text
string
size
int64
token_count
int64
import connexion import six import flask import copy import os import base64 import time from mcenter_server_api.models.inline_response200 import InlineResponse200 # noqa: E501 from mcenter_server_api.models.inline_response2001 import InlineResponse2001 # noqa: E501 from mcenter_server_api.models.user import User # noqa: E501 from mcenter_server_api import util from . import base users = dict(AdminID=dict(username='admin', password='admin', createdBy='admin', created=0, id='AdminID')) def _cleanuser(u): u = copy.copy(u) del u['password'] return u def _finduserbyname(username): for u in users.values(): if u['username'] == username: return u return None def _finduser(userId): if userId in users: return users[userId] flask.abort(404) def auth_login_post(body): # noqa: E501 """Authenticate user # noqa: E501 :param user: username and password fields for authentication :type user: dict | bytes :rtype: InlineResponse200 """ u = _finduserbyname(body['username']) if u is None: flask.abort(403) if u['password'] != body['password']: flask.abort(403) return dict(token=base.add_session(u)) def auth_validate_post(body): # noqa: E501 """Register an user # noqa: E501 :param authorization: Bearer Token :type authorization: str :rtype: InlineResponse2001 """ return 'do some magic!' def me_get(): # noqa: E501 """Get user detail of current user # noqa: E501 :rtype: User """ s = base.check_session() return _cleanuser(s['user']) def users_get(): # noqa: E501 """Get list of users # noqa: E501 :rtype: List[User] """ base.check_session() ret = [] for u in users.values(): ret.append(_cleanuser(u)) return ret def users_post(body): # noqa: E501 """Create a new user # noqa: E501 :param user: User detail description :type user: dict | bytes :rtype: User """ s = base.check_session() if _finduserbyname(body['username']) is not None: flask.abort(500) if not body['password']: flask.abort(500) base.finish_creation(body, s, users) return _cleanuser(body) def users_user_id_delete(userId): # noqa: E501 """Deregister an user # noqa: E501 :param user_id: User identifier :type user_id: str :rtype: None """ s = base.check_session() u = _finduser(userId) k = u['username'] if k == s['user']['username']: flask.abort(500) del users[userId] def users_user_id_get(userId): # noqa: E501 """List details of specific user # noqa: E501 :param user_id: User identifier :type user_id: str :rtype: User """ base.check_session() return _cleanuser(_finduser(userId)) def users_user_id_put(userId, body): # noqa: E501 """Update user information # noqa: E501 :param user_id: User identifier :type user_id: str :param user: Update user object :type user: dict | bytes :rtype: User """ base.check_session() u = _finduser(userId) for k, v in body.items(): if k not in ['id', 'created', 'createdBy'] and v is not None: u[k] = v return _cleanuser(u)
3,336
1,197
from .DashReactJsonSchemaForm import DashReactJsonSchemaForm __all__ = [ "DashReactJsonSchemaForm" ]
105
38
from functools import reduce import numpy as np from sparse import SparseTensor def reduce_prod(seq): return reduce(lambda item_1, item_2: item_1 * item_2, seq) class Polynomial: def __init__(self, coeff, indices, merge=True): """\\sum_{i=0}^{N-1} coeff[i] \\Pi_{j=0}^{NV-1} x_j^{indices[i, j]}""" self.degree = np.max(np.sum(indices, axis=-1)) self.n_elements = indices.shape[-1] if merge: self.coeff, self.indices = SparseTensor.merge(coeff, indices) else: self.coeff, self.indices = coeff, indices def __call__(self, x): coeff = np.reshape(self.coeff, newshape=(1, -1)) x = np.reshape(x, newshape=(-1, 1, self.n_elements)) indices = np.reshape(self.indices, newshape=(1, -1, self.n_elements)) return np.sum(coeff * np.prod(np.power(x, indices), axis=2), axis=1) def __str__(self): return '\n'.join(["{:.2f}\t{}".format(c, index) for c, index in zip(self.coeff, self.indices)]) def __neg__(self): return Polynomial(-self.coeff, self.indices, merge=False) def __add__(self, other): if type(other).__name__ in ["bool", "int", "float", "int64", "float64"]: other = Polynomial(np.array([other, ]), np.zeros(shape=(1, self.n_elements), dtype=self.indices.dtype), merge=False) return self.__add__(other) elif isinstance(other, Polynomial): assert self.n_elements == other.n_elements return Polynomial(np.hstack([self.coeff, other.coeff]), np.vstack([self.indices, other.indices]), merge=True) else: raise ValueError def __sub__(self, other): return self.__add__(other.__neg__()) def __mul__(self, other): if type(other).__name__ in ["bool", "int", "float", "int64", "float64"]: return Polynomial(self.coeff * other, self.indices, merge=False) elif isinstance(other, Polynomial): assert self.n_elements == other.n_elements coeff = np.expand_dims(self.coeff, axis=0) * np.expand_dims(other.coeff, axis=1) coeff = coeff.flatten() indices = np.expand_dims(self.indices, axis=0) + np.expand_dims(other.indices, axis=1) indices = np.reshape(indices, newshape=(-1, self.n_elements)) return Polynomial(coeff, indices, merge=True) else: raise ValueError def derivative(self, order=1): """ +----------+-----------------+--------------+ | item | data type | shape | +----------+-----------------+--------------+ | order | int | [] | | return | PolynomialArray | [ND] * order | +----------+-----------------+--------------+ """ array = [self] for _ in range(order): collection = [] for poly in array: for i in range(self.indices.shape[1]): coeff = poly.coeff * poly.indices[:, i] indices = np.maximum(poly.indices - np.eye(poly.n_elements, dtype=poly.indices.dtype)[[i], :], 0) collection.append(Polynomial(coeff, indices, merge=True)) array = collection return PolynomialArray(array, shape=[self.indices.shape[1]] * order) def directional_derivative(self, c, order=1): """ +----------+---------------+--------------+ | item | data type | shape | +----------+---------------+--------------+ | order | numpy.ndarray | [ND] * order | | order | int | [] | | return | Polynomial | [ND] * order | +----------+---------------+--------------+ return: \\sum_{ij...} c_{ij...} \\frac{\\partial^ self}{\partial \lambda_i \partial \lambda_j ...} """ coeff = self.coeff indices = self.indices dim = self.n_elements for axis in range(order): coeff = np.expand_dims(coeff, axis=0) * np.transpose(indices, axes=[-1] + list(range(axis+1))) indices = np.expand_dims(indices, axis=0) - np.expand_dims(np.eye(dim, dtype=np.int), axis=list(range(1, axis + 2))) indices = np.maximum(indices, 0) coeff = (np.expand_dims(c, axis=-1) * coeff).flatten() indices = np.reshape(indices, newshape=(-1, dim)) return Polynomial(coeff, indices, merge=True) class PolynomialArray: def __init__(self, array, shape): self.array, self.shape = array, list(shape) def reshape(self, shape): shape = list(shape) for axis in range(shape.__len__()): if shape[axis] == -1: shape[axis] = -reduce_prod(self.shape) // reduce_prod(shape) break return PolynomialArray(self.array, shape) def transpose(self, axes): transpose_indices = np.transpose(np.reshape(np.arange(self.array.__len__()), newshape=self.shape), axes=axes) array = [self.array[index] for index in transpose_indices.flatten()] shape = [self.shape[axis] for axis in axes] return PolynomialArray(array, shape) def sum(self, axis, keep_dim=False): axes = [axis] + [ax for ax in range(self.shape.__len__()) if ax != axis] transpose_array = self.transpose(axes) result = reduce(lambda u, v: u + v, [transpose_array[k] for k in range(transpose_array.shape[0])]) if keep_dim: result.shape.insert(axis, 1) return result def __call__(self, x): return np.reshape(np.stack([poly(x) for poly in self.array], axis=1), newshape=[-1] + self.shape) def __getitem__(self, item): valid_indices = np.reshape(np.arange(self.array.__len__()), newshape=self.shape)[item] array = [self.array[index] for index in valid_indices.flatten()] shape = valid_indices.shape return array[0] if shape == () else PolynomialArray(array, shape) def __eq__(self, other): return (self.shape == other.shape) and sum([sp != op for sp, op in zip(self.array, other.array)]) == 0 def __neg__(self): return PolynomialArray([-array for array in self.array], self.shape) def __add__(self, other): # TODO: in large scale calculation, this operator works slowly in serial mode. if type(other).__name__ in ["bool", "int", "float", "Polynomial"]: array = PolynomialArray([sa + other for sa in self.array], self.shape) return array.reshape(self.shape) elif isinstance(other, np.ndarray): n_elements, dtype = self.array[0].n_elements, self.array[0].indices.dtype arr = [Polynomial(np.array([item, ]), np.zeros(shape=(1, n_elements), dtype=dtype)) for item in other.flatten()] return self.__add__(PolynomialArray(arr, shape=other.shape)) elif isinstance(other, PolynomialArray): self_indices = np.reshape(np.arange(np.prod(self.shape)), self.shape) o_indices = np.reshape(np.arange(np.prod(other.shape)), other.shape) self_indices, o_indices = self_indices + np.zeros_like(o_indices), o_indices + np.zeros_like(self_indices) array = [self.array[si] + other.array[oi] for si, oi in zip(self_indices.flatten(), o_indices.flatten())] return PolynomialArray(array, shape=self_indices.shape) else: raise ValueError def __sub__(self, other): return self.__add__(other.__neg__()) def __mul__(self, other): # TODO: in large scale calculation, this operator works slowly in serial mode. if type(other).__name__ in ["bool", "int", "float", "Polynomial"]: array = PolynomialArray([sa * other for sa in self.array], self.shape) return array.reshape(self.shape) elif isinstance(other, np.ndarray): n_elements, dtype = self.array[0].n_elements, self.array[0].indices.dtype arr = [Polynomial(np.array([item, ]), np.zeros(shape=(1, n_elements), dtype=dtype)) for item in other.flatten()] return self.__mul__(PolynomialArray(arr, shape=other.shape)) elif isinstance(other, PolynomialArray): self_indices = np.reshape(np.arange(np.prod(self.shape)), self.shape) o_indices = np.reshape(np.arange(np.prod(other.shape)), other.shape) self_indices, o_indices = self_indices + np.zeros_like(o_indices), o_indices + np.zeros_like(self_indices) array = [self.array[si] * other.array[oi] for si, oi in zip(self_indices.flatten(), o_indices.flatten())] return PolynomialArray(array, shape=self_indices.shape) else: raise ValueError @classmethod def stack(cls, arrays, axis): axis %= arrays[0].shape.__len__() + 1 array = sum([item.array for item in arrays], []) shape = [arrays.__len__()] + list(arrays[0].shape) axes = [i for i in range(shape.__len__()) if i != axis] axes.insert(axis, 0) return PolynomialArray(array, shape).transpose(axes) @classmethod def concat(cls, arrays, axis): axes = [axis] + [i for i in range(arrays[0].shape.__len__()) if i != axis] shape = [-1] + [dim for i, dim in enumerate(arrays[0].shape) if i != axis] arrays = sum([cls.transpose(array, axes).array for array in arrays], []) arrays = cls(arrays, shape=(arrays.__len__(), )) arrays = arrays.reshape(shape) axes = list(range(1, shape.__len__())) axes.insert(axis, 0) return arrays.transpose(axes) def derivative(self, order=1): """ +----------+-----------------+---------------------------+ | item | data type | shape | +----------+-----------------+---------------------------+ | order | int | [] | | return | PolynomialArray | self.shape + [ND] * order | +----------+-----------------+---------------------------+ """ array = PolynomialArray.stack([poly.derivative(order) for poly in self.array], axis=0) return array.reshape(self.shape + array.shape[1:]) def directional_derivative(self, c, order=1): """ +----------+-----------------+---------------------------+ | item | data type | shape | +----------+-----------------+---------------------------+ | c | numpy.ndarray | self.shape + [ND] * order | | order | int | [] | | return | numpy.ndarray | self.shape | +----------+-----------------+---------------------------+ return: \\sum_{ij...} c_{ij...}^{uv...} \\frac{\\partial^ self_{uv...}}{\partial \lambda_i \partial \lambda_j ...} """ ni = max([p.coeff.__len__() for p in self.array]) dim = self.array[0].n_elements coeff = [np.concatenate([p.coeff, np.zeros(shape=(ni - p.coeff.__len__(), ))], axis=0) for p in self.array] coeff = np.stack(coeff, axis=1) # shape = [NI, ?] indices = [np.concatenate([p.indices, np.zeros(shape=(ni - p.coeff.__len__(), dim), dtype=np.int)], axis=0) for p in self.array] indices = np.stack(indices, axis=2) # shape = [NI, ND, ?] for axis in range(order): axes = [axis + 1] + [i for i in range(axis + 3) if i != axis + 1] coeff = np.expand_dims(coeff, axis=0) * np.transpose(indices, axes=axes) axes = list(range(1, axis + 2)) + [axis + 3] indices = np.expand_dims(indices, axis=0) - np.expand_dims(np.eye(dim, dtype=np.int), axis=axes) indices = np.maximum(indices, 0) c = np.reshape(c, newshape=[-1, 1] + [dim] * order) c = np.transpose(c, axes=list(range(2, order + 2)) + [1, 0]) # shape = [ND] * order + [1] + [?] coeff = np.reshape((c * coeff), newshape=(dim ** order * ni, -1)) # shape = [ND] * order + [NI] + [?] indices = np.reshape(indices, newshape=(dim ** order * ni, dim, -1)) # shape = [ND] * order + [NI] + [ND] + [?] return PolynomialArray([Polynomial(coeff[:, i], indices[:, :, i], merge=True) for i in range(coeff.shape[-1])], shape=self.shape) def integral(self, dim, determinant): """ Working correctly in triangulation grid only! \Pi_i \alpha_i! \int_K \Pi_i \lambda_i^{\alpha_i} dx = ------------------------ * determinant (dim + \Sum_i \alpha_i)! """ ni = max([p.coeff.__len__() for p in self.array]) nd = self.array[0].n_elements coeff = [np.concatenate([p.coeff, np.zeros(shape=(ni - p.coeff.__len__(), ))], axis=0) for p in self.array] coeff = np.stack(coeff, axis=1) # shape = [NI, ?] indices = [np.concatenate([p.indices, np.zeros(shape=(ni - p.coeff.__len__(), nd), dtype=np.int)], axis=0) for p in self.array] indices = np.stack(indices, axis=2) # shape = [NI, ND, ?] degree = np.max(indices) if degree == 0: numerator = np.ones_like(indices) # shape = [NI, ND, ?] else: numerator = reduce_prod([np.maximum(indices - i, 1) for i in range(degree)]) # shape = [NI, ND, ?] numerator = np.prod(numerator, axis=1) # shape = [NI, ?] denominator = np.sum(indices, axis=1) + dim # shape = [NI, ?] denominator = reduce_prod([np.maximum(denominator - i, 1) for i in range(degree + dim)]) # shape = [NI, ?] return np.reshape(np.sum(coeff * numerator / denominator, axis=0), newshape=self.shape) * determinant def unit_test(): np.set_printoptions(precision=2) x = np.random.rand(4, 3) const_array = np.random.rand(8, 7) # item 6, degree 2, elements 3 poly = Polynomial(coeff=np.random.rand(6), indices=np.random.randint(0, 3, size=(6, 3))) polys_1 = [Polynomial(coeff=np.random.rand(5), indices=np.random.randint(0, 5, size=(5, 3))) for _ in range(56)] polys_1 = PolynomialArray(polys_1, [8, 7]) polys_2 = [Polynomial(coeff=np.random.rand(4), indices=np.random.randint(0, 5, size=(4, 3))) for i in range(56)] polys_2 = PolynomialArray(polys_2, [8, 7]) polys_3 = [Polynomial(coeff=np.random.rand(3), indices=np.random.randint(0, 5, size=(3, 3))) for i in range(7*8*9)] polys_3 = PolynomialArray(polys_3, [9, 8, 7]) # four fundamental rules print("polys_1(x) + np.pi - (polys_1 + np.pi)(x):") print(np.max(np.abs(polys_1(x) + np.pi - (polys_1 + np.pi)(x)))) print("polys_1(x) + poly(x) - (polys_1 + poly)(x):") print(np.max(np.abs(polys_1(x) + np.reshape(poly(x), (-1, 1, 1)) - (polys_1 + poly)(x)))) print("polys_1(x) + np.expand_dims(const_array, axis=0) - (polys_1 + const_array)(x):") print(np.max(np.abs(polys_1(x) + np.expand_dims(const_array, axis=0) - (polys_1 + const_array)(x)))) print("polys_1(x) + polys_2(x) - (polys_1 + polys_2)(x):") print(np.max(np.abs(polys_1(x) + polys_2(x) - (polys_1 + polys_2)(x)))) print("polys_1[:, [1]](x) + polys_2[[-1], :](x) - (polys_1[:, [1]] + polys_2[[-1], :])(x):") print(np.max(np.abs(polys_1[:, [1]](x) + polys_2[[-1], :](x) - (polys_1[:, [1]] + polys_2[[-1], :])(x)))) print("polys_1(x) - np.pi - (polys_1 - np.pi)(x):") print(np.max(np.abs(polys_1(x) - np.pi - (polys_1 - np.pi)(x)))) print("polys_1(x) - poly(x) - (polys_1 - poly)(x):") print(np.max(np.abs(polys_1(x) - np.reshape(poly(x), (-1, 1, 1)) - (polys_1 - poly)(x)))) print("polys_1(x) - np.expand_dims(const_array, axis=0) - (polys_1 - const_array)(x):") print(np.max(np.abs(polys_1(x) - np.expand_dims(const_array, axis=0) - (polys_1 - const_array)(x)))) print("polys_1(x) - polys_2(x) - (polys_1 - polys_2)(x):") print(np.max(np.abs(polys_1(x) - polys_2(x) - (polys_1 - polys_2)(x)))) print("polys_1[:, [1]](x) - polys_2[[-1], :](x) - (polys_1[:, [1]] - polys_2[[-1], :])(x):") print(np.max(np.abs(polys_1[:, [1]](x) - polys_2[[-1], :](x) - (polys_1[:, [1]] - polys_2[[-1], :])(x)))) print("polys_1(x) * np.pi - (polys_1 * np.pi)(x):") print(np.max(np.abs(polys_1(x) * np.pi - (polys_1 * np.pi)(x)))) print("polys_1(x) * poly(x) - (polys_1 * poly)(x):") print(np.max(np.abs(polys_1(x) * np.reshape(poly(x), (-1, 1, 1)) - (polys_1 * poly)(x)))) print("polys_1(x) * np.expand_dims(const_array, axis=0) - (polys_1 * const_array)(x):") print(np.max(np.abs(polys_1(x) * np.expand_dims(const_array, axis=0) - (polys_1 * const_array)(x)))) print("polys_1(x) * polys_2(x) - (polys_1 * polys_2)(x):") print(np.max(np.abs(polys_1(x) * polys_2(x) - (polys_1 * polys_2)(x)))) print("polys_1[:, [1]](x) * polys_2[[-1], :](x) - (polys_1[:, [1]] * polys_2[[-1], :])(x):") print(np.max(np.abs(polys_1[:, [1]](x) * polys_2[[-1], :](x) - (polys_1[:, [1]] * polys_2[[-1], :])(x)))) print(np.max(np.abs(polys_1.reshape(shape=[2, 4, 7])(x) - np.reshape(polys_1(x), newshape=(-1, 2, 4, 7))))) # check concat print("PolynomialArray.concat([polys_1, polys_2], axis=1)(x) - np.concatenate([polys_1(x), polys_2(x)], axis=1):") print(np.max(np.abs(PolynomialArray.concat([polys_1, polys_2], axis=1)(x) - np.concatenate([polys_1(x), polys_2(x)], axis=2)))) # check sum print(np.max(np.abs(polys_3.sum(axis=0, keep_dim=True)(x) - np.sum(polys_3(x), axis=0 + 1, keepdims=True)))) print(np.max(np.abs(polys_3.sum(axis=1, keep_dim=True)(x) - np.sum(polys_3(x), axis=1 + 1, keepdims=True)))) print(np.max(np.abs(polys_3.sum(axis=2, keep_dim=True)(x) - np.sum(polys_3(x), axis=2 + 1, keepdims=True)))) # check integral poly_1 = Polynomial( coeff=np.array([ 1, 3, ]), indices=np.array([ [1, 2, 3, 4], [1, 1, 1, 1], ]) ) poly_2 = Polynomial( coeff=np.array([ 2, 4, ]), indices=np.array([ [4, 3, 2, 1], [0, 0, 0, 0], ]) ) poly = PolynomialArray(array=[poly_1, poly_2], shape=(2, )) ans_1 = 0.5 * 1 * (1 * 2 * 6 * 24) / reduce_prod(list(range(1, 14))) ans_1 += 0.5 * 3 * (1 * 1 * 1 * 1) / reduce_prod(list(range(1, 8))) ans_2 = 2 * 2 * (1 * 2 * 6 * 24) / reduce_prod(list(range(1, 14))) ans_2 += 2 * 4 * (1 * 1 * 1 * 1) / reduce_prod(list(range(1, 4))) print(poly.integral(dim=3, determinant=np.array([0.5, 2])) - np.array([ans_1, ans_2])) # check derivative poly = poly.derivative(order=1) print(poly[0, 1]) # check derivative in Polynomial c = np.random.rand(3, 3) coeff = np.random.randint(100, size=(4, )) / 100 indices = np.random.randint(10, size=(4, 3)) poly = Polynomial(coeff, indices) type_1 = (poly.derivative(order=2) * c).sum(axis=0).sum(axis=0) type_2 = poly.directional_derivative(c, order=2) error = type_1 - type_2 error = Polynomial(error.coeff, error.indices, merge=True) print("error:", error) # check derivative in PolynomialArray poly = PolynomialArray([poly, poly+1, poly-1, poly*2], shape=(2, 2)) c = np.random.rand(2, 2, 3, 3) type_1 = (poly.derivative(order=2) * c).sum(axis=2).sum(axis=2) type_2 = poly.directional_derivative(c, order=2) for item in (type_1 - type_2).array: item = Polynomial(item.coeff, item.indices, merge=True) print("error:", item) if __name__ == "__main__": unit_test()
19,471
7,142
"""The poll management text.""" from .poll import get_poll_text def get_poll_management_text(session, poll, show_warning=False): """Create the management interface for a poll.""" poll_text = get_poll_text(session, poll, show_warning) return poll_text
266
84
# Generated by Django 2.2.3 on 2020-04-16 12:13 from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('programming', '0008_auto_20200415_1406'), ] operations = [ migrations.AlterModelOptions( name='badge', options={'ordering': ['badge_tier']}, ), ]
354
134
import csv a = [[1,2,3], [4,5,6]] with open('test.csv', 'w', newline='') as testfile: csvwriter = csv.writer(testfile) for row in a: csvwriter.writerow(row) with open('test.csv', 'r') as testfile: csvreader = csv.reader(testfile) for row in csvreader: print(row)
273
113
''' Faça um programa que leia o nome completo de uma pessoa, mostrando em seguida o primeiro e o último nome separadamente. Ex.: Ana Maria de Souza primeiro = Ana último = Souza ''' n = str(input('Digite seu nome completo: ')).strip() nome = n.split() # split particiona e cria uma lista começando no indice 0 print('Muito prazer em te conhecer!') print('Seu primeiro nome é {}'.format(nome[0])) print('Seu segundo nome é {}'.format(nome[1])) # indice 1 pega o segundo nome print('Seu último nome é {}'.format(nome[len(nome)-1]))
543
185
from django import forms from django.contrib.auth.forms import ( UserCreationForm, SetPasswordForm, ) from hknweb.models import User, Profile class SettingsForm(forms.ModelForm): class Meta: model = User fields = ("username", "email", "first_name", "last_name", "password") class ProfileForm(forms.ModelForm): class Meta: model = Profile fields = ( "picture", "private", "phone_number", "date_of_birth", "resume", "graduation_date", "candidate_semester", ) class SignupForm(UserCreationForm): first_name = forms.CharField(max_length=30, required=True) last_name = forms.CharField(max_length=30, required=True) email = forms.EmailField(max_length=200, required=True) def clean_email(self): email = self.cleaned_data.get("email") if (email is None) or not email.endswith("berkeley.edu"): raise forms.ValidationError( "Please a berkeley.edu email to register!", code="invalid" ) else: return email class Meta: model = User fields = ( "first_name", "last_name", "username", "email", "password1", "password2", ) class UpdatePasswordForm(SetPasswordForm): new_password1 = forms.CharField( max_length=30, label="New password", widget=forms.PasswordInput ) new_password1.help_text = "" class ValidPasswordForm(forms.ModelForm): password = forms.CharField(widget=forms.PasswordInput()) class Meta: model = User fields = ("password",)
1,715
490
#!/usr/bin/env python # -*- coding: utf-8 -*- """Postfix mail log parser and filter. This script filters and parses Postfix logs based on provided filter parameters. Example: To use this script type 'python pfstats.py -h'. Below is an example that filteres postfix log file (even gziped) based on date, sender of the email and email status:: $ python pfstats.py -d 'Jul 26' -t 'bounced' -s 'info@altinukshini.com' Todo: * Filter and parse logs from a year ago * Add receiver filter * Maybe provide from-to date filtering option """ __author__ = "Altin Ukshini" __copyright__ = "Copyright (c) 2017, Altin Ukshini" __license__ = "MIT License" __version__ = "1.0" __maintainer__ = "Altin Ukshini" __email__ = "altin.ukshini@gmail.com" __status__ = "Production" import re import os import sys import gzip import time import argparse import datetime from random import randint from argparse import RawTextHelpFormatter from collections import defaultdict ######################################################## # Config ######################################################## default_log_file = r'/var/log/postfix/mail.log' default_log_dir = r'/var/log/postfix/' # Must end with slash '/' ######################################################## # Predefined variables ######################################################## sender_lines = [] status_lines = [] status_lines_by_type = {'bounced' : [], 'deferred' : [], 'sent' : [], 'rejected' : []} status_types = ['bounced', 'deferred', 'sent', 'rejected'] file_random_no = randint(100000, 999990) generated_results = defaultdict(dict) working_dir = os.getcwd() + '/' start_time = time.time() ### All this formatting bcs of postfix date format :) date = datetime.datetime.now() date_today_year = date.strftime("%Y") date_today_month = date.strftime("%b") date_today_day = date.strftime("%d").lstrip('0') date_today = date_today_month + " " + date_today_day if int(date_today_day) < 10: date_today = date_today_month + " " + date_today_day ######################################################## # Functions ######################################################## def get_receiver(line): """Return a string Filter line and get the email receiver to=<>. """ receiver = re.search('(?<=to=<).*?(?=>)', line) return receiver.group() def get_sender(line): """Return a string Filter line and get the email sender from=<>. """ sender = re.search('(?<=from=<).*?(?=>)', line) return sender.group() def get_email_subject(line): """Return a string Filter line and get the email subject Subject:. """ subject = re.search('(?<=Subject: ).*?(?=\sfrom)', line) return subject.group() def get_email_status(line): """Return a string Filter line and get the email status (sent, bounced, deferred, rejected). """ status = re.search('(?<=status=).*?(?=\s)', line) return status.group() def get_host_message(line, status): """Return a string Filter line and get the host message located after status. """ message = re.search('status=' + status + ' (.*)', line) return message.group(1) def get_message_id(line): """Return a string Filter line and get the email/message id. """ return line.split()[5].replace(":","") def get_line_date(line): """Return a string Filter line and get the email date (beginning of the line). """ return line.split()[0] + " " + str(line.split()[1]) def check_sender_line(line): """Return a boolean Check if line contains specific words to validate if that's the line we want. """ return 'cleanup' in line and 'from=' in line and 'Subject' in line def filter_line_sender_subject(line): """Return void Filter line based on sender and subject message and append it to predefined dicts. """ global args, sender_lines if args.sender is not None and args.message is not None: if args.sender in line and args.message in line: sender_lines.append(line) elif args.sender is not None and args.message is None: if args.sender in line: sender_lines.append(line) elif args.message is not None and args.sender is None: if args.message in line: sender_lines.append(line) else: sender_lines.append(line) def filter_line(line): """Return void Filter line based on check_sender_line() and email status type and append to corresponding predefined dicts """ global sender_lines, status_lines, status_lines_by_type, status_types if check_sender_line(line): filter_line_sender_subject(line) elif args.type in status_types: if str('status='+args.type) in line and 'to=' in line and 'dsn=' in line: status_lines.append(line) else: if 'status=' in line and 'to=' in line and 'dsn=' in line : line_email_status = get_email_status(line) if line_email_status in status_types: status_lines_by_type[line_email_status].append(line) def check_if_gz(file_name): """Return a boolean Check if filename ends with gz extension """ return file_name.endswith('.gz') def filter_log_file(log_file): """Return a string Open file and start filtering line by line. Apply date filtering as well. """ global date_today, date_filter if check_if_gz(log_file): with gzip.open(log_file, 'rt') as log_file: for line in log_file: print(line) if date_filter in line: filter_line(line) else: with open(log_file,'r') as log_file: for line in log_file: if date_filter in line: filter_line(line) log_file.close() def process_line(sender_line, status_lines, status_type, file): """Return void For each sender, check corresponding message status by message id, extract the required parameters from lines and write them to generated file. """ global args, generated_results message_id = get_message_id(sender_line) sender = get_sender(sender_line) subject = get_email_subject(sender_line) for status_line in status_lines: if message_id in status_line: receiver = get_receiver(status_line) host_message = get_host_message(status_line, status_type) line_date = get_line_date(status_line) generated_results[status_type] += 1 file.write( line_date + args.output_delimiter + sender + args.output_delimiter + receiver + args.output_delimiter + message_id + args.output_delimiter + subject + args.output_delimiter + host_message + "\n") def write_file_header(file): """Return void Writes file header that represent columns. """ global args file.write( "date" + args.output_delimiter + "sender" + args.output_delimiter + "receiver" + args.output_delimiter + "message_id" + args.output_delimiter + "subject" + args.output_delimiter + "host_message\n") def date_filter_formated(date_filter): """Return datetime Returns the date provided to a specific format '%Y %b %d'. """ return datetime.datetime.strptime(datetime.datetime.now().strftime('%Y ') + date_filter, '%Y %b %d') def date_filter_int(date_filter): """Return int Returns the datetime provided to a specific format '%Y%b%d' as integer. """ return int(date_filter_formated(date_filter).strftime('%Y%m%d')) def get_files_in_log_dir(default_log_dir): """Return list Returns a list of files from provided directory path. """ all_log_files = [f for f in os.listdir(default_log_dir) if os.path.isfile(os.path.join(default_log_dir, f))] if not all_log_files: sys.exit("Default log directory has no files in it!") return all_log_files def generate_files_to_check(date_filter): """Return list Based on the date filter provided as argument (or today's date), generate the supposed filenames (with specific date and format) to check in log directory. This will return two filenames. """ today_plusone = datetime.datetime.now() + datetime.timedelta(days = 1) today_minusone = datetime.datetime.now() - datetime.timedelta(days = 1) date_filter_plusone = date_filter_formated(date_filter) + datetime.timedelta(days = 1) if (date_filter_int(date_filter) < int(datetime.datetime.now().strftime('%Y%m%d')) and date_filter_int(date_filter) == int(today_minusone.strftime('%Y%m%d'))): return [ 'mail.log-' + datetime.datetime.now().strftime('%Y%m%d'), 'mail.log-' + date_filter_formated(date_filter).strftime('%Y%m%d') + '.gz' ] elif (date_filter_int(date_filter) < int(datetime.datetime.now().strftime('%Y%m%d')) and date_filter_int(date_filter) < int(today_minusone.strftime('%Y%m%d'))): return [ 'mail.log-' + date_filter_formated(date_filter).strftime('%Y%m%d') + '.gz', 'mail.log-' + date_filter_plusone.strftime('%Y%m%d') + '.gz' ] return [] def populate_temp_log_file(file_name, temp_log_file): """Return void Populates the combined temporary log file from provided log in log directory. """ if check_if_gz(file_name): with gzip.open(file_name, 'rt') as gz_mail_log: for line in gz_mail_log: temp_log_file.write(line) gz_mail_log.close() else: with open(file_name, 'r') as mail_log: for line in mail_log: temp_log_file.write(line) mail_log.close() def generate_working_log(date_filter): """Return void Generates combined working log from different logs from postfix log directory based on date filter. """ global args, log_file, working_dir log_dir_files = get_files_in_log_dir(args.log_dir) selected_files = generate_files_to_check(date_filter) temp_log_file = open(working_dir + 'temp-' + str(date_filter_formated(date_filter).strftime('%Y%m%d')) + '.log', 'w') for selected_file in selected_files: if selected_file in log_dir_files: populate_temp_log_file(args.log_dir + selected_file, temp_log_file) else: print("File not found: " + selected_file) temp_log_file.close() log_file = working_dir + 'temp-' + str(date_filter_formated(date_filter).strftime('%Y%m%d')) + '.log' def print_results(results): """Return void Prints the end results of the file processing """ global args, file_random_no print("\n************************* RESULTS *************************\n") if results: total = 0 for result in results: total += results[result] if result == 'sent': print(result + ": \t" + str(results[result]) \ + "\t\t" + result + "-" + str(file_random_no) \ + "." + args.output_filetype) else: print(result + ":\t" + str(results[result]) + "\t\t" \ + result + "-" + str(file_random_no) \ + "." + args.output_filetype) print("\n-----\nTotal:\t\t" + str(total)) else: print('Results could not be printed') print("\n***********************************************************") if __name__ == "__main__": ######################################################## # Argument(s) Parser ######################################################## parser = argparse.ArgumentParser(description='Filter and parse Postfix log files.', formatter_class=RawTextHelpFormatter) parser.add_argument('-d', '--date', dest='date', default=date_today, metavar='', help='''Specify different date. Default is current date.\nFormat: Jan 20 (note one space) & Jan 2 (note two spaces).\nDefault is todays date: ''' + date_today + '\n\n') parser.add_argument('-t', '--type', dest='type', default='all', metavar='', help='Type of email status: bounced, sent, rejected, deferred.\nDefault is all.\n\n') parser.add_argument('-s', '--sender', dest='sender', metavar='', help='Specify senders address in order to query logs matching this parameter\n\n') parser.add_argument('-m', '--message', dest='message', metavar='', help='''Postfix default log format must be changed for this option to work. Add subject message in logs, and then you can use this option to query\nthose emails with specific subject message.\n\n''') parser.add_argument('-l', '--log', dest='log', default=default_log_file, metavar='', help='Specify the log file you want to use.\nDefault is: ' + default_log_file + '\n\n') parser.add_argument('--log-dir', dest='log_dir', default=default_log_dir, metavar='', help='Specify the log directory.\nDefault is: ' + default_log_dir + '\n\n') parser.add_argument('--output-directory', dest='output_directory', default=working_dir, metavar='', help='Specify the generated file(s) directory.\nDefault is current working directory: ' + working_dir + '\n\n') parser.add_argument('--output-delimiter', dest='output_delimiter', default=';', metavar='', help='Specify the generated output delimiter.\nDefault is ";"\n\n') parser.add_argument('--output-filetype', dest='output_filetype', default='csv', metavar='', help='Specify the generated output file type.\nDefault is "csv"\n\n') args = parser.parse_args() ## Validate arguments log_file = default_log_file date_filter = date_today # Check if provided parameters are valid if os.path.isfile(args.log) is not True: parser.error('Provided log file does not exist: ' + args.log) if args.output_directory != working_dir and args.output_directory.endswith('/') is not True: parser.error('Generated output file(s) directory must end with slash "/"') if args.log_dir != default_log_dir and args.log_dir.endswith('/') is not True: parser.error('Log directory must end with slash "/"') if os.path.exists(args.output_directory) is not True: parser.error('Generated output file(s) directory does not exist: ' + args.output_directory) if os.path.exists(args.log_dir) is not True: parser.error('This log directory does not exist in this system: ' + args.log_dir + '\nMaybe provide a different log dir with --log-dir') # If date provided, change date filter to the provided one if args.date != date_filter: date_filter = args.date # If log provided, change default log file to provided one if args.log != log_file: log_file = args.log ######################################################## # Execution / Log parsing and filtering ######################################################## # Check if provided date is valid if int(date_filter_formated(date_filter).strftime('%Y%m%d')) > int(datetime.datetime.now().strftime('%Y%m%d')): sys.exit("Provided date format is wrong or higher than today's date!") # In case the date filter is provided, and it is different from today, # it means that we will have to generate a temp log which contains # combined logs from default log dir (gzip logrotated files included) if date_filter != date_today and log_file == default_log_file: generate_working_log(date_filter) # Start filtering log file based on provided filters filter_log_file(log_file) # If there were no senders/filter matches, exit if not sender_lines: sys.exit("No matching lines found to be processed with provided filters in log file (" + log_file + "). Exiting...") # Start parsing # If message status type provided, filter only those messages if args.type in status_types: generated_results[args.type] = 0 with open(args.output_directory + args.type + '-' \ + str(file_random_no) + '.' \ + args.output_filetype, 'w') as generated_file: write_file_header(generated_file) for sender_line in sender_lines: process_line(sender_line, status_lines, args.type, generated_file) generated_file.close() # Else, filter all status types (bounced, sent, rejected, deferred) else: for status_type in status_types: generated_results[status_type] = 0 with open(args.output_directory + status_type + '-' \ + str(file_random_no) + '.' \ + args.output_filetype, 'w') as generated_file: write_file_header(generated_file) for sender_line in sender_lines: process_line(sender_line, status_lines_by_type[status_type], \ status_type, generated_file) generated_file.close() # Generate and print results print_results(generated_results) print("--- %s seconds ---" % (time.time() - start_time))
18,184
5,352
__author__ = 'lichengwu' def get_groups(sharding): sc = (int(sharding) - 1) * 8 group_list = "" for s in xrange(sc, sc + 8): group_list += str(s) + "," return group_list[:-1] def get_note(host): v = host[3] if v == 'm': return 'message_' + host[17:] else: t = host[4] if t == 'o': return 'b2c_' + v + '_' + host[19:] elif t == 'r': return 'rt_' + v + '_' + host[19:] elif t == 'b': return "b2b_" + v + '_' + host[18:] if __name__ == "__main__": config = """atw7b010100054060.et2\t10.100.54.60 atw8b010100054070.et2\t10.100.54.70 atw5b010100054057.et2\t10.100.54.57 atw6b010100054058.et2\t10.100.54.58 atw5b010179212040.s.et2\t10.179.212.40 atw6b010179213116.s.et2\t10.179.213.116 atw7b010179213117.s.et2\t10.179.213.117 atw8b010179213164.s.et2\t10.179.213.164""" for line in config.split("\n"): pair = line.split("\t") host = pair[0].strip() ip = pair[1].strip() sharding = host[3] if sharding == 'm': print "insert into atw_server_config(gmt_create, gmt_modified, server_ip, biz_type, note, group_list, start_mode) values(now(), now(), '%s', 3, '%s', '0', 2);" % ( ip, get_note(host)) else: print "insert into atw_server_config(gmt_create, gmt_modified, server_ip, biz_type, note, group_list, start_mode) values(now(), now(), '%s', 3, '%s', '%s', 2);" % ( ip, get_note(host),get_groups(sharding))
1,524
749
class EventLogPermissionEntry(object): """ Defines the smallest unit of a code access security permission that is set for an System.Diagnostics.EventLog. EventLogPermissionEntry(permissionAccess: EventLogPermissionAccess,machineName: str) """ @staticmethod def __new__(self, permissionAccess, machineName): """ __new__(cls: type,permissionAccess: EventLogPermissionAccess,machineName: str) """ pass MachineName = property( lambda self: object(), lambda self, v: None, lambda self: None ) """Gets the name of the computer on which to read or write events. Get: MachineName(self: EventLogPermissionEntry) -> str """ PermissionAccess = property( lambda self: object(), lambda self, v: None, lambda self: None ) """Gets the permission access levels used in the permissions request. Get: PermissionAccess(self: EventLogPermissionEntry) -> EventLogPermissionAccess """
992
286
from typing import List BoolList = List[bool] DictList = List[dict] FloatList = List[float] IntList = List[int] StrList = List[str]
133
47
# -*- coding: utf-8 -*- # Copyright 2010 British Broadcasting Corporation and Kamaelia Contributors(1) # # (1) Kamaelia Contributors are listed in the AUTHORS file and at # http://www.kamaelia.org/AUTHORS - please extend this file, # not this notice. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from Shard import * class switchShard(shard): """ Generates a switch-type if statement. General form is: ... elif <switchVar> <compare> <conditions[i]>: shards[i] ... Arguments: name = name of new shard, default None. If no name is specified a default name will be generated switchVar = the switch variable as a string, e.g. 'event.type' conditions = list of variables (as strings) to compare against switchVar, one for each branch. Any branches without conditions will be placed in an 'else' branch. Any conditions without branches will be ignored compare = string of comparison operator. The same operator will be used for all branches, default is '==' shards = list containing one shard for each branch, in the same order as the relevant condition. If there are fewer conditions than shards, those remaining will be placed in an 'else' branch """ # default initialisation parameters initargs = {} initargs['name'] = None initargs['switchVar'] = '' initargs['conditions'] = [] initargs['shards'] = [] initargs['compare'] = '==' # compulsory init parameters required = ['switchVar', 'shards', 'conditions'] def __init__(self, name = None, switchVar = '', conditions = [], shards = [], compare = '=='): if not (switchVar or shards or conditions): raise ArgumentError, 'a switch variable and at least one branch and condition must be provided' compare = ' ' + compare + ' ' ifbr, cond = shards.pop(0), conditions.pop(0) ifline = ['if ' + switchVar + compare + cond + ':\n'] ifbranch = shard('if branch', shards = [ifbr]) code = ifline + ifbranch.addindent() if len(conditions) > len(shards): conditions = conditions[0:len(shards)] # ignore excess conditions while conditions: elifbr, cond = shards.pop(0), conditions.pop(0) elifline = ['elif ' + switchVar + compare + cond + ':\n'] sh = shard('elif branch', shards = [elifbr]) code += elifline + sh.addindent() if shards: # shards remaining, place into else branch sh = shard('else branch', shards = shards) code += ['else:\n'] + sh.addindent() super(switchShard, self).__init__(shards = [code])
3,396
922
#!/usr/bin/env python # -*- coding: utf-8 -*- # # Copyright © 2020 UWATC. All rights reserved. # # Use of this source code is governed by an MIT license that can # be found in the LICENSE.txt file or at https://opensource.org/licenses/MIT from .AgentTemplate import AgentTemplate class SimpleAgent(AgentTemplate): def handle_orders(self, place_order, cancel_order, current_orders, wallet): # data = get_data(self.data_array[0], self.timestamp) # Do nothing for SimpleAgent pass
486
165
# Program that downloads all episodes of a podcast # Features # -- Functions: add, remove, update # - Run the file to update without having to use python interpreter # - Download all episodes of a podcast, put into the correct folder # - Tag each file with metadata from the feed and the stored config import os import sys import pickle import requests import datetime import feedparser import subprocess STORAGE_DIR = "C:\\Users\\Dylan\\Python\\pod\\storage\\" LOGFILE = "C:\\Users\\Dylan\\Python\\pod\\log.txt" FFMPEG_PATH = "C:\\Users\\Dylan\\Python\\pod\\ffmpeg.exe" TEMP_DIR = "C:\\Users\\Dylan\\AppData\\Local\\Temp\\" debug = False class Podcast: """For internal use. Class to hold attributes of a podcast.""" def __init__(self, name: str, feed: str, storage_dir: str, prefix: str, album: str, artist: str, year: str, art: str): self.name = name self.feed = feed self.storage_dir = storage_dir self.prefix = prefix self.album = album self.artist = artist self.year = year self.art = art def log(text): """For internal use. Easily log events. To display these events onscreen as they occur, set pod.debug = True.""" if debug: print("--debug: " + text) with open(LOGFILE, 'a') as log: log.write(datetime.datetime.now().isoformat() + ': ' + str(text) + '\n') def add(): """Creates a stored configuration file for the given feed, "*.pod", so that the feed can be checked quickly without having to specify the URL or metadata again.""" podcast_obj = Podcast( input("Podcast name: "), input("Feed URL: "), input("Storage dir: "), input("Prefix: "), input("Album: "), input("Artist: "), input("Release year: "), input("Album art URL: ") ) with open(STORAGE_DIR + podcast_obj.name + '.pod', 'wb') as file: pickle.dump(podcast_obj, file) def remove(): """Removes the configuration file associated with the given podcast.""" name = input("Name of podcast to remove: ") if os.path.exists(STORAGE_DIR + name + '.pod'): os.remove(STORAGE_DIR + name + '.pod') else: print('-- %s does not exist' % name) def update(): """Checks for new entries from all feeds, download and tag new episodes.""" # For each stored podcast config for file in os.listdir(STORAGE_DIR): with open(STORAGE_DIR + file, 'rb') as f: podcast_obj = pickle.load(f) log("Updating podcast: %s" % podcast_obj.name) print('Updating "%s":' % podcast_obj.name) # Get feed feed = feedparser.parse(podcast_obj.feed) length = len(feed.entries) # Create storage dir if it does not exist if not os.path.exists(podcast_obj.storage_dir): os.mkdir(podcast_obj.storage_dir) # Download image if it does not exist image_path = podcast_obj.storage_dir + podcast_obj.prefix + "_Album_Art.png" if not os.path.exists(image_path): print("Downloading podcast cover art...") log("Downloading image") response = requests.get(podcast_obj.art) with open(image_path, 'wb') as imgfile: imgfile.write(response.content) # Set podcast-specific metadata # image_path set above, title set per-episode album = podcast_obj.album artist = podcast_obj.artist year = podcast_obj.year # Get episodes from feed in chronological order for i in range(length-1, -1, -1): # Get current episode number ep_num = length - i display_prefix = podcast_obj.prefix + "_" + str(ep_num).zfill(3) # Get episode title title = feed.entries[i].title # Get episode URL episode_url = "" # Variables for x = 0 # the while loop skip_this_item = False while ('.mp3' not in episode_url and '.wav' not in episode_url and '.m4a' not in episode_url): try: episode_url = feed.entries[i]['links'][x]['href'] except: skip_this_item = True break log("episode_url: %s" % episode_url) x += 1 if ".mp3" in episode_url: ext = ".mp3" if ".wav" in episode_url: ext = ".wav" if ".m4a" in episode_url: ext = ".m4a" # Get full episode destination path # xpath is the temporary file as it was downloaded with only the name changed # path is the final file xpath = TEMP_DIR + display_prefix + "X" + ext path = podcast_obj.storage_dir + display_prefix + ext # Skip this episode if already downloaded if os.path.exists(path): continue if skip_this_item: print(display_prefix + ": Skipped due to file extension (item likely not audio)") log(display_prefix + ": Skipped due to file extension (item likely not audio)") skip_this_item = False continue # Show which episode is in progress print(display_prefix + ': Downloading...') log('In progress: %s' % display_prefix) # Download episode HEADER_STRING = {'User-Agent': 'Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/87.0.4280.88 Safari/537.36 Edg/87.0.664.66'} response = requests.get(episode_url, headers=HEADER_STRING) # Fail if size is less than 1MB if sys.getsizeof(response.content) < 1000000: # If size is less than 1MB log("FATAL ERROR: response.content = %s bytes" % sys.getsizeof(response)) raise IOError("-- response.content was only %s bytes" % sys.getsizeof(response.content)) # Fail upon bad HTTP status code if not response.ok: log("FATAL ERROR: Bad response: status code %s" % response.status_code) raise ConnectionError("-- Response not ok, status code %s" % response.status_code) # Write mp3 data to file # Since this is done after the download is complete, interruptions will only break episodes # if they occur during the file being written to disk. If the script is interrupted during download, # the script will simply restart the download of the interrupted episode on the next run. with open(xpath, 'wb') as f: f.write(response.content) # Write correct metadata to clean file # Force using ID3v2.3 tags for best results # Only fatal errors will be displayed print(display_prefix + ": Writing correct metadata...") log("Writing metadata") subprocess.run([FFMPEG_PATH, "-i", xpath, "-i", image_path, "-map", "0:0", "-map", "1:0", "-codec", "copy", "-id3v2_version", "3", "-metadata:s:v", 'title="Album cover"',"-metadata:s:v", 'comment="Cover (front)"', "-metadata", "track=" + str(ep_num), "-metadata", "title=" + title, "-metadata", "album=" + album, "-metadata", "album_artist=" + artist, "-metadata", "artist=" + artist, "-metadata", "year=" + year, "-metadata", "genre=Podcast", "-loglevel", "fatal", path]) # Delete temporary file os.remove(xpath) log("Download complete: %s" % path) log("Update complete.") print("Files located in the following folder: %s" % podcast_obj.storage_dir) if __name__ == '__main__': update()
8,349
2,455
import time import numpy as np import cv2 from mss import mss from threading_ext.GameRecorder import GameRecorder from threading_ext.PausableThread import PausableThread class RecordingThread(PausableThread): def __init__(self, training_data_path: str, session_number: int, recorder: GameRecorder): super(RecordingThread, self).__init__() self.recorder = recorder self.training_data = [] self.training_data_path = training_data_path self.session_number = session_number def run(self): monitor = {"top": 40, "left": 0, "width": 1024, "height": 728} s_to_ms = 1000 with mss() as sct: while not self.killed: start_time_ms = round(time.time() * s_to_ms, 0) screen = np.asarray(sct.grab(monitor)) screen = cv2.resize(screen, (480, 270)) screen = cv2.cvtColor(screen, cv2.COLOR_BGR2GRAY) self.training_data.append([screen, np.asarray(self.recorder.flattened_state())]) self.sleep_if_paused() self.save_if_necessary() self.wait(start_time_ms) def save_if_necessary(self): if len(self.training_data) % 100 == 0: print(len(self.training_data)) if len(self.training_data) == 500: np.save(self.training_data_path.format(self.session_number), self.training_data) print('saved_data in file nb {}'.format(self.session_number)) self.session_number += 1 self.training_data = [] def wait(self, start_time_ms: int): delay_ms = 1000 / 6 end_time_ms = round(time.time() * 1000, 0) duration_ms = end_time_ms - start_time_ms print('loop time {}ms'.format(duration_ms)) time.sleep(max((delay_ms - duration_ms)/1000, 0)) def rewind(self): self.session_number -= 1 self.training_data = []
1,954
651
#! /usr/bin/python3 import threading import socket from test import create_upd_clients from client import multicast_receive def test_multicast_receive(): clients = create_upd_clients(3) def run(client: socket.socket) -> None: multicast_receive(client) threads = [threading.Thread(name=f'client_[{i+1}]', target=run, args=(client,)) for i, client in enumerate(clients)] for t in threads: t.start() for t in threads: t.join() if __name__ == '__main__': try: test_multicast_receive() except Exception as e: print(e) finally: input('Press [ENTER]...')
638
215
from tools import * from model import * import torch import torch.nn as nn from torch.autograd import Variable import torch.nn.functional as F from torch.utils.data import Dataset, DataLoader class NamesDataset(Dataset): """Name Classification dataset""" def __init__(self, path): self.data = pd.read_csv(path, sep='\t').dropna() self.X = self.data['name'] self.y = self.data['label'] def __len__(self): return len(self.X) def __getitem__(self, index): content = torch.from_numpy(encode_input(self.data['name'][index])).float() label = label_to_number[self.data['label'][index]] sample = {'X': content, 'y': label} return sample name_dataset = NamesDataset('data/names/names_train_new.csv') dataloader = DataLoader(name_dataset, batch_size=32, shuffle=True, num_workers=0) charcnn = CharCNN(n_classes=len(set(name_data['label'])), vocab_size=len(chars), max_seq_length=max_name_len) criterion = nn.CrossEntropyLoss() from tqdm import tqdm_notebook def train(model, dataloader, num_epochs): cuda = torch.cuda.is_available() if cuda: model.cuda() optimizer = torch.optim.Adam(model.parameters()) loss_history_avg = [] loss_history = [] #bar = tqdm_notebook(total=len(dataloader)) for i in range(num_epochs): per_epoch_losses = [] for batch in dataloader: X = Variable(batch['X']) y = Variable(batch['y']) if cuda: X = X.cuda() y = y.cuda() model.zero_grad() outputs = model(X) loss = criterion(outputs, y) loss.backward() optimizer.step() per_epoch_losses.append(loss.data[0]) #bar.set_postfix(loss=loss.data[0]) #bar.update(1) loss_history_avg.append(np.mean(per_epoch_losses)) loss_history.append( loss.data[0] ) print('epoch[%d] loss: %.4f' % (i, loss.data[0])) return loss_history, loss_history_avg loss_history, loss_history_avg = train(charcnn, dataloader, 100) torch.save(charcnn, 'charcnn.pth')
2,135
745
# Generated by Django 3.1 on 2021-05-04 03:47 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('automated_logging', '0018_decoratoroverrideexclusiontest_foreignkeytest_fullclassbasedexclusiontest_fulldecoratorbasedexclusio'), ] operations = [ migrations.AlterField( model_name='modelevent', name='user', field=models.IntegerField(help_text='User ID from the Authentication system', null=True), ), migrations.AlterField( model_name='requestevent', name='user', field=models.IntegerField(help_text='User ID from the Authentication system', null=True), ), ]
737
215
# -*- coding: utf-8 -*- # Copyright 2013 Sebastian Ramacher <sebastian+dev@ramacher.at> # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED “AS IS”, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # SOFTWARE. """ Tests for the libdiscid module """ from __future__ import unicode_literals class PutSuccess(object): first = 1 last = 15 sectors = 258725 seconds = 3450 offsets = (150, 17510, 33275, 45910, 57805, 78310, 94650, 109580, 132010, 149160, 165115, 177710, 203325, 215555, 235590) track_seconds = (231, 210, 168, 159, 273, 218, 199, 299, 229, 213, 168, 342, 163, 267, 308) disc_id = 'TqvKjMu7dMliSfmVEBtrL7sBSno-' freedb_id = 'b60d770f' toc = ' '.join(map(str, [first, last, sectors] + list(offsets))) class _PutFail(object): sectors = 200 offsets = (1, 2, 3, 4, 5, 6, 7) class PutFail1(_PutFail): first = 13 last = 1 class PutFail2(_PutFail): first = 0 last = 10 class PutFail2_2(_PutFail): first = 100 last = 200 class PutFail3(_PutFail): first = 0 last = 0 class PutFail3_2(_PutFail): first = 1 last = 100
2,037
891
# -*- coding: utf-8 -*- """Top-level package for Alexa Skill Boilerplate.""" __author__ = """James Lin""" __email__ = 'james@lin.net.nz' __version__ = '0.1.0'
161
71
#Author: Wallace He from __future__ import absolute_import from __future__ import division from __future__ import print_function import glob import keras from keras.models import Sequential from keras.models import model_from_json from keras.models import load_model import partition import train_CNN def train_teacher (nb_teachers, teacher_id): """ This function trains a single teacher model with responds teacher's ID among an ensemble of nb_teachers models for the dataset specified. The model will be save in directory. :param nb_teachers: total number of teachers in the ensemble :param teacher_id: id of the teacher being trained :return: True if everything went well """ # Load the dataset X_train, X_test, y_train, y_test = train_CNN.get_dataset() # Retrieve subset of data for this teacher data, labels = partition.partition_dataset(X_train, y_train, nb_teachers, teacher_id) print("Length of training data: " + str(len(labels))) # Define teacher checkpoint filename and full path filename = str(nb_teachers) + '_teachers_' + str(teacher_id) + '.hdf5' filename2 = str(nb_teachers) + '_teachers_' + str(teacher_id) + '.h5' # Perform teacher training need to modify # Create teacher model model, opt = train_CNN.create_six_conv_layer(data.shape[1:]) model.compile(loss='categorical_crossentropy', optimizer=opt, metrics=['accuracy']) model, hist = train_CNN.training(model, data, X_test, labels, y_test,filename, data_augmentation=True) #modify model_json = model.to_json() with open("model.json", "w") as json_file: json_file.write(model_json) # serialize weights to HDF5 model.save_weights(filename2) print("Saved model to disk") return True
1,881
584
import requests import shutil import pandas as pd from typing import Dict, List def fetch_descartes_human_tissue(out_file: str, verbose: bool = True) -> None: """Function to fetch Loom Single-Cell tissue data from Descartes human database. Args: out_file: Output file that is going to store .loom data verbose: If True (default), print statements about download Examples: >>> fetch_descartes_human_tissue("Human_Tissue.loom") """ url = ( "https://shendure-web.gs.washington.edu/content/members/cao1025/" "public/FCA_RNA_supp_files/scanpy_cells_all/" "Human_RNA_processed.loom" ) if verbose: print("Downloading Human Single-Cell data from Descartes database") print(f"data url: {url}") with requests.get(url, stream=True, timeout=60) as data: with open(out_file, 'wb') as out: shutil.copyfileobj(data.raw, out) if verbose: print(f"Downloaded data to {out_file}") def fetch_descartes_by_tissue( list_tissues: List[str], out_dir: str, verbose: bool = True ) -> None: """Function to fetch Loom Single-Cell tissue data from Descartes human database by choosing which tissues will be donwloaded. Args: list_tissues: List of tissues names to be downloaded. out_dir: Output directory that is going to store .loom data. verbose: If True (default), print statements about download. Examples: >>> fetch_descartes_by_tissue( list_tissues=["Thymus", "Hearth"] out_dir="data" ) """ base_url = ( "https://shendure-web.gs.washington.edu/content/members/cao1025/" "public/FCA_RNA_supp_files/scanpy_cells_by_tissue" ) for tissue in list_tissues: url = f"{base_url}/{tissue}_processed.loom" if verbose: print(( f"Downloading {tissue} tissue Human Single-Cell data " "from Descartes database" )) print(f"data url: {url}") file_name = f"{out_dir}/{tissue}_data.loom" with requests.get(url, stream=True, timeout=60) as data: with open(file_name, 'wb') as out: shutil.copyfileobj(data.raw, out) if verbose: print(f"Downloaded {file_name} to {out_dir}") def fetch_de_genes_for_cell_type( verbose: bool = False ) -> Dict[str, List[str]]: """Function to fetch Differentially Expressed (DE) genes from Descartes Human Atlas from 77 Main Cell types found in 15 Organs. Args: verbose: If True (default), print statements about download Returns: Dictionary mapping each main cell type to its differentially expressed genes. Example: { "Acinar cells": ["MIR1302-11", "FAM138A", ...], "Myeloid cells": ["CU459201.1", "OR4G4P", ...] ... } """ url = ( "https://atlas.fredhutch.org/data/bbi/descartes/human_gtex/" "downloads/data_summarize_fetus_data/DE_gene_77_main_cell_type.csv" ) if verbose: print(( "Downloading Human Single-Cell Differentially Expressed" "genes for 77 Main Cell types found in 15 Organs." )) print(f"data url: {url}") de_df = pd.read_csv(url) cell_types = de_df["max.cluster"].unique() de_mapping = {} for type in cell_types: list_genes = de_df[ de_df["max.cluster"] == type ]["gene_id"].tolist() list_genes = [gene.replace("'", "") for gene in list_genes] de_mapping[type] = list_genes return de_mapping
3,651
1,202
#!/usr/bin/env python3.6 import random #importing random module from user import User #importing class User from credential import Credential #importing class Credential def create_credential(username,accountname,password): """ create_credential function that creates an instance of the class credential """ new_credential = Credential(username,accountname,password) return new_credential def create_user(name, login_password): """ create_user function that creates an instance of the class user """ new_user = User(name,login_password) return new_user def saveCredential(credential): """ saveCredential function to save the credential created by the user """ credential.save_credential() def saveUser(user): """ saveUser function to create a user account whenever a user signs up with password locker """ user.save_user() def deleteCredential(credential): """ deleteCredential function that helps user delete an existing credential """ credential.delete_credential() def findCredential(account_name): """ findCredential function to search for a credential by accountname and return all its details """ return Credential.find_accountname(account_name) def credentialExists(account_name): """ credentialExists function to check whether a credential exists and return True or False """ return Credential.credential_exists(account_name) def displayCredentials(): """ displayCredentials function to display the credentials currently saved """ return Credential.display_credentials() def displayUser(): """ displayUser function to display user details if user has an account """ return User.display_all() def copyUsername(account_name): """ copyUsername function that enables user to copy their user name to their machine clip board """ return Credential.copy_username(account_name) def copyAccountname(account_name): """ copyAccountname function that enables user to copy their accountname to the machine clipboard """ return Credential.copy_accountname(account_name) def copyPassword(account_name): """ copyPassword function that enables user to copy their password to the machine clipboard """ return Credential.copy_password(account_name) def main(): user_name = input("Hello, welcome to Password_Locker. What is your name? \n") print("Hi {}. What would you like to do?".format(user_name)) while True: userShortCodes = input("Use these shortcodes to pick an action: \n ca - Create Account \n ex - Exit Password Locker:\n") if userShortCodes == "ca": userName = input("Please enter a user name for account set up:") loginPassword = input("Please enter your password: ") saveUser(create_user(userName, loginPassword)) print("The following are details to your account: \n Username: {} \n password: {}".format(userName, loginPassword)) username_login = input("Thank you for signing up with us. \n please enter your username to login: ") password_login = input("Please enter your password: ") if loginPassword == password_login and userName == username_login: if User.display_all(): userShortCodes = input("Would you like to proceed to your credentials? Use this short code: \n sc - See your credential: \n ") if userShortCodes == "sc": while True: short_code = input("Use these shortcodes to choose an action: \n cc- create new credential \n delc - delete credential \n fc - find credential \n cp - copy credential \n ex - exit credentials \n dc -display credential :\n ").lower() if short_code == "cc": print("New Credential:") username = input("Please enter your user name: \n") accountname = input("Please enter your account name: \n") password_choice = input("Would you like to have your password auto-generated? y/n : \n ").lower() # Password generator if password_choice == "n": password = input("Please enter your password: \n") else: password_length = input("What length of password would you like to have? \n ") random_password = [] for i in range (0, int(password_length)): #loop through the number of times equal to preferred length of password random_password.append(random.randint(0,9)) def convert (random_password): s = [str(i) for i in random_password] res = int("".join(s)) return (res) print ("Your generated password of ",password_length," characters is ", convert(random_password)) password = input("Please enter the above generated password: \n") response = input("Would you like to save the credential you just made? y/n: \n") if response == "y": saveCredential(create_credential(username, accountname, password)) print("--" * 10) print(f"credentials successfully saved! \n {username} \n {accountname} \n {password}") print("--" * 10) elif short_code == "dc": if displayCredentials(): print("Here is a list of all your credentials: \n") print("--" * 10) for credential in displayCredentials(): print(f"{credential.username} \n {credential.accountname} \n {password}") else: print("You dont seem to have any credentials saved") elif short_code == "fc": search_accountname = input("Please enter the account you want to search for: \n") if credentialExists(search_accountname): found_credential = findCredential(search_accountname) print("Account searched \n") print("-- \n" * 10) print (f"Username: {found_credential.username} \n Accountname: {found_credential.accountname} \n Password: {found_credential.password}") else: print("That credential does not exist") elif short_code == "cp": copy_account_name = input("Please enter your accountname: ") if credentialExists(copy_account_name): copy_choices = input("What would you like to copy from {}? \n pd - Password \n us - username \n ac - accountname \n".format(copy_account_name)).lower() if copy_choices == "us": copyUsername(copy_account_name) print("Username successfully copied!") elif copy_choices == "pd": copyPassword(copy_account_name) print("Password successfully copied!") elif copy_choices == "ac": copyAccountname(copy_account_name) print("Account-name successfully copied!") else: print("{} account does not exist!".format(copy_account_name)) elif short_code == "delc": search_accountname = input("Please enter the account you would like deleted: \n") if credentialExists(search_accountname): found_credential = findCredential(search_accountname) deleteCredential(found_credential) print(f"{search_accountname} has successfully been deleted") else: print(f"{search_accountname} does not exist") elif short_code == "ex": print("Exiting credentials........") break else: print("Incorrect username or password") elif userShortCodes == "ex": print("Logging out.......") break if __name__ == '__main__': main()
9,528
2,121
'''Line up operators...''' import cp_actions as cp import re def act(controller, bundle, options): ''' Required action method ''' context = cp.get_context(controller) line_ending = cp.get_line_ending(context) lines, range = cp.lines_and_range(context) newlines = line_ending.join(balance_operators(lines.split(line_ending))) cp.insert_text_and_select(context, newlines, range, cp.new_range(range.location, len(newlines))) def balance_operators(lines): r = re.compile("^(.*[^\s])\s*((?:==?|<<|>>|&|\||\^)=|=[>&\*]|(?<![\.\+\-\*\/~%])[\.\+\-\*\/~%]?=)\s*([^\s].*)$") vars = [] ops = [] vals = [] ret = [] for line in lines: result = r.match(line) if result: vars.append(result.group(1)) ops.append(result.group(2)) vals.append(result.group(3)) for line in lines: result = r.match(line) if result: ret.append(" ".join((result.group(1).ljust(len(max(vars, key=len))), result.group(2).rjust(len(max(ops, key=len))), result.group(3)))) else: ret.append(line) return ret
1,173
416
import numpy as np import pandas as pd import itertools ''' Section below creates lists for your reaction parameters. Change names of lists where appropriate ''' #For bigger lists use np.arange(min_value, max_value, step) Pyridine = [0.1, 0.2, 0.3] # in mmol Aldehyde = [0.1, 0.2, 0.3] # in mmol Isocyanide = [0.1, 0.2, 0.3] # in mmol Temperature = [10, 20, 40, 60, 80] # in C Solvent = [0.1, 0.25, 0.5, 1, 1.5] # in mL Catalyst = [0, 1, 2, 3, 4, 5, 7.5, 10] # in mol% Time = [5, 10, 15, 30, 60] # in minutes ''' The following lines create all combos possible for the values listed above and saves as text file. Change names where appropriate. ''' combinations = list(itertools.product(Pyridine, Aldehyde, Isocyanide, Temperature, Solvent, Catalyst, Time)) df = pd.DataFrame(combinations) df.to_csv('all_combos716.txt', sep = '\t', header = ['Pyridine', 'Aldehyde', 'Isocyanide', 'Temperature', 'Solvent', 'Catalyst', 'Time']) ''' Below, 10 random reaction are selected from all possible combinations. The reactions are stored in a text file. Change names of header as appropriate. ''' random_data = df.sample(n=10, random_state=1) df_random_data = pd.DataFrame(random_data) df_random_data.to_csv('train_data716.txt', sep= '\t', header = ['Pyridine', 'Aldehyde', 'Isocyanide', 'Temperature', 'Solvent', 'Catalyst', 'Time'])
1,333
529
import enum class ConnectionState(enum.Enum): PING = "ping" SEND_SYN = "syn" WAIT_FOR_SYN = "wait" OPEN = "open" RELAY = "relay" UNREACHABLE = "unreachable"
183
79
""" rpath task function """ from mechlib import filesys from mechlib.filesys import build_fs from mechlib.filesys import root_locs def rpath_fs(ts_dct, tsname, mod_ini_thy_info, es_keyword_dct, run_prefix, save_prefix): """ reaction path filesystem """ # Set up coordinate name rxn_coord = es_keyword_dct.get('rxncoord') # Get the zma and ts locs zma_locs = (ts_dct['zma_idx'],) ts_locs = (int(tsname.split('_')[-1]),) # Build filesys object down to TS FS ts_fs = build_fs( run_prefix, save_prefix, 'TRANSITION STATE', thy_locs=mod_ini_thy_info[1:], **root_locs(ts_dct, saddle=True)) ini_ts_run_fs, ini_ts_save_fs = ts_fs # generate fs if rxn_coord == 'irc': # Try and locate a minimum-energy conformer cnf_fs = build_fs( run_prefix, save_prefix, 'CONFORMER', thy_locs=mod_ini_thy_info[1:], **root_locs(ts_dct, saddle=True, name=tsname)) ini_cnf_run_fs, ini_cnf_save_fs = cnf_fs ini_loc_info = filesys.mincnf.min_energy_conformer_locators( ini_cnf_save_fs, mod_ini_thy_info) ini_min_locs, ini_pfx_save_path = ini_loc_info if any(ini_min_locs): # Run IRC from saddle point minimum-energy conformer ini_pfx_run_path = ini_cnf_run_fs[-1].path(ini_min_locs) ini_pfx_save_path = ini_cnf_save_fs[-1].path(ini_min_locs) scn_alg = 'irc-sadpt' else: # Run IRC from series of points {Rmax, Rmax-1, ...} ini_pfx_run_path = ini_ts_run_fs[-1].path(ts_locs) ini_pfx_save_path = ini_ts_save_fs[-1].path(ts_locs) scn_alg = 'irc-rmax' else: # Run a scan along the requested reaction coordinates # Have an auto option that just selects the coordinate? ini_pfx_run_path = ini_ts_run_fs[-1].path(ts_locs) ini_pfx_save_path = ini_ts_save_fs[-1].path(ts_locs) scn_alg = 'drp' # Set up the scan filesystem objects using the predefined prefix scn_fs = build_fs( ini_pfx_run_path, ini_pfx_save_path, 'SCAN', zma_locs=zma_locs) return scn_alg, scn_fs, cnf_fs, ini_min_locs
2,241
880
# -*- coding: utf-8 -*- """ Created on Tue Sep 29 14:38:54 2020 @author: https://stackoverflow.com/questions/18262293/how-to-open-every-file-in-a-folder """ import os #os module imported here location = os.getcwd() # get present working directory location here counter = 0 #keep a count of all files found csvfiles = [] #list to store all csv files found at location filebeginwithhello = [] # list to keep all files that begin with 'hello' otherfiles = [] #list to keep any other file that do not match the criteria for file in os.listdir(location): try: if file.endswith(".csv"): print( "csv file found:\t", file) csvfiles.append(str(file)) counter = counter+1 elif file.endswith(".csv"): #because some files may start with hello and also be a csv file print( "csv file found:\t", file) csvfiles.append(str(file)) counter = counter+1 elif file.startswith("hello"): print( "hello files found: \t", file) filebeginwithhello.append(file) counter = counter+1 else: otherfiles.append(file) print(file) counter = counter+1 except Exception as e: raise e print("No files found here!") print("Total files found:\t", counter)
1,361
417
from urllib.parse import quote from social_core.utils import sanitize_redirect, user_is_authenticated, \ user_is_active, partial_pipeline_data, setting_url def do_auth(backend, redirect_name='next'): # Save any defined next value into session data = backend.strategy.request_data(merge=False) # Save extra data into session. for field_name in backend.setting('FIELDS_STORED_IN_SESSION', []): if field_name in data: backend.strategy.session_set(field_name, data[field_name]) else: backend.strategy.session_set(field_name, None) # uri = None if redirect_name in data: # Check and sanitize a user-defined GET/POST next field value redirect_uri = data[redirect_name] if backend.setting('SANITIZE_REDIRECTS', True): allowed_hosts = backend.setting('ALLOWED_REDIRECT_HOSTS', []) + \ [backend.strategy.request_host()] redirect_uri = sanitize_redirect(allowed_hosts, redirect_uri) backend.strategy.session_set( redirect_name, redirect_uri or backend.setting('LOGIN_REDIRECT_URL') ) response = backend.start() url = response.url.split('?')[1] def form2json(form_data): from urllib.parse import parse_qs, urlparse query = urlparse('?' + form_data).query params = parse_qs(query) return {key: params[key][0] for key in params} from django.core.cache import cache cache.set("oidc_key_" + data.get('key', ''), form2json(url).get('state'), 60 * 10) return response def do_complete(backend, login, user=None, redirect_name='next', *args, **kwargs): data = backend.strategy.request_data() is_authenticated = user_is_authenticated(user) user = user if is_authenticated else None partial = partial_pipeline_data(backend, user, *args, **kwargs) if partial: user = backend.continue_pipeline(partial) # clean partial data after usage backend.strategy.clean_partial_pipeline(partial.token) else: user = backend.complete(user=user, *args, **kwargs) # pop redirect value before the session is trashed on login(), but after # the pipeline so that the pipeline can change the redirect if needed redirect_value = backend.strategy.session_get(redirect_name, '') or \ data.get(redirect_name, '') # check if the output value is something else than a user and just # return it to the client user_model = backend.strategy.storage.user.user_model() if user and not isinstance(user, user_model): return user if is_authenticated: if not user: url = setting_url(backend, redirect_value, 'LOGIN_REDIRECT_URL') else: url = setting_url(backend, redirect_value, 'NEW_ASSOCIATION_REDIRECT_URL', 'LOGIN_REDIRECT_URL') elif user: if user_is_active(user): # catch is_new/social_user in case login() resets the instance is_new = getattr(user, 'is_new', False) social_user = user.social_user login(backend, user, social_user) # store last login backend name in session backend.strategy.session_set('social_auth_last_login_backend', social_user.provider) if is_new: url = setting_url(backend, 'NEW_USER_REDIRECT_URL', redirect_value, 'LOGIN_REDIRECT_URL') else: url = setting_url(backend, redirect_value, 'LOGIN_REDIRECT_URL') else: if backend.setting('INACTIVE_USER_LOGIN', False): social_user = user.social_user login(backend, user, social_user) url = setting_url(backend, 'INACTIVE_USER_URL', 'LOGIN_ERROR_URL', 'LOGIN_URL') else: url = setting_url(backend, 'LOGIN_ERROR_URL', 'LOGIN_URL') if redirect_value and redirect_value != url: redirect_value = quote(redirect_value) url += ('&' if '?' in url else '?') + \ '{0}={1}'.format(redirect_name, redirect_value) if backend.setting('SANITIZE_REDIRECTS', True): allowed_hosts = backend.setting('ALLOWED_REDIRECT_HOSTS', []) + \ [backend.strategy.request_host()] url = sanitize_redirect(allowed_hosts, url) or \ backend.setting('LOGIN_REDIRECT_URL') response = backend.strategy.redirect(url) social_auth = user.social_auth.filter(provider='drycc').\ order_by('-modified').last() response.set_cookie("name", user.username, max_age=social_auth.extra_data.get('expires_in')) response.set_cookie("id_token", social_auth.extra_data.get('id_token'), max_age=social_auth.extra_data.get('expires_in')) from django.core.cache import cache cache.set("oidc_state_" + data.get('state'), {'token': social_auth.extra_data.get('id_token', 'fail'), 'username': user.username}, 60 * 10) return response
5,317
1,533
#!/usr/bin/python # Oct 2019 JMA # make_samples.py Use the splits_aggregator module to create samples ''' Write a short description of what the program does here. Usage: $ ./make_samples.py [-v] [-d ROOT_DIR] [-c pair_cnt] -v verbose output -d data directory to read from -c number of randomly paired cases to generate ''' import os, sys import glob import pprint import re import time from pathlib import Path import pyarrow import pandas as pd import splits_aggregator as sa ### config constants VERBOSE = False ROOT_DIR = Path('D:/OneDrive - Microsoft/data/20news') PAIR_CNT = 1 ######################################################################## class x(object): '' pass ############################################################################### def main(input_dir, pair_cnt): cs = sa.BinaryComparisons(input_dir) pairs_df = cs.random_pairs(pair_cnt) if VERBOSE: print("Pairs: ", pairs_df.shape) cs.embed_in_excel(pairs_df) ######################################################################## if __name__ == '__main__': if '-v' in sys.argv: k = sys.argv.index('-v') VERBOSE = True ## Inputs if '-d' in sys.argv: d = sys.argv.index('-d') ROOT_DIR = Path(sys.argv[d+1]) # else: if '-c' in sys.argv: g = sys.argv.index('-c') PAIR_CNT= int(sys.argv[g+1]) main(ROOT_DIR, PAIR_CNT) print(sys.argv, "\nDone in ", '%5.3f' % time.process_time(), " secs! At UTC: ", time.asctime(time.gmtime()), file=sys.stderr)
1,667
589
# -*- coding: utf-8 -*- # Resource object code # # Created: Di. Feb 3 12:11:53 2015 # by: The Resource Compiler for PySide (Qt v4.8.4) # # WARNING! All changes made in this file will be lost! from PySide import QtCore qt_resource_data = b"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x009QStatusBar::item \x0a{ \x0a\x09border-left: 1px solid #AAAAAA;\x0a} \x0a\x00\x00\x00\x00" qt_resource_name = b"\x00\x03\x00\x00j\xa3\x00c\x00s\x00s\x00\x0e\x0bq\xe6\xc3\x00M\x00a\x00i\x00n\x00W\x00i\x00n\x00d\x00o\x00w\x00.\x00c\x00s\x00s\x00\x0b\x08\x22\xc1\xc3\x00M\x00e\x00n\x00u\x00b\x00a\x00r\x00.\x00c\x00s\x00s\x00\x10\x05[\x0fC\x00P\x00y\x00S\x00u\x00m\x00o\x00W\x00i\x00d\x00g\x00e\x00t\x00.\x00c\x00s\x00s\x00\x0d\x0d\xd42\xe3\x00S\x00t\x00a\x00t\x00u\x00s\x00b\x00a\x00r\x00.\x00c\x00s\x00s\x00\x0b\x083\x86\xe3\x00T\x00o\x00o\x00l\x00b\x00a\x00r\x00.\x00c\x00s\x00s" qt_resource_struct = b"\x00\x00\x00\x00\x00\x02\x00\x00\x00\x01\x00\x00\x00\x01\x00\x00\x00\x00\x00\x02\x00\x00\x00\x05\x00\x00\x00\x02\x00\x00\x00J\x00\x00\x00\x00\x00\x01\x00\x00\x00\x08\x00\x00\x00.\x00\x00\x00\x00\x00\x01\x00\x00\x00\x04\x00\x00\x00\x90\x00\x00\x00\x00\x00\x01\x00\x00\x00I\x00\x00\x00\x0c\x00\x00\x00\x00\x00\x01\x00\x00\x00\x00\x00\x00\x00p\x00\x00\x00\x00\x00\x01\x00\x00\x00\x0c" def qInitResources(): QtCore.qRegisterResourceData(0x01, qt_resource_struct, qt_resource_name, qt_resource_data) def qCleanupResources(): QtCore.qUnregisterResourceData(0x01, qt_resource_struct, qt_resource_name, qt_resource_data) qInitResources()
1,550
1,161
from unittest import TestCase from unittest.mock import patch, Mock import lineflow from lineflow import Dataset from lineflow.core import ConcatDataset, ZipDataset from lineflow.core import RandomAccessConcat, RandomAccessZip class RandomAccessConcatTestCase(TestCase): def setUp(self): self.n = 5 self.base = range(100) self.data = RandomAccessConcat(*[self.base for _ in range(5)]) def test_init(self): self.assertEqual(len(self.data._datasets), self.n) self.assertIsNone(self.data._offsets) self.assertIsNone(self.data._length) def test_iter(self): for x, y in zip(self.data, list(self.base) * self.n): self.assertEqual(x, y) self.assertIsNone(self.data._offsets) self.assertIsNone(self.data._length) def test_supports_random_access_lazily(self): import itertools self.assertIsNone(self.data._offsets) self.assertSequenceEqual(self.data, list(self.base) * self.n) expected_lengths = list(itertools.accumulate(len(self.base) for _ in range(self.n))) self.assertListEqual(self.data._lengths, expected_lengths) self.assertListEqual(self.data._offsets, [0] + expected_lengths[:-1]) def test_raises_index_error_with_invalid_index(self): with self.assertRaises(IndexError): self.data[len(self.data)] self.data[-1] def test_returns_length_lazily(self): self.assertIsNone(self.data._length) self.assertEqual(len(self.data), len(self.base) * self.n) self.assertEqual(self.data._length, len(self.data)) class RandomAccessZipTestCase(TestCase): def setUp(self): self.n = 5 self.base = range(100) self.data = RandomAccessZip(*[self.base for _ in range(5)]) def test_init(self): self.assertEqual(len(self.data._datasets), self.n) self.assertIsNone(self.data._length) def test_iter(self): for x, y in zip(self.data, self.base): self.assertEqual(x, tuple([y] * self.n)) self.assertIsNone(self.data._length) def test_supports_random_access(self): self.assertSequenceEqual(self.data, list(zip(*[self.base for _ in range(self.n)]))) def test_raises_index_error_with_invalid_index(self): with self.assertRaises(IndexError): self.data[len(self.data)] self.data[-1] def test_returns_lengths_lazily(self): self.assertIsNone(self.data._length) self.assertEqual(len(self.data), len(self.base)) self.assertEqual(self.data._length, len(self.data)) class DatasetTestCase(TestCase): def setUp(self): self.base = range(100) self.data = Dataset(self.base) def test_getitem(self): self.assertSequenceEqual(self.data, self.base) def test_supports_slicing(self): slice1 = slice(10, 20) slice2 = slice(0, 99) self.assertListEqual(self.data[slice1], list(self.base[slice1])) self.assertListEqual(self.data[slice2], list(self.base[slice2])) def test_len(self): self.assertEqual(len(self.data), len(self.base)) def test_add(self): data = self.data + self.data + self.data expected = list(self.base) * 3 self.assertSequenceEqual(data, expected) def test_map(self): def f(x): return x ** 2 self.assertSequenceEqual( self.data.map(f), list(map(f, self.base))) def test_keeps_original_dataset_after_multiple_maps(self): def f(x): return x data = self.data for i in range(100): data = data.map(f) self.assertEqual(data._dataset, self.base) self.assertEqual(len(data._funcs), i + 1) def test_supports_method_chain(self): data = self.data.map(lambda x: x ** 2).map(lambda x: x / 2) self.assertSequenceEqual( data, [x ** 2 / 2 for x in self.base]) def test_all(self): self.assertListEqual(self.data.all(), list(self.base)) def test_first(self): self.assertEqual(self.data.first(), self.base[0]) def test_take(self): n = 50 self.assertListEqual(self.data.take(n), list(self.base[:n])) @patch('lineflow.core.Path.open') @patch('lineflow.core.Path') @patch('lineflow.core.pickle.dump') def test_saves_yourself(self, pickle_dump_mock, Path_mock, open_mock): path = Mock() Path_mock.return_value = path # Assume cache doesn't exist, but a directory exists path.exists.return_value = False path.parent.exists.return_value = True # Setup Path.open fp = Mock() open_mock.return_value.__enter__.return_value = fp path.open = open_mock filepath = '/path/to/cache' data = self.data.save(filepath) path.exists.assert_called_once() path.parent.exists.assert_called_once() path.open.assert_called_once_with('wb') pickle_dump_mock.assert_called_once_with(self.data.all(), fp) self.assertIsInstance(data, lineflow.core.CacheDataset) @patch('lineflow.core.Path.open') @patch('lineflow.core.Path') @patch('lineflow.core.pickle.dump') def test_makes_a_directory_and_saves_yourself(self, pickle_dump_mock, Path_mock, open_mock): path = Mock() Path_mock.return_value = path # Assume cache doesn't exist, also a directory doesn't exist path.exists.return_value = False path.parent.exists.return_value = False # Setup Path.open fp = Mock() open_mock.return_value.__enter__.return_value = fp path.open = open_mock filepath = '/path/to/cache' data = self.data.save(filepath) path.exists.assert_called_once() path.parent.exists.assert_called_once() path.parent.mkdir.assert_called_once_with(parents=True) path.open.assert_called_once_with('wb') pickle_dump_mock.assert_called_once_with(self.data.all(), fp) self.assertIsInstance(data, lineflow.core.CacheDataset) @patch('lineflow.core.Path.open') @patch('lineflow.core.Path') @patch('lineflow.core.pickle.dump') def test_maps_func_and_saves_yourself(self, pickle_dump_mock, Path_mock, open_mock): path = Mock() Path_mock.return_value = path # Assume cache doesn't exist, but a directory exists path.exists.return_value = False path.parent.exists.return_value = True # Setup Path.open fp = Mock() open_mock.return_value.__enter__.return_value = fp path.open = open_mock filepath = '/path/to/cache' data = self.data.map(lambda x: x ** 2).save(filepath) path.exists.assert_called_once() path.parent.exists.assert_called_once() path.open.assert_called_once_with('wb') pickle_dump_mock.assert_called_once_with(data.all(), fp) self.assertIsInstance(data, lineflow.core.CacheDataset) self.assertListEqual(data._dataset, [x ** 2 for x in self.base]) for i, x in enumerate(data): y = self.data[i] ** 2 self.assertEqual(x, y) self.assertEqual(data[i], y) @patch('lineflow.core.Path.open') @patch('lineflow.core.Path') @patch('lineflow.core.pickle.load') def test_loads_existed_cache_implicitly(self, pickle_load_mock, Path_mock, open_mock): path = Mock() Path_mock.return_value = path # Assume cache exists path.exists.return_value = True # Setup Path.open fp = Mock() open_mock.return_value.__enter__.return_value = fp path.open = open_mock # Setup pickle.load pickle_load_mock.return_value = list(self.base) filepath = '/path/to/cache' data = self.data.save(filepath) path.exists.assert_called_once() path.open.assert_called_once_with('rb') pickle_load_mock.assert_called_once_with(fp) self.assertIsInstance(data, lineflow.core.CacheDataset) @patch('lineflow.core.open') @patch('lineflow.core.pickle.load') def test_load(self, pickle_load_mock, open_mock): pickle_load_mock.return_value = list(self.base) enter_mock = Mock() open_mock.return_value.__enter__.return_value = enter_mock filepath = '/path/to/dataset' data = lineflow.load(filepath) open_mock.assert_called_once_with(filepath, 'rb') pickle_load_mock.assert_called_once_with(enter_mock) self.assertListEqual(data.all(), list(self.base)) self.assertEqual(data._dataset, list(self.base)) with self.assertWarns(DeprecationWarning): lineflow.Dataset.load(filepath) class LineflowConcatTestCase(TestCase): def setUp(self): self.base = range(100) self.n = 5 self.data = lineflow.concat(*[Dataset(self.base)] * self.n) def test_returns_concat_dataset(self): self.assertIsInstance(self.data, ConcatDataset) self.assertIsInstance(self.data._dataset, RandomAccessConcat) def test_keeps_original_dataset_after_multiple_maps(self): def f(x): return x data = self.data for i in range(100): data = data.map(f) self.assertIsInstance(data._dataset, RandomAccessConcat) self.assertEqual(len(data._funcs), i + 1) def test_supports_random_access(self): self.assertSequenceEqual(self.data, list(self.base) * self.n) class LineflowZipTestCase(TestCase): def setUp(self): self.base = range(100) self.n = 5 self.data = lineflow.zip(*[Dataset(self.base)] * self.n) def test_returns_zip_dataset(self): self.assertIsInstance(self.data, ZipDataset) self.assertIsInstance(self.data._dataset, RandomAccessZip) def test_keeps_original_dataset_after_multiple_maps(self): def f(x): return x data = self.data for i in range(100): data = data.map(f) self.assertIsInstance(data._dataset, RandomAccessZip) self.assertEqual(len(data._funcs), i + 1) def test_supports_random_access(self): self.assertSequenceEqual(self.data, list(zip(*[self.base for _ in range(self.n)]))) class LineflowFilterTestCase(TestCase): def setUp(self): self.data = Dataset(range(100)) def test_returns_filtered_data_eagerly(self): result = lineflow.filter(lambda x: x % 2 == 0, self.data) expected = [x for x in self.data if x % 2 == 0] self.assertListEqual(result, expected) def test_returns_filtered_data_lazily(self): result = lineflow.filter(lambda x: x % 2 == 0, self.data, lazy=True) self.assertIsInstance(result, filter) expected = [x for x in self.data if x % 2 == 0] for x, y in zip(result, expected): self.assertEqual(x, y) class LineflowFlatMapTestCase(TestCase): def setUp(self): self.data = Dataset(range(100)) def test_returns_flat_mapped_data_eagerly(self): result = lineflow.flat_map(lambda x: [x] * 3, self.data) expected = [[x] * 3 for x in self.data] expected = [x for xs in expected for x in xs] self.assertListEqual(result, expected) def test_returns_flat_mapped_data_lazily(self): import itertools result = lineflow.flat_map(lambda x: [x] * 3, self.data, lazy=True) self.assertIsInstance(result, itertools.chain) expected = list(itertools.chain.from_iterable( [[x] * 3 for x in self.data])) for x, y in zip(result, expected): self.assertEqual(x, y)
12,081
3,895
import math import numpy as np def eng_string(x, format='%.3g', si=True): ''' Taken from: https://stackoverflow.com/questions/17973278/python-decimal-engineering-notation-for-mili-10e-3-and-micro-10e-6/40691220 Returns float/int value <x> formatted in a simplified engineering format - using an exponent that is a multiple of 3. format: printf-style string used to format the value before the exponent. si: if true, use SI suffix for exponent, e.g. k instead of e3, n instead of e-9 etc. E.g. with format='%.2f': 1.23e-08 => 12.30e-9 123 => 123.00 1230.0 => 1.23e3 -1230000.0 => -1.23e6 and with si=True: 1230.0 => 1.23k -1230000.0 => -1.23M ''' sign = '' if x < 0: x = -x sign = '-' exp = int(math.floor(math.log10(x))) exp3 = exp - (exp % 3) x3 = x / (10 ** exp3) if si and exp3 >= -24 and exp3 <= 24 and exp3 != 0: exp3_text = 'yzafpnum kMGTPEZY'[(exp3 + 24) // 3] elif exp3 == 0: exp3_text = '' else: exp3_text = 'e%s' % exp3 return ('%s' + format + '%s') % (sign, x3, exp3_text) remove_nans = lambda x: x[~np.isnan(x)] import sys import os from contextlib import contextmanager @contextmanager def stdout_redirected(to=os.devnull): ''' From StackOverflow: https://stackoverflow.com/questions/5081657/how-do-i-prevent-a-c-shared-library-to-print-on-stdout-in-python Usage: import os with stdout_redirected(to=filename): print("from Python") os.system("echo non-Python applications are also supported") ''' fd = sys.stdout.fileno() ##### assert that Python and C stdio write using the same file descriptor ####assert libc.fileno(ctypes.c_void_p.in_dll(libc, "stdout")) == fd == 1 def _redirect_stdout(to): sys.stdout.close() # + implicit flush() os.dup2(to.fileno(), fd) # fd writes to 'to' file sys.stdout = os.fdopen(fd, 'w') # Python writes to fd with os.fdopen(os.dup(fd), 'w') as old_stdout: with open(to, 'w') as file: _redirect_stdout(to=file) try: yield # allow code to be run with the redirected stdout finally: _redirect_stdout(to=old_stdout) # restore stdout. # buffering and flags such as # CLOEXEC may be different
2,393
898
# Directory.py # Import from flask import Blueprint, render_template # Make Blueprint for __init__.py Directory = Blueprint("Directory", __name__) # App Welcome Page @Directory.route('/') def index(): return render_template("home.html", message = "DS Med Cabinet API using natural language processing to recommend the best cannabis strains to Med Cabinet members.") # Strain JSON Page @Directory.route("/strainjson") def df(): return render_template("json.html") # Strain Table Page @Directory.route("/straintable") def dataframe(): return render_template("df.html")
595
173
# Generated by Django 3.1.1 on 2020-09-16 15:11 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ("product", "0124_auto_20200909_0904"), ] operations = [ migrations.AlterModelOptions( name="productvariant", options={"ordering": ("sort_order", "sku")}, ), migrations.AddField( model_name="productvariant", name="sort_order", field=models.IntegerField(db_index=True, editable=False, null=True), ), ]
567
189
__author__ = 'yinjun' """ Definition of TreeNode: class TreeNode: def __init__(self, val): this.val = val this.left, this.right = None, None """ class Solution: """ @param root: The root of binary tree. @return: buttom-up level order in a list of lists of integers """ def levelOrderBottom(self, root): # write your code here result = [] if root == None: return result queue = [] queue.append(root) l = 1 while l >0: level = [] for i in range(l): n = queue.pop(0) l -= 1 level.append(n.val) if n.left!=None: queue.append(n.left) l+=1 if n.right!=None: queue.append(n.right) l+=1 result.insert(0, level) return result
943
279
# -*- coding: utf-8 -*- from setuptools import setup, find_packages with open('requirements.txt') as f: install_requires = f.read().strip().split('\n') # get version from __version__ variable in mtrh_dev/__init__.py from mtrh_dev import __version__ as version setup( name='mtrh_dev', version=version, description='For all MTRH dev Frappe and ERPNext modifications', author='MTRH', author_email='erp@mtrh.go.ke', packages=find_packages(), zip_safe=False, include_package_data=True, install_requires=install_requires )
530
194
#!/usr/bin/env python3 import subprocess as sub import time import simplejson as json import os from sys import stderr import subprocess import platform import sys import stat import pwd import grp import BrewPiUtil as util import brewpiVersion import expandLogMessage from packaging import version from MigrateSettings import MigrateSettings from ConvertBrewPiDevice import ConvertBrewPiDevice msg_map = {"a": "Arduino"} def printStdErr(*objs): # Log to stderr.txt print(*objs, file=sys.stderr) sys.stderr.flush() def printStdOut(*objs): # Log to stdout.txt print(*objs, file=sys.stdout) sys.stderr.flush() def asbyte(v): return chr(v & 0xFF) class LightYModem: """ Receive_Packet - first byte SOH/STX (for 128/1024 byte size packets) - EOT (end) - CA CA abort - ABORT1 or ABORT2 is abort Then 2 bytes for seqno (although the sequence number isn't checked) Then the packet data Then CRC16? First packet sent is a filename packet: - zero-terminated filename - file size (ascii) followed by space? """ packet_len = 1024 stx = 2 eot = 4 ack = 6 nak = 0x15 ca = 0x18 crc16 = 0x43 abort1 = 0x41 abort2 = 0x61 def __init__(self): self.seq = None self.ymodem = None def _read_response(self): ch1 = '' while not ch1: ch1 = self.ymodem.read(1) ch1 = ord(ch1) if ch1 == LightYModem.ack and self.seq == 0: # may send also a crc16 ch2 = self.ymodem.read(1) elif ch1 == LightYModem.ca: # cancel, always sent in pairs ch2 = self.ymodem.read(1) return ch1 def _send_ymodem_packet(self, data): # pad string to 1024 chars data = data.ljust(LightYModem.packet_len) seqchr = asbyte(self.seq & 0xFF) seqchr_neg = asbyte((-self.seq-1) & 0xFF) crc16 = '\x00\x00' packet = asbyte(LightYModem.stx) + seqchr + seqchr_neg + data + crc16 if len(packet) != 1029: raise Exception("packet length is wrong!") self.ymodem.write(packet) self.ymodem.flush() response = self._read_response() if response == LightYModem.ack: printStdErr("Sent packet nr %d " % (self.seq)) self.seq += 1 return response def _send_close(self): self.ymodem.write(asbyte(LightYModem.eot)) self.ymodem.flush() response = self._read_response() if response == LightYModem.ack: self.send_filename_header("", 0) self.ymodem.close() def send_packet(self, file, output): response = LightYModem.eot data = file.read(LightYModem.packet_len) if len(data): response = self._send_ymodem_packet(data) return response def send_filename_header(self, name, size): self.seq = 0 packet = name + asbyte(0) + str(size) + ' ' return self._send_ymodem_packet(packet) def transfer(self, file, ymodem, output): self.ymodem = ymodem # file: the file to transfer via ymodem # ymodem: the ymodem endpoint (a file-like object supporting write) # output: a stream for output messages file.seek(0, os.SEEK_END) size = file.tell() file.seek(0, os.SEEK_SET) response = self.send_filename_header("binary", size) while response == LightYModem.ack: response = self.send_packet(file, output) file.close() if response == LightYModem.eot: self._send_close() return response def fetchBoardSettings(boardsFile, boardType): boardSettings = {} for line in boardsFile: line = line.decode() if line.startswith(boardType): # strip board name, period and \n setting = line.replace(boardType + '.', '', 1).strip() [key, sign, val] = setting.rpartition('=') boardSettings[key] = val return boardSettings def loadBoardsFile(arduinohome): boardsFileContent = None try: boardsFileContent = open( arduinohome + 'hardware/arduino/boards.txt', 'rb').readlines() except IOError: printStdErr( "Could not read boards.txt from Arduino, probably because Arduino has not been installed.") printStdErr("Please install it with: 'sudo apt install arduino-core'") return boardsFileContent def programController(config, boardType, hexFile, restoreWhat): programmer = SerialProgrammer.create(config, boardType) return programmer.program(hexFile, restoreWhat) def json_decode_response(line): try: return json.loads(line[2:]) except json.decoder.JSONDecodeError as e: printStdErr("\nJSON decode error: {0}".format(str(e))) printStdErr("\nLine received was: {0}".format(line)) class SerialProgrammer: @staticmethod def create(config, boardType): if boardType == 'arduino': msg_map["a"] = "Arduino" programmer = ArduinoProgrammer(config, boardType) if boardType == 'uno': msg_map["a"] = "Arduino" programmer = ArduinoProgrammer(config, boardType) else: msg_map["a"] = "Arduino" programmer = ArduinoProgrammer(config, boardType) return programmer def __init__(self, config): self.config = config self.restoreSettings = False self.restoreDevices = False self.ser = None self.versionNew = None self.versionOld = None self.oldSettings = {} def program(self, hexFile, restoreWhat): printStdErr("\n%(a)s program script started." % msg_map) self.parse_restore_settings(restoreWhat) if self.restoreSettings or self.restoreDevices: printStdErr("Checking old version before programming.\n") if not self.open_serial(self.config, 57600, 0.2): return 0 self.delay_serial_open() # request all settings from board before programming if self.fetch_current_version(): self.retrieve_settings_from_serial() self.save_settings_to_file() if not self.ser: if not self.open_serial(self.config, 57600, 0.2): return 0 self.delay_serial_open() if(hexFile): if not self.flash_file(hexFile): return 0 self.fetch_new_version() self.reset_settings() if self.restoreSettings or self.restoreDevices: printStdErr( "\nChecking which settings and devices may be restored.") if self.versionNew is None: printStdErr("\nWarning: Cannot receive version number from controller after programming.", "\nRestoring settings/devices settings failed.") return 0 if not self.versionOld and (self.restoreSettings or self.restoreDevices): printStdErr("\nCould not receive valid version number from old board, no settings/devices", "\nhave been restored.") return 0 if self.restoreSettings: printStdErr("\nTrying to restore compatible settings from {0} to {1}".format(self.versionOld.toString(), self.versionNew.toString())) if(self.versionNew.isNewer("0.2")): printStdErr( "\nSettings may only be restored when updating to BrewPi 0.2.0 or higher") self.restoreSettings = False if self.restoreSettings: self.restore_settings() if self.restoreDevices: self.restore_devices() printStdErr("\n%(a)s program script complete." % msg_map) self.ser.close() self.ser = None return 1 def parse_restore_settings(self, restoreWhat): restoreSettings = False restoreDevices = False if 'settings' in restoreWhat: if restoreWhat['settings']: if version.parse(self.versionNew) >= version.parse(self.versionOld): # Only restore settings on same or newer restoreSettings = True if 'devices' in restoreWhat: if restoreWhat['devices']: if version.parse(self.versionNew) >= version.parse(self.versionOld): # Only restore devices on same or newer restoreDevices = True # Even when restoreSettings and restoreDevices are set to True here, # they might be set to false due to version incompatibility later printStdErr("\nSettings will {0}be restored{1}.".format(("" if restoreSettings else "not "), (" if possible" if restoreSettings else ""))) printStdErr("\nDevices will {0}be restored{1}.\n".format(("" if restoreDevices else "not "), (" if possible" if restoreDevices else ""))) self.restoreSettings = restoreSettings self.restoreDevices = restoreDevices def open_serial(self, config, baud, timeout): if self.ser: self.ser.close() self.ser = None self.ser = util.setupSerial(config, baud, timeout, 1.0, True) if self.ser is None: return False return True def open_serial_with_retry(self, config, baud, timeout): # reopen serial port retries = 30 self.ser = None while retries: time.sleep(1) if self.open_serial(config, baud, timeout): return True retries -= 1 return False def delay_serial_open(self): pass def fetch_version(self, msg): version = brewpiVersion.getVersionFromSerial(self.ser) if version is None: printStdErr("\nWarning: Cannot receive version number from controller. Your controller is", "\neither not programmed yet or running a very old version of BrewPi. It will", "\nbe reset to defaults.") else: printStdErr("{0}\nFound:\n{1}\non port:{2}".format(msg, version.toExtendedString(), self.ser.name)) return version def fetch_current_version(self): self.versionOld = self.fetch_version("\nChecking current version:\n") return self.versionOld def fetch_new_version(self): self.versionNew = self.fetch_version("\nChecking new version:\n") return self.versionNew def retrieve_settings_from_serial(self): ser = self.ser self.oldSettings.clear() printStdErr("\nRequesting old settings from %(a)s." % msg_map) expected_responses = 2 # versions older than 2.0.0 did not have a device manager if not self.versionOld.isNewer("0.2.0"): expected_responses += 1 ser.write("d{}".encode()) # installed devices time.sleep(1) ser.write("c".encode()) # control constants ser.write("s".encode()) # control settings time.sleep(2) while expected_responses: line = ser.readline().decode() if line: line = util.asciiToUnicode(str(line)) if line[0] == 'C': expected_responses -= 1 self.oldSettings['controlConstants'] = json_decode_response( line) elif line[0] == 'S': expected_responses -= 1 self.oldSettings['controlSettings'] = json_decode_response( line) elif line[0] == 'd': expected_responses -= 1 self.oldSettings['installedDevices'] = json_decode_response( line) def save_settings_to_file(self): # This is format" "2019-01-08-16-50-15" oldSettingsFileName = 'settings-{0}.json'.format(time.strftime("%Y-%m-%dT%H-%M-%S")) settingsBackupDir = '{0}settings/controller-backup/'.format(util.addSlash(util.scriptPath())) if not os.path.exists(settingsBackupDir): os.makedirs(settingsBackupDir) # Set owner and permissions for directory fileMode = stat.S_IRWXU | stat.S_IRWXG | stat.S_IROTH | stat.S_IXOTH # 775 owner = 'brewpi' group = 'brewpi' uid = pwd.getpwnam(owner).pw_uid gid = grp.getgrnam(group).gr_gid os.chown(settingsBackupDir, uid, gid) # chown dir os.chmod(settingsBackupDir, fileMode) # chmod dir oldSettingsFilePath = os.path.join( settingsBackupDir, oldSettingsFileName) oldSettingsFile = open(oldSettingsFilePath, 'w') oldSettingsFile.write(json.dumps(self.oldSettings)) oldSettingsFile.truncate() oldSettingsFile.close() # Set owner and permissions for file fileMode = stat.S_IRUSR | stat.S_IWUSR | stat.S_IRGRP | stat.S_IWGRP # 660 owner = 'brewpi' group = 'brewpi' uid = pwd.getpwnam(owner).pw_uid gid = grp.getgrnam(group).gr_gid os.chown(oldSettingsFilePath, uid, gid) # chown file os.chmod(oldSettingsFilePath, fileMode) # chmod file printStdErr("\nSaved old settings to file {0}.".format(oldSettingsFileName)) def delay(self, countDown): printStdErr("") while countDown > 0: time.sleep(1) printStdErr("Back up in {0}.".format(str(countDown))) countDown -= 1 def reset_settings(self, setTestMode=False): printStdErr("\nResetting EEPROM to default settings.") self.ser.write('E\n'.encode()) if setTestMode: self.ser.write('j{mode:t}'.encode()) time.sleep(5) # resetting EEPROM takes a while, wait 5 seconds # read log messages from arduino while 1: # read all lines on serial interface line = self.ser.readline() if line: # line available? if line[0] == 'D': self.print_debug_log(line) else: break def print_debug_log(self, line): try: # debug message received expandedMessage = expandLogMessage.expandLogMessage(line[2:]) printStdErr(expandedMessage) except Exception as e: # catch all exceptions, because out of date file could cause errors printStdErr("\nError while expanding log message: {0}".format(str(e))) printStdErr(("%(a)s debug message: " % msg_map) + line[2:]) def restore_settings(self): oldSettingsDict = self.get_combined_settings_dict(self.oldSettings) ms = MigrateSettings() restored, omitted = ms.getKeyValuePairs(oldSettingsDict, self.versionOld.toString(), self.versionNew.toString()) printStdErr("\nMigrating these settings:\n{0}".format(json.dumps(dict(restored.items())))) printStdErr("\nOmitting these settings:\n{0}".format(json.dumps(dict(omitted.items())))) self.send_restored_settings(restored) def get_combined_settings_dict(self, oldSettings): # copy keys/values from controlConstants combined = oldSettings.get('controlConstants').copy() # add keys/values from controlSettings combined.update(oldSettings.get('controlSettings')) return combined def send_restored_settings(self, restoredSettings): for key in restoredSettings: setting = restoredSettings[key] command = "j{" + json.dumps(key) + ":" + \ json.dumps(setting) + "}\n" self.ser.write(command.encode()) # make readline blocking for max 5 seconds to give the controller time to respond after every setting oldTimeout = self.ser.timeout self.ser.timeout = 5 # read all replies while 1: line = self.ser.readline() if line: # line available? if line[0] == 'D': self.print_debug_log(line) if self.ser.inWaiting() == 0: #if self.ser.readline() == 0: # WiFi Change break self.ser.timeout = 5 def restore_devices(self): ser = self.ser oldDevices = self.oldSettings.get('installedDevices') if oldDevices: printStdErr("\nNow trying to restore previously installed devices:\n{0}".format(oldDevices)) else: printStdErr("\nNo devices to restore.") return detectedDevices = None for device in oldDevices: printStdErr("\nRestoring device:\n{0}".format(json.dumps(device))) if "a" in device.keys(): # check for sensors configured as first on bus if int(device['a'], 16) == 0: printStdErr("A OneWire sensor was configured to be autodetected as the first sensor on the", "\nbus, but this is no longer supported. We'll attempt to automatically find the", "\naddress and add the sensor based on its address.") if detectedDevices is None: ser.write("h{}".encode()) # installed devices time.sleep(1) # get list of detected devices for line in ser: if line[0] == 'h': detectedDevices = json_decode_response(line) for detectedDevice in detectedDevices: if device['p'] == detectedDevice['p']: # get address from sensor that was first on bus device['a'] = detectedDevice['a'] _temp = "U" + json.dumps(device) ser.write(_temp.encode()) requestTime = time.time() # read log messages from arduino while 1: # read all lines on serial interface line = ser.readline() if line: # line available? if line[0] == 'D': self.print_debug_log(line) elif line[0] == 'U': printStdErr( ("%(a)s reports: device updated to: " % msg_map) + line[2:]) break if time.time() > requestTime + 5: # wait max 5 seconds for an answer break printStdErr("\nRestoring installed devices done.") class ArduinoProgrammer(SerialProgrammer): def __init__(self, config, boardType): SerialProgrammer.__init__(self, config) self.boardType = boardType def delay_serial_open(self): if self.boardType == "uno": # Allow Arduino UNO to restart time.sleep(10) def flash_file(self, hexFile): config, boardType = self.config, self.boardType printStdErr("\nLoading programming settings from board.txt.") # Location of Arduino sdk arduinohome = config.get('arduinoHome', '/usr/share/arduino/') # Location of avr tools avrdudehome = config.get( 'avrdudeHome', arduinohome + 'hardware/tools/') # Default to empty string because avrsize is on path avrsizehome = config.get('avrsizeHome', '') # Location of global avr conf avrconf = config.get('avrConf', avrdudehome + 'avrdude.conf') boardsFile = loadBoardsFile(arduinohome) if not boardsFile: return False boardSettings = fetchBoardSettings(boardsFile, boardType) # Parse the Arduino board file to get the right program settings for line in boardsFile: line = line.decode() if line.startswith(boardType): # strip board name, period and \n _boardType = (boardType + '.').encode() setting = line.encode().replace(_boardType, ''.encode(), 1).strip() [key, sign, val] = setting.rpartition('='.encode()) boardSettings[key] = val printStdErr("\nChecking hex file size with avr-size.") # Start programming the Arduino avrsizeCommand = avrsizehome + 'avr-size ' + "\"" + hexFile + "\"" # Check program size against maximum size p = sub.Popen(avrsizeCommand, stdout=sub.PIPE, stderr=sub.PIPE, shell=True) output, errors = p.communicate() programSize = output.split()[7] printStdErr('\nProgram size: {0} bytes out of max {1}.'.format(programSize.decode(), boardSettings['upload.maximum_size'])) # Another check just to be sure if int(programSize.decode()) > int(boardSettings['upload.maximum_size']): printStdErr( "\nERROR: Program size is bigger than maximum size for your Arduino {0}.".format(boardType)) return False hexFileDir = os.path.dirname(hexFile) hexFileLocal = os.path.basename(hexFile) time.sleep(1) # Get serial port while in bootloader # Convert udev rule based port to /dev/tty* if not config['port'].startswith("/dev/tty"): convert = ConvertBrewPiDevice() config['port'] = convert.get_device_from_brewpidev(config['port']) bootLoaderPort = util.findSerialPort(bootLoader=True, my_port=config['port']) if not bootLoaderPort: printStdErr("\nERROR: Could not find port in bootloader.") return False programCommand = (avrdudehome + 'avrdude' + ' -F' + # override device signature check ' -e' + # erase flash and eeprom before programming. This prevents issues with corrupted EEPROM ' -p ' + boardSettings['build.mcu'] + ' -c ' + boardSettings['upload.protocol'] + ' -b ' + boardSettings['upload.speed'] + ' -P ' + bootLoaderPort + ' -U ' + 'flash:w:' + "\"" + hexFileLocal + "\"" + ' -C ' + avrconf) print("DEBUG: Programming command: {}".format(programCommand)) printStdErr("\nProgramming Arduino with avrdude.") p = sub.Popen(programCommand, stdout=sub.PIPE, stderr=sub.PIPE, shell=True, cwd=hexFileDir) output, errors = p.communicate() output = output.decode() errors = errors.decode() # avrdude only uses stderr, append its output to the returnString printStdErr("\nResult of invoking avrdude:{0}".format(errors)) if("bytes of flash verified" in errors): printStdErr("Avrdude done, programming successful.") else: printStdErr("There was an error while programming.") return False printStdErr("\nGiving the Arduino 10 seconds to reset.") self.delay(10) return True
23,062
6,650
""" MassOpenCloud / Hardware Isolation Layer (MOC/HIL) Slurm and *NX Subprocess Command Helpers May 2017, Tim Donahue tpd001@gmail.com """ import os from pwd import getpwnam, getpwuid from subprocess import Popen, PIPE from time import time from hil_slurm_constants import (HIL_RESNAME_PREFIX, HIL_RESNAME_FIELD_SEPARATOR, HIL_RESERVATION_OPERATIONS, RES_CREATE_FLAGS, HIL_RESERVE, HIL_RELEASE) from hil_slurm_settings import SLURM_INSTALL_DIR from hil_slurm_logging import log_debug, log_info, log_error def _output_debug_info(fname, stdout_data, stderr_data): log_debug('%s: Stdout %s' % (fname, stdout_data)) log_debug('%s: Stderr %s' % (fname, stderr_data)) def _exec_subprocess_cmd(cmd): ''' Execute a command in a subprocess and wait for completion ''' debug = False p = None try: p = Popen(cmd, stdout=PIPE, stderr=PIPE) (stdout_data, stderr_data) = p.communicate() except Exception as e: stdout_data = None stderr_data ='error: Exception on Popen or communicate' log_debug('Exception on Popen or communicate') log_debug('Exception: %s' % e) if debug: f = _exec_subprocess_cmd.__name__ log_debug('%s: cmd is %s' % (f, cmd)) log_debug('%s: stdout is %s' % (f, stdout_data)) log_debug('%s: stderr is %s' % (f, stderr_data)) return stdout_data, stderr_data def _scontrol_show_stdout_to_dict_list(stdout_data, stderr_data, debug=False): ''' Convert the 'scontrol show' stdout data to a list of dicts Nearly all params are of the form "keyword=value". If they all were, a neat functional one-liner would do... ''' stdout_dict_list = [] if len(stderr_data): return [] # Split the output and remove the trailing None from the subprocess output stdout_lines = stdout_data.split(os.linesep) stdout_lines = filter(None, stdout_lines) # Convert the output to a list of dicts for line in stdout_lines: stdout_line_dict = {} for kv_pair in line.split(' '): kv = kv_pair.split('=') if (len(kv) == 2): stdout_line_dict[kv[0]] = kv[1] elif debug: log_debug('Failed to convert `$s`' % kv_pair) stdout_dict_list.append(stdout_line_dict) return stdout_dict_list def exec_scontrol_cmd(action, entity, entity_id=None, debug=True, **kwargs): ''' Build an 'scontrol <action> <entity>' command and pass to an executor Specify single-line output to support stdout postprocessing ''' cmd = [os.path.join(SLURM_INSTALL_DIR, 'scontrol'), action] if entity: cmd.append(entity) if entity_id: cmd.append(entity_id) cmd.append('-o') if kwargs: for k, v in kwargs.iteritems(): cmd.append('%s=%s' % (k,v)) if debug: log_debug('exec_scontrol_cmd(): Command %s' % cmd) stdout_data, stderr_data = _exec_subprocess_cmd(cmd) if debug: log_debug('exec_scontrol_cmd(): Stdout %s' % stdout_data) log_debug('exec_scontrol_cmd(): Stderr %s' % stderr_data) return stdout_data, stderr_data def exec_scontrol_show_cmd(entity, entity_id, debug=False, **kwargs): ''' Run the 'scontrol show' command on the entity and ID Convert standard output data to a list of dictionaries, one per line ''' stdout_data, stderr_data = exec_scontrol_cmd('show', entity, entity_id, debug=debug, **kwargs) # Check for errors. # If anything in stderr, return it # Next, check if stdout includes various error strings - 'scontrol show' # writes error output to stdout. # Failure indications: # Reservation: stdout includes 'not found' # Job: stdout includes 'Invalid job id' # Copy stdout to stderr if found. # If stderr is empty, and stdout does not contain an error string, # convert stdout to a list of dicts and return that stdout_dict_list = [] entity_error_dict = { 'reservation': 'not found', 'job': 'Invalid job id' } cmd = 'scontrol show ' + entity if (len(stderr_data) != 0): log_debug('Command `%s` failed' % cmd) log_debug(' stderr: %s' % stderr_data) elif (entity in entity_error_dict) and (entity_error_dict[entity] in stdout_data): if debug: log_debug('Command `%s` failed' % cmd) log_debug(' stderr: %s' % stderr_data) stderr_data = stdout_data stdout_data = None else: stdout_dict_list = _scontrol_show_stdout_to_dict_list(stdout_data, stderr_data) return stdout_dict_list, stdout_data, stderr_data def create_slurm_reservation(name, user, t_start_s, t_end_s, nodes=None, flags=RES_CREATE_FLAGS, features=None, debug=False): ''' Create a Slurm reservation via 'scontrol create reservation' ''' if nodes is None: nodes = 'ALL' t_end_arg = {'duration': 'UNLIMITED'} if t_end_s is None else {'endtime': t_end_s} return exec_scontrol_cmd('create', 'reservation', entity_id=None, debug=debug, ReservationName=name, starttime=t_start_s, user=user, nodes=nodes, flags=flags, features=features, **t_end_arg) def delete_slurm_reservation(name, debug=False): ''' Delete a Slurm reservation via 'scontrol delete reservation=<name>' ''' return exec_scontrol_cmd('delete', None, debug=debug, reservation=name) def update_slurm_reservation(name, debug=False, **kwargs): ''' Update a Slurm reservation via 'scontrol update reservation=<name> <kwargs>' ''' return exec_scontrol_cmd('update', None, reservation=name, debug=debug, **kwargs) def get_hil_reservation_name(env_dict, restype_s, t_start_s): ''' Create a reservation name, combining the HIL reservation prefix, the username, the job ID, and the ToD (YMD_HMS) Structure: NamePrefix _ [release|reserve] _ uname _ job_UID _ str(int(time())) ''' resname = HIL_RESNAME_PREFIX + restype_s + HIL_RESNAME_FIELD_SEPARATOR resname += env_dict['username'] + HIL_RESNAME_FIELD_SEPARATOR resname += env_dict['job_uid'] + HIL_RESNAME_FIELD_SEPARATOR resname += str(int(time())) return resname def parse_hil_reservation_name(resname): ''' Attempt to split a reservation name into HIL reservation name components: HIL reservation prefix, reservation type, user name, uid, and time This looks like overkill, except for the presence of other reservations in the system, with semi-arbitrary names. ''' prefix = None restype = None user = None uid = None time_s = None if resname.startswith(HIL_RESNAME_PREFIX): resname_partitions = resname.partition(HIL_RESNAME_PREFIX) prefix = resname_partitions[1] try: restype, user, uid, time_s = resname_partitions[2].split(HIL_RESNAME_FIELD_SEPARATOR) except: pass return prefix, restype, user, uid, time_s def is_hil_reservation(resname, restype_in): ''' Check if the passed reservation name: - Starts with the HIL reservation prefix - Is a HIL reserve or release reservation - Contains a valid user name and UID - Optionally, is specifically a reserve or release reservation - $$$ Could verify nodes have HIL property set ''' prefix, restype, uname, uid, _ = parse_hil_reservation_name(resname) if (prefix != HIL_RESNAME_PREFIX): # log_error('No HIL reservation prefix') return False if restype_in: if (restype != restype_in): # log_error('Reservation type mismatch') return False elif restype not in HIL_RESERVATION_OPERATIONS: log_error('Unknown reservation type') return False try: pwdbe1 = getpwnam(uname) pwdbe2 = getpwuid(int(uid)) if pwdbe1 != pwdbe2: # log_error('Reservation `%s`: User and UID inconsistent' % resname) return False except KeyError: # log_error('Key error') return False return True def get_object_data(what_obj, obj_id, debug=False): ''' Get a list of dictionaries of information on the object, via 'scontrol show <what_object> <object_id>' ''' objdata_dict_list, stdout_data, stderr_data = exec_scontrol_show_cmd(what_obj, obj_id, debug=False) if (len(stderr_data) != 0): if debug: log_debug('Failed to retrieve data for %s `%s`' % (what_obj, obj_id)) log_debug(' %s' % stderr_data) return objdata_dict_list def get_partition_data(partition_id): ''' Get a list of dictionaries of information on the partition(s), via 'scontrol show partition' ''' return get_object_data('partition', partition_id, debug=False) def get_job_data(job_id): ''' Get a list of dictionaries of information on the job(s), via 'scontrol show job' ''' return get_object_data('job', job_id, debug=False) def get_hil_reservations(): ''' Get a list of all Slurm reservations, return that subset which are HIL reservations ''' resdata_dict_list = [] resdata_dict_list, stdout_data, stderr_data = exec_scontrol_show_cmd('reservation', None) for resdata_dict in resdata_dict_list: if resdata_dict and is_hil_reservation(resdata_dict['ReservationName'], None): continue else: resdata_dict_list.remove(resdata_dict) return resdata_dict_list def log_hil_reservation(resname, stderr_data, t_start_s=None, t_end_s=None): if len(stderr_data): log_error('Error creating reservation `%s`'% resname) log_error(' Error string: %s' % stderr_data.strip('\n'), separator=False) else: log_info('Created HIL reservation `%s`' % resname) # EOF
10,086
3,273
# -*- coding: utf-8 -*- # PyContourlet # # A Python library for the Contourlet Transform. # # Copyright (C) 2011 Mazay Jiménez # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation version 2. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this program; if not, write to the Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. from numpy import * # from scipy.signal.filter_design import firwin from .mctrans import * from .modulate2 import * from .ldfilter import * from .ld2quin import * from .reverse2 import * from .dmaxflat import * def dfilters(fname, type): """ DFILTERS Generate directional 2D filters Input: fname: Filter name. Available 'fname' are: 'haar': the Haar filters 'vk': McClellan transformed of the filter from the VK book 'ko': orthogonal filter in the Kovacevic's paper 'kos': smooth 'ko' filter 'lax': 17 x 17 by Lu, Antoniou and Xu 'sk': 9 x 9 by Shah and Kalker 'cd': 7 and 9 McClellan transformed by Cohen and Daubechies 'pkva': ladder filters by Phong et al. 'oqf_362': regular 3 x 6 filter 'dvmlp': regular linear phase biorthogonal filter with 3 dvm 'sinc': ideal filter (*NO perfect recontruction*) 'dmaxflat': diamond maxflat filters obtained from a three stage ladder type: 'd' or 'r' for decomposition or reconstruction filters Output: h0, h1: diamond filter pair (lowpass and highpass) To test those filters (for the PR condition for the FIR case), verify that: convolve(h0, modulate2(h1, 'b')) + convolve(modulate2(h0, 'b'), h1) = 2 (replace + with - for even size filters) To test for orthogonal filter convolve(h, reverse2(h)) + modulate2(convolve(h, reverse2(h)), 'b') = 2 """ # The diamond-shaped filter pair if fname == "haar": if str.lower(type[0]) == 'd': h0 = array([1, 1]) / sqrt(2) h1 = array([-1, 1]) / sqrt(2) else: h0 = array([1, 1]) / sqrt(2) h1 = array([1, -1]) / sqrt(2) return h0, h1 elif fname == "vk": if str.lower(type[0]) == 'd': h0 = array([1, 2, 1]) / 4.0 h1 = array([-1, -2, 6, -2, -1]) / 4.0 else: h0 = array([-1, 2, 6, 2, -1]) / 4.0 h1 = array([-1, 2, -1]) / 4.0 # McClellan transfrom to obtain 2D diamond filters t = array([[0, 1, 0], [1, 0, 1], [0, 1, 0]]) / 4.0 # diamond kernel h0 = mctrans(h0, t) h1 = mctrans(h1, t) return h0, h1 elif fname == "ko": # orthogonal filters in Kovacevic's thesis a0, a1, a2 = 2, 0.5, 1 h0 = array([[0, -a1, -a0 * a1, 0], [-a2, -a0 * a2, -a0, 1], [0, a0 * a1 * a2, -a1 * a2, 0]]) # h1 = qmf2(h0); h1 = array([[0, -a1 * a2, -a0 * a1 * a2, 0], [1, a0, -a0 * a2, a2], [0, -a0 * a1, a1, 0]]) # Normalize filter sum and norm; norm = sqrt(2) / sum(h0) h0 = h0 * norm h1 = h1 * norm if str.lower(type[0]) == 'r': # Reverse filters for reconstruction h0 = h0[::-1, ::-1] h1 = h1[::-1, ::-1] return h0, h1 elif fname == "kos": # Smooth orthogonal filters in Kovacevic's thesis a0, a1, a2 = -sqrt(3), -sqrt(3), 2 + sqrt(3) h0 = array([[0, -a1, -a0 * a1, 0], [-a2, -a0 * a2, -a0, 1], [0, a0 * a1 * a2, -a1 * a2, 0]]) # h1 = qmf2(h0); h1 = array([[0, -a1 * a2, -a0 * a1 * a2, 0], [1, a0, -a0 * a2, a2], [0, -a0 * a1, a1, 0]]) # Normalize filter sum and norm; norm = sqrt(2) / sum(h0) h0 = h0 * norm h1 = h1 * norm if str.lower(type[0]) == 'r': # Reverse filters for reconstruction h0 = h0[::-1, ::-1] h1 = h1[::-1, ::-1] return h0, h1 elif fname == "lax": # by Lu, Antoniou and Xu h = array([[-1.2972901e-5, 1.2316237e-4, -7.5212207e-5, 6.3686104e-5, 9.4800610e-5, -7.5862919e-5, 2.9586164e-4, -1.8430337e-4], [1.2355540e-4, -1.2780882e-4, -1.9663685e-5, -4.5956538e-5, -6.5195193e-4, -2.4722942e-4, -2.1538331e-5, -7.0882131e-4], [-7.5319075e-5, -1.9350810e-5, -7.1947086e-4, 1.2295412e-3, 5.7411214e-4, 4.4705422e-4, 1.9623554e-3, 3.3596717e-4], [6.3400249e-5, -2.4947178e-4, 4.4905711e-4, -4.1053629e-3, -2.8588307e-3, 4.3782726e-3, -3.1690509e-3, -3.4371484e-3], [9.6404973e-5, -4.6116254e-5, 1.2371871e-3, -1.1675575e-2, 1.6173911e-2, -4.1197559e-3, 4.4911165e-3, 1.1635130e-2], [-7.6955555e-5, -6.5618379e-4, 5.7752252e-4, 1.6211426e-2, 2.1310378e-2, -2.8712621e-3, -4.8422645e-2, -5.9246338e-3], [2.9802986e-4, -2.1365364e-5, 1.9701350e-3, 4.5047673e-3, -4.8489158e-2, -3.1809526e-3, -2.9406153e-2, 1.8993868e-1], [-1.8556637e-4, -7.1279432e-4, 3.3839195e-4, 1.1662001e-2, -5.9398223e-3, -3.4467920e-3, 1.9006499e-1, 5.7235228e-1]]) h0 = sqrt(2) * vstack((hstack((h, h[:, len(h) - 2::-1])), hstack((h[len(h) - 2::-1, :], h[len(h) - 2::-1, len(h) - 2::-1])))) h1 = modulate2(h0, 'b', None) return h0, h1 elif fname == "sk": # by Shah and Kalker h = array([[0.621729, 0.161889, -0.0126949, -0.00542504, 0.00124838], [0.161889, -0.0353769, -0.0162751, -0.00499353, 0], [-0.0126949, -0.0162751, 0.00749029, 0, 0], [-0.00542504, 0.00499353, 0, 0, 0], [0.00124838, 0, 0, 0, 0]]) h0 = sqrt(2) * vstack((hstack((h[len(h):0:-1, len(h):0:-1], h[len(h):0:-1, :])), hstack((h[:, len(h):0:-1], h)))) h1 = modulate2(h0, 'b', None) return h0, h1 elif fname == "dvmlp": q = sqrt(2) b = 0.02 b1 = b * b h = array([[b / q, 0, -2 * q * b, 0, 3 * q * b, 0, -2 * q * b, 0, b / q], [0, -1 / (16 * q), 0, 9 / (16 * q), 1 / q, 9 / (16 * q), 0, -1 / (16 * q), 0], [b / q, 0, -2 * q * b, 0, 3 * q * b, 0, -2 * q * b, 0, b / q]]) g0 = array([[-b1 / q, 0, 4 * b1 * q, 0, -14 * q * b1, 0, 28 * q * b1, 0, -35 * q * b1, 0, 28 * q * b1, 0, -14 * q * b1, 0, 4 * b1 * q, 0, -b1 / q], [0, b / (8 * q), 0, -13 * b / (8 * q), b / q, 33 * b / (8 * q), -2 * q * b, -21 * b / (8 * q), 3 * q * b, -21 * b / (8 * q), -2 * q * b, 33 * b / (8 * q), b / q, -13 * b / (8 * q), 0, b / (8 * q), 0], [-q * b1, 0, -1 / (256 * q) + 8 * q * b1, 0, 9 / (128 * q) - 28 * q * b1, -1 / (q * 16), -63 / (256 * q) + 56 * q * b1, 9 / (16 * q), 87 / (64 * q) - 70 * q * b1, 9 / (16 * q), -63 / (256 * q) + 56 * q * b1, -1 / (q * 16), 9 / (128 * q) - 28 * q * b1, 0, -1 / (256 * q) + 8 * q * b1, 0, -q * b1], [0, b / (8 * q), 0, -13 * b / (8 * q), b / q, 33 * b / (8 * q), -2 * q * b, -21 * b / (8 * q), 3 * q * b, -21 * b / (8 * q), -2 * q * b, 33 * b / (8 * q), b / q, -13 * b / (8 * q), 0, b / (8 * q), 0], [-b1 / q, 0, 4 * b1 * q, 0, -14 * q * b1, 0, 28 * q * b1, 0, -35 * q * b1, 0, 28 * q * b1, 0, -14 * q * b1, 0, 4 * b1 * q, 0, -b1 / q]]) h1 = modulate2(g0, 'b', None) h0 = h.copy() if str.lower(type[0]) == 'r': h1 = modulate2(h, 'b', None) h0 = g0.copy() return h0, h1 elif fname == "cd" or fname == "7-9": # by Cohen and Daubechies # 1D prototype filters: the '7-9' pair h0 = array([0.026748757411, -0.016864118443, -0.078223266529, 0.266864118443, 0.602949018236, 0.266864118443, -0.078223266529, -0.016864118443, 0.026748757411]) g0 = array([-0.045635881557, -0.028771763114, 0.295635881557, 0.557543526229, 0.295635881557, -0.028771763114, -0.045635881557]) if str.lower(type[0]) == 'd': h1 = modulate2(g0, 'c', None) else: h1 = modulate2(h0, 'c', None) h0 = g0.copy() # Use McClellan to obtain 2D filters t = array([[0, 1, 0], [1, 0, 1], [0, 1, 0]]) / 4.0 # diamond kernel h0 = sqrt(2) * mctrans(h0, t) h1 = sqrt(2) * mctrans(h1, t) return h0, h1 elif fname == "pkva" or fname == "ldtest": # Filters from the ladder structure # Allpass filter for the ladder structure network beta = ldfilter(fname) # Analysis filters h0, h1 = ld2quin(beta) # Normalize norm h0 = sqrt(2) * h0 h1 = sqrt(2) * h1 # Synthesis filters if str.lower(type[0]) == 'r': f0 = modulate2(h1, 'b', None) f1 = modulate2(h0, 'b', None) h0 = f0.copy() h1 = f1.copy() return h0, h1 # elif fname == "pkva-half4": # Filters from the ladder structure # # Allpass filter for the ladder structure network # beta = ldfilterhalf(4) # # # Analysis filters # h0, h1 = ld2quin(beta) # # # Normalize norm # h0 = sqrt(2) * h0 # h1 = sqrt(2) * h1 # # # Synthesis filters # if str.lower(type[0]) == 'r': # f0 = modulate2(h1, 'b', None) # f1 = modulate2(h0, 'b', None) # h0 = f0 # h1 = f1 # return h0, h1 # # elif fname == "pkva-half6": # Filters from the ladder structure # # Allpass filter for the ladder structure network # beta = ldfilterhalf(6) # # # Analysis filters # h0, h1 = ld2quin(beta) # # # Normalize norm # h0 = sqrt(2) * h0 # h1 = sqrt(2) * h1 # # # Synthesis filters # if srtring.lower(type[0]) == 'r': # f0 = modulate2(h1, 'b', None) # f1 = modulate2(h0, 'b', None) # h0 = f0 # h1 = f1 # return h0, h1 # # elif fname == "pkva-half8": # Filters from the ladder structure # # Allpass filter for the ladder structure network # beta = ldfilterhalf(8) # # # Analysis filters # h0, h1 = ld2quin(beta) # # # Normalize norm # h0 = sqrt(2) * h0 # h1 = sqrt(2) * h1 # # # Synthesis filters # if str.lower(type[0]) == 'r': # f0 = modulate2(h1, 'b', None) # f1 = modulate2(h0, 'b', None) # h0 = f0 # h1 = f1 # return h0, h1 # elif fname == "sinc": # The "sinc" case, NO Perfect Reconstruction # # Ideal low and high pass filters # flength = 30 # # h0 = firwin(flength + 1, 0.5) # h1 = modulate2(h0, 'c', None) # # # Use McClellan to obtain 2D filters # t = array([[0, 1, 0], [1, 0, 1], [0, 1, 0]]) / 4.0 # diamond kernel # h0 = sqrt(2) * mctrans(h0, t) # h1 = sqrt(2) * mctrans(h1, t) # return h0, h1 elif fname == "oqf_362": # Some "home-made" filters! h0 = sqrt(2) / 64 * array([[sqrt(15), -3, 0], [0, 5, -sqrt(15)], [-2 * sqrt(15), 30, 0], [0, 30, 2 * sqrt(15)], [sqrt(15), 5, 0], [0, -3, -sqrt(15)]]).conj().T h1 = -reverse2(modulate2(h0, 'b', None)) if str.lower(type[0]) == 'r': # Reverse filters for reconstruction h0 = h0[::-1, ::-1] h1 = h1[::-1, ::-1] return h0, h1 elif fname == "test": # Only for the shape, not for PR h0 = array([[0, 1, 0], [1, 4, 1], [0, 1, 0]]) h1 = array([[0, -1, 0], [-1, 4, -1], [0, -1, 0]]) return h0, h1 elif fname == "testDVM": # Only for directional vanishing moment h0 = array([[1, 1], [1, 1]]) / sqrt(2) h1 = array([[-1, 1], [1, -1]]) / sqrt(2) return h0, h1 elif fname == "qmf": # by Lu, Antoniou and Xu # ideal response # window m, n = 2, 2 w = empty([5, 5]) w1d = kaiser(4 * m + 1, 2.6) for n1 in range(-m, m + 1): for n2 in range(-n, n + 1): w[n1 + m, n2 + n] = w1d[2 * m + n1 + n2] * w1d[2 * m + n1 - n2] h = empty([5, 5]) for n1 in range(-m, m + 1): for n2 in range(-n, n + 1): h[n1 + m, n2 + n] = .5 * sinc((n1 + n2) / 2.0) * .5 * sinc((n1 - n2) / 2.0) c = sum(h) h = sqrt(2) * h / c h0 = h * w h1 = modulate2(h0, 'b', None) return h0, h1 #h0 = modulate2(h,'r'); #h1 = modulate2(h,'b'); elif fname == "qmf2": # by Lu, Antoniou and Xu # ideal response # window h = array([[-.001104, .002494, -0.001744, 0.004895, -0.000048, -.000311], [0.008918, -0.002844, -0.025197, -0.017135, 0.003905, -0.000081], [-0.007587, -0.065904, 0.100431, -0.055878, 0.007023, 0.001504], [0.001725, 0.184162, 0.632115, 0.099414, -0.027006, -0.001110], [-0.017935, -0.000491, 0.191397, -0.001787, -0.010587, 0.002060], [.001353, 0.005635, -0.001231, -0.009052, -0.002668, 0.000596]]) h0 = h / sum(h) h1 = modulate2(h0, 'b', None) return h0, h1 #h0 = modulate2(h,'r'); #h1 = modulate2(h,'b'); elif fname == "dmaxflat4": M1 = 1 / sqrt(2) M2 = M1 k1 = 1 - sqrt(2) k3 = k1 k2 = M1 h = array([.25 * k2 * k3, .5 * k2, 1 + .5 * k2 * k3]) * M1 h = hstack((h, h[len(h) - 2::-1])) g = array([-.125 * k1 * k2 * k3, 0.25 * k1 * k2, (-0.5 * k1 - 0.5 * k3 - 0.375 * k1 * k2 * k3), 1 + .5 * k1 * k2]) * M2 g = hstack((g, g[len(g) - 2::-1])) B = dmaxflat(4, 0) h0 = mctrans(h, B) g0 = mctrans(g, B) h0 = sqrt(2) * h0 / sum(h0) g0 = sqrt(2) * g0 / sum(g0) h1 = modulate2(g0, 'b', None) if str.lower(type[0]) == 'r': h1 = modulate2(h0, 'b', None) h0 = g0.copy() return h0, h1 elif fname == "dmaxflat5": M1 = 1 / sqrt(2) M2 = M1 k1 = 1 - sqrt(2) k3 = k1 k2 = M1 h = array([.25 * k2 * k3, .5 * k2, 1 + .5 * k2 * k3]) * M1 h = hstack((h, h[len(h) - 2::-1])) g = array([-.125 * k1 * k2 * k3, 0.25 * k1 * k2, (-0.5 * k1 - 0.5 * k3 - 0.375 * k1 * k2 * k3), 1 + .5 * k1 * k2]) * M2 g = hstack((g, g[len(g) - 2::-1])) B = dmaxflat(5, 0) h0 = mctrans(h, B) g0 = mctrans(g, B) h0 = sqrt(2) * h0 / sum(h0) g0 = sqrt(2) * g0 / sum(g0) h1 = modulate2(g0, 'b', None) if str.lower(type[0]) == 'r': h1 = modulate2(h0, 'b', None) h0 = g0.copy() return h0, h1 elif fname == "dmaxflat6": M1 = 1 / sqrt(2) M2 = M1 k1 = 1 - sqrt(2) k3 = k1 k2 = M1 h = array([.25 * k2 * k3, .5 * k2, 1 + .5 * k2 * k3]) * M1 h = hstack((h, h[len(h) - 2::-1])) g = array([-.125 * k1 * k2 * k3, 0.25 * k1 * k2, (-0.5 * k1 - 0.5 * k3 - 0.375 * k1 * k2 * k3), 1 + .5 * k1 * k2]) * M2 g = hstack((g, g[len(g) - 2::-1])) B = dmaxflat(6, 0) h0 = mctrans(h, B) g0 = mctrans(g, B) h0 = sqrt(2) * h0 / sum(h0) g0 = sqrt(2) * g0 / sum(g0) h1 = modulate2(g0, 'b', None) if str.lower(type[0]) == 'r': h1 = modulate2(h0, 'b', None) h0 = g0.copy() return h0, h1 elif fname == "dmaxflat7": M1 = 1 / sqrt(2) M2 = M1 k1 = 1 - sqrt(2) k3 = k1 k2 = M1 h = array([.25 * k2 * k3, .5 * k2, 1 + .5 * k2 * k3]) * M1 h = hstack((h, h[len(h) - 2::-1])) g = array([-.125 * k1 * k2 * k3, 0.25 * k1 * k2, (-0.5 * k1 - 0.5 * k3 - 0.375 * k1 * k2 * k3), 1 + .5 * k1 * k2]) * M2 g = hstack((g, g[len(g) - 2::-1])) B = dmaxflat(7, 0) h0 = mctrans(h, B) g0 = mctrans(g, B) h0 = sqrt(2) * h0 / sum(h0) g0 = sqrt(2) * g0 / sum(g0) h1 = modulate2(g0, 'b') if str.lower(type[0]) == 'r': h1 = modulate2(h0, 'b') h0 = g0.copy() return h0, h1
17,596
8,304
""" External libraries packaged with for version stability """ from .tabulate import tabulate
96
25
# -*- coding: utf-8 -*- from boltons.statsutils import Stats def test_stats_basic(): da = Stats(range(20)) assert da.mean == 9.5 assert round(da.std_dev, 2) == 5.77 assert da.variance == 33.25 assert da.skewness == 0 assert round(da.kurtosis, 1) == 1.9 assert da.median == 9.5 def _test_pearson(): import random from statsutils import pearson_type def get_pt(dist): vals = [dist() for x in range(10000)] pt = pearson_type(vals) return pt for x in range(3): # pt = get_pt(dist=lambda: random.normalvariate(15, 5)) # expect 0, normal # pt = get_pt(dist=lambda: random.weibullvariate(2, 3)) # gets 1, beta, weibull not specifically supported # pt = get_pt(dist=lambda: random.gammavariate(2, 3)) # expect 3, gamma # pt = get_pt(dist=lambda: random.betavariate(2, 3)) # expect 1, beta # pt = get_pt(dist=lambda: random.expovariate(0.2)) # expect 3, beta pt = get_pt(dist=lambda: random.uniform(0.0, 10.0)) # gets 2 print('pearson type:', pt) # import pdb;pdb.set_trace()
1,112
442
import os import pprint import json import random accept = False colors = { "Vo": "#e05ab4", "Da": "#59afe1", "Vi": "#e0e05a" } with open('idols.json') as f: idols = (json.load(f))["idols"] # Insert 23 data def pick(msg): global accept if not accept: print("Not accept") return for i in range(5): pick_one(msg) accept = False def pick_one(msg): global idols idolno = random.randrange(len(idols)) idol = idols[idolno] print(f"{msg.user['real_name']} gets {idol['unit']} {idol['name']}") attachments = [ { 'title': idol['name'], 'text': f"所属ユニット: {idol['unit']}", 'color': colors[idol["type"]], 'image_url': idol["url"] }] msg.send_webapi('', json.dumps(attachments)) def command(): global accept ipt = input() print(f"Get input: {ipt}") if ipt == "a": accept = True print("Set accept") elif ipt == "d": accept = False print("Set deny")
1,018
385
class WorldState(object): def __init__(self): self.variables = {} def clone(self): temporary_world_state = WorldState() temporary_world_state.variables = self.variables return temporary_world_state
240
64
"""Plot Widgets for the UWB Simulation GUI This file contains several plot widgets that can be used to plot simulation data in real time and redraw the plots with matplotlib for better quality. Classes: QLivePlot: Base class for real time plots QLivePlot_Groundtrack: Real time plot for groundtrack QLivePlot_Position: Real time plot for x, y, z positions QLivePlot_Velocity: Real time plot for x, y, z velocities QLivePlot_Attitude: Real time plot for attitude """ from PyQt5 import QtWidgets import pyqtgraph as pg import matplotlib.pyplot as plt import numpy as np from UWBsim.utils import dataTypes class QLivePlot(QtWidgets.QWidget): """Base Class for real time plots using pyqtgraph Methods: reset: clear the plot area and data update_data: Pass new data to the plot widget update_plot: Update the plot with the most recent data """ def __init__(self, *args, **kwargs): """Initialize the QLivePlot class Initializes the widget and creates the basic elements required for plotting. """ super(QLivePlot,self).__init__(*args, **kwargs) self.layout = QtWidgets.QVBoxLayout() self.canvas = pg.GraphicsLayoutWidget() self.canvas.setBackground('#FAFAFA') self.layout.addWidget(self.canvas) self.export_button = QtWidgets.QPushButton('plot with matplotlib') self.export_button.clicked.connect(self._export_button_clicked) self.layout.addWidget(self.export_button) self.setLayout(self.layout) # same colors used by matplotlib #self.data_colors = ['#1F77B4','#FF7F0E','#2CA02C','#D62728','#9467BD','#8C564B'] # Switch true and ekf color for publication self.data_colors = ['#2CA02C','#FF7F0E','#1F77B4','#D62728','#9467BD','#8C564B'] self.n_subplots = 1 self.data = [{}] self.lines = [{}] def reset(self): for i in range(self.n_subplots): self.plot_area[i].clear() self.plot_area[i].legend.items = [] self.data = [{} for _ in range(self.n_subplots)] self.lines = [{} for _ in range(self.n_subplots)] def update_data(self, **estimates): return NotImplemented def update_plot(self): for i in range(self.n_subplots): for key, values in self.data[i].items(): if key in self.lines[i]: self.lines[i][key].setData(values[0], values[1]) else: color_i = len(self.lines[i]) self.lines[i][key] = self.plot_area[i].plot(values[0], values[1], name=key, pen=self.data_colors[color_i]) def _export_button_clicked(self): plt.rcParams.update({ "text.usetex": True, "font.family": "serif", "font.serif": ["Computer Modern Roman"], }) fig = plt.figure() ax = [] for i in range(self.n_subplots): ax.append(fig.add_subplot(self.n_subplots,1,i+1)) legend = [] for key, values in self.data[i].items(): ax[i].plot(values[0], values[1]) legend.append(key) ax[i].legend(legend) ax[i].grid(b=True) plt.show() class QLivePlot_GroundTrack(QLivePlot): def __init__(self, *args, **kwargs): super(QLivePlot_GroundTrack, self).__init__(*args, **kwargs) self.n_subplots = 1 self.plot_area = [] self.plot_area.append(self.canvas.addPlot()) self.plot_area[0].setTitle('Ground Track') self.plot_area[0].setLabels(left='y [m]', bottom='x [m]') self.plot_area[0].setXRange(-4,4,padding=0) self.plot_area[0].setYRange(-4,4,padding=0) self.plot_area[0].showGrid(x=True, y=True) self.plot_area[0].addLegend() self.color_i = 0 def update_data(self, **drone_state_data): for key, state in drone_state_data.items(): if key == 'time': continue else: x = state[0] y = state[1] if key in self.data[0]: self.data[0][key][0].append(x) self.data[0][key][1].append(y) else: self.data[0][key] = [[x],[y]] self.color_i += 1 def _export_button_clicked(self): plt.rcParams.update({ "text.usetex": True, "font.family": "serif", "font.serif": ["Computer Modern Roman"], }) fig = plt.figure() ax = [] for i in range(self.n_subplots): ax.append(fig.add_subplot(self.n_subplots,1,i+1)) legend = [] j = 0 for key, values in self.data[i].items(): ax[i].plot(values[0], values[1], color=self.data_colors[j]) legend.append(key) j += 1 #ax[i].legend(legend) # Publication legend ax[i].legend(["Ground truth","MHE", "EKF"]) ax[i].grid(b=True) ax[i].set_xlabel('x [m]') ax[i].set_ylabel('y [m]') #ax[i].set_title('Groundtrack') plt.show() class QLivePlot_Position(QLivePlot): def __init__(self, *args, **kwargs): super(QLivePlot_Position, self).__init__(*args, **kwargs) self.n_subplots = 3 self.data = [{},{},{}] self.lines = [{},{},{}] self.plot_area = [] for i in range(self.n_subplots): self.plot_area.append(self.canvas.addPlot()) self.plot_area[i].showGrid(x=True, y=True) self.plot_area[i].addLegend() self.canvas.nextRow() self.plot_area[0].setLabels(left='x [m]', bottom='t [s]') self.plot_area[1].setLabels(left='y [m]', bottom='t [s]') self.plot_area[2].setLabels(left='z [m]', bottom='t [s]') self.color_i = 0 def update_data(self, **drone_state_data): for key,state in drone_state_data.items(): if key == 'time': continue else: x = state[0] y = state[1] z = state[2] t = drone_state_data['time'] if key in self.data[0]: self.data[0][key][0].append(t) self.data[0][key][1].append(x) self.data[1][key][0].append(t) self.data[1][key][1].append(y) self.data[2][key][0].append(t) self.data[2][key][1].append(z) else: self.data[0][key] = [[t],[x]] self.data[1][key] = [[t],[y]] self.data[2][key] = [[t],[z]] def _export_button_clicked(self): plt.rcParams.update({ "text.usetex": True, "font.family": "serif", "font.serif": ["Computer Modern Roman"], }) ylabels = ['x [m]', 'y [m]', 'z [m]'] fig = plt.figure() ax = [] for i in range(self.n_subplots): ax.append(fig.add_subplot(self.n_subplots,1,i+1)) legend = [] for key, values in self.data[i].items(): ax[i].plot(values[0], values[1]) legend.append(key) ax[i].legend(legend) ax[i].grid(b=True) ax[i].set_xlabel('t [s]') ax[i].set_ylabel(ylabels[i]) plt.show() class QLivePlot_Velocity(QLivePlot): def __init__(self, *args, **kwargs): super(QLivePlot_Velocity, self).__init__(*args, **kwargs) self.n_subplots = 3 self.data = [{},{},{}] self.lines = [{},{},{}] self.plot_area = [] for i in range(self.n_subplots): self.plot_area.append(self.canvas.addPlot()) self.plot_area[i].showGrid(x=True, y=True) self.plot_area[i].addLegend() self.canvas.nextRow() self.plot_area[0].setLabels(left='vx [m/s]', bottom='t [s]') self.plot_area[1].setLabels(left='vy [m/s]', bottom='t [s]') self.plot_area[2].setLabels(left='vz [m/s]', bottom='t [s]') self.color_i = 0 def update_data(self, **drone_state_data): for key,state in drone_state_data.items(): if key == 'time': continue else: vx = state[3] vy = state[4] vz = state[5] t = drone_state_data['time'] if key in self.data[0]: self.data[0][key][0].append(t) self.data[0][key][1].append(vx) self.data[1][key][0].append(t) self.data[1][key][1].append(vy) self.data[2][key][0].append(t) self.data[2][key][1].append(vz) else: self.data[0][key] = [[t],[vx]] self.data[1][key] = [[t],[vy]] self.data[2][key] = [[t],[vz]] class QLivePlot_Attitude(QLivePlot): def __init__(self, *args, **kwargs): super(QLivePlot_Attitude, self).__init__(*args, **kwargs) self.n_subplots = 3 self.data = [{},{},{}] self.lines = [{},{},{}] self.plot_area = [] for i in range(self.n_subplots): self.plot_area.append(self.canvas.addPlot()) self.plot_area[i].showGrid(x=True, y=True) self.plot_area[i].addLegend() self.canvas.nextRow() self.plot_area[0].setLabels(left='Roll [rad]', bottom='t [s]') self.plot_area[1].setLabels(left='Pitch [rad]', bottom='t [s]') self.plot_area[2].setLabels(left='Yaw [rad]', bottom='t [s]') self.color_i = 0 def update_data(self, **kwargs): for key,value in kwargs.items(): if isinstance(value, dataTypes.State_XVQW): r = value.q.get_roll() p = value.q.get_pitch() y = value.q.get_yaw() t = value.timestamp if key in self.data[0]: self.data[0][key][0].append(t) self.data[0][key][1].append(r) self.data[1][key][0].append(t) self.data[1][key][1].append(p) self.data[2][key][0].append(t) self.data[2][key][1].append(y) else: self.data[0][key] = [[t],[r]] self.data[1][key] = [[t],[p]] self.data[2][key] = [[t],[y]] else: pass #print('Plot can only be updated with State_XVQW data type.')
10,782
3,546
#!/usr/bin/env python from pda.dataset import init_aggregate_and_appliance_dataset_figure import matplotlib.pyplot as plt from scipy.stats import * import numpy as np subplots, chan = init_aggregate_and_appliance_dataset_figure( start_date='2013/6/4 10:00', end_date='2013/6/4 13:30', n_subplots=2, date_format='%H:%M:%S', alpha=0.6, plot_appliance_ground_truth=False) DISPLAY = ['mean', 'std', 'ptp', 'gmean', 'skew'] WINDOW = 60 n = chan.series.size - WINDOW labels = ['mean', 'std', 'ptp', 'gmean', 'skew'] summary_stats = np.empty((n,len(labels))) print("Calculating...") for i in range(1,n): chunk = chan.series.values[i:i+WINDOW] summary_stats[i] = (chunk.mean(), chunk.std(), chunk.ptp(), gmean(chunk), skew(chunk)) print("Plotting...") for i, label in enumerate(labels): if label in DISPLAY: subplots[1].plot(chan.series.index[WINDOW:], summary_stats[:,i], label=label) plt.legend() plt.grid() plt.show() print("Done!")
1,018
397
import socket import json import struct from sciibo.core.helpers import Queue from .thread import SocketThread class ConnectionThread(SocketThread): def __init__(self, sock): super(ConnectionThread, self).__init__() self.sock = sock # The number of bytes we are expecting self.expecting = None # Partial message we received so far self.partial = None # Outgoing message queue self.queue = Queue() # Player id this connection belongs to self.player = None def disconnected(self): self.stop() self.trigger('receive', self, {'type': 'disconnect'}) def action(self): if not self.expecting: # Send messages while not self.queue.empty(): data = self.queue.get() message = json.dumps(data) self.sock.sendall(struct.pack("i", len(message)) + message.encode()) self.queue.task_done() # Receive message size data = self.sock.recv(struct.calcsize("i")) if not data: self.disconnected() return # We are now looking for a message self.expecting = struct.unpack("i", data)[0] self.partial = "" return # Receive at most what we are expecting data = self.sock.recv(self.expecting) if not data: self.disconnected() return # Bytes to string data = data.decode() self.partial += data self.expecting -= len(data) # Received complete message if not self.expecting: try: data = json.loads(self.partial) except ValueError: return if not isinstance(data, dict): return type = data.get('type') if not type: return self.trigger('receive', self, data) self.expecting = None self.partial = None def send(self, data): self.queue.put(data) def on_error(self): # Trigger disconnect when an error occurs, but not # when the connection was stopped (using after_actions). self.disconnected() def after_actions(self): # Send out queued messages before closing socket try: while not self.queue.empty(): data = self.queue.get() message = json.dumps(data) self.sock.sendall(struct.pack("i", len(message)) + message.encode()) self.queue.task_done() except socket.error: return
2,691
696
# Copyright (C) 2008 Jimmy Do <jimmydo@users.sourceforge.net> # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA import math import gobject import gtk class PieMeter(gtk.Image): _DEFAULT_SIZE = 24 def __init__(self): gtk.Image.__init__(self) self._progress = 0.0 self._fill_color = (0.0, 1.0, 0.0) def set_progress(self, progress): assert progress >= 0.0 assert progress <= 1.0 self._progress = progress if self.window is not None: self.window.invalidate_rect(self.allocation, True) def set_fill_color(self, red, green, blue): assert 0.0 <= red <= 1.0 assert 0.0 <= green <= 1.0 assert 0.0 <= blue <= 1.0 self._fill_color = (red, green, blue) if self.window is not None: self.window.invalidate_rect(self.allocation, True) def do_size_request(self, requisition): requisition.width = PieMeter._DEFAULT_SIZE requisition.height = PieMeter._DEFAULT_SIZE def do_expose_event(self, event): context = event.window.cairo_create() rect = self.allocation x = rect.x + (rect.width / 2) y = rect.y + (rect.height / 2) radius = (min(rect.width, rect.height) / 2) # Draw background circle context.arc(x, y, radius, 0, 2 * math.pi) context.set_source_rgba(0.8, 0.8, 0.8) context.fill() # Draw pie context.arc(x, y, radius, (-0.5 * math.pi) + self._progress * 2 * math.pi, 1.5 * math.pi) context.line_to(x, y) context.close_path() (red, green, blue) = self._fill_color context.set_source_rgb(red, green, blue) context.fill() # Draw circle outline context.arc(x, y, radius, 0, 2 * math.pi) context.set_source_rgba(1, 1, 1) context.set_line_width(1.0) context.stroke() gobject.type_register(PieMeter)
2,651
882
import arcade import timeit BALL_DRAG = 0.001 NO_FLIPPER = 0 FLIPPER_UP = 1 class MyApplication(arcade.Window): """ Main application class. """ def __init__(self, width, height, resizable): super().__init__(width, height, resizable=resizable) self.sprite_list = arcade.SpriteList() self.left_flipper_list = arcade.SpriteList() self.right_flipper_list = arcade.SpriteList() self.left_flipper_state = NO_FLIPPER self.right_flipper_state = NO_FLIPPER self.time = 0 arcade.set_background_color(arcade.color.DARK_SLATE_GRAY) # Top wall for x in range(20, 800, 40): wall = arcade.PhysicsAABB("images/boxCrate_double.png", [x, 980], [40, 40], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) # Left wall for y in range(260, 980, 40): wall = arcade.PhysicsAABB("images/boxCrate_double.png", [20, y], [40, 40], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) # Right wall for y in range(260, 980, 40): wall = arcade.PhysicsAABB("images/boxCrate_double.png", [780, y], [40, 40], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) # Left bottom slope y = 260 for x in range(40, 280, 10): y -= 5 wall = arcade.PhysicsAABB("images/boxCrate_double.png", [x, y], [10, 10], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) # Right bottom slope y = 260 for x in range(760, 520, -10): y -= 5 wall = arcade.PhysicsAABB("images/boxCrate_double.png", [x, y], [10, 10], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) # Left flipper y = 135 for x in range(280, 350, 10): wall = arcade.PhysicsAABB("images/boxCrate_double.png", [x, y], [10, 10], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) self.left_flipper_list.append(wall) y -= 5 # Right flipper y = 135 for x in range(520, 440, -10): wall = arcade.PhysicsAABB("images/boxCrate_double.png", [x, y], [10, 10], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) self.right_flipper_list.append(wall) y -= 5 # Bumpers for row in range(2): for column in range(2): bumper = arcade.PhysicsCircle("images/bumper.png", [250 + 300 * column, 450 + 300 * row], 35, [0, 0], 1.5, 100, BALL_DRAG) bumper.static = True self.sprite_list.append(bumper) wall = arcade.PhysicsAABB("images/python_logo.png", [400, 600], [150, 150], [0, 0], 1, 100, 0) wall.static = True self.sprite_list.append(wall) def on_draw(self): """ Render the screen. """ # This command has to happen before we start drawing arcade.start_render() self.sprite_list.draw() start_x = 20 start_y = 10 arcade.draw_text("Processing time: {:.3f}".format(self.time), start_x, start_y, arcade.color.BLACK, 12) def update(self, x): """ Move everything """ start_time = timeit.default_timer() arcade.process_2d_physics_movement(self.sprite_list, gravity=0.08) arcade.process_2d_physics_collisions(self.sprite_list) # -- Left flipper control if self.left_flipper_state == FLIPPER_UP and self.left_flipper_list[0].center_y < 145: y = 2 y_change = 2 for sprite in self.left_flipper_list: sprite.change_y = y y += y_change sprite.frozen = False elif self.left_flipper_state == NO_FLIPPER and self.left_flipper_list[0].center_y > 135: y = -2 y_change = -2 for sprite in self.left_flipper_list: sprite.change_y = y y += y_change sprite.frozen = False else: for sprite in self.left_flipper_list: sprite.change_y = 0 sprite.frozen = True # -- Right flipper control if self.right_flipper_state == FLIPPER_UP and self.right_flipper_list[0].center_y < 145: y = 2 y_change = 2 for sprite in self.right_flipper_list: sprite.change_y = y y += y_change sprite.frozen = False elif self.right_flipper_state == NO_FLIPPER and self.right_flipper_list[0].center_y > 135: y = -2 y_change = -2 for sprite in self.right_flipper_list: sprite.change_y = y y += y_change sprite.frozen = False else: for sprite in self.right_flipper_list: sprite.change_y = 0 sprite.frozen = True for sprite in self.sprite_list: if sprite.center_y < -20: sprite.kill() self.time = timeit.default_timer() - start_time def on_key_press(self, key, modifiers): """ Called whenever the mouse moves. """ if key == arcade.key.LEFT: self.left_flipper_state = FLIPPER_UP elif key == arcade.key.RIGHT: self.right_flipper_state = FLIPPER_UP elif key == arcade.key.SPACE: x = 720 y = 300 ball = arcade.PhysicsCircle("images/pool_cue_ball.png", [x, y], 15, [0, +20], 1, .25, BALL_DRAG) self.sprite_list.append(ball) def on_key_release(self, key, modifiers): """ Called when the user presses a mouse button. """ if key == arcade.key.LEFT: self.left_flipper_state = NO_FLIPPER elif key == arcade.key.RIGHT: self.right_flipper_state = NO_FLIPPER window = MyApplication(800, 1000, resizable=False) window.set_size(700, 700) arcade.run()
6,192
2,251
import json from loguru import logger from .config import PERFORMATIVE, PERFORMATIVE_PACK, PERFORMATIVE_PACK_TAKEN, TEAM, X, Y, Z, NAME, ACTION, CREATE, \ TYPE from .agent import AbstractAgent, LONG_RECEIVE_WAIT from .vector import Vector3D from spade.message import Message from spade.behaviour import OneShotBehaviour, CyclicBehaviour from spade.template import Template from spade.agent import Agent PACK_NONE: int = 1000 PACK_MEDICPACK: int = 1001 PACK_AMMOPACK: int = 1002 PACK_OBJPACK: int = 1003 PACK_NAME = { PACK_NONE: 'NONE', PACK_MEDICPACK: 'MEDIC', PACK_AMMOPACK: 'AMMO', PACK_OBJPACK: 'OBJ' } PACK_AUTODESTROY_TIMEOUT: int = 25 class Pack(AbstractAgent, Agent): def __str__(self): return "P(" + str(PACK_NAME[self.type]) + "," + str(self.position) + ")" def __init__(self, name, passwd="secret", manager_jid="cmanager@localhost", x=0, z=0, team=0): Agent.__init__(self, name, passwd) AbstractAgent.__init__(self, name, team) self.type = PACK_NONE self.manager = manager_jid self.position = Vector3D() self.position.x = x self.position.y = 0 self.position.z = z async def setup(self): self.add_behaviour(self.CreatePackBehaviour()) t = Template() t.set_metadata(PERFORMATIVE, PERFORMATIVE_PACK_TAKEN) self.add_behaviour(self.PackTakenResponderBehaviour(), t) class CreatePackBehaviour(OneShotBehaviour): async def run(self): msg = Message(to=self.agent.manager) msg.set_metadata(PERFORMATIVE, PERFORMATIVE_PACK) msg.body = json.dumps({ NAME: self.agent.name, TEAM: self.agent.team, ACTION: CREATE, TYPE: self.agent.type, X: self.agent.position.x, Y: self.agent.position.y, Z: self.agent.position.z }) await self.send(msg) logger.info("CreatePack msg sent: {}".format(msg)) class PackTakenResponderBehaviour(CyclicBehaviour): async def run(self): msg = await self.receive(timeout=LONG_RECEIVE_WAIT) if msg is not None: content = msg.body await self.agent.perform_pack_taken(content) # await self.agent.stop()
2,350
809
import numpy as np import pybullet as p class Initializer(): def __init__(self,floor_known=None,floor_frame_path=None,): if floor_known: self.RT = np.load(floor_frame_path) else: self.RT =np.eye(4) self.rbdl2bullet = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 20, 21, 22] r_knee_id = 26 r_ankle_id = 28 r_foot_id = 30 r_toe_id = 34 r_heel_id = 35 self.r_kafth_ids = [r_knee_id, r_ankle_id, r_foot_id, r_toe_id, r_heel_id] l_knee_id = 9 l_ankle_id = 11 l_foot_id = 13 l_toe_id = 17 l_heel_id = 18 self.l_kafth_ids = [l_knee_id, l_ankle_id, l_foot_id, l_toe_id, l_heel_id] self.params1={ "scale":1000,"iter":8,"delta_t":0.001,"j_kp":117497,"j_kd":3300,"bt_kp":155000, "bt_kd":2300,"br_kp":50000,"br_kd":2800} self.params2={ "scale":1000,"iter":8,"delta_t":0.01,"j_kp":300,"j_kd":150,"bt_kp":600, "bt_kd":300,"br_kp":300,"br_kd":150} self.con_j_ids_bullet = {"r_toe_id":34,"r_heel_id":35,"l_toe_id":17,"l_heel_id":18} def get_params(self): return self.params2#self.params1 def get_con_j_idx_bullet(self): return self.con_j_ids_bullet def remove_collisions(self,id_a,id_b): ### turn of collision between humanoids ### for i in range(p.getNumJoints(id_a)): for j in range(p.getNumJoints(id_b)): p.setCollisionFilterPair(id_a, id_b, i, j, 0) return 0 def get_knee_ankle_foot_toe_heel_ids_rbdl(self): return self.l_kafth_ids,self.r_kafth_ids def get_rbdl2bullet(self): return self.rbdl2bullet def change_humanoid_color(self,id_robot,color): for j in range(p.getNumJoints(id_robot)): p.changeVisualShape(id_robot, j, rgbaColor=color) return 0 def get_R_T(self): R = self.RT[:3, :3] T = self.RT[:-1, 3:].reshape(3) return R,T
2,178
1,066
import tensorflow.keras as keras # pad_sequences from pad_sequences import pad_sequences_adjacency from pad_sequences import pad_sequences_sparse def pad_idseqs(func): def wrapper(*args, **kwargs): # read and remove padding settings maxlen = kwargs.pop('maxlen', None) padding = kwargs.pop('padding', 'pre') truncating = kwargs.pop('truncating', 'pre') # run the NLP task idseqs, VOCAB = func(*args, **kwargs) # padding and update vocabulary if maxlen is not None: if "[PAD]" not in VOCAB: VOCAB.append("[PAD]") idseqs = keras.preprocessing.sequence.pad_sequences( idseqs, maxlen=maxlen, value=VOCAB.index("[PAD]"), padding=padding, truncating=truncating).tolist() return idseqs, VOCAB return wrapper def pad_adjacmatrix(func): def wrapper(*args, **kwargs): # read and remove padding settings maxlen = kwargs.pop('maxlen', None) padding = kwargs.pop('padding', 'pre') truncating = kwargs.pop('truncating', 'pre') # run the NLP task adjac_matrix, seqs_lens = func(*args, **kwargs) # pad adjacency matrix of children relationships if maxlen is not None: adjac_matrix = pad_sequences_adjacency( sequences=adjac_matrix, seqlen=seqs_lens, maxlen=maxlen, padding=padding, truncating=truncating) return adjac_matrix, seqs_lens return wrapper def pad_maskseqs(func): def wrapper(*args, **kwargs): # read and remove padding settings maxlen = kwargs.pop('maxlen', None) padding = kwargs.pop('padding', 'pre') truncating = kwargs.pop('truncating', 'pre') # run the NLP task maskseqs, seqs_lens, VOCAB = func(*args, **kwargs) # pad sparse mask sequence if maxlen is not None: maskseqs = pad_sequences_sparse( sequences=maskseqs, seqlen=seqs_lens, maxlen=maxlen, padding=padding, truncating=truncating) return maskseqs, seqs_lens, VOCAB return wrapper def pad_merge_adjac_maskseqs(func): def wrapper(*args, **kwargs): # read and remove padding settings maxlen = kwargs.pop('maxlen', None) padding = kwargs.pop('padding', 'pre') truncating = kwargs.pop('truncating', 'pre') # run the NLP task adjac, onehot, seqs_lens, n_classes = func(*args, **kwargs) # pad adjacency matrix of children relationships if maxlen is not None: adjac = pad_sequences_adjacency( sequences=adjac, seqlen=seqs_lens, maxlen=maxlen, padding=padding, truncating=truncating) onehot = pad_sequences_sparse( sequences=onehot, seqlen=seqs_lens, maxlen=maxlen, padding=padding, truncating=truncating) # shift index of adjac matrix adjac = [[(i + n_classes, j) for i, j in sent] for sent in adjac] # merge both sparse matrices maskseqs = [adjac[k] + onehot[k] for k in range(len(adjac))] # done return maskseqs, seqs_lens return wrapper
3,220
991
import unittest import threading from g1.threads import locks class ReadWriteLockTest(unittest.TestCase): def setUp(self): super().setUp() self.rwlock = locks.ReadWriteLock() def assert_state(self, num_readers, num_writers): self.assertEqual(self.rwlock._num_readers, num_readers) self.assertEqual(self.rwlock._num_writers, num_writers) def test_read_lock(self): self.assert_state(0, 0) self.assertTrue(self.rwlock.reader_acquire(timeout=0.01)) self.assert_state(1, 0) self.assertTrue(self.rwlock.reader_acquire(timeout=0.01)) self.assert_state(2, 0) self.assertFalse(self.rwlock.writer_acquire(timeout=0.01)) self.assert_state(2, 0) self.rwlock.reader_release() self.rwlock.reader_release() self.assert_state(0, 0) def test_write_lock(self): self.assert_state(0, 0) self.assertTrue(self.rwlock.writer_acquire(timeout=0.01)) self.assert_state(0, 1) self.assertFalse(self.rwlock.reader_acquire(timeout=0.01)) self.assert_state(0, 1) self.assertFalse(self.rwlock.writer_acquire(timeout=0.01)) self.assert_state(0, 1) self.rwlock.writer_release() self.assert_state(0, 0) def start_reader_thread(self, event): thread = threading.Thread( target=acquire_then_set, args=(self.rwlock.reader_acquire, event), daemon=True, ) thread.start() def start_writer_thread(self, event): thread = threading.Thread( target=acquire_then_set, args=(self.rwlock.writer_acquire, event), daemon=True, ) thread.start() def test_reader_notify_writers(self): self.rwlock.reader_acquire() event1 = threading.Event() event2 = threading.Event() event3 = threading.Event() self.start_writer_thread(event1) self.start_writer_thread(event2) self.start_writer_thread(event3) self.assertFalse(event1.wait(0.01)) self.assertFalse(event2.wait(0.01)) self.assertFalse(event3.wait(0.01)) self.rwlock.reader_release() self.assertEqual( sorted([ event1.wait(0.01), event2.wait(0.01), event3.wait(0.01), ]), [False, False, True], ) def test_writer_notify_readers(self): self.rwlock.writer_acquire() event1 = threading.Event() event2 = threading.Event() self.start_reader_thread(event1) self.start_reader_thread(event2) self.assertFalse(event1.wait(0.01)) self.assertFalse(event2.wait(0.01)) self.rwlock.writer_release() self.assertTrue(event1.wait(0.01)) self.assertTrue(event2.wait(0.01)) def test_writer_notify_writers(self): self.rwlock.writer_acquire() event1 = threading.Event() event2 = threading.Event() event3 = threading.Event() self.start_writer_thread(event1) self.start_writer_thread(event2) self.start_writer_thread(event3) self.assertFalse(event1.wait(0.01)) self.assertFalse(event2.wait(0.01)) self.assertFalse(event3.wait(0.01)) self.rwlock.writer_release() self.assertEqual( sorted([ event1.wait(0.01), event2.wait(0.01), event3.wait(0.01), ]), [False, False, True], ) def test_writer_notify_readers_and_writers(self): self.rwlock.writer_acquire() event1 = threading.Event() event2 = threading.Event() event3 = threading.Event() event4 = threading.Event() event5 = threading.Event() self.start_reader_thread(event1) self.start_reader_thread(event2) self.start_writer_thread(event3) self.start_writer_thread(event4) self.start_writer_thread(event5) self.assertFalse(event1.wait(0.01)) self.assertFalse(event2.wait(0.01)) self.assertFalse(event3.wait(0.01)) self.assertFalse(event4.wait(0.01)) self.assertFalse(event5.wait(0.01)) self.rwlock.writer_release() self.assertIn( ( [ event1.wait(0.01), event2.wait(0.01), ], sorted([ event3.wait(0.01), event4.wait(0.01), event5.wait(0.01), ]), ), [ ([True, True], [False, False, False]), ([False, False], [False, False, True]), ], ) def acquire_then_set(acquire, event): acquire() event.set() if __name__ == '__main__': unittest.main()
4,894
1,621
""" Here definitions and attributes of all statistical distributions that are used in the simulation are defined""" from abc import ABCMeta, abstractmethod import random #import np class StatDis(object): __metaclass__ = ABCMeta def __init__(self): pass @abstractmethod def generate(self): pass class UniformDis(StatDis): def __init__(self, minVal, maxVal): self.minVal = minVal self.maxVal = maxVal def generate(self): return random.uniform(self.minVal, self.maxVal) class NormalDis(StatDis): def __init__(self, mean, std): self.mean = mean self.std = std def generate(self): return np.random.normal(self.mean, self.std, 1)[0] class ConstantDis(StatDis): def __init__(self, val): self.val = val def generate(self): return self.val class TriangularDis(StatDis): def __init__(self, low, high, mode): self.low = low self.high = high self.mode = mode def generate(self): return random.triangular(self.low, self.high, self.mode)
1,104
337
#!/usr/bin/env python3 import csv import xml.etree.ElementTree as ET import sys import os.path class QuestionData: final_answer = "" final_answer_time = 0 first_answer = "" attempts = 0 first_answer_time = 0 def __init__(self,final_answer,final_answer_time,attempts,first_answer,first_answer_time): self.final_answer = final_answer self.final_answer_time = final_answer_time self.first_answer = first_answer self.first_answer_time = first_answer_time self.attempts = attempts def xml_to_csv(xml_filename): """ Parses .xml files generated by newer versions of iClicker software in SessionData A CSV file will be written to the same path as the XML file, so it is important that any path, be it absolute or relative, is included in the xml_filename argument. The CSV file is not a perfect replica of older (i.e. iClicker 6) CSV files, but is our best approximation at this time. It should be enough for Rainbow Grades to function properly. """ csv_filename = xml_filename[:-3] + "csv" try: with open(xml_filename,"r") as readfile: tree = ET.parse(xml_filename) root = tree.getroot() questions_in_order = [] start_times = {} stop_times = {} user_question_data = {} for child in root: if child.tag == "p": # This is a polling tag question = child.attrib["qn"] start_times[question] = child.attrib["strt"] stop_times[question] = child.attrib["stp"] questions_in_order.append(question) question_votes = {} for qchild in child: if qchild.tag == "v": # This is a voting tag clicker_id = qchild.attrib["id"] if clicker_id not in user_question_data: user_question_data[clicker_id] = {} user_question_data[clicker_id][question] = {} if "fans" in qchild.attrib: user_question_data[clicker_id][question] = QuestionData(qchild.attrib["ans"], qchild.attrib["fanst"], qchild.attrib["att"], qchild.attrib["fans"], qchild.attrib["tm"]) question_votes[clicker_id] = qchild.attrib["ans"] with open(csv_filename, 'w') as writefile: csvwriter = csv.writer(writefile) # Need to change dialect to be iclicker compliant # Write the header # Right now we don't have min reply/min correct in XML land, instead we have MinPart_S next_row = ["Scoring"] if "perf" in root.attrib: performance = root.attrib["perf"] else: performance = -1 if "part" in root.attrib: participation = root.attrib["part"] else: participation = 1 csvwriter.writerow(["Scoring", "Performance = " + performance, "Participation = " + participation, "Min Reply = 2", "Min Correct = 0", " "]) next_row = ["Question", " ", " "] for i in range(len(questions_in_order)): next_row = next_row + ["Question " + str(i + 1), "Score", "Final Answer Time", "Number of Attempts", "First Response", "Time"] csvwriter.writerow(next_row) next_row = ["Start Time", " ", " "] for question in questions_in_order: next_row = next_row + [" " + start_times[question], " ", " ", " ", " ", " "] csvwriter.writerow(next_row) next_row = ["Stop Time", " ", " "] first_stop = True for question in questions_in_order: if not first_stop: next_row = next_row + [" " + stop_times[question], " ", " ", " ", " ", " "] else: next_row = next_row + [stop_times[question], " ", " ", " ", " ", " "] first_stop = False csvwriter.writerow(next_row) next_row = ["Correct Answer", " ", " "] first_stop = True for question in questions_in_order: if not first_stop: next_row = next_row + [" ", " ", " ", " ", " ", " "] else: next_row = next_row + ["", " ", " ", " ", " ", " "] first_stop = False csvwriter.writerow(next_row) for user in sorted(user_question_data.keys()): next_row = [user, "", "0"] for question in questions_in_order: if question in user_question_data[user]: qd = user_question_data[user][question] next_row = next_row + [qd.final_answer, 0, qd.final_answer_time, qd.attempts, qd.first_answer, qd.first_answer_time] else: next_row = next_row + ["", "", "", "", "", ""] csvwriter.writerow(next_row) except IOError as e: print("File I/O error: {}".format(e)) exit(-1) if __name__ == '__main__': if len(sys.argv) != 2: print("Correct usage is {} [file with iclicker {\"file\":...} entries]".format(sys.argv[0])) exit(-1) files = [] try: with open(sys.argv[1]) as json_file: for line in json_file: # Extract just the filenames of the session data files += [x.strip()[1:-1] for x in line.split("[")[1].split("]")[0].split(",")] except IOError as e: print("Error reading JSON excerpt: {}".format(e)) for filename in files: if len(filename) >= 4 and filename[-4:] == ".xml": xml_to_csv(filename)
6,594
1,753
import dash import dash_core_components as dcc import dash_html_components as html divider_text = ' • ' def get_navigation_header(page_nm): font_size_param = 16 dot_style = dict( color = 'gray', fontSize = '%spx' % (font_size_param), ) default_style = dict( position = 'relative', textDecoration = 'none', textTransform = 'uppercase', fontFamily = 'sans-serif', color = 'black', marginBottom = '2px', fontSize = '%spx' % (font_size_param), ) import copy selected_style = copy.copy(default_style) selected_style['borderBottom'] = '1px solid' styles = dict() for nm in ['single', 'batch', 'gene', 'guide', 'about']: if page_nm == nm: styles[nm] = selected_style else: styles[nm] = default_style return html.Div( [ html.H4( 'inDelphi', style = dict( textAlign = 'center', ), ), html.Div( [ html.A( 'Single mode', href = 'single', style = styles['single'], className = 'dynamicunderline', ), html.Span( divider_text, ), html.A( 'Batch mode', href = 'batch', style = styles['batch'], className = 'dynamicunderline', ), html.Span( divider_text, ), html.A( 'Gene mode', href = 'gene', style = styles['gene'], className = 'dynamicunderline', ), html.Span( divider_text, ), html.A( 'User guide', href = 'guide', style = styles['guide'], className = 'dynamicunderline', ), html.Span( divider_text, ), html.A( 'About', href = 'about', style = styles['about'], className = 'dynamicunderline', ), ], style = dict( marginBottom = 20, textAlign = 'center', ), className = 'row', ), ], )
2,255
697
/home/runner/.cache/pip/pool/68/e2/05/188e3a14bbe42690f0cbce7c7c576b1dbc9d3d1bb571a2d3908f144cea
96
71
# -*- coding: utf-8 -*- """ Created on Tue May 24 11:14:03 2016 @author: Wajih-PC """ import numpy as np def normalize(x,mu,sigma): x = np.subtract(x,mu) x = np.true_divide(x,sigma) return x
217
108
class Solution: def searchRange(self, nums: List[int], target: int) -> List[int]: left, right = self.first(nums, target), self.last(nums, target) return [left, right] def last(self, nums, target) : if not nums : return -1 left, right = 0, len(nums) -1 while left + 1 < right : mid = (left + right) // 2 if nums[mid] <= target : left = mid else : right = mid if nums[right] == target : return right if nums[left] == target : return left return -1 def first(self, nums, target) : if not nums : return -1 left, right = 0, len(nums) -1 while left + 1 < right : mid = (left + right) // 2 if nums[mid] < target : left = mid else : right = mid if nums[left] == target : return left if nums[right] == target : return right return -1
1,070
314
import pandas as pd import numpy as np #定义资料集 df1 = pd.DataFrame(np.ones((3, 4)) * 0, columns=['a', 'b', 'c', 'd']) df2 = pd.DataFrame(np.ones((3, 4)) * 1, columns=['a', 'b', 'c', 'd']) df3 = pd.DataFrame(np.ones((3, 4)) * 2, columns=['a', 'b', 'c', 'd']) #concat纵向合并 axis=0纵向,axis=1横向 res = pd.concat([df1, df2, df3], axis=1) #打印结果 print(res) #将index_ignore设定为True,序号升序显示(index从0-8) res = pd.concat([df1, df2, df3], axis=0, ignore_index=True) #打印结果 print(res) #定义资料集 df1 = pd.DataFrame(np.ones((3, 4)) * 0, columns=['a', 'b', 'c', 'd'], index=[1, 2, 3]) df2 = pd.DataFrame(np.ones((3, 4)) * 1, columns=['b', 'c', 'd', 'e'], index=[2, 3, 4]) #纵向"外"合并df1与df2,默认join为outer,即相同的column才合并,不同则NaN res = pd.concat([df1, df2], axis=0, join='outer') #打印结果 print(res) #纵向"内"合并df1与df2,当join为inner时column不同的数据将会被丢弃 res = pd.concat([df1, df2], axis=0, join='inner') #打印结果 print(res) #定义资料集 df1 = pd.DataFrame(np.ones((3, 4)) * 0, columns=['a', 'b', 'c', 'd']) df2 = pd.DataFrame(np.ones((3, 4)) * 1, columns=['a', 'b', 'c', 'd']) df3 = pd.DataFrame(np.ones((3, 4)) * 1, columns=['a', 'b', 'c', 'd']) s1 = pd.Series([1, 2, 3, 4], index=['a', 'b', 'c', 'd']) #将df2合并到df1的下面,以及重置index,并打印出结果 res = df1.append(df2, ignore_index=True) #注意append仅能纵向合并 print(res) #合并多个df,将df2与df3合并至df1的下面,以及重置index,并打印出结果 res = df1.append([df2, df3], ignore_index=True) print(res) #合并series,将s1合并至df1,以及重置index,并打印出结果 res = df1.append(s1, ignore_index=True) print(res)
1,526
844
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations class Migration(migrations.Migration): dependencies = [ ('core', '0050_customersetting_can_view_mail'), ] operations = [ migrations.AddField( model_name='customersetting', name='transfer_max_size', field=models.IntegerField(default=0, help_text='\u5355\u4f4d\uff1aM\uff0c\u90ae\u4ef6\u5927\u5c0f\u8d85\u8fc7\u8be5\u9600\u503c\uff0c\u5219\u8be5\u90ae\u4ef6\u53d1\u9001\u65f6\u81ea\u52a8\u8f6c\u7f51\u7edc\u9644\u4ef6, \u9ed8\u8ba4\u503c\uff10, \u8868\u793a\u7528\u7cfb\u7edf\u9ed8\u8ba4\u8bbe\u7f6e\u503c', verbose_name='\u4e2d\u7ee7\uff1a\u81ea\u52a8\u8f6c\u7f51\u7edc\u9644\u4ef6\u6700\u5927\u9600\u503c'), ), ]
799
450
import urllib import sched import time from threading import Thread from token import Token from ..utils.http import do_basic_secure_post from ..exceptions.exceptions import BasicAuthenticationFailedException class DefaultSequencingOAuth2Client(object): # Attribute for value of redirect url ATTR_REDIRECT_URL = "redirect_uri" # Attribute for value of response type ATTR_RESPONSE_TYPE = "response_type" # Attribute for value state ATTR_STATE = "state" # Attribute for value client id ATTR_CLIENT_ID = "client_id" # Attribute for value scope ATTR_SCOPE = "scope" # Attribute for value code ATTR_CODE = "code" # Attribute for value refresh token ATTR_REFRESH_TOKEN = "refresh_token" # Attribute for access token ATTR_ACCESS_TOKEN = "access_token" # Attribute for value grant type ATTR_GRANT_TYPE = "grant_type" # Attribute for value expires in ATTR_EXPIRES_IN = "expires_in" def __init__(self, auth_parameters): self.auth_parameters = auth_parameters self.token = None self._token_refresher = None def http_redirect_parameters(self): attributes = { self.ATTR_REDIRECT_URL: self.auth_parameters.redirect_uri, self.ATTR_RESPONSE_TYPE: self.auth_parameters.response_type, self.ATTR_STATE: self.auth_parameters.state, self.ATTR_CLIENT_ID: self.auth_parameters.client_id, self.ATTR_SCOPE: self.auth_parameters.scope } return attributes def login_redirect_url(self): params = urllib.urlencode(self.http_redirect_parameters()) return '%s?%s' % (self.auth_parameters.oauth_authorization_uri, params) def authorize(self, response_code, response_state): if response_state != self.auth_parameters.state: raise ValueError("Invalid state parameter") uri = self.auth_parameters.oauth_token_uri params = { self.ATTR_GRANT_TYPE: self.auth_parameters.grant_type, self.ATTR_CODE: response_code, self.ATTR_REDIRECT_URL: self.auth_parameters.redirect_uri } result = do_basic_secure_post(uri, self.auth_parameters, params) if result is None: raise BasicAuthenticationFailedException("Failure authentication.") access_token = result[self.ATTR_ACCESS_TOKEN] refresh_token = result[self.ATTR_REFRESH_TOKEN] timelife = int(result[self.ATTR_EXPIRES_IN]) self.token = Token(access_token, refresh_token, timelife) self._token_refresher = self.__TokenRefresher(self, timelife - 60) self._token_refresher.start() return self.token def is_authorized(self): return (self.token is not None) and (self.token.lifetime != 0) def _refresh_token(self): uri = self.auth_parameters.oauth_token_refresh_uri params = { self.ATTR_GRANT_TYPE: self.auth_parameters.grant_type_refresh_token, self.ATTR_REFRESH_TOKEN: self.token.refresh_token } result = do_basic_secure_post(uri, self.auth_parameters, params) if result is None: raise BasicAuthenticationFailedException("Authentication against backend failed. " + "Server replied with: " + result) access_token = result[self.ATTR_ACCESS_TOKEN] refresh_token = self.token.refresh_token timelife = result[self.ATTR_EXPIRES_IN] self.token = Token(access_token, refresh_token, timelife) class __TokenRefresher(Thread): def __init__(self, outer, frequency): Thread.__init__(self) self.outer = outer self.frequency = frequency self.scheduler = sched.scheduler(time.time, time.sleep) def run(self): self.scheduler.enter(self.frequency, 1, self.__run_refresh_token, ()) self.scheduler.run() def __run_refresh_token(self): self.outer._refresh_token() self.scheduler.enter(self.frequency, 1, self.__run_refresh_token, ())
4,128
1,236
from elasticsearch import Elasticsearch, RequestsHttpConnection from requests_aws4auth import AWS4Auth import boto3 def get_es_client(conn, silent=False): """ Returns the elasticsearch client connected through port forwarding settings """ elastic_url = "https://localhost:9222" protocol_config = { "scheme": "https", "port": 9222, "use_ssl": True, "verify_certs": False, } credentials = boto3.Session(profile_name=conn.aws.profile_name).get_credentials() http_auth = AWS4Auth(credentials.access_key, credentials.secret_key, "eu-central-1", "es", session_token=credentials.token) es_client = Elasticsearch( [elastic_url], http_auth=http_auth, connection_class=RequestsHttpConnection, **protocol_config ) # test if it works if not silent and not es_client.cat.health(request_timeout=30): raise ValueError('Credentials do not work for Elastic search') return es_client
1,019
302
from pprint import pprint import pytest from flask_taxonomies.proxies import current_flask_taxonomies from flask_taxonomies.term_identification import TermIdentification from invenio_records import Record from oarepo_taxonomies.exceptions import DeleteAbortedError from oarepo_taxonomies.signals import lock_term from oarepo_taxonomies.tasks import unlock_term def test_taxonomy_delete(app, db, taxonomy_tree, test_record): taxonomies = current_flask_taxonomies.list_taxonomies(session=None).all() assert len(taxonomies) == 1 with pytest.raises(DeleteAbortedError): current_flask_taxonomies.delete_taxonomy(taxonomies[0]) taxonomies = current_flask_taxonomies.list_taxonomies(session=None).all() assert len(taxonomies) == 1 def test_taxonomy_delete_2(app, db, taxonomy_tree): taxonomies = current_flask_taxonomies.list_taxonomies(session=None).all() assert len(taxonomies) == 1 current_flask_taxonomies.delete_taxonomy(taxonomies[0]) taxonomies = current_flask_taxonomies.list_taxonomies(session=None).all() assert len(taxonomies) == 0 def test_taxonomy_term_delete(app, db, taxonomy_tree): taxonomy = current_flask_taxonomies.get_taxonomy("test_taxonomy") terms = current_flask_taxonomies.list_taxonomy(taxonomy).all() term = terms[1] ti = TermIdentification(term=term) current_flask_taxonomies.delete_term(ti) def test_taxonomy_term_delete_2(app, db, taxonomy_tree, test_record): taxonomy = current_flask_taxonomies.get_taxonomy("test_taxonomy") terms = current_flask_taxonomies.list_taxonomy(taxonomy).all() term = terms[1] ti = TermIdentification(term=term) with pytest.raises(DeleteAbortedError): current_flask_taxonomies.delete_term(ti) def test_taxonomy_term_moved(app, db, taxonomy_tree, test_record): taxonomy = current_flask_taxonomies.get_taxonomy("test_taxonomy") terms = current_flask_taxonomies.list_taxonomy(taxonomy).all() old_record = Record.get_record(id_=test_record.id) old_taxonomy = old_record["taxonomy"] assert old_taxonomy == [{ 'is_ancestor': True, 'level': 1, 'links': { 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a' }, 'test': 'extra_data' }, { 'is_ancestor': True, 'level': 2, 'links': { 'parent': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a', 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b' }, 'test': 'extra_data' }, { 'is_ancestor': False, 'level': 3, 'links': { 'parent': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b', 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b/c' }, 'test': 'extra_data' }] ti = TermIdentification(term=terms[2]) current_flask_taxonomies.move_term(ti, new_parent=terms[0], remove_after_delete=False) db.session.commit() new_record = Record.get_record(id_=test_record.id) new_taxonomy = new_record["taxonomy"] new_terms = current_flask_taxonomies.list_taxonomy(taxonomy).all() assert new_terms[-1].parent_id == 1 # assert new_taxonomy == [{ # 'is_ancestor': True, # 'links': { # 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a' # }, # 'test': 'extra_data' # }, # { # 'is_ancestor': False, # 'links': { # 'parent': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a', # 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/c' # }, # 'test': 'extra_data' # }] def test_taxonomy_term_update(app, db, taxonomy_tree, test_record): taxonomy = current_flask_taxonomies.get_taxonomy("test_taxonomy") terms = current_flask_taxonomies.list_taxonomy(taxonomy).all() old_record = Record.get_record(id_=test_record.id) assert old_record == { 'pid': 1, 'taxonomy': [{ 'is_ancestor': True, 'level': 1, 'links': {'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a'}, 'test': 'extra_data' }, { 'is_ancestor': True, 'level': 2, 'links': { 'parent': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a', 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b' }, 'test': 'extra_data' }, { 'is_ancestor': False, 'level': 3, 'links': { 'parent': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b', 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b/c' }, 'test': 'extra_data' }], 'title': 'record 1' } term = terms[-1] current_flask_taxonomies.update_term(term, extra_data={"new_data": "changed extra data"}) new_record = Record.get_record(id_=test_record.id) assert new_record == { 'pid': 1, 'taxonomy': [{ 'is_ancestor': True, 'level': 1, 'links': {'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a'}, 'test': 'extra_data' }, { 'is_ancestor': True, 'level': 2, 'links': { 'parent': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a', 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b' }, 'test': 'extra_data' }, { 'is_ancestor': False, 'level': 3, 'links': { 'parent': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b', 'self': 'http://127.0.0.1:5000/2.0/taxonomies/test_taxonomy/a/b/c' }, 'new_data': 'changed extra data', 'test': 'extra_data' }], 'title': 'record 1' } def test_lock_unlock_term(app, db, taxonomy_tree): term_identification = TermIdentification(taxonomy="test_taxonomy", slug="a/b/c") term = list(current_flask_taxonomies.filter_term( term_identification))[0] lock_term(locked_terms=[term.id], term=term) db.session.commit() term = list(current_flask_taxonomies.filter_term( term_identification))[0] assert term.busy_count == 1 unlock_term(url=term.links().envelope["self"]) term = list(current_flask_taxonomies.filter_term( term_identification))[0] assert term.busy_count == 0
7,135
2,530
from django.core.mail import send_mail, BadHeaderError from django.http import HttpResponse from django.shortcuts import render, redirect from .forms import ContactForm from profiles.models import UserProfile def contactView(request): if request.user.is_authenticated: try: profile = UserProfile.objects.get(user=request.user) form = ContactForm(initial={ 'from_email': profile.user.email, }) except UserProfile.DoesNotExist: form = ContactForm() else: form = ContactForm() if request.method == 'POST': form = ContactForm(request.POST) if form.is_valid(): subject = form.cleaned_data['subject'] from_email = form.cleaned_data['from_email'] message = form.cleaned_data['message'] try: send_mail( subject, message, from_email, ['elsinnarisami@gmail.com']) except BadHeaderError: return HttpResponse('Invalid header found.') return redirect('success') context = { 'contact_page': 'active', 'form': form, } return render(request, "sendemail/contact.html", context) def successView(request): return render(request, "sendemail/contact_success.html")
1,322
347
from tests.utils import _mock_gql create_deposit_response = dict( createDepositAccount=dict( accountNumber="123", accountName="john doe", accountType="deposit", bankName="Providus", accountReference="ref", ) ) def test_create_deposit(): from buycoins import accounts _mock_gql(create_deposit_response) acc = accounts.create_deposit("john doe") assert type(acc) == accounts.VirtualDepositAccountType assert acc.account_number == "123" assert acc.account_reference == "ref" assert acc.account_name == "john doe"
592
196
from fabric.decorators import task, roles from haus_vars import APP_INFO, parse_vars from fabric.api import run, execute from fabric.context_managers import cd from heroku import create_fixture_on_s3, grab_fixture_on_s3 import cStringIO def copyBucket(srcBucketName, dstBucketName, aws_key, aws_secret, folder_name='uploads'): from boto.s3.connection import S3Connection conn = S3Connection(aws_key, aws_secret) source = conn.get_bucket(srcBucketName); destination = conn.get_bucket(dstBucketName); if folder_name: s3keys = source.list(folder_name) else: s3keys = source.list() for k in s3keys: print 'Copying ' + k.key + ' from ' + srcBucketName + ' to ' + dstBucketName destination.copy_key(k.key, srcBucketName, k.key, preserve_acl=True) def copyBucketDifferentOwners(src_settings, dst_settings, folder_name='uploads'): from boto.s3.connection import S3Connection srcBucketName = src_settings['AWS_BUCKET_NAME'] dstBucketName = dst_settings['AWS_BUCKET_NAME'] src_conn = S3Connection(src_settings['AWS_ACCESS_KEY_ID'], src_settings['AWS_SECRET_ACCESS_KEY']) dst_conn = S3Connection(dst_settings['AWS_ACCESS_KEY_ID'], dst_settings['AWS_SECRET_ACCESS_KEY']) source = src_conn.get_bucket(srcBucketName); destination = dst_conn.get_bucket(dstBucketName); if folder_name: s3keys = source.list(folder_name) else: s3keys = source.list() for k in s3keys: print 'Copying ' + k.key + ' from ' + srcBucketName + ' to ' + dstBucketName f = cStringIO.StringIO() k.get_contents_to_file(f) nk = destination.new_key(k.key) f.seek(0) nk.set_contents_from_file(f, policy='public-read', headers={ 'Content-Type': k.content_type } ) @task @roles('vagrant') def update_uploads(src_env='staging', dst_env='dev', different_owners=False): """copies the uploads folder from src_env to dst_env s3 buckets, pass different_owners=True to copy between s3 buckets that belong to different accounts""" print "UPDATING UPLOADS...." different_owners = str(different_owners).lower() == 'true' print "{}".format(APP_INFO) src_app_env = APP_INFO[src_env]['APP_ENV'] dst_app_env = APP_INFO[dst_env]['APP_ENV'] with(cd('/var/www')): src_settings = parse_vars(run("APP_ENV={} ./manage.py settings_vars AWS_ACCESS_KEY_ID AWS_SECRET_ACCESS_KEY AWS_BUCKET_NAME".format(src_app_env))) dst_settings = parse_vars(run("APP_ENV={} ./manage.py settings_vars AWS_ACCESS_KEY_ID AWS_SECRET_ACCESS_KEY AWS_BUCKET_NAME".format(dst_app_env))) src = src_settings['AWS_BUCKET_NAME'] dst = dst_settings['AWS_BUCKET_NAME'] folder = 'uploads' owners = { 'dev': 1, 'staging': 1, 'production': 1, } if different_owners or owners[src_env] != owners[dst_env]: copyBucketDifferentOwners(src_settings, dst_settings, folder) else: copyBucket(src, dst, src_settings['AWS_ACCESS_KEY_ID'], src_settings['AWS_SECRET_ACCESS_KEY'], folder) @task @roles('vagrant') def update_fixture(src_env='staging', dst_env='dev', do_update_uploads=True, *args, **kwargs): """ updates fixture and downloads it for given src_env (staging by default) copies uploads directory from src_env to dst_env s3 buckets unless update_uploads=False""" if str(do_update_uploads).lower() == 'false': do_update_uploads = False execute(create_fixture_on_s3, env=src_env) execute(grab_fixture_on_s3, env=src_env) if do_update_uploads: execute(update_uploads, src_env=src_env, dst_env=dst_env)
3,755
1,325
from umysqldb import connections from umysqldb import cursors def connect(db, host="localhost", port=3306, user="root", passwd="root", charset="utf8", cursorclass=cursors.Cursor, autocommit=False): return connections.Connection(database=db, host=host, port=port, user=user, passwd=passwd, charset=charset, cursorclass=cursorclass, autocommit=autocommit) Connection = Connect = connect
505
133
import re import networkx import itertools import argparse import json def build_network(filename,outfile,mb_threshold): regex = re.compile('([0-9]+) kB: (.*)(?=\()') network_list = [] current_network = [] with open(filename, 'r') as memlog: ignore_line = True for line in memlog.readlines(): if not ignore_line: result = regex.search(line) if (result is not None): current_network.append((result.group(1), result.group(2),)) if 'Total PSS by process:' in line: ignore_line = False if 'Total PSS by OOM adjustment:' in line: ignore_line = True if 'SAMPLE_TIME:' in line: edges = itertools.combinations(current_network,2) g = networkx.Graph() g.add_nodes_from(current_network) g.add_edges_from(edges) current_network = [] network_list.append(g) G = networkx.Graph() for n in network_list: for i in n.nodes(): if int(i[0]) > mb_threshold: #if it's using more than the memory threshold if i[1] not in G.nodes(): #include it in the summary graph G.add_node(i[1]) for j in n.neighbors(i): if int(j[0]) > mb_threshold: w = int(i[0])+int(j[0]) if ([i[1]],[j[1]]) in G.edges(): G[i[1]][j[1]]['weight'] += w elif ([j[1]],[i[1]]) in G.edges(): G[j[1]][i[1]]['weight'] += w else: G.add_edge(i[1],j[1],weight=w) # write result to edge list (CSV-type file) networkx.write_edgelist(G, outfile, data=['weight']) if __name__ == '__main__': argparser = argparse.ArgumentParser(description='Build a network from the given usage log file, then write it to an edge list.') argparser.add_argument('--filename',type=str,help='provide the memory log file for building the network. Defaults to ./memory.log.sample',default='./memory.log.sample') argparser.add_argument('--outfile',type=str,help='specify the desired path/name for the output edge list. Defaults to ./example.edgelist',default='./example.edgelist') argparser.add_argument('--threshold',type=int,help='specify the minimum memory threshold (in MB) of the processes used in the final network. Defaults to 1000',default=1000) args = argparser.parse_args() build_network(args.filename,args.outfile,args.threshold)
2,696
802
from sys import argv from random import randint from time import time import matplotlib.pyplot as plt def insertion_sort(arr): n = len(arr) for i in range(1, n): v = arr[i] j = i - 1 while j >= 0 and arr[j] > v: arr[j + 1] = arr[j] j -= 1 arr[j + 1] = v if __name__ == '__main__': if len(argv) > 1: sz = int(argv[1]) arr = [randint(1, 1000) for _ in range(sz)] #print(arr) start = time() insertion_sort(arr) end = time() #print(arr) print(end - start) else: # performs automated testing x = [] y = [] sizes = [10, 50, 100, 200, 500, 1000, 1200, 1500, 2000, 2500, 3000, 5000, 6000, 7000, 8000, 9000, 10000, 20000, 30000, 40000] for sz in sizes: t = 0 print("running size", sz) for _ in range(10): arr = [randint(1, 10000) for _ in range(sz)] start = time() insertion_sort(arr) end = time() t += (end - start) * 1000 x.append(sz) y.append(t // 10) # Plot results of tests plt.plot(x, y) plt.xlabel("n (size of array)") plt.ylabel("time (ms)") plt.show() #plt.savefig("python_running_times.png", format='png')
1,428
575
from invoke import Collection, task from opstrich.invoke import check, openssl @task def deploy(c): """ Build and run a Docker container to deploy. """ c.run("docker build -t zappa-lambda .") c.run("docker run -e AWS_ACCESS_KEY_ID -e AWS_SECRET_ACCESS_KEY zappa-lambda") c.run( "DJANGO_CONFIGURATION=ProdCollectStaticConfig poetry run python manage.py collectstatic --noinput" ) @task def ci_deploy(c): """ Perform pre-deploy steps needed in CI and then deploy. """ openssl.decrypt(c, "zappa_settings.json") deploy(c) namespace = Collection(check, openssl, deploy, ci_deploy)
638
212
import torch import numpy as np import copy def remove(path): data = torch.load(path) location_list, action_list = [np.reshape(st[0], (1, 8)) for st in data], [st[1] for st in data] location_list = np.concatenate(location_list, axis=0) action_list = np.asarray(action_list) action_0 = action_list == 0 action_1 = action_list == 1 action_2 = action_list == 2 action_3 = action_list == 3 location_0 = location_list[action_0, :] location_1 = location_list[action_1, :] location_2 = location_list[action_2, :] location_3 = location_list[action_3, :] action_0 = action_list[action_list == 0] action_1 = action_list[action_list == 1] action_2 = action_list[action_list == 2] action_3 = action_list[action_list == 3] action_l = copy.deepcopy([action_0, action_1, action_2, action_3]) location_l = copy.deepcopy([location_0, location_1, location_2, location_3]) a_hori, l_hori = [], [] for a, l in zip(action_l, location_l): a = a[l[:, 0] > 0.1] l = l[l[:, 0] > 0.1] a_hori.append(a) l_hori.append(l) location_hori = np.concatenate(l_hori, axis=0) action_hori = np.concatenate(a_hori, axis=0) print("horizontal : ", location_hori.shape, action_hori.shape) # Vertical action_l = copy.deepcopy([action_0, action_1, action_2, action_3]) location_l = copy.deepcopy([location_0, location_1, location_2, location_3]) a_verti, l_verti = [], [] for a, l in zip(action_l, location_l): a = a[l[:, 1] < 0.8] l = l[l[:, 1] < 0.8] a_verti.append(a) l_verti.append(l) location_verti = np.concatenate(l_verti, axis=0) action_verti = np.concatenate(a_verti, axis=0) print("vertical : ", location_verti.shape, action_verti.shape) # Save for i, (a, l) in enumerate(zip(a_verti, l_verti)): torch.save([l, a], f"/home/seungjae/Desktop/lunarlander/replay_buffer_vertical_{i}.pt") for i, (a, l) in enumerate(zip(a_hori, l_hori)): torch.save([l, a], f"/home/seungjae/Desktop/lunarlander/replay_buffer_horizontal_{i}.pt") # torch.save([location_hori, action_hori], "/home/seungjae/Desktop/lunarlander/replay_buffer_horizontal.pt") # torch.save([location_verti, action_verti], "/home/seungjae/Desktop/lunarlander/replay_buffer_vertical.pt") if __name__ == "__main__": path = "/home/seungjae/Desktop/lunarlander/replay_buffer.pt" remove(path)
2,490
997
def e(): print("This is function e in file d!") class E: def __init__(self): self.content = "This is class E in file d" def print(self): print(self.content)
188
63
""" Content negotiation deals with selecting an appropriate renderer given the incoming request. Typically this will be based on the request's Accept header. """ import flask as fl from . import exc class BaseContentNegotiator(object): def get_accept_mimetypes(self, request=None): """Given the incoming request, return a list of mimetypes this client supports as :class:`~werkzeug.datastructures.MIMEAccept` object. """ return (request or fl.request).accept_mimetypes def select_renderer(self, renderers, mimetype=None, prefer=None, request=None): raise NotImplementedError('.select_renderer() must be implemented') class DefaultContentNegotiator(BaseContentNegotiator): def _get_precedence(self, accepts, mimetype): ix = accepts.find(mimetype) if ix < 0: return 0 v = accepts[ix][0] if '/' not in v: return 0 vtype, vsubtype = v == '*' and ('*', '*') or v.split('/', 1) vtype, vsubtype = vtype.strip(), vsubtype.strip() if not vtype or not vsubtype or (vtype == '*' and vsubtype != '*'): return 0 elif vtype == '*': return 1 elif vsubtype == '*': return 2 else: return 3 def _filter_renderers(self, accepts, renderers): best_quality = -1 for r in renderers: q = accepts.quality(r.mimetype) if q > 0 and q >= best_quality: p = self._get_precedence(accepts, r.mimetype) best_quality = q yield r, q, p def best_matches(self, accepts, renderers, limit=None): rv = [] best_quality = -1 renderers = self._filter_renderers(accepts, renderers) for renderer, quality, precedence in sorted(renderers, key=lambda i: i[1:], reverse=True): if quality < best_quality or (limit and len(rv) >= limit): break best_quality = quality rv.append((renderer, renderer.mimetype)) return rv def select_renderer(self, renderers, mimetype=None, prefer=None, request=None): """Given the incoming request and a list of renderers, return a two-tuple of: (renderer, mimetype). """ accepts = self.get_accept_mimetypes(request) if mimetype: if accepts.quality(mimetype) > 0: for renderer in renderers: if renderer.mimetype == mimetype: return renderer, mimetype raise exc.NotAcceptable() renderers = self.best_matches(accepts, renderers) if renderers: if prefer: for renderer, mimetype in renderers: if mimetype == prefer: return renderer, mimetype return renderers[0] raise exc.NotAcceptable()
2,435
942
# Generated by Django 3.0.8 on 2020-08-11 14:16 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('accounts', '0004_addtocart'), ] operations = [ migrations.AddField( model_name='addtocart', name='cart_useremail', field=models.EmailField(default=None, max_length=254), ), ]
403
140
import pprint import sys import re FILE = sys.stdin #FILE = open('sample.in') def is_palindrome(n): k = str(n) return list(k) == list(reversed(k)) def reverse_add(n): return n + int(str(n)[::-1]) #import ipdb;ipdb.set_trace() test_cases = range(int(FILE.readline())) #import ipdb; ipdb.set_trace() for tc in test_cases: n = int(FILE.readline().strip()) total_sum_count = 1 n = reverse_add(n) while not is_palindrome(n): n = reverse_add(n) total_sum_count += 1 print(total_sum_count, n)
539
216
from .baseprocessor import BaseProcessor class FB15K237Processor(BaseProcessor): def __init__(self, node_lut, relation_lut, reprocess): super().__init__("FB15K237", node_lut, relation_lut, reprocess)
214
75
import time import os import pathlib import sys from subprocess import call #TODO: Maybe make a pip_handler file idk def pip_install(packageName: str): try: call(f'py -m pip install {packageName}') except: call(f'pip install {packageName}') try: from pypresence import presence except: pip_install("pypresence") STATUS_TEXT = str(sys.argv) IMGID_CONSTS = ['furcock_img', 'blacked_img', 'censored_img', 'goon_img', 'goon2_img', 'hypno_img', 'futa_img', 'healslut_img', 'gross_img'] if not STATUS_TEXT == '': try: #if has file, tries to split at newline break # uses first line as the string for text description # uses second line as the image id for requesting image from discord api ls = STATUS_TEXT.split('\n') STATUS_TEXT[0] = ls[0] if ls[1] in IMGID_CONSTS: STATUS_TEXT[1] = ls[1] except: print('failed line split') #tweak this def do_discord(): # conn = presence.Presence('') #TODO: Make Discord API go brrr # conn.connect() # conn.update(state=textObj[0], large_image=textObj[1], start=int(time.time())) while True: time.sleep(15) do_discord()
1,256
459
import bpy import subprocess REBUILD = 0 if REBUILD: subprocess.call([ "g++", bpy.path.abspath('//../main.cpp'), bpy.path.abspath('//../PtTree.cpp'), "-o", bpy.path.abspath('//PtTree') ]) # Collect the input data. verts = bpy.data.meshes['PointCloud'].vertices query_amount = 5 query_obj = bpy.data.objects['Search'] query_pos = query_obj.location query_radius = query_obj.dimensions[0] / 2 points = [str(v.co.x) + ',' + str(v.co.y) for v in verts] args = [ bpy.path.abspath('//PtTree.exe'), str(query_amount), str(query_radius), str(query_pos.x) + ',' + str(query_pos.y), *points ] # Make the call. proc = subprocess.run(args, encoding='utf-8', stdout=subprocess.PIPE) stdout = proc.stdout.split('\n') [print(line) for line in stdout] ids = [int(line.split(" ")[0]) for line in stdout] # Visualize the output. bpy.ops.object.mode_set(mode="OBJECT") for i in range(len(verts)): verts[i].select = False if i in ids: verts[i].select = True bpy.ops.object.mode_set(mode="EDIT")
1,086
426
# zschema sub-schema for zgrab2's ssh module (modules/ssh.go) # Registers zgrab2-ssh globally, and ssh with the main zgrab2 schema. from zschema.leaves import * from zschema.compounds import * import zschema.registry import zcrypto_schemas.zcrypto as zcrypto from . import zgrab2 # NOTE: Despite the fact that we have e.g. "supportedHostKeyAlgos", # "allSupportedCiphers", etc, including a different value is not syntactically # incorrect...so all of the following algorithm identifiers are Strings with # examples=[...], rather tha Enums with values=[...]. # lib/ssh/common.go -- allSupportedKexAlgos KexAlgorithm = String.with_args( doc="An ssh key exchange algorithm identifier, named according to section 6 of https://www.ietf.org/rfc/rfc4251.txt; see https://www.iana.org/assignments/ssh-parameters/ssh-parameters.xhtml#ssh-parameters-15 for standard values.", examples=[ "diffie-hellman-group1-sha1", "diffie-hellman-group14-sha1", "ecdh-sha2-nistp256", "ecdh-sha2-nistp384", "ecdh-sha2-nistp521", "curve25519-sha256@libssh.org", "diffie-hellman-group-exchange-sha1", "diffie-hellman-group-exchange-sha256", ] ) KexAlgorithms = ListOf.with_args(KexAlgorithm()) # Defined in lib/ssh/common.go -- supportedHostKeyAlgos, though they are # generated via PublicKey.Type() KeyAlgorithm = String.with_args( doc="An ssh public key algorithm identifier, named according to section 6 of https://www.ietf.org/rfc/rfc4251.txt; see https://www.iana.org/assignments/ssh-parameters/ssh-parameters.xhtml#ssh-parameters-19 for standard values.", examples=[ "ssh-rsa-cert-v01@openssh.com", "ssh-dss-cert-v01@openssh.com", "ecdsa-sha2-nistp256-cert-v01@openssh.com", "ecdsa-sha2-nistp384-cert-v01@openssh.com", "ecdsa-sha2-nistp521-cert-v01@openssh.com", "ssh-ed25519-cert-v01@openssh.com", "ssh-rsa", "ssh-dss", "ecdsa-sha2-nistp256", "ecdsa-sha2-nistp384", "ecdsa-sha2-nistp521", "ssh-ed25519", ] ) KeyAlgorithms = ListOf.with_args(KeyAlgorithm()) # From lib/ssh/common.go -- allSupportedCiphers CipherAlgorithm = String.with_args( doc="An ssh cipher algorithm identifier, named according to section 6 of https://www.ietf.org/rfc/rfc4251.txt; see https://www.iana.org/assignments/ssh-parameters/ssh-parameters.xhtml#ssh-parameters-16 for standard values.", examples=[ "aes128-ctr", "aes192-ctr", "aes256-ctr", "aes128-gcm@openssh.com", "aes128-cbc", "3des-cbc", "arcfour256", "arcfour128", "arcfour", ] ) CipherAlgorithms = ListOf.with_args(CipherAlgorithm()) # From lib/ssh/common.go -- supportedMACs. MACAlgorithm = String.with_args( doc="An ssh MAC algorithm identifier, named according to section 6 of https://www.ietf.org/rfc/rfc4251.txt; see https://www.iana.org/assignments/ssh-parameters/ssh-parameters.xhtml#ssh-parameters-18 for standard values.", examples=["hmac-sha2-256", "hmac-sha1", "hmac-sha1-96"] ) MACAlgorithms = ListOf.with_args(MACAlgorithm()) # From lib/ssh/common.go -- supportedCompressions CompressionAlgorithm = String.with_args( doc="An ssh compression algorithm identifier, named according to section 6 of https://www.ietf.org/rfc/rfc4251.txt; see https://www.iana.org/assignments/ssh-parameters/ssh-parameters.xhtml#ssh-parameters-20 for standard values.", examples=["none", "zlib"] ) CompressionAlgorithms = ListOf.with_args(CompressionAlgorithm()) LanguageTag = String.with_args(doc="A language tag, as defined in https://www.ietf.org/rfc/rfc3066.txt.") LanguageTags = ListOf.with_args(LanguageTag(), doc="A name-list of language tags in order of preference.") # zgrab2/lib/ssh/messages.go: (Json)kexInitMsg KexInitMessage = SubRecordType({ "cookie": Binary(), "kex_algorithms": KexAlgorithms(doc="Key exchange algorithms used in the handshake."), "host_key_algorithms": KeyAlgorithms(doc="Asymmetric key algorithms for the host key supported by the client."), "client_to_server_ciphers": CipherAlgorithms(), "server_to_client_ciphers": CipherAlgorithms(), "client_to_server_macs": MACAlgorithms(), "server_to_client_macs": MACAlgorithms(), "client_to_server_compression": CompressionAlgorithms(), "server_to_client_compression": CompressionAlgorithms(), "client_to_server_languages": LanguageTags(), "server_to_client_languages": LanguageTags(), "first_kex_follows": Boolean(), "reserved": Unsigned32BitInteger(), }) # zgrab2/lib/ssh/log.go: EndpointId EndpointID = SubRecordType({ "raw": String(), "version": String(), "software": String(), "comment": String(), }) # This could be merged into a single class with e.g. an analyzed param, # but it's probably clearer to just duplicate it. AnalyzedEndpointID = SubRecordType({ "raw": AnalyzedString(), "version": String(), "software": AnalyzedString(), "comment": AnalyzedString(), }) # zgrab2/lib/ssh/kex.go: kexResult KexResult = SubRecordType({ "H": Binary(), "K": Binary(), "session_id": Binary() }) # zgrab2/lib/ssh/keys.go: ed25519PublicKey ED25519PublicKey = SubRecordType({ "public_bytes": Binary(), }) # zgrab2/lib/ssh/kex.go: curve25519sha256JsonLogParameters (via curve25519sha256) Curve25519SHA256Params = SubRecordType({ "client_public": Binary(required=False), "client_private": Binary(required=False), "server_public": Binary(required=False), }) # zgrab2/lib/ssh/certs.go: JsonSignature Signature = SubRecordType({ "parsed": SubRecord({ "algorithm": KeyAlgorithm(), "value": Binary(), }), "raw": Binary(), "h": Binary(), }) # lib/ssh/kex.go: PublicKeyJsonLog, sans the certkey_public_key (since that would create a loop) SSHPublicKey = SubRecordType({ "raw": Binary(), "fingerprint_sha256": String(), # TODO: Enum? Obviously must serialize to one of rsa/dsa/ecdsa/ed25519_public_key... "algorithm": String(), # For compatiblity with ztag "key_algorithm":String(), "rsa_public_key": zcrypto.RSAPublicKey(), "dsa_public_key": zcrypto.DSAPublicKey(), "ecdsa_public_key": zcrypto.ECDSAPublicKey(), "ed25519_public_key": ED25519PublicKey(), }) # lib/ssh/certs.go: JsonCertType CertType = SubRecordType({ "id": Unsigned32BitInteger(doc="The numerical certificate type value. 1 identifies user certificates, 2 identifies host certificates."), "name": Enum(values=["USER", "HOST", "unknown"], doc="The human-readable name for the certificate type."), }) # lib/ssh/certs.go: JsonCertificate SSHPublicKeyCert = SubRecord.with_args({ # TODO: Use / include our cert type here, or maybe somewhere else in the response? "certkey_public_key": SubRecord({ "nonce": Binary(), # Note that this is not recursive, since SSHPublicKey() does not include certkey_public_key. "key": SSHPublicKey(), "serial": String(doc="The certificate serial number, encoded as a base-10 string."), "cert_type": CertType(), "key_id": String(doc="A free-form text field filled in by the CA at the time of signing, intended to identify the principal in log messages."), "valid_principals": ListOf(String(), doc="Names for which this certificate is valid; hostnames for cert_type=HOST certificates and usernames for cert_type=USER certificates."), "validity": SubRecord({ "valid_after": DateTime(doc="Timestamp of when certificate is first valid. Timezone is UTC."), "valid_before": DateTime(doc="Timestamp of when certificate expires. Timezone is UTC."), "length": Signed64BitInteger(), }), "reserved": Binary(), "signature_key": SSHPublicKey(), "signature": Signature(), "parse_error": String(), "extensions": SubRecord({ "known": SubRecord({ "permit_X11_forwarding": String(), "permit_agent_forwarding": String(), "permit_port_forwarding": String(), "permit_pty": String(), "permit_user_rc": String(), }), "unknown": ListOf(String()), }), "critical_options": SubRecord({ "known": SubRecord({ "force_command": String(), "source_address": String(), }), "unknown": ListOf(String()), }) }) }, extends=SSHPublicKey()) # zgrab2/lib/ssh/common.go: directionAlgorithms DirectionAlgorithms = SubRecordType({ "cipher": CipherAlgorithm(), "mac": MACAlgorithm(), "compression": CompressionAlgorithm(), }) # zgrab2/lib/ssh/kex.go: interface kexAlgorithm # Searching usages of kexAlgorithm turns up: # - dhGroup: dh_params, server_signature, server_host_key # - ecdh: ecdh_params, server_signature, server_host_key # - curve25519sha256: curve25519_sha256_params, server_signature, server_host_key # - dhGEXSHA: dh_params, server_signature, server_host_key KeyExchange = SubRecordType({ "curve25519_sha256_params": Curve25519SHA256Params(), "ecdh_params": zcrypto.ECDHParams(), "dh_params": zcrypto.DHParams(), "server_signature": Signature(), "server_host_key": SSHPublicKeyCert(), }) # zgrab2/lib/ssh/common.go: algorithms (aux in MarshalJSON) AlgorithmSelection = SubRecordType({ "dh_kex_algorithm": KexAlgorithm(), "host_key_algorithm": KeyAlgorithm(), "client_to_server_alg_group": DirectionAlgorithms(), "server_to_client_alg_group": DirectionAlgorithms(), }) # zgrab2/lib/ssh/log.go: HandshakeLog # TODO: Can ssh re-use any of the generic TLS model? ssh_scan_response = SubRecord({ "result": SubRecord({ "banner": WhitespaceAnalyzedString(), "server_id": AnalyzedEndpointID(), "client_id": EndpointID(), "server_key_exchange": KexInitMessage(), "client_key_exchange": KexInitMessage(), "algorithm_selection": AlgorithmSelection(), "key_exchange": KeyExchange(), "userauth": ListOf(String()), "crypto": KexResult(), }) }, extends=zgrab2.base_scan_response) zschema.registry.register_schema("zgrab2-ssh", ssh_scan_response) zgrab2.register_scan_response_type("ssh", ssh_scan_response)
10,274
3,485
from flask import render_template,request,redirect,url_for,abort from ..models import User,Post,Comment,Subscriber from ..requests import get_quotes from . import main from .forms import PostForm,CommentForm,DelForm,UpdateProfile from app.auth.forms import SubscriptionForm from .. import db,photos from flask_login import login_required,current_user import markdown2 from ..email import mail_message from app.auth import views,forms # from sqlalchemy import desc @main.route('/',methods = ['GET','POST']) def index(): ''' View root page function that returns the index page and its data ''' quotes=get_quotes() title = 'Home - Welcome to The best Blogging Website Online' posts=Post.query.all() # desc(posts) users= None for post in posts: comments=Comment.query.filter_by(post_id=post.id).all() return render_template('index.html', title = title,posts=posts, users=users,quotes=quotes,comments=comments) @main.route('/user/<uname>') def profile(uname): user = User.query.filter_by(username = uname).first() if user is None: abort(404) return render_template("profile/profile.html", user = user) @main.route('/user/<uname>/update/bio',methods = ['GET','POST']) @login_required def update_bio(uname): user = User.query.filter_by(username = uname).first() if user is None: abort(404) form = UpdateProfile() if form.validate_on_submit(): user.bio = form.bio.data db.session.add(user) db.session.commit() return redirect(url_for('.profile',uname=user.username)) return render_template('profile/update_bio.html',form =form) # @main.route('/user/update/pitch/<id>',methods = ['GET','POST']) # def single_review(id): # pitch=Pitch.query.get(id) # if pitch is None: # abort(404) # form = PitchForm() # # if form.validate_on_submit(): # user.pitches = form.pitches.data # # db.session.add(user) # db.session.commit() # # return redirect(url_for('.profile',pitch=user.pitches)) # # format_pitch = markdown2.markdown(pitch.movie_pitch,extras=["code-friendly", "fenced-code-blocks"]) # return render_template('new_pitch.html',pitch = pitch,format_pitch=format_pitch) @main.route('/new_post/',methods = ['GET','POST']) @login_required def new_post(): form = PostForm() if form.validate_on_submit(): post = Post(name = form.name.data, user_id = current_user.id) db.session.add(post) db.session.commit() subscribers=Subscriber.query.filter_by(email=Subscriber.email).all() form = SubscriptionForm() for subscriber in subscribers: mail_message("A New Blog Post is added","email/welcome_user",subscriber.email,subscribers=subscribers) return redirect(url_for('.index')) return render_template('profile/new_post.html',post_form=form) # @main.route('/delete_post/<int:id>',methods = ['GET','POST']) # def del_post(id): @main.route('/new_comment/<int:id>',methods = ['GET','POST']) def new_comment(id): form = CommentForm() form2=DelForm() posts=Post.query.filter_by(id=id).all() comments=Comment.query.filter_by(post_id=id).all() if form.validate_on_submit(): comment = Comment(name = form.name.data, post_id = id) db.session.add(comment) db.session.commit() if form2.validate_on_submit(): comment=Comment.query.filter_by(id=id).delete() # db.session.delete(comment) db.session.commit() # if button.click() return redirect(url_for('.index')) return render_template('profile/new_comment.html',comment_form=form,del_form=form2,comments=comments,posts=posts) # @main.route('/new_vote/',methods = ['GET','POST']) # @login_required # def new_vote(): # form = VoteForm() # # votes = get_vote(id) # # if form.validate_on_submit(): # pitch = Pitch(name = form.name.data, user_id = current_user.id) # upvote = Vote(upvote = form.validate_on_submit(),pitch_id = pitch.id) # downvote = Vote(downvote = form.validate_on_submit(),pitch_id = pitch.id) # up=0 # down=0 # for upvote in vote: # up+=1 # db.session.add(upvote=up) # db.session.commit() # for downvote in vote: # down+=1 # db.session.add(downvote=down) # db.session.commit() # user=User.query.filter_by(id = pitch.id).first() # return redirect(url_for('.index')) # # return render_template('profile/new_comment.html',comment_form=form) # return render_template('new_vote.html',upvote = upvote, downvote = downvote, vote_form=form, votes=votes) @main.route('/user/<uname>/update/pic',methods= ['POST']) @login_required def update_pic(uname): user = User.query.filter_by(username = uname).first() if 'photo' in request.files: filename = photos.save(request.files['photo']) path = f'photos/{filename}' user.profile_pic_path = path db.session.commit() return redirect(url_for('main.profile',uname=uname))
5,123
1,671
# int, float, complex Numeric Types # Float are nothing but decimal values pi = 3.14 print(pi)
100
36
from django.conf import settings from django.contrib.auth.decorators import login_required from django.http import HttpResponse from uw_saml.utils import is_member_of_group # Create your views here. @login_required def index(request): if is_member_of_group(request, settings.UW_SAML_PERMISSIONS['perm2']): return HttpResponse("Hello, world. You have perm2.") else: return HttpResponse("Hello, world. You don't have perm2.")
452
136
#! /usr/bin/env python -u # coding=utf-8 from shutil import copyfile from genoml.steps import PhenoScale, StepBase from genoml.utils import DescriptionLoader __author__ = 'Sayed Hadi Hashemi' class ModelValidateStep(StepBase): """performs validation with existing data""" _valid_prefix = None def _reduce_validate(self): self.execute_command([ self._dependecies["Plink"], "--bfile", self._opt.valid_geno_dir, "--extract", "{}.reduced_genos_snpList".format(self._opt.prune_prefix), "--recode", "A", "--out", "{}.reduced_genos".format(self._valid_prefix) ], name="Plink") def _merge(self): self.merge_reduced() def _main(self): if self._opt.pheno_scale == PhenoScale.DISCRETE: script_name = self._opt.VALIDATE_DISC if self._opt.pheno_scale == PhenoScale.DISCRETE \ else self._opt.VALIDATE_CONT self.execute_command([ self._dependecies["R"], script_name, self._valid_prefix, self._opt.n_cores, self._opt.impute_data, self._opt.prune_prefix #todo: new best_model ], name="VALIDATE_CONT, please make sure you have included .cov and .addit validation files, if used for " "training.") @DescriptionLoader.function_description("validation_step") def process(self): self._valid_prefix = "{}_validation".format(self._opt.prune_prefix) self.model_validate() def merge_reduced(self): self.execute_command([ self._dependecies["R"], self._opt.MERGE, self._opt.valid_geno_dir, self._opt.valid_pheno_file, self.xna(self._opt.valid_cov_file), self.xna(self._opt.valid_addit_file), self._valid_prefix ], name="R") @staticmethod def xna(s): return s if s is not None else "NA" # todo: new def model_validate(self): """this function performs validation with existing data""" # check if GWAS is present (meaning it was also present in training), otherwise the Prune option has been used # TODO: find a way to ensure user is providing GWAS for validation, in case it was used during training if self._opt.gwas_file is None: # we need to specify the forced allele here from the training set genotype file, this pulls the allele to # force # TODO: refactor to a Python code self.cut_column(self._opt.geno_prefix + ".bim", "2,5", self._opt.prune_prefix + ".allelesToForce") # plink self.execute_command([ self._dependecies["Plink"], "--bfile", self._opt.valid_geno_dir, "--extract", self._opt.prune_prefix + '.reduced_genos_snpList', "--recode", "A", "--recode-allele", self._opt.prune_prefix + '.allelesToForce', "--out", self._valid_prefix + '.reduced_genos' ], name="model_validate") else: # gwas_file is not None # plink self.execute_command([ self._dependecies["Plink"], "--bfile", self._opt.valid_geno_dir, "--extract", self._opt.prune_prefix + '.reduced_genos_snpList', "--recode", "A", "--recode-allele", self._opt.prune_prefix + '.variantWeightings', "--out", self._valid_prefix + '.reduced_genos' ], name="model_validate") # copy copyfile(self._opt.prune_prefix + ".temp.snpsToPull2", self._valid_prefix + ".temp.snpsToPull2") self.execute_command([ self._dependecies["R"], self._opt.SCALE_VAR_DOSES_VALID, self._opt.prune_prefix, self._opt.gwas_file, self._opt.valid_geno_dir, self._opt.geno_prefix ], name="validate") self.merge_reduced() self._main() self.execute_command([ self._dependecies["R"], self._opt.CHECK_VALIDATION, self._valid_prefix, self._opt.valid_pheno_file ], name="CHECK_VALIDATION")
4,370
1,287
from typing import Tuple, List from resotocore.dependencies import parse_args from resotocore.types import JsonElement def test_parse_override() -> None: def parse(args: str) -> List[Tuple[str, JsonElement]]: return parse_args(args.split()).config_override # type: ignore assert parse(f"--override a=foo") == [("a", "foo")] assert parse(f"--override a=foo,bla") == [("a", ["foo", "bla"])] assert parse(f"--override a=foo,bla b=a,b,c") == [("a", ["foo", "bla"]), ("b", ["a", "b", "c"])] assert parse(f'--override a="value,with,comma,in,quotes"') == [("a", "value,with,comma,in,quotes")] assert parse(f'--override a=some,value,"with,comma"') == [("a", ["some", "value", "with,comma"])]
721
263
############################################################################## # Copyright 2018 Rigetti Computing # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ############################################################################## from typing import List, Optional, Sequence, cast from qcs_api_client.client import QCSClientConfiguration from pyquil.api._abstract_compiler import AbstractBenchmarker from pyquil.api._compiler_client import ( GenerateRandomizedBenchmarkingSequenceRequest, ConjugatePauliByCliffordRequest, CompilerClient, ) from pyquil.paulis import PauliTerm, is_identity from pyquil.quil import address_qubits, Program from pyquil.quilbase import Gate class BenchmarkConnection(AbstractBenchmarker): """ Represents a connection to a server that generates benchmarking data. """ def __init__(self, *, timeout: float = 10.0, client_configuration: Optional[QCSClientConfiguration] = None): """ Client to communicate with the benchmarking data endpoint. :param timeout: Time limit for requests, in seconds. :param client_configuration: Optional client configuration. If none is provided, a default one will be loaded. """ self._compiler_client = CompilerClient( client_configuration=client_configuration or QCSClientConfiguration.load(), request_timeout=timeout, ) def apply_clifford_to_pauli(self, clifford: Program, pauli_in: PauliTerm) -> PauliTerm: r""" Given a circuit that consists only of elements of the Clifford group, return its action on a PauliTerm. In particular, for Clifford C, and Pauli P, this returns the PauliTerm representing CPC^{\dagger}. :param clifford: A Program that consists only of Clifford operations. :param pauli_in: A PauliTerm to be acted on by clifford via conjugation. :return: A PauliTerm corresponding to clifford * pauli_in * clifford^{\dagger} """ # do nothing if `pauli_in` is the identity if is_identity(pauli_in): return pauli_in indices_and_terms = list(zip(*list(pauli_in.operations_as_set()))) request = ConjugatePauliByCliffordRequest( pauli_indices=list(indices_and_terms[0]), pauli_symbols=list(indices_and_terms[1]), clifford=clifford.out(calibrations=False), ) response = self._compiler_client.conjugate_pauli_by_clifford(request) phase_factor, paulis = response.phase_factor, response.pauli pauli_out = PauliTerm("I", 0, 1.0j ** phase_factor) clifford_qubits = clifford.get_qubits() pauli_qubits = pauli_in.get_qubits() all_qubits = sorted(set(cast(List[int], pauli_qubits)).union(set(cast(List[int], clifford_qubits)))) # The returned pauli will have specified its value on all_qubits, sorted by index. # This is maximal set of qubits that can be affected by this conjugation. for i, pauli in enumerate(paulis): pauli_out = cast(PauliTerm, pauli_out * PauliTerm(pauli, all_qubits[i])) return cast(PauliTerm, pauli_out * pauli_in.coefficient) def generate_rb_sequence( self, depth: int, gateset: Sequence[Gate], seed: Optional[int] = None, interleaver: Optional[Program] = None, ) -> List[Program]: """ Construct a randomized benchmarking experiment on the given qubits, decomposing into gateset. If interleaver is not provided, the returned sequence will have the form C_1 C_2 ... C_(depth-1) C_inv , where each C is a Clifford element drawn from gateset, C_{< depth} are randomly selected, and C_inv is selected so that the entire sequence composes to the identity. If an interleaver G (which must be a Clifford, and which will be decomposed into the native gateset) is provided, then the sequence instead takes the form C_1 G C_2 G ... C_(depth-1) G C_inv . The JSON response is a list of lists of indices, or Nones. In the former case, they are the index of the gate in the gateset. :param depth: The number of Clifford gates to include in the randomized benchmarking experiment. This is different than the number of gates in the resulting experiment. :param gateset: A list of pyquil gates to decompose the Clifford elements into. These must generate the clifford group on the qubits of interest. e.g. for one qubit [RZ(np.pi/2), RX(np.pi/2)]. :param seed: A positive integer used to seed the PRNG. :param interleaver: A Program object that encodes a Clifford element. :return: A list of pyquil programs. Each pyquil program is a circuit that represents an element of the Clifford group. When these programs are composed, the resulting Program will be the randomized benchmarking experiment of the desired depth. e.g. if the return programs are called cliffords then `sum(cliffords, Program())` will give the randomized benchmarking experiment, which will compose to the identity program. """ # Support QubitPlaceholders: we temporarily index to arbitrary integers. # `generate_rb_sequence` handles mapping back to the original gateset gates. gateset_as_program = address_qubits(sum(gateset, Program())) qubits = len(gateset_as_program.get_qubits()) gateset_for_api = gateset_as_program.out().splitlines() interleaver_out: Optional[str] = None if interleaver: assert isinstance(interleaver, Program) interleaver_out = interleaver.out(calibrations=False) depth = int(depth) # needs to be jsonable, no np.int64 please! request = GenerateRandomizedBenchmarkingSequenceRequest( depth=depth, num_qubits=qubits, gateset=gateset_for_api, seed=seed, interleaver=interleaver_out, ) response = self._compiler_client.generate_randomized_benchmarking_sequence(request) programs = [] for clifford in response.sequence: clifford_program = Program() if interleaver: clifford_program._calibrations = interleaver.calibrations # Like below, we reversed the order because the API currently hands back the Clifford # decomposition right-to-left. for index in reversed(clifford): clifford_program.inst(gateset[index]) programs.append(clifford_program) # The programs are returned in "textbook style" right-to-left order. To compose them into # the correct pyquil program, we reverse the order. return list(reversed(programs))
7,374
2,045
n = input("Мы будем проверять теорию коллатца. Введите число") def collatz(num): num = int(num) if not num: return None while num != 1: num = num/2 if num % 2 == 0 else 3*num + 1 collatz(n)
212
91
class Solution: def findPair(self, arr, L,N): store = set() for num in arr : if num in store : return True store.add(num - N) store.add(num + N) return False if __name__ == '__main__': t = int(input()) for _ in range(t): L,N = [int(x) for x in input().split()] arr = [int(x) for x in input().split()] solObj = Solution() if(solObj.findPair(arr,L, N)): print(1) else: print(-1)
554
181
from dataclasses import dataclass from tlh.const import RomVariant from intervaltree import IntervalTree, Interval @dataclass class Pointer: rom_variant: RomVariant = None address: int = 0 points_to: int = 0 certainty: int = 0 author: str = '' note: str = '' class PointerList: def __init__(self, pointers: list[Pointer], rom_variant: RomVariant) -> None: intervals = [] for pointer in pointers: if pointer.rom_variant == rom_variant: intervals.append(Interval(pointer.address, pointer.address+4, pointer)) self.tree = IntervalTree(intervals) def get_pointers_at(self, index: int) -> list[Pointer]: pointers = [] for interval in self.tree.at(index): pointers.append(interval.data) return pointers def append(self, pointer: Pointer) -> None: self.tree.add(Interval(pointer.address, pointer.address+4, pointer)) def remove(self, pointer: Pointer) -> None: self.tree.remove(Interval(pointer.address, pointer.address+4, pointer)) def __iter__(self): return map(lambda x: x.data, self.tree.__iter__()) def get_sorted_pointers(self) -> list[Pointer]: return map(lambda x: x.data, sorted(self.tree))
1,270
378
from django.db import models from djangoyearlessdate.models import YearlessDateField, YearField from djangoyearlessdate.helpers import YearlessDate class YearlessDateModel(models.Model): """Sample model for testing YearlessDateField. """ yearless_date = YearlessDateField() optional_yearless_date = YearlessDateField(blank=True, null=True) yearless_date_with_default = YearlessDateField(default=YearlessDate(day=3, month=5)) class YearModel(models.Model): """Sample model for testing YearField. """ year = YearField()
554
160
from ror.RORParameters import RORParameters from ror.RORResult import RORResult from ror.AbstractTieResolver import AbstractTieResolver from ror.result_aggregator_utils import Rank class NoTieResolver(AbstractTieResolver): def __init__(self) -> None: super().__init__('NoResolver') def resolve_rank(self, rank: Rank, result: RORResult, parameters: RORParameters) -> Rank: super().resolve_rank(rank, result, parameters) return rank def help(self) -> str: return 'This resolver does nothing. It just returns same rank as was provided as an input.'
597
166
""" util This package is for util modules """
47
16
# Time: O(n) # Space: O(1) class Solution(object): def numTimesAllBlue(self, light): """ :type light: List[int] :rtype: int """ result, right = 0, 0 for i, num in enumerate(light, 1): right = max(right, num) result += (right == i) return result
331
108
def input_parse(): with open("day1.txt", r) as inputFile: input_list = inputFile.readline() return
119
39
import itertools import logging from typing import Dict, Tuple from tilapia.lib.basic import bip44 from tilapia.lib.basic.functional.require import require from tilapia.lib.hardware import interfaces as hardware_interfaces from tilapia.lib.provider import data from tilapia.lib.provider.chains import btc from tilapia.lib.provider.chains.bch.sdk import cash_address from tilapia.lib.secret import interfaces as secret_interfaces logger = logging.getLogger("app.chain") class BCHProvider(btc.BTCProvider): ADDRESS_PREFIX = "bitcoincash" def pubkey_to_address(self, verifier: secret_interfaces.VerifierInterface, encoding: str = None) -> str: require(encoding == "P2PKH", f"Invalid address encoding: {encoding}") pubkey = verifier.get_pubkey(compressed=True) pubkey_hash = self.network.keys.public(pubkey).hash160(is_compressed=True) if encoding == "P2PKH": # Pay To Public Key Hash address = cash_address.to_cash_address(self.ADDRESS_PREFIX, pubkey_hash) else: raise Exception("Should not be here") return address def verify_address(self, address: str) -> data.AddressValidation: is_valid, encoding = False, None try: if ":" not in address: address = f"{self.ADDRESS_PREFIX}:{address}" prefix, _ = address.split(":") if prefix == self.ADDRESS_PREFIX: is_valid = cash_address.is_valid_cash_address(address) encoding = "P2PKH" if is_valid else None except Exception as e: logger.exception(f"Illegal address: {address}, error: {e}") address = address if is_valid else "" return data.AddressValidation( normalized_address=address, display_address=address, is_valid=is_valid, encoding=encoding, ) def _cash_address_to_legacy_address(self, address: str) -> str: if ":" not in address: return address pubkey_hash = cash_address.export_pubkey_hash(address) return self.network.address.for_p2pkh(pubkey_hash) def _pre_process_unsigned_tx(self, unsigned_tx: data.UnsignedTx, signers: dict) -> Tuple[data.UnsignedTx, dict]: for i in itertools.chain(unsigned_tx.inputs, unsigned_tx.outputs): i.address = self._cash_address_to_legacy_address(i.address) # pycoin supports legacy bch address only signers = {self._cash_address_to_legacy_address(k): v for k, v in signers.items()} return unsigned_tx, signers def sign_transaction( self, unsigned_tx: data.UnsignedTx, signers: Dict[str, secret_interfaces.SignerInterface] ) -> data.SignedTx: unsigned_tx, signers = self._pre_process_unsigned_tx(unsigned_tx, signers) return super(BCHProvider, self).sign_transaction(unsigned_tx, signers) def hardware_sign_transaction( self, hardware_client: hardware_interfaces.HardwareClientInterface, unsigned_tx: data.UnsignedTx, bip44_path_of_signers: Dict[str, bip44.BIP44Path], ) -> data.SignedTx: unsigned_tx, bip44_path_of_signers = self._pre_process_unsigned_tx(unsigned_tx, bip44_path_of_signers) return super(BCHProvider, self).hardware_sign_transaction(hardware_client, unsigned_tx, bip44_path_of_signers) def get_token_info_by_address(self, token_address: str) -> Tuple[str, str, int]: raise NotImplementedError()
3,472
1,090
""" DFA Automata Implementation """ class State: """ Nodes/States in an automaton """ def __init__(self, isAccept, arrows): # Boolean, wether or not this state is an accept state self.isAccept = isAccept # dictionary of keys/labels:Other states self.arrows = arrows class DFA: """ A DFA """ def __init__(self, start): # Starting state self.start = start def match(self, s): """ check and return wether or not string s is accepted by our automaton """ # Current state we are in currentState = self.start # Loop through characters in state for c in s: # Set current state as one pointed to by key of c currentState = currentState.arrows[c] # Return wether or not current state is an accept state return currentState.isAccept def compile(): """ Create our automaton """ # Creating an DFA with two states; 0 points to themselves, and 1 points to the other. (checking for even parity) # Compile is standard terminoligy for creating something like this # Create start state start = State(True, {}) # Other state other = State(False, {}) # The states point to themselves for 0 start.arrows['0'] = start other.arrows['0'] = other # They point to eachother for 1 start.arrows['1'] = other other.arrows['1'] = start a = DFA(start) return a # Create automaton instance myAuto = compile() # tests for s in ['1100', '11111', '', '1', '0']: result = myAuto.match(s) print(f"{s} accepted? {result}") for s in ['000', '001', '010', '011', '100', '101', '110', '111']: result = myAuto.match(s) print(f"{s} accepted? {result}")
1,747
546
# Generated by Django 2.2.3 on 2019-08-29 15:30 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('database', '0026_auto_20190829_1528'), ] operations = [ migrations.AddField( model_name='vendor', name='email', field=models.EmailField(blank=True, max_length=100), ), migrations.AddField( model_name='vendor', name='phone_number', field=models.CharField(blank=True, max_length=100), ), ]
568
193
import sys import os class PDF(object): def pdf(self, docx): sofficepath = 'soffice' convertcmd = '%s --headless --convert-to pdf %%s' % sofficepath os.popen(convertcmd % docx)
207
73
""" _ _ _ _ _ _ __ | |_| |_ __ ___ | (_) |__ | '_ \| __| | '_ ` _ \| | | '_ \ | | | | |_| | | | | | | | | |_) | |_| |_|\__|_|_| |_| |_|_|_|_.__/ A robust, fast and efficient 'first-class' Python Library for NTLM authentication, signing and encryption (c) 2015, Ian Clegg <ian.clegg@sourcewarp.com> ntlmlib is licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import logging # Set default logging handler to avoid "No handler found" warnings. try: # Python 2.7+ from logging import NullHandler except ImportError: class NullHandler(logging.Handler): def emit(self, record): pass logging.getLogger(__name__).addHandler(NullHandler())
1,181
375