Add files using upload-large-folder tool

.gitattributes

@@ -697,3 +697,4 @@ mplug_owl2/lib/python3.10/site-packages/pillow.libs/liblcms2-525547ec.so.2.0.16
 mplug_owl2/lib/python3.10/site-packages/pillow.libs/libtiff-a92b430c.so.6.0.2 filter=lfs diff=lfs merge=lfs -text
 mplug_owl2/lib/python3.10/site-packages/pillow.libs/libharfbuzz-07d0ad17.so.0.61010.0 filter=lfs diff=lfs merge=lfs -text
 mplug_owl2/lib/python3.10/site-packages/idna/__pycache__/uts46data.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text
+pllava/lib/python3.10/site-packages/numpy/core/_simd.cpython-310-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text

mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tree/__init__.py

@@ -0,0 +1,6 @@
+from .branchings import *
+from .coding import *
+from .mst import *
+from .recognition import *
+from .operations import *
+from .decomposition import *

mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tree/coding.py

@@ -0,0 +1,413 @@
+"""Functions for encoding and decoding trees.
+
+Since a tree is a highly restricted form of graph, it can be represented
+concisely in several ways. This module includes functions for encoding
+and decoding trees in the form of nested tuples and Prüfer
+sequences. The former requires a rooted tree, whereas the latter can be
+applied to unrooted trees. Furthermore, there is a bijection from Prüfer
+sequences to labeled trees.
+
+"""
+
+from collections import Counter
+from itertools import chain
+
+import networkx as nx
+from networkx.utils import not_implemented_for
+
+__all__ = [
+    "from_nested_tuple",
+    "from_prufer_sequence",
+    "NotATree",
+    "to_nested_tuple",
+    "to_prufer_sequence",
+]
+
+
+class NotATree(nx.NetworkXException):
+    """Raised when a function expects a tree (that is, a connected
+    undirected graph with no cycles) but gets a non-tree graph as input
+    instead.
+
+    """
+
+
+@not_implemented_for("directed")
+@nx._dispatchable(graphs="T")
+def to_nested_tuple(T, root, canonical_form=False):
+    """Returns a nested tuple representation of the given tree.
+
+    The nested tuple representation of a tree is defined
+    recursively. The tree with one node and no edges is represented by
+    the empty tuple, ``()``. A tree with ``k`` subtrees is represented
+    by a tuple of length ``k`` in which each element is the nested tuple
+    representation of a subtree.
+
+    Parameters
+    ----------
+    T : NetworkX graph
+        An undirected graph object representing a tree.
+
+    root : node
+        The node in ``T`` to interpret as the root of the tree.
+
+    canonical_form : bool
+        If ``True``, each tuple is sorted so that the function returns
+        a canonical form for rooted trees. This means "lighter" subtrees
+        will appear as nested tuples before "heavier" subtrees. In this
+        way, each isomorphic rooted tree has the same nested tuple
+        representation.
+
+    Returns
+    -------
+    tuple
+        A nested tuple representation of the tree.
+
+    Notes
+    -----
+    This function is *not* the inverse of :func:`from_nested_tuple`; the
+    only guarantee is that the rooted trees are isomorphic.
+
+    See also
+    --------
+    from_nested_tuple
+    to_prufer_sequence
+
+    Examples
+    --------
+    The tree need not be a balanced binary tree::
+
+        >>> T = nx.Graph()
+        >>> T.add_edges_from([(0, 1), (0, 2), (0, 3)])
+        >>> T.add_edges_from([(1, 4), (1, 5)])
+        >>> T.add_edges_from([(3, 6), (3, 7)])
+        >>> root = 0
+        >>> nx.to_nested_tuple(T, root)
+        (((), ()), (), ((), ()))
+
+    Continuing the above example, if ``canonical_form`` is ``True``, the
+    nested tuples will be sorted::
+
+        >>> nx.to_nested_tuple(T, root, canonical_form=True)
+        ((), ((), ()), ((), ()))
+
+    Even the path graph can be interpreted as a tree::
+
+        >>> T = nx.path_graph(4)
+        >>> root = 0
+        >>> nx.to_nested_tuple(T, root)
+        ((((),),),)
+
+    """
+
+    def _make_tuple(T, root, _parent):
+        """Recursively compute the nested tuple representation of the
+        given rooted tree.
+
+        ``_parent`` is the parent node of ``root`` in the supertree in
+        which ``T`` is a subtree, or ``None`` if ``root`` is the root of
+        the supertree. This argument is used to determine which
+        neighbors of ``root`` are children and which is the parent.
+
+        """
+        # Get the neighbors of `root` that are not the parent node. We
+        # are guaranteed that `root` is always in `T` by construction.
+        children = set(T[root]) - {_parent}
+        if len(children) == 0:
+            return ()
+        nested = (_make_tuple(T, v, root) for v in children)
+        if canonical_form:
+            nested = sorted(nested)
+        return tuple(nested)
+
+    # Do some sanity checks on the input.
+    if not nx.is_tree(T):
+        raise nx.NotATree("provided graph is not a tree")
+    if root not in T:
+        raise nx.NodeNotFound(f"Graph {T} contains no node {root}")
+
+    return _make_tuple(T, root, None)
+
+
+@nx._dispatchable(graphs=None, returns_graph=True)
+def from_nested_tuple(sequence, sensible_relabeling=False):
+    """Returns the rooted tree corresponding to the given nested tuple.
+
+    The nested tuple representation of a tree is defined
+    recursively. The tree with one node and no edges is represented by
+    the empty tuple, ``()``. A tree with ``k`` subtrees is represented
+    by a tuple of length ``k`` in which each element is the nested tuple
+    representation of a subtree.
+
+    Parameters
+    ----------
+    sequence : tuple
+        A nested tuple representing a rooted tree.
+
+    sensible_relabeling : bool
+        Whether to relabel the nodes of the tree so that nodes are
+        labeled in increasing order according to their breadth-first
+        search order from the root node.
+
+    Returns
+    -------
+    NetworkX graph
+        The tree corresponding to the given nested tuple, whose root
+        node is node 0. If ``sensible_labeling`` is ``True``, nodes will
+        be labeled in breadth-first search order starting from the root
+        node.
+
+    Notes
+    -----
+    This function is *not* the inverse of :func:`to_nested_tuple`; the
+    only guarantee is that the rooted trees are isomorphic.
+
+    See also
+    --------
+    to_nested_tuple
+    from_prufer_sequence
+
+    Examples
+    --------
+    Sensible relabeling ensures that the nodes are labeled from the root
+    starting at 0::
+
+        >>> balanced = (((), ()), ((), ()))
+        >>> T = nx.from_nested_tuple(balanced, sensible_relabeling=True)
+        >>> edges = [(0, 1), (0, 2), (1, 3), (1, 4), (2, 5), (2, 6)]
+        >>> all((u, v) in T.edges() or (v, u) in T.edges() for (u, v) in edges)
+        True
+
+    """
+
+    def _make_tree(sequence):
+        """Recursively creates a tree from the given sequence of nested
+        tuples.
+
+        This function employs the :func:`~networkx.tree.join` function
+        to recursively join subtrees into a larger tree.
+
+        """
+        # The empty sequence represents the empty tree, which is the
+        # (unique) graph with a single node. We mark the single node
+        # with an attribute that indicates that it is the root of the
+        # graph.
+        if len(sequence) == 0:
+            return nx.empty_graph(1)
+        # For a nonempty sequence, get the subtrees for each child
+        # sequence and join all the subtrees at their roots. After
+        # joining the subtrees, the root is node 0.
+        return nx.tree.join_trees([(_make_tree(child), 0) for child in sequence])
+
+    # Make the tree and remove the `is_root` node attribute added by the
+    # helper function.
+    T = _make_tree(sequence)
+    if sensible_relabeling:
+        # Relabel the nodes according to their breadth-first search
+        # order, starting from the root node (that is, the node 0).
+        bfs_nodes = chain([0], (v for u, v in nx.bfs_edges(T, 0)))
+        labels = {v: i for i, v in enumerate(bfs_nodes)}
+        # We would like to use `copy=False`, but `relabel_nodes` doesn't
+        # allow a relabel mapping that can't be topologically sorted.
+        T = nx.relabel_nodes(T, labels)
+    return T
+
+
+@not_implemented_for("directed")
+@nx._dispatchable(graphs="T")
+def to_prufer_sequence(T):
+    r"""Returns the Prüfer sequence of the given tree.
+
+    A *Prüfer sequence* is a list of *n* - 2 numbers between 0 and
+    *n* - 1, inclusive. The tree corresponding to a given Prüfer
+    sequence can be recovered by repeatedly joining a node in the
+    sequence with a node with the smallest potential degree according to
+    the sequence.
+
+    Parameters
+    ----------
+    T : NetworkX graph
+        An undirected graph object representing a tree.
+
+    Returns
+    -------
+    list
+        The Prüfer sequence of the given tree.
+
+    Raises
+    ------
+    NetworkXPointlessConcept
+        If the number of nodes in `T` is less than two.
+
+    NotATree
+        If `T` is not a tree.
+
+    KeyError
+        If the set of nodes in `T` is not {0, …, *n* - 1}.
+
+    Notes
+    -----
+    There is a bijection from labeled trees to Prüfer sequences. This
+    function is the inverse of the :func:`from_prufer_sequence`
+    function.
+
+    Sometimes Prüfer sequences use nodes labeled from 1 to *n* instead
+    of from 0 to *n* - 1. This function requires nodes to be labeled in
+    the latter form. You can use :func:`~networkx.relabel_nodes` to
+    relabel the nodes of your tree to the appropriate format.
+
+    This implementation is from [1]_ and has a running time of
+    $O(n)$.
+
+    See also
+    --------
+    to_nested_tuple
+    from_prufer_sequence
+
+    References
+    ----------
+    .. [1] Wang, Xiaodong, Lei Wang, and Yingjie Wu.
+           "An optimal algorithm for Prufer codes."
+           *Journal of Software Engineering and Applications* 2.02 (2009): 111.
+           <https://doi.org/10.4236/jsea.2009.22016>
+
+    Examples
+    --------
+    There is a bijection between Prüfer sequences and labeled trees, so
+    this function is the inverse of the :func:`from_prufer_sequence`
+    function:
+
+    >>> edges = [(0, 3), (1, 3), (2, 3), (3, 4), (4, 5)]
+    >>> tree = nx.Graph(edges)
+    >>> sequence = nx.to_prufer_sequence(tree)
+    >>> sequence
+    [3, 3, 3, 4]
+    >>> tree2 = nx.from_prufer_sequence(sequence)
+    >>> list(tree2.edges()) == edges
+    True
+
+    """
+    # Perform some sanity checks on the input.
+    n = len(T)
+    if n < 2:
+        msg = "Prüfer sequence undefined for trees with fewer than two nodes"
+        raise nx.NetworkXPointlessConcept(msg)
+    if not nx.is_tree(T):
+        raise nx.NotATree("provided graph is not a tree")
+    if set(T) != set(range(n)):
+        raise KeyError("tree must have node labels {0, ..., n - 1}")
+
+    degree = dict(T.degree())
+
+    def parents(u):
+        return next(v for v in T[u] if degree[v] > 1)
+
+    index = u = next(k for k in range(n) if degree[k] == 1)
+    result = []
+    for i in range(n - 2):
+        v = parents(u)
+        result.append(v)
+        degree[v] -= 1
+        if v < index and degree[v] == 1:
+            u = v
+        else:
+            index = u = next(k for k in range(index + 1, n) if degree[k] == 1)
+    return result
+
+
+@nx._dispatchable(graphs=None, returns_graph=True)
+def from_prufer_sequence(sequence):
+    r"""Returns the tree corresponding to the given Prüfer sequence.
+
+    A *Prüfer sequence* is a list of *n* - 2 numbers between 0 and
+    *n* - 1, inclusive. The tree corresponding to a given Prüfer
+    sequence can be recovered by repeatedly joining a node in the
+    sequence with a node with the smallest potential degree according to
+    the sequence.
+
+    Parameters
+    ----------
+    sequence : list
+        A Prüfer sequence, which is a list of *n* - 2 integers between
+        zero and *n* - 1, inclusive.
+
+    Returns
+    -------
+    NetworkX graph
+        The tree corresponding to the given Prüfer sequence.
+
+    Raises
+    ------
+    NetworkXError
+        If the Prüfer sequence is not valid.
+
+    Notes
+    -----
+    There is a bijection from labeled trees to Prüfer sequences. This
+    function is the inverse of the :func:`from_prufer_sequence` function.
+
+    Sometimes Prüfer sequences use nodes labeled from 1 to *n* instead
+    of from 0 to *n* - 1. This function requires nodes to be labeled in
+    the latter form. You can use :func:`networkx.relabel_nodes` to
+    relabel the nodes of your tree to the appropriate format.
+
+    This implementation is from [1]_ and has a running time of
+    $O(n)$.
+
+    References
+    ----------
+    .. [1] Wang, Xiaodong, Lei Wang, and Yingjie Wu.
+           "An optimal algorithm for Prufer codes."
+           *Journal of Software Engineering and Applications* 2.02 (2009): 111.
+           <https://doi.org/10.4236/jsea.2009.22016>
+
+    See also
+    --------
+    from_nested_tuple
+    to_prufer_sequence
+
+    Examples
+    --------
+    There is a bijection between Prüfer sequences and labeled trees, so
+    this function is the inverse of the :func:`to_prufer_sequence`
+    function:
+
+    >>> edges = [(0, 3), (1, 3), (2, 3), (3, 4), (4, 5)]
+    >>> tree = nx.Graph(edges)
+    >>> sequence = nx.to_prufer_sequence(tree)
+    >>> sequence
+    [3, 3, 3, 4]
+    >>> tree2 = nx.from_prufer_sequence(sequence)
+    >>> list(tree2.edges()) == edges
+    True
+
+    """
+    n = len(sequence) + 2
+    # `degree` stores the remaining degree (plus one) for each node. The
+    # degree of a node in the decoded tree is one more than the number
+    # of times it appears in the code.
+    degree = Counter(chain(sequence, range(n)))
+    T = nx.empty_graph(n)
+    # `not_orphaned` is the set of nodes that have a parent in the
+    # tree. After the loop, there should be exactly two nodes that are
+    # not in this set.
+    not_orphaned = set()
+    index = u = next(k for k in range(n) if degree[k] == 1)
+    for v in sequence:
+        # check the validity of the prufer sequence
+        if v < 0 or v > n - 1:
+            raise nx.NetworkXError(
+                f"Invalid Prufer sequence: Values must be between 0 and {n-1}, got {v}"
+            )
+        T.add_edge(u, v)
+        not_orphaned.add(u)
+        degree[v] -= 1
+        if v < index and degree[v] == 1:
+            u = v
+        else:
+            index = u = next(k for k in range(index + 1, n) if degree[k] == 1)
+    # At this point, there must be exactly two orphaned nodes; join them.
+    orphans = set(T) - not_orphaned
+    u, v = orphans
+    T.add_edge(u, v)
+    return T

mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tree/decomposition.py

@@ -0,0 +1,88 @@
+r"""Function for computing a junction tree of a graph."""
+
+from itertools import combinations
+
+import networkx as nx
+from networkx.algorithms import chordal_graph_cliques, complete_to_chordal_graph, moral
+from networkx.utils import not_implemented_for
+
+__all__ = ["junction_tree"]
+
+
+@not_implemented_for("multigraph")
+@nx._dispatchable(returns_graph=True)
+def junction_tree(G):
+    r"""Returns a junction tree of a given graph.
+
+    A junction tree (or clique tree) is constructed from a (un)directed graph G.
+    The tree is constructed based on a moralized and triangulated version of G.
+    The tree's nodes consist of maximal cliques and sepsets of the revised graph.
+    The sepset of two cliques is the intersection of the nodes of these cliques,
+    e.g. the sepset of (A,B,C) and (A,C,E,F) is (A,C). These nodes are often called
+    "variables" in this literature. The tree is bipartite with each sepset
+    connected to its two cliques.
+
+    Junction Trees are not unique as the order of clique consideration determines
+    which sepsets are included.
+
+    The junction tree algorithm consists of five steps [1]_:
+
+    1. Moralize the graph
+    2. Triangulate the graph
+    3. Find maximal cliques
+    4. Build the tree from cliques, connecting cliques with shared
+       nodes, set edge-weight to number of shared variables
+    5. Find maximum spanning tree
+
+
+    Parameters
+    ----------
+    G : networkx.Graph
+        Directed or undirected graph.
+
+    Returns
+    -------
+    junction_tree : networkx.Graph
+        The corresponding junction tree of `G`.
+
+    Raises
+    ------
+    NetworkXNotImplemented
+        Raised if `G` is an instance of `MultiGraph` or `MultiDiGraph`.
+
+    References
+    ----------
+    .. [1] Junction tree algorithm:
+       https://en.wikipedia.org/wiki/Junction_tree_algorithm
+
+    .. [2] Finn V. Jensen and Frank Jensen. 1994. Optimal
+       junction trees. In Proceedings of the Tenth international
+       conference on Uncertainty in artificial intelligence (UAI’94).
+       Morgan Kaufmann Publishers Inc., San Francisco, CA, USA, 360–366.
+    """
+
+    clique_graph = nx.Graph()
+
+    if G.is_directed():
+        G = moral.moral_graph(G)
+    chordal_graph, _ = complete_to_chordal_graph(G)
+
+    cliques = [tuple(sorted(i)) for i in chordal_graph_cliques(chordal_graph)]
+    clique_graph.add_nodes_from(cliques, type="clique")
+
+    for edge in combinations(cliques, 2):
+        set_edge_0 = set(edge[0])
+        set_edge_1 = set(edge[1])
+        if not set_edge_0.isdisjoint(set_edge_1):
+            sepset = tuple(sorted(set_edge_0.intersection(set_edge_1)))
+            clique_graph.add_edge(edge[0], edge[1], weight=len(sepset), sepset=sepset)
+
+    junction_tree = nx.maximum_spanning_tree(clique_graph)
+
+    for edge in list(junction_tree.edges(data=True)):
+        junction_tree.add_node(edge[2]["sepset"], type="sepset")
+        junction_tree.add_edge(edge[0], edge[2]["sepset"])
+        junction_tree.add_edge(edge[1], edge[2]["sepset"])
+        junction_tree.remove_edge(edge[0], edge[1])
+
+    return junction_tree

mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tree/mst.py

@@ -0,0 +1,1284 @@
+"""
+Algorithms for calculating min/max spanning trees/forests.
+
+"""
+
+from dataclasses import dataclass, field
+from enum import Enum
+from heapq import heappop, heappush
+from itertools import count
+from math import isnan
+from operator import itemgetter
+from queue import PriorityQueue
+
+import networkx as nx
+from networkx.utils import UnionFind, not_implemented_for, py_random_state
+
+__all__ = [
+    "minimum_spanning_edges",
+    "maximum_spanning_edges",
+    "minimum_spanning_tree",
+    "maximum_spanning_tree",
+    "number_of_spanning_trees",
+    "random_spanning_tree",
+    "partition_spanning_tree",
+    "EdgePartition",
+    "SpanningTreeIterator",
+]
+
+
+class EdgePartition(Enum):
+    """
+    An enum to store the state of an edge partition. The enum is written to the
+    edges of a graph before being pasted to `kruskal_mst_edges`. Options are:
+
+    - EdgePartition.OPEN
+    - EdgePartition.INCLUDED
+    - EdgePartition.EXCLUDED
+    """
+
+    OPEN = 0
+    INCLUDED = 1
+    EXCLUDED = 2
+
+
+@not_implemented_for("multigraph")
+@nx._dispatchable(edge_attrs="weight", preserve_edge_attrs="data")
+def boruvka_mst_edges(
+    G, minimum=True, weight="weight", keys=False, data=True, ignore_nan=False
+):
+    """Iterate over edges of a Borůvka's algorithm min/max spanning tree.
+
+    Parameters
+    ----------
+    G : NetworkX Graph
+        The edges of `G` must have distinct weights,
+        otherwise the edges may not form a tree.
+
+    minimum : bool (default: True)
+        Find the minimum (True) or maximum (False) spanning tree.
+
+    weight : string (default: 'weight')
+        The name of the edge attribute holding the edge weights.
+
+    keys : bool (default: True)
+        This argument is ignored since this function is not
+        implemented for multigraphs; it exists only for consistency
+        with the other minimum spanning tree functions.
+
+    data : bool (default: True)
+        Flag for whether to yield edge attribute dicts.
+        If True, yield edges `(u, v, d)`, where `d` is the attribute dict.
+        If False, yield edges `(u, v)`.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+    """
+    # Initialize a forest, assuming initially that it is the discrete
+    # partition of the nodes of the graph.
+    forest = UnionFind(G)
+
+    def best_edge(component):
+        """Returns the optimum (minimum or maximum) edge on the edge
+        boundary of the given set of nodes.
+
+        A return value of ``None`` indicates an empty boundary.
+
+        """
+        sign = 1 if minimum else -1
+        minwt = float("inf")
+        boundary = None
+        for e in nx.edge_boundary(G, component, data=True):
+            wt = e[-1].get(weight, 1) * sign
+            if isnan(wt):
+                if ignore_nan:
+                    continue
+                msg = f"NaN found as an edge weight. Edge {e}"
+                raise ValueError(msg)
+            if wt < minwt:
+                minwt = wt
+                boundary = e
+        return boundary
+
+    # Determine the optimum edge in the edge boundary of each component
+    # in the forest.
+    best_edges = (best_edge(component) for component in forest.to_sets())
+    best_edges = [edge for edge in best_edges if edge is not None]
+    # If each entry was ``None``, that means the graph was disconnected,
+    # so we are done generating the forest.
+    while best_edges:
+        # Determine the optimum edge in the edge boundary of each
+        # component in the forest.
+        #
+        # This must be a sequence, not an iterator. In this list, the
+        # same edge may appear twice, in different orientations (but
+        # that's okay, since a union operation will be called on the
+        # endpoints the first time it is seen, but not the second time).
+        #
+        # Any ``None`` indicates that the edge boundary for that
+        # component was empty, so that part of the forest has been
+        # completed.
+        #
+        # TODO This can be parallelized, both in the outer loop over
+        # each component in the forest and in the computation of the
+        # minimum. (Same goes for the identical lines outside the loop.)
+        best_edges = (best_edge(component) for component in forest.to_sets())
+        best_edges = [edge for edge in best_edges if edge is not None]
+        # Join trees in the forest using the best edges, and yield that
+        # edge, since it is part of the spanning tree.
+        #
+        # TODO This loop can be parallelized, to an extent (the union
+        # operation must be atomic).
+        for u, v, d in best_edges:
+            if forest[u] != forest[v]:
+                if data:
+                    yield u, v, d
+                else:
+                    yield u, v
+                forest.union(u, v)
+
+
+@nx._dispatchable(
+    edge_attrs={"weight": None, "partition": None}, preserve_edge_attrs="data"
+)
+def kruskal_mst_edges(
+    G, minimum, weight="weight", keys=True, data=True, ignore_nan=False, partition=None
+):
+    """
+    Iterate over edge of a Kruskal's algorithm min/max spanning tree.
+
+    Parameters
+    ----------
+    G : NetworkX Graph
+        The graph holding the tree of interest.
+
+    minimum : bool (default: True)
+        Find the minimum (True) or maximum (False) spanning tree.
+
+    weight : string (default: 'weight')
+        The name of the edge attribute holding the edge weights.
+
+    keys : bool (default: True)
+        If `G` is a multigraph, `keys` controls whether edge keys ar yielded.
+        Otherwise `keys` is ignored.
+
+    data : bool (default: True)
+        Flag for whether to yield edge attribute dicts.
+        If True, yield edges `(u, v, d)`, where `d` is the attribute dict.
+        If False, yield edges `(u, v)`.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+    partition : string (default: None)
+        The name of the edge attribute holding the partition data, if it exists.
+        Partition data is written to the edges using the `EdgePartition` enum.
+        If a partition exists, all included edges and none of the excluded edges
+        will appear in the final tree. Open edges may or may not be used.
+
+    Yields
+    ------
+    edge tuple
+        The edges as discovered by Kruskal's method. Each edge can
+        take the following forms: `(u, v)`, `(u, v, d)` or `(u, v, k, d)`
+        depending on the `key` and `data` parameters
+    """
+    subtrees = UnionFind()
+    if G.is_multigraph():
+        edges = G.edges(keys=True, data=True)
+    else:
+        edges = G.edges(data=True)
+
+    """
+    Sort the edges of the graph with respect to the partition data. 
+    Edges are returned in the following order:
+
+    * Included edges
+    * Open edges from smallest to largest weight
+    * Excluded edges
+    """
+    included_edges = []
+    open_edges = []
+    for e in edges:
+        d = e[-1]
+        wt = d.get(weight, 1)
+        if isnan(wt):
+            if ignore_nan:
+                continue
+            raise ValueError(f"NaN found as an edge weight. Edge {e}")
+
+        edge = (wt,) + e
+        if d.get(partition) == EdgePartition.INCLUDED:
+            included_edges.append(edge)
+        elif d.get(partition) == EdgePartition.EXCLUDED:
+            continue
+        else:
+            open_edges.append(edge)
+
+    if minimum:
+        sorted_open_edges = sorted(open_edges, key=itemgetter(0))
+    else:
+        sorted_open_edges = sorted(open_edges, key=itemgetter(0), reverse=True)
+
+    # Condense the lists into one
+    included_edges.extend(sorted_open_edges)
+    sorted_edges = included_edges
+    del open_edges, sorted_open_edges, included_edges
+
+    # Multigraphs need to handle edge keys in addition to edge data.
+    if G.is_multigraph():
+        for wt, u, v, k, d in sorted_edges:
+            if subtrees[u] != subtrees[v]:
+                if keys:
+                    if data:
+                        yield u, v, k, d
+                    else:
+                        yield u, v, k
+                else:
+                    if data:
+                        yield u, v, d
+                    else:
+                        yield u, v
+                subtrees.union(u, v)
+    else:
+        for wt, u, v, d in sorted_edges:
+            if subtrees[u] != subtrees[v]:
+                if data:
+                    yield u, v, d
+                else:
+                    yield u, v
+                subtrees.union(u, v)
+
+
+@nx._dispatchable(edge_attrs="weight", preserve_edge_attrs="data")
+def prim_mst_edges(G, minimum, weight="weight", keys=True, data=True, ignore_nan=False):
+    """Iterate over edges of Prim's algorithm min/max spanning tree.
+
+    Parameters
+    ----------
+    G : NetworkX Graph
+        The graph holding the tree of interest.
+
+    minimum : bool (default: True)
+        Find the minimum (True) or maximum (False) spanning tree.
+
+    weight : string (default: 'weight')
+        The name of the edge attribute holding the edge weights.
+
+    keys : bool (default: True)
+        If `G` is a multigraph, `keys` controls whether edge keys ar yielded.
+        Otherwise `keys` is ignored.
+
+    data : bool (default: True)
+        Flag for whether to yield edge attribute dicts.
+        If True, yield edges `(u, v, d)`, where `d` is the attribute dict.
+        If False, yield edges `(u, v)`.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+    """
+    is_multigraph = G.is_multigraph()
+    push = heappush
+    pop = heappop
+
+    nodes = set(G)
+    c = count()
+
+    sign = 1 if minimum else -1
+
+    while nodes:
+        u = nodes.pop()
+        frontier = []
+        visited = {u}
+        if is_multigraph:
+            for v, keydict in G.adj[u].items():
+                for k, d in keydict.items():
+                    wt = d.get(weight, 1) * sign
+                    if isnan(wt):
+                        if ignore_nan:
+                            continue
+                        msg = f"NaN found as an edge weight. Edge {(u, v, k, d)}"
+                        raise ValueError(msg)
+                    push(frontier, (wt, next(c), u, v, k, d))
+        else:
+            for v, d in G.adj[u].items():
+                wt = d.get(weight, 1) * sign
+                if isnan(wt):
+                    if ignore_nan:
+                        continue
+                    msg = f"NaN found as an edge weight. Edge {(u, v, d)}"
+                    raise ValueError(msg)
+                push(frontier, (wt, next(c), u, v, d))
+        while nodes and frontier:
+            if is_multigraph:
+                W, _, u, v, k, d = pop(frontier)
+            else:
+                W, _, u, v, d = pop(frontier)
+            if v in visited or v not in nodes:
+                continue
+            # Multigraphs need to handle edge keys in addition to edge data.
+            if is_multigraph and keys:
+                if data:
+                    yield u, v, k, d
+                else:
+                    yield u, v, k
+            else:
+                if data:
+                    yield u, v, d
+                else:
+                    yield u, v
+            # update frontier
+            visited.add(v)
+            nodes.discard(v)
+            if is_multigraph:
+                for w, keydict in G.adj[v].items():
+                    if w in visited:
+                        continue
+                    for k2, d2 in keydict.items():
+                        new_weight = d2.get(weight, 1) * sign
+                        if isnan(new_weight):
+                            if ignore_nan:
+                                continue
+                            msg = f"NaN found as an edge weight. Edge {(v, w, k2, d2)}"
+                            raise ValueError(msg)
+                        push(frontier, (new_weight, next(c), v, w, k2, d2))
+            else:
+                for w, d2 in G.adj[v].items():
+                    if w in visited:
+                        continue
+                    new_weight = d2.get(weight, 1) * sign
+                    if isnan(new_weight):
+                        if ignore_nan:
+                            continue
+                        msg = f"NaN found as an edge weight. Edge {(v, w, d2)}"
+                        raise ValueError(msg)
+                    push(frontier, (new_weight, next(c), v, w, d2))
+
+
+ALGORITHMS = {
+    "boruvka": boruvka_mst_edges,
+    "borůvka": boruvka_mst_edges,
+    "kruskal": kruskal_mst_edges,
+    "prim": prim_mst_edges,
+}
+
+
+@not_implemented_for("directed")
+@nx._dispatchable(edge_attrs="weight", preserve_edge_attrs="data")
+def minimum_spanning_edges(
+    G, algorithm="kruskal", weight="weight", keys=True, data=True, ignore_nan=False
+):
+    """Generate edges in a minimum spanning forest of an undirected
+    weighted graph.
+
+    A minimum spanning tree is a subgraph of the graph (a tree)
+    with the minimum sum of edge weights.  A spanning forest is a
+    union of the spanning trees for each connected component of the graph.
+
+    Parameters
+    ----------
+    G : undirected Graph
+       An undirected graph. If `G` is connected, then the algorithm finds a
+       spanning tree. Otherwise, a spanning forest is found.
+
+    algorithm : string
+       The algorithm to use when finding a minimum spanning tree. Valid
+       choices are 'kruskal', 'prim', or 'boruvka'. The default is 'kruskal'.
+
+    weight : string
+       Edge data key to use for weight (default 'weight').
+
+    keys : bool
+       Whether to yield edge key in multigraphs in addition to the edge.
+       If `G` is not a multigraph, this is ignored.
+
+    data : bool, optional
+       If True yield the edge data along with the edge.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+    Returns
+    -------
+    edges : iterator
+       An iterator over edges in a maximum spanning tree of `G`.
+       Edges connecting nodes `u` and `v` are represented as tuples:
+       `(u, v, k, d)` or `(u, v, k)` or `(u, v, d)` or `(u, v)`
+
+       If `G` is a multigraph, `keys` indicates whether the edge key `k` will
+       be reported in the third position in the edge tuple. `data` indicates
+       whether the edge datadict `d` will appear at the end of the edge tuple.
+
+       If `G` is not a multigraph, the tuples are `(u, v, d)` if `data` is True
+       or `(u, v)` if `data` is False.
+
+    Examples
+    --------
+    >>> from networkx.algorithms import tree
+
+    Find minimum spanning edges by Kruskal's algorithm
+
+    >>> G = nx.cycle_graph(4)
+    >>> G.add_edge(0, 3, weight=2)
+    >>> mst = tree.minimum_spanning_edges(G, algorithm="kruskal", data=False)
+    >>> edgelist = list(mst)
+    >>> sorted(sorted(e) for e in edgelist)
+    [[0, 1], [1, 2], [2, 3]]
+
+    Find minimum spanning edges by Prim's algorithm
+
+    >>> G = nx.cycle_graph(4)
+    >>> G.add_edge(0, 3, weight=2)
+    >>> mst = tree.minimum_spanning_edges(G, algorithm="prim", data=False)
+    >>> edgelist = list(mst)
+    >>> sorted(sorted(e) for e in edgelist)
+    [[0, 1], [1, 2], [2, 3]]
+
+    Notes
+    -----
+    For Borůvka's algorithm, each edge must have a weight attribute, and
+    each edge weight must be distinct.
+
+    For the other algorithms, if the graph edges do not have a weight
+    attribute a default weight of 1 will be used.
+
+    Modified code from David Eppstein, April 2006
+    http://www.ics.uci.edu/~eppstein/PADS/
+
+    """
+    try:
+        algo = ALGORITHMS[algorithm]
+    except KeyError as err:
+        msg = f"{algorithm} is not a valid choice for an algorithm."
+        raise ValueError(msg) from err
+
+    return algo(
+        G, minimum=True, weight=weight, keys=keys, data=data, ignore_nan=ignore_nan
+    )
+
+
+@not_implemented_for("directed")
+@nx._dispatchable(edge_attrs="weight", preserve_edge_attrs="data")
+def maximum_spanning_edges(
+    G, algorithm="kruskal", weight="weight", keys=True, data=True, ignore_nan=False
+):
+    """Generate edges in a maximum spanning forest of an undirected
+    weighted graph.
+
+    A maximum spanning tree is a subgraph of the graph (a tree)
+    with the maximum possible sum of edge weights.  A spanning forest is a
+    union of the spanning trees for each connected component of the graph.
+
+    Parameters
+    ----------
+    G : undirected Graph
+       An undirected graph. If `G` is connected, then the algorithm finds a
+       spanning tree. Otherwise, a spanning forest is found.
+
+    algorithm : string
+       The algorithm to use when finding a maximum spanning tree. Valid
+       choices are 'kruskal', 'prim', or 'boruvka'. The default is 'kruskal'.
+
+    weight : string
+       Edge data key to use for weight (default 'weight').
+
+    keys : bool
+       Whether to yield edge key in multigraphs in addition to the edge.
+       If `G` is not a multigraph, this is ignored.
+
+    data : bool, optional
+       If True yield the edge data along with the edge.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+    Returns
+    -------
+    edges : iterator
+       An iterator over edges in a maximum spanning tree of `G`.
+       Edges connecting nodes `u` and `v` are represented as tuples:
+       `(u, v, k, d)` or `(u, v, k)` or `(u, v, d)` or `(u, v)`
+
+       If `G` is a multigraph, `keys` indicates whether the edge key `k` will
+       be reported in the third position in the edge tuple. `data` indicates
+       whether the edge datadict `d` will appear at the end of the edge tuple.
+
+       If `G` is not a multigraph, the tuples are `(u, v, d)` if `data` is True
+       or `(u, v)` if `data` is False.
+
+    Examples
+    --------
+    >>> from networkx.algorithms import tree
+
+    Find maximum spanning edges by Kruskal's algorithm
+
+    >>> G = nx.cycle_graph(4)
+    >>> G.add_edge(0, 3, weight=2)
+    >>> mst = tree.maximum_spanning_edges(G, algorithm="kruskal", data=False)
+    >>> edgelist = list(mst)
+    >>> sorted(sorted(e) for e in edgelist)
+    [[0, 1], [0, 3], [1, 2]]
+
+    Find maximum spanning edges by Prim's algorithm
+
+    >>> G = nx.cycle_graph(4)
+    >>> G.add_edge(0, 3, weight=2)  # assign weight 2 to edge 0-3
+    >>> mst = tree.maximum_spanning_edges(G, algorithm="prim", data=False)
+    >>> edgelist = list(mst)
+    >>> sorted(sorted(e) for e in edgelist)
+    [[0, 1], [0, 3], [2, 3]]
+
+    Notes
+    -----
+    For Borůvka's algorithm, each edge must have a weight attribute, and
+    each edge weight must be distinct.
+
+    For the other algorithms, if the graph edges do not have a weight
+    attribute a default weight of 1 will be used.
+
+    Modified code from David Eppstein, April 2006
+    http://www.ics.uci.edu/~eppstein/PADS/
+    """
+    try:
+        algo = ALGORITHMS[algorithm]
+    except KeyError as err:
+        msg = f"{algorithm} is not a valid choice for an algorithm."
+        raise ValueError(msg) from err
+
+    return algo(
+        G, minimum=False, weight=weight, keys=keys, data=data, ignore_nan=ignore_nan
+    )
+
+
+@nx._dispatchable(preserve_all_attrs=True, returns_graph=True)
+def minimum_spanning_tree(G, weight="weight", algorithm="kruskal", ignore_nan=False):
+    """Returns a minimum spanning tree or forest on an undirected graph `G`.
+
+    Parameters
+    ----------
+    G : undirected graph
+        An undirected graph. If `G` is connected, then the algorithm finds a
+        spanning tree. Otherwise, a spanning forest is found.
+
+    weight : str
+       Data key to use for edge weights.
+
+    algorithm : string
+       The algorithm to use when finding a minimum spanning tree. Valid
+       choices are 'kruskal', 'prim', or 'boruvka'. The default is
+       'kruskal'.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+    Returns
+    -------
+    G : NetworkX Graph
+       A minimum spanning tree or forest.
+
+    Examples
+    --------
+    >>> G = nx.cycle_graph(4)
+    >>> G.add_edge(0, 3, weight=2)
+    >>> T = nx.minimum_spanning_tree(G)
+    >>> sorted(T.edges(data=True))
+    [(0, 1, {}), (1, 2, {}), (2, 3, {})]
+
+
+    Notes
+    -----
+    For Borůvka's algorithm, each edge must have a weight attribute, and
+    each edge weight must be distinct.
+
+    For the other algorithms, if the graph edges do not have a weight
+    attribute a default weight of 1 will be used.
+
+    There may be more than one tree with the same minimum or maximum weight.
+    See :mod:`networkx.tree.recognition` for more detailed definitions.
+
+    Isolated nodes with self-loops are in the tree as edgeless isolated nodes.
+
+    """
+    edges = minimum_spanning_edges(
+        G, algorithm, weight, keys=True, data=True, ignore_nan=ignore_nan
+    )
+    T = G.__class__()  # Same graph class as G
+    T.graph.update(G.graph)
+    T.add_nodes_from(G.nodes.items())
+    T.add_edges_from(edges)
+    return T
+
+
+@nx._dispatchable(preserve_all_attrs=True, returns_graph=True)
+def partition_spanning_tree(
+    G, minimum=True, weight="weight", partition="partition", ignore_nan=False
+):
+    """
+    Find a spanning tree while respecting a partition of edges.
+
+    Edges can be flagged as either `INCLUDED` which are required to be in the
+    returned tree, `EXCLUDED`, which cannot be in the returned tree and `OPEN`.
+
+    This is used in the SpanningTreeIterator to create new partitions following
+    the algorithm of Sörensen and Janssens [1]_.
+
+    Parameters
+    ----------
+    G : undirected graph
+        An undirected graph.
+
+    minimum : bool (default: True)
+        Determines whether the returned tree is the minimum spanning tree of
+        the partition of the maximum one.
+
+    weight : str
+        Data key to use for edge weights.
+
+    partition : str
+        The key for the edge attribute containing the partition
+        data on the graph. Edges can be included, excluded or open using the
+        `EdgePartition` enum.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+
+    Returns
+    -------
+    G : NetworkX Graph
+        A minimum spanning tree using all of the included edges in the graph and
+        none of the excluded edges.
+
+    References
+    ----------
+    .. [1] G.K. Janssens, K. Sörensen, An algorithm to generate all spanning
+           trees in order of increasing cost, Pesquisa Operacional, 2005-08,
+           Vol. 25 (2), p. 219-229,
+           https://www.scielo.br/j/pope/a/XHswBwRwJyrfL88dmMwYNWp/?lang=en
+    """
+    edges = kruskal_mst_edges(
+        G,
+        minimum,
+        weight,
+        keys=True,
+        data=True,
+        ignore_nan=ignore_nan,
+        partition=partition,
+    )
+    T = G.__class__()  # Same graph class as G
+    T.graph.update(G.graph)
+    T.add_nodes_from(G.nodes.items())
+    T.add_edges_from(edges)
+    return T
+
+
+@nx._dispatchable(preserve_all_attrs=True, returns_graph=True)
+def maximum_spanning_tree(G, weight="weight", algorithm="kruskal", ignore_nan=False):
+    """Returns a maximum spanning tree or forest on an undirected graph `G`.
+
+    Parameters
+    ----------
+    G : undirected graph
+        An undirected graph. If `G` is connected, then the algorithm finds a
+        spanning tree. Otherwise, a spanning forest is found.
+
+    weight : str
+       Data key to use for edge weights.
+
+    algorithm : string
+       The algorithm to use when finding a maximum spanning tree. Valid
+       choices are 'kruskal', 'prim', or 'boruvka'. The default is
+       'kruskal'.
+
+    ignore_nan : bool (default: False)
+        If a NaN is found as an edge weight normally an exception is raised.
+        If `ignore_nan is True` then that edge is ignored instead.
+
+
+    Returns
+    -------
+    G : NetworkX Graph
+       A maximum spanning tree or forest.
+
+
+    Examples
+    --------
+    >>> G = nx.cycle_graph(4)
+    >>> G.add_edge(0, 3, weight=2)
+    >>> T = nx.maximum_spanning_tree(G)
+    >>> sorted(T.edges(data=True))
+    [(0, 1, {}), (0, 3, {'weight': 2}), (1, 2, {})]
+
+
+    Notes
+    -----
+    For Borůvka's algorithm, each edge must have a weight attribute, and
+    each edge weight must be distinct.
+
+    For the other algorithms, if the graph edges do not have a weight
+    attribute a default weight of 1 will be used.
+
+    There may be more than one tree with the same minimum or maximum weight.
+    See :mod:`networkx.tree.recognition` for more detailed definitions.
+
+    Isolated nodes with self-loops are in the tree as edgeless isolated nodes.
+
+    """
+    edges = maximum_spanning_edges(
+        G, algorithm, weight, keys=True, data=True, ignore_nan=ignore_nan
+    )
+    edges = list(edges)
+    T = G.__class__()  # Same graph class as G
+    T.graph.update(G.graph)
+    T.add_nodes_from(G.nodes.items())
+    T.add_edges_from(edges)
+    return T
+
+
+@py_random_state(3)
+@nx._dispatchable(preserve_edge_attrs=True, returns_graph=True)
+def random_spanning_tree(G, weight=None, *, multiplicative=True, seed=None):
+    """
+    Sample a random spanning tree using the edges weights of `G`.
+
+    This function supports two different methods for determining the
+    probability of the graph. If ``multiplicative=True``, the probability
+    is based on the product of edge weights, and if ``multiplicative=False``
+    it is based on the sum of the edge weight. However, since it is
+    easier to determine the total weight of all spanning trees for the
+    multiplicative version, that is significantly faster and should be used if
+    possible. Additionally, setting `weight` to `None` will cause a spanning tree
+    to be selected with uniform probability.
+
+    The function uses algorithm A8 in [1]_ .
+
+    Parameters
+    ----------
+    G : nx.Graph
+        An undirected version of the original graph.
+
+    weight : string
+        The edge key for the edge attribute holding edge weight.
+
+    multiplicative : bool, default=True
+        If `True`, the probability of each tree is the product of its edge weight
+        over the sum of the product of all the spanning trees in the graph. If
+        `False`, the probability is the sum of its edge weight over the sum of
+        the sum of weights for all spanning trees in the graph.
+
+    seed : integer, random_state, or None (default)
+        Indicator of random number generation state.
+        See :ref:`Randomness<randomness>`.
+
+    Returns
+    -------
+    nx.Graph
+        A spanning tree using the distribution defined by the weight of the tree.
+
+    References
+    ----------
+    .. [1] V. Kulkarni, Generating random combinatorial objects, Journal of
+       Algorithms, 11 (1990), pp. 185–207
+    """
+
+    def find_node(merged_nodes, node):
+        """
+        We can think of clusters of contracted nodes as having one
+        representative in the graph. Each node which is not in merged_nodes
+        is still its own representative. Since a representative can be later
+        contracted, we need to recursively search though the dict to find
+        the final representative, but once we know it we can use path
+        compression to speed up the access of the representative for next time.
+
+        This cannot be replaced by the standard NetworkX union_find since that
+        data structure will merge nodes with less representing nodes into the
+        one with more representing nodes but this function requires we merge
+        them using the order that contract_edges contracts using.
+
+        Parameters
+        ----------
+        merged_nodes : dict
+            The dict storing the mapping from node to representative
+        node
+            The node whose representative we seek
+
+        Returns
+        -------
+        The representative of the `node`
+        """
+        if node not in merged_nodes:
+            return node
+        else:
+            rep = find_node(merged_nodes, merged_nodes[node])
+            merged_nodes[node] = rep
+            return rep
+
+    def prepare_graph():
+        """
+        For the graph `G`, remove all edges not in the set `V` and then
+        contract all edges in the set `U`.
+
+        Returns
+        -------
+        A copy of `G` which has had all edges not in `V` removed and all edges
+        in `U` contracted.
+        """
+
+        # The result is a MultiGraph version of G so that parallel edges are
+        # allowed during edge contraction
+        result = nx.MultiGraph(incoming_graph_data=G)
+
+        # Remove all edges not in V
+        edges_to_remove = set(result.edges()).difference(V)
+        result.remove_edges_from(edges_to_remove)
+
+        # Contract all edges in U
+        #
+        # Imagine that you have two edges to contract and they share an
+        # endpoint like this:
+        #                        [0] ----- [1] ----- [2]
+        # If we contract (0, 1) first, the contraction function will always
+        # delete the second node it is passed so the resulting graph would be
+        #                             [0] ----- [2]
+        # and edge (1, 2) no longer exists but (0, 2) would need to be contracted
+        # in its place now. That is why I use the below dict as a merge-find
+        # data structure with path compression to track how the nodes are merged.
+        merged_nodes = {}
+
+        for u, v in U:
+            u_rep = find_node(merged_nodes, u)
+            v_rep = find_node(merged_nodes, v)
+            # We cannot contract a node with itself
+            if u_rep == v_rep:
+                continue
+            nx.contracted_nodes(result, u_rep, v_rep, self_loops=False, copy=False)
+            merged_nodes[v_rep] = u_rep
+
+        return merged_nodes, result
+
+    def spanning_tree_total_weight(G, weight):
+        """
+        Find the sum of weights of the spanning trees of `G` using the
+        appropriate `method`.
+
+        This is easy if the chosen method is 'multiplicative', since we can
+        use Kirchhoff's Tree Matrix Theorem directly. However, with the
+        'additive' method, this process is slightly more complex and less
+        computationally efficient as we have to find the number of spanning
+        trees which contain each possible edge in the graph.
+
+        Parameters
+        ----------
+        G : NetworkX Graph
+            The graph to find the total weight of all spanning trees on.
+
+        weight : string
+            The key for the weight edge attribute of the graph.
+
+        Returns
+        -------
+        float
+            The sum of either the multiplicative or additive weight for all
+            spanning trees in the graph.
+        """
+        if multiplicative:
+            return nx.total_spanning_tree_weight(G, weight)
+        else:
+            # There are two cases for the total spanning tree additive weight.
+            # 1. There is one edge in the graph. Then the only spanning tree is
+            #    that edge itself, which will have a total weight of that edge
+            #    itself.
+            if G.number_of_edges() == 1:
+                return G.edges(data=weight).__iter__().__next__()[2]
+            # 2. There are no edges or two or more edges in the graph. Then, we find the
+            #    total weight of the spanning trees using the formula in the
+            #    reference paper: take the weight of each edge and multiply it by
+            #    the number of spanning trees which include that edge. This
+            #    can be accomplished by contracting the edge and finding the
+            #    multiplicative total spanning tree weight if the weight of each edge
+            #    is assumed to be 1, which is conveniently built into networkx already,
+            #    by calling total_spanning_tree_weight with weight=None.
+            #    Note that with no edges the returned value is just zero.
+            else:
+                total = 0
+                for u, v, w in G.edges(data=weight):
+                    total += w * nx.total_spanning_tree_weight(
+                        nx.contracted_edge(G, edge=(u, v), self_loops=False), None
+                    )
+                return total
+
+    if G.number_of_nodes() < 2:
+        # no edges in the spanning tree
+        return nx.empty_graph(G.nodes)
+
+    U = set()
+    st_cached_value = 0
+    V = set(G.edges())
+    shuffled_edges = list(G.edges())
+    seed.shuffle(shuffled_edges)
+
+    for u, v in shuffled_edges:
+        e_weight = G[u][v][weight] if weight is not None else 1
+        node_map, prepared_G = prepare_graph()
+        G_total_tree_weight = spanning_tree_total_weight(prepared_G, weight)
+        # Add the edge to U so that we can compute the total tree weight
+        # assuming we include that edge
+        # Now, if (u, v) cannot exist in G because it is fully contracted out
+        # of existence, then it by definition cannot influence G_e's Kirchhoff
+        # value. But, we also cannot pick it.
+        rep_edge = (find_node(node_map, u), find_node(node_map, v))
+        # Check to see if the 'representative edge' for the current edge is
+        # in prepared_G. If so, then we can pick it.
+        if rep_edge in prepared_G.edges:
+            prepared_G_e = nx.contracted_edge(
+                prepared_G, edge=rep_edge, self_loops=False
+            )
+            G_e_total_tree_weight = spanning_tree_total_weight(prepared_G_e, weight)
+            if multiplicative:
+                threshold = e_weight * G_e_total_tree_weight / G_total_tree_weight
+            else:
+                numerator = (
+                    st_cached_value + e_weight
+                ) * nx.total_spanning_tree_weight(prepared_G_e) + G_e_total_tree_weight
+                denominator = (
+                    st_cached_value * nx.total_spanning_tree_weight(prepared_G)
+                    + G_total_tree_weight
+                )
+                threshold = numerator / denominator
+        else:
+            threshold = 0.0
+        z = seed.uniform(0.0, 1.0)
+        if z > threshold:
+            # Remove the edge from V since we did not pick it.
+            V.remove((u, v))
+        else:
+            # Add the edge to U since we picked it.
+            st_cached_value += e_weight
+            U.add((u, v))
+        # If we decide to keep an edge, it may complete the spanning tree.
+        if len(U) == G.number_of_nodes() - 1:
+            spanning_tree = nx.Graph()
+            spanning_tree.add_edges_from(U)
+            return spanning_tree
+    raise Exception(f"Something went wrong! Only {len(U)} edges in the spanning tree!")
+
+
+class SpanningTreeIterator:
+    """
+    Iterate over all spanning trees of a graph in either increasing or
+    decreasing cost.
+
+    Notes
+    -----
+    This iterator uses the partition scheme from [1]_ (included edges,
+    excluded edges and open edges) as well as a modified Kruskal's Algorithm
+    to generate minimum spanning trees which respect the partition of edges.
+    For spanning trees with the same weight, ties are broken arbitrarily.
+
+    References
+    ----------
+    .. [1] G.K. Janssens, K. Sörensen, An algorithm to generate all spanning
+           trees in order of increasing cost, Pesquisa Operacional, 2005-08,
+           Vol. 25 (2), p. 219-229,
+           https://www.scielo.br/j/pope/a/XHswBwRwJyrfL88dmMwYNWp/?lang=en
+    """
+
+    @dataclass(order=True)
+    class Partition:
+        """
+        This dataclass represents a partition and stores a dict with the edge
+        data and the weight of the minimum spanning tree of the partition dict.
+        """
+
+        mst_weight: float
+        partition_dict: dict = field(compare=False)
+
+        def __copy__(self):
+            return SpanningTreeIterator.Partition(
+                self.mst_weight, self.partition_dict.copy()
+            )
+
+    def __init__(self, G, weight="weight", minimum=True, ignore_nan=False):
+        """
+        Initialize the iterator
+
+        Parameters
+        ----------
+        G : nx.Graph
+            The directed graph which we need to iterate trees over
+
+        weight : String, default = "weight"
+            The edge attribute used to store the weight of the edge
+
+        minimum : bool, default = True
+            Return the trees in increasing order while true and decreasing order
+            while false.
+
+        ignore_nan : bool, default = False
+            If a NaN is found as an edge weight normally an exception is raised.
+            If `ignore_nan is True` then that edge is ignored instead.
+        """
+        self.G = G.copy()
+        self.G.__networkx_cache__ = None  # Disable caching
+        self.weight = weight
+        self.minimum = minimum
+        self.ignore_nan = ignore_nan
+        # Randomly create a key for an edge attribute to hold the partition data
+        self.partition_key = (
+            "SpanningTreeIterators super secret partition attribute name"
+        )
+
+    def __iter__(self):
+        """
+        Returns
+        -------
+        SpanningTreeIterator
+            The iterator object for this graph
+        """
+        self.partition_queue = PriorityQueue()
+        self._clear_partition(self.G)
+        mst_weight = partition_spanning_tree(
+            self.G, self.minimum, self.weight, self.partition_key, self.ignore_nan
+        ).size(weight=self.weight)
+
+        self.partition_queue.put(
+            self.Partition(mst_weight if self.minimum else -mst_weight, {})
+        )
+
+        return self
+
+    def __next__(self):
+        """
+        Returns
+        -------
+        (multi)Graph
+            The spanning tree of next greatest weight, which ties broken
+            arbitrarily.
+        """
+        if self.partition_queue.empty():
+            del self.G, self.partition_queue
+            raise StopIteration
+
+        partition = self.partition_queue.get()
+        self._write_partition(partition)
+        next_tree = partition_spanning_tree(
+            self.G, self.minimum, self.weight, self.partition_key, self.ignore_nan
+        )
+        self._partition(partition, next_tree)
+
+        self._clear_partition(next_tree)
+        return next_tree
+
+    def _partition(self, partition, partition_tree):
+        """
+        Create new partitions based of the minimum spanning tree of the
+        current minimum partition.
+
+        Parameters
+        ----------
+        partition : Partition
+            The Partition instance used to generate the current minimum spanning
+            tree.
+        partition_tree : nx.Graph
+            The minimum spanning tree of the input partition.
+        """
+        # create two new partitions with the data from the input partition dict
+        p1 = self.Partition(0, partition.partition_dict.copy())
+        p2 = self.Partition(0, partition.partition_dict.copy())
+        for e in partition_tree.edges:
+            # determine if the edge was open or included
+            if e not in partition.partition_dict:
+                # This is an open edge
+                p1.partition_dict[e] = EdgePartition.EXCLUDED
+                p2.partition_dict[e] = EdgePartition.INCLUDED
+
+                self._write_partition(p1)
+                p1_mst = partition_spanning_tree(
+                    self.G,
+                    self.minimum,
+                    self.weight,
+                    self.partition_key,
+                    self.ignore_nan,
+                )
+                p1_mst_weight = p1_mst.size(weight=self.weight)
+                if nx.is_connected(p1_mst):
+                    p1.mst_weight = p1_mst_weight if self.minimum else -p1_mst_weight
+                    self.partition_queue.put(p1.__copy__())
+                p1.partition_dict = p2.partition_dict.copy()
+
+    def _write_partition(self, partition):
+        """
+        Writes the desired partition into the graph to calculate the minimum
+        spanning tree.
+
+        Parameters
+        ----------
+        partition : Partition
+            A Partition dataclass describing a partition on the edges of the
+            graph.
+        """
+
+        partition_dict = partition.partition_dict
+        partition_key = self.partition_key
+        G = self.G
+
+        edges = (
+            G.edges(keys=True, data=True) if G.is_multigraph() else G.edges(data=True)
+        )
+        for *e, d in edges:
+            d[partition_key] = partition_dict.get(tuple(e), EdgePartition.OPEN)
+
+    def _clear_partition(self, G):
+        """
+        Removes partition data from the graph
+        """
+        partition_key = self.partition_key
+        edges = (
+            G.edges(keys=True, data=True) if G.is_multigraph() else G.edges(data=True)
+        )
+        for *e, d in edges:
+            if partition_key in d:
+                del d[partition_key]
+
+
+@nx._dispatchable(edge_attrs="weight")
+def number_of_spanning_trees(G, *, root=None, weight=None):
+    """Returns the number of spanning trees in `G`.
+
+    A spanning tree for an undirected graph is a tree that connects
+    all nodes in the graph. For a directed graph, the analog of a
+    spanning tree is called a (spanning) arborescence. The arborescence
+    includes a unique directed path from the `root` node to each other node.
+    The graph must be weakly connected, and the root must be a node
+    that includes all nodes as successors [3]_. Note that to avoid
+    discussing sink-roots and reverse-arborescences, we have reversed
+    the edge orientation from [3]_ and use the in-degree laplacian.
+
+    This function (when `weight` is `None`) returns the number of
+    spanning trees for an undirected graph and the number of
+    arborescences from a single root node for a directed graph.
+    When `weight` is the name of an edge attribute which holds the
+    weight value of each edge, the function returns the sum over
+    all trees of the multiplicative weight of each tree. That is,
+    the weight of the tree is the product of its edge weights.
+
+    Kirchoff's Tree Matrix Theorem states that any cofactor of the
+    Laplacian matrix of a graph is the number of spanning trees in the
+    graph. (Here we use cofactors for a diagonal entry so that the
+    cofactor becomes the determinant of the matrix with one row
+    and its matching column removed.) For a weighted Laplacian matrix,
+    the cofactor is the sum across all spanning trees of the
+    multiplicative weight of each tree. That is, the weight of each
+    tree is the product of its edge weights. The theorem is also
+    known as Kirchhoff's theorem [1]_ and the Matrix-Tree theorem [2]_.
+
+    For directed graphs, a similar theorem (Tutte's Theorem) holds with
+    the cofactor chosen to be the one with row and column removed that
+    correspond to the root. The cofactor is the number of arborescences
+    with the specified node as root. And the weighted version gives the
+    sum of the arborescence weights with root `root`. The arborescence
+    weight is the product of its edge weights.
+
+    Parameters
+    ----------
+    G : NetworkX graph
+
+    root : node
+       A node in the directed graph `G` that has all nodes as descendants.
+       (This is ignored for undirected graphs.)
+
+    weight : string or None, optional (default=None)
+        The name of the edge attribute holding the edge weight.
+        If `None`, then each edge is assumed to have a weight of 1.
+
+    Returns
+    -------
+    Number
+        Undirected graphs:
+            The number of spanning trees of the graph `G`.
+            Or the sum of all spanning tree weights of the graph `G`
+            where the weight of a tree is the product of its edge weights.
+        Directed graphs:
+            The number of arborescences of `G` rooted at node `root`.
+            Or the sum of all arborescence weights of the graph `G` with
+            specified root where the weight of an arborescence is the product
+            of its edge weights.
+
+    Raises
+    ------
+    NetworkXPointlessConcept
+        If `G` does not contain any nodes.
+
+    NetworkXError
+        If the graph `G` is directed and the root node
+        is not specified or is not in G.
+
+    Examples
+    --------
+    >>> G = nx.complete_graph(5)
+    >>> round(nx.number_of_spanning_trees(G))
+    125
+
+    >>> G = nx.Graph()
+    >>> G.add_edge(1, 2, weight=2)
+    >>> G.add_edge(1, 3, weight=1)
+    >>> G.add_edge(2, 3, weight=1)
+    >>> round(nx.number_of_spanning_trees(G, weight="weight"))
+    5
+
+    Notes
+    -----
+    Self-loops are excluded. Multi-edges are contracted in one edge
+    equal to the sum of the weights.
+
+    References
+    ----------
+    .. [1] Wikipedia
+       "Kirchhoff's theorem."
+       https://en.wikipedia.org/wiki/Kirchhoff%27s_theorem
+    .. [2] Kirchhoff, G. R.
+        Über die Auflösung der Gleichungen, auf welche man
+        bei der Untersuchung der linearen Vertheilung
+        Galvanischer Ströme geführt wird
+        Annalen der Physik und Chemie, vol. 72, pp. 497-508, 1847.
+    .. [3] Margoliash, J.
+        "Matrix-Tree Theorem for Directed Graphs"
+        https://www.math.uchicago.edu/~may/VIGRE/VIGRE2010/REUPapers/Margoliash.pdf
+    """
+    import numpy as np
+
+    if len(G) == 0:
+        raise nx.NetworkXPointlessConcept("Graph G must contain at least one node.")
+
+    # undirected G
+    if not nx.is_directed(G):
+        if not nx.is_connected(G):
+            return 0
+        G_laplacian = nx.laplacian_matrix(G, weight=weight).toarray()
+        return float(np.linalg.det(G_laplacian[1:, 1:]))
+
+    # directed G
+    if root is None:
+        raise nx.NetworkXError("Input `root` must be provided when G is directed")
+    if root not in G:
+        raise nx.NetworkXError("The node root is not in the graph G.")
+    if not nx.is_weakly_connected(G):
+        return 0
+
+    # Compute directed Laplacian matrix
+    nodelist = [root] + [n for n in G if n != root]
+    A = nx.adjacency_matrix(G, nodelist=nodelist, weight=weight)
+    D = np.diag(A.sum(axis=0))
+    G_laplacian = D - A
+
+    # Compute number of spanning trees
+    return float(np.linalg.det(G_laplacian[1:, 1:]))

mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tree/operations.py

@@ -0,0 +1,105 @@
+"""Operations on trees."""
+
+from functools import partial
+from itertools import accumulate, chain
+
+import networkx as nx
+
+__all__ = ["join_trees"]
+
+
+# Argument types don't match dispatching, but allow manual selection of backend
+@nx._dispatchable(graphs=None, returns_graph=True)
+def join_trees(rooted_trees, *, label_attribute=None, first_label=0):
+    """Returns a new rooted tree made by joining `rooted_trees`
+
+    Constructs a new tree by joining each tree in `rooted_trees`.
+    A new root node is added and connected to each of the roots
+    of the input trees. While copying the nodes from the trees,
+    relabeling to integers occurs. If the `label_attribute` is provided,
+    the old node labels will be stored in the new tree under this attribute.
+
+    Parameters
+    ----------
+    rooted_trees : list
+        A list of pairs in which each left element is a NetworkX graph
+        object representing a tree and each right element is the root
+        node of that tree. The nodes of these trees will be relabeled to
+        integers.
+
+    label_attribute : str
+        If provided, the old node labels will be stored in the new tree
+        under this node attribute. If not provided, the original labels
+        of the nodes in the input trees are not stored.
+
+    first_label : int, optional (default=0)
+        Specifies the label for the new root node. If provided, the root node of the joined tree
+        will have this label. If not provided, the root node will default to a label of 0.
+
+    Returns
+    -------
+    NetworkX graph
+        The rooted tree resulting from joining the provided `rooted_trees`. The new tree has a root node
+        labeled as specified by `first_label` (defaulting to 0 if not provided). Subtrees from the input
+        `rooted_trees` are attached to this new root node. Each non-root node, if the `label_attribute`
+        is provided, has an attribute that indicates the original label of the node in the input tree.
+
+    Notes
+    -----
+    Trees are stored in NetworkX as NetworkX Graphs. There is no specific
+    enforcement of the fact that these are trees. Testing for each tree
+    can be done using :func:`networkx.is_tree`.
+
+    Graph, edge, and node attributes are propagated from the given
+    rooted trees to the created tree. If there are any overlapping graph
+    attributes, those from later trees will overwrite those from earlier
+    trees in the tuple of positional arguments.
+
+    Examples
+    --------
+    Join two full balanced binary trees of height *h* to get a full
+    balanced binary tree of depth *h* + 1::
+
+        >>> h = 4
+        >>> left = nx.balanced_tree(2, h)
+        >>> right = nx.balanced_tree(2, h)
+        >>> joined_tree = nx.join_trees([(left, 0), (right, 0)])
+        >>> nx.is_isomorphic(joined_tree, nx.balanced_tree(2, h + 1))
+        True
+
+    """
+    if not rooted_trees:
+        return nx.empty_graph(1)
+
+    # Unzip the zipped list of (tree, root) pairs.
+    trees, roots = zip(*rooted_trees)
+
+    # The join of the trees has the same type as the type of the first tree.
+    R = type(trees[0])()
+
+    lengths = (len(tree) for tree in trees[:-1])
+    first_labels = list(accumulate(lengths, initial=first_label + 1))
+
+    new_roots = []
+    for tree, root, first_node in zip(trees, roots, first_labels):
+        new_root = first_node + list(tree.nodes()).index(root)
+        new_roots.append(new_root)
+
+    # Relabel the nodes so that their union is the integers starting at first_label.
+    relabel = partial(
+        nx.convert_node_labels_to_integers, label_attribute=label_attribute
+    )
+    new_trees = [
+        relabel(tree, first_label=first_label)
+        for tree, first_label in zip(trees, first_labels)
+    ]
+
+    # Add all sets of nodes and edges, attributes
+    for tree in new_trees:
+        R.update(tree)
+
+    # Finally, join the subtrees at the root. We know first_label is unused by the way we relabeled the subtrees.
+    R.add_node(first_label)
+    R.add_edges_from((first_label, root) for root in new_roots)
+
+    return R

mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tree/recognition.py

@@ -0,0 +1,273 @@
+"""
+Recognition Tests
+=================
+
+A *forest* is an acyclic, undirected graph, and a *tree* is a connected forest.
+Depending on the subfield, there are various conventions for generalizing these
+definitions to directed graphs.
+
+In one convention, directed variants of forest and tree are defined in an
+identical manner, except that the direction of the edges is ignored. In effect,
+each directed edge is treated as a single undirected edge. Then, additional
+restrictions are imposed to define *branchings* and *arborescences*.
+
+In another convention, directed variants of forest and tree correspond to
+the previous convention's branchings and arborescences, respectively. Then two
+new terms, *polyforest* and *polytree*, are defined to correspond to the other
+convention's forest and tree.
+
+Summarizing::
+
+   +-----------------------------+
+   | Convention A | Convention B |
+   +=============================+
+   | forest       | polyforest   |
+   | tree         | polytree     |
+   | branching    | forest       |
+   | arborescence | tree         |
+   +-----------------------------+
+
+Each convention has its reasons. The first convention emphasizes definitional
+similarity in that directed forests and trees are only concerned with
+acyclicity and do not have an in-degree constraint, just as their undirected
+counterparts do not. The second convention emphasizes functional similarity
+in the sense that the directed analog of a spanning tree is a spanning
+arborescence. That is, take any spanning tree and choose one node as the root.
+Then every edge is assigned a direction such there is a directed path from the
+root to every other node. The result is a spanning arborescence.
+
+NetworkX follows convention "A". Explicitly, these are:
+
+undirected forest
+   An undirected graph with no undirected cycles.
+
+undirected tree
+   A connected, undirected forest.
+
+directed forest
+   A directed graph with no undirected cycles. Equivalently, the underlying
+   graph structure (which ignores edge orientations) is an undirected forest.
+   In convention B, this is known as a polyforest.
+
+directed tree
+   A weakly connected, directed forest. Equivalently, the underlying graph
+   structure (which ignores edge orientations) is an undirected tree. In
+   convention B, this is known as a polytree.
+
+branching
+   A directed forest with each node having, at most, one parent. So the maximum
+   in-degree is equal to 1. In convention B, this is known as a forest.
+
+arborescence
+   A directed tree with each node having, at most, one parent. So the maximum
+   in-degree is equal to 1. In convention B, this is known as a tree.
+
+For trees and arborescences, the adjective "spanning" may be added to designate
+that the graph, when considered as a forest/branching, consists of a single
+tree/arborescence that includes all nodes in the graph. It is true, by
+definition, that every tree/arborescence is spanning with respect to the nodes
+that define the tree/arborescence and so, it might seem redundant to introduce
+the notion of "spanning". However, the nodes may represent a subset of
+nodes from a larger graph, and it is in this context that the term "spanning"
+becomes a useful notion.
+
+"""
+
+import networkx as nx
+
+__all__ = ["is_arborescence", "is_branching", "is_forest", "is_tree"]
+
+
+@nx.utils.not_implemented_for("undirected")
+@nx._dispatchable
+def is_arborescence(G):
+    """
+    Returns True if `G` is an arborescence.
+
+    An arborescence is a directed tree with maximum in-degree equal to 1.
+
+    Parameters
+    ----------
+    G : graph
+        The graph to test.
+
+    Returns
+    -------
+    b : bool
+        A boolean that is True if `G` is an arborescence.
+
+    Examples
+    --------
+    >>> G = nx.DiGraph([(0, 1), (0, 2), (2, 3), (3, 4)])
+    >>> nx.is_arborescence(G)
+    True
+    >>> G.remove_edge(0, 1)
+    >>> G.add_edge(1, 2)  # maximum in-degree is 2
+    >>> nx.is_arborescence(G)
+    False
+
+    Notes
+    -----
+    In another convention, an arborescence is known as a *tree*.
+
+    See Also
+    --------
+    is_tree
+
+    """
+    return is_tree(G) and max(d for n, d in G.in_degree()) <= 1
+
+
+@nx.utils.not_implemented_for("undirected")
+@nx._dispatchable
+def is_branching(G):
+    """
+    Returns True if `G` is a branching.
+
+    A branching is a directed forest with maximum in-degree equal to 1.
+
+    Parameters
+    ----------
+    G : directed graph
+        The directed graph to test.
+
+    Returns
+    -------
+    b : bool
+        A boolean that is True if `G` is a branching.
+
+    Examples
+    --------
+    >>> G = nx.DiGraph([(0, 1), (1, 2), (2, 3), (3, 4)])
+    >>> nx.is_branching(G)
+    True
+    >>> G.remove_edge(2, 3)
+    >>> G.add_edge(3, 1)  # maximum in-degree is 2
+    >>> nx.is_branching(G)
+    False
+
+    Notes
+    -----
+    In another convention, a branching is also known as a *forest*.
+
+    See Also
+    --------
+    is_forest
+
+    """
+    return is_forest(G) and max(d for n, d in G.in_degree()) <= 1
+
+
+@nx._dispatchable
+def is_forest(G):
+    """
+    Returns True if `G` is a forest.
+
+    A forest is a graph with no undirected cycles.
+
+    For directed graphs, `G` is a forest if the underlying graph is a forest.
+    The underlying graph is obtained by treating each directed edge as a single
+    undirected edge in a multigraph.
+
+    Parameters
+    ----------
+    G : graph
+        The graph to test.
+
+    Returns
+    -------
+    b : bool
+        A boolean that is True if `G` is a forest.
+
+    Raises
+    ------
+    NetworkXPointlessConcept
+        If `G` is empty.
+
+    Examples
+    --------
+    >>> G = nx.Graph()
+    >>> G.add_edges_from([(1, 2), (1, 3), (2, 4), (2, 5)])
+    >>> nx.is_forest(G)
+    True
+    >>> G.add_edge(4, 1)
+    >>> nx.is_forest(G)
+    False
+
+    Notes
+    -----
+    In another convention, a directed forest is known as a *polyforest* and
+    then *forest* corresponds to a *branching*.
+
+    See Also
+    --------
+    is_branching
+
+    """
+    if len(G) == 0:
+        raise nx.exception.NetworkXPointlessConcept("G has no nodes.")
+
+    if G.is_directed():
+        components = (G.subgraph(c) for c in nx.weakly_connected_components(G))
+    else:
+        components = (G.subgraph(c) for c in nx.connected_components(G))
+
+    return all(len(c) - 1 == c.number_of_edges() for c in components)
+
+
+@nx._dispatchable
+def is_tree(G):
+    """
+    Returns True if `G` is a tree.
+
+    A tree is a connected graph with no undirected cycles.
+
+    For directed graphs, `G` is a tree if the underlying graph is a tree. The
+    underlying graph is obtained by treating each directed edge as a single
+    undirected edge in a multigraph.
+
+    Parameters
+    ----------
+    G : graph
+        The graph to test.
+
+    Returns
+    -------
+    b : bool
+        A boolean that is True if `G` is a tree.
+
+    Raises
+    ------
+    NetworkXPointlessConcept
+        If `G` is empty.
+
+    Examples
+    --------
+    >>> G = nx.Graph()
+    >>> G.add_edges_from([(1, 2), (1, 3), (2, 4), (2, 5)])
+    >>> nx.is_tree(G)  # n-1 edges
+    True
+    >>> G.add_edge(3, 4)
+    >>> nx.is_tree(G)  # n edges
+    False
+
+    Notes
+    -----
+    In another convention, a directed tree is known as a *polytree* and then
+    *tree* corresponds to an *arborescence*.
+
+    See Also
+    --------
+    is_arborescence
+
+    """
+    if len(G) == 0:
+        raise nx.exception.NetworkXPointlessConcept("G has no nodes.")
+
+    if G.is_directed():
+        is_connected = nx.is_weakly_connected
+    else:
+        is_connected = nx.is_connected
+
+    # A connected graph with no cycles has n-1 edges.
+    return len(G) - 1 == G.number_of_edges() and is_connected(G)

pllava/lib/python3.10/site-packages/numpy/core/__init__.pyi

@@ -0,0 +1,2 @@
+# NOTE: The `np.core` namespace is deliberately kept empty due to it
+# being private (despite the lack of leading underscore)

pllava/lib/python3.10/site-packages/numpy/core/_asarray.pyi

@@ -0,0 +1,42 @@
+from collections.abc import Iterable
+from typing import Any, TypeVar, Union, overload, Literal
+
+from numpy import ndarray
+from numpy._typing import DTypeLike, _SupportsArrayFunc
+
+_ArrayType = TypeVar("_ArrayType", bound=ndarray[Any, Any])
+
+_Requirements = Literal[
+    "C", "C_CONTIGUOUS", "CONTIGUOUS",
+    "F", "F_CONTIGUOUS", "FORTRAN",
+    "A", "ALIGNED",
+    "W", "WRITEABLE",
+    "O", "OWNDATA"
+]
+_E = Literal["E", "ENSUREARRAY"]
+_RequirementsWithE = Union[_Requirements, _E]
+
+@overload
+def require(
+    a: _ArrayType,
+    dtype: None = ...,
+    requirements: None | _Requirements | Iterable[_Requirements] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> _ArrayType: ...
+@overload
+def require(
+    a: object,
+    dtype: DTypeLike = ...,
+    requirements: _E | Iterable[_RequirementsWithE] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> ndarray[Any, Any]: ...
+@overload
+def require(
+    a: object,
+    dtype: DTypeLike = ...,
+    requirements: None | _Requirements | Iterable[_Requirements] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> ndarray[Any, Any]: ...

pllava/lib/python3.10/site-packages/numpy/core/_dtype_ctypes.py

@@ -0,0 +1,117 @@
+"""
+Conversion from ctypes to dtype.
+
+In an ideal world, we could achieve this through the PEP3118 buffer protocol,
+something like::
+
+    def dtype_from_ctypes_type(t):
+        # needed to ensure that the shape of `t` is within memoryview.format
+        class DummyStruct(ctypes.Structure):
+            _fields_ = [('a', t)]
+
+        # empty to avoid memory allocation
+        ctype_0 = (DummyStruct * 0)()
+        mv = memoryview(ctype_0)
+
+        # convert the struct, and slice back out the field
+        return _dtype_from_pep3118(mv.format)['a']
+
+Unfortunately, this fails because:
+
+* ctypes cannot handle length-0 arrays with PEP3118 (bpo-32782)
+* PEP3118 cannot represent unions, but both numpy and ctypes can
+* ctypes cannot handle big-endian structs with PEP3118 (bpo-32780)
+"""
+
+# We delay-import ctypes for distributions that do not include it.
+# While this module is not used unless the user passes in ctypes
+# members, it is eagerly imported from numpy/core/__init__.py.
+import numpy as np
+
+
+def _from_ctypes_array(t):
+    return np.dtype((dtype_from_ctypes_type(t._type_), (t._length_,)))
+
+
+def _from_ctypes_structure(t):
+    for item in t._fields_:
+        if len(item) > 2:
+            raise TypeError(
+                "ctypes bitfields have no dtype equivalent")
+
+    if hasattr(t, "_pack_"):
+        import ctypes
+        formats = []
+        offsets = []
+        names = []
+        current_offset = 0
+        for fname, ftyp in t._fields_:
+            names.append(fname)
+            formats.append(dtype_from_ctypes_type(ftyp))
+            # Each type has a default offset, this is platform dependent for some types.
+            effective_pack = min(t._pack_, ctypes.alignment(ftyp))
+            current_offset = ((current_offset + effective_pack - 1) // effective_pack) * effective_pack
+            offsets.append(current_offset)
+            current_offset += ctypes.sizeof(ftyp)
+
+        return np.dtype(dict(
+            formats=formats,
+            offsets=offsets,
+            names=names,
+            itemsize=ctypes.sizeof(t)))
+    else:
+        fields = []
+        for fname, ftyp in t._fields_:
+            fields.append((fname, dtype_from_ctypes_type(ftyp)))
+
+        # by default, ctypes structs are aligned
+        return np.dtype(fields, align=True)
+
+
+def _from_ctypes_scalar(t):
+    """
+    Return the dtype type with endianness included if it's the case
+    """
+    if getattr(t, '__ctype_be__', None) is t:
+        return np.dtype('>' + t._type_)
+    elif getattr(t, '__ctype_le__', None) is t:
+        return np.dtype('<' + t._type_)
+    else:
+        return np.dtype(t._type_)
+
+
+def _from_ctypes_union(t):
+    import ctypes
+    formats = []
+    offsets = []
+    names = []
+    for fname, ftyp in t._fields_:
+        names.append(fname)
+        formats.append(dtype_from_ctypes_type(ftyp))
+        offsets.append(0)  # Union fields are offset to 0
+
+    return np.dtype(dict(
+        formats=formats,
+        offsets=offsets,
+        names=names,
+        itemsize=ctypes.sizeof(t)))
+
+
+def dtype_from_ctypes_type(t):
+    """
+    Construct a dtype object from a ctypes type
+    """
+    import _ctypes
+    if issubclass(t, _ctypes.Array):
+        return _from_ctypes_array(t)
+    elif issubclass(t, _ctypes._Pointer):
+        raise TypeError("ctypes pointers have no dtype equivalent")
+    elif issubclass(t, _ctypes.Structure):
+        return _from_ctypes_structure(t)
+    elif issubclass(t, _ctypes.Union):
+        return _from_ctypes_union(t)
+    elif isinstance(getattr(t, '_type_', None), str):
+        return _from_ctypes_scalar(t)
+    else:
+        raise NotImplementedError(
+            "Unknown ctypes type {}".format(t.__name__))

pllava/lib/python3.10/site-packages/numpy/core/_exceptions.py

@@ -0,0 +1,172 @@
+"""
+Various richly-typed exceptions, that also help us deal with string formatting
+in python where it's easier.
+
+By putting the formatting in `__str__`, we also avoid paying the cost for
+users who silence the exceptions.
+"""
+from .._utils import set_module
+
+def _unpack_tuple(tup):
+    if len(tup) == 1:
+        return tup[0]
+    else:
+        return tup
+
+
+def _display_as_base(cls):
+    """
+    A decorator that makes an exception class look like its base.
+
+    We use this to hide subclasses that are implementation details - the user
+    should catch the base type, which is what the traceback will show them.
+
+    Classes decorated with this decorator are subject to removal without a
+    deprecation warning.
+    """
+    assert issubclass(cls, Exception)
+    cls.__name__ = cls.__base__.__name__
+    return cls
+
+
+class UFuncTypeError(TypeError):
+    """ Base class for all ufunc exceptions """
+    def __init__(self, ufunc):
+        self.ufunc = ufunc
+
+
+@_display_as_base
+class _UFuncNoLoopError(UFuncTypeError):
+    """ Thrown when a ufunc loop cannot be found """
+    def __init__(self, ufunc, dtypes):
+        super().__init__(ufunc)
+        self.dtypes = tuple(dtypes)
+
+    def __str__(self):
+        return (
+            "ufunc {!r} did not contain a loop with signature matching types "
+            "{!r} -> {!r}"
+        ).format(
+            self.ufunc.__name__,
+            _unpack_tuple(self.dtypes[:self.ufunc.nin]),
+            _unpack_tuple(self.dtypes[self.ufunc.nin:])
+        )
+
+
+@_display_as_base
+class _UFuncBinaryResolutionError(_UFuncNoLoopError):
+    """ Thrown when a binary resolution fails """
+    def __init__(self, ufunc, dtypes):
+        super().__init__(ufunc, dtypes)
+        assert len(self.dtypes) == 2
+
+    def __str__(self):
+        return (
+            "ufunc {!r} cannot use operands with types {!r} and {!r}"
+        ).format(
+            self.ufunc.__name__, *self.dtypes
+        )
+
+
+@_display_as_base
+class _UFuncCastingError(UFuncTypeError):
+    def __init__(self, ufunc, casting, from_, to):
+        super().__init__(ufunc)
+        self.casting = casting
+        self.from_ = from_
+        self.to = to
+
+
+@_display_as_base
+class _UFuncInputCastingError(_UFuncCastingError):
+    """ Thrown when a ufunc input cannot be casted """
+    def __init__(self, ufunc, casting, from_, to, i):
+        super().__init__(ufunc, casting, from_, to)
+        self.in_i = i
+
+    def __str__(self):
+        # only show the number if more than one input exists
+        i_str = "{} ".format(self.in_i) if self.ufunc.nin != 1 else ""
+        return (
+            "Cannot cast ufunc {!r} input {}from {!r} to {!r} with casting "
+            "rule {!r}"
+        ).format(
+            self.ufunc.__name__, i_str, self.from_, self.to, self.casting
+        )
+
+
+@_display_as_base
+class _UFuncOutputCastingError(_UFuncCastingError):
+    """ Thrown when a ufunc output cannot be casted """
+    def __init__(self, ufunc, casting, from_, to, i):
+        super().__init__(ufunc, casting, from_, to)
+        self.out_i = i
+
+    def __str__(self):
+        # only show the number if more than one output exists
+        i_str = "{} ".format(self.out_i) if self.ufunc.nout != 1 else ""
+        return (
+            "Cannot cast ufunc {!r} output {}from {!r} to {!r} with casting "
+            "rule {!r}"
+        ).format(
+            self.ufunc.__name__, i_str, self.from_, self.to, self.casting
+        )
+
+
+@_display_as_base
+class _ArrayMemoryError(MemoryError):
+    """ Thrown when an array cannot be allocated"""
+    def __init__(self, shape, dtype):
+        self.shape = shape
+        self.dtype = dtype
+
+    @property
+    def _total_size(self):
+        num_bytes = self.dtype.itemsize
+        for dim in self.shape:
+            num_bytes *= dim
+        return num_bytes
+
+    @staticmethod
+    def _size_to_string(num_bytes):
+        """ Convert a number of bytes into a binary size string """
+
+        # https://en.wikipedia.org/wiki/Binary_prefix
+        LOG2_STEP = 10
+        STEP = 1024
+        units = ['bytes', 'KiB', 'MiB', 'GiB', 'TiB', 'PiB', 'EiB']
+
+        unit_i = max(num_bytes.bit_length() - 1, 1) // LOG2_STEP
+        unit_val = 1 << (unit_i * LOG2_STEP)
+        n_units = num_bytes / unit_val
+        del unit_val
+
+        # ensure we pick a unit that is correct after rounding
+        if round(n_units) == STEP:
+            unit_i += 1
+            n_units /= STEP
+
+        # deal with sizes so large that we don't have units for them
+        if unit_i >= len(units):
+            new_unit_i = len(units) - 1
+            n_units *= 1 << ((unit_i - new_unit_i) * LOG2_STEP)
+            unit_i = new_unit_i
+
+        unit_name = units[unit_i]
+        # format with a sensible number of digits
+        if unit_i == 0:
+            # no decimal point on bytes
+            return '{:.0f} {}'.format(n_units, unit_name)
+        elif round(n_units) < 1000:
+            # 3 significant figures, if none are dropped to the left of the .
+            return '{:#.3g} {}'.format(n_units, unit_name)
+        else:
+            # just give all the digits otherwise
+            return '{:#.0f} {}'.format(n_units, unit_name)
+
+    def __str__(self):
+        size_str = self._size_to_string(self._total_size)
+        return (
+            "Unable to allocate {} for an array with shape {} and data type {}"
+            .format(size_str, self.shape, self.dtype)
+        )

pllava/lib/python3.10/site-packages/numpy/core/_simd.cpython-310-x86_64-linux-gnu.so

@@ -0,0 +1,3 @@
+version https://git-lfs.github.com/spec/v1
+oid sha256:b2c96bec20e3c7a59f8f78b30e7fd5142d015e42f2cbd27223c3e862c53e4113
+size 3527040

pllava/lib/python3.10/site-packages/numpy/core/_type_aliases.pyi

@@ -0,0 +1,13 @@
+from typing import Any, TypedDict
+
+from numpy import generic, signedinteger, unsignedinteger, floating, complexfloating
+
+class _SCTypes(TypedDict):
+    int: list[type[signedinteger[Any]]]
+    uint: list[type[unsignedinteger[Any]]]
+    float: list[type[floating[Any]]]
+    complex: list[type[complexfloating[Any, Any]]]
+    others: list[type]
+
+sctypeDict: dict[int | str, type[generic]]
+sctypes: _SCTypes

pllava/lib/python3.10/site-packages/numpy/core/_ufunc_config.py

@@ -0,0 +1,466 @@
+"""
+Functions for changing global ufunc configuration
+
+This provides helpers which wrap `umath.geterrobj` and `umath.seterrobj`
+"""
+import collections.abc
+import contextlib
+import contextvars
+
+from .._utils import set_module
+from .umath import (
+    UFUNC_BUFSIZE_DEFAULT,
+    ERR_IGNORE, ERR_WARN, ERR_RAISE, ERR_CALL, ERR_PRINT, ERR_LOG, ERR_DEFAULT,
+    SHIFT_DIVIDEBYZERO, SHIFT_OVERFLOW, SHIFT_UNDERFLOW, SHIFT_INVALID,
+)
+from . import umath
+
+__all__ = [
+    "seterr", "geterr", "setbufsize", "getbufsize", "seterrcall", "geterrcall",
+    "errstate", '_no_nep50_warning'
+]
+
+_errdict = {"ignore": ERR_IGNORE,
+            "warn": ERR_WARN,
+            "raise": ERR_RAISE,
+            "call": ERR_CALL,
+            "print": ERR_PRINT,
+            "log": ERR_LOG}
+
+_errdict_rev = {value: key for key, value in _errdict.items()}
+
+
+@set_module('numpy')
+def seterr(all=None, divide=None, over=None, under=None, invalid=None):
+    """
+    Set how floating-point errors are handled.
+
+    Note that operations on integer scalar types (such as `int16`) are
+    handled like floating point, and are affected by these settings.
+
+    Parameters
+    ----------
+    all : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Set treatment for all types of floating-point errors at once:
+
+        - ignore: Take no action when the exception occurs.
+        - warn: Print a `RuntimeWarning` (via the Python `warnings` module).
+        - raise: Raise a `FloatingPointError`.
+        - call: Call a function specified using the `seterrcall` function.
+        - print: Print a warning directly to ``stdout``.
+        - log: Record error in a Log object specified by `seterrcall`.
+
+        The default is not to change the current behavior.
+    divide : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for division by zero.
+    over : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for floating-point overflow.
+    under : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for floating-point underflow.
+    invalid : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for invalid floating-point operation.
+
+    Returns
+    -------
+    old_settings : dict
+        Dictionary containing the old settings.
+
+    See also
+    --------
+    seterrcall : Set a callback function for the 'call' mode.
+    geterr, geterrcall, errstate
+
+    Notes
+    -----
+    The floating-point exceptions are defined in the IEEE 754 standard [1]_:
+
+    - Division by zero: infinite result obtained from finite numbers.
+    - Overflow: result too large to be expressed.
+    - Underflow: result so close to zero that some precision
+      was lost.
+    - Invalid operation: result is not an expressible number, typically
+      indicates that a NaN was produced.
+
+    .. [1] https://en.wikipedia.org/wiki/IEEE_754
+
+    Examples
+    --------
+    >>> old_settings = np.seterr(all='ignore')  #seterr to known value
+    >>> np.seterr(over='raise')
+    {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'}
+    >>> np.seterr(**old_settings)  # reset to default
+    {'divide': 'ignore', 'over': 'raise', 'under': 'ignore', 'invalid': 'ignore'}
+
+    >>> np.int16(32000) * np.int16(3)
+    30464
+    >>> old_settings = np.seterr(all='warn', over='raise')
+    >>> np.int16(32000) * np.int16(3)
+    Traceback (most recent call last):
+      File "<stdin>", line 1, in <module>
+    FloatingPointError: overflow encountered in scalar multiply
+
+    >>> old_settings = np.seterr(all='print')
+    >>> np.geterr()
+    {'divide': 'print', 'over': 'print', 'under': 'print', 'invalid': 'print'}
+    >>> np.int16(32000) * np.int16(3)
+    30464
+
+    """
+
+    pyvals = umath.geterrobj()
+    old = geterr()
+
+    if divide is None:
+        divide = all or old['divide']
+    if over is None:
+        over = all or old['over']
+    if under is None:
+        under = all or old['under']
+    if invalid is None:
+        invalid = all or old['invalid']
+
+    maskvalue = ((_errdict[divide] << SHIFT_DIVIDEBYZERO) +
+                 (_errdict[over] << SHIFT_OVERFLOW) +
+                 (_errdict[under] << SHIFT_UNDERFLOW) +
+                 (_errdict[invalid] << SHIFT_INVALID))
+
+    pyvals[1] = maskvalue
+    umath.seterrobj(pyvals)
+    return old
+
+
+@set_module('numpy')
+def geterr():
+    """
+    Get the current way of handling floating-point errors.
+
+    Returns
+    -------
+    res : dict
+        A dictionary with keys "divide", "over", "under", and "invalid",
+        whose values are from the strings "ignore", "print", "log", "warn",
+        "raise", and "call". The keys represent possible floating-point
+        exceptions, and the values define how these exceptions are handled.
+
+    See Also
+    --------
+    geterrcall, seterr, seterrcall
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> np.geterr()
+    {'divide': 'warn', 'over': 'warn', 'under': 'ignore', 'invalid': 'warn'}
+    >>> np.arange(3.) / np.arange(3.)
+    array([nan,  1.,  1.])
+
+    >>> oldsettings = np.seterr(all='warn', over='raise')
+    >>> np.geterr()
+    {'divide': 'warn', 'over': 'raise', 'under': 'warn', 'invalid': 'warn'}
+    >>> np.arange(3.) / np.arange(3.)
+    array([nan,  1.,  1.])
+
+    """
+    maskvalue = umath.geterrobj()[1]
+    mask = 7
+    res = {}
+    val = (maskvalue >> SHIFT_DIVIDEBYZERO) & mask
+    res['divide'] = _errdict_rev[val]
+    val = (maskvalue >> SHIFT_OVERFLOW) & mask
+    res['over'] = _errdict_rev[val]
+    val = (maskvalue >> SHIFT_UNDERFLOW) & mask
+    res['under'] = _errdict_rev[val]
+    val = (maskvalue >> SHIFT_INVALID) & mask
+    res['invalid'] = _errdict_rev[val]
+    return res
+
+
+@set_module('numpy')
+def setbufsize(size):
+    """
+    Set the size of the buffer used in ufuncs.
+
+    Parameters
+    ----------
+    size : int
+        Size of buffer.
+
+    """
+    if size > 10e6:
+        raise ValueError("Buffer size, %s, is too big." % size)
+    if size < 5:
+        raise ValueError("Buffer size, %s, is too small." % size)
+    if size % 16 != 0:
+        raise ValueError("Buffer size, %s, is not a multiple of 16." % size)
+
+    pyvals = umath.geterrobj()
+    old = getbufsize()
+    pyvals[0] = size
+    umath.seterrobj(pyvals)
+    return old
+
+
+@set_module('numpy')
+def getbufsize():
+    """
+    Return the size of the buffer used in ufuncs.
+
+    Returns
+    -------
+    getbufsize : int
+        Size of ufunc buffer in bytes.
+
+    """
+    return umath.geterrobj()[0]
+
+
+@set_module('numpy')
+def seterrcall(func):
+    """
+    Set the floating-point error callback function or log object.
+
+    There are two ways to capture floating-point error messages.  The first
+    is to set the error-handler to 'call', using `seterr`.  Then, set
+    the function to call using this function.
+
+    The second is to set the error-handler to 'log', using `seterr`.
+    Floating-point errors then trigger a call to the 'write' method of
+    the provided object.
+
+    Parameters
+    ----------
+    func : callable f(err, flag) or object with write method
+        Function to call upon floating-point errors ('call'-mode) or
+        object whose 'write' method is used to log such message ('log'-mode).
+
+        The call function takes two arguments. The first is a string describing
+        the type of error (such as "divide by zero", "overflow", "underflow",
+        or "invalid value"), and the second is the status flag.  The flag is a
+        byte, whose four least-significant bits indicate the type of error, one
+        of "divide", "over", "under", "invalid"::
+
+          [0 0 0 0 divide over under invalid]
+
+        In other words, ``flags = divide + 2*over + 4*under + 8*invalid``.
+
+        If an object is provided, its write method should take one argument,
+        a string.
+
+    Returns
+    -------
+    h : callable, log instance or None
+        The old error handler.
+
+    See Also
+    --------
+    seterr, geterr, geterrcall
+
+    Examples
+    --------
+    Callback upon error:
+
+    >>> def err_handler(type, flag):
+    ...     print("Floating point error (%s), with flag %s" % (type, flag))
+    ...
+
+    >>> saved_handler = np.seterrcall(err_handler)
+    >>> save_err = np.seterr(all='call')
+
+    >>> np.array([1, 2, 3]) / 0.0
+    Floating point error (divide by zero), with flag 1
+    array([inf, inf, inf])
+
+    >>> np.seterrcall(saved_handler)
+    <function err_handler at 0x...>
+    >>> np.seterr(**save_err)
+    {'divide': 'call', 'over': 'call', 'under': 'call', 'invalid': 'call'}
+
+    Log error message:
+
+    >>> class Log:
+    ...     def write(self, msg):
+    ...         print("LOG: %s" % msg)
+    ...
+
+    >>> log = Log()
+    >>> saved_handler = np.seterrcall(log)
+    >>> save_err = np.seterr(all='log')
+
+    >>> np.array([1, 2, 3]) / 0.0
+    LOG: Warning: divide by zero encountered in divide
+    array([inf, inf, inf])
+
+    >>> np.seterrcall(saved_handler)
+    <numpy.core.numeric.Log object at 0x...>
+    >>> np.seterr(**save_err)
+    {'divide': 'log', 'over': 'log', 'under': 'log', 'invalid': 'log'}
+
+    """
+    if func is not None and not isinstance(func, collections.abc.Callable):
+        if (not hasattr(func, 'write') or
+                not isinstance(func.write, collections.abc.Callable)):
+            raise ValueError("Only callable can be used as callback")
+    pyvals = umath.geterrobj()
+    old = geterrcall()
+    pyvals[2] = func
+    umath.seterrobj(pyvals)
+    return old
+
+
+@set_module('numpy')
+def geterrcall():
+    """
+    Return the current callback function used on floating-point errors.
+
+    When the error handling for a floating-point error (one of "divide",
+    "over", "under", or "invalid") is set to 'call' or 'log', the function
+    that is called or the log instance that is written to is returned by
+    `geterrcall`. This function or log instance has been set with
+    `seterrcall`.
+
+    Returns
+    -------
+    errobj : callable, log instance or None
+        The current error handler. If no handler was set through `seterrcall`,
+        ``None`` is returned.
+
+    See Also
+    --------
+    seterrcall, seterr, geterr
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> np.geterrcall()  # we did not yet set a handler, returns None
+
+    >>> oldsettings = np.seterr(all='call')
+    >>> def err_handler(type, flag):
+    ...     print("Floating point error (%s), with flag %s" % (type, flag))
+    >>> oldhandler = np.seterrcall(err_handler)
+    >>> np.array([1, 2, 3]) / 0.0
+    Floating point error (divide by zero), with flag 1
+    array([inf, inf, inf])
+
+    >>> cur_handler = np.geterrcall()
+    >>> cur_handler is err_handler
+    True
+
+    """
+    return umath.geterrobj()[2]
+
+
+class _unspecified:
+    pass
+
+
+_Unspecified = _unspecified()
+
+
+@set_module('numpy')
+class errstate(contextlib.ContextDecorator):
+    """
+    errstate(**kwargs)
+
+    Context manager for floating-point error handling.
+
+    Using an instance of `errstate` as a context manager allows statements in
+    that context to execute with a known error handling behavior. Upon entering
+    the context the error handling is set with `seterr` and `seterrcall`, and
+    upon exiting it is reset to what it was before.
+
+    ..  versionchanged:: 1.17.0
+        `errstate` is also usable as a function decorator, saving
+        a level of indentation if an entire function is wrapped.
+        See :py:class:`contextlib.ContextDecorator` for more information.
+
+    Parameters
+    ----------
+    kwargs : {divide, over, under, invalid}
+        Keyword arguments. The valid keywords are the possible floating-point
+        exceptions. Each keyword should have a string value that defines the
+        treatment for the particular error. Possible values are
+        {'ignore', 'warn', 'raise', 'call', 'print', 'log'}.
+
+    See Also
+    --------
+    seterr, geterr, seterrcall, geterrcall
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> olderr = np.seterr(all='ignore')  # Set error handling to known state.
+
+    >>> np.arange(3) / 0.
+    array([nan, inf, inf])
+    >>> with np.errstate(divide='warn'):
+    ...     np.arange(3) / 0.
+    array([nan, inf, inf])
+
+    >>> np.sqrt(-1)
+    nan
+    >>> with np.errstate(invalid='raise'):
+    ...     np.sqrt(-1)
+    Traceback (most recent call last):
+      File "<stdin>", line 2, in <module>
+    FloatingPointError: invalid value encountered in sqrt
+
+    Outside the context the error handling behavior has not changed:
+
+    >>> np.geterr()
+    {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'}
+
+    """
+
+    def __init__(self, *, call=_Unspecified, **kwargs):
+        self.call = call
+        self.kwargs = kwargs
+
+    def __enter__(self):
+        self.oldstate = seterr(**self.kwargs)
+        if self.call is not _Unspecified:
+            self.oldcall = seterrcall(self.call)
+
+    def __exit__(self, *exc_info):
+        seterr(**self.oldstate)
+        if self.call is not _Unspecified:
+            seterrcall(self.oldcall)
+
+
+def _setdef():
+    defval = [UFUNC_BUFSIZE_DEFAULT, ERR_DEFAULT, None]
+    umath.seterrobj(defval)
+
+
+# set the default values
+_setdef()
+
+
+NO_NEP50_WARNING = contextvars.ContextVar("_no_nep50_warning", default=False)
+
+@set_module('numpy')
+@contextlib.contextmanager
+def _no_nep50_warning():
+    """
+    Context manager to disable NEP 50 warnings.  This context manager is
+    only relevant if the NEP 50 warnings are enabled globally (which is not
+    thread/context safe).
+
+    This warning context manager itself is fully safe, however.
+    """
+    token = NO_NEP50_WARNING.set(True)
+    try:
+        yield
+    finally:
+        NO_NEP50_WARNING.reset(token)

pllava/lib/python3.10/site-packages/numpy/core/defchararray.py

@@ -0,0 +1,2914 @@
+"""
+This module contains a set of functions for vectorized string
+operations and methods.
+
+.. note::
+   The `chararray` class exists for backwards compatibility with
+   Numarray, it is not recommended for new development. Starting from numpy
+   1.4, if one needs arrays of strings, it is recommended to use arrays of
+   `dtype` `object_`, `bytes_` or `str_`, and use the free functions
+   in the `numpy.char` module for fast vectorized string operations.
+
+Some methods will only be available if the corresponding string method is
+available in your version of Python.
+
+The preferred alias for `defchararray` is `numpy.char`.
+
+"""
+import functools
+
+from .._utils import set_module
+from .numerictypes import (
+    bytes_, str_, integer, int_, object_, bool_, character)
+from .numeric import ndarray, compare_chararrays
+from .numeric import array as narray
+from numpy.core.multiarray import _vec_string
+from numpy.core import overrides
+from numpy.compat import asbytes
+import numpy
+
+__all__ = [
+    'equal', 'not_equal', 'greater_equal', 'less_equal',
+    'greater', 'less', 'str_len', 'add', 'multiply', 'mod', 'capitalize',
+    'center', 'count', 'decode', 'encode', 'endswith', 'expandtabs',
+    'find', 'index', 'isalnum', 'isalpha', 'isdigit', 'islower', 'isspace',
+    'istitle', 'isupper', 'join', 'ljust', 'lower', 'lstrip', 'partition',
+    'replace', 'rfind', 'rindex', 'rjust', 'rpartition', 'rsplit',
+    'rstrip', 'split', 'splitlines', 'startswith', 'strip', 'swapcase',
+    'title', 'translate', 'upper', 'zfill', 'isnumeric', 'isdecimal',
+    'array', 'asarray'
+    ]
+
+
+_globalvar = 0
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy.char')
+
+
+def _is_unicode(arr):
+    """Returns True if arr is a string or a string array with a dtype that
+    represents a unicode string, otherwise returns False.
+
+    """
+    if (isinstance(arr, str) or
+            issubclass(numpy.asarray(arr).dtype.type, str)):
+        return True
+    return False
+
+
+def _to_bytes_or_str_array(result, output_dtype_like=None):
+    """
+    Helper function to cast a result back into an array
+    with the appropriate dtype if an object array must be used
+    as an intermediary.
+    """
+    ret = numpy.asarray(result.tolist())
+    dtype = getattr(output_dtype_like, 'dtype', None)
+    if dtype is not None:
+        return ret.astype(type(dtype)(_get_num_chars(ret)), copy=False)
+    return ret
+
+
+def _clean_args(*args):
+    """
+    Helper function for delegating arguments to Python string
+    functions.
+
+    Many of the Python string operations that have optional arguments
+    do not use 'None' to indicate a default value.  In these cases,
+    we need to remove all None arguments, and those following them.
+    """
+    newargs = []
+    for chk in args:
+        if chk is None:
+            break
+        newargs.append(chk)
+    return newargs
+
+def _get_num_chars(a):
+    """
+    Helper function that returns the number of characters per field in
+    a string or unicode array.  This is to abstract out the fact that
+    for a unicode array this is itemsize / 4.
+    """
+    if issubclass(a.dtype.type, str_):
+        return a.itemsize // 4
+    return a.itemsize
+
+
+def _binary_op_dispatcher(x1, x2):
+    return (x1, x2)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def equal(x1, x2):
+    """
+    Return (x1 == x2) element-wise.
+
+    Unlike `numpy.equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    not_equal, greater_equal, less_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '==', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def not_equal(x1, x2):
+    """
+    Return (x1 != x2) element-wise.
+
+    Unlike `numpy.not_equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, greater_equal, less_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '!=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def greater_equal(x1, x2):
+    """
+    Return (x1 >= x2) element-wise.
+
+    Unlike `numpy.greater_equal`, this comparison is performed by
+    first stripping whitespace characters from the end of the string.
+    This behavior is provided for backward-compatibility with
+    numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, less_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '>=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def less_equal(x1, x2):
+    """
+    Return (x1 <= x2) element-wise.
+
+    Unlike `numpy.less_equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '<=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def greater(x1, x2):
+    """
+    Return (x1 > x2) element-wise.
+
+    Unlike `numpy.greater`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, less_equal, less
+    """
+    return compare_chararrays(x1, x2, '>', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def less(x1, x2):
+    """
+    Return (x1 < x2) element-wise.
+
+    Unlike `numpy.greater`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, less_equal, greater
+    """
+    return compare_chararrays(x1, x2, '<', True)
+
+
+def _unary_op_dispatcher(a):
+    return (a,)
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def str_len(a):
+    """
+    Return len(a) element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of integers
+
+    See Also
+    --------
+    len
+
+    Examples
+    --------
+    >>> a = np.array(['Grace Hopper Conference', 'Open Source Day'])
+    >>> np.char.str_len(a)
+    array([23, 15])
+    >>> a = np.array([u'\u0420', u'\u043e'])
+    >>> np.char.str_len(a)
+    array([1, 1])
+    >>> a = np.array([['hello', 'world'], [u'\u0420', u'\u043e']])
+    >>> np.char.str_len(a)
+    array([[5, 5], [1, 1]])
+    """
+    # Note: __len__, etc. currently return ints, which are not C-integers.
+    # Generally intp would be expected for lengths, although int is sufficient
+    # due to the dtype itemsize limitation.
+    return _vec_string(a, int_, '__len__')
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def add(x1, x2):
+    """
+    Return element-wise string concatenation for two arrays of str or unicode.
+
+    Arrays `x1` and `x2` must have the same shape.
+
+    Parameters
+    ----------
+    x1 : array_like of str or unicode
+        Input array.
+    x2 : array_like of str or unicode
+        Input array.
+
+    Returns
+    -------
+    add : ndarray
+        Output array of `bytes_` or `str_`, depending on input types
+        of the same shape as `x1` and `x2`.
+
+    """
+    arr1 = numpy.asarray(x1)
+    arr2 = numpy.asarray(x2)
+    out_size = _get_num_chars(arr1) + _get_num_chars(arr2)
+
+    if type(arr1.dtype) != type(arr2.dtype):
+        # Enforce this for now.  The solution to it will be implement add
+        # as a ufunc.  It never worked right on Python 3: bytes + unicode gave
+        # nonsense unicode + bytes errored, and unicode + object used the
+        # object dtype itemsize as num chars (worked on short strings).
+        # bytes + void worked but promoting void->bytes is dubious also.
+        raise TypeError(
+            "np.char.add() requires both arrays of the same dtype kind, but "
+            f"got dtypes: '{arr1.dtype}' and '{arr2.dtype}' (the few cases "
+            "where this used to work often lead to incorrect results).")
+
+    return _vec_string(arr1, type(arr1.dtype)(out_size), '__add__', (arr2,))
+
+def _multiply_dispatcher(a, i):
+    return (a,)
+
+
+@array_function_dispatch(_multiply_dispatcher)
+def multiply(a, i):
+    """
+    Return (a * i), that is string multiple concatenation,
+    element-wise.
+
+    Values in `i` of less than 0 are treated as 0 (which yields an
+    empty string).
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    i : array_like of ints
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input types
+    
+    Examples
+    --------
+    >>> a = np.array(["a", "b", "c"])
+    >>> np.char.multiply(x, 3)
+    array(['aaa', 'bbb', 'ccc'], dtype='<U3')
+    >>> i = np.array([1, 2, 3])
+    >>> np.char.multiply(a, i)
+    array(['a', 'bb', 'ccc'], dtype='<U3')
+    >>> np.char.multiply(np.array(['a']), i)
+    array(['a', 'aa', 'aaa'], dtype='<U3')
+    >>> a = np.array(['a', 'b', 'c', 'd', 'e', 'f']).reshape((2, 3))
+    >>> np.char.multiply(a, 3)
+    array([['aaa', 'bbb', 'ccc'],
+           ['ddd', 'eee', 'fff']], dtype='<U3')
+    >>> np.char.multiply(a, i)
+    array([['a', 'bb', 'ccc'],
+           ['d', 'ee', 'fff']], dtype='<U3')
+    """
+    a_arr = numpy.asarray(a)
+    i_arr = numpy.asarray(i)
+    if not issubclass(i_arr.dtype.type, integer):
+        raise ValueError("Can only multiply by integers")
+    out_size = _get_num_chars(a_arr) * max(int(i_arr.max()), 0)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(out_size), '__mul__', (i_arr,))
+
+
+def _mod_dispatcher(a, values):
+    return (a, values)
+
+
+@array_function_dispatch(_mod_dispatcher)
+def mod(a, values):
+    """
+    Return (a % i), that is pre-Python 2.6 string formatting
+    (interpolation), element-wise for a pair of array_likes of str
+    or unicode.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    values : array_like of values
+       These values will be element-wise interpolated into the string.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input types
+
+    See Also
+    --------
+    str.__mod__
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, '__mod__', (values,)), a)
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def capitalize(a):
+    """
+    Return a copy of `a` with only the first character of each element
+    capitalized.
+
+    Calls `str.capitalize` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+        Input array of strings to capitalize.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input
+        types
+
+    See Also
+    --------
+    str.capitalize
+
+    Examples
+    --------
+    >>> c = np.array(['a1b2','1b2a','b2a1','2a1b'],'S4'); c
+    array(['a1b2', '1b2a', 'b2a1', '2a1b'],
+        dtype='|S4')
+    >>> np.char.capitalize(c)
+    array(['A1b2', '1b2a', 'B2a1', '2a1b'],
+        dtype='|S4')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'capitalize')
+
+
+def _center_dispatcher(a, width, fillchar=None):
+    return (a,)
+
+
+@array_function_dispatch(_center_dispatcher)
+def center(a, width, fillchar=' '):
+    """
+    Return a copy of `a` with its elements centered in a string of
+    length `width`.
+
+    Calls `str.center` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    width : int
+        The length of the resulting strings
+    fillchar : str or unicode, optional
+        The padding character to use (default is space).
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input
+        types
+
+    See Also
+    --------
+    str.center
+    
+    Notes
+    -----
+    This function is intended to work with arrays of strings.  The
+    fill character is not applied to numeric types.
+
+    Examples
+    --------
+    >>> c = np.array(['a1b2','1b2a','b2a1','2a1b']); c
+    array(['a1b2', '1b2a', 'b2a1', '2a1b'], dtype='<U4')
+    >>> np.char.center(c, width=9)
+    array(['   a1b2  ', '   1b2a  ', '   b2a1  ', '   2a1b  '], dtype='<U9')
+    >>> np.char.center(c, width=9, fillchar='*')
+    array(['***a1b2**', '***1b2a**', '***b2a1**', '***2a1b**'], dtype='<U9')
+    >>> np.char.center(c, width=1)
+    array(['a', '1', 'b', '2'], dtype='<U1')
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    if numpy.issubdtype(a_arr.dtype, numpy.bytes_):
+        fillchar = asbytes(fillchar)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'center', (width_arr, fillchar))
+
+
+def _count_dispatcher(a, sub, start=None, end=None):
+    return (a,)
+
+
+@array_function_dispatch(_count_dispatcher)
+def count(a, sub, start=0, end=None):
+    """
+    Returns an array with the number of non-overlapping occurrences of
+    substring `sub` in the range [`start`, `end`].
+
+    Calls `str.count` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sub : str or unicode
+       The substring to search for.
+
+    start, end : int, optional
+       Optional arguments `start` and `end` are interpreted as slice
+       notation to specify the range in which to count.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of ints.
+
+    See Also
+    --------
+    str.count
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', '  aA  ', 'abBABba'])
+    >>> c
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+    >>> np.char.count(c, 'A')
+    array([3, 1, 1])
+    >>> np.char.count(c, 'aA')
+    array([3, 1, 0])
+    >>> np.char.count(c, 'A', start=1, end=4)
+    array([2, 1, 1])
+    >>> np.char.count(c, 'A', start=1, end=3)
+    array([1, 0, 0])
+
+    """
+    return _vec_string(a, int_, 'count', [sub, start] + _clean_args(end))
+
+
+def _code_dispatcher(a, encoding=None, errors=None):
+    return (a,)
+
+
+@array_function_dispatch(_code_dispatcher)
+def decode(a, encoding=None, errors=None):
+    r"""
+    Calls ``bytes.decode`` element-wise.
+
+    The set of available codecs comes from the Python standard library,
+    and may be extended at runtime.  For more information, see the
+    :mod:`codecs` module.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    encoding : str, optional
+       The name of an encoding
+
+    errors : str, optional
+       Specifies how to handle encoding errors
+
+    Returns
+    -------
+    out : ndarray
+
+    See Also
+    --------
+    :py:meth:`bytes.decode`
+
+    Notes
+    -----
+    The type of the result will depend on the encoding specified.
+
+    Examples
+    --------
+    >>> c = np.array([b'\x81\xc1\x81\xc1\x81\xc1', b'@@\x81\xc1@@',
+    ...               b'\x81\x82\xc2\xc1\xc2\x82\x81'])
+    >>> c
+    array([b'\x81\xc1\x81\xc1\x81\xc1', b'@@\x81\xc1@@',
+    ...    b'\x81\x82\xc2\xc1\xc2\x82\x81'], dtype='|S7')
+    >>> np.char.decode(c, encoding='cp037')
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'decode', _clean_args(encoding, errors)))
+
+
+@array_function_dispatch(_code_dispatcher)
+def encode(a, encoding=None, errors=None):
+    """
+    Calls `str.encode` element-wise.
+
+    The set of available codecs comes from the Python standard library,
+    and may be extended at runtime. For more information, see the codecs
+    module.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    encoding : str, optional
+       The name of an encoding
+
+    errors : str, optional
+       Specifies how to handle encoding errors
+
+    Returns
+    -------
+    out : ndarray
+
+    See Also
+    --------
+    str.encode
+
+    Notes
+    -----
+    The type of the result will depend on the encoding specified.
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'encode', _clean_args(encoding, errors)))
+
+
+def _endswith_dispatcher(a, suffix, start=None, end=None):
+    return (a,)
+
+
+@array_function_dispatch(_endswith_dispatcher)
+def endswith(a, suffix, start=0, end=None):
+    """
+    Returns a boolean array which is `True` where the string element
+    in `a` ends with `suffix`, otherwise `False`.
+
+    Calls `str.endswith` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    suffix : str
+
+    start, end : int, optional
+        With optional `start`, test beginning at that position. With
+        optional `end`, stop comparing at that position.
+
+    Returns
+    -------
+    out : ndarray
+        Outputs an array of bools.
+
+    See Also
+    --------
+    str.endswith
+
+    Examples
+    --------
+    >>> s = np.array(['foo', 'bar'])
+    >>> s[0] = 'foo'
+    >>> s[1] = 'bar'
+    >>> s
+    array(['foo', 'bar'], dtype='<U3')
+    >>> np.char.endswith(s, 'ar')
+    array([False,  True])
+    >>> np.char.endswith(s, 'a', start=1, end=2)
+    array([False,  True])
+
+    """
+    return _vec_string(
+        a, bool_, 'endswith', [suffix, start] + _clean_args(end))
+
+
+def _expandtabs_dispatcher(a, tabsize=None):
+    return (a,)
+
+
+@array_function_dispatch(_expandtabs_dispatcher)
+def expandtabs(a, tabsize=8):
+    """
+    Return a copy of each string element where all tab characters are
+    replaced by one or more spaces.
+
+    Calls `str.expandtabs` element-wise.
+
+    Return a copy of each string element where all tab characters are
+    replaced by one or more spaces, depending on the current column
+    and the given `tabsize`. The column number is reset to zero after
+    each newline occurring in the string. This doesn't understand other
+    non-printing characters or escape sequences.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+        Input array
+    tabsize : int, optional
+        Replace tabs with `tabsize` number of spaces.  If not given defaults
+        to 8 spaces.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.expandtabs
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'expandtabs', (tabsize,)), a)
+
+
+@array_function_dispatch(_count_dispatcher)
+def find(a, sub, start=0, end=None):
+    """
+    For each element, return the lowest index in the string where
+    substring `sub` is found.
+
+    Calls `str.find` element-wise.
+
+    For each element, return the lowest index in the string where
+    substring `sub` is found, such that `sub` is contained in the
+    range [`start`, `end`].
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+        Optional arguments `start` and `end` are interpreted as in
+        slice notation.
+
+    Returns
+    -------
+    out : ndarray or int
+        Output array of ints.  Returns -1 if `sub` is not found.
+
+    See Also
+    --------
+    str.find
+
+    Examples
+    --------
+    >>> a = np.array(["NumPy is a Python library"])
+    >>> np.char.find(a, "Python", start=0, end=None)
+    array([11])
+
+    """
+    return _vec_string(
+        a, int_, 'find', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_count_dispatcher)
+def index(a, sub, start=0, end=None):
+    """
+    Like `find`, but raises `ValueError` when the substring is not found.
+
+    Calls `str.index` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+
+    Returns
+    -------
+    out : ndarray
+        Output array of ints.  Returns -1 if `sub` is not found.
+
+    See Also
+    --------
+    find, str.find
+
+    Examples
+    --------
+    >>> a = np.array(["Computer Science"])
+    >>> np.char.index(a, "Science", start=0, end=None)
+    array([9])
+
+    """
+    return _vec_string(
+        a, int_, 'index', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isalnum(a):
+    """
+    Returns true for each element if all characters in the string are
+    alphanumeric and there is at least one character, false otherwise.
+
+    Calls `str.isalnum` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.isalnum
+    """
+    return _vec_string(a, bool_, 'isalnum')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isalpha(a):
+    """
+    Returns true for each element if all characters in the string are
+    alphabetic and there is at least one character, false otherwise.
+
+    Calls `str.isalpha` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isalpha
+    """
+    return _vec_string(a, bool_, 'isalpha')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isdigit(a):
+    """
+    Returns true for each element if all characters in the string are
+    digits and there is at least one character, false otherwise.
+
+    Calls `str.isdigit` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isdigit
+
+    Examples
+    --------
+    >>> a = np.array(['a', 'b', '0'])
+    >>> np.char.isdigit(a)
+    array([False, False,  True])
+    >>> a = np.array([['a', 'b', '0'], ['c', '1', '2']])
+    >>> np.char.isdigit(a)
+    array([[False, False,  True], [False,  True,  True]])
+    """
+    return _vec_string(a, bool_, 'isdigit')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def islower(a):
+    """
+    Returns true for each element if all cased characters in the
+    string are lowercase and there is at least one cased character,
+    false otherwise.
+
+    Calls `str.islower` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.islower
+    """
+    return _vec_string(a, bool_, 'islower')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isspace(a):
+    """
+    Returns true for each element if there are only whitespace
+    characters in the string and there is at least one character,
+    false otherwise.
+
+    Calls `str.isspace` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isspace
+    """
+    return _vec_string(a, bool_, 'isspace')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def istitle(a):
+    """
+    Returns true for each element if the element is a titlecased
+    string and there is at least one character, false otherwise.
+
+    Call `str.istitle` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.istitle
+    """
+    return _vec_string(a, bool_, 'istitle')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isupper(a):
+    """
+    Return true for each element if all cased characters in the
+    string are uppercase and there is at least one character, false
+    otherwise.
+
+    Call `str.isupper` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isupper
+
+    Examples
+    --------
+    >>> str = "GHC"
+    >>> np.char.isupper(str)
+    array(True)     
+    >>> a = np.array(["hello", "HELLO", "Hello"])
+    >>> np.char.isupper(a)
+    array([False,  True, False]) 
+
+    """
+    return _vec_string(a, bool_, 'isupper')
+
+
+def _join_dispatcher(sep, seq):
+    return (sep, seq)
+
+
+@array_function_dispatch(_join_dispatcher)
+def join(sep, seq):
+    """
+    Return a string which is the concatenation of the strings in the
+    sequence `seq`.
+
+    Calls `str.join` element-wise.
+
+    Parameters
+    ----------
+    sep : array_like of str or unicode
+    seq : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input types
+
+    See Also
+    --------
+    str.join
+
+    Examples
+    --------
+    >>> np.char.join('-', 'osd')
+    array('o-s-d', dtype='<U5')
+
+    >>> np.char.join(['-', '.'], ['ghc', 'osd'])
+    array(['g-h-c', 'o.s.d'], dtype='<U5')
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(sep, object_, 'join', (seq,)), seq)
+
+
+
+def _just_dispatcher(a, width, fillchar=None):
+    return (a,)
+
+
+@array_function_dispatch(_just_dispatcher)
+def ljust(a, width, fillchar=' '):
+    """
+    Return an array with the elements of `a` left-justified in a
+    string of length `width`.
+
+    Calls `str.ljust` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    width : int
+        The length of the resulting strings
+    fillchar : str or unicode, optional
+        The character to use for padding
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.ljust
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    if numpy.issubdtype(a_arr.dtype, numpy.bytes_):
+        fillchar = asbytes(fillchar)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'ljust', (width_arr, fillchar))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def lower(a):
+    """
+    Return an array with the elements converted to lowercase.
+
+    Call `str.lower` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.lower
+
+    Examples
+    --------
+    >>> c = np.array(['A1B C', '1BCA', 'BCA1']); c
+    array(['A1B C', '1BCA', 'BCA1'], dtype='<U5')
+    >>> np.char.lower(c)
+    array(['a1b c', '1bca', 'bca1'], dtype='<U5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'lower')
+
+
+def _strip_dispatcher(a, chars=None):
+    return (a,)
+
+
+@array_function_dispatch(_strip_dispatcher)
+def lstrip(a, chars=None):
+    """
+    For each element in `a`, return a copy with the leading characters
+    removed.
+
+    Calls `str.lstrip` element-wise.
+
+    Parameters
+    ----------
+    a : array-like, {str, unicode}
+        Input array.
+
+    chars : {str, unicode}, optional
+        The `chars` argument is a string specifying the set of
+        characters to be removed. If omitted or None, the `chars`
+        argument defaults to removing whitespace. The `chars` argument
+        is not a prefix; rather, all combinations of its values are
+        stripped.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.lstrip
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', '  aA  ', 'abBABba'])
+    >>> c
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+
+    The 'a' variable is unstripped from c[1] because whitespace leading.
+
+    >>> np.char.lstrip(c, 'a')
+    array(['AaAaA', '  aA  ', 'bBABba'], dtype='<U7')
+
+
+    >>> np.char.lstrip(c, 'A') # leaves c unchanged
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+    >>> (np.char.lstrip(c, ' ') == np.char.lstrip(c, '')).all()
+    ... # XXX: is this a regression? This used to return True
+    ... # np.char.lstrip(c,'') does not modify c at all.
+    False
+    >>> (np.char.lstrip(c, ' ') == np.char.lstrip(c, None)).all()
+    True
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'lstrip', (chars,))
+
+
+def _partition_dispatcher(a, sep):
+    return (a,)
+
+
+@array_function_dispatch(_partition_dispatcher)
+def partition(a, sep):
+    """
+    Partition each element in `a` around `sep`.
+
+    Calls `str.partition` element-wise.
+
+    For each element in `a`, split the element as the first
+    occurrence of `sep`, and return 3 strings containing the part
+    before the separator, the separator itself, and the part after
+    the separator. If the separator is not found, return 3 strings
+    containing the string itself, followed by two empty strings.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array
+    sep : {str, unicode}
+        Separator to split each string element in `a`.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type.
+        The output array will have an extra dimension with 3
+        elements per input element.
+
+    See Also
+    --------
+    str.partition
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'partition', (sep,)), a)
+
+
+def _replace_dispatcher(a, old, new, count=None):
+    return (a,)
+
+
+@array_function_dispatch(_replace_dispatcher)
+def replace(a, old, new, count=None):
+    """
+    For each element in `a`, return a copy of the string with all
+    occurrences of substring `old` replaced by `new`.
+
+    Calls `str.replace` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    old, new : str or unicode
+
+    count : int, optional
+        If the optional argument `count` is given, only the first
+        `count` occurrences are replaced.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.replace
+    
+    Examples
+    --------
+    >>> a = np.array(["That is a mango", "Monkeys eat mangos"])
+    >>> np.char.replace(a, 'mango', 'banana')
+    array(['That is a banana', 'Monkeys eat bananas'], dtype='<U19')
+
+    >>> a = np.array(["The dish is fresh", "This is it"])
+    >>> np.char.replace(a, 'is', 'was')
+    array(['The dwash was fresh', 'Thwas was it'], dtype='<U19')
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'replace', [old, new] + _clean_args(count)), a)
+
+
+@array_function_dispatch(_count_dispatcher)
+def rfind(a, sub, start=0, end=None):
+    """
+    For each element in `a`, return the highest index in the string
+    where substring `sub` is found, such that `sub` is contained
+    within [`start`, `end`].
+
+    Calls `str.rfind` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+        Optional arguments `start` and `end` are interpreted as in
+        slice notation.
+
+    Returns
+    -------
+    out : ndarray
+       Output array of ints.  Return -1 on failure.
+
+    See Also
+    --------
+    str.rfind
+
+    """
+    return _vec_string(
+        a, int_, 'rfind', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_count_dispatcher)
+def rindex(a, sub, start=0, end=None):
+    """
+    Like `rfind`, but raises `ValueError` when the substring `sub` is
+    not found.
+
+    Calls `str.rindex` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+
+    Returns
+    -------
+    out : ndarray
+       Output array of ints.
+
+    See Also
+    --------
+    rfind, str.rindex
+
+    """
+    return _vec_string(
+        a, int_, 'rindex', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_just_dispatcher)
+def rjust(a, width, fillchar=' '):
+    """
+    Return an array with the elements of `a` right-justified in a
+    string of length `width`.
+
+    Calls `str.rjust` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    width : int
+        The length of the resulting strings
+    fillchar : str or unicode, optional
+        The character to use for padding
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.rjust
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    if numpy.issubdtype(a_arr.dtype, numpy.bytes_):
+        fillchar = asbytes(fillchar)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'rjust', (width_arr, fillchar))
+
+
+@array_function_dispatch(_partition_dispatcher)
+def rpartition(a, sep):
+    """
+    Partition (split) each element around the right-most separator.
+
+    Calls `str.rpartition` element-wise.
+
+    For each element in `a`, split the element as the last
+    occurrence of `sep`, and return 3 strings containing the part
+    before the separator, the separator itself, and the part after
+    the separator. If the separator is not found, return 3 strings
+    containing the string itself, followed by two empty strings.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+        Input array
+    sep : str or unicode
+        Right-most separator to split each element in array.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of string or unicode, depending on input
+        type.  The output array will have an extra dimension with
+        3 elements per input element.
+
+    See Also
+    --------
+    str.rpartition
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'rpartition', (sep,)), a)
+
+
+def _split_dispatcher(a, sep=None, maxsplit=None):
+    return (a,)
+
+
+@array_function_dispatch(_split_dispatcher)
+def rsplit(a, sep=None, maxsplit=None):
+    """
+    For each element in `a`, return a list of the words in the
+    string, using `sep` as the delimiter string.
+
+    Calls `str.rsplit` element-wise.
+
+    Except for splitting from the right, `rsplit`
+    behaves like `split`.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sep : str or unicode, optional
+        If `sep` is not specified or None, any whitespace string
+        is a separator.
+    maxsplit : int, optional
+        If `maxsplit` is given, at most `maxsplit` splits are done,
+        the rightmost ones.
+
+    Returns
+    -------
+    out : ndarray
+       Array of list objects
+
+    See Also
+    --------
+    str.rsplit, split
+
+    """
+    # This will return an array of lists of different sizes, so we
+    # leave it as an object array
+    return _vec_string(
+        a, object_, 'rsplit', [sep] + _clean_args(maxsplit))
+
+
+def _strip_dispatcher(a, chars=None):
+    return (a,)
+
+
+@array_function_dispatch(_strip_dispatcher)
+def rstrip(a, chars=None):
+    """
+    For each element in `a`, return a copy with the trailing
+    characters removed.
+
+    Calls `str.rstrip` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    chars : str or unicode, optional
+       The `chars` argument is a string specifying the set of
+       characters to be removed. If omitted or None, the `chars`
+       argument defaults to removing whitespace. The `chars` argument
+       is not a suffix; rather, all combinations of its values are
+       stripped.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.rstrip
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', 'abBABba'], dtype='S7'); c
+    array(['aAaAaA', 'abBABba'],
+        dtype='|S7')
+    >>> np.char.rstrip(c, b'a')
+    array(['aAaAaA', 'abBABb'],
+        dtype='|S7')
+    >>> np.char.rstrip(c, b'A')
+    array(['aAaAa', 'abBABba'],
+        dtype='|S7')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'rstrip', (chars,))
+
+
+@array_function_dispatch(_split_dispatcher)
+def split(a, sep=None, maxsplit=None):
+    """
+    For each element in `a`, return a list of the words in the
+    string, using `sep` as the delimiter string.
+
+    Calls `str.split` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sep : str or unicode, optional
+       If `sep` is not specified or None, any whitespace string is a
+       separator.
+
+    maxsplit : int, optional
+        If `maxsplit` is given, at most `maxsplit` splits are done.
+
+    Returns
+    -------
+    out : ndarray
+        Array of list objects
+
+    See Also
+    --------
+    str.split, rsplit
+
+    """
+    # This will return an array of lists of different sizes, so we
+    # leave it as an object array
+    return _vec_string(
+        a, object_, 'split', [sep] + _clean_args(maxsplit))
+
+
+def _splitlines_dispatcher(a, keepends=None):
+    return (a,)
+
+
+@array_function_dispatch(_splitlines_dispatcher)
+def splitlines(a, keepends=None):
+    """
+    For each element in `a`, return a list of the lines in the
+    element, breaking at line boundaries.
+
+    Calls `str.splitlines` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    keepends : bool, optional
+        Line breaks are not included in the resulting list unless
+        keepends is given and true.
+
+    Returns
+    -------
+    out : ndarray
+        Array of list objects
+
+    See Also
+    --------
+    str.splitlines
+
+    """
+    return _vec_string(
+        a, object_, 'splitlines', _clean_args(keepends))
+
+
+def _startswith_dispatcher(a, prefix, start=None, end=None):
+    return (a,)
+
+
+@array_function_dispatch(_startswith_dispatcher)
+def startswith(a, prefix, start=0, end=None):
+    """
+    Returns a boolean array which is `True` where the string element
+    in `a` starts with `prefix`, otherwise `False`.
+
+    Calls `str.startswith` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    prefix : str
+
+    start, end : int, optional
+        With optional `start`, test beginning at that position. With
+        optional `end`, stop comparing at that position.
+
+    Returns
+    -------
+    out : ndarray
+        Array of booleans
+
+    See Also
+    --------
+    str.startswith
+
+    """
+    return _vec_string(
+        a, bool_, 'startswith', [prefix, start] + _clean_args(end))
+
+
+@array_function_dispatch(_strip_dispatcher)
+def strip(a, chars=None):
+    """
+    For each element in `a`, return a copy with the leading and
+    trailing characters removed.
+
+    Calls `str.strip` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    chars : str or unicode, optional
+       The `chars` argument is a string specifying the set of
+       characters to be removed. If omitted or None, the `chars`
+       argument defaults to removing whitespace. The `chars` argument
+       is not a prefix or suffix; rather, all combinations of its
+       values are stripped.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.strip
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', '  aA  ', 'abBABba'])
+    >>> c
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+    >>> np.char.strip(c)
+    array(['aAaAaA', 'aA', 'abBABba'], dtype='<U7')
+    >>> np.char.strip(c, 'a') # 'a' unstripped from c[1] because whitespace leads
+    array(['AaAaA', '  aA  ', 'bBABb'], dtype='<U7')
+    >>> np.char.strip(c, 'A') # 'A' unstripped from c[1] because (unprinted) ws trails
+    array(['aAaAa', '  aA  ', 'abBABba'], dtype='<U7')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'strip', _clean_args(chars))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def swapcase(a):
+    """
+    Return element-wise a copy of the string with
+    uppercase characters converted to lowercase and vice versa.
+
+    Calls `str.swapcase` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.swapcase
+
+    Examples
+    --------
+    >>> c=np.array(['a1B c','1b Ca','b Ca1','cA1b'],'S5'); c
+    array(['a1B c', '1b Ca', 'b Ca1', 'cA1b'],
+        dtype='|S5')
+    >>> np.char.swapcase(c)
+    array(['A1b C', '1B cA', 'B cA1', 'Ca1B'],
+        dtype='|S5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'swapcase')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def title(a):
+    """
+    Return element-wise title cased version of string or unicode.
+
+    Title case words start with uppercase characters, all remaining cased
+    characters are lowercase.
+
+    Calls `str.title` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.title
+
+    Examples
+    --------
+    >>> c=np.array(['a1b c','1b ca','b ca1','ca1b'],'S5'); c
+    array(['a1b c', '1b ca', 'b ca1', 'ca1b'],
+        dtype='|S5')
+    >>> np.char.title(c)
+    array(['A1B C', '1B Ca', 'B Ca1', 'Ca1B'],
+        dtype='|S5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'title')
+
+
+def _translate_dispatcher(a, table, deletechars=None):
+    return (a,)
+
+
+@array_function_dispatch(_translate_dispatcher)
+def translate(a, table, deletechars=None):
+    """
+    For each element in `a`, return a copy of the string where all
+    characters occurring in the optional argument `deletechars` are
+    removed, and the remaining characters have been mapped through the
+    given translation table.
+
+    Calls `str.translate` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    table : str of length 256
+
+    deletechars : str
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.translate
+
+    """
+    a_arr = numpy.asarray(a)
+    if issubclass(a_arr.dtype.type, str_):
+        return _vec_string(
+            a_arr, a_arr.dtype, 'translate', (table,))
+    else:
+        return _vec_string(
+            a_arr, a_arr.dtype, 'translate', [table] + _clean_args(deletechars))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def upper(a):
+    """
+    Return an array with the elements converted to uppercase.
+
+    Calls `str.upper` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.upper
+
+    Examples
+    --------
+    >>> c = np.array(['a1b c', '1bca', 'bca1']); c
+    array(['a1b c', '1bca', 'bca1'], dtype='<U5')
+    >>> np.char.upper(c)
+    array(['A1B C', '1BCA', 'BCA1'], dtype='<U5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'upper')
+
+
+def _zfill_dispatcher(a, width):
+    return (a,)
+
+
+@array_function_dispatch(_zfill_dispatcher)
+def zfill(a, width):
+    """
+    Return the numeric string left-filled with zeros
+
+    Calls `str.zfill` element-wise.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+    width : int
+        Width of string to left-fill elements in `a`.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.zfill
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'zfill', (width_arr,))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isnumeric(a):
+    """
+    For each element, return True if there are only numeric
+    characters in the element.
+
+    Calls `str.isnumeric` element-wise.
+
+    Numeric characters include digit characters, and all characters
+    that have the Unicode numeric value property, e.g. ``U+2155,
+    VULGAR FRACTION ONE FIFTH``.
+
+    Parameters
+    ----------
+    a : array_like, unicode
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, bool
+        Array of booleans of same shape as `a`.
+
+    See Also
+    --------
+    str.isnumeric
+
+    Examples
+    --------
+    >>> np.char.isnumeric(['123', '123abc', '9.0', '1/4', 'VIII'])
+    array([ True, False, False, False, False])
+
+    """
+    if not _is_unicode(a):
+        raise TypeError("isnumeric is only available for Unicode strings and arrays")
+    return _vec_string(a, bool_, 'isnumeric')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isdecimal(a):
+    """
+    For each element, return True if there are only decimal
+    characters in the element.
+
+    Calls `str.isdecimal` element-wise.
+
+    Decimal characters include digit characters, and all characters
+    that can be used to form decimal-radix numbers,
+    e.g. ``U+0660, ARABIC-INDIC DIGIT ZERO``.
+
+    Parameters
+    ----------
+    a : array_like, unicode
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, bool
+        Array of booleans identical in shape to `a`.
+
+    See Also
+    --------
+    str.isdecimal
+
+    Examples
+    --------
+    >>> np.char.isdecimal(['12345', '4.99', '123ABC', ''])
+    array([ True, False, False, False])
+
+    """ 
+    if not _is_unicode(a):
+        raise TypeError(
+            "isdecimal is only available for Unicode strings and arrays")
+    return _vec_string(a, bool_, 'isdecimal')
+
+
+@set_module('numpy')
+class chararray(ndarray):
+    """
+    chararray(shape, itemsize=1, unicode=False, buffer=None, offset=0,
+              strides=None, order=None)
+
+    Provides a convenient view on arrays of string and unicode values.
+
+    .. note::
+       The `chararray` class exists for backwards compatibility with
+       Numarray, it is not recommended for new development. Starting from numpy
+       1.4, if one needs arrays of strings, it is recommended to use arrays of
+       `dtype` `object_`, `bytes_` or `str_`, and use the free functions
+       in the `numpy.char` module for fast vectorized string operations.
+
+    Versus a regular NumPy array of type `str` or `unicode`, this
+    class adds the following functionality:
+
+      1) values automatically have whitespace removed from the end
+         when indexed
+
+      2) comparison operators automatically remove whitespace from the
+         end when comparing values
+
+      3) vectorized string operations are provided as methods
+         (e.g. `.endswith`) and infix operators (e.g. ``"+", "*", "%"``)
+
+    chararrays should be created using `numpy.char.array` or
+    `numpy.char.asarray`, rather than this constructor directly.
+
+    This constructor creates the array, using `buffer` (with `offset`
+    and `strides`) if it is not ``None``. If `buffer` is ``None``, then
+    constructs a new array with `strides` in "C order", unless both
+    ``len(shape) >= 2`` and ``order='F'``, in which case `strides`
+    is in "Fortran order".
+
+    Methods
+    -------
+    astype
+    argsort
+    copy
+    count
+    decode
+    dump
+    dumps
+    encode
+    endswith
+    expandtabs
+    fill
+    find
+    flatten
+    getfield
+    index
+    isalnum
+    isalpha
+    isdecimal
+    isdigit
+    islower
+    isnumeric
+    isspace
+    istitle
+    isupper
+    item
+    join
+    ljust
+    lower
+    lstrip
+    nonzero
+    put
+    ravel
+    repeat
+    replace
+    reshape
+    resize
+    rfind
+    rindex
+    rjust
+    rsplit
+    rstrip
+    searchsorted
+    setfield
+    setflags
+    sort
+    split
+    splitlines
+    squeeze
+    startswith
+    strip
+    swapaxes
+    swapcase
+    take
+    title
+    tofile
+    tolist
+    tostring
+    translate
+    transpose
+    upper
+    view
+    zfill
+
+    Parameters
+    ----------
+    shape : tuple
+        Shape of the array.
+    itemsize : int, optional
+        Length of each array element, in number of characters. Default is 1.
+    unicode : bool, optional
+        Are the array elements of type unicode (True) or string (False).
+        Default is False.
+    buffer : object exposing the buffer interface or str, optional
+        Memory address of the start of the array data.  Default is None,
+        in which case a new array is created.
+    offset : int, optional
+        Fixed stride displacement from the beginning of an axis?
+        Default is 0. Needs to be >=0.
+    strides : array_like of ints, optional
+        Strides for the array (see `ndarray.strides` for full description).
+        Default is None.
+    order : {'C', 'F'}, optional
+        The order in which the array data is stored in memory: 'C' ->
+        "row major" order (the default), 'F' -> "column major"
+        (Fortran) order.
+
+    Examples
+    --------
+    >>> charar = np.chararray((3, 3))
+    >>> charar[:] = 'a'
+    >>> charar
+    chararray([[b'a', b'a', b'a'],
+               [b'a', b'a', b'a'],
+               [b'a', b'a', b'a']], dtype='|S1')
+
+    >>> charar = np.chararray(charar.shape, itemsize=5)
+    >>> charar[:] = 'abc'
+    >>> charar
+    chararray([[b'abc', b'abc', b'abc'],
+               [b'abc', b'abc', b'abc'],
+               [b'abc', b'abc', b'abc']], dtype='|S5')
+
+    """
+    def __new__(subtype, shape, itemsize=1, unicode=False, buffer=None,
+                offset=0, strides=None, order='C'):
+        global _globalvar
+
+        if unicode:
+            dtype = str_
+        else:
+            dtype = bytes_
+
+        # force itemsize to be a Python int, since using NumPy integer
+        # types results in itemsize.itemsize being used as the size of
+        # strings in the new array.
+        itemsize = int(itemsize)
+
+        if isinstance(buffer, str):
+            # unicode objects do not have the buffer interface
+            filler = buffer
+            buffer = None
+        else:
+            filler = None
+
+        _globalvar = 1
+        if buffer is None:
+            self = ndarray.__new__(subtype, shape, (dtype, itemsize),
+                                   order=order)
+        else:
+            self = ndarray.__new__(subtype, shape, (dtype, itemsize),
+                                   buffer=buffer,
+                                   offset=offset, strides=strides,
+                                   order=order)
+        if filler is not None:
+            self[...] = filler
+        _globalvar = 0
+        return self
+
+    def __array_finalize__(self, obj):
+        # The b is a special case because it is used for reconstructing.
+        if not _globalvar and self.dtype.char not in 'SUbc':
+            raise ValueError("Can only create a chararray from string data.")
+
+    def __getitem__(self, obj):
+        val = ndarray.__getitem__(self, obj)
+
+        if isinstance(val, character):
+            temp = val.rstrip()
+            if len(temp) == 0:
+                val = ''
+            else:
+                val = temp
+
+        return val
+
+    # IMPLEMENTATION NOTE: Most of the methods of this class are
+    # direct delegations to the free functions in this module.
+    # However, those that return an array of strings should instead
+    # return a chararray, so some extra wrapping is required.
+
+    def __eq__(self, other):
+        """
+        Return (self == other) element-wise.
+
+        See Also
+        --------
+        equal
+        """
+        return equal(self, other)
+
+    def __ne__(self, other):
+        """
+        Return (self != other) element-wise.
+
+        See Also
+        --------
+        not_equal
+        """
+        return not_equal(self, other)
+
+    def __ge__(self, other):
+        """
+        Return (self >= other) element-wise.
+
+        See Also
+        --------
+        greater_equal
+        """
+        return greater_equal(self, other)
+
+    def __le__(self, other):
+        """
+        Return (self <= other) element-wise.
+
+        See Also
+        --------
+        less_equal
+        """
+        return less_equal(self, other)
+
+    def __gt__(self, other):
+        """
+        Return (self > other) element-wise.
+
+        See Also
+        --------
+        greater
+        """
+        return greater(self, other)
+
+    def __lt__(self, other):
+        """
+        Return (self < other) element-wise.
+
+        See Also
+        --------
+        less
+        """
+        return less(self, other)
+
+    def __add__(self, other):
+        """
+        Return (self + other), that is string concatenation,
+        element-wise for a pair of array_likes of str or unicode.
+
+        See Also
+        --------
+        add
+        """
+        return asarray(add(self, other))
+
+    def __radd__(self, other):
+        """
+        Return (other + self), that is string concatenation,
+        element-wise for a pair of array_likes of `bytes_` or `str_`.
+
+        See Also
+        --------
+        add
+        """
+        return asarray(add(numpy.asarray(other), self))
+
+    def __mul__(self, i):
+        """
+        Return (self * i), that is string multiple concatenation,
+        element-wise.
+
+        See Also
+        --------
+        multiply
+        """
+        return asarray(multiply(self, i))
+
+    def __rmul__(self, i):
+        """
+        Return (self * i), that is string multiple concatenation,
+        element-wise.
+
+        See Also
+        --------
+        multiply
+        """
+        return asarray(multiply(self, i))
+
+    def __mod__(self, i):
+        """
+        Return (self % i), that is pre-Python 2.6 string formatting
+        (interpolation), element-wise for a pair of array_likes of `bytes_`
+        or `str_`.
+
+        See Also
+        --------
+        mod
+        """
+        return asarray(mod(self, i))
+
+    def __rmod__(self, other):
+        return NotImplemented
+
+    def argsort(self, axis=-1, kind=None, order=None):
+        """
+        Return the indices that sort the array lexicographically.
+
+        For full documentation see `numpy.argsort`, for which this method is
+        in fact merely a "thin wrapper."
+
+        Examples
+        --------
+        >>> c = np.array(['a1b c', '1b ca', 'b ca1', 'Ca1b'], 'S5')
+        >>> c = c.view(np.chararray); c
+        chararray(['a1b c', '1b ca', 'b ca1', 'Ca1b'],
+              dtype='|S5')
+        >>> c[c.argsort()]
+        chararray(['1b ca', 'Ca1b', 'a1b c', 'b ca1'],
+              dtype='|S5')
+
+        """
+        return self.__array__().argsort(axis, kind, order)
+    argsort.__doc__ = ndarray.argsort.__doc__
+
+    def capitalize(self):
+        """
+        Return a copy of `self` with only the first character of each element
+        capitalized.
+
+        See Also
+        --------
+        char.capitalize
+
+        """
+        return asarray(capitalize(self))
+
+    def center(self, width, fillchar=' '):
+        """
+        Return a copy of `self` with its elements centered in a
+        string of length `width`.
+
+        See Also
+        --------
+        center
+        """
+        return asarray(center(self, width, fillchar))
+
+    def count(self, sub, start=0, end=None):
+        """
+        Returns an array with the number of non-overlapping occurrences of
+        substring `sub` in the range [`start`, `end`].
+
+        See Also
+        --------
+        char.count
+
+        """
+        return count(self, sub, start, end)
+
+    def decode(self, encoding=None, errors=None):
+        """
+        Calls ``bytes.decode`` element-wise.
+
+        See Also
+        --------
+        char.decode
+
+        """
+        return decode(self, encoding, errors)
+
+    def encode(self, encoding=None, errors=None):
+        """
+        Calls `str.encode` element-wise.
+
+        See Also
+        --------
+        char.encode
+
+        """
+        return encode(self, encoding, errors)
+
+    def endswith(self, suffix, start=0, end=None):
+        """
+        Returns a boolean array which is `True` where the string element
+        in `self` ends with `suffix`, otherwise `False`.
+
+        See Also
+        --------
+        char.endswith
+
+        """
+        return endswith(self, suffix, start, end)
+
+    def expandtabs(self, tabsize=8):
+        """
+        Return a copy of each string element where all tab characters are
+        replaced by one or more spaces.
+
+        See Also
+        --------
+        char.expandtabs
+
+        """
+        return asarray(expandtabs(self, tabsize))
+
+    def find(self, sub, start=0, end=None):
+        """
+        For each element, return the lowest index in the string where
+        substring `sub` is found.
+
+        See Also
+        --------
+        char.find
+
+        """
+        return find(self, sub, start, end)
+
+    def index(self, sub, start=0, end=None):
+        """
+        Like `find`, but raises `ValueError` when the substring is not found.
+
+        See Also
+        --------
+        char.index
+
+        """
+        return index(self, sub, start, end)
+
+    def isalnum(self):
+        """
+        Returns true for each element if all characters in the string
+        are alphanumeric and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isalnum
+
+        """
+        return isalnum(self)
+
+    def isalpha(self):
+        """
+        Returns true for each element if all characters in the string
+        are alphabetic and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isalpha
+
+        """
+        return isalpha(self)
+
+    def isdigit(self):
+        """
+        Returns true for each element if all characters in the string are
+        digits and there is at least one character, false otherwise.
+
+        See Also
+        --------
+        char.isdigit
+
+        """
+        return isdigit(self)
+
+    def islower(self):
+        """
+        Returns true for each element if all cased characters in the
+        string are lowercase and there is at least one cased character,
+        false otherwise.
+
+        See Also
+        --------
+        char.islower
+
+        """
+        return islower(self)
+
+    def isspace(self):
+        """
+        Returns true for each element if there are only whitespace
+        characters in the string and there is at least one character,
+        false otherwise.
+
+        See Also
+        --------
+        char.isspace
+
+        """
+        return isspace(self)
+
+    def istitle(self):
+        """
+        Returns true for each element if the element is a titlecased
+        string and there is at least one character, false otherwise.
+
+        See Also
+        --------
+        char.istitle
+
+        """
+        return istitle(self)
+
+    def isupper(self):
+        """
+        Returns true for each element if all cased characters in the
+        string are uppercase and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isupper
+
+        """
+        return isupper(self)
+
+    def join(self, seq):
+        """
+        Return a string which is the concatenation of the strings in the
+        sequence `seq`.
+
+        See Also
+        --------
+        char.join
+
+        """
+        return join(self, seq)
+
+    def ljust(self, width, fillchar=' '):
+        """
+        Return an array with the elements of `self` left-justified in a
+        string of length `width`.
+
+        See Also
+        --------
+        char.ljust
+
+        """
+        return asarray(ljust(self, width, fillchar))
+
+    def lower(self):
+        """
+        Return an array with the elements of `self` converted to
+        lowercase.
+
+        See Also
+        --------
+        char.lower
+
+        """
+        return asarray(lower(self))
+
+    def lstrip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the leading characters
+        removed.
+
+        See Also
+        --------
+        char.lstrip
+
+        """
+        return asarray(lstrip(self, chars))
+
+    def partition(self, sep):
+        """
+        Partition each element in `self` around `sep`.
+
+        See Also
+        --------
+        partition
+        """
+        return asarray(partition(self, sep))
+
+    def replace(self, old, new, count=None):
+        """
+        For each element in `self`, return a copy of the string with all
+        occurrences of substring `old` replaced by `new`.
+
+        See Also
+        --------
+        char.replace
+
+        """
+        return asarray(replace(self, old, new, count))
+
+    def rfind(self, sub, start=0, end=None):
+        """
+        For each element in `self`, return the highest index in the string
+        where substring `sub` is found, such that `sub` is contained
+        within [`start`, `end`].
+
+        See Also
+        --------
+        char.rfind
+
+        """
+        return rfind(self, sub, start, end)
+
+    def rindex(self, sub, start=0, end=None):
+        """
+        Like `rfind`, but raises `ValueError` when the substring `sub` is
+        not found.
+
+        See Also
+        --------
+        char.rindex
+
+        """
+        return rindex(self, sub, start, end)
+
+    def rjust(self, width, fillchar=' '):
+        """
+        Return an array with the elements of `self`
+        right-justified in a string of length `width`.
+
+        See Also
+        --------
+        char.rjust
+
+        """
+        return asarray(rjust(self, width, fillchar))
+
+    def rpartition(self, sep):
+        """
+        Partition each element in `self` around `sep`.
+
+        See Also
+        --------
+        rpartition
+        """
+        return asarray(rpartition(self, sep))
+
+    def rsplit(self, sep=None, maxsplit=None):
+        """
+        For each element in `self`, return a list of the words in
+        the string, using `sep` as the delimiter string.
+
+        See Also
+        --------
+        char.rsplit
+
+        """
+        return rsplit(self, sep, maxsplit)
+
+    def rstrip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the trailing
+        characters removed.
+
+        See Also
+        --------
+        char.rstrip
+
+        """
+        return asarray(rstrip(self, chars))
+
+    def split(self, sep=None, maxsplit=None):
+        """
+        For each element in `self`, return a list of the words in the
+        string, using `sep` as the delimiter string.
+
+        See Also
+        --------
+        char.split
+
+        """
+        return split(self, sep, maxsplit)
+
+    def splitlines(self, keepends=None):
+        """
+        For each element in `self`, return a list of the lines in the
+        element, breaking at line boundaries.
+
+        See Also
+        --------
+        char.splitlines
+
+        """
+        return splitlines(self, keepends)
+
+    def startswith(self, prefix, start=0, end=None):
+        """
+        Returns a boolean array which is `True` where the string element
+        in `self` starts with `prefix`, otherwise `False`.
+
+        See Also
+        --------
+        char.startswith
+
+        """
+        return startswith(self, prefix, start, end)
+
+    def strip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the leading and
+        trailing characters removed.
+
+        See Also
+        --------
+        char.strip
+
+        """
+        return asarray(strip(self, chars))
+
+    def swapcase(self):
+        """
+        For each element in `self`, return a copy of the string with
+        uppercase characters converted to lowercase and vice versa.
+
+        See Also
+        --------
+        char.swapcase
+
+        """
+        return asarray(swapcase(self))
+
+    def title(self):
+        """
+        For each element in `self`, return a titlecased version of the
+        string: words start with uppercase characters, all remaining cased
+        characters are lowercase.
+
+        See Also
+        --------
+        char.title
+
+        """
+        return asarray(title(self))
+
+    def translate(self, table, deletechars=None):
+        """
+        For each element in `self`, return a copy of the string where
+        all characters occurring in the optional argument
+        `deletechars` are removed, and the remaining characters have
+        been mapped through the given translation table.
+
+        See Also
+        --------
+        char.translate
+
+        """
+        return asarray(translate(self, table, deletechars))
+
+    def upper(self):
+        """
+        Return an array with the elements of `self` converted to
+        uppercase.
+
+        See Also
+        --------
+        char.upper
+
+        """
+        return asarray(upper(self))
+
+    def zfill(self, width):
+        """
+        Return the numeric string left-filled with zeros in a string of
+        length `width`.
+
+        See Also
+        --------
+        char.zfill
+
+        """
+        return asarray(zfill(self, width))
+
+    def isnumeric(self):
+        """
+        For each element in `self`, return True if there are only
+        numeric characters in the element.
+
+        See Also
+        --------
+        char.isnumeric
+
+        """
+        return isnumeric(self)
+
+    def isdecimal(self):
+        """
+        For each element in `self`, return True if there are only
+        decimal characters in the element.
+
+        See Also
+        --------
+        char.isdecimal
+
+        """
+        return isdecimal(self)
+
+
+@set_module("numpy.char")
+def array(obj, itemsize=None, copy=True, unicode=None, order=None):
+    """
+    Create a `chararray`.
+
+    .. note::
+       This class is provided for numarray backward-compatibility.
+       New code (not concerned with numarray compatibility) should use
+       arrays of type `bytes_` or `str_` and use the free functions
+       in :mod:`numpy.char <numpy.core.defchararray>` for fast
+       vectorized string operations instead.
+
+    Versus a regular NumPy array of type `str` or `unicode`, this
+    class adds the following functionality:
+
+      1) values automatically have whitespace removed from the end
+         when indexed
+
+      2) comparison operators automatically remove whitespace from the
+         end when comparing values
+
+      3) vectorized string operations are provided as methods
+         (e.g. `str.endswith`) and infix operators (e.g. ``+, *, %``)
+
+    Parameters
+    ----------
+    obj : array of str or unicode-like
+
+    itemsize : int, optional
+        `itemsize` is the number of characters per scalar in the
+        resulting array.  If `itemsize` is None, and `obj` is an
+        object array or a Python list, the `itemsize` will be
+        automatically determined.  If `itemsize` is provided and `obj`
+        is of type str or unicode, then the `obj` string will be
+        chunked into `itemsize` pieces.
+
+    copy : bool, optional
+        If true (default), then the object is copied.  Otherwise, a copy
+        will only be made if __array__ returns a copy, if obj is a
+        nested sequence, or if a copy is needed to satisfy any of the other
+        requirements (`itemsize`, unicode, `order`, etc.).
+
+    unicode : bool, optional
+        When true, the resulting `chararray` can contain Unicode
+        characters, when false only 8-bit characters.  If unicode is
+        None and `obj` is one of the following:
+
+          - a `chararray`,
+          - an ndarray of type `str` or `unicode`
+          - a Python str or unicode object,
+
+        then the unicode setting of the output array will be
+        automatically determined.
+
+    order : {'C', 'F', 'A'}, optional
+        Specify the order of the array.  If order is 'C' (default), then the
+        array will be in C-contiguous order (last-index varies the
+        fastest).  If order is 'F', then the returned array
+        will be in Fortran-contiguous order (first-index varies the
+        fastest).  If order is 'A', then the returned array may
+        be in any order (either C-, Fortran-contiguous, or even
+        discontiguous).
+    """
+    if isinstance(obj, (bytes, str)):
+        if unicode is None:
+            if isinstance(obj, str):
+                unicode = True
+            else:
+                unicode = False
+
+        if itemsize is None:
+            itemsize = len(obj)
+        shape = len(obj) // itemsize
+
+        return chararray(shape, itemsize=itemsize, unicode=unicode,
+                         buffer=obj, order=order)
+
+    if isinstance(obj, (list, tuple)):
+        obj = numpy.asarray(obj)
+
+    if isinstance(obj, ndarray) and issubclass(obj.dtype.type, character):
+        # If we just have a vanilla chararray, create a chararray
+        # view around it.
+        if not isinstance(obj, chararray):
+            obj = obj.view(chararray)
+
+        if itemsize is None:
+            itemsize = obj.itemsize
+            # itemsize is in 8-bit chars, so for Unicode, we need
+            # to divide by the size of a single Unicode character,
+            # which for NumPy is always 4
+            if issubclass(obj.dtype.type, str_):
+                itemsize //= 4
+
+        if unicode is None:
+            if issubclass(obj.dtype.type, str_):
+                unicode = True
+            else:
+                unicode = False
+
+        if unicode:
+            dtype = str_
+        else:
+            dtype = bytes_
+
+        if order is not None:
+            obj = numpy.asarray(obj, order=order)
+        if (copy or
+                (itemsize != obj.itemsize) or
+                (not unicode and isinstance(obj, str_)) or
+                (unicode and isinstance(obj, bytes_))):
+            obj = obj.astype((dtype, int(itemsize)))
+        return obj
+
+    if isinstance(obj, ndarray) and issubclass(obj.dtype.type, object):
+        if itemsize is None:
+            # Since no itemsize was specified, convert the input array to
+            # a list so the ndarray constructor will automatically
+            # determine the itemsize for us.
+            obj = obj.tolist()
+            # Fall through to the default case
+
+    if unicode:
+        dtype = str_
+    else:
+        dtype = bytes_
+
+    if itemsize is None:
+        val = narray(obj, dtype=dtype, order=order, subok=True)
+    else:
+        val = narray(obj, dtype=(dtype, itemsize), order=order, subok=True)
+    return val.view(chararray)
+
+
+@set_module("numpy.char")
+def asarray(obj, itemsize=None, unicode=None, order=None):
+    """
+    Convert the input to a `chararray`, copying the data only if
+    necessary.
+
+    Versus a regular NumPy array of type `str` or `unicode`, this
+    class adds the following functionality:
+
+      1) values automatically have whitespace removed from the end
+         when indexed
+
+      2) comparison operators automatically remove whitespace from the
+         end when comparing values
+
+      3) vectorized string operations are provided as methods
+         (e.g. `str.endswith`) and infix operators (e.g. ``+``, ``*``,``%``)
+
+    Parameters
+    ----------
+    obj : array of str or unicode-like
+
+    itemsize : int, optional
+        `itemsize` is the number of characters per scalar in the
+        resulting array.  If `itemsize` is None, and `obj` is an
+        object array or a Python list, the `itemsize` will be
+        automatically determined.  If `itemsize` is provided and `obj`
+        is of type str or unicode, then the `obj` string will be
+        chunked into `itemsize` pieces.
+
+    unicode : bool, optional
+        When true, the resulting `chararray` can contain Unicode
+        characters, when false only 8-bit characters.  If unicode is
+        None and `obj` is one of the following:
+
+          - a `chararray`,
+          - an ndarray of type `str` or 'unicode`
+          - a Python str or unicode object,
+
+        then the unicode setting of the output array will be
+        automatically determined.
+
+    order : {'C', 'F'}, optional
+        Specify the order of the array.  If order is 'C' (default), then the
+        array will be in C-contiguous order (last-index varies the
+        fastest).  If order is 'F', then the returned array
+        will be in Fortran-contiguous order (first-index varies the
+        fastest).
+    """
+    return array(obj, itemsize, copy=False,
+                 unicode=unicode, order=order)

pllava/lib/python3.10/site-packages/numpy/core/einsumfunc.py

@@ -0,0 +1,1443 @@
+"""
+Implementation of optimized einsum.
+
+"""
+import itertools
+import operator
+
+from numpy.core.multiarray import c_einsum
+from numpy.core.numeric import asanyarray, tensordot
+from numpy.core.overrides import array_function_dispatch
+
+__all__ = ['einsum', 'einsum_path']
+
+einsum_symbols = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ'
+einsum_symbols_set = set(einsum_symbols)
+
+
+def _flop_count(idx_contraction, inner, num_terms, size_dictionary):
+    """
+    Computes the number of FLOPS in the contraction.
+
+    Parameters
+    ----------
+    idx_contraction : iterable
+        The indices involved in the contraction
+    inner : bool
+        Does this contraction require an inner product?
+    num_terms : int
+        The number of terms in a contraction
+    size_dictionary : dict
+        The size of each of the indices in idx_contraction
+
+    Returns
+    -------
+    flop_count : int
+        The total number of FLOPS required for the contraction.
+
+    Examples
+    --------
+
+    >>> _flop_count('abc', False, 1, {'a': 2, 'b':3, 'c':5})
+    30
+
+    >>> _flop_count('abc', True, 2, {'a': 2, 'b':3, 'c':5})
+    60
+
+    """
+
+    overall_size = _compute_size_by_dict(idx_contraction, size_dictionary)
+    op_factor = max(1, num_terms - 1)
+    if inner:
+        op_factor += 1
+
+    return overall_size * op_factor
+
+def _compute_size_by_dict(indices, idx_dict):
+    """
+    Computes the product of the elements in indices based on the dictionary
+    idx_dict.
+
+    Parameters
+    ----------
+    indices : iterable
+        Indices to base the product on.
+    idx_dict : dictionary
+        Dictionary of index sizes
+
+    Returns
+    -------
+    ret : int
+        The resulting product.
+
+    Examples
+    --------
+    >>> _compute_size_by_dict('abbc', {'a': 2, 'b':3, 'c':5})
+    90
+
+    """
+    ret = 1
+    for i in indices:
+        ret *= idx_dict[i]
+    return ret
+
+
+def _find_contraction(positions, input_sets, output_set):
+    """
+    Finds the contraction for a given set of input and output sets.
+
+    Parameters
+    ----------
+    positions : iterable
+        Integer positions of terms used in the contraction.
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+
+    Returns
+    -------
+    new_result : set
+        The indices of the resulting contraction
+    remaining : list
+        List of sets that have not been contracted, the new set is appended to
+        the end of this list
+    idx_removed : set
+        Indices removed from the entire contraction
+    idx_contraction : set
+        The indices used in the current contraction
+
+    Examples
+    --------
+
+    # A simple dot product test case
+    >>> pos = (0, 1)
+    >>> isets = [set('ab'), set('bc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}], {'b'}, {'a', 'b', 'c'})
+
+    # A more complex case with additional terms in the contraction
+    >>> pos = (0, 2)
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}, {'a', 'c'}], {'b', 'd'}, {'a', 'b', 'c', 'd'})
+    """
+
+    idx_contract = set()
+    idx_remain = output_set.copy()
+    remaining = []
+    for ind, value in enumerate(input_sets):
+        if ind in positions:
+            idx_contract |= value
+        else:
+            remaining.append(value)
+            idx_remain |= value
+
+    new_result = idx_remain & idx_contract
+    idx_removed = (idx_contract - new_result)
+    remaining.append(new_result)
+
+    return (new_result, remaining, idx_removed, idx_contract)
+
+
+def _optimal_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Computes all possible pair contractions, sieves the results based
+    on ``memory_limit`` and returns the lowest cost path. This algorithm
+    scales factorial with respect to the elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The optimal contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _optimal_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    full_results = [(0, [], input_sets)]
+    for iteration in range(len(input_sets) - 1):
+        iter_results = []
+
+        # Compute all unique pairs
+        for curr in full_results:
+            cost, positions, remaining = curr
+            for con in itertools.combinations(range(len(input_sets) - iteration), 2):
+
+                # Find the contraction
+                cont = _find_contraction(con, remaining, output_set)
+                new_result, new_input_sets, idx_removed, idx_contract = cont
+
+                # Sieve the results based on memory_limit
+                new_size = _compute_size_by_dict(new_result, idx_dict)
+                if new_size > memory_limit:
+                    continue
+
+                # Build (total_cost, positions, indices_remaining)
+                total_cost =  cost + _flop_count(idx_contract, idx_removed, len(con), idx_dict)
+                new_pos = positions + [con]
+                iter_results.append((total_cost, new_pos, new_input_sets))
+
+        # Update combinatorial list, if we did not find anything return best
+        # path + remaining contractions
+        if iter_results:
+            full_results = iter_results
+        else:
+            path = min(full_results, key=lambda x: x[0])[1]
+            path += [tuple(range(len(input_sets) - iteration))]
+            return path
+
+    # If we have not found anything return single einsum contraction
+    if len(full_results) == 0:
+        return [tuple(range(len(input_sets)))]
+
+    path = min(full_results, key=lambda x: x[0])[1]
+    return path
+
+def _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit, path_cost, naive_cost):
+    """Compute the cost (removed size + flops) and resultant indices for
+    performing the contraction specified by ``positions``.
+
+    Parameters
+    ----------
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    input_sets : list of sets
+        The indices found on each tensors.
+    output_set : set
+        The output indices of the expression.
+    idx_dict : dict
+        Mapping of each index to its size.
+    memory_limit : int
+        The total allowed size for an intermediary tensor.
+    path_cost : int
+        The contraction cost so far.
+    naive_cost : int
+        The cost of the unoptimized expression.
+
+    Returns
+    -------
+    cost : (int, int)
+        A tuple containing the size of any indices removed, and the flop cost.
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    new_input_sets : list of sets
+        The resulting new list of indices if this proposed contraction is performed.
+
+    """
+
+    # Find the contraction
+    contract = _find_contraction(positions, input_sets, output_set)
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+
+    # Sieve the results based on memory_limit
+    new_size = _compute_size_by_dict(idx_result, idx_dict)
+    if new_size > memory_limit:
+        return None
+
+    # Build sort tuple
+    old_sizes = (_compute_size_by_dict(input_sets[p], idx_dict) for p in positions)
+    removed_size = sum(old_sizes) - new_size
+
+    # NB: removed_size used to be just the size of any removed indices i.e.:
+    #     helpers.compute_size_by_dict(idx_removed, idx_dict)
+    cost = _flop_count(idx_contract, idx_removed, len(positions), idx_dict)
+    sort = (-removed_size, cost)
+
+    # Sieve based on total cost as well
+    if (path_cost + cost) > naive_cost:
+        return None
+
+    # Add contraction to possible choices
+    return [sort, positions, new_input_sets]
+
+
+def _update_other_results(results, best):
+    """Update the positions and provisional input_sets of ``results`` based on
+    performing the contraction result ``best``. Remove any involving the tensors
+    contracted.
+
+    Parameters
+    ----------
+    results : list
+        List of contraction results produced by ``_parse_possible_contraction``.
+    best : list
+        The best contraction of ``results`` i.e. the one that will be performed.
+
+    Returns
+    -------
+    mod_results : list
+        The list of modified results, updated with outcome of ``best`` contraction.
+    """
+
+    best_con = best[1]
+    bx, by = best_con
+    mod_results = []
+
+    for cost, (x, y), con_sets in results:
+
+        # Ignore results involving tensors just contracted
+        if x in best_con or y in best_con:
+            continue
+
+        # Update the input_sets
+        del con_sets[by - int(by > x) - int(by > y)]
+        del con_sets[bx - int(bx > x) - int(bx > y)]
+        con_sets.insert(-1, best[2][-1])
+
+        # Update the position indices
+        mod_con = x - int(x > bx) - int(x > by), y - int(y > bx) - int(y > by)
+        mod_results.append((cost, mod_con, con_sets))
+
+    return mod_results
+
+def _greedy_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Finds the path by contracting the best pair until the input list is
+    exhausted. The best pair is found by minimizing the tuple
+    ``(-prod(indices_removed), cost)``.  What this amounts to is prioritizing
+    matrix multiplication or inner product operations, then Hadamard like
+    operations, and finally outer operations. Outer products are limited by
+    ``memory_limit``. This algorithm scales cubically with respect to the
+    number of elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The greedy contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _greedy_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    # Handle trivial cases that leaked through
+    if len(input_sets) == 1:
+        return [(0,)]
+    elif len(input_sets) == 2:
+        return [(0, 1)]
+
+    # Build up a naive cost
+    contract = _find_contraction(range(len(input_sets)), input_sets, output_set)
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+    naive_cost = _flop_count(idx_contract, idx_removed, len(input_sets), idx_dict)
+
+    # Initially iterate over all pairs
+    comb_iter = itertools.combinations(range(len(input_sets)), 2)
+    known_contractions = []
+
+    path_cost = 0
+    path = []
+
+    for iteration in range(len(input_sets) - 1):
+
+        # Iterate over all pairs on first step, only previously found pairs on subsequent steps
+        for positions in comb_iter:
+
+            # Always initially ignore outer products
+            if input_sets[positions[0]].isdisjoint(input_sets[positions[1]]):
+                continue
+
+            result = _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit, path_cost,
+                                                 naive_cost)
+            if result is not None:
+                known_contractions.append(result)
+
+        # If we do not have a inner contraction, rescan pairs including outer products
+        if len(known_contractions) == 0:
+
+            # Then check the outer products
+            for positions in itertools.combinations(range(len(input_sets)), 2):
+                result = _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit,
+                                                     path_cost, naive_cost)
+                if result is not None:
+                    known_contractions.append(result)
+
+            # If we still did not find any remaining contractions, default back to einsum like behavior
+            if len(known_contractions) == 0:
+                path.append(tuple(range(len(input_sets))))
+                break
+
+        # Sort based on first index
+        best = min(known_contractions, key=lambda x: x[0])
+
+        # Now propagate as many unused contractions as possible to next iteration
+        known_contractions = _update_other_results(known_contractions, best)
+
+        # Next iteration only compute contractions with the new tensor
+        # All other contractions have been accounted for
+        input_sets = best[2]
+        new_tensor_pos = len(input_sets) - 1
+        comb_iter = ((i, new_tensor_pos) for i in range(new_tensor_pos))
+
+        # Update path and total cost
+        path.append(best[1])
+        path_cost += best[0][1]
+
+    return path
+
+
+def _can_dot(inputs, result, idx_removed):
+    """
+    Checks if we can use BLAS (np.tensordot) call and its beneficial to do so.
+
+    Parameters
+    ----------
+    inputs : list of str
+        Specifies the subscripts for summation.
+    result : str
+        Resulting summation.
+    idx_removed : set
+        Indices that are removed in the summation
+
+
+    Returns
+    -------
+    type : bool
+        Returns true if BLAS should and can be used, else False
+
+    Notes
+    -----
+    If the operations is BLAS level 1 or 2 and is not already aligned
+    we default back to einsum as the memory movement to copy is more
+    costly than the operation itself.
+
+
+    Examples
+    --------
+
+    # Standard GEMM operation
+    >>> _can_dot(['ij', 'jk'], 'ik', set('j'))
+    True
+
+    # Can use the standard BLAS, but requires odd data movement
+    >>> _can_dot(['ijj', 'jk'], 'ik', set('j'))
+    False
+
+    # DDOT where the memory is not aligned
+    >>> _can_dot(['ijk', 'ikj'], '', set('ijk'))
+    False
+
+    """
+
+    # All `dot` calls remove indices
+    if len(idx_removed) == 0:
+        return False
+
+    # BLAS can only handle two operands
+    if len(inputs) != 2:
+        return False
+
+    input_left, input_right = inputs
+
+    for c in set(input_left + input_right):
+        # can't deal with repeated indices on same input or more than 2 total
+        nl, nr = input_left.count(c), input_right.count(c)
+        if (nl > 1) or (nr > 1) or (nl + nr > 2):
+            return False
+
+        # can't do implicit summation or dimension collapse e.g.
+        #     "ab,bc->c" (implicitly sum over 'a')
+        #     "ab,ca->ca" (take diagonal of 'a')
+        if nl + nr - 1 == int(c in result):
+            return False
+
+    # Build a few temporaries
+    set_left = set(input_left)
+    set_right = set(input_right)
+    keep_left = set_left - idx_removed
+    keep_right = set_right - idx_removed
+    rs = len(idx_removed)
+
+    # At this point we are a DOT, GEMV, or GEMM operation
+
+    # Handle inner products
+
+    # DDOT with aligned data
+    if input_left == input_right:
+        return True
+
+    # DDOT without aligned data (better to use einsum)
+    if set_left == set_right:
+        return False
+
+    # Handle the 4 possible (aligned) GEMV or GEMM cases
+
+    # GEMM or GEMV no transpose
+    if input_left[-rs:] == input_right[:rs]:
+        return True
+
+    # GEMM or GEMV transpose both
+    if input_left[:rs] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose right
+    if input_left[-rs:] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose left
+    if input_left[:rs] == input_right[:rs]:
+        return True
+
+    # Einsum is faster than GEMV if we have to copy data
+    if not keep_left or not keep_right:
+        return False
+
+    # We are a matrix-matrix product, but we need to copy data
+    return True
+
+
+def _parse_einsum_input(operands):
+    """
+    A reproduction of einsum c side einsum parsing in python.
+
+    Returns
+    -------
+    input_strings : str
+        Parsed input strings
+    output_string : str
+        Parsed output string
+    operands : list of array_like
+        The operands to use in the numpy contraction
+
+    Examples
+    --------
+    The operand list is simplified to reduce printing:
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(4, 4)
+    >>> b = np.random.rand(4, 4, 4)
+    >>> _parse_einsum_input(('...a,...a->...', a, b))
+    ('za,xza', 'xz', [a, b]) # may vary
+
+    >>> _parse_einsum_input((a, [Ellipsis, 0], b, [Ellipsis, 0]))
+    ('za,xza', 'xz', [a, b]) # may vary
+    """
+
+    if len(operands) == 0:
+        raise ValueError("No input operands")
+
+    if isinstance(operands[0], str):
+        subscripts = operands[0].replace(" ", "")
+        operands = [asanyarray(v) for v in operands[1:]]
+
+        # Ensure all characters are valid
+        for s in subscripts:
+            if s in '.,->':
+                continue
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+
+    else:
+        tmp_operands = list(operands)
+        operand_list = []
+        subscript_list = []
+        for p in range(len(operands) // 2):
+            operand_list.append(tmp_operands.pop(0))
+            subscript_list.append(tmp_operands.pop(0))
+
+        output_list = tmp_operands[-1] if len(tmp_operands) else None
+        operands = [asanyarray(v) for v in operand_list]
+        subscripts = ""
+        last = len(subscript_list) - 1
+        for num, sub in enumerate(subscript_list):
+            for s in sub:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError("For this input type lists must contain "
+                                        "either int or Ellipsis") from e
+                    subscripts += einsum_symbols[s]
+            if num != last:
+                subscripts += ","
+
+        if output_list is not None:
+            subscripts += "->"
+            for s in output_list:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError("For this input type lists must contain "
+                                        "either int or Ellipsis") from e
+                    subscripts += einsum_symbols[s]
+    # Check for proper "->"
+    if ("-" in subscripts) or (">" in subscripts):
+        invalid = (subscripts.count("-") > 1) or (subscripts.count(">") > 1)
+        if invalid or (subscripts.count("->") != 1):
+            raise ValueError("Subscripts can only contain one '->'.")
+
+    # Parse ellipses
+    if "." in subscripts:
+        used = subscripts.replace(".", "").replace(",", "").replace("->", "")
+        unused = list(einsum_symbols_set - set(used))
+        ellipse_inds = "".join(unused)
+        longest = 0
+
+        if "->" in subscripts:
+            input_tmp, output_sub = subscripts.split("->")
+            split_subscripts = input_tmp.split(",")
+            out_sub = True
+        else:
+            split_subscripts = subscripts.split(',')
+            out_sub = False
+
+        for num, sub in enumerate(split_subscripts):
+            if "." in sub:
+                if (sub.count(".") != 3) or (sub.count("...") != 1):
+                    raise ValueError("Invalid Ellipses.")
+
+                # Take into account numerical values
+                if operands[num].shape == ():
+                    ellipse_count = 0
+                else:
+                    ellipse_count = max(operands[num].ndim, 1)
+                    ellipse_count -= (len(sub) - 3)
+
+                if ellipse_count > longest:
+                    longest = ellipse_count
+
+                if ellipse_count < 0:
+                    raise ValueError("Ellipses lengths do not match.")
+                elif ellipse_count == 0:
+                    split_subscripts[num] = sub.replace('...', '')
+                else:
+                    rep_inds = ellipse_inds[-ellipse_count:]
+                    split_subscripts[num] = sub.replace('...', rep_inds)
+
+        subscripts = ",".join(split_subscripts)
+        if longest == 0:
+            out_ellipse = ""
+        else:
+            out_ellipse = ellipse_inds[-longest:]
+
+        if out_sub:
+            subscripts += "->" + output_sub.replace("...", out_ellipse)
+        else:
+            # Special care for outputless ellipses
+            output_subscript = ""
+            tmp_subscripts = subscripts.replace(",", "")
+            for s in sorted(set(tmp_subscripts)):
+                if s not in (einsum_symbols):
+                    raise ValueError("Character %s is not a valid symbol." % s)
+                if tmp_subscripts.count(s) == 1:
+                    output_subscript += s
+            normal_inds = ''.join(sorted(set(output_subscript) -
+                                         set(out_ellipse)))
+
+            subscripts += "->" + out_ellipse + normal_inds
+
+    # Build output string if does not exist
+    if "->" in subscripts:
+        input_subscripts, output_subscript = subscripts.split("->")
+    else:
+        input_subscripts = subscripts
+        # Build output subscripts
+        tmp_subscripts = subscripts.replace(",", "")
+        output_subscript = ""
+        for s in sorted(set(tmp_subscripts)):
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+            if tmp_subscripts.count(s) == 1:
+                output_subscript += s
+
+    # Make sure output subscripts are in the input
+    for char in output_subscript:
+        if char not in input_subscripts:
+            raise ValueError("Output character %s did not appear in the input"
+                             % char)
+
+    # Make sure number operands is equivalent to the number of terms
+    if len(input_subscripts.split(',')) != len(operands):
+        raise ValueError("Number of einsum subscripts must be equal to the "
+                         "number of operands.")
+
+    return (input_subscripts, output_subscript, operands)
+
+
+def _einsum_path_dispatcher(*operands, optimize=None, einsum_call=None):
+    # NOTE: technically, we should only dispatch on array-like arguments, not
+    # subscripts (given as strings). But separating operands into
+    # arrays/subscripts is a little tricky/slow (given einsum's two supported
+    # signatures), so as a practical shortcut we dispatch on everything.
+    # Strings will be ignored for dispatching since they don't define
+    # __array_function__.
+    return operands
+
+
+@array_function_dispatch(_einsum_path_dispatcher, module='numpy')
+def einsum_path(*operands, optimize='greedy', einsum_call=False):
+    """
+    einsum_path(subscripts, *operands, optimize='greedy')
+
+    Evaluates the lowest cost contraction order for an einsum expression by
+    considering the creation of intermediate arrays.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation.
+    *operands : list of array_like
+        These are the arrays for the operation.
+    optimize : {bool, list, tuple, 'greedy', 'optimal'}
+        Choose the type of path. If a tuple is provided, the second argument is
+        assumed to be the maximum intermediate size created. If only a single
+        argument is provided the largest input or output array size is used
+        as a maximum intermediate size.
+
+        * if a list is given that starts with ``einsum_path``, uses this as the
+          contraction path
+        * if False no optimization is taken
+        * if True defaults to the 'greedy' algorithm
+        * 'optimal' An algorithm that combinatorially explores all possible
+          ways of contracting the listed tensors and chooses the least costly
+          path. Scales exponentially with the number of terms in the
+          contraction.
+        * 'greedy' An algorithm that chooses the best pair contraction
+          at each step. Effectively, this algorithm searches the largest inner,
+          Hadamard, and then outer products at each step. Scales cubically with
+          the number of terms in the contraction. Equivalent to the 'optimal'
+          path for most contractions.
+
+        Default is 'greedy'.
+
+    Returns
+    -------
+    path : list of tuples
+        A list representation of the einsum path.
+    string_repr : str
+        A printable representation of the einsum path.
+
+    Notes
+    -----
+    The resulting path indicates which terms of the input contraction should be
+    contracted first, the result of this contraction is then appended to the
+    end of the contraction list. This list can then be iterated over until all
+    intermediate contractions are complete.
+
+    See Also
+    --------
+    einsum, linalg.multi_dot
+
+    Examples
+    --------
+
+    We can begin with a chain dot example. In this case, it is optimal to
+    contract the ``b`` and ``c`` tensors first as represented by the first
+    element of the path ``(1, 2)``. The resulting tensor is added to the end
+    of the contraction and the remaining contraction ``(0, 1)`` is then
+    completed.
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(2, 2)
+    >>> b = np.random.rand(2, 5)
+    >>> c = np.random.rand(5, 2)
+    >>> path_info = np.einsum_path('ij,jk,kl->il', a, b, c, optimize='greedy')
+    >>> print(path_info[0])
+    ['einsum_path', (1, 2), (0, 1)]
+    >>> print(path_info[1])
+      Complete contraction:  ij,jk,kl->il # may vary
+             Naive scaling:  4
+         Optimized scaling:  3
+          Naive FLOP count:  1.600e+02
+      Optimized FLOP count:  5.600e+01
+       Theoretical speedup:  2.857
+      Largest intermediate:  4.000e+00 elements
+    -------------------------------------------------------------------------
+    scaling                  current                                remaining
+    -------------------------------------------------------------------------
+       3                   kl,jk->jl                                ij,jl->il
+       3                   jl,ij->il                                   il->il
+
+
+    A more complex index transformation example.
+
+    >>> I = np.random.rand(10, 10, 10, 10)
+    >>> C = np.random.rand(10, 10)
+    >>> path_info = np.einsum_path('ea,fb,abcd,gc,hd->efgh', C, C, I, C, C,
+    ...                            optimize='greedy')
+
+    >>> print(path_info[0])
+    ['einsum_path', (0, 2), (0, 3), (0, 2), (0, 1)]
+    >>> print(path_info[1]) 
+      Complete contraction:  ea,fb,abcd,gc,hd->efgh # may vary
+             Naive scaling:  8
+         Optimized scaling:  5
+          Naive FLOP count:  8.000e+08
+      Optimized FLOP count:  8.000e+05
+       Theoretical speedup:  1000.000
+      Largest intermediate:  1.000e+04 elements
+    --------------------------------------------------------------------------
+    scaling                  current                                remaining
+    --------------------------------------------------------------------------
+       5               abcd,ea->bcde                      fb,gc,hd,bcde->efgh
+       5               bcde,fb->cdef                         gc,hd,cdef->efgh
+       5               cdef,gc->defg                            hd,defg->efgh
+       5               defg,hd->efgh                               efgh->efgh
+    """
+
+    # Figure out what the path really is
+    path_type = optimize
+    if path_type is True:
+        path_type = 'greedy'
+    if path_type is None:
+        path_type = False
+
+    explicit_einsum_path = False
+    memory_limit = None
+
+    # No optimization or a named path algorithm
+    if (path_type is False) or isinstance(path_type, str):
+        pass
+
+    # Given an explicit path
+    elif len(path_type) and (path_type[0] == 'einsum_path'):
+        explicit_einsum_path = True
+
+    # Path tuple with memory limit
+    elif ((len(path_type) == 2) and isinstance(path_type[0], str) and
+            isinstance(path_type[1], (int, float))):
+        memory_limit = int(path_type[1])
+        path_type = path_type[0]
+
+    else:
+        raise TypeError("Did not understand the path: %s" % str(path_type))
+
+    # Hidden option, only einsum should call this
+    einsum_call_arg = einsum_call
+
+    # Python side parsing
+    input_subscripts, output_subscript, operands = _parse_einsum_input(operands)
+
+    # Build a few useful list and sets
+    input_list = input_subscripts.split(',')
+    input_sets = [set(x) for x in input_list]
+    output_set = set(output_subscript)
+    indices = set(input_subscripts.replace(',', ''))
+
+    # Get length of each unique dimension and ensure all dimensions are correct
+    dimension_dict = {}
+    broadcast_indices = [[] for x in range(len(input_list))]
+    for tnum, term in enumerate(input_list):
+        sh = operands[tnum].shape
+        if len(sh) != len(term):
+            raise ValueError("Einstein sum subscript %s does not contain the "
+                             "correct number of indices for operand %d."
+                             % (input_subscripts[tnum], tnum))
+        for cnum, char in enumerate(term):
+            dim = sh[cnum]
+
+            # Build out broadcast indices
+            if dim == 1:
+                broadcast_indices[tnum].append(char)
+
+            if char in dimension_dict.keys():
+                # For broadcasting cases we always want the largest dim size
+                if dimension_dict[char] == 1:
+                    dimension_dict[char] = dim
+                elif dim not in (1, dimension_dict[char]):
+                    raise ValueError("Size of label '%s' for operand %d (%d) "
+                                     "does not match previous terms (%d)."
+                                     % (char, tnum, dimension_dict[char], dim))
+            else:
+                dimension_dict[char] = dim
+
+    # Convert broadcast inds to sets
+    broadcast_indices = [set(x) for x in broadcast_indices]
+
+    # Compute size of each input array plus the output array
+    size_list = [_compute_size_by_dict(term, dimension_dict)
+                 for term in input_list + [output_subscript]]
+    max_size = max(size_list)
+
+    if memory_limit is None:
+        memory_arg = max_size
+    else:
+        memory_arg = memory_limit
+
+    # Compute naive cost
+    # This isn't quite right, need to look into exactly how einsum does this
+    inner_product = (sum(len(x) for x in input_sets) - len(indices)) > 0
+    naive_cost = _flop_count(indices, inner_product, len(input_list), dimension_dict)
+
+    # Compute the path
+    if explicit_einsum_path:
+        path = path_type[1:]
+    elif (
+        (path_type is False)
+        or (len(input_list) in [1, 2])
+        or (indices == output_set)
+    ):
+        # Nothing to be optimized, leave it to einsum
+        path = [tuple(range(len(input_list)))]
+    elif path_type == "greedy":
+        path = _greedy_path(input_sets, output_set, dimension_dict, memory_arg)
+    elif path_type == "optimal":
+        path = _optimal_path(input_sets, output_set, dimension_dict, memory_arg)
+    else:
+        raise KeyError("Path name %s not found", path_type)
+
+    cost_list, scale_list, size_list, contraction_list = [], [], [], []
+
+    # Build contraction tuple (positions, gemm, einsum_str, remaining)
+    for cnum, contract_inds in enumerate(path):
+        # Make sure we remove inds from right to left
+        contract_inds = tuple(sorted(list(contract_inds), reverse=True))
+
+        contract = _find_contraction(contract_inds, input_sets, output_set)
+        out_inds, input_sets, idx_removed, idx_contract = contract
+
+        cost = _flop_count(idx_contract, idx_removed, len(contract_inds), dimension_dict)
+        cost_list.append(cost)
+        scale_list.append(len(idx_contract))
+        size_list.append(_compute_size_by_dict(out_inds, dimension_dict))
+
+        bcast = set()
+        tmp_inputs = []
+        for x in contract_inds:
+            tmp_inputs.append(input_list.pop(x))
+            bcast |= broadcast_indices.pop(x)
+
+        new_bcast_inds = bcast - idx_removed
+
+        # If we're broadcasting, nix blas
+        if not len(idx_removed & bcast):
+            do_blas = _can_dot(tmp_inputs, out_inds, idx_removed)
+        else:
+            do_blas = False
+
+        # Last contraction
+        if (cnum - len(path)) == -1:
+            idx_result = output_subscript
+        else:
+            sort_result = [(dimension_dict[ind], ind) for ind in out_inds]
+            idx_result = "".join([x[1] for x in sorted(sort_result)])
+
+        input_list.append(idx_result)
+        broadcast_indices.append(new_bcast_inds)
+        einsum_str = ",".join(tmp_inputs) + "->" + idx_result
+
+        contraction = (contract_inds, idx_removed, einsum_str, input_list[:], do_blas)
+        contraction_list.append(contraction)
+
+    opt_cost = sum(cost_list) + 1
+
+    if len(input_list) != 1:
+        # Explicit "einsum_path" is usually trusted, but we detect this kind of
+        # mistake in order to prevent from returning an intermediate value.
+        raise RuntimeError(
+            "Invalid einsum_path is specified: {} more operands has to be "
+            "contracted.".format(len(input_list) - 1))
+
+    if einsum_call_arg:
+        return (operands, contraction_list)
+
+    # Return the path along with a nice string representation
+    overall_contraction = input_subscripts + "->" + output_subscript
+    header = ("scaling", "current", "remaining")
+
+    speedup = naive_cost / opt_cost
+    max_i = max(size_list)
+
+    path_print  = "  Complete contraction:  %s\n" % overall_contraction
+    path_print += "         Naive scaling:  %d\n" % len(indices)
+    path_print += "     Optimized scaling:  %d\n" % max(scale_list)
+    path_print += "      Naive FLOP count:  %.3e\n" % naive_cost
+    path_print += "  Optimized FLOP count:  %.3e\n" % opt_cost
+    path_print += "   Theoretical speedup:  %3.3f\n" % speedup
+    path_print += "  Largest intermediate:  %.3e elements\n" % max_i
+    path_print += "-" * 74 + "\n"
+    path_print += "%6s %24s %40s\n" % header
+    path_print += "-" * 74
+
+    for n, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        remaining_str = ",".join(remaining) + "->" + output_subscript
+        path_run = (scale_list[n], einsum_str, remaining_str)
+        path_print += "\n%4d    %24s %40s" % path_run
+
+    path = ['einsum_path'] + path
+    return (path, path_print)
+
+
+def _einsum_dispatcher(*operands, out=None, optimize=None, **kwargs):
+    # Arguably we dispatch on more arguments than we really should; see note in
+    # _einsum_path_dispatcher for why.
+    yield from operands
+    yield out
+
+
+# Rewrite einsum to handle different cases
+@array_function_dispatch(_einsum_dispatcher, module='numpy')
+def einsum(*operands, out=None, optimize=False, **kwargs):
+    """
+    einsum(subscripts, *operands, out=None, dtype=None, order='K',
+           casting='safe', optimize=False)
+
+    Evaluates the Einstein summation convention on the operands.
+
+    Using the Einstein summation convention, many common multi-dimensional,
+    linear algebraic array operations can be represented in a simple fashion.
+    In *implicit* mode `einsum` computes these values.
+
+    In *explicit* mode, `einsum` provides further flexibility to compute
+    other array operations that might not be considered classical Einstein
+    summation operations, by disabling, or forcing summation over specified
+    subscript labels.
+
+    See the notes and examples for clarification.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation as comma separated list of
+        subscript labels. An implicit (classical Einstein summation)
+        calculation is performed unless the explicit indicator '->' is
+        included as well as subscript labels of the precise output form.
+    operands : list of array_like
+        These are the arrays for the operation.
+    out : ndarray, optional
+        If provided, the calculation is done into this array.
+    dtype : {data-type, None}, optional
+        If provided, forces the calculation to use the data type specified.
+        Note that you may have to also give a more liberal `casting`
+        parameter to allow the conversions. Default is None.
+    order : {'C', 'F', 'A', 'K'}, optional
+        Controls the memory layout of the output. 'C' means it should
+        be C contiguous. 'F' means it should be Fortran contiguous,
+        'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise.
+        'K' means it should be as close to the layout as the inputs as
+        is possible, including arbitrarily permuted axes.
+        Default is 'K'.
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur.  Setting this to
+        'unsafe' is not recommended, as it can adversely affect accumulations.
+
+          * 'no' means the data types should not be cast at all.
+          * 'equiv' means only byte-order changes are allowed.
+          * 'safe' means only casts which can preserve values are allowed.
+          * 'same_kind' means only safe casts or casts within a kind,
+            like float64 to float32, are allowed.
+          * 'unsafe' means any data conversions may be done.
+
+        Default is 'safe'.
+    optimize : {False, True, 'greedy', 'optimal'}, optional
+        Controls if intermediate optimization should occur. No optimization
+        will occur if False and True will default to the 'greedy' algorithm.
+        Also accepts an explicit contraction list from the ``np.einsum_path``
+        function. See ``np.einsum_path`` for more details. Defaults to False.
+
+    Returns
+    -------
+    output : ndarray
+        The calculation based on the Einstein summation convention.
+
+    See Also
+    --------
+    einsum_path, dot, inner, outer, tensordot, linalg.multi_dot
+    einops :
+        similar verbose interface is provided by
+        `einops <https://github.com/arogozhnikov/einops>`_ package to cover
+        additional operations: transpose, reshape/flatten, repeat/tile,
+        squeeze/unsqueeze and reductions.
+    opt_einsum :
+        `opt_einsum <https://optimized-einsum.readthedocs.io/en/stable/>`_
+        optimizes contraction order for einsum-like expressions
+        in backend-agnostic manner.
+
+    Notes
+    -----
+    .. versionadded:: 1.6.0
+
+    The Einstein summation convention can be used to compute
+    many multi-dimensional, linear algebraic array operations. `einsum`
+    provides a succinct way of representing these.
+
+    A non-exhaustive list of these operations,
+    which can be computed by `einsum`, is shown below along with examples:
+
+    * Trace of an array, :py:func:`numpy.trace`.
+    * Return a diagonal, :py:func:`numpy.diag`.
+    * Array axis summations, :py:func:`numpy.sum`.
+    * Transpositions and permutations, :py:func:`numpy.transpose`.
+    * Matrix multiplication and dot product, :py:func:`numpy.matmul` :py:func:`numpy.dot`.
+    * Vector inner and outer products, :py:func:`numpy.inner` :py:func:`numpy.outer`.
+    * Broadcasting, element-wise and scalar multiplication, :py:func:`numpy.multiply`.
+    * Tensor contractions, :py:func:`numpy.tensordot`.
+    * Chained array operations, in efficient calculation order, :py:func:`numpy.einsum_path`.
+
+    The subscripts string is a comma-separated list of subscript labels,
+    where each label refers to a dimension of the corresponding operand.
+    Whenever a label is repeated it is summed, so ``np.einsum('i,i', a, b)``
+    is equivalent to :py:func:`np.inner(a,b) <numpy.inner>`. If a label
+    appears only once, it is not summed, so ``np.einsum('i', a)`` produces a
+    view of ``a`` with no changes. A further example ``np.einsum('ij,jk', a, b)``
+    describes traditional matrix multiplication and is equivalent to
+    :py:func:`np.matmul(a,b) <numpy.matmul>`. Repeated subscript labels in one
+    operand take the diagonal. For example, ``np.einsum('ii', a)`` is equivalent
+    to :py:func:`np.trace(a) <numpy.trace>`.
+
+    In *implicit mode*, the chosen subscripts are important
+    since the axes of the output are reordered alphabetically.  This
+    means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while
+    ``np.einsum('ji', a)`` takes its transpose. Additionally,
+    ``np.einsum('ij,jk', a, b)`` returns a matrix multiplication, while,
+    ``np.einsum('ij,jh', a, b)`` returns the transpose of the
+    multiplication since subscript 'h' precedes subscript 'i'.
+
+    In *explicit mode* the output can be directly controlled by
+    specifying output subscript labels.  This requires the
+    identifier '->' as well as the list of output subscript labels.
+    This feature increases the flexibility of the function since
+    summing can be disabled or forced when required. The call
+    ``np.einsum('i->', a)`` is like :py:func:`np.sum(a, axis=-1) <numpy.sum>`,
+    and ``np.einsum('ii->i', a)`` is like :py:func:`np.diag(a) <numpy.diag>`.
+    The difference is that `einsum` does not allow broadcasting by default.
+    Additionally ``np.einsum('ij,jh->ih', a, b)`` directly specifies the
+    order of the output subscript labels and therefore returns matrix
+    multiplication, unlike the example above in implicit mode.
+
+    To enable and control broadcasting, use an ellipsis.  Default
+    NumPy-style broadcasting is done by adding an ellipsis
+    to the left of each term, like ``np.einsum('...ii->...i', a)``.
+    To take the trace along the first and last axes,
+    you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix
+    product with the left-most indices instead of rightmost, one can do
+    ``np.einsum('ij...,jk...->ik...', a, b)``.
+
+    When there is only one operand, no axes are summed, and no output
+    parameter is provided, a view into the operand is returned instead
+    of a new array.  Thus, taking the diagonal as ``np.einsum('ii->i', a)``
+    produces a view (changed in version 1.10.0).
+
+    `einsum` also provides an alternative way to provide the subscripts
+    and operands as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``.
+    If the output shape is not provided in this format `einsum` will be
+    calculated in implicit mode, otherwise it will be performed explicitly.
+    The examples below have corresponding `einsum` calls with the two
+    parameter methods.
+
+    .. versionadded:: 1.10.0
+
+    Views returned from einsum are now writeable whenever the input array
+    is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now
+    have the same effect as :py:func:`np.swapaxes(a, 0, 2) <numpy.swapaxes>`
+    and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal
+    of a 2D array.
+
+    .. versionadded:: 1.12.0
+
+    Added the ``optimize`` argument which will optimize the contraction order
+    of an einsum expression. For a contraction with three or more operands this
+    can greatly increase the computational efficiency at the cost of a larger
+    memory footprint during computation.
+
+    Typically a 'greedy' algorithm is applied which empirical tests have shown
+    returns the optimal path in the majority of cases. In some cases 'optimal'
+    will return the superlative path through a more expensive, exhaustive search.
+    For iterative calculations it may be advisable to calculate the optimal path
+    once and reuse that path by supplying it as an argument. An example is given
+    below.
+
+    See :py:func:`numpy.einsum_path` for more details.
+
+    Examples
+    --------
+    >>> a = np.arange(25).reshape(5,5)
+    >>> b = np.arange(5)
+    >>> c = np.arange(6).reshape(2,3)
+
+    Trace of a matrix:
+
+    >>> np.einsum('ii', a)
+    60
+    >>> np.einsum(a, [0,0])
+    60
+    >>> np.trace(a)
+    60
+
+    Extract the diagonal (requires explicit form):
+
+    >>> np.einsum('ii->i', a)
+    array([ 0,  6, 12, 18, 24])
+    >>> np.einsum(a, [0,0], [0])
+    array([ 0,  6, 12, 18, 24])
+    >>> np.diag(a)
+    array([ 0,  6, 12, 18, 24])
+
+    Sum over an axis (requires explicit form):
+
+    >>> np.einsum('ij->i', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [0,1], [0])
+    array([ 10,  35,  60,  85, 110])
+    >>> np.sum(a, axis=1)
+    array([ 10,  35,  60,  85, 110])
+
+    For higher dimensional arrays summing a single axis can be done with ellipsis:
+
+    >>> np.einsum('...j->...', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [Ellipsis,1], [Ellipsis])
+    array([ 10,  35,  60,  85, 110])
+
+    Compute a matrix transpose, or reorder any number of axes:
+
+    >>> np.einsum('ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum('ij->ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum(c, [1,0])
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.transpose(c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+
+    Vector inner products:
+
+    >>> np.einsum('i,i', b, b)
+    30
+    >>> np.einsum(b, [0], b, [0])
+    30
+    >>> np.inner(b,b)
+    30
+
+    Matrix vector multiplication:
+
+    >>> np.einsum('ij,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum(a, [0,1], b, [1])
+    array([ 30,  80, 130, 180, 230])
+    >>> np.dot(a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum('...j,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+
+    Broadcasting and scalar multiplication:
+
+    >>> np.einsum('..., ...', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(',ij', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(3, [Ellipsis], c, [Ellipsis])
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.multiply(3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+
+    Vector outer product:
+
+    >>> np.einsum('i,j', np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.einsum(np.arange(2)+1, [0], b, [1])
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.outer(np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+
+    Tensor contraction:
+
+    >>> a = np.arange(60.).reshape(3,4,5)
+    >>> b = np.arange(24.).reshape(4,3,2)
+    >>> np.einsum('ijk,jil->kl', a, b)
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3])
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.tensordot(a,b, axes=([1,0],[0,1]))
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+
+    Writeable returned arrays (since version 1.10.0):
+
+    >>> a = np.zeros((3, 3))
+    >>> np.einsum('ii->i', a)[:] = 1
+    >>> a
+    array([[1., 0., 0.],
+           [0., 1., 0.],
+           [0., 0., 1.]])
+
+    Example of ellipsis use:
+
+    >>> a = np.arange(6).reshape((3,2))
+    >>> b = np.arange(12).reshape((4,3))
+    >>> np.einsum('ki,jk->ij', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('ki,...k->i...', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('k...,jk', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+
+    Chained array operations. For more complicated contractions, speed ups
+    might be achieved by repeatedly computing a 'greedy' path or pre-computing the
+    'optimal' path and repeatedly applying it, using an
+    `einsum_path` insertion (since version 1.12.0). Performance improvements can be
+    particularly significant with larger arrays:
+
+    >>> a = np.ones(64).reshape(2,4,8)
+
+    Basic `einsum`: ~1520ms  (benchmarked on 3.1GHz Intel i5.)
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a)
+
+    Sub-optimal `einsum` (due to repeated path calculation time): ~330ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='optimal')
+
+    Greedy `einsum` (faster optimal path approximation): ~160ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='greedy')
+
+    Optimal `einsum` (best usage pattern in some use cases): ~110ms
+
+    >>> path = np.einsum_path('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='optimal')[0]
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize=path)
+
+    """
+    # Special handling if out is specified
+    specified_out = out is not None
+
+    # If no optimization, run pure einsum
+    if optimize is False:
+        if specified_out:
+            kwargs['out'] = out
+        return c_einsum(*operands, **kwargs)
+
+    # Check the kwargs to avoid a more cryptic error later, without having to
+    # repeat default values here
+    valid_einsum_kwargs = ['dtype', 'order', 'casting']
+    unknown_kwargs = [k for (k, v) in kwargs.items() if
+                      k not in valid_einsum_kwargs]
+    if len(unknown_kwargs):
+        raise TypeError("Did not understand the following kwargs: %s"
+                        % unknown_kwargs)
+
+    # Build the contraction list and operand
+    operands, contraction_list = einsum_path(*operands, optimize=optimize,
+                                             einsum_call=True)
+
+    # Handle order kwarg for output array, c_einsum allows mixed case
+    output_order = kwargs.pop('order', 'K')
+    if output_order.upper() == 'A':
+        if all(arr.flags.f_contiguous for arr in operands):
+            output_order = 'F'
+        else:
+            output_order = 'C'
+
+    # Start contraction loop
+    for num, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        tmp_operands = [operands.pop(x) for x in inds]
+
+        # Do we need to deal with the output?
+        handle_out = specified_out and ((num + 1) == len(contraction_list))
+
+        # Call tensordot if still possible
+        if blas:
+            # Checks have already been handled
+            input_str, results_index = einsum_str.split('->')
+            input_left, input_right = input_str.split(',')
+
+            tensor_result = input_left + input_right
+            for s in idx_rm:
+                tensor_result = tensor_result.replace(s, "")
+
+            # Find indices to contract over
+            left_pos, right_pos = [], []
+            for s in sorted(idx_rm):
+                left_pos.append(input_left.find(s))
+                right_pos.append(input_right.find(s))
+
+            # Contract!
+            new_view = tensordot(*tmp_operands, axes=(tuple(left_pos), tuple(right_pos)))
+
+            # Build a new view if needed
+            if (tensor_result != results_index) or handle_out:
+                if handle_out:
+                    kwargs["out"] = out
+                new_view = c_einsum(tensor_result + '->' + results_index, new_view, **kwargs)
+
+        # Call einsum
+        else:
+            # If out was specified
+            if handle_out:
+                kwargs["out"] = out
+
+            # Do the contraction
+            new_view = c_einsum(einsum_str, *tmp_operands, **kwargs)
+
+        # Append new items and dereference what we can
+        operands.append(new_view)
+        del tmp_operands, new_view
+
+    if specified_out:
+        return out
+    else:
+        return asanyarray(operands[0], order=output_order)

pllava/lib/python3.10/site-packages/numpy/core/einsumfunc.pyi

@@ -0,0 +1,187 @@
+from collections.abc import Sequence
+from typing import TypeVar, Any, overload, Union, Literal
+
+from numpy import (
+    ndarray,
+    dtype,
+    bool_,
+    number,
+    _OrderKACF,
+)
+from numpy._typing import (
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+    _DTypeLikeBool,
+    _DTypeLikeUInt,
+    _DTypeLikeInt,
+    _DTypeLikeFloat,
+    _DTypeLikeComplex,
+    _DTypeLikeComplex_co,
+    _DTypeLikeObject,
+)
+
+_ArrayType = TypeVar(
+    "_ArrayType",
+    bound=ndarray[Any, dtype[Union[bool_, number[Any]]]],
+)
+
+_OptimizeKind = None | bool | Literal["greedy", "optimal"] | Sequence[Any]
+_CastingSafe = Literal["no", "equiv", "safe", "same_kind"]
+_CastingUnsafe = Literal["unsafe"]
+
+__all__: list[str]
+
+# TODO: Properly handle the `casting`-based combinatorics
+# TODO: We need to evaluate the content `__subscripts` in order
+# to identify whether or an array or scalar is returned. At a cursory
+# glance this seems like something that can quite easily be done with
+# a mypy plugin.
+# Something like `is_scalar = bool(__subscripts.partition("->")[-1])`
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeBool_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeBool = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeUInt_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeUInt = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeInt_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeInt = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeFloat_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeFloat = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeComplex = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    out: None = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co,
+    out: _ArrayType,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    out: _ArrayType,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeObject_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeObject = ...,
+    out: None = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeObject_co,
+    out: _ArrayType,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    out: _ArrayType,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+
+# NOTE: `einsum_call` is a hidden kwarg unavailable for public use.
+# It is therefore excluded from the signatures below.
+# NOTE: In practice the list consists of a `str` (first element)
+# and a variable number of integer tuples.
+def einsum_path(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co | _DTypeLikeObject,
+    optimize: _OptimizeKind = ...,
+) -> tuple[list[Any], str]: ...

pllava/lib/python3.10/site-packages/numpy/core/fromnumeric.pyi

@@ -0,0 +1,1060 @@
+import datetime as dt
+from collections.abc import Sequence
+from typing import Union, Any, overload, TypeVar, Literal, SupportsIndex
+
+from numpy import (
+    ndarray,
+    number,
+    uint64,
+    int_,
+    int64,
+    intp,
+    float16,
+    bool_,
+    floating,
+    complexfloating,
+    object_,
+    generic,
+    _OrderKACF,
+    _OrderACF,
+    _ModeKind,
+    _PartitionKind,
+    _SortKind,
+    _SortSide,
+    _CastingKind,
+)
+from numpy._typing import (
+    DTypeLike,
+    _DTypeLike,
+    ArrayLike,
+    _ArrayLike,
+    NDArray,
+    _ShapeLike,
+    _Shape,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+    _IntLike_co,
+    _BoolLike_co,
+    _ComplexLike_co,
+    _NumberLike_co,
+    _ScalarLike_co,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+_SCT_uifcO = TypeVar("_SCT_uifcO", bound=number[Any] | object_)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+__all__: list[str]
+
+@overload
+def take(
+    a: _ArrayLike[_SCT],
+    indices: _IntLike_co,
+    axis: None = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> _SCT: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _IntLike_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> Any: ...
+@overload
+def take(
+    a: _ArrayLike[_SCT],
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    mode: _ModeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def reshape(
+    a: _ArrayLike[_SCT],
+    newshape: _ShapeLike,
+    order: _OrderACF = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def reshape(
+    a: ArrayLike,
+    newshape: _ShapeLike,
+    order: _OrderACF = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def choose(
+    a: _IntLike_co,
+    choices: ArrayLike,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> Any: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: _ArrayLike[_SCT],
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: ArrayLike,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: ArrayLike,
+    out: _ArrayType = ...,
+    mode: _ModeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def repeat(
+    a: _ArrayLike[_SCT],
+    repeats: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def repeat(
+    a: ArrayLike,
+    repeats: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+def put(
+    a: NDArray[Any],
+    ind: _ArrayLikeInt_co,
+    v: ArrayLike,
+    mode: _ModeKind = ...,
+) -> None: ...
+
+@overload
+def swapaxes(
+    a: _ArrayLike[_SCT],
+    axis1: SupportsIndex,
+    axis2: SupportsIndex,
+) -> NDArray[_SCT]: ...
+@overload
+def swapaxes(
+    a: ArrayLike,
+    axis1: SupportsIndex,
+    axis2: SupportsIndex,
+) -> NDArray[Any]: ...
+
+@overload
+def transpose(
+    a: _ArrayLike[_SCT],
+    axes: None | _ShapeLike = ...
+) -> NDArray[_SCT]: ...
+@overload
+def transpose(
+    a: ArrayLike,
+    axes: None | _ShapeLike = ...
+) -> NDArray[Any]: ...
+
+@overload
+def partition(
+    a: _ArrayLike[_SCT],
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def partition(
+    a: ArrayLike,
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[Any]: ...
+
+def argpartition(
+    a: ArrayLike,
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[intp]: ...
+
+@overload
+def sort(
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def sort(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[Any]: ...
+
+def argsort(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[intp]: ...
+
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> intp: ...
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> intp: ...
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def searchsorted(
+    a: ArrayLike,
+    v: _ScalarLike_co,
+    side: _SortSide = ...,
+    sorter: None | _ArrayLikeInt_co = ...,  # 1D int array
+) -> intp: ...
+@overload
+def searchsorted(
+    a: ArrayLike,
+    v: ArrayLike,
+    side: _SortSide = ...,
+    sorter: None | _ArrayLikeInt_co = ...,  # 1D int array
+) -> NDArray[intp]: ...
+
+@overload
+def resize(
+    a: _ArrayLike[_SCT],
+    new_shape: _ShapeLike,
+) -> NDArray[_SCT]: ...
+@overload
+def resize(
+    a: ArrayLike,
+    new_shape: _ShapeLike,
+) -> NDArray[Any]: ...
+
+@overload
+def squeeze(
+    a: _SCT,
+    axis: None | _ShapeLike = ...,
+) -> _SCT: ...
+@overload
+def squeeze(
+    a: _ArrayLike[_SCT],
+    axis: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def squeeze(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def diagonal(
+    a: _ArrayLike[_SCT],
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,  # >= 2D array
+) -> NDArray[_SCT]: ...
+@overload
+def diagonal(
+    a: ArrayLike,
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,  # >= 2D array
+) -> NDArray[Any]: ...
+
+@overload
+def trace(
+    a: ArrayLike,  # >= 2D array
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> Any: ...
+@overload
+def trace(
+    a: ArrayLike,  # >= 2D array
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def ravel(a: _ArrayLike[_SCT], order: _OrderKACF = ...) -> NDArray[_SCT]: ...
+@overload
+def ravel(a: ArrayLike, order: _OrderKACF = ...) -> NDArray[Any]: ...
+
+def nonzero(a: ArrayLike) -> tuple[NDArray[intp], ...]: ...
+
+def shape(a: ArrayLike) -> _Shape: ...
+
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def clip(
+    a: _SCT,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> _SCT: ...
+@overload
+def clip(
+    a: _ScalarLike_co,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> Any: ...
+@overload
+def clip(
+    a: _ArrayLike[_SCT],
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: _ArrayType = ...,
+    *,
+    dtype: DTypeLike,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> Any: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: _ArrayType,
+    *,
+    dtype: DTypeLike = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def sum(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    dtype: None = ...,
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def all(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> bool_: ...
+@overload
+def all(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def all(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def any(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> bool_: ...
+@overload
+def any(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def any(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def cumsum(
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def ptp(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+) -> _SCT: ...
+@overload
+def ptp(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def ptp(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def amax(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def amax(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def amax(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def amin(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def amin(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def amin(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+# TODO: `np.prod()``: For object arrays `initial` does not necessarily
+# have to be a numerical scalar.
+# The only requirement is that it is compatible
+# with the `.__mul__()` method(s) of the passed array's elements.
+
+# Note that the same situation holds for all wrappers around
+# `np.ufunc.reduce`, e.g. `np.sum()` (`.__add__()`).
+@overload
+def prod(
+    a: _ArrayLikeBool_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> int_: ...
+@overload
+def prod(
+    a: _ArrayLikeUInt_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> uint64: ...
+@overload
+def prod(
+    a: _ArrayLikeInt_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> int64: ...
+@overload
+def prod(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None | DTypeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None | DTypeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def cumprod(
+    a: _ArrayLikeBool_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[int_]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeUInt_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[uint64]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[int64]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeFloat_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[object_]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+def ndim(a: ArrayLike) -> int: ...
+
+def size(a: ArrayLike, axis: None | int = ...) -> int: ...
+
+@overload
+def around(
+    a: _BoolLike_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> float16: ...
+@overload
+def around(
+    a: _SCT_uifcO,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> _SCT_uifcO: ...
+@overload
+def around(
+    a: _ComplexLike_co | object_,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> Any: ...
+@overload
+def around(
+    a: _ArrayLikeBool_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[float16]: ...
+@overload
+def around(
+    a: _ArrayLike[_SCT_uifcO],
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[_SCT_uifcO]: ...
+@overload
+def around(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def around(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    decimals: SupportsIndex = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def mean(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def std(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def var(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+max = amax
+min = amin
+round = around

pllava/lib/python3.10/site-packages/numpy/core/function_base.py

@@ -0,0 +1,551 @@
+import functools
+import warnings
+import operator
+import types
+
+import numpy as np
+from . import numeric as _nx
+from .numeric import result_type, NaN, asanyarray, ndim
+from numpy.core.multiarray import add_docstring
+from numpy.core import overrides
+
+__all__ = ['logspace', 'linspace', 'geomspace']
+
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy')
+
+
+def _linspace_dispatcher(start, stop, num=None, endpoint=None, retstep=None,
+                         dtype=None, axis=None):
+    return (start, stop)
+
+
+@array_function_dispatch(_linspace_dispatcher)
+def linspace(start, stop, num=50, endpoint=True, retstep=False, dtype=None,
+             axis=0):
+    """
+    Return evenly spaced numbers over a specified interval.
+
+    Returns `num` evenly spaced samples, calculated over the
+    interval [`start`, `stop`].
+
+    The endpoint of the interval can optionally be excluded.
+
+    .. versionchanged:: 1.16.0
+        Non-scalar `start` and `stop` are now supported.
+
+    .. versionchanged:: 1.20.0
+        Values are rounded towards ``-inf`` instead of ``0`` when an
+        integer ``dtype`` is specified. The old behavior can
+        still be obtained with ``np.linspace(start, stop, num).astype(int)``
+
+    Parameters
+    ----------
+    start : array_like
+        The starting value of the sequence.
+    stop : array_like
+        The end value of the sequence, unless `endpoint` is set to False.
+        In that case, the sequence consists of all but the last of ``num + 1``
+        evenly spaced samples, so that `stop` is excluded.  Note that the step
+        size changes when `endpoint` is False.
+    num : int, optional
+        Number of samples to generate. Default is 50. Must be non-negative.
+    endpoint : bool, optional
+        If True, `stop` is the last sample. Otherwise, it is not included.
+        Default is True.
+    retstep : bool, optional
+        If True, return (`samples`, `step`), where `step` is the spacing
+        between samples.
+    dtype : dtype, optional
+        The type of the output array.  If `dtype` is not given, the data type
+        is inferred from `start` and `stop`. The inferred dtype will never be
+        an integer; `float` is chosen even if the arguments would produce an
+        array of integers.
+
+        .. versionadded:: 1.9.0
+
+    axis : int, optional
+        The axis in the result to store the samples.  Relevant only if start
+        or stop are array-like.  By default (0), the samples will be along a
+        new axis inserted at the beginning. Use -1 to get an axis at the end.
+
+        .. versionadded:: 1.16.0
+
+    Returns
+    -------
+    samples : ndarray
+        There are `num` equally spaced samples in the closed interval
+        ``[start, stop]`` or the half-open interval ``[start, stop)``
+        (depending on whether `endpoint` is True or False).
+    step : float, optional
+        Only returned if `retstep` is True
+
+        Size of spacing between samples.
+
+
+    See Also
+    --------
+    arange : Similar to `linspace`, but uses a step size (instead of the
+             number of samples).
+    geomspace : Similar to `linspace`, but with numbers spaced evenly on a log
+                scale (a geometric progression).
+    logspace : Similar to `geomspace`, but with the end points specified as
+               logarithms.
+    :ref:`how-to-partition`
+
+    Examples
+    --------
+    >>> np.linspace(2.0, 3.0, num=5)
+    array([2.  , 2.25, 2.5 , 2.75, 3.  ])
+    >>> np.linspace(2.0, 3.0, num=5, endpoint=False)
+    array([2. ,  2.2,  2.4,  2.6,  2.8])
+    >>> np.linspace(2.0, 3.0, num=5, retstep=True)
+    (array([2.  ,  2.25,  2.5 ,  2.75,  3.  ]), 0.25)
+
+    Graphical illustration:
+
+    >>> import matplotlib.pyplot as plt
+    >>> N = 8
+    >>> y = np.zeros(N)
+    >>> x1 = np.linspace(0, 10, N, endpoint=True)
+    >>> x2 = np.linspace(0, 10, N, endpoint=False)
+    >>> plt.plot(x1, y, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.plot(x2, y + 0.5, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.ylim([-0.5, 1])
+    (-0.5, 1)
+    >>> plt.show()
+
+    """
+    num = operator.index(num)
+    if num < 0:
+        raise ValueError("Number of samples, %s, must be non-negative." % num)
+    div = (num - 1) if endpoint else num
+
+    # Convert float/complex array scalars to float, gh-3504
+    # and make sure one can use variables that have an __array_interface__, gh-6634
+    start = asanyarray(start) * 1.0
+    stop  = asanyarray(stop)  * 1.0
+
+    dt = result_type(start, stop, float(num))
+    if dtype is None:
+        dtype = dt
+        integer_dtype = False
+    else:
+        integer_dtype = _nx.issubdtype(dtype, _nx.integer)
+
+    delta = stop - start
+    y = _nx.arange(0, num, dtype=dt).reshape((-1,) + (1,) * ndim(delta))
+    # In-place multiplication y *= delta/div is faster, but prevents the multiplicant
+    # from overriding what class is produced, and thus prevents, e.g. use of Quantities,
+    # see gh-7142. Hence, we multiply in place only for standard scalar types.
+    if div > 0:
+        _mult_inplace = _nx.isscalar(delta)
+        step = delta / div
+        any_step_zero = (
+            step == 0 if _mult_inplace else _nx.asanyarray(step == 0).any())
+        if any_step_zero:
+            # Special handling for denormal numbers, gh-5437
+            y /= div
+            if _mult_inplace:
+                y *= delta
+            else:
+                y = y * delta
+        else:
+            if _mult_inplace:
+                y *= step
+            else:
+                y = y * step
+    else:
+        # sequences with 0 items or 1 item with endpoint=True (i.e. div <= 0)
+        # have an undefined step
+        step = NaN
+        # Multiply with delta to allow possible override of output class.
+        y = y * delta
+
+    y += start
+
+    if endpoint and num > 1:
+        y[-1, ...] = stop
+
+    if axis != 0:
+        y = _nx.moveaxis(y, 0, axis)
+
+    if integer_dtype:
+        _nx.floor(y, out=y)
+
+    if retstep:
+        return y.astype(dtype, copy=False), step
+    else:
+        return y.astype(dtype, copy=False)
+
+
+def _logspace_dispatcher(start, stop, num=None, endpoint=None, base=None,
+                         dtype=None, axis=None):
+    return (start, stop, base)
+
+
+@array_function_dispatch(_logspace_dispatcher)
+def logspace(start, stop, num=50, endpoint=True, base=10.0, dtype=None,
+             axis=0):
+    """
+    Return numbers spaced evenly on a log scale.
+
+    In linear space, the sequence starts at ``base ** start``
+    (`base` to the power of `start`) and ends with ``base ** stop``
+    (see `endpoint` below).
+
+    .. versionchanged:: 1.16.0
+        Non-scalar `start` and `stop` are now supported.
+
+    .. versionchanged:: 1.25.0
+        Non-scalar 'base` is now supported
+
+    Parameters
+    ----------
+    start : array_like
+        ``base ** start`` is the starting value of the sequence.
+    stop : array_like
+        ``base ** stop`` is the final value of the sequence, unless `endpoint`
+        is False.  In that case, ``num + 1`` values are spaced over the
+        interval in log-space, of which all but the last (a sequence of
+        length `num`) are returned.
+    num : integer, optional
+        Number of samples to generate.  Default is 50.
+    endpoint : boolean, optional
+        If true, `stop` is the last sample. Otherwise, it is not included.
+        Default is True.
+    base : array_like, optional
+        The base of the log space. The step size between the elements in
+        ``ln(samples) / ln(base)`` (or ``log_base(samples)``) is uniform.
+        Default is 10.0.
+    dtype : dtype
+        The type of the output array.  If `dtype` is not given, the data type
+        is inferred from `start` and `stop`. The inferred type will never be
+        an integer; `float` is chosen even if the arguments would produce an
+        array of integers.
+    axis : int, optional
+        The axis in the result to store the samples.  Relevant only if start,
+        stop, or base are array-like.  By default (0), the samples will be
+        along a new axis inserted at the beginning. Use -1 to get an axis at
+        the end.
+
+        .. versionadded:: 1.16.0
+
+
+    Returns
+    -------
+    samples : ndarray
+        `num` samples, equally spaced on a log scale.
+
+    See Also
+    --------
+    arange : Similar to linspace, with the step size specified instead of the
+             number of samples. Note that, when used with a float endpoint, the
+             endpoint may or may not be included.
+    linspace : Similar to logspace, but with the samples uniformly distributed
+               in linear space, instead of log space.
+    geomspace : Similar to logspace, but with endpoints specified directly.
+    :ref:`how-to-partition`
+
+    Notes
+    -----
+    If base is a scalar, logspace is equivalent to the code
+
+    >>> y = np.linspace(start, stop, num=num, endpoint=endpoint)
+    ... # doctest: +SKIP
+    >>> power(base, y).astype(dtype)
+    ... # doctest: +SKIP
+
+    Examples
+    --------
+    >>> np.logspace(2.0, 3.0, num=4)
+    array([ 100.        ,  215.443469  ,  464.15888336, 1000.        ])
+    >>> np.logspace(2.0, 3.0, num=4, endpoint=False)
+    array([100.        ,  177.827941  ,  316.22776602,  562.34132519])
+    >>> np.logspace(2.0, 3.0, num=4, base=2.0)
+    array([4.        ,  5.0396842 ,  6.34960421,  8.        ])
+    >>> np.logspace(2.0, 3.0, num=4, base=[2.0, 3.0], axis=-1)
+    array([[ 4.        ,  5.0396842 ,  6.34960421,  8.        ],
+           [ 9.        , 12.98024613, 18.72075441, 27.        ]])
+
+    Graphical illustration:
+
+    >>> import matplotlib.pyplot as plt
+    >>> N = 10
+    >>> x1 = np.logspace(0.1, 1, N, endpoint=True)
+    >>> x2 = np.logspace(0.1, 1, N, endpoint=False)
+    >>> y = np.zeros(N)
+    >>> plt.plot(x1, y, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.plot(x2, y + 0.5, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.ylim([-0.5, 1])
+    (-0.5, 1)
+    >>> plt.show()
+
+    """
+    ndmax = np.broadcast(start, stop, base).ndim
+    start, stop, base = (
+        np.array(a, copy=False, subok=True, ndmin=ndmax)
+        for a in (start, stop, base)
+    )
+    y = linspace(start, stop, num=num, endpoint=endpoint, axis=axis)
+    base = np.expand_dims(base, axis=axis)
+    if dtype is None:
+        return _nx.power(base, y)
+    return _nx.power(base, y).astype(dtype, copy=False)
+
+
+def _geomspace_dispatcher(start, stop, num=None, endpoint=None, dtype=None,
+                          axis=None):
+    return (start, stop)
+
+
+@array_function_dispatch(_geomspace_dispatcher)
+def geomspace(start, stop, num=50, endpoint=True, dtype=None, axis=0):
+    """
+    Return numbers spaced evenly on a log scale (a geometric progression).
+
+    This is similar to `logspace`, but with endpoints specified directly.
+    Each output sample is a constant multiple of the previous.
+
+    .. versionchanged:: 1.16.0
+        Non-scalar `start` and `stop` are now supported.
+
+    Parameters
+    ----------
+    start : array_like
+        The starting value of the sequence.
+    stop : array_like
+        The final value of the sequence, unless `endpoint` is False.
+        In that case, ``num + 1`` values are spaced over the
+        interval in log-space, of which all but the last (a sequence of
+        length `num`) are returned.
+    num : integer, optional
+        Number of samples to generate.  Default is 50.
+    endpoint : boolean, optional
+        If true, `stop` is the last sample. Otherwise, it is not included.
+        Default is True.
+    dtype : dtype
+        The type of the output array.  If `dtype` is not given, the data type
+        is inferred from `start` and `stop`. The inferred dtype will never be
+        an integer; `float` is chosen even if the arguments would produce an
+        array of integers.
+    axis : int, optional
+        The axis in the result to store the samples.  Relevant only if start
+        or stop are array-like.  By default (0), the samples will be along a
+        new axis inserted at the beginning. Use -1 to get an axis at the end.
+
+        .. versionadded:: 1.16.0
+
+    Returns
+    -------
+    samples : ndarray
+        `num` samples, equally spaced on a log scale.
+
+    See Also
+    --------
+    logspace : Similar to geomspace, but with endpoints specified using log
+               and base.
+    linspace : Similar to geomspace, but with arithmetic instead of geometric
+               progression.
+    arange : Similar to linspace, with the step size specified instead of the
+             number of samples.
+    :ref:`how-to-partition`
+
+    Notes
+    -----
+    If the inputs or dtype are complex, the output will follow a logarithmic
+    spiral in the complex plane.  (There are an infinite number of spirals
+    passing through two points; the output will follow the shortest such path.)
+
+    Examples
+    --------
+    >>> np.geomspace(1, 1000, num=4)
+    array([    1.,    10.,   100.,  1000.])
+    >>> np.geomspace(1, 1000, num=3, endpoint=False)
+    array([   1.,   10.,  100.])
+    >>> np.geomspace(1, 1000, num=4, endpoint=False)
+    array([   1.        ,    5.62341325,   31.6227766 ,  177.827941  ])
+    >>> np.geomspace(1, 256, num=9)
+    array([   1.,    2.,    4.,    8.,   16.,   32.,   64.,  128.,  256.])
+
+    Note that the above may not produce exact integers:
+
+    >>> np.geomspace(1, 256, num=9, dtype=int)
+    array([  1,   2,   4,   7,  16,  32,  63, 127, 256])
+    >>> np.around(np.geomspace(1, 256, num=9)).astype(int)
+    array([  1,   2,   4,   8,  16,  32,  64, 128, 256])
+
+    Negative, decreasing, and complex inputs are allowed:
+
+    >>> np.geomspace(1000, 1, num=4)
+    array([1000.,  100.,   10.,    1.])
+    >>> np.geomspace(-1000, -1, num=4)
+    array([-1000.,  -100.,   -10.,    -1.])
+    >>> np.geomspace(1j, 1000j, num=4)  # Straight line
+    array([0.   +1.j, 0.  +10.j, 0. +100.j, 0.+1000.j])
+    >>> np.geomspace(-1+0j, 1+0j, num=5)  # Circle
+    array([-1.00000000e+00+1.22464680e-16j, -7.07106781e-01+7.07106781e-01j,
+            6.12323400e-17+1.00000000e+00j,  7.07106781e-01+7.07106781e-01j,
+            1.00000000e+00+0.00000000e+00j])
+
+    Graphical illustration of `endpoint` parameter:
+
+    >>> import matplotlib.pyplot as plt
+    >>> N = 10
+    >>> y = np.zeros(N)
+    >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=True), y + 1, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=False), y + 2, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.axis([0.5, 2000, 0, 3])
+    [0.5, 2000, 0, 3]
+    >>> plt.grid(True, color='0.7', linestyle='-', which='both', axis='both')
+    >>> plt.show()
+
+    """
+    start = asanyarray(start)
+    stop = asanyarray(stop)
+    if _nx.any(start == 0) or _nx.any(stop == 0):
+        raise ValueError('Geometric sequence cannot include zero')
+
+    dt = result_type(start, stop, float(num), _nx.zeros((), dtype))
+    if dtype is None:
+        dtype = dt
+    else:
+        # complex to dtype('complex128'), for instance
+        dtype = _nx.dtype(dtype)
+
+    # Promote both arguments to the same dtype in case, for instance, one is
+    # complex and another is negative and log would produce NaN otherwise.
+    # Copy since we may change things in-place further down.
+    start = start.astype(dt, copy=True)
+    stop = stop.astype(dt, copy=True)
+
+    out_sign = _nx.ones(_nx.broadcast(start, stop).shape, dt)
+    # Avoid negligible real or imaginary parts in output by rotating to
+    # positive real, calculating, then undoing rotation
+    if _nx.issubdtype(dt, _nx.complexfloating):
+        all_imag = (start.real == 0.) & (stop.real == 0.)
+        if _nx.any(all_imag):
+            start[all_imag] = start[all_imag].imag
+            stop[all_imag] = stop[all_imag].imag
+            out_sign[all_imag] = 1j
+
+    both_negative = (_nx.sign(start) == -1) & (_nx.sign(stop) == -1)
+    if _nx.any(both_negative):
+        _nx.negative(start, out=start, where=both_negative)
+        _nx.negative(stop, out=stop, where=both_negative)
+        _nx.negative(out_sign, out=out_sign, where=both_negative)
+
+    log_start = _nx.log10(start)
+    log_stop = _nx.log10(stop)
+    result = logspace(log_start, log_stop, num=num,
+                      endpoint=endpoint, base=10.0, dtype=dtype)
+
+    # Make sure the endpoints match the start and stop arguments. This is
+    # necessary because np.exp(np.log(x)) is not necessarily equal to x.
+    if num > 0:
+        result[0] = start
+        if num > 1 and endpoint:
+            result[-1] = stop
+
+    result = out_sign * result
+
+    if axis != 0:
+        result = _nx.moveaxis(result, 0, axis)
+
+    return result.astype(dtype, copy=False)
+
+
+def _needs_add_docstring(obj):
+    """
+    Returns true if the only way to set the docstring of `obj` from python is
+    via add_docstring.
+
+    This function errs on the side of being overly conservative.
+    """
+    Py_TPFLAGS_HEAPTYPE = 1 << 9
+
+    if isinstance(obj, (types.FunctionType, types.MethodType, property)):
+        return False
+
+    if isinstance(obj, type) and obj.__flags__ & Py_TPFLAGS_HEAPTYPE:
+        return False
+
+    return True
+
+
+def _add_docstring(obj, doc, warn_on_python):
+    if warn_on_python and not _needs_add_docstring(obj):
+        warnings.warn(
+            "add_newdoc was used on a pure-python object {}. "
+            "Prefer to attach it directly to the source."
+            .format(obj),
+            UserWarning,
+            stacklevel=3)
+    try:
+        add_docstring(obj, doc)
+    except Exception:
+        pass
+
+
+def add_newdoc(place, obj, doc, warn_on_python=True):
+    """
+    Add documentation to an existing object, typically one defined in C
+
+    The purpose is to allow easier editing of the docstrings without requiring
+    a re-compile. This exists primarily for internal use within numpy itself.
+
+    Parameters
+    ----------
+    place : str
+        The absolute name of the module to import from
+    obj : str
+        The name of the object to add documentation to, typically a class or
+        function name
+    doc : {str, Tuple[str, str], List[Tuple[str, str]]}
+        If a string, the documentation to apply to `obj`
+
+        If a tuple, then the first element is interpreted as an attribute of
+        `obj` and the second as the docstring to apply - ``(method, docstring)``
+
+        If a list, then each element of the list should be a tuple of length
+        two - ``[(method1, docstring1), (method2, docstring2), ...]``
+    warn_on_python : bool
+        If True, the default, emit `UserWarning` if this is used to attach
+        documentation to a pure-python object.
+
+    Notes
+    -----
+    This routine never raises an error if the docstring can't be written, but
+    will raise an error if the object being documented does not exist.
+
+    This routine cannot modify read-only docstrings, as appear
+    in new-style classes or built-in functions. Because this
+    routine never raises an error the caller must check manually
+    that the docstrings were changed.
+
+    Since this function grabs the ``char *`` from a c-level str object and puts
+    it into the ``tp_doc`` slot of the type of `obj`, it violates a number of
+    C-API best-practices, by:
+
+    - modifying a `PyTypeObject` after calling `PyType_Ready`
+    - calling `Py_INCREF` on the str and losing the reference, so the str
+      will never be released
+
+    If possible it should be avoided.
+    """
+    new = getattr(__import__(place, globals(), {}, [obj]), obj)
+    if isinstance(doc, str):
+        _add_docstring(new, doc.strip(), warn_on_python)
+    elif isinstance(doc, tuple):
+        attr, docstring = doc
+        _add_docstring(getattr(new, attr), docstring.strip(), warn_on_python)
+    elif isinstance(doc, list):
+        for attr, docstring in doc:
+            _add_docstring(getattr(new, attr), docstring.strip(), warn_on_python)

pllava/lib/python3.10/site-packages/numpy/core/function_base.pyi

@@ -0,0 +1,187 @@
+from typing import (
+    Literal as L,
+    overload,
+    Any,
+    SupportsIndex,
+    TypeVar,
+)
+
+from numpy import floating, complexfloating, generic
+from numpy._typing import (
+    NDArray,
+    DTypeLike,
+    _DTypeLike,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+
+__all__: list[str]
+
+@overload
+def linspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+@overload
+def linspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[floating[Any]], floating[Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[complexfloating[Any, Any]], complexfloating[Any, Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[_SCT], _SCT]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[Any], Any]: ...
+
+@overload
+def logspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeFloat_co = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def geomspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+# Re-exported to `np.lib.function_base`
+def add_newdoc(
+    place: str,
+    obj: str,
+    doc: str | tuple[str, str] | list[tuple[str, str]],
+    warn_on_python: bool = ...,
+) -> None: ...

pllava/lib/python3.10/site-packages/numpy/core/getlimits.pyi

@@ -0,0 +1,6 @@
+from numpy import (
+    finfo as finfo,
+    iinfo as iinfo,
+)
+
+__all__: list[str]

pllava/lib/python3.10/site-packages/numpy/core/numeric.pyi

@@ -0,0 +1,660 @@
+from collections.abc import Callable, Sequence
+from typing import (
+    Any,
+    overload,
+    TypeVar,
+    Literal,
+    SupportsAbs,
+    SupportsIndex,
+    NoReturn,
+)
+if sys.version_info >= (3, 10):
+    from typing import TypeGuard
+else:
+    from typing_extensions import TypeGuard
+
+from numpy import (
+    ComplexWarning as ComplexWarning,
+    generic,
+    unsignedinteger,
+    signedinteger,
+    floating,
+    complexfloating,
+    bool_,
+    int_,
+    intp,
+    float64,
+    timedelta64,
+    object_,
+    _OrderKACF,
+    _OrderCF,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    DTypeLike,
+    _ShapeLike,
+    _DTypeLike,
+    _ArrayLike,
+    _SupportsArrayFunc,
+    _ScalarLike_co,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeTD64_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeUnknown,
+)
+
+_T = TypeVar("_T")
+_SCT = TypeVar("_SCT", bound=generic)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+_CorrelateMode = Literal["valid", "same", "full"]
+
+__all__: list[str]
+
+@overload
+def zeros_like(
+    a: _ArrayType,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: Literal[True] = ...,
+    shape: None = ...,
+) -> _ArrayType: ...
+@overload
+def zeros_like(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def zeros_like(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+@overload
+def zeros_like(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[_SCT]: ...
+@overload
+def zeros_like(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+
+@overload
+def ones(
+    shape: _ShapeLike,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def ones(
+    shape: _ShapeLike,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones(
+    shape: _ShapeLike,
+    dtype: DTypeLike,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def ones_like(
+    a: _ArrayType,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: Literal[True] = ...,
+    shape: None = ...,
+) -> _ArrayType: ...
+@overload
+def ones_like(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones_like(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+@overload
+def ones_like(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones_like(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: DTypeLike,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def full_like(
+    a: _ArrayType,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: Literal[True] = ...,
+    shape: None = ...,
+) -> _ArrayType: ...
+@overload
+def full_like(
+    a: _ArrayLike[_SCT],
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full_like(
+    a: object,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+@overload
+def full_like(
+    a: Any,
+    fill_value: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full_like(
+    a: Any,
+    fill_value: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+
+@overload
+def count_nonzero(
+    a: ArrayLike,
+    axis: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> int: ...
+@overload
+def count_nonzero(
+    a: ArrayLike,
+    axis: _ShapeLike = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...  # TODO: np.intp or ndarray[np.intp]
+
+def isfortran(a: NDArray[Any] | generic) -> bool: ...
+
+def argwhere(a: ArrayLike) -> NDArray[intp]: ...
+
+def flatnonzero(a: ArrayLike) -> NDArray[intp]: ...
+
+@overload
+def correlate(
+    a: _ArrayLikeUnknown,
+    v: _ArrayLikeUnknown,
+    mode: _CorrelateMode = ...,
+) -> NDArray[Any]: ...
+@overload
+def correlate(
+    a: _ArrayLikeBool_co,
+    v: _ArrayLikeBool_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[bool_]: ...
+@overload
+def correlate(
+    a: _ArrayLikeUInt_co,
+    v: _ArrayLikeUInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeInt_co,
+    v: _ArrayLikeInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeTD64_co,
+    v: _ArrayLikeTD64_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def correlate(
+    a: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def convolve(
+    a: _ArrayLikeUnknown,
+    v: _ArrayLikeUnknown,
+    mode: _CorrelateMode = ...,
+) -> NDArray[Any]: ...
+@overload
+def convolve(
+    a: _ArrayLikeBool_co,
+    v: _ArrayLikeBool_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[bool_]: ...
+@overload
+def convolve(
+    a: _ArrayLikeUInt_co,
+    v: _ArrayLikeUInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeInt_co,
+    v: _ArrayLikeInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeTD64_co,
+    v: _ArrayLikeTD64_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def convolve(
+    a: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def outer(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def outer(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    out: None = ...,
+) -> NDArray[bool_]: ...
+@overload
+def outer(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    out: None = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    out: None = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    out: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    out: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeTD64_co,
+    b: _ArrayLikeTD64_co,
+    out: None = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def outer(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    out: None = ...,
+) -> NDArray[object_]: ...
+@overload
+def outer(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    b: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    out: _ArrayType,
+) -> _ArrayType: ...
+
+@overload
+def tensordot(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[Any]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[bool_]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeTD64_co,
+    b: _ArrayLikeTD64_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def roll(
+    a: _ArrayLike[_SCT],
+    shift: _ShapeLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def roll(
+    a: ArrayLike,
+    shift: _ShapeLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[Any]: ...
+
+def rollaxis(
+    a: NDArray[_SCT],
+    axis: int,
+    start: int = ...,
+) -> NDArray[_SCT]: ...
+
+def moveaxis(
+    a: NDArray[_SCT],
+    source: _ShapeLike,
+    destination: _ShapeLike,
+) -> NDArray[_SCT]: ...
+
+@overload
+def cross(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[Any]: ...
+@overload
+def cross(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NoReturn: ...
+@overload
+def cross(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: type[int] = ...,
+    sparse: Literal[False] = ...,
+) -> NDArray[int_]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: type[int] = ...,
+    sparse: Literal[True] = ...,
+) -> tuple[NDArray[int_], ...]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: _DTypeLike[_SCT],
+    sparse: Literal[False] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: _DTypeLike[_SCT],
+    sparse: Literal[True],
+) -> tuple[NDArray[_SCT], ...]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: DTypeLike,
+    sparse: Literal[False] = ...,
+) -> NDArray[Any]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: DTypeLike,
+    sparse: Literal[True],
+) -> tuple[NDArray[Any], ...]: ...
+
+def fromfunction(
+    function: Callable[..., _T],
+    shape: Sequence[int],
+    *,
+    dtype: DTypeLike = ...,
+    like: _SupportsArrayFunc = ...,
+    **kwargs: Any,
+) -> _T: ...
+
+def isscalar(element: object) -> TypeGuard[
+    generic | bool | int | float | complex | str | bytes | memoryview
+]: ...
+
+def binary_repr(num: SupportsIndex, width: None | int = ...) -> str: ...
+
+def base_repr(
+    number: SupportsAbs[float],
+    base: float = ...,
+    padding: SupportsIndex = ...,
+) -> str: ...
+
+@overload
+def identity(
+    n: int,
+    dtype: None = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def identity(
+    n: int,
+    dtype: _DTypeLike[_SCT],
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def identity(
+    n: int,
+    dtype: DTypeLike,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+def allclose(
+    a: ArrayLike,
+    b: ArrayLike,
+    rtol: float = ...,
+    atol: float = ...,
+    equal_nan: bool = ...,
+) -> bool: ...
+
+@overload
+def isclose(
+    a: _ScalarLike_co,
+    b: _ScalarLike_co,
+    rtol: float = ...,
+    atol: float = ...,
+    equal_nan: bool = ...,
+) -> bool_: ...
+@overload
+def isclose(
+    a: ArrayLike,
+    b: ArrayLike,
+    rtol: float = ...,
+    atol: float = ...,
+    equal_nan: bool = ...,
+) -> NDArray[bool_]: ...
+
+def array_equal(a1: ArrayLike, a2: ArrayLike, equal_nan: bool = ...) -> bool: ...
+
+def array_equiv(a1: ArrayLike, a2: ArrayLike) -> bool: ...

pllava/lib/python3.10/site-packages/numpy/core/numerictypes.pyi

@@ -0,0 +1,156 @@
+import sys
+import types
+from collections.abc import Iterable
+from typing import (
+    Literal as L,
+    Union,
+    overload,
+    Any,
+    TypeVar,
+    Protocol,
+    TypedDict,
+)
+
+from numpy import (
+    ndarray,
+    dtype,
+    generic,
+    bool_,
+    ubyte,
+    ushort,
+    uintc,
+    uint,
+    ulonglong,
+    byte,
+    short,
+    intc,
+    int_,
+    longlong,
+    half,
+    single,
+    double,
+    longdouble,
+    csingle,
+    cdouble,
+    clongdouble,
+    datetime64,
+    timedelta64,
+    object_,
+    str_,
+    bytes_,
+    void,
+)
+
+from numpy.core._type_aliases import (
+    sctypeDict as sctypeDict,
+    sctypes as sctypes,
+)
+
+from numpy._typing import DTypeLike, ArrayLike, _DTypeLike
+
+_T = TypeVar("_T")
+_SCT = TypeVar("_SCT", bound=generic)
+
+class _CastFunc(Protocol):
+    def __call__(
+        self, x: ArrayLike, k: DTypeLike = ...
+    ) -> ndarray[Any, dtype[Any]]: ...
+
+class _TypeCodes(TypedDict):
+    Character: L['c']
+    Integer: L['bhilqp']
+    UnsignedInteger: L['BHILQP']
+    Float: L['efdg']
+    Complex: L['FDG']
+    AllInteger: L['bBhHiIlLqQpP']
+    AllFloat: L['efdgFDG']
+    Datetime: L['Mm']
+    All: L['?bhilqpBHILQPefdgFDGSUVOMm']
+
+class _typedict(dict[type[generic], _T]):
+    def __getitem__(self, key: DTypeLike) -> _T: ...
+
+if sys.version_info >= (3, 10):
+    _TypeTuple = Union[
+        type[Any],
+        types.UnionType,
+        tuple[Union[type[Any], types.UnionType, tuple[Any, ...]], ...],
+    ]
+else:
+    _TypeTuple = Union[
+        type[Any],
+        tuple[Union[type[Any], tuple[Any, ...]], ...],
+    ]
+
+__all__: list[str]
+
+@overload
+def maximum_sctype(t: _DTypeLike[_SCT]) -> type[_SCT]: ...
+@overload
+def maximum_sctype(t: DTypeLike) -> type[Any]: ...
+
+@overload
+def issctype(rep: dtype[Any] | type[Any]) -> bool: ...
+@overload
+def issctype(rep: object) -> L[False]: ...
+
+@overload
+def obj2sctype(rep: _DTypeLike[_SCT], default: None = ...) -> None | type[_SCT]: ...
+@overload
+def obj2sctype(rep: _DTypeLike[_SCT], default: _T) -> _T | type[_SCT]: ...
+@overload
+def obj2sctype(rep: DTypeLike, default: None = ...) -> None | type[Any]: ...
+@overload
+def obj2sctype(rep: DTypeLike, default: _T) -> _T | type[Any]: ...
+@overload
+def obj2sctype(rep: object, default: None = ...) -> None: ...
+@overload
+def obj2sctype(rep: object, default: _T) -> _T: ...
+
+@overload
+def issubclass_(arg1: type[Any], arg2: _TypeTuple) -> bool: ...
+@overload
+def issubclass_(arg1: object, arg2: object) -> L[False]: ...
+
+def issubsctype(arg1: DTypeLike, arg2: DTypeLike) -> bool: ...
+
+def issubdtype(arg1: DTypeLike, arg2: DTypeLike) -> bool: ...
+
+def sctype2char(sctype: DTypeLike) -> str: ...
+
+cast: _typedict[_CastFunc]
+nbytes: _typedict[int]
+typecodes: _TypeCodes
+ScalarType: tuple[
+    type[int],
+    type[float],
+    type[complex],
+    type[bool],
+    type[bytes],
+    type[str],
+    type[memoryview],
+    type[bool_],
+    type[csingle],
+    type[cdouble],
+    type[clongdouble],
+    type[half],
+    type[single],
+    type[double],
+    type[longdouble],
+    type[byte],
+    type[short],
+    type[intc],
+    type[int_],
+    type[longlong],
+    type[timedelta64],
+    type[datetime64],
+    type[object_],
+    type[bytes_],
+    type[str_],
+    type[ubyte],
+    type[ushort],
+    type[uintc],
+    type[uint],
+    type[ulonglong],
+    type[void],
+]

pllava/lib/python3.10/site-packages/numpy/core/records.pyi

@@ -0,0 +1,234 @@
+import os
+from collections.abc import Sequence, Iterable
+from typing import (
+    Any,
+    TypeVar,
+    overload,
+    Protocol,
+)
+
+from numpy import (
+    format_parser as format_parser,
+    record as record,
+    recarray as recarray,
+    dtype,
+    generic,
+    void,
+    _ByteOrder,
+    _SupportsBuffer,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    DTypeLike,
+    NDArray,
+    _ShapeLike,
+    _ArrayLikeVoid_co,
+    _NestedSequence,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+
+_RecArray = recarray[Any, dtype[_SCT]]
+
+class _SupportsReadInto(Protocol):
+    def seek(self, offset: int, whence: int, /) -> object: ...
+    def tell(self, /) -> int: ...
+    def readinto(self, buffer: memoryview, /) -> int: ...
+
+__all__: list[str]
+
+@overload
+def fromarrays(
+    arrayList: Iterable[ArrayLike],
+    dtype: DTypeLike = ...,
+    shape: None | _ShapeLike = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[Any]: ...
+@overload
+def fromarrays(
+    arrayList: Iterable[ArrayLike],
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def fromrecords(
+    recList: _ArrayLikeVoid_co | tuple[Any, ...] | _NestedSequence[tuple[Any, ...]],
+    dtype: DTypeLike = ...,
+    shape: None | _ShapeLike = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[record]: ...
+@overload
+def fromrecords(
+    recList: _ArrayLikeVoid_co | tuple[Any, ...] | _NestedSequence[tuple[Any, ...]],
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def fromstring(
+    datastring: _SupportsBuffer,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[record]: ...
+@overload
+def fromstring(
+    datastring: _SupportsBuffer,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def fromfile(
+    fd: str | bytes | os.PathLike[str] | os.PathLike[bytes] | _SupportsReadInto,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+) -> _RecArray[Any]: ...
+@overload
+def fromfile(
+    fd: str | bytes | os.PathLike[str] | os.PathLike[bytes] | _SupportsReadInto,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+) -> _RecArray[record]: ...
+
+@overload
+def array(
+    obj: _SCT | NDArray[_SCT],
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[_SCT]: ...
+@overload
+def array(
+    obj: ArrayLike,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[Any]: ...
+@overload
+def array(
+    obj: ArrayLike,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+    copy: bool = ...,
+) -> _RecArray[record]: ...
+@overload
+def array(
+    obj: None,
+    dtype: DTypeLike,
+    shape: _ShapeLike,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[Any]: ...
+@overload
+def array(
+    obj: None,
+    dtype: None = ...,
+    *,
+    shape: _ShapeLike,
+    offset: int = ...,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+    copy: bool = ...,
+) -> _RecArray[record]: ...
+@overload
+def array(
+    obj: _SupportsReadInto,
+    dtype: DTypeLike,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    formats: None = ...,
+    names: None = ...,
+    titles: None = ...,
+    aligned: bool = ...,
+    byteorder: None = ...,
+    copy: bool = ...,
+) -> _RecArray[Any]: ...
+@overload
+def array(
+    obj: _SupportsReadInto,
+    dtype: None = ...,
+    shape: None | _ShapeLike = ...,
+    offset: int = ...,
+    *,
+    formats: DTypeLike,
+    names: None | str | Sequence[str] = ...,
+    titles: None | str | Sequence[str] = ...,
+    aligned: bool = ...,
+    byteorder: None | _ByteOrder = ...,
+    copy: bool = ...,
+) -> _RecArray[record]: ...

pllava/lib/python3.10/site-packages/numpy/core/shape_base.pyi

@@ -0,0 +1,123 @@
+from collections.abc import Sequence
+from typing import TypeVar, overload, Any, SupportsIndex
+
+from numpy import generic, _CastingKind
+from numpy._typing import (
+    NDArray,
+    ArrayLike,
+    DTypeLike,
+    _ArrayLike,
+    _DTypeLike,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+__all__: list[str]
+
+@overload
+def atleast_1d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_1d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_1d(*arys: ArrayLike) -> list[NDArray[Any]]: ...
+
+@overload
+def atleast_2d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_2d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_2d(*arys: ArrayLike) -> list[NDArray[Any]]: ...
+
+@overload
+def atleast_3d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_3d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_3d(*arys: ArrayLike) -> list[NDArray[Any]]: ...
+
+@overload
+def vstack(
+    tup: Sequence[_ArrayLike[_SCT]],
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def vstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def vstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+
+@overload
+def hstack(
+    tup: Sequence[_ArrayLike[_SCT]],
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def hstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def hstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+
+@overload
+def stack(
+    arrays: Sequence[_ArrayLike[_SCT]],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> _ArrayType: ...
+
+@overload
+def block(arrays: _ArrayLike[_SCT]) -> NDArray[_SCT]: ...
+@overload
+def block(arrays: ArrayLike) -> NDArray[Any]: ...

pllava/lib/python3.10/site-packages/numpy/core/tests/_locales.py

@@ -0,0 +1,74 @@
+"""Provide class for testing in French locale
+
+"""
+import sys
+import locale
+
+import pytest
+
+__ALL__ = ['CommaDecimalPointLocale']
+
+
+def find_comma_decimal_point_locale():
+    """See if platform has a decimal point as comma locale.
+
+    Find a locale that uses a comma instead of a period as the
+    decimal point.
+
+    Returns
+    -------
+    old_locale: str
+        Locale when the function was called.
+    new_locale: {str, None)
+        First French locale found, None if none found.
+
+    """
+    if sys.platform == 'win32':
+        locales = ['FRENCH']
+    else:
+        locales = ['fr_FR', 'fr_FR.UTF-8', 'fi_FI', 'fi_FI.UTF-8']
+
+    old_locale = locale.getlocale(locale.LC_NUMERIC)
+    new_locale = None
+    try:
+        for loc in locales:
+            try:
+                locale.setlocale(locale.LC_NUMERIC, loc)
+                new_locale = loc
+                break
+            except locale.Error:
+                pass
+    finally:
+        locale.setlocale(locale.LC_NUMERIC, locale=old_locale)
+    return old_locale, new_locale
+
+
+class CommaDecimalPointLocale:
+    """Sets LC_NUMERIC to a locale with comma as decimal point.
+
+    Classes derived from this class have setup and teardown methods that run
+    tests with locale.LC_NUMERIC set to a locale where commas (',') are used as
+    the decimal point instead of periods ('.'). On exit the locale is restored
+    to the initial locale. It also serves as context manager with the same
+    effect. If no such locale is available, the test is skipped.
+
+    .. versionadded:: 1.15.0
+
+    """
+    (cur_locale, tst_locale) = find_comma_decimal_point_locale()
+
+    def setup_method(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def teardown_method(self):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)
+
+    def __enter__(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def __exit__(self, type, value, traceback):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)

pllava/lib/python3.10/site-packages/numpy/core/tests/test_api.py

@@ -0,0 +1,615 @@
+import sys
+
+import numpy as np
+from numpy.core._rational_tests import rational
+import pytest
+from numpy.testing import (
+     assert_, assert_equal, assert_array_equal, assert_raises, assert_warns,
+     HAS_REFCOUNT
+    )
+
+
+def test_array_array():
+    tobj = type(object)
+    ones11 = np.ones((1, 1), np.float64)
+    tndarray = type(ones11)
+    # Test is_ndarray
+    assert_equal(np.array(ones11, dtype=np.float64), ones11)
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tndarray)
+        np.array(ones11)
+        assert_equal(old_refcount, sys.getrefcount(tndarray))
+
+    # test None
+    assert_equal(np.array(None, dtype=np.float64),
+                 np.array(np.nan, dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tobj)
+        np.array(None, dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(tobj))
+
+    # test scalar
+    assert_equal(np.array(1.0, dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(np.float64)
+        np.array(np.array(1.0, dtype=np.float64), dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(np.float64))
+
+    # test string
+    S2 = np.dtype((bytes, 2))
+    S3 = np.dtype((bytes, 3))
+    S5 = np.dtype((bytes, 5))
+    assert_equal(np.array(b"1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array(b"1.0").dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=bytes).dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=S2), np.array(b"1."))
+    assert_equal(np.array(b"1", dtype=S5), np.ones((), dtype=S5))
+
+    # test string
+    U2 = np.dtype((str, 2))
+    U3 = np.dtype((str, 3))
+    U5 = np.dtype((str, 5))
+    assert_equal(np.array("1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array("1.0").dtype, U3)
+    assert_equal(np.array("1.0", dtype=str).dtype, U3)
+    assert_equal(np.array("1.0", dtype=U2), np.array(str("1.")))
+    assert_equal(np.array("1", dtype=U5), np.ones((), dtype=U5))
+
+    builtins = getattr(__builtins__, '__dict__', __builtins__)
+    assert_(hasattr(builtins, 'get'))
+
+    # test memoryview
+    dat = np.array(memoryview(b'1.0'), dtype=np.float64)
+    assert_equal(dat, [49.0, 46.0, 48.0])
+    assert_(dat.dtype.type is np.float64)
+
+    dat = np.array(memoryview(b'1.0'))
+    assert_equal(dat, [49, 46, 48])
+    assert_(dat.dtype.type is np.uint8)
+
+    # test array interface
+    a = np.array(100.0, dtype=np.float64)
+    o = type("o", (object,),
+             dict(__array_interface__=a.__array_interface__))
+    assert_equal(np.array(o, dtype=np.float64), a)
+
+    # test array_struct interface
+    a = np.array([(1, 4.0, 'Hello'), (2, 6.0, 'World')],
+                 dtype=[('f0', int), ('f1', float), ('f2', str)])
+    o = type("o", (object,),
+             dict(__array_struct__=a.__array_struct__))
+    ## wasn't what I expected... is np.array(o) supposed to equal a ?
+    ## instead we get a array([...], dtype=">V18")
+    assert_equal(bytes(np.array(o).data), bytes(a.data))
+
+    # test array
+    o = type("o", (object,),
+             dict(__array__=lambda *x: np.array(100.0, dtype=np.float64)))()
+    assert_equal(np.array(o, dtype=np.float64), np.array(100.0, np.float64))
+
+    # test recursion
+    nested = 1.5
+    for i in range(np.MAXDIMS):
+        nested = [nested]
+
+    # no error
+    np.array(nested)
+
+    # Exceeds recursion limit
+    assert_raises(ValueError, np.array, [nested], dtype=np.float64)
+
+    # Try with lists...
+    # float32
+    assert_equal(np.array([None] * 10, dtype=np.float32),
+                 np.full((10,), np.nan, dtype=np.float32))
+    assert_equal(np.array([[None]] * 10, dtype=np.float32),
+                 np.full((10, 1), np.nan, dtype=np.float32))
+    assert_equal(np.array([[None] * 10], dtype=np.float32),
+                 np.full((1, 10), np.nan, dtype=np.float32))
+    assert_equal(np.array([[None] * 10] * 10, dtype=np.float32),
+                 np.full((10, 10), np.nan, dtype=np.float32))
+    # float64
+    assert_equal(np.array([None] * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None]] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array([1.0] * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([[1.0]] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+    # Try with tuples
+    assert_equal(np.array((None,) * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,)] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array((1.0,) * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([(1.0,)] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+@pytest.mark.parametrize("array", [True, False])
+def test_array_impossible_casts(array):
+    # All builtin types can be forcibly cast, at least theoretically,
+    # but user dtypes cannot necessarily.
+    rt = rational(1, 2)
+    if array:
+        rt = np.array(rt)
+    with assert_raises(TypeError):
+        np.array(rt, dtype="M8")
+
+
+# TODO: remove when fastCopyAndTranspose deprecation expires
+@pytest.mark.parametrize("a",
+    (
+        np.array(2),  # 0D array
+        np.array([3, 2, 7, 0]),  # 1D array
+        np.arange(6).reshape(2, 3)  # 2D array
+    ),
+)
+def test_fastCopyAndTranspose(a):
+    with pytest.deprecated_call():
+        b = np.fastCopyAndTranspose(a)
+        assert_equal(b, a.T)
+        assert b.flags.owndata
+
+
+def test_array_astype():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+    # Default behavior: allows unsafe casts, keeps memory layout,
+    #                   always copies.
+    b = a.astype('i4')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.strides, b.strides)
+    b = a.T.astype('i4')
+    assert_equal(a.T, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.T.strides, b.strides)
+    b = a.astype('f4')
+    assert_equal(a, b)
+    assert_(not (a is b))
+
+    # copy=False parameter can sometimes skip a copy
+    b = a.astype('f4', copy=False)
+    assert_(a is b)
+
+    # order parameter allows overriding of the memory layout,
+    # forcing a copy if the layout is wrong
+    b = a.astype('f4', order='F', copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(b.flags.f_contiguous)
+
+    b = a.astype('f4', order='C', copy=False)
+    assert_equal(a, b)
+    assert_(a is b)
+    assert_(b.flags.c_contiguous)
+
+    # casting parameter allows catching bad casts
+    b = a.astype('c8', casting='safe')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('c8'))
+
+    assert_raises(TypeError, a.astype, 'i4', casting='safe')
+
+    # subok=False passes through a non-subclassed array
+    b = a.astype('f4', subok=0, copy=False)
+    assert_(a is b)
+
+    class MyNDArray(np.ndarray):
+        pass
+
+    a = np.array([[0, 1, 2], [3, 4, 5]], dtype='f4').view(MyNDArray)
+
+    # subok=True passes through a subclass
+    b = a.astype('f4', subok=True, copy=False)
+    assert_(a is b)
+
+    # subok=True is default, and creates a subtype on a cast
+    b = a.astype('i4', copy=False)
+    assert_equal(a, b)
+    assert_equal(type(b), MyNDArray)
+
+    # subok=False never returns a subclass
+    b = a.astype('f4', subok=False, copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(type(b) is not MyNDArray)
+
+    # Make sure converting from string object to fixed length string
+    # does not truncate.
+    a = np.array([b'a'*100], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S100'))
+    a = np.array(['a'*100], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U100'))
+
+    # Same test as above but for strings shorter than 64 characters
+    a = np.array([b'a'*10], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S10'))
+    a = np.array(['a'*10], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U10'))
+
+    a = np.array(123456789012345678901234567890, dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='O').astype('U')
+    assert_array_equal(a, np.array('1234567890' * 3, dtype='U30'))
+
+    a = np.array([123456789012345678901234567890], dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array([123456789012345678901234567890], dtype='O').astype('U')
+    assert_array_equal(a, np.array('1234567890' * 3, dtype='U30'))
+
+    a = np.array(123456789012345678901234567890, dtype='S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='U')
+    assert_array_equal(a, np.array('1234567890' * 3, dtype='U30'))
+
+    a = np.array('a\u0140', dtype='U')
+    b = np.ndarray(buffer=a, dtype='uint32', shape=2)
+    assert_(b.size == 2)
+
+    a = np.array([1000], dtype='i4')
+    assert_raises(TypeError, a.astype, 'S1', casting='safe')
+
+    a = np.array(1000, dtype='i4')
+    assert_raises(TypeError, a.astype, 'U1', casting='safe')
+
+    # gh-24023
+    assert_raises(TypeError, a.astype)
+
+@pytest.mark.parametrize("dt", ["S", "U"])
+def test_array_astype_to_string_discovery_empty(dt):
+    # See also gh-19085
+    arr = np.array([""], dtype=object)
+    # Note, the itemsize is the `0 -> 1` logic, which should change.
+    # The important part the test is rather that it does not error.
+    assert arr.astype(dt).dtype.itemsize == np.dtype(f"{dt}1").itemsize
+
+    # check the same thing for `np.can_cast` (since it accepts arrays)
+    assert np.can_cast(arr, dt, casting="unsafe")
+    assert not np.can_cast(arr, dt, casting="same_kind")
+    # as well as for the object as a descriptor:
+    assert np.can_cast("O", dt, casting="unsafe")
+
+@pytest.mark.parametrize("dt", ["d", "f", "S13", "U32"])
+def test_array_astype_to_void(dt):
+    dt = np.dtype(dt)
+    arr = np.array([], dtype=dt)
+    assert arr.astype("V").dtype.itemsize == dt.itemsize
+
+def test_object_array_astype_to_void():
+    # This is different to `test_array_astype_to_void` as object arrays
+    # are inspected.  The default void is "V8" (8 is the length of double)
+    arr = np.array([], dtype="O").astype("V")
+    assert arr.dtype == "V8"
+
+@pytest.mark.parametrize("t",
+    np.sctypes['uint'] + np.sctypes['int'] + np.sctypes['float']
+)
+def test_array_astype_warning(t):
+    # test ComplexWarning when casting from complex to float or int
+    a = np.array(10, dtype=np.complex_)
+    assert_warns(np.ComplexWarning, a.astype, t)
+
+@pytest.mark.parametrize(["dtype", "out_dtype"],
+        [(np.bytes_, np.bool_),
+         (np.str_, np.bool_),
+         (np.dtype("S10,S9"), np.dtype("?,?"))])
+def test_string_to_boolean_cast(dtype, out_dtype):
+    """
+    Currently, for `astype` strings are cast to booleans effectively by
+    calling `bool(int(string)`. This is not consistent (see gh-9875) and
+    will eventually be deprecated.
+    """
+    arr = np.array(["10", "10\0\0\0", "0\0\0", "0"], dtype=dtype)
+    expected = np.array([True, True, False, False], dtype=out_dtype)
+    assert_array_equal(arr.astype(out_dtype), expected)
+
+@pytest.mark.parametrize(["dtype", "out_dtype"],
+        [(np.bytes_, np.bool_),
+         (np.str_, np.bool_),
+         (np.dtype("S10,S9"), np.dtype("?,?"))])
+def test_string_to_boolean_cast_errors(dtype, out_dtype):
+    """
+    These currently error out, since cast to integers fails, but should not
+    error out in the future.
+    """
+    for invalid in ["False", "True", "", "\0", "non-empty"]:
+        arr = np.array([invalid], dtype=dtype)
+        with assert_raises(ValueError):
+            arr.astype(out_dtype)
+
+@pytest.mark.parametrize("str_type", [str, bytes, np.str_, np.unicode_])
+@pytest.mark.parametrize("scalar_type",
+        [np.complex64, np.complex128, np.clongdouble])
+def test_string_to_complex_cast(str_type, scalar_type):
+    value = scalar_type(b"1+3j")
+    assert scalar_type(value) == 1+3j
+    assert np.array([value], dtype=object).astype(scalar_type)[()] == 1+3j
+    assert np.array(value).astype(scalar_type)[()] == 1+3j
+    arr = np.zeros(1, dtype=scalar_type)
+    arr[0] = value
+    assert arr[0] == 1+3j
+
+@pytest.mark.parametrize("dtype", np.typecodes["AllFloat"])
+def test_none_to_nan_cast(dtype):
+    # Note that at the time of writing this test, the scalar constructors
+    # reject None
+    arr = np.zeros(1, dtype=dtype)
+    arr[0] = None
+    assert np.isnan(arr)[0]
+    assert np.isnan(np.array(None, dtype=dtype))[()]
+    assert np.isnan(np.array([None], dtype=dtype))[0]
+    assert np.isnan(np.array(None).astype(dtype))[()]
+
+def test_copyto_fromscalar():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, 1.5)
+    assert_equal(a, 1.5)
+    np.copyto(a.T, 2.5)
+    assert_equal(a, 2.5)
+
+    # Where-masked copy
+    mask = np.array([[0, 1, 0], [0, 0, 1]], dtype='?')
+    np.copyto(a, 3.5, where=mask)
+    assert_equal(a, [[2.5, 3.5, 2.5], [2.5, 2.5, 3.5]])
+    mask = np.array([[0, 1], [1, 1], [1, 0]], dtype='?')
+    np.copyto(a.T, 4.5, where=mask)
+    assert_equal(a, [[2.5, 4.5, 4.5], [4.5, 4.5, 3.5]])
+
+def test_copyto():
+    a = np.arange(6, dtype='i4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, [[3, 1, 5], [6, 2, 1]])
+    assert_equal(a, [[3, 1, 5], [6, 2, 1]])
+
+    # Overlapping copy should work
+    np.copyto(a[:, :2], a[::-1, 1::-1])
+    assert_equal(a, [[2, 6, 5], [1, 3, 1]])
+
+    # Defaults to 'same_kind' casting
+    assert_raises(TypeError, np.copyto, a, 1.5)
+
+    # Force a copy with 'unsafe' casting, truncating 1.5 to 1
+    np.copyto(a, 1.5, casting='unsafe')
+    assert_equal(a, 1)
+
+    # Copying with a mask
+    np.copyto(a, 3, where=[True, False, True])
+    assert_equal(a, [[3, 1, 3], [3, 1, 3]])
+
+    # Casting rule still applies with a mask
+    assert_raises(TypeError, np.copyto, a, 3.5, where=[True, False, True])
+
+    # Lists of integer 0's and 1's is ok too
+    np.copyto(a, 4.0, casting='unsafe', where=[[0, 1, 1], [1, 0, 0]])
+    assert_equal(a, [[3, 4, 4], [4, 1, 3]])
+
+    # Overlapping copy with mask should work
+    np.copyto(a[:, :2], a[::-1, 1::-1], where=[[0, 1], [1, 1]])
+    assert_equal(a, [[3, 4, 4], [4, 3, 3]])
+
+    # 'dst' must be an array
+    assert_raises(TypeError, np.copyto, [1, 2, 3], [2, 3, 4])
+
+def test_copyto_permut():
+    # test explicit overflow case
+    pad = 500
+    l = [True] * pad + [True, True, True, True]
+    r = np.zeros(len(l)-pad)
+    d = np.ones(len(l)-pad)
+    mask = np.array(l)[pad:]
+    np.copyto(r, d, where=mask[::-1])
+
+    # test all permutation of possible masks, 9 should be sufficient for
+    # current 4 byte unrolled code
+    power = 9
+    d = np.ones(power)
+    for i in range(2**power):
+        r = np.zeros(power)
+        l = [(i & x) != 0 for x in range(power)]
+        mask = np.array(l)
+        np.copyto(r, d, where=mask)
+        assert_array_equal(r == 1, l)
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r, d, where=mask[::-1])
+        assert_array_equal(r == 1, l[::-1])
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::2])
+        assert_array_equal(r[::2] == 1, l[::2])
+        assert_equal(r[::2].sum(), sum(l[::2]))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::-2])
+        assert_array_equal(r[::2] == 1, l[::-2])
+        assert_equal(r[::2].sum(), sum(l[::-2]))
+
+        for c in [0xFF, 0x7F, 0x02, 0x10]:
+            r = np.zeros(power)
+            mask = np.array(l)
+            imask = np.array(l).view(np.uint8)
+            imask[mask != 0] = c
+            np.copyto(r, d, where=mask)
+            assert_array_equal(r == 1, l)
+            assert_equal(r.sum(), sum(l))
+
+    r = np.zeros(power)
+    np.copyto(r, d, where=True)
+    assert_equal(r.sum(), r.size)
+    r = np.ones(power)
+    d = np.zeros(power)
+    np.copyto(r, d, where=False)
+    assert_equal(r.sum(), r.size)
+
+def test_copy_order():
+    a = np.arange(24).reshape(2, 1, 3, 4)
+    b = a.copy(order='F')
+    c = np.arange(24).reshape(2, 1, 4, 3).swapaxes(2, 3)
+
+    def check_copy_result(x, y, ccontig, fcontig, strides=False):
+        assert_(not (x is y))
+        assert_equal(x, y)
+        assert_equal(res.flags.c_contiguous, ccontig)
+        assert_equal(res.flags.f_contiguous, fcontig)
+
+    # Validate the initial state of a, b, and c
+    assert_(a.flags.c_contiguous)
+    assert_(not a.flags.f_contiguous)
+    assert_(not b.flags.c_contiguous)
+    assert_(b.flags.f_contiguous)
+    assert_(not c.flags.c_contiguous)
+    assert_(not c.flags.f_contiguous)
+
+    # Copy with order='C'
+    res = a.copy(order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = c.copy(order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(a, order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(c, order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+
+    # Copy with order='F'
+    res = a.copy(order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = b.copy(order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(a, order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(b, order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+
+    # Copy with order='K'
+    res = a.copy(order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+    res = np.copy(a, order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+
+def test_contiguous_flags():
+    a = np.ones((4, 4, 1))[::2,:,:]
+    a.strides = a.strides[:2] + (-123,)
+    b = np.ones((2, 2, 1, 2, 2)).swapaxes(3, 4)
+
+    def check_contig(a, ccontig, fcontig):
+        assert_(a.flags.c_contiguous == ccontig)
+        assert_(a.flags.f_contiguous == fcontig)
+
+    # Check if new arrays are correct:
+    check_contig(a, False, False)
+    check_contig(b, False, False)
+    check_contig(np.empty((2, 2, 0, 2, 2)), True, True)
+    check_contig(np.array([[[1], [2]]], order='F'), True, True)
+    check_contig(np.empty((2, 2)), True, False)
+    check_contig(np.empty((2, 2), order='F'), False, True)
+
+    # Check that np.array creates correct contiguous flags:
+    check_contig(np.array(a, copy=False), False, False)
+    check_contig(np.array(a, copy=False, order='C'), True, False)
+    check_contig(np.array(a, ndmin=4, copy=False, order='F'), False, True)
+
+    # Check slicing update of flags and :
+    check_contig(a[0], True, True)
+    check_contig(a[None, ::4, ..., None], True, True)
+    check_contig(b[0, 0, ...], False, True)
+    check_contig(b[:, :, 0:0, :, :], True, True)
+
+    # Test ravel and squeeze.
+    check_contig(a.ravel(), True, True)
+    check_contig(np.ones((1, 3, 1)).squeeze(), True, True)
+
+def test_broadcast_arrays():
+    # Test user defined dtypes
+    a = np.array([(1, 2, 3)], dtype='u4,u4,u4')
+    b = np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4')
+    result = np.broadcast_arrays(a, b)
+    assert_equal(result[0], np.array([(1, 2, 3), (1, 2, 3), (1, 2, 3)], dtype='u4,u4,u4'))
+    assert_equal(result[1], np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4'))
+
+@pytest.mark.parametrize(["shape", "fill_value", "expected_output"],
+        [((2, 2), [5.0,  6.0], np.array([[5.0, 6.0], [5.0, 6.0]])),
+         ((3, 2), [1.0,  2.0], np.array([[1.0, 2.0], [1.0, 2.0], [1.0,  2.0]]))])
+def test_full_from_list(shape, fill_value, expected_output):
+    output = np.full(shape, fill_value)
+    assert_equal(output, expected_output)
+
+def test_astype_copyflag():
+    # test the various copyflag options
+    arr = np.arange(10, dtype=np.intp)
+
+    res_true = arr.astype(np.intp, copy=True)
+    assert not np.may_share_memory(arr, res_true)
+    res_always = arr.astype(np.intp, copy=np._CopyMode.ALWAYS)
+    assert not np.may_share_memory(arr, res_always)
+
+    res_false = arr.astype(np.intp, copy=False)
+    # `res_false is arr` currently, but check `may_share_memory`.
+    assert np.may_share_memory(arr, res_false)
+    res_if_needed = arr.astype(np.intp, copy=np._CopyMode.IF_NEEDED)
+    # `res_if_needed is arr` currently, but check `may_share_memory`.
+    assert np.may_share_memory(arr, res_if_needed)
+
+    res_never = arr.astype(np.intp, copy=np._CopyMode.NEVER)
+    assert np.may_share_memory(arr, res_never)
+
+    # Simple tests for when a copy is necessary:
+    res_false = arr.astype(np.float64, copy=False)
+    assert_array_equal(res_false, arr)
+    res_if_needed = arr.astype(np.float64, 
+                               copy=np._CopyMode.IF_NEEDED)
+    assert_array_equal(res_if_needed, arr)
+    assert_raises(ValueError, arr.astype, np.float64,
+                  copy=np._CopyMode.NEVER)

pllava/lib/python3.10/site-packages/numpy/core/tests/test_array_coercion.py

@@ -0,0 +1,898 @@
+"""
+Tests for array coercion, mainly through testing `np.array` results directly.
+Note that other such tests exist, e.g., in `test_api.py` and many corner-cases
+are tested (sometimes indirectly) elsewhere.
+"""
+
+from itertools import permutations, product
+
+import pytest
+from pytest import param
+
+import numpy as np
+from numpy.core._rational_tests import rational
+from numpy.core._multiarray_umath import _discover_array_parameters
+
+from numpy.testing import (
+    assert_array_equal, assert_warns, IS_PYPY)
+
+
+def arraylikes():
+    """
+    Generator for functions converting an array into various array-likes.
+    If full is True (default) it includes array-likes not capable of handling
+    all dtypes.
+    """
+    # base array:
+    def ndarray(a):
+        return a
+
+    yield param(ndarray, id="ndarray")
+
+    # subclass:
+    class MyArr(np.ndarray):
+        pass
+
+    def subclass(a):
+        return a.view(MyArr)
+
+    yield subclass
+
+    class _SequenceLike():
+        # Older NumPy versions, sometimes cared whether a protocol array was
+        # also _SequenceLike.  This shouldn't matter, but keep it for now
+        # for __array__ and not the others.
+        def __len__(self):
+            raise TypeError
+
+        def __getitem__(self):
+            raise TypeError
+
+    # Array-interface
+    class ArrayDunder(_SequenceLike):
+        def __init__(self, a):
+            self.a = a
+
+        def __array__(self, dtype=None):
+            return self.a
+
+    yield param(ArrayDunder, id="__array__")
+
+    # memory-view
+    yield param(memoryview, id="memoryview")
+
+    # Array-interface
+    class ArrayInterface:
+        def __init__(self, a):
+            self.a = a  # need to hold on to keep interface valid
+            self.__array_interface__ = a.__array_interface__
+
+    yield param(ArrayInterface, id="__array_interface__")
+
+    # Array-Struct
+    class ArrayStruct:
+        def __init__(self, a):
+            self.a = a  # need to hold on to keep struct valid
+            self.__array_struct__ = a.__array_struct__
+
+    yield param(ArrayStruct, id="__array_struct__")
+
+
+def scalar_instances(times=True, extended_precision=True, user_dtype=True):
+    # Hard-coded list of scalar instances.
+    # Floats:
+    yield param(np.sqrt(np.float16(5)), id="float16")
+    yield param(np.sqrt(np.float32(5)), id="float32")
+    yield param(np.sqrt(np.float64(5)), id="float64")
+    if extended_precision:
+        yield param(np.sqrt(np.longdouble(5)), id="longdouble")
+
+    # Complex:
+    yield param(np.sqrt(np.complex64(2+3j)), id="complex64")
+    yield param(np.sqrt(np.complex128(2+3j)), id="complex128")
+    if extended_precision:
+        yield param(np.sqrt(np.longcomplex(2+3j)), id="clongdouble")
+
+    # Bool:
+    # XFAIL: Bool should be added, but has some bad properties when it
+    # comes to strings, see also gh-9875
+    # yield param(np.bool_(0), id="bool")
+
+    # Integers:
+    yield param(np.int8(2), id="int8")
+    yield param(np.int16(2), id="int16")
+    yield param(np.int32(2), id="int32")
+    yield param(np.int64(2), id="int64")
+
+    yield param(np.uint8(2), id="uint8")
+    yield param(np.uint16(2), id="uint16")
+    yield param(np.uint32(2), id="uint32")
+    yield param(np.uint64(2), id="uint64")
+
+    # Rational:
+    if user_dtype:
+        yield param(rational(1, 2), id="rational")
+
+    # Cannot create a structured void scalar directly:
+    structured = np.array([(1, 3)], "i,i")[0]
+    assert isinstance(structured, np.void)
+    assert structured.dtype == np.dtype("i,i")
+    yield param(structured, id="structured")
+
+    if times:
+        # Datetimes and timedelta
+        yield param(np.timedelta64(2), id="timedelta64[generic]")
+        yield param(np.timedelta64(23, "s"), id="timedelta64[s]")
+        yield param(np.timedelta64("NaT", "s"), id="timedelta64[s](NaT)")
+
+        yield param(np.datetime64("NaT"), id="datetime64[generic](NaT)")
+        yield param(np.datetime64("2020-06-07 12:43", "ms"), id="datetime64[ms]")
+
+    # Strings and unstructured void:
+    yield param(np.bytes_(b"1234"), id="bytes")
+    yield param(np.str_("2345"), id="unicode")
+    yield param(np.void(b"4321"), id="unstructured_void")
+
+
+def is_parametric_dtype(dtype):
+    """Returns True if the dtype is a parametric legacy dtype (itemsize
+    is 0, or a datetime without units)
+    """
+    if dtype.itemsize == 0:
+        return True
+    if issubclass(dtype.type, (np.datetime64, np.timedelta64)):
+        if dtype.name.endswith("64"):
+            # Generic time units
+            return True
+    return False
+
+
+class TestStringDiscovery:
+    @pytest.mark.parametrize("obj",
+            [object(), 1.2, 10**43, None, "string"],
+            ids=["object", "1.2", "10**43", "None", "string"])
+    def test_basic_stringlength(self, obj):
+        length = len(str(obj))
+        expected = np.dtype(f"S{length}")
+
+        assert np.array(obj, dtype="S").dtype == expected
+        assert np.array([obj], dtype="S").dtype == expected
+
+        # A nested array is also discovered correctly
+        arr = np.array(obj, dtype="O")
+        assert np.array(arr, dtype="S").dtype == expected
+        # Also if we use the dtype class
+        assert np.array(arr, dtype=type(expected)).dtype == expected
+        # Check that .astype() behaves identical
+        assert arr.astype("S").dtype == expected
+        # The DType class is accepted by `.astype()`
+        assert arr.astype(type(np.dtype("S"))).dtype == expected
+
+    @pytest.mark.parametrize("obj",
+            [object(), 1.2, 10**43, None, "string"],
+            ids=["object", "1.2", "10**43", "None", "string"])
+    def test_nested_arrays_stringlength(self, obj):
+        length = len(str(obj))
+        expected = np.dtype(f"S{length}")
+        arr = np.array(obj, dtype="O")
+        assert np.array([arr, arr], dtype="S").dtype == expected
+
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_unpack_first_level(self, arraylike):
+        # We unpack exactly one level of array likes
+        obj = np.array([None])
+        obj[0] = np.array(1.2)
+        # the length of the included item, not of the float dtype
+        length = len(str(obj[0]))
+        expected = np.dtype(f"S{length}")
+
+        obj = arraylike(obj)
+        # casting to string usually calls str(obj)
+        arr = np.array([obj], dtype="S")
+        assert arr.shape == (1, 1)
+        assert arr.dtype == expected
+
+
+class TestScalarDiscovery:
+    def test_void_special_case(self):
+        # Void dtypes with structures discover tuples as elements
+        arr = np.array((1, 2, 3), dtype="i,i,i")
+        assert arr.shape == ()
+        arr = np.array([(1, 2, 3)], dtype="i,i,i")
+        assert arr.shape == (1,)
+
+    def test_char_special_case(self):
+        arr = np.array("string", dtype="c")
+        assert arr.shape == (6,)
+        assert arr.dtype.char == "c"
+        arr = np.array(["string"], dtype="c")
+        assert arr.shape == (1, 6)
+        assert arr.dtype.char == "c"
+
+    def test_char_special_case_deep(self):
+        # Check that the character special case errors correctly if the
+        # array is too deep:
+        nested = ["string"]  # 2 dimensions (due to string being sequence)
+        for i in range(np.MAXDIMS - 2):
+            nested = [nested]
+
+        arr = np.array(nested, dtype='c')
+        assert arr.shape == (1,) * (np.MAXDIMS - 1) + (6,)
+        with pytest.raises(ValueError):
+            np.array([nested], dtype="c")
+
+    def test_unknown_object(self):
+        arr = np.array(object())
+        assert arr.shape == ()
+        assert arr.dtype == np.dtype("O")
+
+    @pytest.mark.parametrize("scalar", scalar_instances())
+    def test_scalar(self, scalar):
+        arr = np.array(scalar)
+        assert arr.shape == ()
+        assert arr.dtype == scalar.dtype
+
+        arr = np.array([[scalar, scalar]])
+        assert arr.shape == (1, 2)
+        assert arr.dtype == scalar.dtype
+
+    # Additionally to string this test also runs into a corner case
+    # with datetime promotion (the difference is the promotion order).
+    @pytest.mark.filterwarnings("ignore:Promotion of numbers:FutureWarning")
+    def test_scalar_promotion(self):
+        for sc1, sc2 in product(scalar_instances(), scalar_instances()):
+            sc1, sc2 = sc1.values[0], sc2.values[0]
+            # test all combinations:
+            try:
+                arr = np.array([sc1, sc2])
+            except (TypeError, ValueError):
+                # The promotion between two times can fail
+                # XFAIL (ValueError): Some object casts are currently undefined
+                continue
+            assert arr.shape == (2,)
+            try:
+                dt1, dt2 = sc1.dtype, sc2.dtype
+                expected_dtype = np.promote_types(dt1, dt2)
+                assert arr.dtype == expected_dtype
+            except TypeError as e:
+                # Will currently always go to object dtype
+                assert arr.dtype == np.dtype("O")
+
+    @pytest.mark.parametrize("scalar", scalar_instances())
+    def test_scalar_coercion(self, scalar):
+        # This tests various scalar coercion paths, mainly for the numerical
+        # types. It includes some paths not directly related to `np.array`.
+        if isinstance(scalar, np.inexact):
+            # Ensure we have a full-precision number if available
+            scalar = type(scalar)((scalar * 2)**0.5)
+
+        if type(scalar) is rational:
+            # Rational generally fails due to a missing cast. In the future
+            # object casts should automatically be defined based on `setitem`.
+            pytest.xfail("Rational to object cast is undefined currently.")
+
+        # Use casting from object:
+        arr = np.array(scalar, dtype=object).astype(scalar.dtype)
+
+        # Test various ways to create an array containing this scalar:
+        arr1 = np.array(scalar).reshape(1)
+        arr2 = np.array([scalar])
+        arr3 = np.empty(1, dtype=scalar.dtype)
+        arr3[0] = scalar
+        arr4 = np.empty(1, dtype=scalar.dtype)
+        arr4[:] = [scalar]
+        # All of these methods should yield the same results
+        assert_array_equal(arr, arr1)
+        assert_array_equal(arr, arr2)
+        assert_array_equal(arr, arr3)
+        assert_array_equal(arr, arr4)
+
+    @pytest.mark.xfail(IS_PYPY, reason="`int(np.complex128(3))` fails on PyPy")
+    @pytest.mark.filterwarnings("ignore::numpy.ComplexWarning")
+    @pytest.mark.parametrize("cast_to", scalar_instances())
+    def test_scalar_coercion_same_as_cast_and_assignment(self, cast_to):
+        """
+        Test that in most cases:
+           * `np.array(scalar, dtype=dtype)`
+           * `np.empty((), dtype=dtype)[()] = scalar`
+           * `np.array(scalar).astype(dtype)`
+        should behave the same.  The only exceptions are parametric dtypes
+        (mainly datetime/timedelta without unit) and void without fields.
+        """
+        dtype = cast_to.dtype  # use to parametrize only the target dtype
+
+        for scalar in scalar_instances(times=False):
+            scalar = scalar.values[0]
+
+            if dtype.type == np.void:
+               if scalar.dtype.fields is not None and dtype.fields is None:
+                    # Here, coercion to "V6" works, but the cast fails.
+                    # Since the types are identical, SETITEM takes care of
+                    # this, but has different rules than the cast.
+                    with pytest.raises(TypeError):
+                        np.array(scalar).astype(dtype)
+                    np.array(scalar, dtype=dtype)
+                    np.array([scalar], dtype=dtype)
+                    continue
+
+            # The main test, we first try to use casting and if it succeeds
+            # continue below testing that things are the same, otherwise
+            # test that the alternative paths at least also fail.
+            try:
+                cast = np.array(scalar).astype(dtype)
+            except (TypeError, ValueError, RuntimeError):
+                # coercion should also raise (error type may change)
+                with pytest.raises(Exception):
+                    np.array(scalar, dtype=dtype)
+
+                if (isinstance(scalar, rational) and
+                        np.issubdtype(dtype, np.signedinteger)):
+                    return
+
+                with pytest.raises(Exception):
+                    np.array([scalar], dtype=dtype)
+                # assignment should also raise
+                res = np.zeros((), dtype=dtype)
+                with pytest.raises(Exception):
+                    res[()] = scalar
+
+                return
+
+            # Non error path:
+            arr = np.array(scalar, dtype=dtype)
+            assert_array_equal(arr, cast)
+            # assignment behaves the same
+            ass = np.zeros((), dtype=dtype)
+            ass[()] = scalar
+            assert_array_equal(ass, cast)
+
+    @pytest.mark.parametrize("pyscalar", [10, 10.32, 10.14j, 10**100])
+    def test_pyscalar_subclasses(self, pyscalar):
+        """NumPy arrays are read/write which means that anything but invariant
+        behaviour is on thin ice.  However, we currently are happy to discover
+        subclasses of Python float, int, complex the same as the base classes.
+        This should potentially be deprecated.
+        """
+        class MyScalar(type(pyscalar)):
+            pass
+
+        res = np.array(MyScalar(pyscalar))
+        expected = np.array(pyscalar)
+        assert_array_equal(res, expected)
+
+    @pytest.mark.parametrize("dtype_char", np.typecodes["All"])
+    def test_default_dtype_instance(self, dtype_char):
+        if dtype_char in "SU":
+            dtype = np.dtype(dtype_char + "1")
+        elif dtype_char == "V":
+            # Legacy behaviour was to use V8. The reason was float64 being the
+            # default dtype and that having 8 bytes.
+            dtype = np.dtype("V8")
+        else:
+            dtype = np.dtype(dtype_char)
+
+        discovered_dtype, _ = _discover_array_parameters([], type(dtype))
+
+        assert discovered_dtype == dtype
+        assert discovered_dtype.itemsize == dtype.itemsize
+
+    @pytest.mark.parametrize("dtype", np.typecodes["Integer"])
+    @pytest.mark.parametrize(["scalar", "error"],
+            [(np.float64(np.nan), ValueError),
+             (np.array(-1).astype(np.ulonglong)[()], OverflowError)])
+    def test_scalar_to_int_coerce_does_not_cast(self, dtype, scalar, error):
+        """
+        Signed integers are currently different in that they do not cast other
+        NumPy scalar, but instead use scalar.__int__(). The hardcoded
+        exception to this rule is `np.array(scalar, dtype=integer)`.
+        """
+        dtype = np.dtype(dtype)
+
+        # This is a special case using casting logic. It warns for the NaN
+        # but allows the cast (giving undefined behaviour).
+        with np.errstate(invalid="ignore"):
+            coerced = np.array(scalar, dtype=dtype)
+            cast = np.array(scalar).astype(dtype)
+        assert_array_equal(coerced, cast)
+
+        # However these fail:
+        with pytest.raises(error):
+            np.array([scalar], dtype=dtype)
+        with pytest.raises(error):
+            cast[()] = scalar
+
+
+class TestTimeScalars:
+    @pytest.mark.parametrize("dtype", [np.int64, np.float32])
+    @pytest.mark.parametrize("scalar",
+            [param(np.timedelta64("NaT", "s"), id="timedelta64[s](NaT)"),
+             param(np.timedelta64(123, "s"), id="timedelta64[s]"),
+             param(np.datetime64("NaT", "generic"), id="datetime64[generic](NaT)"),
+             param(np.datetime64(1, "D"), id="datetime64[D]")],)
+    def test_coercion_basic(self, dtype, scalar):
+        # Note the `[scalar]` is there because np.array(scalar) uses stricter
+        # `scalar.__int__()` rules for backward compatibility right now.
+        arr = np.array(scalar, dtype=dtype)
+        cast = np.array(scalar).astype(dtype)
+        assert_array_equal(arr, cast)
+
+        ass = np.ones((), dtype=dtype)
+        if issubclass(dtype, np.integer):
+            with pytest.raises(TypeError):
+                # raises, as would np.array([scalar], dtype=dtype), this is
+                # conversion from times, but behaviour of integers.
+                ass[()] = scalar
+        else:
+            ass[()] = scalar
+            assert_array_equal(ass, cast)
+
+    @pytest.mark.parametrize("dtype", [np.int64, np.float32])
+    @pytest.mark.parametrize("scalar",
+            [param(np.timedelta64(123, "ns"), id="timedelta64[ns]"),
+             param(np.timedelta64(12, "generic"), id="timedelta64[generic]")])
+    def test_coercion_timedelta_convert_to_number(self, dtype, scalar):
+        # Only "ns" and "generic" timedeltas can be converted to numbers
+        # so these are slightly special.
+        arr = np.array(scalar, dtype=dtype)
+        cast = np.array(scalar).astype(dtype)
+        ass = np.ones((), dtype=dtype)
+        ass[()] = scalar  # raises, as would np.array([scalar], dtype=dtype)
+
+        assert_array_equal(arr, cast)
+        assert_array_equal(cast, cast)
+
+    @pytest.mark.parametrize("dtype", ["S6", "U6"])
+    @pytest.mark.parametrize(["val", "unit"],
+            [param(123, "s", id="[s]"), param(123, "D", id="[D]")])
+    def test_coercion_assignment_datetime(self, val, unit, dtype):
+        # String from datetime64 assignment is currently special cased to
+        # never use casting.  This is because casting will error in this
+        # case, and traditionally in most cases the behaviour is maintained
+        # like this.  (`np.array(scalar, dtype="U6")` would have failed before)
+        # TODO: This discrepancy _should_ be resolved, either by relaxing the
+        #       cast, or by deprecating the first part.
+        scalar = np.datetime64(val, unit)
+        dtype = np.dtype(dtype)
+        cut_string = dtype.type(str(scalar)[:6])
+
+        arr = np.array(scalar, dtype=dtype)
+        assert arr[()] == cut_string
+        ass = np.ones((), dtype=dtype)
+        ass[()] = scalar
+        assert ass[()] == cut_string
+
+        with pytest.raises(RuntimeError):
+            # However, unlike the above assignment using `str(scalar)[:6]`
+            # due to being handled by the string DType and not be casting
+            # the explicit cast fails:
+            np.array(scalar).astype(dtype)
+
+
+    @pytest.mark.parametrize(["val", "unit"],
+            [param(123, "s", id="[s]"), param(123, "D", id="[D]")])
+    def test_coercion_assignment_timedelta(self, val, unit):
+        scalar = np.timedelta64(val, unit)
+
+        # Unlike datetime64, timedelta allows the unsafe cast:
+        np.array(scalar, dtype="S6")
+        cast = np.array(scalar).astype("S6")
+        ass = np.ones((), dtype="S6")
+        ass[()] = scalar
+        expected = scalar.astype("S")[:6]
+        assert cast[()] == expected
+        assert ass[()] == expected
+
+class TestNested:
+    def test_nested_simple(self):
+        initial = [1.2]
+        nested = initial
+        for i in range(np.MAXDIMS - 1):
+            nested = [nested]
+
+        arr = np.array(nested, dtype="float64")
+        assert arr.shape == (1,) * np.MAXDIMS
+        with pytest.raises(ValueError):
+            np.array([nested], dtype="float64")
+
+        with pytest.raises(ValueError, match=".*would exceed the maximum"):
+            np.array([nested])  # user must ask for `object` explicitly
+
+        arr = np.array([nested], dtype=object)
+        assert arr.dtype == np.dtype("O")
+        assert arr.shape == (1,) * np.MAXDIMS
+        assert arr.item() is initial
+
+    def test_pathological_self_containing(self):
+        # Test that this also works for two nested sequences
+        l = []
+        l.append(l)
+        arr = np.array([l, l, l], dtype=object)
+        assert arr.shape == (3,) + (1,) * (np.MAXDIMS - 1)
+
+        # Also check a ragged case:
+        arr = np.array([l, [None], l], dtype=object)
+        assert arr.shape == (3, 1)
+
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_nested_arraylikes(self, arraylike):
+        # We try storing an array like into an array, but the array-like
+        # will have too many dimensions.  This means the shape discovery
+        # decides that the array-like must be treated as an object (a special
+        # case of ragged discovery).  The result will be an array with one
+        # dimension less than the maximum dimensions, and the array being
+        # assigned to it (which does work for object or if `float(arraylike)`
+        # works).
+        initial = arraylike(np.ones((1, 1)))
+
+        nested = initial
+        for i in range(np.MAXDIMS - 1):
+            nested = [nested]
+
+        with pytest.raises(ValueError, match=".*would exceed the maximum"):
+            # It will refuse to assign the array into
+            np.array(nested, dtype="float64")
+
+        # If this is object, we end up assigning a (1, 1) array into (1,)
+        # (due to running out of dimensions), this is currently supported but
+        # a special case which is not ideal.
+        arr = np.array(nested, dtype=object)
+        assert arr.shape == (1,) * np.MAXDIMS
+        assert arr.item() == np.array(initial).item()
+
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_uneven_depth_ragged(self, arraylike):
+        arr = np.arange(4).reshape((2, 2))
+        arr = arraylike(arr)
+
+        # Array is ragged in the second dimension already:
+        out = np.array([arr, [arr]], dtype=object)
+        assert out.shape == (2,)
+        assert out[0] is arr
+        assert type(out[1]) is list
+
+        # Array is ragged in the third dimension:
+        with pytest.raises(ValueError):
+            # This is a broadcast error during assignment, because
+            # the array shape would be (2, 2, 2) but `arr[0, 0] = arr` fails.
+            np.array([arr, [arr, arr]], dtype=object)
+
+    def test_empty_sequence(self):
+        arr = np.array([[], [1], [[1]]], dtype=object)
+        assert arr.shape == (3,)
+
+        # The empty sequence stops further dimension discovery, so the
+        # result shape will be (0,) which leads to an error during:
+        with pytest.raises(ValueError):
+            np.array([[], np.empty((0, 1))], dtype=object)
+
+    def test_array_of_different_depths(self):
+        # When multiple arrays (or array-likes) are included in a
+        # sequences and have different depth, we currently discover
+        # as many dimensions as they share. (see also gh-17224)
+        arr = np.zeros((3, 2))
+        mismatch_first_dim = np.zeros((1, 2))
+        mismatch_second_dim = np.zeros((3, 3))
+
+        dtype, shape = _discover_array_parameters(
+            [arr, mismatch_second_dim], dtype=np.dtype("O"))
+        assert shape == (2, 3)
+
+        dtype, shape = _discover_array_parameters(
+            [arr, mismatch_first_dim], dtype=np.dtype("O"))
+        assert shape == (2,)
+        # The second case is currently supported because the arrays
+        # can be stored as objects:
+        res = np.asarray([arr, mismatch_first_dim], dtype=np.dtype("O"))
+        assert res[0] is arr
+        assert res[1] is mismatch_first_dim
+
+
+class TestBadSequences:
+    # These are tests for bad objects passed into `np.array`, in general
+    # these have undefined behaviour.  In the old code they partially worked
+    # when now they will fail.  We could (and maybe should) create a copy
+    # of all sequences to be safe against bad-actors.
+
+    def test_growing_list(self):
+        # List to coerce, `mylist` will append to it during coercion
+        obj = []
+        class mylist(list):
+            def __len__(self):
+                obj.append([1, 2])
+                return super().__len__()
+
+        obj.append(mylist([1, 2]))
+
+        with pytest.raises(RuntimeError):
+            np.array(obj)
+
+    # Note: We do not test a shrinking list.  These do very evil things
+    #       and the only way to fix them would be to copy all sequences.
+    #       (which may be a real option in the future).
+
+    def test_mutated_list(self):
+        # List to coerce, `mylist` will mutate the first element
+        obj = []
+        class mylist(list):
+            def __len__(self):
+                obj[0] = [2, 3]  # replace with a different list.
+                return super().__len__()
+
+        obj.append([2, 3])
+        obj.append(mylist([1, 2]))
+        # Does not crash:
+        np.array(obj)
+
+    def test_replace_0d_array(self):
+        # List to coerce, `mylist` will mutate the first element
+        obj = []
+        class baditem:
+            def __len__(self):
+                obj[0][0] = 2  # replace with a different list.
+                raise ValueError("not actually a sequence!")
+
+            def __getitem__(self):
+                pass
+
+        # Runs into a corner case in the new code, the `array(2)` is cached
+        # so replacing it invalidates the cache.
+        obj.append([np.array(2), baditem()])
+        with pytest.raises(RuntimeError):
+            np.array(obj)
+
+
+class TestArrayLikes:
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_0d_object_special_case(self, arraylike):
+        arr = np.array(0.)
+        obj = arraylike(arr)
+        # A single array-like is always converted:
+        res = np.array(obj, dtype=object)
+        assert_array_equal(arr, res)
+
+        # But a single 0-D nested array-like never:
+        res = np.array([obj], dtype=object)
+        assert res[0] is obj
+
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    @pytest.mark.parametrize("arr", [np.array(0.), np.arange(4)])
+    def test_object_assignment_special_case(self, arraylike, arr):
+        obj = arraylike(arr)
+        empty = np.arange(1, dtype=object)
+        empty[:] = [obj]
+        assert empty[0] is obj
+
+    def test_0d_generic_special_case(self):
+        class ArraySubclass(np.ndarray):
+            def __float__(self):
+                raise TypeError("e.g. quantities raise on this")
+
+        arr = np.array(0.)
+        obj = arr.view(ArraySubclass)
+        res = np.array(obj)
+        # The subclass is simply cast:
+        assert_array_equal(arr, res)
+
+        # If the 0-D array-like is included, __float__ is currently
+        # guaranteed to be used.  We may want to change that, quantities
+        # and masked arrays half make use of this.
+        with pytest.raises(TypeError):
+            np.array([obj])
+
+        # The same holds for memoryview:
+        obj = memoryview(arr)
+        res = np.array(obj)
+        assert_array_equal(arr, res)
+        with pytest.raises(ValueError):
+            # The error type does not matter much here.
+            np.array([obj])
+
+    def test_arraylike_classes(self):
+        # The classes of array-likes should generally be acceptable to be
+        # stored inside a numpy (object) array.  This tests all of the
+        # special attributes (since all are checked during coercion).
+        arr = np.array(np.int64)
+        assert arr[()] is np.int64
+        arr = np.array([np.int64])
+        assert arr[0] is np.int64
+
+        # This also works for properties/unbound methods:
+        class ArrayLike:
+            @property
+            def __array_interface__(self):
+                pass
+
+            @property
+            def __array_struct__(self):
+                pass
+
+            def __array__(self):
+                pass
+
+        arr = np.array(ArrayLike)
+        assert arr[()] is ArrayLike
+        arr = np.array([ArrayLike])
+        assert arr[0] is ArrayLike
+
+    @pytest.mark.skipif(
+            np.dtype(np.intp).itemsize < 8, reason="Needs 64bit platform")
+    def test_too_large_array_error_paths(self):
+        """Test the error paths, including for memory leaks"""
+        arr = np.array(0, dtype="uint8")
+        # Guarantees that a contiguous copy won't work:
+        arr = np.broadcast_to(arr, 2**62)
+
+        for i in range(5):
+            # repeat, to ensure caching cannot have an effect:
+            with pytest.raises(MemoryError):
+                np.array(arr)
+            with pytest.raises(MemoryError):
+                np.array([arr])
+
+    @pytest.mark.parametrize("attribute",
+        ["__array_interface__", "__array__", "__array_struct__"])
+    @pytest.mark.parametrize("error", [RecursionError, MemoryError])
+    def test_bad_array_like_attributes(self, attribute, error):
+        # RecursionError and MemoryError are considered fatal. All errors
+        # (except AttributeError) should probably be raised in the future,
+        # but shapely made use of it, so it will require a deprecation.
+
+        class BadInterface:
+            def __getattr__(self, attr):
+                if attr == attribute:
+                    raise error
+                super().__getattr__(attr)
+
+        with pytest.raises(error):
+            np.array(BadInterface())
+
+    @pytest.mark.parametrize("error", [RecursionError, MemoryError])
+    def test_bad_array_like_bad_length(self, error):
+        # RecursionError and MemoryError are considered "critical" in
+        # sequences. We could expand this more generally though. (NumPy 1.20)
+        class BadSequence:
+            def __len__(self):
+                raise error
+            def __getitem__(self):
+                # must have getitem to be a Sequence
+                return 1
+
+        with pytest.raises(error):
+            np.array(BadSequence())
+
+
+class TestAsArray:
+    """Test expected behaviors of ``asarray``."""
+
+    def test_dtype_identity(self):
+        """Confirm the intended behavior for *dtype* kwarg.
+
+        The result of ``asarray()`` should have the dtype provided through the
+        keyword argument, when used. This forces unique array handles to be
+        produced for unique np.dtype objects, but (for equivalent dtypes), the
+        underlying data (the base object) is shared with the original array
+        object.
+
+        Ref https://github.com/numpy/numpy/issues/1468
+        """
+        int_array = np.array([1, 2, 3], dtype='i')
+        assert np.asarray(int_array) is int_array
+
+        # The character code resolves to the singleton dtype object provided
+        # by the numpy package.
+        assert np.asarray(int_array, dtype='i') is int_array
+
+        # Derive a dtype from n.dtype('i'), but add a metadata object to force
+        # the dtype to be distinct.
+        unequal_type = np.dtype('i', metadata={'spam': True})
+        annotated_int_array = np.asarray(int_array, dtype=unequal_type)
+        assert annotated_int_array is not int_array
+        assert annotated_int_array.base is int_array
+        # Create an equivalent descriptor with a new and distinct dtype
+        # instance.
+        equivalent_requirement = np.dtype('i', metadata={'spam': True})
+        annotated_int_array_alt = np.asarray(annotated_int_array,
+                                             dtype=equivalent_requirement)
+        assert unequal_type == equivalent_requirement
+        assert unequal_type is not equivalent_requirement
+        assert annotated_int_array_alt is not annotated_int_array
+        assert annotated_int_array_alt.dtype is equivalent_requirement
+
+        # Check the same logic for a pair of C types whose equivalence may vary
+        # between computing environments.
+        # Find an equivalent pair.
+        integer_type_codes = ('i', 'l', 'q')
+        integer_dtypes = [np.dtype(code) for code in integer_type_codes]
+        typeA = None
+        typeB = None
+        for typeA, typeB in permutations(integer_dtypes, r=2):
+            if typeA == typeB:
+                assert typeA is not typeB
+                break
+        assert isinstance(typeA, np.dtype) and isinstance(typeB, np.dtype)
+
+        # These ``asarray()`` calls may produce a new view or a copy,
+        # but never the same object.
+        long_int_array = np.asarray(int_array, dtype='l')
+        long_long_int_array = np.asarray(int_array, dtype='q')
+        assert long_int_array is not int_array
+        assert long_long_int_array is not int_array
+        assert np.asarray(long_int_array, dtype='q') is not long_int_array
+        array_a = np.asarray(int_array, dtype=typeA)
+        assert typeA == typeB
+        assert typeA is not typeB
+        assert array_a.dtype is typeA
+        assert array_a is not np.asarray(array_a, dtype=typeB)
+        assert np.asarray(array_a, dtype=typeB).dtype is typeB
+        assert array_a is np.asarray(array_a, dtype=typeB).base
+
+
+class TestSpecialAttributeLookupFailure:
+    # An exception was raised while fetching the attribute
+
+    class WeirdArrayLike:
+        @property
+        def __array__(self):
+            raise RuntimeError("oops!")
+
+    class WeirdArrayInterface:
+        @property
+        def __array_interface__(self):
+            raise RuntimeError("oops!")
+
+    def test_deprecated(self):
+        with pytest.raises(RuntimeError):
+            np.array(self.WeirdArrayLike())
+        with pytest.raises(RuntimeError):
+            np.array(self.WeirdArrayInterface())
+
+
+def test_subarray_from_array_construction():
+    # Arrays are more complex, since they "broadcast" on success:
+    arr = np.array([1, 2])
+
+    res = arr.astype("(2)i,")
+    assert_array_equal(res, [[1, 1], [2, 2]])
+
+    res = np.array(arr, dtype="(2)i,")
+
+    assert_array_equal(res, [[1, 1], [2, 2]])
+
+    res = np.array([[(1,), (2,)], arr], dtype="(2)i,")
+    assert_array_equal(res, [[[1, 1], [2, 2]], [[1, 1], [2, 2]]])
+
+    # Also try a multi-dimensional example:
+    arr = np.arange(5 * 2).reshape(5, 2)
+    expected = np.broadcast_to(arr[:, :, np.newaxis, np.newaxis], (5, 2, 2, 2))
+
+    res = arr.astype("(2,2)f")
+    assert_array_equal(res, expected)
+
+    res = np.array(arr, dtype="(2,2)f")
+    assert_array_equal(res, expected)
+
+
+def test_empty_string():
+    # Empty strings are unfortunately often converted to S1 and we need to
+    # make sure we are filling the S1 and not the (possibly) detected S0
+    # result.  This should likely just return S0 and if not maybe the decision
+    # to return S1 should be moved.
+    res = np.array([""] * 10, dtype="S")
+    assert_array_equal(res, np.array("\0", "S1"))
+    assert res.dtype == "S1"
+
+    arr = np.array([""] * 10, dtype=object)
+
+    res = arr.astype("S")
+    assert_array_equal(res, b"")
+    assert res.dtype == "S1"
+
+    res = np.array(arr, dtype="S")
+    assert_array_equal(res, b"")
+    # TODO: This is arguably weird/wrong, but seems old:
+    assert res.dtype == f"S{np.dtype('O').itemsize}"
+
+    res = np.array([[""] * 10, arr], dtype="S")
+    assert_array_equal(res, b"")
+    assert res.shape == (2, 10)
+    assert res.dtype == "S1"

pllava/lib/python3.10/site-packages/numpy/core/tests/test_arrayprint.py

@@ -0,0 +1,1047 @@
+import sys
+import gc
+from hypothesis import given
+from hypothesis.extra import numpy as hynp
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_warns, HAS_REFCOUNT,
+    assert_raises_regex,
+    )
+from numpy.core.arrayprint import _typelessdata
+import textwrap
+
+class TestArrayRepr:
+    def test_nan_inf(self):
+        x = np.array([np.nan, np.inf])
+        assert_equal(repr(x), 'array([nan, inf])')
+
+    def test_subclass(self):
+        class sub(np.ndarray): pass
+
+        # one dimensional
+        x1d = np.array([1, 2]).view(sub)
+        assert_equal(repr(x1d), 'sub([1, 2])')
+
+        # two dimensional
+        x2d = np.array([[1, 2], [3, 4]]).view(sub)
+        assert_equal(repr(x2d),
+            'sub([[1, 2],\n'
+            '     [3, 4]])')
+
+        # two dimensional with flexible dtype
+        xstruct = np.ones((2,2), dtype=[('a', '<i4')]).view(sub)
+        assert_equal(repr(xstruct),
+            "sub([[(1,), (1,)],\n"
+            "     [(1,), (1,)]], dtype=[('a', '<i4')])"
+        )
+
+    @pytest.mark.xfail(reason="See gh-10544")
+    def test_object_subclass(self):
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super().__getitem__(ind)
+                return sub(ret)
+
+        # test that object + subclass is OK:
+        x = sub([None, None])
+        assert_equal(repr(x), 'sub([None, None], dtype=object)')
+        assert_equal(str(x), '[None None]')
+
+        x = sub([None, sub([None, None])])
+        assert_equal(repr(x),
+            'sub([None, sub([None, None], dtype=object)], dtype=object)')
+        assert_equal(str(x), '[None sub([None, None], dtype=object)]')
+
+    def test_0d_object_subclass(self):
+        # make sure that subclasses which return 0ds instead
+        # of scalars don't cause infinite recursion in str
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super().__getitem__(ind)
+                return sub(ret)
+
+        x = sub(1)
+        assert_equal(repr(x), 'sub(1)')
+        assert_equal(str(x), '1')
+
+        x = sub([1, 1])
+        assert_equal(repr(x), 'sub([1, 1])')
+        assert_equal(str(x), '[1 1]')
+
+        # check it works properly with object arrays too
+        x = sub(None)
+        assert_equal(repr(x), 'sub(None, dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # plus recursive object arrays (even depth > 1)
+        y = sub(None)
+        x[()] = y
+        y[()] = x
+        assert_equal(repr(x),
+            'sub(sub(sub(..., dtype=object), dtype=object), dtype=object)')
+        assert_equal(str(x), '...')
+        x[()] = 0  # resolve circular references for garbage collector
+
+        # nested 0d-subclass-object
+        x = sub(None)
+        x[()] = sub(None)
+        assert_equal(repr(x), 'sub(sub(None, dtype=object), dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # gh-10663
+        class DuckCounter(np.ndarray):
+            def __getitem__(self, item):
+                result = super().__getitem__(item)
+                if not isinstance(result, DuckCounter):
+                    result = result[...].view(DuckCounter)
+                return result
+
+            def to_string(self):
+                return {0: 'zero', 1: 'one', 2: 'two'}.get(self.item(), 'many')
+
+            def __str__(self):
+                if self.shape == ():
+                    return self.to_string()
+                else:
+                    fmt = {'all': lambda x: x.to_string()}
+                    return np.array2string(self, formatter=fmt)
+
+        dc = np.arange(5).view(DuckCounter)
+        assert_equal(str(dc), "[zero one two many many]")
+        assert_equal(str(dc[0]), "zero")
+
+    def test_self_containing(self):
+        arr0d = np.array(None)
+        arr0d[()] = arr0d
+        assert_equal(repr(arr0d),
+            'array(array(..., dtype=object), dtype=object)')
+        arr0d[()] = 0  # resolve recursion for garbage collector
+
+        arr1d = np.array([None, None])
+        arr1d[1] = arr1d
+        assert_equal(repr(arr1d),
+            'array([None, array(..., dtype=object)], dtype=object)')
+        arr1d[1] = 0  # resolve recursion for garbage collector
+
+        first = np.array(None)
+        second = np.array(None)
+        first[()] = second
+        second[()] = first
+        assert_equal(repr(first),
+            'array(array(array(..., dtype=object), dtype=object), dtype=object)')
+        first[()] = 0  # resolve circular references for garbage collector
+
+    def test_containing_list(self):
+        # printing square brackets directly would be ambiguuous
+        arr1d = np.array([None, None])
+        arr1d[0] = [1, 2]
+        arr1d[1] = [3]
+        assert_equal(repr(arr1d),
+            'array([list([1, 2]), list([3])], dtype=object)')
+
+    def test_void_scalar_recursion(self):
+        # gh-9345
+        repr(np.void(b'test'))  # RecursionError ?
+
+    def test_fieldless_structured(self):
+        # gh-10366
+        no_fields = np.dtype([])
+        arr_no_fields = np.empty(4, dtype=no_fields)
+        assert_equal(repr(arr_no_fields), 'array([(), (), (), ()], dtype=[])')
+
+
+class TestComplexArray:
+    def test_str(self):
+        rvals = [0, 1, -1, np.inf, -np.inf, np.nan]
+        cvals = [complex(rp, ip) for rp in rvals for ip in rvals]
+        dtypes = [np.complex64, np.cdouble, np.clongdouble]
+        actual = [str(np.array([c], dt)) for c in cvals for dt in dtypes]
+        wanted = [
+            '[0.+0.j]',    '[0.+0.j]',    '[0.+0.j]',
+            '[0.+1.j]',    '[0.+1.j]',    '[0.+1.j]',
+            '[0.-1.j]',    '[0.-1.j]',    '[0.-1.j]',
+            '[0.+infj]',   '[0.+infj]',   '[0.+infj]',
+            '[0.-infj]',   '[0.-infj]',   '[0.-infj]',
+            '[0.+nanj]',   '[0.+nanj]',   '[0.+nanj]',
+            '[1.+0.j]',    '[1.+0.j]',    '[1.+0.j]',
+            '[1.+1.j]',    '[1.+1.j]',    '[1.+1.j]',
+            '[1.-1.j]',    '[1.-1.j]',    '[1.-1.j]',
+            '[1.+infj]',   '[1.+infj]',   '[1.+infj]',
+            '[1.-infj]',   '[1.-infj]',   '[1.-infj]',
+            '[1.+nanj]',   '[1.+nanj]',   '[1.+nanj]',
+            '[-1.+0.j]',   '[-1.+0.j]',   '[-1.+0.j]',
+            '[-1.+1.j]',   '[-1.+1.j]',   '[-1.+1.j]',
+            '[-1.-1.j]',   '[-1.-1.j]',   '[-1.-1.j]',
+            '[-1.+infj]',  '[-1.+infj]',  '[-1.+infj]',
+            '[-1.-infj]',  '[-1.-infj]',  '[-1.-infj]',
+            '[-1.+nanj]',  '[-1.+nanj]',  '[-1.+nanj]',
+            '[inf+0.j]',   '[inf+0.j]',   '[inf+0.j]',
+            '[inf+1.j]',   '[inf+1.j]',   '[inf+1.j]',
+            '[inf-1.j]',   '[inf-1.j]',   '[inf-1.j]',
+            '[inf+infj]',  '[inf+infj]',  '[inf+infj]',
+            '[inf-infj]',  '[inf-infj]',  '[inf-infj]',
+            '[inf+nanj]',  '[inf+nanj]',  '[inf+nanj]',
+            '[-inf+0.j]',  '[-inf+0.j]',  '[-inf+0.j]',
+            '[-inf+1.j]',  '[-inf+1.j]',  '[-inf+1.j]',
+            '[-inf-1.j]',  '[-inf-1.j]',  '[-inf-1.j]',
+            '[-inf+infj]', '[-inf+infj]', '[-inf+infj]',
+            '[-inf-infj]', '[-inf-infj]', '[-inf-infj]',
+            '[-inf+nanj]', '[-inf+nanj]', '[-inf+nanj]',
+            '[nan+0.j]',   '[nan+0.j]',   '[nan+0.j]',
+            '[nan+1.j]',   '[nan+1.j]',   '[nan+1.j]',
+            '[nan-1.j]',   '[nan-1.j]',   '[nan-1.j]',
+            '[nan+infj]',  '[nan+infj]',  '[nan+infj]',
+            '[nan-infj]',  '[nan-infj]',  '[nan-infj]',
+            '[nan+nanj]',  '[nan+nanj]',  '[nan+nanj]']
+
+        for res, val in zip(actual, wanted):
+            assert_equal(res, val)
+
+class TestArray2String:
+    def test_basic(self):
+        """Basic test of array2string."""
+        a = np.arange(3)
+        assert_(np.array2string(a) == '[0 1 2]')
+        assert_(np.array2string(a, max_line_width=4, legacy='1.13') == '[0 1\n 2]')
+        assert_(np.array2string(a, max_line_width=4) == '[0\n 1\n 2]')
+
+    def test_unexpected_kwarg(self):
+        # ensure than an appropriate TypeError
+        # is raised when array2string receives
+        # an unexpected kwarg
+
+        with assert_raises_regex(TypeError, 'nonsense'):
+            np.array2string(np.array([1, 2, 3]),
+                            nonsense=None)
+
+    def test_format_function(self):
+        """Test custom format function for each element in array."""
+        def _format_function(x):
+            if np.abs(x) < 1:
+                return '.'
+            elif np.abs(x) < 2:
+                return 'o'
+            else:
+                return 'O'
+
+        x = np.arange(3)
+        x_hex = "[0x0 0x1 0x2]"
+        x_oct = "[0o0 0o1 0o2]"
+        assert_(np.array2string(x, formatter={'all':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'int_kind':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'all':lambda x: "%.4f" % x}) ==
+                "[0.0000 1.0000 2.0000]")
+        assert_equal(np.array2string(x, formatter={'int':lambda x: hex(x)}),
+                x_hex)
+        assert_equal(np.array2string(x, formatter={'int':lambda x: oct(x)}),
+                x_oct)
+
+        x = np.arange(3.)
+        assert_(np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+        assert_(np.array2string(x, formatter={'float':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+
+        s = np.array(['abc', 'def'])
+        assert_(np.array2string(s, formatter={'numpystr':lambda s: s*2}) ==
+                '[abcabc defdef]')
+
+    def test_structure_format_mixed(self):
+        dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))])
+        x = np.array([('Sarah', (8.0, 7.0)), ('John', (6.0, 7.0))], dtype=dt)
+        assert_equal(np.array2string(x),
+                "[('Sarah', [8., 7.]) ('John', [6., 7.])]")
+
+        np.set_printoptions(legacy='1.13')
+        try:
+            # for issue #5692
+            A = np.zeros(shape=10, dtype=[("A", "M8[s]")])
+            A[5:].fill(np.datetime64('NaT'))
+            assert_equal(
+                np.array2string(A),
+                textwrap.dedent("""\
+                [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+                 ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('NaT',) ('NaT',)
+                 ('NaT',) ('NaT',) ('NaT',)]""")
+            )
+        finally:
+            np.set_printoptions(legacy=False)
+
+        # same again, but with non-legacy behavior
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) (                'NaT',)
+             (                'NaT',) (                'NaT',)
+             (                'NaT',) (                'NaT',)]""")
+        )
+
+        # and again, with timedeltas
+        A = np.full(10, 123456, dtype=[("A", "m8[s]")])
+        A[5:].fill(np.datetime64('NaT'))
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [(123456,) (123456,) (123456,) (123456,) (123456,) ( 'NaT',) ( 'NaT',)
+             ( 'NaT',) ( 'NaT',) ( 'NaT',)]""")
+        )
+
+    def test_structure_format_int(self):
+        # See #8160
+        struct_int = np.array([([1, -1],), ([123, 1],)], dtype=[('B', 'i4', 2)])
+        assert_equal(np.array2string(struct_int),
+                "[([  1,  -1],) ([123,   1],)]")
+        struct_2dint = np.array([([[0, 1], [2, 3]],), ([[12, 0], [0, 0]],)],
+                dtype=[('B', 'i4', (2, 2))])
+        assert_equal(np.array2string(struct_2dint),
+                "[([[ 0,  1], [ 2,  3]],) ([[12,  0], [ 0,  0]],)]")
+
+    def test_structure_format_float(self):
+        # See #8172
+        array_scalar = np.array(
+                (1., 2.1234567890123456789, 3.), dtype=('f8,f8,f8'))
+        assert_equal(np.array2string(array_scalar), "(1., 2.12345679, 3.)")
+
+    def test_unstructured_void_repr(self):
+        a = np.array([27, 91, 50, 75,  7, 65, 10,  8,
+                      27, 91, 51, 49,109, 82,101,100], dtype='u1').view('V8')
+        assert_equal(repr(a[0]), r"void(b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08')")
+        assert_equal(str(a[0]), r"b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'")
+        assert_equal(repr(a),
+            r"array([b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'," "\n"
+            r"       b'\x1B\x5B\x33\x31\x6D\x52\x65\x64'], dtype='|V8')")
+
+        assert_equal(eval(repr(a), vars(np)), a)
+        assert_equal(eval(repr(a[0]), vars(np)), a[0])
+
+    def test_edgeitems_kwarg(self):
+        # previously the global print options would be taken over the kwarg
+        arr = np.zeros(3, int)
+        assert_equal(
+            np.array2string(arr, edgeitems=1, threshold=0),
+            "[0 ... 0]"
+        )
+
+    def test_summarize_1d(self):
+        A = np.arange(1001)
+        strA = '[   0    1    2 ...  998  999 1000]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([   0,    1,    2, ...,  998,  999, 1000])'
+        assert_equal(repr(A), reprA)
+
+    def test_summarize_2d(self):
+        A = np.arange(1002).reshape(2, 501)
+        strA = '[[   0    1    2 ...  498  499  500]\n' \
+               ' [ 501  502  503 ...  999 1000 1001]]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([[   0,    1,    2, ...,  498,  499,  500],\n' \
+                '       [ 501,  502,  503, ...,  999, 1000, 1001]])'
+        assert_equal(repr(A), reprA)
+
+    def test_summarize_structure(self):
+        A = (np.arange(2002, dtype="<i8").reshape(2, 1001)
+             .view([('i', "<i8", (1001,))]))
+        strA = ("[[([   0,    1,    2, ...,  998,  999, 1000],)]\n"
+                " [([1001, 1002, 1003, ..., 1999, 2000, 2001],)]]")
+        assert_equal(str(A), strA)
+
+        reprA = ("array([[([   0,    1,    2, ...,  998,  999, 1000],)],\n"
+                 "       [([1001, 1002, 1003, ..., 1999, 2000, 2001],)]],\n"
+                 "      dtype=[('i', '<i8', (1001,))])")
+        assert_equal(repr(A), reprA)
+
+        B = np.ones(2002, dtype=">i8").view([('i', ">i8", (2, 1001))])
+        strB = "[([[1, 1, 1, ..., 1, 1, 1], [1, 1, 1, ..., 1, 1, 1]],)]"
+        assert_equal(str(B), strB)
+
+        reprB = (
+            "array([([[1, 1, 1, ..., 1, 1, 1], [1, 1, 1, ..., 1, 1, 1]],)],\n"
+            "      dtype=[('i', '>i8', (2, 1001))])"
+        )
+        assert_equal(repr(B), reprB)
+
+        C = (np.arange(22, dtype="<i8").reshape(2, 11)
+             .view([('i1', "<i8"), ('i10', "<i8", (10,))]))
+        strC = "[[( 0, [ 1, ..., 10])]\n [(11, [12, ..., 21])]]"
+        assert_equal(np.array2string(C, threshold=1, edgeitems=1), strC)
+
+    def test_linewidth(self):
+        a = np.full(6, 1)
+
+        def make_str(a, width, **kw):
+            return np.array2string(a, separator="", max_line_width=width, **kw)
+
+        assert_equal(make_str(a, 8, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 7, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 5, legacy='1.13'), '[1111\n'
+                                                    ' 11]')
+
+        assert_equal(make_str(a, 8), '[111111]')
+        assert_equal(make_str(a, 7), '[11111\n'
+                                     ' 1]')
+        assert_equal(make_str(a, 5), '[111\n'
+                                     ' 111]')
+
+        b = a[None,None,:]
+
+        assert_equal(make_str(b, 12, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  9, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  8, legacy='1.13'), '[[[11111\n'
+                                                     '   1]]]')
+
+        assert_equal(make_str(b, 12), '[[[111111]]]')
+        assert_equal(make_str(b,  9), '[[[111\n'
+                                      '   111]]]')
+        assert_equal(make_str(b,  8), '[[[11\n'
+                                      '   11\n'
+                                      '   11]]]')
+
+    def test_wide_element(self):
+        a = np.array(['xxxxx'])
+        assert_equal(
+            np.array2string(a, max_line_width=5),
+            "['xxxxx']"
+        )
+        assert_equal(
+            np.array2string(a, max_line_width=5, legacy='1.13'),
+            "[ 'xxxxx']"
+        )
+
+    def test_multiline_repr(self):
+        class MultiLine:
+            def __repr__(self):
+                return "Line 1\nLine 2"
+
+        a = np.array([[None, MultiLine()], [MultiLine(), None]])
+
+        assert_equal(
+            np.array2string(a),
+            '[[None Line 1\n'
+            '       Line 2]\n'
+            ' [Line 1\n'
+            '  Line 2 None]]'
+        )
+        assert_equal(
+            np.array2string(a, max_line_width=5),
+            '[[None\n'
+            '  Line 1\n'
+            '  Line 2]\n'
+            ' [Line 1\n'
+            '  Line 2\n'
+            '  None]]'
+        )
+        assert_equal(
+            repr(a),
+            'array([[None, Line 1\n'
+            '              Line 2],\n'
+            '       [Line 1\n'
+            '        Line 2, None]], dtype=object)'
+        )
+
+        class MultiLineLong:
+            def __repr__(self):
+                return "Line 1\nLooooooooooongestLine2\nLongerLine 3"
+
+        a = np.array([[None, MultiLineLong()], [MultiLineLong(), None]])
+        assert_equal(
+            repr(a),
+            'array([[None, Line 1\n'
+            '              LooooooooooongestLine2\n'
+            '              LongerLine 3          ],\n'
+            '       [Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          , None]], dtype=object)'
+        )
+        assert_equal(
+            np.array_repr(a, 20),
+            'array([[None,\n'
+            '        Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          ],\n'
+            '       [Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          ,\n'
+            '        None]],\n'
+            '      dtype=object)'
+        )
+
+    def test_nested_array_repr(self):
+        a = np.empty((2, 2), dtype=object)
+        a[0, 0] = np.eye(2)
+        a[0, 1] = np.eye(3)
+        a[1, 0] = None
+        a[1, 1] = np.ones((3, 1))
+        assert_equal(
+            repr(a),
+            'array([[array([[1., 0.],\n'
+            '               [0., 1.]]), array([[1., 0., 0.],\n'
+            '                                  [0., 1., 0.],\n'
+            '                                  [0., 0., 1.]])],\n'
+            '       [None, array([[1.],\n'
+            '                     [1.],\n'
+            '                     [1.]])]], dtype=object)'
+        )
+
+    @given(hynp.from_dtype(np.dtype("U")))
+    def test_any_text(self, text):
+        # This test checks that, given any value that can be represented in an
+        # array of dtype("U") (i.e. unicode string), ...
+        a = np.array([text, text, text])
+        # casting a list of them to an array does not e.g. truncate the value
+        assert_equal(a[0], text)
+        # and that np.array2string puts a newline in the expected location
+        expected_repr = "[{0!r} {0!r}\n {0!r}]".format(text)
+        result = np.array2string(a, max_line_width=len(repr(text)) * 2 + 3)
+        assert_equal(result, expected_repr)
+
+    @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts")
+    def test_refcount(self):
+        # make sure we do not hold references to the array due to a recursive
+        # closure (gh-10620)
+        gc.disable()
+        a = np.arange(2)
+        r1 = sys.getrefcount(a)
+        np.array2string(a)
+        np.array2string(a)
+        r2 = sys.getrefcount(a)
+        gc.collect()
+        gc.enable()
+        assert_(r1 == r2)
+
+class TestPrintOptions:
+    """Test getting and setting global print options."""
+
+    def setup_method(self):
+        self.oldopts = np.get_printoptions()
+
+    def teardown_method(self):
+        np.set_printoptions(**self.oldopts)
+
+    def test_basic(self):
+        x = np.array([1.5, 0, 1.234567890])
+        assert_equal(repr(x), "array([1.5       , 0.        , 1.23456789])")
+        np.set_printoptions(precision=4)
+        assert_equal(repr(x), "array([1.5   , 0.    , 1.2346])")
+
+    def test_precision_zero(self):
+        np.set_printoptions(precision=0)
+        for values, string in (
+                ([0.], "0."), ([.3], "0."), ([-.3], "-0."), ([.7], "1."),
+                ([1.5], "2."), ([-1.5], "-2."), ([-15.34], "-15."),
+                ([100.], "100."), ([.2, -1, 122.51], "  0.,  -1., 123."),
+                ([0], "0"), ([-12], "-12"), ([complex(.3, -.7)], "0.-1.j")):
+            x = np.array(values)
+            assert_equal(repr(x), "array([%s])" % string)
+
+    def test_formatter(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+
+    def test_formatter_reset(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'all':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'int':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int_kind':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        x = np.arange(3.)
+        np.set_printoptions(formatter={'float':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1.0, 0.0, 1.0])")
+        np.set_printoptions(formatter={'float_kind':None})
+        assert_equal(repr(x), "array([0., 1., 2.])")
+
+    def test_0d_arrays(self):
+        assert_equal(str(np.array('café', '<U4')), 'café')
+
+        assert_equal(repr(np.array('café', '<U4')),
+                     "array('café', dtype='<U4')")
+        assert_equal(str(np.array('test', np.str_)), 'test')
+
+        a = np.zeros(1, dtype=[('a', '<i4', (3,))])
+        assert_equal(str(a[0]), '([0, 0, 0],)')
+
+        assert_equal(repr(np.datetime64('2005-02-25')[...]),
+                     "array('2005-02-25', dtype='datetime64[D]')")
+
+        assert_equal(repr(np.timedelta64('10', 'Y')[...]),
+                     "array(10, dtype='timedelta64[Y]')")
+
+        # repr of 0d arrays is affected by printoptions
+        x = np.array(1)
+        np.set_printoptions(formatter={'all':lambda x: "test"})
+        assert_equal(repr(x), "array(test)")
+        # str is unaffected
+        assert_equal(str(x), "1")
+
+        # check `style` arg raises
+        assert_warns(DeprecationWarning, np.array2string,
+                                         np.array(1.), style=repr)
+        # but not in legacy mode
+        np.array2string(np.array(1.), style=repr, legacy='1.13')
+        # gh-10934 style was broken in legacy mode, check it works
+        np.array2string(np.array(1.), legacy='1.13')
+
+    def test_float_spacing(self):
+        x = np.array([1., 2., 3.])
+        y = np.array([1., 2., -10.])
+        z = np.array([100., 2., -1.])
+        w = np.array([-100., 2., 1.])
+
+        assert_equal(repr(x), 'array([1., 2., 3.])')
+        assert_equal(repr(y), 'array([  1.,   2., -10.])')
+        assert_equal(repr(np.array(y[0])), 'array(1.)')
+        assert_equal(repr(np.array(y[-1])), 'array(-10.)')
+        assert_equal(repr(z), 'array([100.,   2.,  -1.])')
+        assert_equal(repr(w), 'array([-100.,    2.,    1.])')
+
+        assert_equal(repr(np.array([np.nan, np.inf])), 'array([nan, inf])')
+        assert_equal(repr(np.array([np.nan, -np.inf])), 'array([ nan, -inf])')
+
+        x = np.array([np.inf, 100000, 1.1234])
+        y = np.array([np.inf, 100000, -1.1234])
+        z = np.array([np.inf, 1.1234, -1e120])
+        np.set_printoptions(precision=2)
+        assert_equal(repr(x), 'array([     inf, 1.00e+05, 1.12e+00])')
+        assert_equal(repr(y), 'array([      inf,  1.00e+05, -1.12e+00])')
+        assert_equal(repr(z), 'array([       inf,  1.12e+000, -1.00e+120])')
+
+    def test_bool_spacing(self):
+        assert_equal(repr(np.array([True,  True])),
+                     'array([ True,  True])')
+        assert_equal(repr(np.array([True, False])),
+                     'array([ True, False])')
+        assert_equal(repr(np.array([True])),
+                     'array([ True])')
+        assert_equal(repr(np.array(True)),
+                     'array(True)')
+        assert_equal(repr(np.array(False)),
+                     'array(False)')
+
+    def test_sign_spacing(self):
+        a = np.arange(4.)
+        b = np.array([1.234e9])
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        assert_equal(repr(a), 'array([0., 1., 2., 3.])')
+        assert_equal(repr(np.array(1.)), 'array(1.)')
+        assert_equal(repr(b), 'array([1.234e+09])')
+        assert_equal(repr(np.array([0.])), 'array([0.])')
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign=' ')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(np.array(1.)), 'array( 1.)')
+        assert_equal(repr(b), 'array([ 1.234e+09])')
+        assert_equal(repr(c),
+            "array([ 1.        +1.j        ,  1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign='+')
+        assert_equal(repr(a), 'array([+0., +1., +2., +3.])')
+        assert_equal(repr(np.array(1.)), 'array(+1.)')
+        assert_equal(repr(b), 'array([+1.234e+09])')
+        assert_equal(repr(c),
+            "array([+1.        +1.j        , +1.12345679+1.12345679j])")
+
+        np.set_printoptions(legacy='1.13')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(b),  'array([  1.23400000e+09])')
+        assert_equal(repr(-b), 'array([ -1.23400000e+09])')
+        assert_equal(repr(np.array(1.)), 'array(1.0)')
+        assert_equal(repr(np.array([0.])), 'array([ 0.])')
+        assert_equal(repr(c),
+            "array([ 1.00000000+1.j        ,  1.12345679+1.12345679j])")
+        # gh-10383
+        assert_equal(str(np.array([-1., 10])), "[ -1.  10.]")
+
+        assert_raises(TypeError, np.set_printoptions, wrongarg=True)
+
+    def test_float_overflow_nowarn(self):
+        # make sure internal computations in FloatingFormat don't
+        # warn about overflow
+        repr(np.array([1e4, 0.1], dtype='f2'))
+
+    def test_sign_spacing_structured(self):
+        a = np.ones(2, dtype='<f,<f')
+        assert_equal(repr(a),
+            "array([(1., 1.), (1., 1.)], dtype=[('f0', '<f4'), ('f1', '<f4')])")
+        assert_equal(repr(a[0]), "(1., 1.)")
+
+    def test_floatmode(self):
+        x = np.array([0.6104, 0.922, 0.457, 0.0906, 0.3733, 0.007244,
+                      0.5933, 0.947, 0.2383, 0.4226], dtype=np.float16)
+        y = np.array([0.2918820979355541, 0.5064172631089138,
+                      0.2848750619642916, 0.4342965294660567,
+                      0.7326538397312751, 0.3459503329096204,
+                      0.0862072768214508, 0.39112753029631175],
+                      dtype=np.float64)
+        z = np.arange(6, dtype=np.float16)/10
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        # also make sure 1e23 is right (is between two fp numbers)
+        w = np.array(['1e{}'.format(i) for i in range(25)], dtype=np.float64)
+        # note: we construct w from the strings `1eXX` instead of doing
+        # `10.**arange(24)` because it turns out the two are not equivalent in
+        # python. On some architectures `1e23 != 10.**23`.
+        wp = np.array([1.234e1, 1e2, 1e123])
+
+        # unique mode
+        np.set_printoptions(floatmode='unique')
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918820979355541 , 0.5064172631089138 , 0.2848750619642916 ,\n"
+            "       0.4342965294660567 , 0.7326538397312751 , 0.3459503329096204 ,\n"
+            "       0.0862072768214508 , 0.39112753029631175])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w),
+            "array([1.e+00, 1.e+01, 1.e+02, 1.e+03, 1.e+04, 1.e+05, 1.e+06, 1.e+07,\n"
+            "       1.e+08, 1.e+09, 1.e+10, 1.e+11, 1.e+12, 1.e+13, 1.e+14, 1.e+15,\n"
+            "       1.e+16, 1.e+17, 1.e+18, 1.e+19, 1.e+20, 1.e+21, 1.e+22, 1.e+23,\n"
+            "       1.e+24])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.         +1.j         , 1.123456789+1.123456789j])")
+
+        # maxprec mode, precision=8
+        np.set_printoptions(floatmode='maxprec', precision=8)
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918821 , 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+
+        # fixed mode, precision=4
+        np.set_printoptions(floatmode='fixed', precision=4)
+        assert_equal(repr(x),
+            "array([0.6104, 0.9219, 0.4570, 0.0906, 0.3733, 0.0072, 0.5933, 0.9468,\n"
+            "       0.2383, 0.4226], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2919, 0.5064, 0.2849, 0.4343, 0.7327, 0.3460, 0.0862, 0.3911])")
+        assert_equal(repr(z),
+            "array([0.0000, 0.1000, 0.2000, 0.3000, 0.3999, 0.5000], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.0000e+00, 1.0000e+05, 1.0000e+10, 1.0000e+15, 1.0000e+20])")
+        assert_equal(repr(wp), "array([1.2340e+001, 1.0000e+002, 1.0000e+123])")
+        assert_equal(repr(np.zeros(3)), "array([0.0000, 0.0000, 0.0000])")
+        assert_equal(repr(c),
+            "array([1.0000+1.0000j, 1.1235+1.1235j])")
+        # for larger precision, representation error becomes more apparent:
+        np.set_printoptions(floatmode='fixed', precision=8)
+        assert_equal(repr(z),
+            "array([0.00000000, 0.09997559, 0.19995117, 0.30004883, 0.39990234,\n"
+            "       0.50000000], dtype=float16)")
+
+        # maxprec_equal  mode, precision=8
+        np.set_printoptions(floatmode='maxprec_equal', precision=8)
+        assert_equal(repr(x),
+            "array([0.610352, 0.921875, 0.457031, 0.090576, 0.373291, 0.007244,\n"
+            "       0.593262, 0.946777, 0.238281, 0.422607], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.29188210, 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0.0, 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.00000000+1.00000000j, 1.12345679+1.12345679j])")
+
+        # test unique special case (gh-18609)
+        a = np.float64.fromhex('-1p-97')
+        assert_equal(np.float64(np.array2string(a, floatmode='unique')), a)
+
+    def test_legacy_mode_scalars(self):
+        # in legacy mode, str of floats get truncated, and complex scalars
+        # use * for non-finite imaginary part
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.float64(1.123456789123456789)), '1.12345678912')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nan*j)')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.float64(1.123456789123456789)),
+                     '1.1234567891234568')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nanj)')
+
+    def test_legacy_stray_comma(self):
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ..., 9997 9998 9999]')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ... 9997 9998 9999]')
+
+    def test_dtype_linewidth_wrapping(self):
+        np.set_printoptions(linewidth=75)
+        assert_equal(repr(np.arange(10,20., dtype='f4')),
+            "array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19.], dtype=float32)")
+        assert_equal(repr(np.arange(10,23., dtype='f4')), textwrap.dedent("""\
+            array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19., 20., 21., 22.],
+                  dtype=float32)"""))
+
+        styp = '<U4'
+        assert_equal(repr(np.ones(3, dtype=styp)),
+            "array(['1', '1', '1'], dtype='{}')".format(styp))
+        assert_equal(repr(np.ones(12, dtype=styp)), textwrap.dedent("""\
+            array(['1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1'],
+                  dtype='{}')""".format(styp)))
+
+    @pytest.mark.parametrize(
+        ['native'],
+        [
+            ('bool',),
+            ('uint8',),
+            ('uint16',),
+            ('uint32',),
+            ('uint64',),
+            ('int8',),
+            ('int16',),
+            ('int32',),
+            ('int64',),
+            ('float16',),
+            ('float32',),
+            ('float64',),
+            ('U1',),     # 4-byte width string
+        ],
+    )
+    def test_dtype_endianness_repr(self, native):
+        '''
+        there was an issue where
+        repr(array([0], dtype='<u2')) and repr(array([0], dtype='>u2'))
+        both returned the same thing:
+        array([0], dtype=uint16)
+        even though their dtypes have different endianness.
+        '''
+        native_dtype = np.dtype(native)
+        non_native_dtype = native_dtype.newbyteorder()
+        non_native_repr = repr(np.array([1], non_native_dtype))
+        native_repr = repr(np.array([1], native_dtype))
+        # preserve the sensible default of only showing dtype if nonstandard
+        assert ('dtype' in native_repr) ^ (native_dtype in _typelessdata),\
+                ("an array's repr should show dtype if and only if the type "
+                 'of the array is NOT one of the standard types '
+                 '(e.g., int32, bool, float64).')
+        if non_native_dtype.itemsize > 1:
+            # if the type is >1 byte, the non-native endian version
+            # must show endianness.
+            assert non_native_repr != native_repr
+            assert f"dtype='{non_native_dtype.byteorder}" in non_native_repr
+
+    def test_linewidth_repr(self):
+        a = np.full(7, fill_value=2)
+        np.set_printoptions(linewidth=17)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2])""")
+        )
+        np.set_printoptions(linewidth=17, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+        a = np.full(8, fill_value=2)
+
+        np.set_printoptions(linewidth=18, legacy=False)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2, 2])""")
+        )
+
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+    def test_linewidth_str(self):
+        a = np.full(18, fill_value=2)
+        np.set_printoptions(linewidth=18)
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2
+             2 2]""")
+        )
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2 2]""")
+        )
+
+    def test_edgeitems(self):
+        np.set_printoptions(edgeitems=1, threshold=1)
+        a = np.arange(27).reshape((3, 3, 3))
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([[[ 0, ...,  2],
+                    ...,
+                    [ 6, ...,  8]],
+
+                   ...,
+
+                   [[18, ..., 20],
+                    ...,
+                    [24, ..., 26]]])""")
+        )
+
+        b = np.zeros((3, 3, 1, 1))
+        assert_equal(
+            repr(b),
+            textwrap.dedent("""\
+            array([[[[0.]],
+
+                    ...,
+
+                    [[0.]]],
+
+
+                   ...,
+
+
+                   [[[0.]],
+
+                    ...,
+
+                    [[0.]]]])""")
+        )
+
+        # 1.13 had extra trailing spaces, and was missing newlines
+        np.set_printoptions(legacy='1.13')
+
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([[[ 0, ...,  2],
+                    ..., 
+                    [ 6, ...,  8]],
+
+                   ..., 
+                   [[18, ..., 20],
+                    ..., 
+                    [24, ..., 26]]])""")
+        )
+
+        assert_equal(
+            repr(b),
+            textwrap.dedent("""\
+            array([[[[ 0.]],
+
+                    ..., 
+                    [[ 0.]]],
+
+
+                   ..., 
+                   [[[ 0.]],
+
+                    ..., 
+                    [[ 0.]]]])""")
+        )
+
+    def test_edgeitems_structured(self):
+        np.set_printoptions(edgeitems=1, threshold=1)
+        A = np.arange(5*2*3, dtype="<i8").view([('i', "<i8", (5, 2, 3))])
+        reprA = (
+            "array([([[[ 0, ...,  2], [ 3, ...,  5]], ..., "
+            "[[24, ..., 26], [27, ..., 29]]],)],\n"
+            "      dtype=[('i', '<i8', (5, 2, 3))])"
+        )
+        assert_equal(repr(A), reprA)
+
+    def test_bad_args(self):
+        assert_raises(ValueError, np.set_printoptions, threshold=float('nan'))
+        assert_raises(TypeError, np.set_printoptions, threshold='1')
+        assert_raises(TypeError, np.set_printoptions, threshold=b'1')
+
+        assert_raises(TypeError, np.set_printoptions, precision='1')
+        assert_raises(TypeError, np.set_printoptions, precision=1.5)
+
+def test_unicode_object_array():
+    expected = "array(['é'], dtype=object)"
+    x = np.array(['\xe9'], dtype=object)
+    assert_equal(repr(x), expected)
+
+
+class TestContextManager:
+    def test_ctx_mgr(self):
+        # test that context manager actually works
+        with np.printoptions(precision=2):
+            s = str(np.array([2.0]) / 3)
+        assert_equal(s, '[0.67]')
+
+    def test_ctx_mgr_restores(self):
+        # test that print options are actually restrored
+        opts = np.get_printoptions()
+        with np.printoptions(precision=opts['precision'] - 1,
+                             linewidth=opts['linewidth'] - 4):
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_exceptions(self):
+        # test that print options are restored even if an exception is raised
+        opts = np.get_printoptions()
+        try:
+            with np.printoptions(precision=2, linewidth=11):
+                raise ValueError
+        except ValueError:
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_as_smth(self):
+        opts = {"precision": 2}
+        with np.printoptions(**opts) as ctx:
+            saved_opts = ctx.copy()
+        assert_equal({k: saved_opts[k] for k in opts}, opts)

pllava/lib/python3.10/site-packages/numpy/core/tests/test_custom_dtypes.py

@@ -0,0 +1,253 @@
+import pytest
+
+import numpy as np
+from numpy.testing import assert_array_equal
+from numpy.core._multiarray_umath import (
+    _discover_array_parameters as discover_array_params, _get_sfloat_dtype)
+
+
+SF = _get_sfloat_dtype()
+
+
+class TestSFloat:
+    def _get_array(self, scaling, aligned=True):
+        if not aligned:
+            a = np.empty(3*8 + 1, dtype=np.uint8)[1:]
+            a = a.view(np.float64)
+            a[:] = [1., 2., 3.]
+        else:
+            a = np.array([1., 2., 3.])
+
+        a *= 1./scaling  # the casting code also uses the reciprocal.
+        return a.view(SF(scaling))
+
+    def test_sfloat_rescaled(self):
+        sf = SF(1.)
+        sf2 = sf.scaled_by(2.)
+        assert sf2.get_scaling() == 2.
+        sf6 = sf2.scaled_by(3.)
+        assert sf6.get_scaling() == 6.
+
+    def test_class_discovery(self):
+        # This does not test much, since we always discover the scaling as 1.
+        # But most of NumPy (when writing) does not understand DType classes
+        dt, _ = discover_array_params([1., 2., 3.], dtype=SF)
+        assert dt == SF(1.)
+
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_scaled_float_from_floats(self, scaling):
+        a = np.array([1., 2., 3.], dtype=SF(scaling))
+
+        assert a.dtype.get_scaling() == scaling
+        assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.])
+
+    def test_repr(self):
+        # Check the repr, mainly to cover the code paths:
+        assert repr(SF(scaling=1.)) == "_ScaledFloatTestDType(scaling=1.0)"
+
+    def test_dtype_name(self):
+        assert SF(1.).name == "_ScaledFloatTestDType64"
+
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_sfloat_from_float(self, scaling):
+        a = np.array([1., 2., 3.]).astype(dtype=SF(scaling))
+
+        assert a.dtype.get_scaling() == scaling
+        assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.])
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_sfloat_getitem(self, aligned, scaling):
+        a = self._get_array(1., aligned)
+        assert a.tolist() == [1., 2., 3.]
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    def test_sfloat_casts(self, aligned):
+        a = self._get_array(1., aligned)
+
+        assert np.can_cast(a, SF(-1.), casting="equiv")
+        assert not np.can_cast(a, SF(-1.), casting="no")
+        na = a.astype(SF(-1.))
+        assert_array_equal(-1 * na.view(np.float64), a.view(np.float64))
+
+        assert np.can_cast(a, SF(2.), casting="same_kind")
+        assert not np.can_cast(a, SF(2.), casting="safe")
+        a2 = a.astype(SF(2.))
+        assert_array_equal(2 * a2.view(np.float64), a.view(np.float64))
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    def test_sfloat_cast_internal_errors(self, aligned):
+        a = self._get_array(2e300, aligned)
+
+        with pytest.raises(TypeError,
+                match="error raised inside the core-loop: non-finite factor!"):
+            a.astype(SF(2e-300))
+
+    def test_sfloat_promotion(self):
+        assert np.result_type(SF(2.), SF(3.)) == SF(3.)
+        assert np.result_type(SF(3.), SF(2.)) == SF(3.)
+        # Float64 -> SF(1.) and then promotes normally, so both of this work:
+        assert np.result_type(SF(3.), np.float64) == SF(3.)
+        assert np.result_type(np.float64, SF(0.5)) == SF(1.)
+
+        # Test an undefined promotion:
+        with pytest.raises(TypeError):
+            np.result_type(SF(1.), np.int64)
+
+    def test_basic_multiply(self):
+        a = self._get_array(2.)
+        b = self._get_array(4.)
+
+        res = a * b
+        # multiplies dtype scaling and content separately:
+        assert res.dtype.get_scaling() == 8.
+        expected_view = a.view(np.float64) * b.view(np.float64)
+        assert_array_equal(res.view(np.float64), expected_view)
+
+    def test_possible_and_impossible_reduce(self):
+        # For reductions to work, the first and last operand must have the
+        # same dtype.  For this parametric DType that is not necessarily true.
+        a = self._get_array(2.)
+        # Addition reductin works (as of writing requires to pass initial
+        # because setting a scaled-float from the default `0` fails).
+        res = np.add.reduce(a, initial=0.)
+        assert res == a.astype(np.float64).sum()
+
+        # But each multiplication changes the factor, so a reduction is not
+        # possible (the relaxed version of the old refusal to handle any
+        # flexible dtype).
+        with pytest.raises(TypeError,
+                match="the resolved dtypes are not compatible"):
+            np.multiply.reduce(a)
+
+    def test_basic_ufunc_at(self):
+        float_a = np.array([1., 2., 3.])
+        b = self._get_array(2.)
+
+        float_b = b.view(np.float64).copy()
+        np.multiply.at(float_b, [1, 1, 1], float_a)
+        np.multiply.at(b, [1, 1, 1], float_a)
+
+        assert_array_equal(b.view(np.float64), float_b)
+
+    def test_basic_multiply_promotion(self):
+        float_a = np.array([1., 2., 3.])
+        b = self._get_array(2.)
+
+        res1 = float_a * b
+        res2 = b * float_a
+
+        # one factor is one, so we get the factor of b:
+        assert res1.dtype == res2.dtype == b.dtype
+        expected_view = float_a * b.view(np.float64)
+        assert_array_equal(res1.view(np.float64), expected_view)
+        assert_array_equal(res2.view(np.float64), expected_view)
+
+        # Check that promotion works when `out` is used:
+        np.multiply(b, float_a, out=res2)
+        with pytest.raises(TypeError):
+            # The promoter accepts this (maybe it should not), but the SFloat
+            # result cannot be cast to integer:
+            np.multiply(b, float_a, out=np.arange(3))
+
+    def test_basic_addition(self):
+        a = self._get_array(2.)
+        b = self._get_array(4.)
+
+        res = a + b
+        # addition uses the type promotion rules for the result:
+        assert res.dtype == np.result_type(a.dtype, b.dtype)
+        expected_view = (a.astype(res.dtype).view(np.float64) +
+                         b.astype(res.dtype).view(np.float64))
+        assert_array_equal(res.view(np.float64), expected_view)
+
+    def test_addition_cast_safety(self):
+        """The addition method is special for the scaled float, because it
+        includes the "cast" between different factors, thus cast-safety
+        is influenced by the implementation.
+        """
+        a = self._get_array(2.)
+        b = self._get_array(-2.)
+        c = self._get_array(3.)
+
+        # sign change is "equiv":
+        np.add(a, b, casting="equiv")
+        with pytest.raises(TypeError):
+            np.add(a, b, casting="no")
+
+        # Different factor is "same_kind" (default) so check that "safe" fails
+        with pytest.raises(TypeError):
+            np.add(a, c, casting="safe")
+
+        # Check that casting the output fails also (done by the ufunc here)
+        with pytest.raises(TypeError):
+            np.add(a, a, out=c, casting="safe")
+
+    @pytest.mark.parametrize("ufunc",
+            [np.logical_and, np.logical_or, np.logical_xor])
+    def test_logical_ufuncs_casts_to_bool(self, ufunc):
+        a = self._get_array(2.)
+        a[0] = 0.  # make sure first element is considered False.
+
+        float_equiv = a.astype(float)
+        expected = ufunc(float_equiv, float_equiv)
+        res = ufunc(a, a)
+        assert_array_equal(res, expected)
+
+        # also check that the same works for reductions:
+        expected = ufunc.reduce(float_equiv)
+        res = ufunc.reduce(a)
+        assert_array_equal(res, expected)
+
+        # The output casting does not match the bool, bool -> bool loop:
+        with pytest.raises(TypeError):
+            ufunc(a, a, out=np.empty(a.shape, dtype=int), casting="equiv")
+
+    def test_wrapped_and_wrapped_reductions(self):
+        a = self._get_array(2.)
+        float_equiv = a.astype(float)
+
+        expected = np.hypot(float_equiv, float_equiv)
+        res = np.hypot(a, a)
+        assert res.dtype == a.dtype
+        res_float = res.view(np.float64) * 2
+        assert_array_equal(res_float, expected)
+
+        # Also check reduction (keepdims, due to incorrect getitem)
+        res = np.hypot.reduce(a, keepdims=True)
+        assert res.dtype == a.dtype
+        expected = np.hypot.reduce(float_equiv, keepdims=True)
+        assert res.view(np.float64) * 2 == expected
+
+    def test_astype_class(self):
+        # Very simple test that we accept `.astype()` also on the class.
+        # ScaledFloat always returns the default descriptor, but it does
+        # check the relevant code paths.
+        arr = np.array([1., 2., 3.], dtype=object)
+
+        res = arr.astype(SF)  # passing the class class
+        expected = arr.astype(SF(1.))  # above will have discovered 1. scaling
+        assert_array_equal(res.view(np.float64), expected.view(np.float64))
+
+    def test_creation_class(self):
+        arr1 = np.array([1., 2., 3.], dtype=SF)
+        assert arr1.dtype == SF(1.)
+        arr2 = np.array([1., 2., 3.], dtype=SF(1.))
+        assert_array_equal(arr1.view(np.float64), arr2.view(np.float64))
+
+
+def test_type_pickle():
+    # can't actually unpickle, but we can pickle (if in namespace)
+    import pickle
+
+    np._ScaledFloatTestDType = SF
+
+    s = pickle.dumps(SF)
+    res = pickle.loads(s)
+    assert res is SF
+
+    del np._ScaledFloatTestDType
+
+
+def test_is_numeric():
+    assert SF._is_numeric