize, images: &images, tables: &[], // 셀 내부에서는 테이블 없음 / No tables inside cells }; let context = LineSegmentRenderContext { document, para_shape_class: &para_shape_class, options, para_shape_indent, hcd_position: None, // hcd_position 없음 / No hcd_position page_def: None, // page_def 없음 / No page_def }; let mut state = DocumentRenderState { table_counter_start: 0, // 셀 내부에서는 테이블 번호 사용 안 함 / table numbers not used inside cells pattern_counter, color_to_pattern, }; cell_content.push_str(&render_line_segments_with_content( &content, &context, &mut state, )); if !text.is_empty() { cell_has_text = true; } } } else if !text.is_empty() { // LineSegment가 없으면 텍스트만 렌더링 / Render text only if no LineSegment let rendered_text = text::render_text(&text, &char_shapes, document, &options.css_class_prefix); cell_content.push_str(&format!( r#"<div class="hls {}">{}</div>"#, para_shape_class, rendered_text )); cell_has_text = true; } else if !images.is_empty() { // LineSegment와 텍스트가 없지만 이미지가 있는 경우 / No LineSegment or text but images exist // 이미지만 렌더링 / Render images only for image in &images { let image_html = image::render_image_with_style( &image.url, 0, 0, image.width as INT32, image.height as INT32, 0, 0, ); cell_content.push_str(&image_html); let h_mm = round_to_2dp(int32_to_mm(image.height as INT32)); image_only_max_height_mm = Some( image_only_max_height_mm .map(|cur| cur.max(h_mm)) .unwrap_or(h_mm), ); } } } // (마진 값은 위에서 이미 계산됨) let bottom_margin_mm = cell_margin_to_mm(cell.cell_attributes.bottom_margin); // hcI의 top 위치 계산 / Calculate hcI top position // NOTE: hcI는 "셀 안에서 컨텐츠 블록을 어디에 둘지"만 담당합니다(Top/Center/Bottom). // 글자 baseline/line-height 보정은 LineSegment(hls) 쪽에서 처리합니다. // // IMPORTANT (fixture 기준): // 셀 안에 줄이 여러 개(여러 para_line_seg)인 경우, 첫 줄 높이만으로 center를 계산하면 // fixture보다 과하게 내려가므로(예: 6.44mm), 전체 라인 블록 높이(첫 라인 시작~마지막 라인 끝)를 사용합니다. let hci_top_mm = if let Some(segment) = first_line_segment { // 기본: 단일 라인 높이 / Default: single line height let mut content_height_mm = round_to_2dp(int32_to_mm(segment.line_height)); // 셀 내부 모든 para_line_seg를 스캔하여 전체 콘텐츠 높이 계산 // (min vertical_position ~ max(vertical_position + line_height)) let mut min_vp: Option<i32> = None;
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
true
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/constants.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/constants.rs
/// 테이블 렌더링 상수 / Table rendering constants pub(crate) const SVG_PADDING_MM: f64 = 2.5; pub(crate) const BORDER_COLOR: &str = "#000000"; pub(crate) const BORDER_WIDTH_MM: f64 = 0.12; pub(crate) const BORDER_OFFSET_MM: f64 = 0.06;
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/position.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/position.rs
use crate::document::bodytext::ctrl_header::{CtrlHeaderData, HorzRelTo, VertRelTo}; use crate::document::bodytext::PageDef; use crate::types::{RoundTo2dp, INT32}; use crate::viewer::html::styles::{int32_to_mm, round_to_2dp}; /// viewBox 데이터 / ViewBox data #[derive(Clone, Copy)] pub(crate) struct ViewBox { pub left: f64, pub top: f64, pub width: f64, pub height: f64, } /// SVG viewBox 계산 / Calculate SVG viewBox pub(crate) fn view_box(htb_width: f64, htb_height: f64, padding: f64) -> ViewBox { ViewBox { left: round_to_2dp(-padding), top: round_to_2dp(-padding), width: round_to_2dp(htb_width + (padding * 2.0)), height: round_to_2dp(htb_height + (padding * 2.0)), } } /// 테이블 절대 위치 계산 / Calculate absolute table position pub(crate) fn table_position( hcd_position: Option<(f64, f64)>, page_def: Option<&PageDef>, segment_position: Option<(INT32, INT32)>, ctrl_header: Option<&CtrlHeaderData>, obj_outer_width_mm: Option<f64>, para_start_vertical_mm: Option<f64>, para_start_column_mm: Option<f64>, para_segment_width_mm: Option<f64>, first_para_vertical_mm: Option<f64>, // 첫 번째 문단의 vertical_position (가설 O) / First paragraph's vertical_position (Hypothesis O) ) -> (f64, f64) { // CtrlHeader에서 필요한 정보 추출 / Extract necessary information from CtrlHeader let (offset_x, offset_y, vert_rel_to, horz_rel_to, horz_relative) = if let Some(CtrlHeaderData::ObjectCommon { attribute, offset_x, offset_y, .. }) = ctrl_header { ( Some(*offset_x), Some(*offset_y), Some(attribute.vert_rel_to), Some(attribute.horz_rel_to), Some(attribute.horz_relative), ) } else { (None, None, None, None, None) }; let (base_left, base_top) = if let Some((left, top)) = hcd_position { (left.round_to_2dp(), top.round_to_2dp()) } else if let Some(pd) = page_def { let left = (pd.left_margin.to_mm() + pd.binding_margin.to_mm()).round_to_2dp(); let top = (pd.top_margin.to_mm() + pd.header_margin.to_mm()).round_to_2dp(); (left, top) } else { (20.0, 24.99) }; if let Some((segment_col, segment_vert)) = segment_position { // 레거시 코드처럼 vertical_position을 절대 위치로 직접 사용 / Use vertical_position as absolute position directly like legacy code // vertical_position은 이미 페이지 기준 절대 위치이므로 base_pos를 더하지 않음 / vertical_position is already absolute position relative to page, so don't add base_pos let segment_left_mm = int32_to_mm(segment_col); let segment_top_mm = int32_to_mm(segment_vert); (round_to_2dp(segment_left_mm), round_to_2dp(segment_top_mm)) } else { // 종이(paper) 기준인 경우, 기준 원점은 용지 좌상단이므로 base_left/base_top을 적용하지 않는다. // (page/hcD 기준은 본문 시작점이므로 base_left/base_top이 필요) let base_top_for_obj = if matches!(vert_rel_to, Some(VertRelTo::Paper)) { 0.0 } else { base_top }; let base_left_for_obj = if matches!(horz_rel_to, Some(HorzRelTo::Paper)) { 0.0 } else { base_left }; let offset_left_mm = offset_x.map(|x| x.to_mm()).unwrap_or(0.0); let para_left_mm = if matches!(horz_rel_to, Some(HorzRelTo::Para)) { para_start_column_mm.unwrap_or(0.0) } else { 0.0 }; let obj_w_mm = obj_outer_width_mm.unwrap_or(0.0); // 기준 폭 계산 (right/center 정렬에 필요) // - paper: 용지 폭 // - page/column: 본문(content) 폭 // - para: 현재 LineSeg의 segment_width let mut ref_width_mm = match horz_rel_to { Some(HorzRelTo::Paper) => page_def.map(|pd| pd.paper_width.to_mm()).unwrap_or(210.0), Some(HorzRelTo::Para) => para_segment_width_mm.unwrap_or(0.0), Some(HorzRelTo::Page) | Some(HorzRelTo::Column) | None => { if let Some(pd) = page_def { // content width = paper - (left+binding) - right pd.paper_width.to_mm() - (pd.left_margin.to_mm() + pd.binding_margin.to_mm()) - pd.right_margin.to_mm() } else { 148.0 } } }; // ParaLineSeg.segment_width가 0인 케이스가 있어(빈 문단/앵커 문단), // 이 경우에는 content width에서 para_left를 뺀 값으로 폴백한다. if matches!(horz_rel_to, Some(HorzRelTo::Para)) && ref_width_mm <= 0.0 { if let Some(pd) = page_def { let content_w = pd.paper_width.to_mm() - (pd.left_margin.to_mm() + pd.binding_margin.to_mm()) - pd.right_margin.to_mm(); // 문단 기준 폭은 "문단 시작(col_start)"을 좌우에서 모두 제외한 값으로 해석해야 // fixture(table-position)의 "문단 오른쪽/가운데" 케이스와 일치한다. // 예) content_w(150) - 2*col_start(3.53) = 142.94mm ref_width_mm = (content_w - (para_left_mm * 2.0)).max(0.0); } } // horz_relative (Table 70): 0=left, 1=center, 2=right // NOTE: fixture(table-position.html)의 "오른쪽부터 Nmm" 케이스는 right 기준 계산이 필요합니다. let relative_mode = horz_relative.unwrap_or(0); let left_mm = match relative_mode { 2 => { // right aligned: (ref_right - offset_x - obj_width) base_left_for_obj + para_left_mm + (ref_width_mm - offset_left_mm - obj_w_mm) } 1 => { // centered: (ref_center - obj_width/2) + offset_x base_left_for_obj + para_left_mm + (ref_width_mm / 2.0 - obj_w_mm / 2.0) + offset_left_mm } _ => { // left aligned base_left_for_obj + para_left_mm + offset_left_mm } }; let offset_top_mm = if let (Some(VertRelTo::Para), Some(offset)) = (vert_rel_to, offset_y) { let offset_mm = offset.to_mm(); if let Some(para_start) = para_start_vertical_mm { // y 계산은 base_top 기준이어야 합니다. (base_left 사용은 버그) para_start - base_top_for_obj } else if let Some(first_para) = first_para_vertical_mm { let first_para_relative_mm = first_para - base_top_for_obj; first_para_relative_mm + offset_mm } else { offset_mm } } else { offset_y.map(|y| y.to_mm()).unwrap_or(0.0) }; let final_top_mm = base_top_for_obj + offset_top_mm; (round_to_2dp(left_mm), round_to_2dp(final_top_mm)) } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/size.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/size.rs
use std::collections::HashMap; use crate::document::bodytext::ctrl_header::CtrlHeaderData; use crate::document::bodytext::{ParagraphRecord, Table}; use crate::types::Hwpunit16ToMm; use crate::viewer::html::styles::{int32_to_mm, round_to_2dp}; /// 셀 마진을 mm 단위로 변환 / Convert cell margin to mm fn cell_margin_to_mm(margin_hwpunit: i16) -> f64 { round_to_2dp(int32_to_mm(margin_hwpunit as i32)) } /// 크기 데이터 / Size data #[derive(Clone, Copy)] pub(crate) struct Size { pub width: f64, pub height: f64, } /// CtrlHeader 기반 htb 컨테이너 크기 계산 / Calculate container size from CtrlHeader pub(crate) fn htb_size(ctrl_header: Option<&CtrlHeaderData>) -> Size { if let Some(CtrlHeaderData::ObjectCommon { width, height, margin, .. }) = ctrl_header { let w = width.to_mm() + margin.left.to_mm() + margin.right.to_mm(); let h = height.to_mm() + margin.top.to_mm() + margin.bottom.to_mm(); Size { width: round_to_2dp(w), height: round_to_2dp(h), } } else { Size { width: 0.0, height: 0.0, } } } /// 셀 기반 콘텐츠 크기 계산 / Calculate content size from cells pub(crate) fn content_size(table: &Table, ctrl_header: Option<&CtrlHeaderData>) -> Size { let mut content_width = 0.0; let mut content_height = 0.0; if table.attributes.row_count > 0 && !table.attributes.row_sizes.is_empty() { if let Some(CtrlHeaderData::ObjectCommon { height, .. }) = ctrl_header { let ctrl_header_height_mm = height.to_mm(); // object_common.height를 행 개수로 나눈 기본 행 높이 계산 / Calculate base row height from object_common.height divided by row count let base_row_height_mm = if table.attributes.row_count > 0 { ctrl_header_height_mm / table.attributes.row_count as f64 } else { 0.0 }; // ctrl_header.height가 있어도, shape component가 있는 셀의 실제 높이를 확인하여 더 큰 값을 사용 // Even if ctrl_header.height exists, check actual cell heights with shape components and use the larger value let mut max_row_heights_with_shapes: HashMap<usize, f64> = HashMap::new(); for cell in &table.cells { if cell.cell_attributes.row_span == 1 { let row_idx = cell.cell_attributes.row_address as usize; // 먼저 실제 셀 높이를 가져옴 (cell.cell_attributes.height 우선) / First get actual cell height (cell.cell_attributes.height has priority) let mut cell_height = cell.cell_attributes.height.to_mm(); // shape component가 있는 셀의 경우 shape 높이 + 마진을 고려 / For cells with shape components, consider shape height + margin let mut max_shape_height_mm: Option<f64> = None; // 재귀적으로 모든 ShapeComponent의 높이를 찾는 헬퍼 함수 / Helper function to recursively find height of all ShapeComponents fn find_shape_component_height( children: &[ParagraphRecord], shape_component_height: u32, ) -> Option<f64> { let mut max_height_mm: Option<f64> = None; for child in children { match child { // ShapeComponentPicture: shape_component.height 사용 ParagraphRecord::ShapeComponentPicture { .. } => { let height_hwpunit = shape_component_height as i32; let height_mm = round_to_2dp(int32_to_mm(height_hwpunit)); if max_height_mm.is_none() || height_mm > max_height_mm.unwrap() { max_height_mm = Some(height_mm); } } // 중첩된 ShapeComponent: 재귀적으로 탐색 ParagraphRecord::ShapeComponent { shape_component, children: nested_children, } => { if let Some(height) = find_shape_component_height( nested_children, shape_component.height, ) { if max_height_mm.is_none() || height > max_height_mm.unwrap() { max_height_mm = Some(height); } } } // 다른 shape component 타입들: shape_component.height 사용 ParagraphRecord::ShapeComponentLine { .. } | ParagraphRecord::ShapeComponentRectangle { .. } | ParagraphRecord::ShapeComponentEllipse { .. } | ParagraphRecord::ShapeComponentArc { .. } | ParagraphRecord::ShapeComponentPolygon { .. } | ParagraphRecord::ShapeComponentCurve { .. } | ParagraphRecord::ShapeComponentOle { .. } | ParagraphRecord::ShapeComponentContainer { .. } | ParagraphRecord::ShapeComponentTextArt { .. } | ParagraphRecord::ShapeComponentUnknown { .. } => { // shape_component.height 사용 / Use shape_component.height let height_mm = round_to_2dp(int32_to_mm(shape_component_height as i32)); if max_height_mm.is_none() || height_mm > max_height_mm.unwrap() { max_height_mm = Some(height_mm); } } // ParaLineSeg: line_height 합산하여 높이 계산 ParagraphRecord::ParaLineSeg { segments } => { let total_height_hwpunit: i32 = segments.iter().map(|seg| seg.line_height).sum(); let height_mm = round_to_2dp(int32_to_mm(total_height_hwpunit)); if max_height_mm.is_none() || height_mm > max_height_mm.unwrap() { max_height_mm = Some(height_mm); } } _ => {} } } max_height_mm } for para in &cell.paragraphs { // ShapeComponent의 children에서 모든 shape 높이 찾기 (재귀적으로) / Find all shape heights in ShapeComponent's children (recursively) for record in &para.records { match record { ParagraphRecord::ShapeComponent { shape_component, children, } => { if let Some(shape_height_mm) = find_shape_component_height( children, shape_component.height, ) { if max_shape_height_mm.is_none() || shape_height_mm > max_shape_height_mm.unwrap() { max_shape_height_mm = Some(shape_height_mm); } } break; // ShapeComponent는 하나만 있음 / Only one ShapeComponent per paragraph } // ParaLineSeg가 paragraph records에 직접 있는 경우도 처리 / Also handle ParaLineSeg directly in paragraph records ParagraphRecord::ParaLineSeg { segments } => { let total_height_hwpunit: i32 = segments.iter().map(|seg| seg.line_height).sum(); let height_mm = round_to_2dp(int32_to_mm(total_height_hwpunit)); if max_shape_height_mm.is_none() || height_mm > max_shape_height_mm.unwrap() { max_shape_height_mm = Some(height_mm); } } _ => {} } } } // shape component가 있으면 셀 높이 = shape 높이 + 마진 / If shape component exists, cell height = shape height + margin if let Some(shape_height_mm) = max_shape_height_mm { let top_margin_mm = cell_margin_to_mm(cell.cell_attributes.top_margin); let bottom_margin_mm = cell_margin_to_mm(cell.cell_attributes.bottom_margin); let shape_height_with_margin = shape_height_mm + top_margin_mm + bottom_margin_mm; // shape 높이 + 마진이 기존 셀 높이보다 크면 사용 / Use shape height + margin if larger than existing cell height if shape_height_with_margin > cell_height { cell_height = shape_height_with_margin; } } // shape component가 없고 셀 높이가 매우 작으면 object_common.height를 베이스로 사용 (fallback) // If no shape component and cell height is very small, use object_common.height as base (fallback) if max_shape_height_mm.is_none() && cell_height < 0.1 && base_row_height_mm > 0.0 { cell_height = base_row_height_mm; } let entry = max_row_heights_with_shapes.entry(row_idx).or_insert(0.0f64); *entry = (*entry).max(cell_height); } } // 행 높이 합계 계산 / Calculate sum of row heights let mut calculated_height = 0.0; for row_idx in 0..table.attributes.row_count as usize { if let Some(&height) = max_row_heights_with_shapes.get(&row_idx) { calculated_height += height; } else if base_row_height_mm > 0.0 { // max_row_heights_with_shapes에 없으면 object_common.height를 행 개수로 나눈 값 사용 / If not in max_row_heights_with_shapes, use object_common.height divided by row count calculated_height += base_row_height_mm; } else if let Some(&row_size) = table.attributes.row_sizes.get(row_idx) { let row_height = (row_size as f64 / 7200.0) * 25.4; calculated_height += row_height; } } // ctrl_header.height가 있으면 우선 사용 (이미 shape component 높이를 포함할 수 있음) // If ctrl_header.height exists, use it preferentially (may already include shape component height) // 계산된 높이는 참고용으로만 사용 (ctrl_header.height가 없거나 너무 작을 때만 사용) // Calculated height is only for reference (use only if ctrl_header.height is missing or too small) if calculated_height > ctrl_header_height_mm * 1.1 { // 계산된 높이가 ctrl_header.height보다 10% 이상 크면 사용 (shape component가 추가된 경우) // Use calculated height if it's more than 10% larger than ctrl_header.height (shape component added case) content_height = calculated_height; } else { // 그렇지 않으면 ctrl_header.height 사용 // Otherwise use ctrl_header.height content_height = ctrl_header_height_mm; } } else { let mut max_row_heights: HashMap<usize, f64> = HashMap::new(); for cell in &table.cells { if cell.cell_attributes.row_span == 1 { let row_idx = cell.cell_attributes.row_address as usize; let cell_height = cell.cell_attributes.height.to_mm(); let entry = max_row_heights.entry(row_idx).or_insert(0.0f64); *entry = (*entry).max(cell_height); } } for row_idx in 0..table.attributes.row_count as usize { if let Some(&height) = max_row_heights.get(&row_idx) { content_height += height; } else if let Some(&row_size) = table.attributes.row_sizes.get(row_idx) { let row_height = (row_size as f64 / 7200.0) * 25.4; content_height += row_height; } } } } for cell in &table.cells { if cell.cell_attributes.row_address == 0 { content_width += cell.cell_attributes.width.to_mm(); } } Size { width: round_to_2dp(content_width), height: round_to_2dp(content_height), } } /// htb 컨테이너와 콘텐츠 크기 결합 / Combine container and content size pub(crate) fn resolve_container_size(container: Size, content: Size) -> Size { if container.width == 0.0 || container.height == 0.0 { Size { width: content.width, height: content.height, } } else { container } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/svg/borders.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/svg/borders.rs
use crate::document::bodytext::{Table, TableCell}; use crate::document::docinfo::border_fill::BorderLine; use crate::viewer::html::styles::round_to_2dp; use crate::{BorderFill, HwpDocument}; use crate::viewer::html::ctrl_header::table::geometry::{ calculate_cell_left, calculate_cell_top, get_cell_height, }; use crate::viewer::html::ctrl_header::table::size::Size; fn border_width_code_to_mm(code: u8) -> f64 { match code { 0 => 0.10, 1 => 0.12, 2 => 0.15, 3 => 0.20, 4 => 0.25, 5 => 0.30, 6 => 0.40, 7 => 0.50, 8 => 0.60, 9 => 0.70, 10 => 1.00, 11 => 1.50, 12 => 2.00, 13 => 3.00, 14 => 4.00, 15 => 5.00, _ => 0.12, } } fn colorref_to_hex(c: u32) -> String { // HWP COLORREF는 보통 0x00BBGGRR 형태 let r = (c & 0xFF) as u8; let g = ((c >> 8) & 0xFF) as u8; let b = ((c >> 16) & 0xFF) as u8; format!("#{:02X}{:02X}{:02X}", r, g, b) } fn borderline_stroke_color(line: &BorderLine) -> String { let stroke = colorref_to_hex(line.color.0); stroke } fn borderline_base_width_mm(line: &BorderLine) -> f64 { // 사용자 요청: 굵기(stroke-width)는 원 데이터(표 26) 기준 그대로 유지 border_width_code_to_mm(line.width) } fn render_border_paths( x1: f64, y1: f64, x2: f64, y2: f64, is_vertical: bool, line: &BorderLine, ) -> String { // 레거시(hwpjs.js) 기준: line_type=0은 스타일을 리턴하지 않아 "선 없음" 취급. // 따라서 line_type=0 또는 width=0이면 그리지 않는다. if line.line_type == 0 || line.width == 0 { let _ = (x1, y1, x2, y2, is_vertical); return String::new(); } // 사용자 요청: 굵기(stroke-width)는 그대로 유지하고, // 색(stroke)과 “그려야 하는 선”만 맞춘다. // 따라서 line_type에 따른 2중/3중선(다중 스트로크) 표현은 여기서는 하지 않는다. let stroke = borderline_stroke_color(line); let w = round_to_2dp(borderline_base_width_mm(line)); let (ax1, ay1, ax2, ay2) = if is_vertical { (x1, y1, x2, y2) } else { (x1, y1, x2, y2) }; format!( r#"<path d="M{},{} L{},{}" style="stroke:{};stroke-linecap:butt;stroke-width:{};"></path>"#, round_to_2dp(ax1), round_to_2dp(ay1), round_to_2dp(ax2), round_to_2dp(ay2), stroke, w ) } fn get_border_fill<'a>(document: &'a HwpDocument, id: u16) -> Option<&'a BorderFill> { if id == 0 { return None; } let idx = (id as usize).checked_sub(1)?; document.doc_info.border_fill.get(idx) } fn cell_border_fill_id(table: &Table, cell: &TableCell) -> u16 { // 우선순위(추가 규칙): // 1) TableZone.border_fill_id (있으면 셀 값을 덮어씀) // 2) CellAttributes.border_fill_id // 3) TableAttributes.border_fill_id let row = cell.cell_attributes.row_address; let col = cell.cell_attributes.col_address; if !table.attributes.zones.is_empty() { // 여러 zone이 겹치면 "나중에 나온 zone"이 우선(override)된다고 가정 for zone in table.attributes.zones.iter().rev() { if zone.start_row <= row && row <= zone.end_row && zone.start_col <= col && col <= zone.end_col && zone.border_fill_id != 0 { return zone.border_fill_id; } } } let id = cell.cell_attributes.border_fill_id; if id != 0 { id } else { table.attributes.border_fill_id } } fn pick_thicker(a: BorderLine, b: BorderLine) -> BorderLine { if border_width_code_to_mm(b.width) > border_width_code_to_mm(a.width) { b } else { a } } fn default_borderline( table: &Table, document: &HwpDocument, side: usize, // 0:Left,1:Right,2:Top,3:Bottom ) -> Option<BorderLine> { if table.attributes.border_fill_id == 0 { return None; } get_border_fill(document, table.attributes.border_fill_id).map(|bf| bf.borders[side].clone()) } fn vertical_segment_borderline( table: &Table, document: &HwpDocument, col_x: f64, y0: f64, y1: f64, ctrl_header_height_mm: Option<f64>, is_left_edge: bool, is_right_edge: bool, ) -> Option<BorderLine> { let eps = 0.01; // 바깥 테두리: table.border_fill_id가 있으면 그걸 우선, 없으면 셀 border_fill로 결정 if is_left_edge { if let Some(line) = default_borderline(table, document, 0) { return Some(line); } } if is_right_edge { if let Some(line) = default_borderline(table, document, 1) { return Some(line); } } // 경계선 우선순위(원본 HTML과 일치시키기 위한 규칙): // - 내부선: "왼쪽 셀의 Right"를 우선, 없으면 "오른쪽 셀의 Left" // - 왼쪽 외곽: "첫 열 셀의 Left" // - 오른쪽 외곽: "마지막 열 셀의 Right" let mut from_left_cell_right: Option<BorderLine> = None; let mut from_right_cell_left: Option<BorderLine> = None; // 셀 순서를 고정(행,열 오름차순)해서 “첫 셀 우선” 규칙이 안정적으로 동작하도록 함 let mut cells: Vec<&TableCell> = table.cells.iter().collect(); cells.sort_by_key(|c| (c.cell_attributes.row_address, c.cell_attributes.col_address)); for cell in cells { let cell_left = calculate_cell_left(table, cell); let cell_width = cell.cell_attributes.width.to_mm(); let cell_right = cell_left + cell_width; let cell_top = calculate_cell_top(table, cell, ctrl_header_height_mm); let cell_height = get_cell_height(table, cell, ctrl_header_height_mm); let cell_bottom = cell_top + cell_height; let overlaps_y = !(y1 <= cell_top + eps || y0 >= cell_bottom - eps); if !overlaps_y { continue; } let bf_id = cell_border_fill_id(table, cell); let bf = match get_border_fill(document, bf_id) { Some(v) => v, None => continue, }; // 왼쪽 셀의 Right: 여러 셀이 매칭되면 “첫 셀” 우선(원본/레거시 동작에 더 근접) if (cell_right - col_x).abs() < eps { let cand = bf.borders[1].clone(); if from_left_cell_right.is_none() { from_left_cell_right = Some(cand); } } // 오른쪽 셀의 Left: 여러 셀이 매칭되면 “첫 셀” 우선 if (cell_left - col_x).abs() < eps { let cand = bf.borders[0].clone(); if from_right_cell_left.is_none() { from_right_cell_left = Some(cand); } } } let chosen = if is_left_edge { from_right_cell_left.or(from_left_cell_right) } else if is_right_edge { from_left_cell_right.or(from_right_cell_left) } else { from_left_cell_right.or(from_right_cell_left) }; chosen } fn horizontal_segment_borderline( table: &Table, document: &HwpDocument, row_positions: &[f64], row_y: f64, x0: f64, x1: f64, ctrl_header_height_mm: Option<f64>, is_top_edge: bool, is_bottom_edge: bool, ) -> Option<BorderLine> { let eps = 0.01; let _ = ctrl_header_height_mm; // row_positions 기반 계산을 사용 // 바깥 테두리: table.border_fill_id가 있으면 그걸 우선, 없으면 셀 border_fill로 결정 if is_top_edge { if let Some(line) = default_borderline(table, document, 2) { return Some(line); } } if is_bottom_edge { if let Some(line) = default_borderline(table, document, 3) { return Some(line); } } // 경계선 우선순위(원본 HTML과 일치시키기 위한 규칙): // - 내부선: "위쪽 셀의 Bottom"을 우선, 없으면 "아래쪽 셀의 Top" // - 위쪽 외곽: "첫 행 셀의 Top" // - 아래쪽 외곽: "마지막 행 셀의 Bottom" let mut from_upper_cell_bottom: Option<BorderLine> = None; let mut from_lower_cell_top: Option<BorderLine> = None; // 셀 순서를 고정(행,열 오름차순)해서 “첫 셀 우선” 규칙이 안정적으로 동작하도록 함 let mut cells: Vec<&TableCell> = table.cells.iter().collect(); cells.sort_by_key(|c| (c.cell_attributes.row_address, c.cell_attributes.col_address)); for cell in cells { let row = cell.cell_attributes.row_address as usize; let row_span = if cell.cell_attributes.row_span == 0 { 1usize } else { cell.cell_attributes.row_span as usize }; if row_positions.len() <= row || row_positions.len() <= row + row_span { continue; } let cell_top = row_positions[row]; let cell_bottom = row_positions[row + row_span]; let cell_left = calculate_cell_left(table, cell); let cell_width = cell.cell_attributes.width.to_mm(); let cell_right = cell_left + cell_width; let overlaps_x = !(x1 <= cell_left + eps || x0 >= cell_right - eps); if !overlaps_x { continue; } let bf_id = cell_border_fill_id(table, cell); let bf = match get_border_fill(document, bf_id) { Some(v) => v, None => continue, }; // 위쪽 셀의 Bottom: 여러 셀이 매칭되면 “첫 셀” 우선 if (cell_bottom - row_y).abs() < eps { let cand = bf.borders[3].clone(); if from_upper_cell_bottom.is_none() { from_upper_cell_bottom = Some(cand); } } // 아래쪽 셀의 Top: 여러 셀이 매칭되면 “첫 셀” 우선 if (cell_top - row_y).abs() < eps { let cand = bf.borders[2].clone(); if from_lower_cell_top.is_none() { from_lower_cell_top = Some(cand); } } } let chosen = if is_top_edge { from_lower_cell_top.or(from_upper_cell_bottom) } else if is_bottom_edge { from_upper_cell_bottom.or(from_lower_cell_top) } else { from_upper_cell_bottom.or(from_lower_cell_top) }; chosen } /// 수직 경계선 렌더링 / Render vertical borders pub(crate) fn render_vertical_borders( table: &Table, document: &HwpDocument, column_positions: &[f64], content: Size, ctrl_header_height_mm: Option<f64>, ) -> String { let mut svg_paths = String::new(); let epsilon = 0.01; // 부동소수점 비교를 위한 작은 오차 / Small epsilon for floating point comparison let is_suspect_image_or_caption_table = table.attributes.row_count as usize >= 6 && table.cells.len() >= 12; let mut h11_logged_count = 0usize; for &col_x in column_positions { let is_left_edge = (col_x - 0.0).abs() < epsilon; let is_right_edge = (col_x - content.width).abs() < epsilon; // 레거시/fixture 정합: // 좌/우 외곽선은 “항상 전체 높이”로 그려야 한다. // (부동소수점 오차로 covered_ranges가 생기거나, 셀 병합/커버 계산 때문에 // 외곽선이 위/아래로 끊기는 현상이 발생할 수 있음) if is_left_edge || is_right_edge { if let Some(line) = vertical_segment_borderline( table, document, col_x, 0.0, content.height, ctrl_header_height_mm, is_left_edge, is_right_edge, ) { svg_paths.push_str(&render_border_paths( col_x, 0.0, col_x, content.height, true, &line, )); } continue; } let mut covered_ranges = Vec::new(); for cell in &table.cells { let cell_left = calculate_cell_left(table, cell); let cell_width = cell.cell_attributes.width.to_mm(); let cell_right = cell_left + cell_width; let cell_top = calculate_cell_top(table, cell, ctrl_header_height_mm); let cell_height = get_cell_height(table, cell, ctrl_header_height_mm); // 셀이 해당 열 위치를 가로지르는 경우 (셀의 오른쪽 경계가 정확히 그 위치인 경우는 제외) // Cell crosses the column position (excluding when cell's right boundary is exactly at that position) if cell_left < col_x && cell_right > col_x { covered_ranges.push((cell_top, cell_top + cell_height)); } } covered_ranges.sort_by(|a, b| a.0.partial_cmp(&b.0).unwrap()); let mut segments = Vec::new(); let mut current_y = 0.0; for (cover_start, cover_end) in &covered_ranges { if current_y < *cover_start { segments.push((current_y, *cover_start)); } current_y = current_y.max(*cover_end); } if current_y < content.height { segments.push((current_y, content.height)); } if segments.is_empty() { // 덮인 범위가 없으면 전체 높이에 걸쳐 경계선을 그림 // If no covered ranges, draw border across full height if let Some(line) = vertical_segment_borderline( table, document, col_x, 0.0, content.height, ctrl_header_height_mm, is_left_edge, is_right_edge, ) { svg_paths.push_str(&render_border_paths( col_x, 0.0, col_x, content.height, true, &line, )); } } else if segments.len() == 1 && segments[0].0 == 0.0 && segments[0].1 == content.height { if let Some(line) = vertical_segment_borderline( table, document, col_x, 0.0, content.height, ctrl_header_height_mm, is_left_edge, is_right_edge, ) { svg_paths.push_str(&render_border_paths( col_x, 0.0, col_x, content.height, true, &line, )); } } else { for (y_start, y_end) in segments { if let Some(line) = vertical_segment_borderline( table, document, col_x, y_start, y_end, ctrl_header_height_mm, is_left_edge, is_right_edge, ) { svg_paths.push_str(&render_border_paths( col_x, y_start, col_x, y_end, true, &line, )); } } } } svg_paths } /// 수평 경계선 렌더링 / Render horizontal borders pub(crate) fn render_horizontal_borders( table: &Table, document: &HwpDocument, row_positions: &[f64], content: Size, border_offset: f64, ctrl_header_height_mm: Option<f64>, ) -> String { let mut svg_paths = String::new(); let _ = ctrl_header_height_mm; // row_positions 기반 계산을 사용 for &row_y in row_positions { let is_top_edge = (row_y - 0.0).abs() < 0.01; let is_bottom_edge = (row_y - content.height).abs() < 0.01; let mut covered_ranges = Vec::new(); for cell in &table.cells { let row = cell.cell_attributes.row_address as usize; let row_span = if cell.cell_attributes.row_span == 0 { 1usize } else { cell.cell_attributes.row_span as usize }; if row_positions.len() <= row || row_positions.len() <= row + row_span { continue; } let cell_top = row_positions[row]; let cell_bottom = row_positions[row + row_span]; let cell_left = calculate_cell_left(table, cell); let cell_width = cell.cell_attributes.width.to_mm(); if cell_top < row_y && cell_bottom > row_y { covered_ranges.push((cell_left, cell_left + cell_width)); } } covered_ranges.sort_by(|a, b| a.0.partial_cmp(&b.0).unwrap()); let mut segments = Vec::new(); let mut current_x = 0.0; for (cover_start, cover_end) in &covered_ranges { if current_x < *cover_start { segments.push((current_x, *cover_start)); } current_x = current_x.max(*cover_end); } if current_x < content.width { segments.push((current_x, content.width)); } if segments.is_empty() { continue; } else if segments.len() == 1 && segments[0].0 == 0.0 && segments[0].1 == content.width { let line_opt = horizontal_segment_borderline( table, document, row_positions, row_y, 0.0, content.width, ctrl_header_height_mm, is_top_edge, is_bottom_edge, ); if let Some(line) = line_opt { svg_paths.push_str(&render_border_paths( -border_offset, row_y, content.width + border_offset, row_y, false, &line, )); } } else { for (x_start, x_end) in segments { let line_opt = horizontal_segment_borderline( table, document, row_positions, row_y, x_start, x_end, ctrl_header_height_mm, is_top_edge, is_bottom_edge, ); if let Some(line) = line_opt { svg_paths.push_str(&render_border_paths( x_start - border_offset, row_y, x_end + border_offset, row_y, false, &line, )); } } } } // 테이블 하단 테두리 추가 / Add table bottom border // row_positions는 행의 시작 위치만 포함하므로, 항상 content.height 위치에 하단 테두리를 그려야 함 // row_positions only contains row start positions, so we must always draw bottom border at content.height if let Some(line) = horizontal_segment_borderline( table, document, row_positions, content.height, 0.0, content.width, ctrl_header_height_mm, false, true, ) { svg_paths.push_str(&render_border_paths( -border_offset, content.height, content.width + border_offset, content.height, false, &line, )); } svg_paths }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/html/ctrl_header/table/svg/fills.rs
crates/hwp-core/src/viewer/html/ctrl_header/table/svg/fills.rs
use crate::document::bodytext::Table; use crate::document::FillInfo; use crate::HwpDocument; use crate::viewer::html::styles::round_to_2dp; use crate::viewer::html::ctrl_header::table::geometry::{ calculate_cell_left, calculate_cell_top, get_cell_height, }; use std::collections::HashMap; /// 배경 패턴 및 면 채우기 생성 / Build background patterns and fills pub(crate) fn render_fills( table: &Table, document: &HwpDocument, ctrl_header_height_mm: Option<f64>, pattern_counter: &mut usize, // 문서 레벨 pattern_counter (문서 전체에서 패턴 ID 공유) / Document-level pattern_counter (share pattern IDs across document) color_to_pattern: &mut HashMap<u32, String>, // 문서 레벨 color_to_pattern (문서 전체에서 패턴 ID 공유) / Document-level color_to_pattern (share pattern IDs across document) ) -> (String, String) { let mut svg_paths = String::new(); let mut pattern_defs = String::new(); for (cell_idx, cell) in table.cells.iter().enumerate() { let cell_left = calculate_cell_left(table, cell); let cell_top = calculate_cell_top(table, cell, ctrl_header_height_mm); let cell_width = cell.cell_attributes.width.to_mm(); let cell_height = get_cell_height(table, cell, ctrl_header_height_mm); // 셀의 border_fill_id를 사용하거나, 0이면 테이블의 기본 border_fill_id 사용 // Use cell's border_fill_id, or table's default border_fill_id if 0 let border_fill_id_to_use = if cell.cell_attributes.border_fill_id > 0 { cell.cell_attributes.border_fill_id } else { table.attributes.border_fill_id }; if border_fill_id_to_use > 0 { let border_fill_id = border_fill_id_to_use as usize; // border_fill_id는 1-based이므로 배열 인덱스는 border_fill_id - 1 // border_fill_id is 1-based, so array index is border_fill_id - 1 if border_fill_id > 0 && border_fill_id <= document.doc_info.border_fill.len() { let border_fill = &document.doc_info.border_fill[border_fill_id - 1]; if let FillInfo::Solid(solid) = &border_fill.fill { let color_value = solid.background_color.0; // COLORREF가 0이 아니고 (투명하지 않고) 색상이 있는 경우 // If COLORREF is not 0 (not transparent) and has color if color_value != 0 { // 같은 색상이면 기존 패턴 재사용 / Reuse existing pattern for same color let is_new_pattern = !color_to_pattern.contains_key(&color_value); let pattern_id = if is_new_pattern { let id = format!("w_{:02}", *pattern_counter); *pattern_counter += 1; let color = &solid.background_color; pattern_defs.push_str(&format!( r#"<pattern id="{}" width="10" height="10" patternUnits="userSpaceOnUse"><rect width="10" height="10" fill="rgb({},{},{})" /></pattern>"#, id, color.r(), color.g(), color.b() )); color_to_pattern.insert(color_value, id.clone()); id } else { color_to_pattern.get(&color_value).unwrap().clone() }; svg_paths.push_str(&format!( r#"<path fill="url(#{})" d="M{},{}L{},{}L{},{}L{},{}L{},{}Z "></path>"#, pattern_id, round_to_2dp(cell_left), round_to_2dp(cell_top), round_to_2dp(cell_left + cell_width), round_to_2dp(cell_top), round_to_2dp(cell_left + cell_width), round_to_2dp(cell_top + cell_height), round_to_2dp(cell_left), round_to_2dp(cell_top + cell_height), round_to_2dp(cell_left), round_to_2dp(cell_top) )); } } } } } (pattern_defs, svg_paths) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/core/renderer.rs
crates/hwp-core/src/viewer/core/renderer.rs
/// Renderer trait for different output formats /// 다양한 출력 형식을 위한 렌더러 트레이트 /// /// 각 뷰어(HTML, Markdown, PDF, Image 등)는 이 트레이트를 구현하여 /// HWP 문서를 해당 형식으로 변환합니다. /// /// Each viewer (HTML, Markdown, PDF, Image, etc.) implements this trait /// to convert HWP documents to that format. use crate::document::{bodytext::Table, HwpDocument}; /// Text styling information /// 텍스트 스타일 정보 #[derive(Debug, Clone, Default)] pub struct TextStyles { pub bold: bool, pub italic: bool, pub underline: bool, pub strikethrough: bool, pub superscript: bool, pub subscript: bool, pub font_family: Option<String>, pub font_size: Option<f32>, pub color: Option<String>, pub background_color: Option<String>, } /// Document parts for rendering /// 렌더링을 위한 문서 부분들 #[derive(Debug, Clone, Default)] pub struct DocumentParts { pub headers: Vec<String>, pub body_lines: Vec<String>, pub footers: Vec<String>, pub footnotes: Vec<String>, pub endnotes: Vec<String>, } /// Renderer trait for converting HWP documents to various formats /// HWP 문서를 다양한 형식으로 변환하는 렌더러 트레이트 pub trait Renderer { /// Renderer-specific options type /// 렌더러별 옵션 타입 type Options: Clone; // ===== Text Styling ===== /// Render plain text with optional styles /// 스타일이 적용된 일반 텍스트 렌더링 fn render_text(&self, text: &str, styles: &TextStyles) -> String; /// Render bold text /// 굵은 텍스트 렌더링 fn render_bold(&self, text: &str) -> String; /// Render italic text /// 기울임 텍스트 렌더링 fn render_italic(&self, text: &str) -> String; /// Render underlined text /// 밑줄 텍스트 렌더링 fn render_underline(&self, text: &str) -> String; /// Render strikethrough text /// 취소선 텍스트 렌더링 fn render_strikethrough(&self, text: &str) -> String; /// Render superscript text /// 위첨자 텍스트 렌더링 fn render_superscript(&self, text: &str) -> String; /// Render subscript text /// 아래첨자 텍스트 렌더링 fn render_subscript(&self, text: &str) -> String; // ===== Structure Elements ===== /// Render a paragraph /// 문단 렌더링 fn render_paragraph(&self, content: &str) -> String; /// Render a table /// 테이블 렌더링 fn render_table( &self, table: &Table, document: &HwpDocument, options: &Self::Options, ) -> String; /// Render an image /// 이미지 렌더링 fn render_image( &self, image_id: u16, document: &HwpDocument, options: &Self::Options, ) -> Option<String>; /// Render a page break /// 페이지 구분선 렌더링 fn render_page_break(&self) -> String; // ===== Document Structure ===== /// Render the complete document /// 전체 문서 렌더링 fn render_document( &self, parts: &DocumentParts, document: &HwpDocument, options: &Self::Options, ) -> String; /// Render document header (title, version, etc.) /// 문서 헤더 렌더링 (제목, 버전 등) fn render_document_header( &self, document: &HwpDocument, options: &Self::Options, ) -> String; /// Render document footer (footnotes, endnotes, etc.) /// 문서 푸터 렌더링 (각주, 미주 등) fn render_document_footer( &self, parts: &DocumentParts, options: &Self::Options, ) -> String; // ===== Special Elements ===== /// Render a footnote reference link /// 각주 참조 링크 렌더링 fn render_footnote_ref(&self, id: u32, number: &str, options: &Self::Options) -> String; /// Render an endnote reference link /// 미주 참조 링크 렌더링 fn render_endnote_ref(&self, id: u32, number: &str, options: &Self::Options) -> String; /// Render a footnote back link /// 각주 돌아가기 링크 렌더링 fn render_footnote_back(&self, ref_id: &str, options: &Self::Options) -> String; /// Render an endnote back link /// 미주 돌아가기 링크 렌더링 fn render_endnote_back(&self, ref_id: &str, options: &Self::Options) -> String; /// Render outline number /// 개요 번호 렌더링 fn render_outline_number(&self, level: u8, number: u32, content: &str) -> String; }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/core/bodytext.rs
crates/hwp-core/src/viewer/core/bodytext.rs
/// Common bodytext processing logic /// 공통 본문 처리 로직 /// /// 모든 뷰어에서 공통으로 사용되는 본문 처리 로직을 제공합니다. /// 출력 형식은 Renderer 트레이트를 통해 처리됩니다. /// /// Provides common bodytext processing logic used by all viewers. /// Output format is handled through the Renderer trait. use crate::document::{ColumnDivideType, CtrlHeader, HwpDocument, Paragraph, ParagraphRecord}; use crate::viewer::core::renderer::{DocumentParts, Renderer}; use crate::viewer::markdown::utils::OutlineNumberTracker; use crate::viewer::{html, html::HtmlOptions, MarkdownOptions}; /// Render paragraph using viewer-specific functions /// 뷰어별 함수를 사용하여 문단 렌더링 /// /// 이 함수는 타입별로 기존 뷰어 함수를 호출하여 글자 모양, 개요 번호 등 /// 복잡한 처리를 기존 로직으로 처리합니다. /// /// This function calls existing viewer functions by type to handle complex /// processing like character shapes, outline numbers, etc. with existing logic. /// /// tracker는 문서 전체에 걸쳐 상태를 유지해야 하므로 외부에서 전달받습니다. /// tracker maintains state across the entire document, so it's passed from outside. fn render_paragraph_with_viewer<R: Renderer>( paragraph: &Paragraph, document: &HwpDocument, renderer: &R, options: &R::Options, tracker: &mut dyn TrackerRef, ) -> String where R::Options: 'static, { // 타입 체크를 통해 기존 뷰어 함수 호출 / Call existing viewer functions through type checking // HTML 렌더러인 경우 - 새로운 HTML 뷰어는 process_paragraph를 사용 / If HTML renderer - new HTML viewer uses process_paragraph // HTML 뷰어는 to_html() 함수에서 직접 처리하므로 여기서는 기본 처리 사용 // HTML viewer is handled directly in to_html() function, so use default processing here // Markdown 렌더러인 경우 / If Markdown renderer if std::any::TypeId::of::<R::Options>() == std::any::TypeId::of::<crate::viewer::markdown::MarkdownOptions>() { use crate::viewer::markdown::document::bodytext::paragraph::convert_paragraph_to_markdown; // 안전하게 타입 캐스팅 / Safely cast type unsafe { let md_options = &*(options as *const R::Options as *const crate::viewer::markdown::MarkdownOptions); let md_tracker = tracker.as_markdown_tracker_mut(); return convert_paragraph_to_markdown(paragraph, document, md_options, md_tracker); } } // 기본: 공통 paragraph 처리 사용 / Default: Use common paragraph processing use crate::viewer::core::paragraph::process_paragraph; process_paragraph(paragraph, document, renderer, options) } /// Trait for outline number tracker reference /// 개요 번호 추적기 참조를 위한 트레이트 trait TrackerRef { /// Get mutable reference to HTML tracker /// HTML 추적기의 가변 참조 가져오기 /// Note: 새로운 HTML 뷰어는 OutlineNumberTracker를 사용하지 않음 /// Note: New HTML viewer does not use OutlineNumberTracker unsafe fn as_html_tracker_mut(&mut self) -> &mut (); /// Get mutable reference to Markdown tracker /// Markdown 추적기의 가변 참조 가져오기 unsafe fn as_markdown_tracker_mut(&mut self) -> &mut OutlineNumberTracker; } /// Enum to hold tracker by renderer type /// 렌더러 타입별 추적기를 보관하는 열거형 enum Tracker { /// HTML 뷰어는 더 이상 OutlineNumberTracker를 사용하지 않음 /// HTML viewer no longer uses OutlineNumberTracker Html(()), Markdown(OutlineNumberTracker), } impl TrackerRef for Tracker { unsafe fn as_html_tracker_mut(&mut self) -> &mut () { match self { Tracker::Html(_) => { // 새로운 HTML 뷰어는 tracker를 사용하지 않음 // New HTML viewer does not use tracker std::hint::unreachable_unchecked() } _ => std::hint::unreachable_unchecked(), } } unsafe fn as_markdown_tracker_mut(&mut self) -> &mut OutlineNumberTracker { match self { Tracker::Markdown(tracker) => tracker, _ => std::hint::unreachable_unchecked(), } } } /// Process bodytext and return document parts /// 본문을 처리하고 문서 부분들을 반환 pub fn process_bodytext<R: Renderer>( document: &HwpDocument, renderer: &R, options: &R::Options, ) -> DocumentParts where R::Options: 'static, { let mut parts = DocumentParts::default(); // 각주/미주 번호 추적기 / Footnote/endnote number tracker let mut footnote_counter = 1u32; let mut endnote_counter = 1u32; // 개요 번호 추적기 생성 (렌더러별로 다름) / Create outline number tracker (varies by renderer) // 문서 전체에 걸쳐 상태를 유지해야 하므로 한 번만 생성 / Created only once to maintain state across entire document // 새로운 HTML 뷰어는 tracker를 사용하지 않음 / New HTML viewer does not use tracker let mut tracker: Tracker = if std::any::TypeId::of::<R::Options>() == std::any::TypeId::of::<HtmlOptions>() { Tracker::Html(()) } else if std::any::TypeId::of::<R::Options>() == std::any::TypeId::of::<MarkdownOptions>() { Tracker::Markdown(OutlineNumberTracker::new()) } else { // 기본 렌더러는 tracker가 필요 없을 수 있음 / Default renderer may not need tracker // 하지만 일단 Markdown tracker를 사용 (나중에 필요시 수정) / But use Markdown tracker for now (modify later if needed) Tracker::Markdown(OutlineNumberTracker::new()) }; // Convert body text / 본문 텍스트를 변환 for section in &document.body_text.sections { for paragraph in &section.paragraphs { // control_mask를 사용하여 빠른 필터링 (최적화) / Use control_mask for quick filtering (optimization) let control_mask = &paragraph.para_header.control_mask; // control_mask로 머리말/꼬리말/각주/미주가 있는지 빠르게 확인 / Quickly check if header/footer/footnote/endnote exists using control_mask let has_header_footer = control_mask.has_header_footer(); let has_footnote_endnote = control_mask.has_footnote_endnote(); // 머리말/꼬리말/각주/미주 컨트롤 처리 / Process header/footer/footnote/endnote controls if has_header_footer || has_footnote_endnote { for record in &paragraph.records { if let ParagraphRecord::CtrlHeader { header, children, paragraphs: ctrl_paragraphs, } = record { use crate::document::CtrlId; if header.ctrl_id.as_str() == CtrlId::HEADER { // 머리말 처리 / Process header process_header( header, children, ctrl_paragraphs, document, renderer, options, &mut parts, &mut tracker, ); } else if header.ctrl_id.as_str() == CtrlId::FOOTER { // 꼬리말 처리 / Process footer process_footer( header, children, ctrl_paragraphs, document, renderer, options, &mut parts, &mut tracker, ); } else if header.ctrl_id.as_str() == CtrlId::FOOTNOTE { // 각주 처리 / Process footnote let footnote_id = footnote_counter; footnote_counter += 1; process_footnote( footnote_id, header, children, ctrl_paragraphs, document, renderer, options, &mut parts, &mut tracker, ); } else if header.ctrl_id.as_str() == CtrlId::ENDNOTE { // 미주 처리 / Process endnote let endnote_id = endnote_counter; endnote_counter += 1; process_endnote( endnote_id, header, children, ctrl_paragraphs, document, renderer, options, &mut parts, &mut tracker, ); } // 테이블은 paragraph.rs에서 처리 / Table is processed in paragraph.rs } } } // 일반 본문 문단 처리 (컨트롤이 없는 경우) / Process regular body paragraph (when no controls) if !has_header_footer && !has_footnote_endnote { // 페이지 나누기 확인 / Check for page break let has_page_break = paragraph .para_header .column_divide_type .iter() .any(|t| matches!(t, ColumnDivideType::Page | ColumnDivideType::Section)); if has_page_break && !parts.body_lines.is_empty() { let last_line = parts.body_lines.last().map(String::as_str).unwrap_or(""); // 페이지 구분선이 이미 있는지 확인 (렌더러별로 다름) / Check if page break already exists (varies by renderer) if !last_line.is_empty() && !is_page_break_line(last_line, renderer) { parts.body_lines.push(renderer.render_page_break()); } } // 문단 처리 / Process paragraph let para_content = render_paragraph_with_viewer( paragraph, document, renderer, options, &mut tracker, ); if !para_content.is_empty() { parts.body_lines.push(para_content); } } } } parts } /// Check if a line is a page break line (renderer-specific) /// 페이지 구분선인지 확인 (렌더러별) fn is_page_break_line<R: Renderer>(line: &str, _renderer: &R) -> bool { // HTML: <hr // Markdown: --- line.contains("<hr") || line == "---" } /// Process header /// 머리말 처리 fn process_header<R: Renderer>( _header: &CtrlHeader, children: &[ParagraphRecord], ctrl_paragraphs: &[Paragraph], document: &HwpDocument, renderer: &R, options: &R::Options, parts: &mut DocumentParts, tracker: &mut dyn TrackerRef, ) where R::Options: 'static, { // LIST_HEADER가 있으면 children에서 처리, 없으면 paragraphs에서 처리 // If LIST_HEADER exists, process from children, otherwise from paragraphs let mut found_list_header = false; for child_record in children { if let ParagraphRecord::ListHeader { paragraphs, .. } = child_record { found_list_header = true; // LIST_HEADER 내부의 문단 처리 / Process paragraphs inside LIST_HEADER // 기존 뷰어 함수를 직접 호출 (글자 모양, 개요 번호 등 복잡한 처리를 위해) // Call existing viewer functions directly (for complex processing like character shapes, outline numbers, etc.) for para in paragraphs { let para_content = render_paragraph_with_viewer(para, document, renderer, options, tracker); if !para_content.is_empty() { parts.headers.push(para_content); } } } } // LIST_HEADER가 없으면 paragraphs 처리 / If no LIST_HEADER, process paragraphs if !found_list_header { for para in ctrl_paragraphs { let para_content = render_paragraph_with_viewer(para, document, renderer, options, tracker); if !para_content.is_empty() { parts.headers.push(para_content); } } } } /// Process footer /// 꼬리말 처리 fn process_footer<R: Renderer>( _header: &CtrlHeader, children: &[ParagraphRecord], ctrl_paragraphs: &[Paragraph], document: &HwpDocument, renderer: &R, options: &R::Options, parts: &mut DocumentParts, tracker: &mut dyn TrackerRef, ) where R::Options: 'static, { // LIST_HEADER가 있으면 children에서 처리, 없으면 paragraphs에서 처리 // If LIST_HEADER exists, process from children, otherwise from paragraphs let mut found_list_header = false; for child_record in children { if let ParagraphRecord::ListHeader { paragraphs, .. } = child_record { found_list_header = true; // LIST_HEADER 내부의 문단 처리 / Process paragraphs inside LIST_HEADER for para in paragraphs { let para_content = render_paragraph_with_viewer(para, document, renderer, options, tracker); if !para_content.is_empty() { parts.footers.push(para_content); } } } } // LIST_HEADER가 없으면 paragraphs 처리 / If no LIST_HEADER, process paragraphs if !found_list_header { for para in ctrl_paragraphs { let para_content = render_paragraph_with_viewer(para, document, renderer, options, tracker); if !para_content.is_empty() { parts.footers.push(para_content); } } } } /// Process footnote /// 각주 처리 fn process_footnote<R: Renderer>( footnote_id: u32, _header: &CtrlHeader, _children: &[ParagraphRecord], ctrl_paragraphs: &[Paragraph], document: &HwpDocument, renderer: &R, options: &R::Options, parts: &mut DocumentParts, tracker: &mut dyn TrackerRef, ) where R::Options: 'static, { // 각주 번호 형식 (TODO: FootnoteShape에서 가져오기) // Footnote number format (TODO: Get from FootnoteShape) let footnote_number = format!("{}", footnote_id); // 본문에 각주 참조 링크 삽입 / Insert footnote reference link in body if !parts.body_lines.is_empty() { let last_idx = parts.body_lines.len() - 1; let last_line = &mut parts.body_lines[last_idx]; // 렌더러별로 각주 참조 링크 추가 방법이 다름 // Method to add footnote reference link varies by renderer let footnote_ref = renderer.render_footnote_ref(footnote_id, &footnote_number, options); *last_line = append_to_last_paragraph(last_line, &footnote_ref, renderer); } else { // 본문이 비어있으면 새 문단으로 추가 / Add as new paragraph if body is empty let footnote_ref = renderer.render_footnote_ref(footnote_id, &footnote_number, options); parts .body_lines .push(renderer.render_paragraph(&footnote_ref)); } // 각주 내용 수집 / Collect footnote content for para in ctrl_paragraphs { let para_content = render_paragraph_with_viewer(para, document, renderer, options, tracker); if !para_content.is_empty() { let footnote_ref_id = format!("footnote-{}-ref", footnote_id); let footnote_back = renderer.render_footnote_back(&footnote_ref_id, options); let footnote_id_str = format!("footnote-{}", footnote_id); // 렌더러별 각주 컨테이너 형식 (HTML: <div>, Markdown: 일반 텍스트) // Footnote container format by renderer (HTML: <div>, Markdown: plain text) let footnote_container = format_footnote_container( &footnote_id_str, &footnote_back, &para_content, renderer, options, ); parts.footnotes.push(footnote_container); } } } /// Process endnote /// 미주 처리 fn process_endnote<R: Renderer>( endnote_id: u32, _header: &CtrlHeader, _children: &[ParagraphRecord], ctrl_paragraphs: &[Paragraph], document: &HwpDocument, renderer: &R, options: &R::Options, parts: &mut DocumentParts, tracker: &mut dyn TrackerRef, ) where R::Options: 'static, { // 미주 번호 형식 (TODO: FootnoteShape에서 가져오기) // Endnote number format (TODO: Get from FootnoteShape) let endnote_number = format!("{}", endnote_id); // 본문에 미주 참조 링크 삽입 / Insert endnote reference link in body if !parts.body_lines.is_empty() { let last_idx = parts.body_lines.len() - 1; let last_line = &mut parts.body_lines[last_idx]; let endnote_ref = renderer.render_endnote_ref(endnote_id, &endnote_number, options); *last_line = append_to_last_paragraph(last_line, &endnote_ref, renderer); } else { // 본문이 비어있으면 새 문단으로 추가 / Add as new paragraph if body is empty let endnote_ref = renderer.render_endnote_ref(endnote_id, &endnote_number, options); parts .body_lines .push(renderer.render_paragraph(&endnote_ref)); } // 미주 내용 수집 / Collect endnote content for para in ctrl_paragraphs { let para_content = render_paragraph_with_viewer(para, document, renderer, options, tracker); if !para_content.is_empty() { let endnote_ref_id = format!("endnote-{}-ref", endnote_id); let endnote_back = renderer.render_endnote_back(&endnote_ref_id, options); let endnote_id_str = format!("endnote-{}", endnote_id); parts.endnotes.push(format_endnote_container( &endnote_id_str, &endnote_back, &para_content, renderer, options, )); } } } /// Append content to last paragraph (renderer-specific) /// 마지막 문단에 내용 추가 (렌더러별) fn append_to_last_paragraph<R: Renderer>(last_line: &str, content: &str, _renderer: &R) -> String { // HTML: </p> 태그 앞에 추가 // Markdown: 문단 끝에 추가 if last_line.contains("</p>") { last_line.replace("</p>", &format!(" {}</p>", content)) } else { format!("{} {}", last_line, content) } } /// Format footnote container (renderer-specific) /// 각주 컨테이너 포맷 (렌더러별) fn format_footnote_container<R: Renderer>( id: &str, back_link: &str, content: &str, _renderer: &R, options: &R::Options, ) -> String where R::Options: 'static, { // 타입 체크를 통해 렌더러별 포맷 적용 / Apply renderer-specific format through type checking // HTML 렌더러인 경우 / If HTML renderer if std::any::TypeId::of::<R::Options>() == std::any::TypeId::of::<HtmlOptions>() { unsafe { let html_options = &*(options as *const R::Options as *const html::HtmlOptions); return format!( r#" <div id="{}" class="{}footnote">"#, id, html_options.css_class_prefix ) + &format!(r#" {}"#, back_link) + content + " </div>"; } } // Markdown 렌더러인 경우 / If Markdown renderer if std::any::TypeId::of::<R::Options>() == std::any::TypeId::of::<MarkdownOptions>() { // 마크다운에서는 각주를 [^1]: 형식으로 표시 // In markdown, footnotes are shown as [^1]: return format!("{}{}", back_link, content); } // 기본: 일반 텍스트 / Default: plain text format!("{} {}", back_link, content) } /// Format endnote container (renderer-specific) /// 미주 컨테이너 포맷 (렌더러별) fn format_endnote_container<R: Renderer>( id: &str, back_link: &str, content: &str, _renderer: &R, options: &R::Options, ) -> String where R::Options: 'static, { // 타입 체크를 통해 렌더러별 포맷 적용 / Apply renderer-specific format through type checking // HTML 렌더러인 경우 / If HTML renderer if std::any::TypeId::of::<R::Options>() == std::any::TypeId::of::<HtmlOptions>() { unsafe { let html_options = &*(options as *const R::Options as *const html::HtmlOptions); return format!( r#" <div id="{}" class="{}endnote">"#, id, html_options.css_class_prefix ) + &format!(r#" {}"#, back_link) + content + " </div>"; } } // Markdown 렌더러인 경우 / If Markdown renderer if std::any::TypeId::of::<R::Options>() == std::any::TypeId::of::<MarkdownOptions>() { // 마크다운에서는 미주를 [^1]: 형식으로 표시 // In markdown, endnotes are shown as [^1]: return format!("{}{}", back_link, content); } // 기본: 일반 텍스트 / Default: plain text format!("{} {}", back_link, content) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/core/mod.rs
crates/hwp-core/src/viewer/core/mod.rs
/// Core viewer module - 공통 로직 /// Core viewer module - Common logic /// /// 이 모듈은 모든 뷰어(HTML, Markdown, PDF, Image 등)에서 공통으로 사용되는 /// 로직을 제공합니다. 출력 형식만 다른 렌더러 패턴을 사용합니다. /// /// This module provides common logic used by all viewers (HTML, Markdown, PDF, Image, etc.). /// Uses a renderer pattern where only the output format differs. pub mod bodytext; mod paragraph; pub mod renderer; pub use bodytext::process_bodytext; pub use paragraph::process_paragraph; pub use renderer::{DocumentParts, Renderer, TextStyles};
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/core/paragraph.rs
crates/hwp-core/src/viewer/core/paragraph.rs
/// Common paragraph processing logic /// 공통 문단 처리 로직 /// /// 모든 뷰어에서 공통으로 사용되는 문단 처리 로직을 제공합니다. /// 출력 형식은 Renderer 트레이트를 통해 처리됩니다. /// /// Provides common paragraph processing logic used by all viewers. /// Output format is handled through the Renderer trait. use crate::document::{HwpDocument, Paragraph, ParagraphRecord}; use crate::viewer::core::renderer::Renderer; use crate::viewer::markdown::collect::collect_text_and_images_from_paragraph; /// Process a paragraph and return rendered content /// 문단을 처리하고 렌더링된 내용을 반환 pub fn process_paragraph<R: Renderer>( paragraph: &Paragraph, document: &HwpDocument, renderer: &R, options: &R::Options, ) -> String { if paragraph.records.is_empty() { return String::new(); } let mut parts = Vec::new(); let mut text_parts = Vec::new(); // 같은 문단 내의 텍스트 레코드들을 모음 // TODO: 글자 모양 정보 수집 및 적용 (렌더러별로 다름) // Character shape information collection and application (varies by renderer) // Process all records in order / 모든 레코드를 순서대로 처리 for record in &paragraph.records { match record { ParagraphRecord::ParaText { text, control_char_positions: _, .. } => { // ParaText 처리 / Process ParaText // TODO: 글자 모양 적용 로직 구현 (렌더러별로 다름) // Character shape application logic (varies by renderer) // 현재는 간단히 텍스트만 사용 // For now, just use text let text_content = text.to_string(); text_parts.push(text_content); } ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { // 이미지 처리 / Process image if let Some(image_content) = renderer.render_image( shape_component_picture.picture_info.bindata_id, document, options, ) { parts.push(image_content); } } ParagraphRecord::Table { table } => { // 테이블 처리 / Process table let table_content = renderer.render_table(table, document, options); if !table_content.is_empty() { parts.push(table_content); } } ParagraphRecord::CtrlHeader { header, children, paragraphs: ctrl_paragraphs, .. } => { // 컨트롤 헤더 처리 / Process control header process_ctrl_header( header, children, ctrl_paragraphs, document, renderer, options, &mut parts, ); } _ => { // 기타 레코드는 무시 / Ignore other records } } } // 같은 문단 내의 텍스트를 합침 / Combine text in the same paragraph if !text_parts.is_empty() { let combined_text = text_parts.join(""); // TODO: 개요 번호 처리 (렌더러별로 다름) // Outline number processing (varies by renderer) parts.push(renderer.render_paragraph(&combined_text)); } // HTML로 결합 / Combine into output if parts.is_empty() { return String::new(); } if parts.len() == 1 { return parts[0].clone(); } parts.join("") } /// Process CtrlHeader /// 컨트롤 헤더 처리 fn process_ctrl_header<R: Renderer>( header: &crate::document::CtrlHeader, children: &[ParagraphRecord], ctrl_paragraphs: &[Paragraph], document: &HwpDocument, renderer: &R, options: &R::Options, parts: &mut Vec<String>, ) { use crate::document::CtrlId; // 표 셀 내부의 텍스트와 이미지를 수집하여 셀 내부 문단인지 확인 // Collect text and images from paragraphs in Table.cells to check if they are cell content let mut table_cell_texts: std::collections::HashSet<String> = std::collections::HashSet::new(); let mut table_cell_image_ids: std::collections::HashSet<u16> = std::collections::HashSet::new(); let mut table_cell_para_ids: std::collections::HashSet<u32> = std::collections::HashSet::new(); let mut table_opt: Option<&crate::document::bodytext::Table> = None; let is_table_control = header.ctrl_id.as_str() == CtrlId::TABLE; // 먼저 TABLE을 찾아서 table_opt에 저장 / First find TABLE and store in table_opt for child in children { if let ParagraphRecord::Table { table } = child { table_opt = Some(table); break; } } if let Some(table) = table_opt { for cell in &table.cells { for para in &cell.paragraphs { if para.para_header.instance_id != 0 { table_cell_para_ids.insert(para.para_header.instance_id); } collect_text_and_images_from_paragraph( para, &mut table_cell_texts, &mut table_cell_image_ids, ); } } } // 컨트롤 헤더의 자식 레코드들을 순회하며 처리 / Iterate through control header's child records for child in children { match child { ParagraphRecord::Table { table } => { // 표 변환 / Convert table let table_content = renderer.render_table(table, document, options); if !table_content.is_empty() { parts.push(table_content); } } _ => { // 기타 레코드는 무시 / Ignore other records } } } // CTRL_HEADER 내부의 직접 문단 처리 / Process direct paragraphs inside CTRL_HEADER for para in ctrl_paragraphs { // 표 셀 내부의 문단인지 확인 / Check if paragraph is inside table cell let is_table_cell = if is_table_control && table_opt.is_some() { // 먼저 instance_id로 확인 (가장 정확, 0이 아닌 경우만) let is_table_cell_by_id = !table_cell_para_ids.is_empty() && para.para_header.instance_id != 0 && table_cell_para_ids.contains(&para.para_header.instance_id); if is_table_cell_by_id { true } else { // 재귀적으로 문단에서 텍스트와 이미지를 수집하여 표 셀 내부인지 확인 let mut para_texts = std::collections::HashSet::new(); let mut para_image_ids = std::collections::HashSet::new(); collect_text_and_images_from_paragraph(para, &mut para_texts, &mut para_image_ids); (!para_texts.is_empty() && para_texts .iter() .any(|text| table_cell_texts.contains(text))) || (!para_image_ids.is_empty() && para_image_ids .iter() .any(|id| table_cell_image_ids.contains(id))) } } else { false }; // 표 셀 내부가 아닌 경우에만 처리 / Only process if not inside table cell if !is_table_cell { let para_content = process_paragraph(para, document, renderer, options); if !para_content.is_empty() { parts.push(para_content); } } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/renderer.rs
crates/hwp-core/src/viewer/markdown/renderer.rs
/// Markdown Renderer implementation /// Markdown 렌더러 구현 use crate::document::{bodytext::Table, HwpDocument}; use crate::viewer::core::renderer::{DocumentParts, Renderer, TextStyles}; /// Markdown Renderer pub struct MarkdownRenderer; impl Renderer for MarkdownRenderer { type Options = crate::viewer::markdown::MarkdownOptions; // ===== Text Styling ===== fn render_text(&self, text: &str, _styles: &TextStyles) -> String { // TODO: 스타일 적용 (마크다운에서는 제한적) text.to_string() } fn render_bold(&self, text: &str) -> String { format!("**{}**", text) } fn render_italic(&self, text: &str) -> String { format!("*{}*", text) } fn render_underline(&self, text: &str) -> String { // 마크다운에서는 밑줄을 직접 지원하지 않으므로 HTML 태그 사용 // Markdown doesn't directly support underline, so use HTML tag format!("<u>{}</u>", text) } fn render_strikethrough(&self, text: &str) -> String { format!("~~{}~~", text) } fn render_superscript(&self, text: &str) -> String { // 마크다운에서는 위첨자를 직접 지원하지 않으므로 HTML 태그 사용 // Markdown doesn't directly support superscript, so use HTML tag format!("<sup>{}</sup>", text) } fn render_subscript(&self, text: &str) -> String { // 마크다운에서는 아래첨자를 직접 지원하지 않으므로 HTML 태그 사용 // Markdown doesn't directly support subscript, so use HTML tag format!("<sub>{}</sub>", text) } // ===== Structure Elements ===== fn render_paragraph(&self, content: &str) -> String { // 마크다운에서는 문단이 빈 줄로 구분되므로 그냥 텍스트 반환 // In markdown, paragraphs are separated by blank lines, so just return text content.to_string() } fn render_table( &self, table: &Table, document: &HwpDocument, options: &Self::Options, ) -> String { // 기존 테이블 변환 함수 사용 use crate::viewer::markdown::document::bodytext::table::convert_table_to_markdown; use crate::viewer::markdown::utils::OutlineNumberTracker; let mut tracker = OutlineNumberTracker::new(); convert_table_to_markdown(table, document, options, &mut tracker) } fn render_image( &self, image_id: u16, document: &HwpDocument, options: &Self::Options, ) -> Option<String> { // bindata_id로 직접 이미지 렌더링 / Render image directly by bindata_id use crate::viewer::markdown::common::format_image_markdown; // BinData에서 이미지 데이터 가져오기 / Get image data from BinData if let Some(bin_item) = document .bin_data .items .iter() .find(|item| item.index == image_id) { let image_markdown = format_image_markdown( document, image_id, &bin_item.data, options.image_output_dir.as_deref(), ); if !image_markdown.is_empty() { return Some(image_markdown); } } None } fn render_page_break(&self) -> String { "---\n".to_string() } // ===== Document Structure ===== fn render_document( &self, _parts: &DocumentParts, document: &HwpDocument, options: &Self::Options, ) -> String { // 기존 to_markdown 함수의 로직 사용 use crate::viewer::markdown::to_markdown; to_markdown(document, options) } fn render_document_header( &self, document: &HwpDocument, options: &Self::Options, ) -> String { let mut md = String::new(); md.push_str("# HWP 문서\n"); md.push_str("\n"); if options.include_version != Some(false) { use crate::viewer::markdown::document::fileheader::format_version; md.push_str(&format!("**버전**: {}\n", format_version(document))); md.push_str("\n"); } md } fn render_document_footer( &self, parts: &DocumentParts, _options: &Self::Options, ) -> String { let mut md = String::new(); if !parts.footnotes.is_empty() { md.push_str("## 각주\n"); md.push_str("\n"); for footnote in &parts.footnotes { md.push_str(footnote); md.push_str("\n"); } } if !parts.endnotes.is_empty() { md.push_str("## 미주\n"); md.push_str("\n"); for endnote in &parts.endnotes { md.push_str(endnote); md.push_str("\n"); } } md } // ===== Special Elements ===== fn render_footnote_ref(&self, id: u32, number: &str, _options: &Self::Options) -> String { // 마크다운에서는 각주 참조를 [^1] 형식으로 표시 // In markdown, footnote references are shown as [^1] format!("[^{}]", number) } fn render_endnote_ref(&self, id: u32, number: &str, _options: &Self::Options) -> String { // 마크다운에서는 미주 참조를 [^1] 형식으로 표시 // In markdown, endnote references are shown as [^1] format!("[^{}]", number) } fn render_footnote_back(&self, _ref_id: &str, _options: &Self::Options) -> String { // 마크다운에서는 각주 돌아가기 링크를 지원하지 않음 // Markdown doesn't support footnote back links String::new() } fn render_endnote_back(&self, _ref_id: &str, _options: &Self::Options) -> String { // 마크다운에서는 미주 돌아가기 링크를 지원하지 않음 // Markdown doesn't support endnote back links String::new() } fn render_outline_number(&self, _level: u8, _number: u32, content: &str) -> String { // TODO: 개요 번호 형식 적용 content.to_string() } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/collect.rs
crates/hwp-core/src/viewer/markdown/collect.rs
/// Functions for collecting text and images from paragraphs /// 문단에서 텍스트와 이미지를 수집하는 함수들 use crate::document::ParagraphRecord; /// 재귀적으로 paragraph에서 텍스트와 이미지 ID를 수집 /// Recursively collect text and image IDs from paragraph pub fn collect_text_and_images_from_paragraph( para: &crate::document::bodytext::Paragraph, table_cell_texts: &mut std::collections::HashSet<String>, table_cell_image_ids: &mut std::collections::HashSet<u16>, ) { for record in &para.records { match record { ParagraphRecord::ParaText { text, .. } => { if !text.trim().is_empty() { table_cell_texts.insert(text.trim().to_string()); } } ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { // 이미지 ID 수집 / Collect image ID table_cell_image_ids.insert(shape_component_picture.picture_info.bindata_id); } ParagraphRecord::CtrlHeader { children, paragraphs: ctrl_paragraphs, .. } => { // CTRL_HEADER 내부의 paragraphs도 재귀적으로 확인 / Recursively check paragraphs inside CTRL_HEADER for ctrl_para in ctrl_paragraphs { collect_text_and_images_from_paragraph( ctrl_para, table_cell_texts, table_cell_image_ids, ); } // CTRL_HEADER의 children도 재귀적으로 확인 / Recursively check children of CTRL_HEADER for child in children { match child { ParagraphRecord::ShapeComponent { children, .. } => { // SHAPE_COMPONENT의 children 확인 / Check SHAPE_COMPONENT's children for shape_child in children { match shape_child { ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { table_cell_image_ids.insert( shape_component_picture.picture_info.bindata_id, ); } ParagraphRecord::ListHeader { paragraphs, .. } => { // LIST_HEADER의 paragraphs도 확인 / Check LIST_HEADER's paragraphs for list_para in paragraphs { collect_text_and_images_from_paragraph( list_para, table_cell_texts, table_cell_image_ids, ); } } _ => {} } } } ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { table_cell_image_ids .insert(shape_component_picture.picture_info.bindata_id); } _ => {} } } } _ => {} } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/utils.rs
crates/hwp-core/src/viewer/markdown/utils.rs
/// Utility functions for Markdown conversion /// 마크다운 변환을 위한 유틸리티 함수들 use crate::document::{HeaderShapeType, HwpDocument}; /// 개요 번호 추적 구조체 / Outline number tracking structure /// 각 레벨별로 번호를 추적하여 개요 번호를 생성 /// Tracks numbers per level to generate outline numbers #[derive(Debug, Clone)] pub(crate) struct OutlineNumberTracker { /// 각 레벨별 번호 카운터 (인덱스는 레벨-1) / Number counter per level (index is level-1) counters: [u32; 7], } impl OutlineNumberTracker { /// 새로운 추적기 생성 / Create new tracker pub(crate) fn new() -> Self { Self { counters: [0; 7] } } /// 개요 레벨의 번호를 증가시키고 반환 / Increment and return number for outline level pub(crate) fn get_and_increment(&mut self, level: u8) -> u32 { // 레벨 8 이상은 번호를 사용하지 않음 / Levels 8 and above don't use numbers // 카운터도 증가시키지 않음 / Don't increment counters either if level >= 8 { return 0; } let level_index = (level - 1) as usize; if level_index < 7 { // 현재 레벨의 카운터가 0이 아니면 같은 레벨이 연속으로 나오는 것 // If current level counter is not 0, it means the same level is continuing let is_same_level = self.counters[level_index] > 0; if is_same_level { // 같은 레벨이 연속으로 나올 때: 현재 레벨만 증가, 하위 레벨만 초기화 // When same level continues: only increment current level, reset only lower levels for i in (level_index + 1)..7 { self.counters[i] = 0; } self.counters[level_index] += 1; } else { // 상위 레벨로 이동하거나 새로운 레벨: 현재 레벨과 하위 레벨 모두 초기화 // Moving to higher level or new level: reset current level and lower levels for i in level_index..7 { self.counters[i] = 0; } self.counters[level_index] = 1; } self.counters[level_index] } else { 0 } } } /// 버전 번호를 읽기 쉬운 문자열로 변환 /// Convert version number to readable string pub(crate) fn format_version(document: &HwpDocument) -> String { let version = document.file_header.version; let major = (version >> 24) & 0xFF; let minor = (version >> 16) & 0xFF; let patch = (version >> 8) & 0xFF; let build = version & 0xFF; format!("{}.{:02}.{:02}.{:02}", major, minor, patch, build) } /// 문서에서 첫 번째 PageDef 정보 추출 / Extract first PageDef information from document pub(crate) fn extract_page_info( document: &HwpDocument, ) -> Option<&crate::document::bodytext::PageDef> { use crate::document::ParagraphRecord; for section in &document.body_text.sections { for paragraph in &section.paragraphs { for record in &paragraph.records { if let ParagraphRecord::PageDef { page_def } = record { return Some(page_def); } } } } None } /// Check if a part is a text part (not a block element) /// part가 텍스트인지 확인 (블록 요소가 아님) pub(crate) fn is_text_part(part: &str) -> bool { !is_block_element(part) } /// Check if a part is a block element (image, table, etc.) /// part가 블록 요소인지 확인 (이미지, 표 등) pub(crate) fn is_block_element(part: &str) -> bool { part.starts_with("![이미지]") || part.starts_with("|") // 테이블 / table || part.starts_with("---") // 페이지 구분선 / page break // 개요 번호는 블록 요소가 아님 / Outline numbers are not block elements } /// Check if control header should be processed for markdown /// 컨트롤 헤더가 마크다운 변환에서 처리되어야 하는지 확인 pub(crate) fn should_process_control_header(header: &crate::document::CtrlHeader) -> bool { use crate::document::CtrlId; match header.ctrl_id.as_str() { // 마크다운으로 표현 가능한 컨트롤만 처리 / Only process controls that can be expressed in markdown CtrlId::TABLE => true, CtrlId::SHAPE_OBJECT => true, // 이미지는 자식 레코드에서 처리 / Images are processed from child records CtrlId::HEADER => true, // 머리말 처리 / Process header CtrlId::FOOTER => true, // 꼬리말 처리 / Process footer CtrlId::FOOTNOTE => false, // 각주는 convert_bodytext_to_markdown에서 처리 / Footnotes are processed in convert_bodytext_to_markdown CtrlId::ENDNOTE => false, // 미주는 convert_bodytext_to_markdown에서 처리 / Endnotes are processed in convert_bodytext_to_markdown CtrlId::COLUMN_DEF => false, // 마크다운으로 표현 불가 / Cannot be expressed in markdown CtrlId::PAGE_NUMBER | CtrlId::PAGE_NUMBER_POS => false, // 마크다운으로 표현 불가 / Cannot be expressed in markdown _ => false, // 기타 컨트롤도 마크다운으로 표현 불가 / Other controls also cannot be expressed in markdown } } /// 한글 개요 번호 형식 생성 / Generate Korean outline number format /// 레벨에 따라 다른 번호 형식 사용 / Use different number format based on level fn format_outline_number(level: u8, number: u32) -> String { match level { 1 => format!("{}.", number), // 1. 2 => format!("{}.", number_to_hangul(number)), // 가. 3 => format!("{})", number), // 1) 4 => format!("{})", number_to_hangul(number)), // 가) 5 => format!("({})", number), // (1) 6 => format!("({})", number_to_hangul(number)), // (가) 7 => format!("{}", number_to_circled(number)), // ① _ => format!("{}.", number), // 기본값 / default } } /// 숫자를 한글 자모로 변환 / Convert number to Korean syllable /// 1 -> 가, 2 -> 나, 3 -> 다, ... / 1 -> 가, 2 -> 나, 3 -> 다, ... fn number_to_hangul(number: u32) -> String { // 한글 자모 배열 (가, 나, 다, 라, 마, 바, 사, 아, 자, 차, 카, 타, 파, 하) // Korean syllable array (가, 나, 다, 라, 마, 바, 사, 아, 자, 차, 카, 타, 파, 하) const HANGUL_SYLLABLES: [char; 14] = [ '가', '나', '다', '라', '마', '바', '사', '아', '자', '차', '카', '타', '파', '하', ]; if number == 0 { return String::new(); } let index = ((number - 1) % 14) as usize; HANGUL_SYLLABLES[index].to_string() } /// 숫자를 원 숫자로 변환 / Convert number to circled number /// 1 -> ①, 2 -> ②, 3 -> ③, ... / 1 -> ①, 2 -> ②, 3 -> ③, ... fn number_to_circled(number: u32) -> String { if number == 0 || number > 20 { return format!("{}", number); } // 원 숫자 유니코드 범위: 0x2460-0x2473 (①-⑳) // Circled number Unicode range: 0x2460-0x2473 (①-⑳) let code = 0x2460 + number - 1; char::from_u32(code).unwrap_or(' ').to_string() } /// format_string이 번호를 사용하지 않는지 확인 /// Check if format_string indicates no numbering should be used fn is_format_string_empty_or_null(format_string: &str) -> bool { // 빈 문자열("")은 기본 형식 사용하므로 false 반환 (번호 표시) // Empty string ("") uses default format, so return false (show number) if format_string.is_empty() { return false; } // null 문자(\u0000)만 포함하거나 모든 문자가 null 문자인 경우만 번호 없음 // Only null character (\u0000) or all characters are null means no number // UTF-16LE로 디코딩된 null 문자는 단일 바이트 0 또는 "\u{0000}" 문자열로 나타날 수 있음 // Null character decoded from UTF-16LE may appear as single byte 0 or "\u{0000}" string // 모든 문자가 null 문자인지 확인 (가장 안전한 방법) // Check if all characters are null (safest method) if format_string.chars().all(|c| c == '\u{0000}') { return true; } // UTF-8 바이트가 모두 0인지 확인 (null 문자만 포함) // Check if all UTF-8 bytes are 0 (only null characters) if format_string.as_bytes().iter().all(|&b| b == 0) { return true; } // 단일 null 문자인지 확인 // Check if it's a single null character if format_string.len() == 1 { // 문자로 확인 // Check as character if format_string.chars().next() == Some('\u{0000}') { return true; } // UTF-8 바이트로 확인 // Check as UTF-8 byte if format_string.as_bytes()[0] == 0 { return true; } } false } /// 개요 레벨이면 텍스트 앞에 개요 번호를 추가 /// Add outline number prefix to text if it's an outline level pub(crate) fn convert_to_outline_with_number( text: &str, para_header: &crate::document::bodytext::ParaHeader, document: &HwpDocument, tracker: &mut OutlineNumberTracker, ) -> String { // ParaShape 찾기 (para_shape_id는 인덱스) / Find ParaShape (para_shape_id is index) let para_shape_id = para_header.para_shape_id as usize; if let Some(para_shape) = document.doc_info.para_shapes.get(para_shape_id) { // 개요 타입이면 개요 번호 추가 / If outline type, add outline number if para_shape.attributes1.header_shape_type == HeaderShapeType::Outline { // paragraph_level + 1 = 실제 레벨 (0=레벨1, 1=레벨2, 2=레벨3, ...) // paragraph_level + 1 = actual level (0=level1, 1=level2, 2=level3, ...) let base_level = para_shape.attributes1.paragraph_level + 1; // paragraph_level이 6이고 line_spacing이 7 이상이면 실제 레벨은 para_style_id를 사용하여 결정 // If paragraph_level is 6 and line_spacing is 7 or higher, determine actual level using para_style_id let level = if base_level == 7 { // paragraph_level이 6이면 base_level은 7 / If paragraph_level is 6, base_level is 7 // line_spacing이 7 이상이면 확장 레벨 (8-10) / If line_spacing >= 7, extended level (8-10) // para_style_id를 사용하여 스타일 이름에서 레벨 추출 // Use para_style_id to extract level from style name if let Some(line_spacing) = para_shape.line_spacing { if line_spacing >= 7 && line_spacing <= 10 { // para_style_id로 스타일 찾기 / Find style by para_style_id if let Some(style) = document .doc_info .styles .get(para_header.para_style_id as usize) { // 스타일 이름에서 레벨 추출 (예: "개요 8" -> 8, "개요 9" -> 9, "개요 10" -> 10) // Extract level from style name (e.g., "개요 8" -> 8, "개요 9" -> 9, "개요 10" -> 10) if style.local_name.starts_with("개요 ") { if let Ok(style_level) = style.local_name[3..].trim().parse::<u8>() { if style_level >= 8 && style_level <= 10 { style_level } else { // 스타일 레벨이 범위를 벗어나면 line_spacing 기반 계산 // If style level is out of range, calculate based on line_spacing (line_spacing + 1) as u8 } } else { // 스타일 이름 파싱 실패 시 line_spacing 기반 계산 // If style name parsing fails, calculate based on line_spacing (line_spacing + 1) as u8 } } else { // 스타일 이름이 "개요 "로 시작하지 않으면 line_spacing 기반 계산 // If style name doesn't start with "개요 ", calculate based on line_spacing (line_spacing + 1) as u8 } } else { // 스타일을 찾을 수 없으면 line_spacing 기반 계산 // If style cannot be found, calculate based on line_spacing (line_spacing + 1) as u8 } } else { base_level } } else { base_level } } else { base_level }; // numbering_id로 numbering 정보 찾기 / Find numbering info by numbering_id let numbering_id = para_shape.number_bullet_id as usize; // 레벨 8-10인 경우 extended_levels의 format_string 확인 // For levels 8-10, check format_string from extended_levels if level >= 8 { if let Some(numbering) = document.doc_info.numbering.get(numbering_id) { // 레벨 8은 extended_levels[0], 레벨 9는 extended_levels[1], 레벨 10은 extended_levels[2] // Level 8 is extended_levels[0], level 9 is extended_levels[1], level 10 is extended_levels[2] let extended_index = (level - 8) as usize; // extended_levels 배열 범위 확인 // Check extended_levels array bounds if extended_index < numbering.extended_levels.len() { if let Some(extended_level) = numbering.extended_levels.get(extended_index) { // format_string이 null 문자만 포함하면 번호 없이 텍스트만 반환 // If format_string contains only null character, return text only without number if is_format_string_empty_or_null(&extended_level.format_string) { return text.to_string(); } } } else { // extended_levels 배열 범위를 벗어나면 넘버링 없이 텍스트만 반환 // If extended_levels array index is out of bounds, return text only without number return text.to_string(); } // extended_levels가 없으면 번호 생성 (기본 동작) // If extended_levels don't exist, generate number (default behavior) } else { // numbering이 없으면 넘버링 없이 텍스트만 반환 (레벨 8 이상은 numbering이 필요) // If numbering doesn't exist, return text only without number (levels 8+ require numbering) return text.to_string(); } } // 레벨 1-7인 경우 format_string 확인 (빈 문자열이면 기본 형식 사용) // For levels 1-7, check format_string (empty string uses default format) if let Some(numbering) = document.doc_info.numbering.get(numbering_id) { let level_index = (level - 1) as usize; if let Some(level_info) = numbering.levels.get(level_index) { // format_string이 null 문자만 포함하면 번호 없이 텍스트만 반환 // If format_string contains only null character, return text only without number // 빈 문자열("")은 기본 형식 사용 (번호 표시) // Empty string ("") uses default format (show number) if is_format_string_empty_or_null(&level_info.format_string) { return text.to_string(); } } } // format_string이 있으면 번호 생성 / Generate number if format_string exists let number = tracker.get_and_increment(level); let outline_number = format_outline_number(level, number); return format!("{} {}", outline_number, text); } } text.to_string() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/mod.rs
crates/hwp-core/src/viewer/markdown/mod.rs
/// Markdown converter for HWP documents /// HWP 문서를 마크다운으로 변환하는 모듈 /// /// This module provides functionality to convert HWP documents to Markdown format. /// 이 모듈은 HWP 문서를 마크다운 형식으로 변환하는 기능을 제공합니다. /// /// 구조는 HWPTAG 기준으로 나뉘어 있습니다: /// Structure is organized by HWPTAG: /// - document: 문서 레벨 변환 (bodytext, docinfo, fileheader 등) / Document-level conversion (bodytext, docinfo, fileheader, etc.) /// - bodytext: 본문 텍스트 관련 (para_text, paragraph, list_header, table, shape_component, shape_component_picture) /// - docinfo: 문서 정보 /// - fileheader: 파일 헤더 /// - ctrl_header: CTRL_HEADER (HWPTAG_BEGIN + 55) - CtrlId별로 세분화 /// - utils: 유틸리티 함수들 / Utility functions /// - collect: 텍스트/이미지 수집 함수들 / Text/image collection functions pub mod collect; mod common; mod ctrl_header; pub mod document; mod renderer; pub mod utils; use crate::document::HwpDocument; pub use ctrl_header::convert_control_to_markdown; pub use document::bodytext::convert_paragraph_to_markdown; pub use document::bodytext::convert_table_to_markdown; pub use renderer::MarkdownRenderer; /// Markdown 변환 옵션 / Markdown conversion options #[derive(Debug, Clone)] pub struct MarkdownOptions { /// 이미지를 파일로 저장할 디렉토리 경로 (None이면 base64 데이터 URI로 임베드) /// Optional directory path to save images as files. If None, images are embedded as base64 data URIs. pub image_output_dir: Option<String>, /// HTML 태그 사용 여부 (Some(true)인 경우 테이블 등 개행 불가 영역에 <br> 태그 사용) /// Whether to use HTML tags (if Some(true), use <br> tags in areas where line breaks are not possible, such as tables) pub use_html: Option<bool>, /// 버전 정보 포함 여부 / Whether to include version information pub include_version: Option<bool>, /// 페이지 정보 포함 여부 / Whether to include page information pub include_page_info: Option<bool>, } impl MarkdownOptions { /// 이미지 출력 디렉토리 설정 / Set image output directory pub fn with_image_output_dir(mut self, dir: Option<&str>) -> Self { self.image_output_dir = dir.map(|s| s.to_string()); self } /// HTML 태그 사용 설정 / Set HTML tag usage pub fn with_use_html(mut self, use_html: Option<bool>) -> Self { self.use_html = use_html; self } /// 버전 정보 포함 설정 / Set version information inclusion pub fn with_include_version(mut self, include: Option<bool>) -> Self { self.include_version = include; self } /// 페이지 정보 포함 설정 / Set page information inclusion pub fn with_include_page_info(mut self, include: Option<bool>) -> Self { self.include_page_info = include; self } } /// Convert HWP document to Markdown format /// HWP 문서를 마크다운 형식으로 변환 /// /// # Arguments / 매개변수 /// * `document` - The HWP document to convert / 변환할 HWP 문서 /// * `options` - Markdown conversion options / 마크다운 변환 옵션 /// /// # Returns / 반환값 /// Markdown string representation of the document / 문서의 마크다운 문자열 표현 pub fn to_markdown(document: &HwpDocument, options: &MarkdownOptions) -> String { let mut lines = Vec::new(); // Add document title with version info / 문서 제목과 버전 정보 추가 lines.push("# HWP 문서".to_string()); lines.push(String::new()); // 버전 정보 추가 / Add version information if options.include_version != Some(false) { lines.push(format!("**버전**: {}", document::format_version(document))); lines.push(String::new()); } // 페이지 정보 추가 / Add page information if options.include_page_info == Some(true) { if let Some(page_def) = document::extract_page_info(document) { let paper_width_mm = page_def.paper_width.to_mm(); let paper_height_mm = page_def.paper_height.to_mm(); let left_margin_mm = page_def.left_margin.to_mm(); let right_margin_mm = page_def.right_margin.to_mm(); let top_margin_mm = page_def.top_margin.to_mm(); let bottom_margin_mm = page_def.bottom_margin.to_mm(); lines.push(format!( "**용지 크기**: {:.2}mm x {:.2}mm", paper_width_mm, paper_height_mm )); lines.push(format!( "**용지 방향**: {:?}", page_def.attributes.paper_direction )); lines.push(format!( "**여백**: 좌 {:.2}mm / 우 {:.2}mm / 상 {:.2}mm / 하 {:.2}mm", left_margin_mm, right_margin_mm, top_margin_mm, bottom_margin_mm )); lines.push(String::new()); } } // Convert body text to markdown using common logic / 공통 로직을 사용하여 본문 텍스트를 마크다운으로 변환 use crate::viewer::core::bodytext::process_bodytext; use crate::viewer::markdown::renderer::MarkdownRenderer; let renderer = MarkdownRenderer; let parts = process_bodytext(document, &renderer, options); // 머리말, 본문, 꼬리말, 각주, 미주 순서로 결합 / Combine in order: headers, body, footers, footnotes, endnotes if !parts.headers.is_empty() { lines.extend(parts.headers.clone()); lines.push(String::new()); } lines.extend(parts.body_lines.clone()); if !parts.footers.is_empty() { if !lines.is_empty() && !lines.last().unwrap().is_empty() { lines.push(String::new()); } lines.extend(parts.footers.clone()); } if !parts.footnotes.is_empty() { if !lines.is_empty() && !lines.last().unwrap().is_empty() { lines.push(String::new()); } // 각주 섹션 헤더 추가 / Add footnote section header lines.push("## 각주".to_string()); lines.push(String::new()); lines.extend(parts.footnotes.clone()); } if !parts.endnotes.is_empty() { if !lines.is_empty() && !lines.last().unwrap().is_empty() { lines.push(String::new()); } // 미주 섹션 헤더 추가 / Add endnote section header lines.push("## 미주".to_string()); lines.push(String::new()); lines.extend(parts.endnotes.clone()); } // 문단 사이에 빈 줄을 추가하여 마크다운에서 각 문단이 구분되도록 함 // Add blank lines between paragraphs so each paragraph is distinguished in markdown lines.join("\n\n") }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/common.rs
crates/hwp-core/src/viewer/markdown/common.rs
/// 공통 유틸리티 함수 / Common utility functions /// /// 마크다운 변환에 사용되는 공통 함수들을 제공합니다. /// Provides common functions used in markdown conversion. use crate::document::{BinDataRecord, HwpDocument}; use crate::error::HwpError; use base64::{engine::general_purpose::STANDARD, Engine as _}; use std::fs; use std::path::Path; /// Get MIME type from BinData ID using bin_data_records /// bin_data_records를 사용하여 BinData ID에서 MIME 타입 가져오기 pub(crate) fn get_mime_type_from_bindata_id( document: &HwpDocument, bindata_id: crate::types::WORD, ) -> String { // bin_data_records에서 EMBEDDING 타입의 extension 찾기 / Find extension from EMBEDDING type in bin_data_records for record in &document.doc_info.bin_data { if let BinDataRecord::Embedding { embedding, .. } = record { if embedding.binary_data_id == bindata_id { return match embedding.extension.to_lowercase().as_str() { "jpg" | "jpeg" => "image/jpeg", "png" => "image/png", "gif" => "image/gif", "bmp" => "image/bmp", _ => "image/jpeg", // 기본값 / default } .to_string(); } } } // 기본값 / default "image/jpeg".to_string() } /// Get file extension from BinData ID using bin_data_records /// bin_data_records를 사용하여 BinData ID에서 파일 확장자 가져오기 pub(crate) fn get_extension_from_bindata_id( document: &HwpDocument, bindata_id: crate::types::WORD, ) -> String { // bin_data_records에서 EMBEDDING 타입의 extension 찾기 / Find extension from EMBEDDING type in bin_data_records for record in &document.doc_info.bin_data { if let BinDataRecord::Embedding { embedding, .. } = record { if embedding.binary_data_id == bindata_id { return embedding.extension.clone(); } } } // 기본값 / default "jpg".to_string() } /// Format image markdown - either as base64 data URI or file path /// 이미지 마크다운 포맷 - base64 데이터 URI 또는 파일 경로 pub(crate) fn format_image_markdown( document: &HwpDocument, bindata_id: crate::types::WORD, base64_data: &str, image_output_dir: Option<&str>, ) -> String { match image_output_dir { Some(dir_path) => { // 이미지를 파일로 저장하고 파일 경로를 마크다운에 포함 / Save image as file and include file path in markdown match save_image_to_file(document, bindata_id, base64_data, dir_path) { Ok(file_path) => { // 상대 경로로 변환 (images/ 디렉토리 포함) / Convert to relative path (include images/ directory) let file_path_obj = Path::new(&file_path); let file_name = file_path_obj .file_name() .and_then(|n| n.to_str()) .unwrap_or(&file_path); // images/ 디렉토리 경로 포함 / Include images/ directory path format!("![이미지](images/{})", file_name) } Err(e) => { eprintln!("Failed to save image: {}", e); // 실패 시 base64로 폴백 / Fallback to base64 on failure let mime_type = get_mime_type_from_bindata_id(document, bindata_id); format!("![이미지](data:{};base64,{})", mime_type, base64_data) } } } None => { // base64 데이터 URI로 임베드 / Embed as base64 data URI let mime_type = get_mime_type_from_bindata_id(document, bindata_id); format!("![이미지](data:{};base64,{})", mime_type, base64_data) } } } /// Save image to file from base64 data /// base64 데이터에서 이미지를 파일로 저장 fn save_image_to_file( document: &HwpDocument, bindata_id: crate::types::WORD, base64_data: &str, dir_path: &str, ) -> Result<String, HwpError> { // base64 디코딩 / Decode base64 let image_data = STANDARD .decode(base64_data) .map_err(|e| HwpError::InternalError { message: format!("Failed to decode base64: {}", e), })?; // 파일명 생성 / Generate filename let extension = get_extension_from_bindata_id(document, bindata_id); let file_name = format!("BIN{:04X}.{}", bindata_id, extension); let file_path = Path::new(dir_path).join(&file_name); // 디렉토리 생성 / Create directory fs::create_dir_all(dir_path) .map_err(|e| HwpError::Io(format!("Failed to create directory '{}': {}", dir_path, e)))?; // 파일 저장 / Save file fs::write(&file_path, &image_data).map_err(|e| { HwpError::Io(format!( "Failed to write file '{}': {}", file_path.display(), e )) })?; Ok(file_path.to_string_lossy().to_string()) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/endnote.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/endnote.rs
/// ENDNOTE CtrlId conversion to Markdown /// ENDNOTE CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 이외의 컨트롤과 컨트롤 ID, ENDNOTE ("en ") /// Spec mapping: Table 127 - Controls other than objects and Control IDs, ENDNOTE ("en ") /// Convert ENDNOTE CtrlId to markdown /// ENDNOTE CtrlId를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_endnote_ctrl_to_markdown( _header: &crate::document::CtrlHeader, ) -> String { // 미주 제목 / Endnote title // 실제 내용은 자식 레코드에서 처리됨 / Actual content is processed from child records "## 미주".to_string() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/shape_object.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/shape_object.rs
/// SHAPE_OBJECT CtrlId conversion to Markdown /// SHAPE_OBJECT CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 컨트롤 ID, SHAPE_OBJECT ("gso ") /// Spec mapping: Table 127 - Object Control IDs, SHAPE_OBJECT ("gso ") use crate::document::CtrlHeader; /// Convert SHAPE_OBJECT CtrlId to markdown /// SHAPE_OBJECT CtrlId를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_shape_object_ctrl_to_markdown(_header: &CtrlHeader) -> String { // 그리기 개체 메타데이터는 마크다운 뷰어에서 불필요하므로 빈 문자열 반환 // 실제 이미지나 내용은 자식 레코드에서 처리됨 // Shape object metadata is not needed in markdown viewer, so return empty string // Actual images or content are processed from child records String::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/footer.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/footer.rs
/// FOOTER CtrlId conversion to Markdown /// FOOTER CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 이외의 컨트롤과 컨트롤 ID, FOOTER ("foot") /// Spec mapping: Table 127 - Controls other than objects and Control IDs, FOOTER ("foot") /// Convert FOOTER CtrlId to markdown /// FOOTER CtrlId를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_footer_ctrl_to_markdown(_header: &crate::document::CtrlHeader) -> String { // 꼬리말 제목 / Footer title // 실제 내용은 자식 레코드에서 처리됨 / Actual content is processed from child records "## 꼬리말".to_string() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/column_def.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/column_def.rs
/// COLUMN_DEF CtrlId conversion to Markdown /// COLUMN_DEF CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 이외의 컨트롤과 컨트롤 ID, COLUMN_DEF ("cold") /// Spec mapping: Table 127 - Controls other than objects and Control IDs, COLUMN_DEF ("cold") /// Convert COLUMN_DEF CtrlId to markdown /// COLUMN_DEF CtrlId를 마크다운으로 변환 /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_column_def_ctrl_to_markdown() -> String { // 단 정의는 마크다운 뷰어에서 불필요하므로 빈 문자열 반환 // Column definition is not needed in markdown viewer, so return empty string String::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/table.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/table.rs
/// TABLE CtrlId conversion to Markdown /// TABLE CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 컨트롤 ID, TABLE ("tbl ") /// Spec mapping: Table 127 - Object Control IDs, TABLE ("tbl ") use crate::document::{CtrlHeader, CtrlHeaderData}; /// Convert TABLE CtrlId to markdown /// TABLE CtrlId를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// * `has_table` - 표가 이미 추출되었는지 여부 / Whether table was already extracted /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_table_ctrl_to_markdown(header: &CtrlHeader, has_table: bool) -> String { // 표 (Table) / Table // 표가 이미 추출되었다면 메시지를 출력하지 않음 / Don't output message if table was already extracted if has_table { return String::new(); } let mut md = String::from("**표**"); if let CtrlHeaderData::ObjectCommon { description, .. } = &header.data { if let Some(desc) = description { if !desc.trim().is_empty() { md.push_str(&format!(": {}", desc.trim())); } } } md.push_str("\n\n*[표 내용은 추출되지 않았습니다]*"); md }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/footnote.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/footnote.rs
/// FOOTNOTE CtrlId conversion to Markdown /// FOOTNOTE CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 이외의 컨트롤과 컨트롤 ID, FOOTNOTE ("fn ") /// Spec mapping: Table 127 - Controls other than objects and Control IDs, FOOTNOTE ("fn ") /// Convert FOOTNOTE CtrlId to markdown /// FOOTNOTE CtrlId를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_footnote_ctrl_to_markdown( _header: &crate::document::CtrlHeader, ) -> String { // 각주 제목 / Footnote title // 실제 내용은 자식 레코드에서 처리됨 / Actual content is processed from child records "## 각주".to_string() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/header.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/header.rs
/// HEADER CtrlId conversion to Markdown /// HEADER CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 이외의 컨트롤과 컨트롤 ID, HEADER ("head") /// Spec mapping: Table 127 - Controls other than objects and Control IDs, HEADER ("head") /// Convert HEADER CtrlId to markdown /// HEADER CtrlId를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_header_ctrl_to_markdown( _header: &crate::document::CtrlHeader, ) -> String { // 머리말 제목 / Header title // 실제 내용은 자식 레코드에서 처리됨 / Actual content is processed from child records "## 머리말".to_string() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/mod.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/mod.rs
/// CtrlHeader conversion to Markdown /// CtrlHeader를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 57 - 본문의 데이터 레코드, CTRL_HEADER (HWPTAG_BEGIN + 55) /// Spec mapping: Table 57 - BodyText data records, CTRL_HEADER (HWPTAG_BEGIN + 55) mod column_def; mod endnote; mod footer; mod footnote; mod header; mod page_number; mod shape_object; mod table; use crate::document::{CtrlHeader, CtrlId}; use column_def::convert_column_def_ctrl_to_markdown; use endnote::convert_endnote_ctrl_to_markdown; use footer::convert_footer_ctrl_to_markdown; use footnote::convert_footnote_ctrl_to_markdown; use header::convert_header_ctrl_to_markdown; use page_number::convert_page_number_ctrl_to_markdown; use shape_object::convert_shape_object_ctrl_to_markdown; use table::convert_table_ctrl_to_markdown; /// Convert control header to markdown /// 컨트롤 헤더를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// * `has_table` - 표가 이미 추출되었는지 여부 / Whether table was already extracted /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub fn convert_control_to_markdown(header: &CtrlHeader, has_table: bool) -> String { match header.ctrl_id.as_str() { CtrlId::TABLE => convert_table_ctrl_to_markdown(header, has_table), CtrlId::SHAPE_OBJECT => convert_shape_object_ctrl_to_markdown(header), CtrlId::HEADER => convert_header_ctrl_to_markdown(header), CtrlId::FOOTER => convert_footer_ctrl_to_markdown(header), CtrlId::FOOTNOTE => convert_footnote_ctrl_to_markdown(header), CtrlId::ENDNOTE => convert_endnote_ctrl_to_markdown(header), CtrlId::COLUMN_DEF => convert_column_def_ctrl_to_markdown(), CtrlId::PAGE_NUMBER | CtrlId::PAGE_NUMBER_POS => { convert_page_number_ctrl_to_markdown(header) } _ => { // 기타 컨트롤은 마크다운으로 표현할 수 없으므로 빈 문자열 반환 // Other controls cannot be expressed in markdown, so return empty string String::new() } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/ctrl_header/page_number.rs
crates/hwp-core/src/viewer/markdown/ctrl_header/page_number.rs
/// PAGE_NUMBER CtrlId conversion to Markdown /// PAGE_NUMBER CtrlId를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 127 - 개체 이외의 컨트롤과 컨트롤 ID, PAGE_NUMBER ("pgno") / PAGE_NUMBER_POS ("pgnp") /// Spec mapping: Table 127 - Controls other than objects and Control IDs, PAGE_NUMBER ("pgno") / PAGE_NUMBER_POS ("pgnp") use crate::document::CtrlHeader; /// Convert PAGE_NUMBER or PAGE_NUMBER_POS CtrlId to markdown /// PAGE_NUMBER 또는 PAGE_NUMBER_POS CtrlId를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `header` - 컨트롤 헤더 / Control header /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_page_number_ctrl_to_markdown(_header: &CtrlHeader) -> String { // 쪽 번호 위치는 마크다운으로 표현할 수 없으므로 빈 문자열 반환 // Page number position cannot be expressed in markdown, so return empty string String::new() }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/document/docinfo.rs
crates/hwp-core/src/viewer/markdown/document/docinfo.rs
/// DocInfo conversion to Markdown /// 문서 정보를 마크다운으로 변환하는 모듈 use crate::document::{HwpDocument, ParagraphRecord}; /// 문서에서 첫 번째 PageDef 정보 추출 / Extract first PageDef information from document pub fn extract_page_info(document: &HwpDocument) -> Option<&crate::document::bodytext::PageDef> { for section in &document.body_text.sections { for paragraph in &section.paragraphs { for record in &paragraph.records { if let ParagraphRecord::PageDef { page_def } = record { return Some(page_def); } } } } None }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/document/mod.rs
crates/hwp-core/src/viewer/markdown/document/mod.rs
/// Document-level markdown conversion /// 문서 레벨의 마크다운 변환 /// /// HWP 문서의 각 부분(bodytext, docinfo, fileheader 등)을 마크다운으로 변환하는 모듈 /// Module for converting each part of HWP document (bodytext, docinfo, fileheader, etc.) to markdown pub mod bodytext; mod docinfo; pub mod fileheader; pub use bodytext::convert_bodytext_to_markdown; pub use docinfo::extract_page_info; pub use fileheader::format_version;
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/document/fileheader.rs
crates/hwp-core/src/viewer/markdown/document/fileheader.rs
/// FileHeader conversion to Markdown /// 파일 헤더를 마크다운으로 변환하는 모듈 use crate::document::HwpDocument; /// 버전 번호를 읽기 쉬운 문자열로 변환 /// Convert version number to readable string pub fn format_version(document: &HwpDocument) -> String { let version = document.file_header.version; let major = (version >> 24) & 0xFF; let minor = (version >> 16) & 0xFF; let patch = (version >> 8) & 0xFF; let build = version & 0xFF; format!("{}.{:02}.{:02}.{:02}", major, minor, patch, build) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/document/bodytext/table.rs
crates/hwp-core/src/viewer/markdown/document/bodytext/table.rs
/// Table conversion to Markdown /// 테이블을 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 57 - 본문의 데이터 레코드, TABLE (HWPTAG_BEGIN + 61) /// Spec mapping: Table 57 - BodyText data records, TABLE (HWPTAG_BEGIN + 61) use crate::document::{bodytext::Table, HwpDocument, ParagraphRecord}; /// Convert table to markdown format /// 테이블을 마크다운 형식으로 변환 pub fn convert_table_to_markdown( table: &Table, document: &HwpDocument, options: &crate::viewer::markdown::MarkdownOptions, tracker: &mut crate::viewer::markdown::utils::OutlineNumberTracker, ) -> String { let row_count = table.attributes.row_count as usize; let col_count = table.attributes.col_count as usize; if row_count == 0 || col_count == 0 { return format!("\n\n[Table: {}x{}]\n\n", row_count, col_count); } // 셀이 비어있어도 표 형식으로 출력 / Output table format even if cells are empty if table.cells.is_empty() { // 빈 표 형식으로 출력 / Output empty table format let mut lines = Vec::new(); lines.push(String::new()); let empty_row: Vec<String> = (0..col_count).map(|_| " ".to_string()).collect(); lines.push(format!("| {} |", empty_row.join(" | "))); lines.push(format!( "|{}|", (0..col_count).map(|_| "---").collect::<Vec<_>>().join("|") )); for _ in 1..row_count { lines.push(format!("| {} |", empty_row.join(" | "))); } lines.push(String::new()); return lines.join("\n"); } // 2D 배열로 셀 정렬 (행/열 위치 기준) / Arrange cells in 2D array (by row/column position) // row_address와 col_address는 1부터 시작하므로 0-based 인덱스로 변환 필요 // row_address and col_address start from 1, so need to convert to 0-based index let mut grid: Vec<Vec<Option<String>>> = vec![vec![None; col_count]; row_count]; // row_address와 col_address의 최소값 찾기 (일반적으로 1부터 시작하지만 확인 필요) // Find minimum values of row_address and col_address (usually start from 1, but need to verify) let min_row = table .cells .iter() .map(|c| c.cell_attributes.row_address) .min() .unwrap_or(1); let min_col = table .cells .iter() .map(|c| c.cell_attributes.col_address) .min() .unwrap_or(1); // row_address가 모두 같다면, 셀의 순서를 사용하여 행을 구분 // If all row_address values are the same, use cell order to distinguish rows let all_same_row = table .cells .iter() .all(|c| c.cell_attributes.row_address == min_row); // 셀을 row_address, col_address 순서로 정렬 / Sort cells by row_address, then col_address let mut sorted_cells: Vec<_> = table.cells.iter().enumerate().collect(); sorted_cells.sort_by_key(|(_, cell)| { ( cell.cell_attributes.row_address, cell.cell_attributes.col_address, ) }); // row_address가 모두 같다면, 셀의 순서를 사용하여 행을 구분 // If all row_address are the same, use cell order to distinguish rows if all_same_row { // 셀을 원래 순서대로 처리하되, col_address가 0으로 돌아가면 새 행으로 간주 // Process cells in original order, but consider it a new row when col_address returns to 0 let mut row_index = 0; let mut last_col = u16::MAX; for (_original_idx, cell) in sorted_cells { let col = (cell.cell_attributes.col_address.saturating_sub(min_col)) as usize; // col_address가 이전보다 작거나 같으면 새 행으로 간주 // If col_address is less than or equal to previous, consider it a new row if cell.cell_attributes.col_address <= last_col && last_col != u16::MAX { row_index += 1; if row_index >= row_count { row_index = row_count - 1; } } last_col = cell.cell_attributes.col_address; let row = row_index; if col < col_count { fill_cell_content( &mut grid, cell, row, col, row_count, col_count, document, options, tracker, ); } } } else { // row_address가 다르면 정상적으로 사용 // If row_address differ, use them normally for cell in &table.cells { let row = (cell.cell_attributes.row_address.saturating_sub(min_row)) as usize; let col = (cell.cell_attributes.col_address.saturating_sub(min_col)) as usize; if row < row_count && col < col_count { fill_cell_content( &mut grid, cell, row, col, row_count, col_count, document, options, tracker, ); } } } // 마크다운 표 형식으로 변환 / Convert to markdown table format let mut lines = Vec::new(); lines.push(String::new()); // 빈 줄 추가 / Add empty line // 모든 행을 순서대로 출력 / Output all rows in order for row_idx in 0..row_count { let row_data: Vec<String> = (0..col_count) .map(|col| { grid[row_idx][col] .as_ref() .map(|s| s.clone()) .unwrap_or_else(|| " ".to_string()) }) .collect(); lines.push(format!("| {} |", row_data.join(" | "))); // 첫 번째 행 다음에 구분선 추가 / Add separator line after first row if row_idx == 0 { lines.push(format!( "|{}|", (0..col_count).map(|_| "---").collect::<Vec<_>>().join("|") )); } } lines.push(String::new()); // 빈 줄 추가 / Add empty line lines.join("\n") } /// Fill cell content and handle cell merging /// 셀 내용을 채우고 셀 병합을 처리 fn fill_cell_content( grid: &mut [Vec<Option<String>>], cell: &crate::document::bodytext::TableCell, row: usize, col: usize, row_count: usize, col_count: usize, document: &HwpDocument, options: &crate::viewer::markdown::MarkdownOptions, tracker: &mut crate::viewer::markdown::utils::OutlineNumberTracker, ) { // 셀 내용을 텍스트와 이미지로 변환 / Convert cell content to text and images let mut cell_parts = Vec::new(); let mut has_image = false; // 먼저 이미지가 있는지 확인 / First check if image exists for para in &cell.paragraphs { for rec in &para.records { if matches!(rec, ParagraphRecord::ShapeComponentPicture { .. }) { has_image = true; break; } } if has_image { break; } } // 셀 내부의 문단들을 마크다운으로 변환 / Convert paragraphs inside cell to markdown for (idx, para) in cell.paragraphs.iter().enumerate() { // 테이블 셀 내부에서는 PARA_BREAK를 직접 처리해야 함 // In table cells, we need to handle PARA_BREAK directly // 문단 내의 모든 ParaText 레코드를 먼저 수집하여 함께 처리 // First collect all ParaText records in the paragraph to process together let mut para_text_records = Vec::new(); let mut has_non_text_records = false; for record in &para.records { match record { ParagraphRecord::ParaText { text, control_char_positions, .. } => { para_text_records.push((text, control_char_positions)); } _ => { has_non_text_records = true; } } } // ParaText 레코드가 있으면 직접 처리 / If ParaText records exist, process directly if !para_text_records.is_empty() { let mut para_text_result = String::new(); for (text, control_char_positions) in para_text_records { // PARA_BREAK나 LINE_BREAK를 직접 처리 / Handle PARA_BREAK or LINE_BREAK directly let has_breaks = control_char_positions.iter().any(|pos| { use crate::document::bodytext::ControlChar; pos.code == ControlChar::PARA_BREAK || pos.code == ControlChar::LINE_BREAK }); if !has_breaks { // 제어 문자가 없으면 텍스트만 추가 / If no control characters, just add text para_text_result.push_str(text); continue; } let mut last_char_pos = 0; // control_positions를 정렬하여 순서대로 처리 / Sort control_positions to process in order let mut sorted_positions: Vec<_> = control_char_positions .iter() .filter(|pos| { use crate::document::bodytext::ControlChar; pos.code == ControlChar::PARA_BREAK || pos.code == ControlChar::LINE_BREAK }) .collect(); sorted_positions.sort_by_key(|pos| pos.position); for pos in sorted_positions { // position은 문자 인덱스이므로, 그 위치까지의 텍스트를 문자 단위로 추가 // position is character index, so add text up to that position by character let text_len = text.chars().count(); if pos.position > last_char_pos && pos.position <= text_len { // 문자 단위로 텍스트 추출 / Extract text by character let text_before: String = text .chars() .skip(last_char_pos) .take(pos.position - last_char_pos) .collect(); // trim() 없이 그대로 추가 (정확한 위치 유지) / Add as-is without trim (maintain exact position) para_text_result.push_str(&text_before); } // PARA_BREAK나 LINE_BREAK 위치에 <br> 추가 / Add <br> at PARA_BREAK or LINE_BREAK position if options.use_html == Some(true) { para_text_result.push_str("<br>"); } else { para_text_result.push(' '); } // 제어 문자 다음 위치 / Position after control character // position이 텍스트 끝이면 더 이상 텍스트가 없으므로 text_len으로 설정 // If position is at end of text, set to text_len as there's no more text last_char_pos = if pos.position >= text_len { text_len } else { pos.position + 1 }; } // 마지막 부분의 텍스트 추가 (last_char_pos가 텍스트 길이보다 작을 때만) // Add remaining text (only if last_char_pos is less than text length) let text_len = text.chars().count(); if last_char_pos < text_len { let text_after: String = text.chars().skip(last_char_pos).collect(); // trim() 없이 그대로 추가 / Add as-is without trim para_text_result.push_str(&text_after); } } if !para_text_result.trim().is_empty() { cell_parts.push(para_text_result); } } // ParaText가 아닌 레코드(이미지 등)가 있으면 직접 처리 // Process non-ParaText records (images, etc.) directly if they exist if has_non_text_records { for record in &para.records { match record { ParagraphRecord::ParaText { .. } => { // ParaText는 이미 처리했으므로 건너뜀 / Skip ParaText as it's already processed continue; } ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { // ShapeComponentPicture 변환 / Convert ShapeComponentPicture if let Some(image_md) = crate::viewer::markdown::document::bodytext::shape_component_picture::convert_shape_component_picture_to_markdown( shape_component_picture, document, options.image_output_dir.as_deref(), ) { cell_parts.push(image_md); has_image = true; } } ParagraphRecord::ShapeComponent { shape_component: _, children, } => { // SHAPE_COMPONENT의 children을 재귀적으로 처리 / Recursively process SHAPE_COMPONENT's children let shape_parts = crate::viewer::markdown::document::bodytext::shape_component::convert_shape_component_children_to_markdown( children, document, options.image_output_dir.as_deref(), tracker, ); for shape_part in shape_parts { if shape_part.contains("![이미지]") { has_image = true; } cell_parts.push(shape_part); } } _ => { // 기타 레코드는 서식 정보이므로 건너뜀 / Other records are formatting info, skip } } } } // 마지막 문단이 아니면 문단 사이 공백 추가 // If not last paragraph, add space between paragraphs if idx < cell.paragraphs.len() - 1 { cell_parts.push(" ".to_string()); } } // 셀 내용을 하나의 문자열로 결합 / Combine cell parts into a single string // 표 셀 내부에서는 개행을 공백으로 변환 (마크다운 표는 한 줄로 표시) // In table cells, convert line breaks to spaces (markdown tables are displayed in one line) let cell_text = cell_parts.join(""); // 마크다운 표에서 파이프 문자 이스케이프 처리 / Escape pipe characters in markdown table let cell_content = if cell_text.is_empty() { " ".to_string() // 빈 셀은 공백으로 표시 / Empty cell shows as space } else { cell_text.replace('|', "\\|") // 파이프 문자 이스케이프 / Escape pipe character }; // 셀에 이미 내용이 있으면 덮어쓰지 않음 (병합 셀 처리) // Don't overwrite if cell already has content (handle merged cells) if grid[row][col].is_none() { grid[row][col] = Some(cell_content); // 셀 병합 처리: col_span과 row_span에 따라 병합된 셀을 빈 셀로 채움 // Handle cell merging: fill merged cells with empty cells based on col_span and row_span let col_span = cell.cell_attributes.col_span as usize; let row_span = cell.cell_attributes.row_span as usize; // 병합된 열을 빈 셀로 채움 (마크다운에서는 병합을 직접 표현할 수 없으므로 빈 셀로 처리) // Fill merged columns with empty cells (markdown doesn't support cell merging directly) for c in (col + 1)..(col + col_span).min(col_count) { if grid[row][c].is_none() { grid[row][c] = Some(" ".to_string()); } } // 병합된 행을 빈 셀로 채움 // Fill merged rows with empty cells for r in (row + 1)..(row + row_span).min(row_count) { for c in col..(col + col_span).min(col_count) { if grid[r][c].is_none() { grid[r][c] = Some(" ".to_string()); } } } } }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/document/bodytext/shape_component_picture.rs
crates/hwp-core/src/viewer/markdown/document/bodytext/shape_component_picture.rs
/// ShapeComponentPicture conversion to Markdown /// ShapeComponentPicture를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 57 - 본문의 데이터 레코드, SHAPE_COMPONENT_PICTURE /// Spec mapping: Table 57 - BodyText data records, SHAPE_COMPONENT_PICTURE use crate::document::{bodytext::ShapeComponentPicture, HwpDocument}; use crate::viewer::markdown::common::format_image_markdown; /// Convert ShapeComponentPicture to markdown /// ShapeComponentPicture를 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `shape_component_picture` - 그림 개체 / Picture shape component /// * `document` - HWP 문서 / HWP document /// * `image_output_dir` - 이미지 출력 디렉토리 (선택) / Image output directory (optional) /// /// # Returns / 반환값 /// 마크다운 문자열 / Markdown string pub(crate) fn convert_shape_component_picture_to_markdown( shape_component_picture: &ShapeComponentPicture, document: &HwpDocument, image_output_dir: Option<&str>, ) -> Option<String> { // 그림 개체를 마크다운 이미지로 변환 / Convert picture shape component to markdown image let bindata_id = shape_component_picture.picture_info.bindata_id; // BinData에서 해당 이미지 찾기 / Find image in BinData if let Some(bin_item) = document .bin_data .items .iter() .find(|item| item.index == bindata_id) { let image_markdown = format_image_markdown(document, bindata_id, &bin_item.data, image_output_dir); if !image_markdown.is_empty() { return Some(image_markdown); } } None }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/document/bodytext/mod.rs
crates/hwp-core/src/viewer/markdown/document/bodytext/mod.rs
/// BodyText conversion to Markdown /// 본문 텍스트를 마크다운으로 변환하는 모듈 /// /// HWP 문서의 본문 텍스트(bodytext) 관련 레코드들을 마크다운으로 변환하는 모듈 /// Module for converting BodyText-related records in HWP documents to markdown mod list_header; mod para_text; pub mod paragraph; mod shape_component; pub mod shape_component_picture; pub mod table; use crate::document::{ColumnDivideType, HwpDocument, ParagraphRecord}; use crate::viewer::markdown::MarkdownOptions; pub use paragraph::convert_paragraph_to_markdown; pub use table::convert_table_to_markdown; /// Convert body text to markdown /// 본문 텍스트를 마크다운으로 변환 pub fn convert_bodytext_to_markdown( document: &HwpDocument, options: &MarkdownOptions, ) -> ( Vec<String>, // headers Vec<String>, // body_lines Vec<String>, // footers Vec<String>, // footnotes Vec<String>, // endnotes ) { // 머리말, 본문, 꼬리말, 각주, 미주를 분리하여 수집 / Collect headers, body, footers, footnotes, and endnotes separately let mut headers = Vec::new(); let mut body_lines = Vec::new(); let mut footers = Vec::new(); let mut footnotes = Vec::new(); let mut endnotes = Vec::new(); // 개요 번호 추적기 생성 / Create outline number tracker let mut outline_tracker = crate::viewer::markdown::utils::OutlineNumberTracker::new(); // Convert body text to markdown / 본문 텍스트를 마크다운으로 변환 for section in &document.body_text.sections { for paragraph in &section.paragraphs { // control_mask를 사용하여 빠른 필터링 (최적화) / Use control_mask for quick filtering (optimization) let control_mask = &paragraph.para_header.control_mask; // control_mask로 머리말/꼬리말/각주/미주가 있는지 빠르게 확인 / Quickly check if header/footer/footnote/endnote exists using control_mask // 주의: control_mask는 머리말/꼬리말을 구분하지 못하고, 각주/미주도 구분하지 못함 // Note: control_mask cannot distinguish header/footer or footnote/endnote let has_header_footer = control_mask.has_header_footer(); let has_footnote_endnote = control_mask.has_footnote_endnote(); // 머리말/꼬리말/각주/미주 컨트롤 처리 / Process header/footer/footnote/endnote controls // 하나의 문단에 여러 개의 컨트롤이 있을 수 있으므로 break 없이 모두 처리 // Multiple controls can exist in one paragraph, so process all without break // control_mask로 필터링하여 불필요한 순회 방지 / Filter with control_mask to avoid unnecessary iteration if has_header_footer || has_footnote_endnote { for record in &paragraph.records { if let ParagraphRecord::CtrlHeader { header, children, paragraphs: ctrl_paragraphs, } = record { use crate::document::CtrlId; if header.ctrl_id.as_str() == CtrlId::HEADER { // 머리말 문단 처리 / Process header paragraph // 파서에서 이미 ParaText를 제거하고, LIST_HEADER가 있으면 paragraphs는 비어있음 // Parser already removed ParaText, and if LIST_HEADER exists, paragraphs is empty // LIST_HEADER가 있으면 children에서 처리, 없으면 paragraphs에서 처리 // If LIST_HEADER exists, process from children, otherwise from paragraphs let mut found_list_header = false; for child_record in children { if let ParagraphRecord::ListHeader { paragraphs, .. } = child_record { found_list_header = true; // LIST_HEADER 내부의 문단 처리 / Process paragraphs inside LIST_HEADER for para in paragraphs { let para_md = paragraph::convert_paragraph_to_markdown( para, document, options, &mut outline_tracker, ); if !para_md.is_empty() { headers.push(para_md); } } } } // LIST_HEADER가 없으면 paragraphs 처리 (각주/미주 등) // If no LIST_HEADER, process paragraphs (for footnotes/endnotes, etc.) if !found_list_header { for para in ctrl_paragraphs { let para_md = paragraph::convert_paragraph_to_markdown( para, document, options, &mut outline_tracker, ); if !para_md.is_empty() { headers.push(para_md); } } } } else if header.ctrl_id.as_str() == CtrlId::FOOTER { // 꼬리말 문단 처리 / Process footer paragraph // 파서에서 이미 ParaText를 제거하고, LIST_HEADER가 있으면 paragraphs는 비어있음 // Parser already removed ParaText, and if LIST_HEADER exists, paragraphs is empty // LIST_HEADER가 있으면 children에서 처리, 없으면 paragraphs에서 처리 // If LIST_HEADER exists, process from children, otherwise from paragraphs let mut found_list_header = false; for child_record in children { if let ParagraphRecord::ListHeader { paragraphs, .. } = child_record { found_list_header = true; // LIST_HEADER 내부의 문단 처리 / Process paragraphs inside LIST_HEADER for para in paragraphs { let para_md = paragraph::convert_paragraph_to_markdown( para, document, options, &mut outline_tracker, ); if !para_md.is_empty() { footers.push(para_md); } } } } // LIST_HEADER가 없으면 paragraphs 처리 (각주/미주 등) // If no LIST_HEADER, process paragraphs (for footnotes/endnotes, etc.) if !found_list_header { for para in ctrl_paragraphs { let para_md = paragraph::convert_paragraph_to_markdown( para, document, options, &mut outline_tracker, ); if !para_md.is_empty() { footers.push(para_md); } } } } else if header.ctrl_id.as_str() == CtrlId::FOOTNOTE { // 각주 문단 처리 / Process footnote paragraph // hwplib 방식: LIST_HEADER는 문단 리스트 헤더 정보만 포함하고, // 실제 텍스트는 ParagraphList(paragraphs)에 있음 // hwplib approach: LIST_HEADER only contains paragraph list header info, // actual text is in ParagraphList (paragraphs) for para in ctrl_paragraphs { let para_md = paragraph::convert_paragraph_to_markdown( para, document, options, &mut outline_tracker, ); if !para_md.is_empty() { footnotes.push(para_md); } } // LIST_HEADER는 건너뜀 (자동 번호 템플릿, 실제 텍스트 아님) // Skip LIST_HEADER (auto-number template, not actual text) } else if header.ctrl_id.as_str() == CtrlId::ENDNOTE { // 미주 문단 처리 / Process endnote paragraph // hwplib 방식: LIST_HEADER는 문단 리스트 헤더 정보만 포함하고, // 실제 텍스트는 ParagraphList(paragraphs)에 있음 // hwplib approach: LIST_HEADER only contains paragraph list header info, // actual text is in ParagraphList (paragraphs) for para in ctrl_paragraphs { let para_md = paragraph::convert_paragraph_to_markdown( para, document, options, &mut outline_tracker, ); if !para_md.is_empty() { endnotes.push(para_md); } } // LIST_HEADER는 건너뜀 (자동 번호 템플릿, 실제 텍스트 아님) // Skip LIST_HEADER (auto-number template, not actual text) } } } } // 일반 본문 문단 처리 (컨트롤이 없는 경우) / Process regular body paragraph (when no controls) // control_mask로 일반 문단인지 확인 / Check if regular paragraph using control_mask if !has_header_footer && !has_footnote_endnote { // 일반 본문 문단 처리 / Process regular body paragraph // Check if we need to add page break / 페이지 나누기가 필요한지 확인 let has_page_break = paragraph .para_header .column_divide_type .iter() .any(|t| matches!(t, ColumnDivideType::Page | ColumnDivideType::Section)); if has_page_break && !body_lines.is_empty() { // Only add page break if we have content before / 이전에 내용이 있을 때만 페이지 구분선 추가 let last_line = body_lines.last().map(String::as_str).unwrap_or(""); if !last_line.is_empty() && last_line != "---" { body_lines.push("---".to_string()); body_lines.push(String::new()); } } // Convert paragraph to markdown (includes text and controls) / 문단을 마크다운으로 변환 (텍스트와 컨트롤 포함) let markdown = paragraph::convert_paragraph_to_markdown( paragraph, document, options, &mut outline_tracker, ); if !markdown.is_empty() { body_lines.push(markdown); } } } } (headers, body_lines, footers, footnotes, endnotes) }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false
ohah/hwpjs
https://github.com/ohah/hwpjs/blob/19df26a209c6e780b4c3b03d2ab628209e1ae311/crates/hwp-core/src/viewer/markdown/document/bodytext/shape_component.rs
crates/hwp-core/src/viewer/markdown/document/bodytext/shape_component.rs
/// ShapeComponent conversion to Markdown /// ShapeComponent를 마크다운으로 변환하는 모듈 /// /// 스펙 문서 매핑: 표 57 - 본문의 데이터 레코드, SHAPE_COMPONENT (HWPTAG_BEGIN + 60) /// Spec mapping: Table 57 - BodyText data records, SHAPE_COMPONENT (HWPTAG_BEGIN + 60) use crate::document::{HwpDocument, ParagraphRecord}; use crate::viewer::markdown::document::bodytext::shape_component_picture::convert_shape_component_picture_to_markdown; /// Convert ShapeComponent children to markdown /// ShapeComponent의 자식들을 마크다운으로 변환 /// /// # Arguments / 매개변수 /// * `children` - ShapeComponent의 자식 레코드들 / Child records of ShapeComponent /// * `document` - HWP 문서 / HWP document /// * `image_output_dir` - 이미지 출력 디렉토리 (선택) / Image output directory (optional) /// * `tracker` - 개요 번호 추적기 / Outline number tracker /// /// # Returns / 반환값 /// 마크다운 문자열 리스트 / List of markdown strings pub(crate) fn convert_shape_component_children_to_markdown( children: &[ParagraphRecord], document: &HwpDocument, image_output_dir: Option<&str>, tracker: &mut crate::viewer::markdown::utils::OutlineNumberTracker, ) -> Vec<String> { use crate::viewer::markdown::document::bodytext::paragraph::convert_paragraph_to_markdown; use crate::viewer::markdown::MarkdownOptions; let mut parts = Vec::new(); let options = MarkdownOptions { image_output_dir: image_output_dir.map(|s| s.to_string()), use_html: None, include_version: None, include_page_info: None, }; // SHAPE_COMPONENT의 children을 재귀적으로 처리 / Recursively process SHAPE_COMPONENT's children // SHAPE_COMPONENT_PICTURE는 SHAPE_COMPONENT의 자식으로 올 수 있음 // SHAPE_COMPONENT_PICTURE can be a child of SHAPE_COMPONENT // LIST_HEADER는 글상자 텍스트를 포함할 수 있음 (SHAPE_COMPONENT 내부의 글상자) // LIST_HEADER can contain textbox text (textbox inside SHAPE_COMPONENT) for child in children { match child { ParagraphRecord::ShapeComponentPicture { shape_component_picture, } => { // 그림 개체를 마크다운 이미지로 변환 / Convert picture shape component to markdown image if let Some(image_md) = convert_shape_component_picture_to_markdown( shape_component_picture, document, image_output_dir, ) { parts.push(image_md); } } ParagraphRecord::ListHeader { paragraphs, .. } => { // LIST_HEADER의 paragraphs 처리 (글상자 텍스트) / Process LIST_HEADER's paragraphs (textbox text) // SHAPE_COMPONENT 내부의 LIST_HEADER는 글상자 텍스트를 포함할 수 있음 // LIST_HEADER inside SHAPE_COMPONENT can contain textbox text for para in paragraphs { let para_md = convert_paragraph_to_markdown(para, document, &options, tracker); if !para_md.is_empty() { parts.push(para_md); } } } _ => { // 기타 children은 무시 / Ignore other children } } } parts }
rust
MIT
19df26a209c6e780b4c3b03d2ab628209e1ae311
2026-01-04T20:24:59.575438Z
false