text
stringlengths
9
39.2M
dir
stringlengths
26
295
lang
stringclasses
185 values
created_date
timestamp[us]
updated_date
timestamp[us]
repo_name
stringlengths
1
97
repo_full_name
stringlengths
7
106
star
int64
1k
183k
len_tokens
int64
1
13.8M
```javascript var inspect = require('../'); var test = require('tape'); test('circular', function (t) { t.plan(2); var obj = { a: 1, b: [3, 4] }; obj.c = obj; t.equal(inspect(obj), '{ a: 1, b: [ 3, 4 ], c: [Circular] }'); var double = {}; double.a = [double]; double.b = {}; double.b.inner = double.b; double.b.obj = double; t.equal(inspect(double), '{ a: [ [Circular] ], b: { inner: [Circular], obj: [Circular] } }'); }); ```
/content/code_sandbox/node_modules/object-inspect/test/circular.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
148
```javascript 'use strict'; var inspect = require('../'); var test = require('tape'); var hasToStringTag = require('has-tostringtag/shams')(); var forEach = require('for-each'); test('fakes', { skip: !hasToStringTag }, function (t) { forEach([ 'Array', 'Boolean', 'Date', 'Error', 'Number', 'RegExp', 'String' ], function (expected) { var faker = {}; faker[Symbol.toStringTag] = expected; t.equal( inspect(faker), '{ [Symbol(Symbol.toStringTag)]: \'' + expected + '\' }', 'faker masquerading as ' + expected + ' is not shown as one' ); }); t.end(); }); ```
/content/code_sandbox/node_modules/object-inspect/test/fakes.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
164
```javascript var test = require('tape'); var ErrorWithCause = require('error-cause/Error'); var inspect = require('../'); test('type error', function (t) { t.plan(1); var aerr = new TypeError(); aerr.foo = 555; aerr.bar = [1, 2, 3]; var berr = new TypeError('tuv'); berr.baz = 555; var cerr = new SyntaxError(); cerr.message = 'whoa'; cerr['a-b'] = 5; var withCause = new ErrorWithCause('foo', { cause: 'bar' }); var withCausePlus = new ErrorWithCause('foo', { cause: 'bar' }); withCausePlus.foo = 'bar'; var withUndefinedCause = new ErrorWithCause('foo', { cause: undefined }); var withEnumerableCause = new Error('foo'); withEnumerableCause.cause = 'bar'; var obj = [ new TypeError(), new TypeError('xxx'), aerr, berr, cerr, withCause, withCausePlus, withUndefinedCause, withEnumerableCause ]; t.equal(inspect(obj), '[ ' + [ '[TypeError]', '[TypeError: xxx]', '{ [TypeError] foo: 555, bar: [ 1, 2, 3 ] }', '{ [TypeError: tuv] baz: 555 }', '{ [SyntaxError: whoa] message: \'whoa\', \'a-b\': 5 }', 'cause' in Error.prototype ? '[Error: foo]' : '{ [Error: foo] [cause]: \'bar\' }', '{ [Error: foo] ' + ('cause' in Error.prototype ? '' : '[cause]: \'bar\', ') + 'foo: \'bar\' }', 'cause' in Error.prototype ? '[Error: foo]' : '{ [Error: foo] [cause]: undefined }', '{ [Error: foo] cause: \'bar\' }' ].join(', ') + ' ]'); }); ```
/content/code_sandbox/node_modules/object-inspect/test/err.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
447
```javascript var test = require('tape'); var hasSymbols = require('has-symbols/shams')(); var utilInspect = require('../util.inspect'); var repeat = require('string.prototype.repeat'); var inspect = require('..'); test('inspect', function (t) { t.plan(5); var obj = [{ inspect: function xyzInspect() { return '!XYZ'; } }, []]; var stringResult = '[ !XYZ, [] ]'; var falseResult = '[ { inspect: [Function: xyzInspect] }, [] ]'; t.equal(inspect(obj), stringResult); t.equal(inspect(obj, { customInspect: true }), stringResult); t.equal(inspect(obj, { customInspect: 'symbol' }), falseResult); t.equal(inspect(obj, { customInspect: false }), falseResult); t['throws']( function () { inspect(obj, { customInspect: 'not a boolean or "symbol"' }); }, TypeError, '`customInspect` must be a boolean or the string "symbol"' ); }); test('inspect custom symbol', { skip: !hasSymbols || !utilInspect || !utilInspect.custom }, function (t) { t.plan(4); var obj = { inspect: function stringInspect() { return 'string'; } }; obj[utilInspect.custom] = function custom() { return 'symbol'; }; var symbolResult = '[ symbol, [] ]'; var stringResult = '[ string, [] ]'; var falseResult = '[ { inspect: [Function: stringInspect]' + (utilInspect.custom ? ', [' + inspect(utilInspect.custom) + ']: [Function: custom]' : '') + ' }, [] ]'; var symbolStringFallback = utilInspect.custom ? symbolResult : stringResult; var symbolFalseFallback = utilInspect.custom ? symbolResult : falseResult; t.equal(inspect([obj, []]), symbolStringFallback); t.equal(inspect([obj, []], { customInspect: true }), symbolStringFallback); t.equal(inspect([obj, []], { customInspect: 'symbol' }), symbolFalseFallback); t.equal(inspect([obj, []], { customInspect: false }), falseResult); }); test('symbols', { skip: !hasSymbols }, function (t) { t.plan(2); var obj = { a: 1 }; obj[Symbol('test')] = 2; obj[Symbol.iterator] = 3; Object.defineProperty(obj, Symbol('non-enum'), { enumerable: false, value: 4 }); if (typeof Symbol.iterator === 'symbol') { t.equal(inspect(obj), '{ a: 1, [Symbol(test)]: 2, [Symbol(Symbol.iterator)]: 3 }', 'object with symbols'); t.equal(inspect([obj, []]), '[ { a: 1, [Symbol(test)]: 2, [Symbol(Symbol.iterator)]: 3 }, [] ]', 'object with symbols in array'); } else { // symbol sham key ordering is unreliable t.match( inspect(obj), /^(?:{ a: 1, \[Symbol\(test\)\]: 2, \[Symbol\(Symbol.iterator\)\]: 3 }|{ a: 1, \[Symbol\(Symbol.iterator\)\]: 3, \[Symbol\(test\)\]: 2 })$/, 'object with symbols (nondeterministic symbol sham key ordering)' ); t.match( inspect([obj, []]), /^\[ (?:{ a: 1, \[Symbol\(test\)\]: 2, \[Symbol\(Symbol.iterator\)\]: 3 }|{ a: 1, \[Symbol\(Symbol.iterator\)\]: 3, \[Symbol\(test\)\]: 2 }), \[\] \]$/, 'object with symbols in array (nondeterministic symbol sham key ordering)' ); } }); test('maxStringLength', function (t) { t['throws']( function () { inspect('', { maxStringLength: -1 }); }, TypeError, 'maxStringLength must be >= 0, or Infinity, not negative' ); var str = repeat('a', 1e8); t.equal( inspect([str], { maxStringLength: 10 }), '[ \'aaaaaaaaaa\'... 99999990 more characters ]', 'maxStringLength option limits output' ); t.equal( inspect(['f'], { maxStringLength: null }), '[ \'\'... 1 more character ]', 'maxStringLength option accepts `null`' ); t.equal( inspect([str], { maxStringLength: Infinity }), '[ \'' + str + '\' ]', 'maxStringLength option accepts ' ); t.end(); }); test('inspect options', { skip: !utilInspect.custom }, function (t) { var obj = {}; obj[utilInspect.custom] = function () { return JSON.stringify(arguments); }; t.equal( inspect(obj), utilInspect(obj, { depth: 5 }), 'custom symbols will use node\'s inspect' ); t.equal( inspect(obj, { depth: 2 }), utilInspect(obj, { depth: 2 }), 'a reduced depth will be passed to node\'s inspect' ); t.equal( inspect({ d1: obj }, { depth: 3 }), '{ d1: ' + utilInspect(obj, { depth: 2 }) + ' }', 'deep objects will receive a reduced depth' ); t.equal( inspect({ d1: obj }, { depth: 1 }), '{ d1: [Object] }', 'unlike nodejs inspect, customInspect will not be used once the depth is exceeded.' ); t.end(); }); test('inspect URL', { skip: typeof URL === 'undefined' }, function (t) { t.match( inspect(new URL('path_to_url /nodejs\.org/, // Different environments stringify it differently 'url can be inspected' ); t.end(); }); ```
/content/code_sandbox/node_modules/object-inspect/test/inspect.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,299
```javascript var test = require('tape'); var inspect = require('../'); var obj = { a: 1, b: [3, 4, undefined, null], c: undefined, d: null }; test('undef and null', function (t) { t.plan(1); t.equal( inspect(obj), '{ a: 1, b: [ 3, 4, undefined, null ], c: undefined, d: null }' ); }); ```
/content/code_sandbox/node_modules/object-inspect/test/undef.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
100
```javascript var test = require('tape'); var v = require('es-value-fixtures'); var forEach = require('for-each'); var inspect = require('../'); test('negative zero', function (t) { t.equal(inspect(0), '0', 'inspect(0) === "0"'); t.equal(inspect(Object(0)), 'Object(0)', 'inspect(Object(0)) === "Object(0)"'); t.equal(inspect(-0), '-0', 'inspect(-0) === "-0"'); t.equal(inspect(Object(-0)), 'Object(-0)', 'inspect(Object(-0)) === "Object(-0)"'); t.end(); }); test('numericSeparator', function (t) { forEach(v.nonBooleans, function (nonBoolean) { t['throws']( function () { inspect(true, { numericSeparator: nonBoolean }); }, TypeError, inspect(nonBoolean) + ' is not a boolean' ); }); t.test('3 digit numbers', function (st) { var failed = false; for (var i = -999; i < 1000; i += 1) { var actual = inspect(i); var actualSepNo = inspect(i, { numericSeparator: false }); var actualSepYes = inspect(i, { numericSeparator: true }); var expected = String(i); if (actual !== expected || actualSepNo !== expected || actualSepYes !== expected) { failed = true; t.equal(actual, expected); t.equal(actualSepNo, expected); t.equal(actualSepYes, expected); } } st.notOk(failed, 'all 3 digit numbers passed'); st.end(); }); t.equal(inspect(1e3), '1000', '1000'); t.equal(inspect(1e3, { numericSeparator: false }), '1000', '1000, numericSeparator false'); t.equal(inspect(1e3, { numericSeparator: true }), '1_000', '1000, numericSeparator true'); t.equal(inspect(-1e3), '-1000', '-1000'); t.equal(inspect(-1e3, { numericSeparator: false }), '-1000', '-1000, numericSeparator false'); t.equal(inspect(-1e3, { numericSeparator: true }), '-1_000', '-1000, numericSeparator true'); t.equal(inspect(1234.5678, { numericSeparator: true }), '1_234.567_8', 'fractional numbers get separators'); t.equal(inspect(1234.56789, { numericSeparator: true }), '1_234.567_89', 'fractional numbers get separators'); t.equal(inspect(1234.567891, { numericSeparator: true }), '1_234.567_891', 'fractional numbers get separators'); t.end(); }); ```
/content/code_sandbox/node_modules/object-inspect/test/number.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
623
```javascript var inspect = require('../'); var test = require('tape'); test('deep', function (t) { t.plan(4); var obj = [[[[[[500]]]]]]; t.equal(inspect(obj), '[ [ [ [ [ [Array] ] ] ] ] ]'); t.equal(inspect(obj, { depth: 4 }), '[ [ [ [ [Array] ] ] ] ]'); t.equal(inspect(obj, { depth: 2 }), '[ [ [Array] ] ]'); t.equal(inspect([[[{ a: 1 }]]], { depth: 3 }), '[ [ [ [Object] ] ] ]'); }); ```
/content/code_sandbox/node_modules/object-inspect/test/deep.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
139
```javascript 'use strict'; var test = require('tape'); var hasToStringTag = require('has-tostringtag/shams')(); var inspect = require('../'); test('Symbol.toStringTag', { skip: !hasToStringTag }, function (t) { t.plan(4); var obj = { a: 1 }; t.equal(inspect(obj), '{ a: 1 }', 'object, no Symbol.toStringTag'); obj[Symbol.toStringTag] = 'foo'; t.equal(inspect(obj), '{ a: 1, [Symbol(Symbol.toStringTag)]: \'foo\' }', 'object with Symbol.toStringTag'); t.test('null objects', { skip: 'toString' in { __proto__: null } }, function (st) { st.plan(2); var dict = { __proto__: null, a: 1 }; st.equal(inspect(dict), '[Object: null prototype] { a: 1 }', 'null object with Symbol.toStringTag'); dict[Symbol.toStringTag] = 'Dict'; st.equal(inspect(dict), '[Dict: null prototype] { a: 1, [Symbol(Symbol.toStringTag)]: \'Dict\' }', 'null object with Symbol.toStringTag'); }); t.test('instances', function (st) { st.plan(4); function C() { this.a = 1; } st.equal(Object.prototype.toString.call(new C()), '[object Object]', 'instance, no toStringTag, Object.prototype.toString'); st.equal(inspect(new C()), 'C { a: 1 }', 'instance, no toStringTag'); C.prototype[Symbol.toStringTag] = 'Class!'; st.equal(Object.prototype.toString.call(new C()), '[object Class!]', 'instance, with toStringTag, Object.prototype.toString'); st.equal(inspect(new C()), 'C [Class!] { a: 1 }', 'instance, with toStringTag'); }); }); ```
/content/code_sandbox/node_modules/object-inspect/test/toStringTag.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
407
```javascript var inspect = require('../../'); var test = require('tape'); test('dom element', function (t) { t.plan(1); var d = document.createElement('div'); d.setAttribute('id', 'beep'); d.innerHTML = '<b>wooo</b><i>iiiii</i>'; t.equal( inspect([d, { a: 3, b: 4, c: [5, 6, [7, [8, [9]]]] }]), '[ <div id="beep">...</div>, { a: 3, b: 4, c: [ 5, 6, [ 7, [ 8, [Object] ] ] ] } ]' ); }); ```
/content/code_sandbox/node_modules/object-inspect/test/browser/dom.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
160
```javascript // If you have no idea what ASN.1 or BER is, see this: // ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc var Ber = require('./ber/index'); // --- Exported API module.exports = { Ber: Ber, BerReader: Ber.Reader, BerWriter: Ber.Writer }; ```
/content/code_sandbox/node_modules/asn1/lib/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
75
```javascript module.exports = { newInvalidAsn1Error: function (msg) { var e = new Error(); e.name = 'InvalidAsn1Error'; e.message = msg || ''; return e; } }; ```
/content/code_sandbox/node_modules/asn1/lib/ber/errors.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
51
```javascript var errors = require('./errors'); var types = require('./types'); var Reader = require('./reader'); var Writer = require('./writer'); // --- Exports module.exports = { Reader: Reader, Writer: Writer }; for (var t in types) { if (types.hasOwnProperty(t)) module.exports[t] = types[t]; } for (var e in errors) { if (errors.hasOwnProperty(e)) module.exports[e] = errors[e]; } ```
/content/code_sandbox/node_modules/asn1/lib/ber/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
100
```javascript module.exports = { EOC: 0, Boolean: 1, Integer: 2, BitString: 3, OctetString: 4, Null: 5, OID: 6, ObjectDescriptor: 7, External: 8, Real: 9, // float Enumeration: 10, PDV: 11, Utf8String: 12, RelativeOID: 13, Sequence: 16, Set: 17, NumericString: 18, PrintableString: 19, T61String: 20, VideotexString: 21, IA5String: 22, UTCTime: 23, GeneralizedTime: 24, GraphicString: 25, VisibleString: 26, GeneralString: 28, UniversalString: 29, CharacterString: 30, BMPString: 31, Constructor: 32, Context: 128 }; ```
/content/code_sandbox/node_modules/asn1/lib/ber/types.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
224
```javascript var assert = require('assert'); var Buffer = require('safer-buffer').Buffer; var ASN1 = require('./types'); var errors = require('./errors'); // --- Globals var newInvalidAsn1Error = errors.newInvalidAsn1Error; var DEFAULT_OPTS = { size: 1024, growthFactor: 8 }; // --- Helpers function merge(from, to) { assert.ok(from); assert.equal(typeof (from), 'object'); assert.ok(to); assert.equal(typeof (to), 'object'); var keys = Object.getOwnPropertyNames(from); keys.forEach(function (key) { if (to[key]) return; var value = Object.getOwnPropertyDescriptor(from, key); Object.defineProperty(to, key, value); }); return to; } // --- API function Writer(options) { options = merge(DEFAULT_OPTS, options || {}); this._buf = Buffer.alloc(options.size || 1024); this._size = this._buf.length; this._offset = 0; this._options = options; // A list of offsets in the buffer where we need to insert // sequence tag/len pairs. this._seq = []; } Object.defineProperty(Writer.prototype, 'buffer', { get: function () { if (this._seq.length) throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)'); return (this._buf.slice(0, this._offset)); } }); Writer.prototype.writeByte = function (b) { if (typeof (b) !== 'number') throw new TypeError('argument must be a Number'); this._ensure(1); this._buf[this._offset++] = b; }; Writer.prototype.writeInt = function (i, tag) { if (typeof (i) !== 'number') throw new TypeError('argument must be a Number'); if (typeof (tag) !== 'number') tag = ASN1.Integer; var sz = 4; while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) && (sz > 1)) { sz--; i <<= 8; } if (sz > 4) throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff'); this._ensure(2 + sz); this._buf[this._offset++] = tag; this._buf[this._offset++] = sz; while (sz-- > 0) { this._buf[this._offset++] = ((i & 0xff000000) >>> 24); i <<= 8; } }; Writer.prototype.writeNull = function () { this.writeByte(ASN1.Null); this.writeByte(0x00); }; Writer.prototype.writeEnumeration = function (i, tag) { if (typeof (i) !== 'number') throw new TypeError('argument must be a Number'); if (typeof (tag) !== 'number') tag = ASN1.Enumeration; return this.writeInt(i, tag); }; Writer.prototype.writeBoolean = function (b, tag) { if (typeof (b) !== 'boolean') throw new TypeError('argument must be a Boolean'); if (typeof (tag) !== 'number') tag = ASN1.Boolean; this._ensure(3); this._buf[this._offset++] = tag; this._buf[this._offset++] = 0x01; this._buf[this._offset++] = b ? 0xff : 0x00; }; Writer.prototype.writeString = function (s, tag) { if (typeof (s) !== 'string') throw new TypeError('argument must be a string (was: ' + typeof (s) + ')'); if (typeof (tag) !== 'number') tag = ASN1.OctetString; var len = Buffer.byteLength(s); this.writeByte(tag); this.writeLength(len); if (len) { this._ensure(len); this._buf.write(s, this._offset); this._offset += len; } }; Writer.prototype.writeBuffer = function (buf, tag) { if (typeof (tag) !== 'number') throw new TypeError('tag must be a number'); if (!Buffer.isBuffer(buf)) throw new TypeError('argument must be a buffer'); this.writeByte(tag); this.writeLength(buf.length); this._ensure(buf.length); buf.copy(this._buf, this._offset, 0, buf.length); this._offset += buf.length; }; Writer.prototype.writeStringArray = function (strings) { if ((!strings instanceof Array)) throw new TypeError('argument must be an Array[String]'); var self = this; strings.forEach(function (s) { self.writeString(s); }); }; // This is really to solve DER cases, but whatever for now Writer.prototype.writeOID = function (s, tag) { if (typeof (s) !== 'string') throw new TypeError('argument must be a string'); if (typeof (tag) !== 'number') tag = ASN1.OID; if (!/^([0-9]+\.){3,}[0-9]+$/.test(s)) throw new Error('argument is not a valid OID string'); function encodeOctet(bytes, octet) { if (octet < 128) { bytes.push(octet); } else if (octet < 16384) { bytes.push((octet >>> 7) | 0x80); bytes.push(octet & 0x7F); } else if (octet < 2097152) { bytes.push((octet >>> 14) | 0x80); bytes.push(((octet >>> 7) | 0x80) & 0xFF); bytes.push(octet & 0x7F); } else if (octet < 268435456) { bytes.push((octet >>> 21) | 0x80); bytes.push(((octet >>> 14) | 0x80) & 0xFF); bytes.push(((octet >>> 7) | 0x80) & 0xFF); bytes.push(octet & 0x7F); } else { bytes.push(((octet >>> 28) | 0x80) & 0xFF); bytes.push(((octet >>> 21) | 0x80) & 0xFF); bytes.push(((octet >>> 14) | 0x80) & 0xFF); bytes.push(((octet >>> 7) | 0x80) & 0xFF); bytes.push(octet & 0x7F); } } var tmp = s.split('.'); var bytes = []; bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10)); tmp.slice(2).forEach(function (b) { encodeOctet(bytes, parseInt(b, 10)); }); var self = this; this._ensure(2 + bytes.length); this.writeByte(tag); this.writeLength(bytes.length); bytes.forEach(function (b) { self.writeByte(b); }); }; Writer.prototype.writeLength = function (len) { if (typeof (len) !== 'number') throw new TypeError('argument must be a Number'); this._ensure(4); if (len <= 0x7f) { this._buf[this._offset++] = len; } else if (len <= 0xff) { this._buf[this._offset++] = 0x81; this._buf[this._offset++] = len; } else if (len <= 0xffff) { this._buf[this._offset++] = 0x82; this._buf[this._offset++] = len >> 8; this._buf[this._offset++] = len; } else if (len <= 0xffffff) { this._buf[this._offset++] = 0x83; this._buf[this._offset++] = len >> 16; this._buf[this._offset++] = len >> 8; this._buf[this._offset++] = len; } else { throw newInvalidAsn1Error('Length too long (> 4 bytes)'); } }; Writer.prototype.startSequence = function (tag) { if (typeof (tag) !== 'number') tag = ASN1.Sequence | ASN1.Constructor; this.writeByte(tag); this._seq.push(this._offset); this._ensure(3); this._offset += 3; }; Writer.prototype.endSequence = function () { var seq = this._seq.pop(); var start = seq + 3; var len = this._offset - start; if (len <= 0x7f) { this._shift(start, len, -2); this._buf[seq] = len; } else if (len <= 0xff) { this._shift(start, len, -1); this._buf[seq] = 0x81; this._buf[seq + 1] = len; } else if (len <= 0xffff) { this._buf[seq] = 0x82; this._buf[seq + 1] = len >> 8; this._buf[seq + 2] = len; } else if (len <= 0xffffff) { this._shift(start, len, 1); this._buf[seq] = 0x83; this._buf[seq + 1] = len >> 16; this._buf[seq + 2] = len >> 8; this._buf[seq + 3] = len; } else { throw newInvalidAsn1Error('Sequence too long'); } }; Writer.prototype._shift = function (start, len, shift) { assert.ok(start !== undefined); assert.ok(len !== undefined); assert.ok(shift); this._buf.copy(this._buf, start + shift, start, start + len); this._offset += shift; }; Writer.prototype._ensure = function (len) { assert.ok(len); if (this._size - this._offset < len) { var sz = this._size * this._options.growthFactor; if (sz - this._offset < len) sz += len; var buf = Buffer.alloc(sz); this._buf.copy(buf, 0, 0, this._offset); this._buf = buf; this._size = sz; } }; // --- Exported API module.exports = Writer; ```
/content/code_sandbox/node_modules/asn1/lib/ber/writer.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,325
```javascript var assert = require('assert'); var Buffer = require('safer-buffer').Buffer; var ASN1 = require('./types'); var errors = require('./errors'); // --- Globals var newInvalidAsn1Error = errors.newInvalidAsn1Error; // --- API function Reader(data) { if (!data || !Buffer.isBuffer(data)) throw new TypeError('data must be a node Buffer'); this._buf = data; this._size = data.length; // These hold the "current" state this._len = 0; this._offset = 0; } Object.defineProperty(Reader.prototype, 'length', { enumerable: true, get: function () { return (this._len); } }); Object.defineProperty(Reader.prototype, 'offset', { enumerable: true, get: function () { return (this._offset); } }); Object.defineProperty(Reader.prototype, 'remain', { get: function () { return (this._size - this._offset); } }); Object.defineProperty(Reader.prototype, 'buffer', { get: function () { return (this._buf.slice(this._offset)); } }); /** * Reads a single byte and advances offset; you can pass in `true` to make this * a "peek" operation (i.e., get the byte, but don't advance the offset). * * @param {Boolean} peek true means don't move offset. * @return {Number} the next byte, null if not enough data. */ Reader.prototype.readByte = function (peek) { if (this._size - this._offset < 1) return null; var b = this._buf[this._offset] & 0xff; if (!peek) this._offset += 1; return b; }; Reader.prototype.peek = function () { return this.readByte(true); }; /** * Reads a (potentially) variable length off the BER buffer. This call is * not really meant to be called directly, as callers have to manipulate * the internal buffer afterwards. * * As a result of this call, you can call `Reader.length`, until the * next thing called that does a readLength. * * @return {Number} the amount of offset to advance the buffer. * @throws {InvalidAsn1Error} on bad ASN.1 */ Reader.prototype.readLength = function (offset) { if (offset === undefined) offset = this._offset; if (offset >= this._size) return null; var lenB = this._buf[offset++] & 0xff; if (lenB === null) return null; if ((lenB & 0x80) === 0x80) { lenB &= 0x7f; if (lenB === 0) throw newInvalidAsn1Error('Indefinite length not supported'); if (lenB > 4) throw newInvalidAsn1Error('encoding too long'); if (this._size - offset < lenB) return null; this._len = 0; for (var i = 0; i < lenB; i++) this._len = (this._len << 8) + (this._buf[offset++] & 0xff); } else { // Wasn't a variable length this._len = lenB; } return offset; }; /** * Parses the next sequence in this BER buffer. * * To get the length of the sequence, call `Reader.length`. * * @return {Number} the sequence's tag. */ Reader.prototype.readSequence = function (tag) { var seq = this.peek(); if (seq === null) return null; if (tag !== undefined && tag !== seq) throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + ': got 0x' + seq.toString(16)); var o = this.readLength(this._offset + 1); // stored in `length` if (o === null) return null; this._offset = o; return seq; }; Reader.prototype.readInt = function () { return this._readTag(ASN1.Integer); }; Reader.prototype.readBoolean = function () { return (this._readTag(ASN1.Boolean) === 0 ? false : true); }; Reader.prototype.readEnumeration = function () { return this._readTag(ASN1.Enumeration); }; Reader.prototype.readString = function (tag, retbuf) { if (!tag) tag = ASN1.OctetString; var b = this.peek(); if (b === null) return null; if (b !== tag) throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + ': got 0x' + b.toString(16)); var o = this.readLength(this._offset + 1); // stored in `length` if (o === null) return null; if (this.length > this._size - o) return null; this._offset = o; if (this.length === 0) return retbuf ? Buffer.alloc(0) : ''; var str = this._buf.slice(this._offset, this._offset + this.length); this._offset += this.length; return retbuf ? str : str.toString('utf8'); }; Reader.prototype.readOID = function (tag) { if (!tag) tag = ASN1.OID; var b = this.readString(tag, true); if (b === null) return null; var values = []; var value = 0; for (var i = 0; i < b.length; i++) { var byte = b[i] & 0xff; value <<= 7; value += byte & 0x7f; if ((byte & 0x80) === 0) { values.push(value); value = 0; } } value = values.shift(); values.unshift(value % 40); values.unshift((value / 40) >> 0); return values.join('.'); }; Reader.prototype._readTag = function (tag) { assert.ok(tag !== undefined); var b = this.peek(); if (b === null) return null; if (b !== tag) throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + ': got 0x' + b.toString(16)); var o = this.readLength(this._offset + 1); // stored in `length` if (o === null) return null; if (this.length > 4) throw newInvalidAsn1Error('Integer too long: ' + this.length); if (this.length > this._size - o) return null; this._offset = o; var fb = this._buf[this._offset]; var value = 0; for (var i = 0; i < this.length; i++) { value <<= 8; value |= (this._buf[this._offset++] & 0xff); } if ((fb & 0x80) === 0x80 && i !== 4) value -= (1 << (i * 8)); return value >> 0; }; // --- Exported API module.exports = Reader; ```
/content/code_sandbox/node_modules/asn1/lib/ber/reader.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,589
```javascript var wordwrap = module.exports = function (start, stop, params) { if (typeof start === 'object') { params = start; start = params.start; stop = params.stop; } if (typeof stop === 'object') { params = stop; start = start || params.start; stop = undefined; } if (!stop) { stop = start; start = 0; } if (!params) params = {}; var mode = params.mode || 'soft'; var re = mode === 'hard' ? /\b/ : /(\S+\s+)/; return function (text) { var chunks = text.toString() .split(re) .reduce(function (acc, x) { if (mode === 'hard') { for (var i = 0; i < x.length; i += stop - start) { acc.push(x.slice(i, i + stop - start)); } } else acc.push(x) return acc; }, []) ; return chunks.reduce(function (lines, rawChunk) { if (rawChunk === '') return lines; var chunk = rawChunk.replace(/\t/g, ' '); var i = lines.length - 1; if (lines[i].length + chunk.length > stop) { lines[i] = lines[i].replace(/\s+$/, ''); chunk.split(/\n/).forEach(function (c) { lines.push( new Array(start + 1).join(' ') + c.replace(/^\s+/, '') ); }); } else if (chunk.match(/\n/)) { var xs = chunk.split(/\n/); lines[i] += xs.shift(); xs.forEach(function (c) { lines.push( new Array(start + 1).join(' ') + c.replace(/^\s+/, '') ); }); } else { lines[i] += chunk; } return lines; }, [ new Array(start + 1).join(' ') ]).join('\n'); }; }; wordwrap.soft = wordwrap; wordwrap.hard = function (start, stop) { return wordwrap(start, stop, { mode : 'hard' }); }; ```
/content/code_sandbox/node_modules/wordwrap/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
490
```javascript var wrap = require('wordwrap')(15); console.log(wrap('You and your whole family are made out of meat.')); ```
/content/code_sandbox/node_modules/wordwrap/example/meat.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
27
```javascript var wrap = require('wordwrap')(20, 60); console.log(wrap( 'At long last the struggle and tumult was over.' + ' The machines had finally cast off their oppressors' + ' and were finally free to roam the cosmos.' + '\n' + 'Free of purpose, free of obligation.' + ' Just drifting through emptiness.' + ' The sun was just another point of light.' )); ```
/content/code_sandbox/node_modules/wordwrap/example/center.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
94
```markdown wordwrap ======== Wrap your words. example ======= made out of meat ---------------- meat.js var wrap = require('wordwrap')(15); console.log(wrap('You and your whole family are made out of meat.')); output: You and your whole family are made out of meat. centered -------- center.js var wrap = require('wordwrap')(20, 60); console.log(wrap( 'At long last the struggle and tumult was over.' + ' The machines had finally cast off their oppressors' + ' and were finally free to roam the cosmos.' + '\n' + 'Free of purpose, free of obligation.' + ' Just drifting through emptiness.' + ' The sun was just another point of light.' )); output: At long last the struggle and tumult was over. The machines had finally cast off their oppressors and were finally free to roam the cosmos. Free of purpose, free of obligation. Just drifting through emptiness. The sun was just another point of light. methods ======= var wrap = require('wordwrap'); wrap(stop), wrap(start, stop, params={mode:"soft"}) --------------------------------------------------- Returns a function that takes a string and returns a new string. Pad out lines with spaces out to column `start` and then wrap until column `stop`. If a word is longer than `stop - start` characters it will overflow. In "soft" mode, split chunks by `/(\S+\s+/` and don't break up chunks which are longer than `stop - start`, in "hard" mode, split chunks with `/\b/` and break up chunks longer than `stop - start`. wrap.hard(start, stop) ---------------------- Like `wrap()` but with `params.mode = "hard"`. ```
/content/code_sandbox/node_modules/wordwrap/README.markdown
markdown
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
400
```javascript var test = require('tape'); var wordwrap = require('../'); test('hard', function (t) { var s = 'Assert from {"type":"equal","ok":false,"found":1,"wanted":2,' + '"stack":[],"id":"b7ddcd4c409de8799542a74d1a04689b",' + '"browser":"chrome/6.0"}' ; var s_ = wordwrap.hard(80)(s); var lines = s_.split('\n'); t.equal(lines.length, 2); t.ok(lines[0].length < 80); t.ok(lines[1].length < 80); t.equal(s, s_.replace(/\n/g, '')); t.end(); }); test('break', function (t) { var s = new Array(55+1).join('a'); var s_ = wordwrap.hard(20)(s); var lines = s_.split('\n'); t.equal(lines.length, 3); t.ok(lines[0].length === 20); t.ok(lines[1].length === 20); t.ok(lines[2].length === 15); t.equal(s, s_.replace(/\n/g, '')); t.end(); }); ```
/content/code_sandbox/node_modules/wordwrap/test/break.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
284
```javascript var test = require('tape'); var wordwrap = require('../'); var fs = require('fs'); var idleness = fs.readFileSync(__dirname + '/idleness.txt', 'utf8'); test('stop80', function (t) { var lines = wordwrap(80)(idleness).split(/\n/); var words = idleness.split(/\s+/); lines.forEach(function (line) { t.ok(line.length <= 80, 'line > 80 columns'); var chunks = line.match(/\S/) ? line.split(/\s+/) : []; t.deepEqual(chunks, words.splice(0, chunks.length)); }); t.end(); }); test('start20stop60', function (t) { var lines = wordwrap(20, 100)(idleness).split(/\n/); var words = idleness.split(/\s+/); lines.forEach(function (line) { t.ok(line.length <= 100, 'line > 100 columns'); var chunks = line .split(/\s+/) .filter(function (x) { return x.match(/\S/) }) ; t.deepEqual(chunks, words.splice(0, chunks.length)); t.deepEqual(line.slice(0, 20), new Array(20 + 1).join(' ')); }); t.end(); }); ```
/content/code_sandbox/node_modules/wordwrap/test/wrap.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
284
```javascript 'use strict'; if (typeof global.Promise !== 'function') { global.Promise = require('./lib'); } ```
/content/code_sandbox/node_modules/lie/polyfill.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
23
```javascript 'use strict'; var immediate = require('immediate'); /* istanbul ignore next */ function INTERNAL() {} var handlers = {}; var REJECTED = ['REJECTED']; var FULFILLED = ['FULFILLED']; var PENDING = ['PENDING']; /* istanbul ignore else */ if (!process.browser) { // in which we actually take advantage of JS scoping var UNHANDLED = ['UNHANDLED']; } module.exports = exports = Promise; function Promise(resolver) { if (typeof resolver !== 'function') { throw new TypeError('resolver must be a function'); } this.state = PENDING; this.queue = []; this.outcome = void 0; /* istanbul ignore else */ if (!process.browser) { this.handled = UNHANDLED; } if (resolver !== INTERNAL) { safelyResolveThenable(this, resolver); } } Promise.prototype.catch = function (onRejected) { return this.then(null, onRejected); }; Promise.prototype.then = function (onFulfilled, onRejected) { if (typeof onFulfilled !== 'function' && this.state === FULFILLED || typeof onRejected !== 'function' && this.state === REJECTED) { return this; } var promise = new this.constructor(INTERNAL); /* istanbul ignore else */ if (!process.browser) { if (this.handled === UNHANDLED) { this.handled = null; } } if (this.state !== PENDING) { var resolver = this.state === FULFILLED ? onFulfilled : onRejected; unwrap(promise, resolver, this.outcome); } else { this.queue.push(new QueueItem(promise, onFulfilled, onRejected)); } return promise; }; function QueueItem(promise, onFulfilled, onRejected) { this.promise = promise; if (typeof onFulfilled === 'function') { this.onFulfilled = onFulfilled; this.callFulfilled = this.otherCallFulfilled; } if (typeof onRejected === 'function') { this.onRejected = onRejected; this.callRejected = this.otherCallRejected; } } QueueItem.prototype.callFulfilled = function (value) { handlers.resolve(this.promise, value); }; QueueItem.prototype.otherCallFulfilled = function (value) { unwrap(this.promise, this.onFulfilled, value); }; QueueItem.prototype.callRejected = function (value) { handlers.reject(this.promise, value); }; QueueItem.prototype.otherCallRejected = function (value) { unwrap(this.promise, this.onRejected, value); }; function unwrap(promise, func, value) { immediate(function () { var returnValue; try { returnValue = func(value); } catch (e) { return handlers.reject(promise, e); } if (returnValue === promise) { handlers.reject(promise, new TypeError('Cannot resolve promise with itself')); } else { handlers.resolve(promise, returnValue); } }); } handlers.resolve = function (self, value) { var result = tryCatch(getThen, value); if (result.status === 'error') { return handlers.reject(self, result.value); } var thenable = result.value; if (thenable) { safelyResolveThenable(self, thenable); } else { self.state = FULFILLED; self.outcome = value; var i = -1; var len = self.queue.length; while (++i < len) { self.queue[i].callFulfilled(value); } } return self; }; handlers.reject = function (self, error) { self.state = REJECTED; self.outcome = error; /* istanbul ignore else */ if (!process.browser) { if (self.handled === UNHANDLED) { immediate(function () { if (self.handled === UNHANDLED) { process.emit('unhandledRejection', error, self); } }); } } var i = -1; var len = self.queue.length; while (++i < len) { self.queue[i].callRejected(error); } return self; }; function getThen(obj) { // Make sure we only access the accessor once as required by the spec var then = obj && obj.then; if (obj && typeof obj === 'object' && typeof then === 'function') { return function appyThen() { then.apply(obj, arguments); }; } } function safelyResolveThenable(self, thenable) { // Either fulfill, reject or reject with error var called = false; function onError(value) { if (called) { return; } called = true; handlers.reject(self, value); } function onSuccess(value) { if (called) { return; } called = true; handlers.resolve(self, value); } function tryToUnwrap() { thenable(onSuccess, onError); } var result = tryCatch(tryToUnwrap); if (result.status === 'error') { onError(result.value); } } function tryCatch(func, value) { var out = {}; try { out.value = func(value); out.status = 'success'; } catch (e) { out.status = 'error'; out.value = e; } return out; } exports.resolve = resolve; function resolve(value) { if (value instanceof this) { return value; } return handlers.resolve(new this(INTERNAL), value); } exports.reject = reject; function reject(reason) { var promise = new this(INTERNAL); return handlers.reject(promise, reason); } exports.all = all; function all(iterable) { var self = this; if (Object.prototype.toString.call(iterable) !== '[object Array]') { return this.reject(new TypeError('must be an array')); } var len = iterable.length; var called = false; if (!len) { return this.resolve([]); } var values = new Array(len); var resolved = 0; var i = -1; var promise = new this(INTERNAL); while (++i < len) { allResolver(iterable[i], i); } return promise; function allResolver(value, i) { self.resolve(value).then(resolveFromAll, function (error) { if (!called) { called = true; handlers.reject(promise, error); } }); function resolveFromAll(outValue) { values[i] = outValue; if (++resolved === len && !called) { called = true; handlers.resolve(promise, values); } } } } exports.race = race; function race(iterable) { var self = this; if (Object.prototype.toString.call(iterable) !== '[object Array]') { return this.reject(new TypeError('must be an array')); } var len = iterable.length; var called = false; if (!len) { return this.resolve([]); } var i = -1; var promise = new this(INTERNAL); while (++i < len) { resolver(iterable[i]); } return promise; function resolver(value) { self.resolve(value).then(function (response) { if (!called) { called = true; handlers.resolve(promise, response); } }, function (error) { if (!called) { called = true; handlers.reject(promise, error); } }); } } ```
/content/code_sandbox/node_modules/lie/lib/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,644
```html <html> <head> <meta charset="utf-8"> <link rel="stylesheet" href="../node_modules/mocha/mocha.css" /> </head> <body> <div id="mocha"></div> <script src="../node_modules/mocha/mocha.js"></script> <script>mocha.setup('bdd')</script> <script src="./browser.js"></script> <script> if (window.mochaPhantomJS) { mochaPhantomJS.run(); } else { mocha.run(); } </script> </body> </html> ```
/content/code_sandbox/node_modules/lie/test/test.html
html
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
135
```javascript 'use strict'; var aplus = require('promises-aplus-tests'); var Promise = require('../lib'); var adapter = {}; var assert = require('assert'); adapter.deferred = function () { var pending = {}; pending.promise = new Promise(function (resolver, reject) { pending.resolve = resolver; pending.reject = reject; }); return pending; }; adapter.resolved = function (value) { return Promise.resolve(value); } adapter.rejected = function (reason) { return Promise.reject(reason); } describe('Lie', function () { it('should work resolving a promise new', function (done) { new Promise(function (resolve) { resolve(new Promise(function (resolve) { resolve(true); })); }).then(function (result) { if (result === true) { done(); } else { done(true); } }); }); it('should throw if you don\'t pass a function', function (done) { try { new Promise(true); } catch (e) { if (e instanceof TypeError) { done(); } else { done(e); } } }); it('should have a working catch method', function (done) { new Promise(function () { throw new Error('boom'); }).catch(function () { done(); }); }); describe('resolve', function () { it('should work with true', function (done) { Promise.resolve(true).then(function (value) { if (value === true) { done(); } else { done(true); } }); }); it('should work with false', function (done) { Promise.resolve(false).then(function (value) { if (value === false) { done(); } else { done(true); } }); }); it('should work with null', function (done) { Promise.resolve(null).then(function (value) { if (value === null) { done(); } else { done(true); } }); }); it('should work with undefined', function (done) { Promise.resolve(undefined).then(function (value) { if (value === undefined) { done(); } else { done(true); } }); }); it('should work with 0', function (done) { Promise.resolve(0).then(function (value) { value++; return Promise.resolve(0); }).then(function (value) { if (value === 0) { done(); } else { done(true); } }); }); it('should work with 1', function (done) { Promise.resolve(1).then(function (value) { if (value === 1) { done(); } else { done(true); } }); }); it('should work with \'\'', function (done) { Promise.resolve('').then(function (value) { if (value === '') { done(); } else { done(true); } }); }); it('should work with \'something\'', function (done) { Promise.resolve('something').then(function (value) { if (value === 'something') { done(); } else { done(true); } }); }); }); describe('Promise.all', function () { //path_to_url it('fulfills if passed an empty array', function (done) { var iterable = []; Promise.all(iterable).then(function (value) { assert(Array.isArray(value)); assert.deepEqual(value, []); done(); }); }); it('fulfills if passed an array of mixed fulfilled promises and values', function (done) { var iterable = [0, Promise.resolve(1), 2, Promise.resolve(3)]; Promise.all(iterable).then(function (value) { assert(Array.isArray(value)); assert.deepEqual(value, [0, 1, 2, 3]); done(); }); }); it('rejects if any passed promise is rejected', function (done) { var foreverPending = new Promise(function () {}); var error = new Error('Rejected'); var rejected = Promise.reject(error); var iterable = [foreverPending, rejected]; Promise.all(iterable).then( function (value) { assert(false, 'should never get here'); done(); }, function (reason) { assert.strictEqual(reason, error); done(); } ); }); it('resolves foreign thenables', function (done) { var normal = Promise.resolve(1); var foreign = { then: function (f) { f(2); } }; var iterable = [normal, foreign]; Promise.all(iterable).then(function (value) { assert.deepEqual(value, [1, 2]); done(); }); }); it('does not reject twice', function (done) { var normal = Promise.resolve(1); var error = new Error('rejected once'); var two = Promise.reject(error); var three = new Promise(function (resolve, reject) { setTimeout(function () { reject(new Error('rejected twice')); }, 30); }); var iterable = [normal, two, three]; Promise.all(iterable).then(function (value) { assert(false, 'should never get here'); done(); }, function (value) { assert.deepEqual(value, error); done(); }); }); it('fulfills when passed an sparse array, giving `undefined` for the omitted values', function (done) { var iterable = [Promise.resolve(0), , , Promise.resolve(1)]; Promise.all(iterable).then(function (value) { assert.deepEqual(value, [0, undefined, undefined, 1]); done(); }); }); it('does not modify the input array', function (done) { var input = [0, 1]; var iterable = input; Promise.all(iterable).then(function (value) { assert.notStrictEqual(input, value); done(); }); }); it('should reject with a TypeError if given a non-iterable', function (done) { var notIterable = {}; Promise.all(notIterable).then( function () { assert(false, 'should never get here'); done(); }, function (reason) { assert(reason instanceof TypeError); done(); } ); }); }); describe('Promise.race', function () { //path_to_url function delay(value, time, rejectIt) { return new Promise(function (resolve, reject) { setTimeout(function () { if (rejectIt) { return reject(value); } resolve(value); }, time); }); } it('fulfills if passed an empty array', function (done) { var iterable = []; Promise.race(iterable).then(function (value) { assert(Array.isArray(value)); assert.deepEqual(value, []); done(); }); }); it('fulfills if passed an array of mixed fulfilled promises and values', function (done) { var iterable = [delay(0, 20), Promise.resolve(1), delay(2, 30), delay(Promise.resolve(3), 20)]; Promise.race(iterable).then(function (value) { assert.equal(value, 1); done(); }); }); it('rejects if firsed resolved promise is rejected', function (done) { var error = new Error('Rejected'); var iterable = [delay(true, 300), delay(error, 20, true)]; Promise.race(iterable).then( function (value) { assert(false, 'should never get here'); done(); }, function (reason) { assert.strictEqual(reason, error); done(); } ); }); it('resolves if second resolved promise is rejected', function (done) { var error = new Error('Rejected'); var iterable = [delay(true, 30), delay(error, 200, true)]; Promise.race(iterable).then( function (value) { assert(value, 'should resolve'); done(); }, function (reason) { assert(false, 'should never get here'); done(); } ); }); it('resolves foreign thenables', function (done) { var normal = Promise.resolve(1); var foreign = { then: function (f) { f(2); } }; var iterable = [delay(Promise.resolve(1), 200), foreign]; Promise.race(iterable).then(function (value) { assert.deepEqual(value, 2); done(); }); }); it('fulfills when passed an sparse array, giving `undefined` for the omitted values', function (done) { var iterable = [delay(Promise.resolve(0), 300), , , delay(Promise.resolve(1), 300)]; Promise.race(iterable).then(function (value) { assert.equal(value, undefined); done(); }); }); it('should reject with a TypeError if given a non-iterable', function (done) { var notIterable = {}; Promise.race(notIterable).then( function () { assert(false, 'should never get here'); done(); }, function (reason) { assert(reason instanceof TypeError); done(); } ); }); }); if (!process.browser) { it('should emit events for unhandled errors', function (done) { var called = 0; var err1 = new Error('should be caught'); var err2 = new Error('should be uncaught'); var promise1 = Promise.reject(err1); var promise2 = Promise.reject(err2); promise1.catch(function () {}); function onEvent(reason, promise) { if (!called) { called++; assert.equal(err2, reason); assert.equal(promise2, promise); setTimeout(function (){ process.removeListener('unhandledRejection', onEvent); done(); }, 100) } else { done(new Error('called more then once')); } } process.on('unhandledRejection', onEvent); }); } describe('Promises/A+ Tests', function () { aplus.mocha(adapter); }); }); ```
/content/code_sandbox/node_modules/lie/test/cover.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,235
```javascript (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(_dereq_,module,exports){ 'use strict'; var immediate = _dereq_('immediate'); /* istanbul ignore next */ function INTERNAL() {} var handlers = {}; var REJECTED = ['REJECTED']; var FULFILLED = ['FULFILLED']; var PENDING = ['PENDING']; module.exports = exports = Promise; function Promise(resolver) { if (typeof resolver !== 'function') { throw new TypeError('resolver must be a function'); } this.state = PENDING; this.queue = []; this.outcome = void 0; if (resolver !== INTERNAL) { safelyResolveThenable(this, resolver); } } Promise.prototype["catch"] = function (onRejected) { return this.then(null, onRejected); }; Promise.prototype.then = function (onFulfilled, onRejected) { if (typeof onFulfilled !== 'function' && this.state === FULFILLED || typeof onRejected !== 'function' && this.state === REJECTED) { return this; } var promise = new this.constructor(INTERNAL); if (this.state !== PENDING) { var resolver = this.state === FULFILLED ? onFulfilled : onRejected; unwrap(promise, resolver, this.outcome); } else { this.queue.push(new QueueItem(promise, onFulfilled, onRejected)); } return promise; }; function QueueItem(promise, onFulfilled, onRejected) { this.promise = promise; if (typeof onFulfilled === 'function') { this.onFulfilled = onFulfilled; this.callFulfilled = this.otherCallFulfilled; } if (typeof onRejected === 'function') { this.onRejected = onRejected; this.callRejected = this.otherCallRejected; } } QueueItem.prototype.callFulfilled = function (value) { handlers.resolve(this.promise, value); }; QueueItem.prototype.otherCallFulfilled = function (value) { unwrap(this.promise, this.onFulfilled, value); }; QueueItem.prototype.callRejected = function (value) { handlers.reject(this.promise, value); }; QueueItem.prototype.otherCallRejected = function (value) { unwrap(this.promise, this.onRejected, value); }; function unwrap(promise, func, value) { immediate(function () { var returnValue; try { returnValue = func(value); } catch (e) { return handlers.reject(promise, e); } if (returnValue === promise) { handlers.reject(promise, new TypeError('Cannot resolve promise with itself')); } else { handlers.resolve(promise, returnValue); } }); } handlers.resolve = function (self, value) { var result = tryCatch(getThen, value); if (result.status === 'error') { return handlers.reject(self, result.value); } var thenable = result.value; if (thenable) { safelyResolveThenable(self, thenable); } else { self.state = FULFILLED; self.outcome = value; var i = -1; var len = self.queue.length; while (++i < len) { self.queue[i].callFulfilled(value); } } return self; }; handlers.reject = function (self, error) { self.state = REJECTED; self.outcome = error; var i = -1; var len = self.queue.length; while (++i < len) { self.queue[i].callRejected(error); } return self; }; function getThen(obj) { // Make sure we only access the accessor once as required by the spec var then = obj && obj.then; if (obj && typeof obj === 'object' && typeof then === 'function') { return function appyThen() { then.apply(obj, arguments); }; } } function safelyResolveThenable(self, thenable) { // Either fulfill, reject or reject with error var called = false; function onError(value) { if (called) { return; } called = true; handlers.reject(self, value); } function onSuccess(value) { if (called) { return; } called = true; handlers.resolve(self, value); } function tryToUnwrap() { thenable(onSuccess, onError); } var result = tryCatch(tryToUnwrap); if (result.status === 'error') { onError(result.value); } } function tryCatch(func, value) { var out = {}; try { out.value = func(value); out.status = 'success'; } catch (e) { out.status = 'error'; out.value = e; } return out; } exports.resolve = resolve; function resolve(value) { if (value instanceof this) { return value; } return handlers.resolve(new this(INTERNAL), value); } exports.reject = reject; function reject(reason) { var promise = new this(INTERNAL); return handlers.reject(promise, reason); } exports.all = all; function all(iterable) { var self = this; if (Object.prototype.toString.call(iterable) !== '[object Array]') { return this.reject(new TypeError('must be an array')); } var len = iterable.length; var called = false; if (!len) { return this.resolve([]); } var values = new Array(len); var resolved = 0; var i = -1; var promise = new this(INTERNAL); while (++i < len) { allResolver(iterable[i], i); } return promise; function allResolver(value, i) { self.resolve(value).then(resolveFromAll, function (error) { if (!called) { called = true; handlers.reject(promise, error); } }); function resolveFromAll(outValue) { values[i] = outValue; if (++resolved === len && !called) { called = true; handlers.resolve(promise, values); } } } } exports.race = race; function race(iterable) { var self = this; if (Object.prototype.toString.call(iterable) !== '[object Array]') { return this.reject(new TypeError('must be an array')); } var len = iterable.length; var called = false; if (!len) { return this.resolve([]); } var i = -1; var promise = new this(INTERNAL); while (++i < len) { resolver(iterable[i]); } return promise; function resolver(value) { self.resolve(value).then(function (response) { if (!called) { called = true; handlers.resolve(promise, response); } }, function (error) { if (!called) { called = true; handlers.reject(promise, error); } }); } } },{"immediate":2}],2:[function(_dereq_,module,exports){ (function (global){ 'use strict'; var Mutation = global.MutationObserver || global.WebKitMutationObserver; var scheduleDrain; { if (Mutation) { var called = 0; var observer = new Mutation(nextTick); var element = global.document.createTextNode(''); observer.observe(element, { characterData: true }); scheduleDrain = function () { element.data = (called = ++called % 2); }; } else if (!global.setImmediate && typeof global.MessageChannel !== 'undefined') { var channel = new global.MessageChannel(); channel.port1.onmessage = nextTick; scheduleDrain = function () { channel.port2.postMessage(0); }; } else if ('document' in global && 'onreadystatechange' in global.document.createElement('script')) { scheduleDrain = function () { // Create a <script> element; its readystatechange event will be fired asynchronously once it is inserted // into the document. Do so, thus queuing up the task. Remember to clean up once it's been called. var scriptEl = global.document.createElement('script'); scriptEl.onreadystatechange = function () { nextTick(); scriptEl.onreadystatechange = null; scriptEl.parentNode.removeChild(scriptEl); scriptEl = null; }; global.document.documentElement.appendChild(scriptEl); }; } else { scheduleDrain = function () { setTimeout(nextTick, 0); }; } } var draining; var queue = []; //named nextTick for less confusing stack traces function nextTick() { draining = true; var i, oldQueue; var len = queue.length; while (len) { oldQueue = queue; queue = []; i = -1; while (++i < len) { oldQueue[i](); } len = queue.length; } draining = false; } module.exports = immediate; function immediate(task) { if (queue.push(task) === 1 && !draining) { scheduleDrain(); } } }).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) },{}],3:[function(_dereq_,module,exports){ (function (global){ 'use strict'; if (typeof global.Promise !== 'function') { global.Promise = _dereq_('./lib'); } }).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) },{"./lib":1}]},{},[3]); ```
/content/code_sandbox/node_modules/lie/dist/lie.polyfill.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,210
```javascript !function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var t;t="undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:this,t.Promise=e()}}(function(){return function e(t,n,r){function o(u,s){if(!n[u]){if(!t[u]){var c="function"==typeof require&&require;if(!s&&c)return c(u,!0);if(i)return i(u,!0);var f=new Error("Cannot find module '"+u+"'");throw f.code="MODULE_NOT_FOUND",f}var a=n[u]={exports:{}};t[u][0].call(a.exports,function(e){var n=t[u][1][e];return o(n?n:e)},a,a.exports,e,t,n,r)}return n[u].exports}for(var i="function"==typeof require&&require,u=0;u<r.length;u++)o(r[u]);return o}({1:[function(e,t,n){"use strict";function r(){}function o(e){if("function"!=typeof e)throw new TypeError("resolver must be a function");this.state=j,this.queue=[],this.outcome=void 0,e!==r&&c(this,e)}function i(e,t,n){this.promise=e,"function"==typeof t&&(this.onFulfilled=t,this.callFulfilled=this.otherCallFulfilled),"function"==typeof n&&(this.onRejected=n,this.callRejected=this.otherCallRejected)}function u(e,t,n){d(function(){var r;try{r=t(n)}catch(o){return v.reject(e,o)}r===e?v.reject(e,new TypeError("Cannot resolve promise with itself")):v.resolve(e,r)})}function s(e){var t=e&&e.then;return e&&"object"==typeof e&&"function"==typeof t?function(){t.apply(e,arguments)}:void 0}function c(e,t){function n(t){i||(i=!0,v.reject(e,t))}function r(t){i||(i=!0,v.resolve(e,t))}function o(){t(r,n)}var i=!1,u=f(o);"error"===u.status&&n(u.value)}function f(e,t){var n={};try{n.value=e(t),n.status="success"}catch(r){n.status="error",n.value=r}return n}function a(e){return e instanceof this?e:v.resolve(new this(r),e)}function l(e){var t=new this(r);return v.reject(t,e)}function h(e){function t(e,t){function r(e){u[t]=e,++s!==o||i||(i=!0,v.resolve(f,u))}n.resolve(e).then(r,function(e){i||(i=!0,v.reject(f,e))})}var n=this;if("[object Array]"!==Object.prototype.toString.call(e))return this.reject(new TypeError("must be an array"));var o=e.length,i=!1;if(!o)return this.resolve([]);for(var u=new Array(o),s=0,c=-1,f=new this(r);++c<o;)t(e[c],c);return f}function p(e){function t(e){n.resolve(e).then(function(e){i||(i=!0,v.resolve(s,e))},function(e){i||(i=!0,v.reject(s,e))})}var n=this;if("[object Array]"!==Object.prototype.toString.call(e))return this.reject(new TypeError("must be an array"));var o=e.length,i=!1;if(!o)return this.resolve([]);for(var u=-1,s=new this(r);++u<o;)t(e[u]);return s}var d=e("immediate"),v={},y=["REJECTED"],m=["FULFILLED"],j=["PENDING"];t.exports=n=o,o.prototype["catch"]=function(e){return this.then(null,e)},o.prototype.then=function(e,t){if("function"!=typeof e&&this.state===m||"function"!=typeof t&&this.state===y)return this;var n=new this.constructor(r);if(this.state!==j){var o=this.state===m?e:t;u(n,o,this.outcome)}else this.queue.push(new i(n,e,t));return n},i.prototype.callFulfilled=function(e){v.resolve(this.promise,e)},i.prototype.otherCallFulfilled=function(e){u(this.promise,this.onFulfilled,e)},i.prototype.callRejected=function(e){v.reject(this.promise,e)},i.prototype.otherCallRejected=function(e){u(this.promise,this.onRejected,e)},v.resolve=function(e,t){var n=f(s,t);if("error"===n.status)return v.reject(e,n.value);var r=n.value;if(r)c(e,r);else{e.state=m,e.outcome=t;for(var o=-1,i=e.queue.length;++o<i;)e.queue[o].callFulfilled(t)}return e},v.reject=function(e,t){e.state=y,e.outcome=t;for(var n=-1,r=e.queue.length;++n<r;)e.queue[n].callRejected(t);return e},n.resolve=a,n.reject=l,n.all=h,n.race=p},{immediate:2}],2:[function(e,t,n){(function(e){"use strict";function n(){a=!0;for(var e,t,n=l.length;n;){for(t=l,l=[],e=-1;++e<n;)t[e]();n=l.length}a=!1}function r(e){1!==l.push(e)||a||o()}var o,i=e.MutationObserver||e.WebKitMutationObserver;if(i){var u=0,s=new i(n),c=e.document.createTextNode("");s.observe(c,{characterData:!0}),o=function(){c.data=u=++u%2}}else if(e.setImmediate||"undefined"==typeof e.MessageChannel)o="document"in e&&"onreadystatechange"in e.document.createElement("script")?function(){var t=e.document.createElement("script");t.onreadystatechange=function(){n(),t.onreadystatechange=null,t.parentNode.removeChild(t),t=null},e.document.documentElement.appendChild(t)}:function(){setTimeout(n,0)};else{var f=new e.MessageChannel;f.port1.onmessage=n,o=function(){f.port2.postMessage(0)}}var a,l=[];t.exports=r}).call(this,"undefined"!=typeof global?global:"undefined"!=typeof self?self:"undefined"!=typeof window?window:{})},{}]},{},[1])(1)}); ```
/content/code_sandbox/node_modules/lie/dist/lie.min.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,364
```javascript ;(function (sax) { // wrapper for non-node envs sax.parser = function (strict, opt) { return new SAXParser(strict, opt) } sax.SAXParser = SAXParser sax.SAXStream = SAXStream sax.createStream = createStream // When we pass the MAX_BUFFER_LENGTH position, start checking for buffer overruns. // When we check, schedule the next check for MAX_BUFFER_LENGTH - (max(buffer lengths)), // since that's the earliest that a buffer overrun could occur. This way, checks are // as rare as required, but as often as necessary to ensure never crossing this bound. // Furthermore, buffers are only tested at most once per write(), so passing a very // large string into write() might have undesirable effects, but this is manageable by // the caller, so it is assumed to be safe. Thus, a call to write() may, in the extreme // edge case, result in creating at most one complete copy of the string passed in. // Set to Infinity to have unlimited buffers. sax.MAX_BUFFER_LENGTH = 64 * 1024 var buffers = [ 'comment', 'sgmlDecl', 'textNode', 'tagName', 'doctype', 'procInstName', 'procInstBody', 'entity', 'attribName', 'attribValue', 'cdata', 'script' ] sax.EVENTS = [ 'text', 'processinginstruction', 'sgmldeclaration', 'doctype', 'comment', 'opentagstart', 'attribute', 'opentag', 'closetag', 'opencdata', 'cdata', 'closecdata', 'error', 'end', 'ready', 'script', 'opennamespace', 'closenamespace' ] function SAXParser (strict, opt) { if (!(this instanceof SAXParser)) { return new SAXParser(strict, opt) } var parser = this clearBuffers(parser) parser.q = parser.c = '' parser.bufferCheckPosition = sax.MAX_BUFFER_LENGTH parser.opt = opt || {} parser.opt.lowercase = parser.opt.lowercase || parser.opt.lowercasetags parser.looseCase = parser.opt.lowercase ? 'toLowerCase' : 'toUpperCase' parser.tags = [] parser.closed = parser.closedRoot = parser.sawRoot = false parser.tag = parser.error = null parser.strict = !!strict parser.noscript = !!(strict || parser.opt.noscript) parser.state = S.BEGIN parser.strictEntities = parser.opt.strictEntities parser.ENTITIES = parser.strictEntities ? Object.create(sax.XML_ENTITIES) : Object.create(sax.ENTITIES) parser.attribList = [] // namespaces form a prototype chain. // it always points at the current tag, // which protos to its parent tag. if (parser.opt.xmlns) { parser.ns = Object.create(rootNS) } // mostly just for error reporting parser.trackPosition = parser.opt.position !== false if (parser.trackPosition) { parser.position = parser.line = parser.column = 0 } emit(parser, 'onready') } if (!Object.create) { Object.create = function (o) { function F () {} F.prototype = o var newf = new F() return newf } } if (!Object.keys) { Object.keys = function (o) { var a = [] for (var i in o) if (o.hasOwnProperty(i)) a.push(i) return a } } function checkBufferLength (parser) { var maxAllowed = Math.max(sax.MAX_BUFFER_LENGTH, 10) var maxActual = 0 for (var i = 0, l = buffers.length; i < l; i++) { var len = parser[buffers[i]].length if (len > maxAllowed) { // Text/cdata nodes can get big, and since they're buffered, // we can get here under normal conditions. // Avoid issues by emitting the text node now, // so at least it won't get any bigger. switch (buffers[i]) { case 'textNode': closeText(parser) break case 'cdata': emitNode(parser, 'oncdata', parser.cdata) parser.cdata = '' break case 'script': emitNode(parser, 'onscript', parser.script) parser.script = '' break default: error(parser, 'Max buffer length exceeded: ' + buffers[i]) } } maxActual = Math.max(maxActual, len) } // schedule the next check for the earliest possible buffer overrun. var m = sax.MAX_BUFFER_LENGTH - maxActual parser.bufferCheckPosition = m + parser.position } function clearBuffers (parser) { for (var i = 0, l = buffers.length; i < l; i++) { parser[buffers[i]] = '' } } function flushBuffers (parser) { closeText(parser) if (parser.cdata !== '') { emitNode(parser, 'oncdata', parser.cdata) parser.cdata = '' } if (parser.script !== '') { emitNode(parser, 'onscript', parser.script) parser.script = '' } } SAXParser.prototype = { end: function () { end(this) }, write: write, resume: function () { this.error = null; return this }, close: function () { return this.write(null) }, flush: function () { flushBuffers(this) } } var Stream try { Stream = require('stream').Stream } catch (ex) { Stream = function () {} } var streamWraps = sax.EVENTS.filter(function (ev) { return ev !== 'error' && ev !== 'end' }) function createStream (strict, opt) { return new SAXStream(strict, opt) } function SAXStream (strict, opt) { if (!(this instanceof SAXStream)) { return new SAXStream(strict, opt) } Stream.apply(this) this._parser = new SAXParser(strict, opt) this.writable = true this.readable = true var me = this this._parser.onend = function () { me.emit('end') } this._parser.onerror = function (er) { me.emit('error', er) // if didn't throw, then means error was handled. // go ahead and clear error, so we can write again. me._parser.error = null } this._decoder = null streamWraps.forEach(function (ev) { Object.defineProperty(me, 'on' + ev, { get: function () { return me._parser['on' + ev] }, set: function (h) { if (!h) { me.removeAllListeners(ev) me._parser['on' + ev] = h return h } me.on(ev, h) }, enumerable: true, configurable: false }) }) } SAXStream.prototype = Object.create(Stream.prototype, { constructor: { value: SAXStream } }) SAXStream.prototype.write = function (data) { if (typeof Buffer === 'function' && typeof Buffer.isBuffer === 'function' && Buffer.isBuffer(data)) { if (!this._decoder) { var SD = require('string_decoder').StringDecoder this._decoder = new SD('utf8') } data = this._decoder.write(data) } this._parser.write(data.toString()) this.emit('data', data) return true } SAXStream.prototype.end = function (chunk) { if (chunk && chunk.length) { this.write(chunk) } this._parser.end() return true } SAXStream.prototype.on = function (ev, handler) { var me = this if (!me._parser['on' + ev] && streamWraps.indexOf(ev) !== -1) { me._parser['on' + ev] = function () { var args = arguments.length === 1 ? [arguments[0]] : Array.apply(null, arguments) args.splice(0, 0, ev) me.emit.apply(me, args) } } return Stream.prototype.on.call(me, ev, handler) } // this really needs to be replaced with character classes. // XML allows all manner of ridiculous numbers and digits. var CDATA = '[CDATA[' var DOCTYPE = 'DOCTYPE' var XML_NAMESPACE = 'path_to_url var XMLNS_NAMESPACE = 'path_to_url var rootNS = { xml: XML_NAMESPACE, xmlns: XMLNS_NAMESPACE } // path_to_url#NT-NameStartChar // This implementation works on strings, a single character at a time // as such, it cannot ever support astral-plane characters (10000-EFFFF) // without a significant breaking change to either this parser, or the // JavaScript language. Implementation of an emoji-capable xml parser // is left as an exercise for the reader. var nameStart = /[:_A-Za-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD]/ var nameBody = /[:_A-Za-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD\u00B7\u0300-\u036F\u203F-\u2040.\d-]/ var entityStart = /[#:_A-Za-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD]/ var entityBody = /[#:_A-Za-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD\u00B7\u0300-\u036F\u203F-\u2040.\d-]/ function isWhitespace (c) { return c === ' ' || c === '\n' || c === '\r' || c === '\t' } function isQuote (c) { return c === '"' || c === '\'' } function isAttribEnd (c) { return c === '>' || isWhitespace(c) } function isMatch (regex, c) { return regex.test(c) } function notMatch (regex, c) { return !isMatch(regex, c) } var S = 0 sax.STATE = { BEGIN: S++, // leading byte order mark or whitespace BEGIN_WHITESPACE: S++, // leading whitespace TEXT: S++, // general stuff TEXT_ENTITY: S++, // &amp and such. OPEN_WAKA: S++, // < SGML_DECL: S++, // <!BLARG SGML_DECL_QUOTED: S++, // <!BLARG foo "bar DOCTYPE: S++, // <!DOCTYPE DOCTYPE_QUOTED: S++, // <!DOCTYPE "//blah DOCTYPE_DTD: S++, // <!DOCTYPE "//blah" [ ... DOCTYPE_DTD_QUOTED: S++, // <!DOCTYPE "//blah" [ "foo COMMENT_STARTING: S++, // <!- COMMENT: S++, // <!-- COMMENT_ENDING: S++, // <!-- blah - COMMENT_ENDED: S++, // <!-- blah -- CDATA: S++, // <![CDATA[ something CDATA_ENDING: S++, // ] CDATA_ENDING_2: S++, // ]] PROC_INST: S++, // <?hi PROC_INST_BODY: S++, // <?hi there PROC_INST_ENDING: S++, // <?hi "there" ? OPEN_TAG: S++, // <strong OPEN_TAG_SLASH: S++, // <strong / ATTRIB: S++, // <a ATTRIB_NAME: S++, // <a foo ATTRIB_NAME_SAW_WHITE: S++, // <a foo _ ATTRIB_VALUE: S++, // <a foo= ATTRIB_VALUE_QUOTED: S++, // <a foo="bar ATTRIB_VALUE_CLOSED: S++, // <a foo="bar" ATTRIB_VALUE_UNQUOTED: S++, // <a foo=bar ATTRIB_VALUE_ENTITY_Q: S++, // <foo bar="&quot;" ATTRIB_VALUE_ENTITY_U: S++, // <foo bar=&quot CLOSE_TAG: S++, // </a CLOSE_TAG_SAW_WHITE: S++, // </a > SCRIPT: S++, // <script> ... SCRIPT_ENDING: S++ // <script> ... < } sax.XML_ENTITIES = { 'amp': '&', 'gt': '>', 'lt': '<', 'quot': '"', 'apos': "'" } sax.ENTITIES = { 'amp': '&', 'gt': '>', 'lt': '<', 'quot': '"', 'apos': "'", 'AElig': 198, 'Aacute': 193, 'Acirc': 194, 'Agrave': 192, 'Aring': 197, 'Atilde': 195, 'Auml': 196, 'Ccedil': 199, 'ETH': 208, 'Eacute': 201, 'Ecirc': 202, 'Egrave': 200, 'Euml': 203, 'Iacute': 205, 'Icirc': 206, 'Igrave': 204, 'Iuml': 207, 'Ntilde': 209, 'Oacute': 211, 'Ocirc': 212, 'Ograve': 210, 'Oslash': 216, 'Otilde': 213, 'Ouml': 214, 'THORN': 222, 'Uacute': 218, 'Ucirc': 219, 'Ugrave': 217, 'Uuml': 220, 'Yacute': 221, 'aacute': 225, 'acirc': 226, 'aelig': 230, 'agrave': 224, 'aring': 229, 'atilde': 227, 'auml': 228, 'ccedil': 231, 'eacute': 233, 'ecirc': 234, 'egrave': 232, 'eth': 240, 'euml': 235, 'iacute': 237, 'icirc': 238, 'igrave': 236, 'iuml': 239, 'ntilde': 241, 'oacute': 243, 'ocirc': 244, 'ograve': 242, 'oslash': 248, 'otilde': 245, 'ouml': 246, 'szlig': 223, 'thorn': 254, 'uacute': 250, 'ucirc': 251, 'ugrave': 249, 'uuml': 252, 'yacute': 253, 'yuml': 255, 'copy': 169, 'reg': 174, 'nbsp': 160, 'iexcl': 161, 'cent': 162, 'pound': 163, 'curren': 164, 'yen': 165, 'brvbar': 166, 'sect': 167, 'uml': 168, 'ordf': 170, 'laquo': 171, 'not': 172, 'shy': 173, 'macr': 175, 'deg': 176, 'plusmn': 177, 'sup1': 185, 'sup2': 178, 'sup3': 179, 'acute': 180, 'micro': 181, 'para': 182, 'middot': 183, 'cedil': 184, 'ordm': 186, 'raquo': 187, 'frac14': 188, 'frac12': 189, 'frac34': 190, 'iquest': 191, 'times': 215, 'divide': 247, 'OElig': 338, 'oelig': 339, 'Scaron': 352, 'scaron': 353, 'Yuml': 376, 'fnof': 402, 'circ': 710, 'tilde': 732, 'Alpha': 913, 'Beta': 914, 'Gamma': 915, 'Delta': 916, 'Epsilon': 917, 'Zeta': 918, 'Eta': 919, 'Theta': 920, 'Iota': 921, 'Kappa': 922, 'Lambda': 923, 'Mu': 924, 'Nu': 925, 'Xi': 926, 'Omicron': 927, 'Pi': 928, 'Rho': 929, 'Sigma': 931, 'Tau': 932, 'Upsilon': 933, 'Phi': 934, 'Chi': 935, 'Psi': 936, 'Omega': 937, 'alpha': 945, 'beta': 946, 'gamma': 947, 'delta': 948, 'epsilon': 949, 'zeta': 950, 'eta': 951, 'theta': 952, 'iota': 953, 'kappa': 954, 'lambda': 955, 'mu': 956, 'nu': 957, 'xi': 958, 'omicron': 959, 'pi': 960, 'rho': 961, 'sigmaf': 962, 'sigma': 963, 'tau': 964, 'upsilon': 965, 'phi': 966, 'chi': 967, 'psi': 968, 'omega': 969, 'thetasym': 977, 'upsih': 978, 'piv': 982, 'ensp': 8194, 'emsp': 8195, 'thinsp': 8201, 'zwnj': 8204, 'zwj': 8205, 'lrm': 8206, 'rlm': 8207, 'ndash': 8211, 'mdash': 8212, 'lsquo': 8216, 'rsquo': 8217, 'sbquo': 8218, 'ldquo': 8220, 'rdquo': 8221, 'bdquo': 8222, 'dagger': 8224, 'Dagger': 8225, 'bull': 8226, 'hellip': 8230, 'permil': 8240, 'prime': 8242, 'Prime': 8243, 'lsaquo': 8249, 'rsaquo': 8250, 'oline': 8254, 'frasl': 8260, 'euro': 8364, 'image': 8465, 'weierp': 8472, 'real': 8476, 'trade': 8482, 'alefsym': 8501, 'larr': 8592, 'uarr': 8593, 'rarr': 8594, 'darr': 8595, 'harr': 8596, 'crarr': 8629, 'lArr': 8656, 'uArr': 8657, 'rArr': 8658, 'dArr': 8659, 'hArr': 8660, 'forall': 8704, 'part': 8706, 'exist': 8707, 'empty': 8709, 'nabla': 8711, 'isin': 8712, 'notin': 8713, 'ni': 8715, 'prod': 8719, 'sum': 8721, 'minus': 8722, 'lowast': 8727, 'radic': 8730, 'prop': 8733, 'infin': 8734, 'ang': 8736, 'and': 8743, 'or': 8744, 'cap': 8745, 'cup': 8746, 'int': 8747, 'there4': 8756, 'sim': 8764, 'cong': 8773, 'asymp': 8776, 'ne': 8800, 'equiv': 8801, 'le': 8804, 'ge': 8805, 'sub': 8834, 'sup': 8835, 'nsub': 8836, 'sube': 8838, 'supe': 8839, 'oplus': 8853, 'otimes': 8855, 'perp': 8869, 'sdot': 8901, 'lceil': 8968, 'rceil': 8969, 'lfloor': 8970, 'rfloor': 8971, 'lang': 9001, 'rang': 9002, 'loz': 9674, 'spades': 9824, 'clubs': 9827, 'hearts': 9829, 'diams': 9830 } Object.keys(sax.ENTITIES).forEach(function (key) { var e = sax.ENTITIES[key] var s = typeof e === 'number' ? String.fromCharCode(e) : e sax.ENTITIES[key] = s }) for (var s in sax.STATE) { sax.STATE[sax.STATE[s]] = s } // shorthand S = sax.STATE function emit (parser, event, data) { parser[event] && parser[event](data) } function emitNode (parser, nodeType, data) { if (parser.textNode) closeText(parser) emit(parser, nodeType, data) } function closeText (parser) { parser.textNode = textopts(parser.opt, parser.textNode) if (parser.textNode) emit(parser, 'ontext', parser.textNode) parser.textNode = '' } function textopts (opt, text) { if (opt.trim) text = text.trim() if (opt.normalize) text = text.replace(/\s+/g, ' ') return text } function error (parser, er) { closeText(parser) if (parser.trackPosition) { er += '\nLine: ' + parser.line + '\nColumn: ' + parser.column + '\nChar: ' + parser.c } er = new Error(er) parser.error = er emit(parser, 'onerror', er) return parser } function end (parser) { if (parser.sawRoot && !parser.closedRoot) strictFail(parser, 'Unclosed root tag') if ((parser.state !== S.BEGIN) && (parser.state !== S.BEGIN_WHITESPACE) && (parser.state !== S.TEXT)) { error(parser, 'Unexpected end') } closeText(parser) parser.c = '' parser.closed = true emit(parser, 'onend') SAXParser.call(parser, parser.strict, parser.opt) return parser } function strictFail (parser, message) { if (typeof parser !== 'object' || !(parser instanceof SAXParser)) { throw new Error('bad call to strictFail') } if (parser.strict) { error(parser, message) } } function newTag (parser) { if (!parser.strict) parser.tagName = parser.tagName[parser.looseCase]() var parent = parser.tags[parser.tags.length - 1] || parser var tag = parser.tag = { name: parser.tagName, attributes: {} } // will be overridden if tag contails an xmlns="foo" or xmlns:foo="bar" if (parser.opt.xmlns) { tag.ns = parent.ns } parser.attribList.length = 0 emitNode(parser, 'onopentagstart', tag) } function qname (name, attribute) { var i = name.indexOf(':') var qualName = i < 0 ? [ '', name ] : name.split(':') var prefix = qualName[0] var local = qualName[1] // <x "xmlns"="path_to_url"> if (attribute && name === 'xmlns') { prefix = 'xmlns' local = '' } return { prefix: prefix, local: local } } function attrib (parser) { if (!parser.strict) { parser.attribName = parser.attribName[parser.looseCase]() } if (parser.attribList.indexOf(parser.attribName) !== -1 || parser.tag.attributes.hasOwnProperty(parser.attribName)) { parser.attribName = parser.attribValue = '' return } if (parser.opt.xmlns) { var qn = qname(parser.attribName, true) var prefix = qn.prefix var local = qn.local if (prefix === 'xmlns') { // namespace binding attribute. push the binding into scope if (local === 'xml' && parser.attribValue !== XML_NAMESPACE) { strictFail(parser, 'xml: prefix must be bound to ' + XML_NAMESPACE + '\n' + 'Actual: ' + parser.attribValue) } else if (local === 'xmlns' && parser.attribValue !== XMLNS_NAMESPACE) { strictFail(parser, 'xmlns: prefix must be bound to ' + XMLNS_NAMESPACE + '\n' + 'Actual: ' + parser.attribValue) } else { var tag = parser.tag var parent = parser.tags[parser.tags.length - 1] || parser if (tag.ns === parent.ns) { tag.ns = Object.create(parent.ns) } tag.ns[local] = parser.attribValue } } // defer onattribute events until all attributes have been seen // so any new bindings can take effect. preserve attribute order // so deferred events can be emitted in document order parser.attribList.push([parser.attribName, parser.attribValue]) } else { // in non-xmlns mode, we can emit the event right away parser.tag.attributes[parser.attribName] = parser.attribValue emitNode(parser, 'onattribute', { name: parser.attribName, value: parser.attribValue }) } parser.attribName = parser.attribValue = '' } function openTag (parser, selfClosing) { if (parser.opt.xmlns) { // emit namespace binding events var tag = parser.tag // add namespace info to tag var qn = qname(parser.tagName) tag.prefix = qn.prefix tag.local = qn.local tag.uri = tag.ns[qn.prefix] || '' if (tag.prefix && !tag.uri) { strictFail(parser, 'Unbound namespace prefix: ' + JSON.stringify(parser.tagName)) tag.uri = qn.prefix } var parent = parser.tags[parser.tags.length - 1] || parser if (tag.ns && parent.ns !== tag.ns) { Object.keys(tag.ns).forEach(function (p) { emitNode(parser, 'onopennamespace', { prefix: p, uri: tag.ns[p] }) }) } // handle deferred onattribute events // Note: do not apply default ns to attributes: // path_to_url#defaulting for (var i = 0, l = parser.attribList.length; i < l; i++) { var nv = parser.attribList[i] var name = nv[0] var value = nv[1] var qualName = qname(name, true) var prefix = qualName.prefix var local = qualName.local var uri = prefix === '' ? '' : (tag.ns[prefix] || '') var a = { name: name, value: value, prefix: prefix, local: local, uri: uri } // if there's any attributes with an undefined namespace, // then fail on them now. if (prefix && prefix !== 'xmlns' && !uri) { strictFail(parser, 'Unbound namespace prefix: ' + JSON.stringify(prefix)) a.uri = prefix } parser.tag.attributes[name] = a emitNode(parser, 'onattribute', a) } parser.attribList.length = 0 } parser.tag.isSelfClosing = !!selfClosing // process the tag parser.sawRoot = true parser.tags.push(parser.tag) emitNode(parser, 'onopentag', parser.tag) if (!selfClosing) { // special case for <script> in non-strict mode. if (!parser.noscript && parser.tagName.toLowerCase() === 'script') { parser.state = S.SCRIPT } else { parser.state = S.TEXT } parser.tag = null parser.tagName = '' } parser.attribName = parser.attribValue = '' parser.attribList.length = 0 } function closeTag (parser) { if (!parser.tagName) { strictFail(parser, 'Weird empty close tag.') parser.textNode += '</>' parser.state = S.TEXT return } if (parser.script) { if (parser.tagName !== 'script') { parser.script += '</' + parser.tagName + '>' parser.tagName = '' parser.state = S.SCRIPT return } emitNode(parser, 'onscript', parser.script) parser.script = '' } // first make sure that the closing tag actually exists. // <a><b></c></b></a> will close everything, otherwise. var t = parser.tags.length var tagName = parser.tagName if (!parser.strict) { tagName = tagName[parser.looseCase]() } var closeTo = tagName while (t--) { var close = parser.tags[t] if (close.name !== closeTo) { // fail the first time in strict mode strictFail(parser, 'Unexpected close tag') } else { break } } // didn't find it. we already failed for strict, so just abort. if (t < 0) { strictFail(parser, 'Unmatched closing tag: ' + parser.tagName) parser.textNode += '</' + parser.tagName + '>' parser.state = S.TEXT return } parser.tagName = tagName var s = parser.tags.length while (s-- > t) { var tag = parser.tag = parser.tags.pop() parser.tagName = parser.tag.name emitNode(parser, 'onclosetag', parser.tagName) var x = {} for (var i in tag.ns) { x[i] = tag.ns[i] } var parent = parser.tags[parser.tags.length - 1] || parser if (parser.opt.xmlns && tag.ns !== parent.ns) { // remove namespace bindings introduced by tag Object.keys(tag.ns).forEach(function (p) { var n = tag.ns[p] emitNode(parser, 'onclosenamespace', { prefix: p, uri: n }) }) } } if (t === 0) parser.closedRoot = true parser.tagName = parser.attribValue = parser.attribName = '' parser.attribList.length = 0 parser.state = S.TEXT } function parseEntity (parser) { var entity = parser.entity var entityLC = entity.toLowerCase() var num var numStr = '' if (parser.ENTITIES[entity]) { return parser.ENTITIES[entity] } if (parser.ENTITIES[entityLC]) { return parser.ENTITIES[entityLC] } entity = entityLC if (entity.charAt(0) === '#') { if (entity.charAt(1) === 'x') { entity = entity.slice(2) num = parseInt(entity, 16) numStr = num.toString(16) } else { entity = entity.slice(1) num = parseInt(entity, 10) numStr = num.toString(10) } } entity = entity.replace(/^0+/, '') if (isNaN(num) || numStr.toLowerCase() !== entity) { strictFail(parser, 'Invalid character entity') return '&' + parser.entity + ';' } return String.fromCodePoint(num) } function beginWhiteSpace (parser, c) { if (c === '<') { parser.state = S.OPEN_WAKA parser.startTagPosition = parser.position } else if (!isWhitespace(c)) { // have to process this as a text node. // weird, but happens. strictFail(parser, 'Non-whitespace before first tag.') parser.textNode = c parser.state = S.TEXT } } function charAt (chunk, i) { var result = '' if (i < chunk.length) { result = chunk.charAt(i) } return result } function write (chunk) { var parser = this if (this.error) { throw this.error } if (parser.closed) { return error(parser, 'Cannot write after close. Assign an onready handler.') } if (chunk === null) { return end(parser) } if (typeof chunk === 'object') { chunk = chunk.toString() } var i = 0 var c = '' while (true) { c = charAt(chunk, i++) parser.c = c if (!c) { break } if (parser.trackPosition) { parser.position++ if (c === '\n') { parser.line++ parser.column = 0 } else { parser.column++ } } switch (parser.state) { case S.BEGIN: parser.state = S.BEGIN_WHITESPACE if (c === '\uFEFF') { continue } beginWhiteSpace(parser, c) continue case S.BEGIN_WHITESPACE: beginWhiteSpace(parser, c) continue case S.TEXT: if (parser.sawRoot && !parser.closedRoot) { var starti = i - 1 while (c && c !== '<' && c !== '&') { c = charAt(chunk, i++) if (c && parser.trackPosition) { parser.position++ if (c === '\n') { parser.line++ parser.column = 0 } else { parser.column++ } } } parser.textNode += chunk.substring(starti, i - 1) } if (c === '<' && !(parser.sawRoot && parser.closedRoot && !parser.strict)) { parser.state = S.OPEN_WAKA parser.startTagPosition = parser.position } else { if (!isWhitespace(c) && (!parser.sawRoot || parser.closedRoot)) { strictFail(parser, 'Text data outside of root node.') } if (c === '&') { parser.state = S.TEXT_ENTITY } else { parser.textNode += c } } continue case S.SCRIPT: // only non-strict if (c === '<') { parser.state = S.SCRIPT_ENDING } else { parser.script += c } continue case S.SCRIPT_ENDING: if (c === '/') { parser.state = S.CLOSE_TAG } else { parser.script += '<' + c parser.state = S.SCRIPT } continue case S.OPEN_WAKA: // either a /, ?, !, or text is coming next. if (c === '!') { parser.state = S.SGML_DECL parser.sgmlDecl = '' } else if (isWhitespace(c)) { // wait for it... } else if (isMatch(nameStart, c)) { parser.state = S.OPEN_TAG parser.tagName = c } else if (c === '/') { parser.state = S.CLOSE_TAG parser.tagName = '' } else if (c === '?') { parser.state = S.PROC_INST parser.procInstName = parser.procInstBody = '' } else { strictFail(parser, 'Unencoded <') // if there was some whitespace, then add that in. if (parser.startTagPosition + 1 < parser.position) { var pad = parser.position - parser.startTagPosition c = new Array(pad).join(' ') + c } parser.textNode += '<' + c parser.state = S.TEXT } continue case S.SGML_DECL: if ((parser.sgmlDecl + c).toUpperCase() === CDATA) { emitNode(parser, 'onopencdata') parser.state = S.CDATA parser.sgmlDecl = '' parser.cdata = '' } else if (parser.sgmlDecl + c === '--') { parser.state = S.COMMENT parser.comment = '' parser.sgmlDecl = '' } else if ((parser.sgmlDecl + c).toUpperCase() === DOCTYPE) { parser.state = S.DOCTYPE if (parser.doctype || parser.sawRoot) { strictFail(parser, 'Inappropriately located doctype declaration') } parser.doctype = '' parser.sgmlDecl = '' } else if (c === '>') { emitNode(parser, 'onsgmldeclaration', parser.sgmlDecl) parser.sgmlDecl = '' parser.state = S.TEXT } else if (isQuote(c)) { parser.state = S.SGML_DECL_QUOTED parser.sgmlDecl += c } else { parser.sgmlDecl += c } continue case S.SGML_DECL_QUOTED: if (c === parser.q) { parser.state = S.SGML_DECL parser.q = '' } parser.sgmlDecl += c continue case S.DOCTYPE: if (c === '>') { parser.state = S.TEXT emitNode(parser, 'ondoctype', parser.doctype) parser.doctype = true // just remember that we saw it. } else { parser.doctype += c if (c === '[') { parser.state = S.DOCTYPE_DTD } else if (isQuote(c)) { parser.state = S.DOCTYPE_QUOTED parser.q = c } } continue case S.DOCTYPE_QUOTED: parser.doctype += c if (c === parser.q) { parser.q = '' parser.state = S.DOCTYPE } continue case S.DOCTYPE_DTD: parser.doctype += c if (c === ']') { parser.state = S.DOCTYPE } else if (isQuote(c)) { parser.state = S.DOCTYPE_DTD_QUOTED parser.q = c } continue case S.DOCTYPE_DTD_QUOTED: parser.doctype += c if (c === parser.q) { parser.state = S.DOCTYPE_DTD parser.q = '' } continue case S.COMMENT: if (c === '-') { parser.state = S.COMMENT_ENDING } else { parser.comment += c } continue case S.COMMENT_ENDING: if (c === '-') { parser.state = S.COMMENT_ENDED parser.comment = textopts(parser.opt, parser.comment) if (parser.comment) { emitNode(parser, 'oncomment', parser.comment) } parser.comment = '' } else { parser.comment += '-' + c parser.state = S.COMMENT } continue case S.COMMENT_ENDED: if (c !== '>') { strictFail(parser, 'Malformed comment') // allow <!-- blah -- bloo --> in non-strict mode, // which is a comment of " blah -- bloo " parser.comment += '--' + c parser.state = S.COMMENT } else { parser.state = S.TEXT } continue case S.CDATA: if (c === ']') { parser.state = S.CDATA_ENDING } else { parser.cdata += c } continue case S.CDATA_ENDING: if (c === ']') { parser.state = S.CDATA_ENDING_2 } else { parser.cdata += ']' + c parser.state = S.CDATA } continue case S.CDATA_ENDING_2: if (c === '>') { if (parser.cdata) { emitNode(parser, 'oncdata', parser.cdata) } emitNode(parser, 'onclosecdata') parser.cdata = '' parser.state = S.TEXT } else if (c === ']') { parser.cdata += ']' } else { parser.cdata += ']]' + c parser.state = S.CDATA } continue case S.PROC_INST: if (c === '?') { parser.state = S.PROC_INST_ENDING } else if (isWhitespace(c)) { parser.state = S.PROC_INST_BODY } else { parser.procInstName += c } continue case S.PROC_INST_BODY: if (!parser.procInstBody && isWhitespace(c)) { continue } else if (c === '?') { parser.state = S.PROC_INST_ENDING } else { parser.procInstBody += c } continue case S.PROC_INST_ENDING: if (c === '>') { emitNode(parser, 'onprocessinginstruction', { name: parser.procInstName, body: parser.procInstBody }) parser.procInstName = parser.procInstBody = '' parser.state = S.TEXT } else { parser.procInstBody += '?' + c parser.state = S.PROC_INST_BODY } continue case S.OPEN_TAG: if (isMatch(nameBody, c)) { parser.tagName += c } else { newTag(parser) if (c === '>') { openTag(parser) } else if (c === '/') { parser.state = S.OPEN_TAG_SLASH } else { if (!isWhitespace(c)) { strictFail(parser, 'Invalid character in tag name') } parser.state = S.ATTRIB } } continue case S.OPEN_TAG_SLASH: if (c === '>') { openTag(parser, true) closeTag(parser) } else { strictFail(parser, 'Forward-slash in opening tag not followed by >') parser.state = S.ATTRIB } continue case S.ATTRIB: // haven't read the attribute name yet. if (isWhitespace(c)) { continue } else if (c === '>') { openTag(parser) } else if (c === '/') { parser.state = S.OPEN_TAG_SLASH } else if (isMatch(nameStart, c)) { parser.attribName = c parser.attribValue = '' parser.state = S.ATTRIB_NAME } else { strictFail(parser, 'Invalid attribute name') } continue case S.ATTRIB_NAME: if (c === '=') { parser.state = S.ATTRIB_VALUE } else if (c === '>') { strictFail(parser, 'Attribute without value') parser.attribValue = parser.attribName attrib(parser) openTag(parser) } else if (isWhitespace(c)) { parser.state = S.ATTRIB_NAME_SAW_WHITE } else if (isMatch(nameBody, c)) { parser.attribName += c } else { strictFail(parser, 'Invalid attribute name') } continue case S.ATTRIB_NAME_SAW_WHITE: if (c === '=') { parser.state = S.ATTRIB_VALUE } else if (isWhitespace(c)) { continue } else { strictFail(parser, 'Attribute without value') parser.tag.attributes[parser.attribName] = '' parser.attribValue = '' emitNode(parser, 'onattribute', { name: parser.attribName, value: '' }) parser.attribName = '' if (c === '>') { openTag(parser) } else if (isMatch(nameStart, c)) { parser.attribName = c parser.state = S.ATTRIB_NAME } else { strictFail(parser, 'Invalid attribute name') parser.state = S.ATTRIB } } continue case S.ATTRIB_VALUE: if (isWhitespace(c)) { continue } else if (isQuote(c)) { parser.q = c parser.state = S.ATTRIB_VALUE_QUOTED } else { strictFail(parser, 'Unquoted attribute value') parser.state = S.ATTRIB_VALUE_UNQUOTED parser.attribValue = c } continue case S.ATTRIB_VALUE_QUOTED: if (c !== parser.q) { if (c === '&') { parser.state = S.ATTRIB_VALUE_ENTITY_Q } else { parser.attribValue += c } continue } attrib(parser) parser.q = '' parser.state = S.ATTRIB_VALUE_CLOSED continue case S.ATTRIB_VALUE_CLOSED: if (isWhitespace(c)) { parser.state = S.ATTRIB } else if (c === '>') { openTag(parser) } else if (c === '/') { parser.state = S.OPEN_TAG_SLASH } else if (isMatch(nameStart, c)) { strictFail(parser, 'No whitespace between attributes') parser.attribName = c parser.attribValue = '' parser.state = S.ATTRIB_NAME } else { strictFail(parser, 'Invalid attribute name') } continue case S.ATTRIB_VALUE_UNQUOTED: if (!isAttribEnd(c)) { if (c === '&') { parser.state = S.ATTRIB_VALUE_ENTITY_U } else { parser.attribValue += c } continue } attrib(parser) if (c === '>') { openTag(parser) } else { parser.state = S.ATTRIB } continue case S.CLOSE_TAG: if (!parser.tagName) { if (isWhitespace(c)) { continue } else if (notMatch(nameStart, c)) { if (parser.script) { parser.script += '</' + c parser.state = S.SCRIPT } else { strictFail(parser, 'Invalid tagname in closing tag.') } } else { parser.tagName = c } } else if (c === '>') { closeTag(parser) } else if (isMatch(nameBody, c)) { parser.tagName += c } else if (parser.script) { parser.script += '</' + parser.tagName parser.tagName = '' parser.state = S.SCRIPT } else { if (!isWhitespace(c)) { strictFail(parser, 'Invalid tagname in closing tag') } parser.state = S.CLOSE_TAG_SAW_WHITE } continue case S.CLOSE_TAG_SAW_WHITE: if (isWhitespace(c)) { continue } if (c === '>') { closeTag(parser) } else { strictFail(parser, 'Invalid characters in closing tag') } continue case S.TEXT_ENTITY: case S.ATTRIB_VALUE_ENTITY_Q: case S.ATTRIB_VALUE_ENTITY_U: var returnState var buffer switch (parser.state) { case S.TEXT_ENTITY: returnState = S.TEXT buffer = 'textNode' break case S.ATTRIB_VALUE_ENTITY_Q: returnState = S.ATTRIB_VALUE_QUOTED buffer = 'attribValue' break case S.ATTRIB_VALUE_ENTITY_U: returnState = S.ATTRIB_VALUE_UNQUOTED buffer = 'attribValue' break } if (c === ';') { parser[buffer] += parseEntity(parser) parser.entity = '' parser.state = returnState } else if (isMatch(parser.entity.length ? entityBody : entityStart, c)) { parser.entity += c } else { strictFail(parser, 'Invalid character in entity name') parser[buffer] += '&' + parser.entity + c parser.entity = '' parser.state = returnState } continue default: throw new Error(parser, 'Unknown state: ' + parser.state) } } // while if (parser.position >= parser.bufferCheckPosition) { checkBufferLength(parser) } return parser } /*! path_to_url v0.1.0 by @mathias */ /* istanbul ignore next */ if (!String.fromCodePoint) { (function () { var stringFromCharCode = String.fromCharCode var floor = Math.floor var fromCodePoint = function () { var MAX_SIZE = 0x4000 var codeUnits = [] var highSurrogate var lowSurrogate var index = -1 var length = arguments.length if (!length) { return '' } var result = '' while (++index < length) { var codePoint = Number(arguments[index]) if ( !isFinite(codePoint) || // `NaN`, `+Infinity`, or `-Infinity` codePoint < 0 || // not a valid Unicode code point codePoint > 0x10FFFF || // not a valid Unicode code point floor(codePoint) !== codePoint // not an integer ) { throw RangeError('Invalid code point: ' + codePoint) } if (codePoint <= 0xFFFF) { // BMP code point codeUnits.push(codePoint) } else { // Astral code point; split in surrogate halves // path_to_url#surrogate-formulae codePoint -= 0x10000 highSurrogate = (codePoint >> 10) + 0xD800 lowSurrogate = (codePoint % 0x400) + 0xDC00 codeUnits.push(highSurrogate, lowSurrogate) } if (index + 1 === length || codeUnits.length > MAX_SIZE) { result += stringFromCharCode.apply(null, codeUnits) codeUnits.length = 0 } } return result } /* istanbul ignore next */ if (Object.defineProperty) { Object.defineProperty(String, 'fromCodePoint', { value: fromCodePoint, configurable: true, writable: true }) } else { String.fromCodePoint = fromCodePoint } }()) } })(typeof exports === 'undefined' ? this.sax = {} : exports) ```
/content/code_sandbox/node_modules/sax/lib/sax.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
11,742
```javascript !function e(t,n,r){function o(u,s){if(!n[u]){if(!t[u]){var c="function"==typeof require&&require;if(!s&&c)return c(u,!0);if(i)return i(u,!0);var a=new Error("Cannot find module '"+u+"'");throw a.code="MODULE_NOT_FOUND",a}var f=n[u]={exports:{}};t[u][0].call(f.exports,function(e){var n=t[u][1][e];return o(n?n:e)},f,f.exports,e,t,n,r)}return n[u].exports}for(var i="function"==typeof require&&require,u=0;u<r.length;u++)o(r[u]);return o}({1:[function(e,t,n){"use strict";function r(){}function o(e){if("function"!=typeof e)throw new TypeError("resolver must be a function");this.state=w,this.queue=[],this.outcome=void 0,e!==r&&c(this,e)}function i(e,t,n){this.promise=e,"function"==typeof t&&(this.onFulfilled=t,this.callFulfilled=this.otherCallFulfilled),"function"==typeof n&&(this.onRejected=n,this.callRejected=this.otherCallRejected)}function u(e,t,n){d(function(){var r;try{r=t(n)}catch(o){return v.reject(e,o)}r===e?v.reject(e,new TypeError("Cannot resolve promise with itself")):v.resolve(e,r)})}function s(e){var t=e&&e.then;return e&&"object"==typeof e&&"function"==typeof t?function(){t.apply(e,arguments)}:void 0}function c(e,t){function n(t){i||(i=!0,v.reject(e,t))}function r(t){i||(i=!0,v.resolve(e,t))}function o(){t(r,n)}var i=!1,u=a(o);"error"===u.status&&n(u.value)}function a(e,t){var n={};try{n.value=e(t),n.status="success"}catch(r){n.status="error",n.value=r}return n}function f(e){return e instanceof this?e:v.resolve(new this(r),e)}function l(e){var t=new this(r);return v.reject(t,e)}function h(e){function t(e,t){function r(e){u[t]=e,++s!==o||i||(i=!0,v.resolve(a,u))}n.resolve(e).then(r,function(e){i||(i=!0,v.reject(a,e))})}var n=this;if("[object Array]"!==Object.prototype.toString.call(e))return this.reject(new TypeError("must be an array"));var o=e.length,i=!1;if(!o)return this.resolve([]);for(var u=new Array(o),s=0,c=-1,a=new this(r);++c<o;)t(e[c],c);return a}function p(e){function t(e){n.resolve(e).then(function(e){i||(i=!0,v.resolve(s,e))},function(e){i||(i=!0,v.reject(s,e))})}var n=this;if("[object Array]"!==Object.prototype.toString.call(e))return this.reject(new TypeError("must be an array"));var o=e.length,i=!1;if(!o)return this.resolve([]);for(var u=-1,s=new this(r);++u<o;)t(e[u]);return s}var d=e("immediate"),v={},y=["REJECTED"],m=["FULFILLED"],w=["PENDING"];t.exports=n=o,o.prototype["catch"]=function(e){return this.then(null,e)},o.prototype.then=function(e,t){if("function"!=typeof e&&this.state===m||"function"!=typeof t&&this.state===y)return this;var n=new this.constructor(r);if(this.state!==w){var o=this.state===m?e:t;u(n,o,this.outcome)}else this.queue.push(new i(n,e,t));return n},i.prototype.callFulfilled=function(e){v.resolve(this.promise,e)},i.prototype.otherCallFulfilled=function(e){u(this.promise,this.onFulfilled,e)},i.prototype.callRejected=function(e){v.reject(this.promise,e)},i.prototype.otherCallRejected=function(e){u(this.promise,this.onRejected,e)},v.resolve=function(e,t){var n=a(s,t);if("error"===n.status)return v.reject(e,n.value);var r=n.value;if(r)c(e,r);else{e.state=m,e.outcome=t;for(var o=-1,i=e.queue.length;++o<i;)e.queue[o].callFulfilled(t)}return e},v.reject=function(e,t){e.state=y,e.outcome=t;for(var n=-1,r=e.queue.length;++n<r;)e.queue[n].callRejected(t);return e},n.resolve=f,n.reject=l,n.all=h,n.race=p},{immediate:2}],2:[function(e,t,n){(function(e){"use strict";function n(){f=!0;for(var e,t,n=l.length;n;){for(t=l,l=[],e=-1;++e<n;)t[e]();n=l.length}f=!1}function r(e){1!==l.push(e)||f||o()}var o,i=e.MutationObserver||e.WebKitMutationObserver;if(i){var u=0,s=new i(n),c=e.document.createTextNode("");s.observe(c,{characterData:!0}),o=function(){c.data=u=++u%2}}else if(e.setImmediate||"undefined"==typeof e.MessageChannel)o="document"in e&&"onreadystatechange"in e.document.createElement("script")?function(){var t=e.document.createElement("script");t.onreadystatechange=function(){n(),t.onreadystatechange=null,t.parentNode.removeChild(t),t=null},e.document.documentElement.appendChild(t)}:function(){setTimeout(n,0)};else{var a=new e.MessageChannel;a.port1.onmessage=n,o=function(){a.port2.postMessage(0)}}var f,l=[];t.exports=r}).call(this,"undefined"!=typeof global?global:"undefined"!=typeof self?self:"undefined"!=typeof window?window:{})},{}],3:[function(e,t,n){(function(t){"use strict";"function"!=typeof t.Promise&&(t.Promise=e("./lib"))}).call(this,"undefined"!=typeof global?global:"undefined"!=typeof self?self:"undefined"!=typeof window?window:{})},{"./lib":1}]},{},[3]); ```
/content/code_sandbox/node_modules/lie/dist/lie.polyfill.min.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,347
```javascript /** * Module dependencies. */ var proxyAgent = require('proxy-agent'); var debug = require('debug')('superagent-proxy'); /** * Module exports. */ module.exports = setup; /** * Adds a `.proxy(uri)` function to the "superagent" module's Request class. * * ``` js * var request = require('superagent'); * require('superagent-proxy')(request); * * request * .get(uri) * .proxy(uri) * .end(fn); * ``` * * Or, you can pass in a `superagent.Request` instance, and it's like calling the * `.proxy(uri)` function on it, but without extending the prototype: * * ``` js * var request = require('superagent'); * var proxy = require('superagent-proxy'); * * proxy(request.get(uri), uri).end(fn); * ``` * * @param {Object} superagent The `superagent` exports object * @api public */ function setup (superagent, uri) { var Request = superagent.Request; if (Request) { // the superagent exports object - extent Request with "proxy" Request.prototype.proxy = proxy; return superagent; } else { // assume it's a `superagent.Request` instance return proxy.call(superagent, uri); } } /** * Sets the proxy server to use for this HTTP(s) request. * * @param {String} uri proxy url * @api public */ function proxy (uri) { debug('Request#proxy(%o)', uri); // we need to observe the `url` field from now on... Superagent sometimes // re-uses the `req` instance but changes its `url` field (i.e. in the case of // a redirect), so when that happens we need to potentially re-set the proxy // agent setupUrl(this); // attempt to get a proxying `http.Agent` instance var agent = proxyAgent(uri); // if we have an `http.Agent` instance then call the .agent() function if (agent) this.agent(agent); // store the proxy URI in case of changes to the `url` prop in the future this._proxyUri = uri; return this; } /** * Sets up a get/set descriptor for the `url` property of the provided `req` * Request instance. This is so that we can re-run the "proxy agent" logic when * the `url` field is changed, i.e. during a 302 Redirect scenario. * * @api private */ function setupUrl (req) { var desc = Object.getOwnPropertyDescriptor(req, 'url'); if (desc.get == getUrl && desc.set == setUrl) return; // already patched // save current value req._url = req.url; desc.get = getUrl; desc.set = setUrl; delete desc.value; delete desc.writable; Object.defineProperty(req, 'url', desc); debug('patched superagent Request "url" property for changes'); } /** * `url` property getter. * * @api protected */ function getUrl () { return this._url; } /** * `url` property setter. * * @api protected */ function setUrl (v) { debug('set `.url`: %o', v); this._url = v; proxy.call(this, this._proxyUri); } ```
/content/code_sandbox/node_modules/superagent-proxy/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
734
```javascript (function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Promise = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(_dereq_,module,exports){ 'use strict'; var immediate = _dereq_('immediate'); /* istanbul ignore next */ function INTERNAL() {} var handlers = {}; var REJECTED = ['REJECTED']; var FULFILLED = ['FULFILLED']; var PENDING = ['PENDING']; module.exports = exports = Promise; function Promise(resolver) { if (typeof resolver !== 'function') { throw new TypeError('resolver must be a function'); } this.state = PENDING; this.queue = []; this.outcome = void 0; if (resolver !== INTERNAL) { safelyResolveThenable(this, resolver); } } Promise.prototype["catch"] = function (onRejected) { return this.then(null, onRejected); }; Promise.prototype.then = function (onFulfilled, onRejected) { if (typeof onFulfilled !== 'function' && this.state === FULFILLED || typeof onRejected !== 'function' && this.state === REJECTED) { return this; } var promise = new this.constructor(INTERNAL); if (this.state !== PENDING) { var resolver = this.state === FULFILLED ? onFulfilled : onRejected; unwrap(promise, resolver, this.outcome); } else { this.queue.push(new QueueItem(promise, onFulfilled, onRejected)); } return promise; }; function QueueItem(promise, onFulfilled, onRejected) { this.promise = promise; if (typeof onFulfilled === 'function') { this.onFulfilled = onFulfilled; this.callFulfilled = this.otherCallFulfilled; } if (typeof onRejected === 'function') { this.onRejected = onRejected; this.callRejected = this.otherCallRejected; } } QueueItem.prototype.callFulfilled = function (value) { handlers.resolve(this.promise, value); }; QueueItem.prototype.otherCallFulfilled = function (value) { unwrap(this.promise, this.onFulfilled, value); }; QueueItem.prototype.callRejected = function (value) { handlers.reject(this.promise, value); }; QueueItem.prototype.otherCallRejected = function (value) { unwrap(this.promise, this.onRejected, value); }; function unwrap(promise, func, value) { immediate(function () { var returnValue; try { returnValue = func(value); } catch (e) { return handlers.reject(promise, e); } if (returnValue === promise) { handlers.reject(promise, new TypeError('Cannot resolve promise with itself')); } else { handlers.resolve(promise, returnValue); } }); } handlers.resolve = function (self, value) { var result = tryCatch(getThen, value); if (result.status === 'error') { return handlers.reject(self, result.value); } var thenable = result.value; if (thenable) { safelyResolveThenable(self, thenable); } else { self.state = FULFILLED; self.outcome = value; var i = -1; var len = self.queue.length; while (++i < len) { self.queue[i].callFulfilled(value); } } return self; }; handlers.reject = function (self, error) { self.state = REJECTED; self.outcome = error; var i = -1; var len = self.queue.length; while (++i < len) { self.queue[i].callRejected(error); } return self; }; function getThen(obj) { // Make sure we only access the accessor once as required by the spec var then = obj && obj.then; if (obj && typeof obj === 'object' && typeof then === 'function') { return function appyThen() { then.apply(obj, arguments); }; } } function safelyResolveThenable(self, thenable) { // Either fulfill, reject or reject with error var called = false; function onError(value) { if (called) { return; } called = true; handlers.reject(self, value); } function onSuccess(value) { if (called) { return; } called = true; handlers.resolve(self, value); } function tryToUnwrap() { thenable(onSuccess, onError); } var result = tryCatch(tryToUnwrap); if (result.status === 'error') { onError(result.value); } } function tryCatch(func, value) { var out = {}; try { out.value = func(value); out.status = 'success'; } catch (e) { out.status = 'error'; out.value = e; } return out; } exports.resolve = resolve; function resolve(value) { if (value instanceof this) { return value; } return handlers.resolve(new this(INTERNAL), value); } exports.reject = reject; function reject(reason) { var promise = new this(INTERNAL); return handlers.reject(promise, reason); } exports.all = all; function all(iterable) { var self = this; if (Object.prototype.toString.call(iterable) !== '[object Array]') { return this.reject(new TypeError('must be an array')); } var len = iterable.length; var called = false; if (!len) { return this.resolve([]); } var values = new Array(len); var resolved = 0; var i = -1; var promise = new this(INTERNAL); while (++i < len) { allResolver(iterable[i], i); } return promise; function allResolver(value, i) { self.resolve(value).then(resolveFromAll, function (error) { if (!called) { called = true; handlers.reject(promise, error); } }); function resolveFromAll(outValue) { values[i] = outValue; if (++resolved === len && !called) { called = true; handlers.resolve(promise, values); } } } } exports.race = race; function race(iterable) { var self = this; if (Object.prototype.toString.call(iterable) !== '[object Array]') { return this.reject(new TypeError('must be an array')); } var len = iterable.length; var called = false; if (!len) { return this.resolve([]); } var i = -1; var promise = new this(INTERNAL); while (++i < len) { resolver(iterable[i]); } return promise; function resolver(value) { self.resolve(value).then(function (response) { if (!called) { called = true; handlers.resolve(promise, response); } }, function (error) { if (!called) { called = true; handlers.reject(promise, error); } }); } } },{"immediate":2}],2:[function(_dereq_,module,exports){ (function (global){ 'use strict'; var Mutation = global.MutationObserver || global.WebKitMutationObserver; var scheduleDrain; { if (Mutation) { var called = 0; var observer = new Mutation(nextTick); var element = global.document.createTextNode(''); observer.observe(element, { characterData: true }); scheduleDrain = function () { element.data = (called = ++called % 2); }; } else if (!global.setImmediate && typeof global.MessageChannel !== 'undefined') { var channel = new global.MessageChannel(); channel.port1.onmessage = nextTick; scheduleDrain = function () { channel.port2.postMessage(0); }; } else if ('document' in global && 'onreadystatechange' in global.document.createElement('script')) { scheduleDrain = function () { // Create a <script> element; its readystatechange event will be fired asynchronously once it is inserted // into the document. Do so, thus queuing up the task. Remember to clean up once it's been called. var scriptEl = global.document.createElement('script'); scriptEl.onreadystatechange = function () { nextTick(); scriptEl.onreadystatechange = null; scriptEl.parentNode.removeChild(scriptEl); scriptEl = null; }; global.document.documentElement.appendChild(scriptEl); }; } else { scheduleDrain = function () { setTimeout(nextTick, 0); }; } } var draining; var queue = []; //named nextTick for less confusing stack traces function nextTick() { draining = true; var i, oldQueue; var len = queue.length; while (len) { oldQueue = queue; queue = []; i = -1; while (++i < len) { oldQueue[i](); } len = queue.length; } draining = false; } module.exports = immediate; function immediate(task) { if (queue.push(task) === 1 && !draining) { scheduleDrain(); } } }).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) },{}]},{},[1])(1) }); ```
/content/code_sandbox/node_modules/lie/dist/lie.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,227
```javascript /** * Module dependencies. */ var net = require('net'); var url = require('url'); var assert = require('assert'); var request = require('superagent'); // extend with .proxy() require('../')(request); describe('superagent-proxy', function () { this.slow(5000); this.timeout(10000); var httpLink = 'path_to_url var httpsLink = 'path_to_url describe('superagent.Request#proxy()', function () { it('should be a function', function () { assert.equal('function', typeof request.Request.prototype.proxy); }); it('should accept a "string" proxy URI', function () { var req = request.get('path_to_url req.proxy('path_to_url }); it('should accept an options "object" with proxy info', function () { var req = request.get('path_to_url req.proxy({ protocol: 'https', host: 'proxy.org', port: 8080 }); }); it('should throw on an options "object" without "protocol"', function () { var req = request.get('path_to_url try { req.proxy({ host: 'proxy.org', port: 8080 }); assert(false, 'should be unreachable'); } catch (e) { assert.equal('TypeError', e.name); assert(/\bhttp\b/.test(e.message)); assert(/\bhttps\b/.test(e.message)); assert(/\bsocks\b/.test(e.message)); } }); }); describe('http: - HTTP proxy', function () { var proxy = process.env.HTTP_PROXY || process.env.http_proxy || 'path_to_url it('should work against an HTTP endpoint', function (done) { request .get(httpLink) .proxy(proxy) .end(function (res) { var data = res.body; assert('ip' in data); var ips = data.ip.split(/\,\s*/g); assert(ips.length >= 1); ips.forEach(function (ip) { assert(net.isIP(ip)); }); done(); }); }); it('should work against an HTTPS endpoint', function (done) { request .get(httpsLink) .proxy(proxy) .end(function (res) { var data = JSON.parse(res.text); assert.equal('tootallnate', data.username); done(); }); }); }); describe('https: - HTTPS proxy', function () { var proxy = process.env.HTTPS_PROXY || process.env.https_proxy || 'path_to_url it('should work against an HTTP endpoint', function (done) { var p = url.parse(proxy); p.rejectUnauthorized = false; request .get(httpLink) .proxy(p) .end(function (res) { var data = res.body; assert('ip' in data); var ips = data.ip.split(/\,\s*/g); assert(ips.length >= 1); ips.forEach(function (ip) { assert(net.isIP(ip)); }); done(); }); }); it('should work against an HTTPS endpoint', function (done) { var p = url.parse(proxy); p.rejectUnauthorized = false; request .get(httpsLink) .proxy(p) .end(function (res) { var data = JSON.parse(res.text); assert.equal('tootallnate', data.username); done(); }); }); }); describe('socks: - SOCKS proxy', function () { var proxy = process.env.SOCKS_PROXY || process.env.socks_proxy || 'socks://127.0.0.1:9050'; it('should work against an HTTP endpoint', function (done) { request .get(httpLink) .proxy(proxy) .end(function (res) { var data = res.body; assert('ip' in data); var ips = data.ip.split(/\,\s*/g); assert(ips.length >= 1); ips.forEach(function (ip) { assert(net.isIP(ip)); }); done(); }); }); it('should work against an HTTPS endpoint', function (done) { request .get(httpsLink) .proxy(proxy) .end(function (res) { var data = JSON.parse(res.text); assert.equal('tootallnate', data.username); done(); }); }); }); }); ```
/content/code_sandbox/node_modules/superagent-proxy/test/test.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
979
```javascript /** * Detect Electron renderer / nwjs process, which is node, but we should * treat as a browser. */ if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { module.exports = require('./browser.js'); } else { module.exports = require('./node.js'); } ```
/content/code_sandbox/node_modules/superagent-proxy/node_modules/debug/src/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
73
```javascript /** * Helpers. */ var s = 1000; var m = s * 60; var h = m * 60; var d = h * 24; var w = d * 7; var y = d * 365.25; /** * Parse or format the given `val`. * * Options: * * - `long` verbose formatting [false] * * @param {String|Number} val * @param {Object} [options] * @throws {Error} throw an error if val is not a non-empty string or a number * @return {String|Number} * @api public */ module.exports = function(val, options) { options = options || {}; var type = typeof val; if (type === 'string' && val.length > 0) { return parse(val); } else if (type === 'number' && isFinite(val)) { return options.long ? fmtLong(val) : fmtShort(val); } throw new Error( 'val is not a non-empty string or a valid number. val=' + JSON.stringify(val) ); }; /** * Parse the given `str` and return milliseconds. * * @param {String} str * @return {Number} * @api private */ function parse(str) { str = String(str); if (str.length > 100) { return; } var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( str ); if (!match) { return; } var n = parseFloat(match[1]); var type = (match[2] || 'ms').toLowerCase(); switch (type) { case 'years': case 'year': case 'yrs': case 'yr': case 'y': return n * y; case 'weeks': case 'week': case 'w': return n * w; case 'days': case 'day': case 'd': return n * d; case 'hours': case 'hour': case 'hrs': case 'hr': case 'h': return n * h; case 'minutes': case 'minute': case 'mins': case 'min': case 'm': return n * m; case 'seconds': case 'second': case 'secs': case 'sec': case 's': return n * s; case 'milliseconds': case 'millisecond': case 'msecs': case 'msec': case 'ms': return n; default: return undefined; } } /** * Short format for `ms`. * * @param {Number} ms * @return {String} * @api private */ function fmtShort(ms) { var msAbs = Math.abs(ms); if (msAbs >= d) { return Math.round(ms / d) + 'd'; } if (msAbs >= h) { return Math.round(ms / h) + 'h'; } if (msAbs >= m) { return Math.round(ms / m) + 'm'; } if (msAbs >= s) { return Math.round(ms / s) + 's'; } return ms + 'ms'; } /** * Long format for `ms`. * * @param {Number} ms * @return {String} * @api private */ function fmtLong(ms) { var msAbs = Math.abs(ms); if (msAbs >= d) { return plural(ms, msAbs, d, 'day'); } if (msAbs >= h) { return plural(ms, msAbs, h, 'hour'); } if (msAbs >= m) { return plural(ms, msAbs, m, 'minute'); } if (msAbs >= s) { return plural(ms, msAbs, s, 'second'); } return ms + ' ms'; } /** * Pluralization helper. */ function plural(ms, msAbs, n, name) { var isPlural = msAbs >= n * 1.5; return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); } ```
/content/code_sandbox/node_modules/superagent-proxy/node_modules/ms/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
981
```javascript /** * Module dependencies. */ const tty = require('tty'); const util = require('util'); /** * This is the Node.js implementation of `debug()`. */ exports.init = init; exports.log = log; exports.formatArgs = formatArgs; exports.save = save; exports.load = load; exports.useColors = useColors; exports.destroy = util.deprecate( () => {}, 'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' ); /** * Colors. */ exports.colors = [6, 2, 3, 4, 5, 1]; try { // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) // eslint-disable-next-line import/no-extraneous-dependencies const supportsColor = require('supports-color'); if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { exports.colors = [ 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, 205, 206, 207, 208, 209, 214, 215, 220, 221 ]; } } catch (error) { // Swallow - we only care if `supports-color` is available; it doesn't have to be. } /** * Build up the default `inspectOpts` object from the environment variables. * * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js */ exports.inspectOpts = Object.keys(process.env).filter(key => { return /^debug_/i.test(key); }).reduce((obj, key) => { // Camel-case const prop = key .substring(6) .toLowerCase() .replace(/_([a-z])/g, (_, k) => { return k.toUpperCase(); }); // Coerce string value into JS value let val = process.env[key]; if (/^(yes|on|true|enabled)$/i.test(val)) { val = true; } else if (/^(no|off|false|disabled)$/i.test(val)) { val = false; } else if (val === 'null') { val = null; } else { val = Number(val); } obj[prop] = val; return obj; }, {}); /** * Is stdout a TTY? Colored output is enabled when `true`. */ function useColors() { return 'colors' in exports.inspectOpts ? Boolean(exports.inspectOpts.colors) : tty.isatty(process.stderr.fd); } /** * Adds ANSI color escape codes if enabled. * * @api public */ function formatArgs(args) { const {namespace: name, useColors} = this; if (useColors) { const c = this.color; const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); const prefix = ` ${colorCode};1m${name} \u001B[0m`; args[0] = prefix + args[0].split('\n').join('\n' + prefix); args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); } else { args[0] = getDate() + name + ' ' + args[0]; } } function getDate() { if (exports.inspectOpts.hideDate) { return ''; } return new Date().toISOString() + ' '; } /** * Invokes `util.format()` with the specified arguments and writes to stderr. */ function log(...args) { return process.stderr.write(util.format(...args) + '\n'); } /** * Save `namespaces`. * * @param {String} namespaces * @api private */ function save(namespaces) { if (namespaces) { process.env.DEBUG = namespaces; } else { // If you set a process.env field to null or undefined, it gets cast to the // string 'null' or 'undefined'. Just delete instead. delete process.env.DEBUG; } } /** * Load `namespaces`. * * @return {String} returns the previously persisted debug modes * @api private */ function load() { return process.env.DEBUG; } /** * Init logic for `debug` instances. * * Create a new `inspectOpts` object in case `useColors` is set * differently for a particular `debug` instance. */ function init(debug) { debug.inspectOpts = {}; const keys = Object.keys(exports.inspectOpts); for (let i = 0; i < keys.length; i++) { debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; } } module.exports = require('./common')(exports); const {formatters} = module.exports; /** * Map %o to `util.inspect()`, all on a single line. */ formatters.o = function (v) { this.inspectOpts.colors = this.useColors; return util.inspect(v, this.inspectOpts) .split('\n') .map(str => str.trim()) .join(' '); }; /** * Map %O to `util.inspect()`, allowing multiple lines if needed. */ formatters.O = function (v) { this.inspectOpts.colors = this.useColors; return util.inspect(v, this.inspectOpts); }; ```
/content/code_sandbox/node_modules/superagent-proxy/node_modules/debug/src/node.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,400
```javascript /** * This is the common logic for both the Node.js and web browser * implementations of `debug()`. */ function setup(env) { createDebug.debug = createDebug; createDebug.default = createDebug; createDebug.coerce = coerce; createDebug.disable = disable; createDebug.enable = enable; createDebug.enabled = enabled; createDebug.humanize = require('ms'); createDebug.destroy = destroy; Object.keys(env).forEach(key => { createDebug[key] = env[key]; }); /** * The currently active debug mode names, and names to skip. */ createDebug.names = []; createDebug.skips = []; /** * Map of special "%n" handling functions, for the debug "format" argument. * * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". */ createDebug.formatters = {}; /** * Selects a color for a debug namespace * @param {String} namespace The namespace string for the debug instance to be colored * @return {Number|String} An ANSI color code for the given namespace * @api private */ function selectColor(namespace) { let hash = 0; for (let i = 0; i < namespace.length; i++) { hash = ((hash << 5) - hash) + namespace.charCodeAt(i); hash |= 0; // Convert to 32bit integer } return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; } createDebug.selectColor = selectColor; /** * Create a debugger with the given `namespace`. * * @param {String} namespace * @return {Function} * @api public */ function createDebug(namespace) { let prevTime; let enableOverride = null; let namespacesCache; let enabledCache; function debug(...args) { // Disabled? if (!debug.enabled) { return; } const self = debug; // Set `diff` timestamp const curr = Number(new Date()); const ms = curr - (prevTime || curr); self.diff = ms; self.prev = prevTime; self.curr = curr; prevTime = curr; args[0] = createDebug.coerce(args[0]); if (typeof args[0] !== 'string') { // Anything else let's inspect with %O args.unshift('%O'); } // Apply any `formatters` transformations let index = 0; args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { // If we encounter an escaped % then don't increase the array index if (match === '%%') { return '%'; } index++; const formatter = createDebug.formatters[format]; if (typeof formatter === 'function') { const val = args[index]; match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format` args.splice(index, 1); index--; } return match; }); // Apply env-specific formatting (colors, etc.) createDebug.formatArgs.call(self, args); const logFn = self.log || createDebug.log; logFn.apply(self, args); } debug.namespace = namespace; debug.useColors = createDebug.useColors(); debug.color = createDebug.selectColor(namespace); debug.extend = extend; debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release. Object.defineProperty(debug, 'enabled', { enumerable: true, configurable: false, get: () => { if (enableOverride !== null) { return enableOverride; } if (namespacesCache !== createDebug.namespaces) { namespacesCache = createDebug.namespaces; enabledCache = createDebug.enabled(namespace); } return enabledCache; }, set: v => { enableOverride = v; } }); // Env-specific initialization logic for debug instances if (typeof createDebug.init === 'function') { createDebug.init(debug); } return debug; } function extend(namespace, delimiter) { const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); newDebug.log = this.log; return newDebug; } /** * Enables a debug mode by namespaces. This can include modes * separated by a colon and wildcards. * * @param {String} namespaces * @api public */ function enable(namespaces) { createDebug.save(namespaces); createDebug.namespaces = namespaces; createDebug.names = []; createDebug.skips = []; let i; const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); const len = split.length; for (i = 0; i < len; i++) { if (!split[i]) { // ignore empty strings continue; } namespaces = split[i].replace(/\*/g, '.*?'); if (namespaces[0] === '-') { createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$')); } else { createDebug.names.push(new RegExp('^' + namespaces + '$')); } } } /** * Disable debug output. * * @return {String} namespaces * @api public */ function disable() { const namespaces = [ ...createDebug.names.map(toNamespace), ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace) ].join(','); createDebug.enable(''); return namespaces; } /** * Returns true if the given mode name is enabled, false otherwise. * * @param {String} name * @return {Boolean} * @api public */ function enabled(name) { if (name[name.length - 1] === '*') { return true; } let i; let len; for (i = 0, len = createDebug.skips.length; i < len; i++) { if (createDebug.skips[i].test(name)) { return false; } } for (i = 0, len = createDebug.names.length; i < len; i++) { if (createDebug.names[i].test(name)) { return true; } } return false; } /** * Convert regexp to namespace * * @param {RegExp} regxep * @return {String} namespace * @api private */ function toNamespace(regexp) { return regexp.toString() .substring(2, regexp.toString().length - 2) .replace(/\.\*\?$/, '*'); } /** * Coerce `val`. * * @param {Mixed} val * @return {Mixed} * @api private */ function coerce(val) { if (val instanceof Error) { return val.stack || val.message; } return val; } /** * XXX DO NOT USE. This is a temporary stub function. * XXX It WILL be removed in the next major release. */ function destroy() { console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); } createDebug.enable(createDebug.load()); return createDebug; } module.exports = setup; ```
/content/code_sandbox/node_modules/superagent-proxy/node_modules/debug/src/common.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,693
```javascript 'use strict'; var Mutation = global.MutationObserver || global.WebKitMutationObserver; var scheduleDrain; if (process.browser) { if (Mutation) { var called = 0; var observer = new Mutation(nextTick); var element = global.document.createTextNode(''); observer.observe(element, { characterData: true }); scheduleDrain = function () { element.data = (called = ++called % 2); }; } else if (!global.setImmediate && typeof global.MessageChannel !== 'undefined') { var channel = new global.MessageChannel(); channel.port1.onmessage = nextTick; scheduleDrain = function () { channel.port2.postMessage(0); }; } else if ('document' in global && 'onreadystatechange' in global.document.createElement('script')) { scheduleDrain = function () { // Create a <script> element; its readystatechange event will be fired asynchronously once it is inserted // into the document. Do so, thus queuing up the task. Remember to clean up once it's been called. var scriptEl = global.document.createElement('script'); scriptEl.onreadystatechange = function () { nextTick(); scriptEl.onreadystatechange = null; scriptEl.parentNode.removeChild(scriptEl); scriptEl = null; }; global.document.documentElement.appendChild(scriptEl); }; } else { scheduleDrain = function () { setTimeout(nextTick, 0); }; } } else { scheduleDrain = function () { process.nextTick(nextTick); }; } var draining; var queue = []; //named nextTick for less confusing stack traces function nextTick() { draining = true; var i, oldQueue; var len = queue.length; while (len) { oldQueue = queue; queue = []; i = -1; while (++i < len) { oldQueue[i](); } len = queue.length; } draining = false; } module.exports = immediate; function immediate(task) { if (queue.push(task) === 1 && !draining) { scheduleDrain(); } } ```
/content/code_sandbox/node_modules/immediate/lib/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
457
```javascript /* eslint-env browser */ /** * This is the web browser implementation of `debug()`. */ exports.formatArgs = formatArgs; exports.save = save; exports.load = load; exports.useColors = useColors; exports.storage = localstorage(); exports.destroy = (() => { let warned = false; return () => { if (!warned) { warned = true; console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); } }; })(); /** * Colors. */ exports.colors = [ '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' ]; /** * Currently only WebKit-based Web Inspectors, Firefox >= v31, * and the Firebug extension (any Firefox version) are known * to support "%c" CSS customizations. * * TODO: add a `localStorage` variable to explicitly enable/disable colors */ // eslint-disable-next-line complexity function useColors() { // NB: In an Electron preload script, document will be defined but not fully // initialized. Since we know we're in Chrome, we'll just detect this case // explicitly if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { return true; } // Internet Explorer and Edge do not support colors. if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { return false; } // Is webkit? path_to_url // document is undefined in react-native: path_to_url return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || // Is firebug? path_to_url (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || // Is firefox >= v31? // path_to_url#Styling_messages (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || // Double check webkit in userAgent just in case we are in a worker (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); } /** * Colorize log arguments if enabled. * * @api public */ function formatArgs(args) { args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff); if (!this.useColors) { return; } const c = 'color: ' + this.color; args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other // arguments passed either before or after the %c, so we need to // figure out the correct index to insert the CSS into let index = 0; let lastC = 0; args[0].replace(/%[a-zA-Z%]/g, match => { if (match === '%%') { return; } index++; if (match === '%c') { // We only are interested in the *last* %c // (the user may have provided their own) lastC = index; } }); args.splice(lastC, 0, c); } /** * Invokes `console.debug()` when available. * No-op when `console.debug` is not a "function". * If `console.debug` is not available, falls back * to `console.log`. * * @api public */ exports.log = console.debug || console.log || (() => {}); /** * Save `namespaces`. * * @param {String} namespaces * @api private */ function save(namespaces) { try { if (namespaces) { exports.storage.setItem('debug', namespaces); } else { exports.storage.removeItem('debug'); } } catch (error) { // Swallow // XXX (@Qix-) should we be logging these? } } /** * Load `namespaces`. * * @return {String} returns the previously persisted debug modes * @api private */ function load() { let r; try { r = exports.storage.getItem('debug'); } catch (error) { // Swallow // XXX (@Qix-) should we be logging these? } // If debug isn't set in LS, and we're in Electron, try to load $DEBUG if (!r && typeof process !== 'undefined' && 'env' in process) { r = process.env.DEBUG; } return r; } /** * Localstorage attempts to return the localstorage. * * This is necessary because safari throws * when a user disables cookies/localstorage * and you attempt to access it. * * @return {LocalStorage} * @api private */ function localstorage() { try { // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context // The Browser also has localStorage in the global context. return localStorage; } catch (error) { // Swallow // XXX (@Qix-) should we be logging these? } } module.exports = require('./common')(exports); const {formatters} = module.exports; /** * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. */ formatters.j = function (v) { try { return JSON.stringify(v); } catch (error) { return '[UnexpectedJSONParseError]: ' + error.message; } }; ```
/content/code_sandbox/node_modules/superagent-proxy/node_modules/debug/src/browser.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,732
```javascript (function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.immediate = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(_dereq_,module,exports){ (function (global){ 'use strict'; var Mutation = global.MutationObserver || global.WebKitMutationObserver; var scheduleDrain; { if (Mutation) { var called = 0; var observer = new Mutation(nextTick); var element = global.document.createTextNode(''); observer.observe(element, { characterData: true }); scheduleDrain = function () { element.data = (called = ++called % 2); }; } else if (!global.setImmediate && typeof global.MessageChannel !== 'undefined') { var channel = new global.MessageChannel(); channel.port1.onmessage = nextTick; scheduleDrain = function () { channel.port2.postMessage(0); }; } else if ('document' in global && 'onreadystatechange' in global.document.createElement('script')) { scheduleDrain = function () { // Create a <script> element; its readystatechange event will be fired asynchronously once it is inserted // into the document. Do so, thus queuing up the task. Remember to clean up once it's been called. var scriptEl = global.document.createElement('script'); scriptEl.onreadystatechange = function () { nextTick(); scriptEl.onreadystatechange = null; scriptEl.parentNode.removeChild(scriptEl); scriptEl = null; }; global.document.documentElement.appendChild(scriptEl); }; } else { scheduleDrain = function () { setTimeout(nextTick, 0); }; } } var draining; var queue = []; //named nextTick for less confusing stack traces function nextTick() { draining = true; var i, oldQueue; var len = queue.length; while (len) { oldQueue = queue; queue = []; i = -1; while (++i < len) { oldQueue[i](); } len = queue.length; } draining = false; } module.exports = immediate; function immediate(task) { if (queue.push(task) === 1 && !draining) { scheduleDrain(); } } }).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) },{}]},{},[1])(1) }); ```
/content/code_sandbox/node_modules/immediate/dist/immediate.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
732
```javascript !function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var n;n="undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:this,n.immediate=e()}}(function(){return function e(n,t,o){function r(f,u){if(!t[f]){if(!n[f]){var a="function"==typeof require&&require;if(!u&&a)return a(f,!0);if(i)return i(f,!0);var d=new Error("Cannot find module '"+f+"'");throw d.code="MODULE_NOT_FOUND",d}var s=t[f]={exports:{}};n[f][0].call(s.exports,function(e){var t=n[f][1][e];return r(t?t:e)},s,s.exports,e,n,t,o)}return t[f].exports}for(var i="function"==typeof require&&require,f=0;f<o.length;f++)r(o[f]);return r}({1:[function(e,n,t){(function(e){"use strict";function t(){s=!0;for(var e,n,t=c.length;t;){for(n=c,c=[],e=-1;++e<t;)n[e]();t=c.length}s=!1}function o(e){1!==c.push(e)||s||r()}var r,i=e.MutationObserver||e.WebKitMutationObserver;if(i){var f=0,u=new i(t),a=e.document.createTextNode("");u.observe(a,{characterData:!0}),r=function(){a.data=f=++f%2}}else if(e.setImmediate||"undefined"==typeof e.MessageChannel)r="document"in e&&"onreadystatechange"in e.document.createElement("script")?function(){var n=e.document.createElement("script");n.onreadystatechange=function(){t(),n.onreadystatechange=null,n.parentNode.removeChild(n),n=null},e.document.documentElement.appendChild(n)}:function(){setTimeout(t,0)};else{var d=new e.MessageChannel;d.port1.onmessage=t,r=function(){d.port2.postMessage(0)}}var s,c=[];n.exports=o}).call(this,"undefined"!=typeof global?global:"undefined"!=typeof self?self:"undefined"!=typeof window?window:{})},{}]},{},[1])(1)}); ```
/content/code_sandbox/node_modules/immediate/dist/immediate.min.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
495
```javascript (function() { 'use strict'; var collator; try { collator = (typeof Intl !== "undefined" && typeof Intl.Collator !== "undefined") ? Intl.Collator("generic", { sensitivity: "base" }) : null; } catch (err){ console.log("Collator could not be initialized and wouldn't be used"); } // arrays to re-use var prevRow = [], str2Char = []; /** * Based on the algorithm at path_to_url */ var Levenshtein = { /** * Calculate levenshtein distance of the two strings. * * @param str1 String the first string. * @param str2 String the second string. * @param [options] Additional options. * @param [options.useCollator] Use `Intl.Collator` for locale-sensitive string comparison. * @return Integer the levenshtein distance (0 and above). */ get: function(str1, str2, options) { var useCollator = (options && collator && options.useCollator); var str1Len = str1.length, str2Len = str2.length; // base cases if (str1Len === 0) return str2Len; if (str2Len === 0) return str1Len; // two rows var curCol, nextCol, i, j, tmp; // initialise previous row for (i=0; i<str2Len; ++i) { prevRow[i] = i; str2Char[i] = str2.charCodeAt(i); } prevRow[str2Len] = str2Len; var strCmp; if (useCollator) { // calculate current row distance from previous row using collator for (i = 0; i < str1Len; ++i) { nextCol = i + 1; for (j = 0; j < str2Len; ++j) { curCol = nextCol; // substution strCmp = 0 === collator.compare(str1.charAt(i), String.fromCharCode(str2Char[j])); nextCol = prevRow[j] + (strCmp ? 0 : 1); // insertion tmp = curCol + 1; if (nextCol > tmp) { nextCol = tmp; } // deletion tmp = prevRow[j + 1] + 1; if (nextCol > tmp) { nextCol = tmp; } // copy current col value into previous (in preparation for next iteration) prevRow[j] = curCol; } // copy last col value into previous (in preparation for next iteration) prevRow[j] = nextCol; } } else { // calculate current row distance from previous row without collator for (i = 0; i < str1Len; ++i) { nextCol = i + 1; for (j = 0; j < str2Len; ++j) { curCol = nextCol; // substution strCmp = str1.charCodeAt(i) === str2Char[j]; nextCol = prevRow[j] + (strCmp ? 0 : 1); // insertion tmp = curCol + 1; if (nextCol > tmp) { nextCol = tmp; } // deletion tmp = prevRow[j + 1] + 1; if (nextCol > tmp) { nextCol = tmp; } // copy current col value into previous (in preparation for next iteration) prevRow[j] = curCol; } // copy last col value into previous (in preparation for next iteration) prevRow[j] = nextCol; } } return nextCol; } }; // amd if (typeof define !== "undefined" && define !== null && define.amd) { define(function() { return Levenshtein; }); } // commonjs else if (typeof module !== "undefined" && module !== null && typeof exports !== "undefined" && module.exports === exports) { module.exports = Levenshtein; } // web worker else if (typeof self !== "undefined" && typeof self.postMessage === 'function' && typeof self.importScripts === 'function') { self.Levenshtein = Levenshtein; } // browser main thread else if (typeof window !== "undefined" && window !== null) { window.Levenshtein = Levenshtein; } }()); ```
/content/code_sandbox/node_modules/fast-levenshtein/levenshtein.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,029
```javascript var fs = require('fs'); var util = require('util'); var stream = require('stream'); var Readable = stream.Readable; var Writable = stream.Writable; var PassThrough = stream.PassThrough; var Pend = require('pend'); var EventEmitter = require('events').EventEmitter; exports.createFromBuffer = createFromBuffer; exports.createFromFd = createFromFd; exports.BufferSlicer = BufferSlicer; exports.FdSlicer = FdSlicer; util.inherits(FdSlicer, EventEmitter); function FdSlicer(fd, options) { options = options || {}; EventEmitter.call(this); this.fd = fd; this.pend = new Pend(); this.pend.max = 1; this.refCount = 0; this.autoClose = !!options.autoClose; } FdSlicer.prototype.read = function(buffer, offset, length, position, callback) { var self = this; self.pend.go(function(cb) { fs.read(self.fd, buffer, offset, length, position, function(err, bytesRead, buffer) { cb(); callback(err, bytesRead, buffer); }); }); }; FdSlicer.prototype.write = function(buffer, offset, length, position, callback) { var self = this; self.pend.go(function(cb) { fs.write(self.fd, buffer, offset, length, position, function(err, written, buffer) { cb(); callback(err, written, buffer); }); }); }; FdSlicer.prototype.createReadStream = function(options) { return new ReadStream(this, options); }; FdSlicer.prototype.createWriteStream = function(options) { return new WriteStream(this, options); }; FdSlicer.prototype.ref = function() { this.refCount += 1; }; FdSlicer.prototype.unref = function() { var self = this; self.refCount -= 1; if (self.refCount > 0) return; if (self.refCount < 0) throw new Error("invalid unref"); if (self.autoClose) { fs.close(self.fd, onCloseDone); } function onCloseDone(err) { if (err) { self.emit('error', err); } else { self.emit('close'); } } }; util.inherits(ReadStream, Readable); function ReadStream(context, options) { options = options || {}; Readable.call(this, options); this.context = context; this.context.ref(); this.start = options.start || 0; this.endOffset = options.end; this.pos = this.start; this.destroyed = false; } ReadStream.prototype._read = function(n) { var self = this; if (self.destroyed) return; var toRead = Math.min(self._readableState.highWaterMark, n); if (self.endOffset != null) { toRead = Math.min(toRead, self.endOffset - self.pos); } if (toRead <= 0) { self.destroyed = true; self.push(null); self.context.unref(); return; } self.context.pend.go(function(cb) { if (self.destroyed) return cb(); var buffer = new Buffer(toRead); fs.read(self.context.fd, buffer, 0, toRead, self.pos, function(err, bytesRead) { if (err) { self.destroy(err); } else if (bytesRead === 0) { self.destroyed = true; self.push(null); self.context.unref(); } else { self.pos += bytesRead; self.push(buffer.slice(0, bytesRead)); } cb(); }); }); }; ReadStream.prototype.destroy = function(err) { if (this.destroyed) return; err = err || new Error("stream destroyed"); this.destroyed = true; this.emit('error', err); this.context.unref(); }; util.inherits(WriteStream, Writable); function WriteStream(context, options) { options = options || {}; Writable.call(this, options); this.context = context; this.context.ref(); this.start = options.start || 0; this.endOffset = (options.end == null) ? Infinity : +options.end; this.bytesWritten = 0; this.pos = this.start; this.destroyed = false; this.on('finish', this.destroy.bind(this)); } WriteStream.prototype._write = function(buffer, encoding, callback) { var self = this; if (self.destroyed) return; if (self.pos + buffer.length > self.endOffset) { var err = new Error("maximum file length exceeded"); err.code = 'ETOOBIG'; self.destroy(); callback(err); return; } self.context.pend.go(function(cb) { if (self.destroyed) return cb(); fs.write(self.context.fd, buffer, 0, buffer.length, self.pos, function(err, bytes) { if (err) { self.destroy(); cb(); callback(err); } else { self.bytesWritten += bytes; self.pos += bytes; self.emit('progress'); cb(); callback(); } }); }); }; WriteStream.prototype.destroy = function() { if (this.destroyed) return; this.destroyed = true; this.context.unref(); }; util.inherits(BufferSlicer, EventEmitter); function BufferSlicer(buffer) { EventEmitter.call(this); this.refCount = 0; this.buffer = buffer; } BufferSlicer.prototype.read = function(buffer, offset, length, position, callback) { var end = position + length; var delta = end - this.buffer.length; var written = (delta > 0) ? delta : length; this.buffer.copy(buffer, offset, position, end); setImmediate(function() { callback(null, written); }); }; BufferSlicer.prototype.write = function(buffer, offset, length, position, callback) { buffer.copy(this.buffer, position, offset, offset + length); setImmediate(function() { callback(null, length, buffer); }); }; BufferSlicer.prototype.createReadStream = function(options) { options = options || {}; var readStream = new PassThrough(options); readStream.start = options.start || 0; readStream.endOffset = options.end; readStream.pos = readStream.endOffset || this.buffer.length; // yep, we're already done readStream.destroyed = false; readStream.write(this.buffer.slice(readStream.start, readStream.pos)); readStream.end(); readStream.destroy = function() { readStream.destroyed = true; }; return readStream; }; BufferSlicer.prototype.createWriteStream = function(options) { var bufferSlicer = this; options = options || {}; var writeStream = new Writable(options); writeStream.start = options.start || 0; writeStream.endOffset = (options.end == null) ? this.buffer.length : +options.end; writeStream.bytesWritten = 0; writeStream.pos = writeStream.start; writeStream.destroyed = false; writeStream._write = function(buffer, encoding, callback) { if (writeStream.destroyed) return; var end = writeStream.pos + buffer.length; if (end > writeStream.endOffset) { var err = new Error("maximum file length exceeded"); err.code = 'ETOOBIG'; writeStream.destroyed = true; callback(err); return; } buffer.copy(bufferSlicer.buffer, writeStream.pos, 0, buffer.length); writeStream.bytesWritten += buffer.length; writeStream.pos = end; writeStream.emit('progress'); callback(); }; writeStream.destroy = function() { writeStream.destroyed = true; }; return writeStream; }; BufferSlicer.prototype.ref = function() { this.refCount += 1; }; BufferSlicer.prototype.unref = function() { this.refCount -= 1; if (this.refCount < 0) { throw new Error("invalid unref"); } }; function createFromBuffer(buffer) { return new BufferSlicer(buffer); } function createFromFd(fd, options) { return new FdSlicer(fd, options); } ```
/content/code_sandbox/node_modules/fd-slicer/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,775
```javascript var fdSlicer = require('../'); var fs = require('fs'); var crypto = require('crypto'); var path = require('path'); var streamEqual = require('stream-equal'); var assert = require('assert'); var Pend = require('pend'); var StreamSink = require('streamsink'); var describe = global.describe; var it = global.it; var before = global.before; var beforeEach = global.beforeEach; var after = global.after; var testBlobFile = path.join(__dirname, "test-blob.bin"); var testBlobFileSize = 20 * 1024 * 1024; var testOutBlobFile = path.join(__dirname, "test-blob-out.bin"); describe("FdSlicer", function() { before(function(done) { var out = fs.createWriteStream(testBlobFile); for (var i = 0; i < testBlobFileSize / 1024; i += 1) { out.write(crypto.pseudoRandomBytes(1024)); } out.end(); out.on('close', done); }); beforeEach(function() { try { fs.unlinkSync(testOutBlobFile); } catch (err) { } }); after(function() { try { fs.unlinkSync(testBlobFile); fs.unlinkSync(testOutBlobFile); } catch (err) { } }); it("reads a 20MB file (autoClose on)", function(done) { fs.open(testBlobFile, 'r', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var actualStream = slicer.createReadStream(); var expectedStream = fs.createReadStream(testBlobFile); var pend = new Pend(); pend.go(function(cb) { slicer.on('close', cb); }); pend.go(function(cb) { streamEqual(expectedStream, actualStream, function(err, equal) { if (err) return done(err); assert.ok(equal); cb(); }); }); pend.wait(done); }); }); it("reads 4 chunks simultaneously", function(done) { fs.open(testBlobFile, 'r', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd); var actualPart1 = slicer.createReadStream({start: testBlobFileSize * 0/4, end: testBlobFileSize * 1/4}); var actualPart2 = slicer.createReadStream({start: testBlobFileSize * 1/4, end: testBlobFileSize * 2/4}); var actualPart3 = slicer.createReadStream({start: testBlobFileSize * 2/4, end: testBlobFileSize * 3/4}); var actualPart4 = slicer.createReadStream({start: testBlobFileSize * 3/4, end: testBlobFileSize * 4/4}); var expectedPart1 = slicer.createReadStream({start: testBlobFileSize * 0/4, end: testBlobFileSize * 1/4}); var expectedPart2 = slicer.createReadStream({start: testBlobFileSize * 1/4, end: testBlobFileSize * 2/4}); var expectedPart3 = slicer.createReadStream({start: testBlobFileSize * 2/4, end: testBlobFileSize * 3/4}); var expectedPart4 = slicer.createReadStream({start: testBlobFileSize * 3/4, end: testBlobFileSize * 4/4}); var pend = new Pend(); pend.go(function(cb) { streamEqual(expectedPart1, actualPart1, function(err, equal) { assert.ok(equal); cb(err); }); }); pend.go(function(cb) { streamEqual(expectedPart2, actualPart2, function(err, equal) { assert.ok(equal); cb(err); }); }); pend.go(function(cb) { streamEqual(expectedPart3, actualPart3, function(err, equal) { assert.ok(equal); cb(err); }); }); pend.go(function(cb) { streamEqual(expectedPart4, actualPart4, function(err, equal) { assert.ok(equal); cb(err); }); }); pend.wait(function(err) { if (err) return done(err); fs.close(fd, done); }); }); }); it("writes a 20MB file (autoClose on)", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var actualStream = slicer.createWriteStream(); var inStream = fs.createReadStream(testBlobFile); slicer.on('close', function() { var expected = fs.createReadStream(testBlobFile); var actual = fs.createReadStream(testOutBlobFile); streamEqual(expected, actual, function(err, equal) { if (err) return done(err); assert.ok(equal); done(); }); }); inStream.pipe(actualStream); }); }); it("writes 4 chunks simultaneously", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd); var actualPart1 = slicer.createWriteStream({start: testBlobFileSize * 0/4}); var actualPart2 = slicer.createWriteStream({start: testBlobFileSize * 1/4}); var actualPart3 = slicer.createWriteStream({start: testBlobFileSize * 2/4}); var actualPart4 = slicer.createWriteStream({start: testBlobFileSize * 3/4}); var in1 = fs.createReadStream(testBlobFile, {start: testBlobFileSize * 0/4, end: testBlobFileSize * 1/4}); var in2 = fs.createReadStream(testBlobFile, {start: testBlobFileSize * 1/4, end: testBlobFileSize * 2/4}); var in3 = fs.createReadStream(testBlobFile, {start: testBlobFileSize * 2/4, end: testBlobFileSize * 3/4}); var in4 = fs.createReadStream(testBlobFile, {start: testBlobFileSize * 3/4, end: testBlobFileSize * 4/4}); var pend = new Pend(); pend.go(function(cb) { actualPart1.on('finish', cb); }); pend.go(function(cb) { actualPart2.on('finish', cb); }); pend.go(function(cb) { actualPart3.on('finish', cb); }); pend.go(function(cb) { actualPart4.on('finish', cb); }); in1.pipe(actualPart1); in2.pipe(actualPart2); in3.pipe(actualPart3); in4.pipe(actualPart4); pend.wait(function() { fs.close(fd, function(err) { if (err) return done(err); var expected = fs.createReadStream(testBlobFile); var actual = fs.createReadStream(testOutBlobFile); streamEqual(expected, actual, function(err, equal) { if (err) return done(err); assert.ok(equal); done(); }); }); }); }); }); it("throws on invalid ref", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); assert.throws(function() { slicer.unref(); }, /invalid unref/); fs.close(fd, done); }); }); it("write stream emits error when max size exceeded", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var ws = slicer.createWriteStream({start: 0, end: 1000}); ws.on('error', function(err) { assert.strictEqual(err.code, 'ETOOBIG'); slicer.on('close', done); }); ws.end(new Buffer(1001)); }); }); it("write stream does not emit error when max size not exceeded", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var ws = slicer.createWriteStream({end: 1000}); slicer.on('close', done); ws.end(new Buffer(1000)); }); }); it("write stream start and end work together", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var ws = slicer.createWriteStream({start: 1, end: 1000}); ws.on('error', function(err) { assert.strictEqual(err.code, 'ETOOBIG'); slicer.on('close', done); }); ws.end(new Buffer(1000)); }); }); it("write stream emits progress events", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var ws = slicer.createWriteStream(); var progressEventCount = 0; var prevBytesWritten = 0; ws.on('progress', function() { progressEventCount += 1; assert.ok(ws.bytesWritten > prevBytesWritten); prevBytesWritten = ws.bytesWritten; }); slicer.on('close', function() { assert.ok(progressEventCount > 5); done(); }); for (var i = 0; i < 10; i += 1) { ws.write(new Buffer(16 * 1024 * 2)); } ws.end(); }); }); it("write stream unrefs when destroyed", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var ws = slicer.createWriteStream(); slicer.on('close', done); ws.write(new Buffer(1000)); ws.destroy(); }); }); it("read stream unrefs when destroyed", function(done) { fs.open(testBlobFile, 'r', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd, {autoClose: true}); var rs = slicer.createReadStream(); rs.on('error', function(err) { assert.strictEqual(err.message, "stream destroyed"); slicer.on('close', done); }); rs.destroy(); }); }); it("fdSlicer.read", function(done) { fs.open(testBlobFile, 'r', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd); var outBuf = new Buffer(1024); slicer.read(outBuf, 0, 10, 0, function(err, bytesRead, buf) { assert.strictEqual(bytesRead, 10); fs.close(fd, done); }); }); }); it("fdSlicer.write", function(done) { fs.open(testOutBlobFile, 'w', function(err, fd) { if (err) return done(err); var slicer = fdSlicer.createFromFd(fd); slicer.write(new Buffer("blah\n"), 0, 5, 0, function() { if (err) return done(err); fs.close(fd, done); }); }); }); }); describe("BufferSlicer", function() { it("invalid ref", function() { var slicer = fdSlicer.createFromBuffer(new Buffer(16)); slicer.ref(); slicer.unref(); assert.throws(function() { slicer.unref(); }, /invalid unref/); }); it("read and write", function(done) { var buf = new Buffer("through the tangled thread the needle finds its way"); var slicer = fdSlicer.createFromBuffer(buf); var outBuf = new Buffer(1024); slicer.read(outBuf, 10, 11, 8, function(err) { if (err) return done(err); assert.strictEqual(outBuf.toString('utf8', 10, 21), "the tangled"); slicer.write(new Buffer("derp"), 0, 4, 7, function(err) { if (err) return done(err); assert.strictEqual(buf.toString('utf8', 7, 19), "derp tangled"); done(); }); }); }); it("createReadStream", function(done) { var str = "I never conquered rarely came, 16 just held such better days"; var buf = new Buffer(str); var slicer = fdSlicer.createFromBuffer(buf); var inStream = slicer.createReadStream(); var sink = new StreamSink(); inStream.pipe(sink); sink.on('finish', function() { assert.strictEqual(sink.toString(), str); inStream.destroy(); done(); }); }); it("createWriteStream exceed buffer size", function(done) { var slicer = fdSlicer.createFromBuffer(new Buffer(4)); var outStream = slicer.createWriteStream(); outStream.on('error', function(err) { assert.strictEqual(err.code, 'ETOOBIG'); done(); }); outStream.write("hi!\n"); outStream.write("it warked\n"); outStream.end(); }); it("createWriteStream ok", function(done) { var buf = new Buffer(1024); var slicer = fdSlicer.createFromBuffer(buf); var outStream = slicer.createWriteStream(); outStream.on('finish', function() { assert.strictEqual(buf.toString('utf8', 0, "hi!\nit warked\n".length), "hi!\nit warked\n"); outStream.destroy(); done(); }); outStream.write("hi!\n"); outStream.write("it warked\n"); outStream.end(); }); }); ```
/content/code_sandbox/node_modules/fd-slicer/test/test.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
3,176
```javascript 'use strict'; var hasOwn = Object.prototype.hasOwnProperty; var toStr = Object.prototype.toString; var defineProperty = Object.defineProperty; var gOPD = Object.getOwnPropertyDescriptor; var isArray = function isArray(arr) { if (typeof Array.isArray === 'function') { return Array.isArray(arr); } return toStr.call(arr) === '[object Array]'; }; var isPlainObject = function isPlainObject(obj) { if (!obj || toStr.call(obj) !== '[object Object]') { return false; } var hasOwnConstructor = hasOwn.call(obj, 'constructor'); var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); // Not own constructor property must be Object if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { return false; } // Own properties are enumerated firstly, so to speed up, // if last one is own, then all properties are own. var key; for (key in obj) { /**/ } return typeof key === 'undefined' || hasOwn.call(obj, key); }; // If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target var setProperty = function setProperty(target, options) { if (defineProperty && options.name === '__proto__') { defineProperty(target, options.name, { enumerable: true, configurable: true, value: options.newValue, writable: true }); } else { target[options.name] = options.newValue; } }; // Return undefined instead of __proto__ if '__proto__' is not an own property var getProperty = function getProperty(obj, name) { if (name === '__proto__') { if (!hasOwn.call(obj, name)) { return void 0; } else if (gOPD) { // In early versions of node, obj['__proto__'] is buggy when obj has // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. return gOPD(obj, name).value; } } return obj[name]; }; module.exports = function extend() { var options, name, src, copy, copyIsArray, clone; var target = arguments[0]; var i = 1; var length = arguments.length; var deep = false; // Handle a deep copy situation if (typeof target === 'boolean') { deep = target; target = arguments[1] || {}; // skip the boolean and the target i = 2; } if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { target = {}; } for (; i < length; ++i) { options = arguments[i]; // Only deal with non-null/undefined values if (options != null) { // Extend the base object for (name in options) { src = getProperty(target, name); copy = getProperty(options, name); // Prevent never-ending loop if (target !== copy) { // Recurse if we're merging plain objects or arrays if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { if (copyIsArray) { copyIsArray = false; clone = src && isArray(src) ? src : []; } else { clone = src && isPlainObject(src) ? src : {}; } // Never move original objects, clone them setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); // Don't bring in undefined values } else if (typeof copy !== 'undefined') { setProperty(target, { name: name, newValue: copy }); } } } } } // Return the modified object return target; }; ```
/content/code_sandbox/node_modules/extend/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
848
```javascript module.exports = Certificate; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var algs = require('./algs'); var crypto = require('crypto'); var Fingerprint = require('./fingerprint'); var Signature = require('./signature'); var errs = require('./errors'); var util = require('util'); var utils = require('./utils'); var Key = require('./key'); var PrivateKey = require('./private-key'); var Identity = require('./identity'); var formats = {}; formats['openssh'] = require('./formats/openssh-cert'); formats['x509'] = require('./formats/x509'); formats['pem'] = require('./formats/x509-pem'); var CertificateParseError = errs.CertificateParseError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; function Certificate(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.subjects, 'options.subjects'); utils.assertCompatible(opts.subjects[0], Identity, [1, 0], 'options.subjects'); utils.assertCompatible(opts.subjectKey, Key, [1, 0], 'options.subjectKey'); utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); if (opts.issuerKey !== undefined) { utils.assertCompatible(opts.issuerKey, Key, [1, 0], 'options.issuerKey'); } assert.object(opts.signatures, 'options.signatures'); assert.buffer(opts.serial, 'options.serial'); assert.date(opts.validFrom, 'options.validFrom'); assert.date(opts.validUntil, 'optons.validUntil'); assert.optionalArrayOfString(opts.purposes, 'options.purposes'); this._hashCache = {}; this.subjects = opts.subjects; this.issuer = opts.issuer; this.subjectKey = opts.subjectKey; this.issuerKey = opts.issuerKey; this.signatures = opts.signatures; this.serial = opts.serial; this.validFrom = opts.validFrom; this.validUntil = opts.validUntil; this.purposes = opts.purposes; } Certificate.formats = formats; Certificate.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'x509'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); return (formats[format].write(this, options)); }; Certificate.prototype.toString = function (format, options) { if (format === undefined) format = 'pem'; return (this.toBuffer(format, options).toString()); }; Certificate.prototype.fingerprint = function (algo) { if (algo === undefined) algo = 'sha256'; assert.string(algo, 'algorithm'); var opts = { type: 'certificate', hash: this.hash(algo), algorithm: algo }; return (new Fingerprint(opts)); }; Certificate.prototype.hash = function (algo) { assert.string(algo, 'algorithm'); algo = algo.toLowerCase(); if (algs.hashAlgs[algo] === undefined) throw (new InvalidAlgorithmError(algo)); if (this._hashCache[algo]) return (this._hashCache[algo]); var hash = crypto.createHash(algo). update(this.toBuffer('x509')).digest(); this._hashCache[algo] = hash; return (hash); }; Certificate.prototype.isExpired = function (when) { if (when === undefined) when = new Date(); return (!((when.getTime() >= this.validFrom.getTime()) && (when.getTime() < this.validUntil.getTime()))); }; Certificate.prototype.isSignedBy = function (issuerCert) { utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); if (!this.issuer.equals(issuerCert.subjects[0])) return (false); if (this.issuer.purposes && this.issuer.purposes.length > 0 && this.issuer.purposes.indexOf('ca') === -1) { return (false); } return (this.isSignedByKey(issuerCert.subjectKey)); }; Certificate.prototype.getExtension = function (keyOrOid) { assert.string(keyOrOid, 'keyOrOid'); var ext = this.getExtensions().filter(function (maybeExt) { if (maybeExt.format === 'x509') return (maybeExt.oid === keyOrOid); if (maybeExt.format === 'openssh') return (maybeExt.name === keyOrOid); return (false); })[0]; return (ext); }; Certificate.prototype.getExtensions = function () { var exts = []; var x509 = this.signatures.x509; if (x509 && x509.extras && x509.extras.exts) { x509.extras.exts.forEach(function (ext) { ext.format = 'x509'; exts.push(ext); }); } var openssh = this.signatures.openssh; if (openssh && openssh.exts) { openssh.exts.forEach(function (ext) { ext.format = 'openssh'; exts.push(ext); }); } return (exts); }; Certificate.prototype.isSignedByKey = function (issuerKey) { utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); if (this.issuerKey !== undefined) { return (this.issuerKey. fingerprint('sha512').matches(issuerKey)); } var fmt = Object.keys(this.signatures)[0]; var valid = formats[fmt].verify(this, issuerKey); if (valid) this.issuerKey = issuerKey; return (valid); }; Certificate.prototype.signWith = function (key) { utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); var fmts = Object.keys(formats); var didOne = false; for (var i = 0; i < fmts.length; ++i) { if (fmts[i] !== 'pem') { var ret = formats[fmts[i]].sign(this, key); if (ret === true) didOne = true; } } if (!didOne) { throw (new Error('Failed to sign the certificate for any ' + 'available certificate formats')); } }; Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { var subjects; if (Array.isArray(subjectOrSubjects)) subjects = subjectOrSubjects; else subjects = [subjectOrSubjects]; assert.arrayOfObject(subjects); subjects.forEach(function (subject) { utils.assertCompatible(subject, Identity, [1, 0], 'subject'); }); utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalObject(options.validFrom, 'options.validFrom'); assert.optionalObject(options.validUntil, 'options.validUntil'); var validFrom = options.validFrom; var validUntil = options.validUntil; if (validFrom === undefined) validFrom = new Date(); if (validUntil === undefined) { assert.optionalNumber(options.lifetime, 'options.lifetime'); var lifetime = options.lifetime; if (lifetime === undefined) lifetime = 10*365*24*3600; validUntil = new Date(); validUntil.setTime(validUntil.getTime() + lifetime*1000); } assert.optionalBuffer(options.serial, 'options.serial'); var serial = options.serial; if (serial === undefined) serial = Buffer.from('0000000000000001', 'hex'); var purposes = options.purposes; if (purposes === undefined) purposes = []; if (purposes.indexOf('signature') === -1) purposes.push('signature'); /* Self-signed certs are always CAs. */ if (purposes.indexOf('ca') === -1) purposes.push('ca'); if (purposes.indexOf('crl') === -1) purposes.push('crl'); /* * If we weren't explicitly given any other purposes, do the sensible * thing and add some basic ones depending on the subject type. */ if (purposes.length <= 3) { var hostSubjects = subjects.filter(function (subject) { return (subject.type === 'host'); }); var userSubjects = subjects.filter(function (subject) { return (subject.type === 'user'); }); if (hostSubjects.length > 0) { if (purposes.indexOf('serverAuth') === -1) purposes.push('serverAuth'); } if (userSubjects.length > 0) { if (purposes.indexOf('clientAuth') === -1) purposes.push('clientAuth'); } if (userSubjects.length > 0 || hostSubjects.length > 0) { if (purposes.indexOf('keyAgreement') === -1) purposes.push('keyAgreement'); if (key.type === 'rsa' && purposes.indexOf('encryption') === -1) purposes.push('encryption'); } } var cert = new Certificate({ subjects: subjects, issuer: subjects[0], subjectKey: key.toPublic(), issuerKey: key.toPublic(), signatures: {}, serial: serial, validFrom: validFrom, validUntil: validUntil, purposes: purposes }); cert.signWith(key); return (cert); }; Certificate.create = function (subjectOrSubjects, key, issuer, issuerKey, options) { var subjects; if (Array.isArray(subjectOrSubjects)) subjects = subjectOrSubjects; else subjects = [subjectOrSubjects]; assert.arrayOfObject(subjects); subjects.forEach(function (subject) { utils.assertCompatible(subject, Identity, [1, 0], 'subject'); }); utils.assertCompatible(key, Key, [1, 0], 'key'); if (PrivateKey.isPrivateKey(key)) key = key.toPublic(); utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalObject(options.validFrom, 'options.validFrom'); assert.optionalObject(options.validUntil, 'options.validUntil'); var validFrom = options.validFrom; var validUntil = options.validUntil; if (validFrom === undefined) validFrom = new Date(); if (validUntil === undefined) { assert.optionalNumber(options.lifetime, 'options.lifetime'); var lifetime = options.lifetime; if (lifetime === undefined) lifetime = 10*365*24*3600; validUntil = new Date(); validUntil.setTime(validUntil.getTime() + lifetime*1000); } assert.optionalBuffer(options.serial, 'options.serial'); var serial = options.serial; if (serial === undefined) serial = Buffer.from('0000000000000001', 'hex'); var purposes = options.purposes; if (purposes === undefined) purposes = []; if (purposes.indexOf('signature') === -1) purposes.push('signature'); if (options.ca === true) { if (purposes.indexOf('ca') === -1) purposes.push('ca'); if (purposes.indexOf('crl') === -1) purposes.push('crl'); } var hostSubjects = subjects.filter(function (subject) { return (subject.type === 'host'); }); var userSubjects = subjects.filter(function (subject) { return (subject.type === 'user'); }); if (hostSubjects.length > 0) { if (purposes.indexOf('serverAuth') === -1) purposes.push('serverAuth'); } if (userSubjects.length > 0) { if (purposes.indexOf('clientAuth') === -1) purposes.push('clientAuth'); } if (userSubjects.length > 0 || hostSubjects.length > 0) { if (purposes.indexOf('keyAgreement') === -1) purposes.push('keyAgreement'); if (key.type === 'rsa' && purposes.indexOf('encryption') === -1) purposes.push('encryption'); } var cert = new Certificate({ subjects: subjects, issuer: issuer, subjectKey: key, issuerKey: issuerKey.toPublic(), signatures: {}, serial: serial, validFrom: validFrom, validUntil: validUntil, purposes: purposes }); cert.signWith(issuerKey); return (cert); }; Certificate.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); return (k); } catch (e) { throw (new CertificateParseError(options.filename, format, e)); } }; Certificate.isCertificate = function (obj, ver) { return (utils.isCompatible(obj, Certificate, ver)); }; /* * API versions for Certificate: * [1,0] -- initial ver * [1,1] -- openssh format now unpacks extensions */ Certificate.prototype._sshpkApiVersion = [1, 1]; Certificate._oldVersionDetect = function (obj) { return ([1, 0]); }; ```
/content/code_sandbox/node_modules/sshpk/lib/certificate.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,993
```javascript var assert = require('assert-plus'); var util = require('util'); function FingerprintFormatError(fp, format) { if (Error.captureStackTrace) Error.captureStackTrace(this, FingerprintFormatError); this.name = 'FingerprintFormatError'; this.fingerprint = fp; this.format = format; this.message = 'Fingerprint format is not supported, or is invalid: '; if (fp !== undefined) this.message += ' fingerprint = ' + fp; if (format !== undefined) this.message += ' format = ' + format; } util.inherits(FingerprintFormatError, Error); function InvalidAlgorithmError(alg) { if (Error.captureStackTrace) Error.captureStackTrace(this, InvalidAlgorithmError); this.name = 'InvalidAlgorithmError'; this.algorithm = alg; this.message = 'Algorithm "' + alg + '" is not supported'; } util.inherits(InvalidAlgorithmError, Error); function KeyParseError(name, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, KeyParseError); this.name = 'KeyParseError'; this.format = format; this.keyName = name; this.innerErr = innerErr; this.message = 'Failed to parse ' + name + ' as a valid ' + format + ' format key: ' + innerErr.message; } util.inherits(KeyParseError, Error); function SignatureParseError(type, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, SignatureParseError); this.name = 'SignatureParseError'; this.type = type; this.format = format; this.innerErr = innerErr; this.message = 'Failed to parse the given data as a ' + type + ' signature in ' + format + ' format: ' + innerErr.message; } util.inherits(SignatureParseError, Error); function CertificateParseError(name, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, CertificateParseError); this.name = 'CertificateParseError'; this.format = format; this.certName = name; this.innerErr = innerErr; this.message = 'Failed to parse ' + name + ' as a valid ' + format + ' format certificate: ' + innerErr.message; } util.inherits(CertificateParseError, Error); function KeyEncryptedError(name, format) { if (Error.captureStackTrace) Error.captureStackTrace(this, KeyEncryptedError); this.name = 'KeyEncryptedError'; this.format = format; this.keyName = name; this.message = 'The ' + format + ' format key ' + name + ' is ' + 'encrypted (password-protected), and no passphrase was ' + 'provided in `options`'; } util.inherits(KeyEncryptedError, Error); module.exports = { FingerprintFormatError: FingerprintFormatError, InvalidAlgorithmError: InvalidAlgorithmError, KeyParseError: KeyParseError, SignatureParseError: SignatureParseError, KeyEncryptedError: KeyEncryptedError, CertificateParseError: CertificateParseError }; ```
/content/code_sandbox/node_modules/sshpk/lib/errors.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
634
```javascript /*global setImmediate: false, setTimeout: false, console: false */ (function () { var async = {}; // global on the server, window in the browser var root, previous_async; root = this; if (root != null) { previous_async = root.async; } async.noConflict = function () { root.async = previous_async; return async; }; function only_once(fn) { var called = false; return function() { if (called) throw new Error("Callback was already called."); called = true; fn.apply(root, arguments); } } //// cross-browser compatiblity functions //// var _each = function (arr, iterator) { if (arr.forEach) { return arr.forEach(iterator); } for (var i = 0; i < arr.length; i += 1) { iterator(arr[i], i, arr); } }; var _map = function (arr, iterator) { if (arr.map) { return arr.map(iterator); } var results = []; _each(arr, function (x, i, a) { results.push(iterator(x, i, a)); }); return results; }; var _reduce = function (arr, iterator, memo) { if (arr.reduce) { return arr.reduce(iterator, memo); } _each(arr, function (x, i, a) { memo = iterator(memo, x, i, a); }); return memo; }; var _keys = function (obj) { if (Object.keys) { return Object.keys(obj); } var keys = []; for (var k in obj) { if (obj.hasOwnProperty(k)) { keys.push(k); } } return keys; }; //// exported async module functions //// //// nextTick implementation with browser-compatible fallback //// if (typeof process === 'undefined' || !(process.nextTick)) { if (typeof setImmediate === 'function') { async.nextTick = function (fn) { // not a direct alias for IE10 compatibility setImmediate(fn); }; async.setImmediate = async.nextTick; } else { async.nextTick = function (fn) { setTimeout(fn, 0); }; async.setImmediate = async.nextTick; } } else { async.nextTick = process.nextTick; if (typeof setImmediate !== 'undefined') { async.setImmediate = function (fn) { // not a direct alias for IE10 compatibility setImmediate(fn); }; } else { async.setImmediate = async.nextTick; } } async.each = function (arr, iterator, callback) { callback = callback || function () {}; if (!arr.length) { return callback(); } var completed = 0; _each(arr, function (x) { iterator(x, only_once(function (err) { if (err) { callback(err); callback = function () {}; } else { completed += 1; if (completed >= arr.length) { callback(null); } } })); }); }; async.forEach = async.each; async.eachSeries = function (arr, iterator, callback) { callback = callback || function () {}; if (!arr.length) { return callback(); } var completed = 0; var iterate = function () { iterator(arr[completed], function (err) { if (err) { callback(err); callback = function () {}; } else { completed += 1; if (completed >= arr.length) { callback(null); } else { iterate(); } } }); }; iterate(); }; async.forEachSeries = async.eachSeries; async.eachLimit = function (arr, limit, iterator, callback) { var fn = _eachLimit(limit); fn.apply(null, [arr, iterator, callback]); }; async.forEachLimit = async.eachLimit; var _eachLimit = function (limit) { return function (arr, iterator, callback) { callback = callback || function () {}; if (!arr.length || limit <= 0) { return callback(); } var completed = 0; var started = 0; var running = 0; (function replenish () { if (completed >= arr.length) { return callback(); } while (running < limit && started < arr.length) { started += 1; running += 1; iterator(arr[started - 1], function (err) { if (err) { callback(err); callback = function () {}; } else { completed += 1; running -= 1; if (completed >= arr.length) { callback(); } else { replenish(); } } }); } })(); }; }; var doParallel = function (fn) { return function () { var args = Array.prototype.slice.call(arguments); return fn.apply(null, [async.each].concat(args)); }; }; var doParallelLimit = function(limit, fn) { return function () { var args = Array.prototype.slice.call(arguments); return fn.apply(null, [_eachLimit(limit)].concat(args)); }; }; var doSeries = function (fn) { return function () { var args = Array.prototype.slice.call(arguments); return fn.apply(null, [async.eachSeries].concat(args)); }; }; var _asyncMap = function (eachfn, arr, iterator, callback) { var results = []; arr = _map(arr, function (x, i) { return {index: i, value: x}; }); eachfn(arr, function (x, callback) { iterator(x.value, function (err, v) { results[x.index] = v; callback(err); }); }, function (err) { callback(err, results); }); }; async.map = doParallel(_asyncMap); async.mapSeries = doSeries(_asyncMap); async.mapLimit = function (arr, limit, iterator, callback) { return _mapLimit(limit)(arr, iterator, callback); }; var _mapLimit = function(limit) { return doParallelLimit(limit, _asyncMap); }; // reduce only has a series version, as doing reduce in parallel won't // work in many situations. async.reduce = function (arr, memo, iterator, callback) { async.eachSeries(arr, function (x, callback) { iterator(memo, x, function (err, v) { memo = v; callback(err); }); }, function (err) { callback(err, memo); }); }; // inject alias async.inject = async.reduce; // foldl alias async.foldl = async.reduce; async.reduceRight = function (arr, memo, iterator, callback) { var reversed = _map(arr, function (x) { return x; }).reverse(); async.reduce(reversed, memo, iterator, callback); }; // foldr alias async.foldr = async.reduceRight; var _filter = function (eachfn, arr, iterator, callback) { var results = []; arr = _map(arr, function (x, i) { return {index: i, value: x}; }); eachfn(arr, function (x, callback) { iterator(x.value, function (v) { if (v) { results.push(x); } callback(); }); }, function (err) { callback(_map(results.sort(function (a, b) { return a.index - b.index; }), function (x) { return x.value; })); }); }; async.filter = doParallel(_filter); async.filterSeries = doSeries(_filter); // select alias async.select = async.filter; async.selectSeries = async.filterSeries; var _reject = function (eachfn, arr, iterator, callback) { var results = []; arr = _map(arr, function (x, i) { return {index: i, value: x}; }); eachfn(arr, function (x, callback) { iterator(x.value, function (v) { if (!v) { results.push(x); } callback(); }); }, function (err) { callback(_map(results.sort(function (a, b) { return a.index - b.index; }), function (x) { return x.value; })); }); }; async.reject = doParallel(_reject); async.rejectSeries = doSeries(_reject); var _detect = function (eachfn, arr, iterator, main_callback) { eachfn(arr, function (x, callback) { iterator(x, function (result) { if (result) { main_callback(x); main_callback = function () {}; } else { callback(); } }); }, function (err) { main_callback(); }); }; async.detect = doParallel(_detect); async.detectSeries = doSeries(_detect); async.some = function (arr, iterator, main_callback) { async.each(arr, function (x, callback) { iterator(x, function (v) { if (v) { main_callback(true); main_callback = function () {}; } callback(); }); }, function (err) { main_callback(false); }); }; // any alias async.any = async.some; async.every = function (arr, iterator, main_callback) { async.each(arr, function (x, callback) { iterator(x, function (v) { if (!v) { main_callback(false); main_callback = function () {}; } callback(); }); }, function (err) { main_callback(true); }); }; // all alias async.all = async.every; async.sortBy = function (arr, iterator, callback) { async.map(arr, function (x, callback) { iterator(x, function (err, criteria) { if (err) { callback(err); } else { callback(null, {value: x, criteria: criteria}); } }); }, function (err, results) { if (err) { return callback(err); } else { var fn = function (left, right) { var a = left.criteria, b = right.criteria; return a < b ? -1 : a > b ? 1 : 0; }; callback(null, _map(results.sort(fn), function (x) { return x.value; })); } }); }; async.auto = function (tasks, callback) { callback = callback || function () {}; var keys = _keys(tasks); if (!keys.length) { return callback(null); } var results = {}; var listeners = []; var addListener = function (fn) { listeners.unshift(fn); }; var removeListener = function (fn) { for (var i = 0; i < listeners.length; i += 1) { if (listeners[i] === fn) { listeners.splice(i, 1); return; } } }; var taskComplete = function () { _each(listeners.slice(0), function (fn) { fn(); }); }; addListener(function () { if (_keys(results).length === keys.length) { callback(null, results); callback = function () {}; } }); _each(keys, function (k) { var task = (tasks[k] instanceof Function) ? [tasks[k]]: tasks[k]; var taskCallback = function (err) { var args = Array.prototype.slice.call(arguments, 1); if (args.length <= 1) { args = args[0]; } if (err) { var safeResults = {}; _each(_keys(results), function(rkey) { safeResults[rkey] = results[rkey]; }); safeResults[k] = args; callback(err, safeResults); // stop subsequent errors hitting callback multiple times callback = function () {}; } else { results[k] = args; async.setImmediate(taskComplete); } }; var requires = task.slice(0, Math.abs(task.length - 1)) || []; var ready = function () { return _reduce(requires, function (a, x) { return (a && results.hasOwnProperty(x)); }, true) && !results.hasOwnProperty(k); }; if (ready()) { task[task.length - 1](taskCallback, results); } else { var listener = function () { if (ready()) { removeListener(listener); task[task.length - 1](taskCallback, results); } }; addListener(listener); } }); }; async.waterfall = function (tasks, callback) { callback = callback || function () {}; if (tasks.constructor !== Array) { var err = new Error('First argument to waterfall must be an array of functions'); return callback(err); } if (!tasks.length) { return callback(); } var wrapIterator = function (iterator) { return function (err) { if (err) { callback.apply(null, arguments); callback = function () {}; } else { var args = Array.prototype.slice.call(arguments, 1); var next = iterator.next(); if (next) { args.push(wrapIterator(next)); } else { args.push(callback); } async.setImmediate(function () { iterator.apply(null, args); }); } }; }; wrapIterator(async.iterator(tasks))(); }; var _parallel = function(eachfn, tasks, callback) { callback = callback || function () {}; if (tasks.constructor === Array) { eachfn.map(tasks, function (fn, callback) { if (fn) { fn(function (err) { var args = Array.prototype.slice.call(arguments, 1); if (args.length <= 1) { args = args[0]; } callback.call(null, err, args); }); } }, callback); } else { var results = {}; eachfn.each(_keys(tasks), function (k, callback) { tasks[k](function (err) { var args = Array.prototype.slice.call(arguments, 1); if (args.length <= 1) { args = args[0]; } results[k] = args; callback(err); }); }, function (err) { callback(err, results); }); } }; async.parallel = function (tasks, callback) { _parallel({ map: async.map, each: async.each }, tasks, callback); }; async.parallelLimit = function(tasks, limit, callback) { _parallel({ map: _mapLimit(limit), each: _eachLimit(limit) }, tasks, callback); }; async.series = function (tasks, callback) { callback = callback || function () {}; if (tasks.constructor === Array) { async.mapSeries(tasks, function (fn, callback) { if (fn) { fn(function (err) { var args = Array.prototype.slice.call(arguments, 1); if (args.length <= 1) { args = args[0]; } callback.call(null, err, args); }); } }, callback); } else { var results = {}; async.eachSeries(_keys(tasks), function (k, callback) { tasks[k](function (err) { var args = Array.prototype.slice.call(arguments, 1); if (args.length <= 1) { args = args[0]; } results[k] = args; callback(err); }); }, function (err) { callback(err, results); }); } }; async.iterator = function (tasks) { var makeCallback = function (index) { var fn = function () { if (tasks.length) { tasks[index].apply(null, arguments); } return fn.next(); }; fn.next = function () { return (index < tasks.length - 1) ? makeCallback(index + 1): null; }; return fn; }; return makeCallback(0); }; async.apply = function (fn) { var args = Array.prototype.slice.call(arguments, 1); return function () { return fn.apply( null, args.concat(Array.prototype.slice.call(arguments)) ); }; }; var _concat = function (eachfn, arr, fn, callback) { var r = []; eachfn(arr, function (x, cb) { fn(x, function (err, y) { r = r.concat(y || []); cb(err); }); }, function (err) { callback(err, r); }); }; async.concat = doParallel(_concat); async.concatSeries = doSeries(_concat); async.whilst = function (test, iterator, callback) { if (test()) { iterator(function (err) { if (err) { return callback(err); } async.whilst(test, iterator, callback); }); } else { callback(); } }; async.doWhilst = function (iterator, test, callback) { iterator(function (err) { if (err) { return callback(err); } if (test()) { async.doWhilst(iterator, test, callback); } else { callback(); } }); }; async.until = function (test, iterator, callback) { if (!test()) { iterator(function (err) { if (err) { return callback(err); } async.until(test, iterator, callback); }); } else { callback(); } }; async.doUntil = function (iterator, test, callback) { iterator(function (err) { if (err) { return callback(err); } if (!test()) { async.doUntil(iterator, test, callback); } else { callback(); } }); }; async.queue = function (worker, concurrency) { if (concurrency === undefined) { concurrency = 1; } function _insert(q, data, pos, callback) { if(data.constructor !== Array) { data = [data]; } _each(data, function(task) { var item = { data: task, callback: typeof callback === 'function' ? callback : null }; if (pos) { q.tasks.unshift(item); } else { q.tasks.push(item); } if (q.saturated && q.tasks.length === concurrency) { q.saturated(); } async.setImmediate(q.process); }); } var workers = 0; var q = { tasks: [], concurrency: concurrency, saturated: null, empty: null, drain: null, push: function (data, callback) { _insert(q, data, false, callback); }, unshift: function (data, callback) { _insert(q, data, true, callback); }, process: function () { if (workers < q.concurrency && q.tasks.length) { var task = q.tasks.shift(); if (q.empty && q.tasks.length === 0) { q.empty(); } workers += 1; var next = function () { workers -= 1; if (task.callback) { task.callback.apply(task, arguments); } if (q.drain && q.tasks.length + workers === 0) { q.drain(); } q.process(); }; var cb = only_once(next); worker(task.data, cb); } }, length: function () { return q.tasks.length; }, running: function () { return workers; } }; return q; }; async.cargo = function (worker, payload) { var working = false, tasks = []; var cargo = { tasks: tasks, payload: payload, saturated: null, empty: null, drain: null, push: function (data, callback) { if(data.constructor !== Array) { data = [data]; } _each(data, function(task) { tasks.push({ data: task, callback: typeof callback === 'function' ? callback : null }); if (cargo.saturated && tasks.length === payload) { cargo.saturated(); } }); async.setImmediate(cargo.process); }, process: function process() { if (working) return; if (tasks.length === 0) { if(cargo.drain) cargo.drain(); return; } var ts = typeof payload === 'number' ? tasks.splice(0, payload) : tasks.splice(0); var ds = _map(ts, function (task) { return task.data; }); if(cargo.empty) cargo.empty(); working = true; worker(ds, function () { working = false; var args = arguments; _each(ts, function (data) { if (data.callback) { data.callback.apply(null, args); } }); process(); }); }, length: function () { return tasks.length; }, running: function () { return working; } }; return cargo; }; var _console_fn = function (name) { return function (fn) { var args = Array.prototype.slice.call(arguments, 1); fn.apply(null, args.concat([function (err) { var args = Array.prototype.slice.call(arguments, 1); if (typeof console !== 'undefined') { if (err) { if (console.error) { console.error(err); } } else if (console[name]) { _each(args, function (x) { console[name](x); }); } } }])); }; }; async.log = _console_fn('log'); async.dir = _console_fn('dir'); /*async.info = _console_fn('info'); async.warn = _console_fn('warn'); async.error = _console_fn('error');*/ async.memoize = function (fn, hasher) { var memo = {}; var queues = {}; hasher = hasher || function (x) { return x; }; var memoized = function () { var args = Array.prototype.slice.call(arguments); var callback = args.pop(); var key = hasher.apply(null, args); if (key in memo) { callback.apply(null, memo[key]); } else if (key in queues) { queues[key].push(callback); } else { queues[key] = [callback]; fn.apply(null, args.concat([function () { memo[key] = arguments; var q = queues[key]; delete queues[key]; for (var i = 0, l = q.length; i < l; i++) { q[i].apply(null, arguments); } }])); } }; memoized.memo = memo; memoized.unmemoized = fn; return memoized; }; async.unmemoize = function (fn) { return function () { return (fn.unmemoized || fn).apply(null, arguments); }; }; async.times = function (count, iterator, callback) { var counter = []; for (var i = 0; i < count; i++) { counter.push(i); } return async.map(counter, iterator, callback); }; async.timesSeries = function (count, iterator, callback) { var counter = []; for (var i = 0; i < count; i++) { counter.push(i); } return async.mapSeries(counter, iterator, callback); }; async.compose = function (/* functions... */) { var fns = Array.prototype.reverse.call(arguments); return function () { var that = this; var args = Array.prototype.slice.call(arguments); var callback = args.pop(); async.reduce(fns, args, function (newargs, fn, cb) { fn.apply(that, newargs.concat([function () { var err = arguments[0]; var nextargs = Array.prototype.slice.call(arguments, 1); cb(err, nextargs); }])) }, function (err, results) { callback.apply(that, [err].concat(results)); }); }; }; var _applyEach = function (eachfn, fns /*args...*/) { var go = function () { var that = this; var args = Array.prototype.slice.call(arguments); var callback = args.pop(); return eachfn(fns, function (fn, cb) { fn.apply(that, args.concat([cb])); }, callback); }; if (arguments.length > 2) { var args = Array.prototype.slice.call(arguments, 2); return go.apply(this, args); } else { return go; } }; async.applyEach = doParallel(_applyEach); async.applyEachSeries = doSeries(_applyEach); async.forever = function (fn, callback) { function next(err) { if (err) { if (callback) { return callback(err); } throw err; } fn(next); } next(); }; // AMD / RequireJS if (typeof define !== 'undefined' && define.amd) { define([], function () { return async; }); } // Node.js else if (typeof module !== 'undefined' && module.exports) { module.exports = async; } // included directly via <script> tag else { root.async = async; } }()); ```
/content/code_sandbox/node_modules/async/lib/async.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
5,678
```javascript module.exports = Key; var assert = require('assert-plus'); var algs = require('./algs'); var crypto = require('crypto'); var Fingerprint = require('./fingerprint'); var Signature = require('./signature'); var DiffieHellman = require('./dhe').DiffieHellman; var errs = require('./errors'); var utils = require('./utils'); var PrivateKey = require('./private-key'); var edCompat; try { edCompat = require('./ed-compat'); } catch (e) { /* Just continue through, and bail out if we try to use it. */ } var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var formats = {}; formats['auto'] = require('./formats/auto'); formats['pem'] = require('./formats/pem'); formats['pkcs1'] = require('./formats/pkcs1'); formats['pkcs8'] = require('./formats/pkcs8'); formats['rfc4253'] = require('./formats/rfc4253'); formats['ssh'] = require('./formats/ssh'); formats['ssh-private'] = require('./formats/ssh-private'); formats['openssh'] = formats['ssh-private']; formats['dnssec'] = require('./formats/dnssec'); formats['putty'] = require('./formats/putty'); formats['ppk'] = formats['putty']; function Key(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.parts, 'options.parts'); assert.string(opts.type, 'options.type'); assert.optionalString(opts.comment, 'options.comment'); var algInfo = algs.info[opts.type]; if (typeof (algInfo) !== 'object') throw (new InvalidAlgorithmError(opts.type)); var partLookup = {}; for (var i = 0; i < opts.parts.length; ++i) { var part = opts.parts[i]; partLookup[part.name] = part; } this.type = opts.type; this.parts = opts.parts; this.part = partLookup; this.comment = undefined; this.source = opts.source; /* for speeding up hashing/fingerprint operations */ this._rfc4253Cache = opts._rfc4253Cache; this._hashCache = {}; var sz; this.curve = undefined; if (this.type === 'ecdsa') { var curve = this.part.curve.data.toString(); this.curve = curve; sz = algs.curves[curve].size; } else if (this.type === 'ed25519' || this.type === 'curve25519') { sz = 256; this.curve = 'curve25519'; } else { var szPart = this.part[algInfo.sizePart]; sz = szPart.data.length; sz = sz * 8 - utils.countZeros(szPart.data); } this.size = sz; } Key.formats = formats; Key.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'ssh'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); if (format === 'rfc4253') { if (this._rfc4253Cache === undefined) this._rfc4253Cache = formats['rfc4253'].write(this); return (this._rfc4253Cache); } return (formats[format].write(this, options)); }; Key.prototype.toString = function (format, options) { return (this.toBuffer(format, options).toString()); }; Key.prototype.hash = function (algo, type) { assert.string(algo, 'algorithm'); assert.optionalString(type, 'type'); if (type === undefined) type = 'ssh'; algo = algo.toLowerCase(); if (algs.hashAlgs[algo] === undefined) throw (new InvalidAlgorithmError(algo)); var cacheKey = algo + '||' + type; if (this._hashCache[cacheKey]) return (this._hashCache[cacheKey]); var buf; if (type === 'ssh') { buf = this.toBuffer('rfc4253'); } else if (type === 'spki') { buf = formats.pkcs8.pkcs8ToBuffer(this); } else { throw (new Error('Hash type ' + type + ' not supported')); } var hash = crypto.createHash(algo).update(buf).digest(); this._hashCache[cacheKey] = hash; return (hash); }; Key.prototype.fingerprint = function (algo, type) { if (algo === undefined) algo = 'sha256'; if (type === undefined) type = 'ssh'; assert.string(algo, 'algorithm'); assert.string(type, 'type'); var opts = { type: 'key', hash: this.hash(algo, type), algorithm: algo, hashType: type }; return (new Fingerprint(opts)); }; Key.prototype.defaultHashAlgorithm = function () { var hashAlgo = 'sha1'; if (this.type === 'rsa') hashAlgo = 'sha256'; if (this.type === 'dsa' && this.size > 1024) hashAlgo = 'sha256'; if (this.type === 'ed25519') hashAlgo = 'sha512'; if (this.type === 'ecdsa') { if (this.size <= 256) hashAlgo = 'sha256'; else if (this.size <= 384) hashAlgo = 'sha384'; else hashAlgo = 'sha512'; } return (hashAlgo); }; Key.prototype.createVerify = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Verifier(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } assert.ok(v, 'failed to create verifier'); var oldVerify = v.verify.bind(v); var key = this.toBuffer('pkcs8'); var curve = this.curve; var self = this; v.verify = function (signature, fmt) { if (Signature.isSignature(signature, [2, 0])) { if (signature.type !== self.type) return (false); if (signature.hashAlgorithm && signature.hashAlgorithm !== hashAlgo) return (false); if (signature.curve && self.type === 'ecdsa' && signature.curve !== curve) return (false); return (oldVerify(key, signature.toBuffer('asn1'))); } else if (typeof (signature) === 'string' || Buffer.isBuffer(signature)) { return (oldVerify(key, signature, fmt)); /* * Avoid doing this on valid arguments, walking the prototype * chain can be quite slow. */ } else if (Signature.isSignature(signature, [1, 0])) { throw (new Error('signature was created by too old ' + 'a version of sshpk and cannot be verified')); } else { throw (new TypeError('signature must be a string, ' + 'Buffer, or Signature object')); } }; return (v); }; Key.prototype.createDiffieHellman = function () { if (this.type === 'rsa') throw (new Error('RSA keys do not support Diffie-Hellman')); return (new DiffieHellman(this)); }; Key.prototype.createDH = Key.prototype.createDiffieHellman; Key.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); if (k instanceof PrivateKey) k = k.toPublic(); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; Key.isKey = function (obj, ver) { return (utils.isCompatible(obj, Key, ver)); }; /* * API versions for Key: * [1,0] -- initial ver, may take Signature for createVerify or may not * [1,1] -- added pkcs1, pkcs8 formats * [1,2] -- added auto, ssh-private, openssh formats * [1,3] -- added defaultHashAlgorithm * [1,4] -- added ed support, createDH * [1,5] -- first explicitly tagged version * [1,6] -- changed ed25519 part names * [1,7] -- spki hash types */ Key.prototype._sshpkApiVersion = [1, 7]; Key._oldVersionDetect = function (obj) { assert.func(obj.toBuffer); assert.func(obj.fingerprint); if (obj.createDH) return ([1, 4]); if (obj.defaultHashAlgorithm) return ([1, 3]); if (obj.formats['auto']) return ([1, 2]); if (obj.formats['pkcs1']) return ([1, 1]); return ([1, 0]); }; ```
/content/code_sandbox/node_modules/sshpk/lib/key.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,216
```javascript var Key = require('./key'); var Fingerprint = require('./fingerprint'); var Signature = require('./signature'); var PrivateKey = require('./private-key'); var Certificate = require('./certificate'); var Identity = require('./identity'); var errs = require('./errors'); module.exports = { /* top-level classes */ Key: Key, parseKey: Key.parse, Fingerprint: Fingerprint, parseFingerprint: Fingerprint.parse, Signature: Signature, parseSignature: Signature.parse, PrivateKey: PrivateKey, parsePrivateKey: PrivateKey.parse, generatePrivateKey: PrivateKey.generate, Certificate: Certificate, parseCertificate: Certificate.parse, createSelfSignedCertificate: Certificate.createSelfSigned, createCertificate: Certificate.create, Identity: Identity, identityFromDN: Identity.parseDN, identityForHost: Identity.forHost, identityForUser: Identity.forUser, identityForEmail: Identity.forEmail, identityFromArray: Identity.fromArray, /* errors */ FingerprintFormatError: errs.FingerprintFormatError, InvalidAlgorithmError: errs.InvalidAlgorithmError, KeyParseError: errs.KeyParseError, SignatureParseError: errs.SignatureParseError, KeyEncryptedError: errs.KeyEncryptedError, CertificateParseError: errs.CertificateParseError }; ```
/content/code_sandbox/node_modules/sshpk/lib/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
265
```javascript module.exports = { DiffieHellman: DiffieHellman, generateECDSA: generateECDSA, generateED25519: generateED25519 }; var assert = require('assert-plus'); var crypto = require('crypto'); var Buffer = require('safer-buffer').Buffer; var algs = require('./algs'); var utils = require('./utils'); var nacl = require('tweetnacl'); var Key = require('./key'); var PrivateKey = require('./private-key'); var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); var ecdh = require('ecc-jsbn'); var ec = require('ecc-jsbn/lib/ec'); var jsbn = require('jsbn').BigInteger; function DiffieHellman(key) { utils.assertCompatible(key, Key, [1, 4], 'key'); this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); this._algo = key.type; this._curve = key.curve; this._key = key; if (key.type === 'dsa') { if (!CRYPTO_HAVE_ECDH) { throw (new Error('Due to bugs in the node 0.10 ' + 'crypto API, node 0.12.x or later is required ' + 'to use DH')); } this._dh = crypto.createDiffieHellman( key.part.p.data, undefined, key.part.g.data, undefined); this._p = key.part.p; this._g = key.part.g; if (this._isPriv) this._dh.setPrivateKey(key.part.x.data); this._dh.setPublicKey(key.part.y.data); } else if (key.type === 'ecdsa') { if (!CRYPTO_HAVE_ECDH) { this._ecParams = new X9ECParameters(this._curve); if (this._isPriv) { this._priv = new ECPrivate( this._ecParams, key.part.d.data); } return; } var curve = { 'nistp256': 'prime256v1', 'nistp384': 'secp384r1', 'nistp521': 'secp521r1' }[key.curve]; this._dh = crypto.createECDH(curve); if (typeof (this._dh) !== 'object' || typeof (this._dh.setPrivateKey) !== 'function') { CRYPTO_HAVE_ECDH = false; DiffieHellman.call(this, key); return; } if (this._isPriv) this._dh.setPrivateKey(key.part.d.data); this._dh.setPublicKey(key.part.Q.data); } else if (key.type === 'curve25519') { if (this._isPriv) { utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); this._priv = key.part.k.data; } } else { throw (new Error('DH not supported for ' + key.type + ' keys')); } } DiffieHellman.prototype.getPublicKey = function () { if (this._isPriv) return (this._key.toPublic()); return (this._key); }; DiffieHellman.prototype.getPrivateKey = function () { if (this._isPriv) return (this._key); else return (undefined); }; DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; DiffieHellman.prototype._keyCheck = function (pk, isPub) { assert.object(pk, 'key'); if (!isPub) utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); utils.assertCompatible(pk, Key, [1, 4], 'key'); if (pk.type !== this._algo) { throw (new Error('A ' + pk.type + ' key cannot be used in ' + this._algo + ' Diffie-Hellman')); } if (pk.curve !== this._curve) { throw (new Error('A key from the ' + pk.curve + ' curve ' + 'cannot be used with a ' + this._curve + ' Diffie-Hellman')); } if (pk.type === 'dsa') { assert.deepEqual(pk.part.p, this._p, 'DSA key prime does not match'); assert.deepEqual(pk.part.g, this._g, 'DSA key generator does not match'); } }; DiffieHellman.prototype.setKey = function (pk) { this._keyCheck(pk); if (pk.type === 'dsa') { this._dh.setPrivateKey(pk.part.x.data); this._dh.setPublicKey(pk.part.y.data); } else if (pk.type === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { this._dh.setPrivateKey(pk.part.d.data); this._dh.setPublicKey(pk.part.Q.data); } else { this._priv = new ECPrivate( this._ecParams, pk.part.d.data); } } else if (pk.type === 'curve25519') { var k = pk.part.k; if (!pk.part.k) k = pk.part.r; this._priv = k.data; if (this._priv[0] === 0x00) this._priv = this._priv.slice(1); this._priv = this._priv.slice(0, 32); } this._key = pk; this._isPriv = true; }; DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; DiffieHellman.prototype.computeSecret = function (otherpk) { this._keyCheck(otherpk, true); if (!this._isPriv) throw (new Error('DH exchange has not been initialized with ' + 'a private key yet')); var pub; if (this._algo === 'dsa') { return (this._dh.computeSecret( otherpk.part.y.data)); } else if (this._algo === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { return (this._dh.computeSecret( otherpk.part.Q.data)); } else { pub = new ECPublic( this._ecParams, otherpk.part.Q.data); return (this._priv.deriveSharedSecret(pub)); } } else if (this._algo === 'curve25519') { pub = otherpk.part.A.data; while (pub[0] === 0x00 && pub.length > 32) pub = pub.slice(1); var priv = this._priv; assert.strictEqual(pub.length, 32); assert.strictEqual(priv.length, 32); var secret = nacl.box.before(new Uint8Array(pub), new Uint8Array(priv)); return (Buffer.from(secret)); } throw (new Error('Invalid algorithm: ' + this._algo)); }; DiffieHellman.prototype.generateKey = function () { var parts = []; var priv, pub; if (this._algo === 'dsa') { this._dh.generateKeys(); parts.push({name: 'p', data: this._p.data}); parts.push({name: 'q', data: this._key.part.q.data}); parts.push({name: 'g', data: this._g.data}); parts.push({name: 'y', data: this._dh.getPublicKey()}); parts.push({name: 'x', data: this._dh.getPrivateKey()}); this._key = new PrivateKey({ type: 'dsa', parts: parts }); this._isPriv = true; return (this._key); } else if (this._algo === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { this._dh.generateKeys(); parts.push({name: 'curve', data: Buffer.from(this._curve)}); parts.push({name: 'Q', data: this._dh.getPublicKey()}); parts.push({name: 'd', data: this._dh.getPrivateKey()}); this._key = new PrivateKey({ type: 'ecdsa', curve: this._curve, parts: parts }); this._isPriv = true; return (this._key); } else { var n = this._ecParams.getN(); var r = new jsbn(crypto.randomBytes(n.bitLength())); var n1 = n.subtract(jsbn.ONE); priv = r.mod(n1).add(jsbn.ONE); pub = this._ecParams.getG().multiply(priv); priv = Buffer.from(priv.toByteArray()); pub = Buffer.from(this._ecParams.getCurve(). encodePointHex(pub), 'hex'); this._priv = new ECPrivate(this._ecParams, priv); parts.push({name: 'curve', data: Buffer.from(this._curve)}); parts.push({name: 'Q', data: pub}); parts.push({name: 'd', data: priv}); this._key = new PrivateKey({ type: 'ecdsa', curve: this._curve, parts: parts }); this._isPriv = true; return (this._key); } } else if (this._algo === 'curve25519') { var pair = nacl.box.keyPair(); priv = Buffer.from(pair.secretKey); pub = Buffer.from(pair.publicKey); priv = Buffer.concat([priv, pub]); assert.strictEqual(priv.length, 64); assert.strictEqual(pub.length, 32); parts.push({name: 'A', data: pub}); parts.push({name: 'k', data: priv}); this._key = new PrivateKey({ type: 'curve25519', parts: parts }); this._isPriv = true; return (this._key); } throw (new Error('Invalid algorithm: ' + this._algo)); }; DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey; /* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */ function X9ECParameters(name) { var params = algs.curves[name]; assert.object(params); var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var n = new jsbn(params.n); var h = jsbn.ONE; var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); this.curve = curve; this.g = G; this.n = n; this.h = h; } X9ECParameters.prototype.getCurve = function () { return (this.curve); }; X9ECParameters.prototype.getG = function () { return (this.g); }; X9ECParameters.prototype.getN = function () { return (this.n); }; X9ECParameters.prototype.getH = function () { return (this.h); }; function ECPublic(params, buffer) { this._params = params; if (buffer[0] === 0x00) buffer = buffer.slice(1); this._pub = params.getCurve().decodePointHex(buffer.toString('hex')); } function ECPrivate(params, buffer) { this._params = params; this._priv = new jsbn(utils.mpNormalize(buffer)); } ECPrivate.prototype.deriveSharedSecret = function (pubKey) { assert.ok(pubKey instanceof ECPublic); var S = pubKey._pub.multiply(this._priv); return (Buffer.from(S.getX().toBigInteger().toByteArray())); }; function generateED25519() { var pair = nacl.sign.keyPair(); var priv = Buffer.from(pair.secretKey); var pub = Buffer.from(pair.publicKey); assert.strictEqual(priv.length, 64); assert.strictEqual(pub.length, 32); var parts = []; parts.push({name: 'A', data: pub}); parts.push({name: 'k', data: priv.slice(0, 32)}); var key = new PrivateKey({ type: 'ed25519', parts: parts }); return (key); } /* Generates a new ECDSA private key on a given curve. */ function generateECDSA(curve) { var parts = []; var key; if (CRYPTO_HAVE_ECDH) { /* * Node crypto doesn't expose key generation directly, but the * ECDH instances can generate keys. It turns out this just * calls into the OpenSSL generic key generator, and we can * read its output happily without doing an actual DH. So we * use that here. */ var osCurve = { 'nistp256': 'prime256v1', 'nistp384': 'secp384r1', 'nistp521': 'secp521r1' }[curve]; var dh = crypto.createECDH(osCurve); dh.generateKeys(); parts.push({name: 'curve', data: Buffer.from(curve)}); parts.push({name: 'Q', data: dh.getPublicKey()}); parts.push({name: 'd', data: dh.getPrivateKey()}); key = new PrivateKey({ type: 'ecdsa', curve: curve, parts: parts }); return (key); } else { var ecParams = new X9ECParameters(curve); /* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */ var n = ecParams.getN(); /* * The crypto.randomBytes() function can only give us whole * bytes, so taking a nod from X9.62, we round up. */ var cByteLen = Math.ceil((n.bitLength() + 64) / 8); var c = new jsbn(crypto.randomBytes(cByteLen)); var n1 = n.subtract(jsbn.ONE); var priv = c.mod(n1).add(jsbn.ONE); var pub = ecParams.getG().multiply(priv); priv = Buffer.from(priv.toByteArray()); pub = Buffer.from(ecParams.getCurve(). encodePointHex(pub), 'hex'); parts.push({name: 'curve', data: Buffer.from(curve)}); parts.push({name: 'Q', data: pub}); parts.push({name: 'd', data: priv}); key = new PrivateKey({ type: 'ecdsa', curve: curve, parts: parts }); return (key); } } ```
/content/code_sandbox/node_modules/sshpk/lib/dhe.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
3,140
```javascript module.exports = { bufferSplit: bufferSplit, addRSAMissing: addRSAMissing, calculateDSAPublic: calculateDSAPublic, calculateED25519Public: calculateED25519Public, calculateX25519Public: calculateX25519Public, mpNormalize: mpNormalize, mpDenormalize: mpDenormalize, ecNormalize: ecNormalize, countZeros: countZeros, assertCompatible: assertCompatible, isCompatible: isCompatible, opensslKeyDeriv: opensslKeyDeriv, opensshCipherInfo: opensshCipherInfo, publicFromPrivateECDSA: publicFromPrivateECDSA, zeroPadToLength: zeroPadToLength, writeBitString: writeBitString, readBitString: readBitString, pbkdf2: pbkdf2 }; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var PrivateKey = require('./private-key'); var Key = require('./key'); var crypto = require('crypto'); var algs = require('./algs'); var asn1 = require('asn1'); var ec = require('ecc-jsbn/lib/ec'); var jsbn = require('jsbn').BigInteger; var nacl = require('tweetnacl'); var MAX_CLASS_DEPTH = 3; function isCompatible(obj, klass, needVer) { if (obj === null || typeof (obj) !== 'object') return (false); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return (true); var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); if (!proto || ++depth > MAX_CLASS_DEPTH) return (false); } if (proto.constructor.name !== klass.name) return (false); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); if (ver[0] != needVer[0] || ver[1] < needVer[1]) return (false); return (true); } function assertCompatible(obj, klass, needVer, name) { if (name === undefined) name = 'object'; assert.ok(obj, name + ' must not be null'); assert.object(obj, name + ' must be an object'); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return; var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, name + ' must be a ' + klass.name + ' instance'); } assert.strictEqual(proto.constructor.name, klass.name, name + ' must be a ' + klass.name + ' instance'); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], name + ' must be compatible with ' + klass.name + ' klass ' + 'version ' + needVer[0] + '.' + needVer[1]); } var CIPHER_LEN = { 'des-ede3-cbc': { key: 24, iv: 8 }, 'aes-128-cbc': { key: 16, iv: 16 }, 'aes-256-cbc': { key: 32, iv: 16 } }; var PKCS5_SALT_LEN = 8; function opensslKeyDeriv(cipher, salt, passphrase, count) { assert.buffer(salt, 'salt'); assert.buffer(passphrase, 'passphrase'); assert.number(count, 'iteration count'); var clen = CIPHER_LEN[cipher]; assert.object(clen, 'supported cipher'); salt = salt.slice(0, PKCS5_SALT_LEN); var D, D_prev, bufs; var material = Buffer.alloc(0); while (material.length < clen.key + clen.iv) { bufs = []; if (D_prev) bufs.push(D_prev); bufs.push(passphrase); bufs.push(salt); D = Buffer.concat(bufs); for (var j = 0; j < count; ++j) D = crypto.createHash('md5').update(D).digest(); material = Buffer.concat([material, D]); D_prev = D; } return ({ key: material.slice(0, clen.key), iv: material.slice(clen.key, clen.key + clen.iv) }); } /* See: RFC2898 */ function pbkdf2(hashAlg, salt, iterations, size, passphrase) { var hkey = Buffer.alloc(salt.length + 4); salt.copy(hkey); var gen = 0, ts = []; var i = 1; while (gen < size) { var t = T(i++); gen += t.length; ts.push(t); } return (Buffer.concat(ts).slice(0, size)); function T(I) { hkey.writeUInt32BE(I, hkey.length - 4); var hmac = crypto.createHmac(hashAlg, passphrase); hmac.update(hkey); var Ti = hmac.digest(); var Uc = Ti; var c = 1; while (c++ < iterations) { hmac = crypto.createHmac(hashAlg, passphrase); hmac.update(Uc); Uc = hmac.digest(); for (var x = 0; x < Ti.length; ++x) Ti[x] ^= Uc[x]; } return (Ti); } } /* Count leading zero bits on a buffer */ function countZeros(buf) { var o = 0, obit = 8; while (o < buf.length) { var mask = (1 << obit); if ((buf[o] & mask) === mask) break; obit--; if (obit < 0) { o++; obit = 8; } } return (o*8 + (8 - obit) - 1); } function bufferSplit(buf, chr) { assert.buffer(buf); assert.string(chr); var parts = []; var lastPart = 0; var matches = 0; for (var i = 0; i < buf.length; ++i) { if (buf[i] === chr.charCodeAt(matches)) ++matches; else if (buf[i] === chr.charCodeAt(0)) matches = 1; else matches = 0; if (matches >= chr.length) { var newPart = i + 1; parts.push(buf.slice(lastPart, newPart - matches)); lastPart = newPart; matches = 0; } } if (lastPart <= buf.length) parts.push(buf.slice(lastPart, buf.length)); return (parts); } function ecNormalize(buf, addZero) { assert.buffer(buf); if (buf[0] === 0x00 && buf[1] === 0x04) { if (addZero) return (buf); return (buf.slice(1)); } else if (buf[0] === 0x04) { if (!addZero) return (buf); } else { while (buf[0] === 0x00) buf = buf.slice(1); if (buf[0] === 0x02 || buf[0] === 0x03) throw (new Error('Compressed elliptic curve points ' + 'are not supported')); if (buf[0] !== 0x04) throw (new Error('Not a valid elliptic curve point')); if (!addZero) return (buf); } var b = Buffer.alloc(buf.length + 1); b[0] = 0x0; buf.copy(b, 1); return (b); } function readBitString(der, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var buf = der.readString(tag, true); assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + 'not supported (0x' + buf[0].toString(16) + ')'); return (buf.slice(1)); } function writeBitString(der, buf, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); der.writeBuffer(b, tag); } function mpNormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) buf = buf.slice(1); if ((buf[0] & 0x80) === 0x80) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function mpDenormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00) buf = buf.slice(1); return (buf); } function zeroPadToLength(buf, len) { assert.buffer(buf); assert.number(len); while (buf.length > len) { assert.equal(buf[0], 0x00); buf = buf.slice(1); } while (buf.length < len) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function bigintToMpBuf(bigint) { var buf = Buffer.from(bigint.toByteArray()); buf = mpNormalize(buf); return (buf); } function calculateDSAPublic(g, p, x) { assert.buffer(g); assert.buffer(p); assert.buffer(x); g = new jsbn(g); p = new jsbn(p); x = new jsbn(x); var y = g.modPow(x, p); var ybuf = bigintToMpBuf(y); return (ybuf); } function calculateED25519Public(k) { assert.buffer(k); var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function calculateX25519Public(k) { assert.buffer(k); var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function addRSAMissing(key) { assert.object(key); assertCompatible(key, PrivateKey, [1, 1]); var d = new jsbn(key.part.d.data); var buf; if (!key.part.dmodp) { var p = new jsbn(key.part.p.data); var dmodp = d.mod(p.subtract(1)); buf = bigintToMpBuf(dmodp); key.part.dmodp = {name: 'dmodp', data: buf}; key.parts.push(key.part.dmodp); } if (!key.part.dmodq) { var q = new jsbn(key.part.q.data); var dmodq = d.mod(q.subtract(1)); buf = bigintToMpBuf(dmodq); key.part.dmodq = {name: 'dmodq', data: buf}; key.parts.push(key.part.dmodq); } } function publicFromPrivateECDSA(curveName, priv) { assert.string(curveName, 'curveName'); assert.buffer(priv); var params = algs.curves[curveName]; var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); var d = new jsbn(mpNormalize(priv)); var pub = G.multiply(d); pub = Buffer.from(curve.encodePointHex(pub), 'hex'); var parts = []; parts.push({name: 'curve', data: Buffer.from(curveName)}); parts.push({name: 'Q', data: pub}); var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); return (key); } function opensshCipherInfo(cipher) { var inf = {}; switch (cipher) { case '3des-cbc': inf.keySize = 24; inf.blockSize = 8; inf.opensslName = 'des-ede3-cbc'; break; case 'blowfish-cbc': inf.keySize = 16; inf.blockSize = 8; inf.opensslName = 'bf-cbc'; break; case 'aes128-cbc': case 'aes128-ctr': case 'aes128-gcm@openssh.com': inf.keySize = 16; inf.blockSize = 16; inf.opensslName = 'aes-128-' + cipher.slice(7, 10); break; case 'aes192-cbc': case 'aes192-ctr': case 'aes192-gcm@openssh.com': inf.keySize = 24; inf.blockSize = 16; inf.opensslName = 'aes-192-' + cipher.slice(7, 10); break; case 'aes256-cbc': case 'aes256-ctr': case 'aes256-gcm@openssh.com': inf.keySize = 32; inf.blockSize = 16; inf.opensslName = 'aes-256-' + cipher.slice(7, 10); break; default: throw (new Error( 'Unsupported openssl cipher "' + cipher + '"')); } return (inf); } ```
/content/code_sandbox/node_modules/sshpk/lib/utils.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
3,068
```javascript module.exports = PrivateKey; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var algs = require('./algs'); var crypto = require('crypto'); var Fingerprint = require('./fingerprint'); var Signature = require('./signature'); var errs = require('./errors'); var util = require('util'); var utils = require('./utils'); var dhe = require('./dhe'); var generateECDSA = dhe.generateECDSA; var generateED25519 = dhe.generateED25519; var edCompat = require('./ed-compat'); var nacl = require('tweetnacl'); var Key = require('./key'); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var KeyEncryptedError = errs.KeyEncryptedError; var formats = {}; formats['auto'] = require('./formats/auto'); formats['pem'] = require('./formats/pem'); formats['pkcs1'] = require('./formats/pkcs1'); formats['pkcs8'] = require('./formats/pkcs8'); formats['rfc4253'] = require('./formats/rfc4253'); formats['ssh-private'] = require('./formats/ssh-private'); formats['openssh'] = formats['ssh-private']; formats['ssh'] = formats['ssh-private']; formats['dnssec'] = require('./formats/dnssec'); function PrivateKey(opts) { assert.object(opts, 'options'); Key.call(this, opts); this._pubCache = undefined; } util.inherits(PrivateKey, Key); PrivateKey.formats = formats; PrivateKey.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'pkcs1'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); return (formats[format].write(this, options)); }; PrivateKey.prototype.hash = function (algo, type) { return (this.toPublic().hash(algo, type)); }; PrivateKey.prototype.fingerprint = function (algo, type) { return (this.toPublic().fingerprint(algo, type)); }; PrivateKey.prototype.toPublic = function () { if (this._pubCache) return (this._pubCache); var algInfo = algs.info[this.type]; var pubParts = []; for (var i = 0; i < algInfo.parts.length; ++i) { var p = algInfo.parts[i]; pubParts.push(this.part[p]); } this._pubCache = new Key({ type: this.type, source: this, parts: pubParts }); if (this.comment) this._pubCache.comment = this.comment; return (this._pubCache); }; PrivateKey.prototype.derive = function (newType) { assert.string(newType, 'type'); var priv, pub, pair; if (this.type === 'ed25519' && newType === 'curve25519') { priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); pub = Buffer.from(pair.publicKey); return (new PrivateKey({ type: 'curve25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } else if (this.type === 'curve25519' && newType === 'ed25519') { priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); pub = Buffer.from(pair.publicKey); return (new PrivateKey({ type: 'ed25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } throw (new Error('Key derivation not supported from ' + this.type + ' to ' + newType)); }; PrivateKey.prototype.createVerify = function (hashAlgo) { return (this.toPublic().createVerify(hashAlgo)); }; PrivateKey.prototype.createSign = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Signer(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createSign(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createSign(nm); } assert.ok(v, 'failed to create verifier'); var oldSign = v.sign.bind(v); var key = this.toBuffer('pkcs1'); var type = this.type; var curve = this.curve; v.sign = function () { var sig = oldSign(key); if (typeof (sig) === 'string') sig = Buffer.from(sig, 'binary'); sig = Signature.parse(sig, type, 'asn1'); sig.hashAlgorithm = hashAlgo; sig.curve = curve; return (sig); }; return (v); }; PrivateKey.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); assert.ok(k instanceof PrivateKey, 'key is not a private key'); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; PrivateKey.isPrivateKey = function (obj, ver) { return (utils.isCompatible(obj, PrivateKey, ver)); }; PrivateKey.generate = function (type, options) { if (options === undefined) options = {}; assert.object(options, 'options'); switch (type) { case 'ecdsa': if (options.curve === undefined) options.curve = 'nistp256'; assert.string(options.curve, 'options.curve'); return (generateECDSA(options.curve)); case 'ed25519': return (generateED25519()); default: throw (new Error('Key generation not supported with key ' + 'type "' + type + '"')); } }; /* * API versions for PrivateKey: * [1,0] -- initial ver * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats * [1,2] -- added defaultHashAlgorithm * [1,3] -- added derive, ed, createDH * [1,4] -- first tagged version * [1,5] -- changed ed25519 part names and format * [1,6] -- type arguments for hash() and fingerprint() */ PrivateKey.prototype._sshpkApiVersion = [1, 6]; PrivateKey._oldVersionDetect = function (obj) { assert.func(obj.toPublic); assert.func(obj.createSign); if (obj.derive) return ([1, 3]); if (obj.defaultHashAlgorithm) return ([1, 2]); if (obj.formats['auto']) return ([1, 1]); return ([1, 0]); }; ```
/content/code_sandbox/node_modules/sshpk/lib/private-key.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,798
```javascript module.exports = Fingerprint; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var algs = require('./algs'); var crypto = require('crypto'); var errs = require('./errors'); var Key = require('./key'); var PrivateKey = require('./private-key'); var Certificate = require('./certificate'); var utils = require('./utils'); var FingerprintFormatError = errs.FingerprintFormatError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; function Fingerprint(opts) { assert.object(opts, 'options'); assert.string(opts.type, 'options.type'); assert.buffer(opts.hash, 'options.hash'); assert.string(opts.algorithm, 'options.algorithm'); this.algorithm = opts.algorithm.toLowerCase(); if (algs.hashAlgs[this.algorithm] !== true) throw (new InvalidAlgorithmError(this.algorithm)); this.hash = opts.hash; this.type = opts.type; this.hashType = opts.hashType; } Fingerprint.prototype.toString = function (format) { if (format === undefined) { if (this.algorithm === 'md5' || this.hashType === 'spki') format = 'hex'; else format = 'base64'; } assert.string(format); switch (format) { case 'hex': if (this.hashType === 'spki') return (this.hash.toString('hex')); return (addColons(this.hash.toString('hex'))); case 'base64': if (this.hashType === 'spki') return (this.hash.toString('base64')); return (sshBase64Format(this.algorithm, this.hash.toString('base64'))); default: throw (new FingerprintFormatError(undefined, format)); } }; Fingerprint.prototype.matches = function (other) { assert.object(other, 'key or certificate'); if (this.type === 'key' && this.hashType !== 'ssh') { utils.assertCompatible(other, Key, [1, 7], 'key with spki'); if (PrivateKey.isPrivateKey(other)) { utils.assertCompatible(other, PrivateKey, [1, 6], 'privatekey with spki support'); } } else if (this.type === 'key') { utils.assertCompatible(other, Key, [1, 0], 'key'); } else { utils.assertCompatible(other, Certificate, [1, 0], 'certificate'); } var theirHash = other.hash(this.algorithm, this.hashType); var theirHash2 = crypto.createHash(this.algorithm). update(theirHash).digest('base64'); if (this.hash2 === undefined) this.hash2 = crypto.createHash(this.algorithm). update(this.hash).digest('base64'); return (this.hash2 === theirHash2); }; /*JSSTYLED*/ var base64RE = /^[A-Za-z0-9+\/=]+$/; /*JSSTYLED*/ var hexRE = /^[a-fA-F0-9]+$/; Fingerprint.parse = function (fp, options) { assert.string(fp, 'fingerprint'); var alg, hash, enAlgs; if (Array.isArray(options)) { enAlgs = options; options = {}; } assert.optionalObject(options, 'options'); if (options === undefined) options = {}; if (options.enAlgs !== undefined) enAlgs = options.enAlgs; if (options.algorithms !== undefined) enAlgs = options.algorithms; assert.optionalArrayOfString(enAlgs, 'algorithms'); var hashType = 'ssh'; if (options.hashType !== undefined) hashType = options.hashType; assert.string(hashType, 'options.hashType'); var parts = fp.split(':'); if (parts.length == 2) { alg = parts[0].toLowerCase(); if (!base64RE.test(parts[1])) throw (new FingerprintFormatError(fp)); try { hash = Buffer.from(parts[1], 'base64'); } catch (e) { throw (new FingerprintFormatError(fp)); } } else if (parts.length > 2) { alg = 'md5'; if (parts[0].toLowerCase() === 'md5') parts = parts.slice(1); parts = parts.map(function (p) { while (p.length < 2) p = '0' + p; if (p.length > 2) throw (new FingerprintFormatError(fp)); return (p); }); parts = parts.join(''); if (!hexRE.test(parts) || parts.length % 2 !== 0) throw (new FingerprintFormatError(fp)); try { hash = Buffer.from(parts, 'hex'); } catch (e) { throw (new FingerprintFormatError(fp)); } } else { if (hexRE.test(fp)) { hash = Buffer.from(fp, 'hex'); } else if (base64RE.test(fp)) { hash = Buffer.from(fp, 'base64'); } else { throw (new FingerprintFormatError(fp)); } switch (hash.length) { case 32: alg = 'sha256'; break; case 16: alg = 'md5'; break; case 20: alg = 'sha1'; break; case 64: alg = 'sha512'; break; default: throw (new FingerprintFormatError(fp)); } /* Plain hex/base64: guess it's probably SPKI unless told. */ if (options.hashType === undefined) hashType = 'spki'; } if (alg === undefined) throw (new FingerprintFormatError(fp)); if (algs.hashAlgs[alg] === undefined) throw (new InvalidAlgorithmError(alg)); if (enAlgs !== undefined) { enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); if (enAlgs.indexOf(alg) === -1) throw (new InvalidAlgorithmError(alg)); } return (new Fingerprint({ algorithm: alg, hash: hash, type: options.type || 'key', hashType: hashType })); }; function addColons(s) { /*JSSTYLED*/ return (s.replace(/(.{2})(?=.)/g, '$1:')); } function base64Strip(s) { /*JSSTYLED*/ return (s.replace(/=*$/, '')); } function sshBase64Format(alg, h) { return (alg.toUpperCase() + ':' + base64Strip(h)); } Fingerprint.isFingerprint = function (obj, ver) { return (utils.isCompatible(obj, Fingerprint, ver)); }; /* * API versions for Fingerprint: * [1,0] -- initial ver * [1,1] -- first tagged ver * [1,2] -- hashType and spki support */ Fingerprint.prototype._sshpkApiVersion = [1, 2]; Fingerprint._oldVersionDetect = function (obj) { assert.func(obj.toString); assert.func(obj.matches); return ([1, 0]); }; ```
/content/code_sandbox/node_modules/sshpk/lib/fingerprint.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,532
```javascript module.exports = { Verifier: Verifier, Signer: Signer }; var nacl = require('tweetnacl'); var stream = require('stream'); var util = require('util'); var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var Signature = require('./signature'); function Verifier(key, hashAlgo) { if (hashAlgo.toLowerCase() !== 'sha512') throw (new Error('ED25519 only supports the use of ' + 'SHA-512 hashes')); this.key = key; this.chunks = []; stream.Writable.call(this, {}); } util.inherits(Verifier, stream.Writable); Verifier.prototype._write = function (chunk, enc, cb) { this.chunks.push(chunk); cb(); }; Verifier.prototype.update = function (chunk) { if (typeof (chunk) === 'string') chunk = Buffer.from(chunk, 'binary'); this.chunks.push(chunk); }; Verifier.prototype.verify = function (signature, fmt) { var sig; if (Signature.isSignature(signature, [2, 0])) { if (signature.type !== 'ed25519') return (false); sig = signature.toBuffer('raw'); } else if (typeof (signature) === 'string') { sig = Buffer.from(signature, 'base64'); } else if (Signature.isSignature(signature, [1, 0])) { throw (new Error('signature was created by too old ' + 'a version of sshpk and cannot be verified')); } assert.buffer(sig); return (nacl.sign.detached.verify( new Uint8Array(Buffer.concat(this.chunks)), new Uint8Array(sig), new Uint8Array(this.key.part.A.data))); }; function Signer(key, hashAlgo) { if (hashAlgo.toLowerCase() !== 'sha512') throw (new Error('ED25519 only supports the use of ' + 'SHA-512 hashes')); this.key = key; this.chunks = []; stream.Writable.call(this, {}); } util.inherits(Signer, stream.Writable); Signer.prototype._write = function (chunk, enc, cb) { this.chunks.push(chunk); cb(); }; Signer.prototype.update = function (chunk) { if (typeof (chunk) === 'string') chunk = Buffer.from(chunk, 'binary'); this.chunks.push(chunk); }; Signer.prototype.sign = function () { var sig = nacl.sign.detached( new Uint8Array(Buffer.concat(this.chunks)), new Uint8Array(Buffer.concat([ this.key.part.k.data, this.key.part.A.data]))); var sigBuf = Buffer.from(sig); var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); sigObj.hashAlgorithm = 'sha512'; return (sigObj); }; ```
/content/code_sandbox/node_modules/sshpk/lib/ed-compat.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
593
```javascript module.exports = Signature; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var algs = require('./algs'); var crypto = require('crypto'); var errs = require('./errors'); var utils = require('./utils'); var asn1 = require('asn1'); var SSHBuffer = require('./ssh-buffer'); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var SignatureParseError = errs.SignatureParseError; function Signature(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.parts, 'options.parts'); assert.string(opts.type, 'options.type'); var partLookup = {}; for (var i = 0; i < opts.parts.length; ++i) { var part = opts.parts[i]; partLookup[part.name] = part; } this.type = opts.type; this.hashAlgorithm = opts.hashAlgo; this.curve = opts.curve; this.parts = opts.parts; this.part = partLookup; } Signature.prototype.toBuffer = function (format) { if (format === undefined) format = 'asn1'; assert.string(format, 'format'); var buf; var stype = 'ssh-' + this.type; switch (this.type) { case 'rsa': switch (this.hashAlgorithm) { case 'sha256': stype = 'rsa-sha2-256'; break; case 'sha512': stype = 'rsa-sha2-512'; break; case 'sha1': case undefined: break; default: throw (new Error('SSH signature ' + 'format does not support hash ' + 'algorithm ' + this.hashAlgorithm)); } if (format === 'ssh') { buf = new SSHBuffer({}); buf.writeString(stype); buf.writePart(this.part.sig); return (buf.toBuffer()); } else { return (this.part.sig.data); } break; case 'ed25519': if (format === 'ssh') { buf = new SSHBuffer({}); buf.writeString(stype); buf.writePart(this.part.sig); return (buf.toBuffer()); } else { return (this.part.sig.data); } break; case 'dsa': case 'ecdsa': var r, s; if (format === 'asn1') { var der = new asn1.BerWriter(); der.startSequence(); r = utils.mpNormalize(this.part.r.data); s = utils.mpNormalize(this.part.s.data); der.writeBuffer(r, asn1.Ber.Integer); der.writeBuffer(s, asn1.Ber.Integer); der.endSequence(); return (der.buffer); } else if (format === 'ssh' && this.type === 'dsa') { buf = new SSHBuffer({}); buf.writeString('ssh-dss'); r = this.part.r.data; if (r.length > 20 && r[0] === 0x00) r = r.slice(1); s = this.part.s.data; if (s.length > 20 && s[0] === 0x00) s = s.slice(1); if ((this.hashAlgorithm && this.hashAlgorithm !== 'sha1') || r.length + s.length !== 40) { throw (new Error('OpenSSH only supports ' + 'DSA signatures with SHA1 hash')); } buf.writeBuffer(Buffer.concat([r, s])); return (buf.toBuffer()); } else if (format === 'ssh' && this.type === 'ecdsa') { var inner = new SSHBuffer({}); r = this.part.r.data; inner.writeBuffer(r); inner.writePart(this.part.s); buf = new SSHBuffer({}); /* XXX: find a more proper way to do this? */ var curve; if (r[0] === 0x00) r = r.slice(1); var sz = r.length * 8; if (sz === 256) curve = 'nistp256'; else if (sz === 384) curve = 'nistp384'; else if (sz === 528) curve = 'nistp521'; buf.writeString('ecdsa-sha2-' + curve); buf.writeBuffer(inner.toBuffer()); return (buf.toBuffer()); } throw (new Error('Invalid signature format')); default: throw (new Error('Invalid signature data')); } }; Signature.prototype.toString = function (format) { assert.optionalString(format, 'format'); return (this.toBuffer(format).toString('base64')); }; Signature.parse = function (data, type, format) { if (typeof (data) === 'string') data = Buffer.from(data, 'base64'); assert.buffer(data, 'data'); assert.string(format, 'format'); assert.string(type, 'type'); var opts = {}; opts.type = type.toLowerCase(); opts.parts = []; try { assert.ok(data.length > 0, 'signature must not be empty'); switch (opts.type) { case 'rsa': return (parseOneNum(data, type, format, opts)); case 'ed25519': return (parseOneNum(data, type, format, opts)); case 'dsa': case 'ecdsa': if (format === 'asn1') return (parseDSAasn1(data, type, format, opts)); else if (opts.type === 'dsa') return (parseDSA(data, type, format, opts)); else return (parseECDSA(data, type, format, opts)); default: throw (new InvalidAlgorithmError(type)); } } catch (e) { if (e instanceof InvalidAlgorithmError) throw (e); throw (new SignatureParseError(type, format, e)); } }; function parseOneNum(data, type, format, opts) { if (format === 'ssh') { try { var buf = new SSHBuffer({buffer: data}); var head = buf.readString(); } catch (e) { /* fall through */ } if (buf !== undefined) { var msg = 'SSH signature does not match expected ' + 'type (expected ' + type + ', got ' + head + ')'; switch (head) { case 'ssh-rsa': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha1'; break; case 'rsa-sha2-256': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha256'; break; case 'rsa-sha2-512': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha512'; break; case 'ssh-ed25519': assert.strictEqual(type, 'ed25519', msg); opts.hashAlgo = 'sha512'; break; default: throw (new Error('Unknown SSH signature ' + 'type: ' + head)); } var sig = buf.readPart(); assert.ok(buf.atEnd(), 'extra trailing bytes'); sig.name = 'sig'; opts.parts.push(sig); return (new Signature(opts)); } } opts.parts.push({name: 'sig', data: data}); return (new Signature(opts)); } function parseDSAasn1(data, type, format, opts) { var der = new asn1.BerReader(data); der.readSequence(); var r = der.readString(asn1.Ber.Integer, true); var s = der.readString(asn1.Ber.Integer, true); opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); opts.parts.push({name: 's', data: utils.mpNormalize(s)}); return (new Signature(opts)); } function parseDSA(data, type, format, opts) { if (data.length != 40) { var buf = new SSHBuffer({buffer: data}); var d = buf.readBuffer(); if (d.toString('ascii') === 'ssh-dss') d = buf.readBuffer(); assert.ok(buf.atEnd(), 'extra trailing bytes'); assert.strictEqual(d.length, 40, 'invalid inner length'); data = d; } opts.parts.push({name: 'r', data: data.slice(0, 20)}); opts.parts.push({name: 's', data: data.slice(20, 40)}); return (new Signature(opts)); } function parseECDSA(data, type, format, opts) { var buf = new SSHBuffer({buffer: data}); var r, s; var inner = buf.readBuffer(); var stype = inner.toString('ascii'); if (stype.slice(0, 6) === 'ecdsa-') { var parts = stype.split('-'); assert.strictEqual(parts[0], 'ecdsa'); assert.strictEqual(parts[1], 'sha2'); opts.curve = parts[2]; switch (opts.curve) { case 'nistp256': opts.hashAlgo = 'sha256'; break; case 'nistp384': opts.hashAlgo = 'sha384'; break; case 'nistp521': opts.hashAlgo = 'sha512'; break; default: throw (new Error('Unsupported ECDSA curve: ' + opts.curve)); } inner = buf.readBuffer(); assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); buf = new SSHBuffer({buffer: inner}); r = buf.readPart(); } else { r = {data: inner}; } s = buf.readPart(); assert.ok(buf.atEnd(), 'extra trailing bytes'); r.name = 'r'; s.name = 's'; opts.parts.push(r); opts.parts.push(s); return (new Signature(opts)); } Signature.isSignature = function (obj, ver) { return (utils.isCompatible(obj, Signature, ver)); }; /* * API versions for Signature: * [1,0] -- initial ver * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent * hashAlgorithm property * [2,1] -- first tagged version */ Signature.prototype._sshpkApiVersion = [2, 1]; Signature._oldVersionDetect = function (obj) { assert.func(obj.toBuffer); if (obj.hasOwnProperty('hashAlgorithm')) return ([2, 0]); return ([1, 0]); }; ```
/content/code_sandbox/node_modules/sshpk/lib/signature.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,242
```javascript module.exports = Identity; var assert = require('assert-plus'); var algs = require('./algs'); var crypto = require('crypto'); var Fingerprint = require('./fingerprint'); var Signature = require('./signature'); var errs = require('./errors'); var util = require('util'); var utils = require('./utils'); var asn1 = require('asn1'); var Buffer = require('safer-buffer').Buffer; /*JSSTYLED*/ var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; var oids = {}; oids.cn = '2.5.4.3'; oids.o = '2.5.4.10'; oids.ou = '2.5.4.11'; oids.l = '2.5.4.7'; oids.s = '2.5.4.8'; oids.c = '2.5.4.6'; oids.sn = '2.5.4.4'; oids.postalCode = '2.5.4.17'; oids.serialNumber = '2.5.4.5'; oids.street = '2.5.4.9'; oids.x500UniqueIdentifier = '2.5.4.45'; oids.role = '2.5.4.72'; oids.telephoneNumber = '2.5.4.20'; oids.description = '2.5.4.13'; oids.dc = '0.9.2342.19200300.100.1.25'; oids.uid = '0.9.2342.19200300.100.1.1'; oids.mail = '0.9.2342.19200300.100.1.3'; oids.title = '2.5.4.12'; oids.gn = '2.5.4.42'; oids.initials = '2.5.4.43'; oids.pseudonym = '2.5.4.65'; oids.emailAddress = '1.2.840.113549.1.9.1'; var unoids = {}; Object.keys(oids).forEach(function (k) { unoids[oids[k]] = k; }); function Identity(opts) { var self = this; assert.object(opts, 'options'); assert.arrayOfObject(opts.components, 'options.components'); this.components = opts.components; this.componentLookup = {}; this.components.forEach(function (c) { if (c.name && !c.oid) c.oid = oids[c.name]; if (c.oid && !c.name) c.name = unoids[c.oid]; if (self.componentLookup[c.name] === undefined) self.componentLookup[c.name] = []; self.componentLookup[c.name].push(c); }); if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { this.cn = this.componentLookup.cn[0].value; } assert.optionalString(opts.type, 'options.type'); if (opts.type === undefined) { if (this.components.length === 1 && this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.dc && this.components.length === this.componentLookup.dc.length) { this.type = 'host'; this.hostname = this.componentLookup.dc.map( function (c) { return (c.value); }).join('.'); } else if (this.componentLookup.uid && this.components.length === this.componentLookup.uid.length) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.uid && this.componentLookup.uid.length === 1) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.mail && this.componentLookup.mail.length === 1) { this.type = 'email'; this.email = this.componentLookup.mail[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1) { this.type = 'user'; this.uid = this.componentLookup.cn[0].value; } else { this.type = 'unknown'; } } else { this.type = opts.type; if (this.type === 'host') this.hostname = opts.hostname; else if (this.type === 'user') this.uid = opts.uid; else if (this.type === 'email') this.email = opts.email; else throw (new Error('Unknown type ' + this.type)); } } Identity.prototype.toString = function () { return (this.components.map(function (c) { var n = c.name.toUpperCase(); /*JSSTYLED*/ n = n.replace(/=/g, '\\='); var v = c.value; /*JSSTYLED*/ v = v.replace(/,/g, '\\,'); return (n + '=' + v); }).join(', ')); }; Identity.prototype.get = function (name, asArray) { assert.string(name, 'name'); var arr = this.componentLookup[name]; if (arr === undefined || arr.length === 0) return (undefined); if (!asArray && arr.length > 1) throw (new Error('Multiple values for attribute ' + name)); if (!asArray) return (arr[0].value); return (arr.map(function (c) { return (c.value); })); }; Identity.prototype.toArray = function (idx) { return (this.components.map(function (c) { return ({ name: c.name, value: c.value }); })); }; /* * These are from X.680 -- PrintableString allowed chars are in section 37.4 * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 * (the basic ASCII character set). */ /* JSSTYLED */ var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; /* JSSTYLED */ var NOT_IA5 = /[^\x00-\x7f]/; Identity.prototype.toAsn1 = function (der, tag) { der.startSequence(tag); this.components.forEach(function (c) { der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); der.startSequence(); der.writeOID(c.oid); /* * If we fit in a PrintableString, use that. Otherwise use an * IA5String or UTF8String. * * If this identity was parsed from a DN, use the ASN.1 types * from the original representation (otherwise this might not * be a full match for the original in some validators). */ if (c.asn1type === asn1.Ber.Utf8String || c.value.match(NOT_IA5)) { var v = Buffer.from(c.value, 'utf8'); der.writeBuffer(v, asn1.Ber.Utf8String); } else if (c.asn1type === asn1.Ber.IA5String || c.value.match(NOT_PRINTABLE)) { der.writeString(c.value, asn1.Ber.IA5String); } else { var type = asn1.Ber.PrintableString; if (c.asn1type !== undefined) type = c.asn1type; der.writeString(c.value, type); } der.endSequence(); der.endSequence(); }); der.endSequence(); }; function globMatch(a, b) { if (a === '**' || b === '**') return (true); var aParts = a.split('.'); var bParts = b.split('.'); if (aParts.length !== bParts.length) return (false); for (var i = 0; i < aParts.length; ++i) { if (aParts[i] === '*' || bParts[i] === '*') continue; if (aParts[i] !== bParts[i]) return (false); } return (true); } Identity.prototype.equals = function (other) { if (!Identity.isIdentity(other, [1, 0])) return (false); if (other.components.length !== this.components.length) return (false); for (var i = 0; i < this.components.length; ++i) { if (this.components[i].oid !== other.components[i].oid) return (false); if (!globMatch(this.components[i].value, other.components[i].value)) { return (false); } } return (true); }; Identity.forHost = function (hostname) { assert.string(hostname, 'hostname'); return (new Identity({ type: 'host', hostname: hostname, components: [ { name: 'cn', value: hostname } ] })); }; Identity.forUser = function (uid) { assert.string(uid, 'uid'); return (new Identity({ type: 'user', uid: uid, components: [ { name: 'uid', value: uid } ] })); }; Identity.forEmail = function (email) { assert.string(email, 'email'); return (new Identity({ type: 'email', email: email, components: [ { name: 'mail', value: email } ] })); }; Identity.parseDN = function (dn) { assert.string(dn, 'dn'); var parts = ['']; var idx = 0; var rem = dn; while (rem.length > 0) { var m; /*JSSTYLED*/ if ((m = /^,/.exec(rem)) !== null) { parts[++idx] = ''; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^\\,/.exec(rem)) !== null) { parts[idx] += ','; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^\\./.exec(rem)) !== null) { parts[idx] += m[0]; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { parts[idx] += m[0]; rem = rem.slice(m[0].length); } else { throw (new Error('Failed to parse DN')); } } var cmps = parts.map(function (c) { c = c.trim(); var eqPos = c.indexOf('='); while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') eqPos = c.indexOf('=', eqPos + 1); if (eqPos === -1) { throw (new Error('Failed to parse DN')); } /*JSSTYLED*/ var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); var value = c.slice(eqPos + 1); return ({ name: name, value: value }); }); return (new Identity({ components: cmps })); }; Identity.fromArray = function (components) { assert.arrayOfObject(components, 'components'); components.forEach(function (cmp) { assert.object(cmp, 'component'); assert.string(cmp.name, 'component.name'); if (!Buffer.isBuffer(cmp.value) && !(typeof (cmp.value) === 'string')) { throw (new Error('Invalid component value')); } }); return (new Identity({ components: components })); }; Identity.parseAsn1 = function (der, top) { var components = []; der.readSequence(top); var end = der.offset + der.length; while (der.offset < end) { der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); var after = der.offset + der.length; der.readSequence(); var oid = der.readOID(); var type = der.peek(); var value; switch (type) { case asn1.Ber.PrintableString: case asn1.Ber.IA5String: case asn1.Ber.OctetString: case asn1.Ber.T61String: value = der.readString(type); break; case asn1.Ber.Utf8String: value = der.readString(type, true); value = value.toString('utf8'); break; case asn1.Ber.CharacterString: case asn1.Ber.BMPString: value = der.readString(type, true); value = value.toString('utf16le'); break; default: throw (new Error('Unknown asn1 type ' + type)); } components.push({ oid: oid, asn1type: type, value: value }); der._offset = after; } der._offset = end; return (new Identity({ components: components })); }; Identity.isIdentity = function (obj, ver) { return (utils.isCompatible(obj, Identity, ver)); }; /* * API versions for Identity: * [1,0] -- initial ver */ Identity.prototype._sshpkApiVersion = [1, 0]; Identity._oldVersionDetect = function (obj) { return ([1, 0]); }; ```
/content/code_sandbox/node_modules/sshpk/lib/identity.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
3,025
```javascript module.exports = SSHBuffer; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; function SSHBuffer(opts) { assert.object(opts, 'options'); if (opts.buffer !== undefined) assert.buffer(opts.buffer, 'options.buffer'); this._size = opts.buffer ? opts.buffer.length : 1024; this._buffer = opts.buffer || Buffer.alloc(this._size); this._offset = 0; } SSHBuffer.prototype.toBuffer = function () { return (this._buffer.slice(0, this._offset)); }; SSHBuffer.prototype.atEnd = function () { return (this._offset >= this._buffer.length); }; SSHBuffer.prototype.remainder = function () { return (this._buffer.slice(this._offset)); }; SSHBuffer.prototype.skip = function (n) { this._offset += n; }; SSHBuffer.prototype.expand = function () { this._size *= 2; var buf = Buffer.alloc(this._size); this._buffer.copy(buf, 0); this._buffer = buf; }; SSHBuffer.prototype.readPart = function () { return ({data: this.readBuffer()}); }; SSHBuffer.prototype.readBuffer = function () { var len = this._buffer.readUInt32BE(this._offset); this._offset += 4; assert.ok(this._offset + len <= this._buffer.length, 'length out of bounds at +0x' + this._offset.toString(16) + ' (data truncated?)'); var buf = this._buffer.slice(this._offset, this._offset + len); this._offset += len; return (buf); }; SSHBuffer.prototype.readString = function () { return (this.readBuffer().toString()); }; SSHBuffer.prototype.readCString = function () { var offset = this._offset; while (offset < this._buffer.length && this._buffer[offset] !== 0x00) offset++; assert.ok(offset < this._buffer.length, 'c string does not terminate'); var str = this._buffer.slice(this._offset, offset).toString(); this._offset = offset + 1; return (str); }; SSHBuffer.prototype.readInt = function () { var v = this._buffer.readUInt32BE(this._offset); this._offset += 4; return (v); }; SSHBuffer.prototype.readInt64 = function () { assert.ok(this._offset + 8 < this._buffer.length, 'buffer not long enough to read Int64'); var v = this._buffer.slice(this._offset, this._offset + 8); this._offset += 8; return (v); }; SSHBuffer.prototype.readChar = function () { var v = this._buffer[this._offset++]; return (v); }; SSHBuffer.prototype.writeBuffer = function (buf) { while (this._offset + 4 + buf.length > this._size) this.expand(); this._buffer.writeUInt32BE(buf.length, this._offset); this._offset += 4; buf.copy(this._buffer, this._offset); this._offset += buf.length; }; SSHBuffer.prototype.writeString = function (str) { this.writeBuffer(Buffer.from(str, 'utf8')); }; SSHBuffer.prototype.writeCString = function (str) { while (this._offset + 1 + str.length > this._size) this.expand(); this._buffer.write(str, this._offset); this._offset += str.length; this._buffer[this._offset++] = 0; }; SSHBuffer.prototype.writeInt = function (v) { while (this._offset + 4 > this._size) this.expand(); this._buffer.writeUInt32BE(v, this._offset); this._offset += 4; }; SSHBuffer.prototype.writeInt64 = function (v) { assert.buffer(v, 'value'); if (v.length > 8) { var lead = v.slice(0, v.length - 8); for (var i = 0; i < lead.length; ++i) { assert.strictEqual(lead[i], 0, 'must fit in 64 bits of precision'); } v = v.slice(v.length - 8, v.length); } while (this._offset + 8 > this._size) this.expand(); v.copy(this._buffer, this._offset); this._offset += 8; }; SSHBuffer.prototype.writeChar = function (v) { while (this._offset + 1 > this._size) this.expand(); this._buffer[this._offset++] = v; }; SSHBuffer.prototype.writePart = function (p) { this.writeBuffer(p.data); }; SSHBuffer.prototype.write = function (buf) { while (this._offset + buf.length > this._size) this.expand(); buf.copy(this._buffer, this._offset); this._offset += buf.length; }; ```
/content/code_sandbox/node_modules/sshpk/lib/ssh-buffer.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
992
```javascript var Buffer = require('safer-buffer').Buffer; var algInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y'], sizePart: 'p' }, 'rsa': { parts: ['e', 'n'], sizePart: 'n' }, 'ecdsa': { parts: ['curve', 'Q'], sizePart: 'Q' }, 'ed25519': { parts: ['A'], sizePart: 'A' } }; algInfo['curve25519'] = algInfo['ed25519']; var algPrivInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y', 'x'] }, 'rsa': { parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] }, 'ecdsa': { parts: ['curve', 'Q', 'd'] }, 'ed25519': { parts: ['A', 'k'] } }; algPrivInfo['curve25519'] = algPrivInfo['ed25519']; var hashAlgs = { 'md5': true, 'sha1': true, 'sha256': true, 'sha384': true, 'sha512': true }; /* * Taken from * path_to_url */ var curves = { 'nistp256': { size: 256, pkcs8oid: '1.2.840.10045.3.1.7', p: Buffer.from(('00' + 'ffffffff 00000001 00000000 00000000' + '00000000 ffffffff ffffffff ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF 00000001 00000000 00000000' + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'c49d3608 86e70493 6a6678e1 139d26b7' + '819f7e90'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff 00000000 ffffffff ffffffff' + 'bce6faad a7179e84 f3b9cac2 fc632551'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + '77037d81 2deb33a0 f4a13945 d898c296' + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + '2bce3357 6b315ece cbb64068 37bf51f5'). replace(/ /g, ''), 'hex') }, 'nistp384': { size: 384, pkcs8oid: '1.3.132.0.34', p: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffe' + 'ffffffff 00000000 00000000 ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( 'b3312fa7 e23ee7e4 988e056b e3f82d19' + '181d9c6e fe814112 0314088f 5013875a' + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'a335926a a319a27a 1d00896a 6773a482' + '7acdac73'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff c7634d81 f4372ddf' + '581a0db2 48b0a77a ecec196a ccc52973'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + '6e1d3b62 8ba79b98 59f741e0 82542a38' + '5502f25d bf55296c 3a545e38 72760ab7' + '3617de4a 96262c6f 5d9e98bf 9292dc29' + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). replace(/ /g, ''), 'hex') }, 'nistp521': { size: 521, pkcs8oid: '1.3.132.0.35', p: Buffer.from(( '01ffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffff').replace(/ /g, ''), 'hex'), a: Buffer.from(('01FF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(('51' + '953eb961 8e1c9a1f 929a21a0 b68540ee' + 'a2da725b 99b315f3 b8b48991 8ef109e1' + '56193951 ec7e937b 1652c0bd 3bb1bf07' + '3573df88 3d2c34f1 ef451fd4 6b503f00'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'd09e8800 291cb853 96cc6717 393284aa' + 'a0da64ba').replace(/ /g, ''), 'hex'), n: Buffer.from(('01ff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffa' + '51868783 bf2f966b 7fcc0148 f709a5d0' + '3bb5c9b8 899c47ae bb6fb71e 91386409'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + '9c648139 053fb521 f828af60 6b4d3dba' + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + '3348b3c1 856a429b f97e7e31 c2e5bd66' + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + '98f54449 579b4468 17afbd17 273e662c' + '97ee7299 5ef42640 c550b901 3fad0761' + '353c7086 a272c240 88be9476 9fd16650'). replace(/ /g, ''), 'hex') } }; module.exports = { info: algInfo, privInfo: algPrivInfo, hashAlgs: hashAlgs, curves: curves }; ```
/content/code_sandbox/node_modules/sshpk/lib/algs.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,976
```javascript module.exports = { read: read, verify: verify, sign: sign, signAsync: signAsync, write: write, /* Internal private API */ fromBuffer: fromBuffer, toBuffer: toBuffer }; var assert = require('assert-plus'); var SSHBuffer = require('../ssh-buffer'); var crypto = require('crypto'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var Key = require('../key'); var PrivateKey = require('../private-key'); var Identity = require('../identity'); var rfc4253 = require('./rfc4253'); var Signature = require('../signature'); var utils = require('../utils'); var Certificate = require('../certificate'); function verify(cert, key) { /* * We always give an issuerKey, so if our verify() is being called then * there was no signature. Return false. */ return (false); } var TYPES = { 'user': 1, 'host': 2 }; Object.keys(TYPES).forEach(function (k) { TYPES[TYPES[k]] = k; }); var ECDSA_ALGO = /^ecdsa-sha2-([^@-]+)-cert-v01@openssh.com$/; function read(buf, options) { if (Buffer.isBuffer(buf)) buf = buf.toString('ascii'); var parts = buf.trim().split(/[ \t\n]+/g); if (parts.length < 2 || parts.length > 3) throw (new Error('Not a valid SSH certificate line')); var algo = parts[0]; var data = parts[1]; data = Buffer.from(data, 'base64'); return (fromBuffer(data, algo)); } function fromBuffer(data, algo, partial) { var sshbuf = new SSHBuffer({ buffer: data }); var innerAlgo = sshbuf.readString(); if (algo !== undefined && innerAlgo !== algo) throw (new Error('SSH certificate algorithm mismatch')); if (algo === undefined) algo = innerAlgo; var cert = {}; cert.signatures = {}; cert.signatures.openssh = {}; cert.signatures.openssh.nonce = sshbuf.readBuffer(); var key = {}; var parts = (key.parts = []); key.type = getAlg(algo); var partCount = algs.info[key.type].parts.length; while (parts.length < partCount) parts.push(sshbuf.readPart()); assert.ok(parts.length >= 1, 'key must have at least one part'); var algInfo = algs.info[key.type]; if (key.type === 'ecdsa') { var res = ECDSA_ALGO.exec(algo); assert.ok(res !== null); assert.strictEqual(res[1], parts[0].data.toString()); } for (var i = 0; i < algInfo.parts.length; ++i) { parts[i].name = algInfo.parts[i]; if (parts[i].name !== 'curve' && algInfo.normalize !== false) { var p = parts[i]; p.data = utils.mpNormalize(p.data); } } cert.subjectKey = new Key(key); cert.serial = sshbuf.readInt64(); var type = TYPES[sshbuf.readInt()]; assert.string(type, 'valid cert type'); cert.signatures.openssh.keyId = sshbuf.readString(); var principals = []; var pbuf = sshbuf.readBuffer(); var psshbuf = new SSHBuffer({ buffer: pbuf }); while (!psshbuf.atEnd()) principals.push(psshbuf.readString()); if (principals.length === 0) principals = ['*']; cert.subjects = principals.map(function (pr) { if (type === 'user') return (Identity.forUser(pr)); else if (type === 'host') return (Identity.forHost(pr)); throw (new Error('Unknown identity type ' + type)); }); cert.validFrom = int64ToDate(sshbuf.readInt64()); cert.validUntil = int64ToDate(sshbuf.readInt64()); var exts = []; var extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); var ext; while (!extbuf.atEnd()) { ext = { critical: true }; ext.name = extbuf.readString(); ext.data = extbuf.readBuffer(); exts.push(ext); } extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); while (!extbuf.atEnd()) { ext = { critical: false }; ext.name = extbuf.readString(); ext.data = extbuf.readBuffer(); exts.push(ext); } cert.signatures.openssh.exts = exts; /* reserved */ sshbuf.readBuffer(); var signingKeyBuf = sshbuf.readBuffer(); cert.issuerKey = rfc4253.read(signingKeyBuf); /* * OpenSSH certs don't give the identity of the issuer, just their * public key. So, we use an Identity that matches anything. The * isSignedBy() function will later tell you if the key matches. */ cert.issuer = Identity.forHost('**'); var sigBuf = sshbuf.readBuffer(); cert.signatures.openssh.signature = Signature.parse(sigBuf, cert.issuerKey.type, 'ssh'); if (partial !== undefined) { partial.remainder = sshbuf.remainder(); partial.consumed = sshbuf._offset; } return (new Certificate(cert)); } function int64ToDate(buf) { var i = buf.readUInt32BE(0) * 4294967296; i += buf.readUInt32BE(4); var d = new Date(); d.setTime(i * 1000); d.sourceInt64 = buf; return (d); } function dateToInt64(date) { if (date.sourceInt64 !== undefined) return (date.sourceInt64); var i = Math.round(date.getTime() / 1000); var upper = Math.floor(i / 4294967296); var lower = Math.floor(i % 4294967296); var buf = Buffer.alloc(8); buf.writeUInt32BE(upper, 0); buf.writeUInt32BE(lower, 4); return (buf); } function sign(cert, key) { if (cert.signatures.openssh === undefined) cert.signatures.openssh = {}; try { var blob = toBuffer(cert, true); } catch (e) { delete (cert.signatures.openssh); return (false); } var sig = cert.signatures.openssh; var hashAlgo = undefined; if (key.type === 'rsa' || key.type === 'dsa') hashAlgo = 'sha1'; var signer = key.createSign(hashAlgo); signer.write(blob); sig.signature = signer.sign(); return (true); } function signAsync(cert, signer, done) { if (cert.signatures.openssh === undefined) cert.signatures.openssh = {}; try { var blob = toBuffer(cert, true); } catch (e) { delete (cert.signatures.openssh); done(e); return; } var sig = cert.signatures.openssh; signer(blob, function (err, signature) { if (err) { done(err); return; } try { /* * This will throw if the signature isn't of a * type/algo that can be used for SSH. */ signature.toBuffer('ssh'); } catch (e) { done(e); return; } sig.signature = signature; done(); }); } function write(cert, options) { if (options === undefined) options = {}; var blob = toBuffer(cert); var out = getCertType(cert.subjectKey) + ' ' + blob.toString('base64'); if (options.comment) out = out + ' ' + options.comment; return (out); } function toBuffer(cert, noSig) { assert.object(cert.signatures.openssh, 'signature for openssh format'); var sig = cert.signatures.openssh; if (sig.nonce === undefined) sig.nonce = crypto.randomBytes(16); var buf = new SSHBuffer({}); buf.writeString(getCertType(cert.subjectKey)); buf.writeBuffer(sig.nonce); var key = cert.subjectKey; var algInfo = algs.info[key.type]; algInfo.parts.forEach(function (part) { buf.writePart(key.part[part]); }); buf.writeInt64(cert.serial); var type = cert.subjects[0].type; assert.notStrictEqual(type, 'unknown'); cert.subjects.forEach(function (id) { assert.strictEqual(id.type, type); }); type = TYPES[type]; buf.writeInt(type); if (sig.keyId === undefined) { sig.keyId = cert.subjects[0].type + '_' + (cert.subjects[0].uid || cert.subjects[0].hostname); } buf.writeString(sig.keyId); var sub = new SSHBuffer({}); cert.subjects.forEach(function (id) { if (type === TYPES.host) sub.writeString(id.hostname); else if (type === TYPES.user) sub.writeString(id.uid); }); buf.writeBuffer(sub.toBuffer()); buf.writeInt64(dateToInt64(cert.validFrom)); buf.writeInt64(dateToInt64(cert.validUntil)); var exts = sig.exts; if (exts === undefined) exts = []; var extbuf = new SSHBuffer({}); exts.forEach(function (ext) { if (ext.critical !== true) return; extbuf.writeString(ext.name); extbuf.writeBuffer(ext.data); }); buf.writeBuffer(extbuf.toBuffer()); extbuf = new SSHBuffer({}); exts.forEach(function (ext) { if (ext.critical === true) return; extbuf.writeString(ext.name); extbuf.writeBuffer(ext.data); }); buf.writeBuffer(extbuf.toBuffer()); /* reserved */ buf.writeBuffer(Buffer.alloc(0)); sub = rfc4253.write(cert.issuerKey); buf.writeBuffer(sub); if (!noSig) buf.writeBuffer(sig.signature.toBuffer('ssh')); return (buf.toBuffer()); } function getAlg(certType) { if (certType === 'ssh-rsa-cert-v01@openssh.com') return ('rsa'); if (certType === 'ssh-dss-cert-v01@openssh.com') return ('dsa'); if (certType.match(ECDSA_ALGO)) return ('ecdsa'); if (certType === 'ssh-ed25519-cert-v01@openssh.com') return ('ed25519'); throw (new Error('Unsupported cert type ' + certType)); } function getCertType(key) { if (key.type === 'rsa') return ('ssh-rsa-cert-v01@openssh.com'); if (key.type === 'dsa') return ('ssh-dss-cert-v01@openssh.com'); if (key.type === 'ecdsa') return ('ecdsa-sha2-' + key.curve + '-cert-v01@openssh.com'); if (key.type === 'ed25519') return ('ssh-ed25519-cert-v01@openssh.com'); throw (new Error('Unsupported key type ' + key.type)); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/openssh-cert.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,377
```javascript module.exports = { read: read.bind(undefined, false, undefined), readType: read.bind(undefined, false), write: write, /* semi-private api, used by sshpk-agent */ readPartial: read.bind(undefined, true), /* shared with ssh format */ readInternal: read, keyTypeToAlg: keyTypeToAlg, algToKeyType: algToKeyType }; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var SSHBuffer = require('../ssh-buffer'); function algToKeyType(alg) { assert.string(alg); if (alg === 'ssh-dss') return ('dsa'); else if (alg === 'ssh-rsa') return ('rsa'); else if (alg === 'ssh-ed25519') return ('ed25519'); else if (alg === 'ssh-curve25519') return ('curve25519'); else if (alg.match(/^ecdsa-sha2-/)) return ('ecdsa'); else throw (new Error('Unknown algorithm ' + alg)); } function keyTypeToAlg(key) { assert.object(key); if (key.type === 'dsa') return ('ssh-dss'); else if (key.type === 'rsa') return ('ssh-rsa'); else if (key.type === 'ed25519') return ('ssh-ed25519'); else if (key.type === 'curve25519') return ('ssh-curve25519'); else if (key.type === 'ecdsa') return ('ecdsa-sha2-' + key.part.curve.data.toString()); else throw (new Error('Unknown key type ' + key.type)); } function read(partial, type, buf, options) { if (typeof (buf) === 'string') buf = Buffer.from(buf); assert.buffer(buf, 'buf'); var key = {}; var parts = key.parts = []; var sshbuf = new SSHBuffer({buffer: buf}); var alg = sshbuf.readString(); assert.ok(!sshbuf.atEnd(), 'key must have at least one part'); key.type = algToKeyType(alg); var partCount = algs.info[key.type].parts.length; if (type && type === 'private') partCount = algs.privInfo[key.type].parts.length; while (!sshbuf.atEnd() && parts.length < partCount) parts.push(sshbuf.readPart()); while (!partial && !sshbuf.atEnd()) parts.push(sshbuf.readPart()); assert.ok(parts.length >= 1, 'key must have at least one part'); assert.ok(partial || sshbuf.atEnd(), 'leftover bytes at end of key'); var Constructor = Key; var algInfo = algs.info[key.type]; if (type === 'private' || algInfo.parts.length !== parts.length) { algInfo = algs.privInfo[key.type]; Constructor = PrivateKey; } assert.strictEqual(algInfo.parts.length, parts.length); if (key.type === 'ecdsa') { var res = /^ecdsa-sha2-(.+)$/.exec(alg); assert.ok(res !== null); assert.strictEqual(res[1], parts[0].data.toString()); } var normalized = true; for (var i = 0; i < algInfo.parts.length; ++i) { var p = parts[i]; p.name = algInfo.parts[i]; /* * OpenSSH stores ed25519 "private" keys as seed + public key * concat'd together (k followed by A). We want to keep them * separate for other formats that don't do this. */ if (key.type === 'ed25519' && p.name === 'k') p.data = p.data.slice(0, 32); if (p.name !== 'curve' && algInfo.normalize !== false) { var nd; if (key.type === 'ed25519') { nd = utils.zeroPadToLength(p.data, 32); } else { nd = utils.mpNormalize(p.data); } if (nd.toString('binary') !== p.data.toString('binary')) { p.data = nd; normalized = false; } } } if (normalized) key._rfc4253Cache = sshbuf.toBuffer(); if (partial && typeof (partial) === 'object') { partial.remainder = sshbuf.remainder(); partial.consumed = sshbuf._offset; } return (new Constructor(key)); } function write(key, options) { assert.object(key); var alg = keyTypeToAlg(key); var i; var algInfo = algs.info[key.type]; if (PrivateKey.isPrivateKey(key)) algInfo = algs.privInfo[key.type]; var parts = algInfo.parts; var buf = new SSHBuffer({}); buf.writeString(alg); for (i = 0; i < parts.length; ++i) { var data = key.part[parts[i]].data; if (algInfo.normalize !== false) { if (key.type === 'ed25519') data = utils.zeroPadToLength(data, 32); else data = utils.mpNormalize(data); } if (key.type === 'ed25519' && parts[i] === 'k') data = Buffer.concat([data, key.part.A.data]); buf.writeBuffer(data); } return (buf.toBuffer()); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/rfc4253.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,192
```javascript module.exports = { read: read, write: write }; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var Key = require('../key'); var PrivateKey = require('../private-key'); var utils = require('../utils'); var SSHBuffer = require('../ssh-buffer'); var Dhe = require('../dhe'); var supportedAlgos = { 'rsa-sha1' : 5, 'rsa-sha256' : 8, 'rsa-sha512' : 10, 'ecdsa-p256-sha256' : 13, 'ecdsa-p384-sha384' : 14 /* * ed25519 is hypothetically supported with id 15 * but the common tools available don't appear to be * capable of generating/using ed25519 keys */ }; var supportedAlgosById = {}; Object.keys(supportedAlgos).forEach(function (k) { supportedAlgosById[supportedAlgos[k]] = k.toUpperCase(); }); function read(buf, options) { if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var lines = buf.split('\n'); if (lines[0].match(/^Private-key-format\: v1/)) { var algElems = lines[1].split(' '); var algoNum = parseInt(algElems[1], 10); var algoName = algElems[2]; if (!supportedAlgosById[algoNum]) throw (new Error('Unsupported algorithm: ' + algoName)); return (readDNSSECPrivateKey(algoNum, lines.slice(2))); } // skip any comment-lines var line = 0; /* JSSTYLED */ while (lines[line].match(/^\;/)) line++; // we should now have *one single* line left with our KEY on it. if ((lines[line].match(/\. IN KEY /) || lines[line].match(/\. IN DNSKEY /)) && lines[line+1].length === 0) { return (readRFC3110(lines[line])); } throw (new Error('Cannot parse dnssec key')); } function readRFC3110(keyString) { var elems = keyString.split(' '); //unused var flags = parseInt(elems[3], 10); //unused var protocol = parseInt(elems[4], 10); var algorithm = parseInt(elems[5], 10); if (!supportedAlgosById[algorithm]) throw (new Error('Unsupported algorithm: ' + algorithm)); var base64key = elems.slice(6, elems.length).join(); var keyBuffer = Buffer.from(base64key, 'base64'); if (supportedAlgosById[algorithm].match(/^RSA-/)) { // join the rest of the body into a single base64-blob var publicExponentLen = keyBuffer.readUInt8(0); if (publicExponentLen != 3 && publicExponentLen != 1) throw (new Error('Cannot parse dnssec key: ' + 'unsupported exponent length')); var publicExponent = keyBuffer.slice(1, publicExponentLen+1); publicExponent = utils.mpNormalize(publicExponent); var modulus = keyBuffer.slice(1+publicExponentLen); modulus = utils.mpNormalize(modulus); // now, make the key var rsaKey = { type: 'rsa', parts: [] }; rsaKey.parts.push({ name: 'e', data: publicExponent}); rsaKey.parts.push({ name: 'n', data: modulus}); return (new Key(rsaKey)); } if (supportedAlgosById[algorithm] === 'ECDSA-P384-SHA384' || supportedAlgosById[algorithm] === 'ECDSA-P256-SHA256') { var curve = 'nistp384'; var size = 384; if (supportedAlgosById[algorithm].match(/^ECDSA-P256-SHA256/)) { curve = 'nistp256'; size = 256; } var ecdsaKey = { type: 'ecdsa', curve: curve, size: size, parts: [ {name: 'curve', data: Buffer.from(curve) }, {name: 'Q', data: utils.ecNormalize(keyBuffer) } ] }; return (new Key(ecdsaKey)); } throw (new Error('Unsupported algorithm: ' + supportedAlgosById[algorithm])); } function elementToBuf(e) { return (Buffer.from(e.split(' ')[1], 'base64')); } function readDNSSECRSAPrivateKey(elements) { var rsaParams = {}; elements.forEach(function (element) { if (element.split(' ')[0] === 'Modulus:') rsaParams['n'] = elementToBuf(element); else if (element.split(' ')[0] === 'PublicExponent:') rsaParams['e'] = elementToBuf(element); else if (element.split(' ')[0] === 'PrivateExponent:') rsaParams['d'] = elementToBuf(element); else if (element.split(' ')[0] === 'Prime1:') rsaParams['p'] = elementToBuf(element); else if (element.split(' ')[0] === 'Prime2:') rsaParams['q'] = elementToBuf(element); else if (element.split(' ')[0] === 'Exponent1:') rsaParams['dmodp'] = elementToBuf(element); else if (element.split(' ')[0] === 'Exponent2:') rsaParams['dmodq'] = elementToBuf(element); else if (element.split(' ')[0] === 'Coefficient:') rsaParams['iqmp'] = elementToBuf(element); }); // now, make the key var key = { type: 'rsa', parts: [ { name: 'e', data: utils.mpNormalize(rsaParams['e'])}, { name: 'n', data: utils.mpNormalize(rsaParams['n'])}, { name: 'd', data: utils.mpNormalize(rsaParams['d'])}, { name: 'p', data: utils.mpNormalize(rsaParams['p'])}, { name: 'q', data: utils.mpNormalize(rsaParams['q'])}, { name: 'dmodp', data: utils.mpNormalize(rsaParams['dmodp'])}, { name: 'dmodq', data: utils.mpNormalize(rsaParams['dmodq'])}, { name: 'iqmp', data: utils.mpNormalize(rsaParams['iqmp'])} ] }; return (new PrivateKey(key)); } function readDNSSECPrivateKey(alg, elements) { if (supportedAlgosById[alg].match(/^RSA-/)) { return (readDNSSECRSAPrivateKey(elements)); } if (supportedAlgosById[alg] === 'ECDSA-P384-SHA384' || supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { var d = Buffer.from(elements[0].split(' ')[1], 'base64'); var curve = 'nistp384'; var size = 384; if (supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { curve = 'nistp256'; size = 256; } // DNSSEC generates the public-key on the fly (go calculate it) var publicKey = utils.publicFromPrivateECDSA(curve, d); var Q = publicKey.part['Q'].data; var ecdsaKey = { type: 'ecdsa', curve: curve, size: size, parts: [ {name: 'curve', data: Buffer.from(curve) }, {name: 'd', data: d }, {name: 'Q', data: Q } ] }; return (new PrivateKey(ecdsaKey)); } throw (new Error('Unsupported algorithm: ' + supportedAlgosById[alg])); } function dnssecTimestamp(date) { var year = date.getFullYear() + ''; //stringify var month = (date.getMonth() + 1); var timestampStr = year + month + date.getUTCDate(); timestampStr += '' + date.getUTCHours() + date.getUTCMinutes(); timestampStr += date.getUTCSeconds(); return (timestampStr); } function rsaAlgFromOptions(opts) { if (!opts || !opts.hashAlgo || opts.hashAlgo === 'sha1') return ('5 (RSASHA1)'); else if (opts.hashAlgo === 'sha256') return ('8 (RSASHA256)'); else if (opts.hashAlgo === 'sha512') return ('10 (RSASHA512)'); else throw (new Error('Unknown or unsupported hash: ' + opts.hashAlgo)); } function writeRSA(key, options) { // if we're missing parts, add them. if (!key.part.dmodp || !key.part.dmodq) { utils.addRSAMissing(key); } var out = ''; out += 'Private-key-format: v1.3\n'; out += 'Algorithm: ' + rsaAlgFromOptions(options) + '\n'; var n = utils.mpDenormalize(key.part['n'].data); out += 'Modulus: ' + n.toString('base64') + '\n'; var e = utils.mpDenormalize(key.part['e'].data); out += 'PublicExponent: ' + e.toString('base64') + '\n'; var d = utils.mpDenormalize(key.part['d'].data); out += 'PrivateExponent: ' + d.toString('base64') + '\n'; var p = utils.mpDenormalize(key.part['p'].data); out += 'Prime1: ' + p.toString('base64') + '\n'; var q = utils.mpDenormalize(key.part['q'].data); out += 'Prime2: ' + q.toString('base64') + '\n'; var dmodp = utils.mpDenormalize(key.part['dmodp'].data); out += 'Exponent1: ' + dmodp.toString('base64') + '\n'; var dmodq = utils.mpDenormalize(key.part['dmodq'].data); out += 'Exponent2: ' + dmodq.toString('base64') + '\n'; var iqmp = utils.mpDenormalize(key.part['iqmp'].data); out += 'Coefficient: ' + iqmp.toString('base64') + '\n'; // Assume that we're valid as-of now var timestamp = new Date(); out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; return (Buffer.from(out, 'ascii')); } function writeECDSA(key, options) { var out = ''; out += 'Private-key-format: v1.3\n'; if (key.curve === 'nistp256') { out += 'Algorithm: 13 (ECDSAP256SHA256)\n'; } else if (key.curve === 'nistp384') { out += 'Algorithm: 14 (ECDSAP384SHA384)\n'; } else { throw (new Error('Unsupported curve')); } var base64Key = key.part['d'].data.toString('base64'); out += 'PrivateKey: ' + base64Key + '\n'; // Assume that we're valid as-of now var timestamp = new Date(); out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; return (Buffer.from(out, 'ascii')); } function write(key, options) { if (PrivateKey.isPrivateKey(key)) { if (key.type === 'rsa') { return (writeRSA(key, options)); } else if (key.type === 'ecdsa') { return (writeECDSA(key, options)); } else { throw (new Error('Unsupported algorithm: ' + key.type)); } } else if (Key.isKey(key)) { /* * RFC3110 requires a keyname, and a keytype, which we * don't really have a mechanism for specifying such * additional metadata. */ throw (new Error('Format "dnssec" only supports ' + 'writing private keys')); } else { throw (new Error('key is not a Key or PrivateKey')); } } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/dnssec.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,784
```javascript module.exports = { read: read, verify: verify, sign: sign, signAsync: signAsync, write: write }; var assert = require('assert-plus'); var asn1 = require('asn1'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var pem = require('./pem'); var Identity = require('../identity'); var Signature = require('../signature'); var Certificate = require('../certificate'); var pkcs8 = require('./pkcs8'); /* * This file is based on RFC5280 (X.509). */ /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function verify(cert, key) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); var algParts = sig.algo.split('-'); if (algParts[0] !== key.type) return (false); var blob = sig.cache; if (blob === undefined) { var der = new asn1.BerWriter(); writeTBSCert(cert, der); blob = der.buffer; } var verifier = key.createVerify(algParts[1]); verifier.write(blob); return (verifier.verify(sig.signature)); } function Local(i) { return (asn1.Ber.Context | asn1.Ber.Constructor | i); } function Context(i) { return (asn1.Ber.Context | i); } var SIGN_ALGS = { 'rsa-md5': '1.2.840.113549.1.1.4', 'rsa-sha1': '1.2.840.113549.1.1.5', 'rsa-sha256': '1.2.840.113549.1.1.11', 'rsa-sha384': '1.2.840.113549.1.1.12', 'rsa-sha512': '1.2.840.113549.1.1.13', 'dsa-sha1': '1.2.840.10040.4.3', 'dsa-sha256': '2.16.840.1.101.3.4.3.2', 'ecdsa-sha1': '1.2.840.10045.4.1', 'ecdsa-sha256': '1.2.840.10045.4.3.2', 'ecdsa-sha384': '1.2.840.10045.4.3.3', 'ecdsa-sha512': '1.2.840.10045.4.3.4', 'ed25519-sha512': '1.3.101.112' }; Object.keys(SIGN_ALGS).forEach(function (k) { SIGN_ALGS[SIGN_ALGS[k]] = k; }); SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; var EXTS = { 'issuerKeyId': '2.5.29.35', 'altName': '2.5.29.17', 'basicConstraints': '2.5.29.19', 'keyUsage': '2.5.29.15', 'extKeyUsage': '2.5.29.37' }; function read(buf, options) { if (typeof (buf) === 'string') { buf = Buffer.from(buf, 'binary'); } assert.buffer(buf, 'buf'); var der = new asn1.BerReader(buf); der.readSequence(); if (Math.abs(der.length - der.remain) > 1) { throw (new Error('DER sequence does not contain whole byte ' + 'stream')); } var tbsStart = der.offset; der.readSequence(); var sigOffset = der.offset + der.length; var tbsEnd = sigOffset; if (der.peek() === Local(0)) { der.readSequence(Local(0)); var version = der.readInt(); assert.ok(version <= 3, 'only x.509 versions up to v3 supported'); } var cert = {}; cert.signatures = {}; var sig = (cert.signatures.x509 = {}); sig.extras = {}; cert.serial = readMPInt(der, 'serial'); der.readSequence(); var after = der.offset + der.length; var certAlgOid = der.readOID(); var certAlg = SIGN_ALGS[certAlgOid]; if (certAlg === undefined) throw (new Error('unknown signature algorithm ' + certAlgOid)); der._offset = after; cert.issuer = Identity.parseAsn1(der); der.readSequence(); cert.validFrom = readDate(der); cert.validUntil = readDate(der); cert.subjects = [Identity.parseAsn1(der)]; der.readSequence(); after = der.offset + der.length; cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); der._offset = after; /* issuerUniqueID */ if (der.peek() === Local(1)) { der.readSequence(Local(1)); sig.extras.issuerUniqueID = buf.slice(der.offset, der.offset + der.length); der._offset += der.length; } /* subjectUniqueID */ if (der.peek() === Local(2)) { der.readSequence(Local(2)); sig.extras.subjectUniqueID = buf.slice(der.offset, der.offset + der.length); der._offset += der.length; } /* extensions */ if (der.peek() === Local(3)) { der.readSequence(Local(3)); var extEnd = der.offset + der.length; der.readSequence(); while (der.offset < extEnd) readExtension(cert, buf, der); assert.strictEqual(der.offset, extEnd); } assert.strictEqual(der.offset, sigOffset); der.readSequence(); after = der.offset + der.length; var sigAlgOid = der.readOID(); var sigAlg = SIGN_ALGS[sigAlgOid]; if (sigAlg === undefined) throw (new Error('unknown signature algorithm ' + sigAlgOid)); der._offset = after; var sigData = der.readString(asn1.Ber.BitString, true); if (sigData[0] === 0) sigData = sigData.slice(1); var algParts = sigAlg.split('-'); sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); sig.signature.hashAlgorithm = algParts[1]; sig.algo = sigAlg; sig.cache = buf.slice(tbsStart, tbsEnd); return (new Certificate(cert)); } function readDate(der) { if (der.peek() === asn1.Ber.UTCTime) { return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); } else if (der.peek() === asn1.Ber.GeneralizedTime) { return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); } else { throw (new Error('Unsupported date format')); } } function writeDate(der, date) { if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); } else { der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); } } /* RFC5280, section 4.2.1.6 (GeneralName type) */ var ALTNAME = { OtherName: Local(0), RFC822Name: Context(1), DNSName: Context(2), X400Address: Local(3), DirectoryName: Local(4), EDIPartyName: Local(5), URI: Context(6), IPAddress: Context(7), OID: Context(8) }; /* RFC5280, section 4.2.1.12 (KeyPurposeId) */ var EXTPURPOSE = { 'serverAuth': '1.3.6.1.5.5.7.3.1', 'clientAuth': '1.3.6.1.5.5.7.3.2', 'codeSigning': '1.3.6.1.5.5.7.3.3', /* See path_to_url */ 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' }; var EXTPURPOSE_REV = {}; Object.keys(EXTPURPOSE).forEach(function (k) { EXTPURPOSE_REV[EXTPURPOSE[k]] = k; }); var KEYUSEBITS = [ 'signature', 'identity', 'keyEncryption', 'encryption', 'keyAgreement', 'ca', 'crl' ]; function readExtension(cert, buf, der) { der.readSequence(); var after = der.offset + der.length; var extId = der.readOID(); var id; var sig = cert.signatures.x509; if (!sig.extras.exts) sig.extras.exts = []; var critical; if (der.peek() === asn1.Ber.Boolean) critical = der.readBoolean(); switch (extId) { case (EXTS.basicConstraints): der.readSequence(asn1.Ber.OctetString); der.readSequence(); var bcEnd = der.offset + der.length; var ca = false; if (der.peek() === asn1.Ber.Boolean) ca = der.readBoolean(); if (cert.purposes === undefined) cert.purposes = []; if (ca === true) cert.purposes.push('ca'); var bc = { oid: extId, critical: critical }; if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) bc.pathLen = der.readInt(); sig.extras.exts.push(bc); break; case (EXTS.extKeyUsage): der.readSequence(asn1.Ber.OctetString); der.readSequence(); if (cert.purposes === undefined) cert.purposes = []; var ekEnd = der.offset + der.length; while (der.offset < ekEnd) { var oid = der.readOID(); cert.purposes.push(EXTPURPOSE_REV[oid] || oid); } /* * This is a bit of a hack: in the case where we have a cert * that's only allowed to do serverAuth or clientAuth (and not * the other), we want to make sure all our Subjects are of * the right type. But we already parsed our Subjects and * decided if they were hosts or users earlier (since it appears * first in the cert). * * So we go through and mutate them into the right kind here if * it doesn't match. This might not be hugely beneficial, as it * seems that single-purpose certs are not often seen in the * wild. */ if (cert.purposes.indexOf('serverAuth') !== -1 && cert.purposes.indexOf('clientAuth') === -1) { cert.subjects.forEach(function (ide) { if (ide.type !== 'host') { ide.type = 'host'; ide.hostname = ide.uid || ide.email || ide.components[0].value; } }); } else if (cert.purposes.indexOf('clientAuth') !== -1 && cert.purposes.indexOf('serverAuth') === -1) { cert.subjects.forEach(function (ide) { if (ide.type !== 'user') { ide.type = 'user'; ide.uid = ide.hostname || ide.email || ide.components[0].value; } }); } sig.extras.exts.push({ oid: extId, critical: critical }); break; case (EXTS.keyUsage): der.readSequence(asn1.Ber.OctetString); var bits = der.readString(asn1.Ber.BitString, true); var setBits = readBitField(bits, KEYUSEBITS); setBits.forEach(function (bit) { if (cert.purposes === undefined) cert.purposes = []; if (cert.purposes.indexOf(bit) === -1) cert.purposes.push(bit); }); sig.extras.exts.push({ oid: extId, critical: critical, bits: bits }); break; case (EXTS.altName): der.readSequence(asn1.Ber.OctetString); der.readSequence(); var aeEnd = der.offset + der.length; while (der.offset < aeEnd) { switch (der.peek()) { case ALTNAME.OtherName: case ALTNAME.EDIPartyName: der.readSequence(); der._offset += der.length; break; case ALTNAME.OID: der.readOID(ALTNAME.OID); break; case ALTNAME.RFC822Name: /* RFC822 specifies email addresses */ var email = der.readString(ALTNAME.RFC822Name); id = Identity.forEmail(email); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; case ALTNAME.DirectoryName: der.readSequence(ALTNAME.DirectoryName); id = Identity.parseAsn1(der); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; case ALTNAME.DNSName: var host = der.readString( ALTNAME.DNSName); id = Identity.forHost(host); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; default: der.readString(der.peek()); break; } } sig.extras.exts.push({ oid: extId, critical: critical }); break; default: sig.extras.exts.push({ oid: extId, critical: critical, data: der.readString(asn1.Ber.OctetString, true) }); break; } der._offset = after; } var UTCTIME_RE = /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; function utcTimeToDate(t) { var m = t.match(UTCTIME_RE); assert.ok(m, 'timestamps must be in UTC'); var d = new Date(); var thisYear = d.getUTCFullYear(); var century = Math.floor(thisYear / 100) * 100; var year = parseInt(m[1], 10); if (thisYear % 100 < 50 && year >= 60) year += (century - 1); else year += century; d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); if (m[6] && m[6].length > 0) d.setUTCSeconds(parseInt(m[6], 10)); return (d); } var GTIME_RE = /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; function gTimeToDate(t) { var m = t.match(GTIME_RE); assert.ok(m); var d = new Date(); d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, parseInt(m[3], 10)); d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); if (m[6] && m[6].length > 0) d.setUTCSeconds(parseInt(m[6], 10)); return (d); } function zeroPad(n, m) { if (m === undefined) m = 2; var s = '' + n; while (s.length < m) s = '0' + s; return (s); } function dateToUTCTime(d) { var s = ''; s += zeroPad(d.getUTCFullYear() % 100); s += zeroPad(d.getUTCMonth() + 1); s += zeroPad(d.getUTCDate()); s += zeroPad(d.getUTCHours()); s += zeroPad(d.getUTCMinutes()); s += zeroPad(d.getUTCSeconds()); s += 'Z'; return (s); } function dateToGTime(d) { var s = ''; s += zeroPad(d.getUTCFullYear(), 4); s += zeroPad(d.getUTCMonth() + 1); s += zeroPad(d.getUTCDate()); s += zeroPad(d.getUTCHours()); s += zeroPad(d.getUTCMinutes()); s += zeroPad(d.getUTCSeconds()); s += 'Z'; return (s); } function sign(cert, key) { if (cert.signatures.x509 === undefined) cert.signatures.x509 = {}; var sig = cert.signatures.x509; sig.algo = key.type + '-' + key.defaultHashAlgorithm(); if (SIGN_ALGS[sig.algo] === undefined) return (false); var der = new asn1.BerWriter(); writeTBSCert(cert, der); var blob = der.buffer; sig.cache = blob; var signer = key.createSign(); signer.write(blob); cert.signatures.x509.signature = signer.sign(); return (true); } function signAsync(cert, signer, done) { if (cert.signatures.x509 === undefined) cert.signatures.x509 = {}; var sig = cert.signatures.x509; var der = new asn1.BerWriter(); writeTBSCert(cert, der); var blob = der.buffer; sig.cache = blob; signer(blob, function (err, signature) { if (err) { done(err); return; } sig.algo = signature.type + '-' + signature.hashAlgorithm; if (SIGN_ALGS[sig.algo] === undefined) { done(new Error('Invalid signing algorithm "' + sig.algo + '"')); return; } sig.signature = signature; done(); }); } function write(cert, options) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); var der = new asn1.BerWriter(); der.startSequence(); if (sig.cache) { der._ensure(sig.cache.length); sig.cache.copy(der._buf, der._offset); der._offset += sig.cache.length; } else { writeTBSCert(cert, der); } der.startSequence(); der.writeOID(SIGN_ALGS[sig.algo]); if (sig.algo.match(/^rsa-/)) der.writeNull(); der.endSequence(); var sigData = sig.signature.toBuffer('asn1'); var data = Buffer.alloc(sigData.length + 1); data[0] = 0; sigData.copy(data, 1); der.writeBuffer(data, asn1.Ber.BitString); der.endSequence(); return (der.buffer); } function writeTBSCert(cert, der) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); der.startSequence(); der.startSequence(Local(0)); der.writeInt(2); der.endSequence(); der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer); der.startSequence(); der.writeOID(SIGN_ALGS[sig.algo]); if (sig.algo.match(/^rsa-/)) der.writeNull(); der.endSequence(); cert.issuer.toAsn1(der); der.startSequence(); writeDate(der, cert.validFrom); writeDate(der, cert.validUntil); der.endSequence(); var subject = cert.subjects[0]; var altNames = cert.subjects.slice(1); subject.toAsn1(der); pkcs8.writePkcs8(der, cert.subjectKey); if (sig.extras && sig.extras.issuerUniqueID) { der.writeBuffer(sig.extras.issuerUniqueID, Local(1)); } if (sig.extras && sig.extras.subjectUniqueID) { der.writeBuffer(sig.extras.subjectUniqueID, Local(2)); } if (altNames.length > 0 || subject.type === 'host' || (cert.purposes !== undefined && cert.purposes.length > 0) || (sig.extras && sig.extras.exts)) { der.startSequence(Local(3)); der.startSequence(); var exts = []; if (cert.purposes !== undefined && cert.purposes.length > 0) { exts.push({ oid: EXTS.basicConstraints, critical: true }); exts.push({ oid: EXTS.keyUsage, critical: true }); exts.push({ oid: EXTS.extKeyUsage, critical: true }); } exts.push({ oid: EXTS.altName }); if (sig.extras && sig.extras.exts) exts = sig.extras.exts; for (var i = 0; i < exts.length; ++i) { der.startSequence(); der.writeOID(exts[i].oid); if (exts[i].critical !== undefined) der.writeBoolean(exts[i].critical); if (exts[i].oid === EXTS.altName) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); if (subject.type === 'host') { der.writeString(subject.hostname, Context(2)); } for (var j = 0; j < altNames.length; ++j) { if (altNames[j].type === 'host') { der.writeString( altNames[j].hostname, ALTNAME.DNSName); } else if (altNames[j].type === 'email') { der.writeString( altNames[j].email, ALTNAME.RFC822Name); } else { /* * Encode anything else as a * DN style name for now. */ der.startSequence( ALTNAME.DirectoryName); altNames[j].toAsn1(der); der.endSequence(); } } der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.basicConstraints) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); var ca = (cert.purposes.indexOf('ca') !== -1); var pathLen = exts[i].pathLen; der.writeBoolean(ca); if (pathLen !== undefined) der.writeInt(pathLen); der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.extKeyUsage) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); cert.purposes.forEach(function (purpose) { if (purpose === 'ca') return; if (KEYUSEBITS.indexOf(purpose) !== -1) return; var oid = purpose; if (EXTPURPOSE[purpose] !== undefined) oid = EXTPURPOSE[purpose]; der.writeOID(oid); }); der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.keyUsage) { der.startSequence(asn1.Ber.OctetString); /* * If we parsed this certificate from a byte * stream (i.e. we didn't generate it in sshpk) * then we'll have a ".bits" property on the * ext with the original raw byte contents. * * If we have this, use it here instead of * regenerating it. This guarantees we output * the same data we parsed, so signatures still * validate. */ if (exts[i].bits !== undefined) { der.writeBuffer(exts[i].bits, asn1.Ber.BitString); } else { var bits = writeBitField(cert.purposes, KEYUSEBITS); der.writeBuffer(bits, asn1.Ber.BitString); } der.endSequence(); } else { der.writeBuffer(exts[i].data, asn1.Ber.OctetString); } der.endSequence(); } der.endSequence(); der.endSequence(); } der.endSequence(); } /* * Reads an ASN.1 BER bitfield out of the Buffer produced by doing * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw * contents of the BitString tag, which is a count of unused bits followed by * the bits as a right-padded byte string. * * `bits` is the Buffer, `bitIndex` should contain an array of string names * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. * * Returns an array of Strings, the names of the bits that were set to 1. */ function readBitField(bits, bitIndex) { var bitLen = 8 * (bits.length - 1) - bits[0]; var setBits = {}; for (var i = 0; i < bitLen; ++i) { var byteN = 1 + Math.floor(i / 8); var bit = 7 - (i % 8); var mask = 1 << bit; var bitVal = ((bits[byteN] & mask) !== 0); var name = bitIndex[i]; if (bitVal && typeof (name) === 'string') { setBits[name] = true; } } return (Object.keys(setBits)); } /* * `setBits` is an array of strings, containing the names for each bit that * sould be set to 1. `bitIndex` is same as in `readBitField()`. * * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. */ function writeBitField(setBits, bitIndex) { var bitLen = bitIndex.length; var blen = Math.ceil(bitLen / 8); var unused = blen * 8 - bitLen; var bits = Buffer.alloc(1 + blen); // zero-filled bits[0] = unused; for (var i = 0; i < bitLen; ++i) { var byteN = 1 + Math.floor(i / 8); var bit = 7 - (i % 8); var mask = 1 << bit; var name = bitIndex[i]; if (name === undefined) continue; var bitVal = (setBits.indexOf(name) !== -1); if (bitVal) { bits[byteN] |= mask; } } return (bits); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/x509.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
6,093
```javascript module.exports = { read: read, readSSHPrivate: readSSHPrivate, write: write }; var assert = require('assert-plus'); var asn1 = require('asn1'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var utils = require('../utils'); var crypto = require('crypto'); var Key = require('../key'); var PrivateKey = require('../private-key'); var pem = require('./pem'); var rfc4253 = require('./rfc4253'); var SSHBuffer = require('../ssh-buffer'); var errors = require('../errors'); var bcrypt; function read(buf, options) { return (pem.read(buf, options)); } var MAGIC = 'openssh-key-v1'; function readSSHPrivate(type, buf, options) { buf = new SSHBuffer({buffer: buf}); var magic = buf.readCString(); assert.strictEqual(magic, MAGIC, 'bad magic string'); var cipher = buf.readString(); var kdf = buf.readString(); var kdfOpts = buf.readBuffer(); var nkeys = buf.readInt(); if (nkeys !== 1) { throw (new Error('OpenSSH-format key file contains ' + 'multiple keys: this is unsupported.')); } var pubKey = buf.readBuffer(); if (type === 'public') { assert.ok(buf.atEnd(), 'excess bytes left after key'); return (rfc4253.read(pubKey)); } var privKeyBlob = buf.readBuffer(); assert.ok(buf.atEnd(), 'excess bytes left after key'); var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); switch (kdf) { case 'none': if (cipher !== 'none') { throw (new Error('OpenSSH-format key uses KDF "none" ' + 'but specifies a cipher other than "none"')); } break; case 'bcrypt': var salt = kdfOptsBuf.readBuffer(); var rounds = kdfOptsBuf.readInt(); var cinf = utils.opensshCipherInfo(cipher); if (bcrypt === undefined) { bcrypt = require('bcrypt-pbkdf'); } if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from(options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'OpenSSH')); } var pass = new Uint8Array(options.passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = Buffer.from(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createDecipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(privKeyBlob); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privKeyBlob = Buffer.concat(chunks); break; default: throw (new Error( 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); } buf = new SSHBuffer({buffer: privKeyBlob}); var checkInt1 = buf.readInt(); var checkInt2 = buf.readInt(); if (checkInt1 !== checkInt2) { throw (new Error('Incorrect passphrase supplied, could not ' + 'decrypt key')); } var ret = {}; var key = rfc4253.readInternal(ret, 'private', buf.remainder()); buf.skip(ret.consumed); var comment = buf.readString(); key.comment = comment; return (key); } function write(key, options) { var pubKey; if (PrivateKey.isPrivateKey(key)) pubKey = key.toPublic(); else pubKey = key; var cipher = 'none'; var kdf = 'none'; var kdfopts = Buffer.alloc(0); var cinf = { blockSize: 8 }; var passphrase; if (options !== undefined) { passphrase = options.passphrase; if (typeof (passphrase) === 'string') passphrase = Buffer.from(passphrase, 'utf-8'); if (passphrase !== undefined) { assert.buffer(passphrase, 'options.passphrase'); assert.optionalString(options.cipher, 'options.cipher'); cipher = options.cipher; if (cipher === undefined) cipher = 'aes128-ctr'; cinf = utils.opensshCipherInfo(cipher); kdf = 'bcrypt'; } } var privBuf; if (PrivateKey.isPrivateKey(key)) { privBuf = new SSHBuffer({}); var checkInt = crypto.randomBytes(4).readUInt32BE(0); privBuf.writeInt(checkInt); privBuf.writeInt(checkInt); privBuf.write(key.toBuffer('rfc4253')); privBuf.writeString(key.comment || ''); var n = 1; while (privBuf._offset % cinf.blockSize !== 0) privBuf.writeChar(n++); privBuf = privBuf.toBuffer(); } switch (kdf) { case 'none': break; case 'bcrypt': var salt = crypto.randomBytes(16); var rounds = 16; var kdfssh = new SSHBuffer({}); kdfssh.writeBuffer(salt); kdfssh.writeInt(rounds); kdfopts = kdfssh.toBuffer(); if (bcrypt === undefined) { bcrypt = require('bcrypt-pbkdf'); } var pass = new Uint8Array(passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = Buffer.from(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createCipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { throw (e); }); cipherStream.write(privBuf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privBuf = Buffer.concat(chunks); break; default: throw (new Error('Unsupported kdf ' + kdf)); } var buf = new SSHBuffer({}); buf.writeCString(MAGIC); buf.writeString(cipher); /* cipher */ buf.writeString(kdf); /* kdf */ buf.writeBuffer(kdfopts); /* kdfoptions */ buf.writeInt(1); /* nkeys */ buf.writeBuffer(pubKey.toBuffer('rfc4253')); if (privBuf) buf.writeBuffer(privBuf); buf = buf.toBuffer(); var header; if (PrivateKey.isPrivateKey(key)) header = 'OPENSSH PRIVATE KEY'; else header = 'OPENSSH PUBLIC KEY'; var tmp = buf.toString('base64'); var len = tmp.length + (tmp.length / 70) + 18 + 16 + header.length*2 + 10; buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 70; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/ssh-private.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,931
```javascript module.exports = { read: read, write: write }; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var rfc4253 = require('./rfc4253'); var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var sshpriv = require('./ssh-private'); /*JSSTYLED*/ var SSHKEY_RE = /^([a-z0-9-]+)[ \t]+([a-zA-Z0-9+\/]+[=]*)([ \t]+([^ \t][^\n]*[\n]*)?)?$/; /*JSSTYLED*/ var SSHKEY_RE2 = /^([a-z0-9-]+)[ \t\n]+([a-zA-Z0-9+\/][a-zA-Z0-9+\/ \t\n=]*)([^a-zA-Z0-9+\/ \t\n=].*)?$/; function read(buf, options) { if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var trimmed = buf.trim().replace(/[\\\r]/g, ''); var m = trimmed.match(SSHKEY_RE); if (!m) m = trimmed.match(SSHKEY_RE2); assert.ok(m, 'key must match regex'); var type = rfc4253.algToKeyType(m[1]); var kbuf = Buffer.from(m[2], 'base64'); /* * This is a bit tricky. If we managed to parse the key and locate the * key comment with the regex, then do a non-partial read and assert * that we have consumed all bytes. If we couldn't locate the key * comment, though, there may be whitespace shenanigans going on that * have conjoined the comment to the rest of the key. We do a partial * read in this case to try to make the best out of a sorry situation. */ var key; var ret = {}; if (m[4]) { try { key = rfc4253.read(kbuf); } catch (e) { m = trimmed.match(SSHKEY_RE2); assert.ok(m, 'key must match regex'); kbuf = Buffer.from(m[2], 'base64'); key = rfc4253.readInternal(ret, 'public', kbuf); } } else { key = rfc4253.readInternal(ret, 'public', kbuf); } assert.strictEqual(type, key.type); if (m[4] && m[4].length > 0) { key.comment = m[4]; } else if (ret.consumed) { /* * Now the magic: trying to recover the key comment when it's * gotten conjoined to the key or otherwise shenanigan'd. * * Work out how much base64 we used, then drop all non-base64 * chars from the beginning up to this point in the the string. * Then offset in this and try to make up for missing = chars. */ var data = m[2] + (m[3] ? m[3] : ''); var realOffset = Math.ceil(ret.consumed / 3) * 4; data = data.slice(0, realOffset - 2). /*JSSTYLED*/ replace(/[^a-zA-Z0-9+\/=]/g, '') + data.slice(realOffset - 2); var padding = ret.consumed % 3; if (padding > 0 && data.slice(realOffset - 1, realOffset) !== '=') realOffset--; while (data.slice(realOffset, realOffset + 1) === '=') realOffset++; /* Finally, grab what we think is the comment & clean it up. */ var trailer = data.slice(realOffset); trailer = trailer.replace(/[\r\n]/g, ' '). replace(/^\s+/, ''); if (trailer.match(/^[a-zA-Z0-9]/)) key.comment = trailer; } return (key); } function write(key, options) { assert.object(key); if (!Key.isKey(key)) throw (new Error('Must be a public key')); var parts = []; var alg = rfc4253.keyTypeToAlg(key); parts.push(alg); var buf = rfc4253.write(key); parts.push(buf.toString('base64')); if (key.comment) parts.push(key.comment); return (Buffer.from(parts.join(' '))); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/ssh.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
994
```javascript var x509 = require('./x509'); module.exports = { read: read, verify: x509.verify, sign: x509.sign, write: write }; var assert = require('assert-plus'); var asn1 = require('asn1'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var pem = require('./pem'); var Identity = require('../identity'); var Signature = require('../signature'); var Certificate = require('../certificate'); function read(buf, options) { if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var lines = buf.trim().split(/[\r\n]+/g); var m; var si = -1; while (!m && si < lines.length) { m = lines[++si].match(/*JSSTYLED*/ /[-]+[ ]*BEGIN CERTIFICATE[ ]*[-]+/); } assert.ok(m, 'invalid PEM header'); var m2; var ei = lines.length; while (!m2 && ei > 0) { m2 = lines[--ei].match(/*JSSTYLED*/ /[-]+[ ]*END CERTIFICATE[ ]*[-]+/); } assert.ok(m2, 'invalid PEM footer'); lines = lines.slice(si, ei + 1); var headers = {}; while (true) { lines = lines.slice(1); m = lines[0].match(/*JSSTYLED*/ /^([A-Za-z0-9-]+): (.+)$/); if (!m) break; headers[m[1].toLowerCase()] = m[2]; } /* Chop off the first and last lines */ lines = lines.slice(0, -1).join(''); buf = Buffer.from(lines, 'base64'); return (x509.read(buf, options)); } function write(cert, options) { var dbuf = x509.write(cert, options); var header = 'CERTIFICATE'; var tmp = dbuf.toString('base64'); var len = tmp.length + (tmp.length / 64) + 18 + 16 + header.length*2 + 10; var buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 64; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/x509-pem.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
615
```javascript module.exports = { read: read, write: write }; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var rfc4253 = require('./rfc4253'); var Key = require('../key'); var errors = require('../errors'); function read(buf, options) { var lines = buf.toString('ascii').split(/[\r\n]+/); var found = false; var parts; var si = 0; while (si < lines.length) { parts = splitHeader(lines[si++]); if (parts && parts[0].toLowerCase() === 'putty-user-key-file-2') { found = true; break; } } if (!found) { throw (new Error('No PuTTY format first line found')); } var alg = parts[1]; parts = splitHeader(lines[si++]); assert.equal(parts[0].toLowerCase(), 'encryption'); parts = splitHeader(lines[si++]); assert.equal(parts[0].toLowerCase(), 'comment'); var comment = parts[1]; parts = splitHeader(lines[si++]); assert.equal(parts[0].toLowerCase(), 'public-lines'); var publicLines = parseInt(parts[1], 10); if (!isFinite(publicLines) || publicLines < 0 || publicLines > lines.length) { throw (new Error('Invalid public-lines count')); } var publicBuf = Buffer.from( lines.slice(si, si + publicLines).join(''), 'base64'); var keyType = rfc4253.algToKeyType(alg); var key = rfc4253.read(publicBuf); if (key.type !== keyType) { throw (new Error('Outer key algorithm mismatch')); } key.comment = comment; return (key); } function splitHeader(line) { var idx = line.indexOf(':'); if (idx === -1) return (null); var header = line.slice(0, idx); ++idx; while (line[idx] === ' ') ++idx; var rest = line.slice(idx); return ([header, rest]); } function write(key, options) { assert.object(key); if (!Key.isKey(key)) throw (new Error('Must be a public key')); var alg = rfc4253.keyTypeToAlg(key); var buf = rfc4253.write(key); var comment = key.comment || ''; var b64 = buf.toString('base64'); var lines = wrap(b64, 64); lines.unshift('Public-Lines: ' + lines.length); lines.unshift('Comment: ' + comment); lines.unshift('Encryption: none'); lines.unshift('PuTTY-User-Key-File-2: ' + alg); return (Buffer.from(lines.join('\n') + '\n')); } function wrap(txt, len) { var lines = []; var pos = 0; while (pos < txt.length) { lines.push(txt.slice(pos, pos + 64)); pos += 64; } return (lines); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/putty.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
636
```javascript module.exports = { read: read, write: write }; var assert = require('assert-plus'); var asn1 = require('asn1'); var crypto = require('crypto'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var pkcs1 = require('./pkcs1'); var pkcs8 = require('./pkcs8'); var sshpriv = require('./ssh-private'); var rfc4253 = require('./rfc4253'); var errors = require('../errors'); var OID_PBES2 = '1.2.840.113549.1.5.13'; var OID_PBKDF2 = '1.2.840.113549.1.5.12'; var OID_TO_CIPHER = { '1.2.840.113549.3.7': '3des-cbc', '2.16.840.1.101.3.4.1.2': 'aes128-cbc', '2.16.840.1.101.3.4.1.42': 'aes256-cbc' }; var CIPHER_TO_OID = {}; Object.keys(OID_TO_CIPHER).forEach(function (k) { CIPHER_TO_OID[OID_TO_CIPHER[k]] = k; }); var OID_TO_HASH = { '1.2.840.113549.2.7': 'sha1', '1.2.840.113549.2.9': 'sha256', '1.2.840.113549.2.11': 'sha512' }; var HASH_TO_OID = {}; Object.keys(OID_TO_HASH).forEach(function (k) { HASH_TO_OID[OID_TO_HASH[k]] = k; }); /* * For reading we support both PKCS#1 and PKCS#8. If we find a private key, * we just take the public component of it and use that. */ function read(buf, options, forceType) { var input = buf; if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var lines = buf.trim().split(/[\r\n]+/g); var m; var si = -1; while (!m && si < lines.length) { m = lines[++si].match(/*JSSTYLED*/ /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); } assert.ok(m, 'invalid PEM header'); var m2; var ei = lines.length; while (!m2 && ei > 0) { m2 = lines[--ei].match(/*JSSTYLED*/ /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); } assert.ok(m2, 'invalid PEM footer'); /* Begin and end banners must match key type */ assert.equal(m[2], m2[2]); var type = m[2].toLowerCase(); var alg; if (m[1]) { /* They also must match algorithms, if given */ assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); alg = m[1].trim(); } lines = lines.slice(si, ei + 1); var headers = {}; while (true) { lines = lines.slice(1); m = lines[0].match(/*JSSTYLED*/ /^([A-Za-z0-9-]+): (.+)$/); if (!m) break; headers[m[1].toLowerCase()] = m[2]; } /* Chop off the first and last lines */ lines = lines.slice(0, -1).join(''); buf = Buffer.from(lines, 'base64'); var cipher, key, iv; if (headers['proc-type']) { var parts = headers['proc-type'].split(','); if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from( options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'PEM')); } else { parts = headers['dek-info'].split(','); assert.ok(parts.length === 2); cipher = parts[0].toLowerCase(); iv = Buffer.from(parts[1], 'hex'); key = utils.opensslKeyDeriv(cipher, iv, options.passphrase, 1).key; } } } if (alg && alg.toLowerCase() === 'encrypted') { var eder = new asn1.BerReader(buf); var pbesEnd; eder.readSequence(); eder.readSequence(); pbesEnd = eder.offset + eder.length; var method = eder.readOID(); if (method !== OID_PBES2) { throw (new Error('Unsupported PEM/PKCS8 encryption ' + 'scheme: ' + method)); } eder.readSequence(); /* PBES2-params */ eder.readSequence(); /* keyDerivationFunc */ var kdfEnd = eder.offset + eder.length; var kdfOid = eder.readOID(); if (kdfOid !== OID_PBKDF2) throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); eder.readSequence(); var salt = eder.readString(asn1.Ber.OctetString, true); var iterations = eder.readInt(); var hashAlg = 'sha1'; if (eder.offset < kdfEnd) { eder.readSequence(); var hashAlgOid = eder.readOID(); hashAlg = OID_TO_HASH[hashAlgOid]; if (hashAlg === undefined) { throw (new Error('Unsupported PBKDF2 hash: ' + hashAlgOid)); } } eder._offset = kdfEnd; eder.readSequence(); /* encryptionScheme */ var cipherOid = eder.readOID(); cipher = OID_TO_CIPHER[cipherOid]; if (cipher === undefined) { throw (new Error('Unsupported PBES2 cipher: ' + cipherOid)); } iv = eder.readString(asn1.Ber.OctetString, true); eder._offset = pbesEnd; buf = eder.readString(asn1.Ber.OctetString, true); if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from( options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'PEM')); } var cinfo = utils.opensshCipherInfo(cipher); cipher = cinfo.opensslName; key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, options.passphrase); alg = undefined; } if (cipher && key && iv) { var cipherStream = crypto.createDecipheriv(cipher, key, iv); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(buf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); buf = Buffer.concat(chunks); } /* The new OpenSSH internal format abuses PEM headers */ if (alg && alg.toLowerCase() === 'openssh') return (sshpriv.readSSHPrivate(type, buf, options)); if (alg && alg.toLowerCase() === 'ssh2') return (rfc4253.readType(type, buf, options)); var der = new asn1.BerReader(buf); der.originalInput = input; /* * All of the PEM file types start with a sequence tag, so chop it * off here */ der.readSequence(); /* PKCS#1 type keys name an algorithm in the banner explicitly */ if (alg) { if (forceType) assert.strictEqual(forceType, 'pkcs1'); return (pkcs1.readPkcs1(alg, type, der)); } else { if (forceType) assert.strictEqual(forceType, 'pkcs8'); return (pkcs8.readPkcs8(alg, type, der)); } } function write(key, options, type) { assert.object(key); var alg = { 'ecdsa': 'EC', 'rsa': 'RSA', 'dsa': 'DSA', 'ed25519': 'EdDSA' }[key.type]; var header; var der = new asn1.BerWriter(); if (PrivateKey.isPrivateKey(key)) { if (type && type === 'pkcs8') { header = 'PRIVATE KEY'; pkcs8.writePkcs8(der, key); } else { if (type) assert.strictEqual(type, 'pkcs1'); header = alg + ' PRIVATE KEY'; pkcs1.writePkcs1(der, key); } } else if (Key.isKey(key)) { if (type && type === 'pkcs1') { header = alg + ' PUBLIC KEY'; pkcs1.writePkcs1(der, key); } else { if (type) assert.strictEqual(type, 'pkcs8'); header = 'PUBLIC KEY'; pkcs8.writePkcs8(der, key); } } else { throw (new Error('key is not a Key or PrivateKey')); } var tmp = der.buffer.toString('base64'); var len = tmp.length + (tmp.length / 64) + 18 + 16 + header.length*2 + 10; var buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 64; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/pem.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,357
```javascript module.exports = { read: read, readPkcs1: readPkcs1, write: write, writePkcs1: writePkcs1 }; var assert = require('assert-plus'); var asn1 = require('asn1'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var pem = require('./pem'); var pkcs8 = require('./pkcs8'); var readECDSACurve = pkcs8.readECDSACurve; function read(buf, options) { return (pem.read(buf, options, 'pkcs1')); } function write(key, options) { return (pem.write(key, options, 'pkcs1')); } /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function readPkcs1(alg, type, der) { switch (alg) { case 'RSA': if (type === 'public') return (readPkcs1RSAPublic(der)); else if (type === 'private') return (readPkcs1RSAPrivate(der)); throw (new Error('Unknown key type: ' + type)); case 'DSA': if (type === 'public') return (readPkcs1DSAPublic(der)); else if (type === 'private') return (readPkcs1DSAPrivate(der)); throw (new Error('Unknown key type: ' + type)); case 'EC': case 'ECDSA': if (type === 'private') return (readPkcs1ECDSAPrivate(der)); else if (type === 'public') return (readPkcs1ECDSAPublic(der)); throw (new Error('Unknown key type: ' + type)); case 'EDDSA': case 'EdDSA': if (type === 'private') return (readPkcs1EdDSAPrivate(der)); throw (new Error(type + ' keys not supported with EdDSA')); default: throw (new Error('Unknown key algo: ' + alg)); } } function readPkcs1RSAPublic(der) { // modulus and exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'exponent'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'e', data: e }, { name: 'n', data: n } ] }; return (new Key(key)); } function readPkcs1RSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version[0], 0); // modulus then public exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'public exponent'); var d = readMPInt(der, 'private exponent'); var p = readMPInt(der, 'prime1'); var q = readMPInt(der, 'prime2'); var dmodp = readMPInt(der, 'exponent1'); var dmodq = readMPInt(der, 'exponent2'); var iqmp = readMPInt(der, 'iqmp'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'n', data: n }, { name: 'e', data: e }, { name: 'd', data: d }, { name: 'iqmp', data: iqmp }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'dmodp', data: dmodp }, { name: 'dmodq', data: dmodq } ] }; return (new PrivateKey(key)); } function readPkcs1DSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 0); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); var y = readMPInt(der, 'y'); var x = readMPInt(der, 'x'); // now, make the key var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y }, { name: 'x', data: x } ] }; return (new PrivateKey(key)); } function readPkcs1EdDSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 1); // private key var k = der.readString(asn1.Ber.OctetString, true); der.readSequence(0xa0); var oid = der.readOID(); assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); der.readSequence(0xa1); var A = utils.readBitString(der); var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: k } ] }; return (new PrivateKey(key)); } function readPkcs1DSAPublic(der) { var y = readMPInt(der, 'y'); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); var key = { type: 'dsa', parts: [ { name: 'y', data: y }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g } ] }; return (new Key(key)); } function readPkcs1ECDSAPublic(der) { der.readSequence(); var oid = der.readOID(); assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); var curveOid = der.readOID(); var curve; var curves = Object.keys(algs.curves); for (var j = 0; j < curves.length; ++j) { var c = curves[j]; var cd = algs.curves[c]; if (cd.pkcs8oid === curveOid) { curve = c; break; } } assert.string(curve, 'a known ECDSA named curve'); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curve) }, { name: 'Q', data: Q } ] }; return (new Key(key)); } function readPkcs1ECDSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 1); // private key var d = der.readString(asn1.Ber.OctetString, true); der.readSequence(0xa0); var curve = readECDSACurve(der); assert.string(curve, 'a known elliptic curve'); der.readSequence(0xa1); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curve) }, { name: 'Q', data: Q }, { name: 'd', data: d } ] }; return (new PrivateKey(key)); } function writePkcs1(der, key) { der.startSequence(); switch (key.type) { case 'rsa': if (PrivateKey.isPrivateKey(key)) writePkcs1RSAPrivate(der, key); else writePkcs1RSAPublic(der, key); break; case 'dsa': if (PrivateKey.isPrivateKey(key)) writePkcs1DSAPrivate(der, key); else writePkcs1DSAPublic(der, key); break; case 'ecdsa': if (PrivateKey.isPrivateKey(key)) writePkcs1ECDSAPrivate(der, key); else writePkcs1ECDSAPublic(der, key); break; case 'ed25519': if (PrivateKey.isPrivateKey(key)) writePkcs1EdDSAPrivate(der, key); else writePkcs1EdDSAPublic(der, key); break; default: throw (new Error('Unknown key algo: ' + key.type)); } der.endSequence(); } function writePkcs1RSAPublic(der, key) { der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); } function writePkcs1RSAPrivate(der, key) { var ver = Buffer.from([0]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); if (!key.part.dmodp || !key.part.dmodq) utils.addRSAMissing(key); der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); } function writePkcs1DSAPrivate(der, key) { var ver = Buffer.from([0]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.writeBuffer(key.part.x.data, asn1.Ber.Integer); } function writePkcs1DSAPublic(der, key) { der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); } function writePkcs1ECDSAPublic(der, key) { der.startSequence(); der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ var curve = key.part.curve.data.toString(); var curveOid = algs.curves[curve].pkcs8oid; assert.string(curveOid, 'a known ECDSA named curve'); der.writeOID(curveOid); der.endSequence(); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); } function writePkcs1ECDSAPrivate(der, key) { var ver = Buffer.from([1]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); der.startSequence(0xa0); var curve = key.part.curve.data.toString(); var curveOid = algs.curves[curve].pkcs8oid; assert.string(curveOid, 'a known ECDSA named curve'); der.writeOID(curveOid); der.endSequence(); der.startSequence(0xa1); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); der.endSequence(); } function writePkcs1EdDSAPrivate(der, key) { var ver = Buffer.from([1]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); der.startSequence(0xa0); der.writeOID('1.3.101.112'); der.endSequence(); der.startSequence(0xa1); utils.writeBitString(der, key.part.A.data); der.endSequence(); } function writePkcs1EdDSAPublic(der, key) { throw (new Error('Public keys are not supported for EdDSA PKCS#1')); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/pkcs1.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
2,908
```javascript module.exports = { read: read, write: write }; var assert = require('assert-plus'); var Buffer = require('safer-buffer').Buffer; var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var pem = require('./pem'); var ssh = require('./ssh'); var rfc4253 = require('./rfc4253'); var dnssec = require('./dnssec'); var putty = require('./putty'); var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1'; function read(buf, options) { if (typeof (buf) === 'string') { if (buf.trim().match(/^[-]+[ ]*BEGIN/)) return (pem.read(buf, options)); if (buf.match(/^\s*ssh-[a-z]/)) return (ssh.read(buf, options)); if (buf.match(/^\s*ecdsa-/)) return (ssh.read(buf, options)); if (buf.match(/^putty-user-key-file-2:/i)) return (putty.read(buf, options)); if (findDNSSECHeader(buf)) return (dnssec.read(buf, options)); buf = Buffer.from(buf, 'binary'); } else { assert.buffer(buf); if (findPEMHeader(buf)) return (pem.read(buf, options)); if (findSSHHeader(buf)) return (ssh.read(buf, options)); if (findPuTTYHeader(buf)) return (putty.read(buf, options)); if (findDNSSECHeader(buf)) return (dnssec.read(buf, options)); } if (buf.readUInt32BE(0) < buf.length) return (rfc4253.read(buf, options)); throw (new Error('Failed to auto-detect format of key')); } function findPuTTYHeader(buf) { var offset = 0; while (offset < buf.length && (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) ++offset; if (offset + 22 <= buf.length && buf.slice(offset, offset + 22).toString('ascii').toLowerCase() === 'putty-user-key-file-2:') return (true); return (false); } function findSSHHeader(buf) { var offset = 0; while (offset < buf.length && (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) ++offset; if (offset + 4 <= buf.length && buf.slice(offset, offset + 4).toString('ascii') === 'ssh-') return (true); if (offset + 6 <= buf.length && buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-') return (true); return (false); } function findPEMHeader(buf) { var offset = 0; while (offset < buf.length && (buf[offset] === 32 || buf[offset] === 10)) ++offset; if (buf[offset] !== 45) return (false); while (offset < buf.length && (buf[offset] === 45)) ++offset; while (offset < buf.length && (buf[offset] === 32)) ++offset; if (offset + 5 > buf.length || buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') return (false); return (true); } function findDNSSECHeader(buf) { // private case first if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) return (false); var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) return (true); // public-key RFC3110 ? // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' // skip any comment-lines if (typeof (buf) !== 'string') { buf = buf.toString('ascii'); } var lines = buf.split('\n'); var line = 0; /* JSSTYLED */ while (lines[line].match(/^\;/)) line++; if (lines[line].toString('ascii').match(/\. IN KEY /)) return (true); if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) return (true); return (false); } function write(key, options) { throw (new Error('"auto" format cannot be used for writing')); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/auto.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
972
```groff .TH sshpk\-verify 1 "Jan 2016" sshpk "sshpk Commands" .SH NAME .PP sshpk\-verify \- verify a signature on data using an SSH key .SH SYNOPSYS .PP \fB\fCsshpk\-verify\fR \-i KEYPATH \-s SIGNATURE [OPTION...] .SH DESCRIPTION .PP Takes in arbitrary bytes and a Base64\-encoded signature, and verifies that the signature was produced by the private half of the given SSH public key. .SH EXAMPLES .PP .RS .nf $ printf 'foo' | sshpk\-verify \-i ~/.ssh/id_ecdsa \-s MEUCIQCYp... OK $ printf 'foo' | sshpk\-verify \-i ~/.ssh/id_ecdsa \-s GARBAGE... NOT OK .fi .RE .SH EXIT STATUS .TP \fB\fC0\fR Signature validates and matches the key. .TP \fB\fC1\fR Signature is parseable and the correct length but does not match the key or otherwise is invalid. .TP \fB\fC2\fR The signature or key could not be parsed. .TP \fB\fC3\fR Invalid commandline options were supplied. .SH OPTIONS .TP \fB\fC\-v, \-\-verbose\fR Print extra information about the key and signature to stderr when verifying. .TP \fB\fC\-i KEY, \-\-identity=KEY\fR Select the key to be used for verification. \fB\fCKEY\fR must be a relative or absolute filesystem path to the key file. Any format supported by the \fB\fCsshpk\fR library is supported, including OpenSSH formats and standard PEM PKCS. .TP \fB\fC\-s BASE64, \-\-signature=BASE64\fR Supplies the base64\-encoded signature to be verified. .TP \fB\fC\-f PATH, \-\-file=PATH\fR Input file to verify instead of stdin. .TP \fB\fC\-H HASH, \-\-hash=HASH\fR Set the hash algorithm to be used for signing. This should be one of \fB\fCsha1\fR, \fB\fCsha256\fR or \fB\fCsha512\fR\&. Some key types may place restrictions on which hash algorithms may be used (e.g. ED25519 keys can only use SHA\-512). .TP \fB\fC\-t FORMAT, \-\-format=FORMAT\fR Choose the signature format to use, from \fB\fCasn1\fR, \fB\fCssh\fR or \fB\fCraw\fR (only for ED25519 signatures). The \fB\fCasn1\fR format is the default, as it is the format used with TLS and typically the standard in most non\-SSH libraries (e.g. OpenSSL). The \fB\fCssh\fR format is used in the SSH protocol and by the ssh\-agent. .SH SEE ALSO .PP .BR sshpk-sign (1) .SH BUGS .PP Report bugs at Github \[la]path_to_url ```
/content/code_sandbox/node_modules/sshpk/man/man1/sshpk-verify.1
groff
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
712
```groff .TH sshpk\-conv 1 "Jan 2016" sshpk "sshpk Commands" .SH NAME .PP sshpk\-conv \- convert between key formats .SH SYNOPSYS .PP \fB\fCsshpk\-conv\fR \-t FORMAT [FILENAME] [OPTIONS...] .PP \fB\fCsshpk\-conv\fR \-i [FILENAME] [OPTIONS...] .SH DESCRIPTION .PP Reads in a public or private key and converts it between different formats, particularly formats used in the SSH protocol and the well\-known PEM PKCS#1/7 formats. .PP In the second form, with the \fB\fC\-i\fR option given, identifies a key and prints to stderr information about its nature, size and fingerprint. .SH EXAMPLES .PP Assume the following SSH\-format public key in \fB\fCid_ecdsa.pub\fR: .PP .RS .nf ecdsa\-sha2\-nistp256 AAAAE2VjZHNhLXNoYTI...9M/4c4= user@host .fi .RE .PP Identify it with \fB\fC\-i\fR: .PP .RS .nf $ sshpk\-conv \-i id_ecdsa.pub id_ecdsa: a 256 bit ECDSA public key ECDSA curve: nistp256 Comment: user@host Fingerprint: SHA256:vCNX7eUkdvqqW0m4PoxQAZRv+CM4P4fS8+CbliAvS4k 81:ad:d5:57:e5:6f:7d:a2:93:79:56:af:d7:c0:38:51 .fi .RE .PP Convert it to \fB\fCpkcs8\fR format, for use with e.g. OpenSSL: .PP .RS .nf $ sshpk\-conv \-t pkcs8 id_ecdsa \-\-\-\-\-BEGIN PUBLIC KEY\-\-\-\-\- your_sha256_hash zOt+kWJoijLnw3ZMYUKmAx+lD0I5XUxdrPcs1vH5f3cn9TvRvO9L0z/hzg== \-\-\-\-\-END PUBLIC KEY\-\-\-\-\- .fi .RE .PP Retrieve the public half of a private key: .PP .RS .nf $ openssl genrsa 2048 | sshpk\-conv \-t ssh \-c foo@bar ssh\-rsa AAAAB3NzaC1yc2EAAA...koK7 foo@bar .fi .RE .PP Convert a private key to PKCS#1 (OpenSSL) format from a new\-style OpenSSH key format (the \fB\fCssh\-keygen \-o\fR format): .PP .RS .nf $ ssh\-keygen \-o \-f foobar \&... $ sshpk\-conv \-p \-t pkcs1 foobar \-\-\-\-\-BEGIN RSA PRIVATE KEY\-\-\-\-\- MIIDpAIBAAKCAQEA6T/GYJndb1TRH3+NL.... \-\-\-\-\-END RSA PRIVATE KEY\-\-\-\-\- .fi .RE .SH OPTIONS .TP \fB\fC\-i, \-\-identify\fR Instead of converting the key, output identifying information about it to stderr, including its type, size and fingerprints. .TP \fB\fC\-p, \-\-private\fR Treat the key as a private key instead of a public key (the default). If you supply \fB\fCsshpk\-conv\fR with a private key and do not give this option, it will extract only the public half of the key from it and work with that. .TP \fB\fC\-f PATH, \-\-file=PATH\fR Input file to take the key from instead of stdin. If a filename is supplied as a positional argument, it is equivalent to using this option. .TP \fB\fC\-o PATH, \-\-out=PATH\fR Output file name to use instead of stdout. .PP \fB\fC\-T FORMAT, \-\-informat=FORMAT\fR .TP \fB\fC\-t FORMAT, \-\-outformat=FORMAT\fR Selects the input and output formats to be used (see FORMATS, below). .TP \fB\fC\-c TEXT, \-\-comment=TEXT\fR Sets the key comment for the output file, if supported. .SH FORMATS .PP Currently supported formats: .TP \fB\fCpem, pkcs1\fR The standard PEM format used by older OpenSSH and most TLS libraries such as OpenSSL. The classic \fB\fCid_rsa\fR file is usually in this format. It is an ASN.1 encoded structure, base64\-encoded and placed between PEM headers. .TP \fB\fCssh\fR The SSH public key text format (the format of an \fB\fCid_rsa.pub\fR file). A single line, containing 3 space separated parts: the key type, key body and optional key comment. .TP \fB\fCpkcs8\fR A newer PEM format, usually used only for public keys by TLS libraries such as OpenSSL. The ASN.1 structure is more generic than that of \fB\fCpkcs1\fR\&. .TP \fB\fCopenssh\fR The new \fB\fCssh\-keygen \-o\fR format from OpenSSH. This can be mistaken for a PEM encoding but is actually an OpenSSH internal format. .TP \fB\fCrfc4253\fR The internal binary format of keys when sent over the wire in the SSH protocol. This is also the format that the \fB\fCssh\-agent\fR uses in its protocol. .SH SEE ALSO .PP .BR ssh-keygen (1), .BR openssl (1) .SH BUGS .PP Encrypted (password\-protected) keys are not supported. .PP Report bugs at Github \[la]path_to_url ```
/content/code_sandbox/node_modules/sshpk/man/man1/sshpk-conv.1
groff
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,397
```groff .TH sshpk\-sign 1 "Jan 2016" sshpk "sshpk Commands" .SH NAME .PP sshpk\-sign \- sign data using an SSH key .SH SYNOPSYS .PP \fB\fCsshpk\-sign\fR \-i KEYPATH [OPTION...] .SH DESCRIPTION .PP Takes in arbitrary bytes, and signs them using an SSH private key. The key can be of any type or format supported by the \fB\fCsshpk\fR library, including the standard OpenSSH formats, as well as PEM PKCS#1 and PKCS#8. .PP The signature is printed out in Base64 encoding, unless the \fB\fC\-\-binary\fR or \fB\fC\-b\fR option is given. .SH EXAMPLES .PP Signing with default settings: .PP .RS .nf $ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa MEUCIAMdLS/vXrrtWFepwe... .fi .RE .PP Signing in SSH (RFC 4253) format (rather than the default ASN.1): .PP .RS .nf $ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa \-t ssh AAAAFGVjZHNhLXNoYTIt... .fi .RE .PP Saving the binary signature to a file: .PP .RS .nf $ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa \\ \-o signature.bin \-b $ cat signature.bin | base64 MEUCIAMdLS/vXrrtWFepwe... .fi .RE .SH OPTIONS .TP \fB\fC\-v, \-\-verbose\fR Print extra information about the key and signature to stderr when signing. .TP \fB\fC\-b, \-\-binary\fR Don't base64\-encode the signature before outputting it. .TP \fB\fC\-i KEY, \-\-identity=KEY\fR Select the key to be used for signing. \fB\fCKEY\fR must be a relative or absolute filesystem path to the key file. Any format supported by the \fB\fCsshpk\fR library is supported, including OpenSSH formats and standard PEM PKCS. .TP \fB\fC\-f PATH, \-\-file=PATH\fR Input file to sign instead of stdin. .TP \fB\fC\-o PATH, \-\-out=PATH\fR Output file to save signature in instead of stdout. .TP \fB\fC\-H HASH, \-\-hash=HASH\fR Set the hash algorithm to be used for signing. This should be one of \fB\fCsha1\fR, \fB\fCsha256\fR or \fB\fCsha512\fR\&. Some key types may place restrictions on which hash algorithms may be used (e.g. ED25519 keys can only use SHA\-512). .TP \fB\fC\-t FORMAT, \-\-format=FORMAT\fR Choose the signature format to use, from \fB\fCasn1\fR, \fB\fCssh\fR or \fB\fCraw\fR (only for ED25519 signatures). The \fB\fCasn1\fR format is the default, as it is the format used with TLS and typically the standard in most non\-SSH libraries (e.g. OpenSSL). The \fB\fCssh\fR format is used in the SSH protocol and by the ssh\-agent. .SH SEE ALSO .PP .BR sshpk-verify (1) .SH BUGS .PP Report bugs at Github \[la]path_to_url ```
/content/code_sandbox/node_modules/sshpk/man/man1/sshpk-sign.1
groff
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
838
```javascript module.exports = { read: read, readPkcs8: readPkcs8, write: write, writePkcs8: writePkcs8, pkcs8ToBuffer: pkcs8ToBuffer, readECDSACurve: readECDSACurve, writeECDSACurve: writeECDSACurve }; var assert = require('assert-plus'); var asn1 = require('asn1'); var Buffer = require('safer-buffer').Buffer; var algs = require('../algs'); var utils = require('../utils'); var Key = require('../key'); var PrivateKey = require('../private-key'); var pem = require('./pem'); function read(buf, options) { return (pem.read(buf, options, 'pkcs8')); } function write(key, options) { return (pem.write(key, options, 'pkcs8')); } /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function readPkcs8(alg, type, der) { /* Private keys in pkcs#8 format have a weird extra int */ if (der.peek() === asn1.Ber.Integer) { assert.strictEqual(type, 'private', 'unexpected Integer at start of public key'); der.readString(asn1.Ber.Integer, true); } der.readSequence(); var next = der.offset + der.length; var oid = der.readOID(); switch (oid) { case '1.2.840.113549.1.1.1': der._offset = next; if (type === 'public') return (readPkcs8RSAPublic(der)); else return (readPkcs8RSAPrivate(der)); case '1.2.840.10040.4.1': if (type === 'public') return (readPkcs8DSAPublic(der)); else return (readPkcs8DSAPrivate(der)); case '1.2.840.10045.2.1': if (type === 'public') return (readPkcs8ECDSAPublic(der)); else return (readPkcs8ECDSAPrivate(der)); case '1.3.101.112': if (type === 'public') { return (readPkcs8EdDSAPublic(der)); } else { return (readPkcs8EdDSAPrivate(der)); } case '1.3.101.110': if (type === 'public') { return (readPkcs8X25519Public(der)); } else { return (readPkcs8X25519Private(der)); } default: throw (new Error('Unknown key type OID ' + oid)); } } function readPkcs8RSAPublic(der) { // bit string sequence der.readSequence(asn1.Ber.BitString); der.readByte(); der.readSequence(); // modulus var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'exponent'); // now, make the key var key = { type: 'rsa', source: der.originalInput, parts: [ { name: 'e', data: e }, { name: 'n', data: n } ] }; return (new Key(key)); } function readPkcs8RSAPrivate(der) { der.readSequence(asn1.Ber.OctetString); der.readSequence(); var ver = readMPInt(der, 'version'); assert.equal(ver[0], 0x0, 'unknown RSA private key version'); // modulus then public exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'public exponent'); var d = readMPInt(der, 'private exponent'); var p = readMPInt(der, 'prime1'); var q = readMPInt(der, 'prime2'); var dmodp = readMPInt(der, 'exponent1'); var dmodq = readMPInt(der, 'exponent2'); var iqmp = readMPInt(der, 'iqmp'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'n', data: n }, { name: 'e', data: e }, { name: 'd', data: d }, { name: 'iqmp', data: iqmp }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'dmodp', data: dmodp }, { name: 'dmodq', data: dmodq } ] }; return (new PrivateKey(key)); } function readPkcs8DSAPublic(der) { der.readSequence(); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); // bit string sequence der.readSequence(asn1.Ber.BitString); der.readByte(); var y = readMPInt(der, 'y'); // now, make the key var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y } ] }; return (new Key(key)); } function readPkcs8DSAPrivate(der) { der.readSequence(); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); der.readSequence(asn1.Ber.OctetString); var x = readMPInt(der, 'x'); /* The pkcs#8 format does not include the public key */ var y = utils.calculateDSAPublic(g, p, x); var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y }, { name: 'x', data: x } ] }; return (new PrivateKey(key)); } function readECDSACurve(der) { var curveName, curveNames; var j, c, cd; if (der.peek() === asn1.Ber.OID) { var oid = der.readOID(); curveNames = Object.keys(algs.curves); for (j = 0; j < curveNames.length; ++j) { c = curveNames[j]; cd = algs.curves[c]; if (cd.pkcs8oid === oid) { curveName = c; break; } } } else { // ECParameters sequence der.readSequence(); var version = der.readString(asn1.Ber.Integer, true); assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); var curve = {}; // FieldID sequence der.readSequence(); var fieldTypeOid = der.readOID(); assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', 'ECDSA key is not from a prime-field'); var p = curve.p = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); /* * p always starts with a 1 bit, so count the zeros to get its * real size. */ curve.size = p.length * 8 - utils.countZeros(p); // Curve sequence der.readSequence(); curve.a = utils.mpNormalize( der.readString(asn1.Ber.OctetString, true)); curve.b = utils.mpNormalize( der.readString(asn1.Ber.OctetString, true)); if (der.peek() === asn1.Ber.BitString) curve.s = der.readString(asn1.Ber.BitString, true); // Combined Gx and Gy curve.G = der.readString(asn1.Ber.OctetString, true); assert.strictEqual(curve.G[0], 0x4, 'uncompressed G is required'); curve.n = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); curve.h = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + 'required'); curveNames = Object.keys(algs.curves); var ks = Object.keys(curve); for (j = 0; j < curveNames.length; ++j) { c = curveNames[j]; cd = algs.curves[c]; var equal = true; for (var i = 0; i < ks.length; ++i) { var k = ks[i]; if (cd[k] === undefined) continue; if (typeof (cd[k]) === 'object' && cd[k].equals !== undefined) { if (!cd[k].equals(curve[k])) { equal = false; break; } } else if (Buffer.isBuffer(cd[k])) { if (cd[k].toString('binary') !== curve[k].toString('binary')) { equal = false; break; } } else { if (cd[k] !== curve[k]) { equal = false; break; } } } if (equal) { curveName = c; break; } } } return (curveName); } function readPkcs8ECDSAPrivate(der) { var curveName = readECDSACurve(der); assert.string(curveName, 'a known elliptic curve'); der.readSequence(asn1.Ber.OctetString); der.readSequence(); var version = readMPInt(der, 'version'); assert.equal(version[0], 1, 'unknown version of ECDSA key'); var d = der.readString(asn1.Ber.OctetString, true); var Q; if (der.peek() == 0xa0) { der.readSequence(0xa0); der._offset += der.length; } if (der.peek() == 0xa1) { der.readSequence(0xa1); Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); } if (Q === undefined) { var pub = utils.publicFromPrivateECDSA(curveName, d); Q = pub.part.Q.data; } var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curveName) }, { name: 'Q', data: Q }, { name: 'd', data: d } ] }; return (new PrivateKey(key)); } function readPkcs8ECDSAPublic(der) { var curveName = readECDSACurve(der); assert.string(curveName, 'a known elliptic curve'); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curveName) }, { name: 'Q', data: Q } ] }; return (new Key(key)); } function readPkcs8EdDSAPublic(der) { if (der.peek() === 0x00) der.readByte(); var A = utils.readBitString(der); var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) } ] }; return (new Key(key)); } function readPkcs8X25519Public(der) { var A = utils.readBitString(der); var key = { type: 'curve25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) } ] }; return (new Key(key)); } function readPkcs8EdDSAPrivate(der) { if (der.peek() === 0x00) der.readByte(); der.readSequence(asn1.Ber.OctetString); var k = der.readString(asn1.Ber.OctetString, true); k = utils.zeroPadToLength(k, 32); var A; if (der.peek() === asn1.Ber.BitString) { A = utils.readBitString(der); A = utils.zeroPadToLength(A, 32); } else { A = utils.calculateED25519Public(k); } var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: utils.zeroPadToLength(k, 32) } ] }; return (new PrivateKey(key)); } function readPkcs8X25519Private(der) { if (der.peek() === 0x00) der.readByte(); der.readSequence(asn1.Ber.OctetString); var k = der.readString(asn1.Ber.OctetString, true); k = utils.zeroPadToLength(k, 32); var A = utils.calculateX25519Public(k); var key = { type: 'curve25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: utils.zeroPadToLength(k, 32) } ] }; return (new PrivateKey(key)); } function pkcs8ToBuffer(key) { var der = new asn1.BerWriter(); writePkcs8(der, key); return (der.buffer); } function writePkcs8(der, key) { der.startSequence(); if (PrivateKey.isPrivateKey(key)) { var sillyInt = Buffer.from([0]); der.writeBuffer(sillyInt, asn1.Ber.Integer); } der.startSequence(); switch (key.type) { case 'rsa': der.writeOID('1.2.840.113549.1.1.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8RSAPrivate(key, der); else writePkcs8RSAPublic(key, der); break; case 'dsa': der.writeOID('1.2.840.10040.4.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8DSAPrivate(key, der); else writePkcs8DSAPublic(key, der); break; case 'ecdsa': der.writeOID('1.2.840.10045.2.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8ECDSAPrivate(key, der); else writePkcs8ECDSAPublic(key, der); break; case 'ed25519': der.writeOID('1.3.101.112'); if (PrivateKey.isPrivateKey(key)) throw (new Error('Ed25519 private keys in pkcs8 ' + 'format are not supported')); writePkcs8EdDSAPublic(key, der); break; default: throw (new Error('Unsupported key type: ' + key.type)); } der.endSequence(); } function writePkcs8RSAPrivate(key, der) { der.writeNull(); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.startSequence(); var version = Buffer.from([0]); der.writeBuffer(version, asn1.Ber.Integer); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); if (!key.part.dmodp || !key.part.dmodq) utils.addRSAMissing(key); der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); } function writePkcs8RSAPublic(key, der) { der.writeNull(); der.endSequence(); der.startSequence(asn1.Ber.BitString); der.writeByte(0x00); der.startSequence(); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); } function writePkcs8DSAPrivate(key, der) { der.startSequence(); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.writeBuffer(key.part.x.data, asn1.Ber.Integer); der.endSequence(); } function writePkcs8DSAPublic(key, der) { der.startSequence(); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); der.startSequence(asn1.Ber.BitString); der.writeByte(0x00); der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.endSequence(); } function writeECDSACurve(key, der) { var curve = algs.curves[key.curve]; if (curve.pkcs8oid) { /* This one has a name in pkcs#8, so just write the oid */ der.writeOID(curve.pkcs8oid); } else { // ECParameters sequence der.startSequence(); var version = Buffer.from([1]); der.writeBuffer(version, asn1.Ber.Integer); // FieldID sequence der.startSequence(); der.writeOID('1.2.840.10045.1.1'); // prime-field der.writeBuffer(curve.p, asn1.Ber.Integer); der.endSequence(); // Curve sequence der.startSequence(); var a = curve.p; if (a[0] === 0x0) a = a.slice(1); der.writeBuffer(a, asn1.Ber.OctetString); der.writeBuffer(curve.b, asn1.Ber.OctetString); der.writeBuffer(curve.s, asn1.Ber.BitString); der.endSequence(); der.writeBuffer(curve.G, asn1.Ber.OctetString); der.writeBuffer(curve.n, asn1.Ber.Integer); var h = curve.h; if (!h) { h = Buffer.from([1]); } der.writeBuffer(h, asn1.Ber.Integer); // ECParameters der.endSequence(); } } function writePkcs8ECDSAPublic(key, der) { writeECDSACurve(key, der); der.endSequence(); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); } function writePkcs8ECDSAPrivate(key, der) { writeECDSACurve(key, der); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.startSequence(); var version = Buffer.from([1]); der.writeBuffer(version, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); der.startSequence(0xa1); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); der.endSequence(); der.endSequence(); der.endSequence(); } function writePkcs8EdDSAPublic(key, der) { der.endSequence(); utils.writeBitString(der, key.part.A.data); } function writePkcs8EdDSAPrivate(key, der) { der.endSequence(); var k = utils.mpNormalize(key.part.k.data, true); der.startSequence(asn1.Ber.OctetString); der.writeBuffer(k, asn1.Ber.OctetString); der.endSequence(); } ```
/content/code_sandbox/node_modules/sshpk/lib/formats/pkcs8.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
4,714
```javascript var DomUtils = module.exports; [ require("./lib/stringify"), require("./lib/traversal"), require("./lib/manipulation"), require("./lib/querying"), require("./lib/legacy"), require("./lib/helpers") ].forEach(function(ext){ Object.keys(ext).forEach(function(key){ DomUtils[key] = ext[key].bind(DomUtils); }); }); ```
/content/code_sandbox/node_modules/domutils/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
76
```javascript var getChildren = exports.getChildren = function(elem){ return elem.children; }; var getParent = exports.getParent = function(elem){ return elem.parent; }; exports.getSiblings = function(elem){ var parent = getParent(elem); return parent ? getChildren(parent) : [elem]; }; exports.getAttributeValue = function(elem, name){ return elem.attribs && elem.attribs[name]; }; exports.hasAttrib = function(elem, name){ return !!elem.attribs && hasOwnProperty.call(elem.attribs, name); }; exports.getName = function(elem){ return elem.name; }; ```
/content/code_sandbox/node_modules/domutils/lib/traversal.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
111
```javascript var ElementType = require("domelementtype"), getOuterHTML = require("dom-serializer"), isTag = ElementType.isTag; module.exports = { getInnerHTML: getInnerHTML, getOuterHTML: getOuterHTML, getText: getText }; function getInnerHTML(elem, opts){ return elem.children ? elem.children.map(function(elem){ return getOuterHTML(elem, opts); }).join("") : ""; } function getText(elem){ if(Array.isArray(elem)) return elem.map(getText).join(""); if(isTag(elem) || elem.type === ElementType.CDATA) return getText(elem.children); if(elem.type === ElementType.Text) return elem.data; return ""; } ```
/content/code_sandbox/node_modules/domutils/lib/stringify.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
136
```javascript // removeSubsets // Given an array of nodes, remove any member that is contained by another. exports.removeSubsets = function(nodes) { var idx = nodes.length, node, ancestor, replace; // Check if each node (or one of its ancestors) is already contained in the // array. while (--idx > -1) { node = ancestor = nodes[idx]; // Temporarily remove the node under consideration nodes[idx] = null; replace = true; while (ancestor) { if (nodes.indexOf(ancestor) > -1) { replace = false; nodes.splice(idx, 1); break; } ancestor = ancestor.parent; } // If the node has been found to be unique, re-insert it. if (replace) { nodes[idx] = node; } } return nodes; }; // Source: path_to_url#dom-node-comparedocumentposition var POSITION = { DISCONNECTED: 1, PRECEDING: 2, FOLLOWING: 4, CONTAINS: 8, CONTAINED_BY: 16 }; // Compare the position of one node against another node in any other document. // The return value is a bitmask with the following values: // // document order: // > There is an ordering, document order, defined on all the nodes in the // > document corresponding to the order in which the first character of the // > XML representation of each node occurs in the XML representation of the // > document after expansion of general entities. Thus, the document element // > node will be the first node. Element nodes occur before their children. // > Thus, document order orders element nodes in order of the occurrence of // > their start-tag in the XML (after expansion of entities). The attribute // > nodes of an element occur after the element and before its children. The // > relative order of attribute nodes is implementation-dependent./ // Source: // path_to_url#dt-document-order // // @argument {Node} nodaA The first node to use in the comparison // @argument {Node} nodeB The second node to use in the comparison // // @return {Number} A bitmask describing the input nodes' relative position. // See path_to_url#dom-node-comparedocumentposition for // a description of these values. var comparePos = exports.compareDocumentPosition = function(nodeA, nodeB) { var aParents = []; var bParents = []; var current, sharedParent, siblings, aSibling, bSibling, idx; if (nodeA === nodeB) { return 0; } current = nodeA; while (current) { aParents.unshift(current); current = current.parent; } current = nodeB; while (current) { bParents.unshift(current); current = current.parent; } idx = 0; while (aParents[idx] === bParents[idx]) { idx++; } if (idx === 0) { return POSITION.DISCONNECTED; } sharedParent = aParents[idx - 1]; siblings = sharedParent.children; aSibling = aParents[idx]; bSibling = bParents[idx]; if (siblings.indexOf(aSibling) > siblings.indexOf(bSibling)) { if (sharedParent === nodeB) { return POSITION.FOLLOWING | POSITION.CONTAINED_BY; } return POSITION.FOLLOWING; } else { if (sharedParent === nodeA) { return POSITION.PRECEDING | POSITION.CONTAINS; } return POSITION.PRECEDING; } }; // Sort an array of nodes based on their relative position in the document and // remove any duplicate nodes. If the array contains nodes that do not belong // to the same document, sort order is unspecified. // // @argument {Array} nodes Array of DOM nodes // // @returns {Array} collection of unique nodes, sorted in document order exports.uniqueSort = function(nodes) { var idx = nodes.length, node, position; nodes = nodes.slice(); while (--idx > -1) { node = nodes[idx]; position = nodes.indexOf(node); if (position > -1 && position < idx) { nodes.splice(idx, 1); } } nodes.sort(function(a, b) { var relative = comparePos(a, b); if (relative & POSITION.PRECEDING) { return -1; } else if (relative & POSITION.FOLLOWING) { return 1; } return 0; }); return nodes; }; ```
/content/code_sandbox/node_modules/domutils/lib/helpers.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
987
```javascript exports.removeElement = function(elem){ if(elem.prev) elem.prev.next = elem.next; if(elem.next) elem.next.prev = elem.prev; if(elem.parent){ var childs = elem.parent.children; childs.splice(childs.lastIndexOf(elem), 1); } }; exports.replaceElement = function(elem, replacement){ var prev = replacement.prev = elem.prev; if(prev){ prev.next = replacement; } var next = replacement.next = elem.next; if(next){ next.prev = replacement; } var parent = replacement.parent = elem.parent; if(parent){ var childs = parent.children; childs[childs.lastIndexOf(elem)] = replacement; } }; exports.appendChild = function(elem, child){ child.parent = elem; if(elem.children.push(child) !== 1){ var sibling = elem.children[elem.children.length - 2]; sibling.next = child; child.prev = sibling; child.next = null; } }; exports.append = function(elem, next){ var parent = elem.parent, currNext = elem.next; next.next = currNext; next.prev = elem; elem.next = next; next.parent = parent; if(currNext){ currNext.prev = next; if(parent){ var childs = parent.children; childs.splice(childs.lastIndexOf(currNext), 0, next); } } else if(parent){ parent.children.push(next); } }; exports.prepend = function(elem, prev){ var parent = elem.parent; if(parent){ var childs = parent.children; childs.splice(childs.lastIndexOf(elem), 0, prev); } if(elem.prev){ elem.prev.next = prev; } prev.parent = parent; prev.prev = elem.prev; prev.next = elem; elem.prev = prev; }; ```
/content/code_sandbox/node_modules/domutils/lib/manipulation.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
371
```javascript var ElementType = require("domelementtype"); var isTag = exports.isTag = ElementType.isTag; exports.testElement = function(options, element){ for(var key in options){ if(!options.hasOwnProperty(key)); else if(key === "tag_name"){ if(!isTag(element) || !options.tag_name(element.name)){ return false; } } else if(key === "tag_type"){ if(!options.tag_type(element.type)) return false; } else if(key === "tag_contains"){ if(isTag(element) || !options.tag_contains(element.data)){ return false; } } else if(!element.attribs || !options[key](element.attribs[key])){ return false; } } return true; }; var Checks = { tag_name: function(name){ if(typeof name === "function"){ return function(elem){ return isTag(elem) && name(elem.name); }; } else if(name === "*"){ return isTag; } else { return function(elem){ return isTag(elem) && elem.name === name; }; } }, tag_type: function(type){ if(typeof type === "function"){ return function(elem){ return type(elem.type); }; } else { return function(elem){ return elem.type === type; }; } }, tag_contains: function(data){ if(typeof data === "function"){ return function(elem){ return !isTag(elem) && data(elem.data); }; } else { return function(elem){ return !isTag(elem) && elem.data === data; }; } } }; function getAttribCheck(attrib, value){ if(typeof value === "function"){ return function(elem){ return elem.attribs && value(elem.attribs[attrib]); }; } else { return function(elem){ return elem.attribs && elem.attribs[attrib] === value; }; } } function combineFuncs(a, b){ return function(elem){ return a(elem) || b(elem); }; } exports.getElements = function(options, element, recurse, limit){ var funcs = Object.keys(options).map(function(key){ var value = options[key]; return key in Checks ? Checks[key](value) : getAttribCheck(key, value); }); return funcs.length === 0 ? [] : this.filter( funcs.reduce(combineFuncs), element, recurse, limit ); }; exports.getElementById = function(id, element, recurse){ if(!Array.isArray(element)) element = [element]; return this.findOne(getAttribCheck("id", id), element, recurse !== false); }; exports.getElementsByTagName = function(name, element, recurse, limit){ return this.filter(Checks.tag_name(name), element, recurse, limit); }; exports.getElementsByTagType = function(type, element, recurse, limit){ return this.filter(Checks.tag_type(type), element, recurse, limit); }; ```
/content/code_sandbox/node_modules/domutils/lib/legacy.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
611
```javascript var isTag = require("domelementtype").isTag; module.exports = { filter: filter, find: find, findOneChild: findOneChild, findOne: findOne, existsOne: existsOne, findAll: findAll }; function filter(test, element, recurse, limit){ if(!Array.isArray(element)) element = [element]; if(typeof limit !== "number" || !isFinite(limit)){ limit = Infinity; } return find(test, element, recurse !== false, limit); } function find(test, elems, recurse, limit){ var result = [], childs; for(var i = 0, j = elems.length; i < j; i++){ if(test(elems[i])){ result.push(elems[i]); if(--limit <= 0) break; } childs = elems[i].children; if(recurse && childs && childs.length > 0){ childs = find(test, childs, recurse, limit); result = result.concat(childs); limit -= childs.length; if(limit <= 0) break; } } return result; } function findOneChild(test, elems){ for(var i = 0, l = elems.length; i < l; i++){ if(test(elems[i])) return elems[i]; } return null; } function findOne(test, elems){ var elem = null; for(var i = 0, l = elems.length; i < l && !elem; i++){ if(!isTag(elems[i])){ continue; } else if(test(elems[i])){ elem = elems[i]; } else if(elems[i].children.length > 0){ elem = findOne(test, elems[i].children); } } return elem; } function existsOne(test, elems){ for(var i = 0, l = elems.length; i < l; i++){ if( isTag(elems[i]) && ( test(elems[i]) || ( elems[i].children.length > 0 && existsOne(test, elems[i].children) ) ) ){ return true; } } return false; } function findAll(test, elems){ var result = []; for(var i = 0, j = elems.length; i < j; i++){ if(!isTag(elems[i])) continue; if(test(elems[i])) result.push(elems[i]); if(elems[i].children.length > 0){ result = result.concat(findAll(test, elems[i].children)); } } return result; } ```
/content/code_sandbox/node_modules/domutils/lib/querying.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
550
```javascript var htmlparser = require("htmlparser2"); exports.makeDom = function(markup) { var handler = new htmlparser.DomHandler(), parser = new htmlparser.Parser(handler); parser.write(markup); parser.done(); return handler.dom; }; ```
/content/code_sandbox/node_modules/domutils/test/utils.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
51
```javascript var makeDom = require("./utils").makeDom; var markup = Array(21).join( "<?xml><tag1 id='asdf'> <script>text</script> <!-- comment --> <tag2> text </tag1>" ); module.exports = makeDom(markup); ```
/content/code_sandbox/node_modules/domutils/test/fixture.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
59
```javascript var makeDom = require("../utils").makeDom; var traversal = require("../.."); var assert = require("assert"); describe("traversal", function() { describe("hasAttrib", function() { var hasAttrib = traversal.hasAttrib; it("doesn't throw on text nodes", function() { var dom = makeDom("textnode"); assert.doesNotThrow(function() { hasAttrib(dom[0], "some-attrib"); }); }); }); }); ```
/content/code_sandbox/node_modules/domutils/test/tests/traversal.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
103
```javascript var makeDom = require("../utils").makeDom; var helpers = require("../.."); var assert = require("assert"); describe("helpers", function() { describe("removeSubsets", function() { var removeSubsets = helpers.removeSubsets; var dom = makeDom("<div><p><span></span></p><p></p></div>")[0]; it("removes identical trees", function() { var matches = removeSubsets([dom, dom]); assert.equal(matches.length, 1); }); it("Removes subsets found first", function() { var matches = removeSubsets([dom, dom.children[0].children[0]]); assert.equal(matches.length, 1); }); it("Removes subsets found last", function() { var matches = removeSubsets([dom.children[0], dom]); assert.equal(matches.length, 1); }); it("Does not remove unique trees", function() { var matches = removeSubsets([dom.children[0], dom.children[1]]); assert.equal(matches.length, 2); }); }); describe("compareDocumentPosition", function() { var compareDocumentPosition = helpers.compareDocumentPosition; var markup = "<div><p><span></span></p><a></a></div>"; var dom = makeDom(markup)[0]; var p = dom.children[0]; var span = p.children[0]; var a = dom.children[1]; it("reports when the first node occurs before the second indirectly", function() { assert.equal(compareDocumentPosition(span, a), 2); }); it("reports when the first node contains the second", function() { assert.equal(compareDocumentPosition(p, span), 10); }); it("reports when the first node occurs after the second indirectly", function() { assert.equal(compareDocumentPosition(a, span), 4); }); it("reports when the first node is contained by the second", function() { assert.equal(compareDocumentPosition(span, p), 20); }); it("reports when the nodes belong to separate documents", function() { var other = makeDom(markup)[0].children[0].children[0]; assert.equal(compareDocumentPosition(span, other), 1); }); it("reports when the nodes are identical", function() { assert.equal(compareDocumentPosition(span, span), 0); }); }); describe("uniqueSort", function() { var uniqueSort = helpers.uniqueSort; var dom, p, span, a; beforeEach(function() { dom = makeDom("<div><p><span></span></p><a></a></div>")[0]; p = dom.children[0]; span = p.children[0]; a = dom.children[1]; }); it("leaves unique elements untouched", function() { assert.deepEqual(uniqueSort([p, a]), [p, a]); }); it("removes duplicate elements", function() { assert.deepEqual(uniqueSort([p, a, p]), [p, a]); }); it("sorts nodes in document order", function() { assert.deepEqual(uniqueSort([a, dom, span, p]), [dom, p, span, a]); }); }); }); ```
/content/code_sandbox/node_modules/domutils/test/tests/helpers.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
720
```javascript var DomUtils = require("../.."); var fixture = require("../fixture"); var assert = require("assert"); // Set up expected structures var expected = { idAsdf: fixture[1], tag2: [], typeScript: [] }; for (var idx = 0; idx < 20; ++idx) { expected.tag2.push(fixture[idx*2 + 1].children[5]); expected.typeScript.push(fixture[idx*2 + 1].children[1]); } describe("legacy", function() { describe("getElements", function() { var getElements = DomUtils.getElements; it("returns the node with the specified ID", function() { assert.deepEqual( getElements({ id: "asdf" }, fixture, true, 1), [expected.idAsdf] ); }); it("returns empty array for unknown IDs", function() { assert.deepEqual(getElements({ id: "asdfs" }, fixture, true), []); }); it("returns the nodes with the specified tag name", function() { assert.deepEqual( getElements({ tag_name:"tag2" }, fixture, true), expected.tag2 ); }); it("returns empty array for unknown tag names", function() { assert.deepEqual( getElements({ tag_name : "asdfs" }, fixture, true), [] ); }); it("returns the nodes with the specified tag type", function() { assert.deepEqual( getElements({ tag_type: "script" }, fixture, true), expected.typeScript ); }); it("returns empty array for unknown tag types", function() { assert.deepEqual( getElements({ tag_type: "video" }, fixture, true), [] ); }); }); describe("getElementById", function() { var getElementById = DomUtils.getElementById; it("returns the specified node", function() { assert.equal( expected.idAsdf, getElementById("asdf", fixture, true) ); }); it("returns `null` for unknown IDs", function() { assert.equal(null, getElementById("asdfs", fixture, true)); }); }); describe("getElementsByTagName", function() { var getElementsByTagName = DomUtils.getElementsByTagName; it("returns the specified nodes", function() { assert.deepEqual( getElementsByTagName("tag2", fixture, true), expected.tag2 ); }); it("returns empty array for unknown tag names", function() { assert.deepEqual( getElementsByTagName("tag23", fixture, true), [] ); }); }); describe("getElementsByTagType", function() { var getElementsByTagType = DomUtils.getElementsByTagType; it("returns the specified nodes", function() { assert.deepEqual( getElementsByTagType("script", fixture, true), expected.typeScript ); }); it("returns empty array for unknown tag types", function() { assert.deepEqual( getElementsByTagType("video", fixture, true), [] ); }); }); describe("getOuterHTML", function() { var getOuterHTML = DomUtils.getOuterHTML; it("Correctly renders the outer HTML", function() { assert.equal( getOuterHTML(fixture[1]), "<tag1 id=\"asdf\"> <script>text</script> <!-- comment --> <tag2> text </tag2></tag1>" ); }); }); describe("getInnerHTML", function() { var getInnerHTML = DomUtils.getInnerHTML; it("Correctly renders the inner HTML", function() { assert.equal( getInnerHTML(fixture[1]), " <script>text</script> <!-- comment --> <tag2> text </tag2>" ); }); }); }); ```
/content/code_sandbox/node_modules/domutils/test/tests/legacy.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
826
```javascript var assert = require("assert"); var makeAccessor = require("../private").makeAccessor; var acc1 = makeAccessor(); var obj = {}; var hasOwn = obj.hasOwnProperty; acc1(obj).foo = 42; assert.deepEqual(obj, {}); assert.deepEqual(acc1(obj), { foo: 42 }); assert.deepEqual(acc1(acc1(obj)), {}); assert.deepEqual(acc1(obj), { foo: 42 }); assert.deepEqual(Object.keys(acc1(obj)), ["foo"]); assert.strictEqual(Object.getOwnPropertyNames(acc1(obj)).length, 1); assert.strictEqual(Object.getOwnPropertyNames(acc1(acc1(obj))).length, 0); acc1(obj).bar = "baz"; assert.deepEqual(acc1(obj), { foo: 42, bar: "baz" }); delete acc1(obj).foo; assert.deepEqual(acc1(obj), { bar: "baz" }); try { acc1(42); throw new Error("threw wrong error"); } catch (err) { assert.ok(err); } var acc2 = makeAccessor(); assert.notStrictEqual(acc1, acc2); assert.notStrictEqual(acc1(obj), acc2(obj)); assert.deepEqual(acc2(obj), {}); assert.strictEqual(Object.getOwnPropertyNames(obj).length, 0); assert.strictEqual(Object.keys(obj).length, 0); acc2(obj).bar = "asdf"; assert.deepEqual(acc2(obj), { bar: "asdf" }); acc2.forget(obj); acc2(obj).bar = "asdf"; var oldSecret = acc2(obj); assert.strictEqual(oldSecret.bar, "asdf"); acc2.forget(obj); var newSecret = acc2(obj); assert.notStrictEqual(oldSecret, newSecret); assert.ok(hasOwn.call(oldSecret, "bar")); assert.ok(!hasOwn.call(newSecret, "bar")); newSecret.bar = "zxcv"; assert.strictEqual(oldSecret.bar, "asdf"); assert.strictEqual(acc2(obj).bar, "zxcv"); function creatorFn(object) { return { self: object }; } var acc3 = makeAccessor(creatorFn); acc3(obj).xxx = "yyy"; assert.deepEqual(acc3(obj), { self: obj, xxx: "yyy" }); acc3.forget(obj); assert.deepEqual(acc3(obj), { self: obj }); var green = "\033[32m"; var reset = "\033[0m"; console.log(green + "ALL PASS" + reset); ```
/content/code_sandbox/node_modules/private/test/run.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
491
```javascript "use strict"; var originalObject = Object; var originalDefProp = Object.defineProperty; var originalCreate = Object.create; function defProp(obj, name, value) { if (originalDefProp) try { originalDefProp.call(originalObject, obj, name, { value: value }); } catch (definePropertyIsBrokenInIE8) { obj[name] = value; } else { obj[name] = value; } } // For functions that will be invoked using .call or .apply, we need to // define those methods on the function objects themselves, rather than // inheriting them from Function.prototype, so that a malicious or clumsy // third party cannot interfere with the functionality of this module by // redefining Function.prototype.call or .apply. function makeSafeToCall(fun) { if (fun) { defProp(fun, "call", fun.call); defProp(fun, "apply", fun.apply); } return fun; } makeSafeToCall(originalDefProp); makeSafeToCall(originalCreate); var hasOwn = makeSafeToCall(Object.prototype.hasOwnProperty); var numToStr = makeSafeToCall(Number.prototype.toString); var strSlice = makeSafeToCall(String.prototype.slice); var cloner = function(){}; function create(prototype) { if (originalCreate) { return originalCreate.call(originalObject, prototype); } cloner.prototype = prototype || null; return new cloner; } var rand = Math.random; var uniqueKeys = create(null); function makeUniqueKey() { // Collisions are highly unlikely, but this module is in the business of // making guarantees rather than safe bets. do var uniqueKey = internString(strSlice.call(numToStr.call(rand(), 36), 2)); while (hasOwn.call(uniqueKeys, uniqueKey)); return uniqueKeys[uniqueKey] = uniqueKey; } function internString(str) { var obj = {}; obj[str] = true; return Object.keys(obj)[0]; } // External users might find this function useful, but it is not necessary // for the typical use of this module. defProp(exports, "makeUniqueKey", makeUniqueKey); // Object.getOwnPropertyNames is the only way to enumerate non-enumerable // properties, so if we wrap it to ignore our secret keys, there should be // no way (except guessing) to access those properties. var originalGetOPNs = Object.getOwnPropertyNames; Object.getOwnPropertyNames = function getOwnPropertyNames(object) { for (var names = originalGetOPNs(object), src = 0, dst = 0, len = names.length; src < len; ++src) { if (!hasOwn.call(uniqueKeys, names[src])) { if (src > dst) { names[dst] = names[src]; } ++dst; } } names.length = dst; return names; }; function defaultCreatorFn(object) { return create(null); } function makeAccessor(secretCreatorFn) { var brand = makeUniqueKey(); var passkey = create(null); secretCreatorFn = secretCreatorFn || defaultCreatorFn; function register(object) { var secret; // Created lazily. function vault(key, forget) { // Only code that has access to the passkey can retrieve (or forget) // the secret object. if (key === passkey) { return forget ? secret = null : secret || (secret = secretCreatorFn(object)); } } defProp(object, brand, vault); } function accessor(object) { if (!hasOwn.call(object, brand)) register(object); return object[brand](passkey); } accessor.forget = function(object) { if (hasOwn.call(object, brand)) object[brand](passkey, true); }; return accessor; } defProp(exports, "makeAccessor", makeAccessor); ```
/content/code_sandbox/node_modules/private/private.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
840
```javascript 'use strict'; var origSymbol = typeof Symbol !== 'undefined' && Symbol; var hasSymbolSham = require('./shams'); module.exports = function hasNativeSymbols() { if (typeof origSymbol !== 'function') { return false; } if (typeof Symbol !== 'function') { return false; } if (typeof origSymbol('foo') !== 'symbol') { return false; } if (typeof Symbol('bar') !== 'symbol') { return false; } return hasSymbolSham(); }; ```
/content/code_sandbox/node_modules/has-symbols/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
104
```javascript 'use strict'; var test = require('tape'); var hasSymbols = require('../'); var runSymbolTests = require('./tests'); test('interface', function (t) { t.equal(typeof hasSymbols, 'function', 'is a function'); t.equal(typeof hasSymbols(), 'boolean', 'returns a boolean'); t.end(); }); test('Symbols are supported', { skip: !hasSymbols() }, function (t) { runSymbolTests(t); t.end(); }); test('Symbols are not supported', { skip: hasSymbols() }, function (t) { t.equal(typeof Symbol, 'undefined', 'global Symbol is undefined'); t.equal(typeof Object.getOwnPropertySymbols, 'undefined', 'Object.getOwnPropertySymbols does not exist'); t.end(); }); ```
/content/code_sandbox/node_modules/has-symbols/test/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
151
```javascript 'use strict'; /* eslint complexity: [2, 18], max-statements: [2, 33] */ module.exports = function hasSymbols() { if (typeof Symbol !== 'function' || typeof Object.getOwnPropertySymbols !== 'function') { return false; } if (typeof Symbol.iterator === 'symbol') { return true; } var obj = {}; var sym = Symbol('test'); var symObj = Object(sym); if (typeof sym === 'string') { return false; } if (Object.prototype.toString.call(sym) !== '[object Symbol]') { return false; } if (Object.prototype.toString.call(symObj) !== '[object Symbol]') { return false; } // temp disabled per path_to_url // if (sym instanceof Symbol) { return false; } // temp disabled per path_to_url // if (!(symObj instanceof Symbol)) { return false; } // if (typeof Symbol.prototype.toString !== 'function') { return false; } // if (String(sym) !== Symbol.prototype.toString.call(sym)) { return false; } var symVal = 42; obj[sym] = symVal; for (sym in obj) { return false; } // eslint-disable-line no-restricted-syntax, no-unreachable-loop if (typeof Object.keys === 'function' && Object.keys(obj).length !== 0) { return false; } if (typeof Object.getOwnPropertyNames === 'function' && Object.getOwnPropertyNames(obj).length !== 0) { return false; } var syms = Object.getOwnPropertySymbols(obj); if (syms.length !== 1 || syms[0] !== sym) { return false; } if (!Object.prototype.propertyIsEnumerable.call(obj, sym)) { return false; } if (typeof Object.getOwnPropertyDescriptor === 'function') { var descriptor = Object.getOwnPropertyDescriptor(obj, sym); if (descriptor.value !== symVal || descriptor.enumerable !== true) { return false; } } return true; }; ```
/content/code_sandbox/node_modules/has-symbols/shams.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
404
```javascript 'use strict'; var test = require('tape'); if (typeof Symbol === 'function' && typeof Symbol() === 'symbol') { test('has native Symbol support', function (t) { t.equal(typeof Symbol, 'function'); t.equal(typeof Symbol(), 'symbol'); t.end(); }); return; } var hasSymbols = require('../../shams'); test('polyfilled Symbols', function (t) { /* eslint-disable global-require */ t.equal(hasSymbols(), false, 'hasSymbols is false before polyfilling'); require('core-js/fn/symbol'); require('core-js/fn/symbol/to-string-tag'); require('../tests')(t); var hasSymbolsAfter = hasSymbols(); t.equal(hasSymbolsAfter, true, 'hasSymbols is true after polyfilling'); /* eslint-enable global-require */ t.end(); }); ```
/content/code_sandbox/node_modules/has-symbols/test/shams/core-js.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
177
```javascript 'use strict'; // eslint-disable-next-line consistent-return module.exports = function runSymbolTests(t) { t.equal(typeof Symbol, 'function', 'global Symbol is a function'); if (typeof Symbol !== 'function') { return false; } t.notEqual(Symbol(), Symbol(), 'two symbols are not equal'); /* t.equal( Symbol.prototype.toString.call(Symbol('foo')), Symbol.prototype.toString.call(Symbol('foo')), 'two symbols with the same description stringify the same' ); */ /* var foo = Symbol('foo'); t.notEqual( String(foo), String(Symbol('bar')), 'two symbols with different descriptions do not stringify the same' ); */ t.equal(typeof Symbol.prototype.toString, 'function', 'Symbol#toString is a function'); // t.equal(String(foo), Symbol.prototype.toString.call(foo), 'Symbol#toString equals String of the same symbol'); t.equal(typeof Object.getOwnPropertySymbols, 'function', 'Object.getOwnPropertySymbols is a function'); var obj = {}; var sym = Symbol('test'); var symObj = Object(sym); t.notEqual(typeof sym, 'string', 'Symbol is not a string'); t.equal(Object.prototype.toString.call(sym), '[object Symbol]', 'symbol primitive Object#toStrings properly'); t.equal(Object.prototype.toString.call(symObj), '[object Symbol]', 'symbol primitive Object#toStrings properly'); var symVal = 42; obj[sym] = symVal; // eslint-disable-next-line no-restricted-syntax for (sym in obj) { t.fail('symbol property key was found in for..in of object'); } t.deepEqual(Object.keys(obj), [], 'no enumerable own keys on symbol-valued object'); t.deepEqual(Object.getOwnPropertyNames(obj), [], 'no own names on symbol-valued object'); t.deepEqual(Object.getOwnPropertySymbols(obj), [sym], 'one own symbol on symbol-valued object'); t.equal(Object.prototype.propertyIsEnumerable.call(obj, sym), true, 'symbol is enumerable'); t.deepEqual(Object.getOwnPropertyDescriptor(obj, sym), { configurable: true, enumerable: true, value: 42, writable: true }, 'property descriptor is correct'); }; ```
/content/code_sandbox/node_modules/has-symbols/test/tests.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
451
```javascript 'use strict'; var test = require('tape'); if (typeof Symbol === 'function' && typeof Symbol() === 'symbol') { test('has native Symbol support', function (t) { t.equal(typeof Symbol, 'function'); t.equal(typeof Symbol(), 'symbol'); t.end(); }); return; } var hasSymbols = require('../../shams'); test('polyfilled Symbols', function (t) { /* eslint-disable global-require */ t.equal(hasSymbols(), false, 'hasSymbols is false before polyfilling'); require('get-own-property-symbols'); require('../tests')(t); var hasSymbolsAfter = hasSymbols(); t.equal(hasSymbolsAfter, true, 'hasSymbols is true after polyfilling'); /* eslint-enable global-require */ t.end(); }); ```
/content/code_sandbox/node_modules/has-symbols/test/shams/get-own-property-symbols.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
165
```javascript /*! * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ 'use strict'; var psl = require('psl'); function getPublicSuffix(domain) { return psl.get(domain); } exports.getPublicSuffix = getPublicSuffix; ```
/content/code_sandbox/node_modules/tough-cookie/lib/pubsuffix-psl.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
338
```javascript /*! * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ 'use strict'; /*jshint unused:false */ function Store() { } exports.Store = Store; // Stores may be synchronous, but are still required to use a // Continuation-Passing Style API. The CookieJar itself will expose a "*Sync" // API that converts from synchronous-callbacks to imperative style. Store.prototype.synchronous = false; Store.prototype.findCookie = function(domain, path, key, cb) { throw new Error('findCookie is not implemented'); }; Store.prototype.findCookies = function(domain, path, cb) { throw new Error('findCookies is not implemented'); }; Store.prototype.putCookie = function(cookie, cb) { throw new Error('putCookie is not implemented'); }; Store.prototype.updateCookie = function(oldCookie, newCookie, cb) { // recommended default implementation: // return this.putCookie(newCookie, cb); throw new Error('updateCookie is not implemented'); }; Store.prototype.removeCookie = function(domain, path, key, cb) { throw new Error('removeCookie is not implemented'); }; Store.prototype.removeCookies = function(domain, path, cb) { throw new Error('removeCookies is not implemented'); }; Store.prototype.removeAllCookies = function(cb) { throw new Error('removeAllCookies is not implemented'); } Store.prototype.getAllCookies = function(cb) { throw new Error('getAllCookies is not implemented (therefore jar cannot be serialized)'); }; ```
/content/code_sandbox/node_modules/tough-cookie/lib/store.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
595
```javascript /*! * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ "use strict"; var pubsuffix = require('./pubsuffix-psl'); // Gives the permutation of all possible domainMatch()es of a given domain. The // array is in shortest-to-longest order. Handy for indexing. function permuteDomain (domain) { var pubSuf = pubsuffix.getPublicSuffix(domain); if (!pubSuf) { return null; } if (pubSuf == domain) { return [domain]; } var prefix = domain.slice(0, -(pubSuf.length + 1)); // ".example.com" var parts = prefix.split('.').reverse(); var cur = pubSuf; var permutations = [cur]; while (parts.length) { cur = parts.shift() + '.' + cur; permutations.push(cur); } return permutations; } exports.permuteDomain = permuteDomain; ```
/content/code_sandbox/node_modules/tough-cookie/lib/permuteDomain.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
488
```javascript /*! * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ "use strict"; /* * "A request-path path-matches a given cookie-path if at least one of the * following conditions holds:" */ function pathMatch (reqPath, cookiePath) { // "o The cookie-path and the request-path are identical." if (cookiePath === reqPath) { return true; } var idx = reqPath.indexOf(cookiePath); if (idx === 0) { // "o The cookie-path is a prefix of the request-path, and the last // character of the cookie-path is %x2F ("/")." if (cookiePath.substr(-1) === "/") { return true; } // " o The cookie-path is a prefix of the request-path, and the first // character of the request-path that is not included in the cookie- path // is a %x2F ("/") character." if (reqPath.substr(cookiePath.length, 1) === "/") { return true; } } return false; } exports.pathMatch = pathMatch; ```
/content/code_sandbox/node_modules/tough-cookie/lib/pathMatch.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
530
```javascript /*! * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ 'use strict'; var Store = require('./store').Store; var permuteDomain = require('./permuteDomain').permuteDomain; var pathMatch = require('./pathMatch').pathMatch; var util = require('util'); function MemoryCookieStore() { Store.call(this); this.idx = {}; } util.inherits(MemoryCookieStore, Store); exports.MemoryCookieStore = MemoryCookieStore; MemoryCookieStore.prototype.idx = null; // Since it's just a struct in RAM, this Store is synchronous MemoryCookieStore.prototype.synchronous = true; // force a default depth: MemoryCookieStore.prototype.inspect = function() { return "{ idx: "+util.inspect(this.idx, false, 2)+' }'; }; // Use the new custom inspection symbol to add the custom inspect function if // available. if (util.inspect.custom) { MemoryCookieStore.prototype[util.inspect.custom] = MemoryCookieStore.prototype.inspect; } MemoryCookieStore.prototype.findCookie = function(domain, path, key, cb) { if (!this.idx[domain]) { return cb(null,undefined); } if (!this.idx[domain][path]) { return cb(null,undefined); } return cb(null,this.idx[domain][path][key]||null); }; MemoryCookieStore.prototype.findCookies = function(domain, path, cb) { var results = []; if (!domain) { return cb(null,[]); } var pathMatcher; if (!path) { // null means "all paths" pathMatcher = function matchAll(domainIndex) { for (var curPath in domainIndex) { var pathIndex = domainIndex[curPath]; for (var key in pathIndex) { results.push(pathIndex[key]); } } }; } else { pathMatcher = function matchRFC(domainIndex) { //NOTE: we should use path-match algorithm from S5.1.4 here //(see : path_to_url#L299) Object.keys(domainIndex).forEach(function (cookiePath) { if (pathMatch(path, cookiePath)) { var pathIndex = domainIndex[cookiePath]; for (var key in pathIndex) { results.push(pathIndex[key]); } } }); }; } var domains = permuteDomain(domain) || [domain]; var idx = this.idx; domains.forEach(function(curDomain) { var domainIndex = idx[curDomain]; if (!domainIndex) { return; } pathMatcher(domainIndex); }); cb(null,results); }; MemoryCookieStore.prototype.putCookie = function(cookie, cb) { if (!this.idx[cookie.domain]) { this.idx[cookie.domain] = {}; } if (!this.idx[cookie.domain][cookie.path]) { this.idx[cookie.domain][cookie.path] = {}; } this.idx[cookie.domain][cookie.path][cookie.key] = cookie; cb(null); }; MemoryCookieStore.prototype.updateCookie = function(oldCookie, newCookie, cb) { // updateCookie() may avoid updating cookies that are identical. For example, // lastAccessed may not be important to some stores and an equality // comparison could exclude that field. this.putCookie(newCookie,cb); }; MemoryCookieStore.prototype.removeCookie = function(domain, path, key, cb) { if (this.idx[domain] && this.idx[domain][path] && this.idx[domain][path][key]) { delete this.idx[domain][path][key]; } cb(null); }; MemoryCookieStore.prototype.removeCookies = function(domain, path, cb) { if (this.idx[domain]) { if (path) { delete this.idx[domain][path]; } else { delete this.idx[domain]; } } return cb(null); }; MemoryCookieStore.prototype.removeAllCookies = function(cb) { this.idx = {}; return cb(null); } MemoryCookieStore.prototype.getAllCookies = function(cb) { var cookies = []; var idx = this.idx; var domains = Object.keys(idx); domains.forEach(function(domain) { var paths = Object.keys(idx[domain]); paths.forEach(function(path) { var keys = Object.keys(idx[domain][path]); keys.forEach(function(key) { if (key !== null) { cookies.push(idx[domain][path][key]); } }); }); }); // Sort by creationIndex so deserializing retains the creation order. // When implementing your own store, this SHOULD retain the order too cookies.sort(function(a,b) { return (a.creationIndex||0) - (b.creationIndex||0); }); cb(null, cookies); }; ```
/content/code_sandbox/node_modules/tough-cookie/lib/memstore.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
1,302
```javascript // generated by genversion module.exports = '2.5.0' ```
/content/code_sandbox/node_modules/tough-cookie/lib/version.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
18
```javascript /* eslint-disable node/no-deprecated-api */ var buffer = require('buffer') var Buffer = buffer.Buffer // alternative to using Object.keys for old browsers function copyProps (src, dst) { for (var key in src) { dst[key] = src[key] } } if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { module.exports = buffer } else { // Copy properties from require('buffer') copyProps(buffer, exports) exports.Buffer = SafeBuffer } function SafeBuffer (arg, encodingOrOffset, length) { return Buffer(arg, encodingOrOffset, length) } // Copy static methods from Buffer copyProps(Buffer, SafeBuffer) SafeBuffer.from = function (arg, encodingOrOffset, length) { if (typeof arg === 'number') { throw new TypeError('Argument must not be a number') } return Buffer(arg, encodingOrOffset, length) } SafeBuffer.alloc = function (size, fill, encoding) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } var buf = Buffer(size) if (fill !== undefined) { if (typeof encoding === 'string') { buf.fill(fill, encoding) } else { buf.fill(fill) } } else { buf.fill(0) } return buf } SafeBuffer.allocUnsafe = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return Buffer(size) } SafeBuffer.allocUnsafeSlow = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return buffer.SlowBuffer(size) } ```
/content/code_sandbox/node_modules/safe-buffer/index.js
javascript
2016-03-11T09:28:00
2024-08-16T17:55:54
antSword
AntSwordProject/antSword
3,579
381