code stringlengths 1 1.72M | language stringclasses 1 value |
|---|---|
#! /usr/bin/env python
"""Non-terminal symbols of Python grammar (from "graminit.h")."""
# This file is automatically generated; please don't muck it up!
#
# To update the symbols in this file, 'cd' to the top directory of
# the python source tree after building the interpreter and run:
#
# python Lib/symbol.py
#--start constants--
single_input = 256
file_input = 257
eval_input = 258
decorator = 259
decorators = 260
decorated = 261
funcdef = 262
parameters = 263
varargslist = 264
fpdef = 265
fplist = 266
stmt = 267
simple_stmt = 268
small_stmt = 269
expr_stmt = 270
augassign = 271
print_stmt = 272
del_stmt = 273
pass_stmt = 274
flow_stmt = 275
break_stmt = 276
continue_stmt = 277
return_stmt = 278
yield_stmt = 279
raise_stmt = 280
import_stmt = 281
import_name = 282
import_from = 283
import_as_name = 284
dotted_as_name = 285
import_as_names = 286
dotted_as_names = 287
dotted_name = 288
global_stmt = 289
exec_stmt = 290
assert_stmt = 291
compound_stmt = 292
if_stmt = 293
while_stmt = 294
for_stmt = 295
try_stmt = 296
with_stmt = 297
with_item = 298
except_clause = 299
suite = 300
testlist_safe = 301
old_test = 302
old_lambdef = 303
test = 304
or_test = 305
and_test = 306
not_test = 307
comparison = 308
comp_op = 309
expr = 310
xor_expr = 311
and_expr = 312
shift_expr = 313
arith_expr = 314
term = 315
factor = 316
power = 317
atom = 318
listmaker = 319
testlist_comp = 320
lambdef = 321
trailer = 322
subscriptlist = 323
subscript = 324
sliceop = 325
exprlist = 326
testlist = 327
dictmaker = 328
dictorsetmaker = 329
classdef = 330
arglist = 331
argument = 332
list_iter = 333
list_for = 334
list_if = 335
comp_iter = 336
comp_for = 337
comp_if = 338
testlist1 = 339
encoding_decl = 340
yield_expr = 341
#--end constants--
sym_name = {}
for _name, _value in globals().items():
if type(_value) is type(0):
sym_name[_value] = _name
def main():
import sys
import token
if len(sys.argv) == 1:
sys.argv = sys.argv + ["Include/graminit.h", "Lib/symbol.py"]
token.main()
if __name__ == "__main__":
main()
| Python |
#! /usr/bin/env python
"""Conversions to/from quoted-printable transport encoding as per RFC 1521."""
# (Dec 1991 version).
__all__ = ["encode", "decode", "encodestring", "decodestring"]
ESCAPE = '='
MAXLINESIZE = 76
HEX = '0123456789ABCDEF'
EMPTYSTRING = ''
try:
from binascii import a2b_qp, b2a_qp
except ImportError:
a2b_qp = None
b2a_qp = None
def needsquoting(c, quotetabs, header):
"""Decide whether a particular character needs to be quoted.
The 'quotetabs' flag indicates whether embedded tabs and spaces should be
quoted. Note that line-ending tabs and spaces are always encoded, as per
RFC 1521.
"""
if c in ' \t':
return quotetabs
# if header, we have to escape _ because _ is used to escape space
if c == '_':
return header
return c == ESCAPE or not (' ' <= c <= '~')
def quote(c):
"""Quote a single character."""
i = ord(c)
return ESCAPE + HEX[i//16] + HEX[i%16]
def encode(input, output, quotetabs, header = 0):
"""Read 'input', apply quoted-printable encoding, and write to 'output'.
'input' and 'output' are files with readline() and write() methods.
The 'quotetabs' flag indicates whether embedded tabs and spaces should be
quoted. Note that line-ending tabs and spaces are always encoded, as per
RFC 1521.
The 'header' flag indicates whether we are encoding spaces as _ as per
RFC 1522.
"""
if b2a_qp is not None:
data = input.read()
odata = b2a_qp(data, quotetabs = quotetabs, header = header)
output.write(odata)
return
def write(s, output=output, lineEnd='\n'):
# RFC 1521 requires that the line ending in a space or tab must have
# that trailing character encoded.
if s and s[-1:] in ' \t':
output.write(s[:-1] + quote(s[-1]) + lineEnd)
elif s == '.':
output.write(quote(s) + lineEnd)
else:
output.write(s + lineEnd)
prevline = None
while 1:
line = input.readline()
if not line:
break
outline = []
# Strip off any readline induced trailing newline
stripped = ''
if line[-1:] == '\n':
line = line[:-1]
stripped = '\n'
# Calculate the un-length-limited encoded line
for c in line:
if needsquoting(c, quotetabs, header):
c = quote(c)
if header and c == ' ':
outline.append('_')
else:
outline.append(c)
# First, write out the previous line
if prevline is not None:
write(prevline)
# Now see if we need any soft line breaks because of RFC-imposed
# length limitations. Then do the thisline->prevline dance.
thisline = EMPTYSTRING.join(outline)
while len(thisline) > MAXLINESIZE:
# Don't forget to include the soft line break `=' sign in the
# length calculation!
write(thisline[:MAXLINESIZE-1], lineEnd='=\n')
thisline = thisline[MAXLINESIZE-1:]
# Write out the current line
prevline = thisline
# Write out the last line, without a trailing newline
if prevline is not None:
write(prevline, lineEnd=stripped)
def encodestring(s, quotetabs = 0, header = 0):
if b2a_qp is not None:
return b2a_qp(s, quotetabs = quotetabs, header = header)
from cStringIO import StringIO
infp = StringIO(s)
outfp = StringIO()
encode(infp, outfp, quotetabs, header)
return outfp.getvalue()
def decode(input, output, header = 0):
"""Read 'input', apply quoted-printable decoding, and write to 'output'.
'input' and 'output' are files with readline() and write() methods.
If 'header' is true, decode underscore as space (per RFC 1522)."""
if a2b_qp is not None:
data = input.read()
odata = a2b_qp(data, header = header)
output.write(odata)
return
new = ''
while 1:
line = input.readline()
if not line: break
i, n = 0, len(line)
if n > 0 and line[n-1] == '\n':
partial = 0; n = n-1
# Strip trailing whitespace
while n > 0 and line[n-1] in " \t\r":
n = n-1
else:
partial = 1
while i < n:
c = line[i]
if c == '_' and header:
new = new + ' '; i = i+1
elif c != ESCAPE:
new = new + c; i = i+1
elif i+1 == n and not partial:
partial = 1; break
elif i+1 < n and line[i+1] == ESCAPE:
new = new + ESCAPE; i = i+2
elif i+2 < n and ishex(line[i+1]) and ishex(line[i+2]):
new = new + chr(unhex(line[i+1:i+3])); i = i+3
else: # Bad escape sequence -- leave it in
new = new + c; i = i+1
if not partial:
output.write(new + '\n')
new = ''
if new:
output.write(new)
def decodestring(s, header = 0):
if a2b_qp is not None:
return a2b_qp(s, header = header)
from cStringIO import StringIO
infp = StringIO(s)
outfp = StringIO()
decode(infp, outfp, header = header)
return outfp.getvalue()
# Other helper functions
def ishex(c):
"""Return true if the character 'c' is a hexadecimal digit."""
return '0' <= c <= '9' or 'a' <= c <= 'f' or 'A' <= c <= 'F'
def unhex(s):
"""Get the integer value of a hexadecimal number."""
bits = 0
for c in s:
if '0' <= c <= '9':
i = ord('0')
elif 'a' <= c <= 'f':
i = ord('a')-10
elif 'A' <= c <= 'F':
i = ord('A')-10
else:
break
bits = bits*16 + (ord(c) - i)
return bits
def main():
import sys
import getopt
try:
opts, args = getopt.getopt(sys.argv[1:], 'td')
except getopt.error, msg:
sys.stdout = sys.stderr
print msg
print "usage: quopri [-t | -d] [file] ..."
print "-t: quote tabs"
print "-d: decode; default encode"
sys.exit(2)
deco = 0
tabs = 0
for o, a in opts:
if o == '-t': tabs = 1
if o == '-d': deco = 1
if tabs and deco:
sys.stdout = sys.stderr
print "-t and -d are mutually exclusive"
sys.exit(2)
if not args: args = ['-']
sts = 0
for file in args:
if file == '-':
fp = sys.stdin
else:
try:
fp = open(file)
except IOError, msg:
sys.stderr.write("%s: can't open (%s)\n" % (file, msg))
sts = 1
continue
if deco:
decode(fp, sys.stdout)
else:
encode(fp, sys.stdout, tabs)
if fp is not sys.stdin:
fp.close()
if sts:
sys.exit(sts)
if __name__ == '__main__':
main()
| Python |
#! /usr/bin/env python
"""Mimification and unmimification of mail messages.
Decode quoted-printable parts of a mail message or encode using
quoted-printable.
Usage:
mimify(input, output)
unmimify(input, output, decode_base64 = 0)
to encode and decode respectively. Input and output may be the name
of a file or an open file object. Only a readline() method is used
on the input file, only a write() method is used on the output file.
When using file names, the input and output file names may be the
same.
Interactive usage:
mimify.py -e [infile [outfile]]
mimify.py -d [infile [outfile]]
to encode and decode respectively. Infile defaults to standard
input and outfile to standard output.
"""
# Configure
MAXLEN = 200 # if lines longer than this, encode as quoted-printable
CHARSET = 'ISO-8859-1' # default charset for non-US-ASCII mail
QUOTE = '> ' # string replies are quoted with
# End configure
import re
import warnings
warnings.warn("the mimify module is deprecated; use the email package instead",
DeprecationWarning, 2)
__all__ = ["mimify","unmimify","mime_encode_header","mime_decode_header"]
qp = re.compile('^content-transfer-encoding:\\s*quoted-printable', re.I)
base64_re = re.compile('^content-transfer-encoding:\\s*base64', re.I)
mp = re.compile('^content-type:.*multipart/.*boundary="?([^;"\n]*)', re.I|re.S)
chrset = re.compile('^(content-type:.*charset=")(us-ascii|iso-8859-[0-9]+)(".*)', re.I|re.S)
he = re.compile('^-*\n')
mime_code = re.compile('=([0-9a-f][0-9a-f])', re.I)
mime_head = re.compile('=\\?iso-8859-1\\?q\\?([^? \t\n]+)\\?=', re.I)
repl = re.compile('^subject:\\s+re: ', re.I)
class File:
"""A simple fake file object that knows about limited read-ahead and
boundaries. The only supported method is readline()."""
def __init__(self, file, boundary):
self.file = file
self.boundary = boundary
self.peek = None
def readline(self):
if self.peek is not None:
return ''
line = self.file.readline()
if not line:
return line
if self.boundary:
if line == self.boundary + '\n':
self.peek = line
return ''
if line == self.boundary + '--\n':
self.peek = line
return ''
return line
class HeaderFile:
def __init__(self, file):
self.file = file
self.peek = None
def readline(self):
if self.peek is not None:
line = self.peek
self.peek = None
else:
line = self.file.readline()
if not line:
return line
if he.match(line):
return line
while 1:
self.peek = self.file.readline()
if len(self.peek) == 0 or \
(self.peek[0] != ' ' and self.peek[0] != '\t'):
return line
line = line + self.peek
self.peek = None
def mime_decode(line):
"""Decode a single line of quoted-printable text to 8bit."""
newline = ''
pos = 0
while 1:
res = mime_code.search(line, pos)
if res is None:
break
newline = newline + line[pos:res.start(0)] + \
chr(int(res.group(1), 16))
pos = res.end(0)
return newline + line[pos:]
def mime_decode_header(line):
"""Decode a header line to 8bit."""
newline = ''
pos = 0
while 1:
res = mime_head.search(line, pos)
if res is None:
break
match = res.group(1)
# convert underscores to spaces (before =XX conversion!)
match = ' '.join(match.split('_'))
newline = newline + line[pos:res.start(0)] + mime_decode(match)
pos = res.end(0)
return newline + line[pos:]
def unmimify_part(ifile, ofile, decode_base64 = 0):
"""Convert a quoted-printable part of a MIME mail message to 8bit."""
multipart = None
quoted_printable = 0
is_base64 = 0
is_repl = 0
if ifile.boundary and ifile.boundary[:2] == QUOTE:
prefix = QUOTE
else:
prefix = ''
# read header
hfile = HeaderFile(ifile)
while 1:
line = hfile.readline()
if not line:
return
if prefix and line[:len(prefix)] == prefix:
line = line[len(prefix):]
pref = prefix
else:
pref = ''
line = mime_decode_header(line)
if qp.match(line):
quoted_printable = 1
continue # skip this header
if decode_base64 and base64_re.match(line):
is_base64 = 1
continue
ofile.write(pref + line)
if not prefix and repl.match(line):
# we're dealing with a reply message
is_repl = 1
mp_res = mp.match(line)
if mp_res:
multipart = '--' + mp_res.group(1)
if he.match(line):
break
if is_repl and (quoted_printable or multipart):
is_repl = 0
# read body
while 1:
line = ifile.readline()
if not line:
return
line = re.sub(mime_head, '\\1', line)
if prefix and line[:len(prefix)] == prefix:
line = line[len(prefix):]
pref = prefix
else:
pref = ''
## if is_repl and len(line) >= 4 and line[:4] == QUOTE+'--' and line[-3:] != '--\n':
## multipart = line[:-1]
while multipart:
if line == multipart + '--\n':
ofile.write(pref + line)
multipart = None
line = None
break
if line == multipart + '\n':
ofile.write(pref + line)
nifile = File(ifile, multipart)
unmimify_part(nifile, ofile, decode_base64)
line = nifile.peek
if not line:
# premature end of file
break
continue
# not a boundary between parts
break
if line and quoted_printable:
while line[-2:] == '=\n':
line = line[:-2]
newline = ifile.readline()
if newline[:len(QUOTE)] == QUOTE:
newline = newline[len(QUOTE):]
line = line + newline
line = mime_decode(line)
if line and is_base64 and not pref:
import base64
line = base64.decodestring(line)
if line:
ofile.write(pref + line)
def unmimify(infile, outfile, decode_base64 = 0):
"""Convert quoted-printable parts of a MIME mail message to 8bit."""
if type(infile) == type(''):
ifile = open(infile)
if type(outfile) == type('') and infile == outfile:
import os
d, f = os.path.split(infile)
os.rename(infile, os.path.join(d, ',' + f))
else:
ifile = infile
if type(outfile) == type(''):
ofile = open(outfile, 'w')
else:
ofile = outfile
nifile = File(ifile, None)
unmimify_part(nifile, ofile, decode_base64)
ofile.flush()
mime_char = re.compile('[=\177-\377]') # quote these chars in body
mime_header_char = re.compile('[=?\177-\377]') # quote these in header
def mime_encode(line, header):
"""Code a single line as quoted-printable.
If header is set, quote some extra characters."""
if header:
reg = mime_header_char
else:
reg = mime_char
newline = ''
pos = 0
if len(line) >= 5 and line[:5] == 'From ':
# quote 'From ' at the start of a line for stupid mailers
newline = ('=%02x' % ord('F')).upper()
pos = 1
while 1:
res = reg.search(line, pos)
if res is None:
break
newline = newline + line[pos:res.start(0)] + \
('=%02x' % ord(res.group(0))).upper()
pos = res.end(0)
line = newline + line[pos:]
newline = ''
while len(line) >= 75:
i = 73
while line[i] == '=' or line[i-1] == '=':
i = i - 1
i = i + 1
newline = newline + line[:i] + '=\n'
line = line[i:]
return newline + line
mime_header = re.compile('([ \t(]|^)([-a-zA-Z0-9_+]*[\177-\377][-a-zA-Z0-9_+\177-\377]*)(?=[ \t)]|\n)')
def mime_encode_header(line):
"""Code a single header line as quoted-printable."""
newline = ''
pos = 0
while 1:
res = mime_header.search(line, pos)
if res is None:
break
newline = '%s%s%s=?%s?Q?%s?=' % \
(newline, line[pos:res.start(0)], res.group(1),
CHARSET, mime_encode(res.group(2), 1))
pos = res.end(0)
return newline + line[pos:]
mv = re.compile('^mime-version:', re.I)
cte = re.compile('^content-transfer-encoding:', re.I)
iso_char = re.compile('[\177-\377]')
def mimify_part(ifile, ofile, is_mime):
"""Convert an 8bit part of a MIME mail message to quoted-printable."""
has_cte = is_qp = is_base64 = 0
multipart = None
must_quote_body = must_quote_header = has_iso_chars = 0
header = []
header_end = ''
message = []
message_end = ''
# read header
hfile = HeaderFile(ifile)
while 1:
line = hfile.readline()
if not line:
break
if not must_quote_header and iso_char.search(line):
must_quote_header = 1
if mv.match(line):
is_mime = 1
if cte.match(line):
has_cte = 1
if qp.match(line):
is_qp = 1
elif base64_re.match(line):
is_base64 = 1
mp_res = mp.match(line)
if mp_res:
multipart = '--' + mp_res.group(1)
if he.match(line):
header_end = line
break
header.append(line)
# read body
while 1:
line = ifile.readline()
if not line:
break
if multipart:
if line == multipart + '--\n':
message_end = line
break
if line == multipart + '\n':
message_end = line
break
if is_base64:
message.append(line)
continue
if is_qp:
while line[-2:] == '=\n':
line = line[:-2]
newline = ifile.readline()
if newline[:len(QUOTE)] == QUOTE:
newline = newline[len(QUOTE):]
line = line + newline
line = mime_decode(line)
message.append(line)
if not has_iso_chars:
if iso_char.search(line):
has_iso_chars = must_quote_body = 1
if not must_quote_body:
if len(line) > MAXLEN:
must_quote_body = 1
# convert and output header and body
for line in header:
if must_quote_header:
line = mime_encode_header(line)
chrset_res = chrset.match(line)
if chrset_res:
if has_iso_chars:
# change us-ascii into iso-8859-1
if chrset_res.group(2).lower() == 'us-ascii':
line = '%s%s%s' % (chrset_res.group(1),
CHARSET,
chrset_res.group(3))
else:
# change iso-8859-* into us-ascii
line = '%sus-ascii%s' % chrset_res.group(1, 3)
if has_cte and cte.match(line):
line = 'Content-Transfer-Encoding: '
if is_base64:
line = line + 'base64\n'
elif must_quote_body:
line = line + 'quoted-printable\n'
else:
line = line + '7bit\n'
ofile.write(line)
if (must_quote_header or must_quote_body) and not is_mime:
ofile.write('Mime-Version: 1.0\n')
ofile.write('Content-Type: text/plain; ')
if has_iso_chars:
ofile.write('charset="%s"\n' % CHARSET)
else:
ofile.write('charset="us-ascii"\n')
if must_quote_body and not has_cte:
ofile.write('Content-Transfer-Encoding: quoted-printable\n')
ofile.write(header_end)
for line in message:
if must_quote_body:
line = mime_encode(line, 0)
ofile.write(line)
ofile.write(message_end)
line = message_end
while multipart:
if line == multipart + '--\n':
# read bit after the end of the last part
while 1:
line = ifile.readline()
if not line:
return
if must_quote_body:
line = mime_encode(line, 0)
ofile.write(line)
if line == multipart + '\n':
nifile = File(ifile, multipart)
mimify_part(nifile, ofile, 1)
line = nifile.peek
if not line:
# premature end of file
break
ofile.write(line)
continue
# unexpectedly no multipart separator--copy rest of file
while 1:
line = ifile.readline()
if not line:
return
if must_quote_body:
line = mime_encode(line, 0)
ofile.write(line)
def mimify(infile, outfile):
"""Convert 8bit parts of a MIME mail message to quoted-printable."""
if type(infile) == type(''):
ifile = open(infile)
if type(outfile) == type('') and infile == outfile:
import os
d, f = os.path.split(infile)
os.rename(infile, os.path.join(d, ',' + f))
else:
ifile = infile
if type(outfile) == type(''):
ofile = open(outfile, 'w')
else:
ofile = outfile
nifile = File(ifile, None)
mimify_part(nifile, ofile, 0)
ofile.flush()
import sys
if __name__ == '__main__' or (len(sys.argv) > 0 and sys.argv[0] == 'mimify'):
import getopt
usage = 'Usage: mimify [-l len] -[ed] [infile [outfile]]'
decode_base64 = 0
opts, args = getopt.getopt(sys.argv[1:], 'l:edb')
if len(args) not in (0, 1, 2):
print usage
sys.exit(1)
if (('-e', '') in opts) == (('-d', '') in opts) or \
((('-b', '') in opts) and (('-d', '') not in opts)):
print usage
sys.exit(1)
for o, a in opts:
if o == '-e':
encode = mimify
elif o == '-d':
encode = unmimify
elif o == '-l':
try:
MAXLEN = int(a)
except (ValueError, OverflowError):
print usage
sys.exit(1)
elif o == '-b':
decode_base64 = 1
if len(args) == 0:
encode_args = (sys.stdin, sys.stdout)
elif len(args) == 1:
encode_args = (args[0], sys.stdout)
else:
encode_args = (args[0], args[1])
if decode_base64:
encode_args = encode_args + (decode_base64,)
encode(*encode_args)
| Python |
#! /usr/bin/env python
"""Read/write support for Maildir, mbox, MH, Babyl, and MMDF mailboxes."""
# Notes for authors of new mailbox subclasses:
#
# Remember to fsync() changes to disk before closing a modified file
# or returning from a flush() method. See functions _sync_flush() and
# _sync_close().
import sys
import os
import time
import calendar
import socket
import errno
import copy
import email
import email.message
import email.generator
import StringIO
try:
if sys.platform == 'os2emx':
# OS/2 EMX fcntl() not adequate
raise ImportError
import fcntl
except ImportError:
fcntl = None
import warnings
with warnings.catch_warnings():
if sys.py3kwarning:
warnings.filterwarnings("ignore", ".*rfc822 has been removed",
DeprecationWarning)
import rfc822
__all__ = [ 'Mailbox', 'Maildir', 'mbox', 'MH', 'Babyl', 'MMDF',
'Message', 'MaildirMessage', 'mboxMessage', 'MHMessage',
'BabylMessage', 'MMDFMessage', 'UnixMailbox',
'PortableUnixMailbox', 'MmdfMailbox', 'MHMailbox', 'BabylMailbox' ]
class Mailbox:
"""A group of messages in a particular place."""
def __init__(self, path, factory=None, create=True):
"""Initialize a Mailbox instance."""
self._path = os.path.abspath(os.path.expanduser(path))
self._factory = factory
def add(self, message):
"""Add message and return assigned key."""
raise NotImplementedError('Method must be implemented by subclass')
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
raise NotImplementedError('Method must be implemented by subclass')
def __delitem__(self, key):
self.remove(key)
def discard(self, key):
"""If the keyed message exists, remove it."""
try:
self.remove(key)
except KeyError:
pass
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
raise NotImplementedError('Method must be implemented by subclass')
def get(self, key, default=None):
"""Return the keyed message, or default if it doesn't exist."""
try:
return self.__getitem__(key)
except KeyError:
return default
def __getitem__(self, key):
"""Return the keyed message; raise KeyError if it doesn't exist."""
if not self._factory:
return self.get_message(key)
else:
return self._factory(self.get_file(key))
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
raise NotImplementedError('Method must be implemented by subclass')
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
raise NotImplementedError('Method must be implemented by subclass')
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
raise NotImplementedError('Method must be implemented by subclass')
def iterkeys(self):
"""Return an iterator over keys."""
raise NotImplementedError('Method must be implemented by subclass')
def keys(self):
"""Return a list of keys."""
return list(self.iterkeys())
def itervalues(self):
"""Return an iterator over all messages."""
for key in self.iterkeys():
try:
value = self[key]
except KeyError:
continue
yield value
def __iter__(self):
return self.itervalues()
def values(self):
"""Return a list of messages. Memory intensive."""
return list(self.itervalues())
def iteritems(self):
"""Return an iterator over (key, message) tuples."""
for key in self.iterkeys():
try:
value = self[key]
except KeyError:
continue
yield (key, value)
def items(self):
"""Return a list of (key, message) tuples. Memory intensive."""
return list(self.iteritems())
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
raise NotImplementedError('Method must be implemented by subclass')
def __contains__(self, key):
return self.has_key(key)
def __len__(self):
"""Return a count of messages in the mailbox."""
raise NotImplementedError('Method must be implemented by subclass')
def clear(self):
"""Delete all messages."""
for key in self.iterkeys():
self.discard(key)
def pop(self, key, default=None):
"""Delete the keyed message and return it, or default."""
try:
result = self[key]
except KeyError:
return default
self.discard(key)
return result
def popitem(self):
"""Delete an arbitrary (key, message) pair and return it."""
for key in self.iterkeys():
return (key, self.pop(key)) # This is only run once.
else:
raise KeyError('No messages in mailbox')
def update(self, arg=None):
"""Change the messages that correspond to certain keys."""
if hasattr(arg, 'iteritems'):
source = arg.iteritems()
elif hasattr(arg, 'items'):
source = arg.items()
else:
source = arg
bad_key = False
for key, message in source:
try:
self[key] = message
except KeyError:
bad_key = True
if bad_key:
raise KeyError('No message with key(s)')
def flush(self):
"""Write any pending changes to the disk."""
raise NotImplementedError('Method must be implemented by subclass')
def lock(self):
"""Lock the mailbox."""
raise NotImplementedError('Method must be implemented by subclass')
def unlock(self):
"""Unlock the mailbox if it is locked."""
raise NotImplementedError('Method must be implemented by subclass')
def close(self):
"""Flush and close the mailbox."""
raise NotImplementedError('Method must be implemented by subclass')
def _dump_message(self, message, target, mangle_from_=False):
# Most files are opened in binary mode to allow predictable seeking.
# To get native line endings on disk, the user-friendly \n line endings
# used in strings and by email.Message are translated here.
"""Dump message contents to target file."""
if isinstance(message, email.message.Message):
buffer = StringIO.StringIO()
gen = email.generator.Generator(buffer, mangle_from_, 0)
gen.flatten(message)
buffer.seek(0)
target.write(buffer.read().replace('\n', os.linesep))
elif isinstance(message, str):
if mangle_from_:
message = message.replace('\nFrom ', '\n>From ')
message = message.replace('\n', os.linesep)
target.write(message)
elif hasattr(message, 'read'):
while True:
line = message.readline()
if line == '':
break
if mangle_from_ and line.startswith('From '):
line = '>From ' + line[5:]
line = line.replace('\n', os.linesep)
target.write(line)
else:
raise TypeError('Invalid message type: %s' % type(message))
class Maildir(Mailbox):
"""A qmail-style Maildir mailbox."""
colon = ':'
def __init__(self, dirname, factory=rfc822.Message, create=True):
"""Initialize a Maildir instance."""
Mailbox.__init__(self, dirname, factory, create)
if not os.path.exists(self._path):
if create:
os.mkdir(self._path, 0700)
os.mkdir(os.path.join(self._path, 'tmp'), 0700)
os.mkdir(os.path.join(self._path, 'new'), 0700)
os.mkdir(os.path.join(self._path, 'cur'), 0700)
else:
raise NoSuchMailboxError(self._path)
self._toc = {}
self._last_read = None # Records last time we read cur/new
# NOTE: we manually invalidate _last_read each time we do any
# modifications ourselves, otherwise we might get tripped up by
# bogus mtime behaviour on some systems (see issue #6896).
def add(self, message):
"""Add message and return assigned key."""
tmp_file = self._create_tmp()
try:
self._dump_message(message, tmp_file)
finally:
_sync_close(tmp_file)
if isinstance(message, MaildirMessage):
subdir = message.get_subdir()
suffix = self.colon + message.get_info()
if suffix == self.colon:
suffix = ''
else:
subdir = 'new'
suffix = ''
uniq = os.path.basename(tmp_file.name).split(self.colon)[0]
dest = os.path.join(self._path, subdir, uniq + suffix)
try:
if hasattr(os, 'link'):
os.link(tmp_file.name, dest)
os.remove(tmp_file.name)
else:
os.rename(tmp_file.name, dest)
except OSError, e:
os.remove(tmp_file.name)
if e.errno == errno.EEXIST:
raise ExternalClashError('Name clash with existing message: %s'
% dest)
else:
raise
if isinstance(message, MaildirMessage):
os.utime(dest, (os.path.getatime(dest), message.get_date()))
# Invalidate cached toc
self._last_read = None
return uniq
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
os.remove(os.path.join(self._path, self._lookup(key)))
# Invalidate cached toc (only on success)
self._last_read = None
def discard(self, key):
"""If the keyed message exists, remove it."""
# This overrides an inapplicable implementation in the superclass.
try:
self.remove(key)
except KeyError:
pass
except OSError, e:
if e.errno != errno.ENOENT:
raise
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
old_subpath = self._lookup(key)
temp_key = self.add(message)
temp_subpath = self._lookup(temp_key)
if isinstance(message, MaildirMessage):
# temp's subdir and suffix were specified by message.
dominant_subpath = temp_subpath
else:
# temp's subdir and suffix were defaults from add().
dominant_subpath = old_subpath
subdir = os.path.dirname(dominant_subpath)
if self.colon in dominant_subpath:
suffix = self.colon + dominant_subpath.split(self.colon)[-1]
else:
suffix = ''
self.discard(key)
new_path = os.path.join(self._path, subdir, key + suffix)
os.rename(os.path.join(self._path, temp_subpath), new_path)
if isinstance(message, MaildirMessage):
os.utime(new_path, (os.path.getatime(new_path),
message.get_date()))
# Invalidate cached toc
self._last_read = None
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
subpath = self._lookup(key)
f = open(os.path.join(self._path, subpath), 'r')
try:
if self._factory:
msg = self._factory(f)
else:
msg = MaildirMessage(f)
finally:
f.close()
subdir, name = os.path.split(subpath)
msg.set_subdir(subdir)
if self.colon in name:
msg.set_info(name.split(self.colon)[-1])
msg.set_date(os.path.getmtime(os.path.join(self._path, subpath)))
return msg
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
f = open(os.path.join(self._path, self._lookup(key)), 'r')
try:
return f.read()
finally:
f.close()
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
f = open(os.path.join(self._path, self._lookup(key)), 'rb')
return _ProxyFile(f)
def iterkeys(self):
"""Return an iterator over keys."""
self._refresh()
for key in self._toc:
try:
self._lookup(key)
except KeyError:
continue
yield key
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
self._refresh()
return key in self._toc
def __len__(self):
"""Return a count of messages in the mailbox."""
self._refresh()
return len(self._toc)
def flush(self):
"""Write any pending changes to disk."""
# Maildir changes are always written immediately, so there's nothing
# to do except invalidate our cached toc.
self._last_read = None
def lock(self):
"""Lock the mailbox."""
return
def unlock(self):
"""Unlock the mailbox if it is locked."""
return
def close(self):
"""Flush and close the mailbox."""
return
def list_folders(self):
"""Return a list of folder names."""
result = []
for entry in os.listdir(self._path):
if len(entry) > 1 and entry[0] == '.' and \
os.path.isdir(os.path.join(self._path, entry)):
result.append(entry[1:])
return result
def get_folder(self, folder):
"""Return a Maildir instance for the named folder."""
return Maildir(os.path.join(self._path, '.' + folder),
factory=self._factory,
create=False)
def add_folder(self, folder):
"""Create a folder and return a Maildir instance representing it."""
path = os.path.join(self._path, '.' + folder)
result = Maildir(path, factory=self._factory)
maildirfolder_path = os.path.join(path, 'maildirfolder')
if not os.path.exists(maildirfolder_path):
os.close(os.open(maildirfolder_path, os.O_CREAT | os.O_WRONLY,
0666))
return result
def remove_folder(self, folder):
"""Delete the named folder, which must be empty."""
path = os.path.join(self._path, '.' + folder)
for entry in os.listdir(os.path.join(path, 'new')) + \
os.listdir(os.path.join(path, 'cur')):
if len(entry) < 1 or entry[0] != '.':
raise NotEmptyError('Folder contains message(s): %s' % folder)
for entry in os.listdir(path):
if entry != 'new' and entry != 'cur' and entry != 'tmp' and \
os.path.isdir(os.path.join(path, entry)):
raise NotEmptyError("Folder contains subdirectory '%s': %s" %
(folder, entry))
for root, dirs, files in os.walk(path, topdown=False):
for entry in files:
os.remove(os.path.join(root, entry))
for entry in dirs:
os.rmdir(os.path.join(root, entry))
os.rmdir(path)
def clean(self):
"""Delete old files in "tmp"."""
now = time.time()
for entry in os.listdir(os.path.join(self._path, 'tmp')):
path = os.path.join(self._path, 'tmp', entry)
if now - os.path.getatime(path) > 129600: # 60 * 60 * 36
os.remove(path)
_count = 1 # This is used to generate unique file names.
def _create_tmp(self):
"""Create a file in the tmp subdirectory and open and return it."""
now = time.time()
hostname = socket.gethostname()
if '/' in hostname:
hostname = hostname.replace('/', r'\057')
if ':' in hostname:
hostname = hostname.replace(':', r'\072')
uniq = "%s.M%sP%sQ%s.%s" % (int(now), int(now % 1 * 1e6), os.getpid(),
Maildir._count, hostname)
path = os.path.join(self._path, 'tmp', uniq)
try:
os.stat(path)
except OSError, e:
if e.errno == errno.ENOENT:
Maildir._count += 1
try:
return _create_carefully(path)
except OSError, e:
if e.errno != errno.EEXIST:
raise
else:
raise
# Fall through to here if stat succeeded or open raised EEXIST.
raise ExternalClashError('Name clash prevented file creation: %s' %
path)
def _refresh(self):
"""Update table of contents mapping."""
if self._last_read is not None:
for subdir in ('new', 'cur'):
mtime = os.path.getmtime(os.path.join(self._path, subdir))
if mtime > self._last_read:
break
else:
return
# We record the current time - 1sec so that, if _refresh() is called
# again in the same second, we will always re-read the mailbox
# just in case it's been modified. (os.path.mtime() only has
# 1sec resolution.) This results in a few unnecessary re-reads
# when _refresh() is called multiple times in the same second,
# but once the clock ticks over, we will only re-read as needed.
now = time.time() - 1
self._toc = {}
def update_dir (subdir):
path = os.path.join(self._path, subdir)
for entry in os.listdir(path):
p = os.path.join(path, entry)
if os.path.isdir(p):
continue
uniq = entry.split(self.colon)[0]
self._toc[uniq] = os.path.join(subdir, entry)
update_dir('new')
update_dir('cur')
self._last_read = now
def _lookup(self, key):
"""Use TOC to return subpath for given key, or raise a KeyError."""
try:
if os.path.exists(os.path.join(self._path, self._toc[key])):
return self._toc[key]
except KeyError:
pass
self._refresh()
try:
return self._toc[key]
except KeyError:
raise KeyError('No message with key: %s' % key)
# This method is for backward compatibility only.
def next(self):
"""Return the next message in a one-time iteration."""
if not hasattr(self, '_onetime_keys'):
self._onetime_keys = self.iterkeys()
while True:
try:
return self[self._onetime_keys.next()]
except StopIteration:
return None
except KeyError:
continue
class _singlefileMailbox(Mailbox):
"""A single-file mailbox."""
def __init__(self, path, factory=None, create=True):
"""Initialize a single-file mailbox."""
Mailbox.__init__(self, path, factory, create)
try:
f = open(self._path, 'rb+')
except IOError, e:
if e.errno == errno.ENOENT:
if create:
f = open(self._path, 'wb+')
else:
raise NoSuchMailboxError(self._path)
elif e.errno == errno.EACCES:
f = open(self._path, 'rb')
else:
raise
self._file = f
self._toc = None
self._next_key = 0
self._pending = False # No changes require rewriting the file.
self._locked = False
self._file_length = None # Used to record mailbox size
def add(self, message):
"""Add message and return assigned key."""
self._lookup()
self._toc[self._next_key] = self._append_message(message)
self._next_key += 1
self._pending = True
return self._next_key - 1
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
self._lookup(key)
del self._toc[key]
self._pending = True
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
self._lookup(key)
self._toc[key] = self._append_message(message)
self._pending = True
def iterkeys(self):
"""Return an iterator over keys."""
self._lookup()
for key in self._toc.keys():
yield key
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
self._lookup()
return key in self._toc
def __len__(self):
"""Return a count of messages in the mailbox."""
self._lookup()
return len(self._toc)
def lock(self):
"""Lock the mailbox."""
if not self._locked:
_lock_file(self._file)
self._locked = True
def unlock(self):
"""Unlock the mailbox if it is locked."""
if self._locked:
_unlock_file(self._file)
self._locked = False
def flush(self):
"""Write any pending changes to disk."""
if not self._pending:
return
# In order to be writing anything out at all, self._toc must
# already have been generated (and presumably has been modified
# by adding or deleting an item).
assert self._toc is not None
# Check length of self._file; if it's changed, some other process
# has modified the mailbox since we scanned it.
self._file.seek(0, 2)
cur_len = self._file.tell()
if cur_len != self._file_length:
raise ExternalClashError('Size of mailbox file changed '
'(expected %i, found %i)' %
(self._file_length, cur_len))
new_file = _create_temporary(self._path)
try:
new_toc = {}
self._pre_mailbox_hook(new_file)
for key in sorted(self._toc.keys()):
start, stop = self._toc[key]
self._file.seek(start)
self._pre_message_hook(new_file)
new_start = new_file.tell()
while True:
buffer = self._file.read(min(4096,
stop - self._file.tell()))
if buffer == '':
break
new_file.write(buffer)
new_toc[key] = (new_start, new_file.tell())
self._post_message_hook(new_file)
except:
new_file.close()
os.remove(new_file.name)
raise
_sync_close(new_file)
# self._file is about to get replaced, so no need to sync.
self._file.close()
try:
os.rename(new_file.name, self._path)
except OSError, e:
if e.errno == errno.EEXIST or \
(os.name == 'os2' and e.errno == errno.EACCES):
os.remove(self._path)
os.rename(new_file.name, self._path)
else:
raise
self._file = open(self._path, 'rb+')
self._toc = new_toc
self._pending = False
if self._locked:
_lock_file(self._file, dotlock=False)
def _pre_mailbox_hook(self, f):
"""Called before writing the mailbox to file f."""
return
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
return
def _post_message_hook(self, f):
"""Called after writing each message to file f."""
return
def close(self):
"""Flush and close the mailbox."""
self.flush()
if self._locked:
self.unlock()
self._file.close() # Sync has been done by self.flush() above.
def _lookup(self, key=None):
"""Return (start, stop) or raise KeyError."""
if self._toc is None:
self._generate_toc()
if key is not None:
try:
return self._toc[key]
except KeyError:
raise KeyError('No message with key: %s' % key)
def _append_message(self, message):
"""Append message to mailbox and return (start, stop) offsets."""
self._file.seek(0, 2)
self._pre_message_hook(self._file)
offsets = self._install_message(message)
self._post_message_hook(self._file)
self._file.flush()
self._file_length = self._file.tell() # Record current length of mailbox
return offsets
class _mboxMMDF(_singlefileMailbox):
"""An mbox or MMDF mailbox."""
_mangle_from_ = True
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
from_line = self._file.readline().replace(os.linesep, '')
string = self._file.read(stop - self._file.tell())
msg = self._message_factory(string.replace(os.linesep, '\n'))
msg.set_from(from_line[5:])
return msg
def get_string(self, key, from_=False):
"""Return a string representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
if not from_:
self._file.readline()
string = self._file.read(stop - self._file.tell())
return string.replace(os.linesep, '\n')
def get_file(self, key, from_=False):
"""Return a file-like representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
if not from_:
self._file.readline()
return _PartialFile(self._file, self._file.tell(), stop)
def _install_message(self, message):
"""Format a message and blindly write to self._file."""
from_line = None
if isinstance(message, str) and message.startswith('From '):
newline = message.find('\n')
if newline != -1:
from_line = message[:newline]
message = message[newline + 1:]
else:
from_line = message
message = ''
elif isinstance(message, _mboxMMDFMessage):
from_line = 'From ' + message.get_from()
elif isinstance(message, email.message.Message):
from_line = message.get_unixfrom() # May be None.
if from_line is None:
from_line = 'From MAILER-DAEMON %s' % time.asctime(time.gmtime())
start = self._file.tell()
self._file.write(from_line + os.linesep)
self._dump_message(message, self._file, self._mangle_from_)
stop = self._file.tell()
return (start, stop)
class mbox(_mboxMMDF):
"""A classic mbox mailbox."""
_mangle_from_ = True
def __init__(self, path, factory=None, create=True):
"""Initialize an mbox mailbox."""
self._message_factory = mboxMessage
_mboxMMDF.__init__(self, path, factory, create)
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
if f.tell() != 0:
f.write(os.linesep)
def _generate_toc(self):
"""Generate key-to-(start, stop) table of contents."""
starts, stops = [], []
self._file.seek(0)
while True:
line_pos = self._file.tell()
line = self._file.readline()
if line.startswith('From '):
if len(stops) < len(starts):
stops.append(line_pos - len(os.linesep))
starts.append(line_pos)
elif line == '':
stops.append(line_pos)
break
self._toc = dict(enumerate(zip(starts, stops)))
self._next_key = len(self._toc)
self._file_length = self._file.tell()
class MMDF(_mboxMMDF):
"""An MMDF mailbox."""
def __init__(self, path, factory=None, create=True):
"""Initialize an MMDF mailbox."""
self._message_factory = MMDFMessage
_mboxMMDF.__init__(self, path, factory, create)
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
f.write('\001\001\001\001' + os.linesep)
def _post_message_hook(self, f):
"""Called after writing each message to file f."""
f.write(os.linesep + '\001\001\001\001' + os.linesep)
def _generate_toc(self):
"""Generate key-to-(start, stop) table of contents."""
starts, stops = [], []
self._file.seek(0)
next_pos = 0
while True:
line_pos = next_pos
line = self._file.readline()
next_pos = self._file.tell()
if line.startswith('\001\001\001\001' + os.linesep):
starts.append(next_pos)
while True:
line_pos = next_pos
line = self._file.readline()
next_pos = self._file.tell()
if line == '\001\001\001\001' + os.linesep:
stops.append(line_pos - len(os.linesep))
break
elif line == '':
stops.append(line_pos)
break
elif line == '':
break
self._toc = dict(enumerate(zip(starts, stops)))
self._next_key = len(self._toc)
self._file.seek(0, 2)
self._file_length = self._file.tell()
class MH(Mailbox):
"""An MH mailbox."""
def __init__(self, path, factory=None, create=True):
"""Initialize an MH instance."""
Mailbox.__init__(self, path, factory, create)
if not os.path.exists(self._path):
if create:
os.mkdir(self._path, 0700)
os.close(os.open(os.path.join(self._path, '.mh_sequences'),
os.O_CREAT | os.O_EXCL | os.O_WRONLY, 0600))
else:
raise NoSuchMailboxError(self._path)
self._locked = False
def add(self, message):
"""Add message and return assigned key."""
keys = self.keys()
if len(keys) == 0:
new_key = 1
else:
new_key = max(keys) + 1
new_path = os.path.join(self._path, str(new_key))
f = _create_carefully(new_path)
try:
if self._locked:
_lock_file(f)
try:
self._dump_message(message, f)
if isinstance(message, MHMessage):
self._dump_sequences(message, new_key)
finally:
if self._locked:
_unlock_file(f)
finally:
_sync_close(f)
return new_key
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
path = os.path.join(self._path, str(key))
try:
f = open(path, 'rb+')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
else:
f.close()
os.remove(path)
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
path = os.path.join(self._path, str(key))
try:
f = open(path, 'rb+')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
try:
if self._locked:
_lock_file(f)
try:
os.close(os.open(path, os.O_WRONLY | os.O_TRUNC))
self._dump_message(message, f)
if isinstance(message, MHMessage):
self._dump_sequences(message, key)
finally:
if self._locked:
_unlock_file(f)
finally:
_sync_close(f)
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
try:
if self._locked:
f = open(os.path.join(self._path, str(key)), 'r+')
else:
f = open(os.path.join(self._path, str(key)), 'r')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
try:
if self._locked:
_lock_file(f)
try:
msg = MHMessage(f)
finally:
if self._locked:
_unlock_file(f)
finally:
f.close()
for name, key_list in self.get_sequences().iteritems():
if key in key_list:
msg.add_sequence(name)
return msg
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
try:
if self._locked:
f = open(os.path.join(self._path, str(key)), 'r+')
else:
f = open(os.path.join(self._path, str(key)), 'r')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
try:
if self._locked:
_lock_file(f)
try:
return f.read()
finally:
if self._locked:
_unlock_file(f)
finally:
f.close()
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
try:
f = open(os.path.join(self._path, str(key)), 'rb')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
return _ProxyFile(f)
def iterkeys(self):
"""Return an iterator over keys."""
return iter(sorted(int(entry) for entry in os.listdir(self._path)
if entry.isdigit()))
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
return os.path.exists(os.path.join(self._path, str(key)))
def __len__(self):
"""Return a count of messages in the mailbox."""
return len(list(self.iterkeys()))
def lock(self):
"""Lock the mailbox."""
if not self._locked:
self._file = open(os.path.join(self._path, '.mh_sequences'), 'rb+')
_lock_file(self._file)
self._locked = True
def unlock(self):
"""Unlock the mailbox if it is locked."""
if self._locked:
_unlock_file(self._file)
_sync_close(self._file)
del self._file
self._locked = False
def flush(self):
"""Write any pending changes to the disk."""
return
def close(self):
"""Flush and close the mailbox."""
if self._locked:
self.unlock()
def list_folders(self):
"""Return a list of folder names."""
result = []
for entry in os.listdir(self._path):
if os.path.isdir(os.path.join(self._path, entry)):
result.append(entry)
return result
def get_folder(self, folder):
"""Return an MH instance for the named folder."""
return MH(os.path.join(self._path, folder),
factory=self._factory, create=False)
def add_folder(self, folder):
"""Create a folder and return an MH instance representing it."""
return MH(os.path.join(self._path, folder),
factory=self._factory)
def remove_folder(self, folder):
"""Delete the named folder, which must be empty."""
path = os.path.join(self._path, folder)
entries = os.listdir(path)
if entries == ['.mh_sequences']:
os.remove(os.path.join(path, '.mh_sequences'))
elif entries == []:
pass
else:
raise NotEmptyError('Folder not empty: %s' % self._path)
os.rmdir(path)
def get_sequences(self):
"""Return a name-to-key-list dictionary to define each sequence."""
results = {}
f = open(os.path.join(self._path, '.mh_sequences'), 'r')
try:
all_keys = set(self.keys())
for line in f:
try:
name, contents = line.split(':')
keys = set()
for spec in contents.split():
if spec.isdigit():
keys.add(int(spec))
else:
start, stop = (int(x) for x in spec.split('-'))
keys.update(range(start, stop + 1))
results[name] = [key for key in sorted(keys) \
if key in all_keys]
if len(results[name]) == 0:
del results[name]
except ValueError:
raise FormatError('Invalid sequence specification: %s' %
line.rstrip())
finally:
f.close()
return results
def set_sequences(self, sequences):
"""Set sequences using the given name-to-key-list dictionary."""
f = open(os.path.join(self._path, '.mh_sequences'), 'r+')
try:
os.close(os.open(f.name, os.O_WRONLY | os.O_TRUNC))
for name, keys in sequences.iteritems():
if len(keys) == 0:
continue
f.write('%s:' % name)
prev = None
completing = False
for key in sorted(set(keys)):
if key - 1 == prev:
if not completing:
completing = True
f.write('-')
elif completing:
completing = False
f.write('%s %s' % (prev, key))
else:
f.write(' %s' % key)
prev = key
if completing:
f.write(str(prev) + '\n')
else:
f.write('\n')
finally:
_sync_close(f)
def pack(self):
"""Re-name messages to eliminate numbering gaps. Invalidates keys."""
sequences = self.get_sequences()
prev = 0
changes = []
for key in self.iterkeys():
if key - 1 != prev:
changes.append((key, prev + 1))
if hasattr(os, 'link'):
os.link(os.path.join(self._path, str(key)),
os.path.join(self._path, str(prev + 1)))
os.unlink(os.path.join(self._path, str(key)))
else:
os.rename(os.path.join(self._path, str(key)),
os.path.join(self._path, str(prev + 1)))
prev += 1
self._next_key = prev + 1
if len(changes) == 0:
return
for name, key_list in sequences.items():
for old, new in changes:
if old in key_list:
key_list[key_list.index(old)] = new
self.set_sequences(sequences)
def _dump_sequences(self, message, key):
"""Inspect a new MHMessage and update sequences appropriately."""
pending_sequences = message.get_sequences()
all_sequences = self.get_sequences()
for name, key_list in all_sequences.iteritems():
if name in pending_sequences:
key_list.append(key)
elif key in key_list:
del key_list[key_list.index(key)]
for sequence in pending_sequences:
if sequence not in all_sequences:
all_sequences[sequence] = [key]
self.set_sequences(all_sequences)
class Babyl(_singlefileMailbox):
"""An Rmail-style Babyl mailbox."""
_special_labels = frozenset(('unseen', 'deleted', 'filed', 'answered',
'forwarded', 'edited', 'resent'))
def __init__(self, path, factory=None, create=True):
"""Initialize a Babyl mailbox."""
_singlefileMailbox.__init__(self, path, factory, create)
self._labels = {}
def add(self, message):
"""Add message and return assigned key."""
key = _singlefileMailbox.add(self, message)
if isinstance(message, BabylMessage):
self._labels[key] = message.get_labels()
return key
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
_singlefileMailbox.remove(self, key)
if key in self._labels:
del self._labels[key]
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
_singlefileMailbox.__setitem__(self, key, message)
if isinstance(message, BabylMessage):
self._labels[key] = message.get_labels()
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
self._file.readline() # Skip '1,' line specifying labels.
original_headers = StringIO.StringIO()
while True:
line = self._file.readline()
if line == '*** EOOH ***' + os.linesep or line == '':
break
original_headers.write(line.replace(os.linesep, '\n'))
visible_headers = StringIO.StringIO()
while True:
line = self._file.readline()
if line == os.linesep or line == '':
break
visible_headers.write(line.replace(os.linesep, '\n'))
body = self._file.read(stop - self._file.tell()).replace(os.linesep,
'\n')
msg = BabylMessage(original_headers.getvalue() + body)
msg.set_visible(visible_headers.getvalue())
if key in self._labels:
msg.set_labels(self._labels[key])
return msg
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
self._file.readline() # Skip '1,' line specifying labels.
original_headers = StringIO.StringIO()
while True:
line = self._file.readline()
if line == '*** EOOH ***' + os.linesep or line == '':
break
original_headers.write(line.replace(os.linesep, '\n'))
while True:
line = self._file.readline()
if line == os.linesep or line == '':
break
return original_headers.getvalue() + \
self._file.read(stop - self._file.tell()).replace(os.linesep,
'\n')
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
return StringIO.StringIO(self.get_string(key).replace('\n',
os.linesep))
def get_labels(self):
"""Return a list of user-defined labels in the mailbox."""
self._lookup()
labels = set()
for label_list in self._labels.values():
labels.update(label_list)
labels.difference_update(self._special_labels)
return list(labels)
def _generate_toc(self):
"""Generate key-to-(start, stop) table of contents."""
starts, stops = [], []
self._file.seek(0)
next_pos = 0
label_lists = []
while True:
line_pos = next_pos
line = self._file.readline()
next_pos = self._file.tell()
if line == '\037\014' + os.linesep:
if len(stops) < len(starts):
stops.append(line_pos - len(os.linesep))
starts.append(next_pos)
labels = [label.strip() for label
in self._file.readline()[1:].split(',')
if label.strip() != '']
label_lists.append(labels)
elif line == '\037' or line == '\037' + os.linesep:
if len(stops) < len(starts):
stops.append(line_pos - len(os.linesep))
elif line == '':
stops.append(line_pos - len(os.linesep))
break
self._toc = dict(enumerate(zip(starts, stops)))
self._labels = dict(enumerate(label_lists))
self._next_key = len(self._toc)
self._file.seek(0, 2)
self._file_length = self._file.tell()
def _pre_mailbox_hook(self, f):
"""Called before writing the mailbox to file f."""
f.write('BABYL OPTIONS:%sVersion: 5%sLabels:%s%s\037' %
(os.linesep, os.linesep, ','.join(self.get_labels()),
os.linesep))
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
f.write('\014' + os.linesep)
def _post_message_hook(self, f):
"""Called after writing each message to file f."""
f.write(os.linesep + '\037')
def _install_message(self, message):
"""Write message contents and return (start, stop)."""
start = self._file.tell()
if isinstance(message, BabylMessage):
special_labels = []
labels = []
for label in message.get_labels():
if label in self._special_labels:
special_labels.append(label)
else:
labels.append(label)
self._file.write('1')
for label in special_labels:
self._file.write(', ' + label)
self._file.write(',,')
for label in labels:
self._file.write(' ' + label + ',')
self._file.write(os.linesep)
else:
self._file.write('1,,' + os.linesep)
if isinstance(message, email.message.Message):
orig_buffer = StringIO.StringIO()
orig_generator = email.generator.Generator(orig_buffer, False, 0)
orig_generator.flatten(message)
orig_buffer.seek(0)
while True:
line = orig_buffer.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
break
self._file.write('*** EOOH ***' + os.linesep)
if isinstance(message, BabylMessage):
vis_buffer = StringIO.StringIO()
vis_generator = email.generator.Generator(vis_buffer, False, 0)
vis_generator.flatten(message.get_visible())
while True:
line = vis_buffer.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
break
else:
orig_buffer.seek(0)
while True:
line = orig_buffer.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
break
while True:
buffer = orig_buffer.read(4096) # Buffer size is arbitrary.
if buffer == '':
break
self._file.write(buffer.replace('\n', os.linesep))
elif isinstance(message, str):
body_start = message.find('\n\n') + 2
if body_start - 2 != -1:
self._file.write(message[:body_start].replace('\n',
os.linesep))
self._file.write('*** EOOH ***' + os.linesep)
self._file.write(message[:body_start].replace('\n',
os.linesep))
self._file.write(message[body_start:].replace('\n',
os.linesep))
else:
self._file.write('*** EOOH ***' + os.linesep + os.linesep)
self._file.write(message.replace('\n', os.linesep))
elif hasattr(message, 'readline'):
original_pos = message.tell()
first_pass = True
while True:
line = message.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
self._file.write('*** EOOH ***' + os.linesep)
if first_pass:
first_pass = False
message.seek(original_pos)
else:
break
while True:
buffer = message.read(4096) # Buffer size is arbitrary.
if buffer == '':
break
self._file.write(buffer.replace('\n', os.linesep))
else:
raise TypeError('Invalid message type: %s' % type(message))
stop = self._file.tell()
return (start, stop)
class Message(email.message.Message):
"""Message with mailbox-format-specific properties."""
def __init__(self, message=None):
"""Initialize a Message instance."""
if isinstance(message, email.message.Message):
self._become_message(copy.deepcopy(message))
if isinstance(message, Message):
message._explain_to(self)
elif isinstance(message, str):
self._become_message(email.message_from_string(message))
elif hasattr(message, "read"):
self._become_message(email.message_from_file(message))
elif message is None:
email.message.Message.__init__(self)
else:
raise TypeError('Invalid message type: %s' % type(message))
def _become_message(self, message):
"""Assume the non-format-specific state of message."""
for name in ('_headers', '_unixfrom', '_payload', '_charset',
'preamble', 'epilogue', 'defects', '_default_type'):
self.__dict__[name] = message.__dict__[name]
def _explain_to(self, message):
"""Copy format-specific state to message insofar as possible."""
if isinstance(message, Message):
return # There's nothing format-specific to explain.
else:
raise TypeError('Cannot convert to specified type')
class MaildirMessage(Message):
"""Message with Maildir-specific properties."""
def __init__(self, message=None):
"""Initialize a MaildirMessage instance."""
self._subdir = 'new'
self._info = ''
self._date = time.time()
Message.__init__(self, message)
def get_subdir(self):
"""Return 'new' or 'cur'."""
return self._subdir
def set_subdir(self, subdir):
"""Set subdir to 'new' or 'cur'."""
if subdir == 'new' or subdir == 'cur':
self._subdir = subdir
else:
raise ValueError("subdir must be 'new' or 'cur': %s" % subdir)
def get_flags(self):
"""Return as a string the flags that are set."""
if self._info.startswith('2,'):
return self._info[2:]
else:
return ''
def set_flags(self, flags):
"""Set the given flags and unset all others."""
self._info = '2,' + ''.join(sorted(flags))
def add_flag(self, flag):
"""Set the given flag(s) without changing others."""
self.set_flags(''.join(set(self.get_flags()) | set(flag)))
def remove_flag(self, flag):
"""Unset the given string flag(s) without changing others."""
if self.get_flags() != '':
self.set_flags(''.join(set(self.get_flags()) - set(flag)))
def get_date(self):
"""Return delivery date of message, in seconds since the epoch."""
return self._date
def set_date(self, date):
"""Set delivery date of message, in seconds since the epoch."""
try:
self._date = float(date)
except ValueError:
raise TypeError("can't convert to float: %s" % date)
def get_info(self):
"""Get the message's "info" as a string."""
return self._info
def set_info(self, info):
"""Set the message's "info" string."""
if isinstance(info, str):
self._info = info
else:
raise TypeError('info must be a string: %s' % type(info))
def _explain_to(self, message):
"""Copy Maildir-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
message.set_flags(self.get_flags())
message.set_subdir(self.get_subdir())
message.set_date(self.get_date())
elif isinstance(message, _mboxMMDFMessage):
flags = set(self.get_flags())
if 'S' in flags:
message.add_flag('R')
if self.get_subdir() == 'cur':
message.add_flag('O')
if 'T' in flags:
message.add_flag('D')
if 'F' in flags:
message.add_flag('F')
if 'R' in flags:
message.add_flag('A')
message.set_from('MAILER-DAEMON', time.gmtime(self.get_date()))
elif isinstance(message, MHMessage):
flags = set(self.get_flags())
if 'S' not in flags:
message.add_sequence('unseen')
if 'R' in flags:
message.add_sequence('replied')
if 'F' in flags:
message.add_sequence('flagged')
elif isinstance(message, BabylMessage):
flags = set(self.get_flags())
if 'S' not in flags:
message.add_label('unseen')
if 'T' in flags:
message.add_label('deleted')
if 'R' in flags:
message.add_label('answered')
if 'P' in flags:
message.add_label('forwarded')
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class _mboxMMDFMessage(Message):
"""Message with mbox- or MMDF-specific properties."""
def __init__(self, message=None):
"""Initialize an mboxMMDFMessage instance."""
self.set_from('MAILER-DAEMON', True)
if isinstance(message, email.message.Message):
unixfrom = message.get_unixfrom()
if unixfrom is not None and unixfrom.startswith('From '):
self.set_from(unixfrom[5:])
Message.__init__(self, message)
def get_from(self):
"""Return contents of "From " line."""
return self._from
def set_from(self, from_, time_=None):
"""Set "From " line, formatting and appending time_ if specified."""
if time_ is not None:
if time_ is True:
time_ = time.gmtime()
from_ += ' ' + time.asctime(time_)
self._from = from_
def get_flags(self):
"""Return as a string the flags that are set."""
return self.get('Status', '') + self.get('X-Status', '')
def set_flags(self, flags):
"""Set the given flags and unset all others."""
flags = set(flags)
status_flags, xstatus_flags = '', ''
for flag in ('R', 'O'):
if flag in flags:
status_flags += flag
flags.remove(flag)
for flag in ('D', 'F', 'A'):
if flag in flags:
xstatus_flags += flag
flags.remove(flag)
xstatus_flags += ''.join(sorted(flags))
try:
self.replace_header('Status', status_flags)
except KeyError:
self.add_header('Status', status_flags)
try:
self.replace_header('X-Status', xstatus_flags)
except KeyError:
self.add_header('X-Status', xstatus_flags)
def add_flag(self, flag):
"""Set the given flag(s) without changing others."""
self.set_flags(''.join(set(self.get_flags()) | set(flag)))
def remove_flag(self, flag):
"""Unset the given string flag(s) without changing others."""
if 'Status' in self or 'X-Status' in self:
self.set_flags(''.join(set(self.get_flags()) - set(flag)))
def _explain_to(self, message):
"""Copy mbox- or MMDF-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
flags = set(self.get_flags())
if 'O' in flags:
message.set_subdir('cur')
if 'F' in flags:
message.add_flag('F')
if 'A' in flags:
message.add_flag('R')
if 'R' in flags:
message.add_flag('S')
if 'D' in flags:
message.add_flag('T')
del message['status']
del message['x-status']
maybe_date = ' '.join(self.get_from().split()[-5:])
try:
message.set_date(calendar.timegm(time.strptime(maybe_date,
'%a %b %d %H:%M:%S %Y')))
except (ValueError, OverflowError):
pass
elif isinstance(message, _mboxMMDFMessage):
message.set_flags(self.get_flags())
message.set_from(self.get_from())
elif isinstance(message, MHMessage):
flags = set(self.get_flags())
if 'R' not in flags:
message.add_sequence('unseen')
if 'A' in flags:
message.add_sequence('replied')
if 'F' in flags:
message.add_sequence('flagged')
del message['status']
del message['x-status']
elif isinstance(message, BabylMessage):
flags = set(self.get_flags())
if 'R' not in flags:
message.add_label('unseen')
if 'D' in flags:
message.add_label('deleted')
if 'A' in flags:
message.add_label('answered')
del message['status']
del message['x-status']
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class mboxMessage(_mboxMMDFMessage):
"""Message with mbox-specific properties."""
class MHMessage(Message):
"""Message with MH-specific properties."""
def __init__(self, message=None):
"""Initialize an MHMessage instance."""
self._sequences = []
Message.__init__(self, message)
def get_sequences(self):
"""Return a list of sequences that include the message."""
return self._sequences[:]
def set_sequences(self, sequences):
"""Set the list of sequences that include the message."""
self._sequences = list(sequences)
def add_sequence(self, sequence):
"""Add sequence to list of sequences including the message."""
if isinstance(sequence, str):
if not sequence in self._sequences:
self._sequences.append(sequence)
else:
raise TypeError('sequence must be a string: %s' % type(sequence))
def remove_sequence(self, sequence):
"""Remove sequence from the list of sequences including the message."""
try:
self._sequences.remove(sequence)
except ValueError:
pass
def _explain_to(self, message):
"""Copy MH-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
sequences = set(self.get_sequences())
if 'unseen' in sequences:
message.set_subdir('cur')
else:
message.set_subdir('cur')
message.add_flag('S')
if 'flagged' in sequences:
message.add_flag('F')
if 'replied' in sequences:
message.add_flag('R')
elif isinstance(message, _mboxMMDFMessage):
sequences = set(self.get_sequences())
if 'unseen' not in sequences:
message.add_flag('RO')
else:
message.add_flag('O')
if 'flagged' in sequences:
message.add_flag('F')
if 'replied' in sequences:
message.add_flag('A')
elif isinstance(message, MHMessage):
for sequence in self.get_sequences():
message.add_sequence(sequence)
elif isinstance(message, BabylMessage):
sequences = set(self.get_sequences())
if 'unseen' in sequences:
message.add_label('unseen')
if 'replied' in sequences:
message.add_label('answered')
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class BabylMessage(Message):
"""Message with Babyl-specific properties."""
def __init__(self, message=None):
"""Initialize an BabylMessage instance."""
self._labels = []
self._visible = Message()
Message.__init__(self, message)
def get_labels(self):
"""Return a list of labels on the message."""
return self._labels[:]
def set_labels(self, labels):
"""Set the list of labels on the message."""
self._labels = list(labels)
def add_label(self, label):
"""Add label to list of labels on the message."""
if isinstance(label, str):
if label not in self._labels:
self._labels.append(label)
else:
raise TypeError('label must be a string: %s' % type(label))
def remove_label(self, label):
"""Remove label from the list of labels on the message."""
try:
self._labels.remove(label)
except ValueError:
pass
def get_visible(self):
"""Return a Message representation of visible headers."""
return Message(self._visible)
def set_visible(self, visible):
"""Set the Message representation of visible headers."""
self._visible = Message(visible)
def update_visible(self):
"""Update and/or sensibly generate a set of visible headers."""
for header in self._visible.keys():
if header in self:
self._visible.replace_header(header, self[header])
else:
del self._visible[header]
for header in ('Date', 'From', 'Reply-To', 'To', 'CC', 'Subject'):
if header in self and header not in self._visible:
self._visible[header] = self[header]
def _explain_to(self, message):
"""Copy Babyl-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
labels = set(self.get_labels())
if 'unseen' in labels:
message.set_subdir('cur')
else:
message.set_subdir('cur')
message.add_flag('S')
if 'forwarded' in labels or 'resent' in labels:
message.add_flag('P')
if 'answered' in labels:
message.add_flag('R')
if 'deleted' in labels:
message.add_flag('T')
elif isinstance(message, _mboxMMDFMessage):
labels = set(self.get_labels())
if 'unseen' not in labels:
message.add_flag('RO')
else:
message.add_flag('O')
if 'deleted' in labels:
message.add_flag('D')
if 'answered' in labels:
message.add_flag('A')
elif isinstance(message, MHMessage):
labels = set(self.get_labels())
if 'unseen' in labels:
message.add_sequence('unseen')
if 'answered' in labels:
message.add_sequence('replied')
elif isinstance(message, BabylMessage):
message.set_visible(self.get_visible())
for label in self.get_labels():
message.add_label(label)
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class MMDFMessage(_mboxMMDFMessage):
"""Message with MMDF-specific properties."""
class _ProxyFile:
"""A read-only wrapper of a file."""
def __init__(self, f, pos=None):
"""Initialize a _ProxyFile."""
self._file = f
if pos is None:
self._pos = f.tell()
else:
self._pos = pos
def read(self, size=None):
"""Read bytes."""
return self._read(size, self._file.read)
def readline(self, size=None):
"""Read a line."""
return self._read(size, self._file.readline)
def readlines(self, sizehint=None):
"""Read multiple lines."""
result = []
for line in self:
result.append(line)
if sizehint is not None:
sizehint -= len(line)
if sizehint <= 0:
break
return result
def __iter__(self):
"""Iterate over lines."""
return iter(self.readline, "")
def tell(self):
"""Return the position."""
return self._pos
def seek(self, offset, whence=0):
"""Change position."""
if whence == 1:
self._file.seek(self._pos)
self._file.seek(offset, whence)
self._pos = self._file.tell()
def close(self):
"""Close the file."""
del self._file
def _read(self, size, read_method):
"""Read size bytes using read_method."""
if size is None:
size = -1
self._file.seek(self._pos)
result = read_method(size)
self._pos = self._file.tell()
return result
class _PartialFile(_ProxyFile):
"""A read-only wrapper of part of a file."""
def __init__(self, f, start=None, stop=None):
"""Initialize a _PartialFile."""
_ProxyFile.__init__(self, f, start)
self._start = start
self._stop = stop
def tell(self):
"""Return the position with respect to start."""
return _ProxyFile.tell(self) - self._start
def seek(self, offset, whence=0):
"""Change position, possibly with respect to start or stop."""
if whence == 0:
self._pos = self._start
whence = 1
elif whence == 2:
self._pos = self._stop
whence = 1
_ProxyFile.seek(self, offset, whence)
def _read(self, size, read_method):
"""Read size bytes using read_method, honoring start and stop."""
remaining = self._stop - self._pos
if remaining <= 0:
return ''
if size is None or size < 0 or size > remaining:
size = remaining
return _ProxyFile._read(self, size, read_method)
def _lock_file(f, dotlock=True):
"""Lock file f using lockf and dot locking."""
dotlock_done = False
try:
if fcntl:
try:
fcntl.lockf(f, fcntl.LOCK_EX | fcntl.LOCK_NB)
except IOError, e:
if e.errno in (errno.EAGAIN, errno.EACCES):
raise ExternalClashError('lockf: lock unavailable: %s' %
f.name)
else:
raise
if dotlock:
try:
pre_lock = _create_temporary(f.name + '.lock')
pre_lock.close()
except IOError, e:
if e.errno == errno.EACCES:
return # Without write access, just skip dotlocking.
else:
raise
try:
if hasattr(os, 'link'):
os.link(pre_lock.name, f.name + '.lock')
dotlock_done = True
os.unlink(pre_lock.name)
else:
os.rename(pre_lock.name, f.name + '.lock')
dotlock_done = True
except OSError, e:
if e.errno == errno.EEXIST or \
(os.name == 'os2' and e.errno == errno.EACCES):
os.remove(pre_lock.name)
raise ExternalClashError('dot lock unavailable: %s' %
f.name)
else:
raise
except:
if fcntl:
fcntl.lockf(f, fcntl.LOCK_UN)
if dotlock_done:
os.remove(f.name + '.lock')
raise
def _unlock_file(f):
"""Unlock file f using lockf and dot locking."""
if fcntl:
fcntl.lockf(f, fcntl.LOCK_UN)
if os.path.exists(f.name + '.lock'):
os.remove(f.name + '.lock')
def _create_carefully(path):
"""Create a file if it doesn't exist and open for reading and writing."""
fd = os.open(path, os.O_CREAT | os.O_EXCL | os.O_RDWR, 0666)
try:
return open(path, 'rb+')
finally:
os.close(fd)
def _create_temporary(path):
"""Create a temp file based on path and open for reading and writing."""
return _create_carefully('%s.%s.%s.%s' % (path, int(time.time()),
socket.gethostname(),
os.getpid()))
def _sync_flush(f):
"""Ensure changes to file f are physically on disk."""
f.flush()
if hasattr(os, 'fsync'):
os.fsync(f.fileno())
def _sync_close(f):
"""Close file f, ensuring all changes are physically on disk."""
_sync_flush(f)
f.close()
## Start: classes from the original module (for backward compatibility).
# Note that the Maildir class, whose name is unchanged, itself offers a next()
# method for backward compatibility.
class _Mailbox:
def __init__(self, fp, factory=rfc822.Message):
self.fp = fp
self.seekp = 0
self.factory = factory
def __iter__(self):
return iter(self.next, None)
def next(self):
while 1:
self.fp.seek(self.seekp)
try:
self._search_start()
except EOFError:
self.seekp = self.fp.tell()
return None
start = self.fp.tell()
self._search_end()
self.seekp = stop = self.fp.tell()
if start != stop:
break
return self.factory(_PartialFile(self.fp, start, stop))
# Recommended to use PortableUnixMailbox instead!
class UnixMailbox(_Mailbox):
def _search_start(self):
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
raise EOFError
if line[:5] == 'From ' and self._isrealfromline(line):
self.fp.seek(pos)
return
def _search_end(self):
self.fp.readline() # Throw away header line
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
return
if line[:5] == 'From ' and self._isrealfromline(line):
self.fp.seek(pos)
return
# An overridable mechanism to test for From-line-ness. You can either
# specify a different regular expression or define a whole new
# _isrealfromline() method. Note that this only gets called for lines
# starting with the 5 characters "From ".
#
# BAW: According to
#http://home.netscape.com/eng/mozilla/2.0/relnotes/demo/content-length.html
# the only portable, reliable way to find message delimiters in a BSD (i.e
# Unix mailbox) style folder is to search for "\n\nFrom .*\n", or at the
# beginning of the file, "^From .*\n". While _fromlinepattern below seems
# like a good idea, in practice, there are too many variations for more
# strict parsing of the line to be completely accurate.
#
# _strict_isrealfromline() is the old version which tries to do stricter
# parsing of the From_ line. _portable_isrealfromline() simply returns
# true, since it's never called if the line doesn't already start with
# "From ".
#
# This algorithm, and the way it interacts with _search_start() and
# _search_end() may not be completely correct, because it doesn't check
# that the two characters preceding "From " are \n\n or the beginning of
# the file. Fixing this would require a more extensive rewrite than is
# necessary. For convenience, we've added a PortableUnixMailbox class
# which does no checking of the format of the 'From' line.
_fromlinepattern = (r"From \s*[^\s]+\s+\w\w\w\s+\w\w\w\s+\d?\d\s+"
r"\d?\d:\d\d(:\d\d)?(\s+[^\s]+)?\s+\d\d\d\d\s*"
r"[^\s]*\s*"
"$")
_regexp = None
def _strict_isrealfromline(self, line):
if not self._regexp:
import re
self._regexp = re.compile(self._fromlinepattern)
return self._regexp.match(line)
def _portable_isrealfromline(self, line):
return True
_isrealfromline = _strict_isrealfromline
class PortableUnixMailbox(UnixMailbox):
_isrealfromline = UnixMailbox._portable_isrealfromline
class MmdfMailbox(_Mailbox):
def _search_start(self):
while 1:
line = self.fp.readline()
if not line:
raise EOFError
if line[:5] == '\001\001\001\001\n':
return
def _search_end(self):
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
return
if line == '\001\001\001\001\n':
self.fp.seek(pos)
return
class MHMailbox:
def __init__(self, dirname, factory=rfc822.Message):
import re
pat = re.compile('^[1-9][0-9]*$')
self.dirname = dirname
# the three following lines could be combined into:
# list = map(long, filter(pat.match, os.listdir(self.dirname)))
list = os.listdir(self.dirname)
list = filter(pat.match, list)
list = map(long, list)
list.sort()
# This only works in Python 1.6 or later;
# before that str() added 'L':
self.boxes = map(str, list)
self.boxes.reverse()
self.factory = factory
def __iter__(self):
return iter(self.next, None)
def next(self):
if not self.boxes:
return None
fn = self.boxes.pop()
fp = open(os.path.join(self.dirname, fn))
msg = self.factory(fp)
try:
msg._mh_msgno = fn
except (AttributeError, TypeError):
pass
return msg
class BabylMailbox(_Mailbox):
def _search_start(self):
while 1:
line = self.fp.readline()
if not line:
raise EOFError
if line == '*** EOOH ***\n':
return
def _search_end(self):
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
return
if line == '\037\014\n' or line == '\037':
self.fp.seek(pos)
return
## End: classes from the original module (for backward compatibility).
class Error(Exception):
"""Raised for module-specific errors."""
class NoSuchMailboxError(Error):
"""The specified mailbox does not exist and won't be created."""
class NotEmptyError(Error):
"""The specified mailbox is not empty and deletion was requested."""
class ExternalClashError(Error):
"""Another process caused an action to fail."""
class FormatError(Error):
"""A file appears to have an invalid format."""
| Python |
#!/usr/bin/env python
# -*- coding: latin-1 -*-
"""Generate Python documentation in HTML or text for interactive use.
In the Python interpreter, do "from pydoc import help" to provide online
help. Calling help(thing) on a Python object documents the object.
Or, at the shell command line outside of Python:
Run "pydoc <name>" to show documentation on something. <name> may be
the name of a function, module, package, or a dotted reference to a
class or function within a module or module in a package. If the
argument contains a path segment delimiter (e.g. slash on Unix,
backslash on Windows) it is treated as the path to a Python source file.
Run "pydoc -k <keyword>" to search for a keyword in the synopsis lines
of all available modules.
Run "pydoc -p <port>" to start an HTTP server on a given port on the
local machine to generate documentation web pages.
For platforms without a command line, "pydoc -g" starts the HTTP server
and also pops up a little window for controlling it.
Run "pydoc -w <name>" to write out the HTML documentation for a module
to a file named "<name>.html".
Module docs for core modules are assumed to be in
http://docs.python.org/library/
This can be overridden by setting the PYTHONDOCS environment variable
to a different URL or to a local directory containing the Library
Reference Manual pages.
"""
__author__ = "Ka-Ping Yee <ping@lfw.org>"
__date__ = "26 February 2001"
__version__ = "$Revision$"
__credits__ = """Guido van Rossum, for an excellent programming language.
Tommy Burnette, the original creator of manpy.
Paul Prescod, for all his work on onlinehelp.
Richard Chamberlain, for the first implementation of textdoc.
"""
# Known bugs that can't be fixed here:
# - imp.load_module() cannot be prevented from clobbering existing
# loaded modules, so calling synopsis() on a binary module file
# changes the contents of any existing module with the same name.
# - If the __file__ attribute on a module is a relative path and
# the current directory is changed with os.chdir(), an incorrect
# path will be displayed.
import sys, imp, os, re, types, inspect, __builtin__, pkgutil
from repr import Repr
from string import expandtabs, find, join, lower, split, strip, rfind, rstrip
from traceback import extract_tb
try:
from collections import deque
except ImportError:
# Python 2.3 compatibility
class deque(list):
def popleft(self):
return self.pop(0)
# --------------------------------------------------------- common routines
def pathdirs():
"""Convert sys.path into a list of absolute, existing, unique paths."""
dirs = []
normdirs = []
for dir in sys.path:
dir = os.path.abspath(dir or '.')
normdir = os.path.normcase(dir)
if normdir not in normdirs and os.path.isdir(dir):
dirs.append(dir)
normdirs.append(normdir)
return dirs
def getdoc(object):
"""Get the doc string or comments for an object."""
result = inspect.getdoc(object) or inspect.getcomments(object)
return result and re.sub('^ *\n', '', rstrip(result)) or ''
def splitdoc(doc):
"""Split a doc string into a synopsis line (if any) and the rest."""
lines = split(strip(doc), '\n')
if len(lines) == 1:
return lines[0], ''
elif len(lines) >= 2 and not rstrip(lines[1]):
return lines[0], join(lines[2:], '\n')
return '', join(lines, '\n')
def classname(object, modname):
"""Get a class name and qualify it with a module name if necessary."""
name = object.__name__
if object.__module__ != modname:
name = object.__module__ + '.' + name
return name
def isdata(object):
"""Check if an object is of a type that probably means it's data."""
return not (inspect.ismodule(object) or inspect.isclass(object) or
inspect.isroutine(object) or inspect.isframe(object) or
inspect.istraceback(object) or inspect.iscode(object))
def replace(text, *pairs):
"""Do a series of global replacements on a string."""
while pairs:
text = join(split(text, pairs[0]), pairs[1])
pairs = pairs[2:]
return text
def cram(text, maxlen):
"""Omit part of a string if needed to make it fit in a maximum length."""
if len(text) > maxlen:
pre = max(0, (maxlen-3)//2)
post = max(0, maxlen-3-pre)
return text[:pre] + '...' + text[len(text)-post:]
return text
_re_stripid = re.compile(r' at 0x[0-9a-f]{6,16}(>+)$', re.IGNORECASE)
def stripid(text):
"""Remove the hexadecimal id from a Python object representation."""
# The behaviour of %p is implementation-dependent in terms of case.
return _re_stripid.sub(r'\1', text)
def _is_some_method(obj):
return inspect.ismethod(obj) or inspect.ismethoddescriptor(obj)
def allmethods(cl):
methods = {}
for key, value in inspect.getmembers(cl, _is_some_method):
methods[key] = 1
for base in cl.__bases__:
methods.update(allmethods(base)) # all your base are belong to us
for key in methods.keys():
methods[key] = getattr(cl, key)
return methods
def _split_list(s, predicate):
"""Split sequence s via predicate, and return pair ([true], [false]).
The return value is a 2-tuple of lists,
([x for x in s if predicate(x)],
[x for x in s if not predicate(x)])
"""
yes = []
no = []
for x in s:
if predicate(x):
yes.append(x)
else:
no.append(x)
return yes, no
def visiblename(name, all=None):
"""Decide whether to show documentation on a variable."""
# Certain special names are redundant.
_hidden_names = ('__builtins__', '__doc__', '__file__', '__path__',
'__module__', '__name__', '__slots__', '__package__')
if name in _hidden_names: return 0
# Private names are hidden, but special names are displayed.
if name.startswith('__') and name.endswith('__'): return 1
if all is not None:
# only document that which the programmer exported in __all__
return name in all
else:
return not name.startswith('_')
def classify_class_attrs(object):
"""Wrap inspect.classify_class_attrs, with fixup for data descriptors."""
def fixup(data):
name, kind, cls, value = data
if inspect.isdatadescriptor(value):
kind = 'data descriptor'
return name, kind, cls, value
return map(fixup, inspect.classify_class_attrs(object))
# ----------------------------------------------------- module manipulation
def ispackage(path):
"""Guess whether a path refers to a package directory."""
if os.path.isdir(path):
for ext in ('.py', '.pyc', '.pyo'):
if os.path.isfile(os.path.join(path, '__init__' + ext)):
return True
return False
def source_synopsis(file):
line = file.readline()
while line[:1] == '#' or not strip(line):
line = file.readline()
if not line: break
line = strip(line)
if line[:4] == 'r"""': line = line[1:]
if line[:3] == '"""':
line = line[3:]
if line[-1:] == '\\': line = line[:-1]
while not strip(line):
line = file.readline()
if not line: break
result = strip(split(line, '"""')[0])
else: result = None
return result
def synopsis(filename, cache={}):
"""Get the one-line summary out of a module file."""
mtime = os.stat(filename).st_mtime
lastupdate, result = cache.get(filename, (0, None))
if lastupdate < mtime:
info = inspect.getmoduleinfo(filename)
try:
file = open(filename)
except IOError:
# module can't be opened, so skip it
return None
if info and 'b' in info[2]: # binary modules have to be imported
try: module = imp.load_module('__temp__', file, filename, info[1:])
except: return None
result = (module.__doc__ or '').splitlines()[0]
del sys.modules['__temp__']
else: # text modules can be directly examined
result = source_synopsis(file)
file.close()
cache[filename] = (mtime, result)
return result
class ErrorDuringImport(Exception):
"""Errors that occurred while trying to import something to document it."""
def __init__(self, filename, exc_info):
exc, value, tb = exc_info
self.filename = filename
self.exc = exc
self.value = value
self.tb = tb
def __str__(self):
exc = self.exc
if type(exc) is types.ClassType:
exc = exc.__name__
return 'problem in %s - %s: %s' % (self.filename, exc, self.value)
def importfile(path):
"""Import a Python source file or compiled file given its path."""
magic = imp.get_magic()
file = open(path, 'r')
if file.read(len(magic)) == magic:
kind = imp.PY_COMPILED
else:
kind = imp.PY_SOURCE
file.close()
filename = os.path.basename(path)
name, ext = os.path.splitext(filename)
file = open(path, 'r')
try:
module = imp.load_module(name, file, path, (ext, 'r', kind))
except:
raise ErrorDuringImport(path, sys.exc_info())
file.close()
return module
def safeimport(path, forceload=0, cache={}):
"""Import a module; handle errors; return None if the module isn't found.
If the module *is* found but an exception occurs, it's wrapped in an
ErrorDuringImport exception and reraised. Unlike __import__, if a
package path is specified, the module at the end of the path is returned,
not the package at the beginning. If the optional 'forceload' argument
is 1, we reload the module from disk (unless it's a dynamic extension)."""
try:
# If forceload is 1 and the module has been previously loaded from
# disk, we always have to reload the module. Checking the file's
# mtime isn't good enough (e.g. the module could contain a class
# that inherits from another module that has changed).
if forceload and path in sys.modules:
if path not in sys.builtin_module_names:
# Avoid simply calling reload() because it leaves names in
# the currently loaded module lying around if they're not
# defined in the new source file. Instead, remove the
# module from sys.modules and re-import. Also remove any
# submodules because they won't appear in the newly loaded
# module's namespace if they're already in sys.modules.
subs = [m for m in sys.modules if m.startswith(path + '.')]
for key in [path] + subs:
# Prevent garbage collection.
cache[key] = sys.modules[key]
del sys.modules[key]
module = __import__(path)
except:
# Did the error occur before or after the module was found?
(exc, value, tb) = info = sys.exc_info()
if path in sys.modules:
# An error occurred while executing the imported module.
raise ErrorDuringImport(sys.modules[path].__file__, info)
elif exc is SyntaxError:
# A SyntaxError occurred before we could execute the module.
raise ErrorDuringImport(value.filename, info)
elif exc is ImportError and extract_tb(tb)[-1][2]=='safeimport':
# The import error occurred directly in this function,
# which means there is no such module in the path.
return None
else:
# Some other error occurred during the importing process.
raise ErrorDuringImport(path, sys.exc_info())
for part in split(path, '.')[1:]:
try: module = getattr(module, part)
except AttributeError: return None
return module
# ---------------------------------------------------- formatter base class
class Doc:
def document(self, object, name=None, *args):
"""Generate documentation for an object."""
args = (object, name) + args
# 'try' clause is to attempt to handle the possibility that inspect
# identifies something in a way that pydoc itself has issues handling;
# think 'super' and how it is a descriptor (which raises the exception
# by lacking a __name__ attribute) and an instance.
if inspect.isgetsetdescriptor(object): return self.docdata(*args)
if inspect.ismemberdescriptor(object): return self.docdata(*args)
try:
if inspect.ismodule(object): return self.docmodule(*args)
if inspect.isclass(object): return self.docclass(*args)
if inspect.isroutine(object): return self.docroutine(*args)
except AttributeError:
pass
if isinstance(object, property): return self.docproperty(*args)
return self.docother(*args)
def fail(self, object, name=None, *args):
"""Raise an exception for unimplemented types."""
message = "don't know how to document object%s of type %s" % (
name and ' ' + repr(name), type(object).__name__)
raise TypeError, message
docmodule = docclass = docroutine = docother = docproperty = docdata = fail
def getdocloc(self, object):
"""Return the location of module docs or None"""
try:
file = inspect.getabsfile(object)
except TypeError:
file = '(built-in)'
docloc = os.environ.get("PYTHONDOCS",
"http://docs.python.org/library")
basedir = os.path.join(sys.exec_prefix, "lib",
"python"+sys.version[0:3])
if (isinstance(object, type(os)) and
(object.__name__ in ('errno', 'exceptions', 'gc', 'imp',
'marshal', 'posix', 'signal', 'sys',
'thread', 'zipimport') or
(file.startswith(basedir) and
not file.startswith(os.path.join(basedir, 'site-packages')))) and
object.__name__ not in ('xml.etree', 'test.pydoc_mod')):
if docloc.startswith("http://"):
docloc = "%s/%s" % (docloc.rstrip("/"), object.__name__)
else:
docloc = os.path.join(docloc, object.__name__ + ".html")
else:
docloc = None
return docloc
# -------------------------------------------- HTML documentation generator
class HTMLRepr(Repr):
"""Class for safely making an HTML representation of a Python object."""
def __init__(self):
Repr.__init__(self)
self.maxlist = self.maxtuple = 20
self.maxdict = 10
self.maxstring = self.maxother = 100
def escape(self, text):
return replace(text, '&', '&', '<', '<', '>', '>')
def repr(self, object):
return Repr.repr(self, object)
def repr1(self, x, level):
if hasattr(type(x), '__name__'):
methodname = 'repr_' + join(split(type(x).__name__), '_')
if hasattr(self, methodname):
return getattr(self, methodname)(x, level)
return self.escape(cram(stripid(repr(x)), self.maxother))
def repr_string(self, x, level):
test = cram(x, self.maxstring)
testrepr = repr(test)
if '\\' in test and '\\' not in replace(testrepr, r'\\', ''):
# Backslashes are only literal in the string and are never
# needed to make any special characters, so show a raw string.
return 'r' + testrepr[0] + self.escape(test) + testrepr[0]
return re.sub(r'((\\[\\abfnrtv\'"]|\\[0-9]..|\\x..|\\u....)+)',
r'<font color="#c040c0">\1</font>',
self.escape(testrepr))
repr_str = repr_string
def repr_instance(self, x, level):
try:
return self.escape(cram(stripid(repr(x)), self.maxstring))
except:
return self.escape('<%s instance>' % x.__class__.__name__)
repr_unicode = repr_string
class HTMLDoc(Doc):
"""Formatter class for HTML documentation."""
# ------------------------------------------- HTML formatting utilities
_repr_instance = HTMLRepr()
repr = _repr_instance.repr
escape = _repr_instance.escape
def page(self, title, contents):
"""Format an HTML page."""
return '''
<!DOCTYPE html PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN">
<html><head><title>Python: %s</title>
</head><body bgcolor="#f0f0f8">
%s
</body></html>''' % (title, contents)
def heading(self, title, fgcol, bgcol, extras=''):
"""Format a page heading."""
return '''
<table width="100%%" cellspacing=0 cellpadding=2 border=0 summary="heading">
<tr bgcolor="%s">
<td valign=bottom> <br>
<font color="%s" face="helvetica, arial"> <br>%s</font></td
><td align=right valign=bottom
><font color="%s" face="helvetica, arial">%s</font></td></tr></table>
''' % (bgcol, fgcol, title, fgcol, extras or ' ')
def section(self, title, fgcol, bgcol, contents, width=6,
prelude='', marginalia=None, gap=' '):
"""Format a section with a heading."""
if marginalia is None:
marginalia = '<tt>' + ' ' * width + '</tt>'
result = '''<p>
<table width="100%%" cellspacing=0 cellpadding=2 border=0 summary="section">
<tr bgcolor="%s">
<td colspan=3 valign=bottom> <br>
<font color="%s" face="helvetica, arial">%s</font></td></tr>
''' % (bgcol, fgcol, title)
if prelude:
result = result + '''
<tr bgcolor="%s"><td rowspan=2>%s</td>
<td colspan=2>%s</td></tr>
<tr><td>%s</td>''' % (bgcol, marginalia, prelude, gap)
else:
result = result + '''
<tr><td bgcolor="%s">%s</td><td>%s</td>''' % (bgcol, marginalia, gap)
return result + '\n<td width="100%%">%s</td></tr></table>' % contents
def bigsection(self, title, *args):
"""Format a section with a big heading."""
title = '<big><strong>%s</strong></big>' % title
return self.section(title, *args)
def preformat(self, text):
"""Format literal preformatted text."""
text = self.escape(expandtabs(text))
return replace(text, '\n\n', '\n \n', '\n\n', '\n \n',
' ', ' ', '\n', '<br>\n')
def multicolumn(self, list, format, cols=4):
"""Format a list of items into a multi-column list."""
result = ''
rows = (len(list)+cols-1)/cols
for col in range(cols):
result = result + '<td width="%d%%" valign=top>' % (100/cols)
for i in range(rows*col, rows*col+rows):
if i < len(list):
result = result + format(list[i]) + '<br>\n'
result = result + '</td>'
return '<table width="100%%" summary="list"><tr>%s</tr></table>' % result
def grey(self, text): return '<font color="#909090">%s</font>' % text
def namelink(self, name, *dicts):
"""Make a link for an identifier, given name-to-URL mappings."""
for dict in dicts:
if name in dict:
return '<a href="%s">%s</a>' % (dict[name], name)
return name
def classlink(self, object, modname):
"""Make a link for a class."""
name, module = object.__name__, sys.modules.get(object.__module__)
if hasattr(module, name) and getattr(module, name) is object:
return '<a href="%s.html#%s">%s</a>' % (
module.__name__, name, classname(object, modname))
return classname(object, modname)
def modulelink(self, object):
"""Make a link for a module."""
return '<a href="%s.html">%s</a>' % (object.__name__, object.__name__)
def modpkglink(self, data):
"""Make a link for a module or package to display in an index."""
name, path, ispackage, shadowed = data
if shadowed:
return self.grey(name)
if path:
url = '%s.%s.html' % (path, name)
else:
url = '%s.html' % name
if ispackage:
text = '<strong>%s</strong> (package)' % name
else:
text = name
return '<a href="%s">%s</a>' % (url, text)
def markup(self, text, escape=None, funcs={}, classes={}, methods={}):
"""Mark up some plain text, given a context of symbols to look for.
Each context dictionary maps object names to anchor names."""
escape = escape or self.escape
results = []
here = 0
pattern = re.compile(r'\b((http|ftp)://\S+[\w/]|'
r'RFC[- ]?(\d+)|'
r'PEP[- ]?(\d+)|'
r'(self\.)?(\w+))')
while True:
match = pattern.search(text, here)
if not match: break
start, end = match.span()
results.append(escape(text[here:start]))
all, scheme, rfc, pep, selfdot, name = match.groups()
if scheme:
url = escape(all).replace('"', '"')
results.append('<a href="%s">%s</a>' % (url, url))
elif rfc:
url = 'http://www.rfc-editor.org/rfc/rfc%d.txt' % int(rfc)
results.append('<a href="%s">%s</a>' % (url, escape(all)))
elif pep:
url = 'http://www.python.org/dev/peps/pep-%04d/' % int(pep)
results.append('<a href="%s">%s</a>' % (url, escape(all)))
elif text[end:end+1] == '(':
results.append(self.namelink(name, methods, funcs, classes))
elif selfdot:
results.append('self.<strong>%s</strong>' % name)
else:
results.append(self.namelink(name, classes))
here = end
results.append(escape(text[here:]))
return join(results, '')
# ---------------------------------------------- type-specific routines
def formattree(self, tree, modname, parent=None):
"""Produce HTML for a class tree as given by inspect.getclasstree()."""
result = ''
for entry in tree:
if type(entry) is type(()):
c, bases = entry
result = result + '<dt><font face="helvetica, arial">'
result = result + self.classlink(c, modname)
if bases and bases != (parent,):
parents = []
for base in bases:
parents.append(self.classlink(base, modname))
result = result + '(' + join(parents, ', ') + ')'
result = result + '\n</font></dt>'
elif type(entry) is type([]):
result = result + '<dd>\n%s</dd>\n' % self.formattree(
entry, modname, c)
return '<dl>\n%s</dl>\n' % result
def docmodule(self, object, name=None, mod=None, *ignored):
"""Produce HTML documentation for a module object."""
name = object.__name__ # ignore the passed-in name
try:
all = object.__all__
except AttributeError:
all = None
parts = split(name, '.')
links = []
for i in range(len(parts)-1):
links.append(
'<a href="%s.html"><font color="#ffffff">%s</font></a>' %
(join(parts[:i+1], '.'), parts[i]))
linkedname = join(links + parts[-1:], '.')
head = '<big><big><strong>%s</strong></big></big>' % linkedname
try:
path = inspect.getabsfile(object)
url = path
if sys.platform == 'win32':
import nturl2path
url = nturl2path.pathname2url(path)
filelink = '<a href="file:%s">%s</a>' % (url, path)
except TypeError:
filelink = '(built-in)'
info = []
if hasattr(object, '__version__'):
version = str(object.__version__)
if version[:11] == '$' + 'Revision: ' and version[-1:] == '$':
version = strip(version[11:-1])
info.append('version %s' % self.escape(version))
if hasattr(object, '__date__'):
info.append(self.escape(str(object.__date__)))
if info:
head = head + ' (%s)' % join(info, ', ')
docloc = self.getdocloc(object)
if docloc is not None:
docloc = '<br><a href="%(docloc)s">Module Docs</a>' % locals()
else:
docloc = ''
result = self.heading(
head, '#ffffff', '#7799ee',
'<a href=".">index</a><br>' + filelink + docloc)
modules = inspect.getmembers(object, inspect.ismodule)
classes, cdict = [], {}
for key, value in inspect.getmembers(object, inspect.isclass):
# if __all__ exists, believe it. Otherwise use old heuristic.
if (all is not None or
(inspect.getmodule(value) or object) is object):
if visiblename(key, all):
classes.append((key, value))
cdict[key] = cdict[value] = '#' + key
for key, value in classes:
for base in value.__bases__:
key, modname = base.__name__, base.__module__
module = sys.modules.get(modname)
if modname != name and module and hasattr(module, key):
if getattr(module, key) is base:
if not key in cdict:
cdict[key] = cdict[base] = modname + '.html#' + key
funcs, fdict = [], {}
for key, value in inspect.getmembers(object, inspect.isroutine):
# if __all__ exists, believe it. Otherwise use old heuristic.
if (all is not None or
inspect.isbuiltin(value) or inspect.getmodule(value) is object):
if visiblename(key, all):
funcs.append((key, value))
fdict[key] = '#-' + key
if inspect.isfunction(value): fdict[value] = fdict[key]
data = []
for key, value in inspect.getmembers(object, isdata):
if visiblename(key, all):
data.append((key, value))
doc = self.markup(getdoc(object), self.preformat, fdict, cdict)
doc = doc and '<tt>%s</tt>' % doc
result = result + '<p>%s</p>\n' % doc
if hasattr(object, '__path__'):
modpkgs = []
for importer, modname, ispkg in pkgutil.iter_modules(object.__path__):
modpkgs.append((modname, name, ispkg, 0))
modpkgs.sort()
contents = self.multicolumn(modpkgs, self.modpkglink)
result = result + self.bigsection(
'Package Contents', '#ffffff', '#aa55cc', contents)
elif modules:
contents = self.multicolumn(
modules, lambda key_value, s=self: s.modulelink(key_value[1]))
result = result + self.bigsection(
'Modules', '#ffffff', '#aa55cc', contents)
if classes:
classlist = map(lambda key_value: key_value[1], classes)
contents = [
self.formattree(inspect.getclasstree(classlist, 1), name)]
for key, value in classes:
contents.append(self.document(value, key, name, fdict, cdict))
result = result + self.bigsection(
'Classes', '#ffffff', '#ee77aa', join(contents))
if funcs:
contents = []
for key, value in funcs:
contents.append(self.document(value, key, name, fdict, cdict))
result = result + self.bigsection(
'Functions', '#ffffff', '#eeaa77', join(contents))
if data:
contents = []
for key, value in data:
contents.append(self.document(value, key))
result = result + self.bigsection(
'Data', '#ffffff', '#55aa55', join(contents, '<br>\n'))
if hasattr(object, '__author__'):
contents = self.markup(str(object.__author__), self.preformat)
result = result + self.bigsection(
'Author', '#ffffff', '#7799ee', contents)
if hasattr(object, '__credits__'):
contents = self.markup(str(object.__credits__), self.preformat)
result = result + self.bigsection(
'Credits', '#ffffff', '#7799ee', contents)
return result
def docclass(self, object, name=None, mod=None, funcs={}, classes={},
*ignored):
"""Produce HTML documentation for a class object."""
realname = object.__name__
name = name or realname
bases = object.__bases__
contents = []
push = contents.append
# Cute little class to pump out a horizontal rule between sections.
class HorizontalRule:
def __init__(self):
self.needone = 0
def maybe(self):
if self.needone:
push('<hr>\n')
self.needone = 1
hr = HorizontalRule()
# List the mro, if non-trivial.
mro = deque(inspect.getmro(object))
if len(mro) > 2:
hr.maybe()
push('<dl><dt>Method resolution order:</dt>\n')
for base in mro:
push('<dd>%s</dd>\n' % self.classlink(base,
object.__module__))
push('</dl>\n')
def spill(msg, attrs, predicate):
ok, attrs = _split_list(attrs, predicate)
if ok:
hr.maybe()
push(msg)
for name, kind, homecls, value in ok:
push(self.document(getattr(object, name), name, mod,
funcs, classes, mdict, object))
push('\n')
return attrs
def spilldescriptors(msg, attrs, predicate):
ok, attrs = _split_list(attrs, predicate)
if ok:
hr.maybe()
push(msg)
for name, kind, homecls, value in ok:
push(self._docdescriptor(name, value, mod))
return attrs
def spilldata(msg, attrs, predicate):
ok, attrs = _split_list(attrs, predicate)
if ok:
hr.maybe()
push(msg)
for name, kind, homecls, value in ok:
base = self.docother(getattr(object, name), name, mod)
if (hasattr(value, '__call__') or
inspect.isdatadescriptor(value)):
doc = getattr(value, "__doc__", None)
else:
doc = None
if doc is None:
push('<dl><dt>%s</dl>\n' % base)
else:
doc = self.markup(getdoc(value), self.preformat,
funcs, classes, mdict)
doc = '<dd><tt>%s</tt>' % doc
push('<dl><dt>%s%s</dl>\n' % (base, doc))
push('\n')
return attrs
attrs = filter(lambda data: visiblename(data[0]),
classify_class_attrs(object))
mdict = {}
for key, kind, homecls, value in attrs:
mdict[key] = anchor = '#' + name + '-' + key
value = getattr(object, key)
try:
# The value may not be hashable (e.g., a data attr with
# a dict or list value).
mdict[value] = anchor
except TypeError:
pass
while attrs:
if mro:
thisclass = mro.popleft()
else:
thisclass = attrs[0][2]
attrs, inherited = _split_list(attrs, lambda t: t[2] is thisclass)
if thisclass is __builtin__.object:
attrs = inherited
continue
elif thisclass is object:
tag = 'defined here'
else:
tag = 'inherited from %s' % self.classlink(thisclass,
object.__module__)
tag += ':<br>\n'
# Sort attrs by name.
try:
attrs.sort(key=lambda t: t[0])
except TypeError:
attrs.sort(lambda t1, t2: cmp(t1[0], t2[0])) # 2.3 compat
# Pump out the attrs, segregated by kind.
attrs = spill('Methods %s' % tag, attrs,
lambda t: t[1] == 'method')
attrs = spill('Class methods %s' % tag, attrs,
lambda t: t[1] == 'class method')
attrs = spill('Static methods %s' % tag, attrs,
lambda t: t[1] == 'static method')
attrs = spilldescriptors('Data descriptors %s' % tag, attrs,
lambda t: t[1] == 'data descriptor')
attrs = spilldata('Data and other attributes %s' % tag, attrs,
lambda t: t[1] == 'data')
assert attrs == []
attrs = inherited
contents = ''.join(contents)
if name == realname:
title = '<a name="%s">class <strong>%s</strong></a>' % (
name, realname)
else:
title = '<strong>%s</strong> = <a name="%s">class %s</a>' % (
name, name, realname)
if bases:
parents = []
for base in bases:
parents.append(self.classlink(base, object.__module__))
title = title + '(%s)' % join(parents, ', ')
doc = self.markup(getdoc(object), self.preformat, funcs, classes, mdict)
doc = doc and '<tt>%s<br> </tt>' % doc
return self.section(title, '#000000', '#ffc8d8', contents, 3, doc)
def formatvalue(self, object):
"""Format an argument default value as text."""
return self.grey('=' + self.repr(object))
def docroutine(self, object, name=None, mod=None,
funcs={}, classes={}, methods={}, cl=None):
"""Produce HTML documentation for a function or method object."""
realname = object.__name__
name = name or realname
anchor = (cl and cl.__name__ or '') + '-' + name
note = ''
skipdocs = 0
if inspect.ismethod(object):
imclass = object.im_class
if cl:
if imclass is not cl:
note = ' from ' + self.classlink(imclass, mod)
else:
if object.im_self is not None:
note = ' method of %s instance' % self.classlink(
object.im_self.__class__, mod)
else:
note = ' unbound %s method' % self.classlink(imclass,mod)
object = object.im_func
if name == realname:
title = '<a name="%s"><strong>%s</strong></a>' % (anchor, realname)
else:
if (cl and realname in cl.__dict__ and
cl.__dict__[realname] is object):
reallink = '<a href="#%s">%s</a>' % (
cl.__name__ + '-' + realname, realname)
skipdocs = 1
else:
reallink = realname
title = '<a name="%s"><strong>%s</strong></a> = %s' % (
anchor, name, reallink)
if inspect.isfunction(object):
args, varargs, varkw, defaults = inspect.getargspec(object)
argspec = inspect.formatargspec(
args, varargs, varkw, defaults, formatvalue=self.formatvalue)
if realname == '<lambda>':
title = '<strong>%s</strong> <em>lambda</em> ' % name
argspec = argspec[1:-1] # remove parentheses
else:
argspec = '(...)'
decl = title + argspec + (note and self.grey(
'<font face="helvetica, arial">%s</font>' % note))
if skipdocs:
return '<dl><dt>%s</dt></dl>\n' % decl
else:
doc = self.markup(
getdoc(object), self.preformat, funcs, classes, methods)
doc = doc and '<dd><tt>%s</tt></dd>' % doc
return '<dl><dt>%s</dt>%s</dl>\n' % (decl, doc)
def _docdescriptor(self, name, value, mod):
results = []
push = results.append
if name:
push('<dl><dt><strong>%s</strong></dt>\n' % name)
if value.__doc__ is not None:
doc = self.markup(getdoc(value), self.preformat)
push('<dd><tt>%s</tt></dd>\n' % doc)
push('</dl>\n')
return ''.join(results)
def docproperty(self, object, name=None, mod=None, cl=None):
"""Produce html documentation for a property."""
return self._docdescriptor(name, object, mod)
def docother(self, object, name=None, mod=None, *ignored):
"""Produce HTML documentation for a data object."""
lhs = name and '<strong>%s</strong> = ' % name or ''
return lhs + self.repr(object)
def docdata(self, object, name=None, mod=None, cl=None):
"""Produce html documentation for a data descriptor."""
return self._docdescriptor(name, object, mod)
def index(self, dir, shadowed=None):
"""Generate an HTML index for a directory of modules."""
modpkgs = []
if shadowed is None: shadowed = {}
for importer, name, ispkg in pkgutil.iter_modules([dir]):
modpkgs.append((name, '', ispkg, name in shadowed))
shadowed[name] = 1
modpkgs.sort()
contents = self.multicolumn(modpkgs, self.modpkglink)
return self.bigsection(dir, '#ffffff', '#ee77aa', contents)
# -------------------------------------------- text documentation generator
class TextRepr(Repr):
"""Class for safely making a text representation of a Python object."""
def __init__(self):
Repr.__init__(self)
self.maxlist = self.maxtuple = 20
self.maxdict = 10
self.maxstring = self.maxother = 100
def repr1(self, x, level):
if hasattr(type(x), '__name__'):
methodname = 'repr_' + join(split(type(x).__name__), '_')
if hasattr(self, methodname):
return getattr(self, methodname)(x, level)
return cram(stripid(repr(x)), self.maxother)
def repr_string(self, x, level):
test = cram(x, self.maxstring)
testrepr = repr(test)
if '\\' in test and '\\' not in replace(testrepr, r'\\', ''):
# Backslashes are only literal in the string and are never
# needed to make any special characters, so show a raw string.
return 'r' + testrepr[0] + test + testrepr[0]
return testrepr
repr_str = repr_string
def repr_instance(self, x, level):
try:
return cram(stripid(repr(x)), self.maxstring)
except:
return '<%s instance>' % x.__class__.__name__
class TextDoc(Doc):
"""Formatter class for text documentation."""
# ------------------------------------------- text formatting utilities
_repr_instance = TextRepr()
repr = _repr_instance.repr
def bold(self, text):
"""Format a string in bold by overstriking."""
return join(map(lambda ch: ch + '\b' + ch, text), '')
def indent(self, text, prefix=' '):
"""Indent text by prepending a given prefix to each line."""
if not text: return ''
lines = split(text, '\n')
lines = map(lambda line, prefix=prefix: prefix + line, lines)
if lines: lines[-1] = rstrip(lines[-1])
return join(lines, '\n')
def section(self, title, contents):
"""Format a section with a given heading."""
return self.bold(title) + '\n' + rstrip(self.indent(contents)) + '\n\n'
# ---------------------------------------------- type-specific routines
def formattree(self, tree, modname, parent=None, prefix=''):
"""Render in text a class tree as returned by inspect.getclasstree()."""
result = ''
for entry in tree:
if type(entry) is type(()):
c, bases = entry
result = result + prefix + classname(c, modname)
if bases and bases != (parent,):
parents = map(lambda c, m=modname: classname(c, m), bases)
result = result + '(%s)' % join(parents, ', ')
result = result + '\n'
elif type(entry) is type([]):
result = result + self.formattree(
entry, modname, c, prefix + ' ')
return result
def docmodule(self, object, name=None, mod=None):
"""Produce text documentation for a given module object."""
name = object.__name__ # ignore the passed-in name
synop, desc = splitdoc(getdoc(object))
result = self.section('NAME', name + (synop and ' - ' + synop))
try:
all = object.__all__
except AttributeError:
all = None
try:
file = inspect.getabsfile(object)
except TypeError:
file = '(built-in)'
result = result + self.section('FILE', file)
docloc = self.getdocloc(object)
if docloc is not None:
result = result + self.section('MODULE DOCS', docloc)
if desc:
result = result + self.section('DESCRIPTION', desc)
classes = []
for key, value in inspect.getmembers(object, inspect.isclass):
# if __all__ exists, believe it. Otherwise use old heuristic.
if (all is not None
or (inspect.getmodule(value) or object) is object):
if visiblename(key, all):
classes.append((key, value))
funcs = []
for key, value in inspect.getmembers(object, inspect.isroutine):
# if __all__ exists, believe it. Otherwise use old heuristic.
if (all is not None or
inspect.isbuiltin(value) or inspect.getmodule(value) is object):
if visiblename(key, all):
funcs.append((key, value))
data = []
for key, value in inspect.getmembers(object, isdata):
if visiblename(key, all):
data.append((key, value))
modpkgs = []
modpkgs_names = set()
if hasattr(object, '__path__'):
for importer, modname, ispkg in pkgutil.iter_modules(object.__path__):
modpkgs_names.add(modname)
if ispkg:
modpkgs.append(modname + ' (package)')
else:
modpkgs.append(modname)
modpkgs.sort()
try:
result = result + self.section(
'PACKAGE CONTENTS', join(modpkgs, '\n'))
except:
result = result + self.section(
'PACKAGE CONTENTS', 'Skipped due to Unicode Path')
# Detect submodules as sometimes created by C extensions
submodules = []
for key, value in inspect.getmembers(object, inspect.ismodule):
if value.__name__.startswith(name + '.') and key not in modpkgs_names:
submodules.append(key)
if submodules:
submodules.sort()
result = result + self.section(
'SUBMODULES', join(submodules, '\n'))
if classes:
classlist = map(lambda key_value: key_value[1], classes)
contents = [self.formattree(
inspect.getclasstree(classlist, 1), name)]
for key, value in classes:
contents.append(self.document(value, key, name))
result = result + self.section('CLASSES', join(contents, '\n'))
if funcs:
contents = []
for key, value in funcs:
contents.append(self.document(value, key, name))
result = result + self.section('FUNCTIONS', join(contents, '\n'))
if data:
contents = []
for key, value in data:
contents.append(self.docother(value, key, name, maxlen=70))
result = result + self.section('DATA', join(contents, '\n'))
if hasattr(object, '__version__'):
version = str(object.__version__)
if version[:11] == '$' + 'Revision: ' and version[-1:] == '$':
version = strip(version[11:-1])
result = result + self.section('VERSION', version)
if hasattr(object, '__date__'):
result = result + self.section('DATE', str(object.__date__))
if hasattr(object, '__author__'):
result = result + self.section('AUTHOR', str(object.__author__))
if hasattr(object, '__credits__'):
result = result + self.section('CREDITS', str(object.__credits__))
return result
def docclass(self, object, name=None, mod=None):
"""Produce text documentation for a given class object."""
realname = object.__name__
name = name or realname
bases = object.__bases__
def makename(c, m=object.__module__):
return classname(c, m)
if name == realname:
title = 'class ' + self.bold(realname)
else:
title = self.bold(name) + ' = class ' + realname
if bases:
parents = map(makename, bases)
title = title + '(%s)' % join(parents, ', ')
doc = getdoc(object)
contents = doc and [doc + '\n'] or []
push = contents.append
# List the mro, if non-trivial.
mro = deque(inspect.getmro(object))
if len(mro) > 2:
push("Method resolution order:")
for base in mro:
push(' ' + makename(base))
push('')
# Cute little class to pump out a horizontal rule between sections.
class HorizontalRule:
def __init__(self):
self.needone = 0
def maybe(self):
if self.needone:
push('-' * 70)
self.needone = 1
hr = HorizontalRule()
def spill(msg, attrs, predicate):
ok, attrs = _split_list(attrs, predicate)
if ok:
hr.maybe()
push(msg)
for name, kind, homecls, value in ok:
push(self.document(getattr(object, name),
name, mod, object))
return attrs
def spilldescriptors(msg, attrs, predicate):
ok, attrs = _split_list(attrs, predicate)
if ok:
hr.maybe()
push(msg)
for name, kind, homecls, value in ok:
push(self._docdescriptor(name, value, mod))
return attrs
def spilldata(msg, attrs, predicate):
ok, attrs = _split_list(attrs, predicate)
if ok:
hr.maybe()
push(msg)
for name, kind, homecls, value in ok:
if (hasattr(value, '__call__') or
inspect.isdatadescriptor(value)):
doc = getdoc(value)
else:
doc = None
push(self.docother(getattr(object, name),
name, mod, maxlen=70, doc=doc) + '\n')
return attrs
attrs = filter(lambda data: visiblename(data[0]),
classify_class_attrs(object))
while attrs:
if mro:
thisclass = mro.popleft()
else:
thisclass = attrs[0][2]
attrs, inherited = _split_list(attrs, lambda t: t[2] is thisclass)
if thisclass is __builtin__.object:
attrs = inherited
continue
elif thisclass is object:
tag = "defined here"
else:
tag = "inherited from %s" % classname(thisclass,
object.__module__)
# Sort attrs by name.
attrs.sort()
# Pump out the attrs, segregated by kind.
attrs = spill("Methods %s:\n" % tag, attrs,
lambda t: t[1] == 'method')
attrs = spill("Class methods %s:\n" % tag, attrs,
lambda t: t[1] == 'class method')
attrs = spill("Static methods %s:\n" % tag, attrs,
lambda t: t[1] == 'static method')
attrs = spilldescriptors("Data descriptors %s:\n" % tag, attrs,
lambda t: t[1] == 'data descriptor')
attrs = spilldata("Data and other attributes %s:\n" % tag, attrs,
lambda t: t[1] == 'data')
assert attrs == []
attrs = inherited
contents = '\n'.join(contents)
if not contents:
return title + '\n'
return title + '\n' + self.indent(rstrip(contents), ' | ') + '\n'
def formatvalue(self, object):
"""Format an argument default value as text."""
return '=' + self.repr(object)
def docroutine(self, object, name=None, mod=None, cl=None):
"""Produce text documentation for a function or method object."""
realname = object.__name__
name = name or realname
note = ''
skipdocs = 0
if inspect.ismethod(object):
imclass = object.im_class
if cl:
if imclass is not cl:
note = ' from ' + classname(imclass, mod)
else:
if object.im_self is not None:
note = ' method of %s instance' % classname(
object.im_self.__class__, mod)
else:
note = ' unbound %s method' % classname(imclass,mod)
object = object.im_func
if name == realname:
title = self.bold(realname)
else:
if (cl and realname in cl.__dict__ and
cl.__dict__[realname] is object):
skipdocs = 1
title = self.bold(name) + ' = ' + realname
if inspect.isfunction(object):
args, varargs, varkw, defaults = inspect.getargspec(object)
argspec = inspect.formatargspec(
args, varargs, varkw, defaults, formatvalue=self.formatvalue)
if realname == '<lambda>':
title = self.bold(name) + ' lambda '
argspec = argspec[1:-1] # remove parentheses
else:
argspec = '(...)'
decl = title + argspec + note
if skipdocs:
return decl + '\n'
else:
doc = getdoc(object) or ''
return decl + '\n' + (doc and rstrip(self.indent(doc)) + '\n')
def _docdescriptor(self, name, value, mod):
results = []
push = results.append
if name:
push(self.bold(name))
push('\n')
doc = getdoc(value) or ''
if doc:
push(self.indent(doc))
push('\n')
return ''.join(results)
def docproperty(self, object, name=None, mod=None, cl=None):
"""Produce text documentation for a property."""
return self._docdescriptor(name, object, mod)
def docdata(self, object, name=None, mod=None, cl=None):
"""Produce text documentation for a data descriptor."""
return self._docdescriptor(name, object, mod)
def docother(self, object, name=None, mod=None, parent=None, maxlen=None, doc=None):
"""Produce text documentation for a data object."""
repr = self.repr(object)
if maxlen:
line = (name and name + ' = ' or '') + repr
chop = maxlen - len(line)
if chop < 0: repr = repr[:chop] + '...'
line = (name and self.bold(name) + ' = ' or '') + repr
if doc is not None:
line += '\n' + self.indent(str(doc))
return line
# --------------------------------------------------------- user interfaces
def pager(text):
"""The first time this is called, determine what kind of pager to use."""
global pager
pager = getpager()
pager(text)
def getpager():
"""Decide what method to use for paging through text."""
if type(sys.stdout) is not types.FileType:
return plainpager
if not sys.stdin.isatty() or not sys.stdout.isatty():
return plainpager
if 'PAGER' in os.environ:
if sys.platform == 'win32': # pipes completely broken in Windows
return lambda text: tempfilepager(plain(text), os.environ['PAGER'])
elif os.environ.get('TERM') in ('dumb', 'emacs'):
return lambda text: pipepager(plain(text), os.environ['PAGER'])
else:
return lambda text: pipepager(text, os.environ['PAGER'])
if os.environ.get('TERM') in ('dumb', 'emacs'):
return plainpager
if sys.platform == 'win32' or sys.platform.startswith('os2'):
return lambda text: tempfilepager(plain(text), 'more <')
if hasattr(os, 'system') and os.system('(less) 2>/dev/null') == 0:
return lambda text: pipepager(text, 'less')
import tempfile
(fd, filename) = tempfile.mkstemp()
os.close(fd)
try:
if hasattr(os, 'system') and os.system('more "%s"' % filename) == 0:
return lambda text: pipepager(text, 'more')
else:
return ttypager
finally:
os.unlink(filename)
def plain(text):
"""Remove boldface formatting from text."""
return re.sub('.\b', '', text)
def pipepager(text, cmd):
"""Page through text by feeding it to another program."""
pipe = os.popen(cmd, 'w')
try:
pipe.write(text)
pipe.close()
except IOError:
pass # Ignore broken pipes caused by quitting the pager program.
def tempfilepager(text, cmd):
"""Page through text by invoking a program on a temporary file."""
import tempfile
filename = tempfile.mktemp()
file = open(filename, 'w')
file.write(text)
file.close()
try:
os.system(cmd + ' "' + filename + '"')
finally:
os.unlink(filename)
def ttypager(text):
"""Page through text on a text terminal."""
lines = split(plain(text), '\n')
try:
import tty
fd = sys.stdin.fileno()
old = tty.tcgetattr(fd)
tty.setcbreak(fd)
getchar = lambda: sys.stdin.read(1)
except (ImportError, AttributeError):
tty = None
getchar = lambda: sys.stdin.readline()[:-1][:1]
try:
r = inc = os.environ.get('LINES', 25) - 1
sys.stdout.write(join(lines[:inc], '\n') + '\n')
while lines[r:]:
sys.stdout.write('-- more --')
sys.stdout.flush()
c = getchar()
if c in ('q', 'Q'):
sys.stdout.write('\r \r')
break
elif c in ('\r', '\n'):
sys.stdout.write('\r \r' + lines[r] + '\n')
r = r + 1
continue
if c in ('b', 'B', '\x1b'):
r = r - inc - inc
if r < 0: r = 0
sys.stdout.write('\n' + join(lines[r:r+inc], '\n') + '\n')
r = r + inc
finally:
if tty:
tty.tcsetattr(fd, tty.TCSAFLUSH, old)
def plainpager(text):
"""Simply print unformatted text. This is the ultimate fallback."""
sys.stdout.write(plain(text))
def describe(thing):
"""Produce a short description of the given thing."""
if inspect.ismodule(thing):
if thing.__name__ in sys.builtin_module_names:
return 'built-in module ' + thing.__name__
if hasattr(thing, '__path__'):
return 'package ' + thing.__name__
else:
return 'module ' + thing.__name__
if inspect.isbuiltin(thing):
return 'built-in function ' + thing.__name__
if inspect.isgetsetdescriptor(thing):
return 'getset descriptor %s.%s.%s' % (
thing.__objclass__.__module__, thing.__objclass__.__name__,
thing.__name__)
if inspect.ismemberdescriptor(thing):
return 'member descriptor %s.%s.%s' % (
thing.__objclass__.__module__, thing.__objclass__.__name__,
thing.__name__)
if inspect.isclass(thing):
return 'class ' + thing.__name__
if inspect.isfunction(thing):
return 'function ' + thing.__name__
if inspect.ismethod(thing):
return 'method ' + thing.__name__
if type(thing) is types.InstanceType:
return 'instance of ' + thing.__class__.__name__
return type(thing).__name__
def locate(path, forceload=0):
"""Locate an object by name or dotted path, importing as necessary."""
parts = [part for part in split(path, '.') if part]
module, n = None, 0
while n < len(parts):
nextmodule = safeimport(join(parts[:n+1], '.'), forceload)
if nextmodule: module, n = nextmodule, n + 1
else: break
if module:
object = module
for part in parts[n:]:
try: object = getattr(object, part)
except AttributeError: return None
return object
else:
if hasattr(__builtin__, path):
return getattr(__builtin__, path)
# --------------------------------------- interactive interpreter interface
text = TextDoc()
html = HTMLDoc()
class _OldStyleClass: pass
_OLD_INSTANCE_TYPE = type(_OldStyleClass())
def resolve(thing, forceload=0):
"""Given an object or a path to an object, get the object and its name."""
if isinstance(thing, str):
object = locate(thing, forceload)
if not object:
raise ImportError, 'no Python documentation found for %r' % thing
return object, thing
else:
return thing, getattr(thing, '__name__', None)
def render_doc(thing, title='Python Library Documentation: %s', forceload=0):
"""Render text documentation, given an object or a path to an object."""
object, name = resolve(thing, forceload)
desc = describe(object)
module = inspect.getmodule(object)
if name and '.' in name:
desc += ' in ' + name[:name.rfind('.')]
elif module and module is not object:
desc += ' in module ' + module.__name__
if type(object) is _OLD_INSTANCE_TYPE:
# If the passed object is an instance of an old-style class,
# document its available methods instead of its value.
object = object.__class__
elif not (inspect.ismodule(object) or
inspect.isclass(object) or
inspect.isroutine(object) or
inspect.isgetsetdescriptor(object) or
inspect.ismemberdescriptor(object) or
isinstance(object, property)):
# If the passed object is a piece of data or an instance,
# document its available methods instead of its value.
object = type(object)
desc += ' object'
return title % desc + '\n\n' + text.document(object, name)
def doc(thing, title='Python Library Documentation: %s', forceload=0):
"""Display text documentation, given an object or a path to an object."""
try:
pager(render_doc(thing, title, forceload))
except (ImportError, ErrorDuringImport), value:
print value
def writedoc(thing, forceload=0):
"""Write HTML documentation to a file in the current directory."""
try:
object, name = resolve(thing, forceload)
page = html.page(describe(object), html.document(object, name))
file = open(name + '.html', 'w')
file.write(page)
file.close()
print 'wrote', name + '.html'
except (ImportError, ErrorDuringImport), value:
print value
def writedocs(dir, pkgpath='', done=None):
"""Write out HTML documentation for all modules in a directory tree."""
if done is None: done = {}
for importer, modname, ispkg in pkgutil.walk_packages([dir], pkgpath):
writedoc(modname)
return
class Helper:
# These dictionaries map a topic name to either an alias, or a tuple
# (label, seealso-items). The "label" is the label of the corresponding
# section in the .rst file under Doc/ and an index into the dictionary
# in pydoc_data/topics.py.
#
# CAUTION: if you change one of these dictionaries, be sure to adapt the
# list of needed labels in Doc/tools/sphinxext/pyspecific.py and
# regenerate the pydoc_data/topics.py file by running
# make pydoc-topics
# in Doc/ and copying the output file into the Lib/ directory.
keywords = {
'and': 'BOOLEAN',
'as': 'with',
'assert': ('assert', ''),
'break': ('break', 'while for'),
'class': ('class', 'CLASSES SPECIALMETHODS'),
'continue': ('continue', 'while for'),
'def': ('function', ''),
'del': ('del', 'BASICMETHODS'),
'elif': 'if',
'else': ('else', 'while for'),
'except': 'try',
'exec': ('exec', ''),
'finally': 'try',
'for': ('for', 'break continue while'),
'from': 'import',
'global': ('global', 'NAMESPACES'),
'if': ('if', 'TRUTHVALUE'),
'import': ('import', 'MODULES'),
'in': ('in', 'SEQUENCEMETHODS2'),
'is': 'COMPARISON',
'lambda': ('lambda', 'FUNCTIONS'),
'not': 'BOOLEAN',
'or': 'BOOLEAN',
'pass': ('pass', ''),
'print': ('print', ''),
'raise': ('raise', 'EXCEPTIONS'),
'return': ('return', 'FUNCTIONS'),
'try': ('try', 'EXCEPTIONS'),
'while': ('while', 'break continue if TRUTHVALUE'),
'with': ('with', 'CONTEXTMANAGERS EXCEPTIONS yield'),
'yield': ('yield', ''),
}
# Either add symbols to this dictionary or to the symbols dictionary
# directly: Whichever is easier. They are merged later.
_symbols_inverse = {
'STRINGS' : ("'", "'''", "r'", "u'", '"""', '"', 'r"', 'u"'),
'OPERATORS' : ('+', '-', '*', '**', '/', '//', '%', '<<', '>>', '&',
'|', '^', '~', '<', '>', '<=', '>=', '==', '!=', '<>'),
'COMPARISON' : ('<', '>', '<=', '>=', '==', '!=', '<>'),
'UNARY' : ('-', '~'),
'AUGMENTEDASSIGNMENT' : ('+=', '-=', '*=', '/=', '%=', '&=', '|=',
'^=', '<<=', '>>=', '**=', '//='),
'BITWISE' : ('<<', '>>', '&', '|', '^', '~'),
'COMPLEX' : ('j', 'J')
}
symbols = {
'%': 'OPERATORS FORMATTING',
'**': 'POWER',
',': 'TUPLES LISTS FUNCTIONS',
'.': 'ATTRIBUTES FLOAT MODULES OBJECTS',
'...': 'ELLIPSIS',
':': 'SLICINGS DICTIONARYLITERALS',
'@': 'def class',
'\\': 'STRINGS',
'_': 'PRIVATENAMES',
'__': 'PRIVATENAMES SPECIALMETHODS',
'`': 'BACKQUOTES',
'(': 'TUPLES FUNCTIONS CALLS',
')': 'TUPLES FUNCTIONS CALLS',
'[': 'LISTS SUBSCRIPTS SLICINGS',
']': 'LISTS SUBSCRIPTS SLICINGS'
}
for topic, symbols_ in _symbols_inverse.iteritems():
for symbol in symbols_:
topics = symbols.get(symbol, topic)
if topic not in topics:
topics = topics + ' ' + topic
symbols[symbol] = topics
topics = {
'TYPES': ('types', 'STRINGS UNICODE NUMBERS SEQUENCES MAPPINGS '
'FUNCTIONS CLASSES MODULES FILES inspect'),
'STRINGS': ('strings', 'str UNICODE SEQUENCES STRINGMETHODS FORMATTING '
'TYPES'),
'STRINGMETHODS': ('string-methods', 'STRINGS FORMATTING'),
'FORMATTING': ('formatstrings', 'OPERATORS'),
'UNICODE': ('strings', 'encodings unicode SEQUENCES STRINGMETHODS '
'FORMATTING TYPES'),
'NUMBERS': ('numbers', 'INTEGER FLOAT COMPLEX TYPES'),
'INTEGER': ('integers', 'int range'),
'FLOAT': ('floating', 'float math'),
'COMPLEX': ('imaginary', 'complex cmath'),
'SEQUENCES': ('typesseq', 'STRINGMETHODS FORMATTING xrange LISTS'),
'MAPPINGS': 'DICTIONARIES',
'FUNCTIONS': ('typesfunctions', 'def TYPES'),
'METHODS': ('typesmethods', 'class def CLASSES TYPES'),
'CODEOBJECTS': ('bltin-code-objects', 'compile FUNCTIONS TYPES'),
'TYPEOBJECTS': ('bltin-type-objects', 'types TYPES'),
'FRAMEOBJECTS': 'TYPES',
'TRACEBACKS': 'TYPES',
'NONE': ('bltin-null-object', ''),
'ELLIPSIS': ('bltin-ellipsis-object', 'SLICINGS'),
'FILES': ('bltin-file-objects', ''),
'SPECIALATTRIBUTES': ('specialattrs', ''),
'CLASSES': ('types', 'class SPECIALMETHODS PRIVATENAMES'),
'MODULES': ('typesmodules', 'import'),
'PACKAGES': 'import',
'EXPRESSIONS': ('operator-summary', 'lambda or and not in is BOOLEAN '
'COMPARISON BITWISE SHIFTING BINARY FORMATTING POWER '
'UNARY ATTRIBUTES SUBSCRIPTS SLICINGS CALLS TUPLES '
'LISTS DICTIONARIES BACKQUOTES'),
'OPERATORS': 'EXPRESSIONS',
'PRECEDENCE': 'EXPRESSIONS',
'OBJECTS': ('objects', 'TYPES'),
'SPECIALMETHODS': ('specialnames', 'BASICMETHODS ATTRIBUTEMETHODS '
'CALLABLEMETHODS SEQUENCEMETHODS1 MAPPINGMETHODS '
'SEQUENCEMETHODS2 NUMBERMETHODS CLASSES'),
'BASICMETHODS': ('customization', 'cmp hash repr str SPECIALMETHODS'),
'ATTRIBUTEMETHODS': ('attribute-access', 'ATTRIBUTES SPECIALMETHODS'),
'CALLABLEMETHODS': ('callable-types', 'CALLS SPECIALMETHODS'),
'SEQUENCEMETHODS1': ('sequence-types', 'SEQUENCES SEQUENCEMETHODS2 '
'SPECIALMETHODS'),
'SEQUENCEMETHODS2': ('sequence-methods', 'SEQUENCES SEQUENCEMETHODS1 '
'SPECIALMETHODS'),
'MAPPINGMETHODS': ('sequence-types', 'MAPPINGS SPECIALMETHODS'),
'NUMBERMETHODS': ('numeric-types', 'NUMBERS AUGMENTEDASSIGNMENT '
'SPECIALMETHODS'),
'EXECUTION': ('execmodel', 'NAMESPACES DYNAMICFEATURES EXCEPTIONS'),
'NAMESPACES': ('naming', 'global ASSIGNMENT DELETION DYNAMICFEATURES'),
'DYNAMICFEATURES': ('dynamic-features', ''),
'SCOPING': 'NAMESPACES',
'FRAMES': 'NAMESPACES',
'EXCEPTIONS': ('exceptions', 'try except finally raise'),
'COERCIONS': ('coercion-rules','CONVERSIONS'),
'CONVERSIONS': ('conversions', 'COERCIONS'),
'IDENTIFIERS': ('identifiers', 'keywords SPECIALIDENTIFIERS'),
'SPECIALIDENTIFIERS': ('id-classes', ''),
'PRIVATENAMES': ('atom-identifiers', ''),
'LITERALS': ('atom-literals', 'STRINGS BACKQUOTES NUMBERS '
'TUPLELITERALS LISTLITERALS DICTIONARYLITERALS'),
'TUPLES': 'SEQUENCES',
'TUPLELITERALS': ('exprlists', 'TUPLES LITERALS'),
'LISTS': ('typesseq-mutable', 'LISTLITERALS'),
'LISTLITERALS': ('lists', 'LISTS LITERALS'),
'DICTIONARIES': ('typesmapping', 'DICTIONARYLITERALS'),
'DICTIONARYLITERALS': ('dict', 'DICTIONARIES LITERALS'),
'BACKQUOTES': ('string-conversions', 'repr str STRINGS LITERALS'),
'ATTRIBUTES': ('attribute-references', 'getattr hasattr setattr '
'ATTRIBUTEMETHODS'),
'SUBSCRIPTS': ('subscriptions', 'SEQUENCEMETHODS1'),
'SLICINGS': ('slicings', 'SEQUENCEMETHODS2'),
'CALLS': ('calls', 'EXPRESSIONS'),
'POWER': ('power', 'EXPRESSIONS'),
'UNARY': ('unary', 'EXPRESSIONS'),
'BINARY': ('binary', 'EXPRESSIONS'),
'SHIFTING': ('shifting', 'EXPRESSIONS'),
'BITWISE': ('bitwise', 'EXPRESSIONS'),
'COMPARISON': ('comparisons', 'EXPRESSIONS BASICMETHODS'),
'BOOLEAN': ('booleans', 'EXPRESSIONS TRUTHVALUE'),
'ASSERTION': 'assert',
'ASSIGNMENT': ('assignment', 'AUGMENTEDASSIGNMENT'),
'AUGMENTEDASSIGNMENT': ('augassign', 'NUMBERMETHODS'),
'DELETION': 'del',
'PRINTING': 'print',
'RETURNING': 'return',
'IMPORTING': 'import',
'CONDITIONAL': 'if',
'LOOPING': ('compound', 'for while break continue'),
'TRUTHVALUE': ('truth', 'if while and or not BASICMETHODS'),
'DEBUGGING': ('debugger', 'pdb'),
'CONTEXTMANAGERS': ('context-managers', 'with'),
}
def __init__(self, input=None, output=None):
self._input = input
self._output = output
input = property(lambda self: self._input or sys.stdin)
output = property(lambda self: self._output or sys.stdout)
def __repr__(self):
if inspect.stack()[1][3] == '?':
self()
return ''
return '<pydoc.Helper instance>'
def __call__(self, request=None):
if request is not None:
self.help(request)
else:
self.intro()
self.interact()
self.output.write('''
You are now leaving help and returning to the Python interpreter.
If you want to ask for help on a particular object directly from the
interpreter, you can type "help(object)". Executing "help('string')"
has the same effect as typing a particular string at the help> prompt.
''')
def interact(self):
self.output.write('\n')
while True:
try:
request = self.getline('help> ')
if not request: break
except (KeyboardInterrupt, EOFError):
break
request = strip(replace(request, '"', '', "'", ''))
if lower(request) in ('q', 'quit'): break
self.help(request)
def getline(self, prompt):
"""Read one line, using raw_input when available."""
if self.input is sys.stdin:
return raw_input(prompt)
else:
self.output.write(prompt)
self.output.flush()
return self.input.readline()
def help(self, request):
if type(request) is type(''):
request = request.strip()
if request == 'help': self.intro()
elif request == 'keywords': self.listkeywords()
elif request == 'symbols': self.listsymbols()
elif request == 'topics': self.listtopics()
elif request == 'modules': self.listmodules()
elif request[:8] == 'modules ':
self.listmodules(split(request)[1])
elif request in self.symbols: self.showsymbol(request)
elif request in self.keywords: self.showtopic(request)
elif request in self.topics: self.showtopic(request)
elif request: doc(request, 'Help on %s:')
elif isinstance(request, Helper): self()
else: doc(request, 'Help on %s:')
self.output.write('\n')
def intro(self):
self.output.write('''
Welcome to Python %s! This is the online help utility.
If this is your first time using Python, you should definitely check out
the tutorial on the Internet at http://docs.python.org/tutorial/.
Enter the name of any module, keyword, or topic to get help on writing
Python programs and using Python modules. To quit this help utility and
return to the interpreter, just type "quit".
To get a list of available modules, keywords, or topics, type "modules",
"keywords", or "topics". Each module also comes with a one-line summary
of what it does; to list the modules whose summaries contain a given word
such as "spam", type "modules spam".
''' % sys.version[:3])
def list(self, items, columns=4, width=80):
items = items[:]
items.sort()
colw = width / columns
rows = (len(items) + columns - 1) / columns
for row in range(rows):
for col in range(columns):
i = col * rows + row
if i < len(items):
self.output.write(items[i])
if col < columns - 1:
self.output.write(' ' + ' ' * (colw-1 - len(items[i])))
self.output.write('\n')
def listkeywords(self):
self.output.write('''
Here is a list of the Python keywords. Enter any keyword to get more help.
''')
self.list(self.keywords.keys())
def listsymbols(self):
self.output.write('''
Here is a list of the punctuation symbols which Python assigns special meaning
to. Enter any symbol to get more help.
''')
self.list(self.symbols.keys())
def listtopics(self):
self.output.write('''
Here is a list of available topics. Enter any topic name to get more help.
''')
self.list(self.topics.keys())
def showtopic(self, topic, more_xrefs=''):
try:
import pydoc_data.topics
except ImportError:
self.output.write('''
Sorry, topic and keyword documentation is not available because the
module "pydoc_data.topics" could not be found.
''')
return
target = self.topics.get(topic, self.keywords.get(topic))
if not target:
self.output.write('no documentation found for %s\n' % repr(topic))
return
if type(target) is type(''):
return self.showtopic(target, more_xrefs)
label, xrefs = target
try:
doc = pydoc_data.topics.topics[label]
except KeyError:
self.output.write('no documentation found for %s\n' % repr(topic))
return
pager(strip(doc) + '\n')
if more_xrefs:
xrefs = (xrefs or '') + ' ' + more_xrefs
if xrefs:
import StringIO, formatter
buffer = StringIO.StringIO()
formatter.DumbWriter(buffer).send_flowing_data(
'Related help topics: ' + join(split(xrefs), ', ') + '\n')
self.output.write('\n%s\n' % buffer.getvalue())
def showsymbol(self, symbol):
target = self.symbols[symbol]
topic, _, xrefs = target.partition(' ')
self.showtopic(topic, xrefs)
def listmodules(self, key=''):
if key:
self.output.write('''
Here is a list of matching modules. Enter any module name to get more help.
''')
apropos(key)
else:
self.output.write('''
Please wait a moment while I gather a list of all available modules...
''')
modules = {}
def callback(path, modname, desc, modules=modules):
if modname and modname[-9:] == '.__init__':
modname = modname[:-9] + ' (package)'
if find(modname, '.') < 0:
modules[modname] = 1
def onerror(modname):
callback(None, modname, None)
ModuleScanner().run(callback, onerror=onerror)
self.list(modules.keys())
self.output.write('''
Enter any module name to get more help. Or, type "modules spam" to search
for modules whose descriptions contain the word "spam".
''')
help = Helper()
class Scanner:
"""A generic tree iterator."""
def __init__(self, roots, children, descendp):
self.roots = roots[:]
self.state = []
self.children = children
self.descendp = descendp
def next(self):
if not self.state:
if not self.roots:
return None
root = self.roots.pop(0)
self.state = [(root, self.children(root))]
node, children = self.state[-1]
if not children:
self.state.pop()
return self.next()
child = children.pop(0)
if self.descendp(child):
self.state.append((child, self.children(child)))
return child
class ModuleScanner:
"""An interruptible scanner that searches module synopses."""
def run(self, callback, key=None, completer=None, onerror=None):
if key: key = lower(key)
self.quit = False
seen = {}
for modname in sys.builtin_module_names:
if modname != '__main__':
seen[modname] = 1
if key is None:
callback(None, modname, '')
else:
desc = split(__import__(modname).__doc__ or '', '\n')[0]
if find(lower(modname + ' - ' + desc), key) >= 0:
callback(None, modname, desc)
for importer, modname, ispkg in pkgutil.walk_packages(onerror=onerror):
if self.quit:
break
if key is None:
callback(None, modname, '')
else:
loader = importer.find_module(modname)
if hasattr(loader,'get_source'):
import StringIO
desc = source_synopsis(
StringIO.StringIO(loader.get_source(modname))
) or ''
if hasattr(loader,'get_filename'):
path = loader.get_filename(modname)
else:
path = None
else:
module = loader.load_module(modname)
desc = (module.__doc__ or '').splitlines()[0]
path = getattr(module,'__file__',None)
if find(lower(modname + ' - ' + desc), key) >= 0:
callback(path, modname, desc)
if completer:
completer()
def apropos(key):
"""Print all the one-line module summaries that contain a substring."""
def callback(path, modname, desc):
if modname[-9:] == '.__init__':
modname = modname[:-9] + ' (package)'
print modname, desc and '- ' + desc
try: import warnings
except ImportError: pass
else: warnings.filterwarnings('ignore') # ignore problems during import
ModuleScanner().run(callback, key)
# --------------------------------------------------- web browser interface
def serve(port, callback=None, completer=None):
import BaseHTTPServer, mimetools, select
# Patch up mimetools.Message so it doesn't break if rfc822 is reloaded.
class Message(mimetools.Message):
def __init__(self, fp, seekable=1):
Message = self.__class__
Message.__bases__[0].__bases__[0].__init__(self, fp, seekable)
self.encodingheader = self.getheader('content-transfer-encoding')
self.typeheader = self.getheader('content-type')
self.parsetype()
self.parseplist()
class DocHandler(BaseHTTPServer.BaseHTTPRequestHandler):
def send_document(self, title, contents):
try:
self.send_response(200)
self.send_header('Content-Type', 'text/html')
self.end_headers()
self.wfile.write(html.page(title, contents))
except IOError: pass
def do_GET(self):
path = self.path
if path[-5:] == '.html': path = path[:-5]
if path[:1] == '/': path = path[1:]
if path and path != '.':
try:
obj = locate(path, forceload=1)
except ErrorDuringImport, value:
self.send_document(path, html.escape(str(value)))
return
if obj:
self.send_document(describe(obj), html.document(obj, path))
else:
self.send_document(path,
'no Python documentation found for %s' % repr(path))
else:
heading = html.heading(
'<big><big><strong>Python: Index of Modules</strong></big></big>',
'#ffffff', '#7799ee')
def bltinlink(name):
return '<a href="%s.html">%s</a>' % (name, name)
names = filter(lambda x: x != '__main__',
sys.builtin_module_names)
contents = html.multicolumn(names, bltinlink)
indices = ['<p>' + html.bigsection(
'Built-in Modules', '#ffffff', '#ee77aa', contents)]
seen = {}
for dir in sys.path:
indices.append(html.index(dir, seen))
contents = heading + join(indices) + '''<p align=right>
<font color="#909090" face="helvetica, arial"><strong>
pydoc</strong> by Ka-Ping Yee <ping@lfw.org></font>'''
self.send_document('Index of Modules', contents)
def log_message(self, *args): pass
class DocServer(BaseHTTPServer.HTTPServer):
def __init__(self, port, callback):
host = 'localhost'
self.address = (host, port)
self.url = 'http://%s:%d/' % (host, port)
self.callback = callback
self.base.__init__(self, self.address, self.handler)
def serve_until_quit(self):
import select
self.quit = False
while not self.quit:
rd, wr, ex = select.select([self.socket.fileno()], [], [], 1)
if rd: self.handle_request()
def server_activate(self):
self.base.server_activate(self)
if self.callback: self.callback(self)
DocServer.base = BaseHTTPServer.HTTPServer
DocServer.handler = DocHandler
DocHandler.MessageClass = Message
try:
try:
DocServer(port, callback).serve_until_quit()
except (KeyboardInterrupt, select.error):
pass
finally:
if completer: completer()
# ----------------------------------------------------- graphical interface
def gui():
"""Graphical interface (starts web server and pops up a control window)."""
class GUI:
def __init__(self, window, port=7464):
self.window = window
self.server = None
self.scanner = None
import Tkinter
self.server_frm = Tkinter.Frame(window)
self.title_lbl = Tkinter.Label(self.server_frm,
text='Starting server...\n ')
self.open_btn = Tkinter.Button(self.server_frm,
text='open browser', command=self.open, state='disabled')
self.quit_btn = Tkinter.Button(self.server_frm,
text='quit serving', command=self.quit, state='disabled')
self.search_frm = Tkinter.Frame(window)
self.search_lbl = Tkinter.Label(self.search_frm, text='Search for')
self.search_ent = Tkinter.Entry(self.search_frm)
self.search_ent.bind('<Return>', self.search)
self.stop_btn = Tkinter.Button(self.search_frm,
text='stop', pady=0, command=self.stop, state='disabled')
if sys.platform == 'win32':
# Trying to hide and show this button crashes under Windows.
self.stop_btn.pack(side='right')
self.window.title('pydoc')
self.window.protocol('WM_DELETE_WINDOW', self.quit)
self.title_lbl.pack(side='top', fill='x')
self.open_btn.pack(side='left', fill='x', expand=1)
self.quit_btn.pack(side='right', fill='x', expand=1)
self.server_frm.pack(side='top', fill='x')
self.search_lbl.pack(side='left')
self.search_ent.pack(side='right', fill='x', expand=1)
self.search_frm.pack(side='top', fill='x')
self.search_ent.focus_set()
font = ('helvetica', sys.platform == 'win32' and 8 or 10)
self.result_lst = Tkinter.Listbox(window, font=font, height=6)
self.result_lst.bind('<Button-1>', self.select)
self.result_lst.bind('<Double-Button-1>', self.goto)
self.result_scr = Tkinter.Scrollbar(window,
orient='vertical', command=self.result_lst.yview)
self.result_lst.config(yscrollcommand=self.result_scr.set)
self.result_frm = Tkinter.Frame(window)
self.goto_btn = Tkinter.Button(self.result_frm,
text='go to selected', command=self.goto)
self.hide_btn = Tkinter.Button(self.result_frm,
text='hide results', command=self.hide)
self.goto_btn.pack(side='left', fill='x', expand=1)
self.hide_btn.pack(side='right', fill='x', expand=1)
self.window.update()
self.minwidth = self.window.winfo_width()
self.minheight = self.window.winfo_height()
self.bigminheight = (self.server_frm.winfo_reqheight() +
self.search_frm.winfo_reqheight() +
self.result_lst.winfo_reqheight() +
self.result_frm.winfo_reqheight())
self.bigwidth, self.bigheight = self.minwidth, self.bigminheight
self.expanded = 0
self.window.wm_geometry('%dx%d' % (self.minwidth, self.minheight))
self.window.wm_minsize(self.minwidth, self.minheight)
self.window.tk.willdispatch()
import threading
threading.Thread(
target=serve, args=(port, self.ready, self.quit)).start()
def ready(self, server):
self.server = server
self.title_lbl.config(
text='Python documentation server at\n' + server.url)
self.open_btn.config(state='normal')
self.quit_btn.config(state='normal')
def open(self, event=None, url=None):
url = url or self.server.url
try:
import webbrowser
webbrowser.open(url)
except ImportError: # pre-webbrowser.py compatibility
if sys.platform == 'win32':
os.system('start "%s"' % url)
else:
rc = os.system('netscape -remote "openURL(%s)" &' % url)
if rc: os.system('netscape "%s" &' % url)
def quit(self, event=None):
if self.server:
self.server.quit = 1
self.window.quit()
def search(self, event=None):
key = self.search_ent.get()
self.stop_btn.pack(side='right')
self.stop_btn.config(state='normal')
self.search_lbl.config(text='Searching for "%s"...' % key)
self.search_ent.forget()
self.search_lbl.pack(side='left')
self.result_lst.delete(0, 'end')
self.goto_btn.config(state='disabled')
self.expand()
import threading
if self.scanner:
self.scanner.quit = 1
self.scanner = ModuleScanner()
threading.Thread(target=self.scanner.run,
args=(self.update, key, self.done)).start()
def update(self, path, modname, desc):
if modname[-9:] == '.__init__':
modname = modname[:-9] + ' (package)'
self.result_lst.insert('end',
modname + ' - ' + (desc or '(no description)'))
def stop(self, event=None):
if self.scanner:
self.scanner.quit = 1
self.scanner = None
def done(self):
self.scanner = None
self.search_lbl.config(text='Search for')
self.search_lbl.pack(side='left')
self.search_ent.pack(side='right', fill='x', expand=1)
if sys.platform != 'win32': self.stop_btn.forget()
self.stop_btn.config(state='disabled')
def select(self, event=None):
self.goto_btn.config(state='normal')
def goto(self, event=None):
selection = self.result_lst.curselection()
if selection:
modname = split(self.result_lst.get(selection[0]))[0]
self.open(url=self.server.url + modname + '.html')
def collapse(self):
if not self.expanded: return
self.result_frm.forget()
self.result_scr.forget()
self.result_lst.forget()
self.bigwidth = self.window.winfo_width()
self.bigheight = self.window.winfo_height()
self.window.wm_geometry('%dx%d' % (self.minwidth, self.minheight))
self.window.wm_minsize(self.minwidth, self.minheight)
self.expanded = 0
def expand(self):
if self.expanded: return
self.result_frm.pack(side='bottom', fill='x')
self.result_scr.pack(side='right', fill='y')
self.result_lst.pack(side='top', fill='both', expand=1)
self.window.wm_geometry('%dx%d' % (self.bigwidth, self.bigheight))
self.window.wm_minsize(self.minwidth, self.bigminheight)
self.expanded = 1
def hide(self, event=None):
self.stop()
self.collapse()
import Tkinter
try:
root = Tkinter.Tk()
# Tk will crash if pythonw.exe has an XP .manifest
# file and the root has is not destroyed explicitly.
# If the problem is ever fixed in Tk, the explicit
# destroy can go.
try:
gui = GUI(root)
root.mainloop()
finally:
root.destroy()
except KeyboardInterrupt:
pass
# -------------------------------------------------- command-line interface
def ispath(x):
return isinstance(x, str) and find(x, os.sep) >= 0
def cli():
"""Command-line interface (looks at sys.argv to decide what to do)."""
import getopt
class BadUsage: pass
# Scripts don't get the current directory in their path by default
# unless they are run with the '-m' switch
if '' not in sys.path:
scriptdir = os.path.dirname(sys.argv[0])
if scriptdir in sys.path:
sys.path.remove(scriptdir)
sys.path.insert(0, '.')
try:
opts, args = getopt.getopt(sys.argv[1:], 'gk:p:w')
writing = 0
for opt, val in opts:
if opt == '-g':
gui()
return
if opt == '-k':
apropos(val)
return
if opt == '-p':
try:
port = int(val)
except ValueError:
raise BadUsage
def ready(server):
print 'pydoc server ready at %s' % server.url
def stopped():
print 'pydoc server stopped'
serve(port, ready, stopped)
return
if opt == '-w':
writing = 1
if not args: raise BadUsage
for arg in args:
if ispath(arg) and not os.path.exists(arg):
print 'file %r does not exist' % arg
break
try:
if ispath(arg) and os.path.isfile(arg):
arg = importfile(arg)
if writing:
if ispath(arg) and os.path.isdir(arg):
writedocs(arg)
else:
writedoc(arg)
else:
help.help(arg)
except ErrorDuringImport, value:
print value
except (getopt.error, BadUsage):
cmd = os.path.basename(sys.argv[0])
print """pydoc - the Python documentation tool
%s <name> ...
Show text documentation on something. <name> may be the name of a
Python keyword, topic, function, module, or package, or a dotted
reference to a class or function within a module or module in a
package. If <name> contains a '%s', it is used as the path to a
Python source file to document. If name is 'keywords', 'topics',
or 'modules', a listing of these things is displayed.
%s -k <keyword>
Search for a keyword in the synopsis lines of all available modules.
%s -p <port>
Start an HTTP server on the given port on the local machine.
%s -g
Pop up a graphical interface for finding and serving documentation.
%s -w <name> ...
Write out the HTML documentation for a module to a file in the current
directory. If <name> contains a '%s', it is treated as a filename; if
it names a directory, documentation is written for all the contents.
""" % (cmd, os.sep, cmd, cmd, cmd, cmd, os.sep)
if __name__ == '__main__': cli()
| Python |
#! /usr/bin/env python
"""Conversions to/from quoted-printable transport encoding as per RFC 1521."""
# (Dec 1991 version).
__all__ = ["encode", "decode", "encodestring", "decodestring"]
ESCAPE = '='
MAXLINESIZE = 76
HEX = '0123456789ABCDEF'
EMPTYSTRING = ''
try:
from binascii import a2b_qp, b2a_qp
except ImportError:
a2b_qp = None
b2a_qp = None
def needsquoting(c, quotetabs, header):
"""Decide whether a particular character needs to be quoted.
The 'quotetabs' flag indicates whether embedded tabs and spaces should be
quoted. Note that line-ending tabs and spaces are always encoded, as per
RFC 1521.
"""
if c in ' \t':
return quotetabs
# if header, we have to escape _ because _ is used to escape space
if c == '_':
return header
return c == ESCAPE or not (' ' <= c <= '~')
def quote(c):
"""Quote a single character."""
i = ord(c)
return ESCAPE + HEX[i//16] + HEX[i%16]
def encode(input, output, quotetabs, header = 0):
"""Read 'input', apply quoted-printable encoding, and write to 'output'.
'input' and 'output' are files with readline() and write() methods.
The 'quotetabs' flag indicates whether embedded tabs and spaces should be
quoted. Note that line-ending tabs and spaces are always encoded, as per
RFC 1521.
The 'header' flag indicates whether we are encoding spaces as _ as per
RFC 1522.
"""
if b2a_qp is not None:
data = input.read()
odata = b2a_qp(data, quotetabs = quotetabs, header = header)
output.write(odata)
return
def write(s, output=output, lineEnd='\n'):
# RFC 1521 requires that the line ending in a space or tab must have
# that trailing character encoded.
if s and s[-1:] in ' \t':
output.write(s[:-1] + quote(s[-1]) + lineEnd)
elif s == '.':
output.write(quote(s) + lineEnd)
else:
output.write(s + lineEnd)
prevline = None
while 1:
line = input.readline()
if not line:
break
outline = []
# Strip off any readline induced trailing newline
stripped = ''
if line[-1:] == '\n':
line = line[:-1]
stripped = '\n'
# Calculate the un-length-limited encoded line
for c in line:
if needsquoting(c, quotetabs, header):
c = quote(c)
if header and c == ' ':
outline.append('_')
else:
outline.append(c)
# First, write out the previous line
if prevline is not None:
write(prevline)
# Now see if we need any soft line breaks because of RFC-imposed
# length limitations. Then do the thisline->prevline dance.
thisline = EMPTYSTRING.join(outline)
while len(thisline) > MAXLINESIZE:
# Don't forget to include the soft line break `=' sign in the
# length calculation!
write(thisline[:MAXLINESIZE-1], lineEnd='=\n')
thisline = thisline[MAXLINESIZE-1:]
# Write out the current line
prevline = thisline
# Write out the last line, without a trailing newline
if prevline is not None:
write(prevline, lineEnd=stripped)
def encodestring(s, quotetabs = 0, header = 0):
if b2a_qp is not None:
return b2a_qp(s, quotetabs = quotetabs, header = header)
from cStringIO import StringIO
infp = StringIO(s)
outfp = StringIO()
encode(infp, outfp, quotetabs, header)
return outfp.getvalue()
def decode(input, output, header = 0):
"""Read 'input', apply quoted-printable decoding, and write to 'output'.
'input' and 'output' are files with readline() and write() methods.
If 'header' is true, decode underscore as space (per RFC 1522)."""
if a2b_qp is not None:
data = input.read()
odata = a2b_qp(data, header = header)
output.write(odata)
return
new = ''
while 1:
line = input.readline()
if not line: break
i, n = 0, len(line)
if n > 0 and line[n-1] == '\n':
partial = 0; n = n-1
# Strip trailing whitespace
while n > 0 and line[n-1] in " \t\r":
n = n-1
else:
partial = 1
while i < n:
c = line[i]
if c == '_' and header:
new = new + ' '; i = i+1
elif c != ESCAPE:
new = new + c; i = i+1
elif i+1 == n and not partial:
partial = 1; break
elif i+1 < n and line[i+1] == ESCAPE:
new = new + ESCAPE; i = i+2
elif i+2 < n and ishex(line[i+1]) and ishex(line[i+2]):
new = new + chr(unhex(line[i+1:i+3])); i = i+3
else: # Bad escape sequence -- leave it in
new = new + c; i = i+1
if not partial:
output.write(new + '\n')
new = ''
if new:
output.write(new)
def decodestring(s, header = 0):
if a2b_qp is not None:
return a2b_qp(s, header = header)
from cStringIO import StringIO
infp = StringIO(s)
outfp = StringIO()
decode(infp, outfp, header = header)
return outfp.getvalue()
# Other helper functions
def ishex(c):
"""Return true if the character 'c' is a hexadecimal digit."""
return '0' <= c <= '9' or 'a' <= c <= 'f' or 'A' <= c <= 'F'
def unhex(s):
"""Get the integer value of a hexadecimal number."""
bits = 0
for c in s:
if '0' <= c <= '9':
i = ord('0')
elif 'a' <= c <= 'f':
i = ord('a')-10
elif 'A' <= c <= 'F':
i = ord('A')-10
else:
break
bits = bits*16 + (ord(c) - i)
return bits
def main():
import sys
import getopt
try:
opts, args = getopt.getopt(sys.argv[1:], 'td')
except getopt.error, msg:
sys.stdout = sys.stderr
print msg
print "usage: quopri [-t | -d] [file] ..."
print "-t: quote tabs"
print "-d: decode; default encode"
sys.exit(2)
deco = 0
tabs = 0
for o, a in opts:
if o == '-t': tabs = 1
if o == '-d': deco = 1
if tabs and deco:
sys.stdout = sys.stderr
print "-t and -d are mutually exclusive"
sys.exit(2)
if not args: args = ['-']
sts = 0
for file in args:
if file == '-':
fp = sys.stdin
else:
try:
fp = open(file)
except IOError, msg:
sys.stderr.write("%s: can't open (%s)\n" % (file, msg))
sts = 1
continue
if deco:
decode(fp, sys.stdout)
else:
encode(fp, sys.stdout, tabs)
if fp is not sys.stdin:
fp.close()
if sts:
sys.exit(sts)
if __name__ == '__main__':
main()
| Python |
"""Routine to "compile" a .py file to a .pyc (or .pyo) file.
This module has intimate knowledge of the format of .pyc files.
"""
import __builtin__
import imp
import marshal
import os
import sys
import traceback
MAGIC = imp.get_magic()
__all__ = ["compile", "main", "PyCompileError"]
class PyCompileError(Exception):
"""Exception raised when an error occurs while attempting to
compile the file.
To raise this exception, use
raise PyCompileError(exc_type,exc_value,file[,msg])
where
exc_type: exception type to be used in error message
type name can be accesses as class variable
'exc_type_name'
exc_value: exception value to be used in error message
can be accesses as class variable 'exc_value'
file: name of file being compiled to be used in error message
can be accesses as class variable 'file'
msg: string message to be written as error message
If no value is given, a default exception message will be given,
consistent with 'standard' py_compile output.
message (or default) can be accesses as class variable 'msg'
"""
def __init__(self, exc_type, exc_value, file, msg=''):
exc_type_name = exc_type.__name__
if exc_type is SyntaxError:
tbtext = ''.join(traceback.format_exception_only(exc_type, exc_value))
errmsg = tbtext.replace('File "<string>"', 'File "%s"' % file)
else:
errmsg = "Sorry: %s: %s" % (exc_type_name,exc_value)
Exception.__init__(self,msg or errmsg,exc_type_name,exc_value,file)
self.exc_type_name = exc_type_name
self.exc_value = exc_value
self.file = file
self.msg = msg or errmsg
def __str__(self):
return self.msg
def wr_long(f, x):
"""Internal; write a 32-bit int to a file in little-endian order."""
f.write(chr( x & 0xff))
f.write(chr((x >> 8) & 0xff))
f.write(chr((x >> 16) & 0xff))
f.write(chr((x >> 24) & 0xff))
def compile(file, cfile=None, dfile=None, doraise=False):
"""Byte-compile one Python source file to Python bytecode.
Arguments:
file: source filename
cfile: target filename; defaults to source with 'c' or 'o' appended
('c' normally, 'o' in optimizing mode, giving .pyc or .pyo)
dfile: purported filename; defaults to source (this is the filename
that will show up in error messages)
doraise: flag indicating whether or not an exception should be
raised when a compile error is found. If an exception
occurs and this flag is set to False, a string
indicating the nature of the exception will be printed,
and the function will return to the caller. If an
exception occurs and this flag is set to True, a
PyCompileError exception will be raised.
Note that it isn't necessary to byte-compile Python modules for
execution efficiency -- Python itself byte-compiles a module when
it is loaded, and if it can, writes out the bytecode to the
corresponding .pyc (or .pyo) file.
However, if a Python installation is shared between users, it is a
good idea to byte-compile all modules upon installation, since
other users may not be able to write in the source directories,
and thus they won't be able to write the .pyc/.pyo file, and then
they would be byte-compiling every module each time it is loaded.
This can slow down program start-up considerably.
See compileall.py for a script/module that uses this module to
byte-compile all installed files (or all files in selected
directories).
"""
with open(file, 'U') as f:
try:
timestamp = long(os.fstat(f.fileno()).st_mtime)
except AttributeError:
timestamp = long(os.stat(file).st_mtime)
codestring = f.read()
try:
codeobject = __builtin__.compile(codestring, dfile or file,'exec')
except Exception,err:
py_exc = PyCompileError(err.__class__,err.args,dfile or file)
if doraise:
raise py_exc
else:
sys.stderr.write(py_exc.msg + '\n')
return
if cfile is None:
cfile = file + (__debug__ and 'c' or 'o')
with open(cfile, 'wb') as fc:
fc.write('\0\0\0\0')
wr_long(fc, timestamp)
marshal.dump(codeobject, fc)
fc.flush()
fc.seek(0, 0)
fc.write(MAGIC)
def main(args=None):
"""Compile several source files.
The files named in 'args' (or on the command line, if 'args' is
not specified) are compiled and the resulting bytecode is cached
in the normal manner. This function does not search a directory
structure to locate source files; it only compiles files named
explicitly. If '-' is the only parameter in args, the list of
files is taken from standard input.
"""
if args is None:
args = sys.argv[1:]
rv = 0
if args == ['-']:
while True:
filename = sys.stdin.readline()
if not filename:
break
filename = filename.rstrip('\n')
try:
compile(filename, doraise=True)
except PyCompileError as error:
rv = 1
sys.stderr.write("%s\n" % error.msg)
except IOError as error:
rv = 1
sys.stderr.write("%s\n" % error)
else:
for filename in args:
try:
compile(filename, doraise=True)
except PyCompileError as error:
# return value to indicate at least one failure
rv = 1
sys.stderr.write(error.msg)
return rv
if __name__ == "__main__":
sys.exit(main())
| Python |
"""Drop-in replacement for the thread module.
Meant to be used as a brain-dead substitute so that threaded code does
not need to be rewritten for when the thread module is not present.
Suggested usage is::
try:
import thread
except ImportError:
import dummy_thread as thread
"""
# Exports only things specified by thread documentation;
# skipping obsolete synonyms allocate(), start_new(), exit_thread().
__all__ = ['error', 'start_new_thread', 'exit', 'get_ident', 'allocate_lock',
'interrupt_main', 'LockType']
import traceback as _traceback
class error(Exception):
"""Dummy implementation of thread.error."""
def __init__(self, *args):
self.args = args
def start_new_thread(function, args, kwargs={}):
"""Dummy implementation of thread.start_new_thread().
Compatibility is maintained by making sure that ``args`` is a
tuple and ``kwargs`` is a dictionary. If an exception is raised
and it is SystemExit (which can be done by thread.exit()) it is
caught and nothing is done; all other exceptions are printed out
by using traceback.print_exc().
If the executed function calls interrupt_main the KeyboardInterrupt will be
raised when the function returns.
"""
if type(args) != type(tuple()):
raise TypeError("2nd arg must be a tuple")
if type(kwargs) != type(dict()):
raise TypeError("3rd arg must be a dict")
global _main
_main = False
try:
function(*args, **kwargs)
except SystemExit:
pass
except:
_traceback.print_exc()
_main = True
global _interrupt
if _interrupt:
_interrupt = False
raise KeyboardInterrupt
def exit():
"""Dummy implementation of thread.exit()."""
raise SystemExit
def get_ident():
"""Dummy implementation of thread.get_ident().
Since this module should only be used when threadmodule is not
available, it is safe to assume that the current process is the
only thread. Thus a constant can be safely returned.
"""
return -1
def allocate_lock():
"""Dummy implementation of thread.allocate_lock()."""
return LockType()
def stack_size(size=None):
"""Dummy implementation of thread.stack_size()."""
if size is not None:
raise error("setting thread stack size not supported")
return 0
class LockType(object):
"""Class implementing dummy implementation of thread.LockType.
Compatibility is maintained by maintaining self.locked_status
which is a boolean that stores the state of the lock. Pickling of
the lock, though, should not be done since if the thread module is
then used with an unpickled ``lock()`` from here problems could
occur from this class not having atomic methods.
"""
def __init__(self):
self.locked_status = False
def acquire(self, waitflag=None):
"""Dummy implementation of acquire().
For blocking calls, self.locked_status is automatically set to
True and returned appropriately based on value of
``waitflag``. If it is non-blocking, then the value is
actually checked and not set if it is already acquired. This
is all done so that threading.Condition's assert statements
aren't triggered and throw a little fit.
"""
if waitflag is None or waitflag:
self.locked_status = True
return True
else:
if not self.locked_status:
self.locked_status = True
return True
else:
return False
__enter__ = acquire
def __exit__(self, typ, val, tb):
self.release()
def release(self):
"""Release the dummy lock."""
# XXX Perhaps shouldn't actually bother to test? Could lead
# to problems for complex, threaded code.
if not self.locked_status:
raise error
self.locked_status = False
return True
def locked(self):
return self.locked_status
# Used to signal that interrupt_main was called in a "thread"
_interrupt = False
# True when not executing in a "thread"
_main = True
def interrupt_main():
"""Set _interrupt flag to True to have start_new_thread raise
KeyboardInterrupt upon exiting."""
if _main:
raise KeyboardInterrupt
else:
global _interrupt
_interrupt = True
| Python |
#
# XML-RPC CLIENT LIBRARY
# $Id$
#
# an XML-RPC client interface for Python.
#
# the marshalling and response parser code can also be used to
# implement XML-RPC servers.
#
# Notes:
# this version is designed to work with Python 2.1 or newer.
#
# History:
# 1999-01-14 fl Created
# 1999-01-15 fl Changed dateTime to use localtime
# 1999-01-16 fl Added Binary/base64 element, default to RPC2 service
# 1999-01-19 fl Fixed array data element (from Skip Montanaro)
# 1999-01-21 fl Fixed dateTime constructor, etc.
# 1999-02-02 fl Added fault handling, handle empty sequences, etc.
# 1999-02-10 fl Fixed problem with empty responses (from Skip Montanaro)
# 1999-06-20 fl Speed improvements, pluggable parsers/transports (0.9.8)
# 2000-11-28 fl Changed boolean to check the truth value of its argument
# 2001-02-24 fl Added encoding/Unicode/SafeTransport patches
# 2001-02-26 fl Added compare support to wrappers (0.9.9/1.0b1)
# 2001-03-28 fl Make sure response tuple is a singleton
# 2001-03-29 fl Don't require empty params element (from Nicholas Riley)
# 2001-06-10 fl Folded in _xmlrpclib accelerator support (1.0b2)
# 2001-08-20 fl Base xmlrpclib.Error on built-in Exception (from Paul Prescod)
# 2001-09-03 fl Allow Transport subclass to override getparser
# 2001-09-10 fl Lazy import of urllib, cgi, xmllib (20x import speedup)
# 2001-10-01 fl Remove containers from memo cache when done with them
# 2001-10-01 fl Use faster escape method (80% dumps speedup)
# 2001-10-02 fl More dumps microtuning
# 2001-10-04 fl Make sure import expat gets a parser (from Guido van Rossum)
# 2001-10-10 sm Allow long ints to be passed as ints if they don't overflow
# 2001-10-17 sm Test for int and long overflow (allows use on 64-bit systems)
# 2001-11-12 fl Use repr() to marshal doubles (from Paul Felix)
# 2002-03-17 fl Avoid buffered read when possible (from James Rucker)
# 2002-04-07 fl Added pythondoc comments
# 2002-04-16 fl Added __str__ methods to datetime/binary wrappers
# 2002-05-15 fl Added error constants (from Andrew Kuchling)
# 2002-06-27 fl Merged with Python CVS version
# 2002-10-22 fl Added basic authentication (based on code from Phillip Eby)
# 2003-01-22 sm Add support for the bool type
# 2003-02-27 gvr Remove apply calls
# 2003-04-24 sm Use cStringIO if available
# 2003-04-25 ak Add support for nil
# 2003-06-15 gn Add support for time.struct_time
# 2003-07-12 gp Correct marshalling of Faults
# 2003-10-31 mvl Add multicall support
# 2004-08-20 mvl Bump minimum supported Python version to 2.1
#
# Copyright (c) 1999-2002 by Secret Labs AB.
# Copyright (c) 1999-2002 by Fredrik Lundh.
#
# info@pythonware.com
# http://www.pythonware.com
#
# --------------------------------------------------------------------
# The XML-RPC client interface is
#
# Copyright (c) 1999-2002 by Secret Labs AB
# Copyright (c) 1999-2002 by Fredrik Lundh
#
# By obtaining, using, and/or copying this software and/or its
# associated documentation, you agree that you have read, understood,
# and will comply with the following terms and conditions:
#
# Permission to use, copy, modify, and distribute this software and
# its associated documentation for any purpose and without fee is
# hereby granted, provided that the above copyright notice appears in
# all copies, and that both that copyright notice and this permission
# notice appear in supporting documentation, and that the name of
# Secret Labs AB or the author not be used in advertising or publicity
# pertaining to distribution of the software without specific, written
# prior permission.
#
# SECRET LABS AB AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD
# TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANT-
# ABILITY AND FITNESS. IN NO EVENT SHALL SECRET LABS AB OR THE AUTHOR
# BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY
# DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS,
# WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS
# ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE
# OF THIS SOFTWARE.
# --------------------------------------------------------------------
#
# things to look into some day:
# TODO: sort out True/False/boolean issues for Python 2.3
"""
An XML-RPC client interface for Python.
The marshalling and response parser code can also be used to
implement XML-RPC servers.
Exported exceptions:
Error Base class for client errors
ProtocolError Indicates an HTTP protocol error
ResponseError Indicates a broken response package
Fault Indicates an XML-RPC fault package
Exported classes:
ServerProxy Represents a logical connection to an XML-RPC server
MultiCall Executor of boxcared xmlrpc requests
Boolean boolean wrapper to generate a "boolean" XML-RPC value
DateTime dateTime wrapper for an ISO 8601 string or time tuple or
localtime integer value to generate a "dateTime.iso8601"
XML-RPC value
Binary binary data wrapper
SlowParser Slow but safe standard parser (based on xmllib)
Marshaller Generate an XML-RPC params chunk from a Python data structure
Unmarshaller Unmarshal an XML-RPC response from incoming XML event message
Transport Handles an HTTP transaction to an XML-RPC server
SafeTransport Handles an HTTPS transaction to an XML-RPC server
Exported constants:
True
False
Exported functions:
boolean Convert any Python value to an XML-RPC boolean
getparser Create instance of the fastest available parser & attach
to an unmarshalling object
dumps Convert an argument tuple or a Fault instance to an XML-RPC
request (or response, if the methodresponse option is used).
loads Convert an XML-RPC packet to unmarshalled data plus a method
name (None if not present).
"""
import re, string, time, operator
from types import *
import socket
import errno
import httplib
try:
import gzip
except ImportError:
gzip = None #python can be built without zlib/gzip support
# --------------------------------------------------------------------
# Internal stuff
try:
unicode
except NameError:
unicode = None # unicode support not available
try:
import datetime
except ImportError:
datetime = None
try:
_bool_is_builtin = False.__class__.__name__ == "bool"
except NameError:
_bool_is_builtin = 0
def _decode(data, encoding, is8bit=re.compile("[\x80-\xff]").search):
# decode non-ascii string (if possible)
if unicode and encoding and is8bit(data):
data = unicode(data, encoding)
return data
def escape(s, replace=string.replace):
s = replace(s, "&", "&")
s = replace(s, "<", "<")
return replace(s, ">", ">",)
if unicode:
def _stringify(string):
# convert to 7-bit ascii if possible
try:
return string.encode("ascii")
except UnicodeError:
return string
else:
def _stringify(string):
return string
__version__ = "1.0.1"
# xmlrpc integer limits
MAXINT = 2L**31-1
MININT = -2L**31
# --------------------------------------------------------------------
# Error constants (from Dan Libby's specification at
# http://xmlrpc-epi.sourceforge.net/specs/rfc.fault_codes.php)
# Ranges of errors
PARSE_ERROR = -32700
SERVER_ERROR = -32600
APPLICATION_ERROR = -32500
SYSTEM_ERROR = -32400
TRANSPORT_ERROR = -32300
# Specific errors
NOT_WELLFORMED_ERROR = -32700
UNSUPPORTED_ENCODING = -32701
INVALID_ENCODING_CHAR = -32702
INVALID_XMLRPC = -32600
METHOD_NOT_FOUND = -32601
INVALID_METHOD_PARAMS = -32602
INTERNAL_ERROR = -32603
# --------------------------------------------------------------------
# Exceptions
##
# Base class for all kinds of client-side errors.
class Error(Exception):
"""Base class for client errors."""
def __str__(self):
return repr(self)
##
# Indicates an HTTP-level protocol error. This is raised by the HTTP
# transport layer, if the server returns an error code other than 200
# (OK).
#
# @param url The target URL.
# @param errcode The HTTP error code.
# @param errmsg The HTTP error message.
# @param headers The HTTP header dictionary.
class ProtocolError(Error):
"""Indicates an HTTP protocol error."""
def __init__(self, url, errcode, errmsg, headers):
Error.__init__(self)
self.url = url
self.errcode = errcode
self.errmsg = errmsg
self.headers = headers
def __repr__(self):
return (
"<ProtocolError for %s: %s %s>" %
(self.url, self.errcode, self.errmsg)
)
##
# Indicates a broken XML-RPC response package. This exception is
# raised by the unmarshalling layer, if the XML-RPC response is
# malformed.
class ResponseError(Error):
"""Indicates a broken response package."""
pass
##
# Indicates an XML-RPC fault response package. This exception is
# raised by the unmarshalling layer, if the XML-RPC response contains
# a fault string. This exception can also used as a class, to
# generate a fault XML-RPC message.
#
# @param faultCode The XML-RPC fault code.
# @param faultString The XML-RPC fault string.
class Fault(Error):
"""Indicates an XML-RPC fault package."""
def __init__(self, faultCode, faultString, **extra):
Error.__init__(self)
self.faultCode = faultCode
self.faultString = faultString
def __repr__(self):
return (
"<Fault %s: %s>" %
(self.faultCode, repr(self.faultString))
)
# --------------------------------------------------------------------
# Special values
##
# Wrapper for XML-RPC boolean values. Use the xmlrpclib.True and
# xmlrpclib.False constants, or the xmlrpclib.boolean() function, to
# generate boolean XML-RPC values.
#
# @param value A boolean value. Any true value is interpreted as True,
# all other values are interpreted as False.
from sys import modules
mod_dict = modules[__name__].__dict__
if _bool_is_builtin:
boolean = Boolean = bool
# to avoid breaking code which references xmlrpclib.{True,False}
mod_dict['True'] = True
mod_dict['False'] = False
else:
class Boolean:
"""Boolean-value wrapper.
Use True or False to generate a "boolean" XML-RPC value.
"""
def __init__(self, value = 0):
self.value = operator.truth(value)
def encode(self, out):
out.write("<value><boolean>%d</boolean></value>\n" % self.value)
def __cmp__(self, other):
if isinstance(other, Boolean):
other = other.value
return cmp(self.value, other)
def __repr__(self):
if self.value:
return "<Boolean True at %x>" % id(self)
else:
return "<Boolean False at %x>" % id(self)
def __int__(self):
return self.value
def __nonzero__(self):
return self.value
mod_dict['True'] = Boolean(1)
mod_dict['False'] = Boolean(0)
##
# Map true or false value to XML-RPC boolean values.
#
# @def boolean(value)
# @param value A boolean value. Any true value is mapped to True,
# all other values are mapped to False.
# @return xmlrpclib.True or xmlrpclib.False.
# @see Boolean
# @see True
# @see False
def boolean(value, _truefalse=(False, True)):
"""Convert any Python value to XML-RPC 'boolean'."""
return _truefalse[operator.truth(value)]
del modules, mod_dict
##
# Wrapper for XML-RPC DateTime values. This converts a time value to
# the format used by XML-RPC.
# <p>
# The value can be given as a string in the format
# "yyyymmddThh:mm:ss", as a 9-item time tuple (as returned by
# time.localtime()), or an integer value (as returned by time.time()).
# The wrapper uses time.localtime() to convert an integer to a time
# tuple.
#
# @param value The time, given as an ISO 8601 string, a time
# tuple, or a integer time value.
def _strftime(value):
if datetime:
if isinstance(value, datetime.datetime):
return "%04d%02d%02dT%02d:%02d:%02d" % (
value.year, value.month, value.day,
value.hour, value.minute, value.second)
if not isinstance(value, (TupleType, time.struct_time)):
if value == 0:
value = time.time()
value = time.localtime(value)
return "%04d%02d%02dT%02d:%02d:%02d" % value[:6]
class DateTime:
"""DateTime wrapper for an ISO 8601 string or time tuple or
localtime integer value to generate 'dateTime.iso8601' XML-RPC
value.
"""
def __init__(self, value=0):
if isinstance(value, StringType):
self.value = value
else:
self.value = _strftime(value)
def make_comparable(self, other):
if isinstance(other, DateTime):
s = self.value
o = other.value
elif datetime and isinstance(other, datetime.datetime):
s = self.value
o = other.strftime("%Y%m%dT%H:%M:%S")
elif isinstance(other, (str, unicode)):
s = self.value
o = other
elif hasattr(other, "timetuple"):
s = self.timetuple()
o = other.timetuple()
else:
otype = (hasattr(other, "__class__")
and other.__class__.__name__
or type(other))
raise TypeError("Can't compare %s and %s" %
(self.__class__.__name__, otype))
return s, o
def __lt__(self, other):
s, o = self.make_comparable(other)
return s < o
def __le__(self, other):
s, o = self.make_comparable(other)
return s <= o
def __gt__(self, other):
s, o = self.make_comparable(other)
return s > o
def __ge__(self, other):
s, o = self.make_comparable(other)
return s >= o
def __eq__(self, other):
s, o = self.make_comparable(other)
return s == o
def __ne__(self, other):
s, o = self.make_comparable(other)
return s != o
def timetuple(self):
return time.strptime(self.value, "%Y%m%dT%H:%M:%S")
def __cmp__(self, other):
s, o = self.make_comparable(other)
return cmp(s, o)
##
# Get date/time value.
#
# @return Date/time value, as an ISO 8601 string.
def __str__(self):
return self.value
def __repr__(self):
return "<DateTime %s at %x>" % (repr(self.value), id(self))
def decode(self, data):
data = str(data)
self.value = string.strip(data)
def encode(self, out):
out.write("<value><dateTime.iso8601>")
out.write(self.value)
out.write("</dateTime.iso8601></value>\n")
def _datetime(data):
# decode xml element contents into a DateTime structure.
value = DateTime()
value.decode(data)
return value
def _datetime_type(data):
t = time.strptime(data, "%Y%m%dT%H:%M:%S")
return datetime.datetime(*tuple(t)[:6])
##
# Wrapper for binary data. This can be used to transport any kind
# of binary data over XML-RPC, using BASE64 encoding.
#
# @param data An 8-bit string containing arbitrary data.
import base64
try:
import cStringIO as StringIO
except ImportError:
import StringIO
class Binary:
"""Wrapper for binary data."""
def __init__(self, data=None):
self.data = data
##
# Get buffer contents.
#
# @return Buffer contents, as an 8-bit string.
def __str__(self):
return self.data or ""
def __cmp__(self, other):
if isinstance(other, Binary):
other = other.data
return cmp(self.data, other)
def decode(self, data):
self.data = base64.decodestring(data)
def encode(self, out):
out.write("<value><base64>\n")
base64.encode(StringIO.StringIO(self.data), out)
out.write("</base64></value>\n")
def _binary(data):
# decode xml element contents into a Binary structure
value = Binary()
value.decode(data)
return value
WRAPPERS = (DateTime, Binary)
if not _bool_is_builtin:
WRAPPERS = WRAPPERS + (Boolean,)
# --------------------------------------------------------------------
# XML parsers
try:
# optional xmlrpclib accelerator
import _xmlrpclib
FastParser = _xmlrpclib.Parser
FastUnmarshaller = _xmlrpclib.Unmarshaller
except (AttributeError, ImportError):
FastParser = FastUnmarshaller = None
try:
import _xmlrpclib
FastMarshaller = _xmlrpclib.Marshaller
except (AttributeError, ImportError):
FastMarshaller = None
try:
from xml.parsers import expat
if not hasattr(expat, "ParserCreate"):
raise ImportError
except ImportError:
ExpatParser = None # expat not available
else:
class ExpatParser:
# fast expat parser for Python 2.0 and later.
def __init__(self, target):
self._parser = parser = expat.ParserCreate(None, None)
self._target = target
parser.StartElementHandler = target.start
parser.EndElementHandler = target.end
parser.CharacterDataHandler = target.data
encoding = None
if not parser.returns_unicode:
encoding = "utf-8"
target.xml(encoding, None)
def feed(self, data):
self._parser.Parse(data, 0)
def close(self):
self._parser.Parse("", 1) # end of data
del self._target, self._parser # get rid of circular references
class SlowParser:
"""Default XML parser (based on xmllib.XMLParser)."""
# this is the slowest parser.
def __init__(self, target):
import xmllib # lazy subclassing (!)
if xmllib.XMLParser not in SlowParser.__bases__:
SlowParser.__bases__ = (xmllib.XMLParser,)
self.handle_xml = target.xml
self.unknown_starttag = target.start
self.handle_data = target.data
self.handle_cdata = target.data
self.unknown_endtag = target.end
try:
xmllib.XMLParser.__init__(self, accept_utf8=1)
except TypeError:
xmllib.XMLParser.__init__(self) # pre-2.0
# --------------------------------------------------------------------
# XML-RPC marshalling and unmarshalling code
##
# XML-RPC marshaller.
#
# @param encoding Default encoding for 8-bit strings. The default
# value is None (interpreted as UTF-8).
# @see dumps
class Marshaller:
"""Generate an XML-RPC params chunk from a Python data structure.
Create a Marshaller instance for each set of parameters, and use
the "dumps" method to convert your data (represented as a tuple)
to an XML-RPC params chunk. To write a fault response, pass a
Fault instance instead. You may prefer to use the "dumps" module
function for this purpose.
"""
# by the way, if you don't understand what's going on in here,
# that's perfectly ok.
def __init__(self, encoding=None, allow_none=0):
self.memo = {}
self.data = None
self.encoding = encoding
self.allow_none = allow_none
dispatch = {}
def dumps(self, values):
out = []
write = out.append
dump = self.__dump
if isinstance(values, Fault):
# fault instance
write("<fault>\n")
dump({'faultCode': values.faultCode,
'faultString': values.faultString},
write)
write("</fault>\n")
else:
# parameter block
# FIXME: the xml-rpc specification allows us to leave out
# the entire <params> block if there are no parameters.
# however, changing this may break older code (including
# old versions of xmlrpclib.py), so this is better left as
# is for now. See @XMLRPC3 for more information. /F
write("<params>\n")
for v in values:
write("<param>\n")
dump(v, write)
write("</param>\n")
write("</params>\n")
result = string.join(out, "")
return result
def __dump(self, value, write):
try:
f = self.dispatch[type(value)]
except KeyError:
# check if this object can be marshalled as a structure
try:
value.__dict__
except:
raise TypeError, "cannot marshal %s objects" % type(value)
# check if this class is a sub-class of a basic type,
# because we don't know how to marshal these types
# (e.g. a string sub-class)
for type_ in type(value).__mro__:
if type_ in self.dispatch.keys():
raise TypeError, "cannot marshal %s objects" % type(value)
f = self.dispatch[InstanceType]
f(self, value, write)
def dump_nil (self, value, write):
if not self.allow_none:
raise TypeError, "cannot marshal None unless allow_none is enabled"
write("<value><nil/></value>")
dispatch[NoneType] = dump_nil
def dump_int(self, value, write):
# in case ints are > 32 bits
if value > MAXINT or value < MININT:
raise OverflowError, "int exceeds XML-RPC limits"
write("<value><int>")
write(str(value))
write("</int></value>\n")
dispatch[IntType] = dump_int
if _bool_is_builtin:
def dump_bool(self, value, write):
write("<value><boolean>")
write(value and "1" or "0")
write("</boolean></value>\n")
dispatch[bool] = dump_bool
def dump_long(self, value, write):
if value > MAXINT or value < MININT:
raise OverflowError, "long int exceeds XML-RPC limits"
write("<value><int>")
write(str(int(value)))
write("</int></value>\n")
dispatch[LongType] = dump_long
def dump_double(self, value, write):
write("<value><double>")
write(repr(value))
write("</double></value>\n")
dispatch[FloatType] = dump_double
def dump_string(self, value, write, escape=escape):
write("<value><string>")
write(escape(value))
write("</string></value>\n")
dispatch[StringType] = dump_string
if unicode:
def dump_unicode(self, value, write, escape=escape):
value = value.encode(self.encoding)
write("<value><string>")
write(escape(value))
write("</string></value>\n")
dispatch[UnicodeType] = dump_unicode
def dump_array(self, value, write):
i = id(value)
if i in self.memo:
raise TypeError, "cannot marshal recursive sequences"
self.memo[i] = None
dump = self.__dump
write("<value><array><data>\n")
for v in value:
dump(v, write)
write("</data></array></value>\n")
del self.memo[i]
dispatch[TupleType] = dump_array
dispatch[ListType] = dump_array
def dump_struct(self, value, write, escape=escape):
i = id(value)
if i in self.memo:
raise TypeError, "cannot marshal recursive dictionaries"
self.memo[i] = None
dump = self.__dump
write("<value><struct>\n")
for k, v in value.items():
write("<member>\n")
if type(k) is not StringType:
if unicode and type(k) is UnicodeType:
k = k.encode(self.encoding)
else:
raise TypeError, "dictionary key must be string"
write("<name>%s</name>\n" % escape(k))
dump(v, write)
write("</member>\n")
write("</struct></value>\n")
del self.memo[i]
dispatch[DictType] = dump_struct
if datetime:
def dump_datetime(self, value, write):
write("<value><dateTime.iso8601>")
write(_strftime(value))
write("</dateTime.iso8601></value>\n")
dispatch[datetime.datetime] = dump_datetime
def dump_instance(self, value, write):
# check for special wrappers
if value.__class__ in WRAPPERS:
self.write = write
value.encode(self)
del self.write
else:
# store instance attributes as a struct (really?)
self.dump_struct(value.__dict__, write)
dispatch[InstanceType] = dump_instance
##
# XML-RPC unmarshaller.
#
# @see loads
class Unmarshaller:
"""Unmarshal an XML-RPC response, based on incoming XML event
messages (start, data, end). Call close() to get the resulting
data structure.
Note that this reader is fairly tolerant, and gladly accepts bogus
XML-RPC data without complaining (but not bogus XML).
"""
# and again, if you don't understand what's going on in here,
# that's perfectly ok.
def __init__(self, use_datetime=0):
self._type = None
self._stack = []
self._marks = []
self._data = []
self._methodname = None
self._encoding = "utf-8"
self.append = self._stack.append
self._use_datetime = use_datetime
if use_datetime and not datetime:
raise ValueError, "the datetime module is not available"
def close(self):
# return response tuple and target method
if self._type is None or self._marks:
raise ResponseError()
if self._type == "fault":
raise Fault(**self._stack[0])
return tuple(self._stack)
def getmethodname(self):
return self._methodname
#
# event handlers
def xml(self, encoding, standalone):
self._encoding = encoding
# FIXME: assert standalone == 1 ???
def start(self, tag, attrs):
# prepare to handle this element
if tag == "array" or tag == "struct":
self._marks.append(len(self._stack))
self._data = []
self._value = (tag == "value")
def data(self, text):
self._data.append(text)
def end(self, tag, join=string.join):
# call the appropriate end tag handler
try:
f = self.dispatch[tag]
except KeyError:
pass # unknown tag ?
else:
return f(self, join(self._data, ""))
#
# accelerator support
def end_dispatch(self, tag, data):
# dispatch data
try:
f = self.dispatch[tag]
except KeyError:
pass # unknown tag ?
else:
return f(self, data)
#
# element decoders
dispatch = {}
def end_nil (self, data):
self.append(None)
self._value = 0
dispatch["nil"] = end_nil
def end_boolean(self, data):
if data == "0":
self.append(False)
elif data == "1":
self.append(True)
else:
raise TypeError, "bad boolean value"
self._value = 0
dispatch["boolean"] = end_boolean
def end_int(self, data):
self.append(int(data))
self._value = 0
dispatch["i4"] = end_int
dispatch["i8"] = end_int
dispatch["int"] = end_int
def end_double(self, data):
self.append(float(data))
self._value = 0
dispatch["double"] = end_double
def end_string(self, data):
if self._encoding:
data = _decode(data, self._encoding)
self.append(_stringify(data))
self._value = 0
dispatch["string"] = end_string
dispatch["name"] = end_string # struct keys are always strings
def end_array(self, data):
mark = self._marks.pop()
# map arrays to Python lists
self._stack[mark:] = [self._stack[mark:]]
self._value = 0
dispatch["array"] = end_array
def end_struct(self, data):
mark = self._marks.pop()
# map structs to Python dictionaries
dict = {}
items = self._stack[mark:]
for i in range(0, len(items), 2):
dict[_stringify(items[i])] = items[i+1]
self._stack[mark:] = [dict]
self._value = 0
dispatch["struct"] = end_struct
def end_base64(self, data):
value = Binary()
value.decode(data)
self.append(value)
self._value = 0
dispatch["base64"] = end_base64
def end_dateTime(self, data):
value = DateTime()
value.decode(data)
if self._use_datetime:
value = _datetime_type(data)
self.append(value)
dispatch["dateTime.iso8601"] = end_dateTime
def end_value(self, data):
# if we stumble upon a value element with no internal
# elements, treat it as a string element
if self._value:
self.end_string(data)
dispatch["value"] = end_value
def end_params(self, data):
self._type = "params"
dispatch["params"] = end_params
def end_fault(self, data):
self._type = "fault"
dispatch["fault"] = end_fault
def end_methodName(self, data):
if self._encoding:
data = _decode(data, self._encoding)
self._methodname = data
self._type = "methodName" # no params
dispatch["methodName"] = end_methodName
## Multicall support
#
class _MultiCallMethod:
# some lesser magic to store calls made to a MultiCall object
# for batch execution
def __init__(self, call_list, name):
self.__call_list = call_list
self.__name = name
def __getattr__(self, name):
return _MultiCallMethod(self.__call_list, "%s.%s" % (self.__name, name))
def __call__(self, *args):
self.__call_list.append((self.__name, args))
class MultiCallIterator:
"""Iterates over the results of a multicall. Exceptions are
thrown in response to xmlrpc faults."""
def __init__(self, results):
self.results = results
def __getitem__(self, i):
item = self.results[i]
if type(item) == type({}):
raise Fault(item['faultCode'], item['faultString'])
elif type(item) == type([]):
return item[0]
else:
raise ValueError,\
"unexpected type in multicall result"
class MultiCall:
"""server -> a object used to boxcar method calls
server should be a ServerProxy object.
Methods can be added to the MultiCall using normal
method call syntax e.g.:
multicall = MultiCall(server_proxy)
multicall.add(2,3)
multicall.get_address("Guido")
To execute the multicall, call the MultiCall object e.g.:
add_result, address = multicall()
"""
def __init__(self, server):
self.__server = server
self.__call_list = []
def __repr__(self):
return "<MultiCall at %x>" % id(self)
__str__ = __repr__
def __getattr__(self, name):
return _MultiCallMethod(self.__call_list, name)
def __call__(self):
marshalled_list = []
for name, args in self.__call_list:
marshalled_list.append({'methodName' : name, 'params' : args})
return MultiCallIterator(self.__server.system.multicall(marshalled_list))
# --------------------------------------------------------------------
# convenience functions
##
# Create a parser object, and connect it to an unmarshalling instance.
# This function picks the fastest available XML parser.
#
# return A (parser, unmarshaller) tuple.
def getparser(use_datetime=0):
"""getparser() -> parser, unmarshaller
Create an instance of the fastest available parser, and attach it
to an unmarshalling object. Return both objects.
"""
if use_datetime and not datetime:
raise ValueError, "the datetime module is not available"
if FastParser and FastUnmarshaller:
if use_datetime:
mkdatetime = _datetime_type
else:
mkdatetime = _datetime
target = FastUnmarshaller(True, False, _binary, mkdatetime, Fault)
parser = FastParser(target)
else:
target = Unmarshaller(use_datetime=use_datetime)
if FastParser:
parser = FastParser(target)
elif ExpatParser:
parser = ExpatParser(target)
else:
parser = SlowParser(target)
return parser, target
##
# Convert a Python tuple or a Fault instance to an XML-RPC packet.
#
# @def dumps(params, **options)
# @param params A tuple or Fault instance.
# @keyparam methodname If given, create a methodCall request for
# this method name.
# @keyparam methodresponse If given, create a methodResponse packet.
# If used with a tuple, the tuple must be a singleton (that is,
# it must contain exactly one element).
# @keyparam encoding The packet encoding.
# @return A string containing marshalled data.
def dumps(params, methodname=None, methodresponse=None, encoding=None,
allow_none=0):
"""data [,options] -> marshalled data
Convert an argument tuple or a Fault instance to an XML-RPC
request (or response, if the methodresponse option is used).
In addition to the data object, the following options can be given
as keyword arguments:
methodname: the method name for a methodCall packet
methodresponse: true to create a methodResponse packet.
If this option is used with a tuple, the tuple must be
a singleton (i.e. it can contain only one element).
encoding: the packet encoding (default is UTF-8)
All 8-bit strings in the data structure are assumed to use the
packet encoding. Unicode strings are automatically converted,
where necessary.
"""
assert isinstance(params, TupleType) or isinstance(params, Fault),\
"argument must be tuple or Fault instance"
if isinstance(params, Fault):
methodresponse = 1
elif methodresponse and isinstance(params, TupleType):
assert len(params) == 1, "response tuple must be a singleton"
if not encoding:
encoding = "utf-8"
if FastMarshaller:
m = FastMarshaller(encoding)
else:
m = Marshaller(encoding, allow_none)
data = m.dumps(params)
if encoding != "utf-8":
xmlheader = "<?xml version='1.0' encoding='%s'?>\n" % str(encoding)
else:
xmlheader = "<?xml version='1.0'?>\n" # utf-8 is default
# standard XML-RPC wrappings
if methodname:
# a method call
if not isinstance(methodname, StringType):
methodname = methodname.encode(encoding)
data = (
xmlheader,
"<methodCall>\n"
"<methodName>", methodname, "</methodName>\n",
data,
"</methodCall>\n"
)
elif methodresponse:
# a method response, or a fault structure
data = (
xmlheader,
"<methodResponse>\n",
data,
"</methodResponse>\n"
)
else:
return data # return as is
return string.join(data, "")
##
# Convert an XML-RPC packet to a Python object. If the XML-RPC packet
# represents a fault condition, this function raises a Fault exception.
#
# @param data An XML-RPC packet, given as an 8-bit string.
# @return A tuple containing the unpacked data, and the method name
# (None if not present).
# @see Fault
def loads(data, use_datetime=0):
"""data -> unmarshalled data, method name
Convert an XML-RPC packet to unmarshalled data plus a method
name (None if not present).
If the XML-RPC packet represents a fault condition, this function
raises a Fault exception.
"""
p, u = getparser(use_datetime=use_datetime)
p.feed(data)
p.close()
return u.close(), u.getmethodname()
##
# Encode a string using the gzip content encoding such as specified by the
# Content-Encoding: gzip
# in the HTTP header, as described in RFC 1952
#
# @param data the unencoded data
# @return the encoded data
def gzip_encode(data):
"""data -> gzip encoded data
Encode data using the gzip content encoding as described in RFC 1952
"""
if not gzip:
raise NotImplementedError
f = StringIO.StringIO()
gzf = gzip.GzipFile(mode="wb", fileobj=f, compresslevel=1)
gzf.write(data)
gzf.close()
encoded = f.getvalue()
f.close()
return encoded
##
# Decode a string using the gzip content encoding such as specified by the
# Content-Encoding: gzip
# in the HTTP header, as described in RFC 1952
#
# @param data The encoded data
# @return the unencoded data
# @raises ValueError if data is not correctly coded.
def gzip_decode(data):
"""gzip encoded data -> unencoded data
Decode data using the gzip content encoding as described in RFC 1952
"""
if not gzip:
raise NotImplementedError
f = StringIO.StringIO(data)
gzf = gzip.GzipFile(mode="rb", fileobj=f)
try:
decoded = gzf.read()
except IOError:
raise ValueError("invalid data")
f.close()
gzf.close()
return decoded
##
# Return a decoded file-like object for the gzip encoding
# as described in RFC 1952.
#
# @param response A stream supporting a read() method
# @return a file-like object that the decoded data can be read() from
class GzipDecodedResponse(gzip.GzipFile if gzip else object):
"""a file-like object to decode a response encoded with the gzip
method, as described in RFC 1952.
"""
def __init__(self, response):
#response doesn't support tell() and read(), required by
#GzipFile
if not gzip:
raise NotImplementedError
self.stringio = StringIO.StringIO(response.read())
gzip.GzipFile.__init__(self, mode="rb", fileobj=self.stringio)
def close(self):
gzip.GzipFile.close(self)
self.stringio.close()
# --------------------------------------------------------------------
# request dispatcher
class _Method:
# some magic to bind an XML-RPC method to an RPC server.
# supports "nested" methods (e.g. examples.getStateName)
def __init__(self, send, name):
self.__send = send
self.__name = name
def __getattr__(self, name):
return _Method(self.__send, "%s.%s" % (self.__name, name))
def __call__(self, *args):
return self.__send(self.__name, args)
##
# Standard transport class for XML-RPC over HTTP.
# <p>
# You can create custom transports by subclassing this method, and
# overriding selected methods.
class Transport:
"""Handles an HTTP transaction to an XML-RPC server."""
# client identifier (may be overridden)
user_agent = "xmlrpclib.py/%s (by www.pythonware.com)" % __version__
#if true, we'll request gzip encoding
accept_gzip_encoding = True
# if positive, encode request using gzip if it exceeds this threshold
# note that many server will get confused, so only use it if you know
# that they can decode such a request
encode_threshold = None #None = don't encode
def __init__(self, use_datetime=0):
self._use_datetime = use_datetime
self._connection = (None, None)
self._extra_headers = []
##
# Send a complete request, and parse the response.
# Retry request if a cached connection has disconnected.
#
# @param host Target host.
# @param handler Target PRC handler.
# @param request_body XML-RPC request body.
# @param verbose Debugging flag.
# @return Parsed response.
def request(self, host, handler, request_body, verbose=0):
#retry request once if cached connection has gone cold
for i in (0, 1):
try:
return self.single_request(host, handler, request_body, verbose)
except socket.error, e:
if i or e.errno not in (errno.ECONNRESET, errno.ECONNABORTED, errno.EPIPE):
raise
except httplib.BadStatusLine: #close after we sent request
if i:
raise
##
# Send a complete request, and parse the response.
#
# @param host Target host.
# @param handler Target PRC handler.
# @param request_body XML-RPC request body.
# @param verbose Debugging flag.
# @return Parsed response.
def single_request(self, host, handler, request_body, verbose=0):
# issue XML-RPC request
h = self.make_connection(host)
if verbose:
h.set_debuglevel(1)
try:
self.send_request(h, handler, request_body)
self.send_host(h, host)
self.send_user_agent(h)
self.send_content(h, request_body)
response = h.getresponse(buffering=True)
if response.status == 200:
self.verbose = verbose
return self.parse_response(response)
except Fault:
raise
except Exception:
# All unexpected errors leave connection in
# a strange state, so we clear it.
self.close()
raise
#discard any response data and raise exception
if (response.getheader("content-length", 0)):
response.read()
raise ProtocolError(
host + handler,
response.status, response.reason,
response.msg,
)
##
# Create parser.
#
# @return A 2-tuple containing a parser and a unmarshaller.
def getparser(self):
# get parser and unmarshaller
return getparser(use_datetime=self._use_datetime)
##
# Get authorization info from host parameter
# Host may be a string, or a (host, x509-dict) tuple; if a string,
# it is checked for a "user:pw@host" format, and a "Basic
# Authentication" header is added if appropriate.
#
# @param host Host descriptor (URL or (URL, x509 info) tuple).
# @return A 3-tuple containing (actual host, extra headers,
# x509 info). The header and x509 fields may be None.
def get_host_info(self, host):
x509 = {}
if isinstance(host, TupleType):
host, x509 = host
import urllib
auth, host = urllib.splituser(host)
if auth:
import base64
auth = base64.encodestring(urllib.unquote(auth))
auth = string.join(string.split(auth), "") # get rid of whitespace
extra_headers = [
("Authorization", "Basic " + auth)
]
else:
extra_headers = None
return host, extra_headers, x509
##
# Connect to server.
#
# @param host Target host.
# @return A connection handle.
def make_connection(self, host):
#return an existing connection if possible. This allows
#HTTP/1.1 keep-alive.
if self._connection and host == self._connection[0]:
return self._connection[1]
# create a HTTP connection object from a host descriptor
chost, self._extra_headers, x509 = self.get_host_info(host)
#store the host argument along with the connection object
self._connection = host, httplib.HTTPConnection(chost)
return self._connection[1]
##
# Clear any cached connection object.
# Used in the event of socket errors.
#
def close(self):
if self._connection[1]:
self._connection[1].close()
self._connection = (None, None)
##
# Send request header.
#
# @param connection Connection handle.
# @param handler Target RPC handler.
# @param request_body XML-RPC body.
def send_request(self, connection, handler, request_body):
if (self.accept_gzip_encoding and gzip):
connection.putrequest("POST", handler, skip_accept_encoding=True)
connection.putheader("Accept-Encoding", "gzip")
else:
connection.putrequest("POST", handler)
##
# Send host name.
#
# @param connection Connection handle.
# @param host Host name.
#
# Note: This function doesn't actually add the "Host"
# header anymore, it is done as part of the connection.putrequest() in
# send_request() above.
def send_host(self, connection, host):
extra_headers = self._extra_headers
if extra_headers:
if isinstance(extra_headers, DictType):
extra_headers = extra_headers.items()
for key, value in extra_headers:
connection.putheader(key, value)
##
# Send user-agent identifier.
#
# @param connection Connection handle.
def send_user_agent(self, connection):
connection.putheader("User-Agent", self.user_agent)
##
# Send request body.
#
# @param connection Connection handle.
# @param request_body XML-RPC request body.
def send_content(self, connection, request_body):
connection.putheader("Content-Type", "text/xml")
#optionally encode the request
if (self.encode_threshold is not None and
self.encode_threshold < len(request_body) and
gzip):
connection.putheader("Content-Encoding", "gzip")
request_body = gzip_encode(request_body)
connection.putheader("Content-Length", str(len(request_body)))
connection.endheaders(request_body)
##
# Parse response.
#
# @param file Stream.
# @return Response tuple and target method.
def parse_response(self, response):
# read response data from httpresponse, and parse it
if response.getheader("Content-Encoding", "") == "gzip":
stream = GzipDecodedResponse(response)
else:
stream = response
p, u = self.getparser()
while 1:
data = stream.read(1024)
if not data:
break
if self.verbose:
print "body:", repr(data)
p.feed(data)
if stream is not response:
stream.close()
p.close()
return u.close()
##
# Standard transport class for XML-RPC over HTTPS.
class SafeTransport(Transport):
"""Handles an HTTPS transaction to an XML-RPC server."""
# FIXME: mostly untested
def make_connection(self, host):
if self._connection and host == self._connection[0]:
return self._connection[1]
# create a HTTPS connection object from a host descriptor
# host may be a string, or a (host, x509-dict) tuple
try:
HTTPS = httplib.HTTPSConnection
except AttributeError:
raise NotImplementedError(
"your version of httplib doesn't support HTTPS"
)
else:
chost, self._extra_headers, x509 = self.get_host_info(host)
self._connection = host, HTTPS(chost, None, **(x509 or {}))
return self._connection[1]
##
# Standard server proxy. This class establishes a virtual connection
# to an XML-RPC server.
# <p>
# This class is available as ServerProxy and Server. New code should
# use ServerProxy, to avoid confusion.
#
# @def ServerProxy(uri, **options)
# @param uri The connection point on the server.
# @keyparam transport A transport factory, compatible with the
# standard transport class.
# @keyparam encoding The default encoding used for 8-bit strings
# (default is UTF-8).
# @keyparam verbose Use a true value to enable debugging output.
# (printed to standard output).
# @see Transport
class ServerProxy:
"""uri [,options] -> a logical connection to an XML-RPC server
uri is the connection point on the server, given as
scheme://host/target.
The standard implementation always supports the "http" scheme. If
SSL socket support is available (Python 2.0), it also supports
"https".
If the target part and the slash preceding it are both omitted,
"/RPC2" is assumed.
The following options can be given as keyword arguments:
transport: a transport factory
encoding: the request encoding (default is UTF-8)
All 8-bit strings passed to the server proxy are assumed to use
the given encoding.
"""
def __init__(self, uri, transport=None, encoding=None, verbose=0,
allow_none=0, use_datetime=0):
# establish a "logical" server connection
# get the url
import urllib
type, uri = urllib.splittype(uri)
if type not in ("http", "https"):
raise IOError, "unsupported XML-RPC protocol"
self.__host, self.__handler = urllib.splithost(uri)
if not self.__handler:
self.__handler = "/RPC2"
if transport is None:
if type == "https":
transport = SafeTransport(use_datetime=use_datetime)
else:
transport = Transport(use_datetime=use_datetime)
self.__transport = transport
self.__encoding = encoding
self.__verbose = verbose
self.__allow_none = allow_none
def __close(self):
self.__transport.close()
def __request(self, methodname, params):
# call a method on the remote server
request = dumps(params, methodname, encoding=self.__encoding,
allow_none=self.__allow_none)
response = self.__transport.request(
self.__host,
self.__handler,
request,
verbose=self.__verbose
)
if len(response) == 1:
response = response[0]
return response
def __repr__(self):
return (
"<ServerProxy for %s%s>" %
(self.__host, self.__handler)
)
__str__ = __repr__
def __getattr__(self, name):
# magic method dispatcher
return _Method(self.__request, name)
# note: to call a remote object with an non-standard name, use
# result getattr(server, "strange-python-name")(args)
def __call__(self, attr):
"""A workaround to get special attributes on the ServerProxy
without interfering with the magic __getattr__
"""
if attr == "close":
return self.__close
elif attr == "transport":
return self.__transport
raise AttributeError("Attribute %r not found" % (attr,))
# compatibility
Server = ServerProxy
# --------------------------------------------------------------------
# test code
if __name__ == "__main__":
# simple test program (from the XML-RPC specification)
# server = ServerProxy("http://localhost:8000") # local server
server = ServerProxy("http://time.xmlrpc.com/RPC2")
print server
try:
print server.currentTime.getCurrentTime()
except Error, v:
print "ERROR", v
multi = MultiCall(server)
multi.currentTime.getCurrentTime()
multi.currentTime.getCurrentTime()
try:
for response in multi():
print response
except Error, v:
print "ERROR", v
| Python |
"""HTTP/1.1 client library
<intro stuff goes here>
<other stuff, too>
HTTPConnection goes through a number of "states", which define when a client
may legally make another request or fetch the response for a particular
request. This diagram details these state transitions:
(null)
|
| HTTPConnection()
v
Idle
|
| putrequest()
v
Request-started
|
| ( putheader() )* endheaders()
v
Request-sent
|
| response = getresponse()
v
Unread-response [Response-headers-read]
|\____________________
| |
| response.read() | putrequest()
v v
Idle Req-started-unread-response
______/|
/ |
response.read() | | ( putheader() )* endheaders()
v v
Request-started Req-sent-unread-response
|
| response.read()
v
Request-sent
This diagram presents the following rules:
-- a second request may not be started until {response-headers-read}
-- a response [object] cannot be retrieved until {request-sent}
-- there is no differentiation between an unread response body and a
partially read response body
Note: this enforcement is applied by the HTTPConnection class. The
HTTPResponse class does not enforce this state machine, which
implies sophisticated clients may accelerate the request/response
pipeline. Caution should be taken, though: accelerating the states
beyond the above pattern may imply knowledge of the server's
connection-close behavior for certain requests. For example, it
is impossible to tell whether the server will close the connection
UNTIL the response headers have been read; this means that further
requests cannot be placed into the pipeline until it is known that
the server will NOT be closing the connection.
Logical State __state __response
------------- ------- ----------
Idle _CS_IDLE None
Request-started _CS_REQ_STARTED None
Request-sent _CS_REQ_SENT None
Unread-response _CS_IDLE <response_class>
Req-started-unread-response _CS_REQ_STARTED <response_class>
Req-sent-unread-response _CS_REQ_SENT <response_class>
"""
from array import array
import os
import socket
from sys import py3kwarning
from urlparse import urlsplit
import warnings
with warnings.catch_warnings():
if py3kwarning:
warnings.filterwarnings("ignore", ".*mimetools has been removed",
DeprecationWarning)
import mimetools
try:
from cStringIO import StringIO
except ImportError:
from StringIO import StringIO
__all__ = ["HTTP", "HTTPResponse", "HTTPConnection",
"HTTPException", "NotConnected", "UnknownProtocol",
"UnknownTransferEncoding", "UnimplementedFileMode",
"IncompleteRead", "InvalidURL", "ImproperConnectionState",
"CannotSendRequest", "CannotSendHeader", "ResponseNotReady",
"BadStatusLine", "error", "responses"]
HTTP_PORT = 80
HTTPS_PORT = 443
_UNKNOWN = 'UNKNOWN'
# connection states
_CS_IDLE = 'Idle'
_CS_REQ_STARTED = 'Request-started'
_CS_REQ_SENT = 'Request-sent'
# status codes
# informational
CONTINUE = 100
SWITCHING_PROTOCOLS = 101
PROCESSING = 102
# successful
OK = 200
CREATED = 201
ACCEPTED = 202
NON_AUTHORITATIVE_INFORMATION = 203
NO_CONTENT = 204
RESET_CONTENT = 205
PARTIAL_CONTENT = 206
MULTI_STATUS = 207
IM_USED = 226
# redirection
MULTIPLE_CHOICES = 300
MOVED_PERMANENTLY = 301
FOUND = 302
SEE_OTHER = 303
NOT_MODIFIED = 304
USE_PROXY = 305
TEMPORARY_REDIRECT = 307
# client error
BAD_REQUEST = 400
UNAUTHORIZED = 401
PAYMENT_REQUIRED = 402
FORBIDDEN = 403
NOT_FOUND = 404
METHOD_NOT_ALLOWED = 405
NOT_ACCEPTABLE = 406
PROXY_AUTHENTICATION_REQUIRED = 407
REQUEST_TIMEOUT = 408
CONFLICT = 409
GONE = 410
LENGTH_REQUIRED = 411
PRECONDITION_FAILED = 412
REQUEST_ENTITY_TOO_LARGE = 413
REQUEST_URI_TOO_LONG = 414
UNSUPPORTED_MEDIA_TYPE = 415
REQUESTED_RANGE_NOT_SATISFIABLE = 416
EXPECTATION_FAILED = 417
UNPROCESSABLE_ENTITY = 422
LOCKED = 423
FAILED_DEPENDENCY = 424
UPGRADE_REQUIRED = 426
# server error
INTERNAL_SERVER_ERROR = 500
NOT_IMPLEMENTED = 501
BAD_GATEWAY = 502
SERVICE_UNAVAILABLE = 503
GATEWAY_TIMEOUT = 504
HTTP_VERSION_NOT_SUPPORTED = 505
INSUFFICIENT_STORAGE = 507
NOT_EXTENDED = 510
# Mapping status codes to official W3C names
responses = {
100: 'Continue',
101: 'Switching Protocols',
200: 'OK',
201: 'Created',
202: 'Accepted',
203: 'Non-Authoritative Information',
204: 'No Content',
205: 'Reset Content',
206: 'Partial Content',
300: 'Multiple Choices',
301: 'Moved Permanently',
302: 'Found',
303: 'See Other',
304: 'Not Modified',
305: 'Use Proxy',
306: '(Unused)',
307: 'Temporary Redirect',
400: 'Bad Request',
401: 'Unauthorized',
402: 'Payment Required',
403: 'Forbidden',
404: 'Not Found',
405: 'Method Not Allowed',
406: 'Not Acceptable',
407: 'Proxy Authentication Required',
408: 'Request Timeout',
409: 'Conflict',
410: 'Gone',
411: 'Length Required',
412: 'Precondition Failed',
413: 'Request Entity Too Large',
414: 'Request-URI Too Long',
415: 'Unsupported Media Type',
416: 'Requested Range Not Satisfiable',
417: 'Expectation Failed',
500: 'Internal Server Error',
501: 'Not Implemented',
502: 'Bad Gateway',
503: 'Service Unavailable',
504: 'Gateway Timeout',
505: 'HTTP Version Not Supported',
}
# maximal amount of data to read at one time in _safe_read
MAXAMOUNT = 1048576
class HTTPMessage(mimetools.Message):
def addheader(self, key, value):
"""Add header for field key handling repeats."""
prev = self.dict.get(key)
if prev is None:
self.dict[key] = value
else:
combined = ", ".join((prev, value))
self.dict[key] = combined
def addcontinue(self, key, more):
"""Add more field data from a continuation line."""
prev = self.dict[key]
self.dict[key] = prev + "\n " + more
def readheaders(self):
"""Read header lines.
Read header lines up to the entirely blank line that terminates them.
The (normally blank) line that ends the headers is skipped, but not
included in the returned list. If a non-header line ends the headers,
(which is an error), an attempt is made to backspace over it; it is
never included in the returned list.
The variable self.status is set to the empty string if all went well,
otherwise it is an error message. The variable self.headers is a
completely uninterpreted list of lines contained in the header (so
printing them will reproduce the header exactly as it appears in the
file).
If multiple header fields with the same name occur, they are combined
according to the rules in RFC 2616 sec 4.2:
Appending each subsequent field-value to the first, each separated
by a comma. The order in which header fields with the same field-name
are received is significant to the interpretation of the combined
field value.
"""
# XXX The implementation overrides the readheaders() method of
# rfc822.Message. The base class design isn't amenable to
# customized behavior here so the method here is a copy of the
# base class code with a few small changes.
self.dict = {}
self.unixfrom = ''
self.headers = hlist = []
self.status = ''
headerseen = ""
firstline = 1
startofline = unread = tell = None
if hasattr(self.fp, 'unread'):
unread = self.fp.unread
elif self.seekable:
tell = self.fp.tell
while True:
if tell:
try:
startofline = tell()
except IOError:
startofline = tell = None
self.seekable = 0
line = self.fp.readline()
if not line:
self.status = 'EOF in headers'
break
# Skip unix From name time lines
if firstline and line.startswith('From '):
self.unixfrom = self.unixfrom + line
continue
firstline = 0
if headerseen and line[0] in ' \t':
# XXX Not sure if continuation lines are handled properly
# for http and/or for repeating headers
# It's a continuation line.
hlist.append(line)
self.addcontinue(headerseen, line.strip())
continue
elif self.iscomment(line):
# It's a comment. Ignore it.
continue
elif self.islast(line):
# Note! No pushback here! The delimiter line gets eaten.
break
headerseen = self.isheader(line)
if headerseen:
# It's a legal header line, save it.
hlist.append(line)
self.addheader(headerseen, line[len(headerseen)+1:].strip())
continue
else:
# It's not a header line; throw it back and stop here.
if not self.dict:
self.status = 'No headers'
else:
self.status = 'Non-header line where header expected'
# Try to undo the read.
if unread:
unread(line)
elif tell:
self.fp.seek(startofline)
else:
self.status = self.status + '; bad seek'
break
class HTTPResponse:
# strict: If true, raise BadStatusLine if the status line can't be
# parsed as a valid HTTP/1.0 or 1.1 status line. By default it is
# false because it prevents clients from talking to HTTP/0.9
# servers. Note that a response with a sufficiently corrupted
# status line will look like an HTTP/0.9 response.
# See RFC 2616 sec 19.6 and RFC 1945 sec 6 for details.
def __init__(self, sock, debuglevel=0, strict=0, method=None, buffering=False):
if buffering:
# The caller won't be using any sock.recv() calls, so buffering
# is fine and recommended for performance.
self.fp = sock.makefile('rb')
else:
# The buffer size is specified as zero, because the headers of
# the response are read with readline(). If the reads were
# buffered the readline() calls could consume some of the
# response, which make be read via a recv() on the underlying
# socket.
self.fp = sock.makefile('rb', 0)
self.debuglevel = debuglevel
self.strict = strict
self._method = method
self.msg = None
# from the Status-Line of the response
self.version = _UNKNOWN # HTTP-Version
self.status = _UNKNOWN # Status-Code
self.reason = _UNKNOWN # Reason-Phrase
self.chunked = _UNKNOWN # is "chunked" being used?
self.chunk_left = _UNKNOWN # bytes left to read in current chunk
self.length = _UNKNOWN # number of bytes left in response
self.will_close = _UNKNOWN # conn will close at end of response
def _read_status(self):
# Initialize with Simple-Response defaults
line = self.fp.readline()
if self.debuglevel > 0:
print "reply:", repr(line)
if not line:
# Presumably, the server closed the connection before
# sending a valid response.
raise BadStatusLine(line)
try:
[version, status, reason] = line.split(None, 2)
except ValueError:
try:
[version, status] = line.split(None, 1)
reason = ""
except ValueError:
# empty version will cause next test to fail and status
# will be treated as 0.9 response.
version = ""
if not version.startswith('HTTP/'):
if self.strict:
self.close()
raise BadStatusLine(line)
else:
# assume it's a Simple-Response from an 0.9 server
self.fp = LineAndFileWrapper(line, self.fp)
return "HTTP/0.9", 200, ""
# The status code is a three-digit number
try:
status = int(status)
if status < 100 or status > 999:
raise BadStatusLine(line)
except ValueError:
raise BadStatusLine(line)
return version, status, reason
def begin(self):
if self.msg is not None:
# we've already started reading the response
return
# read until we get a non-100 response
while True:
version, status, reason = self._read_status()
if status != CONTINUE:
break
# skip the header from the 100 response
while True:
skip = self.fp.readline().strip()
if not skip:
break
if self.debuglevel > 0:
print "header:", skip
self.status = status
self.reason = reason.strip()
if version == 'HTTP/1.0':
self.version = 10
elif version.startswith('HTTP/1.'):
self.version = 11 # use HTTP/1.1 code for HTTP/1.x where x>=1
elif version == 'HTTP/0.9':
self.version = 9
else:
raise UnknownProtocol(version)
if self.version == 9:
self.length = None
self.chunked = 0
self.will_close = 1
self.msg = HTTPMessage(StringIO())
return
self.msg = HTTPMessage(self.fp, 0)
if self.debuglevel > 0:
for hdr in self.msg.headers:
print "header:", hdr,
# don't let the msg keep an fp
self.msg.fp = None
# are we using the chunked-style of transfer encoding?
tr_enc = self.msg.getheader('transfer-encoding')
if tr_enc and tr_enc.lower() == "chunked":
self.chunked = 1
self.chunk_left = None
else:
self.chunked = 0
# will the connection close at the end of the response?
self.will_close = self._check_close()
# do we have a Content-Length?
# NOTE: RFC 2616, S4.4, #3 says we ignore this if tr_enc is "chunked"
length = self.msg.getheader('content-length')
if length and not self.chunked:
try:
self.length = int(length)
except ValueError:
self.length = None
else:
if self.length < 0: # ignore nonsensical negative lengths
self.length = None
else:
self.length = None
# does the body have a fixed length? (of zero)
if (status == NO_CONTENT or status == NOT_MODIFIED or
100 <= status < 200 or # 1xx codes
self._method == 'HEAD'):
self.length = 0
# if the connection remains open, and we aren't using chunked, and
# a content-length was not provided, then assume that the connection
# WILL close.
if not self.will_close and \
not self.chunked and \
self.length is None:
self.will_close = 1
def _check_close(self):
conn = self.msg.getheader('connection')
if self.version == 11:
# An HTTP/1.1 proxy is assumed to stay open unless
# explicitly closed.
conn = self.msg.getheader('connection')
if conn and "close" in conn.lower():
return True
return False
# Some HTTP/1.0 implementations have support for persistent
# connections, using rules different than HTTP/1.1.
# For older HTTP, Keep-Alive indicates persistent connection.
if self.msg.getheader('keep-alive'):
return False
# At least Akamai returns a "Connection: Keep-Alive" header,
# which was supposed to be sent by the client.
if conn and "keep-alive" in conn.lower():
return False
# Proxy-Connection is a netscape hack.
pconn = self.msg.getheader('proxy-connection')
if pconn and "keep-alive" in pconn.lower():
return False
# otherwise, assume it will close
return True
def close(self):
if self.fp:
self.fp.close()
self.fp = None
def isclosed(self):
# NOTE: it is possible that we will not ever call self.close(). This
# case occurs when will_close is TRUE, length is None, and we
# read up to the last byte, but NOT past it.
#
# IMPLIES: if will_close is FALSE, then self.close() will ALWAYS be
# called, meaning self.isclosed() is meaningful.
return self.fp is None
# XXX It would be nice to have readline and __iter__ for this, too.
def read(self, amt=None):
if self.fp is None:
return ''
if self._method == 'HEAD':
self.close()
return ''
if self.chunked:
return self._read_chunked(amt)
if amt is None:
# unbounded read
if self.length is None:
s = self.fp.read()
else:
s = self._safe_read(self.length)
self.length = 0
self.close() # we read everything
return s
if self.length is not None:
if amt > self.length:
# clip the read to the "end of response"
amt = self.length
# we do not use _safe_read() here because this may be a .will_close
# connection, and the user is reading more bytes than will be provided
# (for example, reading in 1k chunks)
s = self.fp.read(amt)
if self.length is not None:
self.length -= len(s)
if not self.length:
self.close()
return s
def _read_chunked(self, amt):
assert self.chunked != _UNKNOWN
chunk_left = self.chunk_left
value = []
while True:
if chunk_left is None:
line = self.fp.readline()
i = line.find(';')
if i >= 0:
line = line[:i] # strip chunk-extensions
try:
chunk_left = int(line, 16)
except ValueError:
# close the connection as protocol synchronisation is
# probably lost
self.close()
raise IncompleteRead(''.join(value))
if chunk_left == 0:
break
if amt is None:
value.append(self._safe_read(chunk_left))
elif amt < chunk_left:
value.append(self._safe_read(amt))
self.chunk_left = chunk_left - amt
return ''.join(value)
elif amt == chunk_left:
value.append(self._safe_read(amt))
self._safe_read(2) # toss the CRLF at the end of the chunk
self.chunk_left = None
return ''.join(value)
else:
value.append(self._safe_read(chunk_left))
amt -= chunk_left
# we read the whole chunk, get another
self._safe_read(2) # toss the CRLF at the end of the chunk
chunk_left = None
# read and discard trailer up to the CRLF terminator
### note: we shouldn't have any trailers!
while True:
line = self.fp.readline()
if not line:
# a vanishingly small number of sites EOF without
# sending the trailer
break
if line == '\r\n':
break
# we read everything; close the "file"
self.close()
return ''.join(value)
def _safe_read(self, amt):
"""Read the number of bytes requested, compensating for partial reads.
Normally, we have a blocking socket, but a read() can be interrupted
by a signal (resulting in a partial read).
Note that we cannot distinguish between EOF and an interrupt when zero
bytes have been read. IncompleteRead() will be raised in this
situation.
This function should be used when <amt> bytes "should" be present for
reading. If the bytes are truly not available (due to EOF), then the
IncompleteRead exception can be used to detect the problem.
"""
# NOTE(gps): As of svn r74426 socket._fileobject.read(x) will never
# return less than x bytes unless EOF is encountered. It now handles
# signal interruptions (socket.error EINTR) internally. This code
# never caught that exception anyways. It seems largely pointless.
# self.fp.read(amt) will work fine.
s = []
while amt > 0:
chunk = self.fp.read(min(amt, MAXAMOUNT))
if not chunk:
raise IncompleteRead(''.join(s), amt)
s.append(chunk)
amt -= len(chunk)
return ''.join(s)
def fileno(self):
return self.fp.fileno()
def getheader(self, name, default=None):
if self.msg is None:
raise ResponseNotReady()
return self.msg.getheader(name, default)
def getheaders(self):
"""Return list of (header, value) tuples."""
if self.msg is None:
raise ResponseNotReady()
return self.msg.items()
class HTTPConnection:
_http_vsn = 11
_http_vsn_str = 'HTTP/1.1'
response_class = HTTPResponse
default_port = HTTP_PORT
auto_open = 1
debuglevel = 0
strict = 0
def __init__(self, host, port=None, strict=None,
timeout=socket._GLOBAL_DEFAULT_TIMEOUT, source_address=None):
self.timeout = timeout
self.source_address = source_address
self.sock = None
self._buffer = []
self.__response = None
self.__state = _CS_IDLE
self._method = None
self._tunnel_host = None
self._tunnel_port = None
self._tunnel_headers = {}
self._set_hostport(host, port)
if strict is not None:
self.strict = strict
def set_tunnel(self, host, port=None, headers=None):
""" Sets up the host and the port for the HTTP CONNECT Tunnelling.
The headers argument should be a mapping of extra HTTP headers
to send with the CONNECT request.
"""
self._tunnel_host = host
self._tunnel_port = port
if headers:
self._tunnel_headers = headers
else:
self._tunnel_headers.clear()
def _set_hostport(self, host, port):
if port is None:
i = host.rfind(':')
j = host.rfind(']') # ipv6 addresses have [...]
if i > j:
try:
port = int(host[i+1:])
except ValueError:
raise InvalidURL("nonnumeric port: '%s'" % host[i+1:])
host = host[:i]
else:
port = self.default_port
if host and host[0] == '[' and host[-1] == ']':
host = host[1:-1]
self.host = host
self.port = port
def set_debuglevel(self, level):
self.debuglevel = level
def _tunnel(self):
self._set_hostport(self._tunnel_host, self._tunnel_port)
self.send("CONNECT %s:%d HTTP/1.0\r\n" % (self.host, self.port))
for header, value in self._tunnel_headers.iteritems():
self.send("%s: %s\r\n" % (header, value))
self.send("\r\n")
response = self.response_class(self.sock, strict = self.strict,
method = self._method)
(version, code, message) = response._read_status()
if code != 200:
self.close()
raise socket.error("Tunnel connection failed: %d %s" % (code,
message.strip()))
while True:
line = response.fp.readline()
if line == '\r\n': break
def connect(self):
"""Connect to the host and port specified in __init__."""
self.sock = socket.create_connection((self.host,self.port),
self.timeout, self.source_address)
if self._tunnel_host:
self._tunnel()
def close(self):
"""Close the connection to the HTTP server."""
if self.sock:
self.sock.close() # close it manually... there may be other refs
self.sock = None
if self.__response:
self.__response.close()
self.__response = None
self.__state = _CS_IDLE
def send(self, data):
"""Send `data' to the server."""
if self.sock is None:
if self.auto_open:
self.connect()
else:
raise NotConnected()
if self.debuglevel > 0:
print "send:", repr(data)
blocksize = 8192
if hasattr(data,'read') and not isinstance(data, array):
if self.debuglevel > 0: print "sendIng a read()able"
datablock = data.read(blocksize)
while datablock:
self.sock.sendall(datablock)
datablock = data.read(blocksize)
else:
self.sock.sendall(data)
def _output(self, s):
"""Add a line of output to the current request buffer.
Assumes that the line does *not* end with \\r\\n.
"""
self._buffer.append(s)
def _send_output(self, message_body=None):
"""Send the currently buffered request and clear the buffer.
Appends an extra \\r\\n to the buffer.
A message_body may be specified, to be appended to the request.
"""
self._buffer.extend(("", ""))
msg = "\r\n".join(self._buffer)
del self._buffer[:]
# If msg and message_body are sent in a single send() call,
# it will avoid performance problems caused by the interaction
# between delayed ack and the Nagle algorithim.
if isinstance(message_body, str):
msg += message_body
message_body = None
self.send(msg)
if message_body is not None:
#message_body was not a string (i.e. it is a file) and
#we must run the risk of Nagle
self.send(message_body)
def putrequest(self, method, url, skip_host=0, skip_accept_encoding=0):
"""Send a request to the server.
`method' specifies an HTTP request method, e.g. 'GET'.
`url' specifies the object being requested, e.g. '/index.html'.
`skip_host' if True does not add automatically a 'Host:' header
`skip_accept_encoding' if True does not add automatically an
'Accept-Encoding:' header
"""
# if a prior response has been completed, then forget about it.
if self.__response and self.__response.isclosed():
self.__response = None
# in certain cases, we cannot issue another request on this connection.
# this occurs when:
# 1) we are in the process of sending a request. (_CS_REQ_STARTED)
# 2) a response to a previous request has signalled that it is going
# to close the connection upon completion.
# 3) the headers for the previous response have not been read, thus
# we cannot determine whether point (2) is true. (_CS_REQ_SENT)
#
# if there is no prior response, then we can request at will.
#
# if point (2) is true, then we will have passed the socket to the
# response (effectively meaning, "there is no prior response"), and
# will open a new one when a new request is made.
#
# Note: if a prior response exists, then we *can* start a new request.
# We are not allowed to begin fetching the response to this new
# request, however, until that prior response is complete.
#
if self.__state == _CS_IDLE:
self.__state = _CS_REQ_STARTED
else:
raise CannotSendRequest()
# Save the method we use, we need it later in the response phase
self._method = method
if not url:
url = '/'
hdr = '%s %s %s' % (method, url, self._http_vsn_str)
self._output(hdr)
if self._http_vsn == 11:
# Issue some standard headers for better HTTP/1.1 compliance
if not skip_host:
# this header is issued *only* for HTTP/1.1
# connections. more specifically, this means it is
# only issued when the client uses the new
# HTTPConnection() class. backwards-compat clients
# will be using HTTP/1.0 and those clients may be
# issuing this header themselves. we should NOT issue
# it twice; some web servers (such as Apache) barf
# when they see two Host: headers
# If we need a non-standard port,include it in the
# header. If the request is going through a proxy,
# but the host of the actual URL, not the host of the
# proxy.
netloc = ''
if url.startswith('http'):
nil, netloc, nil, nil, nil = urlsplit(url)
if netloc:
try:
netloc_enc = netloc.encode("ascii")
except UnicodeEncodeError:
netloc_enc = netloc.encode("idna")
self.putheader('Host', netloc_enc)
else:
try:
host_enc = self.host.encode("ascii")
except UnicodeEncodeError:
host_enc = self.host.encode("idna")
# Wrap the IPv6 Host Header with [] (RFC 2732)
if host_enc.find(':') >= 0:
host_enc = "[" + host_enc + "]"
if self.port == self.default_port:
self.putheader('Host', host_enc)
else:
self.putheader('Host', "%s:%s" % (host_enc, self.port))
# note: we are assuming that clients will not attempt to set these
# headers since *this* library must deal with the
# consequences. this also means that when the supporting
# libraries are updated to recognize other forms, then this
# code should be changed (removed or updated).
# we only want a Content-Encoding of "identity" since we don't
# support encodings such as x-gzip or x-deflate.
if not skip_accept_encoding:
self.putheader('Accept-Encoding', 'identity')
# we can accept "chunked" Transfer-Encodings, but no others
# NOTE: no TE header implies *only* "chunked"
#self.putheader('TE', 'chunked')
# if TE is supplied in the header, then it must appear in a
# Connection header.
#self.putheader('Connection', 'TE')
else:
# For HTTP/1.0, the server will assume "not chunked"
pass
def putheader(self, header, *values):
"""Send a request header line to the server.
For example: h.putheader('Accept', 'text/html')
"""
if self.__state != _CS_REQ_STARTED:
raise CannotSendHeader()
hdr = '%s: %s' % (header, '\r\n\t'.join([str(v) for v in values]))
self._output(hdr)
def endheaders(self, message_body=None):
"""Indicate that the last header line has been sent to the server.
This method sends the request to the server. The optional
message_body argument can be used to pass message body
associated with the request. The message body will be sent in
the same packet as the message headers if possible. The
message_body should be a string.
"""
if self.__state == _CS_REQ_STARTED:
self.__state = _CS_REQ_SENT
else:
raise CannotSendHeader()
self._send_output(message_body)
def request(self, method, url, body=None, headers={}):
"""Send a complete request to the server."""
self._send_request(method, url, body, headers)
def _set_content_length(self, body):
# Set the content-length based on the body.
thelen = None
try:
thelen = str(len(body))
except TypeError, te:
# If this is a file-like object, try to
# fstat its file descriptor
try:
thelen = str(os.fstat(body.fileno()).st_size)
except (AttributeError, OSError):
# Don't send a length if this failed
if self.debuglevel > 0: print "Cannot stat!!"
if thelen is not None:
self.putheader('Content-Length', thelen)
def _send_request(self, method, url, body, headers):
# Honor explicitly requested Host: and Accept-Encoding: headers.
header_names = dict.fromkeys([k.lower() for k in headers])
skips = {}
if 'host' in header_names:
skips['skip_host'] = 1
if 'accept-encoding' in header_names:
skips['skip_accept_encoding'] = 1
self.putrequest(method, url, **skips)
if body and ('content-length' not in header_names):
self._set_content_length(body)
for hdr, value in headers.iteritems():
self.putheader(hdr, value)
self.endheaders(body)
def getresponse(self, buffering=False):
"Get the response from the server."
# if a prior response has been completed, then forget about it.
if self.__response and self.__response.isclosed():
self.__response = None
#
# if a prior response exists, then it must be completed (otherwise, we
# cannot read this response's header to determine the connection-close
# behavior)
#
# note: if a prior response existed, but was connection-close, then the
# socket and response were made independent of this HTTPConnection
# object since a new request requires that we open a whole new
# connection
#
# this means the prior response had one of two states:
# 1) will_close: this connection was reset and the prior socket and
# response operate independently
# 2) persistent: the response was retained and we await its
# isclosed() status to become true.
#
if self.__state != _CS_REQ_SENT or self.__response:
raise ResponseNotReady()
args = (self.sock,)
kwds = {"strict":self.strict, "method":self._method}
if self.debuglevel > 0:
args += (self.debuglevel,)
if buffering:
#only add this keyword if non-default, for compatibility with
#other response_classes.
kwds["buffering"] = True;
response = self.response_class(*args, **kwds)
response.begin()
assert response.will_close != _UNKNOWN
self.__state = _CS_IDLE
if response.will_close:
# this effectively passes the connection to the response
self.close()
else:
# remember this, so we can tell when it is complete
self.__response = response
return response
class HTTP:
"Compatibility class with httplib.py from 1.5."
_http_vsn = 10
_http_vsn_str = 'HTTP/1.0'
debuglevel = 0
_connection_class = HTTPConnection
def __init__(self, host='', port=None, strict=None):
"Provide a default host, since the superclass requires one."
# some joker passed 0 explicitly, meaning default port
if port == 0:
port = None
# Note that we may pass an empty string as the host; this will throw
# an error when we attempt to connect. Presumably, the client code
# will call connect before then, with a proper host.
self._setup(self._connection_class(host, port, strict))
def _setup(self, conn):
self._conn = conn
# set up delegation to flesh out interface
self.send = conn.send
self.putrequest = conn.putrequest
self.putheader = conn.putheader
self.endheaders = conn.endheaders
self.set_debuglevel = conn.set_debuglevel
conn._http_vsn = self._http_vsn
conn._http_vsn_str = self._http_vsn_str
self.file = None
def connect(self, host=None, port=None):
"Accept arguments to set the host/port, since the superclass doesn't."
if host is not None:
self._conn._set_hostport(host, port)
self._conn.connect()
def getfile(self):
"Provide a getfile, since the superclass' does not use this concept."
return self.file
def getreply(self, buffering=False):
"""Compat definition since superclass does not define it.
Returns a tuple consisting of:
- server status code (e.g. '200' if all goes well)
- server "reason" corresponding to status code
- any RFC822 headers in the response from the server
"""
try:
if not buffering:
response = self._conn.getresponse()
else:
#only add this keyword if non-default for compatibility
#with other connection classes
response = self._conn.getresponse(buffering)
except BadStatusLine, e:
### hmm. if getresponse() ever closes the socket on a bad request,
### then we are going to have problems with self.sock
### should we keep this behavior? do people use it?
# keep the socket open (as a file), and return it
self.file = self._conn.sock.makefile('rb', 0)
# close our socket -- we want to restart after any protocol error
self.close()
self.headers = None
return -1, e.line, None
self.headers = response.msg
self.file = response.fp
return response.status, response.reason, response.msg
def close(self):
self._conn.close()
# note that self.file == response.fp, which gets closed by the
# superclass. just clear the object ref here.
### hmm. messy. if status==-1, then self.file is owned by us.
### well... we aren't explicitly closing, but losing this ref will
### do it
self.file = None
try:
import ssl
except ImportError:
pass
else:
class HTTPSConnection(HTTPConnection):
"This class allows communication via SSL."
default_port = HTTPS_PORT
def __init__(self, host, port=None, key_file=None, cert_file=None,
strict=None, timeout=socket._GLOBAL_DEFAULT_TIMEOUT,
source_address=None):
HTTPConnection.__init__(self, host, port, strict, timeout,
source_address)
self.key_file = key_file
self.cert_file = cert_file
def connect(self):
"Connect to a host on a given (SSL) port."
sock = socket.create_connection((self.host, self.port),
self.timeout, self.source_address)
if self._tunnel_host:
self.sock = sock
self._tunnel()
self.sock = ssl.wrap_socket(sock, self.key_file, self.cert_file)
__all__.append("HTTPSConnection")
class HTTPS(HTTP):
"""Compatibility with 1.5 httplib interface
Python 1.5.2 did not have an HTTPS class, but it defined an
interface for sending http requests that is also useful for
https.
"""
_connection_class = HTTPSConnection
def __init__(self, host='', port=None, key_file=None, cert_file=None,
strict=None):
# provide a default host, pass the X509 cert info
# urf. compensate for bad input.
if port == 0:
port = None
self._setup(self._connection_class(host, port, key_file,
cert_file, strict))
# we never actually use these for anything, but we keep them
# here for compatibility with post-1.5.2 CVS.
self.key_file = key_file
self.cert_file = cert_file
def FakeSocket (sock, sslobj):
warnings.warn("FakeSocket is deprecated, and won't be in 3.x. " +
"Use the result of ssl.wrap_socket() directly instead.",
DeprecationWarning, stacklevel=2)
return sslobj
class HTTPException(Exception):
# Subclasses that define an __init__ must call Exception.__init__
# or define self.args. Otherwise, str() will fail.
pass
class NotConnected(HTTPException):
pass
class InvalidURL(HTTPException):
pass
class UnknownProtocol(HTTPException):
def __init__(self, version):
self.args = version,
self.version = version
class UnknownTransferEncoding(HTTPException):
pass
class UnimplementedFileMode(HTTPException):
pass
class IncompleteRead(HTTPException):
def __init__(self, partial, expected=None):
self.args = partial,
self.partial = partial
self.expected = expected
def __repr__(self):
if self.expected is not None:
e = ', %i more expected' % self.expected
else:
e = ''
return 'IncompleteRead(%i bytes read%s)' % (len(self.partial), e)
def __str__(self):
return repr(self)
class ImproperConnectionState(HTTPException):
pass
class CannotSendRequest(ImproperConnectionState):
pass
class CannotSendHeader(ImproperConnectionState):
pass
class ResponseNotReady(ImproperConnectionState):
pass
class BadStatusLine(HTTPException):
def __init__(self, line):
if not line:
line = repr(line)
self.args = line,
self.line = line
# for backwards compatibility
error = HTTPException
class LineAndFileWrapper:
"""A limited file-like object for HTTP/0.9 responses."""
# The status-line parsing code calls readline(), which normally
# get the HTTP status line. For a 0.9 response, however, this is
# actually the first line of the body! Clients need to get a
# readable file object that contains that line.
def __init__(self, line, file):
self._line = line
self._file = file
self._line_consumed = 0
self._line_offset = 0
self._line_left = len(line)
def __getattr__(self, attr):
return getattr(self._file, attr)
def _done(self):
# called when the last byte is read from the line. After the
# call, all read methods are delegated to the underlying file
# object.
self._line_consumed = 1
self.read = self._file.read
self.readline = self._file.readline
self.readlines = self._file.readlines
def read(self, amt=None):
if self._line_consumed:
return self._file.read(amt)
assert self._line_left
if amt is None or amt > self._line_left:
s = self._line[self._line_offset:]
self._done()
if amt is None:
return s + self._file.read()
else:
return s + self._file.read(amt - len(s))
else:
assert amt <= self._line_left
i = self._line_offset
j = i + amt
s = self._line[i:j]
self._line_offset = j
self._line_left -= amt
if self._line_left == 0:
self._done()
return s
def readline(self):
if self._line_consumed:
return self._file.readline()
assert self._line_left
s = self._line[self._line_offset:]
self._done()
return s
def readlines(self, size=None):
if self._line_consumed:
return self._file.readlines(size)
assert self._line_left
L = [self._line[self._line_offset:]]
self._done()
if size is None:
return L + self._file.readlines()
else:
return L + self._file.readlines(size)
def test():
"""Test this module.
A hodge podge of tests collected here, because they have too many
external dependencies for the regular test suite.
"""
import sys
import getopt
opts, args = getopt.getopt(sys.argv[1:], 'd')
dl = 0
for o, a in opts:
if o == '-d': dl = dl + 1
host = 'www.python.org'
selector = '/'
if args[0:]: host = args[0]
if args[1:]: selector = args[1]
h = HTTP()
h.set_debuglevel(dl)
h.connect(host)
h.putrequest('GET', selector)
h.endheaders()
status, reason, headers = h.getreply()
print 'status =', status
print 'reason =', reason
print "read", len(h.getfile().read())
print
if headers:
for header in headers.headers: print header.strip()
print
# minimal test that code to extract host from url works
class HTTP11(HTTP):
_http_vsn = 11
_http_vsn_str = 'HTTP/1.1'
h = HTTP11('www.python.org')
h.putrequest('GET', 'http://www.python.org/~jeremy/')
h.endheaders()
h.getreply()
h.close()
try:
import ssl
except ImportError:
pass
else:
for host, selector in (('sourceforge.net', '/projects/python'),
):
print "https://%s%s" % (host, selector)
hs = HTTPS()
hs.set_debuglevel(dl)
hs.connect(host)
hs.putrequest('GET', selector)
hs.endheaders()
status, reason, headers = hs.getreply()
print 'status =', status
print 'reason =', reason
print "read", len(hs.getfile().read())
print
if headers:
for header in headers.headers: print header.strip()
print
if __name__ == '__main__':
test()
| Python |
"""HTTP cookie handling for web clients.
This module has (now fairly distant) origins in Gisle Aas' Perl module
HTTP::Cookies, from the libwww-perl library.
Docstrings, comments and debug strings in this code refer to the
attributes of the HTTP cookie system as cookie-attributes, to distinguish
them clearly from Python attributes.
Class diagram (note that BSDDBCookieJar and the MSIE* classes are not
distributed with the Python standard library, but are available from
http://wwwsearch.sf.net/):
CookieJar____
/ \ \
FileCookieJar \ \
/ | \ \ \
MozillaCookieJar | LWPCookieJar \ \
| | \
| ---MSIEBase | \
| / | | \
| / MSIEDBCookieJar BSDDBCookieJar
|/
MSIECookieJar
"""
__all__ = ['Cookie', 'CookieJar', 'CookiePolicy', 'DefaultCookiePolicy',
'FileCookieJar', 'LWPCookieJar', 'lwp_cookie_str', 'LoadError',
'MozillaCookieJar']
import re, urlparse, copy, time, urllib
try:
import threading as _threading
except ImportError:
import dummy_threading as _threading
import httplib # only for the default HTTP port
from calendar import timegm
debug = False # set to True to enable debugging via the logging module
logger = None
def _debug(*args):
if not debug:
return
global logger
if not logger:
import logging
logger = logging.getLogger("cookielib")
return logger.debug(*args)
DEFAULT_HTTP_PORT = str(httplib.HTTP_PORT)
MISSING_FILENAME_TEXT = ("a filename was not supplied (nor was the CookieJar "
"instance initialised with one)")
def _warn_unhandled_exception():
# There are a few catch-all except: statements in this module, for
# catching input that's bad in unexpected ways. Warn if any
# exceptions are caught there.
import warnings, traceback, StringIO
f = StringIO.StringIO()
traceback.print_exc(None, f)
msg = f.getvalue()
warnings.warn("cookielib bug!\n%s" % msg, stacklevel=2)
# Date/time conversion
# -----------------------------------------------------------------------------
EPOCH_YEAR = 1970
def _timegm(tt):
year, month, mday, hour, min, sec = tt[:6]
if ((year >= EPOCH_YEAR) and (1 <= month <= 12) and (1 <= mday <= 31) and
(0 <= hour <= 24) and (0 <= min <= 59) and (0 <= sec <= 61)):
return timegm(tt)
else:
return None
DAYS = ["Mon", "Tue", "Wed", "Thu", "Fri", "Sat", "Sun"]
MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun",
"Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]
MONTHS_LOWER = []
for month in MONTHS: MONTHS_LOWER.append(month.lower())
def time2isoz(t=None):
"""Return a string representing time in seconds since epoch, t.
If the function is called without an argument, it will use the current
time.
The format of the returned string is like "YYYY-MM-DD hh:mm:ssZ",
representing Universal Time (UTC, aka GMT). An example of this format is:
1994-11-24 08:49:37Z
"""
if t is None: t = time.time()
year, mon, mday, hour, min, sec = time.gmtime(t)[:6]
return "%04d-%02d-%02d %02d:%02d:%02dZ" % (
year, mon, mday, hour, min, sec)
def time2netscape(t=None):
"""Return a string representing time in seconds since epoch, t.
If the function is called without an argument, it will use the current
time.
The format of the returned string is like this:
Wed, DD-Mon-YYYY HH:MM:SS GMT
"""
if t is None: t = time.time()
year, mon, mday, hour, min, sec, wday = time.gmtime(t)[:7]
return "%s %02d-%s-%04d %02d:%02d:%02d GMT" % (
DAYS[wday], mday, MONTHS[mon-1], year, hour, min, sec)
UTC_ZONES = {"GMT": None, "UTC": None, "UT": None, "Z": None}
TIMEZONE_RE = re.compile(r"^([-+])?(\d\d?):?(\d\d)?$")
def offset_from_tz_string(tz):
offset = None
if tz in UTC_ZONES:
offset = 0
else:
m = TIMEZONE_RE.search(tz)
if m:
offset = 3600 * int(m.group(2))
if m.group(3):
offset = offset + 60 * int(m.group(3))
if m.group(1) == '-':
offset = -offset
return offset
def _str2time(day, mon, yr, hr, min, sec, tz):
# translate month name to number
# month numbers start with 1 (January)
try:
mon = MONTHS_LOWER.index(mon.lower())+1
except ValueError:
# maybe it's already a number
try:
imon = int(mon)
except ValueError:
return None
if 1 <= imon <= 12:
mon = imon
else:
return None
# make sure clock elements are defined
if hr is None: hr = 0
if min is None: min = 0
if sec is None: sec = 0
yr = int(yr)
day = int(day)
hr = int(hr)
min = int(min)
sec = int(sec)
if yr < 1000:
# find "obvious" year
cur_yr = time.localtime(time.time())[0]
m = cur_yr % 100
tmp = yr
yr = yr + cur_yr - m
m = m - tmp
if abs(m) > 50:
if m > 0: yr = yr + 100
else: yr = yr - 100
# convert UTC time tuple to seconds since epoch (not timezone-adjusted)
t = _timegm((yr, mon, day, hr, min, sec, tz))
if t is not None:
# adjust time using timezone string, to get absolute time since epoch
if tz is None:
tz = "UTC"
tz = tz.upper()
offset = offset_from_tz_string(tz)
if offset is None:
return None
t = t - offset
return t
STRICT_DATE_RE = re.compile(
r"^[SMTWF][a-z][a-z], (\d\d) ([JFMASOND][a-z][a-z]) "
"(\d\d\d\d) (\d\d):(\d\d):(\d\d) GMT$")
WEEKDAY_RE = re.compile(
r"^(?:Sun|Mon|Tue|Wed|Thu|Fri|Sat)[a-z]*,?\s*", re.I)
LOOSE_HTTP_DATE_RE = re.compile(
r"""^
(\d\d?) # day
(?:\s+|[-\/])
(\w+) # month
(?:\s+|[-\/])
(\d+) # year
(?:
(?:\s+|:) # separator before clock
(\d\d?):(\d\d) # hour:min
(?::(\d\d))? # optional seconds
)? # optional clock
\s*
([-+]?\d{2,4}|(?![APap][Mm]\b)[A-Za-z]+)? # timezone
\s*
(?:\(\w+\))? # ASCII representation of timezone in parens.
\s*$""", re.X)
def http2time(text):
"""Returns time in seconds since epoch of time represented by a string.
Return value is an integer.
None is returned if the format of str is unrecognized, the time is outside
the representable range, or the timezone string is not recognized. If the
string contains no timezone, UTC is assumed.
The timezone in the string may be numerical (like "-0800" or "+0100") or a
string timezone (like "UTC", "GMT", "BST" or "EST"). Currently, only the
timezone strings equivalent to UTC (zero offset) are known to the function.
The function loosely parses the following formats:
Wed, 09 Feb 1994 22:23:32 GMT -- HTTP format
Tuesday, 08-Feb-94 14:15:29 GMT -- old rfc850 HTTP format
Tuesday, 08-Feb-1994 14:15:29 GMT -- broken rfc850 HTTP format
09 Feb 1994 22:23:32 GMT -- HTTP format (no weekday)
08-Feb-94 14:15:29 GMT -- rfc850 format (no weekday)
08-Feb-1994 14:15:29 GMT -- broken rfc850 format (no weekday)
The parser ignores leading and trailing whitespace. The time may be
absent.
If the year is given with only 2 digits, the function will select the
century that makes the year closest to the current date.
"""
# fast exit for strictly conforming string
m = STRICT_DATE_RE.search(text)
if m:
g = m.groups()
mon = MONTHS_LOWER.index(g[1].lower()) + 1
tt = (int(g[2]), mon, int(g[0]),
int(g[3]), int(g[4]), float(g[5]))
return _timegm(tt)
# No, we need some messy parsing...
# clean up
text = text.lstrip()
text = WEEKDAY_RE.sub("", text, 1) # Useless weekday
# tz is time zone specifier string
day, mon, yr, hr, min, sec, tz = [None]*7
# loose regexp parse
m = LOOSE_HTTP_DATE_RE.search(text)
if m is not None:
day, mon, yr, hr, min, sec, tz = m.groups()
else:
return None # bad format
return _str2time(day, mon, yr, hr, min, sec, tz)
ISO_DATE_RE = re.compile(
"""^
(\d{4}) # year
[-\/]?
(\d\d?) # numerical month
[-\/]?
(\d\d?) # day
(?:
(?:\s+|[-:Tt]) # separator before clock
(\d\d?):?(\d\d) # hour:min
(?::?(\d\d(?:\.\d*)?))? # optional seconds (and fractional)
)? # optional clock
\s*
([-+]?\d\d?:?(:?\d\d)?
|Z|z)? # timezone (Z is "zero meridian", i.e. GMT)
\s*$""", re.X)
def iso2time(text):
"""
As for http2time, but parses the ISO 8601 formats:
1994-02-03 14:15:29 -0100 -- ISO 8601 format
1994-02-03 14:15:29 -- zone is optional
1994-02-03 -- only date
1994-02-03T14:15:29 -- Use T as separator
19940203T141529Z -- ISO 8601 compact format
19940203 -- only date
"""
# clean up
text = text.lstrip()
# tz is time zone specifier string
day, mon, yr, hr, min, sec, tz = [None]*7
# loose regexp parse
m = ISO_DATE_RE.search(text)
if m is not None:
# XXX there's an extra bit of the timezone I'm ignoring here: is
# this the right thing to do?
yr, mon, day, hr, min, sec, tz, _ = m.groups()
else:
return None # bad format
return _str2time(day, mon, yr, hr, min, sec, tz)
# Header parsing
# -----------------------------------------------------------------------------
def unmatched(match):
"""Return unmatched part of re.Match object."""
start, end = match.span(0)
return match.string[:start]+match.string[end:]
HEADER_TOKEN_RE = re.compile(r"^\s*([^=\s;,]+)")
HEADER_QUOTED_VALUE_RE = re.compile(r"^\s*=\s*\"([^\"\\]*(?:\\.[^\"\\]*)*)\"")
HEADER_VALUE_RE = re.compile(r"^\s*=\s*([^\s;,]*)")
HEADER_ESCAPE_RE = re.compile(r"\\(.)")
def split_header_words(header_values):
r"""Parse header values into a list of lists containing key,value pairs.
The function knows how to deal with ",", ";" and "=" as well as quoted
values after "=". A list of space separated tokens are parsed as if they
were separated by ";".
If the header_values passed as argument contains multiple values, then they
are treated as if they were a single value separated by comma ",".
This means that this function is useful for parsing header fields that
follow this syntax (BNF as from the HTTP/1.1 specification, but we relax
the requirement for tokens).
headers = #header
header = (token | parameter) *( [";"] (token | parameter))
token = 1*<any CHAR except CTLs or separators>
separators = "(" | ")" | "<" | ">" | "@"
| "," | ";" | ":" | "\" | <">
| "/" | "[" | "]" | "?" | "="
| "{" | "}" | SP | HT
quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
qdtext = <any TEXT except <">>
quoted-pair = "\" CHAR
parameter = attribute "=" value
attribute = token
value = token | quoted-string
Each header is represented by a list of key/value pairs. The value for a
simple token (not part of a parameter) is None. Syntactically incorrect
headers will not necessarily be parsed as you would want.
This is easier to describe with some examples:
>>> split_header_words(['foo="bar"; port="80,81"; discard, bar=baz'])
[[('foo', 'bar'), ('port', '80,81'), ('discard', None)], [('bar', 'baz')]]
>>> split_header_words(['text/html; charset="iso-8859-1"'])
[[('text/html', None), ('charset', 'iso-8859-1')]]
>>> split_header_words([r'Basic realm="\"foo\bar\""'])
[[('Basic', None), ('realm', '"foobar"')]]
"""
assert not isinstance(header_values, basestring)
result = []
for text in header_values:
orig_text = text
pairs = []
while text:
m = HEADER_TOKEN_RE.search(text)
if m:
text = unmatched(m)
name = m.group(1)
m = HEADER_QUOTED_VALUE_RE.search(text)
if m: # quoted value
text = unmatched(m)
value = m.group(1)
value = HEADER_ESCAPE_RE.sub(r"\1", value)
else:
m = HEADER_VALUE_RE.search(text)
if m: # unquoted value
text = unmatched(m)
value = m.group(1)
value = value.rstrip()
else:
# no value, a lone token
value = None
pairs.append((name, value))
elif text.lstrip().startswith(","):
# concatenated headers, as per RFC 2616 section 4.2
text = text.lstrip()[1:]
if pairs: result.append(pairs)
pairs = []
else:
# skip junk
non_junk, nr_junk_chars = re.subn("^[=\s;]*", "", text)
assert nr_junk_chars > 0, (
"split_header_words bug: '%s', '%s', %s" %
(orig_text, text, pairs))
text = non_junk
if pairs: result.append(pairs)
return result
HEADER_JOIN_ESCAPE_RE = re.compile(r"([\"\\])")
def join_header_words(lists):
"""Do the inverse (almost) of the conversion done by split_header_words.
Takes a list of lists of (key, value) pairs and produces a single header
value. Attribute values are quoted if needed.
>>> join_header_words([[("text/plain", None), ("charset", "iso-8859/1")]])
'text/plain; charset="iso-8859/1"'
>>> join_header_words([[("text/plain", None)], [("charset", "iso-8859/1")]])
'text/plain, charset="iso-8859/1"'
"""
headers = []
for pairs in lists:
attr = []
for k, v in pairs:
if v is not None:
if not re.search(r"^\w+$", v):
v = HEADER_JOIN_ESCAPE_RE.sub(r"\\\1", v) # escape " and \
v = '"%s"' % v
k = "%s=%s" % (k, v)
attr.append(k)
if attr: headers.append("; ".join(attr))
return ", ".join(headers)
def _strip_quotes(text):
if text.startswith('"'):
text = text[1:]
if text.endswith('"'):
text = text[:-1]
return text
def parse_ns_headers(ns_headers):
"""Ad-hoc parser for Netscape protocol cookie-attributes.
The old Netscape cookie format for Set-Cookie can for instance contain
an unquoted "," in the expires field, so we have to use this ad-hoc
parser instead of split_header_words.
XXX This may not make the best possible effort to parse all the crap
that Netscape Cookie headers contain. Ronald Tschalar's HTTPClient
parser is probably better, so could do worse than following that if
this ever gives any trouble.
Currently, this is also used for parsing RFC 2109 cookies.
"""
known_attrs = ("expires", "domain", "path", "secure",
# RFC 2109 attrs (may turn up in Netscape cookies, too)
"version", "port", "max-age")
result = []
for ns_header in ns_headers:
pairs = []
version_set = False
for ii, param in enumerate(re.split(r";\s*", ns_header)):
param = param.rstrip()
if param == "": continue
if "=" not in param:
k, v = param, None
else:
k, v = re.split(r"\s*=\s*", param, 1)
k = k.lstrip()
if ii != 0:
lc = k.lower()
if lc in known_attrs:
k = lc
if k == "version":
# This is an RFC 2109 cookie.
v = _strip_quotes(v)
version_set = True
if k == "expires":
# convert expires date to seconds since epoch
v = http2time(_strip_quotes(v)) # None if invalid
pairs.append((k, v))
if pairs:
if not version_set:
pairs.append(("version", "0"))
result.append(pairs)
return result
IPV4_RE = re.compile(r"\.\d+$")
def is_HDN(text):
"""Return True if text is a host domain name."""
# XXX
# This may well be wrong. Which RFC is HDN defined in, if any (for
# the purposes of RFC 2965)?
# For the current implementation, what about IPv6? Remember to look
# at other uses of IPV4_RE also, if change this.
if IPV4_RE.search(text):
return False
if text == "":
return False
if text[0] == "." or text[-1] == ".":
return False
return True
def domain_match(A, B):
"""Return True if domain A domain-matches domain B, according to RFC 2965.
A and B may be host domain names or IP addresses.
RFC 2965, section 1:
Host names can be specified either as an IP address or a HDN string.
Sometimes we compare one host name with another. (Such comparisons SHALL
be case-insensitive.) Host A's name domain-matches host B's if
* their host name strings string-compare equal; or
* A is a HDN string and has the form NB, where N is a non-empty
name string, B has the form .B', and B' is a HDN string. (So,
x.y.com domain-matches .Y.com but not Y.com.)
Note that domain-match is not a commutative operation: a.b.c.com
domain-matches .c.com, but not the reverse.
"""
# Note that, if A or B are IP addresses, the only relevant part of the
# definition of the domain-match algorithm is the direct string-compare.
A = A.lower()
B = B.lower()
if A == B:
return True
if not is_HDN(A):
return False
i = A.rfind(B)
if i == -1 or i == 0:
# A does not have form NB, or N is the empty string
return False
if not B.startswith("."):
return False
if not is_HDN(B[1:]):
return False
return True
def liberal_is_HDN(text):
"""Return True if text is a sort-of-like a host domain name.
For accepting/blocking domains.
"""
if IPV4_RE.search(text):
return False
return True
def user_domain_match(A, B):
"""For blocking/accepting domains.
A and B may be host domain names or IP addresses.
"""
A = A.lower()
B = B.lower()
if not (liberal_is_HDN(A) and liberal_is_HDN(B)):
if A == B:
# equal IP addresses
return True
return False
initial_dot = B.startswith(".")
if initial_dot and A.endswith(B):
return True
if not initial_dot and A == B:
return True
return False
cut_port_re = re.compile(r":\d+$")
def request_host(request):
"""Return request-host, as defined by RFC 2965.
Variation from RFC: returned value is lowercased, for convenient
comparison.
"""
url = request.get_full_url()
host = urlparse.urlparse(url)[1]
if host == "":
host = request.get_header("Host", "")
# remove port, if present
host = cut_port_re.sub("", host, 1)
return host.lower()
def eff_request_host(request):
"""Return a tuple (request-host, effective request-host name).
As defined by RFC 2965, except both are lowercased.
"""
erhn = req_host = request_host(request)
if req_host.find(".") == -1 and not IPV4_RE.search(req_host):
erhn = req_host + ".local"
return req_host, erhn
def request_path(request):
"""Path component of request-URI, as defined by RFC 2965."""
url = request.get_full_url()
parts = urlparse.urlsplit(url)
path = escape_path(parts.path)
if not path.startswith("/"):
# fix bad RFC 2396 absoluteURI
path = "/" + path
return path
def request_port(request):
host = request.get_host()
i = host.find(':')
if i >= 0:
port = host[i+1:]
try:
int(port)
except ValueError:
_debug("nonnumeric port: '%s'", port)
return None
else:
port = DEFAULT_HTTP_PORT
return port
# Characters in addition to A-Z, a-z, 0-9, '_', '.', and '-' that don't
# need to be escaped to form a valid HTTP URL (RFCs 2396 and 1738).
HTTP_PATH_SAFE = "%/;:@&=+$,!~*'()"
ESCAPED_CHAR_RE = re.compile(r"%([0-9a-fA-F][0-9a-fA-F])")
def uppercase_escaped_char(match):
return "%%%s" % match.group(1).upper()
def escape_path(path):
"""Escape any invalid characters in HTTP URL, and uppercase all escapes."""
# There's no knowing what character encoding was used to create URLs
# containing %-escapes, but since we have to pick one to escape invalid
# path characters, we pick UTF-8, as recommended in the HTML 4.0
# specification:
# http://www.w3.org/TR/REC-html40/appendix/notes.html#h-B.2.1
# And here, kind of: draft-fielding-uri-rfc2396bis-03
# (And in draft IRI specification: draft-duerst-iri-05)
# (And here, for new URI schemes: RFC 2718)
if isinstance(path, unicode):
path = path.encode("utf-8")
path = urllib.quote(path, HTTP_PATH_SAFE)
path = ESCAPED_CHAR_RE.sub(uppercase_escaped_char, path)
return path
def reach(h):
"""Return reach of host h, as defined by RFC 2965, section 1.
The reach R of a host name H is defined as follows:
* If
- H is the host domain name of a host; and,
- H has the form A.B; and
- A has no embedded (that is, interior) dots; and
- B has at least one embedded dot, or B is the string "local".
then the reach of H is .B.
* Otherwise, the reach of H is H.
>>> reach("www.acme.com")
'.acme.com'
>>> reach("acme.com")
'acme.com'
>>> reach("acme.local")
'.local'
"""
i = h.find(".")
if i >= 0:
#a = h[:i] # this line is only here to show what a is
b = h[i+1:]
i = b.find(".")
if is_HDN(h) and (i >= 0 or b == "local"):
return "."+b
return h
def is_third_party(request):
"""
RFC 2965, section 3.3.6:
An unverifiable transaction is to a third-party host if its request-
host U does not domain-match the reach R of the request-host O in the
origin transaction.
"""
req_host = request_host(request)
if not domain_match(req_host, reach(request.get_origin_req_host())):
return True
else:
return False
class Cookie:
"""HTTP Cookie.
This class represents both Netscape and RFC 2965 cookies.
This is deliberately a very simple class. It just holds attributes. It's
possible to construct Cookie instances that don't comply with the cookie
standards. CookieJar.make_cookies is the factory function for Cookie
objects -- it deals with cookie parsing, supplying defaults, and
normalising to the representation used in this class. CookiePolicy is
responsible for checking them to see whether they should be accepted from
and returned to the server.
Note that the port may be present in the headers, but unspecified ("Port"
rather than"Port=80", for example); if this is the case, port is None.
"""
def __init__(self, version, name, value,
port, port_specified,
domain, domain_specified, domain_initial_dot,
path, path_specified,
secure,
expires,
discard,
comment,
comment_url,
rest,
rfc2109=False,
):
if version is not None: version = int(version)
if expires is not None: expires = int(expires)
if port is None and port_specified is True:
raise ValueError("if port is None, port_specified must be false")
self.version = version
self.name = name
self.value = value
self.port = port
self.port_specified = port_specified
# normalise case, as per RFC 2965 section 3.3.3
self.domain = domain.lower()
self.domain_specified = domain_specified
# Sigh. We need to know whether the domain given in the
# cookie-attribute had an initial dot, in order to follow RFC 2965
# (as clarified in draft errata). Needed for the returned $Domain
# value.
self.domain_initial_dot = domain_initial_dot
self.path = path
self.path_specified = path_specified
self.secure = secure
self.expires = expires
self.discard = discard
self.comment = comment
self.comment_url = comment_url
self.rfc2109 = rfc2109
self._rest = copy.copy(rest)
def has_nonstandard_attr(self, name):
return name in self._rest
def get_nonstandard_attr(self, name, default=None):
return self._rest.get(name, default)
def set_nonstandard_attr(self, name, value):
self._rest[name] = value
def is_expired(self, now=None):
if now is None: now = time.time()
if (self.expires is not None) and (self.expires <= now):
return True
return False
def __str__(self):
if self.port is None: p = ""
else: p = ":"+self.port
limit = self.domain + p + self.path
if self.value is not None:
namevalue = "%s=%s" % (self.name, self.value)
else:
namevalue = self.name
return "<Cookie %s for %s>" % (namevalue, limit)
def __repr__(self):
args = []
for name in ("version", "name", "value",
"port", "port_specified",
"domain", "domain_specified", "domain_initial_dot",
"path", "path_specified",
"secure", "expires", "discard", "comment", "comment_url",
):
attr = getattr(self, name)
args.append("%s=%s" % (name, repr(attr)))
args.append("rest=%s" % repr(self._rest))
args.append("rfc2109=%s" % repr(self.rfc2109))
return "Cookie(%s)" % ", ".join(args)
class CookiePolicy:
"""Defines which cookies get accepted from and returned to server.
May also modify cookies, though this is probably a bad idea.
The subclass DefaultCookiePolicy defines the standard rules for Netscape
and RFC 2965 cookies -- override that if you want a customised policy.
"""
def set_ok(self, cookie, request):
"""Return true if (and only if) cookie should be accepted from server.
Currently, pre-expired cookies never get this far -- the CookieJar
class deletes such cookies itself.
"""
raise NotImplementedError()
def return_ok(self, cookie, request):
"""Return true if (and only if) cookie should be returned to server."""
raise NotImplementedError()
def domain_return_ok(self, domain, request):
"""Return false if cookies should not be returned, given cookie domain.
"""
return True
def path_return_ok(self, path, request):
"""Return false if cookies should not be returned, given cookie path.
"""
return True
class DefaultCookiePolicy(CookiePolicy):
"""Implements the standard rules for accepting and returning cookies."""
DomainStrictNoDots = 1
DomainStrictNonDomain = 2
DomainRFC2965Match = 4
DomainLiberal = 0
DomainStrict = DomainStrictNoDots|DomainStrictNonDomain
def __init__(self,
blocked_domains=None, allowed_domains=None,
netscape=True, rfc2965=False,
rfc2109_as_netscape=None,
hide_cookie2=False,
strict_domain=False,
strict_rfc2965_unverifiable=True,
strict_ns_unverifiable=False,
strict_ns_domain=DomainLiberal,
strict_ns_set_initial_dollar=False,
strict_ns_set_path=False,
):
"""Constructor arguments should be passed as keyword arguments only."""
self.netscape = netscape
self.rfc2965 = rfc2965
self.rfc2109_as_netscape = rfc2109_as_netscape
self.hide_cookie2 = hide_cookie2
self.strict_domain = strict_domain
self.strict_rfc2965_unverifiable = strict_rfc2965_unverifiable
self.strict_ns_unverifiable = strict_ns_unverifiable
self.strict_ns_domain = strict_ns_domain
self.strict_ns_set_initial_dollar = strict_ns_set_initial_dollar
self.strict_ns_set_path = strict_ns_set_path
if blocked_domains is not None:
self._blocked_domains = tuple(blocked_domains)
else:
self._blocked_domains = ()
if allowed_domains is not None:
allowed_domains = tuple(allowed_domains)
self._allowed_domains = allowed_domains
def blocked_domains(self):
"""Return the sequence of blocked domains (as a tuple)."""
return self._blocked_domains
def set_blocked_domains(self, blocked_domains):
"""Set the sequence of blocked domains."""
self._blocked_domains = tuple(blocked_domains)
def is_blocked(self, domain):
for blocked_domain in self._blocked_domains:
if user_domain_match(domain, blocked_domain):
return True
return False
def allowed_domains(self):
"""Return None, or the sequence of allowed domains (as a tuple)."""
return self._allowed_domains
def set_allowed_domains(self, allowed_domains):
"""Set the sequence of allowed domains, or None."""
if allowed_domains is not None:
allowed_domains = tuple(allowed_domains)
self._allowed_domains = allowed_domains
def is_not_allowed(self, domain):
if self._allowed_domains is None:
return False
for allowed_domain in self._allowed_domains:
if user_domain_match(domain, allowed_domain):
return False
return True
def set_ok(self, cookie, request):
"""
If you override .set_ok(), be sure to call this method. If it returns
false, so should your subclass (assuming your subclass wants to be more
strict about which cookies to accept).
"""
_debug(" - checking cookie %s=%s", cookie.name, cookie.value)
assert cookie.name is not None
for n in "version", "verifiability", "name", "path", "domain", "port":
fn_name = "set_ok_"+n
fn = getattr(self, fn_name)
if not fn(cookie, request):
return False
return True
def set_ok_version(self, cookie, request):
if cookie.version is None:
# Version is always set to 0 by parse_ns_headers if it's a Netscape
# cookie, so this must be an invalid RFC 2965 cookie.
_debug(" Set-Cookie2 without version attribute (%s=%s)",
cookie.name, cookie.value)
return False
if cookie.version > 0 and not self.rfc2965:
_debug(" RFC 2965 cookies are switched off")
return False
elif cookie.version == 0 and not self.netscape:
_debug(" Netscape cookies are switched off")
return False
return True
def set_ok_verifiability(self, cookie, request):
if request.is_unverifiable() and is_third_party(request):
if cookie.version > 0 and self.strict_rfc2965_unverifiable:
_debug(" third-party RFC 2965 cookie during "
"unverifiable transaction")
return False
elif cookie.version == 0 and self.strict_ns_unverifiable:
_debug(" third-party Netscape cookie during "
"unverifiable transaction")
return False
return True
def set_ok_name(self, cookie, request):
# Try and stop servers setting V0 cookies designed to hack other
# servers that know both V0 and V1 protocols.
if (cookie.version == 0 and self.strict_ns_set_initial_dollar and
cookie.name.startswith("$")):
_debug(" illegal name (starts with '$'): '%s'", cookie.name)
return False
return True
def set_ok_path(self, cookie, request):
if cookie.path_specified:
req_path = request_path(request)
if ((cookie.version > 0 or
(cookie.version == 0 and self.strict_ns_set_path)) and
not req_path.startswith(cookie.path)):
_debug(" path attribute %s is not a prefix of request "
"path %s", cookie.path, req_path)
return False
return True
def set_ok_domain(self, cookie, request):
if self.is_blocked(cookie.domain):
_debug(" domain %s is in user block-list", cookie.domain)
return False
if self.is_not_allowed(cookie.domain):
_debug(" domain %s is not in user allow-list", cookie.domain)
return False
if cookie.domain_specified:
req_host, erhn = eff_request_host(request)
domain = cookie.domain
if self.strict_domain and (domain.count(".") >= 2):
# XXX This should probably be compared with the Konqueror
# (kcookiejar.cpp) and Mozilla implementations, but it's a
# losing battle.
i = domain.rfind(".")
j = domain.rfind(".", 0, i)
if j == 0: # domain like .foo.bar
tld = domain[i+1:]
sld = domain[j+1:i]
if sld.lower() in ("co", "ac", "com", "edu", "org", "net",
"gov", "mil", "int", "aero", "biz", "cat", "coop",
"info", "jobs", "mobi", "museum", "name", "pro",
"travel", "eu") and len(tld) == 2:
# domain like .co.uk
_debug(" country-code second level domain %s", domain)
return False
if domain.startswith("."):
undotted_domain = domain[1:]
else:
undotted_domain = domain
embedded_dots = (undotted_domain.find(".") >= 0)
if not embedded_dots and domain != ".local":
_debug(" non-local domain %s contains no embedded dot",
domain)
return False
if cookie.version == 0:
if (not erhn.endswith(domain) and
(not erhn.startswith(".") and
not ("."+erhn).endswith(domain))):
_debug(" effective request-host %s (even with added "
"initial dot) does not end end with %s",
erhn, domain)
return False
if (cookie.version > 0 or
(self.strict_ns_domain & self.DomainRFC2965Match)):
if not domain_match(erhn, domain):
_debug(" effective request-host %s does not domain-match "
"%s", erhn, domain)
return False
if (cookie.version > 0 or
(self.strict_ns_domain & self.DomainStrictNoDots)):
host_prefix = req_host[:-len(domain)]
if (host_prefix.find(".") >= 0 and
not IPV4_RE.search(req_host)):
_debug(" host prefix %s for domain %s contains a dot",
host_prefix, domain)
return False
return True
def set_ok_port(self, cookie, request):
if cookie.port_specified:
req_port = request_port(request)
if req_port is None:
req_port = "80"
else:
req_port = str(req_port)
for p in cookie.port.split(","):
try:
int(p)
except ValueError:
_debug(" bad port %s (not numeric)", p)
return False
if p == req_port:
break
else:
_debug(" request port (%s) not found in %s",
req_port, cookie.port)
return False
return True
def return_ok(self, cookie, request):
"""
If you override .return_ok(), be sure to call this method. If it
returns false, so should your subclass (assuming your subclass wants to
be more strict about which cookies to return).
"""
# Path has already been checked by .path_return_ok(), and domain
# blocking done by .domain_return_ok().
_debug(" - checking cookie %s=%s", cookie.name, cookie.value)
for n in "version", "verifiability", "secure", "expires", "port", "domain":
fn_name = "return_ok_"+n
fn = getattr(self, fn_name)
if not fn(cookie, request):
return False
return True
def return_ok_version(self, cookie, request):
if cookie.version > 0 and not self.rfc2965:
_debug(" RFC 2965 cookies are switched off")
return False
elif cookie.version == 0 and not self.netscape:
_debug(" Netscape cookies are switched off")
return False
return True
def return_ok_verifiability(self, cookie, request):
if request.is_unverifiable() and is_third_party(request):
if cookie.version > 0 and self.strict_rfc2965_unverifiable:
_debug(" third-party RFC 2965 cookie during unverifiable "
"transaction")
return False
elif cookie.version == 0 and self.strict_ns_unverifiable:
_debug(" third-party Netscape cookie during unverifiable "
"transaction")
return False
return True
def return_ok_secure(self, cookie, request):
if cookie.secure and request.get_type() != "https":
_debug(" secure cookie with non-secure request")
return False
return True
def return_ok_expires(self, cookie, request):
if cookie.is_expired(self._now):
_debug(" cookie expired")
return False
return True
def return_ok_port(self, cookie, request):
if cookie.port:
req_port = request_port(request)
if req_port is None:
req_port = "80"
for p in cookie.port.split(","):
if p == req_port:
break
else:
_debug(" request port %s does not match cookie port %s",
req_port, cookie.port)
return False
return True
def return_ok_domain(self, cookie, request):
req_host, erhn = eff_request_host(request)
domain = cookie.domain
# strict check of non-domain cookies: Mozilla does this, MSIE5 doesn't
if (cookie.version == 0 and
(self.strict_ns_domain & self.DomainStrictNonDomain) and
not cookie.domain_specified and domain != erhn):
_debug(" cookie with unspecified domain does not string-compare "
"equal to request domain")
return False
if cookie.version > 0 and not domain_match(erhn, domain):
_debug(" effective request-host name %s does not domain-match "
"RFC 2965 cookie domain %s", erhn, domain)
return False
if cookie.version == 0 and not ("."+erhn).endswith(domain):
_debug(" request-host %s does not match Netscape cookie domain "
"%s", req_host, domain)
return False
return True
def domain_return_ok(self, domain, request):
# Liberal check of. This is here as an optimization to avoid
# having to load lots of MSIE cookie files unless necessary.
req_host, erhn = eff_request_host(request)
if not req_host.startswith("."):
req_host = "."+req_host
if not erhn.startswith("."):
erhn = "."+erhn
if not (req_host.endswith(domain) or erhn.endswith(domain)):
#_debug(" request domain %s does not match cookie domain %s",
# req_host, domain)
return False
if self.is_blocked(domain):
_debug(" domain %s is in user block-list", domain)
return False
if self.is_not_allowed(domain):
_debug(" domain %s is not in user allow-list", domain)
return False
return True
def path_return_ok(self, path, request):
_debug("- checking cookie path=%s", path)
req_path = request_path(request)
if not req_path.startswith(path):
_debug(" %s does not path-match %s", req_path, path)
return False
return True
def vals_sorted_by_key(adict):
keys = adict.keys()
keys.sort()
return map(adict.get, keys)
def deepvalues(mapping):
"""Iterates over nested mapping, depth-first, in sorted order by key."""
values = vals_sorted_by_key(mapping)
for obj in values:
mapping = False
try:
obj.items
except AttributeError:
pass
else:
mapping = True
for subobj in deepvalues(obj):
yield subobj
if not mapping:
yield obj
# Used as second parameter to dict.get() method, to distinguish absent
# dict key from one with a None value.
class Absent: pass
class CookieJar:
"""Collection of HTTP cookies.
You may not need to know about this class: try
urllib2.build_opener(HTTPCookieProcessor).open(url).
"""
non_word_re = re.compile(r"\W")
quote_re = re.compile(r"([\"\\])")
strict_domain_re = re.compile(r"\.?[^.]*")
domain_re = re.compile(r"[^.]*")
dots_re = re.compile(r"^\.+")
magic_re = r"^\#LWP-Cookies-(\d+\.\d+)"
def __init__(self, policy=None):
if policy is None:
policy = DefaultCookiePolicy()
self._policy = policy
self._cookies_lock = _threading.RLock()
self._cookies = {}
def set_policy(self, policy):
self._policy = policy
def _cookies_for_domain(self, domain, request):
cookies = []
if not self._policy.domain_return_ok(domain, request):
return []
_debug("Checking %s for cookies to return", domain)
cookies_by_path = self._cookies[domain]
for path in cookies_by_path.keys():
if not self._policy.path_return_ok(path, request):
continue
cookies_by_name = cookies_by_path[path]
for cookie in cookies_by_name.values():
if not self._policy.return_ok(cookie, request):
_debug(" not returning cookie")
continue
_debug(" it's a match")
cookies.append(cookie)
return cookies
def _cookies_for_request(self, request):
"""Return a list of cookies to be returned to server."""
cookies = []
for domain in self._cookies.keys():
cookies.extend(self._cookies_for_domain(domain, request))
return cookies
def _cookie_attrs(self, cookies):
"""Return a list of cookie-attributes to be returned to server.
like ['foo="bar"; $Path="/"', ...]
The $Version attribute is also added when appropriate (currently only
once per request).
"""
# add cookies in order of most specific (ie. longest) path first
cookies.sort(key=lambda arg: len(arg.path), reverse=True)
version_set = False
attrs = []
for cookie in cookies:
# set version of Cookie header
# XXX
# What should it be if multiple matching Set-Cookie headers have
# different versions themselves?
# Answer: there is no answer; was supposed to be settled by
# RFC 2965 errata, but that may never appear...
version = cookie.version
if not version_set:
version_set = True
if version > 0:
attrs.append("$Version=%s" % version)
# quote cookie value if necessary
# (not for Netscape protocol, which already has any quotes
# intact, due to the poorly-specified Netscape Cookie: syntax)
if ((cookie.value is not None) and
self.non_word_re.search(cookie.value) and version > 0):
value = self.quote_re.sub(r"\\\1", cookie.value)
else:
value = cookie.value
# add cookie-attributes to be returned in Cookie header
if cookie.value is None:
attrs.append(cookie.name)
else:
attrs.append("%s=%s" % (cookie.name, value))
if version > 0:
if cookie.path_specified:
attrs.append('$Path="%s"' % cookie.path)
if cookie.domain.startswith("."):
domain = cookie.domain
if (not cookie.domain_initial_dot and
domain.startswith(".")):
domain = domain[1:]
attrs.append('$Domain="%s"' % domain)
if cookie.port is not None:
p = "$Port"
if cookie.port_specified:
p = p + ('="%s"' % cookie.port)
attrs.append(p)
return attrs
def add_cookie_header(self, request):
"""Add correct Cookie: header to request (urllib2.Request object).
The Cookie2 header is also added unless policy.hide_cookie2 is true.
"""
_debug("add_cookie_header")
self._cookies_lock.acquire()
try:
self._policy._now = self._now = int(time.time())
cookies = self._cookies_for_request(request)
attrs = self._cookie_attrs(cookies)
if attrs:
if not request.has_header("Cookie"):
request.add_unredirected_header(
"Cookie", "; ".join(attrs))
# if necessary, advertise that we know RFC 2965
if (self._policy.rfc2965 and not self._policy.hide_cookie2 and
not request.has_header("Cookie2")):
for cookie in cookies:
if cookie.version != 1:
request.add_unredirected_header("Cookie2", '$Version="1"')
break
finally:
self._cookies_lock.release()
self.clear_expired_cookies()
def _normalized_cookie_tuples(self, attrs_set):
"""Return list of tuples containing normalised cookie information.
attrs_set is the list of lists of key,value pairs extracted from
the Set-Cookie or Set-Cookie2 headers.
Tuples are name, value, standard, rest, where name and value are the
cookie name and value, standard is a dictionary containing the standard
cookie-attributes (discard, secure, version, expires or max-age,
domain, path and port) and rest is a dictionary containing the rest of
the cookie-attributes.
"""
cookie_tuples = []
boolean_attrs = "discard", "secure"
value_attrs = ("version",
"expires", "max-age",
"domain", "path", "port",
"comment", "commenturl")
for cookie_attrs in attrs_set:
name, value = cookie_attrs[0]
# Build dictionary of standard cookie-attributes (standard) and
# dictionary of other cookie-attributes (rest).
# Note: expiry time is normalised to seconds since epoch. V0
# cookies should have the Expires cookie-attribute, and V1 cookies
# should have Max-Age, but since V1 includes RFC 2109 cookies (and
# since V0 cookies may be a mish-mash of Netscape and RFC 2109), we
# accept either (but prefer Max-Age).
max_age_set = False
bad_cookie = False
standard = {}
rest = {}
for k, v in cookie_attrs[1:]:
lc = k.lower()
# don't lose case distinction for unknown fields
if lc in value_attrs or lc in boolean_attrs:
k = lc
if k in boolean_attrs and v is None:
# boolean cookie-attribute is present, but has no value
# (like "discard", rather than "port=80")
v = True
if k in standard:
# only first value is significant
continue
if k == "domain":
if v is None:
_debug(" missing value for domain attribute")
bad_cookie = True
break
# RFC 2965 section 3.3.3
v = v.lower()
if k == "expires":
if max_age_set:
# Prefer max-age to expires (like Mozilla)
continue
if v is None:
_debug(" missing or invalid value for expires "
"attribute: treating as session cookie")
continue
if k == "max-age":
max_age_set = True
try:
v = int(v)
except ValueError:
_debug(" missing or invalid (non-numeric) value for "
"max-age attribute")
bad_cookie = True
break
# convert RFC 2965 Max-Age to seconds since epoch
# XXX Strictly you're supposed to follow RFC 2616
# age-calculation rules. Remember that zero Max-Age is a
# is a request to discard (old and new) cookie, though.
k = "expires"
v = self._now + v
if (k in value_attrs) or (k in boolean_attrs):
if (v is None and
k not in ("port", "comment", "commenturl")):
_debug(" missing value for %s attribute" % k)
bad_cookie = True
break
standard[k] = v
else:
rest[k] = v
if bad_cookie:
continue
cookie_tuples.append((name, value, standard, rest))
return cookie_tuples
def _cookie_from_cookie_tuple(self, tup, request):
# standard is dict of standard cookie-attributes, rest is dict of the
# rest of them
name, value, standard, rest = tup
domain = standard.get("domain", Absent)
path = standard.get("path", Absent)
port = standard.get("port", Absent)
expires = standard.get("expires", Absent)
# set the easy defaults
version = standard.get("version", None)
if version is not None:
try:
version = int(version)
except ValueError:
return None # invalid version, ignore cookie
secure = standard.get("secure", False)
# (discard is also set if expires is Absent)
discard = standard.get("discard", False)
comment = standard.get("comment", None)
comment_url = standard.get("commenturl", None)
# set default path
if path is not Absent and path != "":
path_specified = True
path = escape_path(path)
else:
path_specified = False
path = request_path(request)
i = path.rfind("/")
if i != -1:
if version == 0:
# Netscape spec parts company from reality here
path = path[:i]
else:
path = path[:i+1]
if len(path) == 0: path = "/"
# set default domain
domain_specified = domain is not Absent
# but first we have to remember whether it starts with a dot
domain_initial_dot = False
if domain_specified:
domain_initial_dot = bool(domain.startswith("."))
if domain is Absent:
req_host, erhn = eff_request_host(request)
domain = erhn
elif not domain.startswith("."):
domain = "."+domain
# set default port
port_specified = False
if port is not Absent:
if port is None:
# Port attr present, but has no value: default to request port.
# Cookie should then only be sent back on that port.
port = request_port(request)
else:
port_specified = True
port = re.sub(r"\s+", "", port)
else:
# No port attr present. Cookie can be sent back on any port.
port = None
# set default expires and discard
if expires is Absent:
expires = None
discard = True
elif expires <= self._now:
# Expiry date in past is request to delete cookie. This can't be
# in DefaultCookiePolicy, because can't delete cookies there.
try:
self.clear(domain, path, name)
except KeyError:
pass
_debug("Expiring cookie, domain='%s', path='%s', name='%s'",
domain, path, name)
return None
return Cookie(version,
name, value,
port, port_specified,
domain, domain_specified, domain_initial_dot,
path, path_specified,
secure,
expires,
discard,
comment,
comment_url,
rest)
def _cookies_from_attrs_set(self, attrs_set, request):
cookie_tuples = self._normalized_cookie_tuples(attrs_set)
cookies = []
for tup in cookie_tuples:
cookie = self._cookie_from_cookie_tuple(tup, request)
if cookie: cookies.append(cookie)
return cookies
def _process_rfc2109_cookies(self, cookies):
rfc2109_as_ns = getattr(self._policy, 'rfc2109_as_netscape', None)
if rfc2109_as_ns is None:
rfc2109_as_ns = not self._policy.rfc2965
for cookie in cookies:
if cookie.version == 1:
cookie.rfc2109 = True
if rfc2109_as_ns:
# treat 2109 cookies as Netscape cookies rather than
# as RFC2965 cookies
cookie.version = 0
def make_cookies(self, response, request):
"""Return sequence of Cookie objects extracted from response object."""
# get cookie-attributes for RFC 2965 and Netscape protocols
headers = response.info()
rfc2965_hdrs = headers.getheaders("Set-Cookie2")
ns_hdrs = headers.getheaders("Set-Cookie")
rfc2965 = self._policy.rfc2965
netscape = self._policy.netscape
if ((not rfc2965_hdrs and not ns_hdrs) or
(not ns_hdrs and not rfc2965) or
(not rfc2965_hdrs and not netscape) or
(not netscape and not rfc2965)):
return [] # no relevant cookie headers: quick exit
try:
cookies = self._cookies_from_attrs_set(
split_header_words(rfc2965_hdrs), request)
except Exception:
_warn_unhandled_exception()
cookies = []
if ns_hdrs and netscape:
try:
# RFC 2109 and Netscape cookies
ns_cookies = self._cookies_from_attrs_set(
parse_ns_headers(ns_hdrs), request)
except Exception:
_warn_unhandled_exception()
ns_cookies = []
self._process_rfc2109_cookies(ns_cookies)
# Look for Netscape cookies (from Set-Cookie headers) that match
# corresponding RFC 2965 cookies (from Set-Cookie2 headers).
# For each match, keep the RFC 2965 cookie and ignore the Netscape
# cookie (RFC 2965 section 9.1). Actually, RFC 2109 cookies are
# bundled in with the Netscape cookies for this purpose, which is
# reasonable behaviour.
if rfc2965:
lookup = {}
for cookie in cookies:
lookup[(cookie.domain, cookie.path, cookie.name)] = None
def no_matching_rfc2965(ns_cookie, lookup=lookup):
key = ns_cookie.domain, ns_cookie.path, ns_cookie.name
return key not in lookup
ns_cookies = filter(no_matching_rfc2965, ns_cookies)
if ns_cookies:
cookies.extend(ns_cookies)
return cookies
def set_cookie_if_ok(self, cookie, request):
"""Set a cookie if policy says it's OK to do so."""
self._cookies_lock.acquire()
try:
self._policy._now = self._now = int(time.time())
if self._policy.set_ok(cookie, request):
self.set_cookie(cookie)
finally:
self._cookies_lock.release()
def set_cookie(self, cookie):
"""Set a cookie, without checking whether or not it should be set."""
c = self._cookies
self._cookies_lock.acquire()
try:
if cookie.domain not in c: c[cookie.domain] = {}
c2 = c[cookie.domain]
if cookie.path not in c2: c2[cookie.path] = {}
c3 = c2[cookie.path]
c3[cookie.name] = cookie
finally:
self._cookies_lock.release()
def extract_cookies(self, response, request):
"""Extract cookies from response, where allowable given the request."""
_debug("extract_cookies: %s", response.info())
self._cookies_lock.acquire()
try:
self._policy._now = self._now = int(time.time())
for cookie in self.make_cookies(response, request):
if self._policy.set_ok(cookie, request):
_debug(" setting cookie: %s", cookie)
self.set_cookie(cookie)
finally:
self._cookies_lock.release()
def clear(self, domain=None, path=None, name=None):
"""Clear some cookies.
Invoking this method without arguments will clear all cookies. If
given a single argument, only cookies belonging to that domain will be
removed. If given two arguments, cookies belonging to the specified
path within that domain are removed. If given three arguments, then
the cookie with the specified name, path and domain is removed.
Raises KeyError if no matching cookie exists.
"""
if name is not None:
if (domain is None) or (path is None):
raise ValueError(
"domain and path must be given to remove a cookie by name")
del self._cookies[domain][path][name]
elif path is not None:
if domain is None:
raise ValueError(
"domain must be given to remove cookies by path")
del self._cookies[domain][path]
elif domain is not None:
del self._cookies[domain]
else:
self._cookies = {}
def clear_session_cookies(self):
"""Discard all session cookies.
Note that the .save() method won't save session cookies anyway, unless
you ask otherwise by passing a true ignore_discard argument.
"""
self._cookies_lock.acquire()
try:
for cookie in self:
if cookie.discard:
self.clear(cookie.domain, cookie.path, cookie.name)
finally:
self._cookies_lock.release()
def clear_expired_cookies(self):
"""Discard all expired cookies.
You probably don't need to call this method: expired cookies are never
sent back to the server (provided you're using DefaultCookiePolicy),
this method is called by CookieJar itself every so often, and the
.save() method won't save expired cookies anyway (unless you ask
otherwise by passing a true ignore_expires argument).
"""
self._cookies_lock.acquire()
try:
now = time.time()
for cookie in self:
if cookie.is_expired(now):
self.clear(cookie.domain, cookie.path, cookie.name)
finally:
self._cookies_lock.release()
def __iter__(self):
return deepvalues(self._cookies)
def __len__(self):
"""Return number of contained cookies."""
i = 0
for cookie in self: i = i + 1
return i
def __repr__(self):
r = []
for cookie in self: r.append(repr(cookie))
return "<%s[%s]>" % (self.__class__, ", ".join(r))
def __str__(self):
r = []
for cookie in self: r.append(str(cookie))
return "<%s[%s]>" % (self.__class__, ", ".join(r))
# derives from IOError for backwards-compatibility with Python 2.4.0
class LoadError(IOError): pass
class FileCookieJar(CookieJar):
"""CookieJar that can be loaded from and saved to a file."""
def __init__(self, filename=None, delayload=False, policy=None):
"""
Cookies are NOT loaded from the named file until either the .load() or
.revert() method is called.
"""
CookieJar.__init__(self, policy)
if filename is not None:
try:
filename+""
except:
raise ValueError("filename must be string-like")
self.filename = filename
self.delayload = bool(delayload)
def save(self, filename=None, ignore_discard=False, ignore_expires=False):
"""Save cookies to a file."""
raise NotImplementedError()
def load(self, filename=None, ignore_discard=False, ignore_expires=False):
"""Load cookies from a file."""
if filename is None:
if self.filename is not None: filename = self.filename
else: raise ValueError(MISSING_FILENAME_TEXT)
f = open(filename)
try:
self._really_load(f, filename, ignore_discard, ignore_expires)
finally:
f.close()
def revert(self, filename=None,
ignore_discard=False, ignore_expires=False):
"""Clear all cookies and reload cookies from a saved file.
Raises LoadError (or IOError) if reversion is not successful; the
object's state will not be altered if this happens.
"""
if filename is None:
if self.filename is not None: filename = self.filename
else: raise ValueError(MISSING_FILENAME_TEXT)
self._cookies_lock.acquire()
try:
old_state = copy.deepcopy(self._cookies)
self._cookies = {}
try:
self.load(filename, ignore_discard, ignore_expires)
except (LoadError, IOError):
self._cookies = old_state
raise
finally:
self._cookies_lock.release()
from _LWPCookieJar import LWPCookieJar, lwp_cookie_str
from _MozillaCookieJar import MozillaCookieJar
| Python |
"""Interface to the compiler's internal symbol tables"""
import _symtable
from _symtable import (USE, DEF_GLOBAL, DEF_LOCAL, DEF_PARAM,
DEF_IMPORT, DEF_BOUND, OPT_IMPORT_STAR, OPT_EXEC, OPT_BARE_EXEC,
SCOPE_OFF, SCOPE_MASK, FREE, GLOBAL_IMPLICIT, GLOBAL_EXPLICIT, CELL, LOCAL)
import weakref
__all__ = ["symtable", "SymbolTable", "Class", "Function", "Symbol"]
def symtable(code, filename, compile_type):
raw = _symtable.symtable(code, filename, compile_type)
for top in raw.itervalues():
if top.name == 'top':
break
return _newSymbolTable(top, filename)
class SymbolTableFactory:
def __init__(self):
self.__memo = weakref.WeakValueDictionary()
def new(self, table, filename):
if table.type == _symtable.TYPE_FUNCTION:
return Function(table, filename)
if table.type == _symtable.TYPE_CLASS:
return Class(table, filename)
return SymbolTable(table, filename)
def __call__(self, table, filename):
key = table, filename
obj = self.__memo.get(key, None)
if obj is None:
obj = self.__memo[key] = self.new(table, filename)
return obj
_newSymbolTable = SymbolTableFactory()
class SymbolTable(object):
def __init__(self, raw_table, filename):
self._table = raw_table
self._filename = filename
self._symbols = {}
def __repr__(self):
if self.__class__ == SymbolTable:
kind = ""
else:
kind = "%s " % self.__class__.__name__
if self._table.name == "global":
return "<{0}SymbolTable for module {1}>".format(kind, self._filename)
else:
return "<{0}SymbolTable for {1} in {2}>".format(kind,
self._table.name,
self._filename)
def get_type(self):
if self._table.type == _symtable.TYPE_MODULE:
return "module"
if self._table.type == _symtable.TYPE_FUNCTION:
return "function"
if self._table.type == _symtable.TYPE_CLASS:
return "class"
assert self._table.type in (1, 2, 3), \
"unexpected type: {0}".format(self._table.type)
def get_id(self):
return self._table.id
def get_name(self):
return self._table.name
def get_lineno(self):
return self._table.lineno
def is_optimized(self):
return bool(self._table.type == _symtable.TYPE_FUNCTION
and not self._table.optimized)
def is_nested(self):
return bool(self._table.nested)
def has_children(self):
return bool(self._table.children)
def has_exec(self):
"""Return true if the scope uses exec"""
return bool(self._table.optimized & (OPT_EXEC | OPT_BARE_EXEC))
def has_import_star(self):
"""Return true if the scope uses import *"""
return bool(self._table.optimized & OPT_IMPORT_STAR)
def get_identifiers(self):
return self._table.symbols.keys()
def lookup(self, name):
sym = self._symbols.get(name)
if sym is None:
flags = self._table.symbols[name]
namespaces = self.__check_children(name)
sym = self._symbols[name] = Symbol(name, flags, namespaces)
return sym
def get_symbols(self):
return [self.lookup(ident) for ident in self.get_identifiers()]
def __check_children(self, name):
return [_newSymbolTable(st, self._filename)
for st in self._table.children
if st.name == name]
def get_children(self):
return [_newSymbolTable(st, self._filename)
for st in self._table.children]
class Function(SymbolTable):
# Default values for instance variables
__params = None
__locals = None
__frees = None
__globals = None
def __idents_matching(self, test_func):
return tuple([ident for ident in self.get_identifiers()
if test_func(self._table.symbols[ident])])
def get_parameters(self):
if self.__params is None:
self.__params = self.__idents_matching(lambda x:x & DEF_PARAM)
return self.__params
def get_locals(self):
if self.__locals is None:
locs = (LOCAL, CELL)
test = lambda x: ((x >> SCOPE_OFF) & SCOPE_MASK) in locs
self.__locals = self.__idents_matching(test)
return self.__locals
def get_globals(self):
if self.__globals is None:
glob = (GLOBAL_IMPLICIT, GLOBAL_EXPLICIT)
test = lambda x:((x >> SCOPE_OFF) & SCOPE_MASK) in glob
self.__globals = self.__idents_matching(test)
return self.__globals
def get_frees(self):
if self.__frees is None:
is_free = lambda x:((x >> SCOPE_OFF) & SCOPE_MASK) == FREE
self.__frees = self.__idents_matching(is_free)
return self.__frees
class Class(SymbolTable):
__methods = None
def get_methods(self):
if self.__methods is None:
d = {}
for st in self._table.children:
d[st.name] = 1
self.__methods = tuple(d)
return self.__methods
class Symbol(object):
def __init__(self, name, flags, namespaces=None):
self.__name = name
self.__flags = flags
self.__scope = (flags >> SCOPE_OFF) & SCOPE_MASK # like PyST_GetScope()
self.__namespaces = namespaces or ()
def __repr__(self):
return "<symbol {0!r}>".format(self.__name)
def get_name(self):
return self.__name
def is_referenced(self):
return bool(self.__flags & _symtable.USE)
def is_parameter(self):
return bool(self.__flags & DEF_PARAM)
def is_global(self):
return bool(self.__scope in (GLOBAL_IMPLICIT, GLOBAL_EXPLICIT))
def is_declared_global(self):
return bool(self.__scope == GLOBAL_EXPLICIT)
def is_local(self):
return bool(self.__flags & DEF_BOUND)
def is_free(self):
return bool(self.__scope == FREE)
def is_imported(self):
return bool(self.__flags & DEF_IMPORT)
def is_assigned(self):
return bool(self.__flags & DEF_LOCAL)
def is_namespace(self):
"""Returns true if name binding introduces new namespace.
If the name is used as the target of a function or class
statement, this will be true.
Note that a single name can be bound to multiple objects. If
is_namespace() is true, the name may also be bound to other
objects, like an int or list, that does not introduce a new
namespace.
"""
return bool(self.__namespaces)
def get_namespaces(self):
"""Return a list of namespaces bound to this name"""
return self.__namespaces
def get_namespace(self):
"""Returns the single namespace bound to this name.
Raises ValueError if the name is bound to multiple namespaces.
"""
if len(self.__namespaces) != 1:
raise ValueError, "name is bound to multiple namespaces"
return self.__namespaces[0]
if __name__ == "__main__":
import os, sys
src = open(sys.argv[0]).read()
mod = symtable(src, os.path.split(sys.argv[0])[1], "exec")
for ident in mod.get_identifiers():
info = mod.lookup(ident)
print info, info.is_local(), info.is_namespace()
| Python |
"""Convert "arbitrary" sound files to AIFF (Apple and SGI's audio format).
Input may be compressed.
Uncompressed file type may be AIFF, WAV, VOC, 8SVX, NeXT/Sun, and others.
An exception is raised if the file is not of a recognized type.
Returned filename is either the input filename or a temporary filename;
in the latter case the caller must ensure that it is removed.
Other temporary files used are removed by the function.
"""
from warnings import warnpy3k
warnpy3k("the toaiff module has been removed in Python 3.0", stacklevel=2)
del warnpy3k
import os
import tempfile
import pipes
import sndhdr
__all__ = ["error", "toaiff"]
table = {}
t = pipes.Template()
t.append('sox -t au - -t aiff -r 8000 -', '--')
table['au'] = t
# XXX The following is actually sub-optimal.
# XXX The HCOM sampling rate can be 22k, 22k/2, 22k/3 or 22k/4.
# XXX We must force the output sampling rate else the SGI won't play
# XXX files sampled at 5.5k or 7.333k; however this means that files
# XXX sampled at 11k are unnecessarily expanded.
# XXX Similar comments apply to some other file types.
t = pipes.Template()
t.append('sox -t hcom - -t aiff -r 22050 -', '--')
table['hcom'] = t
t = pipes.Template()
t.append('sox -t voc - -t aiff -r 11025 -', '--')
table['voc'] = t
t = pipes.Template()
t.append('sox -t wav - -t aiff -', '--')
table['wav'] = t
t = pipes.Template()
t.append('sox -t 8svx - -t aiff -r 16000 -', '--')
table['8svx'] = t
t = pipes.Template()
t.append('sox -t sndt - -t aiff -r 16000 -', '--')
table['sndt'] = t
t = pipes.Template()
t.append('sox -t sndr - -t aiff -r 16000 -', '--')
table['sndr'] = t
uncompress = pipes.Template()
uncompress.append('uncompress', '--')
class error(Exception):
pass
def toaiff(filename):
temps = []
ret = None
try:
ret = _toaiff(filename, temps)
finally:
for temp in temps[:]:
if temp != ret:
try:
os.unlink(temp)
except os.error:
pass
temps.remove(temp)
return ret
def _toaiff(filename, temps):
if filename[-2:] == '.Z':
(fd, fname) = tempfile.mkstemp()
os.close(fd)
temps.append(fname)
sts = uncompress.copy(filename, fname)
if sts:
raise error, filename + ': uncompress failed'
else:
fname = filename
try:
ftype = sndhdr.whathdr(fname)
if ftype:
ftype = ftype[0] # All we're interested in
except IOError, msg:
if type(msg) == type(()) and len(msg) == 2 and \
type(msg[0]) == type(0) and type(msg[1]) == type(''):
msg = msg[1]
if type(msg) != type(''):
msg = repr(msg)
raise error, filename + ': ' + msg
if ftype == 'aiff':
return fname
if ftype is None or not ftype in table:
raise error, '%s: unsupported audio file type %r' % (filename, ftype)
(fd, temp) = tempfile.mkstemp()
os.close(fd)
temps.append(temp)
sts = table[ftype].copy(fname, temp)
if sts:
raise error, filename + ': conversion to aiff failed'
return temp
| Python |
#
# Secret Labs' Regular Expression Engine
#
# convert template to internal format
#
# Copyright (c) 1997-2001 by Secret Labs AB. All rights reserved.
#
# See the sre.py file for information on usage and redistribution.
#
"""Internal support module for sre"""
import _sre, sys
import sre_parse
from sre_constants import *
assert _sre.MAGIC == MAGIC, "SRE module mismatch"
if _sre.CODESIZE == 2:
MAXCODE = 65535
else:
MAXCODE = 0xFFFFFFFFL
def _identityfunction(x):
return x
_LITERAL_CODES = set([LITERAL, NOT_LITERAL])
_REPEATING_CODES = set([REPEAT, MIN_REPEAT, MAX_REPEAT])
_SUCCESS_CODES = set([SUCCESS, FAILURE])
_ASSERT_CODES = set([ASSERT, ASSERT_NOT])
def _compile(code, pattern, flags):
# internal: compile a (sub)pattern
emit = code.append
_len = len
LITERAL_CODES = _LITERAL_CODES
REPEATING_CODES = _REPEATING_CODES
SUCCESS_CODES = _SUCCESS_CODES
ASSERT_CODES = _ASSERT_CODES
for op, av in pattern:
if op in LITERAL_CODES:
if flags & SRE_FLAG_IGNORECASE:
emit(OPCODES[OP_IGNORE[op]])
emit(_sre.getlower(av, flags))
else:
emit(OPCODES[op])
emit(av)
elif op is IN:
if flags & SRE_FLAG_IGNORECASE:
emit(OPCODES[OP_IGNORE[op]])
def fixup(literal, flags=flags):
return _sre.getlower(literal, flags)
else:
emit(OPCODES[op])
fixup = _identityfunction
skip = _len(code); emit(0)
_compile_charset(av, flags, code, fixup)
code[skip] = _len(code) - skip
elif op is ANY:
if flags & SRE_FLAG_DOTALL:
emit(OPCODES[ANY_ALL])
else:
emit(OPCODES[ANY])
elif op in REPEATING_CODES:
if flags & SRE_FLAG_TEMPLATE:
raise error, "internal: unsupported template operator"
emit(OPCODES[REPEAT])
skip = _len(code); emit(0)
emit(av[0])
emit(av[1])
_compile(code, av[2], flags)
emit(OPCODES[SUCCESS])
code[skip] = _len(code) - skip
elif _simple(av) and op is not REPEAT:
if op is MAX_REPEAT:
emit(OPCODES[REPEAT_ONE])
else:
emit(OPCODES[MIN_REPEAT_ONE])
skip = _len(code); emit(0)
emit(av[0])
emit(av[1])
_compile(code, av[2], flags)
emit(OPCODES[SUCCESS])
code[skip] = _len(code) - skip
else:
emit(OPCODES[REPEAT])
skip = _len(code); emit(0)
emit(av[0])
emit(av[1])
_compile(code, av[2], flags)
code[skip] = _len(code) - skip
if op is MAX_REPEAT:
emit(OPCODES[MAX_UNTIL])
else:
emit(OPCODES[MIN_UNTIL])
elif op is SUBPATTERN:
if av[0]:
emit(OPCODES[MARK])
emit((av[0]-1)*2)
# _compile_info(code, av[1], flags)
_compile(code, av[1], flags)
if av[0]:
emit(OPCODES[MARK])
emit((av[0]-1)*2+1)
elif op in SUCCESS_CODES:
emit(OPCODES[op])
elif op in ASSERT_CODES:
emit(OPCODES[op])
skip = _len(code); emit(0)
if av[0] >= 0:
emit(0) # look ahead
else:
lo, hi = av[1].getwidth()
if lo != hi:
raise error, "look-behind requires fixed-width pattern"
emit(lo) # look behind
_compile(code, av[1], flags)
emit(OPCODES[SUCCESS])
code[skip] = _len(code) - skip
elif op is CALL:
emit(OPCODES[op])
skip = _len(code); emit(0)
_compile(code, av, flags)
emit(OPCODES[SUCCESS])
code[skip] = _len(code) - skip
elif op is AT:
emit(OPCODES[op])
if flags & SRE_FLAG_MULTILINE:
av = AT_MULTILINE.get(av, av)
if flags & SRE_FLAG_LOCALE:
av = AT_LOCALE.get(av, av)
elif flags & SRE_FLAG_UNICODE:
av = AT_UNICODE.get(av, av)
emit(ATCODES[av])
elif op is BRANCH:
emit(OPCODES[op])
tail = []
tailappend = tail.append
for av in av[1]:
skip = _len(code); emit(0)
# _compile_info(code, av, flags)
_compile(code, av, flags)
emit(OPCODES[JUMP])
tailappend(_len(code)); emit(0)
code[skip] = _len(code) - skip
emit(0) # end of branch
for tail in tail:
code[tail] = _len(code) - tail
elif op is CATEGORY:
emit(OPCODES[op])
if flags & SRE_FLAG_LOCALE:
av = CH_LOCALE[av]
elif flags & SRE_FLAG_UNICODE:
av = CH_UNICODE[av]
emit(CHCODES[av])
elif op is GROUPREF:
if flags & SRE_FLAG_IGNORECASE:
emit(OPCODES[OP_IGNORE[op]])
else:
emit(OPCODES[op])
emit(av-1)
elif op is GROUPREF_EXISTS:
emit(OPCODES[op])
emit(av[0]-1)
skipyes = _len(code); emit(0)
_compile(code, av[1], flags)
if av[2]:
emit(OPCODES[JUMP])
skipno = _len(code); emit(0)
code[skipyes] = _len(code) - skipyes + 1
_compile(code, av[2], flags)
code[skipno] = _len(code) - skipno
else:
code[skipyes] = _len(code) - skipyes + 1
else:
raise ValueError, ("unsupported operand type", op)
def _compile_charset(charset, flags, code, fixup=None):
# compile charset subprogram
emit = code.append
if fixup is None:
fixup = _identityfunction
for op, av in _optimize_charset(charset, fixup):
emit(OPCODES[op])
if op is NEGATE:
pass
elif op is LITERAL:
emit(fixup(av))
elif op is RANGE:
emit(fixup(av[0]))
emit(fixup(av[1]))
elif op is CHARSET:
code.extend(av)
elif op is BIGCHARSET:
code.extend(av)
elif op is CATEGORY:
if flags & SRE_FLAG_LOCALE:
emit(CHCODES[CH_LOCALE[av]])
elif flags & SRE_FLAG_UNICODE:
emit(CHCODES[CH_UNICODE[av]])
else:
emit(CHCODES[av])
else:
raise error, "internal: unsupported set operator"
emit(OPCODES[FAILURE])
def _optimize_charset(charset, fixup):
# internal: optimize character set
out = []
outappend = out.append
charmap = [0]*256
try:
for op, av in charset:
if op is NEGATE:
outappend((op, av))
elif op is LITERAL:
charmap[fixup(av)] = 1
elif op is RANGE:
for i in range(fixup(av[0]), fixup(av[1])+1):
charmap[i] = 1
elif op is CATEGORY:
# XXX: could append to charmap tail
return charset # cannot compress
except IndexError:
# character set contains unicode characters
return _optimize_unicode(charset, fixup)
# compress character map
i = p = n = 0
runs = []
runsappend = runs.append
for c in charmap:
if c:
if n == 0:
p = i
n = n + 1
elif n:
runsappend((p, n))
n = 0
i = i + 1
if n:
runsappend((p, n))
if len(runs) <= 2:
# use literal/range
for p, n in runs:
if n == 1:
outappend((LITERAL, p))
else:
outappend((RANGE, (p, p+n-1)))
if len(out) < len(charset):
return out
else:
# use bitmap
data = _mk_bitmap(charmap)
outappend((CHARSET, data))
return out
return charset
def _mk_bitmap(bits):
data = []
dataappend = data.append
if _sre.CODESIZE == 2:
start = (1, 0)
else:
start = (1L, 0L)
m, v = start
for c in bits:
if c:
v = v + m
m = m + m
if m > MAXCODE:
dataappend(v)
m, v = start
return data
# To represent a big charset, first a bitmap of all characters in the
# set is constructed. Then, this bitmap is sliced into chunks of 256
# characters, duplicate chunks are eliminated, and each chunk is
# given a number. In the compiled expression, the charset is
# represented by a 16-bit word sequence, consisting of one word for
# the number of different chunks, a sequence of 256 bytes (128 words)
# of chunk numbers indexed by their original chunk position, and a
# sequence of chunks (16 words each).
# Compression is normally good: in a typical charset, large ranges of
# Unicode will be either completely excluded (e.g. if only cyrillic
# letters are to be matched), or completely included (e.g. if large
# subranges of Kanji match). These ranges will be represented by
# chunks of all one-bits or all zero-bits.
# Matching can be also done efficiently: the more significant byte of
# the Unicode character is an index into the chunk number, and the
# less significant byte is a bit index in the chunk (just like the
# CHARSET matching).
# In UCS-4 mode, the BIGCHARSET opcode still supports only subsets
# of the basic multilingual plane; an efficient representation
# for all of UTF-16 has not yet been developed. This means,
# in particular, that negated charsets cannot be represented as
# bigcharsets.
def _optimize_unicode(charset, fixup):
try:
import array
except ImportError:
return charset
charmap = [0]*65536
negate = 0
try:
for op, av in charset:
if op is NEGATE:
negate = 1
elif op is LITERAL:
charmap[fixup(av)] = 1
elif op is RANGE:
for i in xrange(fixup(av[0]), fixup(av[1])+1):
charmap[i] = 1
elif op is CATEGORY:
# XXX: could expand category
return charset # cannot compress
except IndexError:
# non-BMP characters
return charset
if negate:
if sys.maxunicode != 65535:
# XXX: negation does not work with big charsets
return charset
for i in xrange(65536):
charmap[i] = not charmap[i]
comps = {}
mapping = [0]*256
block = 0
data = []
for i in xrange(256):
chunk = tuple(charmap[i*256:(i+1)*256])
new = comps.setdefault(chunk, block)
mapping[i] = new
if new == block:
block = block + 1
data = data + _mk_bitmap(chunk)
header = [block]
if _sre.CODESIZE == 2:
code = 'H'
else:
code = 'I'
# Convert block indices to byte array of 256 bytes
mapping = array.array('b', mapping).tostring()
# Convert byte array to word array
mapping = array.array(code, mapping)
assert mapping.itemsize == _sre.CODESIZE
header = header + mapping.tolist()
data[0:0] = header
return [(BIGCHARSET, data)]
def _simple(av):
# check if av is a "simple" operator
lo, hi = av[2].getwidth()
if lo == 0 and hi == MAXREPEAT:
raise error, "nothing to repeat"
return lo == hi == 1 and av[2][0][0] != SUBPATTERN
def _compile_info(code, pattern, flags):
# internal: compile an info block. in the current version,
# this contains min/max pattern width, and an optional literal
# prefix or a character map
lo, hi = pattern.getwidth()
if lo == 0:
return # not worth it
# look for a literal prefix
prefix = []
prefixappend = prefix.append
prefix_skip = 0
charset = [] # not used
charsetappend = charset.append
if not (flags & SRE_FLAG_IGNORECASE):
# look for literal prefix
for op, av in pattern.data:
if op is LITERAL:
if len(prefix) == prefix_skip:
prefix_skip = prefix_skip + 1
prefixappend(av)
elif op is SUBPATTERN and len(av[1]) == 1:
op, av = av[1][0]
if op is LITERAL:
prefixappend(av)
else:
break
else:
break
# if no prefix, look for charset prefix
if not prefix and pattern.data:
op, av = pattern.data[0]
if op is SUBPATTERN and av[1]:
op, av = av[1][0]
if op is LITERAL:
charsetappend((op, av))
elif op is BRANCH:
c = []
cappend = c.append
for p in av[1]:
if not p:
break
op, av = p[0]
if op is LITERAL:
cappend((op, av))
else:
break
else:
charset = c
elif op is BRANCH:
c = []
cappend = c.append
for p in av[1]:
if not p:
break
op, av = p[0]
if op is LITERAL:
cappend((op, av))
else:
break
else:
charset = c
elif op is IN:
charset = av
## if prefix:
## print "*** PREFIX", prefix, prefix_skip
## if charset:
## print "*** CHARSET", charset
# add an info block
emit = code.append
emit(OPCODES[INFO])
skip = len(code); emit(0)
# literal flag
mask = 0
if prefix:
mask = SRE_INFO_PREFIX
if len(prefix) == prefix_skip == len(pattern.data):
mask = mask + SRE_INFO_LITERAL
elif charset:
mask = mask + SRE_INFO_CHARSET
emit(mask)
# pattern length
if lo < MAXCODE:
emit(lo)
else:
emit(MAXCODE)
prefix = prefix[:MAXCODE]
if hi < MAXCODE:
emit(hi)
else:
emit(0)
# add literal prefix
if prefix:
emit(len(prefix)) # length
emit(prefix_skip) # skip
code.extend(prefix)
# generate overlap table
table = [-1] + ([0]*len(prefix))
for i in xrange(len(prefix)):
table[i+1] = table[i]+1
while table[i+1] > 0 and prefix[i] != prefix[table[i+1]-1]:
table[i+1] = table[table[i+1]-1]+1
code.extend(table[1:]) # don't store first entry
elif charset:
_compile_charset(charset, flags, code)
code[skip] = len(code) - skip
try:
unicode
except NameError:
STRING_TYPES = (type(""),)
else:
STRING_TYPES = (type(""), type(unicode("")))
def isstring(obj):
for tp in STRING_TYPES:
if isinstance(obj, tp):
return 1
return 0
def _code(p, flags):
flags = p.pattern.flags | flags
code = []
# compile info block
_compile_info(code, p, flags)
# compile the pattern
_compile(code, p.data, flags)
code.append(OPCODES[SUCCESS])
return code
def compile(p, flags=0):
# internal: convert pattern list to internal format
if isstring(p):
pattern = p
p = sre_parse.parse(p, flags)
else:
pattern = None
code = _code(p, flags)
# print code
# XXX: <fl> get rid of this limitation!
if p.pattern.groups > 100:
raise AssertionError(
"sorry, but this version only supports 100 named groups"
)
# map in either direction
groupindex = p.pattern.groupdict
indexgroup = [None] * p.pattern.groups
for k, i in groupindex.items():
indexgroup[i] = k
return _sre.compile(
pattern, flags | p.pattern.flags, code,
p.pattern.groups-1,
groupindex, indexgroup
)
| Python |
#! /usr/bin/env python
"""Python interface for the 'lsprof' profiler.
Compatible with the 'profile' module.
"""
__all__ = ["run", "runctx", "help", "Profile"]
import _lsprof
# ____________________________________________________________
# Simple interface
def run(statement, filename=None, sort=-1):
"""Run statement under profiler optionally saving results in filename
This function takes a single argument that can be passed to the
"exec" statement, and an optional file name. In all cases this
routine attempts to "exec" its first argument and gather profiling
statistics from the execution. If no file name is present, then this
function automatically prints a simple profiling report, sorted by the
standard name string (file/line/function-name) that is presented in
each line.
"""
prof = Profile()
result = None
try:
try:
prof = prof.run(statement)
except SystemExit:
pass
finally:
if filename is not None:
prof.dump_stats(filename)
else:
result = prof.print_stats(sort)
return result
def runctx(statement, globals, locals, filename=None, sort=-1):
"""Run statement under profiler, supplying your own globals and locals,
optionally saving results in filename.
statement and filename have the same semantics as profile.run
"""
prof = Profile()
result = None
try:
try:
prof = prof.runctx(statement, globals, locals)
except SystemExit:
pass
finally:
if filename is not None:
prof.dump_stats(filename)
else:
result = prof.print_stats(sort)
return result
# Backwards compatibility.
def help():
print "Documentation for the profile/cProfile modules can be found "
print "in the Python Library Reference, section 'The Python Profiler'."
# ____________________________________________________________
class Profile(_lsprof.Profiler):
"""Profile(custom_timer=None, time_unit=None, subcalls=True, builtins=True)
Builds a profiler object using the specified timer function.
The default timer is a fast built-in one based on real time.
For custom timer functions returning integers, time_unit can
be a float specifying a scale (i.e. how long each integer unit
is, in seconds).
"""
# Most of the functionality is in the base class.
# This subclass only adds convenient and backward-compatible methods.
def print_stats(self, sort=-1):
import pstats
pstats.Stats(self).strip_dirs().sort_stats(sort).print_stats()
def dump_stats(self, file):
import marshal
f = open(file, 'wb')
self.create_stats()
marshal.dump(self.stats, f)
f.close()
def create_stats(self):
self.disable()
self.snapshot_stats()
def snapshot_stats(self):
entries = self.getstats()
self.stats = {}
callersdicts = {}
# call information
for entry in entries:
func = label(entry.code)
nc = entry.callcount # ncalls column of pstats (before '/')
cc = nc - entry.reccallcount # ncalls column of pstats (after '/')
tt = entry.inlinetime # tottime column of pstats
ct = entry.totaltime # cumtime column of pstats
callers = {}
callersdicts[id(entry.code)] = callers
self.stats[func] = cc, nc, tt, ct, callers
# subcall information
for entry in entries:
if entry.calls:
func = label(entry.code)
for subentry in entry.calls:
try:
callers = callersdicts[id(subentry.code)]
except KeyError:
continue
nc = subentry.callcount
cc = nc - subentry.reccallcount
tt = subentry.inlinetime
ct = subentry.totaltime
if func in callers:
prev = callers[func]
nc += prev[0]
cc += prev[1]
tt += prev[2]
ct += prev[3]
callers[func] = nc, cc, tt, ct
# The following two methods can be called by clients to use
# a profiler to profile a statement, given as a string.
def run(self, cmd):
import __main__
dict = __main__.__dict__
return self.runctx(cmd, dict, dict)
def runctx(self, cmd, globals, locals):
self.enable()
try:
exec cmd in globals, locals
finally:
self.disable()
return self
# This method is more useful to profile a single function call.
def runcall(self, func, *args, **kw):
self.enable()
try:
return func(*args, **kw)
finally:
self.disable()
# ____________________________________________________________
def label(code):
if isinstance(code, str):
return ('~', 0, code) # built-in functions ('~' sorts at the end)
else:
return (code.co_filename, code.co_firstlineno, code.co_name)
# ____________________________________________________________
def main():
import os, sys
from optparse import OptionParser
usage = "cProfile.py [-o output_file_path] [-s sort] scriptfile [arg] ..."
parser = OptionParser(usage=usage)
parser.allow_interspersed_args = False
parser.add_option('-o', '--outfile', dest="outfile",
help="Save stats to <outfile>", default=None)
parser.add_option('-s', '--sort', dest="sort",
help="Sort order when printing to stdout, based on pstats.Stats class",
default=-1)
if not sys.argv[1:]:
parser.print_usage()
sys.exit(2)
(options, args) = parser.parse_args()
sys.argv[:] = args
if len(args) > 0:
progname = args[0]
sys.path.insert(0, os.path.dirname(progname))
with open(progname, 'rb') as fp:
code = compile(fp.read(), progname, 'exec')
globs = {
'__file__': progname,
'__name__': '__main__',
'__package__': None,
}
runctx(code, globs, None, options.outfile, options.sort)
else:
parser.print_usage()
return parser
# When invoked as main program, invoke the profiler on a script
if __name__ == '__main__':
main()
| Python |
"""An NNTP client class based on RFC 977: Network News Transfer Protocol.
Example:
>>> from nntplib import NNTP
>>> s = NNTP('news')
>>> resp, count, first, last, name = s.group('comp.lang.python')
>>> print 'Group', name, 'has', count, 'articles, range', first, 'to', last
Group comp.lang.python has 51 articles, range 5770 to 5821
>>> resp, subs = s.xhdr('subject', first + '-' + last)
>>> resp = s.quit()
>>>
Here 'resp' is the server response line.
Error responses are turned into exceptions.
To post an article from a file:
>>> f = open(filename, 'r') # file containing article, including header
>>> resp = s.post(f)
>>>
For descriptions of all methods, read the comments in the code below.
Note that all arguments and return values representing article numbers
are strings, not numbers, since they are rarely used for calculations.
"""
# RFC 977 by Brian Kantor and Phil Lapsley.
# xover, xgtitle, xpath, date methods by Kevan Heydon
# Imports
import re
import socket
__all__ = ["NNTP","NNTPReplyError","NNTPTemporaryError",
"NNTPPermanentError","NNTPProtocolError","NNTPDataError",
"error_reply","error_temp","error_perm","error_proto",
"error_data",]
# Exceptions raised when an error or invalid response is received
class NNTPError(Exception):
"""Base class for all nntplib exceptions"""
def __init__(self, *args):
Exception.__init__(self, *args)
try:
self.response = args[0]
except IndexError:
self.response = 'No response given'
class NNTPReplyError(NNTPError):
"""Unexpected [123]xx reply"""
pass
class NNTPTemporaryError(NNTPError):
"""4xx errors"""
pass
class NNTPPermanentError(NNTPError):
"""5xx errors"""
pass
class NNTPProtocolError(NNTPError):
"""Response does not begin with [1-5]"""
pass
class NNTPDataError(NNTPError):
"""Error in response data"""
pass
# for backwards compatibility
error_reply = NNTPReplyError
error_temp = NNTPTemporaryError
error_perm = NNTPPermanentError
error_proto = NNTPProtocolError
error_data = NNTPDataError
# Standard port used by NNTP servers
NNTP_PORT = 119
# Response numbers that are followed by additional text (e.g. article)
LONGRESP = ['100', '215', '220', '221', '222', '224', '230', '231', '282']
# Line terminators (we always output CRLF, but accept any of CRLF, CR, LF)
CRLF = '\r\n'
# The class itself
class NNTP:
def __init__(self, host, port=NNTP_PORT, user=None, password=None,
readermode=None, usenetrc=True):
"""Initialize an instance. Arguments:
- host: hostname to connect to
- port: port to connect to (default the standard NNTP port)
- user: username to authenticate with
- password: password to use with username
- readermode: if true, send 'mode reader' command after
connecting.
readermode is sometimes necessary if you are connecting to an
NNTP server on the local machine and intend to call
reader-specific comamnds, such as `group'. If you get
unexpected NNTPPermanentErrors, you might need to set
readermode.
"""
self.host = host
self.port = port
self.sock = socket.create_connection((host, port))
self.file = self.sock.makefile('rb')
self.debugging = 0
self.welcome = self.getresp()
# 'mode reader' is sometimes necessary to enable 'reader' mode.
# However, the order in which 'mode reader' and 'authinfo' need to
# arrive differs between some NNTP servers. Try to send
# 'mode reader', and if it fails with an authorization failed
# error, try again after sending authinfo.
readermode_afterauth = 0
if readermode:
try:
self.welcome = self.shortcmd('mode reader')
except NNTPPermanentError:
# error 500, probably 'not implemented'
pass
except NNTPTemporaryError, e:
if user and e.response[:3] == '480':
# Need authorization before 'mode reader'
readermode_afterauth = 1
else:
raise
# If no login/password was specified, try to get them from ~/.netrc
# Presume that if .netc has an entry, NNRP authentication is required.
try:
if usenetrc and not user:
import netrc
credentials = netrc.netrc()
auth = credentials.authenticators(host)
if auth:
user = auth[0]
password = auth[2]
except IOError:
pass
# Perform NNRP authentication if needed.
if user:
resp = self.shortcmd('authinfo user '+user)
if resp[:3] == '381':
if not password:
raise NNTPReplyError(resp)
else:
resp = self.shortcmd(
'authinfo pass '+password)
if resp[:3] != '281':
raise NNTPPermanentError(resp)
if readermode_afterauth:
try:
self.welcome = self.shortcmd('mode reader')
except NNTPPermanentError:
# error 500, probably 'not implemented'
pass
# Get the welcome message from the server
# (this is read and squirreled away by __init__()).
# If the response code is 200, posting is allowed;
# if it 201, posting is not allowed
def getwelcome(self):
"""Get the welcome message from the server
(this is read and squirreled away by __init__()).
If the response code is 200, posting is allowed;
if it 201, posting is not allowed."""
if self.debugging: print '*welcome*', repr(self.welcome)
return self.welcome
def set_debuglevel(self, level):
"""Set the debugging level. Argument 'level' means:
0: no debugging output (default)
1: print commands and responses but not body text etc.
2: also print raw lines read and sent before stripping CR/LF"""
self.debugging = level
debug = set_debuglevel
def putline(self, line):
"""Internal: send one line to the server, appending CRLF."""
line = line + CRLF
if self.debugging > 1: print '*put*', repr(line)
self.sock.sendall(line)
def putcmd(self, line):
"""Internal: send one command to the server (through putline())."""
if self.debugging: print '*cmd*', repr(line)
self.putline(line)
def getline(self):
"""Internal: return one line from the server, stripping CRLF.
Raise EOFError if the connection is closed."""
line = self.file.readline()
if self.debugging > 1:
print '*get*', repr(line)
if not line: raise EOFError
if line[-2:] == CRLF: line = line[:-2]
elif line[-1:] in CRLF: line = line[:-1]
return line
def getresp(self):
"""Internal: get a response from the server.
Raise various errors if the response indicates an error."""
resp = self.getline()
if self.debugging: print '*resp*', repr(resp)
c = resp[:1]
if c == '4':
raise NNTPTemporaryError(resp)
if c == '5':
raise NNTPPermanentError(resp)
if c not in '123':
raise NNTPProtocolError(resp)
return resp
def getlongresp(self, file=None):
"""Internal: get a response plus following text from the server.
Raise various errors if the response indicates an error."""
openedFile = None
try:
# If a string was passed then open a file with that name
if isinstance(file, str):
openedFile = file = open(file, "w")
resp = self.getresp()
if resp[:3] not in LONGRESP:
raise NNTPReplyError(resp)
list = []
while 1:
line = self.getline()
if line == '.':
break
if line[:2] == '..':
line = line[1:]
if file:
file.write(line + "\n")
else:
list.append(line)
finally:
# If this method created the file, then it must close it
if openedFile:
openedFile.close()
return resp, list
def shortcmd(self, line):
"""Internal: send a command and get the response."""
self.putcmd(line)
return self.getresp()
def longcmd(self, line, file=None):
"""Internal: send a command and get the response plus following text."""
self.putcmd(line)
return self.getlongresp(file)
def newgroups(self, date, time, file=None):
"""Process a NEWGROUPS command. Arguments:
- date: string 'yymmdd' indicating the date
- time: string 'hhmmss' indicating the time
Return:
- resp: server response if successful
- list: list of newsgroup names"""
return self.longcmd('NEWGROUPS ' + date + ' ' + time, file)
def newnews(self, group, date, time, file=None):
"""Process a NEWNEWS command. Arguments:
- group: group name or '*'
- date: string 'yymmdd' indicating the date
- time: string 'hhmmss' indicating the time
Return:
- resp: server response if successful
- list: list of message ids"""
cmd = 'NEWNEWS ' + group + ' ' + date + ' ' + time
return self.longcmd(cmd, file)
def list(self, file=None):
"""Process a LIST command. Return:
- resp: server response if successful
- list: list of (group, last, first, flag) (strings)"""
resp, list = self.longcmd('LIST', file)
for i in range(len(list)):
# Parse lines into "group last first flag"
list[i] = tuple(list[i].split())
return resp, list
def description(self, group):
"""Get a description for a single group. If more than one
group matches ('group' is a pattern), return the first. If no
group matches, return an empty string.
This elides the response code from the server, since it can
only be '215' or '285' (for xgtitle) anyway. If the response
code is needed, use the 'descriptions' method.
NOTE: This neither checks for a wildcard in 'group' nor does
it check whether the group actually exists."""
resp, lines = self.descriptions(group)
if len(lines) == 0:
return ""
else:
return lines[0][1]
def descriptions(self, group_pattern):
"""Get descriptions for a range of groups."""
line_pat = re.compile("^(?P<group>[^ \t]+)[ \t]+(.*)$")
# Try the more std (acc. to RFC2980) LIST NEWSGROUPS first
resp, raw_lines = self.longcmd('LIST NEWSGROUPS ' + group_pattern)
if resp[:3] != "215":
# Now the deprecated XGTITLE. This either raises an error
# or succeeds with the same output structure as LIST
# NEWSGROUPS.
resp, raw_lines = self.longcmd('XGTITLE ' + group_pattern)
lines = []
for raw_line in raw_lines:
match = line_pat.search(raw_line.strip())
if match:
lines.append(match.group(1, 2))
return resp, lines
def group(self, name):
"""Process a GROUP command. Argument:
- group: the group name
Returns:
- resp: server response if successful
- count: number of articles (string)
- first: first article number (string)
- last: last article number (string)
- name: the group name"""
resp = self.shortcmd('GROUP ' + name)
if resp[:3] != '211':
raise NNTPReplyError(resp)
words = resp.split()
count = first = last = 0
n = len(words)
if n > 1:
count = words[1]
if n > 2:
first = words[2]
if n > 3:
last = words[3]
if n > 4:
name = words[4].lower()
return resp, count, first, last, name
def help(self, file=None):
"""Process a HELP command. Returns:
- resp: server response if successful
- list: list of strings"""
return self.longcmd('HELP',file)
def statparse(self, resp):
"""Internal: parse the response of a STAT, NEXT or LAST command."""
if resp[:2] != '22':
raise NNTPReplyError(resp)
words = resp.split()
nr = 0
id = ''
n = len(words)
if n > 1:
nr = words[1]
if n > 2:
id = words[2]
return resp, nr, id
def statcmd(self, line):
"""Internal: process a STAT, NEXT or LAST command."""
resp = self.shortcmd(line)
return self.statparse(resp)
def stat(self, id):
"""Process a STAT command. Argument:
- id: article number or message id
Returns:
- resp: server response if successful
- nr: the article number
- id: the message id"""
return self.statcmd('STAT ' + id)
def next(self):
"""Process a NEXT command. No arguments. Return as for STAT."""
return self.statcmd('NEXT')
def last(self):
"""Process a LAST command. No arguments. Return as for STAT."""
return self.statcmd('LAST')
def artcmd(self, line, file=None):
"""Internal: process a HEAD, BODY or ARTICLE command."""
resp, list = self.longcmd(line, file)
resp, nr, id = self.statparse(resp)
return resp, nr, id, list
def head(self, id):
"""Process a HEAD command. Argument:
- id: article number or message id
Returns:
- resp: server response if successful
- nr: article number
- id: message id
- list: the lines of the article's header"""
return self.artcmd('HEAD ' + id)
def body(self, id, file=None):
"""Process a BODY command. Argument:
- id: article number or message id
- file: Filename string or file object to store the article in
Returns:
- resp: server response if successful
- nr: article number
- id: message id
- list: the lines of the article's body or an empty list
if file was used"""
return self.artcmd('BODY ' + id, file)
def article(self, id):
"""Process an ARTICLE command. Argument:
- id: article number or message id
Returns:
- resp: server response if successful
- nr: article number
- id: message id
- list: the lines of the article"""
return self.artcmd('ARTICLE ' + id)
def slave(self):
"""Process a SLAVE command. Returns:
- resp: server response if successful"""
return self.shortcmd('SLAVE')
def xhdr(self, hdr, str, file=None):
"""Process an XHDR command (optional server extension). Arguments:
- hdr: the header type (e.g. 'subject')
- str: an article nr, a message id, or a range nr1-nr2
Returns:
- resp: server response if successful
- list: list of (nr, value) strings"""
pat = re.compile('^([0-9]+) ?(.*)\n?')
resp, lines = self.longcmd('XHDR ' + hdr + ' ' + str, file)
for i in range(len(lines)):
line = lines[i]
m = pat.match(line)
if m:
lines[i] = m.group(1, 2)
return resp, lines
def xover(self, start, end, file=None):
"""Process an XOVER command (optional server extension) Arguments:
- start: start of range
- end: end of range
Returns:
- resp: server response if successful
- list: list of (art-nr, subject, poster, date,
id, references, size, lines)"""
resp, lines = self.longcmd('XOVER ' + start + '-' + end, file)
xover_lines = []
for line in lines:
elem = line.split("\t")
try:
xover_lines.append((elem[0],
elem[1],
elem[2],
elem[3],
elem[4],
elem[5].split(),
elem[6],
elem[7]))
except IndexError:
raise NNTPDataError(line)
return resp,xover_lines
def xgtitle(self, group, file=None):
"""Process an XGTITLE command (optional server extension) Arguments:
- group: group name wildcard (i.e. news.*)
Returns:
- resp: server response if successful
- list: list of (name,title) strings"""
line_pat = re.compile("^([^ \t]+)[ \t]+(.*)$")
resp, raw_lines = self.longcmd('XGTITLE ' + group, file)
lines = []
for raw_line in raw_lines:
match = line_pat.search(raw_line.strip())
if match:
lines.append(match.group(1, 2))
return resp, lines
def xpath(self,id):
"""Process an XPATH command (optional server extension) Arguments:
- id: Message id of article
Returns:
resp: server response if successful
path: directory path to article"""
resp = self.shortcmd("XPATH " + id)
if resp[:3] != '223':
raise NNTPReplyError(resp)
try:
[resp_num, path] = resp.split()
except ValueError:
raise NNTPReplyError(resp)
else:
return resp, path
def date (self):
"""Process the DATE command. Arguments:
None
Returns:
resp: server response if successful
date: Date suitable for newnews/newgroups commands etc.
time: Time suitable for newnews/newgroups commands etc."""
resp = self.shortcmd("DATE")
if resp[:3] != '111':
raise NNTPReplyError(resp)
elem = resp.split()
if len(elem) != 2:
raise NNTPDataError(resp)
date = elem[1][2:8]
time = elem[1][-6:]
if len(date) != 6 or len(time) != 6:
raise NNTPDataError(resp)
return resp, date, time
def post(self, f):
"""Process a POST command. Arguments:
- f: file containing the article
Returns:
- resp: server response if successful"""
resp = self.shortcmd('POST')
# Raises error_??? if posting is not allowed
if resp[0] != '3':
raise NNTPReplyError(resp)
while 1:
line = f.readline()
if not line:
break
if line[-1] == '\n':
line = line[:-1]
if line[:1] == '.':
line = '.' + line
self.putline(line)
self.putline('.')
return self.getresp()
def ihave(self, id, f):
"""Process an IHAVE command. Arguments:
- id: message-id of the article
- f: file containing the article
Returns:
- resp: server response if successful
Note that if the server refuses the article an exception is raised."""
resp = self.shortcmd('IHAVE ' + id)
# Raises error_??? if the server already has it
if resp[0] != '3':
raise NNTPReplyError(resp)
while 1:
line = f.readline()
if not line:
break
if line[-1] == '\n':
line = line[:-1]
if line[:1] == '.':
line = '.' + line
self.putline(line)
self.putline('.')
return self.getresp()
def quit(self):
"""Process a QUIT command and close the socket. Returns:
- resp: server response if successful"""
resp = self.shortcmd('QUIT')
self.file.close()
self.sock.close()
del self.file, self.sock
return resp
# Test retrieval when run as a script.
# Assumption: if there's a local news server, it's called 'news'.
# Assumption: if user queries a remote news server, it's named
# in the environment variable NNTPSERVER (used by slrn and kin)
# and we want readermode off.
if __name__ == '__main__':
import os
newshost = 'news' and os.environ["NNTPSERVER"]
if newshost.find('.') == -1:
mode = 'readermode'
else:
mode = None
s = NNTP(newshost, readermode=mode)
resp, count, first, last, name = s.group('comp.lang.python')
print resp
print 'Group', name, 'has', count, 'articles, range', first, 'to', last
resp, subs = s.xhdr('subject', first + '-' + last)
print resp
for item in subs:
print "%7s %s" % item
resp = s.quit()
print resp
| Python |
"""A dumb and slow but simple dbm clone.
For database spam, spam.dir contains the index (a text file),
spam.bak *may* contain a backup of the index (also a text file),
while spam.dat contains the data (a binary file).
XXX TO DO:
- seems to contain a bug when updating...
- reclaim free space (currently, space once occupied by deleted or expanded
items is never reused)
- support concurrent access (currently, if two processes take turns making
updates, they can mess up the index)
- support efficient access to large databases (currently, the whole index
is read when the database is opened, and some updates rewrite the whole index)
- support opening for read-only (flag = 'm')
"""
import os as _os
import __builtin__
import UserDict
_open = __builtin__.open
_BLOCKSIZE = 512
error = IOError # For anydbm
class _Database(UserDict.DictMixin):
# The on-disk directory and data files can remain in mutually
# inconsistent states for an arbitrarily long time (see comments
# at the end of __setitem__). This is only repaired when _commit()
# gets called. One place _commit() gets called is from __del__(),
# and if that occurs at program shutdown time, module globals may
# already have gotten rebound to None. Since it's crucial that
# _commit() finish successfully, we can't ignore shutdown races
# here, and _commit() must not reference any globals.
_os = _os # for _commit()
_open = _open # for _commit()
def __init__(self, filebasename, mode):
self._mode = mode
# The directory file is a text file. Each line looks like
# "%r, (%d, %d)\n" % (key, pos, siz)
# where key is the string key, pos is the offset into the dat
# file of the associated value's first byte, and siz is the number
# of bytes in the associated value.
self._dirfile = filebasename + _os.extsep + 'dir'
# The data file is a binary file pointed into by the directory
# file, and holds the values associated with keys. Each value
# begins at a _BLOCKSIZE-aligned byte offset, and is a raw
# binary 8-bit string value.
self._datfile = filebasename + _os.extsep + 'dat'
self._bakfile = filebasename + _os.extsep + 'bak'
# The index is an in-memory dict, mirroring the directory file.
self._index = None # maps keys to (pos, siz) pairs
# Mod by Jack: create data file if needed
try:
f = _open(self._datfile, 'r')
except IOError:
f = _open(self._datfile, 'w')
self._chmod(self._datfile)
f.close()
self._update()
# Read directory file into the in-memory index dict.
def _update(self):
self._index = {}
try:
f = _open(self._dirfile)
except IOError:
pass
else:
for line in f:
line = line.rstrip()
key, pos_and_siz_pair = eval(line)
self._index[key] = pos_and_siz_pair
f.close()
# Write the index dict to the directory file. The original directory
# file (if any) is renamed with a .bak extension first. If a .bak
# file currently exists, it's deleted.
def _commit(self):
# CAUTION: It's vital that _commit() succeed, and _commit() can
# be called from __del__(). Therefore we must never reference a
# global in this routine.
if self._index is None:
return # nothing to do
try:
self._os.unlink(self._bakfile)
except self._os.error:
pass
try:
self._os.rename(self._dirfile, self._bakfile)
except self._os.error:
pass
f = self._open(self._dirfile, 'w')
self._chmod(self._dirfile)
for key, pos_and_siz_pair in self._index.iteritems():
f.write("%r, %r\n" % (key, pos_and_siz_pair))
f.close()
sync = _commit
def __getitem__(self, key):
pos, siz = self._index[key] # may raise KeyError
f = _open(self._datfile, 'rb')
f.seek(pos)
dat = f.read(siz)
f.close()
return dat
# Append val to the data file, starting at a _BLOCKSIZE-aligned
# offset. The data file is first padded with NUL bytes (if needed)
# to get to an aligned offset. Return pair
# (starting offset of val, len(val))
def _addval(self, val):
f = _open(self._datfile, 'rb+')
f.seek(0, 2)
pos = int(f.tell())
npos = ((pos + _BLOCKSIZE - 1) // _BLOCKSIZE) * _BLOCKSIZE
f.write('\0'*(npos-pos))
pos = npos
f.write(val)
f.close()
return (pos, len(val))
# Write val to the data file, starting at offset pos. The caller
# is responsible for ensuring that there's enough room starting at
# pos to hold val, without overwriting some other value. Return
# pair (pos, len(val)).
def _setval(self, pos, val):
f = _open(self._datfile, 'rb+')
f.seek(pos)
f.write(val)
f.close()
return (pos, len(val))
# key is a new key whose associated value starts in the data file
# at offset pos and with length siz. Add an index record to
# the in-memory index dict, and append one to the directory file.
def _addkey(self, key, pos_and_siz_pair):
self._index[key] = pos_and_siz_pair
f = _open(self._dirfile, 'a')
self._chmod(self._dirfile)
f.write("%r, %r\n" % (key, pos_and_siz_pair))
f.close()
def __setitem__(self, key, val):
if not type(key) == type('') == type(val):
raise TypeError, "keys and values must be strings"
if key not in self._index:
self._addkey(key, self._addval(val))
else:
# See whether the new value is small enough to fit in the
# (padded) space currently occupied by the old value.
pos, siz = self._index[key]
oldblocks = (siz + _BLOCKSIZE - 1) // _BLOCKSIZE
newblocks = (len(val) + _BLOCKSIZE - 1) // _BLOCKSIZE
if newblocks <= oldblocks:
self._index[key] = self._setval(pos, val)
else:
# The new value doesn't fit in the (padded) space used
# by the old value. The blocks used by the old value are
# forever lost.
self._index[key] = self._addval(val)
# Note that _index may be out of synch with the directory
# file now: _setval() and _addval() don't update the directory
# file. This also means that the on-disk directory and data
# files are in a mutually inconsistent state, and they'll
# remain that way until _commit() is called. Note that this
# is a disaster (for the database) if the program crashes
# (so that _commit() never gets called).
def __delitem__(self, key):
# The blocks used by the associated value are lost.
del self._index[key]
# XXX It's unclear why we do a _commit() here (the code always
# XXX has, so I'm not changing it). _setitem__ doesn't try to
# XXX keep the directory file in synch. Why should we? Or
# XXX why shouldn't __setitem__?
self._commit()
def keys(self):
return self._index.keys()
def has_key(self, key):
return key in self._index
def __contains__(self, key):
return key in self._index
def iterkeys(self):
return self._index.iterkeys()
__iter__ = iterkeys
def __len__(self):
return len(self._index)
def close(self):
self._commit()
self._index = self._datfile = self._dirfile = self._bakfile = None
__del__ = close
def _chmod (self, file):
if hasattr(self._os, 'chmod'):
self._os.chmod(file, self._mode)
def open(file, flag=None, mode=0666):
"""Open the database file, filename, and return corresponding object.
The flag argument, used to control how the database is opened in the
other DBM implementations, is ignored in the dumbdbm module; the
database is always opened for update, and will be created if it does
not exist.
The optional mode argument is the UNIX mode of the file, used only when
the database has to be created. It defaults to octal code 0666 (and
will be modified by the prevailing umask).
"""
# flag argument is currently ignored
# Modify mode depending on the umask
try:
um = _os.umask(0)
_os.umask(um)
except AttributeError:
pass
else:
# Turn off any bits that are set in the umask
mode = mode & (~um)
return _Database(file, mode)
| Python |
"""Common operations on Posix pathnames.
Instead of importing this module directly, import os and refer to
this module as os.path. The "os.path" name is an alias for this
module on Posix systems; on other systems (e.g. Mac, Windows),
os.path provides the same operations in a manner specific to that
platform, and is an alias to another module (e.g. macpath, ntpath).
Some of this can actually be useful on non-Posix systems too, e.g.
for manipulation of the pathname component of URLs.
"""
import os
import sys
import stat
import genericpath
import warnings
from genericpath import *
__all__ = ["normcase","isabs","join","splitdrive","split","splitext",
"basename","dirname","commonprefix","getsize","getmtime",
"getatime","getctime","islink","exists","lexists","isdir","isfile",
"ismount","walk","expanduser","expandvars","normpath","abspath",
"samefile","sameopenfile","samestat",
"curdir","pardir","sep","pathsep","defpath","altsep","extsep",
"devnull","realpath","supports_unicode_filenames","relpath"]
# strings representing various path-related bits and pieces
curdir = '.'
pardir = '..'
extsep = '.'
sep = '/'
pathsep = ':'
defpath = ':/bin:/usr/bin'
altsep = None
devnull = '/dev/null'
# Normalize the case of a pathname. Trivial in Posix, string.lower on Mac.
# On MS-DOS this may also turn slashes into backslashes; however, other
# normalizations (such as optimizing '../' away) are not allowed
# (another function should be defined to do that).
def normcase(s):
"""Normalize case of pathname. Has no effect under Posix"""
return s
# Return whether a path is absolute.
# Trivial in Posix, harder on the Mac or MS-DOS.
def isabs(s):
"""Test whether a path is absolute"""
return s.startswith('/')
# Join pathnames.
# Ignore the previous parts if a part is absolute.
# Insert a '/' unless the first part is empty or already ends in '/'.
def join(a, *p):
"""Join two or more pathname components, inserting '/' as needed.
If any component is an absolute path, all previous path components
will be discarded."""
path = a
for b in p:
if b.startswith('/'):
path = b
elif path == '' or path.endswith('/'):
path += b
else:
path += '/' + b
return path
# Split a path in head (everything up to the last '/') and tail (the
# rest). If the path ends in '/', tail will be empty. If there is no
# '/' in the path, head will be empty.
# Trailing '/'es are stripped from head unless it is the root.
def split(p):
"""Split a pathname. Returns tuple "(head, tail)" where "tail" is
everything after the final slash. Either part may be empty."""
i = p.rfind('/') + 1
head, tail = p[:i], p[i:]
if head and head != '/'*len(head):
head = head.rstrip('/')
return head, tail
# Split a path in root and extension.
# The extension is everything starting at the last dot in the last
# pathname component; the root is everything before that.
# It is always true that root + ext == p.
def splitext(p):
return genericpath._splitext(p, sep, altsep, extsep)
splitext.__doc__ = genericpath._splitext.__doc__
# Split a pathname into a drive specification and the rest of the
# path. Useful on DOS/Windows/NT; on Unix, the drive is always empty.
def splitdrive(p):
"""Split a pathname into drive and path. On Posix, drive is always
empty."""
return '', p
# Return the tail (basename) part of a path, same as split(path)[1].
def basename(p):
"""Returns the final component of a pathname"""
i = p.rfind('/') + 1
return p[i:]
# Return the head (dirname) part of a path, same as split(path)[0].
def dirname(p):
"""Returns the directory component of a pathname"""
i = p.rfind('/') + 1
head = p[:i]
if head and head != '/'*len(head):
head = head.rstrip('/')
return head
# Is a path a symbolic link?
# This will always return false on systems where os.lstat doesn't exist.
def islink(path):
"""Test whether a path is a symbolic link"""
try:
st = os.lstat(path)
except (os.error, AttributeError):
return False
return stat.S_ISLNK(st.st_mode)
# Being true for dangling symbolic links is also useful.
def lexists(path):
"""Test whether a path exists. Returns True for broken symbolic links"""
try:
os.lstat(path)
except os.error:
return False
return True
# Are two filenames really pointing to the same file?
def samefile(f1, f2):
"""Test whether two pathnames reference the same actual file"""
s1 = os.stat(f1)
s2 = os.stat(f2)
return samestat(s1, s2)
# Are two open files really referencing the same file?
# (Not necessarily the same file descriptor!)
def sameopenfile(fp1, fp2):
"""Test whether two open file objects reference the same file"""
s1 = os.fstat(fp1)
s2 = os.fstat(fp2)
return samestat(s1, s2)
# Are two stat buffers (obtained from stat, fstat or lstat)
# describing the same file?
def samestat(s1, s2):
"""Test whether two stat buffers reference the same file"""
return s1.st_ino == s2.st_ino and \
s1.st_dev == s2.st_dev
# Is a path a mount point?
# (Does this work for all UNIXes? Is it even guaranteed to work by Posix?)
def ismount(path):
"""Test whether a path is a mount point"""
if islink(path):
# A symlink can never be a mount point
return False
try:
s1 = os.lstat(path)
s2 = os.lstat(join(path, '..'))
except os.error:
return False # It doesn't exist -- so not a mount point :-)
dev1 = s1.st_dev
dev2 = s2.st_dev
if dev1 != dev2:
return True # path/.. on a different device as path
ino1 = s1.st_ino
ino2 = s2.st_ino
if ino1 == ino2:
return True # path/.. is the same i-node as path
return False
# Directory tree walk.
# For each directory under top (including top itself, but excluding
# '.' and '..'), func(arg, dirname, filenames) is called, where
# dirname is the name of the directory and filenames is the list
# of files (and subdirectories etc.) in the directory.
# The func may modify the filenames list, to implement a filter,
# or to impose a different order of visiting.
def walk(top, func, arg):
"""Directory tree walk with callback function.
For each directory in the directory tree rooted at top (including top
itself, but excluding '.' and '..'), call func(arg, dirname, fnames).
dirname is the name of the directory, and fnames a list of the names of
the files and subdirectories in dirname (excluding '.' and '..'). func
may modify the fnames list in-place (e.g. via del or slice assignment),
and walk will only recurse into the subdirectories whose names remain in
fnames; this can be used to implement a filter, or to impose a specific
order of visiting. No semantics are defined for, or required of, arg,
beyond that arg is always passed to func. It can be used, e.g., to pass
a filename pattern, or a mutable object designed to accumulate
statistics. Passing None for arg is common."""
warnings.warnpy3k("In 3.x, os.path.walk is removed in favor of os.walk.",
stacklevel=2)
try:
names = os.listdir(top)
except os.error:
return
func(arg, top, names)
for name in names:
name = join(top, name)
try:
st = os.lstat(name)
except os.error:
continue
if stat.S_ISDIR(st.st_mode):
walk(name, func, arg)
# Expand paths beginning with '~' or '~user'.
# '~' means $HOME; '~user' means that user's home directory.
# If the path doesn't begin with '~', or if the user or $HOME is unknown,
# the path is returned unchanged (leaving error reporting to whatever
# function is called with the expanded path as argument).
# See also module 'glob' for expansion of *, ? and [...] in pathnames.
# (A function should also be defined to do full *sh-style environment
# variable expansion.)
def expanduser(path):
"""Expand ~ and ~user constructions. If user or $HOME is unknown,
do nothing."""
if not path.startswith('~'):
return path
i = path.find('/', 1)
if i < 0:
i = len(path)
if i == 1:
if 'HOME' not in os.environ:
import pwd
userhome = pwd.getpwuid(os.getuid()).pw_dir
else:
userhome = os.environ['HOME']
else:
import pwd
try:
pwent = pwd.getpwnam(path[1:i])
except KeyError:
return path
userhome = pwent.pw_dir
userhome = userhome.rstrip('/') or userhome
return userhome + path[i:]
# Expand paths containing shell variable substitutions.
# This expands the forms $variable and ${variable} only.
# Non-existent variables are left unchanged.
_varprog = None
def expandvars(path):
"""Expand shell variables of form $var and ${var}. Unknown variables
are left unchanged."""
global _varprog
if '$' not in path:
return path
if not _varprog:
import re
_varprog = re.compile(r'\$(\w+|\{[^}]*\})')
i = 0
while True:
m = _varprog.search(path, i)
if not m:
break
i, j = m.span(0)
name = m.group(1)
if name.startswith('{') and name.endswith('}'):
name = name[1:-1]
if name in os.environ:
tail = path[j:]
path = path[:i] + os.environ[name]
i = len(path)
path += tail
else:
i = j
return path
# Normalize a path, e.g. A//B, A/./B and A/foo/../B all become A/B.
# It should be understood that this may change the meaning of the path
# if it contains symbolic links!
def normpath(path):
"""Normalize path, eliminating double slashes, etc."""
# Preserve unicode (if path is unicode)
slash, dot = (u'/', u'.') if isinstance(path, unicode) else ('/', '.')
if path == '':
return dot
initial_slashes = path.startswith('/')
# POSIX allows one or two initial slashes, but treats three or more
# as single slash.
if (initial_slashes and
path.startswith('//') and not path.startswith('///')):
initial_slashes = 2
comps = path.split('/')
new_comps = []
for comp in comps:
if comp in ('', '.'):
continue
if (comp != '..' or (not initial_slashes and not new_comps) or
(new_comps and new_comps[-1] == '..')):
new_comps.append(comp)
elif new_comps:
new_comps.pop()
comps = new_comps
path = slash.join(comps)
if initial_slashes:
path = slash*initial_slashes + path
return path or dot
def abspath(path):
"""Return an absolute path."""
if not isabs(path):
if isinstance(path, unicode):
cwd = os.getcwdu()
else:
cwd = os.getcwd()
path = join(cwd, path)
return normpath(path)
# Return a canonical path (i.e. the absolute location of a file on the
# filesystem).
def realpath(filename):
"""Return the canonical path of the specified filename, eliminating any
symbolic links encountered in the path."""
if isabs(filename):
bits = ['/'] + filename.split('/')[1:]
else:
bits = [''] + filename.split('/')
for i in range(2, len(bits)+1):
component = join(*bits[0:i])
# Resolve symbolic links.
if islink(component):
resolved = _resolve_link(component)
if resolved is None:
# Infinite loop -- return original component + rest of the path
return abspath(join(*([component] + bits[i:])))
else:
newpath = join(*([resolved] + bits[i:]))
return realpath(newpath)
return abspath(filename)
def _resolve_link(path):
"""Internal helper function. Takes a path and follows symlinks
until we either arrive at something that isn't a symlink, or
encounter a path we've seen before (meaning that there's a loop).
"""
paths_seen = set()
while islink(path):
if path in paths_seen:
# Already seen this path, so we must have a symlink loop
return None
paths_seen.add(path)
# Resolve where the link points to
resolved = os.readlink(path)
if not isabs(resolved):
dir = dirname(path)
path = normpath(join(dir, resolved))
else:
path = normpath(resolved)
return path
supports_unicode_filenames = (sys.platform == 'darwin')
def relpath(path, start=curdir):
"""Return a relative version of a path"""
if not path:
raise ValueError("no path specified")
start_list = [x for x in abspath(start).split(sep) if x]
path_list = [x for x in abspath(path).split(sep) if x]
# Work out how much of the filepath is shared by start and path.
i = len(commonprefix([start_list, path_list]))
rel_list = [pardir] * (len(start_list)-i) + path_list[i:]
if not rel_list:
return curdir
return join(*rel_list)
| Python |
#! /usr/bin/env python
"""Token constants (from "token.h")."""
# This file is automatically generated; please don't muck it up!
#
# To update the symbols in this file, 'cd' to the top directory of
# the python source tree after building the interpreter and run:
#
# python Lib/token.py
#--start constants--
ENDMARKER = 0
NAME = 1
NUMBER = 2
STRING = 3
NEWLINE = 4
INDENT = 5
DEDENT = 6
LPAR = 7
RPAR = 8
LSQB = 9
RSQB = 10
COLON = 11
COMMA = 12
SEMI = 13
PLUS = 14
MINUS = 15
STAR = 16
SLASH = 17
VBAR = 18
AMPER = 19
LESS = 20
GREATER = 21
EQUAL = 22
DOT = 23
PERCENT = 24
BACKQUOTE = 25
LBRACE = 26
RBRACE = 27
EQEQUAL = 28
NOTEQUAL = 29
LESSEQUAL = 30
GREATEREQUAL = 31
TILDE = 32
CIRCUMFLEX = 33
LEFTSHIFT = 34
RIGHTSHIFT = 35
DOUBLESTAR = 36
PLUSEQUAL = 37
MINEQUAL = 38
STAREQUAL = 39
SLASHEQUAL = 40
PERCENTEQUAL = 41
AMPEREQUAL = 42
VBAREQUAL = 43
CIRCUMFLEXEQUAL = 44
LEFTSHIFTEQUAL = 45
RIGHTSHIFTEQUAL = 46
DOUBLESTAREQUAL = 47
DOUBLESLASH = 48
DOUBLESLASHEQUAL = 49
AT = 50
OP = 51
ERRORTOKEN = 52
N_TOKENS = 53
NT_OFFSET = 256
#--end constants--
tok_name = {}
for _name, _value in globals().items():
if type(_value) is type(0):
tok_name[_value] = _name
del _name, _value
def ISTERMINAL(x):
return x < NT_OFFSET
def ISNONTERMINAL(x):
return x >= NT_OFFSET
def ISEOF(x):
return x == ENDMARKER
def main():
import re
import sys
args = sys.argv[1:]
inFileName = args and args[0] or "Include/token.h"
outFileName = "Lib/token.py"
if len(args) > 1:
outFileName = args[1]
try:
fp = open(inFileName)
except IOError, err:
sys.stdout.write("I/O error: %s\n" % str(err))
sys.exit(1)
lines = fp.read().split("\n")
fp.close()
prog = re.compile(
"#define[ \t][ \t]*([A-Z0-9][A-Z0-9_]*)[ \t][ \t]*([0-9][0-9]*)",
re.IGNORECASE)
tokens = {}
for line in lines:
match = prog.match(line)
if match:
name, val = match.group(1, 2)
val = int(val)
tokens[val] = name # reverse so we can sort them...
keys = tokens.keys()
keys.sort()
# load the output skeleton from the target:
try:
fp = open(outFileName)
except IOError, err:
sys.stderr.write("I/O error: %s\n" % str(err))
sys.exit(2)
format = fp.read().split("\n")
fp.close()
try:
start = format.index("#--start constants--") + 1
end = format.index("#--end constants--")
except ValueError:
sys.stderr.write("target does not contain format markers")
sys.exit(3)
lines = []
for val in keys:
lines.append("%s = %d" % (tokens[val], val))
format[start:end] = lines
try:
fp = open(outFileName, 'w')
except IOError, err:
sys.stderr.write("I/O error: %s\n" % str(err))
sys.exit(4)
fp.write("\n".join(format))
fp.close()
if __name__ == "__main__":
main()
| Python |
"""Record of phased-in incompatible language changes.
Each line is of the form:
FeatureName = "_Feature(" OptionalRelease "," MandatoryRelease ","
CompilerFlag ")"
where, normally, OptionalRelease < MandatoryRelease, and both are 5-tuples
of the same form as sys.version_info:
(PY_MAJOR_VERSION, # the 2 in 2.1.0a3; an int
PY_MINOR_VERSION, # the 1; an int
PY_MICRO_VERSION, # the 0; an int
PY_RELEASE_LEVEL, # "alpha", "beta", "candidate" or "final"; string
PY_RELEASE_SERIAL # the 3; an int
)
OptionalRelease records the first release in which
from __future__ import FeatureName
was accepted.
In the case of MandatoryReleases that have not yet occurred,
MandatoryRelease predicts the release in which the feature will become part
of the language.
Else MandatoryRelease records when the feature became part of the language;
in releases at or after that, modules no longer need
from __future__ import FeatureName
to use the feature in question, but may continue to use such imports.
MandatoryRelease may also be None, meaning that a planned feature got
dropped.
Instances of class _Feature have two corresponding methods,
.getOptionalRelease() and .getMandatoryRelease().
CompilerFlag is the (bitfield) flag that should be passed in the fourth
argument to the builtin function compile() to enable the feature in
dynamically compiled code. This flag is stored in the .compiler_flag
attribute on _Future instances. These values must match the appropriate
#defines of CO_xxx flags in Include/compile.h.
No feature line is ever to be deleted from this file.
"""
all_feature_names = [
"nested_scopes",
"generators",
"division",
"absolute_import",
"with_statement",
"print_function",
"unicode_literals",
]
__all__ = ["all_feature_names"] + all_feature_names
# The CO_xxx symbols are defined here under the same names used by
# compile.h, so that an editor search will find them here. However,
# they're not exported in __all__, because they don't really belong to
# this module.
CO_NESTED = 0x0010 # nested_scopes
CO_GENERATOR_ALLOWED = 0 # generators (obsolete, was 0x1000)
CO_FUTURE_DIVISION = 0x2000 # division
CO_FUTURE_ABSOLUTE_IMPORT = 0x4000 # perform absolute imports by default
CO_FUTURE_WITH_STATEMENT = 0x8000 # with statement
CO_FUTURE_PRINT_FUNCTION = 0x10000 # print function
CO_FUTURE_UNICODE_LITERALS = 0x20000 # unicode string literals
class _Feature:
def __init__(self, optionalRelease, mandatoryRelease, compiler_flag):
self.optional = optionalRelease
self.mandatory = mandatoryRelease
self.compiler_flag = compiler_flag
def getOptionalRelease(self):
"""Return first release in which this feature was recognized.
This is a 5-tuple, of the same form as sys.version_info.
"""
return self.optional
def getMandatoryRelease(self):
"""Return release in which this feature will become mandatory.
This is a 5-tuple, of the same form as sys.version_info, or, if
the feature was dropped, is None.
"""
return self.mandatory
def __repr__(self):
return "_Feature" + repr((self.optional,
self.mandatory,
self.compiler_flag))
nested_scopes = _Feature((2, 1, 0, "beta", 1),
(2, 2, 0, "alpha", 0),
CO_NESTED)
generators = _Feature((2, 2, 0, "alpha", 1),
(2, 3, 0, "final", 0),
CO_GENERATOR_ALLOWED)
division = _Feature((2, 2, 0, "alpha", 2),
(3, 0, 0, "alpha", 0),
CO_FUTURE_DIVISION)
absolute_import = _Feature((2, 5, 0, "alpha", 1),
(2, 7, 0, "alpha", 0),
CO_FUTURE_ABSOLUTE_IMPORT)
with_statement = _Feature((2, 5, 0, "alpha", 1),
(2, 6, 0, "alpha", 0),
CO_FUTURE_WITH_STATEMENT)
print_function = _Feature((2, 6, 0, "alpha", 2),
(3, 0, 0, "alpha", 0),
CO_FUTURE_PRINT_FUNCTION)
unicode_literals = _Feature((2, 6, 0, "alpha", 2),
(3, 0, 0, "alpha", 0),
CO_FUTURE_UNICODE_LITERALS)
| Python |
"""An FTP client class and some helper functions.
Based on RFC 959: File Transfer Protocol (FTP), by J. Postel and J. Reynolds
Example:
>>> from ftplib import FTP
>>> ftp = FTP('ftp.python.org') # connect to host, default port
>>> ftp.login() # default, i.e.: user anonymous, passwd anonymous@
'230 Guest login ok, access restrictions apply.'
>>> ftp.retrlines('LIST') # list directory contents
total 9
drwxr-xr-x 8 root wheel 1024 Jan 3 1994 .
drwxr-xr-x 8 root wheel 1024 Jan 3 1994 ..
drwxr-xr-x 2 root wheel 1024 Jan 3 1994 bin
drwxr-xr-x 2 root wheel 1024 Jan 3 1994 etc
d-wxrwxr-x 2 ftp wheel 1024 Sep 5 13:43 incoming
drwxr-xr-x 2 root wheel 1024 Nov 17 1993 lib
drwxr-xr-x 6 1094 wheel 1024 Sep 13 19:07 pub
drwxr-xr-x 3 root wheel 1024 Jan 3 1994 usr
-rw-r--r-- 1 root root 312 Aug 1 1994 welcome.msg
'226 Transfer complete.'
>>> ftp.quit()
'221 Goodbye.'
>>>
A nice test that reveals some of the network dialogue would be:
python ftplib.py -d localhost -l -p -l
"""
#
# Changes and improvements suggested by Steve Majewski.
# Modified by Jack to work on the mac.
# Modified by Siebren to support docstrings and PASV.
# Modified by Phil Schwartz to add storbinary and storlines callbacks.
# Modified by Giampaolo Rodola' to add TLS support.
#
import os
import sys
# Import SOCKS module if it exists, else standard socket module socket
try:
import SOCKS; socket = SOCKS; del SOCKS # import SOCKS as socket
from socket import getfqdn; socket.getfqdn = getfqdn; del getfqdn
except ImportError:
import socket
from socket import _GLOBAL_DEFAULT_TIMEOUT
__all__ = ["FTP","Netrc"]
# Magic number from <socket.h>
MSG_OOB = 0x1 # Process data out of band
# The standard FTP server control port
FTP_PORT = 21
# Exception raised when an error or invalid response is received
class Error(Exception): pass
class error_reply(Error): pass # unexpected [123]xx reply
class error_temp(Error): pass # 4xx errors
class error_perm(Error): pass # 5xx errors
class error_proto(Error): pass # response does not begin with [1-5]
# All exceptions (hopefully) that may be raised here and that aren't
# (always) programming errors on our side
all_errors = (Error, IOError, EOFError)
# Line terminators (we always output CRLF, but accept any of CRLF, CR, LF)
CRLF = '\r\n'
# The class itself
class FTP:
'''An FTP client class.
To create a connection, call the class using these arguments:
host, user, passwd, acct, timeout
The first four arguments are all strings, and have default value ''.
timeout must be numeric and defaults to None if not passed,
meaning that no timeout will be set on any ftp socket(s)
If a timeout is passed, then this is now the default timeout for all ftp
socket operations for this instance.
Then use self.connect() with optional host and port argument.
To download a file, use ftp.retrlines('RETR ' + filename),
or ftp.retrbinary() with slightly different arguments.
To upload a file, use ftp.storlines() or ftp.storbinary(),
which have an open file as argument (see their definitions
below for details).
The download/upload functions first issue appropriate TYPE
and PORT or PASV commands.
'''
debugging = 0
host = ''
port = FTP_PORT
sock = None
file = None
welcome = None
passiveserver = 1
# Initialization method (called by class instantiation).
# Initialize host to localhost, port to standard ftp port
# Optional arguments are host (for connect()),
# and user, passwd, acct (for login())
def __init__(self, host='', user='', passwd='', acct='',
timeout=_GLOBAL_DEFAULT_TIMEOUT):
self.timeout = timeout
if host:
self.connect(host)
if user:
self.login(user, passwd, acct)
def connect(self, host='', port=0, timeout=-999):
'''Connect to host. Arguments are:
- host: hostname to connect to (string, default previous host)
- port: port to connect to (integer, default previous port)
'''
if host != '':
self.host = host
if port > 0:
self.port = port
if timeout != -999:
self.timeout = timeout
self.sock = socket.create_connection((self.host, self.port), self.timeout)
self.af = self.sock.family
self.file = self.sock.makefile('rb')
self.welcome = self.getresp()
return self.welcome
def getwelcome(self):
'''Get the welcome message from the server.
(this is read and squirreled away by connect())'''
if self.debugging:
print '*welcome*', self.sanitize(self.welcome)
return self.welcome
def set_debuglevel(self, level):
'''Set the debugging level.
The required argument level means:
0: no debugging output (default)
1: print commands and responses but not body text etc.
2: also print raw lines read and sent before stripping CR/LF'''
self.debugging = level
debug = set_debuglevel
def set_pasv(self, val):
'''Use passive or active mode for data transfers.
With a false argument, use the normal PORT mode,
With a true argument, use the PASV command.'''
self.passiveserver = val
# Internal: "sanitize" a string for printing
def sanitize(self, s):
if s[:5] == 'pass ' or s[:5] == 'PASS ':
i = len(s)
while i > 5 and s[i-1] in '\r\n':
i = i-1
s = s[:5] + '*'*(i-5) + s[i:]
return repr(s)
# Internal: send one line to the server, appending CRLF
def putline(self, line):
line = line + CRLF
if self.debugging > 1: print '*put*', self.sanitize(line)
self.sock.sendall(line)
# Internal: send one command to the server (through putline())
def putcmd(self, line):
if self.debugging: print '*cmd*', self.sanitize(line)
self.putline(line)
# Internal: return one line from the server, stripping CRLF.
# Raise EOFError if the connection is closed
def getline(self):
line = self.file.readline()
if self.debugging > 1:
print '*get*', self.sanitize(line)
if not line: raise EOFError
if line[-2:] == CRLF: line = line[:-2]
elif line[-1:] in CRLF: line = line[:-1]
return line
# Internal: get a response from the server, which may possibly
# consist of multiple lines. Return a single string with no
# trailing CRLF. If the response consists of multiple lines,
# these are separated by '\n' characters in the string
def getmultiline(self):
line = self.getline()
if line[3:4] == '-':
code = line[:3]
while 1:
nextline = self.getline()
line = line + ('\n' + nextline)
if nextline[:3] == code and \
nextline[3:4] != '-':
break
return line
# Internal: get a response from the server.
# Raise various errors if the response indicates an error
def getresp(self):
resp = self.getmultiline()
if self.debugging: print '*resp*', self.sanitize(resp)
self.lastresp = resp[:3]
c = resp[:1]
if c in ('1', '2', '3'):
return resp
if c == '4':
raise error_temp, resp
if c == '5':
raise error_perm, resp
raise error_proto, resp
def voidresp(self):
"""Expect a response beginning with '2'."""
resp = self.getresp()
if resp[:1] != '2':
raise error_reply, resp
return resp
def abort(self):
'''Abort a file transfer. Uses out-of-band data.
This does not follow the procedure from the RFC to send Telnet
IP and Synch; that doesn't seem to work with the servers I've
tried. Instead, just send the ABOR command as OOB data.'''
line = 'ABOR' + CRLF
if self.debugging > 1: print '*put urgent*', self.sanitize(line)
self.sock.sendall(line, MSG_OOB)
resp = self.getmultiline()
if resp[:3] not in ('426', '225', '226'):
raise error_proto, resp
def sendcmd(self, cmd):
'''Send a command and return the response.'''
self.putcmd(cmd)
return self.getresp()
def voidcmd(self, cmd):
"""Send a command and expect a response beginning with '2'."""
self.putcmd(cmd)
return self.voidresp()
def sendport(self, host, port):
'''Send a PORT command with the current host and the given
port number.
'''
hbytes = host.split('.')
pbytes = [repr(port//256), repr(port%256)]
bytes = hbytes + pbytes
cmd = 'PORT ' + ','.join(bytes)
return self.voidcmd(cmd)
def sendeprt(self, host, port):
'''Send a EPRT command with the current host and the given port number.'''
af = 0
if self.af == socket.AF_INET:
af = 1
if self.af == socket.AF_INET6:
af = 2
if af == 0:
raise error_proto, 'unsupported address family'
fields = ['', repr(af), host, repr(port), '']
cmd = 'EPRT ' + '|'.join(fields)
return self.voidcmd(cmd)
def makeport(self):
'''Create a new socket and send a PORT command for it.'''
msg = "getaddrinfo returns an empty list"
sock = None
for res in socket.getaddrinfo(None, 0, self.af, socket.SOCK_STREAM, 0, socket.AI_PASSIVE):
af, socktype, proto, canonname, sa = res
try:
sock = socket.socket(af, socktype, proto)
sock.bind(sa)
except socket.error, msg:
if sock:
sock.close()
sock = None
continue
break
if not sock:
raise socket.error, msg
sock.listen(1)
port = sock.getsockname()[1] # Get proper port
host = self.sock.getsockname()[0] # Get proper host
if self.af == socket.AF_INET:
resp = self.sendport(host, port)
else:
resp = self.sendeprt(host, port)
if self.timeout is not _GLOBAL_DEFAULT_TIMEOUT:
sock.settimeout(self.timeout)
return sock
def makepasv(self):
if self.af == socket.AF_INET:
host, port = parse227(self.sendcmd('PASV'))
else:
host, port = parse229(self.sendcmd('EPSV'), self.sock.getpeername())
return host, port
def ntransfercmd(self, cmd, rest=None):
"""Initiate a transfer over the data connection.
If the transfer is active, send a port command and the
transfer command, and accept the connection. If the server is
passive, send a pasv command, connect to it, and start the
transfer command. Either way, return the socket for the
connection and the expected size of the transfer. The
expected size may be None if it could not be determined.
Optional `rest' argument can be a string that is sent as the
argument to a REST command. This is essentially a server
marker used to tell the server to skip over any data up to the
given marker.
"""
size = None
if self.passiveserver:
host, port = self.makepasv()
conn = socket.create_connection((host, port), self.timeout)
if rest is not None:
self.sendcmd("REST %s" % rest)
resp = self.sendcmd(cmd)
# Some servers apparently send a 200 reply to
# a LIST or STOR command, before the 150 reply
# (and way before the 226 reply). This seems to
# be in violation of the protocol (which only allows
# 1xx or error messages for LIST), so we just discard
# this response.
if resp[0] == '2':
resp = self.getresp()
if resp[0] != '1':
raise error_reply, resp
else:
sock = self.makeport()
if rest is not None:
self.sendcmd("REST %s" % rest)
resp = self.sendcmd(cmd)
# See above.
if resp[0] == '2':
resp = self.getresp()
if resp[0] != '1':
raise error_reply, resp
conn, sockaddr = sock.accept()
if self.timeout is not _GLOBAL_DEFAULT_TIMEOUT:
conn.settimeout(self.timeout)
if resp[:3] == '150':
# this is conditional in case we received a 125
size = parse150(resp)
return conn, size
def transfercmd(self, cmd, rest=None):
"""Like ntransfercmd() but returns only the socket."""
return self.ntransfercmd(cmd, rest)[0]
def login(self, user = '', passwd = '', acct = ''):
'''Login, default anonymous.'''
if not user: user = 'anonymous'
if not passwd: passwd = ''
if not acct: acct = ''
if user == 'anonymous' and passwd in ('', '-'):
# If there is no anonymous ftp password specified
# then we'll just use anonymous@
# We don't send any other thing because:
# - We want to remain anonymous
# - We want to stop SPAM
# - We don't want to let ftp sites to discriminate by the user,
# host or country.
passwd = passwd + 'anonymous@'
resp = self.sendcmd('USER ' + user)
if resp[0] == '3': resp = self.sendcmd('PASS ' + passwd)
if resp[0] == '3': resp = self.sendcmd('ACCT ' + acct)
if resp[0] != '2':
raise error_reply, resp
return resp
def retrbinary(self, cmd, callback, blocksize=8192, rest=None):
"""Retrieve data in binary mode. A new port is created for you.
Args:
cmd: A RETR command.
callback: A single parameter callable to be called on each
block of data read.
blocksize: The maximum number of bytes to read from the
socket at one time. [default: 8192]
rest: Passed to transfercmd(). [default: None]
Returns:
The response code.
"""
self.voidcmd('TYPE I')
conn = self.transfercmd(cmd, rest)
while 1:
data = conn.recv(blocksize)
if not data:
break
callback(data)
conn.close()
return self.voidresp()
def retrlines(self, cmd, callback = None):
"""Retrieve data in line mode. A new port is created for you.
Args:
cmd: A RETR, LIST, NLST, or MLSD command.
callback: An optional single parameter callable that is called
for each line with the trailing CRLF stripped.
[default: print_line()]
Returns:
The response code.
"""
if callback is None: callback = print_line
resp = self.sendcmd('TYPE A')
conn = self.transfercmd(cmd)
fp = conn.makefile('rb')
while 1:
line = fp.readline()
if self.debugging > 2: print '*retr*', repr(line)
if not line:
break
if line[-2:] == CRLF:
line = line[:-2]
elif line[-1:] == '\n':
line = line[:-1]
callback(line)
fp.close()
conn.close()
return self.voidresp()
def storbinary(self, cmd, fp, blocksize=8192, callback=None, rest=None):
"""Store a file in binary mode. A new port is created for you.
Args:
cmd: A STOR command.
fp: A file-like object with a read(num_bytes) method.
blocksize: The maximum data size to read from fp and send over
the connection at once. [default: 8192]
callback: An optional single parameter callable that is called on
on each block of data after it is sent. [default: None]
rest: Passed to transfercmd(). [default: None]
Returns:
The response code.
"""
self.voidcmd('TYPE I')
conn = self.transfercmd(cmd, rest)
while 1:
buf = fp.read(blocksize)
if not buf: break
conn.sendall(buf)
if callback: callback(buf)
conn.close()
return self.voidresp()
def storlines(self, cmd, fp, callback=None):
"""Store a file in line mode. A new port is created for you.
Args:
cmd: A STOR command.
fp: A file-like object with a readline() method.
callback: An optional single parameter callable that is called on
on each line after it is sent. [default: None]
Returns:
The response code.
"""
self.voidcmd('TYPE A')
conn = self.transfercmd(cmd)
while 1:
buf = fp.readline()
if not buf: break
if buf[-2:] != CRLF:
if buf[-1] in CRLF: buf = buf[:-1]
buf = buf + CRLF
conn.sendall(buf)
if callback: callback(buf)
conn.close()
return self.voidresp()
def acct(self, password):
'''Send new account name.'''
cmd = 'ACCT ' + password
return self.voidcmd(cmd)
def nlst(self, *args):
'''Return a list of files in a given directory (default the current).'''
cmd = 'NLST'
for arg in args:
cmd = cmd + (' ' + arg)
files = []
self.retrlines(cmd, files.append)
return files
def dir(self, *args):
'''List a directory in long form.
By default list current directory to stdout.
Optional last argument is callback function; all
non-empty arguments before it are concatenated to the
LIST command. (This *should* only be used for a pathname.)'''
cmd = 'LIST'
func = None
if args[-1:] and type(args[-1]) != type(''):
args, func = args[:-1], args[-1]
for arg in args:
if arg:
cmd = cmd + (' ' + arg)
self.retrlines(cmd, func)
def rename(self, fromname, toname):
'''Rename a file.'''
resp = self.sendcmd('RNFR ' + fromname)
if resp[0] != '3':
raise error_reply, resp
return self.voidcmd('RNTO ' + toname)
def delete(self, filename):
'''Delete a file.'''
resp = self.sendcmd('DELE ' + filename)
if resp[:3] in ('250', '200'):
return resp
else:
raise error_reply, resp
def cwd(self, dirname):
'''Change to a directory.'''
if dirname == '..':
try:
return self.voidcmd('CDUP')
except error_perm, msg:
if msg.args[0][:3] != '500':
raise
elif dirname == '':
dirname = '.' # does nothing, but could return error
cmd = 'CWD ' + dirname
return self.voidcmd(cmd)
def size(self, filename):
'''Retrieve the size of a file.'''
# The SIZE command is defined in RFC-3659
resp = self.sendcmd('SIZE ' + filename)
if resp[:3] == '213':
s = resp[3:].strip()
try:
return int(s)
except (OverflowError, ValueError):
return long(s)
def mkd(self, dirname):
'''Make a directory, return its full pathname.'''
resp = self.sendcmd('MKD ' + dirname)
return parse257(resp)
def rmd(self, dirname):
'''Remove a directory.'''
return self.voidcmd('RMD ' + dirname)
def pwd(self):
'''Return current working directory.'''
resp = self.sendcmd('PWD')
return parse257(resp)
def quit(self):
'''Quit, and close the connection.'''
resp = self.voidcmd('QUIT')
self.close()
return resp
def close(self):
'''Close the connection without assuming anything about it.'''
if self.file:
self.file.close()
self.sock.close()
self.file = self.sock = None
try:
import ssl
except ImportError:
pass
else:
class FTP_TLS(FTP):
'''A FTP subclass which adds TLS support to FTP as described
in RFC-4217.
Connect as usual to port 21 implicitly securing the FTP control
connection before authenticating.
Securing the data connection requires user to explicitly ask
for it by calling prot_p() method.
Usage example:
>>> from ftplib import FTP_TLS
>>> ftps = FTP_TLS('ftp.python.org')
>>> ftps.login() # login anonimously previously securing control channel
'230 Guest login ok, access restrictions apply.'
>>> ftps.prot_p() # switch to secure data connection
'200 Protection level set to P'
>>> ftps.retrlines('LIST') # list directory content securely
total 9
drwxr-xr-x 8 root wheel 1024 Jan 3 1994 .
drwxr-xr-x 8 root wheel 1024 Jan 3 1994 ..
drwxr-xr-x 2 root wheel 1024 Jan 3 1994 bin
drwxr-xr-x 2 root wheel 1024 Jan 3 1994 etc
d-wxrwxr-x 2 ftp wheel 1024 Sep 5 13:43 incoming
drwxr-xr-x 2 root wheel 1024 Nov 17 1993 lib
drwxr-xr-x 6 1094 wheel 1024 Sep 13 19:07 pub
drwxr-xr-x 3 root wheel 1024 Jan 3 1994 usr
-rw-r--r-- 1 root root 312 Aug 1 1994 welcome.msg
'226 Transfer complete.'
>>> ftps.quit()
'221 Goodbye.'
>>>
'''
ssl_version = ssl.PROTOCOL_TLSv1
def __init__(self, host='', user='', passwd='', acct='', keyfile=None,
certfile=None, timeout=_GLOBAL_DEFAULT_TIMEOUT):
self.keyfile = keyfile
self.certfile = certfile
self._prot_p = False
FTP.__init__(self, host, user, passwd, acct, timeout)
def login(self, user='', passwd='', acct='', secure=True):
if secure and not isinstance(self.sock, ssl.SSLSocket):
self.auth()
return FTP.login(self, user, passwd, acct)
def auth(self):
'''Set up secure control connection by using TLS/SSL.'''
if isinstance(self.sock, ssl.SSLSocket):
raise ValueError("Already using TLS")
if self.ssl_version == ssl.PROTOCOL_TLSv1:
resp = self.voidcmd('AUTH TLS')
else:
resp = self.voidcmd('AUTH SSL')
self.sock = ssl.wrap_socket(self.sock, self.keyfile, self.certfile,
ssl_version=self.ssl_version)
self.file = self.sock.makefile(mode='rb')
return resp
def prot_p(self):
'''Set up secure data connection.'''
# PROT defines whether or not the data channel is to be protected.
# Though RFC-2228 defines four possible protection levels,
# RFC-4217 only recommends two, Clear and Private.
# Clear (PROT C) means that no security is to be used on the
# data-channel, Private (PROT P) means that the data-channel
# should be protected by TLS.
# PBSZ command MUST still be issued, but must have a parameter of
# '0' to indicate that no buffering is taking place and the data
# connection should not be encapsulated.
self.voidcmd('PBSZ 0')
resp = self.voidcmd('PROT P')
self._prot_p = True
return resp
def prot_c(self):
'''Set up clear text data connection.'''
resp = self.voidcmd('PROT C')
self._prot_p = False
return resp
# --- Overridden FTP methods
def ntransfercmd(self, cmd, rest=None):
conn, size = FTP.ntransfercmd(self, cmd, rest)
if self._prot_p:
conn = ssl.wrap_socket(conn, self.keyfile, self.certfile,
ssl_version=self.ssl_version)
return conn, size
def retrbinary(self, cmd, callback, blocksize=8192, rest=None):
self.voidcmd('TYPE I')
conn = self.transfercmd(cmd, rest)
try:
while 1:
data = conn.recv(blocksize)
if not data:
break
callback(data)
# shutdown ssl layer
if isinstance(conn, ssl.SSLSocket):
conn.unwrap()
finally:
conn.close()
return self.voidresp()
def retrlines(self, cmd, callback = None):
if callback is None: callback = print_line
resp = self.sendcmd('TYPE A')
conn = self.transfercmd(cmd)
fp = conn.makefile('rb')
try:
while 1:
line = fp.readline()
if self.debugging > 2: print '*retr*', repr(line)
if not line:
break
if line[-2:] == CRLF:
line = line[:-2]
elif line[-1:] == '\n':
line = line[:-1]
callback(line)
# shutdown ssl layer
if isinstance(conn, ssl.SSLSocket):
conn.unwrap()
finally:
fp.close()
conn.close()
return self.voidresp()
def storbinary(self, cmd, fp, blocksize=8192, callback=None, rest=None):
self.voidcmd('TYPE I')
conn = self.transfercmd(cmd, rest)
try:
while 1:
buf = fp.read(blocksize)
if not buf: break
conn.sendall(buf)
if callback: callback(buf)
# shutdown ssl layer
if isinstance(conn, ssl.SSLSocket):
conn.unwrap()
finally:
conn.close()
return self.voidresp()
def storlines(self, cmd, fp, callback=None):
self.voidcmd('TYPE A')
conn = self.transfercmd(cmd)
try:
while 1:
buf = fp.readline()
if not buf: break
if buf[-2:] != CRLF:
if buf[-1] in CRLF: buf = buf[:-1]
buf = buf + CRLF
conn.sendall(buf)
if callback: callback(buf)
# shutdown ssl layer
if isinstance(conn, ssl.SSLSocket):
conn.unwrap()
finally:
conn.close()
return self.voidresp()
__all__.append('FTP_TLS')
all_errors = (Error, IOError, EOFError, ssl.SSLError)
_150_re = None
def parse150(resp):
'''Parse the '150' response for a RETR request.
Returns the expected transfer size or None; size is not guaranteed to
be present in the 150 message.
'''
if resp[:3] != '150':
raise error_reply, resp
global _150_re
if _150_re is None:
import re
_150_re = re.compile("150 .* \((\d+) bytes\)", re.IGNORECASE)
m = _150_re.match(resp)
if not m:
return None
s = m.group(1)
try:
return int(s)
except (OverflowError, ValueError):
return long(s)
_227_re = None
def parse227(resp):
'''Parse the '227' response for a PASV request.
Raises error_proto if it does not contain '(h1,h2,h3,h4,p1,p2)'
Return ('host.addr.as.numbers', port#) tuple.'''
if resp[:3] != '227':
raise error_reply, resp
global _227_re
if _227_re is None:
import re
_227_re = re.compile(r'(\d+),(\d+),(\d+),(\d+),(\d+),(\d+)')
m = _227_re.search(resp)
if not m:
raise error_proto, resp
numbers = m.groups()
host = '.'.join(numbers[:4])
port = (int(numbers[4]) << 8) + int(numbers[5])
return host, port
def parse229(resp, peer):
'''Parse the '229' response for a EPSV request.
Raises error_proto if it does not contain '(|||port|)'
Return ('host.addr.as.numbers', port#) tuple.'''
if resp[:3] != '229':
raise error_reply, resp
left = resp.find('(')
if left < 0: raise error_proto, resp
right = resp.find(')', left + 1)
if right < 0:
raise error_proto, resp # should contain '(|||port|)'
if resp[left + 1] != resp[right - 1]:
raise error_proto, resp
parts = resp[left + 1:right].split(resp[left+1])
if len(parts) != 5:
raise error_proto, resp
host = peer[0]
port = int(parts[3])
return host, port
def parse257(resp):
'''Parse the '257' response for a MKD or PWD request.
This is a response to a MKD or PWD request: a directory name.
Returns the directoryname in the 257 reply.'''
if resp[:3] != '257':
raise error_reply, resp
if resp[3:5] != ' "':
return '' # Not compliant to RFC 959, but UNIX ftpd does this
dirname = ''
i = 5
n = len(resp)
while i < n:
c = resp[i]
i = i+1
if c == '"':
if i >= n or resp[i] != '"':
break
i = i+1
dirname = dirname + c
return dirname
def print_line(line):
'''Default retrlines callback to print a line.'''
print line
def ftpcp(source, sourcename, target, targetname = '', type = 'I'):
'''Copy file from one FTP-instance to another.'''
if not targetname: targetname = sourcename
type = 'TYPE ' + type
source.voidcmd(type)
target.voidcmd(type)
sourcehost, sourceport = parse227(source.sendcmd('PASV'))
target.sendport(sourcehost, sourceport)
# RFC 959: the user must "listen" [...] BEFORE sending the
# transfer request.
# So: STOR before RETR, because here the target is a "user".
treply = target.sendcmd('STOR ' + targetname)
if treply[:3] not in ('125', '150'): raise error_proto # RFC 959
sreply = source.sendcmd('RETR ' + sourcename)
if sreply[:3] not in ('125', '150'): raise error_proto # RFC 959
source.voidresp()
target.voidresp()
class Netrc:
"""Class to parse & provide access to 'netrc' format files.
See the netrc(4) man page for information on the file format.
WARNING: This class is obsolete -- use module netrc instead.
"""
__defuser = None
__defpasswd = None
__defacct = None
def __init__(self, filename=None):
if filename is None:
if "HOME" in os.environ:
filename = os.path.join(os.environ["HOME"],
".netrc")
else:
raise IOError, \
"specify file to load or set $HOME"
self.__hosts = {}
self.__macros = {}
fp = open(filename, "r")
in_macro = 0
while 1:
line = fp.readline()
if not line: break
if in_macro and line.strip():
macro_lines.append(line)
continue
elif in_macro:
self.__macros[macro_name] = tuple(macro_lines)
in_macro = 0
words = line.split()
host = user = passwd = acct = None
default = 0
i = 0
while i < len(words):
w1 = words[i]
if i+1 < len(words):
w2 = words[i + 1]
else:
w2 = None
if w1 == 'default':
default = 1
elif w1 == 'machine' and w2:
host = w2.lower()
i = i + 1
elif w1 == 'login' and w2:
user = w2
i = i + 1
elif w1 == 'password' and w2:
passwd = w2
i = i + 1
elif w1 == 'account' and w2:
acct = w2
i = i + 1
elif w1 == 'macdef' and w2:
macro_name = w2
macro_lines = []
in_macro = 1
break
i = i + 1
if default:
self.__defuser = user or self.__defuser
self.__defpasswd = passwd or self.__defpasswd
self.__defacct = acct or self.__defacct
if host:
if host in self.__hosts:
ouser, opasswd, oacct = \
self.__hosts[host]
user = user or ouser
passwd = passwd or opasswd
acct = acct or oacct
self.__hosts[host] = user, passwd, acct
fp.close()
def get_hosts(self):
"""Return a list of hosts mentioned in the .netrc file."""
return self.__hosts.keys()
def get_account(self, host):
"""Returns login information for the named host.
The return value is a triple containing userid,
password, and the accounting field.
"""
host = host.lower()
user = passwd = acct = None
if host in self.__hosts:
user, passwd, acct = self.__hosts[host]
user = user or self.__defuser
passwd = passwd or self.__defpasswd
acct = acct or self.__defacct
return user, passwd, acct
def get_macros(self):
"""Return a list of all defined macro names."""
return self.__macros.keys()
def get_macro(self, macro):
"""Return a sequence of lines which define a named macro."""
return self.__macros[macro]
def test():
'''Test program.
Usage: ftp [-d] [-r[file]] host [-l[dir]] [-d[dir]] [-p] [file] ...
-d dir
-l list
-p password
'''
if len(sys.argv) < 2:
print test.__doc__
sys.exit(0)
debugging = 0
rcfile = None
while sys.argv[1] == '-d':
debugging = debugging+1
del sys.argv[1]
if sys.argv[1][:2] == '-r':
# get name of alternate ~/.netrc file:
rcfile = sys.argv[1][2:]
del sys.argv[1]
host = sys.argv[1]
ftp = FTP(host)
ftp.set_debuglevel(debugging)
userid = passwd = acct = ''
try:
netrc = Netrc(rcfile)
except IOError:
if rcfile is not None:
sys.stderr.write("Could not open account file"
" -- using anonymous login.")
else:
try:
userid, passwd, acct = netrc.get_account(host)
except KeyError:
# no account for host
sys.stderr.write(
"No account -- using anonymous login.")
ftp.login(userid, passwd, acct)
for file in sys.argv[2:]:
if file[:2] == '-l':
ftp.dir(file[2:])
elif file[:2] == '-d':
cmd = 'CWD'
if file[2:]: cmd = cmd + ' ' + file[2:]
resp = ftp.sendcmd(cmd)
elif file == '-p':
ftp.set_pasv(not ftp.passiveserver)
else:
ftp.retrbinary('RETR ' + file, \
sys.stdout.write, 1024)
ftp.quit()
if __name__ == '__main__':
test()
| Python |
"""Convert a NT pathname to a file URL and vice versa."""
def url2pathname(url):
"""OS-specific conversion from a relative URL of the 'file' scheme
to a file system path; not recommended for general use."""
# e.g.
# ///C|/foo/bar/spam.foo
# becomes
# C:\foo\bar\spam.foo
import string, urllib
# Windows itself uses ":" even in URLs.
url = url.replace(':', '|')
if not '|' in url:
# No drive specifier, just convert slashes
if url[:4] == '////':
# path is something like ////host/path/on/remote/host
# convert this to \\host\path\on\remote\host
# (notice halving of slashes at the start of the path)
url = url[2:]
components = url.split('/')
# make sure not to convert quoted slashes :-)
return urllib.unquote('\\'.join(components))
comp = url.split('|')
if len(comp) != 2 or comp[0][-1] not in string.ascii_letters:
error = 'Bad URL: ' + url
raise IOError, error
drive = comp[0][-1].upper()
components = comp[1].split('/')
path = drive + ':'
for comp in components:
if comp:
path = path + '\\' + urllib.unquote(comp)
return path
def pathname2url(p):
"""OS-specific conversion from a file system path to a relative URL
of the 'file' scheme; not recommended for general use."""
# e.g.
# C:\foo\bar\spam.foo
# becomes
# ///C|/foo/bar/spam.foo
import urllib
if not ':' in p:
# No drive specifier, just convert slashes and quote the name
if p[:2] == '\\\\':
# path is something like \\host\path\on\remote\host
# convert this to ////host/path/on/remote/host
# (notice doubling of slashes at the start of the path)
p = '\\\\' + p
components = p.split('\\')
return urllib.quote('/'.join(components))
comp = p.split(':')
if len(comp) != 2 or len(comp[0]) > 1:
error = 'Bad path: ' + p
raise IOError, error
drive = urllib.quote(comp[0].upper())
components = comp[1].split('\\')
path = '///' + drive + ':'
for comp in components:
if comp:
path = path + '/' + urllib.quote(comp)
return path
| Python |
"""A readline()-style interface to the parts of a multipart message.
The MultiFile class makes each part of a multipart message "feel" like
an ordinary file, as long as you use fp.readline(). Allows recursive
use, for nested multipart messages. Probably best used together
with module mimetools.
Suggested use:
real_fp = open(...)
fp = MultiFile(real_fp)
"read some lines from fp"
fp.push(separator)
while 1:
"read lines from fp until it returns an empty string" (A)
if not fp.next(): break
fp.pop()
"read remaining lines from fp until it returns an empty string"
The latter sequence may be used recursively at (A).
It is also allowed to use multiple push()...pop() sequences.
If seekable is given as 0, the class code will not do the bookkeeping
it normally attempts in order to make seeks relative to the beginning of the
current file part. This may be useful when using MultiFile with a non-
seekable stream object.
"""
from warnings import warn
warn("the multifile module has been deprecated since Python 2.5",
DeprecationWarning, stacklevel=2)
del warn
__all__ = ["MultiFile","Error"]
class Error(Exception):
pass
class MultiFile:
seekable = 0
def __init__(self, fp, seekable=1):
self.fp = fp
self.stack = []
self.level = 0
self.last = 0
if seekable:
self.seekable = 1
self.start = self.fp.tell()
self.posstack = []
def tell(self):
if self.level > 0:
return self.lastpos
return self.fp.tell() - self.start
def seek(self, pos, whence=0):
here = self.tell()
if whence:
if whence == 1:
pos = pos + here
elif whence == 2:
if self.level > 0:
pos = pos + self.lastpos
else:
raise Error, "can't use whence=2 yet"
if not 0 <= pos <= here or \
self.level > 0 and pos > self.lastpos:
raise Error, 'bad MultiFile.seek() call'
self.fp.seek(pos + self.start)
self.level = 0
self.last = 0
def readline(self):
if self.level > 0:
return ''
line = self.fp.readline()
# Real EOF?
if not line:
self.level = len(self.stack)
self.last = (self.level > 0)
if self.last:
raise Error, 'sudden EOF in MultiFile.readline()'
return ''
assert self.level == 0
# Fast check to see if this is just data
if self.is_data(line):
return line
else:
# Ignore trailing whitespace on marker lines
marker = line.rstrip()
# No? OK, try to match a boundary.
# Return the line (unstripped) if we don't.
for i, sep in enumerate(reversed(self.stack)):
if marker == self.section_divider(sep):
self.last = 0
break
elif marker == self.end_marker(sep):
self.last = 1
break
else:
return line
# We only get here if we see a section divider or EOM line
if self.seekable:
self.lastpos = self.tell() - len(line)
self.level = i+1
if self.level > 1:
raise Error,'Missing endmarker in MultiFile.readline()'
return ''
def readlines(self):
list = []
while 1:
line = self.readline()
if not line: break
list.append(line)
return list
def read(self): # Note: no size argument -- read until EOF only!
return ''.join(self.readlines())
def next(self):
while self.readline(): pass
if self.level > 1 or self.last:
return 0
self.level = 0
self.last = 0
if self.seekable:
self.start = self.fp.tell()
return 1
def push(self, sep):
if self.level > 0:
raise Error, 'bad MultiFile.push() call'
self.stack.append(sep)
if self.seekable:
self.posstack.append(self.start)
self.start = self.fp.tell()
def pop(self):
if self.stack == []:
raise Error, 'bad MultiFile.pop() call'
if self.level <= 1:
self.last = 0
else:
abslastpos = self.lastpos + self.start
self.level = max(0, self.level - 1)
self.stack.pop()
if self.seekable:
self.start = self.posstack.pop()
if self.level > 0:
self.lastpos = abslastpos - self.start
def is_data(self, line):
return line[:2] != '--'
def section_divider(self, str):
return "--" + str
def end_marker(self, str):
return "--" + str + "--"
| Python |
"""Utility functions for copying and archiving files and directory trees.
XXX The functions here don't copy the resource fork or other metadata on Mac.
"""
import os
import sys
import stat
from os.path import abspath
import fnmatch
import collections
import errno
try:
from pwd import getpwnam
except ImportError:
getpwnam = None
try:
from grp import getgrnam
except ImportError:
getgrnam = None
__all__ = ["copyfileobj", "copyfile", "copymode", "copystat", "copy", "copy2",
"copytree", "move", "rmtree", "Error", "SpecialFileError",
"ExecError", "make_archive", "get_archive_formats",
"register_archive_format", "unregister_archive_format"]
class Error(EnvironmentError):
pass
class SpecialFileError(EnvironmentError):
"""Raised when trying to do a kind of operation (e.g. copying) which is
not supported on a special file (e.g. a named pipe)"""
class ExecError(EnvironmentError):
"""Raised when a command could not be executed"""
try:
WindowsError
except NameError:
WindowsError = None
def copyfileobj(fsrc, fdst, length=16*1024):
"""copy data from file-like object fsrc to file-like object fdst"""
while 1:
buf = fsrc.read(length)
if not buf:
break
fdst.write(buf)
def _samefile(src, dst):
# Macintosh, Unix.
if hasattr(os.path, 'samefile'):
try:
return os.path.samefile(src, dst)
except OSError:
return False
# All other platforms: check for same pathname.
return (os.path.normcase(os.path.abspath(src)) ==
os.path.normcase(os.path.abspath(dst)))
def copyfile(src, dst):
"""Copy data from src to dst"""
if _samefile(src, dst):
raise Error("`%s` and `%s` are the same file" % (src, dst))
for fn in [src, dst]:
try:
st = os.stat(fn)
except OSError:
# File most likely does not exist
pass
else:
# XXX What about other special files? (sockets, devices...)
if stat.S_ISFIFO(st.st_mode):
raise SpecialFileError("`%s` is a named pipe" % fn)
with open(src, 'rb') as fsrc:
with open(dst, 'wb') as fdst:
copyfileobj(fsrc, fdst)
def copymode(src, dst):
"""Copy mode bits from src to dst"""
if hasattr(os, 'chmod'):
st = os.stat(src)
mode = stat.S_IMODE(st.st_mode)
os.chmod(dst, mode)
def copystat(src, dst):
"""Copy all stat info (mode bits, atime, mtime, flags) from src to dst"""
st = os.stat(src)
mode = stat.S_IMODE(st.st_mode)
if hasattr(os, 'utime'):
os.utime(dst, (st.st_atime, st.st_mtime))
if hasattr(os, 'chmod'):
os.chmod(dst, mode)
if hasattr(os, 'chflags') and hasattr(st, 'st_flags'):
try:
os.chflags(dst, st.st_flags)
except OSError, why:
if (not hasattr(errno, 'EOPNOTSUPP') or
why.errno != errno.EOPNOTSUPP):
raise
def copy(src, dst):
"""Copy data and mode bits ("cp src dst").
The destination may be a directory.
"""
if os.path.isdir(dst):
dst = os.path.join(dst, os.path.basename(src))
copyfile(src, dst)
copymode(src, dst)
def copy2(src, dst):
"""Copy data and all stat info ("cp -p src dst").
The destination may be a directory.
"""
if os.path.isdir(dst):
dst = os.path.join(dst, os.path.basename(src))
copyfile(src, dst)
copystat(src, dst)
def ignore_patterns(*patterns):
"""Function that can be used as copytree() ignore parameter.
Patterns is a sequence of glob-style patterns
that are used to exclude files"""
def _ignore_patterns(path, names):
ignored_names = []
for pattern in patterns:
ignored_names.extend(fnmatch.filter(names, pattern))
return set(ignored_names)
return _ignore_patterns
def copytree(src, dst, symlinks=False, ignore=None):
"""Recursively copy a directory tree using copy2().
The destination directory must not already exist.
If exception(s) occur, an Error is raised with a list of reasons.
If the optional symlinks flag is true, symbolic links in the
source tree result in symbolic links in the destination tree; if
it is false, the contents of the files pointed to by symbolic
links are copied.
The optional ignore argument is a callable. If given, it
is called with the `src` parameter, which is the directory
being visited by copytree(), and `names` which is the list of
`src` contents, as returned by os.listdir():
callable(src, names) -> ignored_names
Since copytree() is called recursively, the callable will be
called once for each directory that is copied. It returns a
list of names relative to the `src` directory that should
not be copied.
XXX Consider this example code rather than the ultimate tool.
"""
names = os.listdir(src)
if ignore is not None:
ignored_names = ignore(src, names)
else:
ignored_names = set()
os.makedirs(dst)
errors = []
for name in names:
if name in ignored_names:
continue
srcname = os.path.join(src, name)
dstname = os.path.join(dst, name)
try:
if symlinks and os.path.islink(srcname):
linkto = os.readlink(srcname)
os.symlink(linkto, dstname)
elif os.path.isdir(srcname):
copytree(srcname, dstname, symlinks, ignore)
else:
# Will raise a SpecialFileError for unsupported file types
copy2(srcname, dstname)
# catch the Error from the recursive copytree so that we can
# continue with other files
except Error, err:
errors.extend(err.args[0])
except EnvironmentError, why:
errors.append((srcname, dstname, str(why)))
try:
copystat(src, dst)
except OSError, why:
if WindowsError is not None and isinstance(why, WindowsError):
# Copying file access times may fail on Windows
pass
else:
errors.extend((src, dst, str(why)))
if errors:
raise Error, errors
def rmtree(path, ignore_errors=False, onerror=None):
"""Recursively delete a directory tree.
If ignore_errors is set, errors are ignored; otherwise, if onerror
is set, it is called to handle the error with arguments (func,
path, exc_info) where func is os.listdir, os.remove, or os.rmdir;
path is the argument to that function that caused it to fail; and
exc_info is a tuple returned by sys.exc_info(). If ignore_errors
is false and onerror is None, an exception is raised.
"""
if ignore_errors:
def onerror(*args):
pass
elif onerror is None:
def onerror(*args):
raise
try:
if os.path.islink(path):
# symlinks to directories are forbidden, see bug #1669
raise OSError("Cannot call rmtree on a symbolic link")
except OSError:
onerror(os.path.islink, path, sys.exc_info())
# can't continue even if onerror hook returns
return
names = []
try:
names = os.listdir(path)
except os.error, err:
onerror(os.listdir, path, sys.exc_info())
for name in names:
fullname = os.path.join(path, name)
try:
mode = os.lstat(fullname).st_mode
except os.error:
mode = 0
if stat.S_ISDIR(mode):
rmtree(fullname, ignore_errors, onerror)
else:
try:
os.remove(fullname)
except os.error, err:
onerror(os.remove, fullname, sys.exc_info())
try:
os.rmdir(path)
except os.error:
onerror(os.rmdir, path, sys.exc_info())
def _basename(path):
# A basename() variant which first strips the trailing slash, if present.
# Thus we always get the last component of the path, even for directories.
return os.path.basename(path.rstrip(os.path.sep))
def move(src, dst):
"""Recursively move a file or directory to another location. This is
similar to the Unix "mv" command.
If the destination is a directory or a symlink to a directory, the source
is moved inside the directory. The destination path must not already
exist.
If the destination already exists but is not a directory, it may be
overwritten depending on os.rename() semantics.
If the destination is on our current filesystem, then rename() is used.
Otherwise, src is copied to the destination and then removed.
A lot more could be done here... A look at a mv.c shows a lot of
the issues this implementation glosses over.
"""
real_dst = dst
if os.path.isdir(dst):
real_dst = os.path.join(dst, _basename(src))
if os.path.exists(real_dst):
raise Error, "Destination path '%s' already exists" % real_dst
try:
os.rename(src, real_dst)
except OSError:
if os.path.isdir(src):
if _destinsrc(src, dst):
raise Error, "Cannot move a directory '%s' into itself '%s'." % (src, dst)
copytree(src, real_dst, symlinks=True)
rmtree(src)
else:
copy2(src, real_dst)
os.unlink(src)
def _destinsrc(src, dst):
src = abspath(src)
dst = abspath(dst)
if not src.endswith(os.path.sep):
src += os.path.sep
if not dst.endswith(os.path.sep):
dst += os.path.sep
return dst.startswith(src)
def _get_gid(name):
"""Returns a gid, given a group name."""
if getgrnam is None or name is None:
return None
try:
result = getgrnam(name)
except KeyError:
result = None
if result is not None:
return result[2]
return None
def _get_uid(name):
"""Returns an uid, given a user name."""
if getpwnam is None or name is None:
return None
try:
result = getpwnam(name)
except KeyError:
result = None
if result is not None:
return result[2]
return None
def _make_tarball(base_name, base_dir, compress="gzip", verbose=0, dry_run=0,
owner=None, group=None, logger=None):
"""Create a (possibly compressed) tar file from all the files under
'base_dir'.
'compress' must be "gzip" (the default), "bzip2", or None.
'owner' and 'group' can be used to define an owner and a group for the
archive that is being built. If not provided, the current owner and group
will be used.
The output tar file will be named 'base_dir' + ".tar", possibly plus
the appropriate compression extension (".gz", or ".bz2").
Returns the output filename.
"""
tar_compression = {'gzip': 'gz', 'bzip2': 'bz2', None: ''}
compress_ext = {'gzip': '.gz', 'bzip2': '.bz2'}
# flags for compression program, each element of list will be an argument
if compress is not None and compress not in compress_ext.keys():
raise ValueError, \
("bad value for 'compress': must be None, 'gzip' or 'bzip2'")
archive_name = base_name + '.tar' + compress_ext.get(compress, '')
archive_dir = os.path.dirname(archive_name)
if not os.path.exists(archive_dir):
logger.info("creating %s" % archive_dir)
if not dry_run:
os.makedirs(archive_dir)
# creating the tarball
import tarfile # late import so Python build itself doesn't break
if logger is not None:
logger.info('Creating tar archive')
uid = _get_uid(owner)
gid = _get_gid(group)
def _set_uid_gid(tarinfo):
if gid is not None:
tarinfo.gid = gid
tarinfo.gname = group
if uid is not None:
tarinfo.uid = uid
tarinfo.uname = owner
return tarinfo
if not dry_run:
tar = tarfile.open(archive_name, 'w|%s' % tar_compression[compress])
try:
tar.add(base_dir, filter=_set_uid_gid)
finally:
tar.close()
return archive_name
def _call_external_zip(base_dir, zip_filename, verbose=False, dry_run=False):
# XXX see if we want to keep an external call here
if verbose:
zipoptions = "-r"
else:
zipoptions = "-rq"
from distutils.errors import DistutilsExecError
from distutils.spawn import spawn
try:
spawn(["zip", zipoptions, zip_filename, base_dir], dry_run=dry_run)
except DistutilsExecError:
# XXX really should distinguish between "couldn't find
# external 'zip' command" and "zip failed".
raise ExecError, \
("unable to create zip file '%s': "
"could neither import the 'zipfile' module nor "
"find a standalone zip utility") % zip_filename
def _make_zipfile(base_name, base_dir, verbose=0, dry_run=0, logger=None):
"""Create a zip file from all the files under 'base_dir'.
The output zip file will be named 'base_dir' + ".zip". Uses either the
"zipfile" Python module (if available) or the InfoZIP "zip" utility
(if installed and found on the default search path). If neither tool is
available, raises ExecError. Returns the name of the output zip
file.
"""
zip_filename = base_name + ".zip"
archive_dir = os.path.dirname(base_name)
if not os.path.exists(archive_dir):
if logger is not None:
logger.info("creating %s", archive_dir)
if not dry_run:
os.makedirs(archive_dir)
# If zipfile module is not available, try spawning an external 'zip'
# command.
try:
import zipfile
except ImportError:
zipfile = None
if zipfile is None:
_call_external_zip(base_dir, zip_filename, verbose, dry_run)
else:
if logger is not None:
logger.info("creating '%s' and adding '%s' to it",
zip_filename, base_dir)
if not dry_run:
zip = zipfile.ZipFile(zip_filename, "w",
compression=zipfile.ZIP_DEFLATED)
for dirpath, dirnames, filenames in os.walk(base_dir):
for name in filenames:
path = os.path.normpath(os.path.join(dirpath, name))
if os.path.isfile(path):
zip.write(path, path)
if logger is not None:
logger.info("adding '%s'", path)
zip.close()
return zip_filename
_ARCHIVE_FORMATS = {
'gztar': (_make_tarball, [('compress', 'gzip')], "gzip'ed tar-file"),
'bztar': (_make_tarball, [('compress', 'bzip2')], "bzip2'ed tar-file"),
'tar': (_make_tarball, [('compress', None)], "uncompressed tar file"),
'zip': (_make_zipfile, [],"ZIP file")
}
def get_archive_formats():
"""Returns a list of supported formats for archiving and unarchiving.
Each element of the returned sequence is a tuple (name, description)
"""
formats = [(name, registry[2]) for name, registry in
_ARCHIVE_FORMATS.items()]
formats.sort()
return formats
def register_archive_format(name, function, extra_args=None, description=''):
"""Registers an archive format.
name is the name of the format. function is the callable that will be
used to create archives. If provided, extra_args is a sequence of
(name, value) tuples that will be passed as arguments to the callable.
description can be provided to describe the format, and will be returned
by the get_archive_formats() function.
"""
if extra_args is None:
extra_args = []
if not isinstance(function, collections.Callable):
raise TypeError('The %s object is not callable' % function)
if not isinstance(extra_args, (tuple, list)):
raise TypeError('extra_args needs to be a sequence')
for element in extra_args:
if not isinstance(element, (tuple, list)) or len(element) !=2 :
raise TypeError('extra_args elements are : (arg_name, value)')
_ARCHIVE_FORMATS[name] = (function, extra_args, description)
def unregister_archive_format(name):
del _ARCHIVE_FORMATS[name]
def make_archive(base_name, format, root_dir=None, base_dir=None, verbose=0,
dry_run=0, owner=None, group=None, logger=None):
"""Create an archive file (eg. zip or tar).
'base_name' is the name of the file to create, minus any format-specific
extension; 'format' is the archive format: one of "zip", "tar", "bztar"
or "gztar".
'root_dir' is a directory that will be the root directory of the
archive; ie. we typically chdir into 'root_dir' before creating the
archive. 'base_dir' is the directory where we start archiving from;
ie. 'base_dir' will be the common prefix of all files and
directories in the archive. 'root_dir' and 'base_dir' both default
to the current directory. Returns the name of the archive file.
'owner' and 'group' are used when creating a tar archive. By default,
uses the current owner and group.
"""
save_cwd = os.getcwd()
if root_dir is not None:
if logger is not None:
logger.debug("changing into '%s'", root_dir)
base_name = os.path.abspath(base_name)
if not dry_run:
os.chdir(root_dir)
if base_dir is None:
base_dir = os.curdir
kwargs = {'dry_run': dry_run, 'logger': logger}
try:
format_info = _ARCHIVE_FORMATS[format]
except KeyError:
raise ValueError, "unknown archive format '%s'" % format
func = format_info[0]
for arg, val in format_info[1]:
kwargs[arg] = val
if format != 'zip':
kwargs['owner'] = owner
kwargs['group'] = group
try:
filename = func(base_name, base_dir, **kwargs)
finally:
if root_dir is not None:
if logger is not None:
logger.debug("changing back to '%s'", save_cwd)
os.chdir(save_cwd)
return filename
| Python |
"""Filename matching with shell patterns.
fnmatch(FILENAME, PATTERN) matches according to the local convention.
fnmatchcase(FILENAME, PATTERN) always takes case in account.
The functions operate by translating the pattern into a regular
expression. They cache the compiled regular expressions for speed.
The function translate(PATTERN) returns a regular expression
corresponding to PATTERN. (It does not compile it.)
"""
import re
__all__ = ["filter", "fnmatch", "fnmatchcase", "translate"]
_cache = {}
_MAXCACHE = 100
def _purge():
"""Clear the pattern cache"""
_cache.clear()
def fnmatch(name, pat):
"""Test whether FILENAME matches PATTERN.
Patterns are Unix shell style:
* matches everything
? matches any single character
[seq] matches any character in seq
[!seq] matches any char not in seq
An initial period in FILENAME is not special.
Both FILENAME and PATTERN are first case-normalized
if the operating system requires it.
If you don't want this, use fnmatchcase(FILENAME, PATTERN).
"""
import os
name = os.path.normcase(name)
pat = os.path.normcase(pat)
return fnmatchcase(name, pat)
def filter(names, pat):
"""Return the subset of the list NAMES that match PAT"""
import os,posixpath
result=[]
pat=os.path.normcase(pat)
if not pat in _cache:
res = translate(pat)
if len(_cache) >= _MAXCACHE:
_cache.clear()
_cache[pat] = re.compile(res)
match=_cache[pat].match
if os.path is posixpath:
# normcase on posix is NOP. Optimize it away from the loop.
for name in names:
if match(name):
result.append(name)
else:
for name in names:
if match(os.path.normcase(name)):
result.append(name)
return result
def fnmatchcase(name, pat):
"""Test whether FILENAME matches PATTERN, including case.
This is a version of fnmatch() which doesn't case-normalize
its arguments.
"""
if not pat in _cache:
res = translate(pat)
if len(_cache) >= _MAXCACHE:
_cache.clear()
_cache[pat] = re.compile(res)
return _cache[pat].match(name) is not None
def translate(pat):
"""Translate a shell PATTERN to a regular expression.
There is no way to quote meta-characters.
"""
i, n = 0, len(pat)
res = ''
while i < n:
c = pat[i]
i = i+1
if c == '*':
res = res + '.*'
elif c == '?':
res = res + '.'
elif c == '[':
j = i
if j < n and pat[j] == '!':
j = j+1
if j < n and pat[j] == ']':
j = j+1
while j < n and pat[j] != ']':
j = j+1
if j >= n:
res = res + '\\['
else:
stuff = pat[i:j].replace('\\','\\\\')
i = j+1
if stuff[0] == '!':
stuff = '^' + stuff[1:]
elif stuff[0] == '^':
stuff = '\\' + stuff
res = '%s[%s]' % (res, stuff)
else:
res = res + re.escape(c)
return res + '\Z(?ms)'
| Python |
#! /usr/bin/env python
"""RFC 3548: Base16, Base32, Base64 Data Encodings"""
# Modified 04-Oct-1995 by Jack Jansen to use binascii module
# Modified 30-Dec-2003 by Barry Warsaw to add full RFC 3548 support
import re
import struct
import binascii
__all__ = [
# Legacy interface exports traditional RFC 1521 Base64 encodings
'encode', 'decode', 'encodestring', 'decodestring',
# Generalized interface for other encodings
'b64encode', 'b64decode', 'b32encode', 'b32decode',
'b16encode', 'b16decode',
# Standard Base64 encoding
'standard_b64encode', 'standard_b64decode',
# Some common Base64 alternatives. As referenced by RFC 3458, see thread
# starting at:
#
# http://zgp.org/pipermail/p2p-hackers/2001-September/000316.html
'urlsafe_b64encode', 'urlsafe_b64decode',
]
_translation = [chr(_x) for _x in range(256)]
EMPTYSTRING = ''
def _translate(s, altchars):
translation = _translation[:]
for k, v in altchars.items():
translation[ord(k)] = v
return s.translate(''.join(translation))
# Base64 encoding/decoding uses binascii
def b64encode(s, altchars=None):
"""Encode a string using Base64.
s is the string to encode. Optional altchars must be a string of at least
length 2 (additional characters are ignored) which specifies an
alternative alphabet for the '+' and '/' characters. This allows an
application to e.g. generate url or filesystem safe Base64 strings.
The encoded string is returned.
"""
# Strip off the trailing newline
encoded = binascii.b2a_base64(s)[:-1]
if altchars is not None:
return _translate(encoded, {'+': altchars[0], '/': altchars[1]})
return encoded
def b64decode(s, altchars=None):
"""Decode a Base64 encoded string.
s is the string to decode. Optional altchars must be a string of at least
length 2 (additional characters are ignored) which specifies the
alternative alphabet used instead of the '+' and '/' characters.
The decoded string is returned. A TypeError is raised if s were
incorrectly padded or if there are non-alphabet characters present in the
string.
"""
if altchars is not None:
s = _translate(s, {altchars[0]: '+', altchars[1]: '/'})
try:
return binascii.a2b_base64(s)
except binascii.Error, msg:
# Transform this exception for consistency
raise TypeError(msg)
def standard_b64encode(s):
"""Encode a string using the standard Base64 alphabet.
s is the string to encode. The encoded string is returned.
"""
return b64encode(s)
def standard_b64decode(s):
"""Decode a string encoded with the standard Base64 alphabet.
s is the string to decode. The decoded string is returned. A TypeError
is raised if the string is incorrectly padded or if there are non-alphabet
characters present in the string.
"""
return b64decode(s)
def urlsafe_b64encode(s):
"""Encode a string using a url-safe Base64 alphabet.
s is the string to encode. The encoded string is returned. The alphabet
uses '-' instead of '+' and '_' instead of '/'.
"""
return b64encode(s, '-_')
def urlsafe_b64decode(s):
"""Decode a string encoded with the standard Base64 alphabet.
s is the string to decode. The decoded string is returned. A TypeError
is raised if the string is incorrectly padded or if there are non-alphabet
characters present in the string.
The alphabet uses '-' instead of '+' and '_' instead of '/'.
"""
return b64decode(s, '-_')
# Base32 encoding/decoding must be done in Python
_b32alphabet = {
0: 'A', 9: 'J', 18: 'S', 27: '3',
1: 'B', 10: 'K', 19: 'T', 28: '4',
2: 'C', 11: 'L', 20: 'U', 29: '5',
3: 'D', 12: 'M', 21: 'V', 30: '6',
4: 'E', 13: 'N', 22: 'W', 31: '7',
5: 'F', 14: 'O', 23: 'X',
6: 'G', 15: 'P', 24: 'Y',
7: 'H', 16: 'Q', 25: 'Z',
8: 'I', 17: 'R', 26: '2',
}
_b32tab = _b32alphabet.items()
_b32tab.sort()
_b32tab = [v for k, v in _b32tab]
_b32rev = dict([(v, long(k)) for k, v in _b32alphabet.items()])
def b32encode(s):
"""Encode a string using Base32.
s is the string to encode. The encoded string is returned.
"""
parts = []
quanta, leftover = divmod(len(s), 5)
# Pad the last quantum with zero bits if necessary
if leftover:
s += ('\0' * (5 - leftover))
quanta += 1
for i in range(quanta):
# c1 and c2 are 16 bits wide, c3 is 8 bits wide. The intent of this
# code is to process the 40 bits in units of 5 bits. So we take the 1
# leftover bit of c1 and tack it onto c2. Then we take the 2 leftover
# bits of c2 and tack them onto c3. The shifts and masks are intended
# to give us values of exactly 5 bits in width.
c1, c2, c3 = struct.unpack('!HHB', s[i*5:(i+1)*5])
c2 += (c1 & 1) << 16 # 17 bits wide
c3 += (c2 & 3) << 8 # 10 bits wide
parts.extend([_b32tab[c1 >> 11], # bits 1 - 5
_b32tab[(c1 >> 6) & 0x1f], # bits 6 - 10
_b32tab[(c1 >> 1) & 0x1f], # bits 11 - 15
_b32tab[c2 >> 12], # bits 16 - 20 (1 - 5)
_b32tab[(c2 >> 7) & 0x1f], # bits 21 - 25 (6 - 10)
_b32tab[(c2 >> 2) & 0x1f], # bits 26 - 30 (11 - 15)
_b32tab[c3 >> 5], # bits 31 - 35 (1 - 5)
_b32tab[c3 & 0x1f], # bits 36 - 40 (1 - 5)
])
encoded = EMPTYSTRING.join(parts)
# Adjust for any leftover partial quanta
if leftover == 1:
return encoded[:-6] + '======'
elif leftover == 2:
return encoded[:-4] + '===='
elif leftover == 3:
return encoded[:-3] + '==='
elif leftover == 4:
return encoded[:-1] + '='
return encoded
def b32decode(s, casefold=False, map01=None):
"""Decode a Base32 encoded string.
s is the string to decode. Optional casefold is a flag specifying whether
a lowercase alphabet is acceptable as input. For security purposes, the
default is False.
RFC 3548 allows for optional mapping of the digit 0 (zero) to the letter O
(oh), and for optional mapping of the digit 1 (one) to either the letter I
(eye) or letter L (el). The optional argument map01 when not None,
specifies which letter the digit 1 should be mapped to (when map01 is not
None, the digit 0 is always mapped to the letter O). For security
purposes the default is None, so that 0 and 1 are not allowed in the
input.
The decoded string is returned. A TypeError is raised if s were
incorrectly padded or if there are non-alphabet characters present in the
string.
"""
quanta, leftover = divmod(len(s), 8)
if leftover:
raise TypeError('Incorrect padding')
# Handle section 2.4 zero and one mapping. The flag map01 will be either
# False, or the character to map the digit 1 (one) to. It should be
# either L (el) or I (eye).
if map01:
s = _translate(s, {'0': 'O', '1': map01})
if casefold:
s = s.upper()
# Strip off pad characters from the right. We need to count the pad
# characters because this will tell us how many null bytes to remove from
# the end of the decoded string.
padchars = 0
mo = re.search('(?P<pad>[=]*)$', s)
if mo:
padchars = len(mo.group('pad'))
if padchars > 0:
s = s[:-padchars]
# Now decode the full quanta
parts = []
acc = 0
shift = 35
for c in s:
val = _b32rev.get(c)
if val is None:
raise TypeError('Non-base32 digit found')
acc += _b32rev[c] << shift
shift -= 5
if shift < 0:
parts.append(binascii.unhexlify('%010x' % acc))
acc = 0
shift = 35
# Process the last, partial quanta
last = binascii.unhexlify('%010x' % acc)
if padchars == 0:
last = '' # No characters
elif padchars == 1:
last = last[:-1]
elif padchars == 3:
last = last[:-2]
elif padchars == 4:
last = last[:-3]
elif padchars == 6:
last = last[:-4]
else:
raise TypeError('Incorrect padding')
parts.append(last)
return EMPTYSTRING.join(parts)
# RFC 3548, Base 16 Alphabet specifies uppercase, but hexlify() returns
# lowercase. The RFC also recommends against accepting input case
# insensitively.
def b16encode(s):
"""Encode a string using Base16.
s is the string to encode. The encoded string is returned.
"""
return binascii.hexlify(s).upper()
def b16decode(s, casefold=False):
"""Decode a Base16 encoded string.
s is the string to decode. Optional casefold is a flag specifying whether
a lowercase alphabet is acceptable as input. For security purposes, the
default is False.
The decoded string is returned. A TypeError is raised if s were
incorrectly padded or if there are non-alphabet characters present in the
string.
"""
if casefold:
s = s.upper()
if re.search('[^0-9A-F]', s):
raise TypeError('Non-base16 digit found')
return binascii.unhexlify(s)
# Legacy interface. This code could be cleaned up since I don't believe
# binascii has any line length limitations. It just doesn't seem worth it
# though.
MAXLINESIZE = 76 # Excluding the CRLF
MAXBINSIZE = (MAXLINESIZE//4)*3
def encode(input, output):
"""Encode a file."""
while True:
s = input.read(MAXBINSIZE)
if not s:
break
while len(s) < MAXBINSIZE:
ns = input.read(MAXBINSIZE-len(s))
if not ns:
break
s += ns
line = binascii.b2a_base64(s)
output.write(line)
def decode(input, output):
"""Decode a file."""
while True:
line = input.readline()
if not line:
break
s = binascii.a2b_base64(line)
output.write(s)
def encodestring(s):
"""Encode a string into multiple lines of base-64 data."""
pieces = []
for i in range(0, len(s), MAXBINSIZE):
chunk = s[i : i + MAXBINSIZE]
pieces.append(binascii.b2a_base64(chunk))
return "".join(pieces)
def decodestring(s):
"""Decode a string."""
return binascii.a2b_base64(s)
# Useable as a script...
def test():
"""Small test program"""
import sys, getopt
try:
opts, args = getopt.getopt(sys.argv[1:], 'deut')
except getopt.error, msg:
sys.stdout = sys.stderr
print msg
print """usage: %s [-d|-e|-u|-t] [file|-]
-d, -u: decode
-e: encode (default)
-t: encode and decode string 'Aladdin:open sesame'"""%sys.argv[0]
sys.exit(2)
func = encode
for o, a in opts:
if o == '-e': func = encode
if o == '-d': func = decode
if o == '-u': func = decode
if o == '-t': test1(); return
if args and args[0] != '-':
with open(args[0], 'rb') as f:
func(f, sys.stdout)
else:
func(sys.stdin, sys.stdout)
def test1():
s0 = "Aladdin:open sesame"
s1 = encodestring(s0)
s2 = decodestring(s1)
print s0, repr(s1), s2
if __name__ == '__main__':
test()
| Python |
"""Simple class to read IFF chunks.
An IFF chunk (used in formats such as AIFF, TIFF, RMFF (RealMedia File
Format)) has the following structure:
+----------------+
| ID (4 bytes) |
+----------------+
| size (4 bytes) |
+----------------+
| data |
| ... |
+----------------+
The ID is a 4-byte string which identifies the type of chunk.
The size field (a 32-bit value, encoded using big-endian byte order)
gives the size of the whole chunk, including the 8-byte header.
Usually an IFF-type file consists of one or more chunks. The proposed
usage of the Chunk class defined here is to instantiate an instance at
the start of each chunk and read from the instance until it reaches
the end, after which a new instance can be instantiated. At the end
of the file, creating a new instance will fail with a EOFError
exception.
Usage:
while True:
try:
chunk = Chunk(file)
except EOFError:
break
chunktype = chunk.getname()
while True:
data = chunk.read(nbytes)
if not data:
pass
# do something with data
The interface is file-like. The implemented methods are:
read, close, seek, tell, isatty.
Extra methods are: skip() (called by close, skips to the end of the chunk),
getname() (returns the name (ID) of the chunk)
The __init__ method has one required argument, a file-like object
(including a chunk instance), and one optional argument, a flag which
specifies whether or not chunks are aligned on 2-byte boundaries. The
default is 1, i.e. aligned.
"""
class Chunk:
def __init__(self, file, align=True, bigendian=True, inclheader=False):
import struct
self.closed = False
self.align = align # whether to align to word (2-byte) boundaries
if bigendian:
strflag = '>'
else:
strflag = '<'
self.file = file
self.chunkname = file.read(4)
if len(self.chunkname) < 4:
raise EOFError
try:
self.chunksize = struct.unpack(strflag+'L', file.read(4))[0]
except struct.error:
raise EOFError
if inclheader:
self.chunksize = self.chunksize - 8 # subtract header
self.size_read = 0
try:
self.offset = self.file.tell()
except (AttributeError, IOError):
self.seekable = False
else:
self.seekable = True
def getname(self):
"""Return the name (ID) of the current chunk."""
return self.chunkname
def getsize(self):
"""Return the size of the current chunk."""
return self.chunksize
def close(self):
if not self.closed:
self.skip()
self.closed = True
def isatty(self):
if self.closed:
raise ValueError, "I/O operation on closed file"
return False
def seek(self, pos, whence=0):
"""Seek to specified position into the chunk.
Default position is 0 (start of chunk).
If the file is not seekable, this will result in an error.
"""
if self.closed:
raise ValueError, "I/O operation on closed file"
if not self.seekable:
raise IOError, "cannot seek"
if whence == 1:
pos = pos + self.size_read
elif whence == 2:
pos = pos + self.chunksize
if pos < 0 or pos > self.chunksize:
raise RuntimeError
self.file.seek(self.offset + pos, 0)
self.size_read = pos
def tell(self):
if self.closed:
raise ValueError, "I/O operation on closed file"
return self.size_read
def read(self, size=-1):
"""Read at most size bytes from the chunk.
If size is omitted or negative, read until the end
of the chunk.
"""
if self.closed:
raise ValueError, "I/O operation on closed file"
if self.size_read >= self.chunksize:
return ''
if size < 0:
size = self.chunksize - self.size_read
if size > self.chunksize - self.size_read:
size = self.chunksize - self.size_read
data = self.file.read(size)
self.size_read = self.size_read + len(data)
if self.size_read == self.chunksize and \
self.align and \
(self.chunksize & 1):
dummy = self.file.read(1)
self.size_read = self.size_read + len(dummy)
return data
def skip(self):
"""Skip the rest of the chunk.
If you are not interested in the contents of the chunk,
this method should be called so that the file points to
the start of the next chunk.
"""
if self.closed:
raise ValueError, "I/O operation on closed file"
if self.seekable:
try:
n = self.chunksize - self.size_read
# maybe fix alignment
if self.align and (self.chunksize & 1):
n = n + 1
self.file.seek(n, 1)
self.size_read = self.size_read + n
return
except IOError:
pass
while self.size_read < self.chunksize:
n = min(8192, self.chunksize - self.size_read)
dummy = self.read(n)
if not dummy:
raise EOFError
| Python |
"""Open an arbitrary URL.
See the following document for more info on URLs:
"Names and Addresses, URIs, URLs, URNs, URCs", at
http://www.w3.org/pub/WWW/Addressing/Overview.html
See also the HTTP spec (from which the error codes are derived):
"HTTP - Hypertext Transfer Protocol", at
http://www.w3.org/pub/WWW/Protocols/
Related standards and specs:
- RFC1808: the "relative URL" spec. (authoritative status)
- RFC1738 - the "URL standard". (authoritative status)
- RFC1630 - the "URI spec". (informational status)
The object returned by URLopener().open(file) will differ per
protocol. All you know is that is has methods read(), readline(),
readlines(), fileno(), close() and info(). The read*(), fileno()
and close() methods work like those of open files.
The info() method returns a mimetools.Message object which can be
used to query various info about the object, if available.
(mimetools.Message objects are queried with the getheader() method.)
"""
import string
import socket
import os
import time
import sys
from urlparse import urljoin as basejoin
__all__ = ["urlopen", "URLopener", "FancyURLopener", "urlretrieve",
"urlcleanup", "quote", "quote_plus", "unquote", "unquote_plus",
"urlencode", "url2pathname", "pathname2url", "splittag",
"localhost", "thishost", "ftperrors", "basejoin", "unwrap",
"splittype", "splithost", "splituser", "splitpasswd", "splitport",
"splitnport", "splitquery", "splitattr", "splitvalue",
"getproxies"]
__version__ = '1.17' # XXX This version is not always updated :-(
MAXFTPCACHE = 10 # Trim the ftp cache beyond this size
# Helper for non-unix systems
if os.name == 'nt':
from nturl2path import url2pathname, pathname2url
elif os.name == 'riscos':
from rourl2path import url2pathname, pathname2url
else:
def url2pathname(pathname):
"""OS-specific conversion from a relative URL of the 'file' scheme
to a file system path; not recommended for general use."""
return unquote(pathname)
def pathname2url(pathname):
"""OS-specific conversion from a file system path to a relative URL
of the 'file' scheme; not recommended for general use."""
return quote(pathname)
# This really consists of two pieces:
# (1) a class which handles opening of all sorts of URLs
# (plus assorted utilities etc.)
# (2) a set of functions for parsing URLs
# XXX Should these be separated out into different modules?
# Shortcut for basic usage
_urlopener = None
def urlopen(url, data=None, proxies=None):
"""Create a file-like object for the specified URL to read from."""
from warnings import warnpy3k
warnpy3k("urllib.urlopen() has been removed in Python 3.0 in "
"favor of urllib2.urlopen()", stacklevel=2)
global _urlopener
if proxies is not None:
opener = FancyURLopener(proxies=proxies)
elif not _urlopener:
opener = FancyURLopener()
_urlopener = opener
else:
opener = _urlopener
if data is None:
return opener.open(url)
else:
return opener.open(url, data)
def urlretrieve(url, filename=None, reporthook=None, data=None):
global _urlopener
if not _urlopener:
_urlopener = FancyURLopener()
return _urlopener.retrieve(url, filename, reporthook, data)
def urlcleanup():
if _urlopener:
_urlopener.cleanup()
_safe_quoters.clear()
ftpcache.clear()
# check for SSL
try:
import ssl
except:
_have_ssl = False
else:
_have_ssl = True
# exception raised when downloaded size does not match content-length
class ContentTooShortError(IOError):
def __init__(self, message, content):
IOError.__init__(self, message)
self.content = content
ftpcache = {}
class URLopener:
"""Class to open URLs.
This is a class rather than just a subroutine because we may need
more than one set of global protocol-specific options.
Note -- this is a base class for those who don't want the
automatic handling of errors type 302 (relocated) and 401
(authorization needed)."""
__tempfiles = None
version = "Python-urllib/%s" % __version__
# Constructor
def __init__(self, proxies=None, **x509):
if proxies is None:
proxies = getproxies()
assert hasattr(proxies, 'has_key'), "proxies must be a mapping"
self.proxies = proxies
self.key_file = x509.get('key_file')
self.cert_file = x509.get('cert_file')
self.addheaders = [('User-Agent', self.version)]
self.__tempfiles = []
self.__unlink = os.unlink # See cleanup()
self.tempcache = None
# Undocumented feature: if you assign {} to tempcache,
# it is used to cache files retrieved with
# self.retrieve(). This is not enabled by default
# since it does not work for changing documents (and I
# haven't got the logic to check expiration headers
# yet).
self.ftpcache = ftpcache
# Undocumented feature: you can use a different
# ftp cache by assigning to the .ftpcache member;
# in case you want logically independent URL openers
# XXX This is not threadsafe. Bah.
def __del__(self):
self.close()
def close(self):
self.cleanup()
def cleanup(self):
# This code sometimes runs when the rest of this module
# has already been deleted, so it can't use any globals
# or import anything.
if self.__tempfiles:
for file in self.__tempfiles:
try:
self.__unlink(file)
except OSError:
pass
del self.__tempfiles[:]
if self.tempcache:
self.tempcache.clear()
def addheader(self, *args):
"""Add a header to be used by the HTTP interface only
e.g. u.addheader('Accept', 'sound/basic')"""
self.addheaders.append(args)
# External interface
def open(self, fullurl, data=None):
"""Use URLopener().open(file) instead of open(file, 'r')."""
fullurl = unwrap(toBytes(fullurl))
# percent encode url, fixing lame server errors for e.g, like space
# within url paths.
fullurl = quote(fullurl, safe="%/:=&?~#+!$,;'@()*[]|")
if self.tempcache and fullurl in self.tempcache:
filename, headers = self.tempcache[fullurl]
fp = open(filename, 'rb')
return addinfourl(fp, headers, fullurl)
urltype, url = splittype(fullurl)
if not urltype:
urltype = 'file'
if urltype in self.proxies:
proxy = self.proxies[urltype]
urltype, proxyhost = splittype(proxy)
host, selector = splithost(proxyhost)
url = (host, fullurl) # Signal special case to open_*()
else:
proxy = None
name = 'open_' + urltype
self.type = urltype
name = name.replace('-', '_')
if not hasattr(self, name):
if proxy:
return self.open_unknown_proxy(proxy, fullurl, data)
else:
return self.open_unknown(fullurl, data)
try:
if data is None:
return getattr(self, name)(url)
else:
return getattr(self, name)(url, data)
except socket.error, msg:
raise IOError, ('socket error', msg), sys.exc_info()[2]
def open_unknown(self, fullurl, data=None):
"""Overridable interface to open unknown URL type."""
type, url = splittype(fullurl)
raise IOError, ('url error', 'unknown url type', type)
def open_unknown_proxy(self, proxy, fullurl, data=None):
"""Overridable interface to open unknown URL type."""
type, url = splittype(fullurl)
raise IOError, ('url error', 'invalid proxy for %s' % type, proxy)
# External interface
def retrieve(self, url, filename=None, reporthook=None, data=None):
"""retrieve(url) returns (filename, headers) for a local object
or (tempfilename, headers) for a remote object."""
url = unwrap(toBytes(url))
if self.tempcache and url in self.tempcache:
return self.tempcache[url]
type, url1 = splittype(url)
if filename is None and (not type or type == 'file'):
try:
fp = self.open_local_file(url1)
hdrs = fp.info()
fp.close()
return url2pathname(splithost(url1)[1]), hdrs
except IOError:
pass
fp = self.open(url, data)
try:
headers = fp.info()
if filename:
tfp = open(filename, 'wb')
else:
import tempfile
garbage, path = splittype(url)
garbage, path = splithost(path or "")
path, garbage = splitquery(path or "")
path, garbage = splitattr(path or "")
suffix = os.path.splitext(path)[1]
(fd, filename) = tempfile.mkstemp(suffix)
self.__tempfiles.append(filename)
tfp = os.fdopen(fd, 'wb')
try:
result = filename, headers
if self.tempcache is not None:
self.tempcache[url] = result
bs = 1024*8
size = -1
read = 0
blocknum = 0
if reporthook:
if "content-length" in headers:
size = int(headers["Content-Length"])
reporthook(blocknum, bs, size)
while 1:
block = fp.read(bs)
if block == "":
break
read += len(block)
tfp.write(block)
blocknum += 1
if reporthook:
reporthook(blocknum, bs, size)
finally:
tfp.close()
finally:
fp.close()
# raise exception if actual size does not match content-length header
if size >= 0 and read < size:
raise ContentTooShortError("retrieval incomplete: got only %i out "
"of %i bytes" % (read, size), result)
return result
# Each method named open_<type> knows how to open that type of URL
def open_http(self, url, data=None):
"""Use HTTP protocol."""
import httplib
user_passwd = None
proxy_passwd= None
if isinstance(url, str):
host, selector = splithost(url)
if host:
user_passwd, host = splituser(host)
host = unquote(host)
realhost = host
else:
host, selector = url
# check whether the proxy contains authorization information
proxy_passwd, host = splituser(host)
# now we proceed with the url we want to obtain
urltype, rest = splittype(selector)
url = rest
user_passwd = None
if urltype.lower() != 'http':
realhost = None
else:
realhost, rest = splithost(rest)
if realhost:
user_passwd, realhost = splituser(realhost)
if user_passwd:
selector = "%s://%s%s" % (urltype, realhost, rest)
if proxy_bypass(realhost):
host = realhost
#print "proxy via http:", host, selector
if not host: raise IOError, ('http error', 'no host given')
if proxy_passwd:
import base64
proxy_auth = base64.b64encode(proxy_passwd).strip()
else:
proxy_auth = None
if user_passwd:
import base64
auth = base64.b64encode(user_passwd).strip()
else:
auth = None
h = httplib.HTTP(host)
if data is not None:
h.putrequest('POST', selector)
h.putheader('Content-Type', 'application/x-www-form-urlencoded')
h.putheader('Content-Length', '%d' % len(data))
else:
h.putrequest('GET', selector)
if proxy_auth: h.putheader('Proxy-Authorization', 'Basic %s' % proxy_auth)
if auth: h.putheader('Authorization', 'Basic %s' % auth)
if realhost: h.putheader('Host', realhost)
for args in self.addheaders: h.putheader(*args)
h.endheaders(data)
errcode, errmsg, headers = h.getreply()
fp = h.getfile()
if errcode == -1:
if fp: fp.close()
# something went wrong with the HTTP status line
raise IOError, ('http protocol error', 0,
'got a bad status line', None)
# According to RFC 2616, "2xx" code indicates that the client's
# request was successfully received, understood, and accepted.
if (200 <= errcode < 300):
return addinfourl(fp, headers, "http:" + url, errcode)
else:
if data is None:
return self.http_error(url, fp, errcode, errmsg, headers)
else:
return self.http_error(url, fp, errcode, errmsg, headers, data)
def http_error(self, url, fp, errcode, errmsg, headers, data=None):
"""Handle http errors.
Derived class can override this, or provide specific handlers
named http_error_DDD where DDD is the 3-digit error code."""
# First check if there's a specific handler for this error
name = 'http_error_%d' % errcode
if hasattr(self, name):
method = getattr(self, name)
if data is None:
result = method(url, fp, errcode, errmsg, headers)
else:
result = method(url, fp, errcode, errmsg, headers, data)
if result: return result
return self.http_error_default(url, fp, errcode, errmsg, headers)
def http_error_default(self, url, fp, errcode, errmsg, headers):
"""Default error handler: close the connection and raise IOError."""
void = fp.read()
fp.close()
raise IOError, ('http error', errcode, errmsg, headers)
if _have_ssl:
def open_https(self, url, data=None):
"""Use HTTPS protocol."""
import httplib
user_passwd = None
proxy_passwd = None
if isinstance(url, str):
host, selector = splithost(url)
if host:
user_passwd, host = splituser(host)
host = unquote(host)
realhost = host
else:
host, selector = url
# here, we determine, whether the proxy contains authorization information
proxy_passwd, host = splituser(host)
urltype, rest = splittype(selector)
url = rest
user_passwd = None
if urltype.lower() != 'https':
realhost = None
else:
realhost, rest = splithost(rest)
if realhost:
user_passwd, realhost = splituser(realhost)
if user_passwd:
selector = "%s://%s%s" % (urltype, realhost, rest)
#print "proxy via https:", host, selector
if not host: raise IOError, ('https error', 'no host given')
if proxy_passwd:
import base64
proxy_auth = base64.b64encode(proxy_passwd).strip()
else:
proxy_auth = None
if user_passwd:
import base64
auth = base64.b64encode(user_passwd).strip()
else:
auth = None
h = httplib.HTTPS(host, 0,
key_file=self.key_file,
cert_file=self.cert_file)
if data is not None:
h.putrequest('POST', selector)
h.putheader('Content-Type',
'application/x-www-form-urlencoded')
h.putheader('Content-Length', '%d' % len(data))
else:
h.putrequest('GET', selector)
if proxy_auth: h.putheader('Proxy-Authorization', 'Basic %s' % proxy_auth)
if auth: h.putheader('Authorization', 'Basic %s' % auth)
if realhost: h.putheader('Host', realhost)
for args in self.addheaders: h.putheader(*args)
h.endheaders(data)
errcode, errmsg, headers = h.getreply()
fp = h.getfile()
if errcode == -1:
if fp: fp.close()
# something went wrong with the HTTP status line
raise IOError, ('http protocol error', 0,
'got a bad status line', None)
# According to RFC 2616, "2xx" code indicates that the client's
# request was successfully received, understood, and accepted.
if (200 <= errcode < 300):
return addinfourl(fp, headers, "https:" + url, errcode)
else:
if data is None:
return self.http_error(url, fp, errcode, errmsg, headers)
else:
return self.http_error(url, fp, errcode, errmsg, headers,
data)
def open_file(self, url):
"""Use local file or FTP depending on form of URL."""
if not isinstance(url, str):
raise IOError, ('file error', 'proxy support for file protocol currently not implemented')
if url[:2] == '//' and url[2:3] != '/' and url[2:12].lower() != 'localhost/':
return self.open_ftp(url)
else:
return self.open_local_file(url)
def open_local_file(self, url):
"""Use local file."""
import mimetypes, mimetools, email.utils
try:
from cStringIO import StringIO
except ImportError:
from StringIO import StringIO
host, file = splithost(url)
localname = url2pathname(file)
try:
stats = os.stat(localname)
except OSError, e:
raise IOError(e.errno, e.strerror, e.filename)
size = stats.st_size
modified = email.utils.formatdate(stats.st_mtime, usegmt=True)
mtype = mimetypes.guess_type(url)[0]
headers = mimetools.Message(StringIO(
'Content-Type: %s\nContent-Length: %d\nLast-modified: %s\n' %
(mtype or 'text/plain', size, modified)))
if not host:
urlfile = file
if file[:1] == '/':
urlfile = 'file://' + file
return addinfourl(open(localname, 'rb'),
headers, urlfile)
host, port = splitport(host)
if not port \
and socket.gethostbyname(host) in (localhost(), thishost()):
urlfile = file
if file[:1] == '/':
urlfile = 'file://' + file
return addinfourl(open(localname, 'rb'),
headers, urlfile)
raise IOError, ('local file error', 'not on local host')
def open_ftp(self, url):
"""Use FTP protocol."""
if not isinstance(url, str):
raise IOError, ('ftp error', 'proxy support for ftp protocol currently not implemented')
import mimetypes, mimetools
try:
from cStringIO import StringIO
except ImportError:
from StringIO import StringIO
host, path = splithost(url)
if not host: raise IOError, ('ftp error', 'no host given')
host, port = splitport(host)
user, host = splituser(host)
if user: user, passwd = splitpasswd(user)
else: passwd = None
host = unquote(host)
user = user or ''
passwd = passwd or ''
host = socket.gethostbyname(host)
if not port:
import ftplib
port = ftplib.FTP_PORT
else:
port = int(port)
path, attrs = splitattr(path)
path = unquote(path)
dirs = path.split('/')
dirs, file = dirs[:-1], dirs[-1]
if dirs and not dirs[0]: dirs = dirs[1:]
if dirs and not dirs[0]: dirs[0] = '/'
key = user, host, port, '/'.join(dirs)
# XXX thread unsafe!
if len(self.ftpcache) > MAXFTPCACHE:
# Prune the cache, rather arbitrarily
for k in self.ftpcache.keys():
if k != key:
v = self.ftpcache[k]
del self.ftpcache[k]
v.close()
try:
if not key in self.ftpcache:
self.ftpcache[key] = \
ftpwrapper(user, passwd, host, port, dirs)
if not file: type = 'D'
else: type = 'I'
for attr in attrs:
attr, value = splitvalue(attr)
if attr.lower() == 'type' and \
value in ('a', 'A', 'i', 'I', 'd', 'D'):
type = value.upper()
(fp, retrlen) = self.ftpcache[key].retrfile(file, type)
mtype = mimetypes.guess_type("ftp:" + url)[0]
headers = ""
if mtype:
headers += "Content-Type: %s\n" % mtype
if retrlen is not None and retrlen >= 0:
headers += "Content-Length: %d\n" % retrlen
headers = mimetools.Message(StringIO(headers))
return addinfourl(fp, headers, "ftp:" + url)
except ftperrors(), msg:
raise IOError, ('ftp error', msg), sys.exc_info()[2]
def open_data(self, url, data=None):
"""Use "data" URL."""
if not isinstance(url, str):
raise IOError, ('data error', 'proxy support for data protocol currently not implemented')
# ignore POSTed data
#
# syntax of data URLs:
# dataurl := "data:" [ mediatype ] [ ";base64" ] "," data
# mediatype := [ type "/" subtype ] *( ";" parameter )
# data := *urlchar
# parameter := attribute "=" value
import mimetools
try:
from cStringIO import StringIO
except ImportError:
from StringIO import StringIO
try:
[type, data] = url.split(',', 1)
except ValueError:
raise IOError, ('data error', 'bad data URL')
if not type:
type = 'text/plain;charset=US-ASCII'
semi = type.rfind(';')
if semi >= 0 and '=' not in type[semi:]:
encoding = type[semi+1:]
type = type[:semi]
else:
encoding = ''
msg = []
msg.append('Date: %s'%time.strftime('%a, %d %b %Y %H:%M:%S GMT',
time.gmtime(time.time())))
msg.append('Content-type: %s' % type)
if encoding == 'base64':
import base64
data = base64.decodestring(data)
else:
data = unquote(data)
msg.append('Content-Length: %d' % len(data))
msg.append('')
msg.append(data)
msg = '\n'.join(msg)
f = StringIO(msg)
headers = mimetools.Message(f, 0)
#f.fileno = None # needed for addinfourl
return addinfourl(f, headers, url)
class FancyURLopener(URLopener):
"""Derived class with handlers for errors we can handle (perhaps)."""
def __init__(self, *args, **kwargs):
URLopener.__init__(self, *args, **kwargs)
self.auth_cache = {}
self.tries = 0
self.maxtries = 10
def http_error_default(self, url, fp, errcode, errmsg, headers):
"""Default error handling -- don't raise an exception."""
return addinfourl(fp, headers, "http:" + url, errcode)
def http_error_302(self, url, fp, errcode, errmsg, headers, data=None):
"""Error 302 -- relocated (temporarily)."""
self.tries += 1
if self.maxtries and self.tries >= self.maxtries:
if hasattr(self, "http_error_500"):
meth = self.http_error_500
else:
meth = self.http_error_default
self.tries = 0
return meth(url, fp, 500,
"Internal Server Error: Redirect Recursion", headers)
result = self.redirect_internal(url, fp, errcode, errmsg, headers,
data)
self.tries = 0
return result
def redirect_internal(self, url, fp, errcode, errmsg, headers, data):
if 'location' in headers:
newurl = headers['location']
elif 'uri' in headers:
newurl = headers['uri']
else:
return
void = fp.read()
fp.close()
# In case the server sent a relative URL, join with original:
newurl = basejoin(self.type + ":" + url, newurl)
return self.open(newurl)
def http_error_301(self, url, fp, errcode, errmsg, headers, data=None):
"""Error 301 -- also relocated (permanently)."""
return self.http_error_302(url, fp, errcode, errmsg, headers, data)
def http_error_303(self, url, fp, errcode, errmsg, headers, data=None):
"""Error 303 -- also relocated (essentially identical to 302)."""
return self.http_error_302(url, fp, errcode, errmsg, headers, data)
def http_error_307(self, url, fp, errcode, errmsg, headers, data=None):
"""Error 307 -- relocated, but turn POST into error."""
if data is None:
return self.http_error_302(url, fp, errcode, errmsg, headers, data)
else:
return self.http_error_default(url, fp, errcode, errmsg, headers)
def http_error_401(self, url, fp, errcode, errmsg, headers, data=None):
"""Error 401 -- authentication required.
This function supports Basic authentication only."""
if not 'www-authenticate' in headers:
URLopener.http_error_default(self, url, fp,
errcode, errmsg, headers)
stuff = headers['www-authenticate']
import re
match = re.match('[ \t]*([^ \t]+)[ \t]+realm="([^"]*)"', stuff)
if not match:
URLopener.http_error_default(self, url, fp,
errcode, errmsg, headers)
scheme, realm = match.groups()
if scheme.lower() != 'basic':
URLopener.http_error_default(self, url, fp,
errcode, errmsg, headers)
name = 'retry_' + self.type + '_basic_auth'
if data is None:
return getattr(self,name)(url, realm)
else:
return getattr(self,name)(url, realm, data)
def http_error_407(self, url, fp, errcode, errmsg, headers, data=None):
"""Error 407 -- proxy authentication required.
This function supports Basic authentication only."""
if not 'proxy-authenticate' in headers:
URLopener.http_error_default(self, url, fp,
errcode, errmsg, headers)
stuff = headers['proxy-authenticate']
import re
match = re.match('[ \t]*([^ \t]+)[ \t]+realm="([^"]*)"', stuff)
if not match:
URLopener.http_error_default(self, url, fp,
errcode, errmsg, headers)
scheme, realm = match.groups()
if scheme.lower() != 'basic':
URLopener.http_error_default(self, url, fp,
errcode, errmsg, headers)
name = 'retry_proxy_' + self.type + '_basic_auth'
if data is None:
return getattr(self,name)(url, realm)
else:
return getattr(self,name)(url, realm, data)
def retry_proxy_http_basic_auth(self, url, realm, data=None):
host, selector = splithost(url)
newurl = 'http://' + host + selector
proxy = self.proxies['http']
urltype, proxyhost = splittype(proxy)
proxyhost, proxyselector = splithost(proxyhost)
i = proxyhost.find('@') + 1
proxyhost = proxyhost[i:]
user, passwd = self.get_user_passwd(proxyhost, realm, i)
if not (user or passwd): return None
proxyhost = quote(user, safe='') + ':' + quote(passwd, safe='') + '@' + proxyhost
self.proxies['http'] = 'http://' + proxyhost + proxyselector
if data is None:
return self.open(newurl)
else:
return self.open(newurl, data)
def retry_proxy_https_basic_auth(self, url, realm, data=None):
host, selector = splithost(url)
newurl = 'https://' + host + selector
proxy = self.proxies['https']
urltype, proxyhost = splittype(proxy)
proxyhost, proxyselector = splithost(proxyhost)
i = proxyhost.find('@') + 1
proxyhost = proxyhost[i:]
user, passwd = self.get_user_passwd(proxyhost, realm, i)
if not (user or passwd): return None
proxyhost = quote(user, safe='') + ':' + quote(passwd, safe='') + '@' + proxyhost
self.proxies['https'] = 'https://' + proxyhost + proxyselector
if data is None:
return self.open(newurl)
else:
return self.open(newurl, data)
def retry_http_basic_auth(self, url, realm, data=None):
host, selector = splithost(url)
i = host.find('@') + 1
host = host[i:]
user, passwd = self.get_user_passwd(host, realm, i)
if not (user or passwd): return None
host = quote(user, safe='') + ':' + quote(passwd, safe='') + '@' + host
newurl = 'http://' + host + selector
if data is None:
return self.open(newurl)
else:
return self.open(newurl, data)
def retry_https_basic_auth(self, url, realm, data=None):
host, selector = splithost(url)
i = host.find('@') + 1
host = host[i:]
user, passwd = self.get_user_passwd(host, realm, i)
if not (user or passwd): return None
host = quote(user, safe='') + ':' + quote(passwd, safe='') + '@' + host
newurl = 'https://' + host + selector
if data is None:
return self.open(newurl)
else:
return self.open(newurl, data)
def get_user_passwd(self, host, realm, clear_cache=0):
key = realm + '@' + host.lower()
if key in self.auth_cache:
if clear_cache:
del self.auth_cache[key]
else:
return self.auth_cache[key]
user, passwd = self.prompt_user_passwd(host, realm)
if user or passwd: self.auth_cache[key] = (user, passwd)
return user, passwd
def prompt_user_passwd(self, host, realm):
"""Override this in a GUI environment!"""
import getpass
try:
user = raw_input("Enter username for %s at %s: " % (realm,
host))
passwd = getpass.getpass("Enter password for %s in %s at %s: " %
(user, realm, host))
return user, passwd
except KeyboardInterrupt:
print
return None, None
# Utility functions
_localhost = None
def localhost():
"""Return the IP address of the magic hostname 'localhost'."""
global _localhost
if _localhost is None:
_localhost = socket.gethostbyname('localhost')
return _localhost
_thishost = None
def thishost():
"""Return the IP address of the current host."""
global _thishost
if _thishost is None:
_thishost = socket.gethostbyname(socket.gethostname())
return _thishost
_ftperrors = None
def ftperrors():
"""Return the set of errors raised by the FTP class."""
global _ftperrors
if _ftperrors is None:
import ftplib
_ftperrors = ftplib.all_errors
return _ftperrors
_noheaders = None
def noheaders():
"""Return an empty mimetools.Message object."""
global _noheaders
if _noheaders is None:
import mimetools
try:
from cStringIO import StringIO
except ImportError:
from StringIO import StringIO
_noheaders = mimetools.Message(StringIO(), 0)
_noheaders.fp.close() # Recycle file descriptor
return _noheaders
# Utility classes
class ftpwrapper:
"""Class used by open_ftp() for cache of open FTP connections."""
def __init__(self, user, passwd, host, port, dirs,
timeout=socket._GLOBAL_DEFAULT_TIMEOUT):
self.user = user
self.passwd = passwd
self.host = host
self.port = port
self.dirs = dirs
self.timeout = timeout
self.init()
def init(self):
import ftplib
self.busy = 0
self.ftp = ftplib.FTP()
self.ftp.connect(self.host, self.port, self.timeout)
self.ftp.login(self.user, self.passwd)
for dir in self.dirs:
self.ftp.cwd(dir)
def retrfile(self, file, type):
import ftplib
self.endtransfer()
if type in ('d', 'D'): cmd = 'TYPE A'; isdir = 1
else: cmd = 'TYPE ' + type; isdir = 0
try:
self.ftp.voidcmd(cmd)
except ftplib.all_errors:
self.init()
self.ftp.voidcmd(cmd)
conn = None
if file and not isdir:
# Try to retrieve as a file
try:
cmd = 'RETR ' + file
conn = self.ftp.ntransfercmd(cmd)
except ftplib.error_perm, reason:
if str(reason)[:3] != '550':
raise IOError, ('ftp error', reason), sys.exc_info()[2]
if not conn:
# Set transfer mode to ASCII!
self.ftp.voidcmd('TYPE A')
# Try a directory listing. Verify that directory exists.
if file:
pwd = self.ftp.pwd()
try:
try:
self.ftp.cwd(file)
except ftplib.error_perm, reason:
raise IOError, ('ftp error', reason), sys.exc_info()[2]
finally:
self.ftp.cwd(pwd)
cmd = 'LIST ' + file
else:
cmd = 'LIST'
conn = self.ftp.ntransfercmd(cmd)
self.busy = 1
# Pass back both a suitably decorated object and a retrieval length
return (addclosehook(conn[0].makefile('rb'),
self.endtransfer), conn[1])
def endtransfer(self):
if not self.busy:
return
self.busy = 0
try:
self.ftp.voidresp()
except ftperrors():
pass
def close(self):
self.endtransfer()
try:
self.ftp.close()
except ftperrors():
pass
class addbase:
"""Base class for addinfo and addclosehook."""
def __init__(self, fp):
self.fp = fp
self.read = self.fp.read
self.readline = self.fp.readline
if hasattr(self.fp, "readlines"): self.readlines = self.fp.readlines
if hasattr(self.fp, "fileno"):
self.fileno = self.fp.fileno
else:
self.fileno = lambda: None
if hasattr(self.fp, "__iter__"):
self.__iter__ = self.fp.__iter__
if hasattr(self.fp, "next"):
self.next = self.fp.next
def __repr__(self):
return '<%s at %r whose fp = %r>' % (self.__class__.__name__,
id(self), self.fp)
def close(self):
self.read = None
self.readline = None
self.readlines = None
self.fileno = None
if self.fp: self.fp.close()
self.fp = None
class addclosehook(addbase):
"""Class to add a close hook to an open file."""
def __init__(self, fp, closehook, *hookargs):
addbase.__init__(self, fp)
self.closehook = closehook
self.hookargs = hookargs
def close(self):
addbase.close(self)
if self.closehook:
self.closehook(*self.hookargs)
self.closehook = None
self.hookargs = None
class addinfo(addbase):
"""class to add an info() method to an open file."""
def __init__(self, fp, headers):
addbase.__init__(self, fp)
self.headers = headers
def info(self):
return self.headers
class addinfourl(addbase):
"""class to add info() and geturl() methods to an open file."""
def __init__(self, fp, headers, url, code=None):
addbase.__init__(self, fp)
self.headers = headers
self.url = url
self.code = code
def info(self):
return self.headers
def getcode(self):
return self.code
def geturl(self):
return self.url
# Utilities to parse URLs (most of these return None for missing parts):
# unwrap('<URL:type://host/path>') --> 'type://host/path'
# splittype('type:opaquestring') --> 'type', 'opaquestring'
# splithost('//host[:port]/path') --> 'host[:port]', '/path'
# splituser('user[:passwd]@host[:port]') --> 'user[:passwd]', 'host[:port]'
# splitpasswd('user:passwd') -> 'user', 'passwd'
# splitport('host:port') --> 'host', 'port'
# splitquery('/path?query') --> '/path', 'query'
# splittag('/path#tag') --> '/path', 'tag'
# splitattr('/path;attr1=value1;attr2=value2;...') ->
# '/path', ['attr1=value1', 'attr2=value2', ...]
# splitvalue('attr=value') --> 'attr', 'value'
# unquote('abc%20def') -> 'abc def'
# quote('abc def') -> 'abc%20def')
try:
unicode
except NameError:
def _is_unicode(x):
return 0
else:
def _is_unicode(x):
return isinstance(x, unicode)
def toBytes(url):
"""toBytes(u"URL") --> 'URL'."""
# Most URL schemes require ASCII. If that changes, the conversion
# can be relaxed
if _is_unicode(url):
try:
url = url.encode("ASCII")
except UnicodeError:
raise UnicodeError("URL " + repr(url) +
" contains non-ASCII characters")
return url
def unwrap(url):
"""unwrap('<URL:type://host/path>') --> 'type://host/path'."""
url = url.strip()
if url[:1] == '<' and url[-1:] == '>':
url = url[1:-1].strip()
if url[:4] == 'URL:': url = url[4:].strip()
return url
_typeprog = None
def splittype(url):
"""splittype('type:opaquestring') --> 'type', 'opaquestring'."""
global _typeprog
if _typeprog is None:
import re
_typeprog = re.compile('^([^/:]+):')
match = _typeprog.match(url)
if match:
scheme = match.group(1)
return scheme.lower(), url[len(scheme) + 1:]
return None, url
_hostprog = None
def splithost(url):
"""splithost('//host[:port]/path') --> 'host[:port]', '/path'."""
global _hostprog
if _hostprog is None:
import re
_hostprog = re.compile('^//([^/?]*)(.*)$')
match = _hostprog.match(url)
if match:
host_port = match.group(1)
path = match.group(2)
if path and not path.startswith('/'):
path = '/' + path
return host_port, path
return None, url
_userprog = None
def splituser(host):
"""splituser('user[:passwd]@host[:port]') --> 'user[:passwd]', 'host[:port]'."""
global _userprog
if _userprog is None:
import re
_userprog = re.compile('^(.*)@(.*)$')
match = _userprog.match(host)
if match: return match.group(1, 2)
return None, host
_passwdprog = None
def splitpasswd(user):
"""splitpasswd('user:passwd') -> 'user', 'passwd'."""
global _passwdprog
if _passwdprog is None:
import re
_passwdprog = re.compile('^([^:]*):(.*)$',re.S)
match = _passwdprog.match(user)
if match: return match.group(1, 2)
return user, None
# splittag('/path#tag') --> '/path', 'tag'
_portprog = None
def splitport(host):
"""splitport('host:port') --> 'host', 'port'."""
global _portprog
if _portprog is None:
import re
_portprog = re.compile('^(.*):([0-9]+)$')
match = _portprog.match(host)
if match: return match.group(1, 2)
return host, None
_nportprog = None
def splitnport(host, defport=-1):
"""Split host and port, returning numeric port.
Return given default port if no ':' found; defaults to -1.
Return numerical port if a valid number are found after ':'.
Return None if ':' but not a valid number."""
global _nportprog
if _nportprog is None:
import re
_nportprog = re.compile('^(.*):(.*)$')
match = _nportprog.match(host)
if match:
host, port = match.group(1, 2)
try:
if not port: raise ValueError, "no digits"
nport = int(port)
except ValueError:
nport = None
return host, nport
return host, defport
_queryprog = None
def splitquery(url):
"""splitquery('/path?query') --> '/path', 'query'."""
global _queryprog
if _queryprog is None:
import re
_queryprog = re.compile('^(.*)\?([^?]*)$')
match = _queryprog.match(url)
if match: return match.group(1, 2)
return url, None
_tagprog = None
def splittag(url):
"""splittag('/path#tag') --> '/path', 'tag'."""
global _tagprog
if _tagprog is None:
import re
_tagprog = re.compile('^(.*)#([^#]*)$')
match = _tagprog.match(url)
if match: return match.group(1, 2)
return url, None
def splitattr(url):
"""splitattr('/path;attr1=value1;attr2=value2;...') ->
'/path', ['attr1=value1', 'attr2=value2', ...]."""
words = url.split(';')
return words[0], words[1:]
_valueprog = None
def splitvalue(attr):
"""splitvalue('attr=value') --> 'attr', 'value'."""
global _valueprog
if _valueprog is None:
import re
_valueprog = re.compile('^([^=]*)=(.*)$')
match = _valueprog.match(attr)
if match: return match.group(1, 2)
return attr, None
# urlparse contains a duplicate of this method to avoid a circular import. If
# you update this method, also update the copy in urlparse. This code
# duplication does not exist in Python3.
_hexdig = '0123456789ABCDEFabcdef'
_hextochr = dict((a + b, chr(int(a + b, 16)))
for a in _hexdig for b in _hexdig)
def unquote(s):
"""unquote('abc%20def') -> 'abc def'."""
res = s.split('%')
# fastpath
if len(res) == 1:
return s
s = res[0]
for item in res[1:]:
try:
s += _hextochr[item[:2]] + item[2:]
except KeyError:
s += '%' + item
except UnicodeDecodeError:
s += unichr(int(item[:2], 16)) + item[2:]
return s
def unquote_plus(s):
"""unquote('%7e/abc+def') -> '~/abc def'"""
s = s.replace('+', ' ')
return unquote(s)
always_safe = ('ABCDEFGHIJKLMNOPQRSTUVWXYZ'
'abcdefghijklmnopqrstuvwxyz'
'0123456789' '_.-')
_safe_map = {}
for i, c in zip(xrange(256), str(bytearray(xrange(256)))):
_safe_map[c] = c if (i < 128 and c in always_safe) else '%{:02X}'.format(i)
_safe_quoters = {}
def quote(s, safe='/'):
"""quote('abc def') -> 'abc%20def'
Each part of a URL, e.g. the path info, the query, etc., has a
different set of reserved characters that must be quoted.
RFC 2396 Uniform Resource Identifiers (URI): Generic Syntax lists
the following reserved characters.
reserved = ";" | "/" | "?" | ":" | "@" | "&" | "=" | "+" |
"$" | ","
Each of these characters is reserved in some component of a URL,
but not necessarily in all of them.
By default, the quote function is intended for quoting the path
section of a URL. Thus, it will not encode '/'. This character
is reserved, but in typical usage the quote function is being
called on a path where the existing slash characters are used as
reserved characters.
"""
# fastpath
if not s:
if s is None:
raise TypeError('None object cannot be quoted')
return s
cachekey = (safe, always_safe)
try:
(quoter, safe) = _safe_quoters[cachekey]
except KeyError:
safe_map = _safe_map.copy()
safe_map.update([(c, c) for c in safe])
quoter = safe_map.__getitem__
safe = always_safe + safe
_safe_quoters[cachekey] = (quoter, safe)
if not s.rstrip(safe):
return s
return ''.join(map(quoter, s))
def quote_plus(s, safe=''):
"""Quote the query fragment of a URL; replacing ' ' with '+'"""
if ' ' in s:
s = quote(s, safe + ' ')
return s.replace(' ', '+')
return quote(s, safe)
def urlencode(query, doseq=0):
"""Encode a sequence of two-element tuples or dictionary into a URL query string.
If any values in the query arg are sequences and doseq is true, each
sequence element is converted to a separate parameter.
If the query arg is a sequence of two-element tuples, the order of the
parameters in the output will match the order of parameters in the
input.
"""
if hasattr(query,"items"):
# mapping objects
query = query.items()
else:
# it's a bother at times that strings and string-like objects are
# sequences...
try:
# non-sequence items should not work with len()
# non-empty strings will fail this
if len(query) and not isinstance(query[0], tuple):
raise TypeError
# zero-length sequences of all types will get here and succeed,
# but that's a minor nit - since the original implementation
# allowed empty dicts that type of behavior probably should be
# preserved for consistency
except TypeError:
ty,va,tb = sys.exc_info()
raise TypeError, "not a valid non-string sequence or mapping object", tb
l = []
if not doseq:
# preserve old behavior
for k, v in query:
k = quote_plus(str(k))
v = quote_plus(str(v))
l.append(k + '=' + v)
else:
for k, v in query:
k = quote_plus(str(k))
if isinstance(v, str):
v = quote_plus(v)
l.append(k + '=' + v)
elif _is_unicode(v):
# is there a reasonable way to convert to ASCII?
# encode generates a string, but "replace" or "ignore"
# lose information and "strict" can raise UnicodeError
v = quote_plus(v.encode("ASCII","replace"))
l.append(k + '=' + v)
else:
try:
# is this a sufficient test for sequence-ness?
len(v)
except TypeError:
# not a sequence
v = quote_plus(str(v))
l.append(k + '=' + v)
else:
# loop over the sequence
for elt in v:
l.append(k + '=' + quote_plus(str(elt)))
return '&'.join(l)
# Proxy handling
def getproxies_environment():
"""Return a dictionary of scheme -> proxy server URL mappings.
Scan the environment for variables named <scheme>_proxy;
this seems to be the standard convention. If you need a
different way, you can pass a proxies dictionary to the
[Fancy]URLopener constructor.
"""
proxies = {}
for name, value in os.environ.items():
name = name.lower()
if value and name[-6:] == '_proxy':
proxies[name[:-6]] = value
return proxies
def proxy_bypass_environment(host):
"""Test if proxies should not be used for a particular host.
Checks the environment for a variable named no_proxy, which should
be a list of DNS suffixes separated by commas, or '*' for all hosts.
"""
no_proxy = os.environ.get('no_proxy', '') or os.environ.get('NO_PROXY', '')
# '*' is special case for always bypass
if no_proxy == '*':
return 1
# strip port off host
hostonly, port = splitport(host)
# check if the host ends with any of the DNS suffixes
for name in no_proxy.split(','):
if name and (hostonly.endswith(name) or host.endswith(name)):
return 1
# otherwise, don't bypass
return 0
if sys.platform == 'darwin':
from _scproxy import _get_proxy_settings, _get_proxies
def proxy_bypass_macosx_sysconf(host):
"""
Return True iff this host shouldn't be accessed using a proxy
This function uses the MacOSX framework SystemConfiguration
to fetch the proxy information.
"""
import re
import socket
from fnmatch import fnmatch
hostonly, port = splitport(host)
def ip2num(ipAddr):
parts = ipAddr.split('.')
parts = map(int, parts)
if len(parts) != 4:
parts = (parts + [0, 0, 0, 0])[:4]
return (parts[0] << 24) | (parts[1] << 16) | (parts[2] << 8) | parts[3]
proxy_settings = _get_proxy_settings()
# Check for simple host names:
if '.' not in host:
if proxy_settings['exclude_simple']:
return True
hostIP = None
for value in proxy_settings.get('exceptions', ()):
# Items in the list are strings like these: *.local, 169.254/16
if not value: continue
m = re.match(r"(\d+(?:\.\d+)*)(/\d+)?", value)
if m is not None:
if hostIP is None:
try:
hostIP = socket.gethostbyname(hostonly)
hostIP = ip2num(hostIP)
except socket.error:
continue
base = ip2num(m.group(1))
mask = m.group(2)
if mask is None:
mask = 8 * (m.group(1).count('.') + 1)
else:
mask = int(mask[1:])
mask = 32 - mask
if (hostIP >> mask) == (base >> mask):
return True
elif fnmatch(host, value):
return True
return False
def getproxies_macosx_sysconf():
"""Return a dictionary of scheme -> proxy server URL mappings.
This function uses the MacOSX framework SystemConfiguration
to fetch the proxy information.
"""
return _get_proxies()
def proxy_bypass(host):
if getproxies_environment():
return proxy_bypass_environment(host)
else:
return proxy_bypass_macosx_sysconf(host)
def getproxies():
return getproxies_environment() or getproxies_macosx_sysconf()
elif os.name == 'nt':
def getproxies_registry():
"""Return a dictionary of scheme -> proxy server URL mappings.
Win32 uses the registry to store proxies.
"""
proxies = {}
try:
import _winreg
except ImportError:
# Std module, so should be around - but you never know!
return proxies
try:
internetSettings = _winreg.OpenKey(_winreg.HKEY_CURRENT_USER,
r'Software\Microsoft\Windows\CurrentVersion\Internet Settings')
proxyEnable = _winreg.QueryValueEx(internetSettings,
'ProxyEnable')[0]
if proxyEnable:
# Returned as Unicode but problems if not converted to ASCII
proxyServer = str(_winreg.QueryValueEx(internetSettings,
'ProxyServer')[0])
if '=' in proxyServer:
# Per-protocol settings
for p in proxyServer.split(';'):
protocol, address = p.split('=', 1)
# See if address has a type:// prefix
import re
if not re.match('^([^/:]+)://', address):
address = '%s://%s' % (protocol, address)
proxies[protocol] = address
else:
# Use one setting for all protocols
if proxyServer[:5] == 'http:':
proxies['http'] = proxyServer
else:
proxies['http'] = 'http://%s' % proxyServer
proxies['https'] = 'https://%s' % proxyServer
proxies['ftp'] = 'ftp://%s' % proxyServer
internetSettings.Close()
except (WindowsError, ValueError, TypeError):
# Either registry key not found etc, or the value in an
# unexpected format.
# proxies already set up to be empty so nothing to do
pass
return proxies
def getproxies():
"""Return a dictionary of scheme -> proxy server URL mappings.
Returns settings gathered from the environment, if specified,
or the registry.
"""
return getproxies_environment() or getproxies_registry()
def proxy_bypass_registry(host):
try:
import _winreg
import re
except ImportError:
# Std modules, so should be around - but you never know!
return 0
try:
internetSettings = _winreg.OpenKey(_winreg.HKEY_CURRENT_USER,
r'Software\Microsoft\Windows\CurrentVersion\Internet Settings')
proxyEnable = _winreg.QueryValueEx(internetSettings,
'ProxyEnable')[0]
proxyOverride = str(_winreg.QueryValueEx(internetSettings,
'ProxyOverride')[0])
# ^^^^ Returned as Unicode but problems if not converted to ASCII
except WindowsError:
return 0
if not proxyEnable or not proxyOverride:
return 0
# try to make a host list from name and IP address.
rawHost, port = splitport(host)
host = [rawHost]
try:
addr = socket.gethostbyname(rawHost)
if addr != rawHost:
host.append(addr)
except socket.error:
pass
try:
fqdn = socket.getfqdn(rawHost)
if fqdn != rawHost:
host.append(fqdn)
except socket.error:
pass
# make a check value list from the registry entry: replace the
# '<local>' string by the localhost entry and the corresponding
# canonical entry.
proxyOverride = proxyOverride.split(';')
# now check if we match one of the registry values.
for test in proxyOverride:
if test == '<local>':
if '.' not in rawHost:
return 1
test = test.replace(".", r"\.") # mask dots
test = test.replace("*", r".*") # change glob sequence
test = test.replace("?", r".") # change glob char
for val in host:
# print "%s <--> %s" %( test, val )
if re.match(test, val, re.I):
return 1
return 0
def proxy_bypass(host):
"""Return a dictionary of scheme -> proxy server URL mappings.
Returns settings gathered from the environment, if specified,
or the registry.
"""
if getproxies_environment():
return proxy_bypass_environment(host)
else:
return proxy_bypass_registry(host)
else:
# By default use environment variables
getproxies = getproxies_environment
proxy_bypass = proxy_bypass_environment
# Test and time quote() and unquote()
def test1():
s = ''
for i in range(256): s = s + chr(i)
s = s*4
t0 = time.time()
qs = quote(s)
uqs = unquote(qs)
t1 = time.time()
if uqs != s:
print 'Wrong!'
print repr(s)
print repr(qs)
print repr(uqs)
print round(t1 - t0, 3), 'sec'
def reporthook(blocknum, blocksize, totalsize):
# Report during remote transfers
print "Block number: %d, Block size: %d, Total size: %d" % (
blocknum, blocksize, totalsize)
# Test program
def test(args=[]):
if not args:
args = [
'/etc/passwd',
'file:/etc/passwd',
'file://localhost/etc/passwd',
'ftp://ftp.gnu.org/pub/README',
'http://www.python.org/index.html',
]
if hasattr(URLopener, "open_https"):
args.append('https://synergy.as.cmu.edu/~geek/')
try:
for url in args:
print '-'*10, url, '-'*10
fn, h = urlretrieve(url, None, reporthook)
print fn
if h:
print '======'
for k in h.keys(): print k + ':', h[k]
print '======'
with open(fn, 'rb') as fp:
data = fp.read()
if '\r' in data:
table = string.maketrans("", "")
data = data.translate(table, "\r")
print data
fn, h = None, None
print '-'*40
finally:
urlcleanup()
def main():
import getopt, sys
try:
opts, args = getopt.getopt(sys.argv[1:], "th")
except getopt.error, msg:
print msg
print "Use -h for help"
return
t = 0
for o, a in opts:
if o == '-t':
t = t + 1
if o == '-h':
print "Usage: python urllib.py [-t] [url ...]"
print "-t runs self-test;",
print "otherwise, contents of urls are printed"
return
if t:
if t > 1:
test1()
test(args)
else:
if not args:
print "Use -h for help"
for url in args:
print urlopen(url).read(),
# Run test program when run as a script
if __name__ == '__main__':
main()
| Python |
"""Bisection algorithms."""
def insort_right(a, x, lo=0, hi=None):
"""Insert item x in list a, and keep it sorted assuming a is sorted.
If x is already in a, insert it to the right of the rightmost x.
Optional args lo (default 0) and hi (default len(a)) bound the
slice of a to be searched.
"""
if lo < 0:
raise ValueError('lo must be non-negative')
if hi is None:
hi = len(a)
while lo < hi:
mid = (lo+hi)//2
if x < a[mid]: hi = mid
else: lo = mid+1
a.insert(lo, x)
insort = insort_right # backward compatibility
def bisect_right(a, x, lo=0, hi=None):
"""Return the index where to insert item x in list a, assuming a is sorted.
The return value i is such that all e in a[:i] have e <= x, and all e in
a[i:] have e > x. So if x already appears in the list, a.insert(x) will
insert just after the rightmost x already there.
Optional args lo (default 0) and hi (default len(a)) bound the
slice of a to be searched.
"""
if lo < 0:
raise ValueError('lo must be non-negative')
if hi is None:
hi = len(a)
while lo < hi:
mid = (lo+hi)//2
if x < a[mid]: hi = mid
else: lo = mid+1
return lo
bisect = bisect_right # backward compatibility
def insort_left(a, x, lo=0, hi=None):
"""Insert item x in list a, and keep it sorted assuming a is sorted.
If x is already in a, insert it to the left of the leftmost x.
Optional args lo (default 0) and hi (default len(a)) bound the
slice of a to be searched.
"""
if lo < 0:
raise ValueError('lo must be non-negative')
if hi is None:
hi = len(a)
while lo < hi:
mid = (lo+hi)//2
if a[mid] < x: lo = mid+1
else: hi = mid
a.insert(lo, x)
def bisect_left(a, x, lo=0, hi=None):
"""Return the index where to insert item x in list a, assuming a is sorted.
The return value i is such that all e in a[:i] have e < x, and all e in
a[i:] have e >= x. So if x already appears in the list, a.insert(x) will
insert just before the leftmost x already there.
Optional args lo (default 0) and hi (default len(a)) bound the
slice of a to be searched.
"""
if lo < 0:
raise ValueError('lo must be non-negative')
if hi is None:
hi = len(a)
while lo < hi:
mid = (lo+hi)//2
if a[mid] < x: lo = mid+1
else: hi = mid
return lo
# Overwrite above definitions with a fast C implementation
try:
from _bisect import *
except ImportError:
pass
| Python |
# -*-mode: python; fill-column: 75; tab-width: 8; coding: iso-latin-1-unix -*-
#
# $Id$
#
# Tix.py -- Tix widget wrappers.
#
# For Tix, see http://tix.sourceforge.net
#
# - Sudhir Shenoy (sshenoy@gol.com), Dec. 1995.
# based on an idea of Jean-Marc Lugrin (lugrin@ms.com)
#
# NOTE: In order to minimize changes to Tkinter.py, some of the code here
# (TixWidget.__init__) has been taken from Tkinter (Widget.__init__)
# and will break if there are major changes in Tkinter.
#
# The Tix widgets are represented by a class hierarchy in python with proper
# inheritance of base classes.
#
# As a result after creating a 'w = StdButtonBox', I can write
# w.ok['text'] = 'Who Cares'
# or w.ok['bg'] = w['bg']
# or even w.ok.invoke()
# etc.
#
# Compare the demo tixwidgets.py to the original Tcl program and you will
# appreciate the advantages.
#
from Tkinter import *
from Tkinter import _flatten, _cnfmerge, _default_root
# WARNING - TkVersion is a limited precision floating point number
if TkVersion < 3.999:
raise ImportError, "This version of Tix.py requires Tk 4.0 or higher"
import _tkinter # If this fails your Python may not be configured for Tk
# Some more constants (for consistency with Tkinter)
WINDOW = 'window'
TEXT = 'text'
STATUS = 'status'
IMMEDIATE = 'immediate'
IMAGE = 'image'
IMAGETEXT = 'imagetext'
BALLOON = 'balloon'
AUTO = 'auto'
ACROSSTOP = 'acrosstop'
# A few useful constants for the Grid widget
ASCII = 'ascii'
CELL = 'cell'
COLUMN = 'column'
DECREASING = 'decreasing'
INCREASING = 'increasing'
INTEGER = 'integer'
MAIN = 'main'
MAX = 'max'
REAL = 'real'
ROW = 'row'
S_REGION = 's-region'
X_REGION = 'x-region'
Y_REGION = 'y-region'
# Some constants used by Tkinter dooneevent()
TCL_DONT_WAIT = 1 << 1
TCL_WINDOW_EVENTS = 1 << 2
TCL_FILE_EVENTS = 1 << 3
TCL_TIMER_EVENTS = 1 << 4
TCL_IDLE_EVENTS = 1 << 5
TCL_ALL_EVENTS = 0
# BEWARE - this is implemented by copying some code from the Widget class
# in Tkinter (to override Widget initialization) and is therefore
# liable to break.
import Tkinter, os
# Could probably add this to Tkinter.Misc
class tixCommand:
"""The tix commands provide access to miscellaneous elements
of Tix's internal state and the Tix application context.
Most of the information manipulated by these commands pertains
to the application as a whole, or to a screen or
display, rather than to a particular window.
This is a mixin class, assumed to be mixed to Tkinter.Tk
that supports the self.tk.call method.
"""
def tix_addbitmapdir(self, directory):
"""Tix maintains a list of directories under which
the tix_getimage and tix_getbitmap commands will
search for image files. The standard bitmap directory
is $TIX_LIBRARY/bitmaps. The addbitmapdir command
adds directory into this list. By using this
command, the image files of an applications can
also be located using the tix_getimage or tix_getbitmap
command.
"""
return self.tk.call('tix', 'addbitmapdir', directory)
def tix_cget(self, option):
"""Returns the current value of the configuration
option given by option. Option may be any of the
options described in the CONFIGURATION OPTIONS section.
"""
return self.tk.call('tix', 'cget', option)
def tix_configure(self, cnf=None, **kw):
"""Query or modify the configuration options of the Tix application
context. If no option is specified, returns a dictionary all of the
available options. If option is specified with no value, then the
command returns a list describing the one named option (this list
will be identical to the corresponding sublist of the value
returned if no option is specified). If one or more option-value
pairs are specified, then the command modifies the given option(s)
to have the given value(s); in this case the command returns an
empty string. Option may be any of the configuration options.
"""
# Copied from Tkinter.py
if kw:
cnf = _cnfmerge((cnf, kw))
elif cnf:
cnf = _cnfmerge(cnf)
if cnf is None:
cnf = {}
for x in self.tk.split(self.tk.call('tix', 'configure')):
cnf[x[0][1:]] = (x[0][1:],) + x[1:]
return cnf
if isinstance(cnf, StringType):
x = self.tk.split(self.tk.call('tix', 'configure', '-'+cnf))
return (x[0][1:],) + x[1:]
return self.tk.call(('tix', 'configure') + self._options(cnf))
def tix_filedialog(self, dlgclass=None):
"""Returns the file selection dialog that may be shared among
different calls from this application. This command will create a
file selection dialog widget when it is called the first time. This
dialog will be returned by all subsequent calls to tix_filedialog.
An optional dlgclass parameter can be passed to specified what type
of file selection dialog widget is desired. Possible options are
tix FileSelectDialog or tixExFileSelectDialog.
"""
if dlgclass is not None:
return self.tk.call('tix', 'filedialog', dlgclass)
else:
return self.tk.call('tix', 'filedialog')
def tix_getbitmap(self, name):
"""Locates a bitmap file of the name name.xpm or name in one of the
bitmap directories (see the tix_addbitmapdir command above). By
using tix_getbitmap, you can avoid hard coding the pathnames of the
bitmap files in your application. When successful, it returns the
complete pathname of the bitmap file, prefixed with the character
'@'. The returned value can be used to configure the -bitmap
option of the TK and Tix widgets.
"""
return self.tk.call('tix', 'getbitmap', name)
def tix_getimage(self, name):
"""Locates an image file of the name name.xpm, name.xbm or name.ppm
in one of the bitmap directories (see the addbitmapdir command
above). If more than one file with the same name (but different
extensions) exist, then the image type is chosen according to the
depth of the X display: xbm images are chosen on monochrome
displays and color images are chosen on color displays. By using
tix_ getimage, you can advoid hard coding the pathnames of the
image files in your application. When successful, this command
returns the name of the newly created image, which can be used to
configure the -image option of the Tk and Tix widgets.
"""
return self.tk.call('tix', 'getimage', name)
def tix_option_get(self, name):
"""Gets the options manitained by the Tix
scheme mechanism. Available options include:
active_bg active_fg bg
bold_font dark1_bg dark1_fg
dark2_bg dark2_fg disabled_fg
fg fixed_font font
inactive_bg inactive_fg input1_bg
input2_bg italic_font light1_bg
light1_fg light2_bg light2_fg
menu_font output1_bg output2_bg
select_bg select_fg selector
"""
# could use self.tk.globalgetvar('tixOption', name)
return self.tk.call('tix', 'option', 'get', name)
def tix_resetoptions(self, newScheme, newFontSet, newScmPrio=None):
"""Resets the scheme and fontset of the Tix application to
newScheme and newFontSet, respectively. This affects only those
widgets created after this call. Therefore, it is best to call the
resetoptions command before the creation of any widgets in a Tix
application.
The optional parameter newScmPrio can be given to reset the
priority level of the Tk options set by the Tix schemes.
Because of the way Tk handles the X option database, after Tix has
been has imported and inited, it is not possible to reset the color
schemes and font sets using the tix config command. Instead, the
tix_resetoptions command must be used.
"""
if newScmPrio is not None:
return self.tk.call('tix', 'resetoptions', newScheme, newFontSet, newScmPrio)
else:
return self.tk.call('tix', 'resetoptions', newScheme, newFontSet)
class Tk(Tkinter.Tk, tixCommand):
"""Toplevel widget of Tix which represents mostly the main window
of an application. It has an associated Tcl interpreter."""
def __init__(self, screenName=None, baseName=None, className='Tix'):
Tkinter.Tk.__init__(self, screenName, baseName, className)
tixlib = os.environ.get('TIX_LIBRARY')
self.tk.eval('global auto_path; lappend auto_path [file dir [info nameof]]')
if tixlib is not None:
self.tk.eval('global auto_path; lappend auto_path {%s}' % tixlib)
self.tk.eval('global tcl_pkgPath; lappend tcl_pkgPath {%s}' % tixlib)
# Load Tix - this should work dynamically or statically
# If it's static, tcl/tix8.1/pkgIndex.tcl should have
# 'load {} Tix'
# If it's dynamic under Unix, tcl/tix8.1/pkgIndex.tcl should have
# 'load libtix8.1.8.3.so Tix'
self.tk.eval('package require Tix')
def destroy(self):
# For safety, remove an delete_window binding before destroy
self.protocol("WM_DELETE_WINDOW", "")
Tkinter.Tk.destroy(self)
# The Tix 'tixForm' geometry manager
class Form:
"""The Tix Form geometry manager
Widgets can be arranged by specifying attachments to other widgets.
See Tix documentation for complete details"""
def config(self, cnf={}, **kw):
self.tk.call('tixForm', self._w, *self._options(cnf, kw))
form = config
def __setitem__(self, key, value):
Form.form(self, {key: value})
def check(self):
return self.tk.call('tixForm', 'check', self._w)
def forget(self):
self.tk.call('tixForm', 'forget', self._w)
def grid(self, xsize=0, ysize=0):
if (not xsize) and (not ysize):
x = self.tk.call('tixForm', 'grid', self._w)
y = self.tk.splitlist(x)
z = ()
for x in y:
z = z + (self.tk.getint(x),)
return z
return self.tk.call('tixForm', 'grid', self._w, xsize, ysize)
def info(self, option=None):
if not option:
return self.tk.call('tixForm', 'info', self._w)
if option[0] != '-':
option = '-' + option
return self.tk.call('tixForm', 'info', self._w, option)
def slaves(self):
return map(self._nametowidget,
self.tk.splitlist(
self.tk.call(
'tixForm', 'slaves', self._w)))
Tkinter.Widget.__bases__ = Tkinter.Widget.__bases__ + (Form,)
class TixWidget(Tkinter.Widget):
"""A TixWidget class is used to package all (or most) Tix widgets.
Widget initialization is extended in two ways:
1) It is possible to give a list of options which must be part of
the creation command (so called Tix 'static' options). These cannot be
given as a 'config' command later.
2) It is possible to give the name of an existing TK widget. These are
child widgets created automatically by a Tix mega-widget. The Tk call
to create these widgets is therefore bypassed in TixWidget.__init__
Both options are for use by subclasses only.
"""
def __init__ (self, master=None, widgetName=None,
static_options=None, cnf={}, kw={}):
# Merge keywords and dictionary arguments
if kw:
cnf = _cnfmerge((cnf, kw))
else:
cnf = _cnfmerge(cnf)
# Move static options into extra. static_options must be
# a list of keywords (or None).
extra=()
# 'options' is always a static option
if static_options:
static_options.append('options')
else:
static_options = ['options']
for k,v in cnf.items()[:]:
if k in static_options:
extra = extra + ('-' + k, v)
del cnf[k]
self.widgetName = widgetName
Widget._setup(self, master, cnf)
# If widgetName is None, this is a dummy creation call where the
# corresponding Tk widget has already been created by Tix
if widgetName:
self.tk.call(widgetName, self._w, *extra)
# Non-static options - to be done via a 'config' command
if cnf:
Widget.config(self, cnf)
# Dictionary to hold subwidget names for easier access. We can't
# use the children list because the public Tix names may not be the
# same as the pathname component
self.subwidget_list = {}
# We set up an attribute access function so that it is possible to
# do w.ok['text'] = 'Hello' rather than w.subwidget('ok')['text'] = 'Hello'
# when w is a StdButtonBox.
# We can even do w.ok.invoke() because w.ok is subclassed from the
# Button class if you go through the proper constructors
def __getattr__(self, name):
if name in self.subwidget_list:
return self.subwidget_list[name]
raise AttributeError, name
def set_silent(self, value):
"""Set a variable without calling its action routine"""
self.tk.call('tixSetSilent', self._w, value)
def subwidget(self, name):
"""Return the named subwidget (which must have been created by
the sub-class)."""
n = self._subwidget_name(name)
if not n:
raise TclError, "Subwidget " + name + " not child of " + self._name
# Remove header of name and leading dot
n = n[len(self._w)+1:]
return self._nametowidget(n)
def subwidgets_all(self):
"""Return all subwidgets."""
names = self._subwidget_names()
if not names:
return []
retlist = []
for name in names:
name = name[len(self._w)+1:]
try:
retlist.append(self._nametowidget(name))
except:
# some of the widgets are unknown e.g. border in LabelFrame
pass
return retlist
def _subwidget_name(self,name):
"""Get a subwidget name (returns a String, not a Widget !)"""
try:
return self.tk.call(self._w, 'subwidget', name)
except TclError:
return None
def _subwidget_names(self):
"""Return the name of all subwidgets."""
try:
x = self.tk.call(self._w, 'subwidgets', '-all')
return self.tk.split(x)
except TclError:
return None
def config_all(self, option, value):
"""Set configuration options for all subwidgets (and self)."""
if option == '':
return
elif not isinstance(option, StringType):
option = repr(option)
if not isinstance(value, StringType):
value = repr(value)
names = self._subwidget_names()
for name in names:
self.tk.call(name, 'configure', '-' + option, value)
# These are missing from Tkinter
def image_create(self, imgtype, cnf={}, master=None, **kw):
if not master:
master = Tkinter._default_root
if not master:
raise RuntimeError, 'Too early to create image'
if kw and cnf: cnf = _cnfmerge((cnf, kw))
elif kw: cnf = kw
options = ()
for k, v in cnf.items():
if hasattr(v, '__call__'):
v = self._register(v)
options = options + ('-'+k, v)
return master.tk.call(('image', 'create', imgtype,) + options)
def image_delete(self, imgname):
try:
self.tk.call('image', 'delete', imgname)
except TclError:
# May happen if the root was destroyed
pass
# Subwidgets are child widgets created automatically by mega-widgets.
# In python, we have to create these subwidgets manually to mirror their
# existence in Tk/Tix.
class TixSubWidget(TixWidget):
"""Subwidget class.
This is used to mirror child widgets automatically created
by Tix/Tk as part of a mega-widget in Python (which is not informed
of this)"""
def __init__(self, master, name,
destroy_physically=1, check_intermediate=1):
if check_intermediate:
path = master._subwidget_name(name)
try:
path = path[len(master._w)+1:]
plist = path.split('.')
except:
plist = []
if not check_intermediate:
# immediate descendant
TixWidget.__init__(self, master, None, None, {'name' : name})
else:
# Ensure that the intermediate widgets exist
parent = master
for i in range(len(plist) - 1):
n = '.'.join(plist[:i+1])
try:
w = master._nametowidget(n)
parent = w
except KeyError:
# Create the intermediate widget
parent = TixSubWidget(parent, plist[i],
destroy_physically=0,
check_intermediate=0)
# The Tk widget name is in plist, not in name
if plist:
name = plist[-1]
TixWidget.__init__(self, parent, None, None, {'name' : name})
self.destroy_physically = destroy_physically
def destroy(self):
# For some widgets e.g., a NoteBook, when we call destructors,
# we must be careful not to destroy the frame widget since this
# also destroys the parent NoteBook thus leading to an exception
# in Tkinter when it finally calls Tcl to destroy the NoteBook
for c in self.children.values(): c.destroy()
if self._name in self.master.children:
del self.master.children[self._name]
if self._name in self.master.subwidget_list:
del self.master.subwidget_list[self._name]
if self.destroy_physically:
# This is bypassed only for a few widgets
self.tk.call('destroy', self._w)
# Useful func. to split Tcl lists and return as a dict. From Tkinter.py
def _lst2dict(lst):
dict = {}
for x in lst:
dict[x[0][1:]] = (x[0][1:],) + x[1:]
return dict
# Useful class to create a display style - later shared by many items.
# Contributed by Steffen Kremser
class DisplayStyle:
"""DisplayStyle - handle configuration options shared by
(multiple) Display Items"""
def __init__(self, itemtype, cnf={}, **kw):
master = _default_root # global from Tkinter
if not master and 'refwindow' in cnf: master=cnf['refwindow']
elif not master and 'refwindow' in kw: master= kw['refwindow']
elif not master: raise RuntimeError, "Too early to create display style: no root window"
self.tk = master.tk
self.stylename = self.tk.call('tixDisplayStyle', itemtype,
*self._options(cnf,kw) )
def __str__(self):
return self.stylename
def _options(self, cnf, kw):
if kw and cnf:
cnf = _cnfmerge((cnf, kw))
elif kw:
cnf = kw
opts = ()
for k, v in cnf.items():
opts = opts + ('-'+k, v)
return opts
def delete(self):
self.tk.call(self.stylename, 'delete')
def __setitem__(self,key,value):
self.tk.call(self.stylename, 'configure', '-%s'%key, value)
def config(self, cnf={}, **kw):
return _lst2dict(
self.tk.split(
self.tk.call(
self.stylename, 'configure', *self._options(cnf,kw))))
def __getitem__(self,key):
return self.tk.call(self.stylename, 'cget', '-%s'%key)
######################################################
### The Tix Widget classes - in alphabetical order ###
######################################################
class Balloon(TixWidget):
"""Balloon help widget.
Subwidget Class
--------- -----
label Label
message Message"""
# FIXME: It should inherit -superclass tixShell
def __init__(self, master=None, cnf={}, **kw):
# static seem to be -installcolormap -initwait -statusbar -cursor
static = ['options', 'installcolormap', 'initwait', 'statusbar',
'cursor']
TixWidget.__init__(self, master, 'tixBalloon', static, cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label',
destroy_physically=0)
self.subwidget_list['message'] = _dummyLabel(self, 'message',
destroy_physically=0)
def bind_widget(self, widget, cnf={}, **kw):
"""Bind balloon widget to another.
One balloon widget may be bound to several widgets at the same time"""
self.tk.call(self._w, 'bind', widget._w, *self._options(cnf, kw))
def unbind_widget(self, widget):
self.tk.call(self._w, 'unbind', widget._w)
class ButtonBox(TixWidget):
"""ButtonBox - A container for pushbuttons.
Subwidgets are the buttons added with the add method.
"""
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixButtonBox',
['orientation', 'options'], cnf, kw)
def add(self, name, cnf={}, **kw):
"""Add a button with given name to box."""
btn = self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = _dummyButton(self, name)
return btn
def invoke(self, name):
if name in self.subwidget_list:
self.tk.call(self._w, 'invoke', name)
class ComboBox(TixWidget):
"""ComboBox - an Entry field with a dropdown menu. The user can select a
choice by either typing in the entry subwdget or selecting from the
listbox subwidget.
Subwidget Class
--------- -----
entry Entry
arrow Button
slistbox ScrolledListBox
tick Button
cross Button : present if created with the fancy option"""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__ (self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixComboBox',
['editable', 'dropdown', 'fancy', 'options'],
cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
self.subwidget_list['arrow'] = _dummyButton(self, 'arrow')
self.subwidget_list['slistbox'] = _dummyScrolledListBox(self,
'slistbox')
try:
self.subwidget_list['tick'] = _dummyButton(self, 'tick')
self.subwidget_list['cross'] = _dummyButton(self, 'cross')
except TypeError:
# unavailable when -fancy not specified
pass
# align
def add_history(self, str):
self.tk.call(self._w, 'addhistory', str)
def append_history(self, str):
self.tk.call(self._w, 'appendhistory', str)
def insert(self, index, str):
self.tk.call(self._w, 'insert', index, str)
def pick(self, index):
self.tk.call(self._w, 'pick', index)
class Control(TixWidget):
"""Control - An entry field with value change arrows. The user can
adjust the value by pressing the two arrow buttons or by entering
the value directly into the entry. The new value will be checked
against the user-defined upper and lower limits.
Subwidget Class
--------- -----
incr Button
decr Button
entry Entry
label Label"""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__ (self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixControl', ['options'], cnf, kw)
self.subwidget_list['incr'] = _dummyButton(self, 'incr')
self.subwidget_list['decr'] = _dummyButton(self, 'decr')
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
def decrement(self):
self.tk.call(self._w, 'decr')
def increment(self):
self.tk.call(self._w, 'incr')
def invoke(self):
self.tk.call(self._w, 'invoke')
def update(self):
self.tk.call(self._w, 'update')
class DirList(TixWidget):
"""DirList - displays a list view of a directory, its previous
directories and its sub-directories. The user can choose one of
the directories displayed in the list or change to another directory.
Subwidget Class
--------- -----
hlist HList
hsb Scrollbar
vsb Scrollbar"""
# FIXME: It should inherit -superclass tixScrolledHList
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirList', ['options'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def chdir(self, dir):
self.tk.call(self._w, 'chdir', dir)
class DirTree(TixWidget):
"""DirTree - Directory Listing in a hierarchical view.
Displays a tree view of a directory, its previous directories and its
sub-directories. The user can choose one of the directories displayed
in the list or change to another directory.
Subwidget Class
--------- -----
hlist HList
hsb Scrollbar
vsb Scrollbar"""
# FIXME: It should inherit -superclass tixScrolledHList
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirTree', ['options'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def chdir(self, dir):
self.tk.call(self._w, 'chdir', dir)
class DirSelectBox(TixWidget):
"""DirSelectBox - Motif style file select box.
It is generally used for
the user to choose a file. FileSelectBox stores the files mostly
recently selected into a ComboBox widget so that they can be quickly
selected again.
Subwidget Class
--------- -----
selection ComboBox
filter ComboBox
dirlist ScrolledListBox
filelist ScrolledListBox"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirSelectBox', ['options'], cnf, kw)
self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx')
class ExFileSelectBox(TixWidget):
"""ExFileSelectBox - MS Windows style file select box.
It provides an convenient method for the user to select files.
Subwidget Class
--------- -----
cancel Button
ok Button
hidden Checkbutton
types ComboBox
dir ComboBox
file ComboBox
dirlist ScrolledListBox
filelist ScrolledListBox"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixExFileSelectBox', ['options'], cnf, kw)
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden')
self.subwidget_list['types'] = _dummyComboBox(self, 'types')
self.subwidget_list['dir'] = _dummyComboBox(self, 'dir')
self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
self.subwidget_list['file'] = _dummyComboBox(self, 'file')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
def filter(self):
self.tk.call(self._w, 'filter')
def invoke(self):
self.tk.call(self._w, 'invoke')
# Should inherit from a Dialog class
class DirSelectDialog(TixWidget):
"""The DirSelectDialog widget presents the directories in the file
system in a dialog window. The user can use this dialog window to
navigate through the file system to select the desired directory.
Subwidgets Class
---------- -----
dirbox DirSelectDialog"""
# FIXME: It should inherit -superclass tixDialogShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirSelectDialog',
['options'], cnf, kw)
self.subwidget_list['dirbox'] = _dummyDirSelectBox(self, 'dirbox')
# cancel and ok buttons are missing
def popup(self):
self.tk.call(self._w, 'popup')
def popdown(self):
self.tk.call(self._w, 'popdown')
# Should inherit from a Dialog class
class ExFileSelectDialog(TixWidget):
"""ExFileSelectDialog - MS Windows style file select dialog.
It provides an convenient method for the user to select files.
Subwidgets Class
---------- -----
fsbox ExFileSelectBox"""
# FIXME: It should inherit -superclass tixDialogShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixExFileSelectDialog',
['options'], cnf, kw)
self.subwidget_list['fsbox'] = _dummyExFileSelectBox(self, 'fsbox')
def popup(self):
self.tk.call(self._w, 'popup')
def popdown(self):
self.tk.call(self._w, 'popdown')
class FileSelectBox(TixWidget):
"""ExFileSelectBox - Motif style file select box.
It is generally used for
the user to choose a file. FileSelectBox stores the files mostly
recently selected into a ComboBox widget so that they can be quickly
selected again.
Subwidget Class
--------- -----
selection ComboBox
filter ComboBox
dirlist ScrolledListBox
filelist ScrolledListBox"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixFileSelectBox', ['options'], cnf, kw)
self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
self.subwidget_list['filter'] = _dummyComboBox(self, 'filter')
self.subwidget_list['selection'] = _dummyComboBox(self, 'selection')
def apply_filter(self): # name of subwidget is same as command
self.tk.call(self._w, 'filter')
def invoke(self):
self.tk.call(self._w, 'invoke')
# Should inherit from a Dialog class
class FileSelectDialog(TixWidget):
"""FileSelectDialog - Motif style file select dialog.
Subwidgets Class
---------- -----
btns StdButtonBox
fsbox FileSelectBox"""
# FIXME: It should inherit -superclass tixStdDialogShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixFileSelectDialog',
['options'], cnf, kw)
self.subwidget_list['btns'] = _dummyStdButtonBox(self, 'btns')
self.subwidget_list['fsbox'] = _dummyFileSelectBox(self, 'fsbox')
def popup(self):
self.tk.call(self._w, 'popup')
def popdown(self):
self.tk.call(self._w, 'popdown')
class FileEntry(TixWidget):
"""FileEntry - Entry field with button that invokes a FileSelectDialog.
The user can type in the filename manually. Alternatively, the user can
press the button widget that sits next to the entry, which will bring
up a file selection dialog.
Subwidgets Class
---------- -----
button Button
entry Entry"""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixFileEntry',
['dialogtype', 'options'], cnf, kw)
self.subwidget_list['button'] = _dummyButton(self, 'button')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
def invoke(self):
self.tk.call(self._w, 'invoke')
def file_dialog(self):
# FIXME: return python object
pass
class HList(TixWidget, XView, YView):
"""HList - Hierarchy display widget can be used to display any data
that have a hierarchical structure, for example, file system directory
trees. The list entries are indented and connected by branch lines
according to their places in the hierachy.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixHList',
['columns', 'options'], cnf, kw)
def add(self, entry, cnf={}, **kw):
return self.tk.call(self._w, 'add', entry, *self._options(cnf, kw))
def add_child(self, parent=None, cnf={}, **kw):
if not parent:
parent = ''
return self.tk.call(
self._w, 'addchild', parent, *self._options(cnf, kw))
def anchor_set(self, entry):
self.tk.call(self._w, 'anchor', 'set', entry)
def anchor_clear(self):
self.tk.call(self._w, 'anchor', 'clear')
def column_width(self, col=0, width=None, chars=None):
if not chars:
return self.tk.call(self._w, 'column', 'width', col, width)
else:
return self.tk.call(self._w, 'column', 'width', col,
'-char', chars)
def delete_all(self):
self.tk.call(self._w, 'delete', 'all')
def delete_entry(self, entry):
self.tk.call(self._w, 'delete', 'entry', entry)
def delete_offsprings(self, entry):
self.tk.call(self._w, 'delete', 'offsprings', entry)
def delete_siblings(self, entry):
self.tk.call(self._w, 'delete', 'siblings', entry)
def dragsite_set(self, index):
self.tk.call(self._w, 'dragsite', 'set', index)
def dragsite_clear(self):
self.tk.call(self._w, 'dragsite', 'clear')
def dropsite_set(self, index):
self.tk.call(self._w, 'dropsite', 'set', index)
def dropsite_clear(self):
self.tk.call(self._w, 'dropsite', 'clear')
def header_create(self, col, cnf={}, **kw):
self.tk.call(self._w, 'header', 'create', col, *self._options(cnf, kw))
def header_configure(self, col, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'header', 'configure', col)))
self.tk.call(self._w, 'header', 'configure', col,
*self._options(cnf, kw))
def header_cget(self, col, opt):
return self.tk.call(self._w, 'header', 'cget', col, opt)
def header_exists(self, col):
return self.tk.call(self._w, 'header', 'exists', col)
def header_delete(self, col):
self.tk.call(self._w, 'header', 'delete', col)
def header_size(self, col):
return self.tk.call(self._w, 'header', 'size', col)
def hide_entry(self, entry):
self.tk.call(self._w, 'hide', 'entry', entry)
def indicator_create(self, entry, cnf={}, **kw):
self.tk.call(
self._w, 'indicator', 'create', entry, *self._options(cnf, kw))
def indicator_configure(self, entry, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'indicator', 'configure', entry)))
self.tk.call(
self._w, 'indicator', 'configure', entry, *self._options(cnf, kw))
def indicator_cget(self, entry, opt):
return self.tk.call(self._w, 'indicator', 'cget', entry, opt)
def indicator_exists(self, entry):
return self.tk.call (self._w, 'indicator', 'exists', entry)
def indicator_delete(self, entry):
self.tk.call(self._w, 'indicator', 'delete', entry)
def indicator_size(self, entry):
return self.tk.call(self._w, 'indicator', 'size', entry)
def info_anchor(self):
return self.tk.call(self._w, 'info', 'anchor')
def info_bbox(self, entry):
return self._getints(
self.tk.call(self._w, 'info', 'bbox', entry)) or None
def info_children(self, entry=None):
c = self.tk.call(self._w, 'info', 'children', entry)
return self.tk.splitlist(c)
def info_data(self, entry):
return self.tk.call(self._w, 'info', 'data', entry)
def info_dragsite(self):
return self.tk.call(self._w, 'info', 'dragsite')
def info_dropsite(self):
return self.tk.call(self._w, 'info', 'dropsite')
def info_exists(self, entry):
return self.tk.call(self._w, 'info', 'exists', entry)
def info_hidden(self, entry):
return self.tk.call(self._w, 'info', 'hidden', entry)
def info_next(self, entry):
return self.tk.call(self._w, 'info', 'next', entry)
def info_parent(self, entry):
return self.tk.call(self._w, 'info', 'parent', entry)
def info_prev(self, entry):
return self.tk.call(self._w, 'info', 'prev', entry)
def info_selection(self):
c = self.tk.call(self._w, 'info', 'selection')
return self.tk.splitlist(c)
def item_cget(self, entry, col, opt):
return self.tk.call(self._w, 'item', 'cget', entry, col, opt)
def item_configure(self, entry, col, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'item', 'configure', entry, col)))
self.tk.call(self._w, 'item', 'configure', entry, col,
*self._options(cnf, kw))
def item_create(self, entry, col, cnf={}, **kw):
self.tk.call(
self._w, 'item', 'create', entry, col, *self._options(cnf, kw))
def item_exists(self, entry, col):
return self.tk.call(self._w, 'item', 'exists', entry, col)
def item_delete(self, entry, col):
self.tk.call(self._w, 'item', 'delete', entry, col)
def entrycget(self, entry, opt):
return self.tk.call(self._w, 'entrycget', entry, opt)
def entryconfigure(self, entry, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'entryconfigure', entry)))
self.tk.call(self._w, 'entryconfigure', entry,
*self._options(cnf, kw))
def nearest(self, y):
return self.tk.call(self._w, 'nearest', y)
def see(self, entry):
self.tk.call(self._w, 'see', entry)
def selection_clear(self, cnf={}, **kw):
self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw))
def selection_includes(self, entry):
return self.tk.call(self._w, 'selection', 'includes', entry)
def selection_set(self, first, last=None):
self.tk.call(self._w, 'selection', 'set', first, last)
def show_entry(self, entry):
return self.tk.call(self._w, 'show', 'entry', entry)
class InputOnly(TixWidget):
"""InputOnly - Invisible widget. Unix only.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixInputOnly', None, cnf, kw)
class LabelEntry(TixWidget):
"""LabelEntry - Entry field with label. Packages an entry widget
and a label into one mega widget. It can beused be used to simplify
the creation of ``entry-form'' type of interface.
Subwidgets Class
---------- -----
label Label
entry Entry"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixLabelEntry',
['labelside','options'], cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
class LabelFrame(TixWidget):
"""LabelFrame - Labelled Frame container. Packages a frame widget
and a label into one mega widget. To create widgets inside a
LabelFrame widget, one creates the new widgets relative to the
frame subwidget and manage them inside the frame subwidget.
Subwidgets Class
---------- -----
label Label
frame Frame"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixLabelFrame',
['labelside','options'], cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['frame'] = _dummyFrame(self, 'frame')
class ListNoteBook(TixWidget):
"""A ListNoteBook widget is very similar to the TixNoteBook widget:
it can be used to display many windows in a limited space using a
notebook metaphor. The notebook is divided into a stack of pages
(windows). At one time only one of these pages can be shown.
The user can navigate through these pages by
choosing the name of the desired page in the hlist subwidget."""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixListNoteBook', ['options'], cnf, kw)
# Is this necessary? It's not an exposed subwidget in Tix.
self.subwidget_list['pane'] = _dummyPanedWindow(self, 'pane',
destroy_physically=0)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['shlist'] = _dummyScrolledHList(self, 'shlist')
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = TixSubWidget(self, name)
return self.subwidget_list[name]
def page(self, name):
return self.subwidget(name)
def pages(self):
# Can't call subwidgets_all directly because we don't want .nbframe
names = self.tk.split(self.tk.call(self._w, 'pages'))
ret = []
for x in names:
ret.append(self.subwidget(x))
return ret
def raise_page(self, name): # raise is a python keyword
self.tk.call(self._w, 'raise', name)
class Meter(TixWidget):
"""The Meter widget can be used to show the progress of a background
job which may take a long time to execute.
"""
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixMeter',
['options'], cnf, kw)
class NoteBook(TixWidget):
"""NoteBook - Multi-page container widget (tabbed notebook metaphor).
Subwidgets Class
---------- -----
nbframe NoteBookFrame
<pages> page widgets added dynamically with the add method"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self,master,'tixNoteBook', ['options'], cnf, kw)
self.subwidget_list['nbframe'] = TixSubWidget(self, 'nbframe',
destroy_physically=0)
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = TixSubWidget(self, name)
return self.subwidget_list[name]
def delete(self, name):
self.tk.call(self._w, 'delete', name)
self.subwidget_list[name].destroy()
del self.subwidget_list[name]
def page(self, name):
return self.subwidget(name)
def pages(self):
# Can't call subwidgets_all directly because we don't want .nbframe
names = self.tk.split(self.tk.call(self._w, 'pages'))
ret = []
for x in names:
ret.append(self.subwidget(x))
return ret
def raise_page(self, name): # raise is a python keyword
self.tk.call(self._w, 'raise', name)
def raised(self):
return self.tk.call(self._w, 'raised')
class NoteBookFrame(TixWidget):
# FIXME: This is dangerous to expose to be called on its own.
pass
class OptionMenu(TixWidget):
"""OptionMenu - creates a menu button of options.
Subwidget Class
--------- -----
menubutton Menubutton
menu Menu"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixOptionMenu',
['labelside', 'options'], cnf, kw)
self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton')
self.subwidget_list['menu'] = _dummyMenu(self, 'menu')
def add_command(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', 'command', name, *self._options(cnf, kw))
def add_separator(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', 'separator', name, *self._options(cnf, kw))
def delete(self, name):
self.tk.call(self._w, 'delete', name)
def disable(self, name):
self.tk.call(self._w, 'disable', name)
def enable(self, name):
self.tk.call(self._w, 'enable', name)
class PanedWindow(TixWidget):
"""PanedWindow - Multi-pane container widget
allows the user to interactively manipulate the sizes of several
panes. The panes can be arranged either vertically or horizontally.The
user changes the sizes of the panes by dragging the resize handle
between two panes.
Subwidgets Class
---------- -----
<panes> g/p widgets added dynamically with the add method."""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixPanedWindow', ['orientation', 'options'], cnf, kw)
# add delete forget panecget paneconfigure panes setsize
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = TixSubWidget(self, name,
check_intermediate=0)
return self.subwidget_list[name]
def delete(self, name):
self.tk.call(self._w, 'delete', name)
self.subwidget_list[name].destroy()
del self.subwidget_list[name]
def forget(self, name):
self.tk.call(self._w, 'forget', name)
def panecget(self, entry, opt):
return self.tk.call(self._w, 'panecget', entry, opt)
def paneconfigure(self, entry, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'paneconfigure', entry)))
self.tk.call(self._w, 'paneconfigure', entry, *self._options(cnf, kw))
def panes(self):
names = self.tk.splitlist(self.tk.call(self._w, 'panes'))
return [self.subwidget(x) for x in names]
class PopupMenu(TixWidget):
"""PopupMenu widget can be used as a replacement of the tk_popup command.
The advantage of the Tix PopupMenu widget is it requires less application
code to manipulate.
Subwidgets Class
---------- -----
menubutton Menubutton
menu Menu"""
# FIXME: It should inherit -superclass tixShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixPopupMenu', ['options'], cnf, kw)
self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton')
self.subwidget_list['menu'] = _dummyMenu(self, 'menu')
def bind_widget(self, widget):
self.tk.call(self._w, 'bind', widget._w)
def unbind_widget(self, widget):
self.tk.call(self._w, 'unbind', widget._w)
def post_widget(self, widget, x, y):
self.tk.call(self._w, 'post', widget._w, x, y)
class ResizeHandle(TixWidget):
"""Internal widget to draw resize handles on Scrolled widgets."""
def __init__(self, master, cnf={}, **kw):
# There seems to be a Tix bug rejecting the configure method
# Let's try making the flags -static
flags = ['options', 'command', 'cursorfg', 'cursorbg',
'handlesize', 'hintcolor', 'hintwidth',
'x', 'y']
# In fact, x y height width are configurable
TixWidget.__init__(self, master, 'tixResizeHandle',
flags, cnf, kw)
def attach_widget(self, widget):
self.tk.call(self._w, 'attachwidget', widget._w)
def detach_widget(self, widget):
self.tk.call(self._w, 'detachwidget', widget._w)
def hide(self, widget):
self.tk.call(self._w, 'hide', widget._w)
def show(self, widget):
self.tk.call(self._w, 'show', widget._w)
class ScrolledHList(TixWidget):
"""ScrolledHList - HList with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledHList', ['options'],
cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledListBox(TixWidget):
"""ScrolledListBox - Listbox with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledListBox', ['options'], cnf, kw)
self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledText(TixWidget):
"""ScrolledText - Text with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledText', ['options'], cnf, kw)
self.subwidget_list['text'] = _dummyText(self, 'text')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledTList(TixWidget):
"""ScrolledTList - TList with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledTList', ['options'],
cnf, kw)
self.subwidget_list['tlist'] = _dummyTList(self, 'tlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledWindow(TixWidget):
"""ScrolledWindow - Window with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledWindow', ['options'], cnf, kw)
self.subwidget_list['window'] = _dummyFrame(self, 'window')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class Select(TixWidget):
"""Select - Container of button subwidgets. It can be used to provide
radio-box or check-box style of selection options for the user.
Subwidgets are buttons added dynamically using the add method."""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixSelect',
['allowzero', 'radio', 'orientation', 'labelside',
'options'],
cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = _dummyButton(self, name)
return self.subwidget_list[name]
def invoke(self, name):
self.tk.call(self._w, 'invoke', name)
class Shell(TixWidget):
"""Toplevel window.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixShell', ['options', 'title'], cnf, kw)
class DialogShell(TixWidget):
"""Toplevel window, with popup popdown and center methods.
It tells the window manager that it is a dialog window and should be
treated specially. The exact treatment depends on the treatment of
the window manager.
Subwidgets - None"""
# FIXME: It should inherit from Shell
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master,
'tixDialogShell',
['options', 'title', 'mapped',
'minheight', 'minwidth',
'parent', 'transient'], cnf, kw)
def popdown(self):
self.tk.call(self._w, 'popdown')
def popup(self):
self.tk.call(self._w, 'popup')
def center(self):
self.tk.call(self._w, 'center')
class StdButtonBox(TixWidget):
"""StdButtonBox - Standard Button Box (OK, Apply, Cancel and Help) """
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixStdButtonBox',
['orientation', 'options'], cnf, kw)
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['apply'] = _dummyButton(self, 'apply')
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['help'] = _dummyButton(self, 'help')
def invoke(self, name):
if name in self.subwidget_list:
self.tk.call(self._w, 'invoke', name)
class TList(TixWidget, XView, YView):
"""TList - Hierarchy display widget which can be
used to display data in a tabular format. The list entries of a TList
widget are similar to the entries in the Tk listbox widget. The main
differences are (1) the TList widget can display the list entries in a
two dimensional format and (2) you can use graphical images as well as
multiple colors and fonts for the list entries.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixTList', ['options'], cnf, kw)
def active_set(self, index):
self.tk.call(self._w, 'active', 'set', index)
def active_clear(self):
self.tk.call(self._w, 'active', 'clear')
def anchor_set(self, index):
self.tk.call(self._w, 'anchor', 'set', index)
def anchor_clear(self):
self.tk.call(self._w, 'anchor', 'clear')
def delete(self, from_, to=None):
self.tk.call(self._w, 'delete', from_, to)
def dragsite_set(self, index):
self.tk.call(self._w, 'dragsite', 'set', index)
def dragsite_clear(self):
self.tk.call(self._w, 'dragsite', 'clear')
def dropsite_set(self, index):
self.tk.call(self._w, 'dropsite', 'set', index)
def dropsite_clear(self):
self.tk.call(self._w, 'dropsite', 'clear')
def insert(self, index, cnf={}, **kw):
self.tk.call(self._w, 'insert', index, *self._options(cnf, kw))
def info_active(self):
return self.tk.call(self._w, 'info', 'active')
def info_anchor(self):
return self.tk.call(self._w, 'info', 'anchor')
def info_down(self, index):
return self.tk.call(self._w, 'info', 'down', index)
def info_left(self, index):
return self.tk.call(self._w, 'info', 'left', index)
def info_right(self, index):
return self.tk.call(self._w, 'info', 'right', index)
def info_selection(self):
c = self.tk.call(self._w, 'info', 'selection')
return self.tk.splitlist(c)
def info_size(self):
return self.tk.call(self._w, 'info', 'size')
def info_up(self, index):
return self.tk.call(self._w, 'info', 'up', index)
def nearest(self, x, y):
return self.tk.call(self._w, 'nearest', x, y)
def see(self, index):
self.tk.call(self._w, 'see', index)
def selection_clear(self, cnf={}, **kw):
self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw))
def selection_includes(self, index):
return self.tk.call(self._w, 'selection', 'includes', index)
def selection_set(self, first, last=None):
self.tk.call(self._w, 'selection', 'set', first, last)
class Tree(TixWidget):
"""Tree - The tixTree widget can be used to display hierachical
data in a tree form. The user can adjust
the view of the tree by opening or closing parts of the tree."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixTree',
['options'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def autosetmode(self):
'''This command calls the setmode method for all the entries in this
Tree widget: if an entry has no child entries, its mode is set to
none. Otherwise, if the entry has any hidden child entries, its mode is
set to open; otherwise its mode is set to close.'''
self.tk.call(self._w, 'autosetmode')
def close(self, entrypath):
'''Close the entry given by entryPath if its mode is close.'''
self.tk.call(self._w, 'close', entrypath)
def getmode(self, entrypath):
'''Returns the current mode of the entry given by entryPath.'''
return self.tk.call(self._w, 'getmode', entrypath)
def open(self, entrypath):
'''Open the entry given by entryPath if its mode is open.'''
self.tk.call(self._w, 'open', entrypath)
def setmode(self, entrypath, mode='none'):
'''This command is used to indicate whether the entry given by
entryPath has children entries and whether the children are visible. mode
must be one of open, close or none. If mode is set to open, a (+)
indicator is drawn next to the entry. If mode is set to close, a (-)
indicator is drawn next to the entry. If mode is set to none, no
indicators will be drawn for this entry. The default mode is none. The
open mode indicates the entry has hidden children and this entry can be
opened by the user. The close mode indicates that all the children of the
entry are now visible and the entry can be closed by the user.'''
self.tk.call(self._w, 'setmode', entrypath, mode)
# Could try subclassing Tree for CheckList - would need another arg to init
class CheckList(TixWidget):
"""The CheckList widget
displays a list of items to be selected by the user. CheckList acts
similarly to the Tk checkbutton or radiobutton widgets, except it is
capable of handling many more items than checkbuttons or radiobuttons.
"""
# FIXME: It should inherit -superclass tixTree
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixCheckList',
['options', 'radio'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def autosetmode(self):
'''This command calls the setmode method for all the entries in this
Tree widget: if an entry has no child entries, its mode is set to
none. Otherwise, if the entry has any hidden child entries, its mode is
set to open; otherwise its mode is set to close.'''
self.tk.call(self._w, 'autosetmode')
def close(self, entrypath):
'''Close the entry given by entryPath if its mode is close.'''
self.tk.call(self._w, 'close', entrypath)
def getmode(self, entrypath):
'''Returns the current mode of the entry given by entryPath.'''
return self.tk.call(self._w, 'getmode', entrypath)
def open(self, entrypath):
'''Open the entry given by entryPath if its mode is open.'''
self.tk.call(self._w, 'open', entrypath)
def getselection(self, mode='on'):
'''Returns a list of items whose status matches status. If status is
not specified, the list of items in the "on" status will be returned.
Mode can be on, off, default'''
c = self.tk.split(self.tk.call(self._w, 'getselection', mode))
return self.tk.splitlist(c)
def getstatus(self, entrypath):
'''Returns the current status of entryPath.'''
return self.tk.call(self._w, 'getstatus', entrypath)
def setstatus(self, entrypath, mode='on'):
'''Sets the status of entryPath to be status. A bitmap will be
displayed next to the entry its status is on, off or default.'''
self.tk.call(self._w, 'setstatus', entrypath, mode)
###########################################################################
### The subclassing below is used to instantiate the subwidgets in each ###
### mega widget. This allows us to access their methods directly. ###
###########################################################################
class _dummyButton(Button, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyCheckbutton(Checkbutton, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyEntry(Entry, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyFrame(Frame, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyLabel(Label, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyListbox(Listbox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyMenu(Menu, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyMenubutton(Menubutton, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyScrollbar(Scrollbar, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyText(Text, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyScrolledListBox(ScrolledListBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class _dummyHList(HList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyScrolledHList(ScrolledHList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class _dummyTList(TList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyComboBox(ComboBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, ['fancy',destroy_physically])
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
self.subwidget_list['arrow'] = _dummyButton(self, 'arrow')
self.subwidget_list['slistbox'] = _dummyScrolledListBox(self,
'slistbox')
try:
self.subwidget_list['tick'] = _dummyButton(self, 'tick')
#cross Button : present if created with the fancy option
self.subwidget_list['cross'] = _dummyButton(self, 'cross')
except TypeError:
# unavailable when -fancy not specified
pass
class _dummyDirList(DirList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class _dummyDirSelectBox(DirSelectBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx')
class _dummyExFileSelectBox(ExFileSelectBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden')
self.subwidget_list['types'] = _dummyComboBox(self, 'types')
self.subwidget_list['dir'] = _dummyComboBox(self, 'dir')
self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
self.subwidget_list['file'] = _dummyComboBox(self, 'file')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
class _dummyFileSelectBox(FileSelectBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
self.subwidget_list['filter'] = _dummyComboBox(self, 'filter')
self.subwidget_list['selection'] = _dummyComboBox(self, 'selection')
class _dummyFileComboBox(ComboBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['dircbx'] = _dummyComboBox(self, 'dircbx')
class _dummyStdButtonBox(StdButtonBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['apply'] = _dummyButton(self, 'apply')
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['help'] = _dummyButton(self, 'help')
class _dummyNoteBookFrame(NoteBookFrame, TixSubWidget):
def __init__(self, master, name, destroy_physically=0):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyPanedWindow(PanedWindow, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
########################
### Utility Routines ###
########################
#mike Should tixDestroy be exposed as a wrapper? - but not for widgets.
def OptionName(widget):
'''Returns the qualified path name for the widget. Normally used to set
default options for subwidgets. See tixwidgets.py'''
return widget.tk.call('tixOptionName', widget._w)
# Called with a dictionary argument of the form
# {'*.c':'C source files', '*.txt':'Text Files', '*':'All files'}
# returns a string which can be used to configure the fsbox file types
# in an ExFileSelectBox. i.e.,
# '{{*} {* - All files}} {{*.c} {*.c - C source files}} {{*.txt} {*.txt - Text Files}}'
def FileTypeList(dict):
s = ''
for type in dict.keys():
s = s + '{{' + type + '} {' + type + ' - ' + dict[type] + '}} '
return s
# Still to be done:
# tixIconView
class CObjView(TixWidget):
"""This file implements the Canvas Object View widget. This is a base
class of IconView. It implements automatic placement/adjustment of the
scrollbars according to the canvas objects inside the canvas subwidget.
The scrollbars are adjusted so that the canvas is just large enough
to see all the objects.
"""
# FIXME: It should inherit -superclass tixScrolledWidget
pass
class Grid(TixWidget, XView, YView):
'''The Tix Grid command creates a new window and makes it into a
tixGrid widget. Additional options, may be specified on the command
line or in the option database to configure aspects such as its cursor
and relief.
A Grid widget displays its contents in a two dimensional grid of cells.
Each cell may contain one Tix display item, which may be in text,
graphics or other formats. See the DisplayStyle class for more information
about Tix display items. Individual cells, or groups of cells, can be
formatted with a wide range of attributes, such as its color, relief and
border.
Subwidgets - None'''
# valid specific resources as of Tk 8.4
# editdonecmd, editnotifycmd, floatingcols, floatingrows, formatcmd,
# highlightbackground, highlightcolor, leftmargin, itemtype, selectmode,
# selectunit, topmargin,
def __init__(self, master=None, cnf={}, **kw):
static= []
self.cnf= cnf
TixWidget.__init__(self, master, 'tixGrid', static, cnf, kw)
# valid options as of Tk 8.4
# anchor, bdtype, cget, configure, delete, dragsite, dropsite, entrycget,
# edit, entryconfigure, format, geometryinfo, info, index, move, nearest,
# selection, set, size, unset, xview, yview
def anchor_clear(self):
"""Removes the selection anchor."""
self.tk.call(self, 'anchor', 'clear')
def anchor_get(self):
"Get the (x,y) coordinate of the current anchor cell"
return self._getints(self.tk.call(self, 'anchor', 'get'))
def anchor_set(self, x, y):
"""Set the selection anchor to the cell at (x, y)."""
self.tk.call(self, 'anchor', 'set', x, y)
def delete_row(self, from_, to=None):
"""Delete rows between from_ and to inclusive.
If to is not provided, delete only row at from_"""
if to is None:
self.tk.call(self, 'delete', 'row', from_)
else:
self.tk.call(self, 'delete', 'row', from_, to)
def delete_column(self, from_, to=None):
"""Delete columns between from_ and to inclusive.
If to is not provided, delete only column at from_"""
if to is None:
self.tk.call(self, 'delete', 'column', from_)
else:
self.tk.call(self, 'delete', 'column', from_, to)
def edit_apply(self):
"""If any cell is being edited, de-highlight the cell and applies
the changes."""
self.tk.call(self, 'edit', 'apply')
def edit_set(self, x, y):
"""Highlights the cell at (x, y) for editing, if the -editnotify
command returns True for this cell."""
self.tk.call(self, 'edit', 'set', x, y)
def entrycget(self, x, y, option):
"Get the option value for cell at (x,y)"
if option and option[0] != '-':
option = '-' + option
return self.tk.call(self, 'entrycget', x, y, option)
def entryconfigure(self, x, y, cnf=None, **kw):
return self._configure(('entryconfigure', x, y), cnf, kw)
# def format
# def index
def info_exists(self, x, y):
"Return True if display item exists at (x,y)"
return self._getboolean(self.tk.call(self, 'info', 'exists', x, y))
def info_bbox(self, x, y):
# This seems to always return '', at least for 'text' displayitems
return self.tk.call(self, 'info', 'bbox', x, y)
def move_column(self, from_, to, offset):
"""Moves the the range of columns from position FROM through TO by
the distance indicated by OFFSET. For example, move_column(2, 4, 1)
moves the columns 2,3,4 to columns 3,4,5."""
self.tk.call(self, 'move', 'column', from_, to, offset)
def move_row(self, from_, to, offset):
"""Moves the the range of rows from position FROM through TO by
the distance indicated by OFFSET.
For example, move_row(2, 4, 1) moves the rows 2,3,4 to rows 3,4,5."""
self.tk.call(self, 'move', 'row', from_, to, offset)
def nearest(self, x, y):
"Return coordinate of cell nearest pixel coordinate (x,y)"
return self._getints(self.tk.call(self, 'nearest', x, y))
# def selection adjust
# def selection clear
# def selection includes
# def selection set
# def selection toggle
def set(self, x, y, itemtype=None, **kw):
args= self._options(self.cnf, kw)
if itemtype is not None:
args= ('-itemtype', itemtype) + args
self.tk.call(self, 'set', x, y, *args)
def size_column(self, index, **kw):
"""Queries or sets the size of the column given by
INDEX. INDEX may be any non-negative
integer that gives the position of a given column.
INDEX can also be the string "default"; in this case, this command
queries or sets the default size of all columns.
When no option-value pair is given, this command returns a tuple
containing the current size setting of the given column. When
option-value pairs are given, the corresponding options of the
size setting of the given column are changed. Options may be one
of the follwing:
pad0 pixels
Specifies the paddings to the left of a column.
pad1 pixels
Specifies the paddings to the right of a column.
size val
Specifies the width of a column .
Val may be: "auto" -- the width of the column is set the
the widest cell in the column; a valid Tk screen distance
unit; or a real number following by the word chars
(e.g. 3.4chars) that sets the width of the column to the
given number of characters."""
return self.tk.split(self.tk.call(self._w, 'size', 'column', index,
*self._options({}, kw)))
def size_row(self, index, **kw):
"""Queries or sets the size of the row given by
INDEX. INDEX may be any non-negative
integer that gives the position of a given row .
INDEX can also be the string "default"; in this case, this command
queries or sets the default size of all rows.
When no option-value pair is given, this command returns a list con-
taining the current size setting of the given row . When option-value
pairs are given, the corresponding options of the size setting of the
given row are changed. Options may be one of the follwing:
pad0 pixels
Specifies the paddings to the top of a row.
pad1 pixels
Specifies the paddings to the the bottom of a row.
size val
Specifies the height of a row.
Val may be: "auto" -- the height of the row is set the
the highest cell in the row; a valid Tk screen distance
unit; or a real number following by the word chars
(e.g. 3.4chars) that sets the height of the row to the
given number of characters."""
return self.tk.split(self.tk.call(
self, 'size', 'row', index, *self._options({}, kw)))
def unset(self, x, y):
"""Clears the cell at (x, y) by removing its display item."""
self.tk.call(self._w, 'unset', x, y)
class ScrolledGrid(Grid):
'''Scrolled Grid widgets'''
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master=None, cnf={}, **kw):
static= []
self.cnf= cnf
TixWidget.__init__(self, master, 'tixScrolledGrid', static, cnf, kw)
| Python |
# dialog.py -- Tkinter interface to the tk_dialog script.
from Tkinter import *
from Tkinter import _cnfmerge
if TkVersion <= 3.6:
DIALOG_ICON = 'warning'
else:
DIALOG_ICON = 'questhead'
class Dialog(Widget):
def __init__(self, master=None, cnf={}, **kw):
cnf = _cnfmerge((cnf, kw))
self.widgetName = '__dialog__'
Widget._setup(self, master, cnf)
self.num = self.tk.getint(
self.tk.call(
'tk_dialog', self._w,
cnf['title'], cnf['text'],
cnf['bitmap'], cnf['default'],
*cnf['strings']))
try: Widget.destroy(self)
except TclError: pass
def destroy(self): pass
def _test():
d = Dialog(None, {'title': 'File Modified',
'text':
'File "Python.h" has been modified'
' since the last time it was saved.'
' Do you want to save it before'
' exiting the application.',
'bitmap': DIALOG_ICON,
'default': 0,
'strings': ('Save File',
'Discard Changes',
'Return to Editor')})
print d.num
if __name__ == '__main__':
t = Button(None, {'text': 'Test',
'command': _test,
Pack: {}})
q = Button(None, {'text': 'Quit',
'command': t.quit,
Pack: {}})
t.mainloop()
| Python |
# -*-mode: python; fill-column: 75; tab-width: 8; coding: iso-latin-1-unix -*-
#
# $Id$
#
# Tix.py -- Tix widget wrappers.
#
# For Tix, see http://tix.sourceforge.net
#
# - Sudhir Shenoy (sshenoy@gol.com), Dec. 1995.
# based on an idea of Jean-Marc Lugrin (lugrin@ms.com)
#
# NOTE: In order to minimize changes to Tkinter.py, some of the code here
# (TixWidget.__init__) has been taken from Tkinter (Widget.__init__)
# and will break if there are major changes in Tkinter.
#
# The Tix widgets are represented by a class hierarchy in python with proper
# inheritance of base classes.
#
# As a result after creating a 'w = StdButtonBox', I can write
# w.ok['text'] = 'Who Cares'
# or w.ok['bg'] = w['bg']
# or even w.ok.invoke()
# etc.
#
# Compare the demo tixwidgets.py to the original Tcl program and you will
# appreciate the advantages.
#
from Tkinter import *
from Tkinter import _flatten, _cnfmerge, _default_root
# WARNING - TkVersion is a limited precision floating point number
if TkVersion < 3.999:
raise ImportError, "This version of Tix.py requires Tk 4.0 or higher"
import _tkinter # If this fails your Python may not be configured for Tk
# Some more constants (for consistency with Tkinter)
WINDOW = 'window'
TEXT = 'text'
STATUS = 'status'
IMMEDIATE = 'immediate'
IMAGE = 'image'
IMAGETEXT = 'imagetext'
BALLOON = 'balloon'
AUTO = 'auto'
ACROSSTOP = 'acrosstop'
# A few useful constants for the Grid widget
ASCII = 'ascii'
CELL = 'cell'
COLUMN = 'column'
DECREASING = 'decreasing'
INCREASING = 'increasing'
INTEGER = 'integer'
MAIN = 'main'
MAX = 'max'
REAL = 'real'
ROW = 'row'
S_REGION = 's-region'
X_REGION = 'x-region'
Y_REGION = 'y-region'
# Some constants used by Tkinter dooneevent()
TCL_DONT_WAIT = 1 << 1
TCL_WINDOW_EVENTS = 1 << 2
TCL_FILE_EVENTS = 1 << 3
TCL_TIMER_EVENTS = 1 << 4
TCL_IDLE_EVENTS = 1 << 5
TCL_ALL_EVENTS = 0
# BEWARE - this is implemented by copying some code from the Widget class
# in Tkinter (to override Widget initialization) and is therefore
# liable to break.
import Tkinter, os
# Could probably add this to Tkinter.Misc
class tixCommand:
"""The tix commands provide access to miscellaneous elements
of Tix's internal state and the Tix application context.
Most of the information manipulated by these commands pertains
to the application as a whole, or to a screen or
display, rather than to a particular window.
This is a mixin class, assumed to be mixed to Tkinter.Tk
that supports the self.tk.call method.
"""
def tix_addbitmapdir(self, directory):
"""Tix maintains a list of directories under which
the tix_getimage and tix_getbitmap commands will
search for image files. The standard bitmap directory
is $TIX_LIBRARY/bitmaps. The addbitmapdir command
adds directory into this list. By using this
command, the image files of an applications can
also be located using the tix_getimage or tix_getbitmap
command.
"""
return self.tk.call('tix', 'addbitmapdir', directory)
def tix_cget(self, option):
"""Returns the current value of the configuration
option given by option. Option may be any of the
options described in the CONFIGURATION OPTIONS section.
"""
return self.tk.call('tix', 'cget', option)
def tix_configure(self, cnf=None, **kw):
"""Query or modify the configuration options of the Tix application
context. If no option is specified, returns a dictionary all of the
available options. If option is specified with no value, then the
command returns a list describing the one named option (this list
will be identical to the corresponding sublist of the value
returned if no option is specified). If one or more option-value
pairs are specified, then the command modifies the given option(s)
to have the given value(s); in this case the command returns an
empty string. Option may be any of the configuration options.
"""
# Copied from Tkinter.py
if kw:
cnf = _cnfmerge((cnf, kw))
elif cnf:
cnf = _cnfmerge(cnf)
if cnf is None:
cnf = {}
for x in self.tk.split(self.tk.call('tix', 'configure')):
cnf[x[0][1:]] = (x[0][1:],) + x[1:]
return cnf
if isinstance(cnf, StringType):
x = self.tk.split(self.tk.call('tix', 'configure', '-'+cnf))
return (x[0][1:],) + x[1:]
return self.tk.call(('tix', 'configure') + self._options(cnf))
def tix_filedialog(self, dlgclass=None):
"""Returns the file selection dialog that may be shared among
different calls from this application. This command will create a
file selection dialog widget when it is called the first time. This
dialog will be returned by all subsequent calls to tix_filedialog.
An optional dlgclass parameter can be passed to specified what type
of file selection dialog widget is desired. Possible options are
tix FileSelectDialog or tixExFileSelectDialog.
"""
if dlgclass is not None:
return self.tk.call('tix', 'filedialog', dlgclass)
else:
return self.tk.call('tix', 'filedialog')
def tix_getbitmap(self, name):
"""Locates a bitmap file of the name name.xpm or name in one of the
bitmap directories (see the tix_addbitmapdir command above). By
using tix_getbitmap, you can avoid hard coding the pathnames of the
bitmap files in your application. When successful, it returns the
complete pathname of the bitmap file, prefixed with the character
'@'. The returned value can be used to configure the -bitmap
option of the TK and Tix widgets.
"""
return self.tk.call('tix', 'getbitmap', name)
def tix_getimage(self, name):
"""Locates an image file of the name name.xpm, name.xbm or name.ppm
in one of the bitmap directories (see the addbitmapdir command
above). If more than one file with the same name (but different
extensions) exist, then the image type is chosen according to the
depth of the X display: xbm images are chosen on monochrome
displays and color images are chosen on color displays. By using
tix_ getimage, you can advoid hard coding the pathnames of the
image files in your application. When successful, this command
returns the name of the newly created image, which can be used to
configure the -image option of the Tk and Tix widgets.
"""
return self.tk.call('tix', 'getimage', name)
def tix_option_get(self, name):
"""Gets the options manitained by the Tix
scheme mechanism. Available options include:
active_bg active_fg bg
bold_font dark1_bg dark1_fg
dark2_bg dark2_fg disabled_fg
fg fixed_font font
inactive_bg inactive_fg input1_bg
input2_bg italic_font light1_bg
light1_fg light2_bg light2_fg
menu_font output1_bg output2_bg
select_bg select_fg selector
"""
# could use self.tk.globalgetvar('tixOption', name)
return self.tk.call('tix', 'option', 'get', name)
def tix_resetoptions(self, newScheme, newFontSet, newScmPrio=None):
"""Resets the scheme and fontset of the Tix application to
newScheme and newFontSet, respectively. This affects only those
widgets created after this call. Therefore, it is best to call the
resetoptions command before the creation of any widgets in a Tix
application.
The optional parameter newScmPrio can be given to reset the
priority level of the Tk options set by the Tix schemes.
Because of the way Tk handles the X option database, after Tix has
been has imported and inited, it is not possible to reset the color
schemes and font sets using the tix config command. Instead, the
tix_resetoptions command must be used.
"""
if newScmPrio is not None:
return self.tk.call('tix', 'resetoptions', newScheme, newFontSet, newScmPrio)
else:
return self.tk.call('tix', 'resetoptions', newScheme, newFontSet)
class Tk(Tkinter.Tk, tixCommand):
"""Toplevel widget of Tix which represents mostly the main window
of an application. It has an associated Tcl interpreter."""
def __init__(self, screenName=None, baseName=None, className='Tix'):
Tkinter.Tk.__init__(self, screenName, baseName, className)
tixlib = os.environ.get('TIX_LIBRARY')
self.tk.eval('global auto_path; lappend auto_path [file dir [info nameof]]')
if tixlib is not None:
self.tk.eval('global auto_path; lappend auto_path {%s}' % tixlib)
self.tk.eval('global tcl_pkgPath; lappend tcl_pkgPath {%s}' % tixlib)
# Load Tix - this should work dynamically or statically
# If it's static, tcl/tix8.1/pkgIndex.tcl should have
# 'load {} Tix'
# If it's dynamic under Unix, tcl/tix8.1/pkgIndex.tcl should have
# 'load libtix8.1.8.3.so Tix'
self.tk.eval('package require Tix')
def destroy(self):
# For safety, remove an delete_window binding before destroy
self.protocol("WM_DELETE_WINDOW", "")
Tkinter.Tk.destroy(self)
# The Tix 'tixForm' geometry manager
class Form:
"""The Tix Form geometry manager
Widgets can be arranged by specifying attachments to other widgets.
See Tix documentation for complete details"""
def config(self, cnf={}, **kw):
self.tk.call('tixForm', self._w, *self._options(cnf, kw))
form = config
def __setitem__(self, key, value):
Form.form(self, {key: value})
def check(self):
return self.tk.call('tixForm', 'check', self._w)
def forget(self):
self.tk.call('tixForm', 'forget', self._w)
def grid(self, xsize=0, ysize=0):
if (not xsize) and (not ysize):
x = self.tk.call('tixForm', 'grid', self._w)
y = self.tk.splitlist(x)
z = ()
for x in y:
z = z + (self.tk.getint(x),)
return z
return self.tk.call('tixForm', 'grid', self._w, xsize, ysize)
def info(self, option=None):
if not option:
return self.tk.call('tixForm', 'info', self._w)
if option[0] != '-':
option = '-' + option
return self.tk.call('tixForm', 'info', self._w, option)
def slaves(self):
return map(self._nametowidget,
self.tk.splitlist(
self.tk.call(
'tixForm', 'slaves', self._w)))
Tkinter.Widget.__bases__ = Tkinter.Widget.__bases__ + (Form,)
class TixWidget(Tkinter.Widget):
"""A TixWidget class is used to package all (or most) Tix widgets.
Widget initialization is extended in two ways:
1) It is possible to give a list of options which must be part of
the creation command (so called Tix 'static' options). These cannot be
given as a 'config' command later.
2) It is possible to give the name of an existing TK widget. These are
child widgets created automatically by a Tix mega-widget. The Tk call
to create these widgets is therefore bypassed in TixWidget.__init__
Both options are for use by subclasses only.
"""
def __init__ (self, master=None, widgetName=None,
static_options=None, cnf={}, kw={}):
# Merge keywords and dictionary arguments
if kw:
cnf = _cnfmerge((cnf, kw))
else:
cnf = _cnfmerge(cnf)
# Move static options into extra. static_options must be
# a list of keywords (or None).
extra=()
# 'options' is always a static option
if static_options:
static_options.append('options')
else:
static_options = ['options']
for k,v in cnf.items()[:]:
if k in static_options:
extra = extra + ('-' + k, v)
del cnf[k]
self.widgetName = widgetName
Widget._setup(self, master, cnf)
# If widgetName is None, this is a dummy creation call where the
# corresponding Tk widget has already been created by Tix
if widgetName:
self.tk.call(widgetName, self._w, *extra)
# Non-static options - to be done via a 'config' command
if cnf:
Widget.config(self, cnf)
# Dictionary to hold subwidget names for easier access. We can't
# use the children list because the public Tix names may not be the
# same as the pathname component
self.subwidget_list = {}
# We set up an attribute access function so that it is possible to
# do w.ok['text'] = 'Hello' rather than w.subwidget('ok')['text'] = 'Hello'
# when w is a StdButtonBox.
# We can even do w.ok.invoke() because w.ok is subclassed from the
# Button class if you go through the proper constructors
def __getattr__(self, name):
if name in self.subwidget_list:
return self.subwidget_list[name]
raise AttributeError, name
def set_silent(self, value):
"""Set a variable without calling its action routine"""
self.tk.call('tixSetSilent', self._w, value)
def subwidget(self, name):
"""Return the named subwidget (which must have been created by
the sub-class)."""
n = self._subwidget_name(name)
if not n:
raise TclError, "Subwidget " + name + " not child of " + self._name
# Remove header of name and leading dot
n = n[len(self._w)+1:]
return self._nametowidget(n)
def subwidgets_all(self):
"""Return all subwidgets."""
names = self._subwidget_names()
if not names:
return []
retlist = []
for name in names:
name = name[len(self._w)+1:]
try:
retlist.append(self._nametowidget(name))
except:
# some of the widgets are unknown e.g. border in LabelFrame
pass
return retlist
def _subwidget_name(self,name):
"""Get a subwidget name (returns a String, not a Widget !)"""
try:
return self.tk.call(self._w, 'subwidget', name)
except TclError:
return None
def _subwidget_names(self):
"""Return the name of all subwidgets."""
try:
x = self.tk.call(self._w, 'subwidgets', '-all')
return self.tk.split(x)
except TclError:
return None
def config_all(self, option, value):
"""Set configuration options for all subwidgets (and self)."""
if option == '':
return
elif not isinstance(option, StringType):
option = repr(option)
if not isinstance(value, StringType):
value = repr(value)
names = self._subwidget_names()
for name in names:
self.tk.call(name, 'configure', '-' + option, value)
# These are missing from Tkinter
def image_create(self, imgtype, cnf={}, master=None, **kw):
if not master:
master = Tkinter._default_root
if not master:
raise RuntimeError, 'Too early to create image'
if kw and cnf: cnf = _cnfmerge((cnf, kw))
elif kw: cnf = kw
options = ()
for k, v in cnf.items():
if hasattr(v, '__call__'):
v = self._register(v)
options = options + ('-'+k, v)
return master.tk.call(('image', 'create', imgtype,) + options)
def image_delete(self, imgname):
try:
self.tk.call('image', 'delete', imgname)
except TclError:
# May happen if the root was destroyed
pass
# Subwidgets are child widgets created automatically by mega-widgets.
# In python, we have to create these subwidgets manually to mirror their
# existence in Tk/Tix.
class TixSubWidget(TixWidget):
"""Subwidget class.
This is used to mirror child widgets automatically created
by Tix/Tk as part of a mega-widget in Python (which is not informed
of this)"""
def __init__(self, master, name,
destroy_physically=1, check_intermediate=1):
if check_intermediate:
path = master._subwidget_name(name)
try:
path = path[len(master._w)+1:]
plist = path.split('.')
except:
plist = []
if not check_intermediate:
# immediate descendant
TixWidget.__init__(self, master, None, None, {'name' : name})
else:
# Ensure that the intermediate widgets exist
parent = master
for i in range(len(plist) - 1):
n = '.'.join(plist[:i+1])
try:
w = master._nametowidget(n)
parent = w
except KeyError:
# Create the intermediate widget
parent = TixSubWidget(parent, plist[i],
destroy_physically=0,
check_intermediate=0)
# The Tk widget name is in plist, not in name
if plist:
name = plist[-1]
TixWidget.__init__(self, parent, None, None, {'name' : name})
self.destroy_physically = destroy_physically
def destroy(self):
# For some widgets e.g., a NoteBook, when we call destructors,
# we must be careful not to destroy the frame widget since this
# also destroys the parent NoteBook thus leading to an exception
# in Tkinter when it finally calls Tcl to destroy the NoteBook
for c in self.children.values(): c.destroy()
if self._name in self.master.children:
del self.master.children[self._name]
if self._name in self.master.subwidget_list:
del self.master.subwidget_list[self._name]
if self.destroy_physically:
# This is bypassed only for a few widgets
self.tk.call('destroy', self._w)
# Useful func. to split Tcl lists and return as a dict. From Tkinter.py
def _lst2dict(lst):
dict = {}
for x in lst:
dict[x[0][1:]] = (x[0][1:],) + x[1:]
return dict
# Useful class to create a display style - later shared by many items.
# Contributed by Steffen Kremser
class DisplayStyle:
"""DisplayStyle - handle configuration options shared by
(multiple) Display Items"""
def __init__(self, itemtype, cnf={}, **kw):
master = _default_root # global from Tkinter
if not master and 'refwindow' in cnf: master=cnf['refwindow']
elif not master and 'refwindow' in kw: master= kw['refwindow']
elif not master: raise RuntimeError, "Too early to create display style: no root window"
self.tk = master.tk
self.stylename = self.tk.call('tixDisplayStyle', itemtype,
*self._options(cnf,kw) )
def __str__(self):
return self.stylename
def _options(self, cnf, kw):
if kw and cnf:
cnf = _cnfmerge((cnf, kw))
elif kw:
cnf = kw
opts = ()
for k, v in cnf.items():
opts = opts + ('-'+k, v)
return opts
def delete(self):
self.tk.call(self.stylename, 'delete')
def __setitem__(self,key,value):
self.tk.call(self.stylename, 'configure', '-%s'%key, value)
def config(self, cnf={}, **kw):
return _lst2dict(
self.tk.split(
self.tk.call(
self.stylename, 'configure', *self._options(cnf,kw))))
def __getitem__(self,key):
return self.tk.call(self.stylename, 'cget', '-%s'%key)
######################################################
### The Tix Widget classes - in alphabetical order ###
######################################################
class Balloon(TixWidget):
"""Balloon help widget.
Subwidget Class
--------- -----
label Label
message Message"""
# FIXME: It should inherit -superclass tixShell
def __init__(self, master=None, cnf={}, **kw):
# static seem to be -installcolormap -initwait -statusbar -cursor
static = ['options', 'installcolormap', 'initwait', 'statusbar',
'cursor']
TixWidget.__init__(self, master, 'tixBalloon', static, cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label',
destroy_physically=0)
self.subwidget_list['message'] = _dummyLabel(self, 'message',
destroy_physically=0)
def bind_widget(self, widget, cnf={}, **kw):
"""Bind balloon widget to another.
One balloon widget may be bound to several widgets at the same time"""
self.tk.call(self._w, 'bind', widget._w, *self._options(cnf, kw))
def unbind_widget(self, widget):
self.tk.call(self._w, 'unbind', widget._w)
class ButtonBox(TixWidget):
"""ButtonBox - A container for pushbuttons.
Subwidgets are the buttons added with the add method.
"""
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixButtonBox',
['orientation', 'options'], cnf, kw)
def add(self, name, cnf={}, **kw):
"""Add a button with given name to box."""
btn = self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = _dummyButton(self, name)
return btn
def invoke(self, name):
if name in self.subwidget_list:
self.tk.call(self._w, 'invoke', name)
class ComboBox(TixWidget):
"""ComboBox - an Entry field with a dropdown menu. The user can select a
choice by either typing in the entry subwdget or selecting from the
listbox subwidget.
Subwidget Class
--------- -----
entry Entry
arrow Button
slistbox ScrolledListBox
tick Button
cross Button : present if created with the fancy option"""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__ (self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixComboBox',
['editable', 'dropdown', 'fancy', 'options'],
cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
self.subwidget_list['arrow'] = _dummyButton(self, 'arrow')
self.subwidget_list['slistbox'] = _dummyScrolledListBox(self,
'slistbox')
try:
self.subwidget_list['tick'] = _dummyButton(self, 'tick')
self.subwidget_list['cross'] = _dummyButton(self, 'cross')
except TypeError:
# unavailable when -fancy not specified
pass
# align
def add_history(self, str):
self.tk.call(self._w, 'addhistory', str)
def append_history(self, str):
self.tk.call(self._w, 'appendhistory', str)
def insert(self, index, str):
self.tk.call(self._w, 'insert', index, str)
def pick(self, index):
self.tk.call(self._w, 'pick', index)
class Control(TixWidget):
"""Control - An entry field with value change arrows. The user can
adjust the value by pressing the two arrow buttons or by entering
the value directly into the entry. The new value will be checked
against the user-defined upper and lower limits.
Subwidget Class
--------- -----
incr Button
decr Button
entry Entry
label Label"""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__ (self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixControl', ['options'], cnf, kw)
self.subwidget_list['incr'] = _dummyButton(self, 'incr')
self.subwidget_list['decr'] = _dummyButton(self, 'decr')
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
def decrement(self):
self.tk.call(self._w, 'decr')
def increment(self):
self.tk.call(self._w, 'incr')
def invoke(self):
self.tk.call(self._w, 'invoke')
def update(self):
self.tk.call(self._w, 'update')
class DirList(TixWidget):
"""DirList - displays a list view of a directory, its previous
directories and its sub-directories. The user can choose one of
the directories displayed in the list or change to another directory.
Subwidget Class
--------- -----
hlist HList
hsb Scrollbar
vsb Scrollbar"""
# FIXME: It should inherit -superclass tixScrolledHList
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirList', ['options'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def chdir(self, dir):
self.tk.call(self._w, 'chdir', dir)
class DirTree(TixWidget):
"""DirTree - Directory Listing in a hierarchical view.
Displays a tree view of a directory, its previous directories and its
sub-directories. The user can choose one of the directories displayed
in the list or change to another directory.
Subwidget Class
--------- -----
hlist HList
hsb Scrollbar
vsb Scrollbar"""
# FIXME: It should inherit -superclass tixScrolledHList
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirTree', ['options'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def chdir(self, dir):
self.tk.call(self._w, 'chdir', dir)
class DirSelectBox(TixWidget):
"""DirSelectBox - Motif style file select box.
It is generally used for
the user to choose a file. FileSelectBox stores the files mostly
recently selected into a ComboBox widget so that they can be quickly
selected again.
Subwidget Class
--------- -----
selection ComboBox
filter ComboBox
dirlist ScrolledListBox
filelist ScrolledListBox"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirSelectBox', ['options'], cnf, kw)
self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx')
class ExFileSelectBox(TixWidget):
"""ExFileSelectBox - MS Windows style file select box.
It provides an convenient method for the user to select files.
Subwidget Class
--------- -----
cancel Button
ok Button
hidden Checkbutton
types ComboBox
dir ComboBox
file ComboBox
dirlist ScrolledListBox
filelist ScrolledListBox"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixExFileSelectBox', ['options'], cnf, kw)
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden')
self.subwidget_list['types'] = _dummyComboBox(self, 'types')
self.subwidget_list['dir'] = _dummyComboBox(self, 'dir')
self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
self.subwidget_list['file'] = _dummyComboBox(self, 'file')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
def filter(self):
self.tk.call(self._w, 'filter')
def invoke(self):
self.tk.call(self._w, 'invoke')
# Should inherit from a Dialog class
class DirSelectDialog(TixWidget):
"""The DirSelectDialog widget presents the directories in the file
system in a dialog window. The user can use this dialog window to
navigate through the file system to select the desired directory.
Subwidgets Class
---------- -----
dirbox DirSelectDialog"""
# FIXME: It should inherit -superclass tixDialogShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixDirSelectDialog',
['options'], cnf, kw)
self.subwidget_list['dirbox'] = _dummyDirSelectBox(self, 'dirbox')
# cancel and ok buttons are missing
def popup(self):
self.tk.call(self._w, 'popup')
def popdown(self):
self.tk.call(self._w, 'popdown')
# Should inherit from a Dialog class
class ExFileSelectDialog(TixWidget):
"""ExFileSelectDialog - MS Windows style file select dialog.
It provides an convenient method for the user to select files.
Subwidgets Class
---------- -----
fsbox ExFileSelectBox"""
# FIXME: It should inherit -superclass tixDialogShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixExFileSelectDialog',
['options'], cnf, kw)
self.subwidget_list['fsbox'] = _dummyExFileSelectBox(self, 'fsbox')
def popup(self):
self.tk.call(self._w, 'popup')
def popdown(self):
self.tk.call(self._w, 'popdown')
class FileSelectBox(TixWidget):
"""ExFileSelectBox - Motif style file select box.
It is generally used for
the user to choose a file. FileSelectBox stores the files mostly
recently selected into a ComboBox widget so that they can be quickly
selected again.
Subwidget Class
--------- -----
selection ComboBox
filter ComboBox
dirlist ScrolledListBox
filelist ScrolledListBox"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixFileSelectBox', ['options'], cnf, kw)
self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
self.subwidget_list['filter'] = _dummyComboBox(self, 'filter')
self.subwidget_list['selection'] = _dummyComboBox(self, 'selection')
def apply_filter(self): # name of subwidget is same as command
self.tk.call(self._w, 'filter')
def invoke(self):
self.tk.call(self._w, 'invoke')
# Should inherit from a Dialog class
class FileSelectDialog(TixWidget):
"""FileSelectDialog - Motif style file select dialog.
Subwidgets Class
---------- -----
btns StdButtonBox
fsbox FileSelectBox"""
# FIXME: It should inherit -superclass tixStdDialogShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixFileSelectDialog',
['options'], cnf, kw)
self.subwidget_list['btns'] = _dummyStdButtonBox(self, 'btns')
self.subwidget_list['fsbox'] = _dummyFileSelectBox(self, 'fsbox')
def popup(self):
self.tk.call(self._w, 'popup')
def popdown(self):
self.tk.call(self._w, 'popdown')
class FileEntry(TixWidget):
"""FileEntry - Entry field with button that invokes a FileSelectDialog.
The user can type in the filename manually. Alternatively, the user can
press the button widget that sits next to the entry, which will bring
up a file selection dialog.
Subwidgets Class
---------- -----
button Button
entry Entry"""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixFileEntry',
['dialogtype', 'options'], cnf, kw)
self.subwidget_list['button'] = _dummyButton(self, 'button')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
def invoke(self):
self.tk.call(self._w, 'invoke')
def file_dialog(self):
# FIXME: return python object
pass
class HList(TixWidget, XView, YView):
"""HList - Hierarchy display widget can be used to display any data
that have a hierarchical structure, for example, file system directory
trees. The list entries are indented and connected by branch lines
according to their places in the hierachy.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixHList',
['columns', 'options'], cnf, kw)
def add(self, entry, cnf={}, **kw):
return self.tk.call(self._w, 'add', entry, *self._options(cnf, kw))
def add_child(self, parent=None, cnf={}, **kw):
if not parent:
parent = ''
return self.tk.call(
self._w, 'addchild', parent, *self._options(cnf, kw))
def anchor_set(self, entry):
self.tk.call(self._w, 'anchor', 'set', entry)
def anchor_clear(self):
self.tk.call(self._w, 'anchor', 'clear')
def column_width(self, col=0, width=None, chars=None):
if not chars:
return self.tk.call(self._w, 'column', 'width', col, width)
else:
return self.tk.call(self._w, 'column', 'width', col,
'-char', chars)
def delete_all(self):
self.tk.call(self._w, 'delete', 'all')
def delete_entry(self, entry):
self.tk.call(self._w, 'delete', 'entry', entry)
def delete_offsprings(self, entry):
self.tk.call(self._w, 'delete', 'offsprings', entry)
def delete_siblings(self, entry):
self.tk.call(self._w, 'delete', 'siblings', entry)
def dragsite_set(self, index):
self.tk.call(self._w, 'dragsite', 'set', index)
def dragsite_clear(self):
self.tk.call(self._w, 'dragsite', 'clear')
def dropsite_set(self, index):
self.tk.call(self._w, 'dropsite', 'set', index)
def dropsite_clear(self):
self.tk.call(self._w, 'dropsite', 'clear')
def header_create(self, col, cnf={}, **kw):
self.tk.call(self._w, 'header', 'create', col, *self._options(cnf, kw))
def header_configure(self, col, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'header', 'configure', col)))
self.tk.call(self._w, 'header', 'configure', col,
*self._options(cnf, kw))
def header_cget(self, col, opt):
return self.tk.call(self._w, 'header', 'cget', col, opt)
def header_exists(self, col):
return self.tk.call(self._w, 'header', 'exists', col)
def header_delete(self, col):
self.tk.call(self._w, 'header', 'delete', col)
def header_size(self, col):
return self.tk.call(self._w, 'header', 'size', col)
def hide_entry(self, entry):
self.tk.call(self._w, 'hide', 'entry', entry)
def indicator_create(self, entry, cnf={}, **kw):
self.tk.call(
self._w, 'indicator', 'create', entry, *self._options(cnf, kw))
def indicator_configure(self, entry, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'indicator', 'configure', entry)))
self.tk.call(
self._w, 'indicator', 'configure', entry, *self._options(cnf, kw))
def indicator_cget(self, entry, opt):
return self.tk.call(self._w, 'indicator', 'cget', entry, opt)
def indicator_exists(self, entry):
return self.tk.call (self._w, 'indicator', 'exists', entry)
def indicator_delete(self, entry):
self.tk.call(self._w, 'indicator', 'delete', entry)
def indicator_size(self, entry):
return self.tk.call(self._w, 'indicator', 'size', entry)
def info_anchor(self):
return self.tk.call(self._w, 'info', 'anchor')
def info_bbox(self, entry):
return self._getints(
self.tk.call(self._w, 'info', 'bbox', entry)) or None
def info_children(self, entry=None):
c = self.tk.call(self._w, 'info', 'children', entry)
return self.tk.splitlist(c)
def info_data(self, entry):
return self.tk.call(self._w, 'info', 'data', entry)
def info_dragsite(self):
return self.tk.call(self._w, 'info', 'dragsite')
def info_dropsite(self):
return self.tk.call(self._w, 'info', 'dropsite')
def info_exists(self, entry):
return self.tk.call(self._w, 'info', 'exists', entry)
def info_hidden(self, entry):
return self.tk.call(self._w, 'info', 'hidden', entry)
def info_next(self, entry):
return self.tk.call(self._w, 'info', 'next', entry)
def info_parent(self, entry):
return self.tk.call(self._w, 'info', 'parent', entry)
def info_prev(self, entry):
return self.tk.call(self._w, 'info', 'prev', entry)
def info_selection(self):
c = self.tk.call(self._w, 'info', 'selection')
return self.tk.splitlist(c)
def item_cget(self, entry, col, opt):
return self.tk.call(self._w, 'item', 'cget', entry, col, opt)
def item_configure(self, entry, col, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'item', 'configure', entry, col)))
self.tk.call(self._w, 'item', 'configure', entry, col,
*self._options(cnf, kw))
def item_create(self, entry, col, cnf={}, **kw):
self.tk.call(
self._w, 'item', 'create', entry, col, *self._options(cnf, kw))
def item_exists(self, entry, col):
return self.tk.call(self._w, 'item', 'exists', entry, col)
def item_delete(self, entry, col):
self.tk.call(self._w, 'item', 'delete', entry, col)
def entrycget(self, entry, opt):
return self.tk.call(self._w, 'entrycget', entry, opt)
def entryconfigure(self, entry, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'entryconfigure', entry)))
self.tk.call(self._w, 'entryconfigure', entry,
*self._options(cnf, kw))
def nearest(self, y):
return self.tk.call(self._w, 'nearest', y)
def see(self, entry):
self.tk.call(self._w, 'see', entry)
def selection_clear(self, cnf={}, **kw):
self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw))
def selection_includes(self, entry):
return self.tk.call(self._w, 'selection', 'includes', entry)
def selection_set(self, first, last=None):
self.tk.call(self._w, 'selection', 'set', first, last)
def show_entry(self, entry):
return self.tk.call(self._w, 'show', 'entry', entry)
class InputOnly(TixWidget):
"""InputOnly - Invisible widget. Unix only.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixInputOnly', None, cnf, kw)
class LabelEntry(TixWidget):
"""LabelEntry - Entry field with label. Packages an entry widget
and a label into one mega widget. It can beused be used to simplify
the creation of ``entry-form'' type of interface.
Subwidgets Class
---------- -----
label Label
entry Entry"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixLabelEntry',
['labelside','options'], cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
class LabelFrame(TixWidget):
"""LabelFrame - Labelled Frame container. Packages a frame widget
and a label into one mega widget. To create widgets inside a
LabelFrame widget, one creates the new widgets relative to the
frame subwidget and manage them inside the frame subwidget.
Subwidgets Class
---------- -----
label Label
frame Frame"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixLabelFrame',
['labelside','options'], cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['frame'] = _dummyFrame(self, 'frame')
class ListNoteBook(TixWidget):
"""A ListNoteBook widget is very similar to the TixNoteBook widget:
it can be used to display many windows in a limited space using a
notebook metaphor. The notebook is divided into a stack of pages
(windows). At one time only one of these pages can be shown.
The user can navigate through these pages by
choosing the name of the desired page in the hlist subwidget."""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixListNoteBook', ['options'], cnf, kw)
# Is this necessary? It's not an exposed subwidget in Tix.
self.subwidget_list['pane'] = _dummyPanedWindow(self, 'pane',
destroy_physically=0)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['shlist'] = _dummyScrolledHList(self, 'shlist')
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = TixSubWidget(self, name)
return self.subwidget_list[name]
def page(self, name):
return self.subwidget(name)
def pages(self):
# Can't call subwidgets_all directly because we don't want .nbframe
names = self.tk.split(self.tk.call(self._w, 'pages'))
ret = []
for x in names:
ret.append(self.subwidget(x))
return ret
def raise_page(self, name): # raise is a python keyword
self.tk.call(self._w, 'raise', name)
class Meter(TixWidget):
"""The Meter widget can be used to show the progress of a background
job which may take a long time to execute.
"""
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixMeter',
['options'], cnf, kw)
class NoteBook(TixWidget):
"""NoteBook - Multi-page container widget (tabbed notebook metaphor).
Subwidgets Class
---------- -----
nbframe NoteBookFrame
<pages> page widgets added dynamically with the add method"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self,master,'tixNoteBook', ['options'], cnf, kw)
self.subwidget_list['nbframe'] = TixSubWidget(self, 'nbframe',
destroy_physically=0)
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = TixSubWidget(self, name)
return self.subwidget_list[name]
def delete(self, name):
self.tk.call(self._w, 'delete', name)
self.subwidget_list[name].destroy()
del self.subwidget_list[name]
def page(self, name):
return self.subwidget(name)
def pages(self):
# Can't call subwidgets_all directly because we don't want .nbframe
names = self.tk.split(self.tk.call(self._w, 'pages'))
ret = []
for x in names:
ret.append(self.subwidget(x))
return ret
def raise_page(self, name): # raise is a python keyword
self.tk.call(self._w, 'raise', name)
def raised(self):
return self.tk.call(self._w, 'raised')
class NoteBookFrame(TixWidget):
# FIXME: This is dangerous to expose to be called on its own.
pass
class OptionMenu(TixWidget):
"""OptionMenu - creates a menu button of options.
Subwidget Class
--------- -----
menubutton Menubutton
menu Menu"""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixOptionMenu',
['labelside', 'options'], cnf, kw)
self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton')
self.subwidget_list['menu'] = _dummyMenu(self, 'menu')
def add_command(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', 'command', name, *self._options(cnf, kw))
def add_separator(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', 'separator', name, *self._options(cnf, kw))
def delete(self, name):
self.tk.call(self._w, 'delete', name)
def disable(self, name):
self.tk.call(self._w, 'disable', name)
def enable(self, name):
self.tk.call(self._w, 'enable', name)
class PanedWindow(TixWidget):
"""PanedWindow - Multi-pane container widget
allows the user to interactively manipulate the sizes of several
panes. The panes can be arranged either vertically or horizontally.The
user changes the sizes of the panes by dragging the resize handle
between two panes.
Subwidgets Class
---------- -----
<panes> g/p widgets added dynamically with the add method."""
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixPanedWindow', ['orientation', 'options'], cnf, kw)
# add delete forget panecget paneconfigure panes setsize
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = TixSubWidget(self, name,
check_intermediate=0)
return self.subwidget_list[name]
def delete(self, name):
self.tk.call(self._w, 'delete', name)
self.subwidget_list[name].destroy()
del self.subwidget_list[name]
def forget(self, name):
self.tk.call(self._w, 'forget', name)
def panecget(self, entry, opt):
return self.tk.call(self._w, 'panecget', entry, opt)
def paneconfigure(self, entry, cnf={}, **kw):
if cnf is None:
return _lst2dict(
self.tk.split(
self.tk.call(self._w, 'paneconfigure', entry)))
self.tk.call(self._w, 'paneconfigure', entry, *self._options(cnf, kw))
def panes(self):
names = self.tk.splitlist(self.tk.call(self._w, 'panes'))
return [self.subwidget(x) for x in names]
class PopupMenu(TixWidget):
"""PopupMenu widget can be used as a replacement of the tk_popup command.
The advantage of the Tix PopupMenu widget is it requires less application
code to manipulate.
Subwidgets Class
---------- -----
menubutton Menubutton
menu Menu"""
# FIXME: It should inherit -superclass tixShell
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixPopupMenu', ['options'], cnf, kw)
self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton')
self.subwidget_list['menu'] = _dummyMenu(self, 'menu')
def bind_widget(self, widget):
self.tk.call(self._w, 'bind', widget._w)
def unbind_widget(self, widget):
self.tk.call(self._w, 'unbind', widget._w)
def post_widget(self, widget, x, y):
self.tk.call(self._w, 'post', widget._w, x, y)
class ResizeHandle(TixWidget):
"""Internal widget to draw resize handles on Scrolled widgets."""
def __init__(self, master, cnf={}, **kw):
# There seems to be a Tix bug rejecting the configure method
# Let's try making the flags -static
flags = ['options', 'command', 'cursorfg', 'cursorbg',
'handlesize', 'hintcolor', 'hintwidth',
'x', 'y']
# In fact, x y height width are configurable
TixWidget.__init__(self, master, 'tixResizeHandle',
flags, cnf, kw)
def attach_widget(self, widget):
self.tk.call(self._w, 'attachwidget', widget._w)
def detach_widget(self, widget):
self.tk.call(self._w, 'detachwidget', widget._w)
def hide(self, widget):
self.tk.call(self._w, 'hide', widget._w)
def show(self, widget):
self.tk.call(self._w, 'show', widget._w)
class ScrolledHList(TixWidget):
"""ScrolledHList - HList with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledHList', ['options'],
cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledListBox(TixWidget):
"""ScrolledListBox - Listbox with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledListBox', ['options'], cnf, kw)
self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledText(TixWidget):
"""ScrolledText - Text with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledText', ['options'], cnf, kw)
self.subwidget_list['text'] = _dummyText(self, 'text')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledTList(TixWidget):
"""ScrolledTList - TList with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledTList', ['options'],
cnf, kw)
self.subwidget_list['tlist'] = _dummyTList(self, 'tlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class ScrolledWindow(TixWidget):
"""ScrolledWindow - Window with automatic scrollbars."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixScrolledWindow', ['options'], cnf, kw)
self.subwidget_list['window'] = _dummyFrame(self, 'window')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class Select(TixWidget):
"""Select - Container of button subwidgets. It can be used to provide
radio-box or check-box style of selection options for the user.
Subwidgets are buttons added dynamically using the add method."""
# FIXME: It should inherit -superclass tixLabelWidget
def __init__(self, master, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixSelect',
['allowzero', 'radio', 'orientation', 'labelside',
'options'],
cnf, kw)
self.subwidget_list['label'] = _dummyLabel(self, 'label')
def add(self, name, cnf={}, **kw):
self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
self.subwidget_list[name] = _dummyButton(self, name)
return self.subwidget_list[name]
def invoke(self, name):
self.tk.call(self._w, 'invoke', name)
class Shell(TixWidget):
"""Toplevel window.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixShell', ['options', 'title'], cnf, kw)
class DialogShell(TixWidget):
"""Toplevel window, with popup popdown and center methods.
It tells the window manager that it is a dialog window and should be
treated specially. The exact treatment depends on the treatment of
the window manager.
Subwidgets - None"""
# FIXME: It should inherit from Shell
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master,
'tixDialogShell',
['options', 'title', 'mapped',
'minheight', 'minwidth',
'parent', 'transient'], cnf, kw)
def popdown(self):
self.tk.call(self._w, 'popdown')
def popup(self):
self.tk.call(self._w, 'popup')
def center(self):
self.tk.call(self._w, 'center')
class StdButtonBox(TixWidget):
"""StdButtonBox - Standard Button Box (OK, Apply, Cancel and Help) """
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixStdButtonBox',
['orientation', 'options'], cnf, kw)
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['apply'] = _dummyButton(self, 'apply')
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['help'] = _dummyButton(self, 'help')
def invoke(self, name):
if name in self.subwidget_list:
self.tk.call(self._w, 'invoke', name)
class TList(TixWidget, XView, YView):
"""TList - Hierarchy display widget which can be
used to display data in a tabular format. The list entries of a TList
widget are similar to the entries in the Tk listbox widget. The main
differences are (1) the TList widget can display the list entries in a
two dimensional format and (2) you can use graphical images as well as
multiple colors and fonts for the list entries.
Subwidgets - None"""
def __init__ (self,master=None,cnf={}, **kw):
TixWidget.__init__(self, master, 'tixTList', ['options'], cnf, kw)
def active_set(self, index):
self.tk.call(self._w, 'active', 'set', index)
def active_clear(self):
self.tk.call(self._w, 'active', 'clear')
def anchor_set(self, index):
self.tk.call(self._w, 'anchor', 'set', index)
def anchor_clear(self):
self.tk.call(self._w, 'anchor', 'clear')
def delete(self, from_, to=None):
self.tk.call(self._w, 'delete', from_, to)
def dragsite_set(self, index):
self.tk.call(self._w, 'dragsite', 'set', index)
def dragsite_clear(self):
self.tk.call(self._w, 'dragsite', 'clear')
def dropsite_set(self, index):
self.tk.call(self._w, 'dropsite', 'set', index)
def dropsite_clear(self):
self.tk.call(self._w, 'dropsite', 'clear')
def insert(self, index, cnf={}, **kw):
self.tk.call(self._w, 'insert', index, *self._options(cnf, kw))
def info_active(self):
return self.tk.call(self._w, 'info', 'active')
def info_anchor(self):
return self.tk.call(self._w, 'info', 'anchor')
def info_down(self, index):
return self.tk.call(self._w, 'info', 'down', index)
def info_left(self, index):
return self.tk.call(self._w, 'info', 'left', index)
def info_right(self, index):
return self.tk.call(self._w, 'info', 'right', index)
def info_selection(self):
c = self.tk.call(self._w, 'info', 'selection')
return self.tk.splitlist(c)
def info_size(self):
return self.tk.call(self._w, 'info', 'size')
def info_up(self, index):
return self.tk.call(self._w, 'info', 'up', index)
def nearest(self, x, y):
return self.tk.call(self._w, 'nearest', x, y)
def see(self, index):
self.tk.call(self._w, 'see', index)
def selection_clear(self, cnf={}, **kw):
self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw))
def selection_includes(self, index):
return self.tk.call(self._w, 'selection', 'includes', index)
def selection_set(self, first, last=None):
self.tk.call(self._w, 'selection', 'set', first, last)
class Tree(TixWidget):
"""Tree - The tixTree widget can be used to display hierachical
data in a tree form. The user can adjust
the view of the tree by opening or closing parts of the tree."""
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixTree',
['options'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def autosetmode(self):
'''This command calls the setmode method for all the entries in this
Tree widget: if an entry has no child entries, its mode is set to
none. Otherwise, if the entry has any hidden child entries, its mode is
set to open; otherwise its mode is set to close.'''
self.tk.call(self._w, 'autosetmode')
def close(self, entrypath):
'''Close the entry given by entryPath if its mode is close.'''
self.tk.call(self._w, 'close', entrypath)
def getmode(self, entrypath):
'''Returns the current mode of the entry given by entryPath.'''
return self.tk.call(self._w, 'getmode', entrypath)
def open(self, entrypath):
'''Open the entry given by entryPath if its mode is open.'''
self.tk.call(self._w, 'open', entrypath)
def setmode(self, entrypath, mode='none'):
'''This command is used to indicate whether the entry given by
entryPath has children entries and whether the children are visible. mode
must be one of open, close or none. If mode is set to open, a (+)
indicator is drawn next to the entry. If mode is set to close, a (-)
indicator is drawn next to the entry. If mode is set to none, no
indicators will be drawn for this entry. The default mode is none. The
open mode indicates the entry has hidden children and this entry can be
opened by the user. The close mode indicates that all the children of the
entry are now visible and the entry can be closed by the user.'''
self.tk.call(self._w, 'setmode', entrypath, mode)
# Could try subclassing Tree for CheckList - would need another arg to init
class CheckList(TixWidget):
"""The CheckList widget
displays a list of items to be selected by the user. CheckList acts
similarly to the Tk checkbutton or radiobutton widgets, except it is
capable of handling many more items than checkbuttons or radiobuttons.
"""
# FIXME: It should inherit -superclass tixTree
def __init__(self, master=None, cnf={}, **kw):
TixWidget.__init__(self, master, 'tixCheckList',
['options', 'radio'], cnf, kw)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
def autosetmode(self):
'''This command calls the setmode method for all the entries in this
Tree widget: if an entry has no child entries, its mode is set to
none. Otherwise, if the entry has any hidden child entries, its mode is
set to open; otherwise its mode is set to close.'''
self.tk.call(self._w, 'autosetmode')
def close(self, entrypath):
'''Close the entry given by entryPath if its mode is close.'''
self.tk.call(self._w, 'close', entrypath)
def getmode(self, entrypath):
'''Returns the current mode of the entry given by entryPath.'''
return self.tk.call(self._w, 'getmode', entrypath)
def open(self, entrypath):
'''Open the entry given by entryPath if its mode is open.'''
self.tk.call(self._w, 'open', entrypath)
def getselection(self, mode='on'):
'''Returns a list of items whose status matches status. If status is
not specified, the list of items in the "on" status will be returned.
Mode can be on, off, default'''
c = self.tk.split(self.tk.call(self._w, 'getselection', mode))
return self.tk.splitlist(c)
def getstatus(self, entrypath):
'''Returns the current status of entryPath.'''
return self.tk.call(self._w, 'getstatus', entrypath)
def setstatus(self, entrypath, mode='on'):
'''Sets the status of entryPath to be status. A bitmap will be
displayed next to the entry its status is on, off or default.'''
self.tk.call(self._w, 'setstatus', entrypath, mode)
###########################################################################
### The subclassing below is used to instantiate the subwidgets in each ###
### mega widget. This allows us to access their methods directly. ###
###########################################################################
class _dummyButton(Button, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyCheckbutton(Checkbutton, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyEntry(Entry, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyFrame(Frame, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyLabel(Label, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyListbox(Listbox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyMenu(Menu, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyMenubutton(Menubutton, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyScrollbar(Scrollbar, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyText(Text, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyScrolledListBox(ScrolledListBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class _dummyHList(HList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyScrolledHList(ScrolledHList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class _dummyTList(TList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyComboBox(ComboBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, ['fancy',destroy_physically])
self.subwidget_list['label'] = _dummyLabel(self, 'label')
self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
self.subwidget_list['arrow'] = _dummyButton(self, 'arrow')
self.subwidget_list['slistbox'] = _dummyScrolledListBox(self,
'slistbox')
try:
self.subwidget_list['tick'] = _dummyButton(self, 'tick')
#cross Button : present if created with the fancy option
self.subwidget_list['cross'] = _dummyButton(self, 'cross')
except TypeError:
# unavailable when -fancy not specified
pass
class _dummyDirList(DirList, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
class _dummyDirSelectBox(DirSelectBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx')
class _dummyExFileSelectBox(ExFileSelectBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden')
self.subwidget_list['types'] = _dummyComboBox(self, 'types')
self.subwidget_list['dir'] = _dummyComboBox(self, 'dir')
self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
self.subwidget_list['file'] = _dummyComboBox(self, 'file')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
class _dummyFileSelectBox(FileSelectBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
self.subwidget_list['filter'] = _dummyComboBox(self, 'filter')
self.subwidget_list['selection'] = _dummyComboBox(self, 'selection')
class _dummyFileComboBox(ComboBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['dircbx'] = _dummyComboBox(self, 'dircbx')
class _dummyStdButtonBox(StdButtonBox, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
self.subwidget_list['ok'] = _dummyButton(self, 'ok')
self.subwidget_list['apply'] = _dummyButton(self, 'apply')
self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
self.subwidget_list['help'] = _dummyButton(self, 'help')
class _dummyNoteBookFrame(NoteBookFrame, TixSubWidget):
def __init__(self, master, name, destroy_physically=0):
TixSubWidget.__init__(self, master, name, destroy_physically)
class _dummyPanedWindow(PanedWindow, TixSubWidget):
def __init__(self, master, name, destroy_physically=1):
TixSubWidget.__init__(self, master, name, destroy_physically)
########################
### Utility Routines ###
########################
#mike Should tixDestroy be exposed as a wrapper? - but not for widgets.
def OptionName(widget):
'''Returns the qualified path name for the widget. Normally used to set
default options for subwidgets. See tixwidgets.py'''
return widget.tk.call('tixOptionName', widget._w)
# Called with a dictionary argument of the form
# {'*.c':'C source files', '*.txt':'Text Files', '*':'All files'}
# returns a string which can be used to configure the fsbox file types
# in an ExFileSelectBox. i.e.,
# '{{*} {* - All files}} {{*.c} {*.c - C source files}} {{*.txt} {*.txt - Text Files}}'
def FileTypeList(dict):
s = ''
for type in dict.keys():
s = s + '{{' + type + '} {' + type + ' - ' + dict[type] + '}} '
return s
# Still to be done:
# tixIconView
class CObjView(TixWidget):
"""This file implements the Canvas Object View widget. This is a base
class of IconView. It implements automatic placement/adjustment of the
scrollbars according to the canvas objects inside the canvas subwidget.
The scrollbars are adjusted so that the canvas is just large enough
to see all the objects.
"""
# FIXME: It should inherit -superclass tixScrolledWidget
pass
class Grid(TixWidget, XView, YView):
'''The Tix Grid command creates a new window and makes it into a
tixGrid widget. Additional options, may be specified on the command
line or in the option database to configure aspects such as its cursor
and relief.
A Grid widget displays its contents in a two dimensional grid of cells.
Each cell may contain one Tix display item, which may be in text,
graphics or other formats. See the DisplayStyle class for more information
about Tix display items. Individual cells, or groups of cells, can be
formatted with a wide range of attributes, such as its color, relief and
border.
Subwidgets - None'''
# valid specific resources as of Tk 8.4
# editdonecmd, editnotifycmd, floatingcols, floatingrows, formatcmd,
# highlightbackground, highlightcolor, leftmargin, itemtype, selectmode,
# selectunit, topmargin,
def __init__(self, master=None, cnf={}, **kw):
static= []
self.cnf= cnf
TixWidget.__init__(self, master, 'tixGrid', static, cnf, kw)
# valid options as of Tk 8.4
# anchor, bdtype, cget, configure, delete, dragsite, dropsite, entrycget,
# edit, entryconfigure, format, geometryinfo, info, index, move, nearest,
# selection, set, size, unset, xview, yview
def anchor_clear(self):
"""Removes the selection anchor."""
self.tk.call(self, 'anchor', 'clear')
def anchor_get(self):
"Get the (x,y) coordinate of the current anchor cell"
return self._getints(self.tk.call(self, 'anchor', 'get'))
def anchor_set(self, x, y):
"""Set the selection anchor to the cell at (x, y)."""
self.tk.call(self, 'anchor', 'set', x, y)
def delete_row(self, from_, to=None):
"""Delete rows between from_ and to inclusive.
If to is not provided, delete only row at from_"""
if to is None:
self.tk.call(self, 'delete', 'row', from_)
else:
self.tk.call(self, 'delete', 'row', from_, to)
def delete_column(self, from_, to=None):
"""Delete columns between from_ and to inclusive.
If to is not provided, delete only column at from_"""
if to is None:
self.tk.call(self, 'delete', 'column', from_)
else:
self.tk.call(self, 'delete', 'column', from_, to)
def edit_apply(self):
"""If any cell is being edited, de-highlight the cell and applies
the changes."""
self.tk.call(self, 'edit', 'apply')
def edit_set(self, x, y):
"""Highlights the cell at (x, y) for editing, if the -editnotify
command returns True for this cell."""
self.tk.call(self, 'edit', 'set', x, y)
def entrycget(self, x, y, option):
"Get the option value for cell at (x,y)"
if option and option[0] != '-':
option = '-' + option
return self.tk.call(self, 'entrycget', x, y, option)
def entryconfigure(self, x, y, cnf=None, **kw):
return self._configure(('entryconfigure', x, y), cnf, kw)
# def format
# def index
def info_exists(self, x, y):
"Return True if display item exists at (x,y)"
return self._getboolean(self.tk.call(self, 'info', 'exists', x, y))
def info_bbox(self, x, y):
# This seems to always return '', at least for 'text' displayitems
return self.tk.call(self, 'info', 'bbox', x, y)
def move_column(self, from_, to, offset):
"""Moves the the range of columns from position FROM through TO by
the distance indicated by OFFSET. For example, move_column(2, 4, 1)
moves the columns 2,3,4 to columns 3,4,5."""
self.tk.call(self, 'move', 'column', from_, to, offset)
def move_row(self, from_, to, offset):
"""Moves the the range of rows from position FROM through TO by
the distance indicated by OFFSET.
For example, move_row(2, 4, 1) moves the rows 2,3,4 to rows 3,4,5."""
self.tk.call(self, 'move', 'row', from_, to, offset)
def nearest(self, x, y):
"Return coordinate of cell nearest pixel coordinate (x,y)"
return self._getints(self.tk.call(self, 'nearest', x, y))
# def selection adjust
# def selection clear
# def selection includes
# def selection set
# def selection toggle
def set(self, x, y, itemtype=None, **kw):
args= self._options(self.cnf, kw)
if itemtype is not None:
args= ('-itemtype', itemtype) + args
self.tk.call(self, 'set', x, y, *args)
def size_column(self, index, **kw):
"""Queries or sets the size of the column given by
INDEX. INDEX may be any non-negative
integer that gives the position of a given column.
INDEX can also be the string "default"; in this case, this command
queries or sets the default size of all columns.
When no option-value pair is given, this command returns a tuple
containing the current size setting of the given column. When
option-value pairs are given, the corresponding options of the
size setting of the given column are changed. Options may be one
of the follwing:
pad0 pixels
Specifies the paddings to the left of a column.
pad1 pixels
Specifies the paddings to the right of a column.
size val
Specifies the width of a column .
Val may be: "auto" -- the width of the column is set the
the widest cell in the column; a valid Tk screen distance
unit; or a real number following by the word chars
(e.g. 3.4chars) that sets the width of the column to the
given number of characters."""
return self.tk.split(self.tk.call(self._w, 'size', 'column', index,
*self._options({}, kw)))
def size_row(self, index, **kw):
"""Queries or sets the size of the row given by
INDEX. INDEX may be any non-negative
integer that gives the position of a given row .
INDEX can also be the string "default"; in this case, this command
queries or sets the default size of all rows.
When no option-value pair is given, this command returns a list con-
taining the current size setting of the given row . When option-value
pairs are given, the corresponding options of the size setting of the
given row are changed. Options may be one of the follwing:
pad0 pixels
Specifies the paddings to the top of a row.
pad1 pixels
Specifies the paddings to the the bottom of a row.
size val
Specifies the height of a row.
Val may be: "auto" -- the height of the row is set the
the highest cell in the row; a valid Tk screen distance
unit; or a real number following by the word chars
(e.g. 3.4chars) that sets the height of the row to the
given number of characters."""
return self.tk.split(self.tk.call(
self, 'size', 'row', index, *self._options({}, kw)))
def unset(self, x, y):
"""Clears the cell at (x, y) by removing its display item."""
self.tk.call(self._w, 'unset', x, y)
class ScrolledGrid(Grid):
'''Scrolled Grid widgets'''
# FIXME: It should inherit -superclass tixScrolledWidget
def __init__(self, master=None, cnf={}, **kw):
static= []
self.cnf= cnf
TixWidget.__init__(self, master, 'tixScrolledGrid', static, cnf, kw)
| Python |
"""A ScrolledText widget feels like a text widget but also has a
vertical scroll bar on its right. (Later, options may be added to
add a horizontal bar as well, to make the bars disappear
automatically when not needed, to move them to the other side of the
window, etc.)
Configuration options are passed to the Text widget.
A Frame widget is inserted between the master and the text, to hold
the Scrollbar widget.
Most methods calls are inherited from the Text widget; Pack, Grid and
Place methods are redirected to the Frame widget however.
"""
__all__ = ['ScrolledText']
from Tkinter import Frame, Text, Scrollbar, Pack, Grid, Place
from Tkconstants import RIGHT, LEFT, Y, BOTH
class ScrolledText(Text):
def __init__(self, master=None, **kw):
self.frame = Frame(master)
self.vbar = Scrollbar(self.frame)
self.vbar.pack(side=RIGHT, fill=Y)
kw.update({'yscrollcommand': self.vbar.set})
Text.__init__(self, self.frame, **kw)
self.pack(side=LEFT, fill=BOTH, expand=True)
self.vbar['command'] = self.yview
# Copy geometry methods of self.frame without overriding Text
# methods -- hack!
text_meths = vars(Text).keys()
methods = vars(Pack).keys() + vars(Grid).keys() + vars(Place).keys()
methods = set(methods).difference(text_meths)
for m in methods:
if m[0] != '_' and m != 'config' and m != 'configure':
setattr(self, m, getattr(self.frame, m))
def __str__(self):
return str(self.frame)
def example():
import __main__
from Tkconstants import END
stext = ScrolledText(bg='white', height=10)
stext.insert(END, __main__.__doc__)
stext.pack(fill=BOTH, side=LEFT, expand=True)
stext.focus_set()
stext.mainloop()
if __name__ == "__main__":
example()
| Python |
# Symbolic constants for Tk
# Booleans
NO=FALSE=OFF=0
YES=TRUE=ON=1
# -anchor and -sticky
N='n'
S='s'
W='w'
E='e'
NW='nw'
SW='sw'
NE='ne'
SE='se'
NS='ns'
EW='ew'
NSEW='nsew'
CENTER='center'
# -fill
NONE='none'
X='x'
Y='y'
BOTH='both'
# -side
LEFT='left'
TOP='top'
RIGHT='right'
BOTTOM='bottom'
# -relief
RAISED='raised'
SUNKEN='sunken'
FLAT='flat'
RIDGE='ridge'
GROOVE='groove'
SOLID = 'solid'
# -orient
HORIZONTAL='horizontal'
VERTICAL='vertical'
# -tabs
NUMERIC='numeric'
# -wrap
CHAR='char'
WORD='word'
# -align
BASELINE='baseline'
# -bordermode
INSIDE='inside'
OUTSIDE='outside'
# Special tags, marks and insert positions
SEL='sel'
SEL_FIRST='sel.first'
SEL_LAST='sel.last'
END='end'
INSERT='insert'
CURRENT='current'
ANCHOR='anchor'
ALL='all' # e.g. Canvas.delete(ALL)
# Text widget and button states
NORMAL='normal'
DISABLED='disabled'
ACTIVE='active'
# Canvas state
HIDDEN='hidden'
# Menu item types
CASCADE='cascade'
CHECKBUTTON='checkbutton'
COMMAND='command'
RADIOBUTTON='radiobutton'
SEPARATOR='separator'
# Selection modes for list boxes
SINGLE='single'
BROWSE='browse'
MULTIPLE='multiple'
EXTENDED='extended'
# Activestyle for list boxes
# NONE='none' is also valid
DOTBOX='dotbox'
UNDERLINE='underline'
# Various canvas styles
PIESLICE='pieslice'
CHORD='chord'
ARC='arc'
FIRST='first'
LAST='last'
BUTT='butt'
PROJECTING='projecting'
ROUND='round'
BEVEL='bevel'
MITER='miter'
# Arguments to xview/yview
MOVETO='moveto'
SCROLL='scroll'
UNITS='units'
PAGES='pages'
| Python |
"""Wrapper functions for Tcl/Tk.
Tkinter provides classes which allow the display, positioning and
control of widgets. Toplevel widgets are Tk and Toplevel. Other
widgets are Frame, Label, Entry, Text, Canvas, Button, Radiobutton,
Checkbutton, Scale, Listbox, Scrollbar, OptionMenu, Spinbox
LabelFrame and PanedWindow.
Properties of the widgets are specified with keyword arguments.
Keyword arguments have the same name as the corresponding resource
under Tk.
Widgets are positioned with one of the geometry managers Place, Pack
or Grid. These managers can be called with methods place, pack, grid
available in every Widget.
Actions are bound to events by resources (e.g. keyword argument
command) or with the method bind.
Example (Hello, World):
import Tkinter
from Tkconstants import *
tk = Tkinter.Tk()
frame = Tkinter.Frame(tk, relief=RIDGE, borderwidth=2)
frame.pack(fill=BOTH,expand=1)
label = Tkinter.Label(frame, text="Hello, World")
label.pack(fill=X, expand=1)
button = Tkinter.Button(frame,text="Exit",command=tk.destroy)
button.pack(side=BOTTOM)
tk.mainloop()
"""
__version__ = "$Revision$"
import sys
if sys.platform == "win32":
# Attempt to configure Tcl/Tk without requiring PATH
import FixTk
import _tkinter # If this fails your Python may not be configured for Tk
tkinter = _tkinter # b/w compat for export
TclError = _tkinter.TclError
from types import *
from Tkconstants import *
wantobjects = 1
TkVersion = float(_tkinter.TK_VERSION)
TclVersion = float(_tkinter.TCL_VERSION)
READABLE = _tkinter.READABLE
WRITABLE = _tkinter.WRITABLE
EXCEPTION = _tkinter.EXCEPTION
# These are not always defined, e.g. not on Win32 with Tk 8.0 :-(
try: _tkinter.createfilehandler
except AttributeError: _tkinter.createfilehandler = None
try: _tkinter.deletefilehandler
except AttributeError: _tkinter.deletefilehandler = None
def _flatten(tuple):
"""Internal function."""
res = ()
for item in tuple:
if type(item) in (TupleType, ListType):
res = res + _flatten(item)
elif item is not None:
res = res + (item,)
return res
try: _flatten = _tkinter._flatten
except AttributeError: pass
def _cnfmerge(cnfs):
"""Internal function."""
if type(cnfs) is DictionaryType:
return cnfs
elif type(cnfs) in (NoneType, StringType):
return cnfs
else:
cnf = {}
for c in _flatten(cnfs):
try:
cnf.update(c)
except (AttributeError, TypeError), msg:
print "_cnfmerge: fallback due to:", msg
for k, v in c.items():
cnf[k] = v
return cnf
try: _cnfmerge = _tkinter._cnfmerge
except AttributeError: pass
class Event:
"""Container for the properties of an event.
Instances of this type are generated if one of the following events occurs:
KeyPress, KeyRelease - for keyboard events
ButtonPress, ButtonRelease, Motion, Enter, Leave, MouseWheel - for mouse events
Visibility, Unmap, Map, Expose, FocusIn, FocusOut, Circulate,
Colormap, Gravity, Reparent, Property, Destroy, Activate,
Deactivate - for window events.
If a callback function for one of these events is registered
using bind, bind_all, bind_class, or tag_bind, the callback is
called with an Event as first argument. It will have the
following attributes (in braces are the event types for which
the attribute is valid):
serial - serial number of event
num - mouse button pressed (ButtonPress, ButtonRelease)
focus - whether the window has the focus (Enter, Leave)
height - height of the exposed window (Configure, Expose)
width - width of the exposed window (Configure, Expose)
keycode - keycode of the pressed key (KeyPress, KeyRelease)
state - state of the event as a number (ButtonPress, ButtonRelease,
Enter, KeyPress, KeyRelease,
Leave, Motion)
state - state as a string (Visibility)
time - when the event occurred
x - x-position of the mouse
y - y-position of the mouse
x_root - x-position of the mouse on the screen
(ButtonPress, ButtonRelease, KeyPress, KeyRelease, Motion)
y_root - y-position of the mouse on the screen
(ButtonPress, ButtonRelease, KeyPress, KeyRelease, Motion)
char - pressed character (KeyPress, KeyRelease)
send_event - see X/Windows documentation
keysym - keysym of the event as a string (KeyPress, KeyRelease)
keysym_num - keysym of the event as a number (KeyPress, KeyRelease)
type - type of the event as a number
widget - widget in which the event occurred
delta - delta of wheel movement (MouseWheel)
"""
pass
_support_default_root = 1
_default_root = None
def NoDefaultRoot():
"""Inhibit setting of default root window.
Call this function to inhibit that the first instance of
Tk is used for windows without an explicit parent window.
"""
global _support_default_root
_support_default_root = 0
global _default_root
_default_root = None
del _default_root
def _tkerror(err):
"""Internal function."""
pass
def _exit(code='0'):
"""Internal function. Calling it will throw the exception SystemExit."""
raise SystemExit, code
_varnum = 0
class Variable:
"""Class to define value holders for e.g. buttons.
Subclasses StringVar, IntVar, DoubleVar, BooleanVar are specializations
that constrain the type of the value returned from get()."""
_default = ""
def __init__(self, master=None, value=None, name=None):
"""Construct a variable
MASTER can be given as master widget.
VALUE is an optional value (defaults to "")
NAME is an optional Tcl name (defaults to PY_VARnum).
If NAME matches an existing variable and VALUE is omitted
then the existing value is retained.
"""
global _varnum
if not master:
master = _default_root
self._master = master
self._tk = master.tk
if name:
self._name = name
else:
self._name = 'PY_VAR' + repr(_varnum)
_varnum += 1
if value is not None:
self.set(value)
elif not self._tk.call("info", "exists", self._name):
self.set(self._default)
def __del__(self):
"""Unset the variable in Tcl."""
self._tk.globalunsetvar(self._name)
def __str__(self):
"""Return the name of the variable in Tcl."""
return self._name
def set(self, value):
"""Set the variable to VALUE."""
return self._tk.globalsetvar(self._name, value)
def get(self):
"""Return value of variable."""
return self._tk.globalgetvar(self._name)
def trace_variable(self, mode, callback):
"""Define a trace callback for the variable.
MODE is one of "r", "w", "u" for read, write, undefine.
CALLBACK must be a function which is called when
the variable is read, written or undefined.
Return the name of the callback.
"""
cbname = self._master._register(callback)
self._tk.call("trace", "variable", self._name, mode, cbname)
return cbname
trace = trace_variable
def trace_vdelete(self, mode, cbname):
"""Delete the trace callback for a variable.
MODE is one of "r", "w", "u" for read, write, undefine.
CBNAME is the name of the callback returned from trace_variable or trace.
"""
self._tk.call("trace", "vdelete", self._name, mode, cbname)
self._master.deletecommand(cbname)
def trace_vinfo(self):
"""Return all trace callback information."""
return map(self._tk.split, self._tk.splitlist(
self._tk.call("trace", "vinfo", self._name)))
def __eq__(self, other):
"""Comparison for equality (==).
Note: if the Variable's master matters to behavior
also compare self._master == other._master
"""
return self.__class__.__name__ == other.__class__.__name__ \
and self._name == other._name
class StringVar(Variable):
"""Value holder for strings variables."""
_default = ""
def __init__(self, master=None, value=None, name=None):
"""Construct a string variable.
MASTER can be given as master widget.
VALUE is an optional value (defaults to "")
NAME is an optional Tcl name (defaults to PY_VARnum).
If NAME matches an existing variable and VALUE is omitted
then the existing value is retained.
"""
Variable.__init__(self, master, value, name)
def get(self):
"""Return value of variable as string."""
value = self._tk.globalgetvar(self._name)
if isinstance(value, basestring):
return value
return str(value)
class IntVar(Variable):
"""Value holder for integer variables."""
_default = 0
def __init__(self, master=None, value=None, name=None):
"""Construct an integer variable.
MASTER can be given as master widget.
VALUE is an optional value (defaults to 0)
NAME is an optional Tcl name (defaults to PY_VARnum).
If NAME matches an existing variable and VALUE is omitted
then the existing value is retained.
"""
Variable.__init__(self, master, value, name)
def set(self, value):
"""Set the variable to value, converting booleans to integers."""
if isinstance(value, bool):
value = int(value)
return Variable.set(self, value)
def get(self):
"""Return the value of the variable as an integer."""
return getint(self._tk.globalgetvar(self._name))
class DoubleVar(Variable):
"""Value holder for float variables."""
_default = 0.0
def __init__(self, master=None, value=None, name=None):
"""Construct a float variable.
MASTER can be given as master widget.
VALUE is an optional value (defaults to 0.0)
NAME is an optional Tcl name (defaults to PY_VARnum).
If NAME matches an existing variable and VALUE is omitted
then the existing value is retained.
"""
Variable.__init__(self, master, value, name)
def get(self):
"""Return the value of the variable as a float."""
return getdouble(self._tk.globalgetvar(self._name))
class BooleanVar(Variable):
"""Value holder for boolean variables."""
_default = False
def __init__(self, master=None, value=None, name=None):
"""Construct a boolean variable.
MASTER can be given as master widget.
VALUE is an optional value (defaults to False)
NAME is an optional Tcl name (defaults to PY_VARnum).
If NAME matches an existing variable and VALUE is omitted
then the existing value is retained.
"""
Variable.__init__(self, master, value, name)
def get(self):
"""Return the value of the variable as a bool."""
return self._tk.getboolean(self._tk.globalgetvar(self._name))
def mainloop(n=0):
"""Run the main loop of Tcl."""
_default_root.tk.mainloop(n)
getint = int
getdouble = float
def getboolean(s):
"""Convert true and false to integer values 1 and 0."""
return _default_root.tk.getboolean(s)
# Methods defined on both toplevel and interior widgets
class Misc:
"""Internal class.
Base class which defines methods common for interior widgets."""
# XXX font command?
_tclCommands = None
def destroy(self):
"""Internal function.
Delete all Tcl commands created for
this widget in the Tcl interpreter."""
if self._tclCommands is not None:
for name in self._tclCommands:
#print '- Tkinter: deleted command', name
self.tk.deletecommand(name)
self._tclCommands = None
def deletecommand(self, name):
"""Internal function.
Delete the Tcl command provided in NAME."""
#print '- Tkinter: deleted command', name
self.tk.deletecommand(name)
try:
self._tclCommands.remove(name)
except ValueError:
pass
def tk_strictMotif(self, boolean=None):
"""Set Tcl internal variable, whether the look and feel
should adhere to Motif.
A parameter of 1 means adhere to Motif (e.g. no color
change if mouse passes over slider).
Returns the set value."""
return self.tk.getboolean(self.tk.call(
'set', 'tk_strictMotif', boolean))
def tk_bisque(self):
"""Change the color scheme to light brown as used in Tk 3.6 and before."""
self.tk.call('tk_bisque')
def tk_setPalette(self, *args, **kw):
"""Set a new color scheme for all widget elements.
A single color as argument will cause that all colors of Tk
widget elements are derived from this.
Alternatively several keyword parameters and its associated
colors can be given. The following keywords are valid:
activeBackground, foreground, selectColor,
activeForeground, highlightBackground, selectBackground,
background, highlightColor, selectForeground,
disabledForeground, insertBackground, troughColor."""
self.tk.call(('tk_setPalette',)
+ _flatten(args) + _flatten(kw.items()))
def tk_menuBar(self, *args):
"""Do not use. Needed in Tk 3.6 and earlier."""
pass # obsolete since Tk 4.0
def wait_variable(self, name='PY_VAR'):
"""Wait until the variable is modified.
A parameter of type IntVar, StringVar, DoubleVar or
BooleanVar must be given."""
self.tk.call('tkwait', 'variable', name)
waitvar = wait_variable # XXX b/w compat
def wait_window(self, window=None):
"""Wait until a WIDGET is destroyed.
If no parameter is given self is used."""
if window is None:
window = self
self.tk.call('tkwait', 'window', window._w)
def wait_visibility(self, window=None):
"""Wait until the visibility of a WIDGET changes
(e.g. it appears).
If no parameter is given self is used."""
if window is None:
window = self
self.tk.call('tkwait', 'visibility', window._w)
def setvar(self, name='PY_VAR', value='1'):
"""Set Tcl variable NAME to VALUE."""
self.tk.setvar(name, value)
def getvar(self, name='PY_VAR'):
"""Return value of Tcl variable NAME."""
return self.tk.getvar(name)
getint = int
getdouble = float
def getboolean(self, s):
"""Return a boolean value for Tcl boolean values true and false given as parameter."""
return self.tk.getboolean(s)
def focus_set(self):
"""Direct input focus to this widget.
If the application currently does not have the focus
this widget will get the focus if the application gets
the focus through the window manager."""
self.tk.call('focus', self._w)
focus = focus_set # XXX b/w compat?
def focus_force(self):
"""Direct input focus to this widget even if the
application does not have the focus. Use with
caution!"""
self.tk.call('focus', '-force', self._w)
def focus_get(self):
"""Return the widget which has currently the focus in the
application.
Use focus_displayof to allow working with several
displays. Return None if application does not have
the focus."""
name = self.tk.call('focus')
if name == 'none' or not name: return None
return self._nametowidget(name)
def focus_displayof(self):
"""Return the widget which has currently the focus on the
display where this widget is located.
Return None if the application does not have the focus."""
name = self.tk.call('focus', '-displayof', self._w)
if name == 'none' or not name: return None
return self._nametowidget(name)
def focus_lastfor(self):
"""Return the widget which would have the focus if top level
for this widget gets the focus from the window manager."""
name = self.tk.call('focus', '-lastfor', self._w)
if name == 'none' or not name: return None
return self._nametowidget(name)
def tk_focusFollowsMouse(self):
"""The widget under mouse will get automatically focus. Can not
be disabled easily."""
self.tk.call('tk_focusFollowsMouse')
def tk_focusNext(self):
"""Return the next widget in the focus order which follows
widget which has currently the focus.
The focus order first goes to the next child, then to
the children of the child recursively and then to the
next sibling which is higher in the stacking order. A
widget is omitted if it has the takefocus resource set
to 0."""
name = self.tk.call('tk_focusNext', self._w)
if not name: return None
return self._nametowidget(name)
def tk_focusPrev(self):
"""Return previous widget in the focus order. See tk_focusNext for details."""
name = self.tk.call('tk_focusPrev', self._w)
if not name: return None
return self._nametowidget(name)
def after(self, ms, func=None, *args):
"""Call function once after given time.
MS specifies the time in milliseconds. FUNC gives the
function which shall be called. Additional parameters
are given as parameters to the function call. Return
identifier to cancel scheduling with after_cancel."""
if not func:
# I'd rather use time.sleep(ms*0.001)
self.tk.call('after', ms)
else:
def callit():
try:
func(*args)
finally:
try:
self.deletecommand(name)
except TclError:
pass
name = self._register(callit)
return self.tk.call('after', ms, name)
def after_idle(self, func, *args):
"""Call FUNC once if the Tcl main loop has no event to
process.
Return an identifier to cancel the scheduling with
after_cancel."""
return self.after('idle', func, *args)
def after_cancel(self, id):
"""Cancel scheduling of function identified with ID.
Identifier returned by after or after_idle must be
given as first parameter."""
try:
data = self.tk.call('after', 'info', id)
# In Tk 8.3, splitlist returns: (script, type)
# In Tk 8.4, splitlist may return (script, type) or (script,)
script = self.tk.splitlist(data)[0]
self.deletecommand(script)
except TclError:
pass
self.tk.call('after', 'cancel', id)
def bell(self, displayof=0):
"""Ring a display's bell."""
self.tk.call(('bell',) + self._displayof(displayof))
# Clipboard handling:
def clipboard_get(self, **kw):
"""Retrieve data from the clipboard on window's display.
The window keyword defaults to the root window of the Tkinter
application.
The type keyword specifies the form in which the data is
to be returned and should be an atom name such as STRING
or FILE_NAME. Type defaults to STRING.
This command is equivalent to:
selection_get(CLIPBOARD)
"""
return self.tk.call(('clipboard', 'get') + self._options(kw))
def clipboard_clear(self, **kw):
"""Clear the data in the Tk clipboard.
A widget specified for the optional displayof keyword
argument specifies the target display."""
if 'displayof' not in kw: kw['displayof'] = self._w
self.tk.call(('clipboard', 'clear') + self._options(kw))
def clipboard_append(self, string, **kw):
"""Append STRING to the Tk clipboard.
A widget specified at the optional displayof keyword
argument specifies the target display. The clipboard
can be retrieved with selection_get."""
if 'displayof' not in kw: kw['displayof'] = self._w
self.tk.call(('clipboard', 'append') + self._options(kw)
+ ('--', string))
# XXX grab current w/o window argument
def grab_current(self):
"""Return widget which has currently the grab in this application
or None."""
name = self.tk.call('grab', 'current', self._w)
if not name: return None
return self._nametowidget(name)
def grab_release(self):
"""Release grab for this widget if currently set."""
self.tk.call('grab', 'release', self._w)
def grab_set(self):
"""Set grab for this widget.
A grab directs all events to this and descendant
widgets in the application."""
self.tk.call('grab', 'set', self._w)
def grab_set_global(self):
"""Set global grab for this widget.
A global grab directs all events to this and
descendant widgets on the display. Use with caution -
other applications do not get events anymore."""
self.tk.call('grab', 'set', '-global', self._w)
def grab_status(self):
"""Return None, "local" or "global" if this widget has
no, a local or a global grab."""
status = self.tk.call('grab', 'status', self._w)
if status == 'none': status = None
return status
def option_add(self, pattern, value, priority = None):
"""Set a VALUE (second parameter) for an option
PATTERN (first parameter).
An optional third parameter gives the numeric priority
(defaults to 80)."""
self.tk.call('option', 'add', pattern, value, priority)
def option_clear(self):
"""Clear the option database.
It will be reloaded if option_add is called."""
self.tk.call('option', 'clear')
def option_get(self, name, className):
"""Return the value for an option NAME for this widget
with CLASSNAME.
Values with higher priority override lower values."""
return self.tk.call('option', 'get', self._w, name, className)
def option_readfile(self, fileName, priority = None):
"""Read file FILENAME into the option database.
An optional second parameter gives the numeric
priority."""
self.tk.call('option', 'readfile', fileName, priority)
def selection_clear(self, **kw):
"""Clear the current X selection."""
if 'displayof' not in kw: kw['displayof'] = self._w
self.tk.call(('selection', 'clear') + self._options(kw))
def selection_get(self, **kw):
"""Return the contents of the current X selection.
A keyword parameter selection specifies the name of
the selection and defaults to PRIMARY. A keyword
parameter displayof specifies a widget on the display
to use."""
if 'displayof' not in kw: kw['displayof'] = self._w
return self.tk.call(('selection', 'get') + self._options(kw))
def selection_handle(self, command, **kw):
"""Specify a function COMMAND to call if the X
selection owned by this widget is queried by another
application.
This function must return the contents of the
selection. The function will be called with the
arguments OFFSET and LENGTH which allows the chunking
of very long selections. The following keyword
parameters can be provided:
selection - name of the selection (default PRIMARY),
type - type of the selection (e.g. STRING, FILE_NAME)."""
name = self._register(command)
self.tk.call(('selection', 'handle') + self._options(kw)
+ (self._w, name))
def selection_own(self, **kw):
"""Become owner of X selection.
A keyword parameter selection specifies the name of
the selection (default PRIMARY)."""
self.tk.call(('selection', 'own') +
self._options(kw) + (self._w,))
def selection_own_get(self, **kw):
"""Return owner of X selection.
The following keyword parameter can
be provided:
selection - name of the selection (default PRIMARY),
type - type of the selection (e.g. STRING, FILE_NAME)."""
if 'displayof' not in kw: kw['displayof'] = self._w
name = self.tk.call(('selection', 'own') + self._options(kw))
if not name: return None
return self._nametowidget(name)
def send(self, interp, cmd, *args):
"""Send Tcl command CMD to different interpreter INTERP to be executed."""
return self.tk.call(('send', interp, cmd) + args)
def lower(self, belowThis=None):
"""Lower this widget in the stacking order."""
self.tk.call('lower', self._w, belowThis)
def tkraise(self, aboveThis=None):
"""Raise this widget in the stacking order."""
self.tk.call('raise', self._w, aboveThis)
lift = tkraise
def colormodel(self, value=None):
"""Useless. Not implemented in Tk."""
return self.tk.call('tk', 'colormodel', self._w, value)
def winfo_atom(self, name, displayof=0):
"""Return integer which represents atom NAME."""
args = ('winfo', 'atom') + self._displayof(displayof) + (name,)
return getint(self.tk.call(args))
def winfo_atomname(self, id, displayof=0):
"""Return name of atom with identifier ID."""
args = ('winfo', 'atomname') \
+ self._displayof(displayof) + (id,)
return self.tk.call(args)
def winfo_cells(self):
"""Return number of cells in the colormap for this widget."""
return getint(
self.tk.call('winfo', 'cells', self._w))
def winfo_children(self):
"""Return a list of all widgets which are children of this widget."""
result = []
for child in self.tk.splitlist(
self.tk.call('winfo', 'children', self._w)):
try:
# Tcl sometimes returns extra windows, e.g. for
# menus; those need to be skipped
result.append(self._nametowidget(child))
except KeyError:
pass
return result
def winfo_class(self):
"""Return window class name of this widget."""
return self.tk.call('winfo', 'class', self._w)
def winfo_colormapfull(self):
"""Return true if at the last color request the colormap was full."""
return self.tk.getboolean(
self.tk.call('winfo', 'colormapfull', self._w))
def winfo_containing(self, rootX, rootY, displayof=0):
"""Return the widget which is at the root coordinates ROOTX, ROOTY."""
args = ('winfo', 'containing') \
+ self._displayof(displayof) + (rootX, rootY)
name = self.tk.call(args)
if not name: return None
return self._nametowidget(name)
def winfo_depth(self):
"""Return the number of bits per pixel."""
return getint(self.tk.call('winfo', 'depth', self._w))
def winfo_exists(self):
"""Return true if this widget exists."""
return getint(
self.tk.call('winfo', 'exists', self._w))
def winfo_fpixels(self, number):
"""Return the number of pixels for the given distance NUMBER
(e.g. "3c") as float."""
return getdouble(self.tk.call(
'winfo', 'fpixels', self._w, number))
def winfo_geometry(self):
"""Return geometry string for this widget in the form "widthxheight+X+Y"."""
return self.tk.call('winfo', 'geometry', self._w)
def winfo_height(self):
"""Return height of this widget."""
return getint(
self.tk.call('winfo', 'height', self._w))
def winfo_id(self):
"""Return identifier ID for this widget."""
return self.tk.getint(
self.tk.call('winfo', 'id', self._w))
def winfo_interps(self, displayof=0):
"""Return the name of all Tcl interpreters for this display."""
args = ('winfo', 'interps') + self._displayof(displayof)
return self.tk.splitlist(self.tk.call(args))
def winfo_ismapped(self):
"""Return true if this widget is mapped."""
return getint(
self.tk.call('winfo', 'ismapped', self._w))
def winfo_manager(self):
"""Return the window mananger name for this widget."""
return self.tk.call('winfo', 'manager', self._w)
def winfo_name(self):
"""Return the name of this widget."""
return self.tk.call('winfo', 'name', self._w)
def winfo_parent(self):
"""Return the name of the parent of this widget."""
return self.tk.call('winfo', 'parent', self._w)
def winfo_pathname(self, id, displayof=0):
"""Return the pathname of the widget given by ID."""
args = ('winfo', 'pathname') \
+ self._displayof(displayof) + (id,)
return self.tk.call(args)
def winfo_pixels(self, number):
"""Rounded integer value of winfo_fpixels."""
return getint(
self.tk.call('winfo', 'pixels', self._w, number))
def winfo_pointerx(self):
"""Return the x coordinate of the pointer on the root window."""
return getint(
self.tk.call('winfo', 'pointerx', self._w))
def winfo_pointerxy(self):
"""Return a tuple of x and y coordinates of the pointer on the root window."""
return self._getints(
self.tk.call('winfo', 'pointerxy', self._w))
def winfo_pointery(self):
"""Return the y coordinate of the pointer on the root window."""
return getint(
self.tk.call('winfo', 'pointery', self._w))
def winfo_reqheight(self):
"""Return requested height of this widget."""
return getint(
self.tk.call('winfo', 'reqheight', self._w))
def winfo_reqwidth(self):
"""Return requested width of this widget."""
return getint(
self.tk.call('winfo', 'reqwidth', self._w))
def winfo_rgb(self, color):
"""Return tuple of decimal values for red, green, blue for
COLOR in this widget."""
return self._getints(
self.tk.call('winfo', 'rgb', self._w, color))
def winfo_rootx(self):
"""Return x coordinate of upper left corner of this widget on the
root window."""
return getint(
self.tk.call('winfo', 'rootx', self._w))
def winfo_rooty(self):
"""Return y coordinate of upper left corner of this widget on the
root window."""
return getint(
self.tk.call('winfo', 'rooty', self._w))
def winfo_screen(self):
"""Return the screen name of this widget."""
return self.tk.call('winfo', 'screen', self._w)
def winfo_screencells(self):
"""Return the number of the cells in the colormap of the screen
of this widget."""
return getint(
self.tk.call('winfo', 'screencells', self._w))
def winfo_screendepth(self):
"""Return the number of bits per pixel of the root window of the
screen of this widget."""
return getint(
self.tk.call('winfo', 'screendepth', self._w))
def winfo_screenheight(self):
"""Return the number of pixels of the height of the screen of this widget
in pixel."""
return getint(
self.tk.call('winfo', 'screenheight', self._w))
def winfo_screenmmheight(self):
"""Return the number of pixels of the height of the screen of
this widget in mm."""
return getint(
self.tk.call('winfo', 'screenmmheight', self._w))
def winfo_screenmmwidth(self):
"""Return the number of pixels of the width of the screen of
this widget in mm."""
return getint(
self.tk.call('winfo', 'screenmmwidth', self._w))
def winfo_screenvisual(self):
"""Return one of the strings directcolor, grayscale, pseudocolor,
staticcolor, staticgray, or truecolor for the default
colormodel of this screen."""
return self.tk.call('winfo', 'screenvisual', self._w)
def winfo_screenwidth(self):
"""Return the number of pixels of the width of the screen of
this widget in pixel."""
return getint(
self.tk.call('winfo', 'screenwidth', self._w))
def winfo_server(self):
"""Return information of the X-Server of the screen of this widget in
the form "XmajorRminor vendor vendorVersion"."""
return self.tk.call('winfo', 'server', self._w)
def winfo_toplevel(self):
"""Return the toplevel widget of this widget."""
return self._nametowidget(self.tk.call(
'winfo', 'toplevel', self._w))
def winfo_viewable(self):
"""Return true if the widget and all its higher ancestors are mapped."""
return getint(
self.tk.call('winfo', 'viewable', self._w))
def winfo_visual(self):
"""Return one of the strings directcolor, grayscale, pseudocolor,
staticcolor, staticgray, or truecolor for the
colormodel of this widget."""
return self.tk.call('winfo', 'visual', self._w)
def winfo_visualid(self):
"""Return the X identifier for the visual for this widget."""
return self.tk.call('winfo', 'visualid', self._w)
def winfo_visualsavailable(self, includeids=0):
"""Return a list of all visuals available for the screen
of this widget.
Each item in the list consists of a visual name (see winfo_visual), a
depth and if INCLUDEIDS=1 is given also the X identifier."""
data = self.tk.split(
self.tk.call('winfo', 'visualsavailable', self._w,
includeids and 'includeids' or None))
if type(data) is StringType:
data = [self.tk.split(data)]
return map(self.__winfo_parseitem, data)
def __winfo_parseitem(self, t):
"""Internal function."""
return t[:1] + tuple(map(self.__winfo_getint, t[1:]))
def __winfo_getint(self, x):
"""Internal function."""
return int(x, 0)
def winfo_vrootheight(self):
"""Return the height of the virtual root window associated with this
widget in pixels. If there is no virtual root window return the
height of the screen."""
return getint(
self.tk.call('winfo', 'vrootheight', self._w))
def winfo_vrootwidth(self):
"""Return the width of the virtual root window associated with this
widget in pixel. If there is no virtual root window return the
width of the screen."""
return getint(
self.tk.call('winfo', 'vrootwidth', self._w))
def winfo_vrootx(self):
"""Return the x offset of the virtual root relative to the root
window of the screen of this widget."""
return getint(
self.tk.call('winfo', 'vrootx', self._w))
def winfo_vrooty(self):
"""Return the y offset of the virtual root relative to the root
window of the screen of this widget."""
return getint(
self.tk.call('winfo', 'vrooty', self._w))
def winfo_width(self):
"""Return the width of this widget."""
return getint(
self.tk.call('winfo', 'width', self._w))
def winfo_x(self):
"""Return the x coordinate of the upper left corner of this widget
in the parent."""
return getint(
self.tk.call('winfo', 'x', self._w))
def winfo_y(self):
"""Return the y coordinate of the upper left corner of this widget
in the parent."""
return getint(
self.tk.call('winfo', 'y', self._w))
def update(self):
"""Enter event loop until all pending events have been processed by Tcl."""
self.tk.call('update')
def update_idletasks(self):
"""Enter event loop until all idle callbacks have been called. This
will update the display of windows but not process events caused by
the user."""
self.tk.call('update', 'idletasks')
def bindtags(self, tagList=None):
"""Set or get the list of bindtags for this widget.
With no argument return the list of all bindtags associated with
this widget. With a list of strings as argument the bindtags are
set to this list. The bindtags determine in which order events are
processed (see bind)."""
if tagList is None:
return self.tk.splitlist(
self.tk.call('bindtags', self._w))
else:
self.tk.call('bindtags', self._w, tagList)
def _bind(self, what, sequence, func, add, needcleanup=1):
"""Internal function."""
if type(func) is StringType:
self.tk.call(what + (sequence, func))
elif func:
funcid = self._register(func, self._substitute,
needcleanup)
cmd = ('%sif {"[%s %s]" == "break"} break\n'
%
(add and '+' or '',
funcid, self._subst_format_str))
self.tk.call(what + (sequence, cmd))
return funcid
elif sequence:
return self.tk.call(what + (sequence,))
else:
return self.tk.splitlist(self.tk.call(what))
def bind(self, sequence=None, func=None, add=None):
"""Bind to this widget at event SEQUENCE a call to function FUNC.
SEQUENCE is a string of concatenated event
patterns. An event pattern is of the form
<MODIFIER-MODIFIER-TYPE-DETAIL> where MODIFIER is one
of Control, Mod2, M2, Shift, Mod3, M3, Lock, Mod4, M4,
Button1, B1, Mod5, M5 Button2, B2, Meta, M, Button3,
B3, Alt, Button4, B4, Double, Button5, B5 Triple,
Mod1, M1. TYPE is one of Activate, Enter, Map,
ButtonPress, Button, Expose, Motion, ButtonRelease
FocusIn, MouseWheel, Circulate, FocusOut, Property,
Colormap, Gravity Reparent, Configure, KeyPress, Key,
Unmap, Deactivate, KeyRelease Visibility, Destroy,
Leave and DETAIL is the button number for ButtonPress,
ButtonRelease and DETAIL is the Keysym for KeyPress and
KeyRelease. Examples are
<Control-Button-1> for pressing Control and mouse button 1 or
<Alt-A> for pressing A and the Alt key (KeyPress can be omitted).
An event pattern can also be a virtual event of the form
<<AString>> where AString can be arbitrary. This
event can be generated by event_generate.
If events are concatenated they must appear shortly
after each other.
FUNC will be called if the event sequence occurs with an
instance of Event as argument. If the return value of FUNC is
"break" no further bound function is invoked.
An additional boolean parameter ADD specifies whether FUNC will
be called additionally to the other bound function or whether
it will replace the previous function.
Bind will return an identifier to allow deletion of the bound function with
unbind without memory leak.
If FUNC or SEQUENCE is omitted the bound function or list
of bound events are returned."""
return self._bind(('bind', self._w), sequence, func, add)
def unbind(self, sequence, funcid=None):
"""Unbind for this widget for event SEQUENCE the
function identified with FUNCID."""
self.tk.call('bind', self._w, sequence, '')
if funcid:
self.deletecommand(funcid)
def bind_all(self, sequence=None, func=None, add=None):
"""Bind to all widgets at an event SEQUENCE a call to function FUNC.
An additional boolean parameter ADD specifies whether FUNC will
be called additionally to the other bound function or whether
it will replace the previous function. See bind for the return value."""
return self._bind(('bind', 'all'), sequence, func, add, 0)
def unbind_all(self, sequence):
"""Unbind for all widgets for event SEQUENCE all functions."""
self.tk.call('bind', 'all' , sequence, '')
def bind_class(self, className, sequence=None, func=None, add=None):
"""Bind to widgets with bindtag CLASSNAME at event
SEQUENCE a call of function FUNC. An additional
boolean parameter ADD specifies whether FUNC will be
called additionally to the other bound function or
whether it will replace the previous function. See bind for
the return value."""
return self._bind(('bind', className), sequence, func, add, 0)
def unbind_class(self, className, sequence):
"""Unbind for a all widgets with bindtag CLASSNAME for event SEQUENCE
all functions."""
self.tk.call('bind', className , sequence, '')
def mainloop(self, n=0):
"""Call the mainloop of Tk."""
self.tk.mainloop(n)
def quit(self):
"""Quit the Tcl interpreter. All widgets will be destroyed."""
self.tk.quit()
def _getints(self, string):
"""Internal function."""
if string:
return tuple(map(getint, self.tk.splitlist(string)))
def _getdoubles(self, string):
"""Internal function."""
if string:
return tuple(map(getdouble, self.tk.splitlist(string)))
def _getboolean(self, string):
"""Internal function."""
if string:
return self.tk.getboolean(string)
def _displayof(self, displayof):
"""Internal function."""
if displayof:
return ('-displayof', displayof)
if displayof is None:
return ('-displayof', self._w)
return ()
def _options(self, cnf, kw = None):
"""Internal function."""
if kw:
cnf = _cnfmerge((cnf, kw))
else:
cnf = _cnfmerge(cnf)
res = ()
for k, v in cnf.items():
if v is not None:
if k[-1] == '_': k = k[:-1]
if hasattr(v, '__call__'):
v = self._register(v)
elif isinstance(v, (tuple, list)):
nv = []
for item in v:
if not isinstance(item, (basestring, int)):
break
elif isinstance(item, int):
nv.append('%d' % item)
else:
# format it to proper Tcl code if it contains space
nv.append(('{%s}' if ' ' in item else '%s') % item)
else:
v = ' '.join(nv)
res = res + ('-'+k, v)
return res
def nametowidget(self, name):
"""Return the Tkinter instance of a widget identified by
its Tcl name NAME."""
name = str(name).split('.')
w = self
if not name[0]:
w = w._root()
name = name[1:]
for n in name:
if not n:
break
w = w.children[n]
return w
_nametowidget = nametowidget
def _register(self, func, subst=None, needcleanup=1):
"""Return a newly created Tcl function. If this
function is called, the Python function FUNC will
be executed. An optional function SUBST can
be given which will be executed before FUNC."""
f = CallWrapper(func, subst, self).__call__
name = repr(id(f))
try:
func = func.im_func
except AttributeError:
pass
try:
name = name + func.__name__
except AttributeError:
pass
self.tk.createcommand(name, f)
if needcleanup:
if self._tclCommands is None:
self._tclCommands = []
self._tclCommands.append(name)
return name
register = _register
def _root(self):
"""Internal function."""
w = self
while w.master: w = w.master
return w
_subst_format = ('%#', '%b', '%f', '%h', '%k',
'%s', '%t', '%w', '%x', '%y',
'%A', '%E', '%K', '%N', '%W', '%T', '%X', '%Y', '%D')
_subst_format_str = " ".join(_subst_format)
def _substitute(self, *args):
"""Internal function."""
if len(args) != len(self._subst_format): return args
getboolean = self.tk.getboolean
getint = int
def getint_event(s):
"""Tk changed behavior in 8.4.2, returning "??" rather more often."""
try:
return int(s)
except ValueError:
return s
nsign, b, f, h, k, s, t, w, x, y, A, E, K, N, W, T, X, Y, D = args
# Missing: (a, c, d, m, o, v, B, R)
e = Event()
# serial field: valid vor all events
# number of button: ButtonPress and ButtonRelease events only
# height field: Configure, ConfigureRequest, Create,
# ResizeRequest, and Expose events only
# keycode field: KeyPress and KeyRelease events only
# time field: "valid for events that contain a time field"
# width field: Configure, ConfigureRequest, Create, ResizeRequest,
# and Expose events only
# x field: "valid for events that contain a x field"
# y field: "valid for events that contain a y field"
# keysym as decimal: KeyPress and KeyRelease events only
# x_root, y_root fields: ButtonPress, ButtonRelease, KeyPress,
# KeyRelease,and Motion events
e.serial = getint(nsign)
e.num = getint_event(b)
try: e.focus = getboolean(f)
except TclError: pass
e.height = getint_event(h)
e.keycode = getint_event(k)
e.state = getint_event(s)
e.time = getint_event(t)
e.width = getint_event(w)
e.x = getint_event(x)
e.y = getint_event(y)
e.char = A
try: e.send_event = getboolean(E)
except TclError: pass
e.keysym = K
e.keysym_num = getint_event(N)
e.type = T
try:
e.widget = self._nametowidget(W)
except KeyError:
e.widget = W
e.x_root = getint_event(X)
e.y_root = getint_event(Y)
try:
e.delta = getint(D)
except ValueError:
e.delta = 0
return (e,)
def _report_exception(self):
"""Internal function."""
import sys
exc, val, tb = sys.exc_type, sys.exc_value, sys.exc_traceback
root = self._root()
root.report_callback_exception(exc, val, tb)
def _configure(self, cmd, cnf, kw):
"""Internal function."""
if kw:
cnf = _cnfmerge((cnf, kw))
elif cnf:
cnf = _cnfmerge(cnf)
if cnf is None:
cnf = {}
for x in self.tk.split(
self.tk.call(_flatten((self._w, cmd)))):
cnf[x[0][1:]] = (x[0][1:],) + x[1:]
return cnf
if type(cnf) is StringType:
x = self.tk.split(
self.tk.call(_flatten((self._w, cmd, '-'+cnf))))
return (x[0][1:],) + x[1:]
self.tk.call(_flatten((self._w, cmd)) + self._options(cnf))
# These used to be defined in Widget:
def configure(self, cnf=None, **kw):
"""Configure resources of a widget.
The values for resources are specified as keyword
arguments. To get an overview about
the allowed keyword arguments call the method keys.
"""
return self._configure('configure', cnf, kw)
config = configure
def cget(self, key):
"""Return the resource value for a KEY given as string."""
return self.tk.call(self._w, 'cget', '-' + key)
__getitem__ = cget
def __setitem__(self, key, value):
self.configure({key: value})
def __contains__(self, key):
raise TypeError("Tkinter objects don't support 'in' tests.")
def keys(self):
"""Return a list of all resource names of this widget."""
return map(lambda x: x[0][1:],
self.tk.split(self.tk.call(self._w, 'configure')))
def __str__(self):
"""Return the window path name of this widget."""
return self._w
# Pack methods that apply to the master
_noarg_ = ['_noarg_']
def pack_propagate(self, flag=_noarg_):
"""Set or get the status for propagation of geometry information.
A boolean argument specifies whether the geometry information
of the slaves will determine the size of this widget. If no argument
is given the current setting will be returned.
"""
if flag is Misc._noarg_:
return self._getboolean(self.tk.call(
'pack', 'propagate', self._w))
else:
self.tk.call('pack', 'propagate', self._w, flag)
propagate = pack_propagate
def pack_slaves(self):
"""Return a list of all slaves of this widget
in its packing order."""
return map(self._nametowidget,
self.tk.splitlist(
self.tk.call('pack', 'slaves', self._w)))
slaves = pack_slaves
# Place method that applies to the master
def place_slaves(self):
"""Return a list of all slaves of this widget
in its packing order."""
return map(self._nametowidget,
self.tk.splitlist(
self.tk.call(
'place', 'slaves', self._w)))
# Grid methods that apply to the master
def grid_bbox(self, column=None, row=None, col2=None, row2=None):
"""Return a tuple of integer coordinates for the bounding
box of this widget controlled by the geometry manager grid.
If COLUMN, ROW is given the bounding box applies from
the cell with row and column 0 to the specified
cell. If COL2 and ROW2 are given the bounding box
starts at that cell.
The returned integers specify the offset of the upper left
corner in the master widget and the width and height.
"""
args = ('grid', 'bbox', self._w)
if column is not None and row is not None:
args = args + (column, row)
if col2 is not None and row2 is not None:
args = args + (col2, row2)
return self._getints(self.tk.call(*args)) or None
bbox = grid_bbox
def _grid_configure(self, command, index, cnf, kw):
"""Internal function."""
if type(cnf) is StringType and not kw:
if cnf[-1:] == '_':
cnf = cnf[:-1]
if cnf[:1] != '-':
cnf = '-'+cnf
options = (cnf,)
else:
options = self._options(cnf, kw)
if not options:
res = self.tk.call('grid',
command, self._w, index)
words = self.tk.splitlist(res)
dict = {}
for i in range(0, len(words), 2):
key = words[i][1:]
value = words[i+1]
if not value:
value = None
elif '.' in value:
value = getdouble(value)
else:
value = getint(value)
dict[key] = value
return dict
res = self.tk.call(
('grid', command, self._w, index)
+ options)
if len(options) == 1:
if not res: return None
# In Tk 7.5, -width can be a float
if '.' in res: return getdouble(res)
return getint(res)
def grid_columnconfigure(self, index, cnf={}, **kw):
"""Configure column INDEX of a grid.
Valid resources are minsize (minimum size of the column),
weight (how much does additional space propagate to this column)
and pad (how much space to let additionally)."""
return self._grid_configure('columnconfigure', index, cnf, kw)
columnconfigure = grid_columnconfigure
def grid_location(self, x, y):
"""Return a tuple of column and row which identify the cell
at which the pixel at position X and Y inside the master
widget is located."""
return self._getints(
self.tk.call(
'grid', 'location', self._w, x, y)) or None
def grid_propagate(self, flag=_noarg_):
"""Set or get the status for propagation of geometry information.
A boolean argument specifies whether the geometry information
of the slaves will determine the size of this widget. If no argument
is given, the current setting will be returned.
"""
if flag is Misc._noarg_:
return self._getboolean(self.tk.call(
'grid', 'propagate', self._w))
else:
self.tk.call('grid', 'propagate', self._w, flag)
def grid_rowconfigure(self, index, cnf={}, **kw):
"""Configure row INDEX of a grid.
Valid resources are minsize (minimum size of the row),
weight (how much does additional space propagate to this row)
and pad (how much space to let additionally)."""
return self._grid_configure('rowconfigure', index, cnf, kw)
rowconfigure = grid_rowconfigure
def grid_size(self):
"""Return a tuple of the number of column and rows in the grid."""
return self._getints(
self.tk.call('grid', 'size', self._w)) or None
size = grid_size
def grid_slaves(self, row=None, column=None):
"""Return a list of all slaves of this widget
in its packing order."""
args = ()
if row is not None:
args = args + ('-row', row)
if column is not None:
args = args + ('-column', column)
return map(self._nametowidget,
self.tk.splitlist(self.tk.call(
('grid', 'slaves', self._w) + args)))
# Support for the "event" command, new in Tk 4.2.
# By Case Roole.
def event_add(self, virtual, *sequences):
"""Bind a virtual event VIRTUAL (of the form <<Name>>)
to an event SEQUENCE such that the virtual event is triggered
whenever SEQUENCE occurs."""
args = ('event', 'add', virtual) + sequences
self.tk.call(args)
def event_delete(self, virtual, *sequences):
"""Unbind a virtual event VIRTUAL from SEQUENCE."""
args = ('event', 'delete', virtual) + sequences
self.tk.call(args)
def event_generate(self, sequence, **kw):
"""Generate an event SEQUENCE. Additional
keyword arguments specify parameter of the event
(e.g. x, y, rootx, rooty)."""
args = ('event', 'generate', self._w, sequence)
for k, v in kw.items():
args = args + ('-%s' % k, str(v))
self.tk.call(args)
def event_info(self, virtual=None):
"""Return a list of all virtual events or the information
about the SEQUENCE bound to the virtual event VIRTUAL."""
return self.tk.splitlist(
self.tk.call('event', 'info', virtual))
# Image related commands
def image_names(self):
"""Return a list of all existing image names."""
return self.tk.call('image', 'names')
def image_types(self):
"""Return a list of all available image types (e.g. phote bitmap)."""
return self.tk.call('image', 'types')
class CallWrapper:
"""Internal class. Stores function to call when some user
defined Tcl function is called e.g. after an event occurred."""
def __init__(self, func, subst, widget):
"""Store FUNC, SUBST and WIDGET as members."""
self.func = func
self.subst = subst
self.widget = widget
def __call__(self, *args):
"""Apply first function SUBST to arguments, than FUNC."""
try:
if self.subst:
args = self.subst(*args)
return self.func(*args)
except SystemExit, msg:
raise SystemExit, msg
except:
self.widget._report_exception()
class XView:
"""Mix-in class for querying and changing the horizontal position
of a widget's window."""
def xview(self, *args):
"""Query and change the horizontal position of the view."""
res = self.tk.call(self._w, 'xview', *args)
if not args:
return self._getdoubles(res)
def xview_moveto(self, fraction):
"""Adjusts the view in the window so that FRACTION of the
total width of the canvas is off-screen to the left."""
self.tk.call(self._w, 'xview', 'moveto', fraction)
def xview_scroll(self, number, what):
"""Shift the x-view according to NUMBER which is measured in "units"
or "pages" (WHAT)."""
self.tk.call(self._w, 'xview', 'scroll', number, what)
class YView:
"""Mix-in class for querying and changing the vertical position
of a widget's window."""
def yview(self, *args):
"""Query and change the vertical position of the view."""
res = self.tk.call(self._w, 'yview', *args)
if not args:
return self._getdoubles(res)
def yview_moveto(self, fraction):
"""Adjusts the view in the window so that FRACTION of the
total height of the canvas is off-screen to the top."""
self.tk.call(self._w, 'yview', 'moveto', fraction)
def yview_scroll(self, number, what):
"""Shift the y-view according to NUMBER which is measured in
"units" or "pages" (WHAT)."""
self.tk.call(self._w, 'yview', 'scroll', number, what)
class Wm:
"""Provides functions for the communication with the window manager."""
def wm_aspect(self,
minNumer=None, minDenom=None,
maxNumer=None, maxDenom=None):
"""Instruct the window manager to set the aspect ratio (width/height)
of this widget to be between MINNUMER/MINDENOM and MAXNUMER/MAXDENOM. Return a tuple
of the actual values if no argument is given."""
return self._getints(
self.tk.call('wm', 'aspect', self._w,
minNumer, minDenom,
maxNumer, maxDenom))
aspect = wm_aspect
def wm_attributes(self, *args):
"""This subcommand returns or sets platform specific attributes
The first form returns a list of the platform specific flags and
their values. The second form returns the value for the specific
option. The third form sets one or more of the values. The values
are as follows:
On Windows, -disabled gets or sets whether the window is in a
disabled state. -toolwindow gets or sets the style of the window
to toolwindow (as defined in the MSDN). -topmost gets or sets
whether this is a topmost window (displays above all other
windows).
On Macintosh, XXXXX
On Unix, there are currently no special attribute values.
"""
args = ('wm', 'attributes', self._w) + args
return self.tk.call(args)
attributes=wm_attributes
def wm_client(self, name=None):
"""Store NAME in WM_CLIENT_MACHINE property of this widget. Return
current value."""
return self.tk.call('wm', 'client', self._w, name)
client = wm_client
def wm_colormapwindows(self, *wlist):
"""Store list of window names (WLIST) into WM_COLORMAPWINDOWS property
of this widget. This list contains windows whose colormaps differ from their
parents. Return current list of widgets if WLIST is empty."""
if len(wlist) > 1:
wlist = (wlist,) # Tk needs a list of windows here
args = ('wm', 'colormapwindows', self._w) + wlist
return map(self._nametowidget, self.tk.call(args))
colormapwindows = wm_colormapwindows
def wm_command(self, value=None):
"""Store VALUE in WM_COMMAND property. It is the command
which shall be used to invoke the application. Return current
command if VALUE is None."""
return self.tk.call('wm', 'command', self._w, value)
command = wm_command
def wm_deiconify(self):
"""Deiconify this widget. If it was never mapped it will not be mapped.
On Windows it will raise this widget and give it the focus."""
return self.tk.call('wm', 'deiconify', self._w)
deiconify = wm_deiconify
def wm_focusmodel(self, model=None):
"""Set focus model to MODEL. "active" means that this widget will claim
the focus itself, "passive" means that the window manager shall give
the focus. Return current focus model if MODEL is None."""
return self.tk.call('wm', 'focusmodel', self._w, model)
focusmodel = wm_focusmodel
def wm_frame(self):
"""Return identifier for decorative frame of this widget if present."""
return self.tk.call('wm', 'frame', self._w)
frame = wm_frame
def wm_geometry(self, newGeometry=None):
"""Set geometry to NEWGEOMETRY of the form =widthxheight+x+y. Return
current value if None is given."""
return self.tk.call('wm', 'geometry', self._w, newGeometry)
geometry = wm_geometry
def wm_grid(self,
baseWidth=None, baseHeight=None,
widthInc=None, heightInc=None):
"""Instruct the window manager that this widget shall only be
resized on grid boundaries. WIDTHINC and HEIGHTINC are the width and
height of a grid unit in pixels. BASEWIDTH and BASEHEIGHT are the
number of grid units requested in Tk_GeometryRequest."""
return self._getints(self.tk.call(
'wm', 'grid', self._w,
baseWidth, baseHeight, widthInc, heightInc))
grid = wm_grid
def wm_group(self, pathName=None):
"""Set the group leader widgets for related widgets to PATHNAME. Return
the group leader of this widget if None is given."""
return self.tk.call('wm', 'group', self._w, pathName)
group = wm_group
def wm_iconbitmap(self, bitmap=None, default=None):
"""Set bitmap for the iconified widget to BITMAP. Return
the bitmap if None is given.
Under Windows, the DEFAULT parameter can be used to set the icon
for the widget and any descendents that don't have an icon set
explicitly. DEFAULT can be the relative path to a .ico file
(example: root.iconbitmap(default='myicon.ico') ). See Tk
documentation for more information."""
if default:
return self.tk.call('wm', 'iconbitmap', self._w, '-default', default)
else:
return self.tk.call('wm', 'iconbitmap', self._w, bitmap)
iconbitmap = wm_iconbitmap
def wm_iconify(self):
"""Display widget as icon."""
return self.tk.call('wm', 'iconify', self._w)
iconify = wm_iconify
def wm_iconmask(self, bitmap=None):
"""Set mask for the icon bitmap of this widget. Return the
mask if None is given."""
return self.tk.call('wm', 'iconmask', self._w, bitmap)
iconmask = wm_iconmask
def wm_iconname(self, newName=None):
"""Set the name of the icon for this widget. Return the name if
None is given."""
return self.tk.call('wm', 'iconname', self._w, newName)
iconname = wm_iconname
def wm_iconposition(self, x=None, y=None):
"""Set the position of the icon of this widget to X and Y. Return
a tuple of the current values of X and X if None is given."""
return self._getints(self.tk.call(
'wm', 'iconposition', self._w, x, y))
iconposition = wm_iconposition
def wm_iconwindow(self, pathName=None):
"""Set widget PATHNAME to be displayed instead of icon. Return the current
value if None is given."""
return self.tk.call('wm', 'iconwindow', self._w, pathName)
iconwindow = wm_iconwindow
def wm_maxsize(self, width=None, height=None):
"""Set max WIDTH and HEIGHT for this widget. If the window is gridded
the values are given in grid units. Return the current values if None
is given."""
return self._getints(self.tk.call(
'wm', 'maxsize', self._w, width, height))
maxsize = wm_maxsize
def wm_minsize(self, width=None, height=None):
"""Set min WIDTH and HEIGHT for this widget. If the window is gridded
the values are given in grid units. Return the current values if None
is given."""
return self._getints(self.tk.call(
'wm', 'minsize', self._w, width, height))
minsize = wm_minsize
def wm_overrideredirect(self, boolean=None):
"""Instruct the window manager to ignore this widget
if BOOLEAN is given with 1. Return the current value if None
is given."""
return self._getboolean(self.tk.call(
'wm', 'overrideredirect', self._w, boolean))
overrideredirect = wm_overrideredirect
def wm_positionfrom(self, who=None):
"""Instruct the window manager that the position of this widget shall
be defined by the user if WHO is "user", and by its own policy if WHO is
"program"."""
return self.tk.call('wm', 'positionfrom', self._w, who)
positionfrom = wm_positionfrom
def wm_protocol(self, name=None, func=None):
"""Bind function FUNC to command NAME for this widget.
Return the function bound to NAME if None is given. NAME could be
e.g. "WM_SAVE_YOURSELF" or "WM_DELETE_WINDOW"."""
if hasattr(func, '__call__'):
command = self._register(func)
else:
command = func
return self.tk.call(
'wm', 'protocol', self._w, name, command)
protocol = wm_protocol
def wm_resizable(self, width=None, height=None):
"""Instruct the window manager whether this width can be resized
in WIDTH or HEIGHT. Both values are boolean values."""
return self.tk.call('wm', 'resizable', self._w, width, height)
resizable = wm_resizable
def wm_sizefrom(self, who=None):
"""Instruct the window manager that the size of this widget shall
be defined by the user if WHO is "user", and by its own policy if WHO is
"program"."""
return self.tk.call('wm', 'sizefrom', self._w, who)
sizefrom = wm_sizefrom
def wm_state(self, newstate=None):
"""Query or set the state of this widget as one of normal, icon,
iconic (see wm_iconwindow), withdrawn, or zoomed (Windows only)."""
return self.tk.call('wm', 'state', self._w, newstate)
state = wm_state
def wm_title(self, string=None):
"""Set the title of this widget."""
return self.tk.call('wm', 'title', self._w, string)
title = wm_title
def wm_transient(self, master=None):
"""Instruct the window manager that this widget is transient
with regard to widget MASTER."""
return self.tk.call('wm', 'transient', self._w, master)
transient = wm_transient
def wm_withdraw(self):
"""Withdraw this widget from the screen such that it is unmapped
and forgotten by the window manager. Re-draw it with wm_deiconify."""
return self.tk.call('wm', 'withdraw', self._w)
withdraw = wm_withdraw
class Tk(Misc, Wm):
"""Toplevel widget of Tk which represents mostly the main window
of an appliation. It has an associated Tcl interpreter."""
_w = '.'
def __init__(self, screenName=None, baseName=None, className='Tk',
useTk=1, sync=0, use=None):
"""Return a new Toplevel widget on screen SCREENNAME. A new Tcl interpreter will
be created. BASENAME will be used for the identification of the profile file (see
readprofile).
It is constructed from sys.argv[0] without extensions if None is given. CLASSNAME
is the name of the widget class."""
self.master = None
self.children = {}
self._tkloaded = 0
# to avoid recursions in the getattr code in case of failure, we
# ensure that self.tk is always _something_.
self.tk = None
if baseName is None:
import sys, os
baseName = os.path.basename(sys.argv[0])
baseName, ext = os.path.splitext(baseName)
if ext not in ('.py', '.pyc', '.pyo'):
baseName = baseName + ext
interactive = 0
self.tk = _tkinter.create(screenName, baseName, className, interactive, wantobjects, useTk, sync, use)
if useTk:
self._loadtk()
self.readprofile(baseName, className)
def loadtk(self):
if not self._tkloaded:
self.tk.loadtk()
self._loadtk()
def _loadtk(self):
self._tkloaded = 1
global _default_root
# Version sanity checks
tk_version = self.tk.getvar('tk_version')
if tk_version != _tkinter.TK_VERSION:
raise RuntimeError, \
"tk.h version (%s) doesn't match libtk.a version (%s)" \
% (_tkinter.TK_VERSION, tk_version)
# Under unknown circumstances, tcl_version gets coerced to float
tcl_version = str(self.tk.getvar('tcl_version'))
if tcl_version != _tkinter.TCL_VERSION:
raise RuntimeError, \
"tcl.h version (%s) doesn't match libtcl.a version (%s)" \
% (_tkinter.TCL_VERSION, tcl_version)
if TkVersion < 4.0:
raise RuntimeError, \
"Tk 4.0 or higher is required; found Tk %s" \
% str(TkVersion)
# Create and register the tkerror and exit commands
# We need to inline parts of _register here, _ register
# would register differently-named commands.
if self._tclCommands is None:
self._tclCommands = []
self.tk.createcommand('tkerror', _tkerror)
self.tk.createcommand('exit', _exit)
self._tclCommands.append('tkerror')
self._tclCommands.append('exit')
if _support_default_root and not _default_root:
_default_root = self
self.protocol("WM_DELETE_WINDOW", self.destroy)
def destroy(self):
"""Destroy this and all descendants widgets. This will
end the application of this Tcl interpreter."""
for c in self.children.values(): c.destroy()
self.tk.call('destroy', self._w)
Misc.destroy(self)
global _default_root
if _support_default_root and _default_root is self:
_default_root = None
def readprofile(self, baseName, className):
"""Internal function. It reads BASENAME.tcl and CLASSNAME.tcl into
the Tcl Interpreter and calls execfile on BASENAME.py and CLASSNAME.py if
such a file exists in the home directory."""
import os
if 'HOME' in os.environ: home = os.environ['HOME']
else: home = os.curdir
class_tcl = os.path.join(home, '.%s.tcl' % className)
class_py = os.path.join(home, '.%s.py' % className)
base_tcl = os.path.join(home, '.%s.tcl' % baseName)
base_py = os.path.join(home, '.%s.py' % baseName)
dir = {'self': self}
exec 'from Tkinter import *' in dir
if os.path.isfile(class_tcl):
self.tk.call('source', class_tcl)
if os.path.isfile(class_py):
execfile(class_py, dir)
if os.path.isfile(base_tcl):
self.tk.call('source', base_tcl)
if os.path.isfile(base_py):
execfile(base_py, dir)
def report_callback_exception(self, exc, val, tb):
"""Internal function. It reports exception on sys.stderr."""
import traceback, sys
sys.stderr.write("Exception in Tkinter callback\n")
sys.last_type = exc
sys.last_value = val
sys.last_traceback = tb
traceback.print_exception(exc, val, tb)
def __getattr__(self, attr):
"Delegate attribute access to the interpreter object"
return getattr(self.tk, attr)
# Ideally, the classes Pack, Place and Grid disappear, the
# pack/place/grid methods are defined on the Widget class, and
# everybody uses w.pack_whatever(...) instead of Pack.whatever(w,
# ...), with pack(), place() and grid() being short for
# pack_configure(), place_configure() and grid_columnconfigure(), and
# forget() being short for pack_forget(). As a practical matter, I'm
# afraid that there is too much code out there that may be using the
# Pack, Place or Grid class, so I leave them intact -- but only as
# backwards compatibility features. Also note that those methods that
# take a master as argument (e.g. pack_propagate) have been moved to
# the Misc class (which now incorporates all methods common between
# toplevel and interior widgets). Again, for compatibility, these are
# copied into the Pack, Place or Grid class.
def Tcl(screenName=None, baseName=None, className='Tk', useTk=0):
return Tk(screenName, baseName, className, useTk)
class Pack:
"""Geometry manager Pack.
Base class to use the methods pack_* in every widget."""
def pack_configure(self, cnf={}, **kw):
"""Pack a widget in the parent widget. Use as options:
after=widget - pack it after you have packed widget
anchor=NSEW (or subset) - position widget according to
given direction
before=widget - pack it before you will pack widget
expand=bool - expand widget if parent size grows
fill=NONE or X or Y or BOTH - fill widget if widget grows
in=master - use master to contain this widget
in_=master - see 'in' option description
ipadx=amount - add internal padding in x direction
ipady=amount - add internal padding in y direction
padx=amount - add padding in x direction
pady=amount - add padding in y direction
side=TOP or BOTTOM or LEFT or RIGHT - where to add this widget.
"""
self.tk.call(
('pack', 'configure', self._w)
+ self._options(cnf, kw))
pack = configure = config = pack_configure
def pack_forget(self):
"""Unmap this widget and do not use it for the packing order."""
self.tk.call('pack', 'forget', self._w)
forget = pack_forget
def pack_info(self):
"""Return information about the packing options
for this widget."""
words = self.tk.splitlist(
self.tk.call('pack', 'info', self._w))
dict = {}
for i in range(0, len(words), 2):
key = words[i][1:]
value = words[i+1]
if value[:1] == '.':
value = self._nametowidget(value)
dict[key] = value
return dict
info = pack_info
propagate = pack_propagate = Misc.pack_propagate
slaves = pack_slaves = Misc.pack_slaves
class Place:
"""Geometry manager Place.
Base class to use the methods place_* in every widget."""
def place_configure(self, cnf={}, **kw):
"""Place a widget in the parent widget. Use as options:
in=master - master relative to which the widget is placed
in_=master - see 'in' option description
x=amount - locate anchor of this widget at position x of master
y=amount - locate anchor of this widget at position y of master
relx=amount - locate anchor of this widget between 0.0 and 1.0
relative to width of master (1.0 is right edge)
rely=amount - locate anchor of this widget between 0.0 and 1.0
relative to height of master (1.0 is bottom edge)
anchor=NSEW (or subset) - position anchor according to given direction
width=amount - width of this widget in pixel
height=amount - height of this widget in pixel
relwidth=amount - width of this widget between 0.0 and 1.0
relative to width of master (1.0 is the same width
as the master)
relheight=amount - height of this widget between 0.0 and 1.0
relative to height of master (1.0 is the same
height as the master)
bordermode="inside" or "outside" - whether to take border width of
master widget into account
"""
self.tk.call(
('place', 'configure', self._w)
+ self._options(cnf, kw))
place = configure = config = place_configure
def place_forget(self):
"""Unmap this widget."""
self.tk.call('place', 'forget', self._w)
forget = place_forget
def place_info(self):
"""Return information about the placing options
for this widget."""
words = self.tk.splitlist(
self.tk.call('place', 'info', self._w))
dict = {}
for i in range(0, len(words), 2):
key = words[i][1:]
value = words[i+1]
if value[:1] == '.':
value = self._nametowidget(value)
dict[key] = value
return dict
info = place_info
slaves = place_slaves = Misc.place_slaves
class Grid:
"""Geometry manager Grid.
Base class to use the methods grid_* in every widget."""
# Thanks to Masazumi Yoshikawa (yosikawa@isi.edu)
def grid_configure(self, cnf={}, **kw):
"""Position a widget in the parent widget in a grid. Use as options:
column=number - use cell identified with given column (starting with 0)
columnspan=number - this widget will span several columns
in=master - use master to contain this widget
in_=master - see 'in' option description
ipadx=amount - add internal padding in x direction
ipady=amount - add internal padding in y direction
padx=amount - add padding in x direction
pady=amount - add padding in y direction
row=number - use cell identified with given row (starting with 0)
rowspan=number - this widget will span several rows
sticky=NSEW - if cell is larger on which sides will this
widget stick to the cell boundary
"""
self.tk.call(
('grid', 'configure', self._w)
+ self._options(cnf, kw))
grid = configure = config = grid_configure
bbox = grid_bbox = Misc.grid_bbox
columnconfigure = grid_columnconfigure = Misc.grid_columnconfigure
def grid_forget(self):
"""Unmap this widget."""
self.tk.call('grid', 'forget', self._w)
forget = grid_forget
def grid_remove(self):
"""Unmap this widget but remember the grid options."""
self.tk.call('grid', 'remove', self._w)
def grid_info(self):
"""Return information about the options
for positioning this widget in a grid."""
words = self.tk.splitlist(
self.tk.call('grid', 'info', self._w))
dict = {}
for i in range(0, len(words), 2):
key = words[i][1:]
value = words[i+1]
if value[:1] == '.':
value = self._nametowidget(value)
dict[key] = value
return dict
info = grid_info
location = grid_location = Misc.grid_location
propagate = grid_propagate = Misc.grid_propagate
rowconfigure = grid_rowconfigure = Misc.grid_rowconfigure
size = grid_size = Misc.grid_size
slaves = grid_slaves = Misc.grid_slaves
class BaseWidget(Misc):
"""Internal class."""
def _setup(self, master, cnf):
"""Internal function. Sets up information about children."""
if _support_default_root:
global _default_root
if not master:
if not _default_root:
_default_root = Tk()
master = _default_root
self.master = master
self.tk = master.tk
name = None
if 'name' in cnf:
name = cnf['name']
del cnf['name']
if not name:
name = repr(id(self))
self._name = name
if master._w=='.':
self._w = '.' + name
else:
self._w = master._w + '.' + name
self.children = {}
if self._name in self.master.children:
self.master.children[self._name].destroy()
self.master.children[self._name] = self
def __init__(self, master, widgetName, cnf={}, kw={}, extra=()):
"""Construct a widget with the parent widget MASTER, a name WIDGETNAME
and appropriate options."""
if kw:
cnf = _cnfmerge((cnf, kw))
self.widgetName = widgetName
BaseWidget._setup(self, master, cnf)
if self._tclCommands is None:
self._tclCommands = []
classes = []
for k in cnf.keys():
if type(k) is ClassType:
classes.append((k, cnf[k]))
del cnf[k]
self.tk.call(
(widgetName, self._w) + extra + self._options(cnf))
for k, v in classes:
k.configure(self, v)
def destroy(self):
"""Destroy this and all descendants widgets."""
for c in self.children.values(): c.destroy()
self.tk.call('destroy', self._w)
if self._name in self.master.children:
del self.master.children[self._name]
Misc.destroy(self)
def _do(self, name, args=()):
# XXX Obsolete -- better use self.tk.call directly!
return self.tk.call((self._w, name) + args)
class Widget(BaseWidget, Pack, Place, Grid):
"""Internal class.
Base class for a widget which can be positioned with the geometry managers
Pack, Place or Grid."""
pass
class Toplevel(BaseWidget, Wm):
"""Toplevel widget, e.g. for dialogs."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a toplevel widget with the parent MASTER.
Valid resource names: background, bd, bg, borderwidth, class,
colormap, container, cursor, height, highlightbackground,
highlightcolor, highlightthickness, menu, relief, screen, takefocus,
use, visual, width."""
if kw:
cnf = _cnfmerge((cnf, kw))
extra = ()
for wmkey in ['screen', 'class_', 'class', 'visual',
'colormap']:
if wmkey in cnf:
val = cnf[wmkey]
# TBD: a hack needed because some keys
# are not valid as keyword arguments
if wmkey[-1] == '_': opt = '-'+wmkey[:-1]
else: opt = '-'+wmkey
extra = extra + (opt, val)
del cnf[wmkey]
BaseWidget.__init__(self, master, 'toplevel', cnf, {}, extra)
root = self._root()
self.iconname(root.iconname())
self.title(root.title())
self.protocol("WM_DELETE_WINDOW", self.destroy)
class Button(Widget):
"""Button widget."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a button widget with the parent MASTER.
STANDARD OPTIONS
activebackground, activeforeground, anchor,
background, bitmap, borderwidth, cursor,
disabledforeground, font, foreground
highlightbackground, highlightcolor,
highlightthickness, image, justify,
padx, pady, relief, repeatdelay,
repeatinterval, takefocus, text,
textvariable, underline, wraplength
WIDGET-SPECIFIC OPTIONS
command, compound, default, height,
overrelief, state, width
"""
Widget.__init__(self, master, 'button', cnf, kw)
def tkButtonEnter(self, *dummy):
self.tk.call('tkButtonEnter', self._w)
def tkButtonLeave(self, *dummy):
self.tk.call('tkButtonLeave', self._w)
def tkButtonDown(self, *dummy):
self.tk.call('tkButtonDown', self._w)
def tkButtonUp(self, *dummy):
self.tk.call('tkButtonUp', self._w)
def tkButtonInvoke(self, *dummy):
self.tk.call('tkButtonInvoke', self._w)
def flash(self):
"""Flash the button.
This is accomplished by redisplaying
the button several times, alternating between active and
normal colors. At the end of the flash the button is left
in the same normal/active state as when the command was
invoked. This command is ignored if the button's state is
disabled.
"""
self.tk.call(self._w, 'flash')
def invoke(self):
"""Invoke the command associated with the button.
The return value is the return value from the command,
or an empty string if there is no command associated with
the button. This command is ignored if the button's state
is disabled.
"""
return self.tk.call(self._w, 'invoke')
# Indices:
# XXX I don't like these -- take them away
def AtEnd():
return 'end'
def AtInsert(*args):
s = 'insert'
for a in args:
if a: s = s + (' ' + a)
return s
def AtSelFirst():
return 'sel.first'
def AtSelLast():
return 'sel.last'
def At(x, y=None):
if y is None:
return '@%r' % (x,)
else:
return '@%r,%r' % (x, y)
class Canvas(Widget, XView, YView):
"""Canvas widget to display graphical elements like lines or text."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a canvas widget with the parent MASTER.
Valid resource names: background, bd, bg, borderwidth, closeenough,
confine, cursor, height, highlightbackground, highlightcolor,
highlightthickness, insertbackground, insertborderwidth,
insertofftime, insertontime, insertwidth, offset, relief,
scrollregion, selectbackground, selectborderwidth, selectforeground,
state, takefocus, width, xscrollcommand, xscrollincrement,
yscrollcommand, yscrollincrement."""
Widget.__init__(self, master, 'canvas', cnf, kw)
def addtag(self, *args):
"""Internal function."""
self.tk.call((self._w, 'addtag') + args)
def addtag_above(self, newtag, tagOrId):
"""Add tag NEWTAG to all items above TAGORID."""
self.addtag(newtag, 'above', tagOrId)
def addtag_all(self, newtag):
"""Add tag NEWTAG to all items."""
self.addtag(newtag, 'all')
def addtag_below(self, newtag, tagOrId):
"""Add tag NEWTAG to all items below TAGORID."""
self.addtag(newtag, 'below', tagOrId)
def addtag_closest(self, newtag, x, y, halo=None, start=None):
"""Add tag NEWTAG to item which is closest to pixel at X, Y.
If several match take the top-most.
All items closer than HALO are considered overlapping (all are
closests). If START is specified the next below this tag is taken."""
self.addtag(newtag, 'closest', x, y, halo, start)
def addtag_enclosed(self, newtag, x1, y1, x2, y2):
"""Add tag NEWTAG to all items in the rectangle defined
by X1,Y1,X2,Y2."""
self.addtag(newtag, 'enclosed', x1, y1, x2, y2)
def addtag_overlapping(self, newtag, x1, y1, x2, y2):
"""Add tag NEWTAG to all items which overlap the rectangle
defined by X1,Y1,X2,Y2."""
self.addtag(newtag, 'overlapping', x1, y1, x2, y2)
def addtag_withtag(self, newtag, tagOrId):
"""Add tag NEWTAG to all items with TAGORID."""
self.addtag(newtag, 'withtag', tagOrId)
def bbox(self, *args):
"""Return a tuple of X1,Y1,X2,Y2 coordinates for a rectangle
which encloses all items with tags specified as arguments."""
return self._getints(
self.tk.call((self._w, 'bbox') + args)) or None
def tag_unbind(self, tagOrId, sequence, funcid=None):
"""Unbind for all items with TAGORID for event SEQUENCE the
function identified with FUNCID."""
self.tk.call(self._w, 'bind', tagOrId, sequence, '')
if funcid:
self.deletecommand(funcid)
def tag_bind(self, tagOrId, sequence=None, func=None, add=None):
"""Bind to all items with TAGORID at event SEQUENCE a call to function FUNC.
An additional boolean parameter ADD specifies whether FUNC will be
called additionally to the other bound function or whether it will
replace the previous function. See bind for the return value."""
return self._bind((self._w, 'bind', tagOrId),
sequence, func, add)
def canvasx(self, screenx, gridspacing=None):
"""Return the canvas x coordinate of pixel position SCREENX rounded
to nearest multiple of GRIDSPACING units."""
return getdouble(self.tk.call(
self._w, 'canvasx', screenx, gridspacing))
def canvasy(self, screeny, gridspacing=None):
"""Return the canvas y coordinate of pixel position SCREENY rounded
to nearest multiple of GRIDSPACING units."""
return getdouble(self.tk.call(
self._w, 'canvasy', screeny, gridspacing))
def coords(self, *args):
"""Return a list of coordinates for the item given in ARGS."""
# XXX Should use _flatten on args
return map(getdouble,
self.tk.splitlist(
self.tk.call((self._w, 'coords') + args)))
def _create(self, itemType, args, kw): # Args: (val, val, ..., cnf={})
"""Internal function."""
args = _flatten(args)
cnf = args[-1]
if type(cnf) in (DictionaryType, TupleType):
args = args[:-1]
else:
cnf = {}
return getint(self.tk.call(
self._w, 'create', itemType,
*(args + self._options(cnf, kw))))
def create_arc(self, *args, **kw):
"""Create arc shaped region with coordinates x1,y1,x2,y2."""
return self._create('arc', args, kw)
def create_bitmap(self, *args, **kw):
"""Create bitmap with coordinates x1,y1."""
return self._create('bitmap', args, kw)
def create_image(self, *args, **kw):
"""Create image item with coordinates x1,y1."""
return self._create('image', args, kw)
def create_line(self, *args, **kw):
"""Create line with coordinates x1,y1,...,xn,yn."""
return self._create('line', args, kw)
def create_oval(self, *args, **kw):
"""Create oval with coordinates x1,y1,x2,y2."""
return self._create('oval', args, kw)
def create_polygon(self, *args, **kw):
"""Create polygon with coordinates x1,y1,...,xn,yn."""
return self._create('polygon', args, kw)
def create_rectangle(self, *args, **kw):
"""Create rectangle with coordinates x1,y1,x2,y2."""
return self._create('rectangle', args, kw)
def create_text(self, *args, **kw):
"""Create text with coordinates x1,y1."""
return self._create('text', args, kw)
def create_window(self, *args, **kw):
"""Create window with coordinates x1,y1,x2,y2."""
return self._create('window', args, kw)
def dchars(self, *args):
"""Delete characters of text items identified by tag or id in ARGS (possibly
several times) from FIRST to LAST character (including)."""
self.tk.call((self._w, 'dchars') + args)
def delete(self, *args):
"""Delete items identified by all tag or ids contained in ARGS."""
self.tk.call((self._w, 'delete') + args)
def dtag(self, *args):
"""Delete tag or id given as last arguments in ARGS from items
identified by first argument in ARGS."""
self.tk.call((self._w, 'dtag') + args)
def find(self, *args):
"""Internal function."""
return self._getints(
self.tk.call((self._w, 'find') + args)) or ()
def find_above(self, tagOrId):
"""Return items above TAGORID."""
return self.find('above', tagOrId)
def find_all(self):
"""Return all items."""
return self.find('all')
def find_below(self, tagOrId):
"""Return all items below TAGORID."""
return self.find('below', tagOrId)
def find_closest(self, x, y, halo=None, start=None):
"""Return item which is closest to pixel at X, Y.
If several match take the top-most.
All items closer than HALO are considered overlapping (all are
closests). If START is specified the next below this tag is taken."""
return self.find('closest', x, y, halo, start)
def find_enclosed(self, x1, y1, x2, y2):
"""Return all items in rectangle defined
by X1,Y1,X2,Y2."""
return self.find('enclosed', x1, y1, x2, y2)
def find_overlapping(self, x1, y1, x2, y2):
"""Return all items which overlap the rectangle
defined by X1,Y1,X2,Y2."""
return self.find('overlapping', x1, y1, x2, y2)
def find_withtag(self, tagOrId):
"""Return all items with TAGORID."""
return self.find('withtag', tagOrId)
def focus(self, *args):
"""Set focus to the first item specified in ARGS."""
return self.tk.call((self._w, 'focus') + args)
def gettags(self, *args):
"""Return tags associated with the first item specified in ARGS."""
return self.tk.splitlist(
self.tk.call((self._w, 'gettags') + args))
def icursor(self, *args):
"""Set cursor at position POS in the item identified by TAGORID.
In ARGS TAGORID must be first."""
self.tk.call((self._w, 'icursor') + args)
def index(self, *args):
"""Return position of cursor as integer in item specified in ARGS."""
return getint(self.tk.call((self._w, 'index') + args))
def insert(self, *args):
"""Insert TEXT in item TAGORID at position POS. ARGS must
be TAGORID POS TEXT."""
self.tk.call((self._w, 'insert') + args)
def itemcget(self, tagOrId, option):
"""Return the resource value for an OPTION for item TAGORID."""
return self.tk.call(
(self._w, 'itemcget') + (tagOrId, '-'+option))
def itemconfigure(self, tagOrId, cnf=None, **kw):
"""Configure resources of an item TAGORID.
The values for resources are specified as keyword
arguments. To get an overview about
the allowed keyword arguments call the method without arguments.
"""
return self._configure(('itemconfigure', tagOrId), cnf, kw)
itemconfig = itemconfigure
# lower, tkraise/lift hide Misc.lower, Misc.tkraise/lift,
# so the preferred name for them is tag_lower, tag_raise
# (similar to tag_bind, and similar to the Text widget);
# unfortunately can't delete the old ones yet (maybe in 1.6)
def tag_lower(self, *args):
"""Lower an item TAGORID given in ARGS
(optional below another item)."""
self.tk.call((self._w, 'lower') + args)
lower = tag_lower
def move(self, *args):
"""Move an item TAGORID given in ARGS."""
self.tk.call((self._w, 'move') + args)
def postscript(self, cnf={}, **kw):
"""Print the contents of the canvas to a postscript
file. Valid options: colormap, colormode, file, fontmap,
height, pageanchor, pageheight, pagewidth, pagex, pagey,
rotate, witdh, x, y."""
return self.tk.call((self._w, 'postscript') +
self._options(cnf, kw))
def tag_raise(self, *args):
"""Raise an item TAGORID given in ARGS
(optional above another item)."""
self.tk.call((self._w, 'raise') + args)
lift = tkraise = tag_raise
def scale(self, *args):
"""Scale item TAGORID with XORIGIN, YORIGIN, XSCALE, YSCALE."""
self.tk.call((self._w, 'scale') + args)
def scan_mark(self, x, y):
"""Remember the current X, Y coordinates."""
self.tk.call(self._w, 'scan', 'mark', x, y)
def scan_dragto(self, x, y, gain=10):
"""Adjust the view of the canvas to GAIN times the
difference between X and Y and the coordinates given in
scan_mark."""
self.tk.call(self._w, 'scan', 'dragto', x, y, gain)
def select_adjust(self, tagOrId, index):
"""Adjust the end of the selection near the cursor of an item TAGORID to index."""
self.tk.call(self._w, 'select', 'adjust', tagOrId, index)
def select_clear(self):
"""Clear the selection if it is in this widget."""
self.tk.call(self._w, 'select', 'clear')
def select_from(self, tagOrId, index):
"""Set the fixed end of a selection in item TAGORID to INDEX."""
self.tk.call(self._w, 'select', 'from', tagOrId, index)
def select_item(self):
"""Return the item which has the selection."""
return self.tk.call(self._w, 'select', 'item') or None
def select_to(self, tagOrId, index):
"""Set the variable end of a selection in item TAGORID to INDEX."""
self.tk.call(self._w, 'select', 'to', tagOrId, index)
def type(self, tagOrId):
"""Return the type of the item TAGORID."""
return self.tk.call(self._w, 'type', tagOrId) or None
class Checkbutton(Widget):
"""Checkbutton widget which is either in on- or off-state."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a checkbutton widget with the parent MASTER.
Valid resource names: activebackground, activeforeground, anchor,
background, bd, bg, bitmap, borderwidth, command, cursor,
disabledforeground, fg, font, foreground, height,
highlightbackground, highlightcolor, highlightthickness, image,
indicatoron, justify, offvalue, onvalue, padx, pady, relief,
selectcolor, selectimage, state, takefocus, text, textvariable,
underline, variable, width, wraplength."""
Widget.__init__(self, master, 'checkbutton', cnf, kw)
def deselect(self):
"""Put the button in off-state."""
self.tk.call(self._w, 'deselect')
def flash(self):
"""Flash the button."""
self.tk.call(self._w, 'flash')
def invoke(self):
"""Toggle the button and invoke a command if given as resource."""
return self.tk.call(self._w, 'invoke')
def select(self):
"""Put the button in on-state."""
self.tk.call(self._w, 'select')
def toggle(self):
"""Toggle the button."""
self.tk.call(self._w, 'toggle')
class Entry(Widget, XView):
"""Entry widget which allows to display simple text."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct an entry widget with the parent MASTER.
Valid resource names: background, bd, bg, borderwidth, cursor,
exportselection, fg, font, foreground, highlightbackground,
highlightcolor, highlightthickness, insertbackground,
insertborderwidth, insertofftime, insertontime, insertwidth,
invalidcommand, invcmd, justify, relief, selectbackground,
selectborderwidth, selectforeground, show, state, takefocus,
textvariable, validate, validatecommand, vcmd, width,
xscrollcommand."""
Widget.__init__(self, master, 'entry', cnf, kw)
def delete(self, first, last=None):
"""Delete text from FIRST to LAST (not included)."""
self.tk.call(self._w, 'delete', first, last)
def get(self):
"""Return the text."""
return self.tk.call(self._w, 'get')
def icursor(self, index):
"""Insert cursor at INDEX."""
self.tk.call(self._w, 'icursor', index)
def index(self, index):
"""Return position of cursor."""
return getint(self.tk.call(
self._w, 'index', index))
def insert(self, index, string):
"""Insert STRING at INDEX."""
self.tk.call(self._w, 'insert', index, string)
def scan_mark(self, x):
"""Remember the current X, Y coordinates."""
self.tk.call(self._w, 'scan', 'mark', x)
def scan_dragto(self, x):
"""Adjust the view of the canvas to 10 times the
difference between X and Y and the coordinates given in
scan_mark."""
self.tk.call(self._w, 'scan', 'dragto', x)
def selection_adjust(self, index):
"""Adjust the end of the selection near the cursor to INDEX."""
self.tk.call(self._w, 'selection', 'adjust', index)
select_adjust = selection_adjust
def selection_clear(self):
"""Clear the selection if it is in this widget."""
self.tk.call(self._w, 'selection', 'clear')
select_clear = selection_clear
def selection_from(self, index):
"""Set the fixed end of a selection to INDEX."""
self.tk.call(self._w, 'selection', 'from', index)
select_from = selection_from
def selection_present(self):
"""Return True if there are characters selected in the entry, False
otherwise."""
return self.tk.getboolean(
self.tk.call(self._w, 'selection', 'present'))
select_present = selection_present
def selection_range(self, start, end):
"""Set the selection from START to END (not included)."""
self.tk.call(self._w, 'selection', 'range', start, end)
select_range = selection_range
def selection_to(self, index):
"""Set the variable end of a selection to INDEX."""
self.tk.call(self._w, 'selection', 'to', index)
select_to = selection_to
class Frame(Widget):
"""Frame widget which may contain other widgets and can have a 3D border."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a frame widget with the parent MASTER.
Valid resource names: background, bd, bg, borderwidth, class,
colormap, container, cursor, height, highlightbackground,
highlightcolor, highlightthickness, relief, takefocus, visual, width."""
cnf = _cnfmerge((cnf, kw))
extra = ()
if 'class_' in cnf:
extra = ('-class', cnf['class_'])
del cnf['class_']
elif 'class' in cnf:
extra = ('-class', cnf['class'])
del cnf['class']
Widget.__init__(self, master, 'frame', cnf, {}, extra)
class Label(Widget):
"""Label widget which can display text and bitmaps."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a label widget with the parent MASTER.
STANDARD OPTIONS
activebackground, activeforeground, anchor,
background, bitmap, borderwidth, cursor,
disabledforeground, font, foreground,
highlightbackground, highlightcolor,
highlightthickness, image, justify,
padx, pady, relief, takefocus, text,
textvariable, underline, wraplength
WIDGET-SPECIFIC OPTIONS
height, state, width
"""
Widget.__init__(self, master, 'label', cnf, kw)
class Listbox(Widget, XView, YView):
"""Listbox widget which can display a list of strings."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a listbox widget with the parent MASTER.
Valid resource names: background, bd, bg, borderwidth, cursor,
exportselection, fg, font, foreground, height, highlightbackground,
highlightcolor, highlightthickness, relief, selectbackground,
selectborderwidth, selectforeground, selectmode, setgrid, takefocus,
width, xscrollcommand, yscrollcommand, listvariable."""
Widget.__init__(self, master, 'listbox', cnf, kw)
def activate(self, index):
"""Activate item identified by INDEX."""
self.tk.call(self._w, 'activate', index)
def bbox(self, *args):
"""Return a tuple of X1,Y1,X2,Y2 coordinates for a rectangle
which encloses the item identified by index in ARGS."""
return self._getints(
self.tk.call((self._w, 'bbox') + args)) or None
def curselection(self):
"""Return list of indices of currently selected item."""
# XXX Ought to apply self._getints()...
return self.tk.splitlist(self.tk.call(
self._w, 'curselection'))
def delete(self, first, last=None):
"""Delete items from FIRST to LAST (not included)."""
self.tk.call(self._w, 'delete', first, last)
def get(self, first, last=None):
"""Get list of items from FIRST to LAST (not included)."""
if last:
return self.tk.splitlist(self.tk.call(
self._w, 'get', first, last))
else:
return self.tk.call(self._w, 'get', first)
def index(self, index):
"""Return index of item identified with INDEX."""
i = self.tk.call(self._w, 'index', index)
if i == 'none': return None
return getint(i)
def insert(self, index, *elements):
"""Insert ELEMENTS at INDEX."""
self.tk.call((self._w, 'insert', index) + elements)
def nearest(self, y):
"""Get index of item which is nearest to y coordinate Y."""
return getint(self.tk.call(
self._w, 'nearest', y))
def scan_mark(self, x, y):
"""Remember the current X, Y coordinates."""
self.tk.call(self._w, 'scan', 'mark', x, y)
def scan_dragto(self, x, y):
"""Adjust the view of the listbox to 10 times the
difference between X and Y and the coordinates given in
scan_mark."""
self.tk.call(self._w, 'scan', 'dragto', x, y)
def see(self, index):
"""Scroll such that INDEX is visible."""
self.tk.call(self._w, 'see', index)
def selection_anchor(self, index):
"""Set the fixed end oft the selection to INDEX."""
self.tk.call(self._w, 'selection', 'anchor', index)
select_anchor = selection_anchor
def selection_clear(self, first, last=None):
"""Clear the selection from FIRST to LAST (not included)."""
self.tk.call(self._w,
'selection', 'clear', first, last)
select_clear = selection_clear
def selection_includes(self, index):
"""Return 1 if INDEX is part of the selection."""
return self.tk.getboolean(self.tk.call(
self._w, 'selection', 'includes', index))
select_includes = selection_includes
def selection_set(self, first, last=None):
"""Set the selection from FIRST to LAST (not included) without
changing the currently selected elements."""
self.tk.call(self._w, 'selection', 'set', first, last)
select_set = selection_set
def size(self):
"""Return the number of elements in the listbox."""
return getint(self.tk.call(self._w, 'size'))
def itemcget(self, index, option):
"""Return the resource value for an ITEM and an OPTION."""
return self.tk.call(
(self._w, 'itemcget') + (index, '-'+option))
def itemconfigure(self, index, cnf=None, **kw):
"""Configure resources of an ITEM.
The values for resources are specified as keyword arguments.
To get an overview about the allowed keyword arguments
call the method without arguments.
Valid resource names: background, bg, foreground, fg,
selectbackground, selectforeground."""
return self._configure(('itemconfigure', index), cnf, kw)
itemconfig = itemconfigure
class Menu(Widget):
"""Menu widget which allows to display menu bars, pull-down menus and pop-up menus."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct menu widget with the parent MASTER.
Valid resource names: activebackground, activeborderwidth,
activeforeground, background, bd, bg, borderwidth, cursor,
disabledforeground, fg, font, foreground, postcommand, relief,
selectcolor, takefocus, tearoff, tearoffcommand, title, type."""
Widget.__init__(self, master, 'menu', cnf, kw)
def tk_bindForTraversal(self):
pass # obsolete since Tk 4.0
def tk_mbPost(self):
self.tk.call('tk_mbPost', self._w)
def tk_mbUnpost(self):
self.tk.call('tk_mbUnpost')
def tk_traverseToMenu(self, char):
self.tk.call('tk_traverseToMenu', self._w, char)
def tk_traverseWithinMenu(self, char):
self.tk.call('tk_traverseWithinMenu', self._w, char)
def tk_getMenuButtons(self):
return self.tk.call('tk_getMenuButtons', self._w)
def tk_nextMenu(self, count):
self.tk.call('tk_nextMenu', count)
def tk_nextMenuEntry(self, count):
self.tk.call('tk_nextMenuEntry', count)
def tk_invokeMenu(self):
self.tk.call('tk_invokeMenu', self._w)
def tk_firstMenu(self):
self.tk.call('tk_firstMenu', self._w)
def tk_mbButtonDown(self):
self.tk.call('tk_mbButtonDown', self._w)
def tk_popup(self, x, y, entry=""):
"""Post the menu at position X,Y with entry ENTRY."""
self.tk.call('tk_popup', self._w, x, y, entry)
def activate(self, index):
"""Activate entry at INDEX."""
self.tk.call(self._w, 'activate', index)
def add(self, itemType, cnf={}, **kw):
"""Internal function."""
self.tk.call((self._w, 'add', itemType) +
self._options(cnf, kw))
def add_cascade(self, cnf={}, **kw):
"""Add hierarchical menu item."""
self.add('cascade', cnf or kw)
def add_checkbutton(self, cnf={}, **kw):
"""Add checkbutton menu item."""
self.add('checkbutton', cnf or kw)
def add_command(self, cnf={}, **kw):
"""Add command menu item."""
self.add('command', cnf or kw)
def add_radiobutton(self, cnf={}, **kw):
"""Addd radio menu item."""
self.add('radiobutton', cnf or kw)
def add_separator(self, cnf={}, **kw):
"""Add separator."""
self.add('separator', cnf or kw)
def insert(self, index, itemType, cnf={}, **kw):
"""Internal function."""
self.tk.call((self._w, 'insert', index, itemType) +
self._options(cnf, kw))
def insert_cascade(self, index, cnf={}, **kw):
"""Add hierarchical menu item at INDEX."""
self.insert(index, 'cascade', cnf or kw)
def insert_checkbutton(self, index, cnf={}, **kw):
"""Add checkbutton menu item at INDEX."""
self.insert(index, 'checkbutton', cnf or kw)
def insert_command(self, index, cnf={}, **kw):
"""Add command menu item at INDEX."""
self.insert(index, 'command', cnf or kw)
def insert_radiobutton(self, index, cnf={}, **kw):
"""Addd radio menu item at INDEX."""
self.insert(index, 'radiobutton', cnf or kw)
def insert_separator(self, index, cnf={}, **kw):
"""Add separator at INDEX."""
self.insert(index, 'separator', cnf or kw)
def delete(self, index1, index2=None):
"""Delete menu items between INDEX1 and INDEX2 (included)."""
if index2 is None:
index2 = index1
num_index1, num_index2 = self.index(index1), self.index(index2)
if (num_index1 is None) or (num_index2 is None):
num_index1, num_index2 = 0, -1
for i in range(num_index1, num_index2 + 1):
if 'command' in self.entryconfig(i):
c = str(self.entrycget(i, 'command'))
if c:
self.deletecommand(c)
self.tk.call(self._w, 'delete', index1, index2)
def entrycget(self, index, option):
"""Return the resource value of an menu item for OPTION at INDEX."""
return self.tk.call(self._w, 'entrycget', index, '-' + option)
def entryconfigure(self, index, cnf=None, **kw):
"""Configure a menu item at INDEX."""
return self._configure(('entryconfigure', index), cnf, kw)
entryconfig = entryconfigure
def index(self, index):
"""Return the index of a menu item identified by INDEX."""
i = self.tk.call(self._w, 'index', index)
if i == 'none': return None
return getint(i)
def invoke(self, index):
"""Invoke a menu item identified by INDEX and execute
the associated command."""
return self.tk.call(self._w, 'invoke', index)
def post(self, x, y):
"""Display a menu at position X,Y."""
self.tk.call(self._w, 'post', x, y)
def type(self, index):
"""Return the type of the menu item at INDEX."""
return self.tk.call(self._w, 'type', index)
def unpost(self):
"""Unmap a menu."""
self.tk.call(self._w, 'unpost')
def yposition(self, index):
"""Return the y-position of the topmost pixel of the menu item at INDEX."""
return getint(self.tk.call(
self._w, 'yposition', index))
class Menubutton(Widget):
"""Menubutton widget, obsolete since Tk8.0."""
def __init__(self, master=None, cnf={}, **kw):
Widget.__init__(self, master, 'menubutton', cnf, kw)
class Message(Widget):
"""Message widget to display multiline text. Obsolete since Label does it too."""
def __init__(self, master=None, cnf={}, **kw):
Widget.__init__(self, master, 'message', cnf, kw)
class Radiobutton(Widget):
"""Radiobutton widget which shows only one of several buttons in on-state."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a radiobutton widget with the parent MASTER.
Valid resource names: activebackground, activeforeground, anchor,
background, bd, bg, bitmap, borderwidth, command, cursor,
disabledforeground, fg, font, foreground, height,
highlightbackground, highlightcolor, highlightthickness, image,
indicatoron, justify, padx, pady, relief, selectcolor, selectimage,
state, takefocus, text, textvariable, underline, value, variable,
width, wraplength."""
Widget.__init__(self, master, 'radiobutton', cnf, kw)
def deselect(self):
"""Put the button in off-state."""
self.tk.call(self._w, 'deselect')
def flash(self):
"""Flash the button."""
self.tk.call(self._w, 'flash')
def invoke(self):
"""Toggle the button and invoke a command if given as resource."""
return self.tk.call(self._w, 'invoke')
def select(self):
"""Put the button in on-state."""
self.tk.call(self._w, 'select')
class Scale(Widget):
"""Scale widget which can display a numerical scale."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a scale widget with the parent MASTER.
Valid resource names: activebackground, background, bigincrement, bd,
bg, borderwidth, command, cursor, digits, fg, font, foreground, from,
highlightbackground, highlightcolor, highlightthickness, label,
length, orient, relief, repeatdelay, repeatinterval, resolution,
showvalue, sliderlength, sliderrelief, state, takefocus,
tickinterval, to, troughcolor, variable, width."""
Widget.__init__(self, master, 'scale', cnf, kw)
def get(self):
"""Get the current value as integer or float."""
value = self.tk.call(self._w, 'get')
try:
return getint(value)
except ValueError:
return getdouble(value)
def set(self, value):
"""Set the value to VALUE."""
self.tk.call(self._w, 'set', value)
def coords(self, value=None):
"""Return a tuple (X,Y) of the point along the centerline of the
trough that corresponds to VALUE or the current value if None is
given."""
return self._getints(self.tk.call(self._w, 'coords', value))
def identify(self, x, y):
"""Return where the point X,Y lies. Valid return values are "slider",
"though1" and "though2"."""
return self.tk.call(self._w, 'identify', x, y)
class Scrollbar(Widget):
"""Scrollbar widget which displays a slider at a certain position."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a scrollbar widget with the parent MASTER.
Valid resource names: activebackground, activerelief,
background, bd, bg, borderwidth, command, cursor,
elementborderwidth, highlightbackground,
highlightcolor, highlightthickness, jump, orient,
relief, repeatdelay, repeatinterval, takefocus,
troughcolor, width."""
Widget.__init__(self, master, 'scrollbar', cnf, kw)
def activate(self, index):
"""Display the element at INDEX with activebackground and activerelief.
INDEX can be "arrow1","slider" or "arrow2"."""
self.tk.call(self._w, 'activate', index)
def delta(self, deltax, deltay):
"""Return the fractional change of the scrollbar setting if it
would be moved by DELTAX or DELTAY pixels."""
return getdouble(
self.tk.call(self._w, 'delta', deltax, deltay))
def fraction(self, x, y):
"""Return the fractional value which corresponds to a slider
position of X,Y."""
return getdouble(self.tk.call(self._w, 'fraction', x, y))
def identify(self, x, y):
"""Return the element under position X,Y as one of
"arrow1","slider","arrow2" or ""."""
return self.tk.call(self._w, 'identify', x, y)
def get(self):
"""Return the current fractional values (upper and lower end)
of the slider position."""
return self._getdoubles(self.tk.call(self._w, 'get'))
def set(self, *args):
"""Set the fractional values of the slider position (upper and
lower ends as value between 0 and 1)."""
self.tk.call((self._w, 'set') + args)
class Text(Widget, XView, YView):
"""Text widget which can display text in various forms."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a text widget with the parent MASTER.
STANDARD OPTIONS
background, borderwidth, cursor,
exportselection, font, foreground,
highlightbackground, highlightcolor,
highlightthickness, insertbackground,
insertborderwidth, insertofftime,
insertontime, insertwidth, padx, pady,
relief, selectbackground,
selectborderwidth, selectforeground,
setgrid, takefocus,
xscrollcommand, yscrollcommand,
WIDGET-SPECIFIC OPTIONS
autoseparators, height, maxundo,
spacing1, spacing2, spacing3,
state, tabs, undo, width, wrap,
"""
Widget.__init__(self, master, 'text', cnf, kw)
def bbox(self, *args):
"""Return a tuple of (x,y,width,height) which gives the bounding
box of the visible part of the character at the index in ARGS."""
return self._getints(
self.tk.call((self._w, 'bbox') + args)) or None
def tk_textSelectTo(self, index):
self.tk.call('tk_textSelectTo', self._w, index)
def tk_textBackspace(self):
self.tk.call('tk_textBackspace', self._w)
def tk_textIndexCloser(self, a, b, c):
self.tk.call('tk_textIndexCloser', self._w, a, b, c)
def tk_textResetAnchor(self, index):
self.tk.call('tk_textResetAnchor', self._w, index)
def compare(self, index1, op, index2):
"""Return whether between index INDEX1 and index INDEX2 the
relation OP is satisfied. OP is one of <, <=, ==, >=, >, or !=."""
return self.tk.getboolean(self.tk.call(
self._w, 'compare', index1, op, index2))
def debug(self, boolean=None):
"""Turn on the internal consistency checks of the B-Tree inside the text
widget according to BOOLEAN."""
return self.tk.getboolean(self.tk.call(
self._w, 'debug', boolean))
def delete(self, index1, index2=None):
"""Delete the characters between INDEX1 and INDEX2 (not included)."""
self.tk.call(self._w, 'delete', index1, index2)
def dlineinfo(self, index):
"""Return tuple (x,y,width,height,baseline) giving the bounding box
and baseline position of the visible part of the line containing
the character at INDEX."""
return self._getints(self.tk.call(self._w, 'dlineinfo', index))
def dump(self, index1, index2=None, command=None, **kw):
"""Return the contents of the widget between index1 and index2.
The type of contents returned in filtered based on the keyword
parameters; if 'all', 'image', 'mark', 'tag', 'text', or 'window' are
given and true, then the corresponding items are returned. The result
is a list of triples of the form (key, value, index). If none of the
keywords are true then 'all' is used by default.
If the 'command' argument is given, it is called once for each element
of the list of triples, with the values of each triple serving as the
arguments to the function. In this case the list is not returned."""
args = []
func_name = None
result = None
if not command:
# Never call the dump command without the -command flag, since the
# output could involve Tcl quoting and would be a pain to parse
# right. Instead just set the command to build a list of triples
# as if we had done the parsing.
result = []
def append_triple(key, value, index, result=result):
result.append((key, value, index))
command = append_triple
try:
if not isinstance(command, str):
func_name = command = self._register(command)
args += ["-command", command]
for key in kw:
if kw[key]: args.append("-" + key)
args.append(index1)
if index2:
args.append(index2)
self.tk.call(self._w, "dump", *args)
return result
finally:
if func_name:
self.deletecommand(func_name)
## new in tk8.4
def edit(self, *args):
"""Internal method
This method controls the undo mechanism and
the modified flag. The exact behavior of the
command depends on the option argument that
follows the edit argument. The following forms
of the command are currently supported:
edit_modified, edit_redo, edit_reset, edit_separator
and edit_undo
"""
return self.tk.call(self._w, 'edit', *args)
def edit_modified(self, arg=None):
"""Get or Set the modified flag
If arg is not specified, returns the modified
flag of the widget. The insert, delete, edit undo and
edit redo commands or the user can set or clear the
modified flag. If boolean is specified, sets the
modified flag of the widget to arg.
"""
return self.edit("modified", arg)
def edit_redo(self):
"""Redo the last undone edit
When the undo option is true, reapplies the last
undone edits provided no other edits were done since
then. Generates an error when the redo stack is empty.
Does nothing when the undo option is false.
"""
return self.edit("redo")
def edit_reset(self):
"""Clears the undo and redo stacks
"""
return self.edit("reset")
def edit_separator(self):
"""Inserts a separator (boundary) on the undo stack.
Does nothing when the undo option is false
"""
return self.edit("separator")
def edit_undo(self):
"""Undoes the last edit action
If the undo option is true. An edit action is defined
as all the insert and delete commands that are recorded
on the undo stack in between two separators. Generates
an error when the undo stack is empty. Does nothing
when the undo option is false
"""
return self.edit("undo")
def get(self, index1, index2=None):
"""Return the text from INDEX1 to INDEX2 (not included)."""
return self.tk.call(self._w, 'get', index1, index2)
# (Image commands are new in 8.0)
def image_cget(self, index, option):
"""Return the value of OPTION of an embedded image at INDEX."""
if option[:1] != "-":
option = "-" + option
if option[-1:] == "_":
option = option[:-1]
return self.tk.call(self._w, "image", "cget", index, option)
def image_configure(self, index, cnf=None, **kw):
"""Configure an embedded image at INDEX."""
return self._configure(('image', 'configure', index), cnf, kw)
def image_create(self, index, cnf={}, **kw):
"""Create an embedded image at INDEX."""
return self.tk.call(
self._w, "image", "create", index,
*self._options(cnf, kw))
def image_names(self):
"""Return all names of embedded images in this widget."""
return self.tk.call(self._w, "image", "names")
def index(self, index):
"""Return the index in the form line.char for INDEX."""
return str(self.tk.call(self._w, 'index', index))
def insert(self, index, chars, *args):
"""Insert CHARS before the characters at INDEX. An additional
tag can be given in ARGS. Additional CHARS and tags can follow in ARGS."""
self.tk.call((self._w, 'insert', index, chars) + args)
def mark_gravity(self, markName, direction=None):
"""Change the gravity of a mark MARKNAME to DIRECTION (LEFT or RIGHT).
Return the current value if None is given for DIRECTION."""
return self.tk.call(
(self._w, 'mark', 'gravity', markName, direction))
def mark_names(self):
"""Return all mark names."""
return self.tk.splitlist(self.tk.call(
self._w, 'mark', 'names'))
def mark_set(self, markName, index):
"""Set mark MARKNAME before the character at INDEX."""
self.tk.call(self._w, 'mark', 'set', markName, index)
def mark_unset(self, *markNames):
"""Delete all marks in MARKNAMES."""
self.tk.call((self._w, 'mark', 'unset') + markNames)
def mark_next(self, index):
"""Return the name of the next mark after INDEX."""
return self.tk.call(self._w, 'mark', 'next', index) or None
def mark_previous(self, index):
"""Return the name of the previous mark before INDEX."""
return self.tk.call(self._w, 'mark', 'previous', index) or None
def scan_mark(self, x, y):
"""Remember the current X, Y coordinates."""
self.tk.call(self._w, 'scan', 'mark', x, y)
def scan_dragto(self, x, y):
"""Adjust the view of the text to 10 times the
difference between X and Y and the coordinates given in
scan_mark."""
self.tk.call(self._w, 'scan', 'dragto', x, y)
def search(self, pattern, index, stopindex=None,
forwards=None, backwards=None, exact=None,
regexp=None, nocase=None, count=None, elide=None):
"""Search PATTERN beginning from INDEX until STOPINDEX.
Return the index of the first character of a match or an
empty string."""
args = [self._w, 'search']
if forwards: args.append('-forwards')
if backwards: args.append('-backwards')
if exact: args.append('-exact')
if regexp: args.append('-regexp')
if nocase: args.append('-nocase')
if elide: args.append('-elide')
if count: args.append('-count'); args.append(count)
if pattern and pattern[0] == '-': args.append('--')
args.append(pattern)
args.append(index)
if stopindex: args.append(stopindex)
return str(self.tk.call(tuple(args)))
def see(self, index):
"""Scroll such that the character at INDEX is visible."""
self.tk.call(self._w, 'see', index)
def tag_add(self, tagName, index1, *args):
"""Add tag TAGNAME to all characters between INDEX1 and index2 in ARGS.
Additional pairs of indices may follow in ARGS."""
self.tk.call(
(self._w, 'tag', 'add', tagName, index1) + args)
def tag_unbind(self, tagName, sequence, funcid=None):
"""Unbind for all characters with TAGNAME for event SEQUENCE the
function identified with FUNCID."""
self.tk.call(self._w, 'tag', 'bind', tagName, sequence, '')
if funcid:
self.deletecommand(funcid)
def tag_bind(self, tagName, sequence, func, add=None):
"""Bind to all characters with TAGNAME at event SEQUENCE a call to function FUNC.
An additional boolean parameter ADD specifies whether FUNC will be
called additionally to the other bound function or whether it will
replace the previous function. See bind for the return value."""
return self._bind((self._w, 'tag', 'bind', tagName),
sequence, func, add)
def tag_cget(self, tagName, option):
"""Return the value of OPTION for tag TAGNAME."""
if option[:1] != '-':
option = '-' + option
if option[-1:] == '_':
option = option[:-1]
return self.tk.call(self._w, 'tag', 'cget', tagName, option)
def tag_configure(self, tagName, cnf=None, **kw):
"""Configure a tag TAGNAME."""
return self._configure(('tag', 'configure', tagName), cnf, kw)
tag_config = tag_configure
def tag_delete(self, *tagNames):
"""Delete all tags in TAGNAMES."""
self.tk.call((self._w, 'tag', 'delete') + tagNames)
def tag_lower(self, tagName, belowThis=None):
"""Change the priority of tag TAGNAME such that it is lower
than the priority of BELOWTHIS."""
self.tk.call(self._w, 'tag', 'lower', tagName, belowThis)
def tag_names(self, index=None):
"""Return a list of all tag names."""
return self.tk.splitlist(
self.tk.call(self._w, 'tag', 'names', index))
def tag_nextrange(self, tagName, index1, index2=None):
"""Return a list of start and end index for the first sequence of
characters between INDEX1 and INDEX2 which all have tag TAGNAME.
The text is searched forward from INDEX1."""
return self.tk.splitlist(self.tk.call(
self._w, 'tag', 'nextrange', tagName, index1, index2))
def tag_prevrange(self, tagName, index1, index2=None):
"""Return a list of start and end index for the first sequence of
characters between INDEX1 and INDEX2 which all have tag TAGNAME.
The text is searched backwards from INDEX1."""
return self.tk.splitlist(self.tk.call(
self._w, 'tag', 'prevrange', tagName, index1, index2))
def tag_raise(self, tagName, aboveThis=None):
"""Change the priority of tag TAGNAME such that it is higher
than the priority of ABOVETHIS."""
self.tk.call(
self._w, 'tag', 'raise', tagName, aboveThis)
def tag_ranges(self, tagName):
"""Return a list of ranges of text which have tag TAGNAME."""
return self.tk.splitlist(self.tk.call(
self._w, 'tag', 'ranges', tagName))
def tag_remove(self, tagName, index1, index2=None):
"""Remove tag TAGNAME from all characters between INDEX1 and INDEX2."""
self.tk.call(
self._w, 'tag', 'remove', tagName, index1, index2)
def window_cget(self, index, option):
"""Return the value of OPTION of an embedded window at INDEX."""
if option[:1] != '-':
option = '-' + option
if option[-1:] == '_':
option = option[:-1]
return self.tk.call(self._w, 'window', 'cget', index, option)
def window_configure(self, index, cnf=None, **kw):
"""Configure an embedded window at INDEX."""
return self._configure(('window', 'configure', index), cnf, kw)
window_config = window_configure
def window_create(self, index, cnf={}, **kw):
"""Create a window at INDEX."""
self.tk.call(
(self._w, 'window', 'create', index)
+ self._options(cnf, kw))
def window_names(self):
"""Return all names of embedded windows in this widget."""
return self.tk.splitlist(
self.tk.call(self._w, 'window', 'names'))
def yview_pickplace(self, *what):
"""Obsolete function, use see."""
self.tk.call((self._w, 'yview', '-pickplace') + what)
class _setit:
"""Internal class. It wraps the command in the widget OptionMenu."""
def __init__(self, var, value, callback=None):
self.__value = value
self.__var = var
self.__callback = callback
def __call__(self, *args):
self.__var.set(self.__value)
if self.__callback:
self.__callback(self.__value, *args)
class OptionMenu(Menubutton):
"""OptionMenu which allows the user to select a value from a menu."""
def __init__(self, master, variable, value, *values, **kwargs):
"""Construct an optionmenu widget with the parent MASTER, with
the resource textvariable set to VARIABLE, the initially selected
value VALUE, the other menu values VALUES and an additional
keyword argument command."""
kw = {"borderwidth": 2, "textvariable": variable,
"indicatoron": 1, "relief": RAISED, "anchor": "c",
"highlightthickness": 2}
Widget.__init__(self, master, "menubutton", kw)
self.widgetName = 'tk_optionMenu'
menu = self.__menu = Menu(self, name="menu", tearoff=0)
self.menuname = menu._w
# 'command' is the only supported keyword
callback = kwargs.get('command')
if 'command' in kwargs:
del kwargs['command']
if kwargs:
raise TclError, 'unknown option -'+kwargs.keys()[0]
menu.add_command(label=value,
command=_setit(variable, value, callback))
for v in values:
menu.add_command(label=v,
command=_setit(variable, v, callback))
self["menu"] = menu
def __getitem__(self, name):
if name == 'menu':
return self.__menu
return Widget.__getitem__(self, name)
def destroy(self):
"""Destroy this widget and the associated menu."""
Menubutton.destroy(self)
self.__menu = None
class Image:
"""Base class for images."""
_last_id = 0
def __init__(self, imgtype, name=None, cnf={}, master=None, **kw):
self.name = None
if not master:
master = _default_root
if not master:
raise RuntimeError, 'Too early to create image'
self.tk = master.tk
if not name:
Image._last_id += 1
name = "pyimage%r" % (Image._last_id,) # tk itself would use image<x>
# The following is needed for systems where id(x)
# can return a negative number, such as Linux/m68k:
if name[0] == '-': name = '_' + name[1:]
if kw and cnf: cnf = _cnfmerge((cnf, kw))
elif kw: cnf = kw
options = ()
for k, v in cnf.items():
if hasattr(v, '__call__'):
v = self._register(v)
options = options + ('-'+k, v)
self.tk.call(('image', 'create', imgtype, name,) + options)
self.name = name
def __str__(self): return self.name
def __del__(self):
if self.name:
try:
self.tk.call('image', 'delete', self.name)
except TclError:
# May happen if the root was destroyed
pass
def __setitem__(self, key, value):
self.tk.call(self.name, 'configure', '-'+key, value)
def __getitem__(self, key):
return self.tk.call(self.name, 'configure', '-'+key)
def configure(self, **kw):
"""Configure the image."""
res = ()
for k, v in _cnfmerge(kw).items():
if v is not None:
if k[-1] == '_': k = k[:-1]
if hasattr(v, '__call__'):
v = self._register(v)
res = res + ('-'+k, v)
self.tk.call((self.name, 'config') + res)
config = configure
def height(self):
"""Return the height of the image."""
return getint(
self.tk.call('image', 'height', self.name))
def type(self):
"""Return the type of the imgage, e.g. "photo" or "bitmap"."""
return self.tk.call('image', 'type', self.name)
def width(self):
"""Return the width of the image."""
return getint(
self.tk.call('image', 'width', self.name))
class PhotoImage(Image):
"""Widget which can display colored images in GIF, PPM/PGM format."""
def __init__(self, name=None, cnf={}, master=None, **kw):
"""Create an image with NAME.
Valid resource names: data, format, file, gamma, height, palette,
width."""
Image.__init__(self, 'photo', name, cnf, master, **kw)
def blank(self):
"""Display a transparent image."""
self.tk.call(self.name, 'blank')
def cget(self, option):
"""Return the value of OPTION."""
return self.tk.call(self.name, 'cget', '-' + option)
# XXX config
def __getitem__(self, key):
return self.tk.call(self.name, 'cget', '-' + key)
# XXX copy -from, -to, ...?
def copy(self):
"""Return a new PhotoImage with the same image as this widget."""
destImage = PhotoImage()
self.tk.call(destImage, 'copy', self.name)
return destImage
def zoom(self,x,y=''):
"""Return a new PhotoImage with the same image as this widget
but zoom it with X and Y."""
destImage = PhotoImage()
if y=='': y=x
self.tk.call(destImage, 'copy', self.name, '-zoom',x,y)
return destImage
def subsample(self,x,y=''):
"""Return a new PhotoImage based on the same image as this widget
but use only every Xth or Yth pixel."""
destImage = PhotoImage()
if y=='': y=x
self.tk.call(destImage, 'copy', self.name, '-subsample',x,y)
return destImage
def get(self, x, y):
"""Return the color (red, green, blue) of the pixel at X,Y."""
return self.tk.call(self.name, 'get', x, y)
def put(self, data, to=None):
"""Put row formatted colors to image starting from
position TO, e.g. image.put("{red green} {blue yellow}", to=(4,6))"""
args = (self.name, 'put', data)
if to:
if to[0] == '-to':
to = to[1:]
args = args + ('-to',) + tuple(to)
self.tk.call(args)
# XXX read
def write(self, filename, format=None, from_coords=None):
"""Write image to file FILENAME in FORMAT starting from
position FROM_COORDS."""
args = (self.name, 'write', filename)
if format:
args = args + ('-format', format)
if from_coords:
args = args + ('-from',) + tuple(from_coords)
self.tk.call(args)
class BitmapImage(Image):
"""Widget which can display a bitmap."""
def __init__(self, name=None, cnf={}, master=None, **kw):
"""Create a bitmap with NAME.
Valid resource names: background, data, file, foreground, maskdata, maskfile."""
Image.__init__(self, 'bitmap', name, cnf, master, **kw)
def image_names(): return _default_root.tk.call('image', 'names')
def image_types(): return _default_root.tk.call('image', 'types')
class Spinbox(Widget, XView):
"""spinbox widget."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a spinbox widget with the parent MASTER.
STANDARD OPTIONS
activebackground, background, borderwidth,
cursor, exportselection, font, foreground,
highlightbackground, highlightcolor,
highlightthickness, insertbackground,
insertborderwidth, insertofftime,
insertontime, insertwidth, justify, relief,
repeatdelay, repeatinterval,
selectbackground, selectborderwidth
selectforeground, takefocus, textvariable
xscrollcommand.
WIDGET-SPECIFIC OPTIONS
buttonbackground, buttoncursor,
buttondownrelief, buttonuprelief,
command, disabledbackground,
disabledforeground, format, from,
invalidcommand, increment,
readonlybackground, state, to,
validate, validatecommand values,
width, wrap,
"""
Widget.__init__(self, master, 'spinbox', cnf, kw)
def bbox(self, index):
"""Return a tuple of X1,Y1,X2,Y2 coordinates for a
rectangle which encloses the character given by index.
The first two elements of the list give the x and y
coordinates of the upper-left corner of the screen
area covered by the character (in pixels relative
to the widget) and the last two elements give the
width and height of the character, in pixels. The
bounding box may refer to a region outside the
visible area of the window.
"""
return self.tk.call(self._w, 'bbox', index)
def delete(self, first, last=None):
"""Delete one or more elements of the spinbox.
First is the index of the first character to delete,
and last is the index of the character just after
the last one to delete. If last isn't specified it
defaults to first+1, i.e. a single character is
deleted. This command returns an empty string.
"""
return self.tk.call(self._w, 'delete', first, last)
def get(self):
"""Returns the spinbox's string"""
return self.tk.call(self._w, 'get')
def icursor(self, index):
"""Alter the position of the insertion cursor.
The insertion cursor will be displayed just before
the character given by index. Returns an empty string
"""
return self.tk.call(self._w, 'icursor', index)
def identify(self, x, y):
"""Returns the name of the widget at position x, y
Return value is one of: none, buttondown, buttonup, entry
"""
return self.tk.call(self._w, 'identify', x, y)
def index(self, index):
"""Returns the numerical index corresponding to index
"""
return self.tk.call(self._w, 'index', index)
def insert(self, index, s):
"""Insert string s at index
Returns an empty string.
"""
return self.tk.call(self._w, 'insert', index, s)
def invoke(self, element):
"""Causes the specified element to be invoked
The element could be buttondown or buttonup
triggering the action associated with it.
"""
return self.tk.call(self._w, 'invoke', element)
def scan(self, *args):
"""Internal function."""
return self._getints(
self.tk.call((self._w, 'scan') + args)) or ()
def scan_mark(self, x):
"""Records x and the current view in the spinbox window;
used in conjunction with later scan dragto commands.
Typically this command is associated with a mouse button
press in the widget. It returns an empty string.
"""
return self.scan("mark", x)
def scan_dragto(self, x):
"""Compute the difference between the given x argument
and the x argument to the last scan mark command
It then adjusts the view left or right by 10 times the
difference in x-coordinates. This command is typically
associated with mouse motion events in the widget, to
produce the effect of dragging the spinbox at high speed
through the window. The return value is an empty string.
"""
return self.scan("dragto", x)
def selection(self, *args):
"""Internal function."""
return self._getints(
self.tk.call((self._w, 'selection') + args)) or ()
def selection_adjust(self, index):
"""Locate the end of the selection nearest to the character
given by index,
Then adjust that end of the selection to be at index
(i.e including but not going beyond index). The other
end of the selection is made the anchor point for future
select to commands. If the selection isn't currently in
the spinbox, then a new selection is created to include
the characters between index and the most recent selection
anchor point, inclusive. Returns an empty string.
"""
return self.selection("adjust", index)
def selection_clear(self):
"""Clear the selection
If the selection isn't in this widget then the
command has no effect. Returns an empty string.
"""
return self.selection("clear")
def selection_element(self, element=None):
"""Sets or gets the currently selected element.
If a spinbutton element is specified, it will be
displayed depressed
"""
return self.selection("element", element)
###########################################################################
class LabelFrame(Widget):
"""labelframe widget."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a labelframe widget with the parent MASTER.
STANDARD OPTIONS
borderwidth, cursor, font, foreground,
highlightbackground, highlightcolor,
highlightthickness, padx, pady, relief,
takefocus, text
WIDGET-SPECIFIC OPTIONS
background, class, colormap, container,
height, labelanchor, labelwidget,
visual, width
"""
Widget.__init__(self, master, 'labelframe', cnf, kw)
########################################################################
class PanedWindow(Widget):
"""panedwindow widget."""
def __init__(self, master=None, cnf={}, **kw):
"""Construct a panedwindow widget with the parent MASTER.
STANDARD OPTIONS
background, borderwidth, cursor, height,
orient, relief, width
WIDGET-SPECIFIC OPTIONS
handlepad, handlesize, opaqueresize,
sashcursor, sashpad, sashrelief,
sashwidth, showhandle,
"""
Widget.__init__(self, master, 'panedwindow', cnf, kw)
def add(self, child, **kw):
"""Add a child widget to the panedwindow in a new pane.
The child argument is the name of the child widget
followed by pairs of arguments that specify how to
manage the windows. The possible options and values
are the ones accepted by the paneconfigure method.
"""
self.tk.call((self._w, 'add', child) + self._options(kw))
def remove(self, child):
"""Remove the pane containing child from the panedwindow
All geometry management options for child will be forgotten.
"""
self.tk.call(self._w, 'forget', child)
forget=remove
def identify(self, x, y):
"""Identify the panedwindow component at point x, y
If the point is over a sash or a sash handle, the result
is a two element list containing the index of the sash or
handle, and a word indicating whether it is over a sash
or a handle, such as {0 sash} or {2 handle}. If the point
is over any other part of the panedwindow, the result is
an empty list.
"""
return self.tk.call(self._w, 'identify', x, y)
def proxy(self, *args):
"""Internal function."""
return self._getints(
self.tk.call((self._w, 'proxy') + args)) or ()
def proxy_coord(self):
"""Return the x and y pair of the most recent proxy location
"""
return self.proxy("coord")
def proxy_forget(self):
"""Remove the proxy from the display.
"""
return self.proxy("forget")
def proxy_place(self, x, y):
"""Place the proxy at the given x and y coordinates.
"""
return self.proxy("place", x, y)
def sash(self, *args):
"""Internal function."""
return self._getints(
self.tk.call((self._w, 'sash') + args)) or ()
def sash_coord(self, index):
"""Return the current x and y pair for the sash given by index.
Index must be an integer between 0 and 1 less than the
number of panes in the panedwindow. The coordinates given are
those of the top left corner of the region containing the sash.
pathName sash dragto index x y This command computes the
difference between the given coordinates and the coordinates
given to the last sash coord command for the given sash. It then
moves that sash the computed difference. The return value is the
empty string.
"""
return self.sash("coord", index)
def sash_mark(self, index):
"""Records x and y for the sash given by index;
Used in conjunction with later dragto commands to move the sash.
"""
return self.sash("mark", index)
def sash_place(self, index, x, y):
"""Place the sash given by index at the given coordinates
"""
return self.sash("place", index, x, y)
def panecget(self, child, option):
"""Query a management option for window.
Option may be any value allowed by the paneconfigure subcommand
"""
return self.tk.call(
(self._w, 'panecget') + (child, '-'+option))
def paneconfigure(self, tagOrId, cnf=None, **kw):
"""Query or modify the management options for window.
If no option is specified, returns a list describing all
of the available options for pathName. If option is
specified with no value, then the command returns a list
describing the one named option (this list will be identical
to the corresponding sublist of the value returned if no
option is specified). If one or more option-value pairs are
specified, then the command modifies the given widget
option(s) to have the given value(s); in this case the
command returns an empty string. The following options
are supported:
after window
Insert the window after the window specified. window
should be the name of a window already managed by pathName.
before window
Insert the window before the window specified. window
should be the name of a window already managed by pathName.
height size
Specify a height for the window. The height will be the
outer dimension of the window including its border, if
any. If size is an empty string, or if -height is not
specified, then the height requested internally by the
window will be used initially; the height may later be
adjusted by the movement of sashes in the panedwindow.
Size may be any value accepted by Tk_GetPixels.
minsize n
Specifies that the size of the window cannot be made
less than n. This constraint only affects the size of
the widget in the paned dimension -- the x dimension
for horizontal panedwindows, the y dimension for
vertical panedwindows. May be any value accepted by
Tk_GetPixels.
padx n
Specifies a non-negative value indicating how much
extra space to leave on each side of the window in
the X-direction. The value may have any of the forms
accepted by Tk_GetPixels.
pady n
Specifies a non-negative value indicating how much
extra space to leave on each side of the window in
the Y-direction. The value may have any of the forms
accepted by Tk_GetPixels.
sticky style
If a window's pane is larger than the requested
dimensions of the window, this option may be used
to position (or stretch) the window within its pane.
Style is a string that contains zero or more of the
characters n, s, e or w. The string can optionally
contains spaces or commas, but they are ignored. Each
letter refers to a side (north, south, east, or west)
that the window will "stick" to. If both n and s
(or e and w) are specified, the window will be
stretched to fill the entire height (or width) of
its cavity.
width size
Specify a width for the window. The width will be
the outer dimension of the window including its
border, if any. If size is an empty string, or
if -width is not specified, then the width requested
internally by the window will be used initially; the
width may later be adjusted by the movement of sashes
in the panedwindow. Size may be any value accepted by
Tk_GetPixels.
"""
if cnf is None and not kw:
cnf = {}
for x in self.tk.split(
self.tk.call(self._w,
'paneconfigure', tagOrId)):
cnf[x[0][1:]] = (x[0][1:],) + x[1:]
return cnf
if type(cnf) == StringType and not kw:
x = self.tk.split(self.tk.call(
self._w, 'paneconfigure', tagOrId, '-'+cnf))
return (x[0][1:],) + x[1:]
self.tk.call((self._w, 'paneconfigure', tagOrId) +
self._options(cnf, kw))
paneconfig = paneconfigure
def panes(self):
"""Returns an ordered list of the child panes."""
return self.tk.call(self._w, 'panes')
######################################################################
# Extensions:
class Studbutton(Button):
def __init__(self, master=None, cnf={}, **kw):
Widget.__init__(self, master, 'studbutton', cnf, kw)
self.bind('<Any-Enter>', self.tkButtonEnter)
self.bind('<Any-Leave>', self.tkButtonLeave)
self.bind('<1>', self.tkButtonDown)
self.bind('<ButtonRelease-1>', self.tkButtonUp)
class Tributton(Button):
def __init__(self, master=None, cnf={}, **kw):
Widget.__init__(self, master, 'tributton', cnf, kw)
self.bind('<Any-Enter>', self.tkButtonEnter)
self.bind('<Any-Leave>', self.tkButtonLeave)
self.bind('<1>', self.tkButtonDown)
self.bind('<ButtonRelease-1>', self.tkButtonUp)
self['fg'] = self['bg']
self['activebackground'] = self['bg']
######################################################################
# Test:
def _test():
root = Tk()
text = "This is Tcl/Tk version %s" % TclVersion
if TclVersion >= 8.1:
try:
text = text + unicode("\nThis should be a cedilla: \347",
"iso-8859-1")
except NameError:
pass # no unicode support
label = Label(root, text=text)
label.pack()
test = Button(root, text="Click me!",
command=lambda root=root: root.test.configure(
text="[%s]" % root.test['text']))
test.pack()
root.test = test
quit = Button(root, text="QUIT", command=root.destroy)
quit.pack()
# The following three commands are needed so the window pops
# up on top on Windows...
root.iconify()
root.update()
root.deiconify()
root.mainloop()
if __name__ == '__main__':
_test()
| Python |
# tk common colour chooser dialogue
#
# this module provides an interface to the native color dialogue
# available in Tk 4.2 and newer.
#
# written by Fredrik Lundh, May 1997
#
# fixed initialcolor handling in August 1998
#
#
# options (all have default values):
#
# - initialcolor: colour to mark as selected when dialog is displayed
# (given as an RGB triplet or a Tk color string)
#
# - parent: which window to place the dialog on top of
#
# - title: dialog title
#
from tkCommonDialog import Dialog
#
# color chooser class
class Chooser(Dialog):
"Ask for a color"
command = "tk_chooseColor"
def _fixoptions(self):
try:
# make sure initialcolor is a tk color string
color = self.options["initialcolor"]
if isinstance(color, tuple):
# assume an RGB triplet
self.options["initialcolor"] = "#%02x%02x%02x" % color
except KeyError:
pass
def _fixresult(self, widget, result):
# result can be somethings: an empty tuple, an empty string or
# a Tcl_Obj, so this somewhat weird check handles that
if not result or not str(result):
return None, None # canceled
# to simplify application code, the color chooser returns
# an RGB tuple together with the Tk color string
r, g, b = widget.winfo_rgb(result)
return (r/256, g/256, b/256), str(result)
#
# convenience stuff
def askcolor(color = None, **options):
"Ask for a color"
if color:
options = options.copy()
options["initialcolor"] = color
return Chooser(**options).show()
# --------------------------------------------------------------------
# test stuff
if __name__ == "__main__":
print "color", askcolor()
| Python |
#
# An Introduction to Tkinter
# tkSimpleDialog.py
#
# Copyright (c) 1997 by Fredrik Lundh
#
# fredrik@pythonware.com
# http://www.pythonware.com
#
# --------------------------------------------------------------------
# dialog base class
'''Dialog boxes
This module handles dialog boxes. It contains the following
public symbols:
Dialog -- a base class for dialogs
askinteger -- get an integer from the user
askfloat -- get a float from the user
askstring -- get a string from the user
'''
from Tkinter import *
class Dialog(Toplevel):
'''Class to open dialogs.
This class is intended as a base class for custom dialogs
'''
def __init__(self, parent, title = None):
'''Initialize a dialog.
Arguments:
parent -- a parent window (the application window)
title -- the dialog title
'''
Toplevel.__init__(self, parent)
self.withdraw() # remain invisible for now
# If the master is not viewable, don't
# make the child transient, or else it
# would be opened withdrawn
if parent.winfo_viewable():
self.transient(parent)
if title:
self.title(title)
self.parent = parent
self.result = None
body = Frame(self)
self.initial_focus = self.body(body)
body.pack(padx=5, pady=5)
self.buttonbox()
if not self.initial_focus:
self.initial_focus = self
self.protocol("WM_DELETE_WINDOW", self.cancel)
if self.parent is not None:
self.geometry("+%d+%d" % (parent.winfo_rootx()+50,
parent.winfo_rooty()+50))
self.deiconify() # become visibile now
self.initial_focus.focus_set()
# wait for window to appear on screen before calling grab_set
self.wait_visibility()
self.grab_set()
self.wait_window(self)
def destroy(self):
'''Destroy the window'''
self.initial_focus = None
Toplevel.destroy(self)
#
# construction hooks
def body(self, master):
'''create dialog body.
return widget that should have initial focus.
This method should be overridden, and is called
by the __init__ method.
'''
pass
def buttonbox(self):
'''add standard button box.
override if you do not want the standard buttons
'''
box = Frame(self)
w = Button(box, text="OK", width=10, command=self.ok, default=ACTIVE)
w.pack(side=LEFT, padx=5, pady=5)
w = Button(box, text="Cancel", width=10, command=self.cancel)
w.pack(side=LEFT, padx=5, pady=5)
self.bind("<Return>", self.ok)
self.bind("<Escape>", self.cancel)
box.pack()
#
# standard button semantics
def ok(self, event=None):
if not self.validate():
self.initial_focus.focus_set() # put focus back
return
self.withdraw()
self.update_idletasks()
try:
self.apply()
finally:
self.cancel()
def cancel(self, event=None):
# put focus back to the parent window
if self.parent is not None:
self.parent.focus_set()
self.destroy()
#
# command hooks
def validate(self):
'''validate the data
This method is called automatically to validate the data before the
dialog is destroyed. By default, it always validates OK.
'''
return 1 # override
def apply(self):
'''process the data
This method is called automatically to process the data, *after*
the dialog is destroyed. By default, it does nothing.
'''
pass # override
# --------------------------------------------------------------------
# convenience dialogues
class _QueryDialog(Dialog):
def __init__(self, title, prompt,
initialvalue=None,
minvalue = None, maxvalue = None,
parent = None):
if not parent:
import Tkinter
parent = Tkinter._default_root
self.prompt = prompt
self.minvalue = minvalue
self.maxvalue = maxvalue
self.initialvalue = initialvalue
Dialog.__init__(self, parent, title)
def destroy(self):
self.entry = None
Dialog.destroy(self)
def body(self, master):
w = Label(master, text=self.prompt, justify=LEFT)
w.grid(row=0, padx=5, sticky=W)
self.entry = Entry(master, name="entry")
self.entry.grid(row=1, padx=5, sticky=W+E)
if self.initialvalue:
self.entry.insert(0, self.initialvalue)
self.entry.select_range(0, END)
return self.entry
def validate(self):
import tkMessageBox
try:
result = self.getresult()
except ValueError:
tkMessageBox.showwarning(
"Illegal value",
self.errormessage + "\nPlease try again",
parent = self
)
return 0
if self.minvalue is not None and result < self.minvalue:
tkMessageBox.showwarning(
"Too small",
"The allowed minimum value is %s. "
"Please try again." % self.minvalue,
parent = self
)
return 0
if self.maxvalue is not None and result > self.maxvalue:
tkMessageBox.showwarning(
"Too large",
"The allowed maximum value is %s. "
"Please try again." % self.maxvalue,
parent = self
)
return 0
self.result = result
return 1
class _QueryInteger(_QueryDialog):
errormessage = "Not an integer."
def getresult(self):
return int(self.entry.get())
def askinteger(title, prompt, **kw):
'''get an integer from the user
Arguments:
title -- the dialog title
prompt -- the label text
**kw -- see SimpleDialog class
Return value is an integer
'''
d = _QueryInteger(title, prompt, **kw)
return d.result
class _QueryFloat(_QueryDialog):
errormessage = "Not a floating point value."
def getresult(self):
return float(self.entry.get())
def askfloat(title, prompt, **kw):
'''get a float from the user
Arguments:
title -- the dialog title
prompt -- the label text
**kw -- see SimpleDialog class
Return value is a float
'''
d = _QueryFloat(title, prompt, **kw)
return d.result
class _QueryString(_QueryDialog):
def __init__(self, *args, **kw):
if "show" in kw:
self.__show = kw["show"]
del kw["show"]
else:
self.__show = None
_QueryDialog.__init__(self, *args, **kw)
def body(self, master):
entry = _QueryDialog.body(self, master)
if self.__show is not None:
entry.configure(show=self.__show)
return entry
def getresult(self):
return self.entry.get()
def askstring(title, prompt, **kw):
'''get a string from the user
Arguments:
title -- the dialog title
prompt -- the label text
**kw -- see SimpleDialog class
Return value is a string
'''
d = _QueryString(title, prompt, **kw)
return d.result
if __name__ == "__main__":
root = Tk()
root.update()
print askinteger("Spam", "Egg count", initialvalue=12*12)
print askfloat("Spam", "Egg weight\n(in tons)", minvalue=1, maxvalue=100)
print askstring("Spam", "Egg label")
| Python |
#
# Instant Python
# $Id: tkFileDialog.py 36560 2004-07-18 06:16:08Z tim_one $
#
# tk common file dialogues
#
# this module provides interfaces to the native file dialogues
# available in Tk 4.2 and newer, and the directory dialogue available
# in Tk 8.3 and newer.
#
# written by Fredrik Lundh, May 1997.
#
#
# options (all have default values):
#
# - defaultextension: added to filename if not explicitly given
#
# - filetypes: sequence of (label, pattern) tuples. the same pattern
# may occur with several patterns. use "*" as pattern to indicate
# all files.
#
# - initialdir: initial directory. preserved by dialog instance.
#
# - initialfile: initial file (ignored by the open dialog). preserved
# by dialog instance.
#
# - parent: which window to place the dialog on top of
#
# - title: dialog title
#
# - multiple: if true user may select more than one file
#
# options for the directory chooser:
#
# - initialdir, parent, title: see above
#
# - mustexist: if true, user must pick an existing directory
#
#
from tkCommonDialog import Dialog
class _Dialog(Dialog):
def _fixoptions(self):
try:
# make sure "filetypes" is a tuple
self.options["filetypes"] = tuple(self.options["filetypes"])
except KeyError:
pass
def _fixresult(self, widget, result):
if result:
# keep directory and filename until next time
import os
# convert Tcl path objects to strings
try:
result = result.string
except AttributeError:
# it already is a string
pass
path, file = os.path.split(result)
self.options["initialdir"] = path
self.options["initialfile"] = file
self.filename = result # compatibility
return result
#
# file dialogs
class Open(_Dialog):
"Ask for a filename to open"
command = "tk_getOpenFile"
def _fixresult(self, widget, result):
if isinstance(result, tuple):
# multiple results:
result = tuple([getattr(r, "string", r) for r in result])
if result:
import os
path, file = os.path.split(result[0])
self.options["initialdir"] = path
# don't set initialfile or filename, as we have multiple of these
return result
if not widget.tk.wantobjects() and "multiple" in self.options:
# Need to split result explicitly
return self._fixresult(widget, widget.tk.splitlist(result))
return _Dialog._fixresult(self, widget, result)
class SaveAs(_Dialog):
"Ask for a filename to save as"
command = "tk_getSaveFile"
# the directory dialog has its own _fix routines.
class Directory(Dialog):
"Ask for a directory"
command = "tk_chooseDirectory"
def _fixresult(self, widget, result):
if result:
# convert Tcl path objects to strings
try:
result = result.string
except AttributeError:
# it already is a string
pass
# keep directory until next time
self.options["initialdir"] = result
self.directory = result # compatibility
return result
#
# convenience stuff
def askopenfilename(**options):
"Ask for a filename to open"
return Open(**options).show()
def asksaveasfilename(**options):
"Ask for a filename to save as"
return SaveAs(**options).show()
def askopenfilenames(**options):
"""Ask for multiple filenames to open
Returns a list of filenames or empty list if
cancel button selected
"""
options["multiple"]=1
return Open(**options).show()
# FIXME: are the following perhaps a bit too convenient?
def askopenfile(mode = "r", **options):
"Ask for a filename to open, and returned the opened file"
filename = Open(**options).show()
if filename:
return open(filename, mode)
return None
def askopenfiles(mode = "r", **options):
"""Ask for multiple filenames and return the open file
objects
returns a list of open file objects or an empty list if
cancel selected
"""
files = askopenfilenames(**options)
if files:
ofiles=[]
for filename in files:
ofiles.append(open(filename, mode))
files=ofiles
return files
def asksaveasfile(mode = "w", **options):
"Ask for a filename to save as, and returned the opened file"
filename = SaveAs(**options).show()
if filename:
return open(filename, mode)
return None
def askdirectory (**options):
"Ask for a directory, and return the file name"
return Directory(**options).show()
# --------------------------------------------------------------------
# test stuff
if __name__ == "__main__":
# Since the file name may contain non-ASCII characters, we need
# to find an encoding that likely supports the file name, and
# displays correctly on the terminal.
# Start off with UTF-8
enc = "utf-8"
import sys
# See whether CODESET is defined
try:
import locale
locale.setlocale(locale.LC_ALL,'')
enc = locale.nl_langinfo(locale.CODESET)
except (ImportError, AttributeError):
pass
# dialog for openening files
openfilename=askopenfilename(filetypes=[("all files", "*")])
try:
fp=open(openfilename,"r")
fp.close()
except:
print "Could not open File: "
print sys.exc_info()[1]
print "open", openfilename.encode(enc)
# dialog for saving files
saveasfilename=asksaveasfilename()
print "saveas", saveasfilename.encode(enc)
| Python |
"""Drag-and-drop support for Tkinter.
This is very preliminary. I currently only support dnd *within* one
application, between different windows (or within the same window).
I an trying to make this as generic as possible -- not dependent on
the use of a particular widget or icon type, etc. I also hope that
this will work with Pmw.
To enable an object to be dragged, you must create an event binding
for it that starts the drag-and-drop process. Typically, you should
bind <ButtonPress> to a callback function that you write. The function
should call Tkdnd.dnd_start(source, event), where 'source' is the
object to be dragged, and 'event' is the event that invoked the call
(the argument to your callback function). Even though this is a class
instantiation, the returned instance should not be stored -- it will
be kept alive automatically for the duration of the drag-and-drop.
When a drag-and-drop is already in process for the Tk interpreter, the
call is *ignored*; this normally averts starting multiple simultaneous
dnd processes, e.g. because different button callbacks all
dnd_start().
The object is *not* necessarily a widget -- it can be any
application-specific object that is meaningful to potential
drag-and-drop targets.
Potential drag-and-drop targets are discovered as follows. Whenever
the mouse moves, and at the start and end of a drag-and-drop move, the
Tk widget directly under the mouse is inspected. This is the target
widget (not to be confused with the target object, yet to be
determined). If there is no target widget, there is no dnd target
object. If there is a target widget, and it has an attribute
dnd_accept, this should be a function (or any callable object). The
function is called as dnd_accept(source, event), where 'source' is the
object being dragged (the object passed to dnd_start() above), and
'event' is the most recent event object (generally a <Motion> event;
it can also be <ButtonPress> or <ButtonRelease>). If the dnd_accept()
function returns something other than None, this is the new dnd target
object. If dnd_accept() returns None, or if the target widget has no
dnd_accept attribute, the target widget's parent is considered as the
target widget, and the search for a target object is repeated from
there. If necessary, the search is repeated all the way up to the
root widget. If none of the target widgets can produce a target
object, there is no target object (the target object is None).
The target object thus produced, if any, is called the new target
object. It is compared with the old target object (or None, if there
was no old target widget). There are several cases ('source' is the
source object, and 'event' is the most recent event object):
- Both the old and new target objects are None. Nothing happens.
- The old and new target objects are the same object. Its method
dnd_motion(source, event) is called.
- The old target object was None, and the new target object is not
None. The new target object's method dnd_enter(source, event) is
called.
- The new target object is None, and the old target object is not
None. The old target object's method dnd_leave(source, event) is
called.
- The old and new target objects differ and neither is None. The old
target object's method dnd_leave(source, event), and then the new
target object's method dnd_enter(source, event) is called.
Once this is done, the new target object replaces the old one, and the
Tk mainloop proceeds. The return value of the methods mentioned above
is ignored; if they raise an exception, the normal exception handling
mechanisms take over.
The drag-and-drop processes can end in two ways: a final target object
is selected, or no final target object is selected. When a final
target object is selected, it will always have been notified of the
potential drop by a call to its dnd_enter() method, as described
above, and possibly one or more calls to its dnd_motion() method; its
dnd_leave() method has not been called since the last call to
dnd_enter(). The target is notified of the drop by a call to its
method dnd_commit(source, event).
If no final target object is selected, and there was an old target
object, its dnd_leave(source, event) method is called to complete the
dnd sequence.
Finally, the source object is notified that the drag-and-drop process
is over, by a call to source.dnd_end(target, event), specifying either
the selected target object, or None if no target object was selected.
The source object can use this to implement the commit action; this is
sometimes simpler than to do it in the target's dnd_commit(). The
target's dnd_commit() method could then simply be aliased to
dnd_leave().
At any time during a dnd sequence, the application can cancel the
sequence by calling the cancel() method on the object returned by
dnd_start(). This will call dnd_leave() if a target is currently
active; it will never call dnd_commit().
"""
import Tkinter
# The factory function
def dnd_start(source, event):
h = DndHandler(source, event)
if h.root:
return h
else:
return None
# The class that does the work
class DndHandler:
root = None
def __init__(self, source, event):
if event.num > 5:
return
root = event.widget._root()
try:
root.__dnd
return # Don't start recursive dnd
except AttributeError:
root.__dnd = self
self.root = root
self.source = source
self.target = None
self.initial_button = button = event.num
self.initial_widget = widget = event.widget
self.release_pattern = "<B%d-ButtonRelease-%d>" % (button, button)
self.save_cursor = widget['cursor'] or ""
widget.bind(self.release_pattern, self.on_release)
widget.bind("<Motion>", self.on_motion)
widget['cursor'] = "hand2"
def __del__(self):
root = self.root
self.root = None
if root:
try:
del root.__dnd
except AttributeError:
pass
def on_motion(self, event):
x, y = event.x_root, event.y_root
target_widget = self.initial_widget.winfo_containing(x, y)
source = self.source
new_target = None
while target_widget:
try:
attr = target_widget.dnd_accept
except AttributeError:
pass
else:
new_target = attr(source, event)
if new_target:
break
target_widget = target_widget.master
old_target = self.target
if old_target is new_target:
if old_target:
old_target.dnd_motion(source, event)
else:
if old_target:
self.target = None
old_target.dnd_leave(source, event)
if new_target:
new_target.dnd_enter(source, event)
self.target = new_target
def on_release(self, event):
self.finish(event, 1)
def cancel(self, event=None):
self.finish(event, 0)
def finish(self, event, commit=0):
target = self.target
source = self.source
widget = self.initial_widget
root = self.root
try:
del root.__dnd
self.initial_widget.unbind(self.release_pattern)
self.initial_widget.unbind("<Motion>")
widget['cursor'] = self.save_cursor
self.target = self.source = self.initial_widget = self.root = None
if target:
if commit:
target.dnd_commit(source, event)
else:
target.dnd_leave(source, event)
finally:
source.dnd_end(target, event)
# ----------------------------------------------------------------------
# The rest is here for testing and demonstration purposes only!
class Icon:
def __init__(self, name):
self.name = name
self.canvas = self.label = self.id = None
def attach(self, canvas, x=10, y=10):
if canvas is self.canvas:
self.canvas.coords(self.id, x, y)
return
if self.canvas:
self.detach()
if not canvas:
return
label = Tkinter.Label(canvas, text=self.name,
borderwidth=2, relief="raised")
id = canvas.create_window(x, y, window=label, anchor="nw")
self.canvas = canvas
self.label = label
self.id = id
label.bind("<ButtonPress>", self.press)
def detach(self):
canvas = self.canvas
if not canvas:
return
id = self.id
label = self.label
self.canvas = self.label = self.id = None
canvas.delete(id)
label.destroy()
def press(self, event):
if dnd_start(self, event):
# where the pointer is relative to the label widget:
self.x_off = event.x
self.y_off = event.y
# where the widget is relative to the canvas:
self.x_orig, self.y_orig = self.canvas.coords(self.id)
def move(self, event):
x, y = self.where(self.canvas, event)
self.canvas.coords(self.id, x, y)
def putback(self):
self.canvas.coords(self.id, self.x_orig, self.y_orig)
def where(self, canvas, event):
# where the corner of the canvas is relative to the screen:
x_org = canvas.winfo_rootx()
y_org = canvas.winfo_rooty()
# where the pointer is relative to the canvas widget:
x = event.x_root - x_org
y = event.y_root - y_org
# compensate for initial pointer offset
return x - self.x_off, y - self.y_off
def dnd_end(self, target, event):
pass
class Tester:
def __init__(self, root):
self.top = Tkinter.Toplevel(root)
self.canvas = Tkinter.Canvas(self.top, width=100, height=100)
self.canvas.pack(fill="both", expand=1)
self.canvas.dnd_accept = self.dnd_accept
def dnd_accept(self, source, event):
return self
def dnd_enter(self, source, event):
self.canvas.focus_set() # Show highlight border
x, y = source.where(self.canvas, event)
x1, y1, x2, y2 = source.canvas.bbox(source.id)
dx, dy = x2-x1, y2-y1
self.dndid = self.canvas.create_rectangle(x, y, x+dx, y+dy)
self.dnd_motion(source, event)
def dnd_motion(self, source, event):
x, y = source.where(self.canvas, event)
x1, y1, x2, y2 = self.canvas.bbox(self.dndid)
self.canvas.move(self.dndid, x-x1, y-y1)
def dnd_leave(self, source, event):
self.top.focus_set() # Hide highlight border
self.canvas.delete(self.dndid)
self.dndid = None
def dnd_commit(self, source, event):
self.dnd_leave(source, event)
x, y = source.where(self.canvas, event)
source.attach(self.canvas, x, y)
def test():
root = Tkinter.Tk()
root.geometry("+1+1")
Tkinter.Button(command=root.quit, text="Quit").pack()
t1 = Tester(root)
t1.top.geometry("+1+60")
t2 = Tester(root)
t2.top.geometry("+120+60")
t3 = Tester(root)
t3.top.geometry("+240+60")
i1 = Icon("ICON1")
i2 = Icon("ICON2")
i3 = Icon("ICON3")
i1.attach(t1.canvas)
i2.attach(t2.canvas)
i3.attach(t3.canvas)
root.mainloop()
if __name__ == '__main__':
test()
| Python |
"""A simple but flexible modal dialog box."""
from Tkinter import *
class SimpleDialog:
def __init__(self, master,
text='', buttons=[], default=None, cancel=None,
title=None, class_=None):
if class_:
self.root = Toplevel(master, class_=class_)
else:
self.root = Toplevel(master)
if title:
self.root.title(title)
self.root.iconname(title)
self.message = Message(self.root, text=text, aspect=400)
self.message.pack(expand=1, fill=BOTH)
self.frame = Frame(self.root)
self.frame.pack()
self.num = default
self.cancel = cancel
self.default = default
self.root.bind('<Return>', self.return_event)
for num in range(len(buttons)):
s = buttons[num]
b = Button(self.frame, text=s,
command=(lambda self=self, num=num: self.done(num)))
if num == default:
b.config(relief=RIDGE, borderwidth=8)
b.pack(side=LEFT, fill=BOTH, expand=1)
self.root.protocol('WM_DELETE_WINDOW', self.wm_delete_window)
self._set_transient(master)
def _set_transient(self, master, relx=0.5, rely=0.3):
widget = self.root
widget.withdraw() # Remain invisible while we figure out the geometry
widget.transient(master)
widget.update_idletasks() # Actualize geometry information
if master.winfo_ismapped():
m_width = master.winfo_width()
m_height = master.winfo_height()
m_x = master.winfo_rootx()
m_y = master.winfo_rooty()
else:
m_width = master.winfo_screenwidth()
m_height = master.winfo_screenheight()
m_x = m_y = 0
w_width = widget.winfo_reqwidth()
w_height = widget.winfo_reqheight()
x = m_x + (m_width - w_width) * relx
y = m_y + (m_height - w_height) * rely
if x+w_width > master.winfo_screenwidth():
x = master.winfo_screenwidth() - w_width
elif x < 0:
x = 0
if y+w_height > master.winfo_screenheight():
y = master.winfo_screenheight() - w_height
elif y < 0:
y = 0
widget.geometry("+%d+%d" % (x, y))
widget.deiconify() # Become visible at the desired location
def go(self):
self.root.wait_visibility()
self.root.grab_set()
self.root.mainloop()
self.root.destroy()
return self.num
def return_event(self, event):
if self.default is None:
self.root.bell()
else:
self.done(self.default)
def wm_delete_window(self):
if self.cancel is None:
self.root.bell()
else:
self.done(self.cancel)
def done(self, num):
self.num = num
self.root.quit()
if __name__ == '__main__':
def test():
root = Tk()
def doit(root=root):
d = SimpleDialog(root,
text="This is a test dialog. "
"Would this have been an actual dialog, "
"the buttons below would have been glowing "
"in soft pink light.\n"
"Do you believe this?",
buttons=["Yes", "No", "Cancel"],
default=0,
cancel=2,
title="Test Dialog")
print d.go()
t = Button(root, text='Test', command=doit)
t.pack()
q = Button(root, text='Quit', command=t.quit)
q.pack()
t.mainloop()
test()
| Python |
import sys, os
# Delay import _tkinter until we have set TCL_LIBRARY,
# so that Tcl_FindExecutable has a chance to locate its
# encoding directory.
# Unfortunately, we cannot know the TCL_LIBRARY directory
# if we don't know the tcl version, which we cannot find out
# without import Tcl. Fortunately, Tcl will itself look in
# <TCL_LIBRARY>\..\tcl<TCL_VERSION>, so anything close to
# the real Tcl library will do.
# Expand symbolic links on Vista
try:
import ctypes
ctypes.windll.kernel32.GetFinalPathNameByHandleW
except (ImportError, AttributeError):
def convert_path(s):
return s
else:
def convert_path(s):
assert isinstance(s, str) # sys.prefix contains only bytes
udir = s.decode("mbcs")
hdir = ctypes.windll.kernel32.\
CreateFileW(udir, 0x80, # FILE_READ_ATTRIBUTES
1, # FILE_SHARE_READ
None, 3, # OPEN_EXISTING
0x02000000, # FILE_FLAG_BACKUP_SEMANTICS
None)
if hdir == -1:
# Cannot open directory, give up
return s
buf = ctypes.create_unicode_buffer(u"", 32768)
res = ctypes.windll.kernel32.\
GetFinalPathNameByHandleW(hdir, buf, len(buf),
0) # VOLUME_NAME_DOS
ctypes.windll.kernel32.CloseHandle(hdir)
if res == 0:
# Conversion failed (e.g. network location)
return s
s = buf[:res].encode("mbcs")
# Ignore leading \\?\
if s.startswith("\\\\?\\"):
s = s[4:]
if s.startswith("UNC"):
s = "\\" + s[3:]
return s
prefix = os.path.join(sys.prefix,"tcl")
if not os.path.exists(prefix):
# devdir/../tcltk/lib
prefix = os.path.join(sys.prefix, os.path.pardir, "tcltk", "lib")
prefix = os.path.abspath(prefix)
# if this does not exist, no further search is needed
if os.path.exists(prefix):
prefix = convert_path(prefix)
if "TCL_LIBRARY" not in os.environ:
for name in os.listdir(prefix):
if name.startswith("tcl"):
tcldir = os.path.join(prefix,name)
if os.path.isdir(tcldir):
os.environ["TCL_LIBRARY"] = tcldir
# Compute TK_LIBRARY, knowing that it has the same version
# as Tcl
import _tkinter
ver = str(_tkinter.TCL_VERSION)
if "TK_LIBRARY" not in os.environ:
v = os.path.join(prefix, 'tk'+ver)
if os.path.exists(os.path.join(v, "tclIndex")):
os.environ['TK_LIBRARY'] = v
# We don't know the Tix version, so we must search the entire
# directory
if "TIX_LIBRARY" not in os.environ:
for name in os.listdir(prefix):
if name.startswith("tix"):
tixdir = os.path.join(prefix,name)
if os.path.isdir(tixdir):
os.environ["TIX_LIBRARY"] = tixdir
| Python |
# Tkinter font wrapper
#
# written by Fredrik Lundh, February 1998
#
# FIXME: should add 'displayof' option where relevant (actual, families,
# measure, and metrics)
#
__version__ = "0.9"
import Tkinter
# weight/slant
NORMAL = "normal"
ROMAN = "roman"
BOLD = "bold"
ITALIC = "italic"
def nametofont(name):
"""Given the name of a tk named font, returns a Font representation.
"""
return Font(name=name, exists=True)
class Font:
"""Represents a named font.
Constructor options are:
font -- font specifier (name, system font, or (family, size, style)-tuple)
name -- name to use for this font configuration (defaults to a unique name)
exists -- does a named font by this name already exist?
Creates a new named font if False, points to the existing font if True.
Raises _Tkinter.TclError if the assertion is false.
the following are ignored if font is specified:
family -- font 'family', e.g. Courier, Times, Helvetica
size -- font size in points
weight -- font thickness: NORMAL, BOLD
slant -- font slant: ROMAN, ITALIC
underline -- font underlining: false (0), true (1)
overstrike -- font strikeout: false (0), true (1)
"""
def _set(self, kw):
options = []
for k, v in kw.items():
options.append("-"+k)
options.append(str(v))
return tuple(options)
def _get(self, args):
options = []
for k in args:
options.append("-"+k)
return tuple(options)
def _mkdict(self, args):
options = {}
for i in range(0, len(args), 2):
options[args[i][1:]] = args[i+1]
return options
def __init__(self, root=None, font=None, name=None, exists=False, **options):
if not root:
root = Tkinter._default_root
if font:
# get actual settings corresponding to the given font
font = root.tk.splitlist(root.tk.call("font", "actual", font))
else:
font = self._set(options)
if not name:
name = "font" + str(id(self))
self.name = name
if exists:
self.delete_font = False
# confirm font exists
if self.name not in root.tk.call("font", "names"):
raise Tkinter._tkinter.TclError, "named font %s does not already exist" % (self.name,)
# if font config info supplied, apply it
if font:
root.tk.call("font", "configure", self.name, *font)
else:
# create new font (raises TclError if the font exists)
root.tk.call("font", "create", self.name, *font)
self.delete_font = True
# backlinks!
self._root = root
self._split = root.tk.splitlist
self._call = root.tk.call
def __str__(self):
return self.name
def __eq__(self, other):
return self.name == other.name and isinstance(other, Font)
def __getitem__(self, key):
return self.cget(key)
def __setitem__(self, key, value):
self.configure(**{key: value})
def __del__(self):
try:
if self.delete_font:
self._call("font", "delete", self.name)
except (KeyboardInterrupt, SystemExit):
raise
except Exception:
pass
def copy(self):
"Return a distinct copy of the current font"
return Font(self._root, **self.actual())
def actual(self, option=None):
"Return actual font attributes"
if option:
return self._call("font", "actual", self.name, "-"+option)
else:
return self._mkdict(
self._split(self._call("font", "actual", self.name))
)
def cget(self, option):
"Get font attribute"
return self._call("font", "config", self.name, "-"+option)
def config(self, **options):
"Modify font attributes"
if options:
self._call("font", "config", self.name,
*self._set(options))
else:
return self._mkdict(
self._split(self._call("font", "config", self.name))
)
configure = config
def measure(self, text):
"Return text width"
return int(self._call("font", "measure", self.name, text))
def metrics(self, *options):
"""Return font metrics.
For best performance, create a dummy widget
using this font before calling this method."""
if options:
return int(
self._call("font", "metrics", self.name, self._get(options))
)
else:
res = self._split(self._call("font", "metrics", self.name))
options = {}
for i in range(0, len(res), 2):
options[res[i][1:]] = int(res[i+1])
return options
def families(root=None):
"Get font families (as a tuple)"
if not root:
root = Tkinter._default_root
return root.tk.splitlist(root.tk.call("font", "families"))
def names(root=None):
"Get names of defined fonts (as a tuple)"
if not root:
root = Tkinter._default_root
return root.tk.splitlist(root.tk.call("font", "names"))
# --------------------------------------------------------------------
# test stuff
if __name__ == "__main__":
root = Tkinter.Tk()
# create a font
f = Font(family="times", size=30, weight=NORMAL)
print f.actual()
print f.actual("family")
print f.actual("weight")
print f.config()
print f.cget("family")
print f.cget("weight")
print names()
print f.measure("hello"), f.metrics("linespace")
print f.metrics()
f = Font(font=("Courier", 20, "bold"))
print f.measure("hello"), f.metrics("linespace")
w = Tkinter.Label(root, text="Hello, world", font=f)
w.pack()
w = Tkinter.Button(root, text="Quit!", command=root.destroy)
w.pack()
fb = Font(font=w["font"]).copy()
fb.config(weight=BOLD)
w.config(font=fb)
Tkinter.mainloop()
| Python |
#
# turtle.py: a Tkinter based turtle graphics module for Python
# Version 1.0.1 - 24. 9. 2009
#
# Copyright (C) 2006 - 2010 Gregor Lingl
# email: glingl@aon.at
#
# This software is provided 'as-is', without any express or implied
# warranty. In no event will the authors be held liable for any damages
# arising from the use of this software.
#
# Permission is granted to anyone to use this software for any purpose,
# including commercial applications, and to alter it and redistribute it
# freely, subject to the following restrictions:
#
# 1. The origin of this software must not be misrepresented; you must not
# claim that you wrote the original software. If you use this software
# in a product, an acknowledgment in the product documentation would be
# appreciated but is not required.
# 2. Altered source versions must be plainly marked as such, and must not be
# misrepresented as being the original software.
# 3. This notice may not be removed or altered from any source distribution.
"""
Turtle graphics is a popular way for introducing programming to
kids. It was part of the original Logo programming language developed
by Wally Feurzig and Seymour Papert in 1966.
Imagine a robotic turtle starting at (0, 0) in the x-y plane. Give it
the command turtle.forward(15), and it moves (on-screen!) 15 pixels in
the direction it is facing, drawing a line as it moves. Give it the
command turtle.left(25), and it rotates in-place 25 degrees clockwise.
By combining together these and similar commands, intricate shapes and
pictures can easily be drawn.
----- turtle.py
This module is an extended reimplementation of turtle.py from the
Python standard distribution up to Python 2.5. (See: http://www.python.org)
It tries to keep the merits of turtle.py and to be (nearly) 100%
compatible with it. This means in the first place to enable the
learning programmer to use all the commands, classes and methods
interactively when using the module from within IDLE run with
the -n switch.
Roughly it has the following features added:
- Better animation of the turtle movements, especially of turning the
turtle. So the turtles can more easily be used as a visual feedback
instrument by the (beginning) programmer.
- Different turtle shapes, gif-images as turtle shapes, user defined
and user controllable turtle shapes, among them compound
(multicolored) shapes. Turtle shapes can be stretched and tilted, which
makes turtles very versatile geometrical objects.
- Fine control over turtle movement and screen updates via delay(),
and enhanced tracer() and speed() methods.
- Aliases for the most commonly used commands, like fd for forward etc.,
following the early Logo traditions. This reduces the boring work of
typing long sequences of commands, which often occur in a natural way
when kids try to program fancy pictures on their first encounter with
turtle graphics.
- Turtles now have an undo()-method with configurable undo-buffer.
- Some simple commands/methods for creating event driven programs
(mouse-, key-, timer-events). Especially useful for programming games.
- A scrollable Canvas class. The default scrollable Canvas can be
extended interactively as needed while playing around with the turtle(s).
- A TurtleScreen class with methods controlling background color or
background image, window and canvas size and other properties of the
TurtleScreen.
- There is a method, setworldcoordinates(), to install a user defined
coordinate-system for the TurtleScreen.
- The implementation uses a 2-vector class named Vec2D, derived from tuple.
This class is public, so it can be imported by the application programmer,
which makes certain types of computations very natural and compact.
- Appearance of the TurtleScreen and the Turtles at startup/import can be
configured by means of a turtle.cfg configuration file.
The default configuration mimics the appearance of the old turtle module.
- If configured appropriately the module reads in docstrings from a docstring
dictionary in some different language, supplied separately and replaces
the English ones by those read in. There is a utility function
write_docstringdict() to write a dictionary with the original (English)
docstrings to disc, so it can serve as a template for translations.
Behind the scenes there are some features included with possible
extensions in in mind. These will be commented and documented elsewhere.
"""
_ver = "turtle 1.0b1 - for Python 2.6 - 30. 5. 2008, 18:08"
#print _ver
import Tkinter as TK
import types
import math
import time
import os
from os.path import isfile, split, join
from copy import deepcopy
from math import * ## for compatibility with old turtle module
_tg_classes = ['ScrolledCanvas', 'TurtleScreen', 'Screen',
'RawTurtle', 'Turtle', 'RawPen', 'Pen', 'Shape', 'Vec2D']
_tg_screen_functions = ['addshape', 'bgcolor', 'bgpic', 'bye',
'clearscreen', 'colormode', 'delay', 'exitonclick', 'getcanvas',
'getshapes', 'listen', 'mode', 'onkey', 'onscreenclick', 'ontimer',
'register_shape', 'resetscreen', 'screensize', 'setup',
'setworldcoordinates', 'title', 'tracer', 'turtles', 'update',
'window_height', 'window_width']
_tg_turtle_functions = ['back', 'backward', 'begin_fill', 'begin_poly', 'bk',
'circle', 'clear', 'clearstamp', 'clearstamps', 'clone', 'color',
'degrees', 'distance', 'dot', 'down', 'end_fill', 'end_poly', 'fd',
'fill', 'fillcolor', 'forward', 'get_poly', 'getpen', 'getscreen',
'getturtle', 'goto', 'heading', 'hideturtle', 'home', 'ht', 'isdown',
'isvisible', 'left', 'lt', 'onclick', 'ondrag', 'onrelease', 'pd',
'pen', 'pencolor', 'pendown', 'pensize', 'penup', 'pos', 'position',
'pu', 'radians', 'right', 'reset', 'resizemode', 'rt',
'seth', 'setheading', 'setpos', 'setposition', 'settiltangle',
'setundobuffer', 'setx', 'sety', 'shape', 'shapesize', 'showturtle',
'speed', 'st', 'stamp', 'tilt', 'tiltangle', 'towards', 'tracer',
'turtlesize', 'undo', 'undobufferentries', 'up', 'width',
'window_height', 'window_width', 'write', 'xcor', 'ycor']
_tg_utilities = ['write_docstringdict', 'done', 'mainloop']
_math_functions = ['acos', 'asin', 'atan', 'atan2', 'ceil', 'cos', 'cosh',
'e', 'exp', 'fabs', 'floor', 'fmod', 'frexp', 'hypot', 'ldexp', 'log',
'log10', 'modf', 'pi', 'pow', 'sin', 'sinh', 'sqrt', 'tan', 'tanh']
__all__ = (_tg_classes + _tg_screen_functions + _tg_turtle_functions +
_tg_utilities + _math_functions)
_alias_list = ['addshape', 'backward', 'bk', 'fd', 'ht', 'lt', 'pd', 'pos',
'pu', 'rt', 'seth', 'setpos', 'setposition', 'st',
'turtlesize', 'up', 'width']
_CFG = {"width" : 0.5, # Screen
"height" : 0.75,
"canvwidth" : 400,
"canvheight": 300,
"leftright": None,
"topbottom": None,
"mode": "standard", # TurtleScreen
"colormode": 1.0,
"delay": 10,
"undobuffersize": 1000, # RawTurtle
"shape": "classic",
"pencolor" : "black",
"fillcolor" : "black",
"resizemode" : "noresize",
"visible" : True,
"language": "english", # docstrings
"exampleturtle": "turtle",
"examplescreen": "screen",
"title": "Python Turtle Graphics",
"using_IDLE": False
}
##print "cwd:", os.getcwd()
##print "__file__:", __file__
##
##def show(dictionary):
## print "=========================="
## for key in sorted(dictionary.keys()):
## print key, ":", dictionary[key]
## print "=========================="
## print
def config_dict(filename):
"""Convert content of config-file into dictionary."""
f = open(filename, "r")
cfglines = f.readlines()
f.close()
cfgdict = {}
for line in cfglines:
line = line.strip()
if not line or line.startswith("#"):
continue
try:
key, value = line.split("=")
except:
print "Bad line in config-file %s:\n%s" % (filename,line)
continue
key = key.strip()
value = value.strip()
if value in ["True", "False", "None", "''", '""']:
value = eval(value)
else:
try:
if "." in value:
value = float(value)
else:
value = int(value)
except:
pass # value need not be converted
cfgdict[key] = value
return cfgdict
def readconfig(cfgdict):
"""Read config-files, change configuration-dict accordingly.
If there is a turtle.cfg file in the current working directory,
read it from there. If this contains an importconfig-value,
say 'myway', construct filename turtle_mayway.cfg else use
turtle.cfg and read it from the import-directory, where
turtle.py is located.
Update configuration dictionary first according to config-file,
in the import directory, then according to config-file in the
current working directory.
If no config-file is found, the default configuration is used.
"""
default_cfg = "turtle.cfg"
cfgdict1 = {}
cfgdict2 = {}
if isfile(default_cfg):
cfgdict1 = config_dict(default_cfg)
#print "1. Loading config-file %s from: %s" % (default_cfg, os.getcwd())
if "importconfig" in cfgdict1:
default_cfg = "turtle_%s.cfg" % cfgdict1["importconfig"]
try:
head, tail = split(__file__)
cfg_file2 = join(head, default_cfg)
except:
cfg_file2 = ""
if isfile(cfg_file2):
#print "2. Loading config-file %s:" % cfg_file2
cfgdict2 = config_dict(cfg_file2)
## show(_CFG)
## show(cfgdict2)
_CFG.update(cfgdict2)
## show(_CFG)
## show(cfgdict1)
_CFG.update(cfgdict1)
## show(_CFG)
try:
readconfig(_CFG)
except:
print "No configfile read, reason unknown"
class Vec2D(tuple):
"""A 2 dimensional vector class, used as a helper class
for implementing turtle graphics.
May be useful for turtle graphics programs also.
Derived from tuple, so a vector is a tuple!
Provides (for a, b vectors, k number):
a+b vector addition
a-b vector subtraction
a*b inner product
k*a and a*k multiplication with scalar
|a| absolute value of a
a.rotate(angle) rotation
"""
def __new__(cls, x, y):
return tuple.__new__(cls, (x, y))
def __add__(self, other):
return Vec2D(self[0]+other[0], self[1]+other[1])
def __mul__(self, other):
if isinstance(other, Vec2D):
return self[0]*other[0]+self[1]*other[1]
return Vec2D(self[0]*other, self[1]*other)
def __rmul__(self, other):
if isinstance(other, int) or isinstance(other, float):
return Vec2D(self[0]*other, self[1]*other)
def __sub__(self, other):
return Vec2D(self[0]-other[0], self[1]-other[1])
def __neg__(self):
return Vec2D(-self[0], -self[1])
def __abs__(self):
return (self[0]**2 + self[1]**2)**0.5
def rotate(self, angle):
"""rotate self counterclockwise by angle
"""
perp = Vec2D(-self[1], self[0])
angle = angle * math.pi / 180.0
c, s = math.cos(angle), math.sin(angle)
return Vec2D(self[0]*c+perp[0]*s, self[1]*c+perp[1]*s)
def __getnewargs__(self):
return (self[0], self[1])
def __repr__(self):
return "(%.2f,%.2f)" % self
##############################################################################
### From here up to line : Tkinter - Interface for turtle.py ###
### May be replaced by an interface to some different graphics toolkit ###
##############################################################################
## helper functions for Scrolled Canvas, to forward Canvas-methods
## to ScrolledCanvas class
def __methodDict(cls, _dict):
"""helper function for Scrolled Canvas"""
baseList = list(cls.__bases__)
baseList.reverse()
for _super in baseList:
__methodDict(_super, _dict)
for key, value in cls.__dict__.items():
if type(value) == types.FunctionType:
_dict[key] = value
def __methods(cls):
"""helper function for Scrolled Canvas"""
_dict = {}
__methodDict(cls, _dict)
return _dict.keys()
__stringBody = (
'def %(method)s(self, *args, **kw): return ' +
'self.%(attribute)s.%(method)s(*args, **kw)')
def __forwardmethods(fromClass, toClass, toPart, exclude = ()):
"""Helper functions for Scrolled Canvas, used to forward
ScrolledCanvas-methods to Tkinter.Canvas class.
"""
_dict = {}
__methodDict(toClass, _dict)
for ex in _dict.keys():
if ex[:1] == '_' or ex[-1:] == '_':
del _dict[ex]
for ex in exclude:
if ex in _dict:
del _dict[ex]
for ex in __methods(fromClass):
if ex in _dict:
del _dict[ex]
for method, func in _dict.items():
d = {'method': method, 'func': func}
if type(toPart) == types.StringType:
execString = \
__stringBody % {'method' : method, 'attribute' : toPart}
exec execString in d
fromClass.__dict__[method] = d[method]
class ScrolledCanvas(TK.Frame):
"""Modeled after the scrolled canvas class from Grayons's Tkinter book.
Used as the default canvas, which pops up automatically when
using turtle graphics functions or the Turtle class.
"""
def __init__(self, master, width=500, height=350,
canvwidth=600, canvheight=500):
TK.Frame.__init__(self, master, width=width, height=height)
self._rootwindow = self.winfo_toplevel()
self.width, self.height = width, height
self.canvwidth, self.canvheight = canvwidth, canvheight
self.bg = "white"
self._canvas = TK.Canvas(master, width=width, height=height,
bg=self.bg, relief=TK.SUNKEN, borderwidth=2)
self.hscroll = TK.Scrollbar(master, command=self._canvas.xview,
orient=TK.HORIZONTAL)
self.vscroll = TK.Scrollbar(master, command=self._canvas.yview)
self._canvas.configure(xscrollcommand=self.hscroll.set,
yscrollcommand=self.vscroll.set)
self.rowconfigure(0, weight=1, minsize=0)
self.columnconfigure(0, weight=1, minsize=0)
self._canvas.grid(padx=1, in_ = self, pady=1, row=0,
column=0, rowspan=1, columnspan=1, sticky='news')
self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
column=1, rowspan=1, columnspan=1, sticky='news')
self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
column=0, rowspan=1, columnspan=1, sticky='news')
self.reset()
self._rootwindow.bind('<Configure>', self.onResize)
def reset(self, canvwidth=None, canvheight=None, bg = None):
"""Adjust canvas and scrollbars according to given canvas size."""
if canvwidth:
self.canvwidth = canvwidth
if canvheight:
self.canvheight = canvheight
if bg:
self.bg = bg
self._canvas.config(bg=bg,
scrollregion=(-self.canvwidth//2, -self.canvheight//2,
self.canvwidth//2, self.canvheight//2))
self._canvas.xview_moveto(0.5*(self.canvwidth - self.width + 30) /
self.canvwidth)
self._canvas.yview_moveto(0.5*(self.canvheight- self.height + 30) /
self.canvheight)
self.adjustScrolls()
def adjustScrolls(self):
""" Adjust scrollbars according to window- and canvas-size.
"""
cwidth = self._canvas.winfo_width()
cheight = self._canvas.winfo_height()
self._canvas.xview_moveto(0.5*(self.canvwidth-cwidth)/self.canvwidth)
self._canvas.yview_moveto(0.5*(self.canvheight-cheight)/self.canvheight)
if cwidth < self.canvwidth or cheight < self.canvheight:
self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
column=0, rowspan=1, columnspan=1, sticky='news')
self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
column=1, rowspan=1, columnspan=1, sticky='news')
else:
self.hscroll.grid_forget()
self.vscroll.grid_forget()
def onResize(self, event):
"""self-explanatory"""
self.adjustScrolls()
def bbox(self, *args):
""" 'forward' method, which canvas itself has inherited...
"""
return self._canvas.bbox(*args)
def cget(self, *args, **kwargs):
""" 'forward' method, which canvas itself has inherited...
"""
return self._canvas.cget(*args, **kwargs)
def config(self, *args, **kwargs):
""" 'forward' method, which canvas itself has inherited...
"""
self._canvas.config(*args, **kwargs)
def bind(self, *args, **kwargs):
""" 'forward' method, which canvas itself has inherited...
"""
self._canvas.bind(*args, **kwargs)
def unbind(self, *args, **kwargs):
""" 'forward' method, which canvas itself has inherited...
"""
self._canvas.unbind(*args, **kwargs)
def focus_force(self):
""" 'forward' method, which canvas itself has inherited...
"""
self._canvas.focus_force()
__forwardmethods(ScrolledCanvas, TK.Canvas, '_canvas')
class _Root(TK.Tk):
"""Root class for Screen based on Tkinter."""
def __init__(self):
TK.Tk.__init__(self)
def setupcanvas(self, width, height, cwidth, cheight):
self._canvas = ScrolledCanvas(self, width, height, cwidth, cheight)
self._canvas.pack(expand=1, fill="both")
def _getcanvas(self):
return self._canvas
def set_geometry(self, width, height, startx, starty):
self.geometry("%dx%d%+d%+d"%(width, height, startx, starty))
def ondestroy(self, destroy):
self.wm_protocol("WM_DELETE_WINDOW", destroy)
def win_width(self):
return self.winfo_screenwidth()
def win_height(self):
return self.winfo_screenheight()
Canvas = TK.Canvas
class TurtleScreenBase(object):
"""Provide the basic graphics functionality.
Interface between Tkinter and turtle.py.
To port turtle.py to some different graphics toolkit
a corresponding TurtleScreenBase class has to be implemented.
"""
@staticmethod
def _blankimage():
"""return a blank image object
"""
img = TK.PhotoImage(width=1, height=1)
img.blank()
return img
@staticmethod
def _image(filename):
"""return an image object containing the
imagedata from a gif-file named filename.
"""
return TK.PhotoImage(file=filename)
def __init__(self, cv):
self.cv = cv
if isinstance(cv, ScrolledCanvas):
w = self.cv.canvwidth
h = self.cv.canvheight
else: # expected: ordinary TK.Canvas
w = int(self.cv.cget("width"))
h = int(self.cv.cget("height"))
self.cv.config(scrollregion = (-w//2, -h//2, w//2, h//2 ))
self.canvwidth = w
self.canvheight = h
self.xscale = self.yscale = 1.0
def _createpoly(self):
"""Create an invisible polygon item on canvas self.cv)
"""
return self.cv.create_polygon((0, 0, 0, 0, 0, 0), fill="", outline="")
def _drawpoly(self, polyitem, coordlist, fill=None,
outline=None, width=None, top=False):
"""Configure polygonitem polyitem according to provided
arguments:
coordlist is sequence of coordinates
fill is filling color
outline is outline color
top is a boolean value, which specifies if polyitem
will be put on top of the canvas' displaylist so it
will not be covered by other items.
"""
cl = []
for x, y in coordlist:
cl.append(x * self.xscale)
cl.append(-y * self.yscale)
self.cv.coords(polyitem, *cl)
if fill is not None:
self.cv.itemconfigure(polyitem, fill=fill)
if outline is not None:
self.cv.itemconfigure(polyitem, outline=outline)
if width is not None:
self.cv.itemconfigure(polyitem, width=width)
if top:
self.cv.tag_raise(polyitem)
def _createline(self):
"""Create an invisible line item on canvas self.cv)
"""
return self.cv.create_line(0, 0, 0, 0, fill="", width=2,
capstyle = TK.ROUND)
def _drawline(self, lineitem, coordlist=None,
fill=None, width=None, top=False):
"""Configure lineitem according to provided arguments:
coordlist is sequence of coordinates
fill is drawing color
width is width of drawn line.
top is a boolean value, which specifies if polyitem
will be put on top of the canvas' displaylist so it
will not be covered by other items.
"""
if coordlist is not None:
cl = []
for x, y in coordlist:
cl.append(x * self.xscale)
cl.append(-y * self.yscale)
self.cv.coords(lineitem, *cl)
if fill is not None:
self.cv.itemconfigure(lineitem, fill=fill)
if width is not None:
self.cv.itemconfigure(lineitem, width=width)
if top:
self.cv.tag_raise(lineitem)
def _delete(self, item):
"""Delete graphics item from canvas.
If item is"all" delete all graphics items.
"""
self.cv.delete(item)
def _update(self):
"""Redraw graphics items on canvas
"""
self.cv.update()
def _delay(self, delay):
"""Delay subsequent canvas actions for delay ms."""
self.cv.after(delay)
def _iscolorstring(self, color):
"""Check if the string color is a legal Tkinter color string.
"""
try:
rgb = self.cv.winfo_rgb(color)
ok = True
except TK.TclError:
ok = False
return ok
def _bgcolor(self, color=None):
"""Set canvas' backgroundcolor if color is not None,
else return backgroundcolor."""
if color is not None:
self.cv.config(bg = color)
self._update()
else:
return self.cv.cget("bg")
def _write(self, pos, txt, align, font, pencolor):
"""Write txt at pos in canvas with specified font
and color.
Return text item and x-coord of right bottom corner
of text's bounding box."""
x, y = pos
x = x * self.xscale
y = y * self.yscale
anchor = {"left":"sw", "center":"s", "right":"se" }
item = self.cv.create_text(x-1, -y, text = txt, anchor = anchor[align],
fill = pencolor, font = font)
x0, y0, x1, y1 = self.cv.bbox(item)
self.cv.update()
return item, x1-1
## def _dot(self, pos, size, color):
## """may be implemented for some other graphics toolkit"""
def _onclick(self, item, fun, num=1, add=None):
"""Bind fun to mouse-click event on turtle.
fun must be a function with two arguments, the coordinates
of the clicked point on the canvas.
num, the number of the mouse-button defaults to 1
"""
if fun is None:
self.cv.tag_unbind(item, "<Button-%s>" % num)
else:
def eventfun(event):
x, y = (self.cv.canvasx(event.x)/self.xscale,
-self.cv.canvasy(event.y)/self.yscale)
fun(x, y)
self.cv.tag_bind(item, "<Button-%s>" % num, eventfun, add)
def _onrelease(self, item, fun, num=1, add=None):
"""Bind fun to mouse-button-release event on turtle.
fun must be a function with two arguments, the coordinates
of the point on the canvas where mouse button is released.
num, the number of the mouse-button defaults to 1
If a turtle is clicked, first _onclick-event will be performed,
then _onscreensclick-event.
"""
if fun is None:
self.cv.tag_unbind(item, "<Button%s-ButtonRelease>" % num)
else:
def eventfun(event):
x, y = (self.cv.canvasx(event.x)/self.xscale,
-self.cv.canvasy(event.y)/self.yscale)
fun(x, y)
self.cv.tag_bind(item, "<Button%s-ButtonRelease>" % num,
eventfun, add)
def _ondrag(self, item, fun, num=1, add=None):
"""Bind fun to mouse-move-event (with pressed mouse button) on turtle.
fun must be a function with two arguments, the coordinates of the
actual mouse position on the canvas.
num, the number of the mouse-button defaults to 1
Every sequence of mouse-move-events on a turtle is preceded by a
mouse-click event on that turtle.
"""
if fun is None:
self.cv.tag_unbind(item, "<Button%s-Motion>" % num)
else:
def eventfun(event):
try:
x, y = (self.cv.canvasx(event.x)/self.xscale,
-self.cv.canvasy(event.y)/self.yscale)
fun(x, y)
except:
pass
self.cv.tag_bind(item, "<Button%s-Motion>" % num, eventfun, add)
def _onscreenclick(self, fun, num=1, add=None):
"""Bind fun to mouse-click event on canvas.
fun must be a function with two arguments, the coordinates
of the clicked point on the canvas.
num, the number of the mouse-button defaults to 1
If a turtle is clicked, first _onclick-event will be performed,
then _onscreensclick-event.
"""
if fun is None:
self.cv.unbind("<Button-%s>" % num)
else:
def eventfun(event):
x, y = (self.cv.canvasx(event.x)/self.xscale,
-self.cv.canvasy(event.y)/self.yscale)
fun(x, y)
self.cv.bind("<Button-%s>" % num, eventfun, add)
def _onkey(self, fun, key):
"""Bind fun to key-release event of key.
Canvas must have focus. See method listen
"""
if fun is None:
self.cv.unbind("<KeyRelease-%s>" % key, None)
else:
def eventfun(event):
fun()
self.cv.bind("<KeyRelease-%s>" % key, eventfun)
def _listen(self):
"""Set focus on canvas (in order to collect key-events)
"""
self.cv.focus_force()
def _ontimer(self, fun, t):
"""Install a timer, which calls fun after t milliseconds.
"""
if t == 0:
self.cv.after_idle(fun)
else:
self.cv.after(t, fun)
def _createimage(self, image):
"""Create and return image item on canvas.
"""
return self.cv.create_image(0, 0, image=image)
def _drawimage(self, item, (x, y), image):
"""Configure image item as to draw image object
at position (x,y) on canvas)
"""
self.cv.coords(item, (x * self.xscale, -y * self.yscale))
self.cv.itemconfig(item, image=image)
def _setbgpic(self, item, image):
"""Configure image item as to draw image object
at center of canvas. Set item to the first item
in the displaylist, so it will be drawn below
any other item ."""
self.cv.itemconfig(item, image=image)
self.cv.tag_lower(item)
def _type(self, item):
"""Return 'line' or 'polygon' or 'image' depending on
type of item.
"""
return self.cv.type(item)
def _pointlist(self, item):
"""returns list of coordinate-pairs of points of item
Example (for insiders):
>>> from turtle import *
>>> getscreen()._pointlist(getturtle().turtle._item)
[(0.0, 9.9999999999999982), (0.0, -9.9999999999999982),
(9.9999999999999982, 0.0)]
>>> """
cl = self.cv.coords(item)
pl = [(cl[i], -cl[i+1]) for i in range(0, len(cl), 2)]
return pl
def _setscrollregion(self, srx1, sry1, srx2, sry2):
self.cv.config(scrollregion=(srx1, sry1, srx2, sry2))
def _rescale(self, xscalefactor, yscalefactor):
items = self.cv.find_all()
for item in items:
coordinates = self.cv.coords(item)
newcoordlist = []
while coordinates:
x, y = coordinates[:2]
newcoordlist.append(x * xscalefactor)
newcoordlist.append(y * yscalefactor)
coordinates = coordinates[2:]
self.cv.coords(item, *newcoordlist)
def _resize(self, canvwidth=None, canvheight=None, bg=None):
"""Resize the canvas the turtles are drawing on. Does
not alter the drawing window.
"""
# needs amendment
if not isinstance(self.cv, ScrolledCanvas):
return self.canvwidth, self.canvheight
if canvwidth is canvheight is bg is None:
return self.cv.canvwidth, self.cv.canvheight
if canvwidth is not None:
self.canvwidth = canvwidth
if canvheight is not None:
self.canvheight = canvheight
self.cv.reset(canvwidth, canvheight, bg)
def _window_size(self):
""" Return the width and height of the turtle window.
"""
width = self.cv.winfo_width()
if width <= 1: # the window isn't managed by a geometry manager
width = self.cv['width']
height = self.cv.winfo_height()
if height <= 1: # the window isn't managed by a geometry manager
height = self.cv['height']
return width, height
##############################################################################
### End of Tkinter - interface ###
##############################################################################
class Terminator (Exception):
"""Will be raised in TurtleScreen.update, if _RUNNING becomes False.
Thus stops execution of turtle graphics script. Main purpose: use in
in the Demo-Viewer turtle.Demo.py.
"""
pass
class TurtleGraphicsError(Exception):
"""Some TurtleGraphics Error
"""
class Shape(object):
"""Data structure modeling shapes.
attribute _type is one of "polygon", "image", "compound"
attribute _data is - depending on _type a poygon-tuple,
an image or a list constructed using the addcomponent method.
"""
def __init__(self, type_, data=None):
self._type = type_
if type_ == "polygon":
if isinstance(data, list):
data = tuple(data)
elif type_ == "image":
if isinstance(data, str):
if data.lower().endswith(".gif") and isfile(data):
data = TurtleScreen._image(data)
# else data assumed to be Photoimage
elif type_ == "compound":
data = []
else:
raise TurtleGraphicsError("There is no shape type %s" % type_)
self._data = data
def addcomponent(self, poly, fill, outline=None):
"""Add component to a shape of type compound.
Arguments: poly is a polygon, i. e. a tuple of number pairs.
fill is the fillcolor of the component,
outline is the outline color of the component.
call (for a Shapeobject namend s):
-- s.addcomponent(((0,0), (10,10), (-10,10)), "red", "blue")
Example:
>>> poly = ((0,0),(10,-5),(0,10),(-10,-5))
>>> s = Shape("compound")
>>> s.addcomponent(poly, "red", "blue")
### .. add more components and then use register_shape()
"""
if self._type != "compound":
raise TurtleGraphicsError("Cannot add component to %s Shape"
% self._type)
if outline is None:
outline = fill
self._data.append([poly, fill, outline])
class Tbuffer(object):
"""Ring buffer used as undobuffer for RawTurtle objects."""
def __init__(self, bufsize=10):
self.bufsize = bufsize
self.buffer = [[None]] * bufsize
self.ptr = -1
self.cumulate = False
def reset(self, bufsize=None):
if bufsize is None:
for i in range(self.bufsize):
self.buffer[i] = [None]
else:
self.bufsize = bufsize
self.buffer = [[None]] * bufsize
self.ptr = -1
def push(self, item):
if self.bufsize > 0:
if not self.cumulate:
self.ptr = (self.ptr + 1) % self.bufsize
self.buffer[self.ptr] = item
else:
self.buffer[self.ptr].append(item)
def pop(self):
if self.bufsize > 0:
item = self.buffer[self.ptr]
if item is None:
return None
else:
self.buffer[self.ptr] = [None]
self.ptr = (self.ptr - 1) % self.bufsize
return (item)
def nr_of_items(self):
return self.bufsize - self.buffer.count([None])
def __repr__(self):
return str(self.buffer) + " " + str(self.ptr)
class TurtleScreen(TurtleScreenBase):
"""Provides screen oriented methods like setbg etc.
Only relies upon the methods of TurtleScreenBase and NOT
upon components of the underlying graphics toolkit -
which is Tkinter in this case.
"""
# _STANDARD_DELAY = 5
_RUNNING = True
def __init__(self, cv, mode=_CFG["mode"],
colormode=_CFG["colormode"], delay=_CFG["delay"]):
self._shapes = {
"arrow" : Shape("polygon", ((-10,0), (10,0), (0,10))),
"turtle" : Shape("polygon", ((0,16), (-2,14), (-1,10), (-4,7),
(-7,9), (-9,8), (-6,5), (-7,1), (-5,-3), (-8,-6),
(-6,-8), (-4,-5), (0,-7), (4,-5), (6,-8), (8,-6),
(5,-3), (7,1), (6,5), (9,8), (7,9), (4,7), (1,10),
(2,14))),
"circle" : Shape("polygon", ((10,0), (9.51,3.09), (8.09,5.88),
(5.88,8.09), (3.09,9.51), (0,10), (-3.09,9.51),
(-5.88,8.09), (-8.09,5.88), (-9.51,3.09), (-10,0),
(-9.51,-3.09), (-8.09,-5.88), (-5.88,-8.09),
(-3.09,-9.51), (-0.00,-10.00), (3.09,-9.51),
(5.88,-8.09), (8.09,-5.88), (9.51,-3.09))),
"square" : Shape("polygon", ((10,-10), (10,10), (-10,10),
(-10,-10))),
"triangle" : Shape("polygon", ((10,-5.77), (0,11.55),
(-10,-5.77))),
"classic": Shape("polygon", ((0,0),(-5,-9),(0,-7),(5,-9))),
"blank" : Shape("image", self._blankimage())
}
self._bgpics = {"nopic" : ""}
TurtleScreenBase.__init__(self, cv)
self._mode = mode
self._delayvalue = delay
self._colormode = _CFG["colormode"]
self._keys = []
self.clear()
def clear(self):
"""Delete all drawings and all turtles from the TurtleScreen.
Reset empty TurtleScreen to its initial state: white background,
no backgroundimage, no eventbindings and tracing on.
No argument.
Example (for a TurtleScreen instance named screen):
screen.clear()
Note: this method is not available as function.
"""
self._delayvalue = _CFG["delay"]
self._colormode = _CFG["colormode"]
self._delete("all")
self._bgpic = self._createimage("")
self._bgpicname = "nopic"
self._tracing = 1
self._updatecounter = 0
self._turtles = []
self.bgcolor("white")
for btn in 1, 2, 3:
self.onclick(None, btn)
for key in self._keys[:]:
self.onkey(None, key)
Turtle._pen = None
def mode(self, mode=None):
"""Set turtle-mode ('standard', 'logo' or 'world') and perform reset.
Optional argument:
mode -- on of the strings 'standard', 'logo' or 'world'
Mode 'standard' is compatible with turtle.py.
Mode 'logo' is compatible with most Logo-Turtle-Graphics.
Mode 'world' uses userdefined 'worldcoordinates'. *Attention*: in
this mode angles appear distorted if x/y unit-ratio doesn't equal 1.
If mode is not given, return the current mode.
Mode Initial turtle heading positive angles
------------|-------------------------|-------------------
'standard' to the right (east) counterclockwise
'logo' upward (north) clockwise
Examples:
>>> mode('logo') # resets turtle heading to north
>>> mode()
'logo'
"""
if mode is None:
return self._mode
mode = mode.lower()
if mode not in ["standard", "logo", "world"]:
raise TurtleGraphicsError("No turtle-graphics-mode %s" % mode)
self._mode = mode
if mode in ["standard", "logo"]:
self._setscrollregion(-self.canvwidth//2, -self.canvheight//2,
self.canvwidth//2, self.canvheight//2)
self.xscale = self.yscale = 1.0
self.reset()
def setworldcoordinates(self, llx, lly, urx, ury):
"""Set up a user defined coordinate-system.
Arguments:
llx -- a number, x-coordinate of lower left corner of canvas
lly -- a number, y-coordinate of lower left corner of canvas
urx -- a number, x-coordinate of upper right corner of canvas
ury -- a number, y-coordinate of upper right corner of canvas
Set up user coodinat-system and switch to mode 'world' if necessary.
This performs a screen.reset. If mode 'world' is already active,
all drawings are redrawn according to the new coordinates.
But ATTENTION: in user-defined coordinatesystems angles may appear
distorted. (see Screen.mode())
Example (for a TurtleScreen instance named screen):
>>> screen.setworldcoordinates(-10,-0.5,50,1.5)
>>> for _ in range(36):
left(10)
forward(0.5)
"""
if self.mode() != "world":
self.mode("world")
xspan = float(urx - llx)
yspan = float(ury - lly)
wx, wy = self._window_size()
self.screensize(wx-20, wy-20)
oldxscale, oldyscale = self.xscale, self.yscale
self.xscale = self.canvwidth / xspan
self.yscale = self.canvheight / yspan
srx1 = llx * self.xscale
sry1 = -ury * self.yscale
srx2 = self.canvwidth + srx1
sry2 = self.canvheight + sry1
self._setscrollregion(srx1, sry1, srx2, sry2)
self._rescale(self.xscale/oldxscale, self.yscale/oldyscale)
self.update()
def register_shape(self, name, shape=None):
"""Adds a turtle shape to TurtleScreen's shapelist.
Arguments:
(1) name is the name of a gif-file and shape is None.
Installs the corresponding image shape.
!! Image-shapes DO NOT rotate when turning the turtle,
!! so they do not display the heading of the turtle!
(2) name is an arbitrary string and shape is a tuple
of pairs of coordinates. Installs the corresponding
polygon shape
(3) name is an arbitrary string and shape is a
(compound) Shape object. Installs the corresponding
compound shape.
To use a shape, you have to issue the command shape(shapename).
call: register_shape("turtle.gif")
--or: register_shape("tri", ((0,0), (10,10), (-10,10)))
Example (for a TurtleScreen instance named screen):
>>> screen.register_shape("triangle", ((5,-3),(0,5),(-5,-3)))
"""
if shape is None:
# image
if name.lower().endswith(".gif"):
shape = Shape("image", self._image(name))
else:
raise TurtleGraphicsError("Bad arguments for register_shape.\n"
+ "Use help(register_shape)" )
elif isinstance(shape, tuple):
shape = Shape("polygon", shape)
## else shape assumed to be Shape-instance
self._shapes[name] = shape
# print "shape added:" , self._shapes
def _colorstr(self, color):
"""Return color string corresponding to args.
Argument may be a string or a tuple of three
numbers corresponding to actual colormode,
i.e. in the range 0<=n<=colormode.
If the argument doesn't represent a color,
an error is raised.
"""
if len(color) == 1:
color = color[0]
if isinstance(color, str):
if self._iscolorstring(color) or color == "":
return color
else:
raise TurtleGraphicsError("bad color string: %s" % str(color))
try:
r, g, b = color
except:
raise TurtleGraphicsError("bad color arguments: %s" % str(color))
if self._colormode == 1.0:
r, g, b = [round(255.0*x) for x in (r, g, b)]
if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
raise TurtleGraphicsError("bad color sequence: %s" % str(color))
return "#%02x%02x%02x" % (r, g, b)
def _color(self, cstr):
if not cstr.startswith("#"):
return cstr
if len(cstr) == 7:
cl = [int(cstr[i:i+2], 16) for i in (1, 3, 5)]
elif len(cstr) == 4:
cl = [16*int(cstr[h], 16) for h in cstr[1:]]
else:
raise TurtleGraphicsError("bad colorstring: %s" % cstr)
return tuple([c * self._colormode/255 for c in cl])
def colormode(self, cmode=None):
"""Return the colormode or set it to 1.0 or 255.
Optional argument:
cmode -- one of the values 1.0 or 255
r, g, b values of colortriples have to be in range 0..cmode.
Example (for a TurtleScreen instance named screen):
>>> screen.colormode()
1.0
>>> screen.colormode(255)
>>> turtle.pencolor(240,160,80)
"""
if cmode is None:
return self._colormode
if cmode == 1.0:
self._colormode = float(cmode)
elif cmode == 255:
self._colormode = int(cmode)
def reset(self):
"""Reset all Turtles on the Screen to their initial state.
No argument.
Example (for a TurtleScreen instance named screen):
>>> screen.reset()
"""
for turtle in self._turtles:
turtle._setmode(self._mode)
turtle.reset()
def turtles(self):
"""Return the list of turtles on the screen.
Example (for a TurtleScreen instance named screen):
>>> screen.turtles()
[<turtle.Turtle object at 0x00E11FB0>]
"""
return self._turtles
def bgcolor(self, *args):
"""Set or return backgroundcolor of the TurtleScreen.
Arguments (if given): a color string or three numbers
in the range 0..colormode or a 3-tuple of such numbers.
Example (for a TurtleScreen instance named screen):
>>> screen.bgcolor("orange")
>>> screen.bgcolor()
'orange'
>>> screen.bgcolor(0.5,0,0.5)
>>> screen.bgcolor()
'#800080'
"""
if args:
color = self._colorstr(args)
else:
color = None
color = self._bgcolor(color)
if color is not None:
color = self._color(color)
return color
def tracer(self, n=None, delay=None):
"""Turns turtle animation on/off and set delay for update drawings.
Optional arguments:
n -- nonnegative integer
delay -- nonnegative integer
If n is given, only each n-th regular screen update is really performed.
(Can be used to accelerate the drawing of complex graphics.)
Second arguments sets delay value (see RawTurtle.delay())
Example (for a TurtleScreen instance named screen):
>>> screen.tracer(8, 25)
>>> dist = 2
>>> for i in range(200):
fd(dist)
rt(90)
dist += 2
"""
if n is None:
return self._tracing
self._tracing = int(n)
self._updatecounter = 0
if delay is not None:
self._delayvalue = int(delay)
if self._tracing:
self.update()
def delay(self, delay=None):
""" Return or set the drawing delay in milliseconds.
Optional argument:
delay -- positive integer
Example (for a TurtleScreen instance named screen):
>>> screen.delay(15)
>>> screen.delay()
15
"""
if delay is None:
return self._delayvalue
self._delayvalue = int(delay)
def _incrementudc(self):
"Increment upadate counter."""
if not TurtleScreen._RUNNING:
TurtleScreen._RUNNNING = True
raise Terminator
if self._tracing > 0:
self._updatecounter += 1
self._updatecounter %= self._tracing
def update(self):
"""Perform a TurtleScreen update.
"""
tracing = self._tracing
self._tracing = True
for t in self.turtles():
t._update_data()
t._drawturtle()
self._tracing = tracing
self._update()
def window_width(self):
""" Return the width of the turtle window.
Example (for a TurtleScreen instance named screen):
>>> screen.window_width()
640
"""
return self._window_size()[0]
def window_height(self):
""" Return the height of the turtle window.
Example (for a TurtleScreen instance named screen):
>>> screen.window_height()
480
"""
return self._window_size()[1]
def getcanvas(self):
"""Return the Canvas of this TurtleScreen.
No argument.
Example (for a Screen instance named screen):
>>> cv = screen.getcanvas()
>>> cv
<turtle.ScrolledCanvas instance at 0x010742D8>
"""
return self.cv
def getshapes(self):
"""Return a list of names of all currently available turtle shapes.
No argument.
Example (for a TurtleScreen instance named screen):
>>> screen.getshapes()
['arrow', 'blank', 'circle', ... , 'turtle']
"""
return sorted(self._shapes.keys())
def onclick(self, fun, btn=1, add=None):
"""Bind fun to mouse-click event on canvas.
Arguments:
fun -- a function with two arguments, the coordinates of the
clicked point on the canvas.
num -- the number of the mouse-button, defaults to 1
Example (for a TurtleScreen instance named screen
and a Turtle instance named turtle):
>>> screen.onclick(turtle.goto)
### Subsequently clicking into the TurtleScreen will
### make the turtle move to the clicked point.
>>> screen.onclick(None)
### event-binding will be removed
"""
self._onscreenclick(fun, btn, add)
def onkey(self, fun, key):
"""Bind fun to key-release event of key.
Arguments:
fun -- a function with no arguments
key -- a string: key (e.g. "a") or key-symbol (e.g. "space")
In order to be able to register key-events, TurtleScreen
must have focus. (See method listen.)
Example (for a TurtleScreen instance named screen
and a Turtle instance named turtle):
>>> def f():
fd(50)
lt(60)
>>> screen.onkey(f, "Up")
>>> screen.listen()
### Subsequently the turtle can be moved by
### repeatedly pressing the up-arrow key,
### consequently drawing a hexagon
"""
if fun is None:
if key in self._keys:
self._keys.remove(key)
elif key not in self._keys:
self._keys.append(key)
self._onkey(fun, key)
def listen(self, xdummy=None, ydummy=None):
"""Set focus on TurtleScreen (in order to collect key-events)
No arguments.
Dummy arguments are provided in order
to be able to pass listen to the onclick method.
Example (for a TurtleScreen instance named screen):
>>> screen.listen()
"""
self._listen()
def ontimer(self, fun, t=0):
"""Install a timer, which calls fun after t milliseconds.
Arguments:
fun -- a function with no arguments.
t -- a number >= 0
Example (for a TurtleScreen instance named screen):
>>> running = True
>>> def f():
if running:
fd(50)
lt(60)
screen.ontimer(f, 250)
>>> f() ### makes the turtle marching around
>>> running = False
"""
self._ontimer(fun, t)
def bgpic(self, picname=None):
"""Set background image or return name of current backgroundimage.
Optional argument:
picname -- a string, name of a gif-file or "nopic".
If picname is a filename, set the corresponing image as background.
If picname is "nopic", delete backgroundimage, if present.
If picname is None, return the filename of the current backgroundimage.
Example (for a TurtleScreen instance named screen):
>>> screen.bgpic()
'nopic'
>>> screen.bgpic("landscape.gif")
>>> screen.bgpic()
'landscape.gif'
"""
if picname is None:
return self._bgpicname
if picname not in self._bgpics:
self._bgpics[picname] = self._image(picname)
self._setbgpic(self._bgpic, self._bgpics[picname])
self._bgpicname = picname
def screensize(self, canvwidth=None, canvheight=None, bg=None):
"""Resize the canvas the turtles are drawing on.
Optional arguments:
canvwidth -- positive integer, new width of canvas in pixels
canvheight -- positive integer, new height of canvas in pixels
bg -- colorstring or color-tupel, new backgroundcolor
If no arguments are given, return current (canvaswidth, canvasheight)
Do not alter the drawing window. To observe hidden parts of
the canvas use the scrollbars. (Can make visible those parts
of a drawing, which were outside the canvas before!)
Example (for a Turtle instance named turtle):
>>> turtle.screensize(2000,1500)
### e. g. to search for an erroneously escaped turtle ;-)
"""
return self._resize(canvwidth, canvheight, bg)
onscreenclick = onclick
resetscreen = reset
clearscreen = clear
addshape = register_shape
class TNavigator(object):
"""Navigation part of the RawTurtle.
Implements methods for turtle movement.
"""
START_ORIENTATION = {
"standard": Vec2D(1.0, 0.0),
"world" : Vec2D(1.0, 0.0),
"logo" : Vec2D(0.0, 1.0) }
DEFAULT_MODE = "standard"
DEFAULT_ANGLEOFFSET = 0
DEFAULT_ANGLEORIENT = 1
def __init__(self, mode=DEFAULT_MODE):
self._angleOffset = self.DEFAULT_ANGLEOFFSET
self._angleOrient = self.DEFAULT_ANGLEORIENT
self._mode = mode
self.undobuffer = None
self.degrees()
self._mode = None
self._setmode(mode)
TNavigator.reset(self)
def reset(self):
"""reset turtle to its initial values
Will be overwritten by parent class
"""
self._position = Vec2D(0.0, 0.0)
self._orient = TNavigator.START_ORIENTATION[self._mode]
def _setmode(self, mode=None):
"""Set turtle-mode to 'standard', 'world' or 'logo'.
"""
if mode is None:
return self._mode
if mode not in ["standard", "logo", "world"]:
return
self._mode = mode
if mode in ["standard", "world"]:
self._angleOffset = 0
self._angleOrient = 1
else: # mode == "logo":
self._angleOffset = self._fullcircle/4.
self._angleOrient = -1
def _setDegreesPerAU(self, fullcircle):
"""Helper function for degrees() and radians()"""
self._fullcircle = fullcircle
self._degreesPerAU = 360/fullcircle
if self._mode == "standard":
self._angleOffset = 0
else:
self._angleOffset = fullcircle/4.
def degrees(self, fullcircle=360.0):
""" Set angle measurement units to degrees.
Optional argument:
fullcircle - a number
Set angle measurement units, i. e. set number
of 'degrees' for a full circle. Dafault value is
360 degrees.
Example (for a Turtle instance named turtle):
>>> turtle.left(90)
>>> turtle.heading()
90
Change angle measurement unit to grad (also known as gon,
grade, or gradian and equals 1/100-th of the right angle.)
>>> turtle.degrees(400.0)
>>> turtle.heading()
100
"""
self._setDegreesPerAU(fullcircle)
def radians(self):
""" Set the angle measurement units to radians.
No arguments.
Example (for a Turtle instance named turtle):
>>> turtle.heading()
90
>>> turtle.radians()
>>> turtle.heading()
1.5707963267948966
"""
self._setDegreesPerAU(2*math.pi)
def _go(self, distance):
"""move turtle forward by specified distance"""
ende = self._position + self._orient * distance
self._goto(ende)
def _rotate(self, angle):
"""Turn turtle counterclockwise by specified angle if angle > 0."""
angle *= self._degreesPerAU
self._orient = self._orient.rotate(angle)
def _goto(self, end):
"""move turtle to position end."""
self._position = end
def forward(self, distance):
"""Move the turtle forward by the specified distance.
Aliases: forward | fd
Argument:
distance -- a number (integer or float)
Move the turtle forward by the specified distance, in the direction
the turtle is headed.
Example (for a Turtle instance named turtle):
>>> turtle.position()
(0.00, 0.00)
>>> turtle.forward(25)
>>> turtle.position()
(25.00,0.00)
>>> turtle.forward(-75)
>>> turtle.position()
(-50.00,0.00)
"""
self._go(distance)
def back(self, distance):
"""Move the turtle backward by distance.
Aliases: back | backward | bk
Argument:
distance -- a number
Move the turtle backward by distance ,opposite to the direction the
turtle is headed. Do not change the turtle's heading.
Example (for a Turtle instance named turtle):
>>> turtle.position()
(0.00, 0.00)
>>> turtle.backward(30)
>>> turtle.position()
(-30.00, 0.00)
"""
self._go(-distance)
def right(self, angle):
"""Turn turtle right by angle units.
Aliases: right | rt
Argument:
angle -- a number (integer or float)
Turn turtle right by angle units. (Units are by default degrees,
but can be set via the degrees() and radians() functions.)
Angle orientation depends on mode. (See this.)
Example (for a Turtle instance named turtle):
>>> turtle.heading()
22.0
>>> turtle.right(45)
>>> turtle.heading()
337.0
"""
self._rotate(-angle)
def left(self, angle):
"""Turn turtle left by angle units.
Aliases: left | lt
Argument:
angle -- a number (integer or float)
Turn turtle left by angle units. (Units are by default degrees,
but can be set via the degrees() and radians() functions.)
Angle orientation depends on mode. (See this.)
Example (for a Turtle instance named turtle):
>>> turtle.heading()
22.0
>>> turtle.left(45)
>>> turtle.heading()
67.0
"""
self._rotate(angle)
def pos(self):
"""Return the turtle's current location (x,y), as a Vec2D-vector.
Aliases: pos | position
No arguments.
Example (for a Turtle instance named turtle):
>>> turtle.pos()
(0.00, 240.00)
"""
return self._position
def xcor(self):
""" Return the turtle's x coordinate.
No arguments.
Example (for a Turtle instance named turtle):
>>> reset()
>>> turtle.left(60)
>>> turtle.forward(100)
>>> print turtle.xcor()
50.0
"""
return self._position[0]
def ycor(self):
""" Return the turtle's y coordinate
---
No arguments.
Example (for a Turtle instance named turtle):
>>> reset()
>>> turtle.left(60)
>>> turtle.forward(100)
>>> print turtle.ycor()
86.6025403784
"""
return self._position[1]
def goto(self, x, y=None):
"""Move turtle to an absolute position.
Aliases: setpos | setposition | goto:
Arguments:
x -- a number or a pair/vector of numbers
y -- a number None
call: goto(x, y) # two coordinates
--or: goto((x, y)) # a pair (tuple) of coordinates
--or: goto(vec) # e.g. as returned by pos()
Move turtle to an absolute position. If the pen is down,
a line will be drawn. The turtle's orientation does not change.
Example (for a Turtle instance named turtle):
>>> tp = turtle.pos()
>>> tp
(0.00, 0.00)
>>> turtle.setpos(60,30)
>>> turtle.pos()
(60.00,30.00)
>>> turtle.setpos((20,80))
>>> turtle.pos()
(20.00,80.00)
>>> turtle.setpos(tp)
>>> turtle.pos()
(0.00,0.00)
"""
if y is None:
self._goto(Vec2D(*x))
else:
self._goto(Vec2D(x, y))
def home(self):
"""Move turtle to the origin - coordinates (0,0).
No arguments.
Move turtle to the origin - coordinates (0,0) and set its
heading to its start-orientation (which depends on mode).
Example (for a Turtle instance named turtle):
>>> turtle.home()
"""
self.goto(0, 0)
self.setheading(0)
def setx(self, x):
"""Set the turtle's first coordinate to x
Argument:
x -- a number (integer or float)
Set the turtle's first coordinate to x, leave second coordinate
unchanged.
Example (for a Turtle instance named turtle):
>>> turtle.position()
(0.00, 240.00)
>>> turtle.setx(10)
>>> turtle.position()
(10.00, 240.00)
"""
self._goto(Vec2D(x, self._position[1]))
def sety(self, y):
"""Set the turtle's second coordinate to y
Argument:
y -- a number (integer or float)
Set the turtle's first coordinate to x, second coordinate remains
unchanged.
Example (for a Turtle instance named turtle):
>>> turtle.position()
(0.00, 40.00)
>>> turtle.sety(-10)
>>> turtle.position()
(0.00, -10.00)
"""
self._goto(Vec2D(self._position[0], y))
def distance(self, x, y=None):
"""Return the distance from the turtle to (x,y) in turtle step units.
Arguments:
x -- a number or a pair/vector of numbers or a turtle instance
y -- a number None None
call: distance(x, y) # two coordinates
--or: distance((x, y)) # a pair (tuple) of coordinates
--or: distance(vec) # e.g. as returned by pos()
--or: distance(mypen) # where mypen is another turtle
Example (for a Turtle instance named turtle):
>>> turtle.pos()
(0.00, 0.00)
>>> turtle.distance(30,40)
50.0
>>> pen = Turtle()
>>> pen.forward(77)
>>> turtle.distance(pen)
77.0
"""
if y is not None:
pos = Vec2D(x, y)
if isinstance(x, Vec2D):
pos = x
elif isinstance(x, tuple):
pos = Vec2D(*x)
elif isinstance(x, TNavigator):
pos = x._position
return abs(pos - self._position)
def towards(self, x, y=None):
"""Return the angle of the line from the turtle's position to (x, y).
Arguments:
x -- a number or a pair/vector of numbers or a turtle instance
y -- a number None None
call: distance(x, y) # two coordinates
--or: distance((x, y)) # a pair (tuple) of coordinates
--or: distance(vec) # e.g. as returned by pos()
--or: distance(mypen) # where mypen is another turtle
Return the angle, between the line from turtle-position to position
specified by x, y and the turtle's start orientation. (Depends on
modes - "standard" or "logo")
Example (for a Turtle instance named turtle):
>>> turtle.pos()
(10.00, 10.00)
>>> turtle.towards(0,0)
225.0
"""
if y is not None:
pos = Vec2D(x, y)
if isinstance(x, Vec2D):
pos = x
elif isinstance(x, tuple):
pos = Vec2D(*x)
elif isinstance(x, TNavigator):
pos = x._position
x, y = pos - self._position
result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
result /= self._degreesPerAU
return (self._angleOffset + self._angleOrient*result) % self._fullcircle
def heading(self):
""" Return the turtle's current heading.
No arguments.
Example (for a Turtle instance named turtle):
>>> turtle.left(67)
>>> turtle.heading()
67.0
"""
x, y = self._orient
result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
result /= self._degreesPerAU
return (self._angleOffset + self._angleOrient*result) % self._fullcircle
def setheading(self, to_angle):
"""Set the orientation of the turtle to to_angle.
Aliases: setheading | seth
Argument:
to_angle -- a number (integer or float)
Set the orientation of the turtle to to_angle.
Here are some common directions in degrees:
standard - mode: logo-mode:
-------------------|--------------------
0 - east 0 - north
90 - north 90 - east
180 - west 180 - south
270 - south 270 - west
Example (for a Turtle instance named turtle):
>>> turtle.setheading(90)
>>> turtle.heading()
90
"""
angle = (to_angle - self.heading())*self._angleOrient
full = self._fullcircle
angle = (angle+full/2.)%full - full/2.
self._rotate(angle)
def circle(self, radius, extent = None, steps = None):
""" Draw a circle with given radius.
Arguments:
radius -- a number
extent (optional) -- a number
steps (optional) -- an integer
Draw a circle with given radius. The center is radius units left
of the turtle; extent - an angle - determines which part of the
circle is drawn. If extent is not given, draw the entire circle.
If extent is not a full circle, one endpoint of the arc is the
current pen position. Draw the arc in counterclockwise direction
if radius is positive, otherwise in clockwise direction. Finally
the direction of the turtle is changed by the amount of extent.
As the circle is approximated by an inscribed regular polygon,
steps determines the number of steps to use. If not given,
it will be calculated automatically. Maybe used to draw regular
polygons.
call: circle(radius) # full circle
--or: circle(radius, extent) # arc
--or: circle(radius, extent, steps)
--or: circle(radius, steps=6) # 6-sided polygon
Example (for a Turtle instance named turtle):
>>> turtle.circle(50)
>>> turtle.circle(120, 180) # semicircle
"""
if self.undobuffer:
self.undobuffer.push(["seq"])
self.undobuffer.cumulate = True
speed = self.speed()
if extent is None:
extent = self._fullcircle
if steps is None:
frac = abs(extent)/self._fullcircle
steps = 1+int(min(11+abs(radius)/6.0, 59.0)*frac)
w = 1.0 * extent / steps
w2 = 0.5 * w
l = 2.0 * radius * math.sin(w2*math.pi/180.0*self._degreesPerAU)
if radius < 0:
l, w, w2 = -l, -w, -w2
tr = self.tracer()
dl = self._delay()
if speed == 0:
self.tracer(0, 0)
else:
self.speed(0)
self._rotate(w2)
for i in range(steps):
self.speed(speed)
self._go(l)
self.speed(0)
self._rotate(w)
self._rotate(-w2)
if speed == 0:
self.tracer(tr, dl)
self.speed(speed)
if self.undobuffer:
self.undobuffer.cumulate = False
## three dummy methods to be implemented by child class:
def speed(self, s=0):
"""dummy method - to be overwritten by child class"""
def tracer(self, a=None, b=None):
"""dummy method - to be overwritten by child class"""
def _delay(self, n=None):
"""dummy method - to be overwritten by child class"""
fd = forward
bk = back
backward = back
rt = right
lt = left
position = pos
setpos = goto
setposition = goto
seth = setheading
class TPen(object):
"""Drawing part of the RawTurtle.
Implements drawing properties.
"""
def __init__(self, resizemode=_CFG["resizemode"]):
self._resizemode = resizemode # or "user" or "noresize"
self.undobuffer = None
TPen._reset(self)
def _reset(self, pencolor=_CFG["pencolor"],
fillcolor=_CFG["fillcolor"]):
self._pensize = 1
self._shown = True
self._pencolor = pencolor
self._fillcolor = fillcolor
self._drawing = True
self._speed = 3
self._stretchfactor = (1, 1)
self._tilt = 0
self._outlinewidth = 1
### self.screen = None # to override by child class
def resizemode(self, rmode=None):
"""Set resizemode to one of the values: "auto", "user", "noresize".
(Optional) Argument:
rmode -- one of the strings "auto", "user", "noresize"
Different resizemodes have the following effects:
- "auto" adapts the appearance of the turtle
corresponding to the value of pensize.
- "user" adapts the appearance of the turtle according to the
values of stretchfactor and outlinewidth (outline),
which are set by shapesize()
- "noresize" no adaption of the turtle's appearance takes place.
If no argument is given, return current resizemode.
resizemode("user") is called by a call of shapesize with arguments.
Examples (for a Turtle instance named turtle):
>>> turtle.resizemode("noresize")
>>> turtle.resizemode()
'noresize'
"""
if rmode is None:
return self._resizemode
rmode = rmode.lower()
if rmode in ["auto", "user", "noresize"]:
self.pen(resizemode=rmode)
def pensize(self, width=None):
"""Set or return the line thickness.
Aliases: pensize | width
Argument:
width -- positive number
Set the line thickness to width or return it. If resizemode is set
to "auto" and turtleshape is a polygon, that polygon is drawn with
the same line thickness. If no argument is given, current pensize
is returned.
Example (for a Turtle instance named turtle):
>>> turtle.pensize()
1
turtle.pensize(10) # from here on lines of width 10 are drawn
"""
if width is None:
return self._pensize
self.pen(pensize=width)
def penup(self):
"""Pull the pen up -- no drawing when moving.
Aliases: penup | pu | up
No argument
Example (for a Turtle instance named turtle):
>>> turtle.penup()
"""
if not self._drawing:
return
self.pen(pendown=False)
def pendown(self):
"""Pull the pen down -- drawing when moving.
Aliases: pendown | pd | down
No argument.
Example (for a Turtle instance named turtle):
>>> turtle.pendown()
"""
if self._drawing:
return
self.pen(pendown=True)
def isdown(self):
"""Return True if pen is down, False if it's up.
No argument.
Example (for a Turtle instance named turtle):
>>> turtle.penup()
>>> turtle.isdown()
False
>>> turtle.pendown()
>>> turtle.isdown()
True
"""
return self._drawing
def speed(self, speed=None):
""" Return or set the turtle's speed.
Optional argument:
speed -- an integer in the range 0..10 or a speedstring (see below)
Set the turtle's speed to an integer value in the range 0 .. 10.
If no argument is given: return current speed.
If input is a number greater than 10 or smaller than 0.5,
speed is set to 0.
Speedstrings are mapped to speedvalues in the following way:
'fastest' : 0
'fast' : 10
'normal' : 6
'slow' : 3
'slowest' : 1
speeds from 1 to 10 enforce increasingly faster animation of
line drawing and turtle turning.
Attention:
speed = 0 : *no* animation takes place. forward/back makes turtle jump
and likewise left/right make the turtle turn instantly.
Example (for a Turtle instance named turtle):
>>> turtle.speed(3)
"""
speeds = {'fastest':0, 'fast':10, 'normal':6, 'slow':3, 'slowest':1 }
if speed is None:
return self._speed
if speed in speeds:
speed = speeds[speed]
elif 0.5 < speed < 10.5:
speed = int(round(speed))
else:
speed = 0
self.pen(speed=speed)
def color(self, *args):
"""Return or set the pencolor and fillcolor.
Arguments:
Several input formats are allowed.
They use 0, 1, 2, or 3 arguments as follows:
color()
Return the current pencolor and the current fillcolor
as a pair of color specification strings as are returned
by pencolor and fillcolor.
color(colorstring), color((r,g,b)), color(r,g,b)
inputs as in pencolor, set both, fillcolor and pencolor,
to the given value.
color(colorstring1, colorstring2),
color((r1,g1,b1), (r2,g2,b2))
equivalent to pencolor(colorstring1) and fillcolor(colorstring2)
and analogously, if the other input format is used.
If turtleshape is a polygon, outline and interior of that polygon
is drawn with the newly set colors.
For mor info see: pencolor, fillcolor
Example (for a Turtle instance named turtle):
>>> turtle.color('red', 'green')
>>> turtle.color()
('red', 'green')
>>> colormode(255)
>>> color((40, 80, 120), (160, 200, 240))
>>> color()
('#285078', '#a0c8f0')
"""
if args:
l = len(args)
if l == 1:
pcolor = fcolor = args[0]
elif l == 2:
pcolor, fcolor = args
elif l == 3:
pcolor = fcolor = args
pcolor = self._colorstr(pcolor)
fcolor = self._colorstr(fcolor)
self.pen(pencolor=pcolor, fillcolor=fcolor)
else:
return self._color(self._pencolor), self._color(self._fillcolor)
def pencolor(self, *args):
""" Return or set the pencolor.
Arguments:
Four input formats are allowed:
- pencolor()
Return the current pencolor as color specification string,
possibly in hex-number format (see example).
May be used as input to another color/pencolor/fillcolor call.
- pencolor(colorstring)
s is a Tk color specification string, such as "red" or "yellow"
- pencolor((r, g, b))
*a tuple* of r, g, and b, which represent, an RGB color,
and each of r, g, and b are in the range 0..colormode,
where colormode is either 1.0 or 255
- pencolor(r, g, b)
r, g, and b represent an RGB color, and each of r, g, and b
are in the range 0..colormode
If turtleshape is a polygon, the outline of that polygon is drawn
with the newly set pencolor.
Example (for a Turtle instance named turtle):
>>> turtle.pencolor('brown')
>>> tup = (0.2, 0.8, 0.55)
>>> turtle.pencolor(tup)
>>> turtle.pencolor()
'#33cc8c'
"""
if args:
color = self._colorstr(args)
if color == self._pencolor:
return
self.pen(pencolor=color)
else:
return self._color(self._pencolor)
def fillcolor(self, *args):
""" Return or set the fillcolor.
Arguments:
Four input formats are allowed:
- fillcolor()
Return the current fillcolor as color specification string,
possibly in hex-number format (see example).
May be used as input to another color/pencolor/fillcolor call.
- fillcolor(colorstring)
s is a Tk color specification string, such as "red" or "yellow"
- fillcolor((r, g, b))
*a tuple* of r, g, and b, which represent, an RGB color,
and each of r, g, and b are in the range 0..colormode,
where colormode is either 1.0 or 255
- fillcolor(r, g, b)
r, g, and b represent an RGB color, and each of r, g, and b
are in the range 0..colormode
If turtleshape is a polygon, the interior of that polygon is drawn
with the newly set fillcolor.
Example (for a Turtle instance named turtle):
>>> turtle.fillcolor('violet')
>>> col = turtle.pencolor()
>>> turtle.fillcolor(col)
>>> turtle.fillcolor(0, .5, 0)
"""
if args:
color = self._colorstr(args)
if color == self._fillcolor:
return
self.pen(fillcolor=color)
else:
return self._color(self._fillcolor)
def showturtle(self):
"""Makes the turtle visible.
Aliases: showturtle | st
No argument.
Example (for a Turtle instance named turtle):
>>> turtle.hideturtle()
>>> turtle.showturtle()
"""
self.pen(shown=True)
def hideturtle(self):
"""Makes the turtle invisible.
Aliases: hideturtle | ht
No argument.
It's a good idea to do this while you're in the
middle of a complicated drawing, because hiding
the turtle speeds up the drawing observably.
Example (for a Turtle instance named turtle):
>>> turtle.hideturtle()
"""
self.pen(shown=False)
def isvisible(self):
"""Return True if the Turtle is shown, False if it's hidden.
No argument.
Example (for a Turtle instance named turtle):
>>> turtle.hideturtle()
>>> print turtle.isvisible():
False
"""
return self._shown
def pen(self, pen=None, **pendict):
"""Return or set the pen's attributes.
Arguments:
pen -- a dictionary with some or all of the below listed keys.
**pendict -- one or more keyword-arguments with the below
listed keys as keywords.
Return or set the pen's attributes in a 'pen-dictionary'
with the following key/value pairs:
"shown" : True/False
"pendown" : True/False
"pencolor" : color-string or color-tuple
"fillcolor" : color-string or color-tuple
"pensize" : positive number
"speed" : number in range 0..10
"resizemode" : "auto" or "user" or "noresize"
"stretchfactor": (positive number, positive number)
"outline" : positive number
"tilt" : number
This dictionary can be used as argument for a subsequent
pen()-call to restore the former pen-state. Moreover one
or more of these attributes can be provided as keyword-arguments.
This can be used to set several pen attributes in one statement.
Examples (for a Turtle instance named turtle):
>>> turtle.pen(fillcolor="black", pencolor="red", pensize=10)
>>> turtle.pen()
{'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
'pencolor': 'red', 'pendown': True, 'fillcolor': 'black',
'stretchfactor': (1,1), 'speed': 3}
>>> penstate=turtle.pen()
>>> turtle.color("yellow","")
>>> turtle.penup()
>>> turtle.pen()
{'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
'pencolor': 'yellow', 'pendown': False, 'fillcolor': '',
'stretchfactor': (1,1), 'speed': 3}
>>> p.pen(penstate, fillcolor="green")
>>> p.pen()
{'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
'pencolor': 'red', 'pendown': True, 'fillcolor': 'green',
'stretchfactor': (1,1), 'speed': 3}
"""
_pd = {"shown" : self._shown,
"pendown" : self._drawing,
"pencolor" : self._pencolor,
"fillcolor" : self._fillcolor,
"pensize" : self._pensize,
"speed" : self._speed,
"resizemode" : self._resizemode,
"stretchfactor" : self._stretchfactor,
"outline" : self._outlinewidth,
"tilt" : self._tilt
}
if not (pen or pendict):
return _pd
if isinstance(pen, dict):
p = pen
else:
p = {}
p.update(pendict)
_p_buf = {}
for key in p:
_p_buf[key] = _pd[key]
if self.undobuffer:
self.undobuffer.push(("pen", _p_buf))
newLine = False
if "pendown" in p:
if self._drawing != p["pendown"]:
newLine = True
if "pencolor" in p:
if isinstance(p["pencolor"], tuple):
p["pencolor"] = self._colorstr((p["pencolor"],))
if self._pencolor != p["pencolor"]:
newLine = True
if "pensize" in p:
if self._pensize != p["pensize"]:
newLine = True
if newLine:
self._newLine()
if "pendown" in p:
self._drawing = p["pendown"]
if "pencolor" in p:
self._pencolor = p["pencolor"]
if "pensize" in p:
self._pensize = p["pensize"]
if "fillcolor" in p:
if isinstance(p["fillcolor"], tuple):
p["fillcolor"] = self._colorstr((p["fillcolor"],))
self._fillcolor = p["fillcolor"]
if "speed" in p:
self._speed = p["speed"]
if "resizemode" in p:
self._resizemode = p["resizemode"]
if "stretchfactor" in p:
sf = p["stretchfactor"]
if isinstance(sf, (int, float)):
sf = (sf, sf)
self._stretchfactor = sf
if "outline" in p:
self._outlinewidth = p["outline"]
if "shown" in p:
self._shown = p["shown"]
if "tilt" in p:
self._tilt = p["tilt"]
self._update()
## three dummy methods to be implemented by child class:
def _newLine(self, usePos = True):
"""dummy method - to be overwritten by child class"""
def _update(self, count=True, forced=False):
"""dummy method - to be overwritten by child class"""
def _color(self, args):
"""dummy method - to be overwritten by child class"""
def _colorstr(self, args):
"""dummy method - to be overwritten by child class"""
width = pensize
up = penup
pu = penup
pd = pendown
down = pendown
st = showturtle
ht = hideturtle
class _TurtleImage(object):
"""Helper class: Datatype to store Turtle attributes
"""
def __init__(self, screen, shapeIndex):
self.screen = screen
self._type = None
self._setshape(shapeIndex)
def _setshape(self, shapeIndex):
screen = self.screen # RawTurtle.screens[self.screenIndex]
self.shapeIndex = shapeIndex
if self._type == "polygon" == screen._shapes[shapeIndex]._type:
return
if self._type == "image" == screen._shapes[shapeIndex]._type:
return
if self._type in ["image", "polygon"]:
screen._delete(self._item)
elif self._type == "compound":
for item in self._item:
screen._delete(item)
self._type = screen._shapes[shapeIndex]._type
if self._type == "polygon":
self._item = screen._createpoly()
elif self._type == "image":
self._item = screen._createimage(screen._shapes["blank"]._data)
elif self._type == "compound":
self._item = [screen._createpoly() for item in
screen._shapes[shapeIndex]._data]
class RawTurtle(TPen, TNavigator):
"""Animation part of the RawTurtle.
Puts RawTurtle upon a TurtleScreen and provides tools for
its animation.
"""
screens = []
def __init__(self, canvas=None,
shape=_CFG["shape"],
undobuffersize=_CFG["undobuffersize"],
visible=_CFG["visible"]):
if isinstance(canvas, _Screen):
self.screen = canvas
elif isinstance(canvas, TurtleScreen):
if canvas not in RawTurtle.screens:
RawTurtle.screens.append(canvas)
self.screen = canvas
elif isinstance(canvas, (ScrolledCanvas, Canvas)):
for screen in RawTurtle.screens:
if screen.cv == canvas:
self.screen = screen
break
else:
self.screen = TurtleScreen(canvas)
RawTurtle.screens.append(self.screen)
else:
raise TurtleGraphicsError("bad cavas argument %s" % canvas)
screen = self.screen
TNavigator.__init__(self, screen.mode())
TPen.__init__(self)
screen._turtles.append(self)
self.drawingLineItem = screen._createline()
self.turtle = _TurtleImage(screen, shape)
self._poly = None
self._creatingPoly = False
self._fillitem = self._fillpath = None
self._shown = visible
self._hidden_from_screen = False
self.currentLineItem = screen._createline()
self.currentLine = [self._position]
self.items = [self.currentLineItem]
self.stampItems = []
self._undobuffersize = undobuffersize
self.undobuffer = Tbuffer(undobuffersize)
self._update()
def reset(self):
"""Delete the turtle's drawings and restore its default values.
No argument.
,
Delete the turtle's drawings from the screen, re-center the turtle
and set variables to the default values.
Example (for a Turtle instance named turtle):
>>> turtle.position()
(0.00,-22.00)
>>> turtle.heading()
100.0
>>> turtle.reset()
>>> turtle.position()
(0.00,0.00)
>>> turtle.heading()
0.0
"""
TNavigator.reset(self)
TPen._reset(self)
self._clear()
self._drawturtle()
self._update()
def setundobuffer(self, size):
"""Set or disable undobuffer.
Argument:
size -- an integer or None
If size is an integer an empty undobuffer of given size is installed.
Size gives the maximum number of turtle-actions that can be undone
by the undo() function.
If size is None, no undobuffer is present.
Example (for a Turtle instance named turtle):
>>> turtle.setundobuffer(42)
"""
if size is None:
self.undobuffer = None
else:
self.undobuffer = Tbuffer(size)
def undobufferentries(self):
"""Return count of entries in the undobuffer.
No argument.
Example (for a Turtle instance named turtle):
>>> while undobufferentries():
undo()
"""
if self.undobuffer is None:
return 0
return self.undobuffer.nr_of_items()
def _clear(self):
"""Delete all of pen's drawings"""
self._fillitem = self._fillpath = None
for item in self.items:
self.screen._delete(item)
self.currentLineItem = self.screen._createline()
self.currentLine = []
if self._drawing:
self.currentLine.append(self._position)
self.items = [self.currentLineItem]
self.clearstamps()
self.setundobuffer(self._undobuffersize)
def clear(self):
"""Delete the turtle's drawings from the screen. Do not move turtle.
No arguments.
Delete the turtle's drawings from the screen. Do not move turtle.
State and position of the turtle as well as drawings of other
turtles are not affected.
Examples (for a Turtle instance named turtle):
>>> turtle.clear()
"""
self._clear()
self._update()
def _update_data(self):
self.screen._incrementudc()
if self.screen._updatecounter != 0:
return
if len(self.currentLine)>1:
self.screen._drawline(self.currentLineItem, self.currentLine,
self._pencolor, self._pensize)
def _update(self):
"""Perform a Turtle-data update.
"""
screen = self.screen
if screen._tracing == 0:
return
elif screen._tracing == 1:
self._update_data()
self._drawturtle()
screen._update() # TurtleScreenBase
screen._delay(screen._delayvalue) # TurtleScreenBase
else:
self._update_data()
if screen._updatecounter == 0:
for t in screen.turtles():
t._drawturtle()
screen._update()
def tracer(self, flag=None, delay=None):
"""Turns turtle animation on/off and set delay for update drawings.
Optional arguments:
n -- nonnegative integer
delay -- nonnegative integer
If n is given, only each n-th regular screen update is really performed.
(Can be used to accelerate the drawing of complex graphics.)
Second arguments sets delay value (see RawTurtle.delay())
Example (for a Turtle instance named turtle):
>>> turtle.tracer(8, 25)
>>> dist = 2
>>> for i in range(200):
turtle.fd(dist)
turtle.rt(90)
dist += 2
"""
return self.screen.tracer(flag, delay)
def _color(self, args):
return self.screen._color(args)
def _colorstr(self, args):
return self.screen._colorstr(args)
def _cc(self, args):
"""Convert colortriples to hexstrings.
"""
if isinstance(args, str):
return args
try:
r, g, b = args
except:
raise TurtleGraphicsError("bad color arguments: %s" % str(args))
if self.screen._colormode == 1.0:
r, g, b = [round(255.0*x) for x in (r, g, b)]
if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
raise TurtleGraphicsError("bad color sequence: %s" % str(args))
return "#%02x%02x%02x" % (r, g, b)
def clone(self):
"""Create and return a clone of the turtle.
No argument.
Create and return a clone of the turtle with same position, heading
and turtle properties.
Example (for a Turtle instance named mick):
mick = Turtle()
joe = mick.clone()
"""
screen = self.screen
self._newLine(self._drawing)
turtle = self.turtle
self.screen = None
self.turtle = None # too make self deepcopy-able
q = deepcopy(self)
self.screen = screen
self.turtle = turtle
q.screen = screen
q.turtle = _TurtleImage(screen, self.turtle.shapeIndex)
screen._turtles.append(q)
ttype = screen._shapes[self.turtle.shapeIndex]._type
if ttype == "polygon":
q.turtle._item = screen._createpoly()
elif ttype == "image":
q.turtle._item = screen._createimage(screen._shapes["blank"]._data)
elif ttype == "compound":
q.turtle._item = [screen._createpoly() for item in
screen._shapes[self.turtle.shapeIndex]._data]
q.currentLineItem = screen._createline()
q._update()
return q
def shape(self, name=None):
"""Set turtle shape to shape with given name / return current shapename.
Optional argument:
name -- a string, which is a valid shapename
Set turtle shape to shape with given name or, if name is not given,
return name of current shape.
Shape with name must exist in the TurtleScreen's shape dictionary.
Initially there are the following polygon shapes:
'arrow', 'turtle', 'circle', 'square', 'triangle', 'classic'.
To learn about how to deal with shapes see Screen-method register_shape.
Example (for a Turtle instance named turtle):
>>> turtle.shape()
'arrow'
>>> turtle.shape("turtle")
>>> turtle.shape()
'turtle'
"""
if name is None:
return self.turtle.shapeIndex
if not name in self.screen.getshapes():
raise TurtleGraphicsError("There is no shape named %s" % name)
self.turtle._setshape(name)
self._update()
def shapesize(self, stretch_wid=None, stretch_len=None, outline=None):
"""Set/return turtle's stretchfactors/outline. Set resizemode to "user".
Optinonal arguments:
stretch_wid : positive number
stretch_len : positive number
outline : positive number
Return or set the pen's attributes x/y-stretchfactors and/or outline.
Set resizemode to "user".
If and only if resizemode is set to "user", the turtle will be displayed
stretched according to its stretchfactors:
stretch_wid is stretchfactor perpendicular to orientation
stretch_len is stretchfactor in direction of turtles orientation.
outline determines the width of the shapes's outline.
Examples (for a Turtle instance named turtle):
>>> turtle.resizemode("user")
>>> turtle.shapesize(5, 5, 12)
>>> turtle.shapesize(outline=8)
"""
if stretch_wid is stretch_len is outline is None:
stretch_wid, stretch_len = self._stretchfactor
return stretch_wid, stretch_len, self._outlinewidth
if stretch_wid is not None:
if stretch_len is None:
stretchfactor = stretch_wid, stretch_wid
else:
stretchfactor = stretch_wid, stretch_len
elif stretch_len is not None:
stretchfactor = self._stretchfactor[0], stretch_len
else:
stretchfactor = self._stretchfactor
if outline is None:
outline = self._outlinewidth
self.pen(resizemode="user",
stretchfactor=stretchfactor, outline=outline)
def settiltangle(self, angle):
"""Rotate the turtleshape to point in the specified direction
Optional argument:
angle -- number
Rotate the turtleshape to point in the direction specified by angle,
regardless of its current tilt-angle. DO NOT change the turtle's
heading (direction of movement).
Examples (for a Turtle instance named turtle):
>>> turtle.shape("circle")
>>> turtle.shapesize(5,2)
>>> turtle.settiltangle(45)
>>> stamp()
>>> turtle.fd(50)
>>> turtle.settiltangle(-45)
>>> stamp()
>>> turtle.fd(50)
"""
tilt = -angle * self._degreesPerAU * self._angleOrient
tilt = (tilt * math.pi / 180.0) % (2*math.pi)
self.pen(resizemode="user", tilt=tilt)
def tiltangle(self):
"""Return the current tilt-angle.
No argument.
Return the current tilt-angle, i. e. the angle between the
orientation of the turtleshape and the heading of the turtle
(its direction of movement).
Examples (for a Turtle instance named turtle):
>>> turtle.shape("circle")
>>> turtle.shapesize(5,2)
>>> turtle.tilt(45)
>>> turtle.tiltangle()
>>>
"""
tilt = -self._tilt * (180.0/math.pi) * self._angleOrient
return (tilt / self._degreesPerAU) % self._fullcircle
def tilt(self, angle):
"""Rotate the turtleshape by angle.
Argument:
angle - a number
Rotate the turtleshape by angle from its current tilt-angle,
but do NOT change the turtle's heading (direction of movement).
Examples (for a Turtle instance named turtle):
>>> turtle.shape("circle")
>>> turtle.shapesize(5,2)
>>> turtle.tilt(30)
>>> turtle.fd(50)
>>> turtle.tilt(30)
>>> turtle.fd(50)
"""
self.settiltangle(angle + self.tiltangle())
def _polytrafo(self, poly):
"""Computes transformed polygon shapes from a shape
according to current position and heading.
"""
screen = self.screen
p0, p1 = self._position
e0, e1 = self._orient
e = Vec2D(e0, e1 * screen.yscale / screen.xscale)
e0, e1 = (1.0 / abs(e)) * e
return [(p0+(e1*x+e0*y)/screen.xscale, p1+(-e0*x+e1*y)/screen.yscale)
for (x, y) in poly]
def _drawturtle(self):
"""Manages the correct rendering of the turtle with respect to
its shape, resizemode, stretch and tilt etc."""
screen = self.screen
shape = screen._shapes[self.turtle.shapeIndex]
ttype = shape._type
titem = self.turtle._item
if self._shown and screen._updatecounter == 0 and screen._tracing > 0:
self._hidden_from_screen = False
tshape = shape._data
if ttype == "polygon":
if self._resizemode == "noresize":
w = 1
shape = tshape
else:
if self._resizemode == "auto":
lx = ly = max(1, self._pensize/5.0)
w = self._pensize
tiltangle = 0
elif self._resizemode == "user":
lx, ly = self._stretchfactor
w = self._outlinewidth
tiltangle = self._tilt
shape = [(lx*x, ly*y) for (x, y) in tshape]
t0, t1 = math.sin(tiltangle), math.cos(tiltangle)
shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape]
shape = self._polytrafo(shape)
fc, oc = self._fillcolor, self._pencolor
screen._drawpoly(titem, shape, fill=fc, outline=oc,
width=w, top=True)
elif ttype == "image":
screen._drawimage(titem, self._position, tshape)
elif ttype == "compound":
lx, ly = self._stretchfactor
w = self._outlinewidth
for item, (poly, fc, oc) in zip(titem, tshape):
poly = [(lx*x, ly*y) for (x, y) in poly]
poly = self._polytrafo(poly)
screen._drawpoly(item, poly, fill=self._cc(fc),
outline=self._cc(oc), width=w, top=True)
else:
if self._hidden_from_screen:
return
if ttype == "polygon":
screen._drawpoly(titem, ((0, 0), (0, 0), (0, 0)), "", "")
elif ttype == "image":
screen._drawimage(titem, self._position,
screen._shapes["blank"]._data)
elif ttype == "compound":
for item in titem:
screen._drawpoly(item, ((0, 0), (0, 0), (0, 0)), "", "")
self._hidden_from_screen = True
############################## stamp stuff ###############################
def stamp(self):
"""Stamp a copy of the turtleshape onto the canvas and return its id.
No argument.
Stamp a copy of the turtle shape onto the canvas at the current
turtle position. Return a stamp_id for that stamp, which can be
used to delete it by calling clearstamp(stamp_id).
Example (for a Turtle instance named turtle):
>>> turtle.color("blue")
>>> turtle.stamp()
13
>>> turtle.fd(50)
"""
screen = self.screen
shape = screen._shapes[self.turtle.shapeIndex]
ttype = shape._type
tshape = shape._data
if ttype == "polygon":
stitem = screen._createpoly()
if self._resizemode == "noresize":
w = 1
shape = tshape
else:
if self._resizemode == "auto":
lx = ly = max(1, self._pensize/5.0)
w = self._pensize
tiltangle = 0
elif self._resizemode == "user":
lx, ly = self._stretchfactor
w = self._outlinewidth
tiltangle = self._tilt
shape = [(lx*x, ly*y) for (x, y) in tshape]
t0, t1 = math.sin(tiltangle), math.cos(tiltangle)
shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape]
shape = self._polytrafo(shape)
fc, oc = self._fillcolor, self._pencolor
screen._drawpoly(stitem, shape, fill=fc, outline=oc,
width=w, top=True)
elif ttype == "image":
stitem = screen._createimage("")
screen._drawimage(stitem, self._position, tshape)
elif ttype == "compound":
stitem = []
for element in tshape:
item = screen._createpoly()
stitem.append(item)
stitem = tuple(stitem)
lx, ly = self._stretchfactor
w = self._outlinewidth
for item, (poly, fc, oc) in zip(stitem, tshape):
poly = [(lx*x, ly*y) for (x, y) in poly]
poly = self._polytrafo(poly)
screen._drawpoly(item, poly, fill=self._cc(fc),
outline=self._cc(oc), width=w, top=True)
self.stampItems.append(stitem)
self.undobuffer.push(("stamp", stitem))
return stitem
def _clearstamp(self, stampid):
"""does the work for clearstamp() and clearstamps()
"""
if stampid in self.stampItems:
if isinstance(stampid, tuple):
for subitem in stampid:
self.screen._delete(subitem)
else:
self.screen._delete(stampid)
self.stampItems.remove(stampid)
# Delete stampitem from undobuffer if necessary
# if clearstamp is called directly.
item = ("stamp", stampid)
buf = self.undobuffer
if item not in buf.buffer:
return
index = buf.buffer.index(item)
buf.buffer.remove(item)
if index <= buf.ptr:
buf.ptr = (buf.ptr - 1) % buf.bufsize
buf.buffer.insert((buf.ptr+1)%buf.bufsize, [None])
def clearstamp(self, stampid):
"""Delete stamp with given stampid
Argument:
stampid - an integer, must be return value of previous stamp() call.
Example (for a Turtle instance named turtle):
>>> turtle.color("blue")
>>> astamp = turtle.stamp()
>>> turtle.fd(50)
>>> turtle.clearstamp(astamp)
"""
self._clearstamp(stampid)
self._update()
def clearstamps(self, n=None):
"""Delete all or first/last n of turtle's stamps.
Optional argument:
n -- an integer
If n is None, delete all of pen's stamps,
else if n > 0 delete first n stamps
else if n < 0 delete last n stamps.
Example (for a Turtle instance named turtle):
>>> for i in range(8):
turtle.stamp(); turtle.fd(30)
...
>>> turtle.clearstamps(2)
>>> turtle.clearstamps(-2)
>>> turtle.clearstamps()
"""
if n is None:
toDelete = self.stampItems[:]
elif n >= 0:
toDelete = self.stampItems[:n]
else:
toDelete = self.stampItems[n:]
for item in toDelete:
self._clearstamp(item)
self._update()
def _goto(self, end):
"""Move the pen to the point end, thereby drawing a line
if pen is down. All other methodes for turtle movement depend
on this one.
"""
## Version mit undo-stuff
go_modes = ( self._drawing,
self._pencolor,
self._pensize,
isinstance(self._fillpath, list))
screen = self.screen
undo_entry = ("go", self._position, end, go_modes,
(self.currentLineItem,
self.currentLine[:],
screen._pointlist(self.currentLineItem),
self.items[:])
)
if self.undobuffer:
self.undobuffer.push(undo_entry)
start = self._position
if self._speed and screen._tracing == 1:
diff = (end-start)
diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
delta = diff * (1.0/nhops)
for n in range(1, nhops):
if n == 1:
top = True
else:
top = False
self._position = start + delta * n
if self._drawing:
screen._drawline(self.drawingLineItem,
(start, self._position),
self._pencolor, self._pensize, top)
self._update()
if self._drawing:
screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
fill="", width=self._pensize)
# Turtle now at end,
if self._drawing: # now update currentLine
self.currentLine.append(end)
if isinstance(self._fillpath, list):
self._fillpath.append(end)
###### vererbung!!!!!!!!!!!!!!!!!!!!!!
self._position = end
if self._creatingPoly:
self._poly.append(end)
if len(self.currentLine) > 42: # 42! answer to the ultimate question
# of life, the universe and everything
self._newLine()
self._update() #count=True)
def _undogoto(self, entry):
"""Reverse a _goto. Used for undo()
"""
old, new, go_modes, coodata = entry
drawing, pc, ps, filling = go_modes
cLI, cL, pl, items = coodata
screen = self.screen
if abs(self._position - new) > 0.5:
print "undogoto: HALLO-DA-STIMMT-WAS-NICHT!"
# restore former situation
self.currentLineItem = cLI
self.currentLine = cL
if pl == [(0, 0), (0, 0)]:
usepc = ""
else:
usepc = pc
screen._drawline(cLI, pl, fill=usepc, width=ps)
todelete = [i for i in self.items if (i not in items) and
(screen._type(i) == "line")]
for i in todelete:
screen._delete(i)
self.items.remove(i)
start = old
if self._speed and screen._tracing == 1:
diff = old - new
diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
delta = diff * (1.0/nhops)
for n in range(1, nhops):
if n == 1:
top = True
else:
top = False
self._position = new + delta * n
if drawing:
screen._drawline(self.drawingLineItem,
(start, self._position),
pc, ps, top)
self._update()
if drawing:
screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
fill="", width=ps)
# Turtle now at position old,
self._position = old
## if undo is done during crating a polygon, the last vertex
## will be deleted. if the polygon is entirel deleted,
## creatigPoly will be set to False.
## Polygons created before the last one will not be affected by undo()
if self._creatingPoly:
if len(self._poly) > 0:
self._poly.pop()
if self._poly == []:
self._creatingPoly = False
self._poly = None
if filling:
if self._fillpath == []:
self._fillpath = None
print "Unwahrscheinlich in _undogoto!"
elif self._fillpath is not None:
self._fillpath.pop()
self._update() #count=True)
def _rotate(self, angle):
"""Turns pen clockwise by angle.
"""
if self.undobuffer:
self.undobuffer.push(("rot", angle, self._degreesPerAU))
angle *= self._degreesPerAU
neworient = self._orient.rotate(angle)
tracing = self.screen._tracing
if tracing == 1 and self._speed > 0:
anglevel = 3.0 * self._speed
steps = 1 + int(abs(angle)/anglevel)
delta = 1.0*angle/steps
for _ in range(steps):
self._orient = self._orient.rotate(delta)
self._update()
self._orient = neworient
self._update()
def _newLine(self, usePos=True):
"""Closes current line item and starts a new one.
Remark: if current line became too long, animation
performance (via _drawline) slowed down considerably.
"""
if len(self.currentLine) > 1:
self.screen._drawline(self.currentLineItem, self.currentLine,
self._pencolor, self._pensize)
self.currentLineItem = self.screen._createline()
self.items.append(self.currentLineItem)
else:
self.screen._drawline(self.currentLineItem, top=True)
self.currentLine = []
if usePos:
self.currentLine = [self._position]
def fill(self, flag=None):
"""Call fill(True) before drawing a shape to fill, fill(False) when done.
Optional argument:
flag -- True/False (or 1/0 respectively)
Call fill(True) before drawing the shape you want to fill,
and fill(False) when done.
When used without argument: return fillstate (True if filling,
False else)
Example (for a Turtle instance named turtle):
>>> turtle.fill(True)
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.fill(False)
"""
filling = isinstance(self._fillpath, list)
if flag is None:
return filling
screen = self.screen
entry1 = entry2 = ()
if filling:
if len(self._fillpath) > 2:
self.screen._drawpoly(self._fillitem, self._fillpath,
fill=self._fillcolor)
entry1 = ("dofill", self._fillitem)
if flag:
self._fillitem = self.screen._createpoly()
self.items.append(self._fillitem)
self._fillpath = [self._position]
entry2 = ("beginfill", self._fillitem) # , self._fillpath)
self._newLine()
else:
self._fillitem = self._fillpath = None
if self.undobuffer:
if entry1 == ():
if entry2 != ():
self.undobuffer.push(entry2)
else:
if entry2 == ():
self.undobuffer.push(entry1)
else:
self.undobuffer.push(["seq", entry1, entry2])
self._update()
def begin_fill(self):
"""Called just before drawing a shape to be filled.
No argument.
Example (for a Turtle instance named turtle):
>>> turtle.begin_fill()
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.end_fill()
"""
self.fill(True)
def end_fill(self):
"""Fill the shape drawn after the call begin_fill().
No argument.
Example (for a Turtle instance named turtle):
>>> turtle.begin_fill()
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.left(90)
>>> turtle.forward(100)
>>> turtle.end_fill()
"""
self.fill(False)
def dot(self, size=None, *color):
"""Draw a dot with diameter size, using color.
Optional argumentS:
size -- an integer >= 1 (if given)
color -- a colorstring or a numeric color tuple
Draw a circular dot with diameter size, using color.
If size is not given, the maximum of pensize+4 and 2*pensize is used.
Example (for a Turtle instance named turtle):
>>> turtle.dot()
>>> turtle.fd(50); turtle.dot(20, "blue"); turtle.fd(50)
"""
#print "dot-1:", size, color
if not color:
if isinstance(size, (str, tuple)):
color = self._colorstr(size)
size = self._pensize + max(self._pensize, 4)
else:
color = self._pencolor
if not size:
size = self._pensize + max(self._pensize, 4)
else:
if size is None:
size = self._pensize + max(self._pensize, 4)
color = self._colorstr(color)
#print "dot-2:", size, color
if hasattr(self.screen, "_dot"):
item = self.screen._dot(self._position, size, color)
#print "dot:", size, color, "item:", item
self.items.append(item)
if self.undobuffer:
self.undobuffer.push(("dot", item))
else:
pen = self.pen()
if self.undobuffer:
self.undobuffer.push(["seq"])
self.undobuffer.cumulate = True
try:
if self.resizemode() == 'auto':
self.ht()
self.pendown()
self.pensize(size)
self.pencolor(color)
self.forward(0)
finally:
self.pen(pen)
if self.undobuffer:
self.undobuffer.cumulate = False
def _write(self, txt, align, font):
"""Performs the writing for write()
"""
item, end = self.screen._write(self._position, txt, align, font,
self._pencolor)
self.items.append(item)
if self.undobuffer:
self.undobuffer.push(("wri", item))
return end
def write(self, arg, move=False, align="left", font=("Arial", 8, "normal")):
"""Write text at the current turtle position.
Arguments:
arg -- info, which is to be written to the TurtleScreen
move (optional) -- True/False
align (optional) -- one of the strings "left", "center" or right"
font (optional) -- a triple (fontname, fontsize, fonttype)
Write text - the string representation of arg - at the current
turtle position according to align ("left", "center" or right")
and with the given font.
If move is True, the pen is moved to the bottom-right corner
of the text. By default, move is False.
Example (for a Turtle instance named turtle):
>>> turtle.write('Home = ', True, align="center")
>>> turtle.write((0,0), True)
"""
if self.undobuffer:
self.undobuffer.push(["seq"])
self.undobuffer.cumulate = True
end = self._write(str(arg), align.lower(), font)
if move:
x, y = self.pos()
self.setpos(end, y)
if self.undobuffer:
self.undobuffer.cumulate = False
def begin_poly(self):
"""Start recording the vertices of a polygon.
No argument.
Start recording the vertices of a polygon. Current turtle position
is first point of polygon.
Example (for a Turtle instance named turtle):
>>> turtle.begin_poly()
"""
self._poly = [self._position]
self._creatingPoly = True
def end_poly(self):
"""Stop recording the vertices of a polygon.
No argument.
Stop recording the vertices of a polygon. Current turtle position is
last point of polygon. This will be connected with the first point.
Example (for a Turtle instance named turtle):
>>> turtle.end_poly()
"""
self._creatingPoly = False
def get_poly(self):
"""Return the lastly recorded polygon.
No argument.
Example (for a Turtle instance named turtle):
>>> p = turtle.get_poly()
>>> turtle.register_shape("myFavouriteShape", p)
"""
## check if there is any poly? -- 1st solution:
if self._poly is not None:
return tuple(self._poly)
def getscreen(self):
"""Return the TurtleScreen object, the turtle is drawing on.
No argument.
Return the TurtleScreen object, the turtle is drawing on.
So TurtleScreen-methods can be called for that object.
Example (for a Turtle instance named turtle):
>>> ts = turtle.getscreen()
>>> ts
<turtle.TurtleScreen object at 0x0106B770>
>>> ts.bgcolor("pink")
"""
return self.screen
def getturtle(self):
"""Return the Turtleobject itself.
No argument.
Only reasonable use: as a function to return the 'anonymous turtle':
Example:
>>> pet = getturtle()
>>> pet.fd(50)
>>> pet
<turtle.Turtle object at 0x0187D810>
>>> turtles()
[<turtle.Turtle object at 0x0187D810>]
"""
return self
getpen = getturtle
################################################################
### screen oriented methods recurring to methods of TurtleScreen
################################################################
def window_width(self):
""" Returns the width of the turtle window.
No argument.
Example (for a TurtleScreen instance named screen):
>>> screen.window_width()
640
"""
return self.screen._window_size()[0]
def window_height(self):
""" Return the height of the turtle window.
No argument.
Example (for a TurtleScreen instance named screen):
>>> screen.window_height()
480
"""
return self.screen._window_size()[1]
def _delay(self, delay=None):
"""Set delay value which determines speed of turtle animation.
"""
return self.screen.delay(delay)
##### event binding methods #####
def onclick(self, fun, btn=1, add=None):
"""Bind fun to mouse-click event on this turtle on canvas.
Arguments:
fun -- a function with two arguments, to which will be assigned
the coordinates of the clicked point on the canvas.
num -- number of the mouse-button defaults to 1 (left mouse button).
add -- True or False. If True, new binding will be added, otherwise
it will replace a former binding.
Example for the anonymous turtle, i. e. the procedural way:
>>> def turn(x, y):
left(360)
>>> onclick(turn) # Now clicking into the turtle will turn it.
>>> onclick(None) # event-binding will be removed
"""
self.screen._onclick(self.turtle._item, fun, btn, add)
self._update()
def onrelease(self, fun, btn=1, add=None):
"""Bind fun to mouse-button-release event on this turtle on canvas.
Arguments:
fun -- a function with two arguments, to which will be assigned
the coordinates of the clicked point on the canvas.
num -- number of the mouse-button defaults to 1 (left mouse button).
Example (for a MyTurtle instance named joe):
>>> class MyTurtle(Turtle):
def glow(self,x,y):
self.fillcolor("red")
def unglow(self,x,y):
self.fillcolor("")
>>> joe = MyTurtle()
>>> joe.onclick(joe.glow)
>>> joe.onrelease(joe.unglow)
### clicking on joe turns fillcolor red,
### unclicking turns it to transparent.
"""
self.screen._onrelease(self.turtle._item, fun, btn, add)
self._update()
def ondrag(self, fun, btn=1, add=None):
"""Bind fun to mouse-move event on this turtle on canvas.
Arguments:
fun -- a function with two arguments, to which will be assigned
the coordinates of the clicked point on the canvas.
num -- number of the mouse-button defaults to 1 (left mouse button).
Every sequence of mouse-move-events on a turtle is preceded by a
mouse-click event on that turtle.
Example (for a Turtle instance named turtle):
>>> turtle.ondrag(turtle.goto)
### Subsequently clicking and dragging a Turtle will
### move it across the screen thereby producing handdrawings
### (if pen is down).
"""
self.screen._ondrag(self.turtle._item, fun, btn, add)
def _undo(self, action, data):
"""Does the main part of the work for undo()
"""
if self.undobuffer is None:
return
if action == "rot":
angle, degPAU = data
self._rotate(-angle*degPAU/self._degreesPerAU)
dummy = self.undobuffer.pop()
elif action == "stamp":
stitem = data[0]
self.clearstamp(stitem)
elif action == "go":
self._undogoto(data)
elif action in ["wri", "dot"]:
item = data[0]
self.screen._delete(item)
self.items.remove(item)
elif action == "dofill":
item = data[0]
self.screen._drawpoly(item, ((0, 0),(0, 0),(0, 0)),
fill="", outline="")
elif action == "beginfill":
item = data[0]
self._fillitem = self._fillpath = None
self.screen._delete(item)
self.items.remove(item)
elif action == "pen":
TPen.pen(self, data[0])
self.undobuffer.pop()
def undo(self):
"""undo (repeatedly) the last turtle action.
No argument.
undo (repeatedly) the last turtle action.
Number of available undo actions is determined by the size of
the undobuffer.
Example (for a Turtle instance named turtle):
>>> for i in range(4):
turtle.fd(50); turtle.lt(80)
>>> for i in range(8):
turtle.undo()
"""
if self.undobuffer is None:
return
item = self.undobuffer.pop()
action = item[0]
data = item[1:]
if action == "seq":
while data:
item = data.pop()
self._undo(item[0], item[1:])
else:
self._undo(action, data)
turtlesize = shapesize
RawPen = RawTurtle
### Screen - Singleton ########################
def Screen():
"""Return the singleton screen object.
If none exists at the moment, create a new one and return it,
else return the existing one."""
if Turtle._screen is None:
Turtle._screen = _Screen()
return Turtle._screen
class _Screen(TurtleScreen):
_root = None
_canvas = None
_title = _CFG["title"]
def __init__(self):
# XXX there is no need for this code to be conditional,
# as there will be only a single _Screen instance, anyway
# XXX actually, the turtle demo is injecting root window,
# so perhaps the conditional creation of a root should be
# preserved (perhaps by passing it as an optional parameter)
if _Screen._root is None:
_Screen._root = self._root = _Root()
self._root.title(_Screen._title)
self._root.ondestroy(self._destroy)
if _Screen._canvas is None:
width = _CFG["width"]
height = _CFG["height"]
canvwidth = _CFG["canvwidth"]
canvheight = _CFG["canvheight"]
leftright = _CFG["leftright"]
topbottom = _CFG["topbottom"]
self._root.setupcanvas(width, height, canvwidth, canvheight)
_Screen._canvas = self._root._getcanvas()
TurtleScreen.__init__(self, _Screen._canvas)
self.setup(width, height, leftright, topbottom)
def setup(self, width=_CFG["width"], height=_CFG["height"],
startx=_CFG["leftright"], starty=_CFG["topbottom"]):
""" Set the size and position of the main window.
Arguments:
width: as integer a size in pixels, as float a fraction of the screen.
Default is 50% of screen.
height: as integer the height in pixels, as float a fraction of the
screen. Default is 75% of screen.
startx: if positive, starting position in pixels from the left
edge of the screen, if negative from the right edge
Default, startx=None is to center window horizontally.
starty: if positive, starting position in pixels from the top
edge of the screen, if negative from the bottom edge
Default, starty=None is to center window vertically.
Examples (for a Screen instance named screen):
>>> screen.setup (width=200, height=200, startx=0, starty=0)
sets window to 200x200 pixels, in upper left of screen
>>> screen.setup(width=.75, height=0.5, startx=None, starty=None)
sets window to 75% of screen by 50% of screen and centers
"""
if not hasattr(self._root, "set_geometry"):
return
sw = self._root.win_width()
sh = self._root.win_height()
if isinstance(width, float) and 0 <= width <= 1:
width = sw*width
if startx is None:
startx = (sw - width) / 2
if isinstance(height, float) and 0 <= height <= 1:
height = sh*height
if starty is None:
starty = (sh - height) / 2
self._root.set_geometry(width, height, startx, starty)
self.update()
def title(self, titlestring):
"""Set title of turtle-window
Argument:
titlestring -- a string, to appear in the titlebar of the
turtle graphics window.
This is a method of Screen-class. Not available for TurtleScreen-
objects.
Example (for a Screen instance named screen):
>>> screen.title("Welcome to the turtle-zoo!")
"""
if _Screen._root is not None:
_Screen._root.title(titlestring)
_Screen._title = titlestring
def _destroy(self):
root = self._root
if root is _Screen._root:
Turtle._pen = None
Turtle._screen = None
_Screen._root = None
_Screen._canvas = None
TurtleScreen._RUNNING = True
root.destroy()
def bye(self):
"""Shut the turtlegraphics window.
Example (for a TurtleScreen instance named screen):
>>> screen.bye()
"""
self._destroy()
def exitonclick(self):
"""Go into mainloop until the mouse is clicked.
No arguments.
Bind bye() method to mouseclick on TurtleScreen.
If "using_IDLE" - value in configuration dictionary is False
(default value), enter mainloop.
If IDLE with -n switch (no subprocess) is used, this value should be
set to True in turtle.cfg. In this case IDLE's mainloop
is active also for the client script.
This is a method of the Screen-class and not available for
TurtleScreen instances.
Example (for a Screen instance named screen):
>>> screen.exitonclick()
"""
def exitGracefully(x, y):
"""Screen.bye() with two dummy-parameters"""
self.bye()
self.onclick(exitGracefully)
if _CFG["using_IDLE"]:
return
try:
mainloop()
except AttributeError:
exit(0)
class Turtle(RawTurtle):
"""RawTurtle auto-crating (scrolled) canvas.
When a Turtle object is created or a function derived from some
Turtle method is called a TurtleScreen object is automatically created.
"""
_pen = None
_screen = None
def __init__(self,
shape=_CFG["shape"],
undobuffersize=_CFG["undobuffersize"],
visible=_CFG["visible"]):
if Turtle._screen is None:
Turtle._screen = Screen()
RawTurtle.__init__(self, Turtle._screen,
shape=shape,
undobuffersize=undobuffersize,
visible=visible)
Pen = Turtle
def _getpen():
"""Create the 'anonymous' turtle if not already present."""
if Turtle._pen is None:
Turtle._pen = Turtle()
return Turtle._pen
def _getscreen():
"""Create a TurtleScreen if not already present."""
if Turtle._screen is None:
Turtle._screen = Screen()
return Turtle._screen
def write_docstringdict(filename="turtle_docstringdict"):
"""Create and write docstring-dictionary to file.
Optional argument:
filename -- a string, used as filename
default value is turtle_docstringdict
Has to be called explicitely, (not used by the turtle-graphics classes)
The docstring dictionary will be written to the Python script <filname>.py
It is intended to serve as a template for translation of the docstrings
into different languages.
"""
docsdict = {}
for methodname in _tg_screen_functions:
key = "_Screen."+methodname
docsdict[key] = eval(key).__doc__
for methodname in _tg_turtle_functions:
key = "Turtle."+methodname
docsdict[key] = eval(key).__doc__
f = open("%s.py" % filename,"w")
keys = sorted([x for x in docsdict.keys()
if x.split('.')[1] not in _alias_list])
f.write('docsdict = {\n\n')
for key in keys[:-1]:
f.write('%s :\n' % repr(key))
f.write(' """%s\n""",\n\n' % docsdict[key])
key = keys[-1]
f.write('%s :\n' % repr(key))
f.write(' """%s\n"""\n\n' % docsdict[key])
f.write("}\n")
f.close()
def read_docstrings(lang):
"""Read in docstrings from lang-specific docstring dictionary.
Transfer docstrings, translated to lang, from a dictionary-file
to the methods of classes Screen and Turtle and - in revised form -
to the corresponding functions.
"""
modname = "turtle_docstringdict_%(language)s" % {'language':lang.lower()}
module = __import__(modname)
docsdict = module.docsdict
for key in docsdict:
#print key
try:
eval(key).im_func.__doc__ = docsdict[key]
except:
print "Bad docstring-entry: %s" % key
_LANGUAGE = _CFG["language"]
try:
if _LANGUAGE != "english":
read_docstrings(_LANGUAGE)
except ImportError:
print "Cannot find docsdict for", _LANGUAGE
except:
print ("Unknown Error when trying to import %s-docstring-dictionary" %
_LANGUAGE)
def getmethparlist(ob):
"Get strings describing the arguments for the given object"
argText1 = argText2 = ""
# bit of a hack for methods - turn it into a function
# but we drop the "self" param.
if type(ob)==types.MethodType:
fob = ob.im_func
argOffset = 1
else:
fob = ob
argOffset = 0
# Try and build one for Python defined functions
if type(fob) in [types.FunctionType, types.LambdaType]:
try:
counter = fob.func_code.co_argcount
items2 = list(fob.func_code.co_varnames[argOffset:counter])
realArgs = fob.func_code.co_varnames[argOffset:counter]
defaults = fob.func_defaults or []
defaults = list(map(lambda name: "=%s" % repr(name), defaults))
defaults = [""] * (len(realArgs)-len(defaults)) + defaults
items1 = map(lambda arg, dflt: arg+dflt, realArgs, defaults)
if fob.func_code.co_flags & 0x4:
items1.append("*"+fob.func_code.co_varnames[counter])
items2.append("*"+fob.func_code.co_varnames[counter])
counter += 1
if fob.func_code.co_flags & 0x8:
items1.append("**"+fob.func_code.co_varnames[counter])
items2.append("**"+fob.func_code.co_varnames[counter])
argText1 = ", ".join(items1)
argText1 = "(%s)" % argText1
argText2 = ", ".join(items2)
argText2 = "(%s)" % argText2
except:
pass
return argText1, argText2
def _turtle_docrevise(docstr):
"""To reduce docstrings from RawTurtle class for functions
"""
import re
if docstr is None:
return None
turtlename = _CFG["exampleturtle"]
newdocstr = docstr.replace("%s." % turtlename,"")
parexp = re.compile(r' \(.+ %s\):' % turtlename)
newdocstr = parexp.sub(":", newdocstr)
return newdocstr
def _screen_docrevise(docstr):
"""To reduce docstrings from TurtleScreen class for functions
"""
import re
if docstr is None:
return None
screenname = _CFG["examplescreen"]
newdocstr = docstr.replace("%s." % screenname,"")
parexp = re.compile(r' \(.+ %s\):' % screenname)
newdocstr = parexp.sub(":", newdocstr)
return newdocstr
## The following mechanism makes all methods of RawTurtle and Turtle available
## as functions. So we can enhance, change, add, delete methods to these
## classes and do not need to change anything here.
for methodname in _tg_screen_functions:
pl1, pl2 = getmethparlist(eval('_Screen.' + methodname))
if pl1 == "":
print ">>>>>>", pl1, pl2
continue
defstr = ("def %(key)s%(pl1)s: return _getscreen().%(key)s%(pl2)s" %
{'key':methodname, 'pl1':pl1, 'pl2':pl2})
exec defstr
eval(methodname).__doc__ = _screen_docrevise(eval('_Screen.'+methodname).__doc__)
for methodname in _tg_turtle_functions:
pl1, pl2 = getmethparlist(eval('Turtle.' + methodname))
if pl1 == "":
print ">>>>>>", pl1, pl2
continue
defstr = ("def %(key)s%(pl1)s: return _getpen().%(key)s%(pl2)s" %
{'key':methodname, 'pl1':pl1, 'pl2':pl2})
exec defstr
eval(methodname).__doc__ = _turtle_docrevise(eval('Turtle.'+methodname).__doc__)
done = mainloop = TK.mainloop
del pl1, pl2, defstr
if __name__ == "__main__":
def switchpen():
if isdown():
pu()
else:
pd()
def demo1():
"""Demo of old turtle.py - module"""
reset()
tracer(True)
up()
backward(100)
down()
# draw 3 squares; the last filled
width(3)
for i in range(3):
if i == 2:
fill(1)
for _ in range(4):
forward(20)
left(90)
if i == 2:
color("maroon")
fill(0)
up()
forward(30)
down()
width(1)
color("black")
# move out of the way
tracer(False)
up()
right(90)
forward(100)
right(90)
forward(100)
right(180)
down()
# some text
write("startstart", 1)
write("start", 1)
color("red")
# staircase
for i in range(5):
forward(20)
left(90)
forward(20)
right(90)
# filled staircase
tracer(True)
fill(1)
for i in range(5):
forward(20)
left(90)
forward(20)
right(90)
fill(0)
# more text
def demo2():
"""Demo of some new features."""
speed(1)
st()
pensize(3)
setheading(towards(0, 0))
radius = distance(0, 0)/2.0
rt(90)
for _ in range(18):
switchpen()
circle(radius, 10)
write("wait a moment...")
while undobufferentries():
undo()
reset()
lt(90)
colormode(255)
laenge = 10
pencolor("green")
pensize(3)
lt(180)
for i in range(-2, 16):
if i > 0:
begin_fill()
fillcolor(255-15*i, 0, 15*i)
for _ in range(3):
fd(laenge)
lt(120)
laenge += 10
lt(15)
speed((speed()+1)%12)
end_fill()
lt(120)
pu()
fd(70)
rt(30)
pd()
color("red","yellow")
speed(0)
fill(1)
for _ in range(4):
circle(50, 90)
rt(90)
fd(30)
rt(90)
fill(0)
lt(90)
pu()
fd(30)
pd()
shape("turtle")
tri = getturtle()
tri.resizemode("auto")
turtle = Turtle()
turtle.resizemode("auto")
turtle.shape("turtle")
turtle.reset()
turtle.left(90)
turtle.speed(0)
turtle.up()
turtle.goto(280, 40)
turtle.lt(30)
turtle.down()
turtle.speed(6)
turtle.color("blue","orange")
turtle.pensize(2)
tri.speed(6)
setheading(towards(turtle))
count = 1
while tri.distance(turtle) > 4:
turtle.fd(3.5)
turtle.lt(0.6)
tri.setheading(tri.towards(turtle))
tri.fd(4)
if count % 20 == 0:
turtle.stamp()
tri.stamp()
switchpen()
count += 1
tri.write("CAUGHT! ", font=("Arial", 16, "bold"), align="right")
tri.pencolor("black")
tri.pencolor("red")
def baba(xdummy, ydummy):
clearscreen()
bye()
time.sleep(2)
while undobufferentries():
tri.undo()
turtle.undo()
tri.fd(50)
tri.write(" Click me!", font = ("Courier", 12, "bold") )
tri.onclick(baba, 1)
demo1()
demo2()
exitonclick()
| Python |
# tk common message boxes
#
# this module provides an interface to the native message boxes
# available in Tk 4.2 and newer.
#
# written by Fredrik Lundh, May 1997
#
#
# options (all have default values):
#
# - default: which button to make default (one of the reply codes)
#
# - icon: which icon to display (see below)
#
# - message: the message to display
#
# - parent: which window to place the dialog on top of
#
# - title: dialog title
#
# - type: dialog type; that is, which buttons to display (see below)
#
from tkCommonDialog import Dialog
#
# constants
# icons
ERROR = "error"
INFO = "info"
QUESTION = "question"
WARNING = "warning"
# types
ABORTRETRYIGNORE = "abortretryignore"
OK = "ok"
OKCANCEL = "okcancel"
RETRYCANCEL = "retrycancel"
YESNO = "yesno"
YESNOCANCEL = "yesnocancel"
# replies
ABORT = "abort"
RETRY = "retry"
IGNORE = "ignore"
OK = "ok"
CANCEL = "cancel"
YES = "yes"
NO = "no"
#
# message dialog class
class Message(Dialog):
"A message box"
command = "tk_messageBox"
#
# convenience stuff
# Rename _icon and _type options to allow overriding them in options
def _show(title=None, message=None, _icon=None, _type=None, **options):
if _icon and "icon" not in options: options["icon"] = _icon
if _type and "type" not in options: options["type"] = _type
if title: options["title"] = title
if message: options["message"] = message
res = Message(**options).show()
# In some Tcl installations, yes/no is converted into a boolean.
if isinstance(res, bool):
if res:
return YES
return NO
# In others we get a Tcl_Obj.
return str(res)
def showinfo(title=None, message=None, **options):
"Show an info message"
return _show(title, message, INFO, OK, **options)
def showwarning(title=None, message=None, **options):
"Show a warning message"
return _show(title, message, WARNING, OK, **options)
def showerror(title=None, message=None, **options):
"Show an error message"
return _show(title, message, ERROR, OK, **options)
def askquestion(title=None, message=None, **options):
"Ask a question"
return _show(title, message, QUESTION, YESNO, **options)
def askokcancel(title=None, message=None, **options):
"Ask if operation should proceed; return true if the answer is ok"
s = _show(title, message, QUESTION, OKCANCEL, **options)
return s == OK
def askyesno(title=None, message=None, **options):
"Ask a question; return true if the answer is yes"
s = _show(title, message, QUESTION, YESNO, **options)
return s == YES
def askyesnocancel(title=None, message=None, **options):
"Ask a question; return true if the answer is yes, None if cancelled."
s = _show(title, message, QUESTION, YESNOCANCEL, **options)
# s might be a Tcl index object, so convert it to a string
s = str(s)
if s == CANCEL:
return None
return s == YES
def askretrycancel(title=None, message=None, **options):
"Ask if operation should be retried; return true if the answer is yes"
s = _show(title, message, WARNING, RETRYCANCEL, **options)
return s == RETRY
# --------------------------------------------------------------------
# test stuff
if __name__ == "__main__":
print "info", showinfo("Spam", "Egg Information")
print "warning", showwarning("Spam", "Egg Warning")
print "error", showerror("Spam", "Egg Alert")
print "question", askquestion("Spam", "Question?")
print "proceed", askokcancel("Spam", "Proceed?")
print "yes/no", askyesno("Spam", "Got it?")
print "yes/no/cancel", askyesnocancel("Spam", "Want it?")
print "try again", askretrycancel("Spam", "Try again?")
| Python |
"""File selection dialog classes.
Classes:
- FileDialog
- LoadFileDialog
- SaveFileDialog
"""
from Tkinter import *
from Dialog import Dialog
import os
import fnmatch
dialogstates = {}
class FileDialog:
"""Standard file selection dialog -- no checks on selected file.
Usage:
d = FileDialog(master)
fname = d.go(dir_or_file, pattern, default, key)
if fname is None: ...canceled...
else: ...open file...
All arguments to go() are optional.
The 'key' argument specifies a key in the global dictionary
'dialogstates', which keeps track of the values for the directory
and pattern arguments, overriding the values passed in (it does
not keep track of the default argument!). If no key is specified,
the dialog keeps no memory of previous state. Note that memory is
kept even when the dialog is canceled. (All this emulates the
behavior of the Macintosh file selection dialogs.)
"""
title = "File Selection Dialog"
def __init__(self, master, title=None):
if title is None: title = self.title
self.master = master
self.directory = None
self.top = Toplevel(master)
self.top.title(title)
self.top.iconname(title)
self.botframe = Frame(self.top)
self.botframe.pack(side=BOTTOM, fill=X)
self.selection = Entry(self.top)
self.selection.pack(side=BOTTOM, fill=X)
self.selection.bind('<Return>', self.ok_event)
self.filter = Entry(self.top)
self.filter.pack(side=TOP, fill=X)
self.filter.bind('<Return>', self.filter_command)
self.midframe = Frame(self.top)
self.midframe.pack(expand=YES, fill=BOTH)
self.filesbar = Scrollbar(self.midframe)
self.filesbar.pack(side=RIGHT, fill=Y)
self.files = Listbox(self.midframe, exportselection=0,
yscrollcommand=(self.filesbar, 'set'))
self.files.pack(side=RIGHT, expand=YES, fill=BOTH)
btags = self.files.bindtags()
self.files.bindtags(btags[1:] + btags[:1])
self.files.bind('<ButtonRelease-1>', self.files_select_event)
self.files.bind('<Double-ButtonRelease-1>', self.files_double_event)
self.filesbar.config(command=(self.files, 'yview'))
self.dirsbar = Scrollbar(self.midframe)
self.dirsbar.pack(side=LEFT, fill=Y)
self.dirs = Listbox(self.midframe, exportselection=0,
yscrollcommand=(self.dirsbar, 'set'))
self.dirs.pack(side=LEFT, expand=YES, fill=BOTH)
self.dirsbar.config(command=(self.dirs, 'yview'))
btags = self.dirs.bindtags()
self.dirs.bindtags(btags[1:] + btags[:1])
self.dirs.bind('<ButtonRelease-1>', self.dirs_select_event)
self.dirs.bind('<Double-ButtonRelease-1>', self.dirs_double_event)
self.ok_button = Button(self.botframe,
text="OK",
command=self.ok_command)
self.ok_button.pack(side=LEFT)
self.filter_button = Button(self.botframe,
text="Filter",
command=self.filter_command)
self.filter_button.pack(side=LEFT, expand=YES)
self.cancel_button = Button(self.botframe,
text="Cancel",
command=self.cancel_command)
self.cancel_button.pack(side=RIGHT)
self.top.protocol('WM_DELETE_WINDOW', self.cancel_command)
# XXX Are the following okay for a general audience?
self.top.bind('<Alt-w>', self.cancel_command)
self.top.bind('<Alt-W>', self.cancel_command)
def go(self, dir_or_file=os.curdir, pattern="*", default="", key=None):
if key and key in dialogstates:
self.directory, pattern = dialogstates[key]
else:
dir_or_file = os.path.expanduser(dir_or_file)
if os.path.isdir(dir_or_file):
self.directory = dir_or_file
else:
self.directory, default = os.path.split(dir_or_file)
self.set_filter(self.directory, pattern)
self.set_selection(default)
self.filter_command()
self.selection.focus_set()
self.top.wait_visibility() # window needs to be visible for the grab
self.top.grab_set()
self.how = None
self.master.mainloop() # Exited by self.quit(how)
if key:
directory, pattern = self.get_filter()
if self.how:
directory = os.path.dirname(self.how)
dialogstates[key] = directory, pattern
self.top.destroy()
return self.how
def quit(self, how=None):
self.how = how
self.master.quit() # Exit mainloop()
def dirs_double_event(self, event):
self.filter_command()
def dirs_select_event(self, event):
dir, pat = self.get_filter()
subdir = self.dirs.get('active')
dir = os.path.normpath(os.path.join(self.directory, subdir))
self.set_filter(dir, pat)
def files_double_event(self, event):
self.ok_command()
def files_select_event(self, event):
file = self.files.get('active')
self.set_selection(file)
def ok_event(self, event):
self.ok_command()
def ok_command(self):
self.quit(self.get_selection())
def filter_command(self, event=None):
dir, pat = self.get_filter()
try:
names = os.listdir(dir)
except os.error:
self.master.bell()
return
self.directory = dir
self.set_filter(dir, pat)
names.sort()
subdirs = [os.pardir]
matchingfiles = []
for name in names:
fullname = os.path.join(dir, name)
if os.path.isdir(fullname):
subdirs.append(name)
elif fnmatch.fnmatch(name, pat):
matchingfiles.append(name)
self.dirs.delete(0, END)
for name in subdirs:
self.dirs.insert(END, name)
self.files.delete(0, END)
for name in matchingfiles:
self.files.insert(END, name)
head, tail = os.path.split(self.get_selection())
if tail == os.curdir: tail = ''
self.set_selection(tail)
def get_filter(self):
filter = self.filter.get()
filter = os.path.expanduser(filter)
if filter[-1:] == os.sep or os.path.isdir(filter):
filter = os.path.join(filter, "*")
return os.path.split(filter)
def get_selection(self):
file = self.selection.get()
file = os.path.expanduser(file)
return file
def cancel_command(self, event=None):
self.quit()
def set_filter(self, dir, pat):
if not os.path.isabs(dir):
try:
pwd = os.getcwd()
except os.error:
pwd = None
if pwd:
dir = os.path.join(pwd, dir)
dir = os.path.normpath(dir)
self.filter.delete(0, END)
self.filter.insert(END, os.path.join(dir or os.curdir, pat or "*"))
def set_selection(self, file):
self.selection.delete(0, END)
self.selection.insert(END, os.path.join(self.directory, file))
class LoadFileDialog(FileDialog):
"""File selection dialog which checks that the file exists."""
title = "Load File Selection Dialog"
def ok_command(self):
file = self.get_selection()
if not os.path.isfile(file):
self.master.bell()
else:
self.quit(file)
class SaveFileDialog(FileDialog):
"""File selection dialog which checks that the file may be created."""
title = "Save File Selection Dialog"
def ok_command(self):
file = self.get_selection()
if os.path.exists(file):
if os.path.isdir(file):
self.master.bell()
return
d = Dialog(self.top,
title="Overwrite Existing File Question",
text="Overwrite existing file %r?" % (file,),
bitmap='questhead',
default=1,
strings=("Yes", "Cancel"))
if d.num != 0:
return
else:
head, tail = os.path.split(file)
if not os.path.isdir(head):
self.master.bell()
return
self.quit(file)
def test():
"""Simple test program."""
root = Tk()
root.withdraw()
fd = LoadFileDialog(root)
loadfile = fd.go(key="test")
fd = SaveFileDialog(root)
savefile = fd.go(key="test")
print loadfile, savefile
if __name__ == '__main__':
test()
| Python |
# This module exports classes for the various canvas item types
# NOTE: This module was an experiment and is now obsolete.
# It's best to use the Tkinter.Canvas class directly.
from warnings import warnpy3k
warnpy3k("the Canvas module has been removed in Python 3.0", stacklevel=2)
del warnpy3k
from Tkinter import Canvas, _cnfmerge, _flatten
class CanvasItem:
def __init__(self, canvas, itemType, *args, **kw):
self.canvas = canvas
self.id = canvas._create(itemType, args, kw)
if not hasattr(canvas, 'items'):
canvas.items = {}
canvas.items[self.id] = self
def __str__(self):
return str(self.id)
def __repr__(self):
return '<%s, id=%d>' % (self.__class__.__name__, self.id)
def delete(self):
del self.canvas.items[self.id]
self.canvas.delete(self.id)
def __getitem__(self, key):
v = self.canvas.tk.split(self.canvas.tk.call(
self.canvas._w, 'itemconfigure',
self.id, '-' + key))
return v[4]
cget = __getitem__
def __setitem__(self, key, value):
self.canvas.itemconfig(self.id, {key: value})
def keys(self):
if not hasattr(self, '_keys'):
self._keys = map(lambda x, tk=self.canvas.tk:
tk.splitlist(x)[0][1:],
self.canvas.tk.splitlist(
self.canvas._do(
'itemconfigure',
(self.id,))))
return self._keys
def has_key(self, key):
return key in self.keys()
def __contains__(self, key):
return key in self.keys()
def addtag(self, tag, option='withtag'):
self.canvas.addtag(tag, option, self.id)
def bbox(self):
x1, y1, x2, y2 = self.canvas.bbox(self.id)
return (x1, y1), (x2, y2)
def bind(self, sequence=None, command=None, add=None):
return self.canvas.tag_bind(self.id, sequence, command, add)
def unbind(self, sequence, funcid=None):
self.canvas.tag_unbind(self.id, sequence, funcid)
def config(self, cnf={}, **kw):
return self.canvas.itemconfig(self.id, _cnfmerge((cnf, kw)))
def coords(self, pts = ()):
flat = ()
for x, y in pts: flat = flat + (x, y)
return self.canvas.coords(self.id, *flat)
def dchars(self, first, last=None):
self.canvas.dchars(self.id, first, last)
def dtag(self, ttd):
self.canvas.dtag(self.id, ttd)
def focus(self):
self.canvas.focus(self.id)
def gettags(self):
return self.canvas.gettags(self.id)
def icursor(self, index):
self.canvas.icursor(self.id, index)
def index(self, index):
return self.canvas.index(self.id, index)
def insert(self, beforethis, string):
self.canvas.insert(self.id, beforethis, string)
def lower(self, belowthis=None):
self.canvas.tag_lower(self.id, belowthis)
def move(self, xamount, yamount):
self.canvas.move(self.id, xamount, yamount)
def tkraise(self, abovethis=None):
self.canvas.tag_raise(self.id, abovethis)
raise_ = tkraise # BW compat
def scale(self, xorigin, yorigin, xscale, yscale):
self.canvas.scale(self.id, xorigin, yorigin, xscale, yscale)
def type(self):
return self.canvas.type(self.id)
class Arc(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'arc', *args, **kw)
class Bitmap(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'bitmap', *args, **kw)
class ImageItem(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'image', *args, **kw)
class Line(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'line', *args, **kw)
class Oval(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'oval', *args, **kw)
class Polygon(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'polygon', *args, **kw)
class Rectangle(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'rectangle', *args, **kw)
# XXX "Text" is taken by the Text widget...
class CanvasText(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'text', *args, **kw)
class Window(CanvasItem):
def __init__(self, canvas, *args, **kw):
CanvasItem.__init__(self, canvas, 'window', *args, **kw)
class Group:
def __init__(self, canvas, tag=None):
if not tag:
tag = 'Group%d' % id(self)
self.tag = self.id = tag
self.canvas = canvas
self.canvas.dtag(self.tag)
def str(self):
return self.tag
__str__ = str
def _do(self, cmd, *args):
return self.canvas._do(cmd, (self.tag,) + _flatten(args))
def addtag_above(self, tagOrId):
self._do('addtag', 'above', tagOrId)
def addtag_all(self):
self._do('addtag', 'all')
def addtag_below(self, tagOrId):
self._do('addtag', 'below', tagOrId)
def addtag_closest(self, x, y, halo=None, start=None):
self._do('addtag', 'closest', x, y, halo, start)
def addtag_enclosed(self, x1, y1, x2, y2):
self._do('addtag', 'enclosed', x1, y1, x2, y2)
def addtag_overlapping(self, x1, y1, x2, y2):
self._do('addtag', 'overlapping', x1, y1, x2, y2)
def addtag_withtag(self, tagOrId):
self._do('addtag', 'withtag', tagOrId)
def bbox(self):
return self.canvas._getints(self._do('bbox'))
def bind(self, sequence=None, command=None, add=None):
return self.canvas.tag_bind(self.id, sequence, command, add)
def unbind(self, sequence, funcid=None):
self.canvas.tag_unbind(self.id, sequence, funcid)
def coords(self, *pts):
return self._do('coords', pts)
def dchars(self, first, last=None):
self._do('dchars', first, last)
def delete(self):
self._do('delete')
def dtag(self, tagToDelete=None):
self._do('dtag', tagToDelete)
def focus(self):
self._do('focus')
def gettags(self):
return self.canvas.tk.splitlist(self._do('gettags', self.tag))
def icursor(self, index):
return self._do('icursor', index)
def index(self, index):
return self.canvas.tk.getint(self._do('index', index))
def insert(self, beforeThis, string):
self._do('insert', beforeThis, string)
def config(self, cnf={}, **kw):
return self.canvas.itemconfigure(self.tag, _cnfmerge((cnf,kw)))
def lower(self, belowThis=None):
self._do('lower', belowThis)
def move(self, xAmount, yAmount):
self._do('move', xAmount, yAmount)
def tkraise(self, aboveThis=None):
self._do('raise', aboveThis)
lift = tkraise
def scale(self, xOrigin, yOrigin, xScale, yScale):
self._do('scale', xOrigin, yOrigin, xScale, yScale)
def select_adjust(self, index):
self.canvas._do('select', ('adjust', self.tag, index))
def select_from(self, index):
self.canvas._do('select', ('from', self.tag, index))
def select_to(self, index):
self.canvas._do('select', ('to', self.tag, index))
def type(self):
return self._do('type')
| Python |
"""Ttk wrapper.
This module provides classes to allow using Tk themed widget set.
Ttk is based on a revised and enhanced version of
TIP #48 (http://tip.tcl.tk/48) specified style engine.
Its basic idea is to separate, to the extent possible, the code
implementing a widget's behavior from the code implementing its
appearance. Widget class bindings are primarily responsible for
maintaining the widget state and invoking callbacks, all aspects
of the widgets appearance lies at Themes.
"""
__version__ = "0.3.1"
__author__ = "Guilherme Polo <ggpolo@gmail.com>"
__all__ = ["Button", "Checkbutton", "Combobox", "Entry", "Frame", "Label",
"Labelframe", "LabelFrame", "Menubutton", "Notebook", "Panedwindow",
"PanedWindow", "Progressbar", "Radiobutton", "Scale", "Scrollbar",
"Separator", "Sizegrip", "Style", "Treeview",
# Extensions
"LabeledScale", "OptionMenu",
# functions
"tclobjs_to_py", "setup_master"]
import Tkinter
_flatten = Tkinter._flatten
# Verify if Tk is new enough to not need the Tile package
_REQUIRE_TILE = True if Tkinter.TkVersion < 8.5 else False
def _load_tile(master):
if _REQUIRE_TILE:
import os
tilelib = os.environ.get('TILE_LIBRARY')
if tilelib:
# append custom tile path to the list of directories that
# Tcl uses when attempting to resolve packages with the package
# command
master.tk.eval(
'global auto_path; '
'lappend auto_path {%s}' % tilelib)
master.tk.eval('package require tile') # TclError may be raised here
master._tile_loaded = True
def _format_optdict(optdict, script=False, ignore=None):
"""Formats optdict to a tuple to pass it to tk.call.
E.g. (script=False):
{'foreground': 'blue', 'padding': [1, 2, 3, 4]} returns:
('-foreground', 'blue', '-padding', '1 2 3 4')"""
format = "%s" if not script else "{%s}"
opts = []
for opt, value in optdict.iteritems():
if ignore and opt in ignore:
continue
if isinstance(value, (list, tuple)):
v = []
for val in value:
if isinstance(val, basestring):
v.append(unicode(val) if val else '{}')
else:
v.append(str(val))
# format v according to the script option, but also check for
# space in any value in v in order to group them correctly
value = format % ' '.join(
('{%s}' if ' ' in val else '%s') % val for val in v)
if script and value == '':
value = '{}' # empty string in Python is equivalent to {} in Tcl
opts.append(("-%s" % opt, value))
# Remember: _flatten skips over None
return _flatten(opts)
def _format_mapdict(mapdict, script=False):
"""Formats mapdict to pass it to tk.call.
E.g. (script=False):
{'expand': [('active', 'selected', 'grey'), ('focus', [1, 2, 3, 4])]}
returns:
('-expand', '{active selected} grey focus {1, 2, 3, 4}')"""
# if caller passes a Tcl script to tk.call, all the values need to
# be grouped into words (arguments to a command in Tcl dialect)
format = "%s" if not script else "{%s}"
opts = []
for opt, value in mapdict.iteritems():
opt_val = []
# each value in mapdict is expected to be a sequence, where each item
# is another sequence containing a state (or several) and a value
for statespec in value:
state, val = statespec[:-1], statespec[-1]
if len(state) > 1: # group multiple states
state = "{%s}" % ' '.join(state)
else: # single state
# if it is empty (something that evaluates to False), then
# format it to Tcl code to denote the "normal" state
state = state[0] or '{}'
if isinstance(val, (list, tuple)): # val needs to be grouped
val = "{%s}" % ' '.join(map(str, val))
opt_val.append("%s %s" % (state, val))
opts.append(("-%s" % opt, format % ' '.join(opt_val)))
return _flatten(opts)
def _format_elemcreate(etype, script=False, *args, **kw):
"""Formats args and kw according to the given element factory etype."""
spec = None
opts = ()
if etype in ("image", "vsapi"):
if etype == "image": # define an element based on an image
# first arg should be the default image name
iname = args[0]
# next args, if any, are statespec/value pairs which is almost
# a mapdict, but we just need the value
imagespec = _format_mapdict({None: args[1:]})[1]
spec = "%s %s" % (iname, imagespec)
else:
# define an element whose visual appearance is drawn using the
# Microsoft Visual Styles API which is responsible for the
# themed styles on Windows XP and Vista.
# Availability: Tk 8.6, Windows XP and Vista.
class_name, part_id = args[:2]
statemap = _format_mapdict({None: args[2:]})[1]
spec = "%s %s %s" % (class_name, part_id, statemap)
opts = _format_optdict(kw, script)
elif etype == "from": # clone an element
# it expects a themename and optionally an element to clone from,
# otherwise it will clone {} (empty element)
spec = args[0] # theme name
if len(args) > 1: # elementfrom specified
opts = (args[1], )
if script:
spec = '{%s}' % spec
opts = ' '.join(map(str, opts))
return spec, opts
def _format_layoutlist(layout, indent=0, indent_size=2):
"""Formats a layout list so we can pass the result to ttk::style
layout and ttk::style settings. Note that the layout doesn't has to
be a list necessarily.
E.g.:
[("Menubutton.background", None),
("Menubutton.button", {"children":
[("Menubutton.focus", {"children":
[("Menubutton.padding", {"children":
[("Menubutton.label", {"side": "left", "expand": 1})]
})]
})]
}),
("Menubutton.indicator", {"side": "right"})
]
returns:
Menubutton.background
Menubutton.button -children {
Menubutton.focus -children {
Menubutton.padding -children {
Menubutton.label -side left -expand 1
}
}
}
Menubutton.indicator -side right"""
script = []
for layout_elem in layout:
elem, opts = layout_elem
opts = opts or {}
fopts = ' '.join(map(str, _format_optdict(opts, True, "children")))
head = "%s%s%s" % (' ' * indent, elem, (" %s" % fopts) if fopts else '')
if "children" in opts:
script.append(head + " -children {")
indent += indent_size
newscript, indent = _format_layoutlist(opts['children'], indent,
indent_size)
script.append(newscript)
indent -= indent_size
script.append('%s}' % (' ' * indent))
else:
script.append(head)
return '\n'.join(script), indent
def _script_from_settings(settings):
"""Returns an appropriate script, based on settings, according to
theme_settings definition to be used by theme_settings and
theme_create."""
script = []
# a script will be generated according to settings passed, which
# will then be evaluated by Tcl
for name, opts in settings.iteritems():
# will format specific keys according to Tcl code
if opts.get('configure'): # format 'configure'
s = ' '.join(map(unicode, _format_optdict(opts['configure'], True)))
script.append("ttk::style configure %s %s;" % (name, s))
if opts.get('map'): # format 'map'
s = ' '.join(map(unicode, _format_mapdict(opts['map'], True)))
script.append("ttk::style map %s %s;" % (name, s))
if 'layout' in opts: # format 'layout' which may be empty
if not opts['layout']:
s = 'null' # could be any other word, but this one makes sense
else:
s, _ = _format_layoutlist(opts['layout'])
script.append("ttk::style layout %s {\n%s\n}" % (name, s))
if opts.get('element create'): # format 'element create'
eopts = opts['element create']
etype = eopts[0]
# find where args end, and where kwargs start
argc = 1 # etype was the first one
while argc < len(eopts) and not hasattr(eopts[argc], 'iteritems'):
argc += 1
elemargs = eopts[1:argc]
elemkw = eopts[argc] if argc < len(eopts) and eopts[argc] else {}
spec, opts = _format_elemcreate(etype, True, *elemargs, **elemkw)
script.append("ttk::style element create %s %s %s %s" % (
name, etype, spec, opts))
return '\n'.join(script)
def _dict_from_tcltuple(ttuple, cut_minus=True):
"""Break tuple in pairs, format it properly, then build the return
dict. If cut_minus is True, the supposed '-' prefixing options will
be removed.
ttuple is expected to contain an even number of elements."""
opt_start = 1 if cut_minus else 0
retdict = {}
it = iter(ttuple)
for opt, val in zip(it, it):
retdict[str(opt)[opt_start:]] = val
return tclobjs_to_py(retdict)
def _list_from_statespec(stuple):
"""Construct a list from the given statespec tuple according to the
accepted statespec accepted by _format_mapdict."""
nval = []
for val in stuple:
typename = getattr(val, 'typename', None)
if typename is None:
nval.append(val)
else: # this is a Tcl object
val = str(val)
if typename == 'StateSpec':
val = val.split()
nval.append(val)
it = iter(nval)
return [_flatten(spec) for spec in zip(it, it)]
def _list_from_layouttuple(ltuple):
"""Construct a list from the tuple returned by ttk::layout, this is
somewhat the reverse of _format_layoutlist."""
res = []
indx = 0
while indx < len(ltuple):
name = ltuple[indx]
opts = {}
res.append((name, opts))
indx += 1
while indx < len(ltuple): # grab name's options
opt, val = ltuple[indx:indx + 2]
if not opt.startswith('-'): # found next name
break
opt = opt[1:] # remove the '-' from the option
indx += 2
if opt == 'children':
val = _list_from_layouttuple(val)
opts[opt] = val
return res
def _val_or_dict(options, func, *args):
"""Format options then call func with args and options and return
the appropriate result.
If no option is specified, a dict is returned. If a option is
specified with the None value, the value for that option is returned.
Otherwise, the function just sets the passed options and the caller
shouldn't be expecting a return value anyway."""
options = _format_optdict(options)
res = func(*(args + options))
if len(options) % 2: # option specified without a value, return its value
return res
return _dict_from_tcltuple(res)
def _convert_stringval(value):
"""Converts a value to, hopefully, a more appropriate Python object."""
value = unicode(value)
try:
value = int(value)
except (ValueError, TypeError):
pass
return value
def tclobjs_to_py(adict):
"""Returns adict with its values converted from Tcl objects to Python
objects."""
for opt, val in adict.iteritems():
if val and hasattr(val, '__len__') and not isinstance(val, basestring):
if getattr(val[0], 'typename', None) == 'StateSpec':
val = _list_from_statespec(val)
else:
val = map(_convert_stringval, val)
elif hasattr(val, 'typename'): # some other (single) Tcl object
val = _convert_stringval(val)
adict[opt] = val
return adict
def setup_master(master=None):
"""If master is not None, itself is returned. If master is None,
the default master is returned if there is one, otherwise a new
master is created and returned.
If it is not allowed to use the default root and master is None,
RuntimeError is raised."""
if master is None:
if Tkinter._support_default_root:
master = Tkinter._default_root or Tkinter.Tk()
else:
raise RuntimeError(
"No master specified and Tkinter is "
"configured to not support default root")
return master
class Style(object):
"""Manipulate style database."""
_name = "ttk::style"
def __init__(self, master=None):
master = setup_master(master)
if not getattr(master, '_tile_loaded', False):
# Load tile now, if needed
_load_tile(master)
self.master = master
self.tk = self.master.tk
def configure(self, style, query_opt=None, **kw):
"""Query or sets the default value of the specified option(s) in
style.
Each key in kw is an option and each value is either a string or
a sequence identifying the value for that option."""
if query_opt is not None:
kw[query_opt] = None
return _val_or_dict(kw, self.tk.call, self._name, "configure", style)
def map(self, style, query_opt=None, **kw):
"""Query or sets dynamic values of the specified option(s) in
style.
Each key in kw is an option and each value should be a list or a
tuple (usually) containing statespecs grouped in tuples, or list,
or something else of your preference. A statespec is compound of
one or more states and then a value."""
if query_opt is not None:
return _list_from_statespec(
self.tk.call(self._name, "map", style, '-%s' % query_opt))
return _dict_from_tcltuple(
self.tk.call(self._name, "map", style, *(_format_mapdict(kw))))
def lookup(self, style, option, state=None, default=None):
"""Returns the value specified for option in style.
If state is specified it is expected to be a sequence of one
or more states. If the default argument is set, it is used as
a fallback value in case no specification for option is found."""
state = ' '.join(state) if state else ''
return self.tk.call(self._name, "lookup", style, '-%s' % option,
state, default)
def layout(self, style, layoutspec=None):
"""Define the widget layout for given style. If layoutspec is
omitted, return the layout specification for given style.
layoutspec is expected to be a list or an object different than
None that evaluates to False if you want to "turn off" that style.
If it is a list (or tuple, or something else), each item should be
a tuple where the first item is the layout name and the second item
should have the format described below:
LAYOUTS
A layout can contain the value None, if takes no options, or
a dict of options specifying how to arrange the element.
The layout mechanism uses a simplified version of the pack
geometry manager: given an initial cavity, each element is
allocated a parcel. Valid options/values are:
side: whichside
Specifies which side of the cavity to place the
element; one of top, right, bottom or left. If
omitted, the element occupies the entire cavity.
sticky: nswe
Specifies where the element is placed inside its
allocated parcel.
children: [sublayout... ]
Specifies a list of elements to place inside the
element. Each element is a tuple (or other sequence)
where the first item is the layout name, and the other
is a LAYOUT."""
lspec = None
if layoutspec:
lspec = _format_layoutlist(layoutspec)[0]
elif layoutspec is not None: # will disable the layout ({}, '', etc)
lspec = "null" # could be any other word, but this may make sense
# when calling layout(style) later
return _list_from_layouttuple(
self.tk.call(self._name, "layout", style, lspec))
def element_create(self, elementname, etype, *args, **kw):
"""Create a new element in the current theme of given etype."""
spec, opts = _format_elemcreate(etype, False, *args, **kw)
self.tk.call(self._name, "element", "create", elementname, etype,
spec, *opts)
def element_names(self):
"""Returns the list of elements defined in the current theme."""
return self.tk.call(self._name, "element", "names")
def element_options(self, elementname):
"""Return the list of elementname's options."""
return self.tk.call(self._name, "element", "options", elementname)
def theme_create(self, themename, parent=None, settings=None):
"""Creates a new theme.
It is an error if themename already exists. If parent is
specified, the new theme will inherit styles, elements and
layouts from the specified parent theme. If settings are present,
they are expected to have the same syntax used for theme_settings."""
script = _script_from_settings(settings) if settings else ''
if parent:
self.tk.call(self._name, "theme", "create", themename,
"-parent", parent, "-settings", script)
else:
self.tk.call(self._name, "theme", "create", themename,
"-settings", script)
def theme_settings(self, themename, settings):
"""Temporarily sets the current theme to themename, apply specified
settings and then restore the previous theme.
Each key in settings is a style and each value may contain the
keys 'configure', 'map', 'layout' and 'element create' and they
are expected to have the same format as specified by the methods
configure, map, layout and element_create respectively."""
script = _script_from_settings(settings)
self.tk.call(self._name, "theme", "settings", themename, script)
def theme_names(self):
"""Returns a list of all known themes."""
return self.tk.call(self._name, "theme", "names")
def theme_use(self, themename=None):
"""If themename is None, returns the theme in use, otherwise, set
the current theme to themename, refreshes all widgets and emits
a <<ThemeChanged>> event."""
if themename is None:
# Starting on Tk 8.6, checking this global is no longer needed
# since it allows doing self.tk.call(self._name, "theme", "use")
return self.tk.eval("return $ttk::currentTheme")
# using "ttk::setTheme" instead of "ttk::style theme use" causes
# the variable currentTheme to be updated, also, ttk::setTheme calls
# "ttk::style theme use" in order to change theme.
self.tk.call("ttk::setTheme", themename)
class Widget(Tkinter.Widget):
"""Base class for Tk themed widgets."""
def __init__(self, master, widgetname, kw=None):
"""Constructs a Ttk Widget with the parent master.
STANDARD OPTIONS
class, cursor, takefocus, style
SCROLLABLE WIDGET OPTIONS
xscrollcommand, yscrollcommand
LABEL WIDGET OPTIONS
text, textvariable, underline, image, compound, width
WIDGET STATES
active, disabled, focus, pressed, selected, background,
readonly, alternate, invalid
"""
master = setup_master(master)
if not getattr(master, '_tile_loaded', False):
# Load tile now, if needed
_load_tile(master)
Tkinter.Widget.__init__(self, master, widgetname, kw=kw)
def identify(self, x, y):
"""Returns the name of the element at position x, y, or the empty
string if the point does not lie within any element.
x and y are pixel coordinates relative to the widget."""
return self.tk.call(self._w, "identify", x, y)
def instate(self, statespec, callback=None, *args, **kw):
"""Test the widget's state.
If callback is not specified, returns True if the widget state
matches statespec and False otherwise. If callback is specified,
then it will be invoked with *args, **kw if the widget state
matches statespec. statespec is expected to be a sequence."""
ret = self.tk.call(self._w, "instate", ' '.join(statespec))
if ret and callback:
return callback(*args, **kw)
return bool(ret)
def state(self, statespec=None):
"""Modify or inquire widget state.
Widget state is returned if statespec is None, otherwise it is
set according to the statespec flags and then a new state spec
is returned indicating which flags were changed. statespec is
expected to be a sequence."""
if statespec is not None:
statespec = ' '.join(statespec)
return self.tk.splitlist(str(self.tk.call(self._w, "state", statespec)))
class Button(Widget):
"""Ttk Button widget, displays a textual label and/or image, and
evaluates a command when pressed."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Button widget with the parent master.
STANDARD OPTIONS
class, compound, cursor, image, state, style, takefocus,
text, textvariable, underline, width
WIDGET-SPECIFIC OPTIONS
command, default, width
"""
Widget.__init__(self, master, "ttk::button", kw)
def invoke(self):
"""Invokes the command associated with the button."""
return self.tk.call(self._w, "invoke")
class Checkbutton(Widget):
"""Ttk Checkbutton widget which is either in on- or off-state."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Checkbutton widget with the parent master.
STANDARD OPTIONS
class, compound, cursor, image, state, style, takefocus,
text, textvariable, underline, width
WIDGET-SPECIFIC OPTIONS
command, offvalue, onvalue, variable
"""
Widget.__init__(self, master, "ttk::checkbutton", kw)
def invoke(self):
"""Toggles between the selected and deselected states and
invokes the associated command. If the widget is currently
selected, sets the option variable to the offvalue option
and deselects the widget; otherwise, sets the option variable
to the option onvalue.
Returns the result of the associated command."""
return self.tk.call(self._w, "invoke")
class Entry(Widget, Tkinter.Entry):
"""Ttk Entry widget displays a one-line text string and allows that
string to be edited by the user."""
def __init__(self, master=None, widget=None, **kw):
"""Constructs a Ttk Entry widget with the parent master.
STANDARD OPTIONS
class, cursor, style, takefocus, xscrollcommand
WIDGET-SPECIFIC OPTIONS
exportselection, invalidcommand, justify, show, state,
textvariable, validate, validatecommand, width
VALIDATION MODES
none, key, focus, focusin, focusout, all
"""
Widget.__init__(self, master, widget or "ttk::entry", kw)
def bbox(self, index):
"""Return a tuple of (x, y, width, height) which describes the
bounding box of the character given by index."""
return self.tk.call(self._w, "bbox", index)
def identify(self, x, y):
"""Returns the name of the element at position x, y, or the
empty string if the coordinates are outside the window."""
return self.tk.call(self._w, "identify", x, y)
def validate(self):
"""Force revalidation, independent of the conditions specified
by the validate option. Returns False if validation fails, True
if it succeeds. Sets or clears the invalid state accordingly."""
return bool(self.tk.call(self._w, "validate"))
class Combobox(Entry):
"""Ttk Combobox widget combines a text field with a pop-down list of
values."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Combobox widget with the parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
exportselection, justify, height, postcommand, state,
textvariable, values, width
"""
# The "values" option may need special formatting, so leave to
# _format_optdict the responsability to format it
if "values" in kw:
kw["values"] = _format_optdict({'v': kw["values"]})[1]
Entry.__init__(self, master, "ttk::combobox", **kw)
def __setitem__(self, item, value):
if item == "values":
value = _format_optdict({item: value})[1]
Entry.__setitem__(self, item, value)
def configure(self, cnf=None, **kw):
"""Custom Combobox configure, created to properly format the values
option."""
if "values" in kw:
kw["values"] = _format_optdict({'v': kw["values"]})[1]
return Entry.configure(self, cnf, **kw)
def current(self, newindex=None):
"""If newindex is supplied, sets the combobox value to the
element at position newindex in the list of values. Otherwise,
returns the index of the current value in the list of values
or -1 if the current value does not appear in the list."""
return self.tk.call(self._w, "current", newindex)
def set(self, value):
"""Sets the value of the combobox to value."""
self.tk.call(self._w, "set", value)
class Frame(Widget):
"""Ttk Frame widget is a container, used to group other widgets
together."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Frame with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
borderwidth, relief, padding, width, height
"""
Widget.__init__(self, master, "ttk::frame", kw)
class Label(Widget):
"""Ttk Label widget displays a textual label and/or image."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Label with parent master.
STANDARD OPTIONS
class, compound, cursor, image, style, takefocus, text,
textvariable, underline, width
WIDGET-SPECIFIC OPTIONS
anchor, background, font, foreground, justify, padding,
relief, text, wraplength
"""
Widget.__init__(self, master, "ttk::label", kw)
class Labelframe(Widget):
"""Ttk Labelframe widget is a container used to group other widgets
together. It has an optional label, which may be a plain text string
or another widget."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Labelframe with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
labelanchor, text, underline, padding, labelwidget, width,
height
"""
Widget.__init__(self, master, "ttk::labelframe", kw)
LabelFrame = Labelframe # Tkinter name compatibility
class Menubutton(Widget):
"""Ttk Menubutton widget displays a textual label and/or image, and
displays a menu when pressed."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Menubutton with parent master.
STANDARD OPTIONS
class, compound, cursor, image, state, style, takefocus,
text, textvariable, underline, width
WIDGET-SPECIFIC OPTIONS
direction, menu
"""
Widget.__init__(self, master, "ttk::menubutton", kw)
class Notebook(Widget):
"""Ttk Notebook widget manages a collection of windows and displays
a single one at a time. Each child window is associated with a tab,
which the user may select to change the currently-displayed window."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Notebook with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
height, padding, width
TAB OPTIONS
state, sticky, padding, text, image, compound, underline
TAB IDENTIFIERS (tab_id)
The tab_id argument found in several methods may take any of
the following forms:
* An integer between zero and the number of tabs
* The name of a child window
* A positional specification of the form "@x,y", which
defines the tab
* The string "current", which identifies the
currently-selected tab
* The string "end", which returns the number of tabs (only
valid for method index)
"""
Widget.__init__(self, master, "ttk::notebook", kw)
def add(self, child, **kw):
"""Adds a new tab to the notebook.
If window is currently managed by the notebook but hidden, it is
restored to its previous position."""
self.tk.call(self._w, "add", child, *(_format_optdict(kw)))
def forget(self, tab_id):
"""Removes the tab specified by tab_id, unmaps and unmanages the
associated window."""
self.tk.call(self._w, "forget", tab_id)
def hide(self, tab_id):
"""Hides the tab specified by tab_id.
The tab will not be displayed, but the associated window remains
managed by the notebook and its configuration remembered. Hidden
tabs may be restored with the add command."""
self.tk.call(self._w, "hide", tab_id)
def identify(self, x, y):
"""Returns the name of the tab element at position x, y, or the
empty string if none."""
return self.tk.call(self._w, "identify", x, y)
def index(self, tab_id):
"""Returns the numeric index of the tab specified by tab_id, or
the total number of tabs if tab_id is the string "end"."""
return self.tk.call(self._w, "index", tab_id)
def insert(self, pos, child, **kw):
"""Inserts a pane at the specified position.
pos is either the string end, an integer index, or the name of
a managed child. If child is already managed by the notebook,
moves it to the specified position."""
self.tk.call(self._w, "insert", pos, child, *(_format_optdict(kw)))
def select(self, tab_id=None):
"""Selects the specified tab.
The associated child window will be displayed, and the
previously-selected window (if different) is unmapped. If tab_id
is omitted, returns the widget name of the currently selected
pane."""
return self.tk.call(self._w, "select", tab_id)
def tab(self, tab_id, option=None, **kw):
"""Query or modify the options of the specific tab_id.
If kw is not given, returns a dict of the tab option values. If option
is specified, returns the value of that option. Otherwise, sets the
options to the corresponding values."""
if option is not None:
kw[option] = None
return _val_or_dict(kw, self.tk.call, self._w, "tab", tab_id)
def tabs(self):
"""Returns a list of windows managed by the notebook."""
return self.tk.call(self._w, "tabs") or ()
def enable_traversal(self):
"""Enable keyboard traversal for a toplevel window containing
this notebook.
This will extend the bindings for the toplevel window containing
this notebook as follows:
Control-Tab: selects the tab following the currently selected
one
Shift-Control-Tab: selects the tab preceding the currently
selected one
Alt-K: where K is the mnemonic (underlined) character of any
tab, will select that tab.
Multiple notebooks in a single toplevel may be enabled for
traversal, including nested notebooks. However, notebook traversal
only works properly if all panes are direct children of the
notebook."""
# The only, and good, difference I see is about mnemonics, which works
# after calling this method. Control-Tab and Shift-Control-Tab always
# works (here at least).
self.tk.call("ttk::notebook::enableTraversal", self._w)
class Panedwindow(Widget, Tkinter.PanedWindow):
"""Ttk Panedwindow widget displays a number of subwindows, stacked
either vertically or horizontally."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Panedwindow with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
orient, width, height
PANE OPTIONS
weight
"""
Widget.__init__(self, master, "ttk::panedwindow", kw)
forget = Tkinter.PanedWindow.forget # overrides Pack.forget
def insert(self, pos, child, **kw):
"""Inserts a pane at the specified positions.
pos is either the string end, and integer index, or the name
of a child. If child is already managed by the paned window,
moves it to the specified position."""
self.tk.call(self._w, "insert", pos, child, *(_format_optdict(kw)))
def pane(self, pane, option=None, **kw):
"""Query or modify the options of the specified pane.
pane is either an integer index or the name of a managed subwindow.
If kw is not given, returns a dict of the pane option values. If
option is specified then the value for that option is returned.
Otherwise, sets the options to the correspoding values."""
if option is not None:
kw[option] = None
return _val_or_dict(kw, self.tk.call, self._w, "pane", pane)
def sashpos(self, index, newpos=None):
"""If newpos is specified, sets the position of sash number index.
May adjust the positions of adjacent sashes to ensure that
positions are monotonically increasing. Sash positions are further
constrained to be between 0 and the total size of the widget.
Returns the new position of sash number index."""
return self.tk.call(self._w, "sashpos", index, newpos)
PanedWindow = Panedwindow # Tkinter name compatibility
class Progressbar(Widget):
"""Ttk Progressbar widget shows the status of a long-running
operation. They can operate in two modes: determinate mode shows the
amount completed relative to the total amount of work to be done, and
indeterminate mode provides an animated display to let the user know
that something is happening."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Progressbar with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
orient, length, mode, maximum, value, variable, phase
"""
Widget.__init__(self, master, "ttk::progressbar", kw)
def start(self, interval=None):
"""Begin autoincrement mode: schedules a recurring timer event
that calls method step every interval milliseconds.
interval defaults to 50 milliseconds (20 steps/second) if ommited."""
self.tk.call(self._w, "start", interval)
def step(self, amount=None):
"""Increments the value option by amount.
amount defaults to 1.0 if omitted."""
self.tk.call(self._w, "step", amount)
def stop(self):
"""Stop autoincrement mode: cancels any recurring timer event
initiated by start."""
self.tk.call(self._w, "stop")
class Radiobutton(Widget):
"""Ttk Radiobutton widgets are used in groups to show or change a
set of mutually-exclusive options."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Radiobutton with parent master.
STANDARD OPTIONS
class, compound, cursor, image, state, style, takefocus,
text, textvariable, underline, width
WIDGET-SPECIFIC OPTIONS
command, value, variable
"""
Widget.__init__(self, master, "ttk::radiobutton", kw)
def invoke(self):
"""Sets the option variable to the option value, selects the
widget, and invokes the associated command.
Returns the result of the command, or an empty string if
no command is specified."""
return self.tk.call(self._w, "invoke")
class Scale(Widget, Tkinter.Scale):
"""Ttk Scale widget is typically used to control the numeric value of
a linked variable that varies uniformly over some range."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Scale with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
command, from, length, orient, to, value, variable
"""
Widget.__init__(self, master, "ttk::scale", kw)
def configure(self, cnf=None, **kw):
"""Modify or query scale options.
Setting a value for any of the "from", "from_" or "to" options
generates a <<RangeChanged>> event."""
if cnf:
kw.update(cnf)
Widget.configure(self, **kw)
if any(['from' in kw, 'from_' in kw, 'to' in kw]):
self.event_generate('<<RangeChanged>>')
def get(self, x=None, y=None):
"""Get the current value of the value option, or the value
corresponding to the coordinates x, y if they are specified.
x and y are pixel coordinates relative to the scale widget
origin."""
return self.tk.call(self._w, 'get', x, y)
class Scrollbar(Widget, Tkinter.Scrollbar):
"""Ttk Scrollbar controls the viewport of a scrollable widget."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Scrollbar with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
command, orient
"""
Widget.__init__(self, master, "ttk::scrollbar", kw)
class Separator(Widget):
"""Ttk Separator widget displays a horizontal or vertical separator
bar."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Separator with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus
WIDGET-SPECIFIC OPTIONS
orient
"""
Widget.__init__(self, master, "ttk::separator", kw)
class Sizegrip(Widget):
"""Ttk Sizegrip allows the user to resize the containing toplevel
window by pressing and dragging the grip."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Sizegrip with parent master.
STANDARD OPTIONS
class, cursor, state, style, takefocus
"""
Widget.__init__(self, master, "ttk::sizegrip", kw)
class Treeview(Widget, Tkinter.XView, Tkinter.YView):
"""Ttk Treeview widget displays a hierarchical collection of items.
Each item has a textual label, an optional image, and an optional list
of data values. The data values are displayed in successive columns
after the tree label."""
def __init__(self, master=None, **kw):
"""Construct a Ttk Treeview with parent master.
STANDARD OPTIONS
class, cursor, style, takefocus, xscrollcommand,
yscrollcommand
WIDGET-SPECIFIC OPTIONS
columns, displaycolumns, height, padding, selectmode, show
ITEM OPTIONS
text, image, values, open, tags
TAG OPTIONS
foreground, background, font, image
"""
Widget.__init__(self, master, "ttk::treeview", kw)
def bbox(self, item, column=None):
"""Returns the bounding box (relative to the treeview widget's
window) of the specified item in the form x y width height.
If column is specified, returns the bounding box of that cell.
If the item is not visible (i.e., if it is a descendant of a
closed item or is scrolled offscreen), returns an empty string."""
return self.tk.call(self._w, "bbox", item, column)
def get_children(self, item=None):
"""Returns a tuple of children belonging to item.
If item is not specified, returns root children."""
return self.tk.call(self._w, "children", item or '') or ()
def set_children(self, item, *newchildren):
"""Replaces item's child with newchildren.
Children present in item that are not present in newchildren
are detached from tree. No items in newchildren may be an
ancestor of item."""
self.tk.call(self._w, "children", item, newchildren)
def column(self, column, option=None, **kw):
"""Query or modify the options for the specified column.
If kw is not given, returns a dict of the column option values. If
option is specified then the value for that option is returned.
Otherwise, sets the options to the corresponding values."""
if option is not None:
kw[option] = None
return _val_or_dict(kw, self.tk.call, self._w, "column", column)
def delete(self, *items):
"""Delete all specified items and all their descendants. The root
item may not be deleted."""
self.tk.call(self._w, "delete", items)
def detach(self, *items):
"""Unlinks all of the specified items from the tree.
The items and all of their descendants are still present, and may
be reinserted at another point in the tree, but will not be
displayed. The root item may not be detached."""
self.tk.call(self._w, "detach", items)
def exists(self, item):
"""Returns True if the specified item is present in the three,
False otherwise."""
return bool(self.tk.call(self._w, "exists", item))
def focus(self, item=None):
"""If item is specified, sets the focus item to item. Otherwise,
returns the current focus item, or '' if there is none."""
return self.tk.call(self._w, "focus", item)
def heading(self, column, option=None, **kw):
"""Query or modify the heading options for the specified column.
If kw is not given, returns a dict of the heading option values. If
option is specified then the value for that option is returned.
Otherwise, sets the options to the corresponding values.
Valid options/values are:
text: text
The text to display in the column heading
image: image_name
Specifies an image to display to the right of the column
heading
anchor: anchor
Specifies how the heading text should be aligned. One of
the standard Tk anchor values
command: callback
A callback to be invoked when the heading label is
pressed.
To configure the tree column heading, call this with column = "#0" """
cmd = kw.get('command')
if cmd and not isinstance(cmd, basestring):
# callback not registered yet, do it now
kw['command'] = self.master.register(cmd, self._substitute)
if option is not None:
kw[option] = None
return _val_or_dict(kw, self.tk.call, self._w, 'heading', column)
def identify(self, component, x, y):
"""Returns a description of the specified component under the
point given by x and y, or the empty string if no such component
is present at that position."""
return self.tk.call(self._w, "identify", component, x, y)
def identify_row(self, y):
"""Returns the item ID of the item at position y."""
return self.identify("row", 0, y)
def identify_column(self, x):
"""Returns the data column identifier of the cell at position x.
The tree column has ID #0."""
return self.identify("column", x, 0)
def identify_region(self, x, y):
"""Returns one of:
heading: Tree heading area.
separator: Space between two columns headings;
tree: The tree area.
cell: A data cell.
* Availability: Tk 8.6"""
return self.identify("region", x, y)
def identify_element(self, x, y):
"""Returns the element at position x, y.
* Availability: Tk 8.6"""
return self.identify("element", x, y)
def index(self, item):
"""Returns the integer index of item within its parent's list
of children."""
return self.tk.call(self._w, "index", item)
def insert(self, parent, index, iid=None, **kw):
"""Creates a new item and return the item identifier of the newly
created item.
parent is the item ID of the parent item, or the empty string
to create a new top-level item. index is an integer, or the value
end, specifying where in the list of parent's children to insert
the new item. If index is less than or equal to zero, the new node
is inserted at the beginning, if index is greater than or equal to
the current number of children, it is inserted at the end. If iid
is specified, it is used as the item identifier, iid must not
already exist in the tree. Otherwise, a new unique identifier
is generated."""
opts = _format_optdict(kw)
if iid:
res = self.tk.call(self._w, "insert", parent, index,
"-id", iid, *opts)
else:
res = self.tk.call(self._w, "insert", parent, index, *opts)
return res
def item(self, item, option=None, **kw):
"""Query or modify the options for the specified item.
If no options are given, a dict with options/values for the item
is returned. If option is specified then the value for that option
is returned. Otherwise, sets the options to the corresponding
values as given by kw."""
if option is not None:
kw[option] = None
return _val_or_dict(kw, self.tk.call, self._w, "item", item)
def move(self, item, parent, index):
"""Moves item to position index in parent's list of children.
It is illegal to move an item under one of its descendants. If
index is less than or equal to zero, item is moved to the
beginning, if greater than or equal to the number of children,
it is moved to the end. If item was detached it is reattached."""
self.tk.call(self._w, "move", item, parent, index)
reattach = move # A sensible method name for reattaching detached items
def next(self, item):
"""Returns the identifier of item's next sibling, or '' if item
is the last child of its parent."""
return self.tk.call(self._w, "next", item)
def parent(self, item):
"""Returns the ID of the parent of item, or '' if item is at the
top level of the hierarchy."""
return self.tk.call(self._w, "parent", item)
def prev(self, item):
"""Returns the identifier of item's previous sibling, or '' if
item is the first child of its parent."""
return self.tk.call(self._w, "prev", item)
def see(self, item):
"""Ensure that item is visible.
Sets all of item's ancestors open option to True, and scrolls
the widget if necessary so that item is within the visible
portion of the tree."""
self.tk.call(self._w, "see", item)
def selection(self, selop=None, items=None):
"""If selop is not specified, returns selected items."""
return self.tk.call(self._w, "selection", selop, items)
def selection_set(self, items):
"""items becomes the new selection."""
self.selection("set", items)
def selection_add(self, items):
"""Add items to the selection."""
self.selection("add", items)
def selection_remove(self, items):
"""Remove items from the selection."""
self.selection("remove", items)
def selection_toggle(self, items):
"""Toggle the selection state of each item in items."""
self.selection("toggle", items)
def set(self, item, column=None, value=None):
"""With one argument, returns a dictionary of column/value pairs
for the specified item. With two arguments, returns the current
value of the specified column. With three arguments, sets the
value of given column in given item to the specified value."""
res = self.tk.call(self._w, "set", item, column, value)
if column is None and value is None:
return _dict_from_tcltuple(res, False)
else:
return res
def tag_bind(self, tagname, sequence=None, callback=None):
"""Bind a callback for the given event sequence to the tag tagname.
When an event is delivered to an item, the callbacks for each
of the item's tags option are called."""
self._bind((self._w, "tag", "bind", tagname), sequence, callback, add=0)
def tag_configure(self, tagname, option=None, **kw):
"""Query or modify the options for the specified tagname.
If kw is not given, returns a dict of the option settings for tagname.
If option is specified, returns the value for that option for the
specified tagname. Otherwise, sets the options to the corresponding
values for the given tagname."""
if option is not None:
kw[option] = None
return _val_or_dict(kw, self.tk.call, self._w, "tag", "configure",
tagname)
def tag_has(self, tagname, item=None):
"""If item is specified, returns 1 or 0 depending on whether the
specified item has the given tagname. Otherwise, returns a list of
all items which have the specified tag.
* Availability: Tk 8.6"""
return self.tk.call(self._w, "tag", "has", tagname, item)
# Extensions
class LabeledScale(Frame, object):
"""A Ttk Scale widget with a Ttk Label widget indicating its
current value.
The Ttk Scale can be accessed through instance.scale, and Ttk Label
can be accessed through instance.label"""
def __init__(self, master=None, variable=None, from_=0, to=10, **kw):
"""Construct an horizontal LabeledScale with parent master, a
variable to be associated with the Ttk Scale widget and its range.
If variable is not specified, a Tkinter.IntVar is created.
WIDGET-SPECIFIC OPTIONS
compound: 'top' or 'bottom'
Specifies how to display the label relative to the scale.
Defaults to 'top'.
"""
self._label_top = kw.pop('compound', 'top') == 'top'
Frame.__init__(self, master, **kw)
self._variable = variable or Tkinter.IntVar(master)
self._variable.set(from_)
self._last_valid = from_
self.label = Label(self)
self.scale = Scale(self, variable=self._variable, from_=from_, to=to)
self.scale.bind('<<RangeChanged>>', self._adjust)
# position scale and label according to the compound option
scale_side = 'bottom' if self._label_top else 'top'
label_side = 'top' if scale_side == 'bottom' else 'bottom'
self.scale.pack(side=scale_side, fill='x')
tmp = Label(self).pack(side=label_side) # place holder
self.label.place(anchor='n' if label_side == 'top' else 's')
# update the label as scale or variable changes
self.__tracecb = self._variable.trace_variable('w', self._adjust)
self.bind('<Configure>', self._adjust)
self.bind('<Map>', self._adjust)
def destroy(self):
"""Destroy this widget and possibly its associated variable."""
try:
self._variable.trace_vdelete('w', self.__tracecb)
except AttributeError:
# widget has been destroyed already
pass
else:
del self._variable
Frame.destroy(self)
def _adjust(self, *args):
"""Adjust the label position according to the scale."""
def adjust_label():
self.update_idletasks() # "force" scale redraw
x, y = self.scale.coords()
if self._label_top:
y = self.scale.winfo_y() - self.label.winfo_reqheight()
else:
y = self.scale.winfo_reqheight() + self.label.winfo_reqheight()
self.label.place_configure(x=x, y=y)
from_, to = self.scale['from'], self.scale['to']
if to < from_:
from_, to = to, from_
newval = self._variable.get()
if not from_ <= newval <= to:
# value outside range, set value back to the last valid one
self.value = self._last_valid
return
self._last_valid = newval
self.label['text'] = newval
self.after_idle(adjust_label)
def _get_value(self):
"""Return current scale value."""
return self._variable.get()
def _set_value(self, val):
"""Set new scale value."""
self._variable.set(val)
value = property(_get_value, _set_value)
class OptionMenu(Menubutton):
"""Themed OptionMenu, based after Tkinter's OptionMenu, which allows
the user to select a value from a menu."""
def __init__(self, master, variable, default=None, *values, **kwargs):
"""Construct a themed OptionMenu widget with master as the parent,
the resource textvariable set to variable, the initially selected
value specified by the default parameter, the menu values given by
*values and additional keywords.
WIDGET-SPECIFIC OPTIONS
style: stylename
Menubutton style.
direction: 'above', 'below', 'left', 'right', or 'flush'
Menubutton direction.
command: callback
A callback that will be invoked after selecting an item.
"""
kw = {'textvariable': variable, 'style': kwargs.pop('style', None),
'direction': kwargs.pop('direction', None)}
Menubutton.__init__(self, master, **kw)
self['menu'] = Tkinter.Menu(self, tearoff=False)
self._variable = variable
self._callback = kwargs.pop('command', None)
if kwargs:
raise Tkinter.TclError('unknown option -%s' % (
kwargs.iterkeys().next()))
self.set_menu(default, *values)
def __getitem__(self, item):
if item == 'menu':
return self.nametowidget(Menubutton.__getitem__(self, item))
return Menubutton.__getitem__(self, item)
def set_menu(self, default=None, *values):
"""Build a new menu of radiobuttons with *values and optionally
a default value."""
menu = self['menu']
menu.delete(0, 'end')
for val in values:
menu.add_radiobutton(label=val,
command=Tkinter._setit(self._variable, val, self._callback))
if default:
self._variable.set(default)
def destroy(self):
"""Destroy this widget and its associated variable."""
del self._variable
Menubutton.destroy(self)
| Python |
# base class for tk common dialogues
#
# this module provides a base class for accessing the common
# dialogues available in Tk 4.2 and newer. use tkFileDialog,
# tkColorChooser, and tkMessageBox to access the individual
# dialogs.
#
# written by Fredrik Lundh, May 1997
#
from Tkinter import *
class Dialog:
command = None
def __init__(self, master=None, **options):
# FIXME: should this be placed on the module level instead?
if TkVersion < 4.2:
raise TclError, "this module requires Tk 4.2 or newer"
self.master = master
self.options = options
if not master and options.get('parent'):
self.master = options['parent']
def _fixoptions(self):
pass # hook
def _fixresult(self, widget, result):
return result # hook
def show(self, **options):
# update instance options
for k, v in options.items():
self.options[k] = v
self._fixoptions()
# we need a dummy widget to properly process the options
# (at least as long as we use Tkinter 1.63)
w = Frame(self.master)
try:
s = w.tk.call(self.command, *w._options(self.options))
s = self._fixresult(w, s)
finally:
try:
# get rid of the widget
w.destroy()
except:
pass
return s
| Python |
"""HTTP server base class.
Note: the class in this module doesn't implement any HTTP request; see
SimpleHTTPServer for simple implementations of GET, HEAD and POST
(including CGI scripts). It does, however, optionally implement HTTP/1.1
persistent connections, as of version 0.3.
Contents:
- BaseHTTPRequestHandler: HTTP request handler base class
- test: test function
XXX To do:
- log requests even later (to capture byte count)
- log user-agent header and other interesting goodies
- send error log to separate file
"""
# See also:
#
# HTTP Working Group T. Berners-Lee
# INTERNET-DRAFT R. T. Fielding
# <draft-ietf-http-v10-spec-00.txt> H. Frystyk Nielsen
# Expires September 8, 1995 March 8, 1995
#
# URL: http://www.ics.uci.edu/pub/ietf/http/draft-ietf-http-v10-spec-00.txt
#
# and
#
# Network Working Group R. Fielding
# Request for Comments: 2616 et al
# Obsoletes: 2068 June 1999
# Category: Standards Track
#
# URL: http://www.faqs.org/rfcs/rfc2616.html
# Log files
# ---------
#
# Here's a quote from the NCSA httpd docs about log file format.
#
# | The logfile format is as follows. Each line consists of:
# |
# | host rfc931 authuser [DD/Mon/YYYY:hh:mm:ss] "request" ddd bbbb
# |
# | host: Either the DNS name or the IP number of the remote client
# | rfc931: Any information returned by identd for this person,
# | - otherwise.
# | authuser: If user sent a userid for authentication, the user name,
# | - otherwise.
# | DD: Day
# | Mon: Month (calendar name)
# | YYYY: Year
# | hh: hour (24-hour format, the machine's timezone)
# | mm: minutes
# | ss: seconds
# | request: The first line of the HTTP request as sent by the client.
# | ddd: the status code returned by the server, - if not available.
# | bbbb: the total number of bytes sent,
# | *not including the HTTP/1.0 header*, - if not available
# |
# | You can determine the name of the file accessed through request.
#
# (Actually, the latter is only true if you know the server configuration
# at the time the request was made!)
__version__ = "0.3"
__all__ = ["HTTPServer", "BaseHTTPRequestHandler"]
import sys
import time
import socket # For gethostbyaddr()
from warnings import filterwarnings, catch_warnings
with catch_warnings():
if sys.py3kwarning:
filterwarnings("ignore", ".*mimetools has been removed",
DeprecationWarning)
import mimetools
import SocketServer
# Default error message template
DEFAULT_ERROR_MESSAGE = """\
<head>
<title>Error response</title>
</head>
<body>
<h1>Error response</h1>
<p>Error code %(code)d.
<p>Message: %(message)s.
<p>Error code explanation: %(code)s = %(explain)s.
</body>
"""
DEFAULT_ERROR_CONTENT_TYPE = "text/html"
def _quote_html(html):
return html.replace("&", "&").replace("<", "<").replace(">", ">")
class HTTPServer(SocketServer.TCPServer):
allow_reuse_address = 1 # Seems to make sense in testing environment
def server_bind(self):
"""Override server_bind to store the server name."""
SocketServer.TCPServer.server_bind(self)
host, port = self.socket.getsockname()[:2]
self.server_name = socket.getfqdn(host)
self.server_port = port
class BaseHTTPRequestHandler(SocketServer.StreamRequestHandler):
"""HTTP request handler base class.
The following explanation of HTTP serves to guide you through the
code as well as to expose any misunderstandings I may have about
HTTP (so you don't need to read the code to figure out I'm wrong
:-).
HTTP (HyperText Transfer Protocol) is an extensible protocol on
top of a reliable stream transport (e.g. TCP/IP). The protocol
recognizes three parts to a request:
1. One line identifying the request type and path
2. An optional set of RFC-822-style headers
3. An optional data part
The headers and data are separated by a blank line.
The first line of the request has the form
<command> <path> <version>
where <command> is a (case-sensitive) keyword such as GET or POST,
<path> is a string containing path information for the request,
and <version> should be the string "HTTP/1.0" or "HTTP/1.1".
<path> is encoded using the URL encoding scheme (using %xx to signify
the ASCII character with hex code xx).
The specification specifies that lines are separated by CRLF but
for compatibility with the widest range of clients recommends
servers also handle LF. Similarly, whitespace in the request line
is treated sensibly (allowing multiple spaces between components
and allowing trailing whitespace).
Similarly, for output, lines ought to be separated by CRLF pairs
but most clients grok LF characters just fine.
If the first line of the request has the form
<command> <path>
(i.e. <version> is left out) then this is assumed to be an HTTP
0.9 request; this form has no optional headers and data part and
the reply consists of just the data.
The reply form of the HTTP 1.x protocol again has three parts:
1. One line giving the response code
2. An optional set of RFC-822-style headers
3. The data
Again, the headers and data are separated by a blank line.
The response code line has the form
<version> <responsecode> <responsestring>
where <version> is the protocol version ("HTTP/1.0" or "HTTP/1.1"),
<responsecode> is a 3-digit response code indicating success or
failure of the request, and <responsestring> is an optional
human-readable string explaining what the response code means.
This server parses the request and the headers, and then calls a
function specific to the request type (<command>). Specifically,
a request SPAM will be handled by a method do_SPAM(). If no
such method exists the server sends an error response to the
client. If it exists, it is called with no arguments:
do_SPAM()
Note that the request name is case sensitive (i.e. SPAM and spam
are different requests).
The various request details are stored in instance variables:
- client_address is the client IP address in the form (host,
port);
- command, path and version are the broken-down request line;
- headers is an instance of mimetools.Message (or a derived
class) containing the header information;
- rfile is a file object open for reading positioned at the
start of the optional input data part;
- wfile is a file object open for writing.
IT IS IMPORTANT TO ADHERE TO THE PROTOCOL FOR WRITING!
The first thing to be written must be the response line. Then
follow 0 or more header lines, then a blank line, and then the
actual data (if any). The meaning of the header lines depends on
the command executed by the server; in most cases, when data is
returned, there should be at least one header line of the form
Content-type: <type>/<subtype>
where <type> and <subtype> should be registered MIME types,
e.g. "text/html" or "text/plain".
"""
# The Python system version, truncated to its first component.
sys_version = "Python/" + sys.version.split()[0]
# The server software version. You may want to override this.
# The format is multiple whitespace-separated strings,
# where each string is of the form name[/version].
server_version = "BaseHTTP/" + __version__
# The default request version. This only affects responses up until
# the point where the request line is parsed, so it mainly decides what
# the client gets back when sending a malformed request line.
# Most web servers default to HTTP 0.9, i.e. don't send a status line.
default_request_version = "HTTP/0.9"
def parse_request(self):
"""Parse a request (internal).
The request should be stored in self.raw_requestline; the results
are in self.command, self.path, self.request_version and
self.headers.
Return True for success, False for failure; on failure, an
error is sent back.
"""
self.command = None # set in case of error on the first line
self.request_version = version = self.default_request_version
self.close_connection = 1
requestline = self.raw_requestline
if requestline[-2:] == '\r\n':
requestline = requestline[:-2]
elif requestline[-1:] == '\n':
requestline = requestline[:-1]
self.requestline = requestline
words = requestline.split()
if len(words) == 3:
[command, path, version] = words
if version[:5] != 'HTTP/':
self.send_error(400, "Bad request version (%r)" % version)
return False
try:
base_version_number = version.split('/', 1)[1]
version_number = base_version_number.split(".")
# RFC 2145 section 3.1 says there can be only one "." and
# - major and minor numbers MUST be treated as
# separate integers;
# - HTTP/2.4 is a lower version than HTTP/2.13, which in
# turn is lower than HTTP/12.3;
# - Leading zeros MUST be ignored by recipients.
if len(version_number) != 2:
raise ValueError
version_number = int(version_number[0]), int(version_number[1])
except (ValueError, IndexError):
self.send_error(400, "Bad request version (%r)" % version)
return False
if version_number >= (1, 1) and self.protocol_version >= "HTTP/1.1":
self.close_connection = 0
if version_number >= (2, 0):
self.send_error(505,
"Invalid HTTP Version (%s)" % base_version_number)
return False
elif len(words) == 2:
[command, path] = words
self.close_connection = 1
if command != 'GET':
self.send_error(400,
"Bad HTTP/0.9 request type (%r)" % command)
return False
elif not words:
return False
else:
self.send_error(400, "Bad request syntax (%r)" % requestline)
return False
self.command, self.path, self.request_version = command, path, version
# Examine the headers and look for a Connection directive
self.headers = self.MessageClass(self.rfile, 0)
conntype = self.headers.get('Connection', "")
if conntype.lower() == 'close':
self.close_connection = 1
elif (conntype.lower() == 'keep-alive' and
self.protocol_version >= "HTTP/1.1"):
self.close_connection = 0
return True
def handle_one_request(self):
"""Handle a single HTTP request.
You normally don't need to override this method; see the class
__doc__ string for information on how to handle specific HTTP
commands such as GET and POST.
"""
try:
self.raw_requestline = self.rfile.readline()
if not self.raw_requestline:
self.close_connection = 1
return
if not self.parse_request():
# An error code has been sent, just exit
return
mname = 'do_' + self.command
if not hasattr(self, mname):
self.send_error(501, "Unsupported method (%r)" % self.command)
return
method = getattr(self, mname)
method()
self.wfile.flush() #actually send the response if not already done.
except socket.timeout, e:
#a read or a write timed out. Discard this connection
self.log_error("Request timed out: %r", e)
self.close_connection = 1
return
def handle(self):
"""Handle multiple requests if necessary."""
self.close_connection = 1
self.handle_one_request()
while not self.close_connection:
self.handle_one_request()
def send_error(self, code, message=None):
"""Send and log an error reply.
Arguments are the error code, and a detailed message.
The detailed message defaults to the short entry matching the
response code.
This sends an error response (so it must be called before any
output has been generated), logs the error, and finally sends
a piece of HTML explaining the error to the user.
"""
try:
short, long = self.responses[code]
except KeyError:
short, long = '???', '???'
if message is None:
message = short
explain = long
self.log_error("code %d, message %s", code, message)
# using _quote_html to prevent Cross Site Scripting attacks (see bug #1100201)
content = (self.error_message_format %
{'code': code, 'message': _quote_html(message), 'explain': explain})
self.send_response(code, message)
self.send_header("Content-Type", self.error_content_type)
self.send_header('Connection', 'close')
self.end_headers()
if self.command != 'HEAD' and code >= 200 and code not in (204, 304):
self.wfile.write(content)
error_message_format = DEFAULT_ERROR_MESSAGE
error_content_type = DEFAULT_ERROR_CONTENT_TYPE
def send_response(self, code, message=None):
"""Send the response header and log the response code.
Also send two standard headers with the server software
version and the current date.
"""
self.log_request(code)
if message is None:
if code in self.responses:
message = self.responses[code][0]
else:
message = ''
if self.request_version != 'HTTP/0.9':
self.wfile.write("%s %d %s\r\n" %
(self.protocol_version, code, message))
# print (self.protocol_version, code, message)
self.send_header('Server', self.version_string())
self.send_header('Date', self.date_time_string())
def send_header(self, keyword, value):
"""Send a MIME header."""
if self.request_version != 'HTTP/0.9':
self.wfile.write("%s: %s\r\n" % (keyword, value))
if keyword.lower() == 'connection':
if value.lower() == 'close':
self.close_connection = 1
elif value.lower() == 'keep-alive':
self.close_connection = 0
def end_headers(self):
"""Send the blank line ending the MIME headers."""
if self.request_version != 'HTTP/0.9':
self.wfile.write("\r\n")
def log_request(self, code='-', size='-'):
"""Log an accepted request.
This is called by send_response().
"""
self.log_message('"%s" %s %s',
self.requestline, str(code), str(size))
def log_error(self, format, *args):
"""Log an error.
This is called when a request cannot be fulfilled. By
default it passes the message on to log_message().
Arguments are the same as for log_message().
XXX This should go to the separate error log.
"""
self.log_message(format, *args)
def log_message(self, format, *args):
"""Log an arbitrary message.
This is used by all other logging functions. Override
it if you have specific logging wishes.
The first argument, FORMAT, is a format string for the
message to be logged. If the format string contains
any % escapes requiring parameters, they should be
specified as subsequent arguments (it's just like
printf!).
The client host and current date/time are prefixed to
every message.
"""
sys.stderr.write("%s - - [%s] %s\n" %
(self.address_string(),
self.log_date_time_string(),
format%args))
def version_string(self):
"""Return the server software version string."""
return self.server_version + ' ' + self.sys_version
def date_time_string(self, timestamp=None):
"""Return the current date and time formatted for a message header."""
if timestamp is None:
timestamp = time.time()
year, month, day, hh, mm, ss, wd, y, z = time.gmtime(timestamp)
s = "%s, %02d %3s %4d %02d:%02d:%02d GMT" % (
self.weekdayname[wd],
day, self.monthname[month], year,
hh, mm, ss)
return s
def log_date_time_string(self):
"""Return the current time formatted for logging."""
now = time.time()
year, month, day, hh, mm, ss, x, y, z = time.localtime(now)
s = "%02d/%3s/%04d %02d:%02d:%02d" % (
day, self.monthname[month], year, hh, mm, ss)
return s
weekdayname = ['Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat', 'Sun']
monthname = [None,
'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun',
'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec']
def address_string(self):
"""Return the client address formatted for logging.
This version looks up the full hostname using gethostbyaddr(),
and tries to find a name that contains at least one dot.
"""
host, port = self.client_address[:2]
return socket.getfqdn(host)
# Essentially static class variables
# The version of the HTTP protocol we support.
# Set this to HTTP/1.1 to enable automatic keepalive
protocol_version = "HTTP/1.0"
# The Message-like class used to parse headers
MessageClass = mimetools.Message
# Table mapping response codes to messages; entries have the
# form {code: (shortmessage, longmessage)}.
# See RFC 2616.
responses = {
100: ('Continue', 'Request received, please continue'),
101: ('Switching Protocols',
'Switching to new protocol; obey Upgrade header'),
200: ('OK', 'Request fulfilled, document follows'),
201: ('Created', 'Document created, URL follows'),
202: ('Accepted',
'Request accepted, processing continues off-line'),
203: ('Non-Authoritative Information', 'Request fulfilled from cache'),
204: ('No Content', 'Request fulfilled, nothing follows'),
205: ('Reset Content', 'Clear input form for further input.'),
206: ('Partial Content', 'Partial content follows.'),
300: ('Multiple Choices',
'Object has several resources -- see URI list'),
301: ('Moved Permanently', 'Object moved permanently -- see URI list'),
302: ('Found', 'Object moved temporarily -- see URI list'),
303: ('See Other', 'Object moved -- see Method and URL list'),
304: ('Not Modified',
'Document has not changed since given time'),
305: ('Use Proxy',
'You must use proxy specified in Location to access this '
'resource.'),
307: ('Temporary Redirect',
'Object moved temporarily -- see URI list'),
400: ('Bad Request',
'Bad request syntax or unsupported method'),
401: ('Unauthorized',
'No permission -- see authorization schemes'),
402: ('Payment Required',
'No payment -- see charging schemes'),
403: ('Forbidden',
'Request forbidden -- authorization will not help'),
404: ('Not Found', 'Nothing matches the given URI'),
405: ('Method Not Allowed',
'Specified method is invalid for this resource.'),
406: ('Not Acceptable', 'URI not available in preferred format.'),
407: ('Proxy Authentication Required', 'You must authenticate with '
'this proxy before proceeding.'),
408: ('Request Timeout', 'Request timed out; try again later.'),
409: ('Conflict', 'Request conflict.'),
410: ('Gone',
'URI no longer exists and has been permanently removed.'),
411: ('Length Required', 'Client must specify Content-Length.'),
412: ('Precondition Failed', 'Precondition in headers is false.'),
413: ('Request Entity Too Large', 'Entity is too large.'),
414: ('Request-URI Too Long', 'URI is too long.'),
415: ('Unsupported Media Type', 'Entity body in unsupported format.'),
416: ('Requested Range Not Satisfiable',
'Cannot satisfy request range.'),
417: ('Expectation Failed',
'Expect condition could not be satisfied.'),
500: ('Internal Server Error', 'Server got itself in trouble'),
501: ('Not Implemented',
'Server does not support this operation'),
502: ('Bad Gateway', 'Invalid responses from another server/proxy.'),
503: ('Service Unavailable',
'The server cannot process the request due to a high load'),
504: ('Gateway Timeout',
'The gateway server did not receive a timely response'),
505: ('HTTP Version Not Supported', 'Cannot fulfill request.'),
}
def test(HandlerClass = BaseHTTPRequestHandler,
ServerClass = HTTPServer, protocol="HTTP/1.0"):
"""Test the HTTP request handler class.
This runs an HTTP server on port 8000 (or the first command line
argument).
"""
if sys.argv[1:]:
port = int(sys.argv[1])
else:
port = 8000
server_address = ('', port)
HandlerClass.protocol_version = protocol
httpd = ServerClass(server_address, HandlerClass)
sa = httpd.socket.getsockname()
print "Serving HTTP on", sa[0], "port", sa[1], "..."
httpd.serve_forever()
if __name__ == '__main__':
test()
| Python |
"""A generally useful event scheduler class.
Each instance of this class manages its own queue.
No multi-threading is implied; you are supposed to hack that
yourself, or use a single instance per application.
Each instance is parametrized with two functions, one that is
supposed to return the current time, one that is supposed to
implement a delay. You can implement real-time scheduling by
substituting time and sleep from built-in module time, or you can
implement simulated time by writing your own functions. This can
also be used to integrate scheduling with STDWIN events; the delay
function is allowed to modify the queue. Time can be expressed as
integers or floating point numbers, as long as it is consistent.
Events are specified by tuples (time, priority, action, argument).
As in UNIX, lower priority numbers mean higher priority; in this
way the queue can be maintained as a priority queue. Execution of the
event means calling the action function, passing it the argument
sequence in "argument" (remember that in Python, multiple function
arguments are be packed in a sequence).
The action function may be an instance method so it
has another way to reference private data (besides global variables).
"""
# XXX The timefunc and delayfunc should have been defined as methods
# XXX so you can define new kinds of schedulers using subclassing
# XXX instead of having to define a module or class just to hold
# XXX the global state of your particular time and delay functions.
import heapq
from collections import namedtuple
__all__ = ["scheduler"]
Event = namedtuple('Event', 'time, priority, action, argument')
class scheduler:
def __init__(self, timefunc, delayfunc):
"""Initialize a new instance, passing the time and delay
functions"""
self._queue = []
self.timefunc = timefunc
self.delayfunc = delayfunc
def enterabs(self, time, priority, action, argument):
"""Enter a new event in the queue at an absolute time.
Returns an ID for the event which can be used to remove it,
if necessary.
"""
event = Event(time, priority, action, argument)
heapq.heappush(self._queue, event)
return event # The ID
def enter(self, delay, priority, action, argument):
"""A variant that specifies the time as a relative time.
This is actually the more commonly used interface.
"""
time = self.timefunc() + delay
return self.enterabs(time, priority, action, argument)
def cancel(self, event):
"""Remove an event from the queue.
This must be presented the ID as returned by enter().
If the event is not in the queue, this raises ValueError.
"""
self._queue.remove(event)
heapq.heapify(self._queue)
def empty(self):
"""Check whether the queue is empty."""
return not self._queue
def run(self):
"""Execute events until the queue is empty.
When there is a positive delay until the first event, the
delay function is called and the event is left in the queue;
otherwise, the event is removed from the queue and executed
(its action function is called, passing it the argument). If
the delay function returns prematurely, it is simply
restarted.
It is legal for both the delay function and the action
function to to modify the queue or to raise an exception;
exceptions are not caught but the scheduler's state remains
well-defined so run() may be called again.
A questionable hack is added to allow other threads to run:
just after an event is executed, a delay of 0 is executed, to
avoid monopolizing the CPU when other threads are also
runnable.
"""
# localize variable access to minimize overhead
# and to improve thread safety
q = self._queue
delayfunc = self.delayfunc
timefunc = self.timefunc
pop = heapq.heappop
while q:
time, priority, action, argument = checked_event = q[0]
now = timefunc()
if now < time:
delayfunc(time - now)
else:
event = pop(q)
# Verify that the event was not removed or altered
# by another thread after we last looked at q[0].
if event is checked_event:
action(*argument)
delayfunc(0) # Let other threads run
else:
heapq.heappush(q, event)
@property
def queue(self):
"""An ordered list of upcoming events.
Events are named tuples with fields for:
time, priority, action, arguments
"""
# Use heapq to sort the queue rather than using 'sorted(self._queue)'.
# With heapq, two events scheduled at the same time will show in
# the actual order they would be retrieved.
events = self._queue[:]
return map(heapq.heappop, [events]*len(events))
| Python |
"""
Import utilities
Exported classes:
ImportManager Manage the import process
Importer Base class for replacing standard import functions
BuiltinImporter Emulate the import mechanism for builtin and frozen modules
DynLoadSuffixImporter
"""
from warnings import warnpy3k
warnpy3k("the imputil module has been removed in Python 3.0", stacklevel=2)
del warnpy3k
# note: avoid importing non-builtin modules
import imp ### not available in Jython?
import sys
import __builtin__
# for the DirectoryImporter
import struct
import marshal
__all__ = ["ImportManager","Importer","BuiltinImporter"]
_StringType = type('')
_ModuleType = type(sys) ### doesn't work in Jython...
class ImportManager:
"Manage the import process."
def install(self, namespace=vars(__builtin__)):
"Install this ImportManager into the specified namespace."
if isinstance(namespace, _ModuleType):
namespace = vars(namespace)
# Note: we have no notion of "chaining"
# Record the previous import hook, then install our own.
self.previous_importer = namespace['__import__']
self.namespace = namespace
namespace['__import__'] = self._import_hook
### fix this
#namespace['reload'] = self._reload_hook
def uninstall(self):
"Restore the previous import mechanism."
self.namespace['__import__'] = self.previous_importer
def add_suffix(self, suffix, importFunc):
assert hasattr(importFunc, '__call__')
self.fs_imp.add_suffix(suffix, importFunc)
######################################################################
#
# PRIVATE METHODS
#
clsFilesystemImporter = None
def __init__(self, fs_imp=None):
# we're definitely going to be importing something in the future,
# so let's just load the OS-related facilities.
if not _os_stat:
_os_bootstrap()
# This is the Importer that we use for grabbing stuff from the
# filesystem. It defines one more method (import_from_dir) for our use.
if fs_imp is None:
cls = self.clsFilesystemImporter or _FilesystemImporter
fs_imp = cls()
self.fs_imp = fs_imp
# Initialize the set of suffixes that we recognize and import.
# The default will import dynamic-load modules first, followed by
# .py files (or a .py file's cached bytecode)
for desc in imp.get_suffixes():
if desc[2] == imp.C_EXTENSION:
self.add_suffix(desc[0],
DynLoadSuffixImporter(desc).import_file)
self.add_suffix('.py', py_suffix_importer)
def _import_hook(self, fqname, globals=None, locals=None, fromlist=None):
"""Python calls this hook to locate and import a module."""
parts = fqname.split('.')
# determine the context of this import
parent = self._determine_import_context(globals)
# if there is a parent, then its importer should manage this import
if parent:
module = parent.__importer__._do_import(parent, parts, fromlist)
if module:
return module
# has the top module already been imported?
try:
top_module = sys.modules[parts[0]]
except KeyError:
# look for the topmost module
top_module = self._import_top_module(parts[0])
if not top_module:
# the topmost module wasn't found at all.
raise ImportError, 'No module named ' + fqname
# fast-path simple imports
if len(parts) == 1:
if not fromlist:
return top_module
if not top_module.__dict__.get('__ispkg__'):
# __ispkg__ isn't defined (the module was not imported by us),
# or it is zero.
#
# In the former case, there is no way that we could import
# sub-modules that occur in the fromlist (but we can't raise an
# error because it may just be names) because we don't know how
# to deal with packages that were imported by other systems.
#
# In the latter case (__ispkg__ == 0), there can't be any sub-
# modules present, so we can just return.
#
# In both cases, since len(parts) == 1, the top_module is also
# the "bottom" which is the defined return when a fromlist
# exists.
return top_module
importer = top_module.__dict__.get('__importer__')
if importer:
return importer._finish_import(top_module, parts[1:], fromlist)
# Grrr, some people "import os.path" or do "from os.path import ..."
if len(parts) == 2 and hasattr(top_module, parts[1]):
if fromlist:
return getattr(top_module, parts[1])
else:
return top_module
# If the importer does not exist, then we have to bail. A missing
# importer means that something else imported the module, and we have
# no knowledge of how to get sub-modules out of the thing.
raise ImportError, 'No module named ' + fqname
def _determine_import_context(self, globals):
"""Returns the context in which a module should be imported.
The context could be a loaded (package) module and the imported module
will be looked for within that package. The context could also be None,
meaning there is no context -- the module should be looked for as a
"top-level" module.
"""
if not globals or not globals.get('__importer__'):
# globals does not refer to one of our modules or packages. That
# implies there is no relative import context (as far as we are
# concerned), and it should just pick it off the standard path.
return None
# The globals refer to a module or package of ours. It will define
# the context of the new import. Get the module/package fqname.
parent_fqname = globals['__name__']
# if a package is performing the import, then return itself (imports
# refer to pkg contents)
if globals['__ispkg__']:
parent = sys.modules[parent_fqname]
assert globals is parent.__dict__
return parent
i = parent_fqname.rfind('.')
# a module outside of a package has no particular import context
if i == -1:
return None
# if a module in a package is performing the import, then return the
# package (imports refer to siblings)
parent_fqname = parent_fqname[:i]
parent = sys.modules[parent_fqname]
assert parent.__name__ == parent_fqname
return parent
def _import_top_module(self, name):
# scan sys.path looking for a location in the filesystem that contains
# the module, or an Importer object that can import the module.
for item in sys.path:
if isinstance(item, _StringType):
module = self.fs_imp.import_from_dir(item, name)
else:
module = item.import_top(name)
if module:
return module
return None
def _reload_hook(self, module):
"Python calls this hook to reload a module."
# reloading of a module may or may not be possible (depending on the
# importer), but at least we can validate that it's ours to reload
importer = module.__dict__.get('__importer__')
if not importer:
### oops. now what...
pass
# okay. it is using the imputil system, and we must delegate it, but
# we don't know what to do (yet)
### we should blast the module dict and do another get_code(). need to
### flesh this out and add proper docco...
raise SystemError, "reload not yet implemented"
class Importer:
"Base class for replacing standard import functions."
def import_top(self, name):
"Import a top-level module."
return self._import_one(None, name, name)
######################################################################
#
# PRIVATE METHODS
#
def _finish_import(self, top, parts, fromlist):
# if "a.b.c" was provided, then load the ".b.c" portion down from
# below the top-level module.
bottom = self._load_tail(top, parts)
# if the form is "import a.b.c", then return "a"
if not fromlist:
# no fromlist: return the top of the import tree
return top
# the top module was imported by self.
#
# this means that the bottom module was also imported by self (just
# now, or in the past and we fetched it from sys.modules).
#
# since we imported/handled the bottom module, this means that we can
# also handle its fromlist (and reliably use __ispkg__).
# if the bottom node is a package, then (potentially) import some
# modules.
#
# note: if it is not a package, then "fromlist" refers to names in
# the bottom module rather than modules.
# note: for a mix of names and modules in the fromlist, we will
# import all modules and insert those into the namespace of
# the package module. Python will pick up all fromlist names
# from the bottom (package) module; some will be modules that
# we imported and stored in the namespace, others are expected
# to be present already.
if bottom.__ispkg__:
self._import_fromlist(bottom, fromlist)
# if the form is "from a.b import c, d" then return "b"
return bottom
def _import_one(self, parent, modname, fqname):
"Import a single module."
# has the module already been imported?
try:
return sys.modules[fqname]
except KeyError:
pass
# load the module's code, or fetch the module itself
result = self.get_code(parent, modname, fqname)
if result is None:
return None
module = self._process_result(result, fqname)
# insert the module into its parent
if parent:
setattr(parent, modname, module)
return module
def _process_result(self, result, fqname):
ispkg, code, values = result
# did get_code() return an actual module? (rather than a code object)
is_module = isinstance(code, _ModuleType)
# use the returned module, or create a new one to exec code into
if is_module:
module = code
else:
module = imp.new_module(fqname)
### record packages a bit differently??
module.__importer__ = self
module.__ispkg__ = ispkg
# insert additional values into the module (before executing the code)
module.__dict__.update(values)
# the module is almost ready... make it visible
sys.modules[fqname] = module
# execute the code within the module's namespace
if not is_module:
try:
exec code in module.__dict__
except:
if fqname in sys.modules:
del sys.modules[fqname]
raise
# fetch from sys.modules instead of returning module directly.
# also make module's __name__ agree with fqname, in case
# the "exec code in module.__dict__" played games on us.
module = sys.modules[fqname]
module.__name__ = fqname
return module
def _load_tail(self, m, parts):
"""Import the rest of the modules, down from the top-level module.
Returns the last module in the dotted list of modules.
"""
for part in parts:
fqname = "%s.%s" % (m.__name__, part)
m = self._import_one(m, part, fqname)
if not m:
raise ImportError, "No module named " + fqname
return m
def _import_fromlist(self, package, fromlist):
'Import any sub-modules in the "from" list.'
# if '*' is present in the fromlist, then look for the '__all__'
# variable to find additional items (modules) to import.
if '*' in fromlist:
fromlist = list(fromlist) + \
list(package.__dict__.get('__all__', []))
for sub in fromlist:
# if the name is already present, then don't try to import it (it
# might not be a module!).
if sub != '*' and not hasattr(package, sub):
subname = "%s.%s" % (package.__name__, sub)
submod = self._import_one(package, sub, subname)
if not submod:
raise ImportError, "cannot import name " + subname
def _do_import(self, parent, parts, fromlist):
"""Attempt to import the module relative to parent.
This method is used when the import context specifies that <self>
imported the parent module.
"""
top_name = parts[0]
top_fqname = parent.__name__ + '.' + top_name
top_module = self._import_one(parent, top_name, top_fqname)
if not top_module:
# this importer and parent could not find the module (relatively)
return None
return self._finish_import(top_module, parts[1:], fromlist)
######################################################################
#
# METHODS TO OVERRIDE
#
def get_code(self, parent, modname, fqname):
"""Find and retrieve the code for the given module.
parent specifies a parent module to define a context for importing. It
may be None, indicating no particular context for the search.
modname specifies a single module (not dotted) within the parent.
fqname specifies the fully-qualified module name. This is a
(potentially) dotted name from the "root" of the module namespace
down to the modname.
If there is no parent, then modname==fqname.
This method should return None, or a 3-tuple.
* If the module was not found, then None should be returned.
* The first item of the 2- or 3-tuple should be the integer 0 or 1,
specifying whether the module that was found is a package or not.
* The second item is the code object for the module (it will be
executed within the new module's namespace). This item can also
be a fully-loaded module object (e.g. loaded from a shared lib).
* The third item is a dictionary of name/value pairs that will be
inserted into new module before the code object is executed. This
is provided in case the module's code expects certain values (such
as where the module was found). When the second item is a module
object, then these names/values will be inserted *after* the module
has been loaded/initialized.
"""
raise RuntimeError, "get_code not implemented"
######################################################################
#
# Some handy stuff for the Importers
#
# byte-compiled file suffix character
_suffix_char = __debug__ and 'c' or 'o'
# byte-compiled file suffix
_suffix = '.py' + _suffix_char
def _compile(pathname, timestamp):
"""Compile (and cache) a Python source file.
The file specified by <pathname> is compiled to a code object and
returned.
Presuming the appropriate privileges exist, the bytecodes will be
saved back to the filesystem for future imports. The source file's
modification timestamp must be provided as a Long value.
"""
codestring = open(pathname, 'rU').read()
if codestring and codestring[-1] != '\n':
codestring = codestring + '\n'
code = __builtin__.compile(codestring, pathname, 'exec')
# try to cache the compiled code
try:
f = open(pathname + _suffix_char, 'wb')
except IOError:
pass
else:
f.write('\0\0\0\0')
f.write(struct.pack('<I', timestamp))
marshal.dump(code, f)
f.flush()
f.seek(0, 0)
f.write(imp.get_magic())
f.close()
return code
_os_stat = _os_path_join = None
def _os_bootstrap():
"Set up 'os' module replacement functions for use during import bootstrap."
names = sys.builtin_module_names
join = None
if 'posix' in names:
sep = '/'
from posix import stat
elif 'nt' in names:
sep = '\\'
from nt import stat
elif 'dos' in names:
sep = '\\'
from dos import stat
elif 'os2' in names:
sep = '\\'
from os2 import stat
else:
raise ImportError, 'no os specific module found'
if join is None:
def join(a, b, sep=sep):
if a == '':
return b
lastchar = a[-1:]
if lastchar == '/' or lastchar == sep:
return a + b
return a + sep + b
global _os_stat
_os_stat = stat
global _os_path_join
_os_path_join = join
def _os_path_isdir(pathname):
"Local replacement for os.path.isdir()."
try:
s = _os_stat(pathname)
except OSError:
return None
return (s.st_mode & 0170000) == 0040000
def _timestamp(pathname):
"Return the file modification time as a Long."
try:
s = _os_stat(pathname)
except OSError:
return None
return long(s.st_mtime)
######################################################################
#
# Emulate the import mechanism for builtin and frozen modules
#
class BuiltinImporter(Importer):
def get_code(self, parent, modname, fqname):
if parent:
# these modules definitely do not occur within a package context
return None
# look for the module
if imp.is_builtin(modname):
type = imp.C_BUILTIN
elif imp.is_frozen(modname):
type = imp.PY_FROZEN
else:
# not found
return None
# got it. now load and return it.
module = imp.load_module(modname, None, modname, ('', '', type))
return 0, module, { }
######################################################################
#
# Internal importer used for importing from the filesystem
#
class _FilesystemImporter(Importer):
def __init__(self):
self.suffixes = [ ]
def add_suffix(self, suffix, importFunc):
assert hasattr(importFunc, '__call__')
self.suffixes.append((suffix, importFunc))
def import_from_dir(self, dir, fqname):
result = self._import_pathname(_os_path_join(dir, fqname), fqname)
if result:
return self._process_result(result, fqname)
return None
def get_code(self, parent, modname, fqname):
# This importer is never used with an empty parent. Its existence is
# private to the ImportManager. The ImportManager uses the
# import_from_dir() method to import top-level modules/packages.
# This method is only used when we look for a module within a package.
assert parent
for submodule_path in parent.__path__:
code = self._import_pathname(_os_path_join(submodule_path, modname), fqname)
if code is not None:
return code
return self._import_pathname(_os_path_join(parent.__pkgdir__, modname),
fqname)
def _import_pathname(self, pathname, fqname):
if _os_path_isdir(pathname):
result = self._import_pathname(_os_path_join(pathname, '__init__'),
fqname)
if result:
values = result[2]
values['__pkgdir__'] = pathname
values['__path__'] = [ pathname ]
return 1, result[1], values
return None
for suffix, importFunc in self.suffixes:
filename = pathname + suffix
try:
finfo = _os_stat(filename)
except OSError:
pass
else:
return importFunc(filename, finfo, fqname)
return None
######################################################################
#
# SUFFIX-BASED IMPORTERS
#
def py_suffix_importer(filename, finfo, fqname):
file = filename[:-3] + _suffix
t_py = long(finfo[8])
t_pyc = _timestamp(file)
code = None
if t_pyc is not None and t_pyc >= t_py:
f = open(file, 'rb')
if f.read(4) == imp.get_magic():
t = struct.unpack('<I', f.read(4))[0]
if t == t_py:
code = marshal.load(f)
f.close()
if code is None:
file = filename
code = _compile(file, t_py)
return 0, code, { '__file__' : file }
class DynLoadSuffixImporter:
def __init__(self, desc):
self.desc = desc
def import_file(self, filename, finfo, fqname):
fp = open(filename, self.desc[1])
module = imp.load_module(fqname, fp, filename, self.desc)
module.__file__ = filename
return 0, module, { }
######################################################################
def _print_importers():
items = sys.modules.items()
items.sort()
for name, module in items:
if module:
print name, module.__dict__.get('__importer__', '-- no importer')
else:
print name, '-- non-existent module'
def _test_revamp():
ImportManager().install()
sys.path.insert(0, BuiltinImporter())
######################################################################
#
# TODO
#
# from Finn Bock:
# type(sys) is not a module in Jython. what to use instead?
# imp.C_EXTENSION is not in Jython. same for get_suffixes and new_module
#
# given foo.py of:
# import sys
# sys.modules['foo'] = sys
#
# ---- standard import mechanism
# >>> import foo
# >>> foo
# <module 'sys' (built-in)>
#
# ---- revamped import mechanism
# >>> import imputil
# >>> imputil._test_revamp()
# >>> import foo
# >>> foo
# <module 'foo' from 'foo.py'>
#
#
# from MAL:
# should BuiltinImporter exist in sys.path or hard-wired in ImportManager?
# need __path__ processing
# performance
# move chaining to a subclass [gjs: it's been nuked]
# deinstall should be possible
# query mechanism needed: is a specific Importer installed?
# py/pyc/pyo piping hooks to filter/process these files
# wish list:
# distutils importer hooked to list of standard Internet repositories
# module->file location mapper to speed FS-based imports
# relative imports
# keep chaining so that it can play nice with other import hooks
#
# from Gordon:
# push MAL's mapper into sys.path[0] as a cache (hard-coded for apps)
#
# from Guido:
# need to change sys.* references for rexec environs
# need hook for MAL's walk-me-up import strategy, or Tim's absolute strategy
# watch out for sys.modules[...] is None
# flag to force absolute imports? (speeds _determine_import_context and
# checking for a relative module)
# insert names of archives into sys.path (see quote below)
# note: reload does NOT blast module dict
# shift import mechanisms and policies around; provide for hooks, overrides
# (see quote below)
# add get_source stuff
# get_topcode and get_subcode
# CRLF handling in _compile
# race condition in _compile
# refactoring of os.py to deal with _os_bootstrap problem
# any special handling to do for importing a module with a SyntaxError?
# (e.g. clean up the traceback)
# implement "domain" for path-type functionality using pkg namespace
# (rather than FS-names like __path__)
# don't use the word "private"... maybe "internal"
#
#
# Guido's comments on sys.path caching:
#
# We could cache this in a dictionary: the ImportManager can have a
# cache dict mapping pathnames to importer objects, and a separate
# method for coming up with an importer given a pathname that's not yet
# in the cache. The method should do a stat and/or look at the
# extension to decide which importer class to use; you can register new
# importer classes by registering a suffix or a Boolean function, plus a
# class. If you register a new importer class, the cache is zapped.
# The cache is independent from sys.path (but maintained per
# ImportManager instance) so that rearrangements of sys.path do the
# right thing. If a path is dropped from sys.path the corresponding
# cache entry is simply no longer used.
#
# My/Guido's comments on factoring ImportManager and Importer:
#
# > However, we still have a tension occurring here:
# >
# > 1) implementing policy in ImportManager assists in single-point policy
# > changes for app/rexec situations
# > 2) implementing policy in Importer assists in package-private policy
# > changes for normal, operating conditions
# >
# > I'll see if I can sort out a way to do this. Maybe the Importer class will
# > implement the methods (which can be overridden to change policy) by
# > delegating to ImportManager.
#
# Maybe also think about what kind of policies an Importer would be
# likely to want to change. I have a feeling that a lot of the code
# there is actually not so much policy but a *necessity* to get things
# working given the calling conventions for the __import__ hook: whether
# to return the head or tail of a dotted name, or when to do the "finish
# fromlist" stuff.
#
| Python |
"""Tokenization help for Python programs.
generate_tokens(readline) is a generator that breaks a stream of
text into Python tokens. It accepts a readline-like method which is called
repeatedly to get the next line of input (or "" for EOF). It generates
5-tuples with these members:
the token type (see token.py)
the token (a string)
the starting (row, column) indices of the token (a 2-tuple of ints)
the ending (row, column) indices of the token (a 2-tuple of ints)
the original line (string)
It is designed to match the working of the Python tokenizer exactly, except
that it produces COMMENT tokens for comments and gives type OP for all
operators
Older entry points
tokenize_loop(readline, tokeneater)
tokenize(readline, tokeneater=printtoken)
are the same, except instead of generating tokens, tokeneater is a callback
function to which the 5 fields described above are passed as 5 arguments,
each time a new token is found."""
__author__ = 'Ka-Ping Yee <ping@lfw.org>'
__credits__ = ('GvR, ESR, Tim Peters, Thomas Wouters, Fred Drake, '
'Skip Montanaro, Raymond Hettinger')
import string, re
from token import *
import token
__all__ = [x for x in dir(token) if not x.startswith("_")]
__all__ += ["COMMENT", "tokenize", "generate_tokens", "NL", "untokenize"]
del x
del token
COMMENT = N_TOKENS
tok_name[COMMENT] = 'COMMENT'
NL = N_TOKENS + 1
tok_name[NL] = 'NL'
N_TOKENS += 2
def group(*choices): return '(' + '|'.join(choices) + ')'
def any(*choices): return group(*choices) + '*'
def maybe(*choices): return group(*choices) + '?'
Whitespace = r'[ \f\t]*'
Comment = r'#[^\r\n]*'
Ignore = Whitespace + any(r'\\\r?\n' + Whitespace) + maybe(Comment)
Name = r'[a-zA-Z_]\w*'
Hexnumber = r'0[xX][\da-fA-F]+[lL]?'
Octnumber = r'(0[oO][0-7]+)|(0[0-7]*)[lL]?'
Binnumber = r'0[bB][01]+[lL]?'
Decnumber = r'[1-9]\d*[lL]?'
Intnumber = group(Hexnumber, Binnumber, Octnumber, Decnumber)
Exponent = r'[eE][-+]?\d+'
Pointfloat = group(r'\d+\.\d*', r'\.\d+') + maybe(Exponent)
Expfloat = r'\d+' + Exponent
Floatnumber = group(Pointfloat, Expfloat)
Imagnumber = group(r'\d+[jJ]', Floatnumber + r'[jJ]')
Number = group(Imagnumber, Floatnumber, Intnumber)
# Tail end of ' string.
Single = r"[^'\\]*(?:\\.[^'\\]*)*'"
# Tail end of " string.
Double = r'[^"\\]*(?:\\.[^"\\]*)*"'
# Tail end of ''' string.
Single3 = r"[^'\\]*(?:(?:\\.|'(?!''))[^'\\]*)*'''"
# Tail end of """ string.
Double3 = r'[^"\\]*(?:(?:\\.|"(?!""))[^"\\]*)*"""'
Triple = group("[uU]?[rR]?'''", '[uU]?[rR]?"""')
# Single-line ' or " string.
String = group(r"[uU]?[rR]?'[^\n'\\]*(?:\\.[^\n'\\]*)*'",
r'[uU]?[rR]?"[^\n"\\]*(?:\\.[^\n"\\]*)*"')
# Because of leftmost-then-longest match semantics, be sure to put the
# longest operators first (e.g., if = came before ==, == would get
# recognized as two instances of =).
Operator = group(r"\*\*=?", r">>=?", r"<<=?", r"<>", r"!=",
r"//=?",
r"[+\-*/%&|^=<>]=?",
r"~")
Bracket = '[][(){}]'
Special = group(r'\r?\n', r'[:;.,`@]')
Funny = group(Operator, Bracket, Special)
PlainToken = group(Number, Funny, String, Name)
Token = Ignore + PlainToken
# First (or only) line of ' or " string.
ContStr = group(r"[uU]?[rR]?'[^\n'\\]*(?:\\.[^\n'\\]*)*" +
group("'", r'\\\r?\n'),
r'[uU]?[rR]?"[^\n"\\]*(?:\\.[^\n"\\]*)*' +
group('"', r'\\\r?\n'))
PseudoExtras = group(r'\\\r?\n', Comment, Triple)
PseudoToken = Whitespace + group(PseudoExtras, Number, Funny, ContStr, Name)
tokenprog, pseudoprog, single3prog, double3prog = map(
re.compile, (Token, PseudoToken, Single3, Double3))
endprogs = {"'": re.compile(Single), '"': re.compile(Double),
"'''": single3prog, '"""': double3prog,
"r'''": single3prog, 'r"""': double3prog,
"u'''": single3prog, 'u"""': double3prog,
"ur'''": single3prog, 'ur"""': double3prog,
"R'''": single3prog, 'R"""': double3prog,
"U'''": single3prog, 'U"""': double3prog,
"uR'''": single3prog, 'uR"""': double3prog,
"Ur'''": single3prog, 'Ur"""': double3prog,
"UR'''": single3prog, 'UR"""': double3prog,
"b'''": single3prog, 'b"""': double3prog,
"br'''": single3prog, 'br"""': double3prog,
"B'''": single3prog, 'B"""': double3prog,
"bR'''": single3prog, 'bR"""': double3prog,
"Br'''": single3prog, 'Br"""': double3prog,
"BR'''": single3prog, 'BR"""': double3prog,
'r': None, 'R': None, 'u': None, 'U': None,
'b': None, 'B': None}
triple_quoted = {}
for t in ("'''", '"""',
"r'''", 'r"""', "R'''", 'R"""',
"u'''", 'u"""', "U'''", 'U"""',
"ur'''", 'ur"""', "Ur'''", 'Ur"""',
"uR'''", 'uR"""', "UR'''", 'UR"""',
"b'''", 'b"""', "B'''", 'B"""',
"br'''", 'br"""', "Br'''", 'Br"""',
"bR'''", 'bR"""', "BR'''", 'BR"""'):
triple_quoted[t] = t
single_quoted = {}
for t in ("'", '"',
"r'", 'r"', "R'", 'R"',
"u'", 'u"', "U'", 'U"',
"ur'", 'ur"', "Ur'", 'Ur"',
"uR'", 'uR"', "UR'", 'UR"',
"b'", 'b"', "B'", 'B"',
"br'", 'br"', "Br'", 'Br"',
"bR'", 'bR"', "BR'", 'BR"' ):
single_quoted[t] = t
tabsize = 8
class TokenError(Exception): pass
class StopTokenizing(Exception): pass
def printtoken(type, token, srow_scol, erow_ecol, line): # for testing
srow, scol = srow_scol
erow, ecol = erow_ecol
print "%d,%d-%d,%d:\t%s\t%s" % \
(srow, scol, erow, ecol, tok_name[type], repr(token))
def tokenize(readline, tokeneater=printtoken):
"""
The tokenize() function accepts two parameters: one representing the
input stream, and one providing an output mechanism for tokenize().
The first parameter, readline, must be a callable object which provides
the same interface as the readline() method of built-in file objects.
Each call to the function should return one line of input as a string.
The second parameter, tokeneater, must also be a callable object. It is
called once for each token, with five arguments, corresponding to the
tuples generated by generate_tokens().
"""
try:
tokenize_loop(readline, tokeneater)
except StopTokenizing:
pass
# backwards compatible interface
def tokenize_loop(readline, tokeneater):
for token_info in generate_tokens(readline):
tokeneater(*token_info)
class Untokenizer:
def __init__(self):
self.tokens = []
self.prev_row = 1
self.prev_col = 0
def add_whitespace(self, start):
row, col = start
assert row <= self.prev_row
col_offset = col - self.prev_col
if col_offset:
self.tokens.append(" " * col_offset)
def untokenize(self, iterable):
for t in iterable:
if len(t) == 2:
self.compat(t, iterable)
break
tok_type, token, start, end, line = t
self.add_whitespace(start)
self.tokens.append(token)
self.prev_row, self.prev_col = end
if tok_type in (NEWLINE, NL):
self.prev_row += 1
self.prev_col = 0
return "".join(self.tokens)
def compat(self, token, iterable):
startline = False
indents = []
toks_append = self.tokens.append
toknum, tokval = token
if toknum in (NAME, NUMBER):
tokval += ' '
if toknum in (NEWLINE, NL):
startline = True
prevstring = False
for tok in iterable:
toknum, tokval = tok[:2]
if toknum in (NAME, NUMBER):
tokval += ' '
# Insert a space between two consecutive strings
if toknum == STRING:
if prevstring:
tokval = ' ' + tokval
prevstring = True
else:
prevstring = False
if toknum == INDENT:
indents.append(tokval)
continue
elif toknum == DEDENT:
indents.pop()
continue
elif toknum in (NEWLINE, NL):
startline = True
elif startline and indents:
toks_append(indents[-1])
startline = False
toks_append(tokval)
def untokenize(iterable):
"""Transform tokens back into Python source code.
Each element returned by the iterable must be a token sequence
with at least two elements, a token number and token value. If
only two tokens are passed, the resulting output is poor.
Round-trip invariant for full input:
Untokenized source will match input source exactly
Round-trip invariant for limited intput:
# Output text will tokenize the back to the input
t1 = [tok[:2] for tok in generate_tokens(f.readline)]
newcode = untokenize(t1)
readline = iter(newcode.splitlines(1)).next
t2 = [tok[:2] for tok in generate_tokens(readline)]
assert t1 == t2
"""
ut = Untokenizer()
return ut.untokenize(iterable)
def generate_tokens(readline):
"""
The generate_tokens() generator requires one argment, readline, which
must be a callable object which provides the same interface as the
readline() method of built-in file objects. Each call to the function
should return one line of input as a string. Alternately, readline
can be a callable function terminating with StopIteration:
readline = open(myfile).next # Example of alternate readline
The generator produces 5-tuples with these members: the token type; the
token string; a 2-tuple (srow, scol) of ints specifying the row and
column where the token begins in the source; a 2-tuple (erow, ecol) of
ints specifying the row and column where the token ends in the source;
and the line on which the token was found. The line passed is the
logical line; continuation lines are included.
"""
lnum = parenlev = continued = 0
namechars, numchars = string.ascii_letters + '_', '0123456789'
contstr, needcont = '', 0
contline = None
indents = [0]
while 1: # loop over lines in stream
try:
line = readline()
except StopIteration:
line = ''
lnum += 1
pos, max = 0, len(line)
if contstr: # continued string
if not line:
raise TokenError, ("EOF in multi-line string", strstart)
endmatch = endprog.match(line)
if endmatch:
pos = end = endmatch.end(0)
yield (STRING, contstr + line[:end],
strstart, (lnum, end), contline + line)
contstr, needcont = '', 0
contline = None
elif needcont and line[-2:] != '\\\n' and line[-3:] != '\\\r\n':
yield (ERRORTOKEN, contstr + line,
strstart, (lnum, len(line)), contline)
contstr = ''
contline = None
continue
else:
contstr = contstr + line
contline = contline + line
continue
elif parenlev == 0 and not continued: # new statement
if not line: break
column = 0
while pos < max: # measure leading whitespace
if line[pos] == ' ':
column += 1
elif line[pos] == '\t':
column = (column//tabsize + 1)*tabsize
elif line[pos] == '\f':
column = 0
else:
break
pos += 1
if pos == max:
break
if line[pos] in '#\r\n': # skip comments or blank lines
if line[pos] == '#':
comment_token = line[pos:].rstrip('\r\n')
nl_pos = pos + len(comment_token)
yield (COMMENT, comment_token,
(lnum, pos), (lnum, pos + len(comment_token)), line)
yield (NL, line[nl_pos:],
(lnum, nl_pos), (lnum, len(line)), line)
else:
yield ((NL, COMMENT)[line[pos] == '#'], line[pos:],
(lnum, pos), (lnum, len(line)), line)
continue
if column > indents[-1]: # count indents or dedents
indents.append(column)
yield (INDENT, line[:pos], (lnum, 0), (lnum, pos), line)
while column < indents[-1]:
if column not in indents:
raise IndentationError(
"unindent does not match any outer indentation level",
("<tokenize>", lnum, pos, line))
indents = indents[:-1]
yield (DEDENT, '', (lnum, pos), (lnum, pos), line)
else: # continued statement
if not line:
raise TokenError, ("EOF in multi-line statement", (lnum, 0))
continued = 0
while pos < max:
pseudomatch = pseudoprog.match(line, pos)
if pseudomatch: # scan for tokens
start, end = pseudomatch.span(1)
spos, epos, pos = (lnum, start), (lnum, end), end
token, initial = line[start:end], line[start]
if initial in numchars or \
(initial == '.' and token != '.'): # ordinary number
yield (NUMBER, token, spos, epos, line)
elif initial in '\r\n':
yield (NL if parenlev > 0 else NEWLINE,
token, spos, epos, line)
elif initial == '#':
assert not token.endswith("\n")
yield (COMMENT, token, spos, epos, line)
elif token in triple_quoted:
endprog = endprogs[token]
endmatch = endprog.match(line, pos)
if endmatch: # all on one line
pos = endmatch.end(0)
token = line[start:pos]
yield (STRING, token, spos, (lnum, pos), line)
else:
strstart = (lnum, start) # multiple lines
contstr = line[start:]
contline = line
break
elif initial in single_quoted or \
token[:2] in single_quoted or \
token[:3] in single_quoted:
if token[-1] == '\n': # continued string
strstart = (lnum, start)
endprog = (endprogs[initial] or endprogs[token[1]] or
endprogs[token[2]])
contstr, needcont = line[start:], 1
contline = line
break
else: # ordinary string
yield (STRING, token, spos, epos, line)
elif initial in namechars: # ordinary name
yield (NAME, token, spos, epos, line)
elif initial == '\\': # continued stmt
continued = 1
else:
if initial in '([{':
parenlev += 1
elif initial in ')]}':
parenlev -= 1
yield (OP, token, spos, epos, line)
else:
yield (ERRORTOKEN, line[pos],
(lnum, pos), (lnum, pos+1), line)
pos += 1
for indent in indents[1:]: # pop remaining indent levels
yield (DEDENT, '', (lnum, 0), (lnum, 0), '')
yield (ENDMARKER, '', (lnum, 0), (lnum, 0), '')
if __name__ == '__main__': # testing
import sys
if len(sys.argv) > 1:
tokenize(open(sys.argv[1]).readline)
else:
tokenize(sys.stdin.readline)
| Python |
# Mimic the sqlite3 console shell's .dump command
# Author: Paul Kippes <kippesp@gmail.com>
def _iterdump(connection):
"""
Returns an iterator to the dump of the database in an SQL text format.
Used to produce an SQL dump of the database. Useful to save an in-memory
database for later restoration. This function should not be called
directly but instead called from the Connection method, iterdump().
"""
cu = connection.cursor()
yield('BEGIN TRANSACTION;')
# sqlite_master table contains the SQL CREATE statements for the database.
q = """
SELECT name, type, sql
FROM sqlite_master
WHERE sql NOT NULL AND
type == 'table'
"""
schema_res = cu.execute(q)
for table_name, type, sql in schema_res.fetchall():
if table_name == 'sqlite_sequence':
yield('DELETE FROM sqlite_sequence;')
elif table_name == 'sqlite_stat1':
yield('ANALYZE sqlite_master;')
elif table_name.startswith('sqlite_'):
continue
# NOTE: Virtual table support not implemented
#elif sql.startswith('CREATE VIRTUAL TABLE'):
# qtable = table_name.replace("'", "''")
# yield("INSERT INTO sqlite_master(type,name,tbl_name,rootpage,sql)"\
# "VALUES('table','%s','%s',0,'%s');" %
# qtable,
# qtable,
# sql.replace("''"))
else:
yield('%s;' % sql)
# Build the insert statement for each row of the current table
res = cu.execute("PRAGMA table_info('%s')" % table_name)
column_names = [str(table_info[1]) for table_info in res.fetchall()]
q = "SELECT 'INSERT INTO \"%(tbl_name)s\" VALUES("
q += ",".join(["'||quote(" + col + ")||'" for col in column_names])
q += ")' FROM '%(tbl_name)s'"
query_res = cu.execute(q % {'tbl_name': table_name})
for row in query_res:
yield("%s;" % row[0])
# Now when the type is 'index', 'trigger', or 'view'
q = """
SELECT name, type, sql
FROM sqlite_master
WHERE sql NOT NULL AND
type IN ('index', 'trigger', 'view')
"""
schema_res = cu.execute(q)
for name, type, sql in schema_res.fetchall():
yield('%s;' % sql)
yield('COMMIT;')
| Python |
#! /usr/bin/env python
"""Read/write support for Maildir, mbox, MH, Babyl, and MMDF mailboxes."""
# Notes for authors of new mailbox subclasses:
#
# Remember to fsync() changes to disk before closing a modified file
# or returning from a flush() method. See functions _sync_flush() and
# _sync_close().
import sys
import os
import time
import calendar
import socket
import errno
import copy
import email
import email.message
import email.generator
import StringIO
try:
if sys.platform == 'os2emx':
# OS/2 EMX fcntl() not adequate
raise ImportError
import fcntl
except ImportError:
fcntl = None
import warnings
with warnings.catch_warnings():
if sys.py3kwarning:
warnings.filterwarnings("ignore", ".*rfc822 has been removed",
DeprecationWarning)
import rfc822
__all__ = [ 'Mailbox', 'Maildir', 'mbox', 'MH', 'Babyl', 'MMDF',
'Message', 'MaildirMessage', 'mboxMessage', 'MHMessage',
'BabylMessage', 'MMDFMessage', 'UnixMailbox',
'PortableUnixMailbox', 'MmdfMailbox', 'MHMailbox', 'BabylMailbox' ]
class Mailbox:
"""A group of messages in a particular place."""
def __init__(self, path, factory=None, create=True):
"""Initialize a Mailbox instance."""
self._path = os.path.abspath(os.path.expanduser(path))
self._factory = factory
def add(self, message):
"""Add message and return assigned key."""
raise NotImplementedError('Method must be implemented by subclass')
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
raise NotImplementedError('Method must be implemented by subclass')
def __delitem__(self, key):
self.remove(key)
def discard(self, key):
"""If the keyed message exists, remove it."""
try:
self.remove(key)
except KeyError:
pass
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
raise NotImplementedError('Method must be implemented by subclass')
def get(self, key, default=None):
"""Return the keyed message, or default if it doesn't exist."""
try:
return self.__getitem__(key)
except KeyError:
return default
def __getitem__(self, key):
"""Return the keyed message; raise KeyError if it doesn't exist."""
if not self._factory:
return self.get_message(key)
else:
return self._factory(self.get_file(key))
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
raise NotImplementedError('Method must be implemented by subclass')
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
raise NotImplementedError('Method must be implemented by subclass')
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
raise NotImplementedError('Method must be implemented by subclass')
def iterkeys(self):
"""Return an iterator over keys."""
raise NotImplementedError('Method must be implemented by subclass')
def keys(self):
"""Return a list of keys."""
return list(self.iterkeys())
def itervalues(self):
"""Return an iterator over all messages."""
for key in self.iterkeys():
try:
value = self[key]
except KeyError:
continue
yield value
def __iter__(self):
return self.itervalues()
def values(self):
"""Return a list of messages. Memory intensive."""
return list(self.itervalues())
def iteritems(self):
"""Return an iterator over (key, message) tuples."""
for key in self.iterkeys():
try:
value = self[key]
except KeyError:
continue
yield (key, value)
def items(self):
"""Return a list of (key, message) tuples. Memory intensive."""
return list(self.iteritems())
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
raise NotImplementedError('Method must be implemented by subclass')
def __contains__(self, key):
return self.has_key(key)
def __len__(self):
"""Return a count of messages in the mailbox."""
raise NotImplementedError('Method must be implemented by subclass')
def clear(self):
"""Delete all messages."""
for key in self.iterkeys():
self.discard(key)
def pop(self, key, default=None):
"""Delete the keyed message and return it, or default."""
try:
result = self[key]
except KeyError:
return default
self.discard(key)
return result
def popitem(self):
"""Delete an arbitrary (key, message) pair and return it."""
for key in self.iterkeys():
return (key, self.pop(key)) # This is only run once.
else:
raise KeyError('No messages in mailbox')
def update(self, arg=None):
"""Change the messages that correspond to certain keys."""
if hasattr(arg, 'iteritems'):
source = arg.iteritems()
elif hasattr(arg, 'items'):
source = arg.items()
else:
source = arg
bad_key = False
for key, message in source:
try:
self[key] = message
except KeyError:
bad_key = True
if bad_key:
raise KeyError('No message with key(s)')
def flush(self):
"""Write any pending changes to the disk."""
raise NotImplementedError('Method must be implemented by subclass')
def lock(self):
"""Lock the mailbox."""
raise NotImplementedError('Method must be implemented by subclass')
def unlock(self):
"""Unlock the mailbox if it is locked."""
raise NotImplementedError('Method must be implemented by subclass')
def close(self):
"""Flush and close the mailbox."""
raise NotImplementedError('Method must be implemented by subclass')
def _dump_message(self, message, target, mangle_from_=False):
# Most files are opened in binary mode to allow predictable seeking.
# To get native line endings on disk, the user-friendly \n line endings
# used in strings and by email.Message are translated here.
"""Dump message contents to target file."""
if isinstance(message, email.message.Message):
buffer = StringIO.StringIO()
gen = email.generator.Generator(buffer, mangle_from_, 0)
gen.flatten(message)
buffer.seek(0)
target.write(buffer.read().replace('\n', os.linesep))
elif isinstance(message, str):
if mangle_from_:
message = message.replace('\nFrom ', '\n>From ')
message = message.replace('\n', os.linesep)
target.write(message)
elif hasattr(message, 'read'):
while True:
line = message.readline()
if line == '':
break
if mangle_from_ and line.startswith('From '):
line = '>From ' + line[5:]
line = line.replace('\n', os.linesep)
target.write(line)
else:
raise TypeError('Invalid message type: %s' % type(message))
class Maildir(Mailbox):
"""A qmail-style Maildir mailbox."""
colon = ':'
def __init__(self, dirname, factory=rfc822.Message, create=True):
"""Initialize a Maildir instance."""
Mailbox.__init__(self, dirname, factory, create)
if not os.path.exists(self._path):
if create:
os.mkdir(self._path, 0700)
os.mkdir(os.path.join(self._path, 'tmp'), 0700)
os.mkdir(os.path.join(self._path, 'new'), 0700)
os.mkdir(os.path.join(self._path, 'cur'), 0700)
else:
raise NoSuchMailboxError(self._path)
self._toc = {}
self._last_read = None # Records last time we read cur/new
# NOTE: we manually invalidate _last_read each time we do any
# modifications ourselves, otherwise we might get tripped up by
# bogus mtime behaviour on some systems (see issue #6896).
def add(self, message):
"""Add message and return assigned key."""
tmp_file = self._create_tmp()
try:
self._dump_message(message, tmp_file)
finally:
_sync_close(tmp_file)
if isinstance(message, MaildirMessage):
subdir = message.get_subdir()
suffix = self.colon + message.get_info()
if suffix == self.colon:
suffix = ''
else:
subdir = 'new'
suffix = ''
uniq = os.path.basename(tmp_file.name).split(self.colon)[0]
dest = os.path.join(self._path, subdir, uniq + suffix)
try:
if hasattr(os, 'link'):
os.link(tmp_file.name, dest)
os.remove(tmp_file.name)
else:
os.rename(tmp_file.name, dest)
except OSError, e:
os.remove(tmp_file.name)
if e.errno == errno.EEXIST:
raise ExternalClashError('Name clash with existing message: %s'
% dest)
else:
raise
if isinstance(message, MaildirMessage):
os.utime(dest, (os.path.getatime(dest), message.get_date()))
# Invalidate cached toc
self._last_read = None
return uniq
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
os.remove(os.path.join(self._path, self._lookup(key)))
# Invalidate cached toc (only on success)
self._last_read = None
def discard(self, key):
"""If the keyed message exists, remove it."""
# This overrides an inapplicable implementation in the superclass.
try:
self.remove(key)
except KeyError:
pass
except OSError, e:
if e.errno != errno.ENOENT:
raise
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
old_subpath = self._lookup(key)
temp_key = self.add(message)
temp_subpath = self._lookup(temp_key)
if isinstance(message, MaildirMessage):
# temp's subdir and suffix were specified by message.
dominant_subpath = temp_subpath
else:
# temp's subdir and suffix were defaults from add().
dominant_subpath = old_subpath
subdir = os.path.dirname(dominant_subpath)
if self.colon in dominant_subpath:
suffix = self.colon + dominant_subpath.split(self.colon)[-1]
else:
suffix = ''
self.discard(key)
new_path = os.path.join(self._path, subdir, key + suffix)
os.rename(os.path.join(self._path, temp_subpath), new_path)
if isinstance(message, MaildirMessage):
os.utime(new_path, (os.path.getatime(new_path),
message.get_date()))
# Invalidate cached toc
self._last_read = None
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
subpath = self._lookup(key)
f = open(os.path.join(self._path, subpath), 'r')
try:
if self._factory:
msg = self._factory(f)
else:
msg = MaildirMessage(f)
finally:
f.close()
subdir, name = os.path.split(subpath)
msg.set_subdir(subdir)
if self.colon in name:
msg.set_info(name.split(self.colon)[-1])
msg.set_date(os.path.getmtime(os.path.join(self._path, subpath)))
return msg
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
f = open(os.path.join(self._path, self._lookup(key)), 'r')
try:
return f.read()
finally:
f.close()
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
f = open(os.path.join(self._path, self._lookup(key)), 'rb')
return _ProxyFile(f)
def iterkeys(self):
"""Return an iterator over keys."""
self._refresh()
for key in self._toc:
try:
self._lookup(key)
except KeyError:
continue
yield key
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
self._refresh()
return key in self._toc
def __len__(self):
"""Return a count of messages in the mailbox."""
self._refresh()
return len(self._toc)
def flush(self):
"""Write any pending changes to disk."""
# Maildir changes are always written immediately, so there's nothing
# to do except invalidate our cached toc.
self._last_read = None
def lock(self):
"""Lock the mailbox."""
return
def unlock(self):
"""Unlock the mailbox if it is locked."""
return
def close(self):
"""Flush and close the mailbox."""
return
def list_folders(self):
"""Return a list of folder names."""
result = []
for entry in os.listdir(self._path):
if len(entry) > 1 and entry[0] == '.' and \
os.path.isdir(os.path.join(self._path, entry)):
result.append(entry[1:])
return result
def get_folder(self, folder):
"""Return a Maildir instance for the named folder."""
return Maildir(os.path.join(self._path, '.' + folder),
factory=self._factory,
create=False)
def add_folder(self, folder):
"""Create a folder and return a Maildir instance representing it."""
path = os.path.join(self._path, '.' + folder)
result = Maildir(path, factory=self._factory)
maildirfolder_path = os.path.join(path, 'maildirfolder')
if not os.path.exists(maildirfolder_path):
os.close(os.open(maildirfolder_path, os.O_CREAT | os.O_WRONLY,
0666))
return result
def remove_folder(self, folder):
"""Delete the named folder, which must be empty."""
path = os.path.join(self._path, '.' + folder)
for entry in os.listdir(os.path.join(path, 'new')) + \
os.listdir(os.path.join(path, 'cur')):
if len(entry) < 1 or entry[0] != '.':
raise NotEmptyError('Folder contains message(s): %s' % folder)
for entry in os.listdir(path):
if entry != 'new' and entry != 'cur' and entry != 'tmp' and \
os.path.isdir(os.path.join(path, entry)):
raise NotEmptyError("Folder contains subdirectory '%s': %s" %
(folder, entry))
for root, dirs, files in os.walk(path, topdown=False):
for entry in files:
os.remove(os.path.join(root, entry))
for entry in dirs:
os.rmdir(os.path.join(root, entry))
os.rmdir(path)
def clean(self):
"""Delete old files in "tmp"."""
now = time.time()
for entry in os.listdir(os.path.join(self._path, 'tmp')):
path = os.path.join(self._path, 'tmp', entry)
if now - os.path.getatime(path) > 129600: # 60 * 60 * 36
os.remove(path)
_count = 1 # This is used to generate unique file names.
def _create_tmp(self):
"""Create a file in the tmp subdirectory and open and return it."""
now = time.time()
hostname = socket.gethostname()
if '/' in hostname:
hostname = hostname.replace('/', r'\057')
if ':' in hostname:
hostname = hostname.replace(':', r'\072')
uniq = "%s.M%sP%sQ%s.%s" % (int(now), int(now % 1 * 1e6), os.getpid(),
Maildir._count, hostname)
path = os.path.join(self._path, 'tmp', uniq)
try:
os.stat(path)
except OSError, e:
if e.errno == errno.ENOENT:
Maildir._count += 1
try:
return _create_carefully(path)
except OSError, e:
if e.errno != errno.EEXIST:
raise
else:
raise
# Fall through to here if stat succeeded or open raised EEXIST.
raise ExternalClashError('Name clash prevented file creation: %s' %
path)
def _refresh(self):
"""Update table of contents mapping."""
if self._last_read is not None:
for subdir in ('new', 'cur'):
mtime = os.path.getmtime(os.path.join(self._path, subdir))
if mtime > self._last_read:
break
else:
return
# We record the current time - 1sec so that, if _refresh() is called
# again in the same second, we will always re-read the mailbox
# just in case it's been modified. (os.path.mtime() only has
# 1sec resolution.) This results in a few unnecessary re-reads
# when _refresh() is called multiple times in the same second,
# but once the clock ticks over, we will only re-read as needed.
now = time.time() - 1
self._toc = {}
def update_dir (subdir):
path = os.path.join(self._path, subdir)
for entry in os.listdir(path):
p = os.path.join(path, entry)
if os.path.isdir(p):
continue
uniq = entry.split(self.colon)[0]
self._toc[uniq] = os.path.join(subdir, entry)
update_dir('new')
update_dir('cur')
self._last_read = now
def _lookup(self, key):
"""Use TOC to return subpath for given key, or raise a KeyError."""
try:
if os.path.exists(os.path.join(self._path, self._toc[key])):
return self._toc[key]
except KeyError:
pass
self._refresh()
try:
return self._toc[key]
except KeyError:
raise KeyError('No message with key: %s' % key)
# This method is for backward compatibility only.
def next(self):
"""Return the next message in a one-time iteration."""
if not hasattr(self, '_onetime_keys'):
self._onetime_keys = self.iterkeys()
while True:
try:
return self[self._onetime_keys.next()]
except StopIteration:
return None
except KeyError:
continue
class _singlefileMailbox(Mailbox):
"""A single-file mailbox."""
def __init__(self, path, factory=None, create=True):
"""Initialize a single-file mailbox."""
Mailbox.__init__(self, path, factory, create)
try:
f = open(self._path, 'rb+')
except IOError, e:
if e.errno == errno.ENOENT:
if create:
f = open(self._path, 'wb+')
else:
raise NoSuchMailboxError(self._path)
elif e.errno == errno.EACCES:
f = open(self._path, 'rb')
else:
raise
self._file = f
self._toc = None
self._next_key = 0
self._pending = False # No changes require rewriting the file.
self._locked = False
self._file_length = None # Used to record mailbox size
def add(self, message):
"""Add message and return assigned key."""
self._lookup()
self._toc[self._next_key] = self._append_message(message)
self._next_key += 1
self._pending = True
return self._next_key - 1
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
self._lookup(key)
del self._toc[key]
self._pending = True
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
self._lookup(key)
self._toc[key] = self._append_message(message)
self._pending = True
def iterkeys(self):
"""Return an iterator over keys."""
self._lookup()
for key in self._toc.keys():
yield key
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
self._lookup()
return key in self._toc
def __len__(self):
"""Return a count of messages in the mailbox."""
self._lookup()
return len(self._toc)
def lock(self):
"""Lock the mailbox."""
if not self._locked:
_lock_file(self._file)
self._locked = True
def unlock(self):
"""Unlock the mailbox if it is locked."""
if self._locked:
_unlock_file(self._file)
self._locked = False
def flush(self):
"""Write any pending changes to disk."""
if not self._pending:
return
# In order to be writing anything out at all, self._toc must
# already have been generated (and presumably has been modified
# by adding or deleting an item).
assert self._toc is not None
# Check length of self._file; if it's changed, some other process
# has modified the mailbox since we scanned it.
self._file.seek(0, 2)
cur_len = self._file.tell()
if cur_len != self._file_length:
raise ExternalClashError('Size of mailbox file changed '
'(expected %i, found %i)' %
(self._file_length, cur_len))
new_file = _create_temporary(self._path)
try:
new_toc = {}
self._pre_mailbox_hook(new_file)
for key in sorted(self._toc.keys()):
start, stop = self._toc[key]
self._file.seek(start)
self._pre_message_hook(new_file)
new_start = new_file.tell()
while True:
buffer = self._file.read(min(4096,
stop - self._file.tell()))
if buffer == '':
break
new_file.write(buffer)
new_toc[key] = (new_start, new_file.tell())
self._post_message_hook(new_file)
except:
new_file.close()
os.remove(new_file.name)
raise
_sync_close(new_file)
# self._file is about to get replaced, so no need to sync.
self._file.close()
try:
os.rename(new_file.name, self._path)
except OSError, e:
if e.errno == errno.EEXIST or \
(os.name == 'os2' and e.errno == errno.EACCES):
os.remove(self._path)
os.rename(new_file.name, self._path)
else:
raise
self._file = open(self._path, 'rb+')
self._toc = new_toc
self._pending = False
if self._locked:
_lock_file(self._file, dotlock=False)
def _pre_mailbox_hook(self, f):
"""Called before writing the mailbox to file f."""
return
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
return
def _post_message_hook(self, f):
"""Called after writing each message to file f."""
return
def close(self):
"""Flush and close the mailbox."""
self.flush()
if self._locked:
self.unlock()
self._file.close() # Sync has been done by self.flush() above.
def _lookup(self, key=None):
"""Return (start, stop) or raise KeyError."""
if self._toc is None:
self._generate_toc()
if key is not None:
try:
return self._toc[key]
except KeyError:
raise KeyError('No message with key: %s' % key)
def _append_message(self, message):
"""Append message to mailbox and return (start, stop) offsets."""
self._file.seek(0, 2)
self._pre_message_hook(self._file)
offsets = self._install_message(message)
self._post_message_hook(self._file)
self._file.flush()
self._file_length = self._file.tell() # Record current length of mailbox
return offsets
class _mboxMMDF(_singlefileMailbox):
"""An mbox or MMDF mailbox."""
_mangle_from_ = True
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
from_line = self._file.readline().replace(os.linesep, '')
string = self._file.read(stop - self._file.tell())
msg = self._message_factory(string.replace(os.linesep, '\n'))
msg.set_from(from_line[5:])
return msg
def get_string(self, key, from_=False):
"""Return a string representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
if not from_:
self._file.readline()
string = self._file.read(stop - self._file.tell())
return string.replace(os.linesep, '\n')
def get_file(self, key, from_=False):
"""Return a file-like representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
if not from_:
self._file.readline()
return _PartialFile(self._file, self._file.tell(), stop)
def _install_message(self, message):
"""Format a message and blindly write to self._file."""
from_line = None
if isinstance(message, str) and message.startswith('From '):
newline = message.find('\n')
if newline != -1:
from_line = message[:newline]
message = message[newline + 1:]
else:
from_line = message
message = ''
elif isinstance(message, _mboxMMDFMessage):
from_line = 'From ' + message.get_from()
elif isinstance(message, email.message.Message):
from_line = message.get_unixfrom() # May be None.
if from_line is None:
from_line = 'From MAILER-DAEMON %s' % time.asctime(time.gmtime())
start = self._file.tell()
self._file.write(from_line + os.linesep)
self._dump_message(message, self._file, self._mangle_from_)
stop = self._file.tell()
return (start, stop)
class mbox(_mboxMMDF):
"""A classic mbox mailbox."""
_mangle_from_ = True
def __init__(self, path, factory=None, create=True):
"""Initialize an mbox mailbox."""
self._message_factory = mboxMessage
_mboxMMDF.__init__(self, path, factory, create)
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
if f.tell() != 0:
f.write(os.linesep)
def _generate_toc(self):
"""Generate key-to-(start, stop) table of contents."""
starts, stops = [], []
self._file.seek(0)
while True:
line_pos = self._file.tell()
line = self._file.readline()
if line.startswith('From '):
if len(stops) < len(starts):
stops.append(line_pos - len(os.linesep))
starts.append(line_pos)
elif line == '':
stops.append(line_pos)
break
self._toc = dict(enumerate(zip(starts, stops)))
self._next_key = len(self._toc)
self._file_length = self._file.tell()
class MMDF(_mboxMMDF):
"""An MMDF mailbox."""
def __init__(self, path, factory=None, create=True):
"""Initialize an MMDF mailbox."""
self._message_factory = MMDFMessage
_mboxMMDF.__init__(self, path, factory, create)
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
f.write('\001\001\001\001' + os.linesep)
def _post_message_hook(self, f):
"""Called after writing each message to file f."""
f.write(os.linesep + '\001\001\001\001' + os.linesep)
def _generate_toc(self):
"""Generate key-to-(start, stop) table of contents."""
starts, stops = [], []
self._file.seek(0)
next_pos = 0
while True:
line_pos = next_pos
line = self._file.readline()
next_pos = self._file.tell()
if line.startswith('\001\001\001\001' + os.linesep):
starts.append(next_pos)
while True:
line_pos = next_pos
line = self._file.readline()
next_pos = self._file.tell()
if line == '\001\001\001\001' + os.linesep:
stops.append(line_pos - len(os.linesep))
break
elif line == '':
stops.append(line_pos)
break
elif line == '':
break
self._toc = dict(enumerate(zip(starts, stops)))
self._next_key = len(self._toc)
self._file.seek(0, 2)
self._file_length = self._file.tell()
class MH(Mailbox):
"""An MH mailbox."""
def __init__(self, path, factory=None, create=True):
"""Initialize an MH instance."""
Mailbox.__init__(self, path, factory, create)
if not os.path.exists(self._path):
if create:
os.mkdir(self._path, 0700)
os.close(os.open(os.path.join(self._path, '.mh_sequences'),
os.O_CREAT | os.O_EXCL | os.O_WRONLY, 0600))
else:
raise NoSuchMailboxError(self._path)
self._locked = False
def add(self, message):
"""Add message and return assigned key."""
keys = self.keys()
if len(keys) == 0:
new_key = 1
else:
new_key = max(keys) + 1
new_path = os.path.join(self._path, str(new_key))
f = _create_carefully(new_path)
try:
if self._locked:
_lock_file(f)
try:
self._dump_message(message, f)
if isinstance(message, MHMessage):
self._dump_sequences(message, new_key)
finally:
if self._locked:
_unlock_file(f)
finally:
_sync_close(f)
return new_key
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
path = os.path.join(self._path, str(key))
try:
f = open(path, 'rb+')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
else:
f.close()
os.remove(path)
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
path = os.path.join(self._path, str(key))
try:
f = open(path, 'rb+')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
try:
if self._locked:
_lock_file(f)
try:
os.close(os.open(path, os.O_WRONLY | os.O_TRUNC))
self._dump_message(message, f)
if isinstance(message, MHMessage):
self._dump_sequences(message, key)
finally:
if self._locked:
_unlock_file(f)
finally:
_sync_close(f)
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
try:
if self._locked:
f = open(os.path.join(self._path, str(key)), 'r+')
else:
f = open(os.path.join(self._path, str(key)), 'r')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
try:
if self._locked:
_lock_file(f)
try:
msg = MHMessage(f)
finally:
if self._locked:
_unlock_file(f)
finally:
f.close()
for name, key_list in self.get_sequences().iteritems():
if key in key_list:
msg.add_sequence(name)
return msg
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
try:
if self._locked:
f = open(os.path.join(self._path, str(key)), 'r+')
else:
f = open(os.path.join(self._path, str(key)), 'r')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
try:
if self._locked:
_lock_file(f)
try:
return f.read()
finally:
if self._locked:
_unlock_file(f)
finally:
f.close()
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
try:
f = open(os.path.join(self._path, str(key)), 'rb')
except IOError, e:
if e.errno == errno.ENOENT:
raise KeyError('No message with key: %s' % key)
else:
raise
return _ProxyFile(f)
def iterkeys(self):
"""Return an iterator over keys."""
return iter(sorted(int(entry) for entry in os.listdir(self._path)
if entry.isdigit()))
def has_key(self, key):
"""Return True if the keyed message exists, False otherwise."""
return os.path.exists(os.path.join(self._path, str(key)))
def __len__(self):
"""Return a count of messages in the mailbox."""
return len(list(self.iterkeys()))
def lock(self):
"""Lock the mailbox."""
if not self._locked:
self._file = open(os.path.join(self._path, '.mh_sequences'), 'rb+')
_lock_file(self._file)
self._locked = True
def unlock(self):
"""Unlock the mailbox if it is locked."""
if self._locked:
_unlock_file(self._file)
_sync_close(self._file)
del self._file
self._locked = False
def flush(self):
"""Write any pending changes to the disk."""
return
def close(self):
"""Flush and close the mailbox."""
if self._locked:
self.unlock()
def list_folders(self):
"""Return a list of folder names."""
result = []
for entry in os.listdir(self._path):
if os.path.isdir(os.path.join(self._path, entry)):
result.append(entry)
return result
def get_folder(self, folder):
"""Return an MH instance for the named folder."""
return MH(os.path.join(self._path, folder),
factory=self._factory, create=False)
def add_folder(self, folder):
"""Create a folder and return an MH instance representing it."""
return MH(os.path.join(self._path, folder),
factory=self._factory)
def remove_folder(self, folder):
"""Delete the named folder, which must be empty."""
path = os.path.join(self._path, folder)
entries = os.listdir(path)
if entries == ['.mh_sequences']:
os.remove(os.path.join(path, '.mh_sequences'))
elif entries == []:
pass
else:
raise NotEmptyError('Folder not empty: %s' % self._path)
os.rmdir(path)
def get_sequences(self):
"""Return a name-to-key-list dictionary to define each sequence."""
results = {}
f = open(os.path.join(self._path, '.mh_sequences'), 'r')
try:
all_keys = set(self.keys())
for line in f:
try:
name, contents = line.split(':')
keys = set()
for spec in contents.split():
if spec.isdigit():
keys.add(int(spec))
else:
start, stop = (int(x) for x in spec.split('-'))
keys.update(range(start, stop + 1))
results[name] = [key for key in sorted(keys) \
if key in all_keys]
if len(results[name]) == 0:
del results[name]
except ValueError:
raise FormatError('Invalid sequence specification: %s' %
line.rstrip())
finally:
f.close()
return results
def set_sequences(self, sequences):
"""Set sequences using the given name-to-key-list dictionary."""
f = open(os.path.join(self._path, '.mh_sequences'), 'r+')
try:
os.close(os.open(f.name, os.O_WRONLY | os.O_TRUNC))
for name, keys in sequences.iteritems():
if len(keys) == 0:
continue
f.write('%s:' % name)
prev = None
completing = False
for key in sorted(set(keys)):
if key - 1 == prev:
if not completing:
completing = True
f.write('-')
elif completing:
completing = False
f.write('%s %s' % (prev, key))
else:
f.write(' %s' % key)
prev = key
if completing:
f.write(str(prev) + '\n')
else:
f.write('\n')
finally:
_sync_close(f)
def pack(self):
"""Re-name messages to eliminate numbering gaps. Invalidates keys."""
sequences = self.get_sequences()
prev = 0
changes = []
for key in self.iterkeys():
if key - 1 != prev:
changes.append((key, prev + 1))
if hasattr(os, 'link'):
os.link(os.path.join(self._path, str(key)),
os.path.join(self._path, str(prev + 1)))
os.unlink(os.path.join(self._path, str(key)))
else:
os.rename(os.path.join(self._path, str(key)),
os.path.join(self._path, str(prev + 1)))
prev += 1
self._next_key = prev + 1
if len(changes) == 0:
return
for name, key_list in sequences.items():
for old, new in changes:
if old in key_list:
key_list[key_list.index(old)] = new
self.set_sequences(sequences)
def _dump_sequences(self, message, key):
"""Inspect a new MHMessage and update sequences appropriately."""
pending_sequences = message.get_sequences()
all_sequences = self.get_sequences()
for name, key_list in all_sequences.iteritems():
if name in pending_sequences:
key_list.append(key)
elif key in key_list:
del key_list[key_list.index(key)]
for sequence in pending_sequences:
if sequence not in all_sequences:
all_sequences[sequence] = [key]
self.set_sequences(all_sequences)
class Babyl(_singlefileMailbox):
"""An Rmail-style Babyl mailbox."""
_special_labels = frozenset(('unseen', 'deleted', 'filed', 'answered',
'forwarded', 'edited', 'resent'))
def __init__(self, path, factory=None, create=True):
"""Initialize a Babyl mailbox."""
_singlefileMailbox.__init__(self, path, factory, create)
self._labels = {}
def add(self, message):
"""Add message and return assigned key."""
key = _singlefileMailbox.add(self, message)
if isinstance(message, BabylMessage):
self._labels[key] = message.get_labels()
return key
def remove(self, key):
"""Remove the keyed message; raise KeyError if it doesn't exist."""
_singlefileMailbox.remove(self, key)
if key in self._labels:
del self._labels[key]
def __setitem__(self, key, message):
"""Replace the keyed message; raise KeyError if it doesn't exist."""
_singlefileMailbox.__setitem__(self, key, message)
if isinstance(message, BabylMessage):
self._labels[key] = message.get_labels()
def get_message(self, key):
"""Return a Message representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
self._file.readline() # Skip '1,' line specifying labels.
original_headers = StringIO.StringIO()
while True:
line = self._file.readline()
if line == '*** EOOH ***' + os.linesep or line == '':
break
original_headers.write(line.replace(os.linesep, '\n'))
visible_headers = StringIO.StringIO()
while True:
line = self._file.readline()
if line == os.linesep or line == '':
break
visible_headers.write(line.replace(os.linesep, '\n'))
body = self._file.read(stop - self._file.tell()).replace(os.linesep,
'\n')
msg = BabylMessage(original_headers.getvalue() + body)
msg.set_visible(visible_headers.getvalue())
if key in self._labels:
msg.set_labels(self._labels[key])
return msg
def get_string(self, key):
"""Return a string representation or raise a KeyError."""
start, stop = self._lookup(key)
self._file.seek(start)
self._file.readline() # Skip '1,' line specifying labels.
original_headers = StringIO.StringIO()
while True:
line = self._file.readline()
if line == '*** EOOH ***' + os.linesep or line == '':
break
original_headers.write(line.replace(os.linesep, '\n'))
while True:
line = self._file.readline()
if line == os.linesep or line == '':
break
return original_headers.getvalue() + \
self._file.read(stop - self._file.tell()).replace(os.linesep,
'\n')
def get_file(self, key):
"""Return a file-like representation or raise a KeyError."""
return StringIO.StringIO(self.get_string(key).replace('\n',
os.linesep))
def get_labels(self):
"""Return a list of user-defined labels in the mailbox."""
self._lookup()
labels = set()
for label_list in self._labels.values():
labels.update(label_list)
labels.difference_update(self._special_labels)
return list(labels)
def _generate_toc(self):
"""Generate key-to-(start, stop) table of contents."""
starts, stops = [], []
self._file.seek(0)
next_pos = 0
label_lists = []
while True:
line_pos = next_pos
line = self._file.readline()
next_pos = self._file.tell()
if line == '\037\014' + os.linesep:
if len(stops) < len(starts):
stops.append(line_pos - len(os.linesep))
starts.append(next_pos)
labels = [label.strip() for label
in self._file.readline()[1:].split(',')
if label.strip() != '']
label_lists.append(labels)
elif line == '\037' or line == '\037' + os.linesep:
if len(stops) < len(starts):
stops.append(line_pos - len(os.linesep))
elif line == '':
stops.append(line_pos - len(os.linesep))
break
self._toc = dict(enumerate(zip(starts, stops)))
self._labels = dict(enumerate(label_lists))
self._next_key = len(self._toc)
self._file.seek(0, 2)
self._file_length = self._file.tell()
def _pre_mailbox_hook(self, f):
"""Called before writing the mailbox to file f."""
f.write('BABYL OPTIONS:%sVersion: 5%sLabels:%s%s\037' %
(os.linesep, os.linesep, ','.join(self.get_labels()),
os.linesep))
def _pre_message_hook(self, f):
"""Called before writing each message to file f."""
f.write('\014' + os.linesep)
def _post_message_hook(self, f):
"""Called after writing each message to file f."""
f.write(os.linesep + '\037')
def _install_message(self, message):
"""Write message contents and return (start, stop)."""
start = self._file.tell()
if isinstance(message, BabylMessage):
special_labels = []
labels = []
for label in message.get_labels():
if label in self._special_labels:
special_labels.append(label)
else:
labels.append(label)
self._file.write('1')
for label in special_labels:
self._file.write(', ' + label)
self._file.write(',,')
for label in labels:
self._file.write(' ' + label + ',')
self._file.write(os.linesep)
else:
self._file.write('1,,' + os.linesep)
if isinstance(message, email.message.Message):
orig_buffer = StringIO.StringIO()
orig_generator = email.generator.Generator(orig_buffer, False, 0)
orig_generator.flatten(message)
orig_buffer.seek(0)
while True:
line = orig_buffer.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
break
self._file.write('*** EOOH ***' + os.linesep)
if isinstance(message, BabylMessage):
vis_buffer = StringIO.StringIO()
vis_generator = email.generator.Generator(vis_buffer, False, 0)
vis_generator.flatten(message.get_visible())
while True:
line = vis_buffer.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
break
else:
orig_buffer.seek(0)
while True:
line = orig_buffer.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
break
while True:
buffer = orig_buffer.read(4096) # Buffer size is arbitrary.
if buffer == '':
break
self._file.write(buffer.replace('\n', os.linesep))
elif isinstance(message, str):
body_start = message.find('\n\n') + 2
if body_start - 2 != -1:
self._file.write(message[:body_start].replace('\n',
os.linesep))
self._file.write('*** EOOH ***' + os.linesep)
self._file.write(message[:body_start].replace('\n',
os.linesep))
self._file.write(message[body_start:].replace('\n',
os.linesep))
else:
self._file.write('*** EOOH ***' + os.linesep + os.linesep)
self._file.write(message.replace('\n', os.linesep))
elif hasattr(message, 'readline'):
original_pos = message.tell()
first_pass = True
while True:
line = message.readline()
self._file.write(line.replace('\n', os.linesep))
if line == '\n' or line == '':
self._file.write('*** EOOH ***' + os.linesep)
if first_pass:
first_pass = False
message.seek(original_pos)
else:
break
while True:
buffer = message.read(4096) # Buffer size is arbitrary.
if buffer == '':
break
self._file.write(buffer.replace('\n', os.linesep))
else:
raise TypeError('Invalid message type: %s' % type(message))
stop = self._file.tell()
return (start, stop)
class Message(email.message.Message):
"""Message with mailbox-format-specific properties."""
def __init__(self, message=None):
"""Initialize a Message instance."""
if isinstance(message, email.message.Message):
self._become_message(copy.deepcopy(message))
if isinstance(message, Message):
message._explain_to(self)
elif isinstance(message, str):
self._become_message(email.message_from_string(message))
elif hasattr(message, "read"):
self._become_message(email.message_from_file(message))
elif message is None:
email.message.Message.__init__(self)
else:
raise TypeError('Invalid message type: %s' % type(message))
def _become_message(self, message):
"""Assume the non-format-specific state of message."""
for name in ('_headers', '_unixfrom', '_payload', '_charset',
'preamble', 'epilogue', 'defects', '_default_type'):
self.__dict__[name] = message.__dict__[name]
def _explain_to(self, message):
"""Copy format-specific state to message insofar as possible."""
if isinstance(message, Message):
return # There's nothing format-specific to explain.
else:
raise TypeError('Cannot convert to specified type')
class MaildirMessage(Message):
"""Message with Maildir-specific properties."""
def __init__(self, message=None):
"""Initialize a MaildirMessage instance."""
self._subdir = 'new'
self._info = ''
self._date = time.time()
Message.__init__(self, message)
def get_subdir(self):
"""Return 'new' or 'cur'."""
return self._subdir
def set_subdir(self, subdir):
"""Set subdir to 'new' or 'cur'."""
if subdir == 'new' or subdir == 'cur':
self._subdir = subdir
else:
raise ValueError("subdir must be 'new' or 'cur': %s" % subdir)
def get_flags(self):
"""Return as a string the flags that are set."""
if self._info.startswith('2,'):
return self._info[2:]
else:
return ''
def set_flags(self, flags):
"""Set the given flags and unset all others."""
self._info = '2,' + ''.join(sorted(flags))
def add_flag(self, flag):
"""Set the given flag(s) without changing others."""
self.set_flags(''.join(set(self.get_flags()) | set(flag)))
def remove_flag(self, flag):
"""Unset the given string flag(s) without changing others."""
if self.get_flags() != '':
self.set_flags(''.join(set(self.get_flags()) - set(flag)))
def get_date(self):
"""Return delivery date of message, in seconds since the epoch."""
return self._date
def set_date(self, date):
"""Set delivery date of message, in seconds since the epoch."""
try:
self._date = float(date)
except ValueError:
raise TypeError("can't convert to float: %s" % date)
def get_info(self):
"""Get the message's "info" as a string."""
return self._info
def set_info(self, info):
"""Set the message's "info" string."""
if isinstance(info, str):
self._info = info
else:
raise TypeError('info must be a string: %s' % type(info))
def _explain_to(self, message):
"""Copy Maildir-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
message.set_flags(self.get_flags())
message.set_subdir(self.get_subdir())
message.set_date(self.get_date())
elif isinstance(message, _mboxMMDFMessage):
flags = set(self.get_flags())
if 'S' in flags:
message.add_flag('R')
if self.get_subdir() == 'cur':
message.add_flag('O')
if 'T' in flags:
message.add_flag('D')
if 'F' in flags:
message.add_flag('F')
if 'R' in flags:
message.add_flag('A')
message.set_from('MAILER-DAEMON', time.gmtime(self.get_date()))
elif isinstance(message, MHMessage):
flags = set(self.get_flags())
if 'S' not in flags:
message.add_sequence('unseen')
if 'R' in flags:
message.add_sequence('replied')
if 'F' in flags:
message.add_sequence('flagged')
elif isinstance(message, BabylMessage):
flags = set(self.get_flags())
if 'S' not in flags:
message.add_label('unseen')
if 'T' in flags:
message.add_label('deleted')
if 'R' in flags:
message.add_label('answered')
if 'P' in flags:
message.add_label('forwarded')
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class _mboxMMDFMessage(Message):
"""Message with mbox- or MMDF-specific properties."""
def __init__(self, message=None):
"""Initialize an mboxMMDFMessage instance."""
self.set_from('MAILER-DAEMON', True)
if isinstance(message, email.message.Message):
unixfrom = message.get_unixfrom()
if unixfrom is not None and unixfrom.startswith('From '):
self.set_from(unixfrom[5:])
Message.__init__(self, message)
def get_from(self):
"""Return contents of "From " line."""
return self._from
def set_from(self, from_, time_=None):
"""Set "From " line, formatting and appending time_ if specified."""
if time_ is not None:
if time_ is True:
time_ = time.gmtime()
from_ += ' ' + time.asctime(time_)
self._from = from_
def get_flags(self):
"""Return as a string the flags that are set."""
return self.get('Status', '') + self.get('X-Status', '')
def set_flags(self, flags):
"""Set the given flags and unset all others."""
flags = set(flags)
status_flags, xstatus_flags = '', ''
for flag in ('R', 'O'):
if flag in flags:
status_flags += flag
flags.remove(flag)
for flag in ('D', 'F', 'A'):
if flag in flags:
xstatus_flags += flag
flags.remove(flag)
xstatus_flags += ''.join(sorted(flags))
try:
self.replace_header('Status', status_flags)
except KeyError:
self.add_header('Status', status_flags)
try:
self.replace_header('X-Status', xstatus_flags)
except KeyError:
self.add_header('X-Status', xstatus_flags)
def add_flag(self, flag):
"""Set the given flag(s) without changing others."""
self.set_flags(''.join(set(self.get_flags()) | set(flag)))
def remove_flag(self, flag):
"""Unset the given string flag(s) without changing others."""
if 'Status' in self or 'X-Status' in self:
self.set_flags(''.join(set(self.get_flags()) - set(flag)))
def _explain_to(self, message):
"""Copy mbox- or MMDF-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
flags = set(self.get_flags())
if 'O' in flags:
message.set_subdir('cur')
if 'F' in flags:
message.add_flag('F')
if 'A' in flags:
message.add_flag('R')
if 'R' in flags:
message.add_flag('S')
if 'D' in flags:
message.add_flag('T')
del message['status']
del message['x-status']
maybe_date = ' '.join(self.get_from().split()[-5:])
try:
message.set_date(calendar.timegm(time.strptime(maybe_date,
'%a %b %d %H:%M:%S %Y')))
except (ValueError, OverflowError):
pass
elif isinstance(message, _mboxMMDFMessage):
message.set_flags(self.get_flags())
message.set_from(self.get_from())
elif isinstance(message, MHMessage):
flags = set(self.get_flags())
if 'R' not in flags:
message.add_sequence('unseen')
if 'A' in flags:
message.add_sequence('replied')
if 'F' in flags:
message.add_sequence('flagged')
del message['status']
del message['x-status']
elif isinstance(message, BabylMessage):
flags = set(self.get_flags())
if 'R' not in flags:
message.add_label('unseen')
if 'D' in flags:
message.add_label('deleted')
if 'A' in flags:
message.add_label('answered')
del message['status']
del message['x-status']
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class mboxMessage(_mboxMMDFMessage):
"""Message with mbox-specific properties."""
class MHMessage(Message):
"""Message with MH-specific properties."""
def __init__(self, message=None):
"""Initialize an MHMessage instance."""
self._sequences = []
Message.__init__(self, message)
def get_sequences(self):
"""Return a list of sequences that include the message."""
return self._sequences[:]
def set_sequences(self, sequences):
"""Set the list of sequences that include the message."""
self._sequences = list(sequences)
def add_sequence(self, sequence):
"""Add sequence to list of sequences including the message."""
if isinstance(sequence, str):
if not sequence in self._sequences:
self._sequences.append(sequence)
else:
raise TypeError('sequence must be a string: %s' % type(sequence))
def remove_sequence(self, sequence):
"""Remove sequence from the list of sequences including the message."""
try:
self._sequences.remove(sequence)
except ValueError:
pass
def _explain_to(self, message):
"""Copy MH-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
sequences = set(self.get_sequences())
if 'unseen' in sequences:
message.set_subdir('cur')
else:
message.set_subdir('cur')
message.add_flag('S')
if 'flagged' in sequences:
message.add_flag('F')
if 'replied' in sequences:
message.add_flag('R')
elif isinstance(message, _mboxMMDFMessage):
sequences = set(self.get_sequences())
if 'unseen' not in sequences:
message.add_flag('RO')
else:
message.add_flag('O')
if 'flagged' in sequences:
message.add_flag('F')
if 'replied' in sequences:
message.add_flag('A')
elif isinstance(message, MHMessage):
for sequence in self.get_sequences():
message.add_sequence(sequence)
elif isinstance(message, BabylMessage):
sequences = set(self.get_sequences())
if 'unseen' in sequences:
message.add_label('unseen')
if 'replied' in sequences:
message.add_label('answered')
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class BabylMessage(Message):
"""Message with Babyl-specific properties."""
def __init__(self, message=None):
"""Initialize an BabylMessage instance."""
self._labels = []
self._visible = Message()
Message.__init__(self, message)
def get_labels(self):
"""Return a list of labels on the message."""
return self._labels[:]
def set_labels(self, labels):
"""Set the list of labels on the message."""
self._labels = list(labels)
def add_label(self, label):
"""Add label to list of labels on the message."""
if isinstance(label, str):
if label not in self._labels:
self._labels.append(label)
else:
raise TypeError('label must be a string: %s' % type(label))
def remove_label(self, label):
"""Remove label from the list of labels on the message."""
try:
self._labels.remove(label)
except ValueError:
pass
def get_visible(self):
"""Return a Message representation of visible headers."""
return Message(self._visible)
def set_visible(self, visible):
"""Set the Message representation of visible headers."""
self._visible = Message(visible)
def update_visible(self):
"""Update and/or sensibly generate a set of visible headers."""
for header in self._visible.keys():
if header in self:
self._visible.replace_header(header, self[header])
else:
del self._visible[header]
for header in ('Date', 'From', 'Reply-To', 'To', 'CC', 'Subject'):
if header in self and header not in self._visible:
self._visible[header] = self[header]
def _explain_to(self, message):
"""Copy Babyl-specific state to message insofar as possible."""
if isinstance(message, MaildirMessage):
labels = set(self.get_labels())
if 'unseen' in labels:
message.set_subdir('cur')
else:
message.set_subdir('cur')
message.add_flag('S')
if 'forwarded' in labels or 'resent' in labels:
message.add_flag('P')
if 'answered' in labels:
message.add_flag('R')
if 'deleted' in labels:
message.add_flag('T')
elif isinstance(message, _mboxMMDFMessage):
labels = set(self.get_labels())
if 'unseen' not in labels:
message.add_flag('RO')
else:
message.add_flag('O')
if 'deleted' in labels:
message.add_flag('D')
if 'answered' in labels:
message.add_flag('A')
elif isinstance(message, MHMessage):
labels = set(self.get_labels())
if 'unseen' in labels:
message.add_sequence('unseen')
if 'answered' in labels:
message.add_sequence('replied')
elif isinstance(message, BabylMessage):
message.set_visible(self.get_visible())
for label in self.get_labels():
message.add_label(label)
elif isinstance(message, Message):
pass
else:
raise TypeError('Cannot convert to specified type: %s' %
type(message))
class MMDFMessage(_mboxMMDFMessage):
"""Message with MMDF-specific properties."""
class _ProxyFile:
"""A read-only wrapper of a file."""
def __init__(self, f, pos=None):
"""Initialize a _ProxyFile."""
self._file = f
if pos is None:
self._pos = f.tell()
else:
self._pos = pos
def read(self, size=None):
"""Read bytes."""
return self._read(size, self._file.read)
def readline(self, size=None):
"""Read a line."""
return self._read(size, self._file.readline)
def readlines(self, sizehint=None):
"""Read multiple lines."""
result = []
for line in self:
result.append(line)
if sizehint is not None:
sizehint -= len(line)
if sizehint <= 0:
break
return result
def __iter__(self):
"""Iterate over lines."""
return iter(self.readline, "")
def tell(self):
"""Return the position."""
return self._pos
def seek(self, offset, whence=0):
"""Change position."""
if whence == 1:
self._file.seek(self._pos)
self._file.seek(offset, whence)
self._pos = self._file.tell()
def close(self):
"""Close the file."""
del self._file
def _read(self, size, read_method):
"""Read size bytes using read_method."""
if size is None:
size = -1
self._file.seek(self._pos)
result = read_method(size)
self._pos = self._file.tell()
return result
class _PartialFile(_ProxyFile):
"""A read-only wrapper of part of a file."""
def __init__(self, f, start=None, stop=None):
"""Initialize a _PartialFile."""
_ProxyFile.__init__(self, f, start)
self._start = start
self._stop = stop
def tell(self):
"""Return the position with respect to start."""
return _ProxyFile.tell(self) - self._start
def seek(self, offset, whence=0):
"""Change position, possibly with respect to start or stop."""
if whence == 0:
self._pos = self._start
whence = 1
elif whence == 2:
self._pos = self._stop
whence = 1
_ProxyFile.seek(self, offset, whence)
def _read(self, size, read_method):
"""Read size bytes using read_method, honoring start and stop."""
remaining = self._stop - self._pos
if remaining <= 0:
return ''
if size is None or size < 0 or size > remaining:
size = remaining
return _ProxyFile._read(self, size, read_method)
def _lock_file(f, dotlock=True):
"""Lock file f using lockf and dot locking."""
dotlock_done = False
try:
if fcntl:
try:
fcntl.lockf(f, fcntl.LOCK_EX | fcntl.LOCK_NB)
except IOError, e:
if e.errno in (errno.EAGAIN, errno.EACCES):
raise ExternalClashError('lockf: lock unavailable: %s' %
f.name)
else:
raise
if dotlock:
try:
pre_lock = _create_temporary(f.name + '.lock')
pre_lock.close()
except IOError, e:
if e.errno == errno.EACCES:
return # Without write access, just skip dotlocking.
else:
raise
try:
if hasattr(os, 'link'):
os.link(pre_lock.name, f.name + '.lock')
dotlock_done = True
os.unlink(pre_lock.name)
else:
os.rename(pre_lock.name, f.name + '.lock')
dotlock_done = True
except OSError, e:
if e.errno == errno.EEXIST or \
(os.name == 'os2' and e.errno == errno.EACCES):
os.remove(pre_lock.name)
raise ExternalClashError('dot lock unavailable: %s' %
f.name)
else:
raise
except:
if fcntl:
fcntl.lockf(f, fcntl.LOCK_UN)
if dotlock_done:
os.remove(f.name + '.lock')
raise
def _unlock_file(f):
"""Unlock file f using lockf and dot locking."""
if fcntl:
fcntl.lockf(f, fcntl.LOCK_UN)
if os.path.exists(f.name + '.lock'):
os.remove(f.name + '.lock')
def _create_carefully(path):
"""Create a file if it doesn't exist and open for reading and writing."""
fd = os.open(path, os.O_CREAT | os.O_EXCL | os.O_RDWR, 0666)
try:
return open(path, 'rb+')
finally:
os.close(fd)
def _create_temporary(path):
"""Create a temp file based on path and open for reading and writing."""
return _create_carefully('%s.%s.%s.%s' % (path, int(time.time()),
socket.gethostname(),
os.getpid()))
def _sync_flush(f):
"""Ensure changes to file f are physically on disk."""
f.flush()
if hasattr(os, 'fsync'):
os.fsync(f.fileno())
def _sync_close(f):
"""Close file f, ensuring all changes are physically on disk."""
_sync_flush(f)
f.close()
## Start: classes from the original module (for backward compatibility).
# Note that the Maildir class, whose name is unchanged, itself offers a next()
# method for backward compatibility.
class _Mailbox:
def __init__(self, fp, factory=rfc822.Message):
self.fp = fp
self.seekp = 0
self.factory = factory
def __iter__(self):
return iter(self.next, None)
def next(self):
while 1:
self.fp.seek(self.seekp)
try:
self._search_start()
except EOFError:
self.seekp = self.fp.tell()
return None
start = self.fp.tell()
self._search_end()
self.seekp = stop = self.fp.tell()
if start != stop:
break
return self.factory(_PartialFile(self.fp, start, stop))
# Recommended to use PortableUnixMailbox instead!
class UnixMailbox(_Mailbox):
def _search_start(self):
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
raise EOFError
if line[:5] == 'From ' and self._isrealfromline(line):
self.fp.seek(pos)
return
def _search_end(self):
self.fp.readline() # Throw away header line
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
return
if line[:5] == 'From ' and self._isrealfromline(line):
self.fp.seek(pos)
return
# An overridable mechanism to test for From-line-ness. You can either
# specify a different regular expression or define a whole new
# _isrealfromline() method. Note that this only gets called for lines
# starting with the 5 characters "From ".
#
# BAW: According to
#http://home.netscape.com/eng/mozilla/2.0/relnotes/demo/content-length.html
# the only portable, reliable way to find message delimiters in a BSD (i.e
# Unix mailbox) style folder is to search for "\n\nFrom .*\n", or at the
# beginning of the file, "^From .*\n". While _fromlinepattern below seems
# like a good idea, in practice, there are too many variations for more
# strict parsing of the line to be completely accurate.
#
# _strict_isrealfromline() is the old version which tries to do stricter
# parsing of the From_ line. _portable_isrealfromline() simply returns
# true, since it's never called if the line doesn't already start with
# "From ".
#
# This algorithm, and the way it interacts with _search_start() and
# _search_end() may not be completely correct, because it doesn't check
# that the two characters preceding "From " are \n\n or the beginning of
# the file. Fixing this would require a more extensive rewrite than is
# necessary. For convenience, we've added a PortableUnixMailbox class
# which does no checking of the format of the 'From' line.
_fromlinepattern = (r"From \s*[^\s]+\s+\w\w\w\s+\w\w\w\s+\d?\d\s+"
r"\d?\d:\d\d(:\d\d)?(\s+[^\s]+)?\s+\d\d\d\d\s*"
r"[^\s]*\s*"
"$")
_regexp = None
def _strict_isrealfromline(self, line):
if not self._regexp:
import re
self._regexp = re.compile(self._fromlinepattern)
return self._regexp.match(line)
def _portable_isrealfromline(self, line):
return True
_isrealfromline = _strict_isrealfromline
class PortableUnixMailbox(UnixMailbox):
_isrealfromline = UnixMailbox._portable_isrealfromline
class MmdfMailbox(_Mailbox):
def _search_start(self):
while 1:
line = self.fp.readline()
if not line:
raise EOFError
if line[:5] == '\001\001\001\001\n':
return
def _search_end(self):
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
return
if line == '\001\001\001\001\n':
self.fp.seek(pos)
return
class MHMailbox:
def __init__(self, dirname, factory=rfc822.Message):
import re
pat = re.compile('^[1-9][0-9]*$')
self.dirname = dirname
# the three following lines could be combined into:
# list = map(long, filter(pat.match, os.listdir(self.dirname)))
list = os.listdir(self.dirname)
list = filter(pat.match, list)
list = map(long, list)
list.sort()
# This only works in Python 1.6 or later;
# before that str() added 'L':
self.boxes = map(str, list)
self.boxes.reverse()
self.factory = factory
def __iter__(self):
return iter(self.next, None)
def next(self):
if not self.boxes:
return None
fn = self.boxes.pop()
fp = open(os.path.join(self.dirname, fn))
msg = self.factory(fp)
try:
msg._mh_msgno = fn
except (AttributeError, TypeError):
pass
return msg
class BabylMailbox(_Mailbox):
def _search_start(self):
while 1:
line = self.fp.readline()
if not line:
raise EOFError
if line == '*** EOOH ***\n':
return
def _search_end(self):
while 1:
pos = self.fp.tell()
line = self.fp.readline()
if not line:
return
if line == '\037\014\n' or line == '\037':
self.fp.seek(pos)
return
## End: classes from the original module (for backward compatibility).
class Error(Exception):
"""Raised for module-specific errors."""
class NoSuchMailboxError(Error):
"""The specified mailbox does not exist and won't be created."""
class NotEmptyError(Error):
"""The specified mailbox is not empty and deletion was requested."""
class ExternalClashError(Error):
"""Another process caused an action to fail."""
class FormatError(Error):
"""A file appears to have an invalid format."""
| Python |
"""Extract, format and print information about Python stack traces."""
import linecache
import sys
import types
__all__ = ['extract_stack', 'extract_tb', 'format_exception',
'format_exception_only', 'format_list', 'format_stack',
'format_tb', 'print_exc', 'format_exc', 'print_exception',
'print_last', 'print_stack', 'print_tb', 'tb_lineno']
def _print(file, str='', terminator='\n'):
file.write(str+terminator)
def print_list(extracted_list, file=None):
"""Print the list of tuples as returned by extract_tb() or
extract_stack() as a formatted stack trace to the given file."""
if file is None:
file = sys.stderr
for filename, lineno, name, line in extracted_list:
_print(file,
' File "%s", line %d, in %s' % (filename,lineno,name))
if line:
_print(file, ' %s' % line.strip())
def format_list(extracted_list):
"""Format a list of traceback entry tuples for printing.
Given a list of tuples as returned by extract_tb() or
extract_stack(), return a list of strings ready for printing.
Each string in the resulting list corresponds to the item with the
same index in the argument list. Each string ends in a newline;
the strings may contain internal newlines as well, for those items
whose source text line is not None.
"""
list = []
for filename, lineno, name, line in extracted_list:
item = ' File "%s", line %d, in %s\n' % (filename,lineno,name)
if line:
item = item + ' %s\n' % line.strip()
list.append(item)
return list
def print_tb(tb, limit=None, file=None):
"""Print up to 'limit' stack trace entries from the traceback 'tb'.
If 'limit' is omitted or None, all entries are printed. If 'file'
is omitted or None, the output goes to sys.stderr; otherwise
'file' should be an open file or file-like object with a write()
method.
"""
if file is None:
file = sys.stderr
if limit is None:
if hasattr(sys, 'tracebacklimit'):
limit = sys.tracebacklimit
n = 0
while tb is not None and (limit is None or n < limit):
f = tb.tb_frame
lineno = tb.tb_lineno
co = f.f_code
filename = co.co_filename
name = co.co_name
_print(file,
' File "%s", line %d, in %s' % (filename, lineno, name))
linecache.checkcache(filename)
line = linecache.getline(filename, lineno, f.f_globals)
if line: _print(file, ' ' + line.strip())
tb = tb.tb_next
n = n+1
def format_tb(tb, limit = None):
"""A shorthand for 'format_list(extract_stack(f, limit))."""
return format_list(extract_tb(tb, limit))
def extract_tb(tb, limit = None):
"""Return list of up to limit pre-processed entries from traceback.
This is useful for alternate formatting of stack traces. If
'limit' is omitted or None, all entries are extracted. A
pre-processed stack trace entry is a quadruple (filename, line
number, function name, text) representing the information that is
usually printed for a stack trace. The text is a string with
leading and trailing whitespace stripped; if the source is not
available it is None.
"""
if limit is None:
if hasattr(sys, 'tracebacklimit'):
limit = sys.tracebacklimit
list = []
n = 0
while tb is not None and (limit is None or n < limit):
f = tb.tb_frame
lineno = tb.tb_lineno
co = f.f_code
filename = co.co_filename
name = co.co_name
linecache.checkcache(filename)
line = linecache.getline(filename, lineno, f.f_globals)
if line: line = line.strip()
else: line = None
list.append((filename, lineno, name, line))
tb = tb.tb_next
n = n+1
return list
def print_exception(etype, value, tb, limit=None, file=None):
"""Print exception up to 'limit' stack trace entries from 'tb' to 'file'.
This differs from print_tb() in the following ways: (1) if
traceback is not None, it prints a header "Traceback (most recent
call last):"; (2) it prints the exception type and value after the
stack trace; (3) if type is SyntaxError and value has the
appropriate format, it prints the line where the syntax error
occurred with a caret on the next line indicating the approximate
position of the error.
"""
if file is None:
file = sys.stderr
if tb:
_print(file, 'Traceback (most recent call last):')
print_tb(tb, limit, file)
lines = format_exception_only(etype, value)
for line in lines:
_print(file, line, '')
def format_exception(etype, value, tb, limit = None):
"""Format a stack trace and the exception information.
The arguments have the same meaning as the corresponding arguments
to print_exception(). The return value is a list of strings, each
ending in a newline and some containing internal newlines. When
these lines are concatenated and printed, exactly the same text is
printed as does print_exception().
"""
if tb:
list = ['Traceback (most recent call last):\n']
list = list + format_tb(tb, limit)
else:
list = []
list = list + format_exception_only(etype, value)
return list
def format_exception_only(etype, value):
"""Format the exception part of a traceback.
The arguments are the exception type and value such as given by
sys.last_type and sys.last_value. The return value is a list of
strings, each ending in a newline.
Normally, the list contains a single string; however, for
SyntaxError exceptions, it contains several lines that (when
printed) display detailed information about where the syntax
error occurred.
The message indicating which exception occurred is always the last
string in the list.
"""
# An instance should not have a meaningful value parameter, but
# sometimes does, particularly for string exceptions, such as
# >>> raise string1, string2 # deprecated
#
# Clear these out first because issubtype(string1, SyntaxError)
# would throw another exception and mask the original problem.
if (isinstance(etype, BaseException) or
isinstance(etype, types.InstanceType) or
etype is None or type(etype) is str):
return [_format_final_exc_line(etype, value)]
stype = etype.__name__
if not issubclass(etype, SyntaxError):
return [_format_final_exc_line(stype, value)]
# It was a syntax error; show exactly where the problem was found.
lines = []
try:
msg, (filename, lineno, offset, badline) = value.args
except Exception:
pass
else:
filename = filename or "<string>"
lines.append(' File "%s", line %d\n' % (filename, lineno))
if badline is not None:
lines.append(' %s\n' % badline.strip())
if offset is not None:
caretspace = badline.rstrip('\n')[:offset].lstrip()
# non-space whitespace (likes tabs) must be kept for alignment
caretspace = ((c.isspace() and c or ' ') for c in caretspace)
# only three spaces to account for offset1 == pos 0
lines.append(' %s^\n' % ''.join(caretspace))
value = msg
lines.append(_format_final_exc_line(stype, value))
return lines
def _format_final_exc_line(etype, value):
"""Return a list of a single line -- normal case for format_exception_only"""
valuestr = _some_str(value)
if value is None or not valuestr:
line = "%s\n" % etype
else:
line = "%s: %s\n" % (etype, valuestr)
return line
def _some_str(value):
try:
return str(value)
except Exception:
pass
try:
value = unicode(value)
return value.encode("ascii", "backslashreplace")
except Exception:
pass
return '<unprintable %s object>' % type(value).__name__
def print_exc(limit=None, file=None):
"""Shorthand for 'print_exception(sys.exc_type, sys.exc_value, sys.exc_traceback, limit, file)'.
(In fact, it uses sys.exc_info() to retrieve the same information
in a thread-safe way.)"""
if file is None:
file = sys.stderr
try:
etype, value, tb = sys.exc_info()
print_exception(etype, value, tb, limit, file)
finally:
etype = value = tb = None
def format_exc(limit=None):
"""Like print_exc() but return a string."""
try:
etype, value, tb = sys.exc_info()
return ''.join(format_exception(etype, value, tb, limit))
finally:
etype = value = tb = None
def print_last(limit=None, file=None):
"""This is a shorthand for 'print_exception(sys.last_type,
sys.last_value, sys.last_traceback, limit, file)'."""
if not hasattr(sys, "last_type"):
raise ValueError("no last exception")
if file is None:
file = sys.stderr
print_exception(sys.last_type, sys.last_value, sys.last_traceback,
limit, file)
def print_stack(f=None, limit=None, file=None):
"""Print a stack trace from its invocation point.
The optional 'f' argument can be used to specify an alternate
stack frame at which to start. The optional 'limit' and 'file'
arguments have the same meaning as for print_exception().
"""
if f is None:
try:
raise ZeroDivisionError
except ZeroDivisionError:
f = sys.exc_info()[2].tb_frame.f_back
print_list(extract_stack(f, limit), file)
def format_stack(f=None, limit=None):
"""Shorthand for 'format_list(extract_stack(f, limit))'."""
if f is None:
try:
raise ZeroDivisionError
except ZeroDivisionError:
f = sys.exc_info()[2].tb_frame.f_back
return format_list(extract_stack(f, limit))
def extract_stack(f=None, limit = None):
"""Extract the raw traceback from the current stack frame.
The return value has the same format as for extract_tb(). The
optional 'f' and 'limit' arguments have the same meaning as for
print_stack(). Each item in the list is a quadruple (filename,
line number, function name, text), and the entries are in order
from oldest to newest stack frame.
"""
if f is None:
try:
raise ZeroDivisionError
except ZeroDivisionError:
f = sys.exc_info()[2].tb_frame.f_back
if limit is None:
if hasattr(sys, 'tracebacklimit'):
limit = sys.tracebacklimit
list = []
n = 0
while f is not None and (limit is None or n < limit):
lineno = f.f_lineno
co = f.f_code
filename = co.co_filename
name = co.co_name
linecache.checkcache(filename)
line = linecache.getline(filename, lineno, f.f_globals)
if line: line = line.strip()
else: line = None
list.append((filename, lineno, name, line))
f = f.f_back
n = n+1
list.reverse()
return list
def tb_lineno(tb):
"""Calculate correct line number of traceback given in tb.
Obsolete in 2.3.
"""
return tb.tb_lineno
| Python |
"""functools.py - Tools for working with functions and callable objects
"""
# Python module wrapper for _functools C module
# to allow utilities written in Python to be added
# to the functools module.
# Written by Nick Coghlan <ncoghlan at gmail.com>
# Copyright (C) 2006 Python Software Foundation.
# See C source code for _functools credits/copyright
from _functools import partial, reduce
# update_wrapper() and wraps() are tools to help write
# wrapper functions that can handle naive introspection
WRAPPER_ASSIGNMENTS = ('__module__', '__name__', '__doc__')
WRAPPER_UPDATES = ('__dict__',)
def update_wrapper(wrapper,
wrapped,
assigned = WRAPPER_ASSIGNMENTS,
updated = WRAPPER_UPDATES):
"""Update a wrapper function to look like the wrapped function
wrapper is the function to be updated
wrapped is the original function
assigned is a tuple naming the attributes assigned directly
from the wrapped function to the wrapper function (defaults to
functools.WRAPPER_ASSIGNMENTS)
updated is a tuple naming the attributes of the wrapper that
are updated with the corresponding attribute from the wrapped
function (defaults to functools.WRAPPER_UPDATES)
"""
for attr in assigned:
setattr(wrapper, attr, getattr(wrapped, attr))
for attr in updated:
getattr(wrapper, attr).update(getattr(wrapped, attr, {}))
# Return the wrapper so this can be used as a decorator via partial()
return wrapper
def wraps(wrapped,
assigned = WRAPPER_ASSIGNMENTS,
updated = WRAPPER_UPDATES):
"""Decorator factory to apply update_wrapper() to a wrapper function
Returns a decorator that invokes update_wrapper() with the decorated
function as the wrapper argument and the arguments to wraps() as the
remaining arguments. Default arguments are as for update_wrapper().
This is a convenience function to simplify applying partial() to
update_wrapper().
"""
return partial(update_wrapper, wrapped=wrapped,
assigned=assigned, updated=updated)
def total_ordering(cls):
"""Class decorator that fills in missing ordering methods"""
convert = {
'__lt__': [('__gt__', lambda self, other: other < self),
('__le__', lambda self, other: not other < self),
('__ge__', lambda self, other: not self < other)],
'__le__': [('__ge__', lambda self, other: other <= self),
('__lt__', lambda self, other: not other <= self),
('__gt__', lambda self, other: not self <= other)],
'__gt__': [('__lt__', lambda self, other: other > self),
('__ge__', lambda self, other: not other > self),
('__le__', lambda self, other: not self > other)],
'__ge__': [('__le__', lambda self, other: other >= self),
('__gt__', lambda self, other: not other >= self),
('__lt__', lambda self, other: not self >= other)]
}
roots = set(dir(cls)) & set(convert)
if not roots:
raise ValueError('must define at least one ordering operation: < > <= >=')
root = max(roots) # prefer __lt__ to __le__ to __gt__ to __ge__
for opname, opfunc in convert[root]:
if opname not in roots:
opfunc.__name__ = opname
opfunc.__doc__ = getattr(int, opname).__doc__
setattr(cls, opname, opfunc)
return cls
def cmp_to_key(mycmp):
"""Convert a cmp= function into a key= function"""
class K(object):
def __init__(self, obj, *args):
self.obj = obj
def __lt__(self, other):
return mycmp(self.obj, other.obj) < 0
def __gt__(self, other):
return mycmp(self.obj, other.obj) > 0
def __eq__(self, other):
return mycmp(self.obj, other.obj) == 0
def __le__(self, other):
return mycmp(self.obj, other.obj) <= 0
def __ge__(self, other):
return mycmp(self.obj, other.obj) >= 0
def __ne__(self, other):
return mycmp(self.obj, other.obj) != 0
def __hash__(self):
raise TypeError('hash not implemented')
return K
| Python |
r"""TELNET client class.
Based on RFC 854: TELNET Protocol Specification, by J. Postel and
J. Reynolds
Example:
>>> from telnetlib import Telnet
>>> tn = Telnet('www.python.org', 79) # connect to finger port
>>> tn.write('guido\r\n')
>>> print tn.read_all()
Login Name TTY Idle When Where
guido Guido van Rossum pts/2 <Dec 2 11:10> snag.cnri.reston..
>>>
Note that read_all() won't read until eof -- it just reads some data
-- but it guarantees to read at least one byte unless EOF is hit.
It is possible to pass a Telnet object to select.select() in order to
wait until more data is available. Note that in this case,
read_eager() may return '' even if there was data on the socket,
because the protocol negotiation may have eaten the data. This is why
EOFError is needed in some cases to distinguish between "no data" and
"connection closed" (since the socket also appears ready for reading
when it is closed).
To do:
- option negotiation
- timeout should be intrinsic to the connection object instead of an
option on one of the read calls only
"""
# Imported modules
import sys
import socket
import select
__all__ = ["Telnet"]
# Tunable parameters
DEBUGLEVEL = 0
# Telnet protocol defaults
TELNET_PORT = 23
# Telnet protocol characters (don't change)
IAC = chr(255) # "Interpret As Command"
DONT = chr(254)
DO = chr(253)
WONT = chr(252)
WILL = chr(251)
theNULL = chr(0)
SE = chr(240) # Subnegotiation End
NOP = chr(241) # No Operation
DM = chr(242) # Data Mark
BRK = chr(243) # Break
IP = chr(244) # Interrupt process
AO = chr(245) # Abort output
AYT = chr(246) # Are You There
EC = chr(247) # Erase Character
EL = chr(248) # Erase Line
GA = chr(249) # Go Ahead
SB = chr(250) # Subnegotiation Begin
# Telnet protocol options code (don't change)
# These ones all come from arpa/telnet.h
BINARY = chr(0) # 8-bit data path
ECHO = chr(1) # echo
RCP = chr(2) # prepare to reconnect
SGA = chr(3) # suppress go ahead
NAMS = chr(4) # approximate message size
STATUS = chr(5) # give status
TM = chr(6) # timing mark
RCTE = chr(7) # remote controlled transmission and echo
NAOL = chr(8) # negotiate about output line width
NAOP = chr(9) # negotiate about output page size
NAOCRD = chr(10) # negotiate about CR disposition
NAOHTS = chr(11) # negotiate about horizontal tabstops
NAOHTD = chr(12) # negotiate about horizontal tab disposition
NAOFFD = chr(13) # negotiate about formfeed disposition
NAOVTS = chr(14) # negotiate about vertical tab stops
NAOVTD = chr(15) # negotiate about vertical tab disposition
NAOLFD = chr(16) # negotiate about output LF disposition
XASCII = chr(17) # extended ascii character set
LOGOUT = chr(18) # force logout
BM = chr(19) # byte macro
DET = chr(20) # data entry terminal
SUPDUP = chr(21) # supdup protocol
SUPDUPOUTPUT = chr(22) # supdup output
SNDLOC = chr(23) # send location
TTYPE = chr(24) # terminal type
EOR = chr(25) # end or record
TUID = chr(26) # TACACS user identification
OUTMRK = chr(27) # output marking
TTYLOC = chr(28) # terminal location number
VT3270REGIME = chr(29) # 3270 regime
X3PAD = chr(30) # X.3 PAD
NAWS = chr(31) # window size
TSPEED = chr(32) # terminal speed
LFLOW = chr(33) # remote flow control
LINEMODE = chr(34) # Linemode option
XDISPLOC = chr(35) # X Display Location
OLD_ENVIRON = chr(36) # Old - Environment variables
AUTHENTICATION = chr(37) # Authenticate
ENCRYPT = chr(38) # Encryption option
NEW_ENVIRON = chr(39) # New - Environment variables
# the following ones come from
# http://www.iana.org/assignments/telnet-options
# Unfortunately, that document does not assign identifiers
# to all of them, so we are making them up
TN3270E = chr(40) # TN3270E
XAUTH = chr(41) # XAUTH
CHARSET = chr(42) # CHARSET
RSP = chr(43) # Telnet Remote Serial Port
COM_PORT_OPTION = chr(44) # Com Port Control Option
SUPPRESS_LOCAL_ECHO = chr(45) # Telnet Suppress Local Echo
TLS = chr(46) # Telnet Start TLS
KERMIT = chr(47) # KERMIT
SEND_URL = chr(48) # SEND-URL
FORWARD_X = chr(49) # FORWARD_X
PRAGMA_LOGON = chr(138) # TELOPT PRAGMA LOGON
SSPI_LOGON = chr(139) # TELOPT SSPI LOGON
PRAGMA_HEARTBEAT = chr(140) # TELOPT PRAGMA HEARTBEAT
EXOPL = chr(255) # Extended-Options-List
NOOPT = chr(0)
class Telnet:
"""Telnet interface class.
An instance of this class represents a connection to a telnet
server. The instance is initially not connected; the open()
method must be used to establish a connection. Alternatively, the
host name and optional port number can be passed to the
constructor, too.
Don't try to reopen an already connected instance.
This class has many read_*() methods. Note that some of them
raise EOFError when the end of the connection is read, because
they can return an empty string for other reasons. See the
individual doc strings.
read_until(expected, [timeout])
Read until the expected string has been seen, or a timeout is
hit (default is no timeout); may block.
read_all()
Read all data until EOF; may block.
read_some()
Read at least one byte or EOF; may block.
read_very_eager()
Read all data available already queued or on the socket,
without blocking.
read_eager()
Read either data already queued or some data available on the
socket, without blocking.
read_lazy()
Read all data in the raw queue (processing it first), without
doing any socket I/O.
read_very_lazy()
Reads all data in the cooked queue, without doing any socket
I/O.
read_sb_data()
Reads available data between SB ... SE sequence. Don't block.
set_option_negotiation_callback(callback)
Each time a telnet option is read on the input flow, this callback
(if set) is called with the following parameters :
callback(telnet socket, command, option)
option will be chr(0) when there is no option.
No other action is done afterwards by telnetlib.
"""
def __init__(self, host=None, port=0,
timeout=socket._GLOBAL_DEFAULT_TIMEOUT):
"""Constructor.
When called without arguments, create an unconnected instance.
With a hostname argument, it connects the instance; port number
and timeout are optional.
"""
self.debuglevel = DEBUGLEVEL
self.host = host
self.port = port
self.timeout = timeout
self.sock = None
self.rawq = ''
self.irawq = 0
self.cookedq = ''
self.eof = 0
self.iacseq = '' # Buffer for IAC sequence.
self.sb = 0 # flag for SB and SE sequence.
self.sbdataq = ''
self.option_callback = None
if host is not None:
self.open(host, port, timeout)
def open(self, host, port=0, timeout=socket._GLOBAL_DEFAULT_TIMEOUT):
"""Connect to a host.
The optional second argument is the port number, which
defaults to the standard telnet port (23).
Don't try to reopen an already connected instance.
"""
self.eof = 0
if not port:
port = TELNET_PORT
self.host = host
self.port = port
self.timeout = timeout
self.sock = socket.create_connection((host, port), timeout)
def __del__(self):
"""Destructor -- close the connection."""
self.close()
def msg(self, msg, *args):
"""Print a debug message, when the debug level is > 0.
If extra arguments are present, they are substituted in the
message using the standard string formatting operator.
"""
if self.debuglevel > 0:
print 'Telnet(%s,%d):' % (self.host, self.port),
if args:
print msg % args
else:
print msg
def set_debuglevel(self, debuglevel):
"""Set the debug level.
The higher it is, the more debug output you get (on sys.stdout).
"""
self.debuglevel = debuglevel
def close(self):
"""Close the connection."""
if self.sock:
self.sock.close()
self.sock = 0
self.eof = 1
self.iacseq = ''
self.sb = 0
def get_socket(self):
"""Return the socket object used internally."""
return self.sock
def fileno(self):
"""Return the fileno() of the socket object used internally."""
return self.sock.fileno()
def write(self, buffer):
"""Write a string to the socket, doubling any IAC characters.
Can block if the connection is blocked. May raise
socket.error if the connection is closed.
"""
if IAC in buffer:
buffer = buffer.replace(IAC, IAC+IAC)
self.msg("send %r", buffer)
self.sock.sendall(buffer)
def read_until(self, match, timeout=None):
"""Read until a given string is encountered or until timeout.
When no match is found, return whatever is available instead,
possibly the empty string. Raise EOFError if the connection
is closed and no cooked data is available.
"""
n = len(match)
self.process_rawq()
i = self.cookedq.find(match)
if i >= 0:
i = i+n
buf = self.cookedq[:i]
self.cookedq = self.cookedq[i:]
return buf
s_reply = ([self], [], [])
s_args = s_reply
if timeout is not None:
s_args = s_args + (timeout,)
from time import time
time_start = time()
while not self.eof and select.select(*s_args) == s_reply:
i = max(0, len(self.cookedq)-n)
self.fill_rawq()
self.process_rawq()
i = self.cookedq.find(match, i)
if i >= 0:
i = i+n
buf = self.cookedq[:i]
self.cookedq = self.cookedq[i:]
return buf
if timeout is not None:
elapsed = time() - time_start
if elapsed >= timeout:
break
s_args = s_reply + (timeout-elapsed,)
return self.read_very_lazy()
def read_all(self):
"""Read all data until EOF; block until connection closed."""
self.process_rawq()
while not self.eof:
self.fill_rawq()
self.process_rawq()
buf = self.cookedq
self.cookedq = ''
return buf
def read_some(self):
"""Read at least one byte of cooked data unless EOF is hit.
Return '' if EOF is hit. Block if no data is immediately
available.
"""
self.process_rawq()
while not self.cookedq and not self.eof:
self.fill_rawq()
self.process_rawq()
buf = self.cookedq
self.cookedq = ''
return buf
def read_very_eager(self):
"""Read everything that's possible without blocking in I/O (eager).
Raise EOFError if connection closed and no cooked data
available. Return '' if no cooked data available otherwise.
Don't block unless in the midst of an IAC sequence.
"""
self.process_rawq()
while not self.eof and self.sock_avail():
self.fill_rawq()
self.process_rawq()
return self.read_very_lazy()
def read_eager(self):
"""Read readily available data.
Raise EOFError if connection closed and no cooked data
available. Return '' if no cooked data available otherwise.
Don't block unless in the midst of an IAC sequence.
"""
self.process_rawq()
while not self.cookedq and not self.eof and self.sock_avail():
self.fill_rawq()
self.process_rawq()
return self.read_very_lazy()
def read_lazy(self):
"""Process and return data that's already in the queues (lazy).
Raise EOFError if connection closed and no data available.
Return '' if no cooked data available otherwise. Don't block
unless in the midst of an IAC sequence.
"""
self.process_rawq()
return self.read_very_lazy()
def read_very_lazy(self):
"""Return any data available in the cooked queue (very lazy).
Raise EOFError if connection closed and no data available.
Return '' if no cooked data available otherwise. Don't block.
"""
buf = self.cookedq
self.cookedq = ''
if not buf and self.eof and not self.rawq:
raise EOFError, 'telnet connection closed'
return buf
def read_sb_data(self):
"""Return any data available in the SB ... SE queue.
Return '' if no SB ... SE available. Should only be called
after seeing a SB or SE command. When a new SB command is
found, old unread SB data will be discarded. Don't block.
"""
buf = self.sbdataq
self.sbdataq = ''
return buf
def set_option_negotiation_callback(self, callback):
"""Provide a callback function called after each receipt of a telnet option."""
self.option_callback = callback
def process_rawq(self):
"""Transfer from raw queue to cooked queue.
Set self.eof when connection is closed. Don't block unless in
the midst of an IAC sequence.
"""
buf = ['', '']
try:
while self.rawq:
c = self.rawq_getchar()
if not self.iacseq:
if c == theNULL:
continue
if c == "\021":
continue
if c != IAC:
buf[self.sb] = buf[self.sb] + c
continue
else:
self.iacseq += c
elif len(self.iacseq) == 1:
# 'IAC: IAC CMD [OPTION only for WILL/WONT/DO/DONT]'
if c in (DO, DONT, WILL, WONT):
self.iacseq += c
continue
self.iacseq = ''
if c == IAC:
buf[self.sb] = buf[self.sb] + c
else:
if c == SB: # SB ... SE start.
self.sb = 1
self.sbdataq = ''
elif c == SE:
self.sb = 0
self.sbdataq = self.sbdataq + buf[1]
buf[1] = ''
if self.option_callback:
# Callback is supposed to look into
# the sbdataq
self.option_callback(self.sock, c, NOOPT)
else:
# We can't offer automatic processing of
# suboptions. Alas, we should not get any
# unless we did a WILL/DO before.
self.msg('IAC %d not recognized' % ord(c))
elif len(self.iacseq) == 2:
cmd = self.iacseq[1]
self.iacseq = ''
opt = c
if cmd in (DO, DONT):
self.msg('IAC %s %d',
cmd == DO and 'DO' or 'DONT', ord(opt))
if self.option_callback:
self.option_callback(self.sock, cmd, opt)
else:
self.sock.sendall(IAC + WONT + opt)
elif cmd in (WILL, WONT):
self.msg('IAC %s %d',
cmd == WILL and 'WILL' or 'WONT', ord(opt))
if self.option_callback:
self.option_callback(self.sock, cmd, opt)
else:
self.sock.sendall(IAC + DONT + opt)
except EOFError: # raised by self.rawq_getchar()
self.iacseq = '' # Reset on EOF
self.sb = 0
pass
self.cookedq = self.cookedq + buf[0]
self.sbdataq = self.sbdataq + buf[1]
def rawq_getchar(self):
"""Get next char from raw queue.
Block if no data is immediately available. Raise EOFError
when connection is closed.
"""
if not self.rawq:
self.fill_rawq()
if self.eof:
raise EOFError
c = self.rawq[self.irawq]
self.irawq = self.irawq + 1
if self.irawq >= len(self.rawq):
self.rawq = ''
self.irawq = 0
return c
def fill_rawq(self):
"""Fill raw queue from exactly one recv() system call.
Block if no data is immediately available. Set self.eof when
connection is closed.
"""
if self.irawq >= len(self.rawq):
self.rawq = ''
self.irawq = 0
# The buffer size should be fairly small so as to avoid quadratic
# behavior in process_rawq() above
buf = self.sock.recv(50)
self.msg("recv %r", buf)
self.eof = (not buf)
self.rawq = self.rawq + buf
def sock_avail(self):
"""Test whether data is available on the socket."""
return select.select([self], [], [], 0) == ([self], [], [])
def interact(self):
"""Interaction function, emulates a very dumb telnet client."""
if sys.platform == "win32":
self.mt_interact()
return
while 1:
rfd, wfd, xfd = select.select([self, sys.stdin], [], [])
if self in rfd:
try:
text = self.read_eager()
except EOFError:
print '*** Connection closed by remote host ***'
break
if text:
sys.stdout.write(text)
sys.stdout.flush()
if sys.stdin in rfd:
line = sys.stdin.readline()
if not line:
break
self.write(line)
def mt_interact(self):
"""Multithreaded version of interact()."""
import thread
thread.start_new_thread(self.listener, ())
while 1:
line = sys.stdin.readline()
if not line:
break
self.write(line)
def listener(self):
"""Helper for mt_interact() -- this executes in the other thread."""
while 1:
try:
data = self.read_eager()
except EOFError:
print '*** Connection closed by remote host ***'
return
if data:
sys.stdout.write(data)
else:
sys.stdout.flush()
def expect(self, list, timeout=None):
"""Read until one from a list of a regular expressions matches.
The first argument is a list of regular expressions, either
compiled (re.RegexObject instances) or uncompiled (strings).
The optional second argument is a timeout, in seconds; default
is no timeout.
Return a tuple of three items: the index in the list of the
first regular expression that matches; the match object
returned; and the text read up till and including the match.
If EOF is read and no text was read, raise EOFError.
Otherwise, when nothing matches, return (-1, None, text) where
text is the text received so far (may be the empty string if a
timeout happened).
If a regular expression ends with a greedy match (e.g. '.*')
or if more than one expression can match the same input, the
results are undeterministic, and may depend on the I/O timing.
"""
re = None
list = list[:]
indices = range(len(list))
for i in indices:
if not hasattr(list[i], "search"):
if not re: import re
list[i] = re.compile(list[i])
if timeout is not None:
from time import time
time_start = time()
while 1:
self.process_rawq()
for i in indices:
m = list[i].search(self.cookedq)
if m:
e = m.end()
text = self.cookedq[:e]
self.cookedq = self.cookedq[e:]
return (i, m, text)
if self.eof:
break
if timeout is not None:
elapsed = time() - time_start
if elapsed >= timeout:
break
s_args = ([self.fileno()], [], [], timeout-elapsed)
r, w, x = select.select(*s_args)
if not r:
break
self.fill_rawq()
text = self.read_very_lazy()
if not text and self.eof:
raise EOFError
return (-1, None, text)
def test():
"""Test program for telnetlib.
Usage: python telnetlib.py [-d] ... [host [port]]
Default host is localhost; default port is 23.
"""
debuglevel = 0
while sys.argv[1:] and sys.argv[1] == '-d':
debuglevel = debuglevel+1
del sys.argv[1]
host = 'localhost'
if sys.argv[1:]:
host = sys.argv[1]
port = 0
if sys.argv[2:]:
portstr = sys.argv[2]
try:
port = int(portstr)
except ValueError:
port = socket.getservbyname(portstr, 'tcp')
tn = Telnet()
tn.set_debuglevel(debuglevel)
tn.open(host, port, timeout=0.5)
tn.interact()
tn.close()
if __name__ == '__main__':
test()
| Python |
"""Word completion for GNU readline 2.0.
This requires the latest extension to the readline module. The completer
completes keywords, built-ins and globals in a selectable namespace (which
defaults to __main__); when completing NAME.NAME..., it evaluates (!) the
expression up to the last dot and completes its attributes.
It's very cool to do "import sys" type "sys.", hit the
completion key (twice), and see the list of names defined by the
sys module!
Tip: to use the tab key as the completion key, call
readline.parse_and_bind("tab: complete")
Notes:
- Exceptions raised by the completer function are *ignored* (and
generally cause the completion to fail). This is a feature -- since
readline sets the tty device in raw (or cbreak) mode, printing a
traceback wouldn't work well without some complicated hoopla to save,
reset and restore the tty state.
- The evaluation of the NAME.NAME... form may cause arbitrary
application defined code to be executed if an object with a
__getattr__ hook is found. Since it is the responsibility of the
application (or the user) to enable this feature, I consider this an
acceptable risk. More complicated expressions (e.g. function calls or
indexing operations) are *not* evaluated.
- GNU readline is also used by the built-in functions input() and
raw_input(), and thus these also benefit/suffer from the completer
features. Clearly an interactive application can benefit by
specifying its own completer function and using raw_input() for all
its input.
- When the original stdin is not a tty device, GNU readline is never
used, and this module (and the readline module) are silently inactive.
"""
import __builtin__
import __main__
__all__ = ["Completer"]
class Completer:
def __init__(self, namespace = None):
"""Create a new completer for the command line.
Completer([namespace]) -> completer instance.
If unspecified, the default namespace where completions are performed
is __main__ (technically, __main__.__dict__). Namespaces should be
given as dictionaries.
Completer instances should be used as the completion mechanism of
readline via the set_completer() call:
readline.set_completer(Completer(my_namespace).complete)
"""
if namespace and not isinstance(namespace, dict):
raise TypeError,'namespace must be a dictionary'
# Don't bind to namespace quite yet, but flag whether the user wants a
# specific namespace or to use __main__.__dict__. This will allow us
# to bind to __main__.__dict__ at completion time, not now.
if namespace is None:
self.use_main_ns = 1
else:
self.use_main_ns = 0
self.namespace = namespace
def complete(self, text, state):
"""Return the next possible completion for 'text'.
This is called successively with state == 0, 1, 2, ... until it
returns None. The completion should begin with 'text'.
"""
if self.use_main_ns:
self.namespace = __main__.__dict__
if state == 0:
if "." in text:
self.matches = self.attr_matches(text)
else:
self.matches = self.global_matches(text)
try:
return self.matches[state]
except IndexError:
return None
def _callable_postfix(self, val, word):
if hasattr(val, '__call__'):
word = word + "("
return word
def global_matches(self, text):
"""Compute matches when text is a simple name.
Return a list of all keywords, built-in functions and names currently
defined in self.namespace that match.
"""
import keyword
matches = []
n = len(text)
for word in keyword.kwlist:
if word[:n] == text:
matches.append(word)
for nspace in [__builtin__.__dict__, self.namespace]:
for word, val in nspace.items():
if word[:n] == text and word != "__builtins__":
matches.append(self._callable_postfix(val, word))
return matches
def attr_matches(self, text):
"""Compute matches when text contains a dot.
Assuming the text is of the form NAME.NAME....[NAME], and is
evaluatable in self.namespace, it will be evaluated and its attributes
(as revealed by dir()) are used as possible completions. (For class
instances, class members are also considered.)
WARNING: this can still invoke arbitrary C code, if an object
with a __getattr__ hook is evaluated.
"""
import re
m = re.match(r"(\w+(\.\w+)*)\.(\w*)", text)
if not m:
return []
expr, attr = m.group(1, 3)
try:
thisobject = eval(expr, self.namespace)
except Exception:
return []
# get the content of the object, except __builtins__
words = dir(thisobject)
if "__builtins__" in words:
words.remove("__builtins__")
if hasattr(thisobject, '__class__'):
words.append('__class__')
words.extend(get_class_members(thisobject.__class__))
matches = []
n = len(attr)
for word in words:
if word[:n] == attr and hasattr(thisobject, word):
val = getattr(thisobject, word)
word = self._callable_postfix(val, "%s.%s" % (expr, word))
matches.append(word)
return matches
def get_class_members(klass):
ret = dir(klass)
if hasattr(klass,'__bases__'):
for base in klass.__bases__:
ret = ret + get_class_members(base)
return ret
try:
import readline
except ImportError:
pass
else:
readline.set_completer(Completer().complete)
| Python |
#-------------------------------------------------------------------------
# This file contains real Python object wrappers for DB and DBEnv
# C "objects" that can be usefully subclassed. The previous SWIG
# based interface allowed this thanks to SWIG's shadow classes.
# -- Gregory P. Smith
#-------------------------------------------------------------------------
#
# (C) Copyright 2001 Autonomous Zone Industries
#
# License: This is free software. You may use this software for any
# purpose including modification/redistribution, so long as
# this header remains intact and that you do not claim any
# rights of ownership or authorship of this software. This
# software has been tested, but no warranty is expressed or
# implied.
#
#
# TODO it would be *really nice* to have an automatic shadow class populator
# so that new methods don't need to be added here manually after being
# added to _bsddb.c.
#
import sys
absolute_import = (sys.version_info[0] >= 3)
if absolute_import :
# Because this syntaxis is not valid before Python 2.5
exec("from . import db")
else :
import db
if sys.version_info < (2, 6) :
try:
from UserDict import DictMixin
except ImportError:
# DictMixin is new in Python 2.3
class DictMixin: pass
MutableMapping = DictMixin
else :
import collections
MutableMapping = collections.MutableMapping
class DBEnv:
def __init__(self, *args, **kwargs):
self._cobj = db.DBEnv(*args, **kwargs)
def close(self, *args, **kwargs):
return self._cobj.close(*args, **kwargs)
def open(self, *args, **kwargs):
return self._cobj.open(*args, **kwargs)
def remove(self, *args, **kwargs):
return self._cobj.remove(*args, **kwargs)
def set_shm_key(self, *args, **kwargs):
return self._cobj.set_shm_key(*args, **kwargs)
def set_cachesize(self, *args, **kwargs):
return self._cobj.set_cachesize(*args, **kwargs)
def set_data_dir(self, *args, **kwargs):
return self._cobj.set_data_dir(*args, **kwargs)
def set_flags(self, *args, **kwargs):
return self._cobj.set_flags(*args, **kwargs)
def set_lg_bsize(self, *args, **kwargs):
return self._cobj.set_lg_bsize(*args, **kwargs)
def set_lg_dir(self, *args, **kwargs):
return self._cobj.set_lg_dir(*args, **kwargs)
def set_lg_max(self, *args, **kwargs):
return self._cobj.set_lg_max(*args, **kwargs)
def set_lk_detect(self, *args, **kwargs):
return self._cobj.set_lk_detect(*args, **kwargs)
if db.version() < (4,5):
def set_lk_max(self, *args, **kwargs):
return self._cobj.set_lk_max(*args, **kwargs)
def set_lk_max_locks(self, *args, **kwargs):
return self._cobj.set_lk_max_locks(*args, **kwargs)
def set_lk_max_lockers(self, *args, **kwargs):
return self._cobj.set_lk_max_lockers(*args, **kwargs)
def set_lk_max_objects(self, *args, **kwargs):
return self._cobj.set_lk_max_objects(*args, **kwargs)
def set_mp_mmapsize(self, *args, **kwargs):
return self._cobj.set_mp_mmapsize(*args, **kwargs)
def set_timeout(self, *args, **kwargs):
return self._cobj.set_timeout(*args, **kwargs)
def set_tmp_dir(self, *args, **kwargs):
return self._cobj.set_tmp_dir(*args, **kwargs)
def txn_begin(self, *args, **kwargs):
return self._cobj.txn_begin(*args, **kwargs)
def txn_checkpoint(self, *args, **kwargs):
return self._cobj.txn_checkpoint(*args, **kwargs)
def txn_stat(self, *args, **kwargs):
return self._cobj.txn_stat(*args, **kwargs)
def set_tx_max(self, *args, **kwargs):
return self._cobj.set_tx_max(*args, **kwargs)
def set_tx_timestamp(self, *args, **kwargs):
return self._cobj.set_tx_timestamp(*args, **kwargs)
def lock_detect(self, *args, **kwargs):
return self._cobj.lock_detect(*args, **kwargs)
def lock_get(self, *args, **kwargs):
return self._cobj.lock_get(*args, **kwargs)
def lock_id(self, *args, **kwargs):
return self._cobj.lock_id(*args, **kwargs)
def lock_put(self, *args, **kwargs):
return self._cobj.lock_put(*args, **kwargs)
def lock_stat(self, *args, **kwargs):
return self._cobj.lock_stat(*args, **kwargs)
def log_archive(self, *args, **kwargs):
return self._cobj.log_archive(*args, **kwargs)
def set_get_returns_none(self, *args, **kwargs):
return self._cobj.set_get_returns_none(*args, **kwargs)
def log_stat(self, *args, **kwargs):
return self._cobj.log_stat(*args, **kwargs)
def dbremove(self, *args, **kwargs):
return self._cobj.dbremove(*args, **kwargs)
def dbrename(self, *args, **kwargs):
return self._cobj.dbrename(*args, **kwargs)
def set_encrypt(self, *args, **kwargs):
return self._cobj.set_encrypt(*args, **kwargs)
if db.version() >= (4,4):
def fileid_reset(self, *args, **kwargs):
return self._cobj.fileid_reset(*args, **kwargs)
def lsn_reset(self, *args, **kwargs):
return self._cobj.lsn_reset(*args, **kwargs)
class DB(MutableMapping):
def __init__(self, dbenv, *args, **kwargs):
# give it the proper DBEnv C object that its expecting
self._cobj = db.DB(*((dbenv._cobj,) + args), **kwargs)
# TODO are there other dict methods that need to be overridden?
def __len__(self):
return len(self._cobj)
def __getitem__(self, arg):
return self._cobj[arg]
def __setitem__(self, key, value):
self._cobj[key] = value
def __delitem__(self, arg):
del self._cobj[arg]
if sys.version_info >= (2, 6) :
def __iter__(self) :
return self._cobj.__iter__()
def append(self, *args, **kwargs):
return self._cobj.append(*args, **kwargs)
def associate(self, *args, **kwargs):
return self._cobj.associate(*args, **kwargs)
def close(self, *args, **kwargs):
return self._cobj.close(*args, **kwargs)
def consume(self, *args, **kwargs):
return self._cobj.consume(*args, **kwargs)
def consume_wait(self, *args, **kwargs):
return self._cobj.consume_wait(*args, **kwargs)
def cursor(self, *args, **kwargs):
return self._cobj.cursor(*args, **kwargs)
def delete(self, *args, **kwargs):
return self._cobj.delete(*args, **kwargs)
def fd(self, *args, **kwargs):
return self._cobj.fd(*args, **kwargs)
def get(self, *args, **kwargs):
return self._cobj.get(*args, **kwargs)
def pget(self, *args, **kwargs):
return self._cobj.pget(*args, **kwargs)
def get_both(self, *args, **kwargs):
return self._cobj.get_both(*args, **kwargs)
def get_byteswapped(self, *args, **kwargs):
return self._cobj.get_byteswapped(*args, **kwargs)
def get_size(self, *args, **kwargs):
return self._cobj.get_size(*args, **kwargs)
def get_type(self, *args, **kwargs):
return self._cobj.get_type(*args, **kwargs)
def join(self, *args, **kwargs):
return self._cobj.join(*args, **kwargs)
def key_range(self, *args, **kwargs):
return self._cobj.key_range(*args, **kwargs)
def has_key(self, *args, **kwargs):
return self._cobj.has_key(*args, **kwargs)
def items(self, *args, **kwargs):
return self._cobj.items(*args, **kwargs)
def keys(self, *args, **kwargs):
return self._cobj.keys(*args, **kwargs)
def open(self, *args, **kwargs):
return self._cobj.open(*args, **kwargs)
def put(self, *args, **kwargs):
return self._cobj.put(*args, **kwargs)
def remove(self, *args, **kwargs):
return self._cobj.remove(*args, **kwargs)
def rename(self, *args, **kwargs):
return self._cobj.rename(*args, **kwargs)
def set_bt_minkey(self, *args, **kwargs):
return self._cobj.set_bt_minkey(*args, **kwargs)
def set_bt_compare(self, *args, **kwargs):
return self._cobj.set_bt_compare(*args, **kwargs)
def set_cachesize(self, *args, **kwargs):
return self._cobj.set_cachesize(*args, **kwargs)
def set_flags(self, *args, **kwargs):
return self._cobj.set_flags(*args, **kwargs)
def set_h_ffactor(self, *args, **kwargs):
return self._cobj.set_h_ffactor(*args, **kwargs)
def set_h_nelem(self, *args, **kwargs):
return self._cobj.set_h_nelem(*args, **kwargs)
def set_lorder(self, *args, **kwargs):
return self._cobj.set_lorder(*args, **kwargs)
def set_pagesize(self, *args, **kwargs):
return self._cobj.set_pagesize(*args, **kwargs)
def set_re_delim(self, *args, **kwargs):
return self._cobj.set_re_delim(*args, **kwargs)
def set_re_len(self, *args, **kwargs):
return self._cobj.set_re_len(*args, **kwargs)
def set_re_pad(self, *args, **kwargs):
return self._cobj.set_re_pad(*args, **kwargs)
def set_re_source(self, *args, **kwargs):
return self._cobj.set_re_source(*args, **kwargs)
def set_q_extentsize(self, *args, **kwargs):
return self._cobj.set_q_extentsize(*args, **kwargs)
def stat(self, *args, **kwargs):
return self._cobj.stat(*args, **kwargs)
def sync(self, *args, **kwargs):
return self._cobj.sync(*args, **kwargs)
def type(self, *args, **kwargs):
return self._cobj.type(*args, **kwargs)
def upgrade(self, *args, **kwargs):
return self._cobj.upgrade(*args, **kwargs)
def values(self, *args, **kwargs):
return self._cobj.values(*args, **kwargs)
def verify(self, *args, **kwargs):
return self._cobj.verify(*args, **kwargs)
def set_get_returns_none(self, *args, **kwargs):
return self._cobj.set_get_returns_none(*args, **kwargs)
def set_encrypt(self, *args, **kwargs):
return self._cobj.set_encrypt(*args, **kwargs)
class DBSequence:
def __init__(self, *args, **kwargs):
self._cobj = db.DBSequence(*args, **kwargs)
def close(self, *args, **kwargs):
return self._cobj.close(*args, **kwargs)
def get(self, *args, **kwargs):
return self._cobj.get(*args, **kwargs)
def get_dbp(self, *args, **kwargs):
return self._cobj.get_dbp(*args, **kwargs)
def get_key(self, *args, **kwargs):
return self._cobj.get_key(*args, **kwargs)
def init_value(self, *args, **kwargs):
return self._cobj.init_value(*args, **kwargs)
def open(self, *args, **kwargs):
return self._cobj.open(*args, **kwargs)
def remove(self, *args, **kwargs):
return self._cobj.remove(*args, **kwargs)
def stat(self, *args, **kwargs):
return self._cobj.stat(*args, **kwargs)
def set_cachesize(self, *args, **kwargs):
return self._cobj.set_cachesize(*args, **kwargs)
def set_flags(self, *args, **kwargs):
return self._cobj.set_flags(*args, **kwargs)
def set_range(self, *args, **kwargs):
return self._cobj.set_range(*args, **kwargs)
def get_cachesize(self, *args, **kwargs):
return self._cobj.get_cachesize(*args, **kwargs)
def get_flags(self, *args, **kwargs):
return self._cobj.get_flags(*args, **kwargs)
def get_range(self, *args, **kwargs):
return self._cobj.get_range(*args, **kwargs)
| Python |
#!/usr/bin/env python
#------------------------------------------------------------------------
# Copyright (c) 1997-2001 by Total Control Software
# All Rights Reserved
#------------------------------------------------------------------------
#
# Module Name: dbShelve.py
#
# Description: A reimplementation of the standard shelve.py that
# forces the use of cPickle, and DB.
#
# Creation Date: 11/3/97 3:39:04PM
#
# License: This is free software. You may use this software for any
# purpose including modification/redistribution, so long as
# this header remains intact and that you do not claim any
# rights of ownership or authorship of this software. This
# software has been tested, but no warranty is expressed or
# implied.
#
# 13-Dec-2000: Updated to be used with the new bsddb3 package.
# Added DBShelfCursor class.
#
#------------------------------------------------------------------------
"""Manage shelves of pickled objects using bsddb database files for the
storage.
"""
#------------------------------------------------------------------------
import sys
absolute_import = (sys.version_info[0] >= 3)
if absolute_import :
# Because this syntaxis is not valid before Python 2.5
exec("from . import db")
else :
import db
if sys.version_info[0] >= 3 :
import cPickle # Will be converted to "pickle" by "2to3"
else :
if sys.version_info < (2, 6) :
import cPickle
else :
# When we drop support for python 2.3 and 2.4
# we could use: (in 2.5 we need a __future__ statement)
#
# with warnings.catch_warnings():
# warnings.filterwarnings(...)
# ...
#
# We can not use "with" as is, because it would be invalid syntax
# in python 2.3, 2.4 and (with no __future__) 2.5.
# Here we simulate "with" following PEP 343 :
import warnings
w = warnings.catch_warnings()
w.__enter__()
try :
warnings.filterwarnings('ignore',
message='the cPickle module has been removed in Python 3.0',
category=DeprecationWarning)
import cPickle
finally :
w.__exit__()
del w
#At version 2.3 cPickle switched to using protocol instead of bin
if sys.version_info >= (2, 3):
HIGHEST_PROTOCOL = cPickle.HIGHEST_PROTOCOL
# In python 2.3.*, "cPickle.dumps" accepts no
# named parameters. "pickle.dumps" accepts them,
# so this seems a bug.
if sys.version_info < (2, 4):
def _dumps(object, protocol):
return cPickle.dumps(object, protocol)
else :
def _dumps(object, protocol):
return cPickle.dumps(object, protocol=protocol)
else:
HIGHEST_PROTOCOL = None
def _dumps(object, protocol):
return cPickle.dumps(object, bin=protocol)
if sys.version_info < (2, 6) :
try:
from UserDict import DictMixin
except ImportError:
# DictMixin is new in Python 2.3
class DictMixin: pass
MutableMapping = DictMixin
else :
import collections
MutableMapping = collections.MutableMapping
#------------------------------------------------------------------------
def open(filename, flags=db.DB_CREATE, mode=0660, filetype=db.DB_HASH,
dbenv=None, dbname=None):
"""
A simple factory function for compatibility with the standard
shleve.py module. It can be used like this, where key is a string
and data is a pickleable object:
from bsddb import dbshelve
db = dbshelve.open(filename)
db[key] = data
db.close()
"""
if type(flags) == type(''):
sflag = flags
if sflag == 'r':
flags = db.DB_RDONLY
elif sflag == 'rw':
flags = 0
elif sflag == 'w':
flags = db.DB_CREATE
elif sflag == 'c':
flags = db.DB_CREATE
elif sflag == 'n':
flags = db.DB_TRUNCATE | db.DB_CREATE
else:
raise db.DBError, "flags should be one of 'r', 'w', 'c' or 'n' or use the bsddb.db.DB_* flags"
d = DBShelf(dbenv)
d.open(filename, dbname, filetype, flags, mode)
return d
#---------------------------------------------------------------------------
class DBShelveError(db.DBError): pass
class DBShelf(MutableMapping):
"""A shelf to hold pickled objects, built upon a bsddb DB object. It
automatically pickles/unpickles data objects going to/from the DB.
"""
def __init__(self, dbenv=None):
self.db = db.DB(dbenv)
self._closed = True
if HIGHEST_PROTOCOL:
self.protocol = HIGHEST_PROTOCOL
else:
self.protocol = 1
def __del__(self):
self.close()
def __getattr__(self, name):
"""Many methods we can just pass through to the DB object.
(See below)
"""
return getattr(self.db, name)
#-----------------------------------
# Dictionary access methods
def __len__(self):
return len(self.db)
def __getitem__(self, key):
data = self.db[key]
return cPickle.loads(data)
def __setitem__(self, key, value):
data = _dumps(value, self.protocol)
self.db[key] = data
def __delitem__(self, key):
del self.db[key]
def keys(self, txn=None):
if txn is not None:
return self.db.keys(txn)
else:
return self.db.keys()
if sys.version_info >= (2, 6) :
def __iter__(self) : # XXX: Load all keys in memory :-(
for k in self.db.keys() :
yield k
# Do this when "DB" support iteration
# Or is it enough to pass thru "getattr"?
#
# def __iter__(self) :
# return self.db.__iter__()
def open(self, *args, **kwargs):
self.db.open(*args, **kwargs)
self._closed = False
def close(self, *args, **kwargs):
self.db.close(*args, **kwargs)
self._closed = True
def __repr__(self):
if self._closed:
return '<DBShelf @ 0x%x - closed>' % (id(self))
else:
return repr(dict(self.iteritems()))
def items(self, txn=None):
if txn is not None:
items = self.db.items(txn)
else:
items = self.db.items()
newitems = []
for k, v in items:
newitems.append( (k, cPickle.loads(v)) )
return newitems
def values(self, txn=None):
if txn is not None:
values = self.db.values(txn)
else:
values = self.db.values()
return map(cPickle.loads, values)
#-----------------------------------
# Other methods
def __append(self, value, txn=None):
data = _dumps(value, self.protocol)
return self.db.append(data, txn)
def append(self, value, txn=None):
if self.get_type() == db.DB_RECNO:
return self.__append(value, txn=txn)
raise DBShelveError, "append() only supported when dbshelve opened with filetype=dbshelve.db.DB_RECNO"
def associate(self, secondaryDB, callback, flags=0):
def _shelf_callback(priKey, priData, realCallback=callback):
# Safe in Python 2.x because expresion short circuit
if sys.version_info[0] < 3 or isinstance(priData, bytes) :
data = cPickle.loads(priData)
else :
data = cPickle.loads(bytes(priData, "iso8859-1")) # 8 bits
return realCallback(priKey, data)
return self.db.associate(secondaryDB, _shelf_callback, flags)
#def get(self, key, default=None, txn=None, flags=0):
def get(self, *args, **kw):
# We do it with *args and **kw so if the default value wasn't
# given nothing is passed to the extension module. That way
# an exception can be raised if set_get_returns_none is turned
# off.
data = self.db.get(*args, **kw)
try:
return cPickle.loads(data)
except (EOFError, TypeError, cPickle.UnpicklingError):
return data # we may be getting the default value, or None,
# so it doesn't need unpickled.
def get_both(self, key, value, txn=None, flags=0):
data = _dumps(value, self.protocol)
data = self.db.get(key, data, txn, flags)
return cPickle.loads(data)
def cursor(self, txn=None, flags=0):
c = DBShelfCursor(self.db.cursor(txn, flags))
c.protocol = self.protocol
return c
def put(self, key, value, txn=None, flags=0):
data = _dumps(value, self.protocol)
return self.db.put(key, data, txn, flags)
def join(self, cursorList, flags=0):
raise NotImplementedError
#----------------------------------------------
# Methods allowed to pass-through to self.db
#
# close, delete, fd, get_byteswapped, get_type, has_key,
# key_range, open, remove, rename, stat, sync,
# upgrade, verify, and all set_* methods.
#---------------------------------------------------------------------------
class DBShelfCursor:
"""
"""
def __init__(self, cursor):
self.dbc = cursor
def __del__(self):
self.close()
def __getattr__(self, name):
"""Some methods we can just pass through to the cursor object. (See below)"""
return getattr(self.dbc, name)
#----------------------------------------------
def dup(self, flags=0):
c = DBShelfCursor(self.dbc.dup(flags))
c.protocol = self.protocol
return c
def put(self, key, value, flags=0):
data = _dumps(value, self.protocol)
return self.dbc.put(key, data, flags)
def get(self, *args):
count = len(args) # a method overloading hack
method = getattr(self, 'get_%d' % count)
method(*args)
def get_1(self, flags):
rec = self.dbc.get(flags)
return self._extract(rec)
def get_2(self, key, flags):
rec = self.dbc.get(key, flags)
return self._extract(rec)
def get_3(self, key, value, flags):
data = _dumps(value, self.protocol)
rec = self.dbc.get(key, flags)
return self._extract(rec)
def current(self, flags=0): return self.get_1(flags|db.DB_CURRENT)
def first(self, flags=0): return self.get_1(flags|db.DB_FIRST)
def last(self, flags=0): return self.get_1(flags|db.DB_LAST)
def next(self, flags=0): return self.get_1(flags|db.DB_NEXT)
def prev(self, flags=0): return self.get_1(flags|db.DB_PREV)
def consume(self, flags=0): return self.get_1(flags|db.DB_CONSUME)
def next_dup(self, flags=0): return self.get_1(flags|db.DB_NEXT_DUP)
def next_nodup(self, flags=0): return self.get_1(flags|db.DB_NEXT_NODUP)
def prev_nodup(self, flags=0): return self.get_1(flags|db.DB_PREV_NODUP)
def get_both(self, key, value, flags=0):
data = _dumps(value, self.protocol)
rec = self.dbc.get_both(key, flags)
return self._extract(rec)
def set(self, key, flags=0):
rec = self.dbc.set(key, flags)
return self._extract(rec)
def set_range(self, key, flags=0):
rec = self.dbc.set_range(key, flags)
return self._extract(rec)
def set_recno(self, recno, flags=0):
rec = self.dbc.set_recno(recno, flags)
return self._extract(rec)
set_both = get_both
def _extract(self, rec):
if rec is None:
return None
else:
key, data = rec
# Safe in Python 2.x because expresion short circuit
if sys.version_info[0] < 3 or isinstance(data, bytes) :
return key, cPickle.loads(data)
else :
return key, cPickle.loads(bytes(data, "iso8859-1")) # 8 bits
#----------------------------------------------
# Methods allowed to pass-through to self.dbc
#
# close, count, delete, get_recno, join_item
#---------------------------------------------------------------------------
| Python |
"""
File-like objects that read from or write to a bsddb record.
This implements (nearly) all stdio methods.
f = DBRecIO(db, key, txn=None)
f.close() # explicitly release resources held
flag = f.isatty() # always false
pos = f.tell() # get current position
f.seek(pos) # set current position
f.seek(pos, mode) # mode 0: absolute; 1: relative; 2: relative to EOF
buf = f.read() # read until EOF
buf = f.read(n) # read up to n bytes
f.truncate([size]) # truncate file at to at most size (default: current pos)
f.write(buf) # write at current position
f.writelines(list) # for line in list: f.write(line)
Notes:
- fileno() is left unimplemented so that code which uses it triggers
an exception early.
- There's a simple test set (see end of this file) - not yet updated
for DBRecIO.
- readline() is not implemented yet.
From:
Itamar Shtull-Trauring <itamar@maxnm.com>
"""
import errno
import string
class DBRecIO:
def __init__(self, db, key, txn=None):
self.db = db
self.key = key
self.txn = txn
self.len = None
self.pos = 0
self.closed = 0
self.softspace = 0
def close(self):
if not self.closed:
self.closed = 1
del self.db, self.txn
def isatty(self):
if self.closed:
raise ValueError, "I/O operation on closed file"
return 0
def seek(self, pos, mode = 0):
if self.closed:
raise ValueError, "I/O operation on closed file"
if mode == 1:
pos = pos + self.pos
elif mode == 2:
pos = pos + self.len
self.pos = max(0, pos)
def tell(self):
if self.closed:
raise ValueError, "I/O operation on closed file"
return self.pos
def read(self, n = -1):
if self.closed:
raise ValueError, "I/O operation on closed file"
if n < 0:
newpos = self.len
else:
newpos = min(self.pos+n, self.len)
dlen = newpos - self.pos
r = self.db.get(self.key, txn=self.txn, dlen=dlen, doff=self.pos)
self.pos = newpos
return r
__fixme = """
def readline(self, length=None):
if self.closed:
raise ValueError, "I/O operation on closed file"
if self.buflist:
self.buf = self.buf + string.joinfields(self.buflist, '')
self.buflist = []
i = string.find(self.buf, '\n', self.pos)
if i < 0:
newpos = self.len
else:
newpos = i+1
if length is not None:
if self.pos + length < newpos:
newpos = self.pos + length
r = self.buf[self.pos:newpos]
self.pos = newpos
return r
def readlines(self, sizehint = 0):
total = 0
lines = []
line = self.readline()
while line:
lines.append(line)
total += len(line)
if 0 < sizehint <= total:
break
line = self.readline()
return lines
"""
def truncate(self, size=None):
if self.closed:
raise ValueError, "I/O operation on closed file"
if size is None:
size = self.pos
elif size < 0:
raise IOError(errno.EINVAL,
"Negative size not allowed")
elif size < self.pos:
self.pos = size
self.db.put(self.key, "", txn=self.txn, dlen=self.len-size, doff=size)
def write(self, s):
if self.closed:
raise ValueError, "I/O operation on closed file"
if not s: return
if self.pos > self.len:
self.buflist.append('\0'*(self.pos - self.len))
self.len = self.pos
newpos = self.pos + len(s)
self.db.put(self.key, s, txn=self.txn, dlen=len(s), doff=self.pos)
self.pos = newpos
def writelines(self, list):
self.write(string.joinfields(list, ''))
def flush(self):
if self.closed:
raise ValueError, "I/O operation on closed file"
"""
# A little test suite
def _test():
import sys
if sys.argv[1:]:
file = sys.argv[1]
else:
file = '/etc/passwd'
lines = open(file, 'r').readlines()
text = open(file, 'r').read()
f = StringIO()
for line in lines[:-2]:
f.write(line)
f.writelines(lines[-2:])
if f.getvalue() != text:
raise RuntimeError, 'write failed'
length = f.tell()
print 'File length =', length
f.seek(len(lines[0]))
f.write(lines[1])
f.seek(0)
print 'First line =', repr(f.readline())
here = f.tell()
line = f.readline()
print 'Second line =', repr(line)
f.seek(-len(line), 1)
line2 = f.read(len(line))
if line != line2:
raise RuntimeError, 'bad result after seek back'
f.seek(len(line2), 1)
list = f.readlines()
line = list[-1]
f.seek(f.tell() - len(line))
line2 = f.read()
if line != line2:
raise RuntimeError, 'bad result after seek back from EOF'
print 'Read', len(list), 'more lines'
print 'File length =', f.tell()
if f.tell() != length:
raise RuntimeError, 'bad length'
f.close()
if __name__ == '__main__':
_test()
"""
| Python |
#----------------------------------------------------------------------
# Copyright (c) 1999-2001, Digital Creations, Fredericksburg, VA, USA
# and Andrew Kuchling. All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are
# met:
#
# o Redistributions of source code must retain the above copyright
# notice, this list of conditions, and the disclaimer that follows.
#
# o Redistributions in binary form must reproduce the above copyright
# notice, this list of conditions, and the following disclaimer in
# the documentation and/or other materials provided with the
# distribution.
#
# o Neither the name of Digital Creations nor the names of its
# contributors may be used to endorse or promote products derived
# from this software without specific prior written permission.
#
# THIS SOFTWARE IS PROVIDED BY DIGITAL CREATIONS AND CONTRIBUTORS *AS
# IS* AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED
# TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A
# PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL DIGITAL
# CREATIONS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS
# OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR
# TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE
# USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH
# DAMAGE.
#----------------------------------------------------------------------
# This module is just a placeholder for possible future expansion, in
# case we ever want to augment the stuff in _db in any way. For now
# it just simply imports everything from _db.
import sys
absolute_import = (sys.version_info[0] >= 3)
if not absolute_import :
if __name__.startswith('bsddb3.') :
# import _pybsddb binary as it should be the more recent version from
# a standalone pybsddb addon package than the version included with
# python as bsddb._bsddb.
from _pybsddb import *
from _pybsddb import __version__
else:
from _bsddb import *
from _bsddb import __version__
else :
# Because this syntaxis is not valid before Python 2.5
if __name__.startswith('bsddb3.') :
exec("from ._pybsddb import *")
exec("from ._pybsddb import __version__")
else :
exec("from ._bsddb import *")
exec("from ._bsddb import __version__")
| Python |
#!/usr/bin/env python
#------------------------------------------------------------------------
# Copyright (c) 1997-2001 by Total Control Software
# All Rights Reserved
#------------------------------------------------------------------------
#
# Module Name: dbShelve.py
#
# Description: A reimplementation of the standard shelve.py that
# forces the use of cPickle, and DB.
#
# Creation Date: 11/3/97 3:39:04PM
#
# License: This is free software. You may use this software for any
# purpose including modification/redistribution, so long as
# this header remains intact and that you do not claim any
# rights of ownership or authorship of this software. This
# software has been tested, but no warranty is expressed or
# implied.
#
# 13-Dec-2000: Updated to be used with the new bsddb3 package.
# Added DBShelfCursor class.
#
#------------------------------------------------------------------------
"""Manage shelves of pickled objects using bsddb database files for the
storage.
"""
#------------------------------------------------------------------------
import sys
absolute_import = (sys.version_info[0] >= 3)
if absolute_import :
# Because this syntaxis is not valid before Python 2.5
exec("from . import db")
else :
import db
if sys.version_info[0] >= 3 :
import cPickle # Will be converted to "pickle" by "2to3"
else :
if sys.version_info < (2, 6) :
import cPickle
else :
# When we drop support for python 2.3 and 2.4
# we could use: (in 2.5 we need a __future__ statement)
#
# with warnings.catch_warnings():
# warnings.filterwarnings(...)
# ...
#
# We can not use "with" as is, because it would be invalid syntax
# in python 2.3, 2.4 and (with no __future__) 2.5.
# Here we simulate "with" following PEP 343 :
import warnings
w = warnings.catch_warnings()
w.__enter__()
try :
warnings.filterwarnings('ignore',
message='the cPickle module has been removed in Python 3.0',
category=DeprecationWarning)
import cPickle
finally :
w.__exit__()
del w
#At version 2.3 cPickle switched to using protocol instead of bin
if sys.version_info >= (2, 3):
HIGHEST_PROTOCOL = cPickle.HIGHEST_PROTOCOL
# In python 2.3.*, "cPickle.dumps" accepts no
# named parameters. "pickle.dumps" accepts them,
# so this seems a bug.
if sys.version_info < (2, 4):
def _dumps(object, protocol):
return cPickle.dumps(object, protocol)
else :
def _dumps(object, protocol):
return cPickle.dumps(object, protocol=protocol)
else:
HIGHEST_PROTOCOL = None
def _dumps(object, protocol):
return cPickle.dumps(object, bin=protocol)
if sys.version_info < (2, 6) :
try:
from UserDict import DictMixin
except ImportError:
# DictMixin is new in Python 2.3
class DictMixin: pass
MutableMapping = DictMixin
else :
import collections
MutableMapping = collections.MutableMapping
#------------------------------------------------------------------------
def open(filename, flags=db.DB_CREATE, mode=0660, filetype=db.DB_HASH,
dbenv=None, dbname=None):
"""
A simple factory function for compatibility with the standard
shleve.py module. It can be used like this, where key is a string
and data is a pickleable object:
from bsddb import dbshelve
db = dbshelve.open(filename)
db[key] = data
db.close()
"""
if type(flags) == type(''):
sflag = flags
if sflag == 'r':
flags = db.DB_RDONLY
elif sflag == 'rw':
flags = 0
elif sflag == 'w':
flags = db.DB_CREATE
elif sflag == 'c':
flags = db.DB_CREATE
elif sflag == 'n':
flags = db.DB_TRUNCATE | db.DB_CREATE
else:
raise db.DBError, "flags should be one of 'r', 'w', 'c' or 'n' or use the bsddb.db.DB_* flags"
d = DBShelf(dbenv)
d.open(filename, dbname, filetype, flags, mode)
return d
#---------------------------------------------------------------------------
class DBShelveError(db.DBError): pass
class DBShelf(MutableMapping):
"""A shelf to hold pickled objects, built upon a bsddb DB object. It
automatically pickles/unpickles data objects going to/from the DB.
"""
def __init__(self, dbenv=None):
self.db = db.DB(dbenv)
self._closed = True
if HIGHEST_PROTOCOL:
self.protocol = HIGHEST_PROTOCOL
else:
self.protocol = 1
def __del__(self):
self.close()
def __getattr__(self, name):
"""Many methods we can just pass through to the DB object.
(See below)
"""
return getattr(self.db, name)
#-----------------------------------
# Dictionary access methods
def __len__(self):
return len(self.db)
def __getitem__(self, key):
data = self.db[key]
return cPickle.loads(data)
def __setitem__(self, key, value):
data = _dumps(value, self.protocol)
self.db[key] = data
def __delitem__(self, key):
del self.db[key]
def keys(self, txn=None):
if txn is not None:
return self.db.keys(txn)
else:
return self.db.keys()
if sys.version_info >= (2, 6) :
def __iter__(self) : # XXX: Load all keys in memory :-(
for k in self.db.keys() :
yield k
# Do this when "DB" support iteration
# Or is it enough to pass thru "getattr"?
#
# def __iter__(self) :
# return self.db.__iter__()
def open(self, *args, **kwargs):
self.db.open(*args, **kwargs)
self._closed = False
def close(self, *args, **kwargs):
self.db.close(*args, **kwargs)
self._closed = True
def __repr__(self):
if self._closed:
return '<DBShelf @ 0x%x - closed>' % (id(self))
else:
return repr(dict(self.iteritems()))
def items(self, txn=None):
if txn is not None:
items = self.db.items(txn)
else:
items = self.db.items()
newitems = []
for k, v in items:
newitems.append( (k, cPickle.loads(v)) )
return newitems
def values(self, txn=None):
if txn is not None:
values = self.db.values(txn)
else:
values = self.db.values()
return map(cPickle.loads, values)
#-----------------------------------
# Other methods
def __append(self, value, txn=None):
data = _dumps(value, self.protocol)
return self.db.append(data, txn)
def append(self, value, txn=None):
if self.get_type() == db.DB_RECNO:
return self.__append(value, txn=txn)
raise DBShelveError, "append() only supported when dbshelve opened with filetype=dbshelve.db.DB_RECNO"
def associate(self, secondaryDB, callback, flags=0):
def _shelf_callback(priKey, priData, realCallback=callback):
# Safe in Python 2.x because expresion short circuit
if sys.version_info[0] < 3 or isinstance(priData, bytes) :
data = cPickle.loads(priData)
else :
data = cPickle.loads(bytes(priData, "iso8859-1")) # 8 bits
return realCallback(priKey, data)
return self.db.associate(secondaryDB, _shelf_callback, flags)
#def get(self, key, default=None, txn=None, flags=0):
def get(self, *args, **kw):
# We do it with *args and **kw so if the default value wasn't
# given nothing is passed to the extension module. That way
# an exception can be raised if set_get_returns_none is turned
# off.
data = self.db.get(*args, **kw)
try:
return cPickle.loads(data)
except (EOFError, TypeError, cPickle.UnpicklingError):
return data # we may be getting the default value, or None,
# so it doesn't need unpickled.
def get_both(self, key, value, txn=None, flags=0):
data = _dumps(value, self.protocol)
data = self.db.get(key, data, txn, flags)
return cPickle.loads(data)
def cursor(self, txn=None, flags=0):
c = DBShelfCursor(self.db.cursor(txn, flags))
c.protocol = self.protocol
return c
def put(self, key, value, txn=None, flags=0):
data = _dumps(value, self.protocol)
return self.db.put(key, data, txn, flags)
def join(self, cursorList, flags=0):
raise NotImplementedError
#----------------------------------------------
# Methods allowed to pass-through to self.db
#
# close, delete, fd, get_byteswapped, get_type, has_key,
# key_range, open, remove, rename, stat, sync,
# upgrade, verify, and all set_* methods.
#---------------------------------------------------------------------------
class DBShelfCursor:
"""
"""
def __init__(self, cursor):
self.dbc = cursor
def __del__(self):
self.close()
def __getattr__(self, name):
"""Some methods we can just pass through to the cursor object. (See below)"""
return getattr(self.dbc, name)
#----------------------------------------------
def dup(self, flags=0):
c = DBShelfCursor(self.dbc.dup(flags))
c.protocol = self.protocol
return c
def put(self, key, value, flags=0):
data = _dumps(value, self.protocol)
return self.dbc.put(key, data, flags)
def get(self, *args):
count = len(args) # a method overloading hack
method = getattr(self, 'get_%d' % count)
method(*args)
def get_1(self, flags):
rec = self.dbc.get(flags)
return self._extract(rec)
def get_2(self, key, flags):
rec = self.dbc.get(key, flags)
return self._extract(rec)
def get_3(self, key, value, flags):
data = _dumps(value, self.protocol)
rec = self.dbc.get(key, flags)
return self._extract(rec)
def current(self, flags=0): return self.get_1(flags|db.DB_CURRENT)
def first(self, flags=0): return self.get_1(flags|db.DB_FIRST)
def last(self, flags=0): return self.get_1(flags|db.DB_LAST)
def next(self, flags=0): return self.get_1(flags|db.DB_NEXT)
def prev(self, flags=0): return self.get_1(flags|db.DB_PREV)
def consume(self, flags=0): return self.get_1(flags|db.DB_CONSUME)
def next_dup(self, flags=0): return self.get_1(flags|db.DB_NEXT_DUP)
def next_nodup(self, flags=0): return self.get_1(flags|db.DB_NEXT_NODUP)
def prev_nodup(self, flags=0): return self.get_1(flags|db.DB_PREV_NODUP)
def get_both(self, key, value, flags=0):
data = _dumps(value, self.protocol)
rec = self.dbc.get_both(key, flags)
return self._extract(rec)
def set(self, key, flags=0):
rec = self.dbc.set(key, flags)
return self._extract(rec)
def set_range(self, key, flags=0):
rec = self.dbc.set_range(key, flags)
return self._extract(rec)
def set_recno(self, recno, flags=0):
rec = self.dbc.set_recno(recno, flags)
return self._extract(rec)
set_both = get_both
def _extract(self, rec):
if rec is None:
return None
else:
key, data = rec
# Safe in Python 2.x because expresion short circuit
if sys.version_info[0] < 3 or isinstance(data, bytes) :
return key, cPickle.loads(data)
else :
return key, cPickle.loads(bytes(data, "iso8859-1")) # 8 bits
#----------------------------------------------
# Methods allowed to pass-through to self.dbc
#
# close, count, delete, get_recno, join_item
#---------------------------------------------------------------------------
| Python |
#-----------------------------------------------------------------------
#
# Copyright (C) 2000, 2001 by Autonomous Zone Industries
# Copyright (C) 2002 Gregory P. Smith
#
# License: This is free software. You may use this software for any
# purpose including modification/redistribution, so long as
# this header remains intact and that you do not claim any
# rights of ownership or authorship of this software. This
# software has been tested, but no warranty is expressed or
# implied.
#
# -- Gregory P. Smith <greg@krypto.org>
# This provides a simple database table interface built on top of
# the Python Berkeley DB 3 interface.
#
_cvsid = '$Id$'
import re
import sys
import copy
import random
import struct
if sys.version_info[0] >= 3 :
import pickle
else :
if sys.version_info < (2, 6) :
import cPickle as pickle
else :
# When we drop support for python 2.3 and 2.4
# we could use: (in 2.5 we need a __future__ statement)
#
# with warnings.catch_warnings():
# warnings.filterwarnings(...)
# ...
#
# We can not use "with" as is, because it would be invalid syntax
# in python 2.3, 2.4 and (with no __future__) 2.5.
# Here we simulate "with" following PEP 343 :
import warnings
w = warnings.catch_warnings()
w.__enter__()
try :
warnings.filterwarnings('ignore',
message='the cPickle module has been removed in Python 3.0',
category=DeprecationWarning)
import cPickle as pickle
finally :
w.__exit__()
del w
try:
# For Pythons w/distutils pybsddb
from bsddb3 import db
except ImportError:
# For Python 2.3
from bsddb import db
class TableDBError(StandardError):
pass
class TableAlreadyExists(TableDBError):
pass
class Cond:
"""This condition matches everything"""
def __call__(self, s):
return 1
class ExactCond(Cond):
"""Acts as an exact match condition function"""
def __init__(self, strtomatch):
self.strtomatch = strtomatch
def __call__(self, s):
return s == self.strtomatch
class PrefixCond(Cond):
"""Acts as a condition function for matching a string prefix"""
def __init__(self, prefix):
self.prefix = prefix
def __call__(self, s):
return s[:len(self.prefix)] == self.prefix
class PostfixCond(Cond):
"""Acts as a condition function for matching a string postfix"""
def __init__(self, postfix):
self.postfix = postfix
def __call__(self, s):
return s[-len(self.postfix):] == self.postfix
class LikeCond(Cond):
"""
Acts as a function that will match using an SQL 'LIKE' style
string. Case insensitive and % signs are wild cards.
This isn't perfect but it should work for the simple common cases.
"""
def __init__(self, likestr, re_flags=re.IGNORECASE):
# escape python re characters
chars_to_escape = '.*+()[]?'
for char in chars_to_escape :
likestr = likestr.replace(char, '\\'+char)
# convert %s to wildcards
self.likestr = likestr.replace('%', '.*')
self.re = re.compile('^'+self.likestr+'$', re_flags)
def __call__(self, s):
return self.re.match(s)
#
# keys used to store database metadata
#
_table_names_key = '__TABLE_NAMES__' # list of the tables in this db
_columns = '._COLUMNS__' # table_name+this key contains a list of columns
def _columns_key(table):
return table + _columns
#
# these keys are found within table sub databases
#
_data = '._DATA_.' # this+column+this+rowid key contains table data
_rowid = '._ROWID_.' # this+rowid+this key contains a unique entry for each
# row in the table. (no data is stored)
_rowid_str_len = 8 # length in bytes of the unique rowid strings
def _data_key(table, col, rowid):
return table + _data + col + _data + rowid
def _search_col_data_key(table, col):
return table + _data + col + _data
def _search_all_data_key(table):
return table + _data
def _rowid_key(table, rowid):
return table + _rowid + rowid + _rowid
def _search_rowid_key(table):
return table + _rowid
def contains_metastrings(s) :
"""Verify that the given string does not contain any
metadata strings that might interfere with dbtables database operation.
"""
if (s.find(_table_names_key) >= 0 or
s.find(_columns) >= 0 or
s.find(_data) >= 0 or
s.find(_rowid) >= 0):
# Then
return 1
else:
return 0
class bsdTableDB :
def __init__(self, filename, dbhome, create=0, truncate=0, mode=0600,
recover=0, dbflags=0):
"""bsdTableDB(filename, dbhome, create=0, truncate=0, mode=0600)
Open database name in the dbhome Berkeley DB directory.
Use keyword arguments when calling this constructor.
"""
self.db = None
myflags = db.DB_THREAD
if create:
myflags |= db.DB_CREATE
flagsforenv = (db.DB_INIT_MPOOL | db.DB_INIT_LOCK | db.DB_INIT_LOG |
db.DB_INIT_TXN | dbflags)
# DB_AUTO_COMMIT isn't a valid flag for env.open()
try:
dbflags |= db.DB_AUTO_COMMIT
except AttributeError:
pass
if recover:
flagsforenv = flagsforenv | db.DB_RECOVER
self.env = db.DBEnv()
# enable auto deadlock avoidance
self.env.set_lk_detect(db.DB_LOCK_DEFAULT)
self.env.open(dbhome, myflags | flagsforenv)
if truncate:
myflags |= db.DB_TRUNCATE
self.db = db.DB(self.env)
# this code relies on DBCursor.set* methods to raise exceptions
# rather than returning None
self.db.set_get_returns_none(1)
# allow duplicate entries [warning: be careful w/ metadata]
self.db.set_flags(db.DB_DUP)
self.db.open(filename, db.DB_BTREE, dbflags | myflags, mode)
self.dbfilename = filename
if sys.version_info[0] >= 3 :
class cursor_py3k(object) :
def __init__(self, dbcursor) :
self._dbcursor = dbcursor
def close(self) :
return self._dbcursor.close()
def set_range(self, search) :
v = self._dbcursor.set_range(bytes(search, "iso8859-1"))
if v is not None :
v = (v[0].decode("iso8859-1"),
v[1].decode("iso8859-1"))
return v
def __next__(self) :
v = getattr(self._dbcursor, "next")()
if v is not None :
v = (v[0].decode("iso8859-1"),
v[1].decode("iso8859-1"))
return v
class db_py3k(object) :
def __init__(self, db) :
self._db = db
def cursor(self, txn=None) :
return cursor_py3k(self._db.cursor(txn=txn))
def has_key(self, key, txn=None) :
return getattr(self._db,"has_key")(bytes(key, "iso8859-1"),
txn=txn)
def put(self, key, value, flags=0, txn=None) :
key = bytes(key, "iso8859-1")
if value is not None :
value = bytes(value, "iso8859-1")
return self._db.put(key, value, flags=flags, txn=txn)
def put_bytes(self, key, value, txn=None) :
key = bytes(key, "iso8859-1")
return self._db.put(key, value, txn=txn)
def get(self, key, txn=None, flags=0) :
key = bytes(key, "iso8859-1")
v = self._db.get(key, txn=txn, flags=flags)
if v is not None :
v = v.decode("iso8859-1")
return v
def get_bytes(self, key, txn=None, flags=0) :
key = bytes(key, "iso8859-1")
return self._db.get(key, txn=txn, flags=flags)
def delete(self, key, txn=None) :
key = bytes(key, "iso8859-1")
return self._db.delete(key, txn=txn)
def close (self) :
return self._db.close()
self.db = db_py3k(self.db)
else : # Python 2.x
pass
# Initialize the table names list if this is a new database
txn = self.env.txn_begin()
try:
if not getattr(self.db, "has_key")(_table_names_key, txn):
getattr(self.db, "put_bytes", self.db.put) \
(_table_names_key, pickle.dumps([], 1), txn=txn)
# Yes, bare except
except:
txn.abort()
raise
else:
txn.commit()
# TODO verify more of the database's metadata?
self.__tablecolumns = {}
def __del__(self):
self.close()
def close(self):
if self.db is not None:
self.db.close()
self.db = None
if self.env is not None:
self.env.close()
self.env = None
def checkpoint(self, mins=0):
self.env.txn_checkpoint(mins)
def sync(self):
self.db.sync()
def _db_print(self) :
"""Print the database to stdout for debugging"""
print "******** Printing raw database for debugging ********"
cur = self.db.cursor()
try:
key, data = cur.first()
while 1:
print repr({key: data})
next = cur.next()
if next:
key, data = next
else:
cur.close()
return
except db.DBNotFoundError:
cur.close()
def CreateTable(self, table, columns):
"""CreateTable(table, columns) - Create a new table in the database.
raises TableDBError if it already exists or for other DB errors.
"""
assert isinstance(columns, list)
txn = None
try:
# checking sanity of the table and column names here on
# table creation will prevent problems elsewhere.
if contains_metastrings(table):
raise ValueError(
"bad table name: contains reserved metastrings")
for column in columns :
if contains_metastrings(column):
raise ValueError(
"bad column name: contains reserved metastrings")
columnlist_key = _columns_key(table)
if getattr(self.db, "has_key")(columnlist_key):
raise TableAlreadyExists, "table already exists"
txn = self.env.txn_begin()
# store the table's column info
getattr(self.db, "put_bytes", self.db.put)(columnlist_key,
pickle.dumps(columns, 1), txn=txn)
# add the table name to the tablelist
tablelist = pickle.loads(getattr(self.db, "get_bytes",
self.db.get) (_table_names_key, txn=txn, flags=db.DB_RMW))
tablelist.append(table)
# delete 1st, in case we opened with DB_DUP
self.db.delete(_table_names_key, txn=txn)
getattr(self.db, "put_bytes", self.db.put)(_table_names_key,
pickle.dumps(tablelist, 1), txn=txn)
txn.commit()
txn = None
except db.DBError, dberror:
if txn:
txn.abort()
if sys.version_info < (2, 6) :
raise TableDBError, dberror[1]
else :
raise TableDBError, dberror.args[1]
def ListTableColumns(self, table):
"""Return a list of columns in the given table.
[] if the table doesn't exist.
"""
assert isinstance(table, str)
if contains_metastrings(table):
raise ValueError, "bad table name: contains reserved metastrings"
columnlist_key = _columns_key(table)
if not getattr(self.db, "has_key")(columnlist_key):
return []
pickledcolumnlist = getattr(self.db, "get_bytes",
self.db.get)(columnlist_key)
if pickledcolumnlist:
return pickle.loads(pickledcolumnlist)
else:
return []
def ListTables(self):
"""Return a list of tables in this database."""
pickledtablelist = self.db.get_get(_table_names_key)
if pickledtablelist:
return pickle.loads(pickledtablelist)
else:
return []
def CreateOrExtendTable(self, table, columns):
"""CreateOrExtendTable(table, columns)
Create a new table in the database.
If a table of this name already exists, extend it to have any
additional columns present in the given list as well as
all of its current columns.
"""
assert isinstance(columns, list)
try:
self.CreateTable(table, columns)
except TableAlreadyExists:
# the table already existed, add any new columns
txn = None
try:
columnlist_key = _columns_key(table)
txn = self.env.txn_begin()
# load the current column list
oldcolumnlist = pickle.loads(
getattr(self.db, "get_bytes",
self.db.get)(columnlist_key, txn=txn, flags=db.DB_RMW))
# create a hash table for fast lookups of column names in the
# loop below
oldcolumnhash = {}
for c in oldcolumnlist:
oldcolumnhash[c] = c
# create a new column list containing both the old and new
# column names
newcolumnlist = copy.copy(oldcolumnlist)
for c in columns:
if not c in oldcolumnhash:
newcolumnlist.append(c)
# store the table's new extended column list
if newcolumnlist != oldcolumnlist :
# delete the old one first since we opened with DB_DUP
self.db.delete(columnlist_key, txn=txn)
getattr(self.db, "put_bytes", self.db.put)(columnlist_key,
pickle.dumps(newcolumnlist, 1),
txn=txn)
txn.commit()
txn = None
self.__load_column_info(table)
except db.DBError, dberror:
if txn:
txn.abort()
if sys.version_info < (2, 6) :
raise TableDBError, dberror[1]
else :
raise TableDBError, dberror.args[1]
def __load_column_info(self, table) :
"""initialize the self.__tablecolumns dict"""
# check the column names
try:
tcolpickles = getattr(self.db, "get_bytes",
self.db.get)(_columns_key(table))
except db.DBNotFoundError:
raise TableDBError, "unknown table: %r" % (table,)
if not tcolpickles:
raise TableDBError, "unknown table: %r" % (table,)
self.__tablecolumns[table] = pickle.loads(tcolpickles)
def __new_rowid(self, table, txn) :
"""Create a new unique row identifier"""
unique = 0
while not unique:
# Generate a random 64-bit row ID string
# (note: might have <64 bits of true randomness
# but it's plenty for our database id needs!)
blist = []
for x in xrange(_rowid_str_len):
blist.append(random.randint(0,255))
newid = struct.pack('B'*_rowid_str_len, *blist)
if sys.version_info[0] >= 3 :
newid = newid.decode("iso8859-1") # 8 bits
# Guarantee uniqueness by adding this key to the database
try:
self.db.put(_rowid_key(table, newid), None, txn=txn,
flags=db.DB_NOOVERWRITE)
except db.DBKeyExistError:
pass
else:
unique = 1
return newid
def Insert(self, table, rowdict) :
"""Insert(table, datadict) - Insert a new row into the table
using the keys+values from rowdict as the column values.
"""
txn = None
try:
if not getattr(self.db, "has_key")(_columns_key(table)):
raise TableDBError, "unknown table"
# check the validity of each column name
if not table in self.__tablecolumns:
self.__load_column_info(table)
for column in rowdict.keys() :
if not self.__tablecolumns[table].count(column):
raise TableDBError, "unknown column: %r" % (column,)
# get a unique row identifier for this row
txn = self.env.txn_begin()
rowid = self.__new_rowid(table, txn=txn)
# insert the row values into the table database
for column, dataitem in rowdict.items():
# store the value
self.db.put(_data_key(table, column, rowid), dataitem, txn=txn)
txn.commit()
txn = None
except db.DBError, dberror:
# WIBNI we could just abort the txn and re-raise the exception?
# But no, because TableDBError is not related to DBError via
# inheritance, so it would be backwards incompatible. Do the next
# best thing.
info = sys.exc_info()
if txn:
txn.abort()
self.db.delete(_rowid_key(table, rowid))
if sys.version_info < (2, 6) :
raise TableDBError, dberror[1], info[2]
else :
raise TableDBError, dberror.args[1], info[2]
def Modify(self, table, conditions={}, mappings={}):
"""Modify(table, conditions={}, mappings={}) - Modify items in rows matching 'conditions' using mapping functions in 'mappings'
* table - the table name
* conditions - a dictionary keyed on column names containing
a condition callable expecting the data string as an
argument and returning a boolean.
* mappings - a dictionary keyed on column names containing a
condition callable expecting the data string as an argument and
returning the new string for that column.
"""
try:
matching_rowids = self.__Select(table, [], conditions)
# modify only requested columns
columns = mappings.keys()
for rowid in matching_rowids.keys():
txn = None
try:
for column in columns:
txn = self.env.txn_begin()
# modify the requested column
try:
dataitem = self.db.get(
_data_key(table, column, rowid),
txn=txn)
self.db.delete(
_data_key(table, column, rowid),
txn=txn)
except db.DBNotFoundError:
# XXXXXXX row key somehow didn't exist, assume no
# error
dataitem = None
dataitem = mappings[column](dataitem)
if dataitem is not None:
self.db.put(
_data_key(table, column, rowid),
dataitem, txn=txn)
txn.commit()
txn = None
# catch all exceptions here since we call unknown callables
except:
if txn:
txn.abort()
raise
except db.DBError, dberror:
if sys.version_info < (2, 6) :
raise TableDBError, dberror[1]
else :
raise TableDBError, dberror.args[1]
def Delete(self, table, conditions={}):
"""Delete(table, conditions) - Delete items matching the given
conditions from the table.
* conditions - a dictionary keyed on column names containing
condition functions expecting the data string as an
argument and returning a boolean.
"""
try:
matching_rowids = self.__Select(table, [], conditions)
# delete row data from all columns
columns = self.__tablecolumns[table]
for rowid in matching_rowids.keys():
txn = None
try:
txn = self.env.txn_begin()
for column in columns:
# delete the data key
try:
self.db.delete(_data_key(table, column, rowid),
txn=txn)
except db.DBNotFoundError:
# XXXXXXX column may not exist, assume no error
pass
try:
self.db.delete(_rowid_key(table, rowid), txn=txn)
except db.DBNotFoundError:
# XXXXXXX row key somehow didn't exist, assume no error
pass
txn.commit()
txn = None
except db.DBError, dberror:
if txn:
txn.abort()
raise
except db.DBError, dberror:
if sys.version_info < (2, 6) :
raise TableDBError, dberror[1]
else :
raise TableDBError, dberror.args[1]
def Select(self, table, columns, conditions={}):
"""Select(table, columns, conditions) - retrieve specific row data
Returns a list of row column->value mapping dictionaries.
* columns - a list of which column data to return. If
columns is None, all columns will be returned.
* conditions - a dictionary keyed on column names
containing callable conditions expecting the data string as an
argument and returning a boolean.
"""
try:
if not table in self.__tablecolumns:
self.__load_column_info(table)
if columns is None:
columns = self.__tablecolumns[table]
matching_rowids = self.__Select(table, columns, conditions)
except db.DBError, dberror:
if sys.version_info < (2, 6) :
raise TableDBError, dberror[1]
else :
raise TableDBError, dberror.args[1]
# return the matches as a list of dictionaries
return matching_rowids.values()
def __Select(self, table, columns, conditions):
"""__Select() - Used to implement Select and Delete (above)
Returns a dictionary keyed on rowids containing dicts
holding the row data for columns listed in the columns param
that match the given conditions.
* conditions is a dictionary keyed on column names
containing callable conditions expecting the data string as an
argument and returning a boolean.
"""
# check the validity of each column name
if not table in self.__tablecolumns:
self.__load_column_info(table)
if columns is None:
columns = self.tablecolumns[table]
for column in (columns + conditions.keys()):
if not self.__tablecolumns[table].count(column):
raise TableDBError, "unknown column: %r" % (column,)
# keyed on rows that match so far, containings dicts keyed on
# column names containing the data for that row and column.
matching_rowids = {}
# keys are rowids that do not match
rejected_rowids = {}
# attempt to sort the conditions in such a way as to minimize full
# column lookups
def cmp_conditions(atuple, btuple):
a = atuple[1]
b = btuple[1]
if type(a) is type(b):
# Needed for python 3. "cmp" vanished in 3.0.1
def cmp(a, b) :
if a==b : return 0
if a<b : return -1
return 1
if isinstance(a, PrefixCond) and isinstance(b, PrefixCond):
# longest prefix first
return cmp(len(b.prefix), len(a.prefix))
if isinstance(a, LikeCond) and isinstance(b, LikeCond):
# longest likestr first
return cmp(len(b.likestr), len(a.likestr))
return 0
if isinstance(a, ExactCond):
return -1
if isinstance(b, ExactCond):
return 1
if isinstance(a, PrefixCond):
return -1
if isinstance(b, PrefixCond):
return 1
# leave all unknown condition callables alone as equals
return 0
if sys.version_info < (2, 6) :
conditionlist = conditions.items()
conditionlist.sort(cmp_conditions)
else : # Insertion Sort. Please, improve
conditionlist = []
for i in conditions.items() :
for j, k in enumerate(conditionlist) :
r = cmp_conditions(k, i)
if r == 1 :
conditionlist.insert(j, i)
break
else :
conditionlist.append(i)
# Apply conditions to column data to find what we want
cur = self.db.cursor()
column_num = -1
for column, condition in conditionlist:
column_num = column_num + 1
searchkey = _search_col_data_key(table, column)
# speedup: don't linear search columns within loop
if column in columns:
savethiscolumndata = 1 # save the data for return
else:
savethiscolumndata = 0 # data only used for selection
try:
key, data = cur.set_range(searchkey)
while key[:len(searchkey)] == searchkey:
# extract the rowid from the key
rowid = key[-_rowid_str_len:]
if not rowid in rejected_rowids:
# if no condition was specified or the condition
# succeeds, add row to our match list.
if not condition or condition(data):
if not rowid in matching_rowids:
matching_rowids[rowid] = {}
if savethiscolumndata:
matching_rowids[rowid][column] = data
else:
if rowid in matching_rowids:
del matching_rowids[rowid]
rejected_rowids[rowid] = rowid
key, data = cur.next()
except db.DBError, dberror:
if dberror.args[0] != db.DB_NOTFOUND:
raise
continue
cur.close()
# we're done selecting rows, garbage collect the reject list
del rejected_rowids
# extract any remaining desired column data from the
# database for the matching rows.
if len(columns) > 0:
for rowid, rowdata in matching_rowids.items():
for column in columns:
if column in rowdata:
continue
try:
rowdata[column] = self.db.get(
_data_key(table, column, rowid))
except db.DBError, dberror:
if sys.version_info < (2, 6) :
if dberror[0] != db.DB_NOTFOUND:
raise
else :
if dberror.args[0] != db.DB_NOTFOUND:
raise
rowdata[column] = None
# return the matches
return matching_rowids
def Drop(self, table):
"""Remove an entire table from the database"""
txn = None
try:
txn = self.env.txn_begin()
# delete the column list
self.db.delete(_columns_key(table), txn=txn)
cur = self.db.cursor(txn)
# delete all keys containing this tables column and row info
table_key = _search_all_data_key(table)
while 1:
try:
key, data = cur.set_range(table_key)
except db.DBNotFoundError:
break
# only delete items in this table
if key[:len(table_key)] != table_key:
break
cur.delete()
# delete all rowids used by this table
table_key = _search_rowid_key(table)
while 1:
try:
key, data = cur.set_range(table_key)
except db.DBNotFoundError:
break
# only delete items in this table
if key[:len(table_key)] != table_key:
break
cur.delete()
cur.close()
# delete the tablename from the table name list
tablelist = pickle.loads(
getattr(self.db, "get_bytes", self.db.get)(_table_names_key,
txn=txn, flags=db.DB_RMW))
try:
tablelist.remove(table)
except ValueError:
# hmm, it wasn't there, oh well, that's what we want.
pass
# delete 1st, incase we opened with DB_DUP
self.db.delete(_table_names_key, txn=txn)
getattr(self.db, "put_bytes", self.db.put)(_table_names_key,
pickle.dumps(tablelist, 1), txn=txn)
txn.commit()
txn = None
if table in self.__tablecolumns:
del self.__tablecolumns[table]
except db.DBError, dberror:
if txn:
txn.abort()
raise TableDBError(dberror.args[1])
| Python |
#----------------------------------------------------------------------
# Copyright (c) 1999-2001, Digital Creations, Fredericksburg, VA, USA
# and Andrew Kuchling. All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are
# met:
#
# o Redistributions of source code must retain the above copyright
# notice, this list of conditions, and the disclaimer that follows.
#
# o Redistributions in binary form must reproduce the above copyright
# notice, this list of conditions, and the following disclaimer in
# the documentation and/or other materials provided with the
# distribution.
#
# o Neither the name of Digital Creations nor the names of its
# contributors may be used to endorse or promote products derived
# from this software without specific prior written permission.
#
# THIS SOFTWARE IS PROVIDED BY DIGITAL CREATIONS AND CONTRIBUTORS *AS
# IS* AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED
# TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A
# PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL DIGITAL
# CREATIONS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS
# OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR
# TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE
# USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH
# DAMAGE.
#----------------------------------------------------------------------
"""Support for Berkeley DB 4.1 through 4.8 with a simple interface.
For the full featured object oriented interface use the bsddb.db module
instead. It mirrors the Oracle Berkeley DB C API.
"""
import sys
absolute_import = (sys.version_info[0] >= 3)
if (sys.version_info >= (2, 6)) and (sys.version_info < (3, 0)) :
import warnings
if sys.py3kwarning and (__name__ != 'bsddb3') :
warnings.warnpy3k("in 3.x, the bsddb module has been removed; "
"please use the pybsddb project instead",
DeprecationWarning, 2)
warnings.filterwarnings("ignore", ".*CObject.*", DeprecationWarning,
"bsddb.__init__")
try:
if __name__ == 'bsddb3':
# import _pybsddb binary as it should be the more recent version from
# a standalone pybsddb addon package than the version included with
# python as bsddb._bsddb.
if absolute_import :
# Because this syntaxis is not valid before Python 2.5
exec("from . import _pybsddb")
else :
import _pybsddb
_bsddb = _pybsddb
from bsddb3.dbutils import DeadlockWrap as _DeadlockWrap
else:
import _bsddb
from bsddb.dbutils import DeadlockWrap as _DeadlockWrap
except ImportError:
# Remove ourselves from sys.modules
import sys
del sys.modules[__name__]
raise
# bsddb3 calls it db, but provide _db for backwards compatibility
db = _db = _bsddb
__version__ = db.__version__
error = db.DBError # So bsddb.error will mean something...
#----------------------------------------------------------------------
import sys, os
from weakref import ref
if sys.version_info < (2, 6) :
import UserDict
MutableMapping = UserDict.DictMixin
else :
import collections
MutableMapping = collections.MutableMapping
class _iter_mixin(MutableMapping):
def _make_iter_cursor(self):
cur = _DeadlockWrap(self.db.cursor)
key = id(cur)
self._cursor_refs[key] = ref(cur, self._gen_cref_cleaner(key))
return cur
def _gen_cref_cleaner(self, key):
# use generate the function for the weakref callback here
# to ensure that we do not hold a strict reference to cur
# in the callback.
return lambda ref: self._cursor_refs.pop(key, None)
def __iter__(self):
self._kill_iteration = False
self._in_iter += 1
try:
try:
cur = self._make_iter_cursor()
# FIXME-20031102-greg: race condition. cursor could
# be closed by another thread before this call.
# since we're only returning keys, we call the cursor
# methods with flags=0, dlen=0, dofs=0
key = _DeadlockWrap(cur.first, 0,0,0)[0]
yield key
next = getattr(cur, "next")
while 1:
try:
key = _DeadlockWrap(next, 0,0,0)[0]
yield key
except _bsddb.DBCursorClosedError:
if self._kill_iteration:
raise RuntimeError('Database changed size '
'during iteration.')
cur = self._make_iter_cursor()
# FIXME-20031101-greg: race condition. cursor could
# be closed by another thread before this call.
_DeadlockWrap(cur.set, key,0,0,0)
next = getattr(cur, "next")
except _bsddb.DBNotFoundError:
pass
except _bsddb.DBCursorClosedError:
# the database was modified during iteration. abort.
pass
# When Python 2.3 not supported in bsddb3, we can change this to "finally"
except :
self._in_iter -= 1
raise
self._in_iter -= 1
def iteritems(self):
if not self.db:
return
self._kill_iteration = False
self._in_iter += 1
try:
try:
cur = self._make_iter_cursor()
# FIXME-20031102-greg: race condition. cursor could
# be closed by another thread before this call.
kv = _DeadlockWrap(cur.first)
key = kv[0]
yield kv
next = getattr(cur, "next")
while 1:
try:
kv = _DeadlockWrap(next)
key = kv[0]
yield kv
except _bsddb.DBCursorClosedError:
if self._kill_iteration:
raise RuntimeError('Database changed size '
'during iteration.')
cur = self._make_iter_cursor()
# FIXME-20031101-greg: race condition. cursor could
# be closed by another thread before this call.
_DeadlockWrap(cur.set, key,0,0,0)
next = getattr(cur, "next")
except _bsddb.DBNotFoundError:
pass
except _bsddb.DBCursorClosedError:
# the database was modified during iteration. abort.
pass
# When Python 2.3 not supported in bsddb3, we can change this to "finally"
except :
self._in_iter -= 1
raise
self._in_iter -= 1
class _DBWithCursor(_iter_mixin):
"""
A simple wrapper around DB that makes it look like the bsddbobject in
the old module. It uses a cursor as needed to provide DB traversal.
"""
def __init__(self, db):
self.db = db
self.db.set_get_returns_none(0)
# FIXME-20031101-greg: I believe there is still the potential
# for deadlocks in a multithreaded environment if someone
# attempts to use the any of the cursor interfaces in one
# thread while doing a put or delete in another thread. The
# reason is that _checkCursor and _closeCursors are not atomic
# operations. Doing our own locking around self.dbc,
# self.saved_dbc_key and self._cursor_refs could prevent this.
# TODO: A test case demonstrating the problem needs to be written.
# self.dbc is a DBCursor object used to implement the
# first/next/previous/last/set_location methods.
self.dbc = None
self.saved_dbc_key = None
# a collection of all DBCursor objects currently allocated
# by the _iter_mixin interface.
self._cursor_refs = {}
self._in_iter = 0
self._kill_iteration = False
def __del__(self):
self.close()
def _checkCursor(self):
if self.dbc is None:
self.dbc = _DeadlockWrap(self.db.cursor)
if self.saved_dbc_key is not None:
_DeadlockWrap(self.dbc.set, self.saved_dbc_key)
self.saved_dbc_key = None
# This method is needed for all non-cursor DB calls to avoid
# Berkeley DB deadlocks (due to being opened with DB_INIT_LOCK
# and DB_THREAD to be thread safe) when intermixing database
# operations that use the cursor internally with those that don't.
def _closeCursors(self, save=1):
if self.dbc:
c = self.dbc
self.dbc = None
if save:
try:
self.saved_dbc_key = _DeadlockWrap(c.current, 0,0,0)[0]
except db.DBError:
pass
_DeadlockWrap(c.close)
del c
for cref in self._cursor_refs.values():
c = cref()
if c is not None:
_DeadlockWrap(c.close)
def _checkOpen(self):
if self.db is None:
raise error, "BSDDB object has already been closed"
def isOpen(self):
return self.db is not None
def __len__(self):
self._checkOpen()
return _DeadlockWrap(lambda: len(self.db)) # len(self.db)
if sys.version_info >= (2, 6) :
def __repr__(self) :
if self.isOpen() :
return repr(dict(_DeadlockWrap(self.db.items)))
return repr(dict())
def __getitem__(self, key):
self._checkOpen()
return _DeadlockWrap(lambda: self.db[key]) # self.db[key]
def __setitem__(self, key, value):
self._checkOpen()
self._closeCursors()
if self._in_iter and key not in self:
self._kill_iteration = True
def wrapF():
self.db[key] = value
_DeadlockWrap(wrapF) # self.db[key] = value
def __delitem__(self, key):
self._checkOpen()
self._closeCursors()
if self._in_iter and key in self:
self._kill_iteration = True
def wrapF():
del self.db[key]
_DeadlockWrap(wrapF) # del self.db[key]
def close(self):
self._closeCursors(save=0)
if self.dbc is not None:
_DeadlockWrap(self.dbc.close)
v = 0
if self.db is not None:
v = _DeadlockWrap(self.db.close)
self.dbc = None
self.db = None
return v
def keys(self):
self._checkOpen()
return _DeadlockWrap(self.db.keys)
def has_key(self, key):
self._checkOpen()
return _DeadlockWrap(self.db.has_key, key)
def set_location(self, key):
self._checkOpen()
self._checkCursor()
return _DeadlockWrap(self.dbc.set_range, key)
def next(self): # Renamed by "2to3"
self._checkOpen()
self._checkCursor()
rv = _DeadlockWrap(getattr(self.dbc, "next"))
return rv
if sys.version_info[0] >= 3 : # For "2to3" conversion
next = __next__
def previous(self):
self._checkOpen()
self._checkCursor()
rv = _DeadlockWrap(self.dbc.prev)
return rv
def first(self):
self._checkOpen()
# fix 1725856: don't needlessly try to restore our cursor position
self.saved_dbc_key = None
self._checkCursor()
rv = _DeadlockWrap(self.dbc.first)
return rv
def last(self):
self._checkOpen()
# fix 1725856: don't needlessly try to restore our cursor position
self.saved_dbc_key = None
self._checkCursor()
rv = _DeadlockWrap(self.dbc.last)
return rv
def sync(self):
self._checkOpen()
return _DeadlockWrap(self.db.sync)
#----------------------------------------------------------------------
# Compatibility object factory functions
def hashopen(file, flag='c', mode=0666, pgsize=None, ffactor=None, nelem=None,
cachesize=None, lorder=None, hflags=0):
flags = _checkflag(flag, file)
e = _openDBEnv(cachesize)
d = db.DB(e)
d.set_flags(hflags)
if pgsize is not None: d.set_pagesize(pgsize)
if lorder is not None: d.set_lorder(lorder)
if ffactor is not None: d.set_h_ffactor(ffactor)
if nelem is not None: d.set_h_nelem(nelem)
d.open(file, db.DB_HASH, flags, mode)
return _DBWithCursor(d)
#----------------------------------------------------------------------
def btopen(file, flag='c', mode=0666,
btflags=0, cachesize=None, maxkeypage=None, minkeypage=None,
pgsize=None, lorder=None):
flags = _checkflag(flag, file)
e = _openDBEnv(cachesize)
d = db.DB(e)
if pgsize is not None: d.set_pagesize(pgsize)
if lorder is not None: d.set_lorder(lorder)
d.set_flags(btflags)
if minkeypage is not None: d.set_bt_minkey(minkeypage)
if maxkeypage is not None: d.set_bt_maxkey(maxkeypage)
d.open(file, db.DB_BTREE, flags, mode)
return _DBWithCursor(d)
#----------------------------------------------------------------------
def rnopen(file, flag='c', mode=0666,
rnflags=0, cachesize=None, pgsize=None, lorder=None,
rlen=None, delim=None, source=None, pad=None):
flags = _checkflag(flag, file)
e = _openDBEnv(cachesize)
d = db.DB(e)
if pgsize is not None: d.set_pagesize(pgsize)
if lorder is not None: d.set_lorder(lorder)
d.set_flags(rnflags)
if delim is not None: d.set_re_delim(delim)
if rlen is not None: d.set_re_len(rlen)
if source is not None: d.set_re_source(source)
if pad is not None: d.set_re_pad(pad)
d.open(file, db.DB_RECNO, flags, mode)
return _DBWithCursor(d)
#----------------------------------------------------------------------
def _openDBEnv(cachesize):
e = db.DBEnv()
if cachesize is not None:
if cachesize >= 20480:
e.set_cachesize(0, cachesize)
else:
raise error, "cachesize must be >= 20480"
e.set_lk_detect(db.DB_LOCK_DEFAULT)
e.open('.', db.DB_PRIVATE | db.DB_CREATE | db.DB_THREAD | db.DB_INIT_LOCK | db.DB_INIT_MPOOL)
return e
def _checkflag(flag, file):
if flag == 'r':
flags = db.DB_RDONLY
elif flag == 'rw':
flags = 0
elif flag == 'w':
flags = db.DB_CREATE
elif flag == 'c':
flags = db.DB_CREATE
elif flag == 'n':
flags = db.DB_CREATE
#flags = db.DB_CREATE | db.DB_TRUNCATE
# we used db.DB_TRUNCATE flag for this before but Berkeley DB
# 4.2.52 changed to disallowed truncate with txn environments.
if file is not None and os.path.isfile(file):
os.unlink(file)
else:
raise error, "flags should be one of 'r', 'w', 'c' or 'n'"
return flags | db.DB_THREAD
#----------------------------------------------------------------------
# This is a silly little hack that allows apps to continue to use the
# DB_THREAD flag even on systems without threads without freaking out
# Berkeley DB.
#
# This assumes that if Python was built with thread support then
# Berkeley DB was too.
try:
# 2to3 automatically changes "import thread" to "import _thread"
import thread as T
del T
except ImportError:
db.DB_THREAD = 0
#----------------------------------------------------------------------
| Python |
#------------------------------------------------------------------------
#
# Copyright (C) 2000 Autonomous Zone Industries
#
# License: This is free software. You may use this software for any
# purpose including modification/redistribution, so long as
# this header remains intact and that you do not claim any
# rights of ownership or authorship of this software. This
# software has been tested, but no warranty is expressed or
# implied.
#
# Author: Gregory P. Smith <greg@krypto.org>
#
# Note: I don't know how useful this is in reality since when a
# DBLockDeadlockError happens the current transaction is supposed to be
# aborted. If it doesn't then when the operation is attempted again
# the deadlock is still happening...
# --Robin
#
#------------------------------------------------------------------------
#
# import the time.sleep function in a namespace safe way to allow
# "from bsddb.dbutils import *"
#
from time import sleep as _sleep
import sys
absolute_import = (sys.version_info[0] >= 3)
if absolute_import :
# Because this syntaxis is not valid before Python 2.5
exec("from . import db")
else :
import db
# always sleep at least N seconds between retrys
_deadlock_MinSleepTime = 1.0/128
# never sleep more than N seconds between retrys
_deadlock_MaxSleepTime = 3.14159
# Assign a file object to this for a "sleeping" message to be written to it
# each retry
_deadlock_VerboseFile = None
def DeadlockWrap(function, *_args, **_kwargs):
"""DeadlockWrap(function, *_args, **_kwargs) - automatically retries
function in case of a database deadlock.
This is a function intended to be used to wrap database calls such
that they perform retrys with exponentially backing off sleeps in
between when a DBLockDeadlockError exception is raised.
A 'max_retries' parameter may optionally be passed to prevent it
from retrying forever (in which case the exception will be reraised).
d = DB(...)
d.open(...)
DeadlockWrap(d.put, "foo", data="bar") # set key "foo" to "bar"
"""
sleeptime = _deadlock_MinSleepTime
max_retries = _kwargs.get('max_retries', -1)
if 'max_retries' in _kwargs:
del _kwargs['max_retries']
while True:
try:
return function(*_args, **_kwargs)
except db.DBLockDeadlockError:
if _deadlock_VerboseFile:
_deadlock_VerboseFile.write(
'dbutils.DeadlockWrap: sleeping %1.3f\n' % sleeptime)
_sleep(sleeptime)
# exponential backoff in the sleep time
sleeptime *= 2
if sleeptime > _deadlock_MaxSleepTime:
sleeptime = _deadlock_MaxSleepTime
max_retries -= 1
if max_retries == -1:
raise
#------------------------------------------------------------------------
| Python |
"""
Path operations common to more than one OS
Do not use directly. The OS specific modules import the appropriate
functions from this module themselves.
"""
import os
import stat
__all__ = ['commonprefix', 'exists', 'getatime', 'getctime', 'getmtime',
'getsize', 'isdir', 'isfile']
# Does a path exist?
# This is false for dangling symbolic links on systems that support them.
def exists(path):
"""Test whether a path exists. Returns False for broken symbolic links"""
try:
os.stat(path)
except os.error:
return False
return True
# This follows symbolic links, so both islink() and isdir() can be true
# for the same path ono systems that support symlinks
def isfile(path):
"""Test whether a path is a regular file"""
try:
st = os.stat(path)
except os.error:
return False
return stat.S_ISREG(st.st_mode)
# Is a path a directory?
# This follows symbolic links, so both islink() and isdir()
# can be true for the same path on systems that support symlinks
def isdir(s):
"""Return true if the pathname refers to an existing directory."""
try:
st = os.stat(s)
except os.error:
return False
return stat.S_ISDIR(st.st_mode)
def getsize(filename):
"""Return the size of a file, reported by os.stat()."""
return os.stat(filename).st_size
def getmtime(filename):
"""Return the last modification time of a file, reported by os.stat()."""
return os.stat(filename).st_mtime
def getatime(filename):
"""Return the last access time of a file, reported by os.stat()."""
return os.stat(filename).st_atime
def getctime(filename):
"""Return the metadata change time of a file, reported by os.stat()."""
return os.stat(filename).st_ctime
# Return the longest prefix of all list elements.
def commonprefix(m):
"Given a list of pathnames, returns the longest common leading component"
if not m: return ''
s1 = min(m)
s2 = max(m)
for i, c in enumerate(s1):
if c != s2[i]:
return s1[:i]
return s1
# Split a path in root and extension.
# The extension is everything starting at the last dot in the last
# pathname component; the root is everything before that.
# It is always true that root + ext == p.
# Generic implementation of splitext, to be parametrized with
# the separators
def _splitext(p, sep, altsep, extsep):
"""Split the extension from a pathname.
Extension is everything from the last dot to the end, ignoring
leading dots. Returns "(root, ext)"; ext may be empty."""
sepIndex = p.rfind(sep)
if altsep:
altsepIndex = p.rfind(altsep)
sepIndex = max(sepIndex, altsepIndex)
dotIndex = p.rfind(extsep)
if dotIndex > sepIndex:
# skip all leading dots
filenameIndex = sepIndex + 1
while filenameIndex < dotIndex:
if p[filenameIndex] != extsep:
return p[:dotIndex], p[dotIndex:]
filenameIndex += 1
return p, ''
| Python |
"""runpy.py - locating and running Python code using the module namespace
Provides support for locating and running Python scripts using the Python
module namespace instead of the native filesystem.
This allows Python code to play nicely with non-filesystem based PEP 302
importers when locating support scripts as well as when importing modules.
"""
# Written by Nick Coghlan <ncoghlan at gmail.com>
# to implement PEP 338 (Executing Modules as Scripts)
import sys
import imp
from pkgutil import read_code
try:
from imp import get_loader
except ImportError:
from pkgutil import get_loader
__all__ = [
"run_module", "run_path",
]
class _TempModule(object):
"""Temporarily replace a module in sys.modules with an empty namespace"""
def __init__(self, mod_name):
self.mod_name = mod_name
self.module = imp.new_module(mod_name)
self._saved_module = []
def __enter__(self):
mod_name = self.mod_name
try:
self._saved_module.append(sys.modules[mod_name])
except KeyError:
pass
sys.modules[mod_name] = self.module
return self
def __exit__(self, *args):
if self._saved_module:
sys.modules[self.mod_name] = self._saved_module[0]
else:
del sys.modules[self.mod_name]
self._saved_module = []
class _ModifiedArgv0(object):
def __init__(self, value):
self.value = value
self._saved_value = self._sentinel = object()
def __enter__(self):
if self._saved_value is not self._sentinel:
raise RuntimeError("Already preserving saved value")
self._saved_value = sys.argv[0]
sys.argv[0] = self.value
def __exit__(self, *args):
self.value = self._sentinel
sys.argv[0] = self._saved_value
def _run_code(code, run_globals, init_globals=None,
mod_name=None, mod_fname=None,
mod_loader=None, pkg_name=None):
"""Helper to run code in nominated namespace"""
if init_globals is not None:
run_globals.update(init_globals)
run_globals.update(__name__ = mod_name,
__file__ = mod_fname,
__loader__ = mod_loader,
__package__ = pkg_name)
exec code in run_globals
return run_globals
def _run_module_code(code, init_globals=None,
mod_name=None, mod_fname=None,
mod_loader=None, pkg_name=None):
"""Helper to run code in new namespace with sys modified"""
with _TempModule(mod_name) as temp_module, _ModifiedArgv0(mod_fname):
mod_globals = temp_module.module.__dict__
_run_code(code, mod_globals, init_globals,
mod_name, mod_fname, mod_loader, pkg_name)
# Copy the globals of the temporary module, as they
# may be cleared when the temporary module goes away
return mod_globals.copy()
# This helper is needed due to a missing component in the PEP 302
# loader protocol (specifically, "get_filename" is non-standard)
# Since we can't introduce new features in maintenance releases,
# support was added to zipimporter under the name '_get_filename'
def _get_filename(loader, mod_name):
for attr in ("get_filename", "_get_filename"):
meth = getattr(loader, attr, None)
if meth is not None:
return meth(mod_name)
return None
# Helper to get the loader, code and filename for a module
def _get_module_details(mod_name):
loader = get_loader(mod_name)
if loader is None:
raise ImportError("No module named %s" % mod_name)
if loader.is_package(mod_name):
if mod_name == "__main__" or mod_name.endswith(".__main__"):
raise ImportError("Cannot use package as __main__ module")
try:
pkg_main_name = mod_name + ".__main__"
return _get_module_details(pkg_main_name)
except ImportError, e:
raise ImportError(("%s; %r is a package and cannot " +
"be directly executed") %(e, mod_name))
code = loader.get_code(mod_name)
if code is None:
raise ImportError("No code object available for %s" % mod_name)
filename = _get_filename(loader, mod_name)
return mod_name, loader, code, filename
def _get_main_module_details():
# Helper that gives a nicer error message when attempting to
# execute a zipfile or directory by invoking __main__.py
main_name = "__main__"
try:
return _get_module_details(main_name)
except ImportError as exc:
if main_name in str(exc):
raise ImportError("can't find %r module in %r" %
(main_name, sys.path[0]))
raise
# This function is the actual implementation of the -m switch and direct
# execution of zipfiles and directories and is deliberately kept private.
# This avoids a repeat of the situation where run_module() no longer met the
# needs of mainmodule.c, but couldn't be changed because it was public
def _run_module_as_main(mod_name, alter_argv=True):
"""Runs the designated module in the __main__ namespace
Note that the executed module will have full access to the
__main__ namespace. If this is not desirable, the run_module()
function should be used to run the module code in a fresh namespace.
At the very least, these variables in __main__ will be overwritten:
__name__
__file__
__loader__
__package__
"""
try:
if alter_argv or mod_name != "__main__": # i.e. -m switch
mod_name, loader, code, fname = _get_module_details(mod_name)
else: # i.e. directory or zipfile execution
mod_name, loader, code, fname = _get_main_module_details()
except ImportError as exc:
msg = "%s: %s" % (sys.executable, str(exc))
sys.exit(msg)
pkg_name = mod_name.rpartition('.')[0]
main_globals = sys.modules["__main__"].__dict__
if alter_argv:
sys.argv[0] = fname
return _run_code(code, main_globals, None,
"__main__", fname, loader, pkg_name)
def run_module(mod_name, init_globals=None,
run_name=None, alter_sys=False):
"""Execute a module's code without importing it
Returns the resulting top level namespace dictionary
"""
mod_name, loader, code, fname = _get_module_details(mod_name)
if run_name is None:
run_name = mod_name
pkg_name = mod_name.rpartition('.')[0]
if alter_sys:
return _run_module_code(code, init_globals, run_name,
fname, loader, pkg_name)
else:
# Leave the sys module alone
return _run_code(code, {}, init_globals, run_name,
fname, loader, pkg_name)
# XXX (ncoghlan): Perhaps expose the C API function
# as imp.get_importer instead of reimplementing it in Python?
def _get_importer(path_name):
"""Python version of PyImport_GetImporter C API function"""
cache = sys.path_importer_cache
try:
importer = cache[path_name]
except KeyError:
# Not yet cached. Flag as using the
# standard machinery until we finish
# checking the hooks
cache[path_name] = None
for hook in sys.path_hooks:
try:
importer = hook(path_name)
break
except ImportError:
pass
else:
# The following check looks a bit odd. The trick is that
# NullImporter throws ImportError if the supplied path is a
# *valid* directory entry (and hence able to be handled
# by the standard import machinery)
try:
importer = imp.NullImporter(path_name)
except ImportError:
return None
cache[path_name] = importer
return importer
def _get_code_from_file(fname):
# Check for a compiled file first
with open(fname, "rb") as f:
code = read_code(f)
if code is None:
# That didn't work, so try it as normal source code
with open(fname, "rU") as f:
code = compile(f.read(), fname, 'exec')
return code
def run_path(path_name, init_globals=None, run_name=None):
"""Execute code located at the specified filesystem location
Returns the resulting top level namespace dictionary
The file path may refer directly to a Python script (i.e.
one that could be directly executed with execfile) or else
it may refer to a zipfile or directory containing a top
level __main__.py script.
"""
if run_name is None:
run_name = "<run_path>"
importer = _get_importer(path_name)
if isinstance(importer, imp.NullImporter):
# Not a valid sys.path entry, so run the code directly
# execfile() doesn't help as we want to allow compiled files
code = _get_code_from_file(path_name)
return _run_module_code(code, init_globals, run_name, path_name)
else:
# Importer is defined for path, so add it to
# the start of sys.path
sys.path.insert(0, path_name)
try:
# Here's where things are a little different from the run_module
# case. There, we only had to replace the module in sys while the
# code was running and doing so was somewhat optional. Here, we
# have no choice and we have to remove it even while we read the
# code. If we don't do this, a __loader__ attribute in the
# existing __main__ module may prevent location of the new module.
main_name = "__main__"
saved_main = sys.modules[main_name]
del sys.modules[main_name]
try:
mod_name, loader, code, fname = _get_main_module_details()
finally:
sys.modules[main_name] = saved_main
pkg_name = ""
with _TempModule(run_name) as temp_module, \
_ModifiedArgv0(path_name):
mod_globals = temp_module.module.__dict__
return _run_code(code, mod_globals, init_globals,
run_name, fname, loader, pkg_name).copy()
finally:
try:
sys.path.remove(path_name)
except ValueError:
pass
if __name__ == "__main__":
# Run the module specified as the next command line argument
if len(sys.argv) < 2:
print >> sys.stderr, "No module specified for execution"
else:
del sys.argv[0] # Make the requested module sys.argv[0]
_run_module_as_main(sys.argv[0])
| Python |
"""Recognize image file formats based on their first few bytes."""
__all__ = ["what"]
#-------------------------#
# Recognize image headers #
#-------------------------#
def what(file, h=None):
if h is None:
if isinstance(file, basestring):
f = open(file, 'rb')
h = f.read(32)
else:
location = file.tell()
h = file.read(32)
file.seek(location)
f = None
else:
f = None
try:
for tf in tests:
res = tf(h, f)
if res:
return res
finally:
if f: f.close()
return None
#---------------------------------#
# Subroutines per image file type #
#---------------------------------#
tests = []
def test_jpeg(h, f):
"""JPEG data in JFIF format"""
if h[6:10] == 'JFIF':
return 'jpeg'
tests.append(test_jpeg)
def test_exif(h, f):
"""JPEG data in Exif format"""
if h[6:10] == 'Exif':
return 'jpeg'
tests.append(test_exif)
def test_png(h, f):
if h[:8] == "\211PNG\r\n\032\n":
return 'png'
tests.append(test_png)
def test_gif(h, f):
"""GIF ('87 and '89 variants)"""
if h[:6] in ('GIF87a', 'GIF89a'):
return 'gif'
tests.append(test_gif)
def test_tiff(h, f):
"""TIFF (can be in Motorola or Intel byte order)"""
if h[:2] in ('MM', 'II'):
return 'tiff'
tests.append(test_tiff)
def test_rgb(h, f):
"""SGI image library"""
if h[:2] == '\001\332':
return 'rgb'
tests.append(test_rgb)
def test_pbm(h, f):
"""PBM (portable bitmap)"""
if len(h) >= 3 and \
h[0] == 'P' and h[1] in '14' and h[2] in ' \t\n\r':
return 'pbm'
tests.append(test_pbm)
def test_pgm(h, f):
"""PGM (portable graymap)"""
if len(h) >= 3 and \
h[0] == 'P' and h[1] in '25' and h[2] in ' \t\n\r':
return 'pgm'
tests.append(test_pgm)
def test_ppm(h, f):
"""PPM (portable pixmap)"""
if len(h) >= 3 and \
h[0] == 'P' and h[1] in '36' and h[2] in ' \t\n\r':
return 'ppm'
tests.append(test_ppm)
def test_rast(h, f):
"""Sun raster file"""
if h[:4] == '\x59\xA6\x6A\x95':
return 'rast'
tests.append(test_rast)
def test_xbm(h, f):
"""X bitmap (X10 or X11)"""
s = '#define '
if h[:len(s)] == s:
return 'xbm'
tests.append(test_xbm)
def test_bmp(h, f):
if h[:2] == 'BM':
return 'bmp'
tests.append(test_bmp)
#--------------------#
# Small test program #
#--------------------#
def test():
import sys
recursive = 0
if sys.argv[1:] and sys.argv[1] == '-r':
del sys.argv[1:2]
recursive = 1
try:
if sys.argv[1:]:
testall(sys.argv[1:], recursive, 1)
else:
testall(['.'], recursive, 1)
except KeyboardInterrupt:
sys.stderr.write('\n[Interrupted]\n')
sys.exit(1)
def testall(list, recursive, toplevel):
import sys
import os
for filename in list:
if os.path.isdir(filename):
print filename + '/:',
if recursive or toplevel:
print 'recursing down:'
import glob
names = glob.glob(os.path.join(filename, '*'))
testall(names, recursive, 0)
else:
print '*** directory (use -r) ***'
else:
print filename + ':',
sys.stdout.flush()
try:
print what(filename)
except IOError:
print '*** not found ***'
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Base class for fixers (optional, but recommended)."""
# Python imports
import logging
import itertools
# Local imports
from .patcomp import PatternCompiler
from . import pygram
from .fixer_util import does_tree_import
class BaseFix(object):
"""Optional base class for fixers.
The subclass name must be FixFooBar where FooBar is the result of
removing underscores and capitalizing the words of the fix name.
For example, the class name for a fixer named 'has_key' should be
FixHasKey.
"""
PATTERN = None # Most subclasses should override with a string literal
pattern = None # Compiled pattern, set by compile_pattern()
pattern_tree = None # Tree representation of the pattern
options = None # Options object passed to initializer
filename = None # The filename (set by set_filename)
logger = None # A logger (set by set_filename)
numbers = itertools.count(1) # For new_name()
used_names = set() # A set of all used NAMEs
order = "post" # Does the fixer prefer pre- or post-order traversal
explicit = False # Is this ignored by refactor.py -f all?
run_order = 5 # Fixers will be sorted by run order before execution
# Lower numbers will be run first.
_accept_type = None # [Advanced and not public] This tells RefactoringTool
# which node type to accept when there's not a pattern.
keep_line_order = False # For the bottom matcher: match with the
# original line order
BM_compatible = False # Compatibility with the bottom matching
# module; every fixer should set this
# manually
# Shortcut for access to Python grammar symbols
syms = pygram.python_symbols
def __init__(self, options, log):
"""Initializer. Subclass may override.
Args:
options: an dict containing the options passed to RefactoringTool
that could be used to customize the fixer through the command line.
log: a list to append warnings and other messages to.
"""
self.options = options
self.log = log
self.compile_pattern()
def compile_pattern(self):
"""Compiles self.PATTERN into self.pattern.
Subclass may override if it doesn't want to use
self.{pattern,PATTERN} in .match().
"""
if self.PATTERN is not None:
PC = PatternCompiler()
self.pattern, self.pattern_tree = PC.compile_pattern(self.PATTERN,
with_tree=True)
def set_filename(self, filename):
"""Set the filename, and a logger derived from it.
The main refactoring tool should call this.
"""
self.filename = filename
self.logger = logging.getLogger(filename)
def match(self, node):
"""Returns match for a given parse tree node.
Should return a true or false object (not necessarily a bool).
It may return a non-empty dict of matching sub-nodes as
returned by a matching pattern.
Subclass may override.
"""
results = {"node": node}
return self.pattern.match(node, results) and results
def transform(self, node, results):
"""Returns the transformation for a given parse tree node.
Args:
node: the root of the parse tree that matched the fixer.
results: a dict mapping symbolic names to part of the match.
Returns:
None, or a node that is a modified copy of the
argument node. The node argument may also be modified in-place to
effect the same change.
Subclass *must* override.
"""
raise NotImplementedError()
def new_name(self, template=u"xxx_todo_changeme"):
"""Return a string suitable for use as an identifier
The new name is guaranteed not to conflict with other identifiers.
"""
name = template
while name in self.used_names:
name = template + unicode(self.numbers.next())
self.used_names.add(name)
return name
def log_message(self, message):
if self.first_log:
self.first_log = False
self.log.append("### In file %s ###" % self.filename)
self.log.append(message)
def cannot_convert(self, node, reason=None):
"""Warn the user that a given chunk of code is not valid Python 3,
but that it cannot be converted automatically.
First argument is the top-level node for the code in question.
Optional second argument is why it can't be converted.
"""
lineno = node.get_lineno()
for_output = node.clone()
for_output.prefix = u""
msg = "Line %d: could not convert: %s"
self.log_message(msg % (lineno, for_output))
if reason:
self.log_message(reason)
def warning(self, node, reason):
"""Used for warning the user about possible uncertainty in the
translation.
First argument is the top-level node for the code in question.
Optional second argument is why it can't be converted.
"""
lineno = node.get_lineno()
self.log_message("Line %d: %s" % (lineno, reason))
def start_tree(self, tree, filename):
"""Some fixers need to maintain tree-wide state.
This method is called once, at the start of tree fix-up.
tree - the root node of the tree to be processed.
filename - the name of the file the tree came from.
"""
self.used_names = tree.used_names
self.set_filename(filename)
self.numbers = itertools.count(1)
self.first_log = True
def finish_tree(self, tree, filename):
"""Some fixers need to maintain tree-wide state.
This method is called once, at the conclusion of tree fix-up.
tree - the root node of the tree to be processed.
filename - the name of the file the tree came from.
"""
pass
class ConditionalFix(BaseFix):
""" Base class for fixers which not execute if an import is found. """
# This is the name of the import which, if found, will cause the test to be skipped
skip_on = None
def start_tree(self, *args):
super(ConditionalFix, self).start_tree(*args)
self._should_skip = None
def should_skip(self, node):
if self._should_skip is not None:
return self._should_skip
pkg = self.skip_on.split(".")
name = pkg[-1]
pkg = ".".join(pkg[:-1])
self._should_skip = does_tree_import(pkg, name, node)
return self._should_skip
| Python |
"Utility functions used by the btm_matcher module"
from . import pytree
from .pgen2 import grammar, token
from .pygram import pattern_symbols, python_symbols
syms = pattern_symbols
pysyms = python_symbols
tokens = grammar.opmap
token_labels = token
TYPE_ANY = -1
TYPE_ALTERNATIVES = -2
TYPE_GROUP = -3
class MinNode(object):
"""This class serves as an intermediate representation of the
pattern tree during the conversion to sets of leaf-to-root
subpatterns"""
def __init__(self, type=None, name=None):
self.type = type
self.name = name
self.children = []
self.leaf = False
self.parent = None
self.alternatives = []
self.group = []
def __repr__(self):
return str(self.type) + ' ' + str(self.name)
def leaf_to_root(self):
"""Internal method. Returns a characteristic path of the
pattern tree. This method must be run for all leaves until the
linear subpatterns are merged into a single"""
node = self
subp = []
while node:
if node.type == TYPE_ALTERNATIVES:
node.alternatives.append(subp)
if len(node.alternatives) == len(node.children):
#last alternative
subp = [tuple(node.alternatives)]
node.alternatives = []
node = node.parent
continue
else:
node = node.parent
subp = None
break
if node.type == TYPE_GROUP:
node.group.append(subp)
#probably should check the number of leaves
if len(node.group) == len(node.children):
subp = get_characteristic_subpattern(node.group)
node.group = []
node = node.parent
continue
else:
node = node.parent
subp = None
break
if node.type == token_labels.NAME and node.name:
#in case of type=name, use the name instead
subp.append(node.name)
else:
subp.append(node.type)
node = node.parent
return subp
def get_linear_subpattern(self):
"""Drives the leaf_to_root method. The reason that
leaf_to_root must be run multiple times is because we need to
reject 'group' matches; for example the alternative form
(a | b c) creates a group [b c] that needs to be matched. Since
matching multiple linear patterns overcomes the automaton's
capabilities, leaf_to_root merges each group into a single
choice based on 'characteristic'ity,
i.e. (a|b c) -> (a|b) if b more characteristic than c
Returns: The most 'characteristic'(as defined by
get_characteristic_subpattern) path for the compiled pattern
tree.
"""
for l in self.leaves():
subp = l.leaf_to_root()
if subp:
return subp
def leaves(self):
"Generator that returns the leaves of the tree"
for child in self.children:
for x in child.leaves():
yield x
if not self.children:
yield self
def reduce_tree(node, parent=None):
"""
Internal function. Reduces a compiled pattern tree to an
intermediate representation suitable for feeding the
automaton. This also trims off any optional pattern elements(like
[a], a*).
"""
new_node = None
#switch on the node type
if node.type == syms.Matcher:
#skip
node = node.children[0]
if node.type == syms.Alternatives :
#2 cases
if len(node.children) <= 2:
#just a single 'Alternative', skip this node
new_node = reduce_tree(node.children[0], parent)
else:
#real alternatives
new_node = MinNode(type=TYPE_ALTERNATIVES)
#skip odd children('|' tokens)
for child in node.children:
if node.children.index(child)%2:
continue
reduced = reduce_tree(child, new_node)
if reduced is not None:
new_node.children.append(reduced)
elif node.type == syms.Alternative:
if len(node.children) > 1:
new_node = MinNode(type=TYPE_GROUP)
for child in node.children:
reduced = reduce_tree(child, new_node)
if reduced:
new_node.children.append(reduced)
if not new_node.children:
# delete the group if all of the children were reduced to None
new_node = None
else:
new_node = reduce_tree(node.children[0], parent)
elif node.type == syms.Unit:
if (isinstance(node.children[0], pytree.Leaf) and
node.children[0].value == '('):
#skip parentheses
return reduce_tree(node.children[1], parent)
if ((isinstance(node.children[0], pytree.Leaf) and
node.children[0].value == '[')
or
(len(node.children)>1 and
hasattr(node.children[1], "value") and
node.children[1].value == '[')):
#skip whole unit if its optional
return None
leaf = True
details_node = None
alternatives_node = None
has_repeater = False
repeater_node = None
has_variable_name = False
for child in node.children:
if child.type == syms.Details:
leaf = False
details_node = child
elif child.type == syms.Repeater:
has_repeater = True
repeater_node = child
elif child.type == syms.Alternatives:
alternatives_node = child
if hasattr(child, 'value') and child.value == '=': # variable name
has_variable_name = True
#skip variable name
if has_variable_name:
#skip variable name, '='
name_leaf = node.children[2]
if hasattr(name_leaf, 'value') and name_leaf.value == '(':
# skip parenthesis
name_leaf = node.children[3]
else:
name_leaf = node.children[0]
#set node type
if name_leaf.type == token_labels.NAME:
#(python) non-name or wildcard
if name_leaf.value == 'any':
new_node = MinNode(type=TYPE_ANY)
else:
if hasattr(token_labels, name_leaf.value):
new_node = MinNode(type=getattr(token_labels, name_leaf.value))
else:
new_node = MinNode(type=getattr(pysyms, name_leaf.value))
elif name_leaf.type == token_labels.STRING:
#(python) name or character; remove the apostrophes from
#the string value
name = name_leaf.value.strip("'")
if name in tokens:
new_node = MinNode(type=tokens[name])
else:
new_node = MinNode(type=token_labels.NAME, name=name)
elif name_leaf.type == syms.Alternatives:
new_node = reduce_tree(alternatives_node, parent)
#handle repeaters
if has_repeater:
if repeater_node.children[0].value == '*':
#reduce to None
new_node = None
elif repeater_node.children[0].value == '+':
#reduce to a single occurence i.e. do nothing
pass
else:
#TODO: handle {min, max} repeaters
raise NotImplementedError
pass
#add children
if details_node and new_node is not None:
for child in details_node.children[1:-1]:
#skip '<', '>' markers
reduced = reduce_tree(child, new_node)
if reduced is not None:
new_node.children.append(reduced)
if new_node:
new_node.parent = parent
return new_node
def get_characteristic_subpattern(subpatterns):
"""Picks the most characteristic from a list of linear patterns
Current order used is:
names > common_names > common_chars
"""
if not isinstance(subpatterns, list):
return subpatterns
if len(subpatterns)==1:
return subpatterns[0]
# first pick out the ones containing variable names
subpatterns_with_names = []
subpatterns_with_common_names = []
common_names = ['in', 'for', 'if' , 'not', 'None']
subpatterns_with_common_chars = []
common_chars = "[]().,:"
for subpattern in subpatterns:
if any(rec_test(subpattern, lambda x: type(x) is str)):
if any(rec_test(subpattern,
lambda x: isinstance(x, str) and x in common_chars)):
subpatterns_with_common_chars.append(subpattern)
elif any(rec_test(subpattern,
lambda x: isinstance(x, str) and x in common_names)):
subpatterns_with_common_names.append(subpattern)
else:
subpatterns_with_names.append(subpattern)
if subpatterns_with_names:
subpatterns = subpatterns_with_names
elif subpatterns_with_common_names:
subpatterns = subpatterns_with_common_names
elif subpatterns_with_common_chars:
subpatterns = subpatterns_with_common_chars
# of the remaining subpatterns pick out the longest one
return max(subpatterns, key=len)
def rec_test(sequence, test_func):
"""Tests test_func on all items of sequence and items of included
sub-iterables"""
for x in sequence:
if isinstance(x, (list, tuple)):
for y in rec_test(x, test_func):
yield y
else:
yield test_func(x)
| Python |
"""
Main program for 2to3.
"""
from __future__ import with_statement
import sys
import os
import difflib
import logging
import shutil
import optparse
from . import refactor
def diff_texts(a, b, filename):
"""Return a unified diff of two strings."""
a = a.splitlines()
b = b.splitlines()
return difflib.unified_diff(a, b, filename, filename,
"(original)", "(refactored)",
lineterm="")
class StdoutRefactoringTool(refactor.MultiprocessRefactoringTool):
"""
Prints output to stdout.
"""
def __init__(self, fixers, options, explicit, nobackups, show_diffs):
self.nobackups = nobackups
self.show_diffs = show_diffs
super(StdoutRefactoringTool, self).__init__(fixers, options, explicit)
def log_error(self, msg, *args, **kwargs):
self.errors.append((msg, args, kwargs))
self.logger.error(msg, *args, **kwargs)
def write_file(self, new_text, filename, old_text, encoding):
if not self.nobackups:
# Make backup
backup = filename + ".bak"
if os.path.lexists(backup):
try:
os.remove(backup)
except os.error, err:
self.log_message("Can't remove backup %s", backup)
try:
os.rename(filename, backup)
except os.error, err:
self.log_message("Can't rename %s to %s", filename, backup)
# Actually write the new file
write = super(StdoutRefactoringTool, self).write_file
write(new_text, filename, old_text, encoding)
if not self.nobackups:
shutil.copymode(backup, filename)
def print_output(self, old, new, filename, equal):
if equal:
self.log_message("No changes to %s", filename)
else:
self.log_message("Refactored %s", filename)
if self.show_diffs:
diff_lines = diff_texts(old, new, filename)
try:
if self.output_lock is not None:
with self.output_lock:
for line in diff_lines:
print line
sys.stdout.flush()
else:
for line in diff_lines:
print line
except UnicodeEncodeError:
warn("couldn't encode %s's diff for your terminal" %
(filename,))
return
def warn(msg):
print >> sys.stderr, "WARNING: %s" % (msg,)
def main(fixer_pkg, args=None):
"""Main program.
Args:
fixer_pkg: the name of a package where the fixers are located.
args: optional; a list of command line arguments. If omitted,
sys.argv[1:] is used.
Returns a suggested exit status (0, 1, 2).
"""
# Set up option parser
parser = optparse.OptionParser(usage="2to3 [options] file|dir ...")
parser.add_option("-d", "--doctests_only", action="store_true",
help="Fix up doctests only")
parser.add_option("-f", "--fix", action="append", default=[],
help="Each FIX specifies a transformation; default: all")
parser.add_option("-j", "--processes", action="store", default=1,
type="int", help="Run 2to3 concurrently")
parser.add_option("-x", "--nofix", action="append", default=[],
help="Prevent a fixer from being run.")
parser.add_option("-l", "--list-fixes", action="store_true",
help="List available transformations")
parser.add_option("-p", "--print-function", action="store_true",
help="Modify the grammar so that print() is a function")
parser.add_option("-v", "--verbose", action="store_true",
help="More verbose logging")
parser.add_option("--no-diffs", action="store_true",
help="Don't show diffs of the refactoring")
parser.add_option("-w", "--write", action="store_true",
help="Write back modified files")
parser.add_option("-n", "--nobackups", action="store_true", default=False,
help="Don't write backups for modified files.")
# Parse command line arguments
refactor_stdin = False
flags = {}
options, args = parser.parse_args(args)
if not options.write and options.no_diffs:
warn("not writing files and not printing diffs; that's not very useful")
if not options.write and options.nobackups:
parser.error("Can't use -n without -w")
if options.list_fixes:
print "Available transformations for the -f/--fix option:"
for fixname in refactor.get_all_fix_names(fixer_pkg):
print fixname
if not args:
return 0
if not args:
print >> sys.stderr, "At least one file or directory argument required."
print >> sys.stderr, "Use --help to show usage."
return 2
if "-" in args:
refactor_stdin = True
if options.write:
print >> sys.stderr, "Can't write to stdin."
return 2
if options.print_function:
flags["print_function"] = True
# Set up logging handler
level = logging.DEBUG if options.verbose else logging.INFO
logging.basicConfig(format='%(name)s: %(message)s', level=level)
# Initialize the refactoring tool
avail_fixes = set(refactor.get_fixers_from_package(fixer_pkg))
unwanted_fixes = set(fixer_pkg + ".fix_" + fix for fix in options.nofix)
explicit = set()
if options.fix:
all_present = False
for fix in options.fix:
if fix == "all":
all_present = True
else:
explicit.add(fixer_pkg + ".fix_" + fix)
requested = avail_fixes.union(explicit) if all_present else explicit
else:
requested = avail_fixes.union(explicit)
fixer_names = requested.difference(unwanted_fixes)
rt = StdoutRefactoringTool(sorted(fixer_names), flags, sorted(explicit),
options.nobackups, not options.no_diffs)
# Refactor all files and directories passed as arguments
if not rt.errors:
if refactor_stdin:
rt.refactor_stdin()
else:
try:
rt.refactor(args, options.write, options.doctests_only,
options.processes)
except refactor.MultiprocessingUnsupported:
assert options.processes > 1
print >> sys.stderr, "Sorry, -j isn't " \
"supported on this platform."
return 1
rt.summarize()
# Return error status (0 if rt.errors is zero)
return int(bool(rt.errors))
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Pattern compiler.
The grammer is taken from PatternGrammar.txt.
The compiler compiles a pattern to a pytree.*Pattern instance.
"""
__author__ = "Guido van Rossum <guido@python.org>"
# Python imports
import os
# Fairly local imports
from .pgen2 import driver, literals, token, tokenize, parse, grammar
# Really local imports
from . import pytree
from . import pygram
# The pattern grammar file
_PATTERN_GRAMMAR_FILE = os.path.join(os.path.dirname(__file__),
"PatternGrammar.txt")
class PatternSyntaxError(Exception):
pass
def tokenize_wrapper(input):
"""Tokenizes a string suppressing significant whitespace."""
skip = set((token.NEWLINE, token.INDENT, token.DEDENT))
tokens = tokenize.generate_tokens(driver.generate_lines(input).next)
for quintuple in tokens:
type, value, start, end, line_text = quintuple
if type not in skip:
yield quintuple
class PatternCompiler(object):
def __init__(self, grammar_file=_PATTERN_GRAMMAR_FILE):
"""Initializer.
Takes an optional alternative filename for the pattern grammar.
"""
self.grammar = driver.load_grammar(grammar_file)
self.syms = pygram.Symbols(self.grammar)
self.pygrammar = pygram.python_grammar
self.pysyms = pygram.python_symbols
self.driver = driver.Driver(self.grammar, convert=pattern_convert)
def compile_pattern(self, input, debug=False, with_tree=False):
"""Compiles a pattern string to a nested pytree.*Pattern object."""
tokens = tokenize_wrapper(input)
try:
root = self.driver.parse_tokens(tokens, debug=debug)
except parse.ParseError as e:
raise PatternSyntaxError(str(e))
if with_tree:
return self.compile_node(root), root
else:
return self.compile_node(root)
def compile_node(self, node):
"""Compiles a node, recursively.
This is one big switch on the node type.
"""
# XXX Optimize certain Wildcard-containing-Wildcard patterns
# that can be merged
if node.type == self.syms.Matcher:
node = node.children[0] # Avoid unneeded recursion
if node.type == self.syms.Alternatives:
# Skip the odd children since they are just '|' tokens
alts = [self.compile_node(ch) for ch in node.children[::2]]
if len(alts) == 1:
return alts[0]
p = pytree.WildcardPattern([[a] for a in alts], min=1, max=1)
return p.optimize()
if node.type == self.syms.Alternative:
units = [self.compile_node(ch) for ch in node.children]
if len(units) == 1:
return units[0]
p = pytree.WildcardPattern([units], min=1, max=1)
return p.optimize()
if node.type == self.syms.NegatedUnit:
pattern = self.compile_basic(node.children[1:])
p = pytree.NegatedPattern(pattern)
return p.optimize()
assert node.type == self.syms.Unit
name = None
nodes = node.children
if len(nodes) >= 3 and nodes[1].type == token.EQUAL:
name = nodes[0].value
nodes = nodes[2:]
repeat = None
if len(nodes) >= 2 and nodes[-1].type == self.syms.Repeater:
repeat = nodes[-1]
nodes = nodes[:-1]
# Now we've reduced it to: STRING | NAME [Details] | (...) | [...]
pattern = self.compile_basic(nodes, repeat)
if repeat is not None:
assert repeat.type == self.syms.Repeater
children = repeat.children
child = children[0]
if child.type == token.STAR:
min = 0
max = pytree.HUGE
elif child.type == token.PLUS:
min = 1
max = pytree.HUGE
elif child.type == token.LBRACE:
assert children[-1].type == token.RBRACE
assert len(children) in (3, 5)
min = max = self.get_int(children[1])
if len(children) == 5:
max = self.get_int(children[3])
else:
assert False
if min != 1 or max != 1:
pattern = pattern.optimize()
pattern = pytree.WildcardPattern([[pattern]], min=min, max=max)
if name is not None:
pattern.name = name
return pattern.optimize()
def compile_basic(self, nodes, repeat=None):
# Compile STRING | NAME [Details] | (...) | [...]
assert len(nodes) >= 1
node = nodes[0]
if node.type == token.STRING:
value = unicode(literals.evalString(node.value))
return pytree.LeafPattern(_type_of_literal(value), value)
elif node.type == token.NAME:
value = node.value
if value.isupper():
if value not in TOKEN_MAP:
raise PatternSyntaxError("Invalid token: %r" % value)
if nodes[1:]:
raise PatternSyntaxError("Can't have details for token")
return pytree.LeafPattern(TOKEN_MAP[value])
else:
if value == "any":
type = None
elif not value.startswith("_"):
type = getattr(self.pysyms, value, None)
if type is None:
raise PatternSyntaxError("Invalid symbol: %r" % value)
if nodes[1:]: # Details present
content = [self.compile_node(nodes[1].children[1])]
else:
content = None
return pytree.NodePattern(type, content)
elif node.value == "(":
return self.compile_node(nodes[1])
elif node.value == "[":
assert repeat is None
subpattern = self.compile_node(nodes[1])
return pytree.WildcardPattern([[subpattern]], min=0, max=1)
assert False, node
def get_int(self, node):
assert node.type == token.NUMBER
return int(node.value)
# Map named tokens to the type value for a LeafPattern
TOKEN_MAP = {"NAME": token.NAME,
"STRING": token.STRING,
"NUMBER": token.NUMBER,
"TOKEN": None}
def _type_of_literal(value):
if value[0].isalpha():
return token.NAME
elif value in grammar.opmap:
return grammar.opmap[value]
else:
return None
def pattern_convert(grammar, raw_node_info):
"""Converts raw node information to a Node or Leaf instance."""
type, value, context, children = raw_node_info
if children or type in grammar.number2symbol:
return pytree.Node(type, children, context=context)
else:
return pytree.Leaf(type, value, context=context)
def compile_pattern(pattern):
return PatternCompiler().compile_pattern(pattern)
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Export the Python grammar and symbols."""
# Python imports
import os
# Local imports
from .pgen2 import token
from .pgen2 import driver
from . import pytree
# The grammar file
_GRAMMAR_FILE = os.path.join(os.path.dirname(__file__), "Grammar.txt")
_PATTERN_GRAMMAR_FILE = os.path.join(os.path.dirname(__file__),
"PatternGrammar.txt")
class Symbols(object):
def __init__(self, grammar):
"""Initializer.
Creates an attribute for each grammar symbol (nonterminal),
whose value is the symbol's type (an int >= 256).
"""
for name, symbol in grammar.symbol2number.iteritems():
setattr(self, name, symbol)
python_grammar = driver.load_grammar(_GRAMMAR_FILE)
python_symbols = Symbols(python_grammar)
python_grammar_no_print_statement = python_grammar.copy()
del python_grammar_no_print_statement.keywords["print"]
pattern_grammar = driver.load_grammar(_PATTERN_GRAMMAR_FILE)
pattern_symbols = Symbols(pattern_grammar)
| Python |
"""Utility functions, node construction macros, etc."""
# Author: Collin Winter
from itertools import islice
# Local imports
from .pgen2 import token
from .pytree import Leaf, Node
from .pygram import python_symbols as syms
from . import patcomp
###########################################################
### Common node-construction "macros"
###########################################################
def KeywordArg(keyword, value):
return Node(syms.argument,
[keyword, Leaf(token.EQUAL, u"="), value])
def LParen():
return Leaf(token.LPAR, u"(")
def RParen():
return Leaf(token.RPAR, u")")
def Assign(target, source):
"""Build an assignment statement"""
if not isinstance(target, list):
target = [target]
if not isinstance(source, list):
source.prefix = u" "
source = [source]
return Node(syms.atom,
target + [Leaf(token.EQUAL, u"=", prefix=u" ")] + source)
def Name(name, prefix=None):
"""Return a NAME leaf"""
return Leaf(token.NAME, name, prefix=prefix)
def Attr(obj, attr):
"""A node tuple for obj.attr"""
return [obj, Node(syms.trailer, [Dot(), attr])]
def Comma():
"""A comma leaf"""
return Leaf(token.COMMA, u",")
def Dot():
"""A period (.) leaf"""
return Leaf(token.DOT, u".")
def ArgList(args, lparen=LParen(), rparen=RParen()):
"""A parenthesised argument list, used by Call()"""
node = Node(syms.trailer, [lparen.clone(), rparen.clone()])
if args:
node.insert_child(1, Node(syms.arglist, args))
return node
def Call(func_name, args=None, prefix=None):
"""A function call"""
node = Node(syms.power, [func_name, ArgList(args)])
if prefix is not None:
node.prefix = prefix
return node
def Newline():
"""A newline literal"""
return Leaf(token.NEWLINE, u"\n")
def BlankLine():
"""A blank line"""
return Leaf(token.NEWLINE, u"")
def Number(n, prefix=None):
return Leaf(token.NUMBER, n, prefix=prefix)
def Subscript(index_node):
"""A numeric or string subscript"""
return Node(syms.trailer, [Leaf(token.LBRACE, u"["),
index_node,
Leaf(token.RBRACE, u"]")])
def String(string, prefix=None):
"""A string leaf"""
return Leaf(token.STRING, string, prefix=prefix)
def ListComp(xp, fp, it, test=None):
"""A list comprehension of the form [xp for fp in it if test].
If test is None, the "if test" part is omitted.
"""
xp.prefix = u""
fp.prefix = u" "
it.prefix = u" "
for_leaf = Leaf(token.NAME, u"for")
for_leaf.prefix = u" "
in_leaf = Leaf(token.NAME, u"in")
in_leaf.prefix = u" "
inner_args = [for_leaf, fp, in_leaf, it]
if test:
test.prefix = u" "
if_leaf = Leaf(token.NAME, u"if")
if_leaf.prefix = u" "
inner_args.append(Node(syms.comp_if, [if_leaf, test]))
inner = Node(syms.listmaker, [xp, Node(syms.comp_for, inner_args)])
return Node(syms.atom,
[Leaf(token.LBRACE, u"["),
inner,
Leaf(token.RBRACE, u"]")])
def FromImport(package_name, name_leafs):
""" Return an import statement in the form:
from package import name_leafs"""
# XXX: May not handle dotted imports properly (eg, package_name='foo.bar')
#assert package_name == '.' or '.' not in package_name, "FromImport has "\
# "not been tested with dotted package names -- use at your own "\
# "peril!"
for leaf in name_leafs:
# Pull the leaves out of their old tree
leaf.remove()
children = [Leaf(token.NAME, u"from"),
Leaf(token.NAME, package_name, prefix=u" "),
Leaf(token.NAME, u"import", prefix=u" "),
Node(syms.import_as_names, name_leafs)]
imp = Node(syms.import_from, children)
return imp
###########################################################
### Determine whether a node represents a given literal
###########################################################
def is_tuple(node):
"""Does the node represent a tuple literal?"""
if isinstance(node, Node) and node.children == [LParen(), RParen()]:
return True
return (isinstance(node, Node)
and len(node.children) == 3
and isinstance(node.children[0], Leaf)
and isinstance(node.children[1], Node)
and isinstance(node.children[2], Leaf)
and node.children[0].value == u"("
and node.children[2].value == u")")
def is_list(node):
"""Does the node represent a list literal?"""
return (isinstance(node, Node)
and len(node.children) > 1
and isinstance(node.children[0], Leaf)
and isinstance(node.children[-1], Leaf)
and node.children[0].value == u"["
and node.children[-1].value == u"]")
###########################################################
### Misc
###########################################################
def parenthesize(node):
return Node(syms.atom, [LParen(), node, RParen()])
consuming_calls = set(["sorted", "list", "set", "any", "all", "tuple", "sum",
"min", "max"])
def attr_chain(obj, attr):
"""Follow an attribute chain.
If you have a chain of objects where a.foo -> b, b.foo-> c, etc,
use this to iterate over all objects in the chain. Iteration is
terminated by getattr(x, attr) is None.
Args:
obj: the starting object
attr: the name of the chaining attribute
Yields:
Each successive object in the chain.
"""
next = getattr(obj, attr)
while next:
yield next
next = getattr(next, attr)
p0 = """for_stmt< 'for' any 'in' node=any ':' any* >
| comp_for< 'for' any 'in' node=any any* >
"""
p1 = """
power<
( 'iter' | 'list' | 'tuple' | 'sorted' | 'set' | 'sum' |
'any' | 'all' | (any* trailer< '.' 'join' >) )
trailer< '(' node=any ')' >
any*
>
"""
p2 = """
power<
'sorted'
trailer< '(' arglist<node=any any*> ')' >
any*
>
"""
pats_built = False
def in_special_context(node):
""" Returns true if node is in an environment where all that is required
of it is being itterable (ie, it doesn't matter if it returns a list
or an itterator).
See test_map_nochange in test_fixers.py for some examples and tests.
"""
global p0, p1, p2, pats_built
if not pats_built:
p1 = patcomp.compile_pattern(p1)
p0 = patcomp.compile_pattern(p0)
p2 = patcomp.compile_pattern(p2)
pats_built = True
patterns = [p0, p1, p2]
for pattern, parent in zip(patterns, attr_chain(node, "parent")):
results = {}
if pattern.match(parent, results) and results["node"] is node:
return True
return False
def is_probably_builtin(node):
"""
Check that something isn't an attribute or function name etc.
"""
prev = node.prev_sibling
if prev is not None and prev.type == token.DOT:
# Attribute lookup.
return False
parent = node.parent
if parent.type in (syms.funcdef, syms.classdef):
return False
if parent.type == syms.expr_stmt and parent.children[0] is node:
# Assignment.
return False
if parent.type == syms.parameters or \
(parent.type == syms.typedargslist and (
(prev is not None and prev.type == token.COMMA) or
parent.children[0] is node
)):
# The name of an argument.
return False
return True
def find_indentation(node):
"""Find the indentation of *node*."""
while node is not None:
if node.type == syms.suite and len(node.children) > 2:
indent = node.children[1]
if indent.type == token.INDENT:
return indent.value
node = node.parent
return u""
###########################################################
### The following functions are to find bindings in a suite
###########################################################
def make_suite(node):
if node.type == syms.suite:
return node
node = node.clone()
parent, node.parent = node.parent, None
suite = Node(syms.suite, [node])
suite.parent = parent
return suite
def find_root(node):
"""Find the top level namespace."""
# Scamper up to the top level namespace
while node.type != syms.file_input:
assert node.parent, "Tree is insane! root found before "\
"file_input node was found."
node = node.parent
return node
def does_tree_import(package, name, node):
""" Returns true if name is imported from package at the
top level of the tree which node belongs to.
To cover the case of an import like 'import foo', use
None for the package and 'foo' for the name. """
binding = find_binding(name, find_root(node), package)
return bool(binding)
def is_import(node):
"""Returns true if the node is an import statement."""
return node.type in (syms.import_name, syms.import_from)
def touch_import(package, name, node):
""" Works like `does_tree_import` but adds an import statement
if it was not imported. """
def is_import_stmt(node):
return (node.type == syms.simple_stmt and node.children and
is_import(node.children[0]))
root = find_root(node)
if does_tree_import(package, name, root):
return
# figure out where to insert the new import. First try to find
# the first import and then skip to the last one.
insert_pos = offset = 0
for idx, node in enumerate(root.children):
if not is_import_stmt(node):
continue
for offset, node2 in enumerate(root.children[idx:]):
if not is_import_stmt(node2):
break
insert_pos = idx + offset
break
# if there are no imports where we can insert, find the docstring.
# if that also fails, we stick to the beginning of the file
if insert_pos == 0:
for idx, node in enumerate(root.children):
if (node.type == syms.simple_stmt and node.children and
node.children[0].type == token.STRING):
insert_pos = idx + 1
break
if package is None:
import_ = Node(syms.import_name, [
Leaf(token.NAME, u"import"),
Leaf(token.NAME, name, prefix=u" ")
])
else:
import_ = FromImport(package, [Leaf(token.NAME, name, prefix=u" ")])
children = [import_, Newline()]
root.insert_child(insert_pos, Node(syms.simple_stmt, children))
_def_syms = set([syms.classdef, syms.funcdef])
def find_binding(name, node, package=None):
""" Returns the node which binds variable name, otherwise None.
If optional argument package is supplied, only imports will
be returned.
See test cases for examples."""
for child in node.children:
ret = None
if child.type == syms.for_stmt:
if _find(name, child.children[1]):
return child
n = find_binding(name, make_suite(child.children[-1]), package)
if n: ret = n
elif child.type in (syms.if_stmt, syms.while_stmt):
n = find_binding(name, make_suite(child.children[-1]), package)
if n: ret = n
elif child.type == syms.try_stmt:
n = find_binding(name, make_suite(child.children[2]), package)
if n:
ret = n
else:
for i, kid in enumerate(child.children[3:]):
if kid.type == token.COLON and kid.value == ":":
# i+3 is the colon, i+4 is the suite
n = find_binding(name, make_suite(child.children[i+4]), package)
if n: ret = n
elif child.type in _def_syms and child.children[1].value == name:
ret = child
elif _is_import_binding(child, name, package):
ret = child
elif child.type == syms.simple_stmt:
ret = find_binding(name, child, package)
elif child.type == syms.expr_stmt:
if _find(name, child.children[0]):
ret = child
if ret:
if not package:
return ret
if is_import(ret):
return ret
return None
_block_syms = set([syms.funcdef, syms.classdef, syms.trailer])
def _find(name, node):
nodes = [node]
while nodes:
node = nodes.pop()
if node.type > 256 and node.type not in _block_syms:
nodes.extend(node.children)
elif node.type == token.NAME and node.value == name:
return node
return None
def _is_import_binding(node, name, package=None):
""" Will reuturn node if node will import name, or node
will import * from package. None is returned otherwise.
See test cases for examples. """
if node.type == syms.import_name and not package:
imp = node.children[1]
if imp.type == syms.dotted_as_names:
for child in imp.children:
if child.type == syms.dotted_as_name:
if child.children[2].value == name:
return node
elif child.type == token.NAME and child.value == name:
return node
elif imp.type == syms.dotted_as_name:
last = imp.children[-1]
if last.type == token.NAME and last.value == name:
return node
elif imp.type == token.NAME and imp.value == name:
return node
elif node.type == syms.import_from:
# unicode(...) is used to make life easier here, because
# from a.b import parses to ['import', ['a', '.', 'b'], ...]
if package and unicode(node.children[1]).strip() != package:
return None
n = node.children[3]
if package and _find(u"as", n):
# See test_from_import_as for explanation
return None
elif n.type == syms.import_as_names and _find(name, n):
return node
elif n.type == syms.import_as_name:
child = n.children[2]
if child.type == token.NAME and child.value == name:
return node
elif n.type == token.NAME and n.value == name:
return node
elif package and n.type == token.STAR:
return node
return None
| Python |
#! /usr/bin/env python
"""Token constants (from "token.h")."""
# Taken from Python (r53757) and modified to include some tokens
# originally monkeypatched in by pgen2.tokenize
#--start constants--
ENDMARKER = 0
NAME = 1
NUMBER = 2
STRING = 3
NEWLINE = 4
INDENT = 5
DEDENT = 6
LPAR = 7
RPAR = 8
LSQB = 9
RSQB = 10
COLON = 11
COMMA = 12
SEMI = 13
PLUS = 14
MINUS = 15
STAR = 16
SLASH = 17
VBAR = 18
AMPER = 19
LESS = 20
GREATER = 21
EQUAL = 22
DOT = 23
PERCENT = 24
BACKQUOTE = 25
LBRACE = 26
RBRACE = 27
EQEQUAL = 28
NOTEQUAL = 29
LESSEQUAL = 30
GREATEREQUAL = 31
TILDE = 32
CIRCUMFLEX = 33
LEFTSHIFT = 34
RIGHTSHIFT = 35
DOUBLESTAR = 36
PLUSEQUAL = 37
MINEQUAL = 38
STAREQUAL = 39
SLASHEQUAL = 40
PERCENTEQUAL = 41
AMPEREQUAL = 42
VBAREQUAL = 43
CIRCUMFLEXEQUAL = 44
LEFTSHIFTEQUAL = 45
RIGHTSHIFTEQUAL = 46
DOUBLESTAREQUAL = 47
DOUBLESLASH = 48
DOUBLESLASHEQUAL = 49
AT = 50
OP = 51
COMMENT = 52
NL = 53
RARROW = 54
ERRORTOKEN = 55
N_TOKENS = 56
NT_OFFSET = 256
#--end constants--
tok_name = {}
for _name, _value in globals().items():
if type(_value) is type(0):
tok_name[_value] = _name
def ISTERMINAL(x):
return x < NT_OFFSET
def ISNONTERMINAL(x):
return x >= NT_OFFSET
def ISEOF(x):
return x == ENDMARKER
| Python |
#! /usr/bin/env python
"""Token constants (from "token.h")."""
# Taken from Python (r53757) and modified to include some tokens
# originally monkeypatched in by pgen2.tokenize
#--start constants--
ENDMARKER = 0
NAME = 1
NUMBER = 2
STRING = 3
NEWLINE = 4
INDENT = 5
DEDENT = 6
LPAR = 7
RPAR = 8
LSQB = 9
RSQB = 10
COLON = 11
COMMA = 12
SEMI = 13
PLUS = 14
MINUS = 15
STAR = 16
SLASH = 17
VBAR = 18
AMPER = 19
LESS = 20
GREATER = 21
EQUAL = 22
DOT = 23
PERCENT = 24
BACKQUOTE = 25
LBRACE = 26
RBRACE = 27
EQEQUAL = 28
NOTEQUAL = 29
LESSEQUAL = 30
GREATEREQUAL = 31
TILDE = 32
CIRCUMFLEX = 33
LEFTSHIFT = 34
RIGHTSHIFT = 35
DOUBLESTAR = 36
PLUSEQUAL = 37
MINEQUAL = 38
STAREQUAL = 39
SLASHEQUAL = 40
PERCENTEQUAL = 41
AMPEREQUAL = 42
VBAREQUAL = 43
CIRCUMFLEXEQUAL = 44
LEFTSHIFTEQUAL = 45
RIGHTSHIFTEQUAL = 46
DOUBLESTAREQUAL = 47
DOUBLESLASH = 48
DOUBLESLASHEQUAL = 49
AT = 50
OP = 51
COMMENT = 52
NL = 53
RARROW = 54
ERRORTOKEN = 55
N_TOKENS = 56
NT_OFFSET = 256
#--end constants--
tok_name = {}
for _name, _value in globals().items():
if type(_value) is type(0):
tok_name[_value] = _name
def ISTERMINAL(x):
return x < NT_OFFSET
def ISNONTERMINAL(x):
return x >= NT_OFFSET
def ISEOF(x):
return x == ENDMARKER
| Python |
# Copyright (c) 2001, 2002, 2003, 2004, 2005, 2006 Python Software Foundation.
# All rights reserved.
"""Tokenization help for Python programs.
generate_tokens(readline) is a generator that breaks a stream of
text into Python tokens. It accepts a readline-like method which is called
repeatedly to get the next line of input (or "" for EOF). It generates
5-tuples with these members:
the token type (see token.py)
the token (a string)
the starting (row, column) indices of the token (a 2-tuple of ints)
the ending (row, column) indices of the token (a 2-tuple of ints)
the original line (string)
It is designed to match the working of the Python tokenizer exactly, except
that it produces COMMENT tokens for comments and gives type OP for all
operators
Older entry points
tokenize_loop(readline, tokeneater)
tokenize(readline, tokeneater=printtoken)
are the same, except instead of generating tokens, tokeneater is a callback
function to which the 5 fields described above are passed as 5 arguments,
each time a new token is found."""
__author__ = 'Ka-Ping Yee <ping@lfw.org>'
__credits__ = \
'GvR, ESR, Tim Peters, Thomas Wouters, Fred Drake, Skip Montanaro'
import string, re
from codecs import BOM_UTF8, lookup
from lib2to3.pgen2.token import *
from . import token
__all__ = [x for x in dir(token) if x[0] != '_'] + ["tokenize",
"generate_tokens", "untokenize"]
del token
try:
bytes
except NameError:
# Support bytes type in Python <= 2.5, so 2to3 turns itself into
# valid Python 3 code.
bytes = str
def group(*choices): return '(' + '|'.join(choices) + ')'
def any(*choices): return group(*choices) + '*'
def maybe(*choices): return group(*choices) + '?'
Whitespace = r'[ \f\t]*'
Comment = r'#[^\r\n]*'
Ignore = Whitespace + any(r'\\\r?\n' + Whitespace) + maybe(Comment)
Name = r'[a-zA-Z_]\w*'
Binnumber = r'0[bB][01]*'
Hexnumber = r'0[xX][\da-fA-F]*[lL]?'
Octnumber = r'0[oO]?[0-7]*[lL]?'
Decnumber = r'[1-9]\d*[lL]?'
Intnumber = group(Binnumber, Hexnumber, Octnumber, Decnumber)
Exponent = r'[eE][-+]?\d+'
Pointfloat = group(r'\d+\.\d*', r'\.\d+') + maybe(Exponent)
Expfloat = r'\d+' + Exponent
Floatnumber = group(Pointfloat, Expfloat)
Imagnumber = group(r'\d+[jJ]', Floatnumber + r'[jJ]')
Number = group(Imagnumber, Floatnumber, Intnumber)
# Tail end of ' string.
Single = r"[^'\\]*(?:\\.[^'\\]*)*'"
# Tail end of " string.
Double = r'[^"\\]*(?:\\.[^"\\]*)*"'
# Tail end of ''' string.
Single3 = r"[^'\\]*(?:(?:\\.|'(?!''))[^'\\]*)*'''"
# Tail end of """ string.
Double3 = r'[^"\\]*(?:(?:\\.|"(?!""))[^"\\]*)*"""'
Triple = group("[ubUB]?[rR]?'''", '[ubUB]?[rR]?"""')
# Single-line ' or " string.
String = group(r"[uU]?[rR]?'[^\n'\\]*(?:\\.[^\n'\\]*)*'",
r'[uU]?[rR]?"[^\n"\\]*(?:\\.[^\n"\\]*)*"')
# Because of leftmost-then-longest match semantics, be sure to put the
# longest operators first (e.g., if = came before ==, == would get
# recognized as two instances of =).
Operator = group(r"\*\*=?", r">>=?", r"<<=?", r"<>", r"!=",
r"//=?", r"->",
r"[+\-*/%&|^=<>]=?",
r"~")
Bracket = '[][(){}]'
Special = group(r'\r?\n', r'[:;.,`@]')
Funny = group(Operator, Bracket, Special)
PlainToken = group(Number, Funny, String, Name)
Token = Ignore + PlainToken
# First (or only) line of ' or " string.
ContStr = group(r"[uUbB]?[rR]?'[^\n'\\]*(?:\\.[^\n'\\]*)*" +
group("'", r'\\\r?\n'),
r'[uUbB]?[rR]?"[^\n"\\]*(?:\\.[^\n"\\]*)*' +
group('"', r'\\\r?\n'))
PseudoExtras = group(r'\\\r?\n', Comment, Triple)
PseudoToken = Whitespace + group(PseudoExtras, Number, Funny, ContStr, Name)
tokenprog, pseudoprog, single3prog, double3prog = map(
re.compile, (Token, PseudoToken, Single3, Double3))
endprogs = {"'": re.compile(Single), '"': re.compile(Double),
"'''": single3prog, '"""': double3prog,
"r'''": single3prog, 'r"""': double3prog,
"u'''": single3prog, 'u"""': double3prog,
"b'''": single3prog, 'b"""': double3prog,
"ur'''": single3prog, 'ur"""': double3prog,
"br'''": single3prog, 'br"""': double3prog,
"R'''": single3prog, 'R"""': double3prog,
"U'''": single3prog, 'U"""': double3prog,
"B'''": single3prog, 'B"""': double3prog,
"uR'''": single3prog, 'uR"""': double3prog,
"Ur'''": single3prog, 'Ur"""': double3prog,
"UR'''": single3prog, 'UR"""': double3prog,
"bR'''": single3prog, 'bR"""': double3prog,
"Br'''": single3prog, 'Br"""': double3prog,
"BR'''": single3prog, 'BR"""': double3prog,
'r': None, 'R': None,
'u': None, 'U': None,
'b': None, 'B': None}
triple_quoted = {}
for t in ("'''", '"""',
"r'''", 'r"""', "R'''", 'R"""',
"u'''", 'u"""', "U'''", 'U"""',
"b'''", 'b"""', "B'''", 'B"""',
"ur'''", 'ur"""', "Ur'''", 'Ur"""',
"uR'''", 'uR"""', "UR'''", 'UR"""',
"br'''", 'br"""', "Br'''", 'Br"""',
"bR'''", 'bR"""', "BR'''", 'BR"""',):
triple_quoted[t] = t
single_quoted = {}
for t in ("'", '"',
"r'", 'r"', "R'", 'R"',
"u'", 'u"', "U'", 'U"',
"b'", 'b"', "B'", 'B"',
"ur'", 'ur"', "Ur'", 'Ur"',
"uR'", 'uR"', "UR'", 'UR"',
"br'", 'br"', "Br'", 'Br"',
"bR'", 'bR"', "BR'", 'BR"', ):
single_quoted[t] = t
tabsize = 8
class TokenError(Exception): pass
class StopTokenizing(Exception): pass
def printtoken(type, token, start, end, line): # for testing
(srow, scol) = start
(erow, ecol) = end
print "%d,%d-%d,%d:\t%s\t%s" % \
(srow, scol, erow, ecol, tok_name[type], repr(token))
def tokenize(readline, tokeneater=printtoken):
"""
The tokenize() function accepts two parameters: one representing the
input stream, and one providing an output mechanism for tokenize().
The first parameter, readline, must be a callable object which provides
the same interface as the readline() method of built-in file objects.
Each call to the function should return one line of input as a string.
The second parameter, tokeneater, must also be a callable object. It is
called once for each token, with five arguments, corresponding to the
tuples generated by generate_tokens().
"""
try:
tokenize_loop(readline, tokeneater)
except StopTokenizing:
pass
# backwards compatible interface
def tokenize_loop(readline, tokeneater):
for token_info in generate_tokens(readline):
tokeneater(*token_info)
class Untokenizer:
def __init__(self):
self.tokens = []
self.prev_row = 1
self.prev_col = 0
def add_whitespace(self, start):
row, col = start
assert row <= self.prev_row
col_offset = col - self.prev_col
if col_offset:
self.tokens.append(" " * col_offset)
def untokenize(self, iterable):
for t in iterable:
if len(t) == 2:
self.compat(t, iterable)
break
tok_type, token, start, end, line = t
self.add_whitespace(start)
self.tokens.append(token)
self.prev_row, self.prev_col = end
if tok_type in (NEWLINE, NL):
self.prev_row += 1
self.prev_col = 0
return "".join(self.tokens)
def compat(self, token, iterable):
startline = False
indents = []
toks_append = self.tokens.append
toknum, tokval = token
if toknum in (NAME, NUMBER):
tokval += ' '
if toknum in (NEWLINE, NL):
startline = True
for tok in iterable:
toknum, tokval = tok[:2]
if toknum in (NAME, NUMBER):
tokval += ' '
if toknum == INDENT:
indents.append(tokval)
continue
elif toknum == DEDENT:
indents.pop()
continue
elif toknum in (NEWLINE, NL):
startline = True
elif startline and indents:
toks_append(indents[-1])
startline = False
toks_append(tokval)
cookie_re = re.compile("coding[:=]\s*([-\w.]+)")
def _get_normal_name(orig_enc):
"""Imitates get_normal_name in tokenizer.c."""
# Only care about the first 12 characters.
enc = orig_enc[:12].lower().replace("_", "-")
if enc == "utf-8" or enc.startswith("utf-8-"):
return "utf-8"
if enc in ("latin-1", "iso-8859-1", "iso-latin-1") or \
enc.startswith(("latin-1-", "iso-8859-1-", "iso-latin-1-")):
return "iso-8859-1"
return orig_enc
def detect_encoding(readline):
"""
The detect_encoding() function is used to detect the encoding that should
be used to decode a Python source file. It requires one argment, readline,
in the same way as the tokenize() generator.
It will call readline a maximum of twice, and return the encoding used
(as a string) and a list of any lines (left as bytes) it has read
in.
It detects the encoding from the presence of a utf-8 bom or an encoding
cookie as specified in pep-0263. If both a bom and a cookie are present, but
disagree, a SyntaxError will be raised. If the encoding cookie is an invalid
charset, raise a SyntaxError. Note that if a utf-8 bom is found,
'utf-8-sig' is returned.
If no encoding is specified, then the default of 'utf-8' will be returned.
"""
bom_found = False
encoding = None
default = 'utf-8'
def read_or_stop():
try:
return readline()
except StopIteration:
return bytes()
def find_cookie(line):
try:
line_string = line.decode('ascii')
except UnicodeDecodeError:
return None
matches = cookie_re.findall(line_string)
if not matches:
return None
encoding = _get_normal_name(matches[0])
try:
codec = lookup(encoding)
except LookupError:
# This behaviour mimics the Python interpreter
raise SyntaxError("unknown encoding: " + encoding)
if bom_found:
if codec.name != 'utf-8':
# This behaviour mimics the Python interpreter
raise SyntaxError('encoding problem: utf-8')
encoding += '-sig'
return encoding
first = read_or_stop()
if first.startswith(BOM_UTF8):
bom_found = True
first = first[3:]
default = 'utf-8-sig'
if not first:
return default, []
encoding = find_cookie(first)
if encoding:
return encoding, [first]
second = read_or_stop()
if not second:
return default, [first]
encoding = find_cookie(second)
if encoding:
return encoding, [first, second]
return default, [first, second]
def untokenize(iterable):
"""Transform tokens back into Python source code.
Each element returned by the iterable must be a token sequence
with at least two elements, a token number and token value. If
only two tokens are passed, the resulting output is poor.
Round-trip invariant for full input:
Untokenized source will match input source exactly
Round-trip invariant for limited intput:
# Output text will tokenize the back to the input
t1 = [tok[:2] for tok in generate_tokens(f.readline)]
newcode = untokenize(t1)
readline = iter(newcode.splitlines(1)).next
t2 = [tok[:2] for tokin generate_tokens(readline)]
assert t1 == t2
"""
ut = Untokenizer()
return ut.untokenize(iterable)
def generate_tokens(readline):
"""
The generate_tokens() generator requires one argment, readline, which
must be a callable object which provides the same interface as the
readline() method of built-in file objects. Each call to the function
should return one line of input as a string. Alternately, readline
can be a callable function terminating with StopIteration:
readline = open(myfile).next # Example of alternate readline
The generator produces 5-tuples with these members: the token type; the
token string; a 2-tuple (srow, scol) of ints specifying the row and
column where the token begins in the source; a 2-tuple (erow, ecol) of
ints specifying the row and column where the token ends in the source;
and the line on which the token was found. The line passed is the
logical line; continuation lines are included.
"""
lnum = parenlev = continued = 0
namechars, numchars = string.ascii_letters + '_', '0123456789'
contstr, needcont = '', 0
contline = None
indents = [0]
while 1: # loop over lines in stream
try:
line = readline()
except StopIteration:
line = ''
lnum = lnum + 1
pos, max = 0, len(line)
if contstr: # continued string
if not line:
raise TokenError, ("EOF in multi-line string", strstart)
endmatch = endprog.match(line)
if endmatch:
pos = end = endmatch.end(0)
yield (STRING, contstr + line[:end],
strstart, (lnum, end), contline + line)
contstr, needcont = '', 0
contline = None
elif needcont and line[-2:] != '\\\n' and line[-3:] != '\\\r\n':
yield (ERRORTOKEN, contstr + line,
strstart, (lnum, len(line)), contline)
contstr = ''
contline = None
continue
else:
contstr = contstr + line
contline = contline + line
continue
elif parenlev == 0 and not continued: # new statement
if not line: break
column = 0
while pos < max: # measure leading whitespace
if line[pos] == ' ': column = column + 1
elif line[pos] == '\t': column = (column//tabsize + 1)*tabsize
elif line[pos] == '\f': column = 0
else: break
pos = pos + 1
if pos == max: break
if line[pos] in '#\r\n': # skip comments or blank lines
if line[pos] == '#':
comment_token = line[pos:].rstrip('\r\n')
nl_pos = pos + len(comment_token)
yield (COMMENT, comment_token,
(lnum, pos), (lnum, pos + len(comment_token)), line)
yield (NL, line[nl_pos:],
(lnum, nl_pos), (lnum, len(line)), line)
else:
yield ((NL, COMMENT)[line[pos] == '#'], line[pos:],
(lnum, pos), (lnum, len(line)), line)
continue
if column > indents[-1]: # count indents or dedents
indents.append(column)
yield (INDENT, line[:pos], (lnum, 0), (lnum, pos), line)
while column < indents[-1]:
if column not in indents:
raise IndentationError(
"unindent does not match any outer indentation level",
("<tokenize>", lnum, pos, line))
indents = indents[:-1]
yield (DEDENT, '', (lnum, pos), (lnum, pos), line)
else: # continued statement
if not line:
raise TokenError, ("EOF in multi-line statement", (lnum, 0))
continued = 0
while pos < max:
pseudomatch = pseudoprog.match(line, pos)
if pseudomatch: # scan for tokens
start, end = pseudomatch.span(1)
spos, epos, pos = (lnum, start), (lnum, end), end
token, initial = line[start:end], line[start]
if initial in numchars or \
(initial == '.' and token != '.'): # ordinary number
yield (NUMBER, token, spos, epos, line)
elif initial in '\r\n':
newline = NEWLINE
if parenlev > 0:
newline = NL
yield (newline, token, spos, epos, line)
elif initial == '#':
assert not token.endswith("\n")
yield (COMMENT, token, spos, epos, line)
elif token in triple_quoted:
endprog = endprogs[token]
endmatch = endprog.match(line, pos)
if endmatch: # all on one line
pos = endmatch.end(0)
token = line[start:pos]
yield (STRING, token, spos, (lnum, pos), line)
else:
strstart = (lnum, start) # multiple lines
contstr = line[start:]
contline = line
break
elif initial in single_quoted or \
token[:2] in single_quoted or \
token[:3] in single_quoted:
if token[-1] == '\n': # continued string
strstart = (lnum, start)
endprog = (endprogs[initial] or endprogs[token[1]] or
endprogs[token[2]])
contstr, needcont = line[start:], 1
contline = line
break
else: # ordinary string
yield (STRING, token, spos, epos, line)
elif initial in namechars: # ordinary name
yield (NAME, token, spos, epos, line)
elif initial == '\\': # continued stmt
# This yield is new; needed for better idempotency:
yield (NL, token, spos, (lnum, pos), line)
continued = 1
else:
if initial in '([{': parenlev = parenlev + 1
elif initial in ')]}': parenlev = parenlev - 1
yield (OP, token, spos, epos, line)
else:
yield (ERRORTOKEN, line[pos],
(lnum, pos), (lnum, pos+1), line)
pos = pos + 1
for indent in indents[1:]: # pop remaining indent levels
yield (DEDENT, '', (lnum, 0), (lnum, 0), '')
yield (ENDMARKER, '', (lnum, 0), (lnum, 0), '')
if __name__ == '__main__': # testing
import sys
if len(sys.argv) > 1: tokenize(open(sys.argv[1]).readline)
else: tokenize(sys.stdin.readline)
| Python |
# Copyright 2004-2005 Elemental Security, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Convert graminit.[ch] spit out by pgen to Python code.
Pgen is the Python parser generator. It is useful to quickly create a
parser from a grammar file in Python's grammar notation. But I don't
want my parsers to be written in C (yet), so I'm translating the
parsing tables to Python data structures and writing a Python parse
engine.
Note that the token numbers are constants determined by the standard
Python tokenizer. The standard token module defines these numbers and
their names (the names are not used much). The token numbers are
hardcoded into the Python tokenizer and into pgen. A Python
implementation of the Python tokenizer is also available, in the
standard tokenize module.
On the other hand, symbol numbers (representing the grammar's
non-terminals) are assigned by pgen based on the actual grammar
input.
Note: this module is pretty much obsolete; the pgen module generates
equivalent grammar tables directly from the Grammar.txt input file
without having to invoke the Python pgen C program.
"""
# Python imports
import re
# Local imports
from pgen2 import grammar, token
class Converter(grammar.Grammar):
"""Grammar subclass that reads classic pgen output files.
The run() method reads the tables as produced by the pgen parser
generator, typically contained in two C files, graminit.h and
graminit.c. The other methods are for internal use only.
See the base class for more documentation.
"""
def run(self, graminit_h, graminit_c):
"""Load the grammar tables from the text files written by pgen."""
self.parse_graminit_h(graminit_h)
self.parse_graminit_c(graminit_c)
self.finish_off()
def parse_graminit_h(self, filename):
"""Parse the .h file writen by pgen. (Internal)
This file is a sequence of #define statements defining the
nonterminals of the grammar as numbers. We build two tables
mapping the numbers to names and back.
"""
try:
f = open(filename)
except IOError, err:
print "Can't open %s: %s" % (filename, err)
return False
self.symbol2number = {}
self.number2symbol = {}
lineno = 0
for line in f:
lineno += 1
mo = re.match(r"^#define\s+(\w+)\s+(\d+)$", line)
if not mo and line.strip():
print "%s(%s): can't parse %s" % (filename, lineno,
line.strip())
else:
symbol, number = mo.groups()
number = int(number)
assert symbol not in self.symbol2number
assert number not in self.number2symbol
self.symbol2number[symbol] = number
self.number2symbol[number] = symbol
return True
def parse_graminit_c(self, filename):
"""Parse the .c file writen by pgen. (Internal)
The file looks as follows. The first two lines are always this:
#include "pgenheaders.h"
#include "grammar.h"
After that come four blocks:
1) one or more state definitions
2) a table defining dfas
3) a table defining labels
4) a struct defining the grammar
A state definition has the following form:
- one or more arc arrays, each of the form:
static arc arcs_<n>_<m>[<k>] = {
{<i>, <j>},
...
};
- followed by a state array, of the form:
static state states_<s>[<t>] = {
{<k>, arcs_<n>_<m>},
...
};
"""
try:
f = open(filename)
except IOError, err:
print "Can't open %s: %s" % (filename, err)
return False
# The code below essentially uses f's iterator-ness!
lineno = 0
# Expect the two #include lines
lineno, line = lineno+1, f.next()
assert line == '#include "pgenheaders.h"\n', (lineno, line)
lineno, line = lineno+1, f.next()
assert line == '#include "grammar.h"\n', (lineno, line)
# Parse the state definitions
lineno, line = lineno+1, f.next()
allarcs = {}
states = []
while line.startswith("static arc "):
while line.startswith("static arc "):
mo = re.match(r"static arc arcs_(\d+)_(\d+)\[(\d+)\] = {$",
line)
assert mo, (lineno, line)
n, m, k = map(int, mo.groups())
arcs = []
for _ in range(k):
lineno, line = lineno+1, f.next()
mo = re.match(r"\s+{(\d+), (\d+)},$", line)
assert mo, (lineno, line)
i, j = map(int, mo.groups())
arcs.append((i, j))
lineno, line = lineno+1, f.next()
assert line == "};\n", (lineno, line)
allarcs[(n, m)] = arcs
lineno, line = lineno+1, f.next()
mo = re.match(r"static state states_(\d+)\[(\d+)\] = {$", line)
assert mo, (lineno, line)
s, t = map(int, mo.groups())
assert s == len(states), (lineno, line)
state = []
for _ in range(t):
lineno, line = lineno+1, f.next()
mo = re.match(r"\s+{(\d+), arcs_(\d+)_(\d+)},$", line)
assert mo, (lineno, line)
k, n, m = map(int, mo.groups())
arcs = allarcs[n, m]
assert k == len(arcs), (lineno, line)
state.append(arcs)
states.append(state)
lineno, line = lineno+1, f.next()
assert line == "};\n", (lineno, line)
lineno, line = lineno+1, f.next()
self.states = states
# Parse the dfas
dfas = {}
mo = re.match(r"static dfa dfas\[(\d+)\] = {$", line)
assert mo, (lineno, line)
ndfas = int(mo.group(1))
for i in range(ndfas):
lineno, line = lineno+1, f.next()
mo = re.match(r'\s+{(\d+), "(\w+)", (\d+), (\d+), states_(\d+),$',
line)
assert mo, (lineno, line)
symbol = mo.group(2)
number, x, y, z = map(int, mo.group(1, 3, 4, 5))
assert self.symbol2number[symbol] == number, (lineno, line)
assert self.number2symbol[number] == symbol, (lineno, line)
assert x == 0, (lineno, line)
state = states[z]
assert y == len(state), (lineno, line)
lineno, line = lineno+1, f.next()
mo = re.match(r'\s+("(?:\\\d\d\d)*")},$', line)
assert mo, (lineno, line)
first = {}
rawbitset = eval(mo.group(1))
for i, c in enumerate(rawbitset):
byte = ord(c)
for j in range(8):
if byte & (1<<j):
first[i*8 + j] = 1
dfas[number] = (state, first)
lineno, line = lineno+1, f.next()
assert line == "};\n", (lineno, line)
self.dfas = dfas
# Parse the labels
labels = []
lineno, line = lineno+1, f.next()
mo = re.match(r"static label labels\[(\d+)\] = {$", line)
assert mo, (lineno, line)
nlabels = int(mo.group(1))
for i in range(nlabels):
lineno, line = lineno+1, f.next()
mo = re.match(r'\s+{(\d+), (0|"\w+")},$', line)
assert mo, (lineno, line)
x, y = mo.groups()
x = int(x)
if y == "0":
y = None
else:
y = eval(y)
labels.append((x, y))
lineno, line = lineno+1, f.next()
assert line == "};\n", (lineno, line)
self.labels = labels
# Parse the grammar struct
lineno, line = lineno+1, f.next()
assert line == "grammar _PyParser_Grammar = {\n", (lineno, line)
lineno, line = lineno+1, f.next()
mo = re.match(r"\s+(\d+),$", line)
assert mo, (lineno, line)
ndfas = int(mo.group(1))
assert ndfas == len(self.dfas)
lineno, line = lineno+1, f.next()
assert line == "\tdfas,\n", (lineno, line)
lineno, line = lineno+1, f.next()
mo = re.match(r"\s+{(\d+), labels},$", line)
assert mo, (lineno, line)
nlabels = int(mo.group(1))
assert nlabels == len(self.labels), (lineno, line)
lineno, line = lineno+1, f.next()
mo = re.match(r"\s+(\d+)$", line)
assert mo, (lineno, line)
start = int(mo.group(1))
assert start in self.number2symbol, (lineno, line)
self.start = start
lineno, line = lineno+1, f.next()
assert line == "};\n", (lineno, line)
try:
lineno, line = lineno+1, f.next()
except StopIteration:
pass
else:
assert 0, (lineno, line)
def finish_off(self):
"""Create additional useful structures. (Internal)."""
self.keywords = {} # map from keyword strings to arc labels
self.tokens = {} # map from numeric token values to arc labels
for ilabel, (type, value) in enumerate(self.labels):
if type == token.NAME and value is not None:
self.keywords[value] = ilabel
elif value is None:
self.tokens[type] = ilabel
| Python |
# Copyright 2004-2005 Elemental Security, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Safely evaluate Python string literals without using eval()."""
import re
simple_escapes = {"a": "\a",
"b": "\b",
"f": "\f",
"n": "\n",
"r": "\r",
"t": "\t",
"v": "\v",
"'": "'",
'"': '"',
"\\": "\\"}
def escape(m):
all, tail = m.group(0, 1)
assert all.startswith("\\")
esc = simple_escapes.get(tail)
if esc is not None:
return esc
if tail.startswith("x"):
hexes = tail[1:]
if len(hexes) < 2:
raise ValueError("invalid hex string escape ('\\%s')" % tail)
try:
i = int(hexes, 16)
except ValueError:
raise ValueError("invalid hex string escape ('\\%s')" % tail)
else:
try:
i = int(tail, 8)
except ValueError:
raise ValueError("invalid octal string escape ('\\%s')" % tail)
return chr(i)
def evalString(s):
assert s.startswith("'") or s.startswith('"'), repr(s[:1])
q = s[0]
if s[:3] == q*3:
q = q*3
assert s.endswith(q), repr(s[-len(q):])
assert len(s) >= 2*len(q)
s = s[len(q):-len(q)]
return re.sub(r"\\(\'|\"|\\|[abfnrtv]|x.{0,2}|[0-7]{1,3})", escape, s)
def test():
for i in range(256):
c = chr(i)
s = repr(c)
e = evalString(s)
if e != c:
print i, c, s, e
if __name__ == "__main__":
test()
| Python |
# Copyright 2004-2005 Elemental Security, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
# Pgen imports
from . import grammar, token, tokenize
class PgenGrammar(grammar.Grammar):
pass
class ParserGenerator(object):
def __init__(self, filename, stream=None):
close_stream = None
if stream is None:
stream = open(filename)
close_stream = stream.close
self.filename = filename
self.stream = stream
self.generator = tokenize.generate_tokens(stream.readline)
self.gettoken() # Initialize lookahead
self.dfas, self.startsymbol = self.parse()
if close_stream is not None:
close_stream()
self.first = {} # map from symbol name to set of tokens
self.addfirstsets()
def make_grammar(self):
c = PgenGrammar()
names = self.dfas.keys()
names.sort()
names.remove(self.startsymbol)
names.insert(0, self.startsymbol)
for name in names:
i = 256 + len(c.symbol2number)
c.symbol2number[name] = i
c.number2symbol[i] = name
for name in names:
dfa = self.dfas[name]
states = []
for state in dfa:
arcs = []
for label, next in state.arcs.iteritems():
arcs.append((self.make_label(c, label), dfa.index(next)))
if state.isfinal:
arcs.append((0, dfa.index(state)))
states.append(arcs)
c.states.append(states)
c.dfas[c.symbol2number[name]] = (states, self.make_first(c, name))
c.start = c.symbol2number[self.startsymbol]
return c
def make_first(self, c, name):
rawfirst = self.first[name]
first = {}
for label in rawfirst:
ilabel = self.make_label(c, label)
##assert ilabel not in first # XXX failed on <> ... !=
first[ilabel] = 1
return first
def make_label(self, c, label):
# XXX Maybe this should be a method on a subclass of converter?
ilabel = len(c.labels)
if label[0].isalpha():
# Either a symbol name or a named token
if label in c.symbol2number:
# A symbol name (a non-terminal)
if label in c.symbol2label:
return c.symbol2label[label]
else:
c.labels.append((c.symbol2number[label], None))
c.symbol2label[label] = ilabel
return ilabel
else:
# A named token (NAME, NUMBER, STRING)
itoken = getattr(token, label, None)
assert isinstance(itoken, int), label
assert itoken in token.tok_name, label
if itoken in c.tokens:
return c.tokens[itoken]
else:
c.labels.append((itoken, None))
c.tokens[itoken] = ilabel
return ilabel
else:
# Either a keyword or an operator
assert label[0] in ('"', "'"), label
value = eval(label)
if value[0].isalpha():
# A keyword
if value in c.keywords:
return c.keywords[value]
else:
c.labels.append((token.NAME, value))
c.keywords[value] = ilabel
return ilabel
else:
# An operator (any non-numeric token)
itoken = grammar.opmap[value] # Fails if unknown token
if itoken in c.tokens:
return c.tokens[itoken]
else:
c.labels.append((itoken, None))
c.tokens[itoken] = ilabel
return ilabel
def addfirstsets(self):
names = self.dfas.keys()
names.sort()
for name in names:
if name not in self.first:
self.calcfirst(name)
#print name, self.first[name].keys()
def calcfirst(self, name):
dfa = self.dfas[name]
self.first[name] = None # dummy to detect left recursion
state = dfa[0]
totalset = {}
overlapcheck = {}
for label, next in state.arcs.iteritems():
if label in self.dfas:
if label in self.first:
fset = self.first[label]
if fset is None:
raise ValueError("recursion for rule %r" % name)
else:
self.calcfirst(label)
fset = self.first[label]
totalset.update(fset)
overlapcheck[label] = fset
else:
totalset[label] = 1
overlapcheck[label] = {label: 1}
inverse = {}
for label, itsfirst in overlapcheck.iteritems():
for symbol in itsfirst:
if symbol in inverse:
raise ValueError("rule %s is ambiguous; %s is in the"
" first sets of %s as well as %s" %
(name, symbol, label, inverse[symbol]))
inverse[symbol] = label
self.first[name] = totalset
def parse(self):
dfas = {}
startsymbol = None
# MSTART: (NEWLINE | RULE)* ENDMARKER
while self.type != token.ENDMARKER:
while self.type == token.NEWLINE:
self.gettoken()
# RULE: NAME ':' RHS NEWLINE
name = self.expect(token.NAME)
self.expect(token.OP, ":")
a, z = self.parse_rhs()
self.expect(token.NEWLINE)
#self.dump_nfa(name, a, z)
dfa = self.make_dfa(a, z)
#self.dump_dfa(name, dfa)
oldlen = len(dfa)
self.simplify_dfa(dfa)
newlen = len(dfa)
dfas[name] = dfa
#print name, oldlen, newlen
if startsymbol is None:
startsymbol = name
return dfas, startsymbol
def make_dfa(self, start, finish):
# To turn an NFA into a DFA, we define the states of the DFA
# to correspond to *sets* of states of the NFA. Then do some
# state reduction. Let's represent sets as dicts with 1 for
# values.
assert isinstance(start, NFAState)
assert isinstance(finish, NFAState)
def closure(state):
base = {}
addclosure(state, base)
return base
def addclosure(state, base):
assert isinstance(state, NFAState)
if state in base:
return
base[state] = 1
for label, next in state.arcs:
if label is None:
addclosure(next, base)
states = [DFAState(closure(start), finish)]
for state in states: # NB states grows while we're iterating
arcs = {}
for nfastate in state.nfaset:
for label, next in nfastate.arcs:
if label is not None:
addclosure(next, arcs.setdefault(label, {}))
for label, nfaset in arcs.iteritems():
for st in states:
if st.nfaset == nfaset:
break
else:
st = DFAState(nfaset, finish)
states.append(st)
state.addarc(st, label)
return states # List of DFAState instances; first one is start
def dump_nfa(self, name, start, finish):
print "Dump of NFA for", name
todo = [start]
for i, state in enumerate(todo):
print " State", i, state is finish and "(final)" or ""
for label, next in state.arcs:
if next in todo:
j = todo.index(next)
else:
j = len(todo)
todo.append(next)
if label is None:
print " -> %d" % j
else:
print " %s -> %d" % (label, j)
def dump_dfa(self, name, dfa):
print "Dump of DFA for", name
for i, state in enumerate(dfa):
print " State", i, state.isfinal and "(final)" or ""
for label, next in state.arcs.iteritems():
print " %s -> %d" % (label, dfa.index(next))
def simplify_dfa(self, dfa):
# This is not theoretically optimal, but works well enough.
# Algorithm: repeatedly look for two states that have the same
# set of arcs (same labels pointing to the same nodes) and
# unify them, until things stop changing.
# dfa is a list of DFAState instances
changes = True
while changes:
changes = False
for i, state_i in enumerate(dfa):
for j in range(i+1, len(dfa)):
state_j = dfa[j]
if state_i == state_j:
#print " unify", i, j
del dfa[j]
for state in dfa:
state.unifystate(state_j, state_i)
changes = True
break
def parse_rhs(self):
# RHS: ALT ('|' ALT)*
a, z = self.parse_alt()
if self.value != "|":
return a, z
else:
aa = NFAState()
zz = NFAState()
aa.addarc(a)
z.addarc(zz)
while self.value == "|":
self.gettoken()
a, z = self.parse_alt()
aa.addarc(a)
z.addarc(zz)
return aa, zz
def parse_alt(self):
# ALT: ITEM+
a, b = self.parse_item()
while (self.value in ("(", "[") or
self.type in (token.NAME, token.STRING)):
c, d = self.parse_item()
b.addarc(c)
b = d
return a, b
def parse_item(self):
# ITEM: '[' RHS ']' | ATOM ['+' | '*']
if self.value == "[":
self.gettoken()
a, z = self.parse_rhs()
self.expect(token.OP, "]")
a.addarc(z)
return a, z
else:
a, z = self.parse_atom()
value = self.value
if value not in ("+", "*"):
return a, z
self.gettoken()
z.addarc(a)
if value == "+":
return a, z
else:
return a, a
def parse_atom(self):
# ATOM: '(' RHS ')' | NAME | STRING
if self.value == "(":
self.gettoken()
a, z = self.parse_rhs()
self.expect(token.OP, ")")
return a, z
elif self.type in (token.NAME, token.STRING):
a = NFAState()
z = NFAState()
a.addarc(z, self.value)
self.gettoken()
return a, z
else:
self.raise_error("expected (...) or NAME or STRING, got %s/%s",
self.type, self.value)
def expect(self, type, value=None):
if self.type != type or (value is not None and self.value != value):
self.raise_error("expected %s/%s, got %s/%s",
type, value, self.type, self.value)
value = self.value
self.gettoken()
return value
def gettoken(self):
tup = self.generator.next()
while tup[0] in (tokenize.COMMENT, tokenize.NL):
tup = self.generator.next()
self.type, self.value, self.begin, self.end, self.line = tup
#print token.tok_name[self.type], repr(self.value)
def raise_error(self, msg, *args):
if args:
try:
msg = msg % args
except:
msg = " ".join([msg] + map(str, args))
raise SyntaxError(msg, (self.filename, self.end[0],
self.end[1], self.line))
class NFAState(object):
def __init__(self):
self.arcs = [] # list of (label, NFAState) pairs
def addarc(self, next, label=None):
assert label is None or isinstance(label, str)
assert isinstance(next, NFAState)
self.arcs.append((label, next))
class DFAState(object):
def __init__(self, nfaset, final):
assert isinstance(nfaset, dict)
assert isinstance(iter(nfaset).next(), NFAState)
assert isinstance(final, NFAState)
self.nfaset = nfaset
self.isfinal = final in nfaset
self.arcs = {} # map from label to DFAState
def addarc(self, next, label):
assert isinstance(label, str)
assert label not in self.arcs
assert isinstance(next, DFAState)
self.arcs[label] = next
def unifystate(self, old, new):
for label, next in self.arcs.iteritems():
if next is old:
self.arcs[label] = new
def __eq__(self, other):
# Equality test -- ignore the nfaset instance variable
assert isinstance(other, DFAState)
if self.isfinal != other.isfinal:
return False
# Can't just return self.arcs == other.arcs, because that
# would invoke this method recursively, with cycles...
if len(self.arcs) != len(other.arcs):
return False
for label, next in self.arcs.iteritems():
if next is not other.arcs.get(label):
return False
return True
__hash__ = None # For Py3 compatibility.
def generate_grammar(filename="Grammar.txt"):
p = ParserGenerator(filename)
return p.make_grammar()
| Python |
# Copyright 2004-2005 Elemental Security, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""This module defines the data structures used to represent a grammar.
These are a bit arcane because they are derived from the data
structures used by Python's 'pgen' parser generator.
There's also a table here mapping operators to their names in the
token module; the Python tokenize module reports all operators as the
fallback token code OP, but the parser needs the actual token code.
"""
# Python imports
import pickle
# Local imports
from . import token, tokenize
class Grammar(object):
"""Pgen parsing tables tables conversion class.
Once initialized, this class supplies the grammar tables for the
parsing engine implemented by parse.py. The parsing engine
accesses the instance variables directly. The class here does not
provide initialization of the tables; several subclasses exist to
do this (see the conv and pgen modules).
The load() method reads the tables from a pickle file, which is
much faster than the other ways offered by subclasses. The pickle
file is written by calling dump() (after loading the grammar
tables using a subclass). The report() method prints a readable
representation of the tables to stdout, for debugging.
The instance variables are as follows:
symbol2number -- a dict mapping symbol names to numbers. Symbol
numbers are always 256 or higher, to distinguish
them from token numbers, which are between 0 and
255 (inclusive).
number2symbol -- a dict mapping numbers to symbol names;
these two are each other's inverse.
states -- a list of DFAs, where each DFA is a list of
states, each state is is a list of arcs, and each
arc is a (i, j) pair where i is a label and j is
a state number. The DFA number is the index into
this list. (This name is slightly confusing.)
Final states are represented by a special arc of
the form (0, j) where j is its own state number.
dfas -- a dict mapping symbol numbers to (DFA, first)
pairs, where DFA is an item from the states list
above, and first is a set of tokens that can
begin this grammar rule (represented by a dict
whose values are always 1).
labels -- a list of (x, y) pairs where x is either a token
number or a symbol number, and y is either None
or a string; the strings are keywords. The label
number is the index in this list; label numbers
are used to mark state transitions (arcs) in the
DFAs.
start -- the number of the grammar's start symbol.
keywords -- a dict mapping keyword strings to arc labels.
tokens -- a dict mapping token numbers to arc labels.
"""
def __init__(self):
self.symbol2number = {}
self.number2symbol = {}
self.states = []
self.dfas = {}
self.labels = [(0, "EMPTY")]
self.keywords = {}
self.tokens = {}
self.symbol2label = {}
self.start = 256
def dump(self, filename):
"""Dump the grammar tables to a pickle file."""
f = open(filename, "wb")
pickle.dump(self.__dict__, f, 2)
f.close()
def load(self, filename):
"""Load the grammar tables from a pickle file."""
f = open(filename, "rb")
d = pickle.load(f)
f.close()
self.__dict__.update(d)
def copy(self):
"""
Copy the grammar.
"""
new = self.__class__()
for dict_attr in ("symbol2number", "number2symbol", "dfas", "keywords",
"tokens", "symbol2label"):
setattr(new, dict_attr, getattr(self, dict_attr).copy())
new.labels = self.labels[:]
new.states = self.states[:]
new.start = self.start
return new
def report(self):
"""Dump the grammar tables to standard output, for debugging."""
from pprint import pprint
print "s2n"
pprint(self.symbol2number)
print "n2s"
pprint(self.number2symbol)
print "states"
pprint(self.states)
print "dfas"
pprint(self.dfas)
print "labels"
pprint(self.labels)
print "start", self.start
# Map from operator to number (since tokenize doesn't do this)
opmap_raw = """
( LPAR
) RPAR
[ LSQB
] RSQB
: COLON
, COMMA
; SEMI
+ PLUS
- MINUS
* STAR
/ SLASH
| VBAR
& AMPER
< LESS
> GREATER
= EQUAL
. DOT
% PERCENT
` BACKQUOTE
{ LBRACE
} RBRACE
@ AT
== EQEQUAL
!= NOTEQUAL
<> NOTEQUAL
<= LESSEQUAL
>= GREATEREQUAL
~ TILDE
^ CIRCUMFLEX
<< LEFTSHIFT
>> RIGHTSHIFT
** DOUBLESTAR
+= PLUSEQUAL
-= MINEQUAL
*= STAREQUAL
/= SLASHEQUAL
%= PERCENTEQUAL
&= AMPEREQUAL
|= VBAREQUAL
^= CIRCUMFLEXEQUAL
<<= LEFTSHIFTEQUAL
>>= RIGHTSHIFTEQUAL
**= DOUBLESTAREQUAL
// DOUBLESLASH
//= DOUBLESLASHEQUAL
-> RARROW
"""
opmap = {}
for line in opmap_raw.splitlines():
if line:
op, name = line.split()
opmap[op] = getattr(token, name)
| Python |
# Copyright 2004-2005 Elemental Security, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""The pgen2 package."""
| Python |
# Copyright 2004-2005 Elemental Security, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
# Modifications:
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Parser driver.
This provides a high-level interface to parse a file into a syntax tree.
"""
__author__ = "Guido van Rossum <guido@python.org>"
__all__ = ["Driver", "load_grammar"]
# Python imports
import codecs
import os
import logging
import sys
# Pgen imports
from . import grammar, parse, token, tokenize, pgen
class Driver(object):
def __init__(self, grammar, convert=None, logger=None):
self.grammar = grammar
if logger is None:
logger = logging.getLogger()
self.logger = logger
self.convert = convert
def parse_tokens(self, tokens, debug=False):
"""Parse a series of tokens and return the syntax tree."""
# XXX Move the prefix computation into a wrapper around tokenize.
p = parse.Parser(self.grammar, self.convert)
p.setup()
lineno = 1
column = 0
type = value = start = end = line_text = None
prefix = u""
for quintuple in tokens:
type, value, start, end, line_text = quintuple
if start != (lineno, column):
assert (lineno, column) <= start, ((lineno, column), start)
s_lineno, s_column = start
if lineno < s_lineno:
prefix += "\n" * (s_lineno - lineno)
lineno = s_lineno
column = 0
if column < s_column:
prefix += line_text[column:s_column]
column = s_column
if type in (tokenize.COMMENT, tokenize.NL):
prefix += value
lineno, column = end
if value.endswith("\n"):
lineno += 1
column = 0
continue
if type == token.OP:
type = grammar.opmap[value]
if debug:
self.logger.debug("%s %r (prefix=%r)",
token.tok_name[type], value, prefix)
if p.addtoken(type, value, (prefix, start)):
if debug:
self.logger.debug("Stop.")
break
prefix = ""
lineno, column = end
if value.endswith("\n"):
lineno += 1
column = 0
else:
# We never broke out -- EOF is too soon (how can this happen???)
raise parse.ParseError("incomplete input",
type, value, (prefix, start))
return p.rootnode
def parse_stream_raw(self, stream, debug=False):
"""Parse a stream and return the syntax tree."""
tokens = tokenize.generate_tokens(stream.readline)
return self.parse_tokens(tokens, debug)
def parse_stream(self, stream, debug=False):
"""Parse a stream and return the syntax tree."""
return self.parse_stream_raw(stream, debug)
def parse_file(self, filename, encoding=None, debug=False):
"""Parse a file and return the syntax tree."""
stream = codecs.open(filename, "r", encoding)
try:
return self.parse_stream(stream, debug)
finally:
stream.close()
def parse_string(self, text, debug=False):
"""Parse a string and return the syntax tree."""
tokens = tokenize.generate_tokens(generate_lines(text).next)
return self.parse_tokens(tokens, debug)
def generate_lines(text):
"""Generator that behaves like readline without using StringIO."""
for line in text.splitlines(True):
yield line
while True:
yield ""
def load_grammar(gt="Grammar.txt", gp=None,
save=True, force=False, logger=None):
"""Load the grammar (maybe from a pickle)."""
if logger is None:
logger = logging.getLogger()
if gp is None:
head, tail = os.path.splitext(gt)
if tail == ".txt":
tail = ""
gp = head + tail + ".".join(map(str, sys.version_info)) + ".pickle"
if force or not _newer(gp, gt):
logger.info("Generating grammar tables from %s", gt)
g = pgen.generate_grammar(gt)
if save:
logger.info("Writing grammar tables to %s", gp)
try:
g.dump(gp)
except IOError, e:
logger.info("Writing failed:"+str(e))
else:
g = grammar.Grammar()
g.load(gp)
return g
def _newer(a, b):
"""Inquire whether file a was written since file b."""
if not os.path.exists(a):
return False
if not os.path.exists(b):
return True
return os.path.getmtime(a) >= os.path.getmtime(b)
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""
Python parse tree definitions.
This is a very concrete parse tree; we need to keep every token and
even the comments and whitespace between tokens.
There's also a pattern matching implementation here.
"""
__author__ = "Guido van Rossum <guido@python.org>"
import sys
import warnings
from StringIO import StringIO
HUGE = 0x7FFFFFFF # maximum repeat count, default max
_type_reprs = {}
def type_repr(type_num):
global _type_reprs
if not _type_reprs:
from .pygram import python_symbols
# printing tokens is possible but not as useful
# from .pgen2 import token // token.__dict__.items():
for name, val in python_symbols.__dict__.items():
if type(val) == int: _type_reprs[val] = name
return _type_reprs.setdefault(type_num, type_num)
class Base(object):
"""
Abstract base class for Node and Leaf.
This provides some default functionality and boilerplate using the
template pattern.
A node may be a subnode of at most one parent.
"""
# Default values for instance variables
type = None # int: token number (< 256) or symbol number (>= 256)
parent = None # Parent node pointer, or None
children = () # Tuple of subnodes
was_changed = False
was_checked = False
def __new__(cls, *args, **kwds):
"""Constructor that prevents Base from being instantiated."""
assert cls is not Base, "Cannot instantiate Base"
return object.__new__(cls)
def __eq__(self, other):
"""
Compare two nodes for equality.
This calls the method _eq().
"""
if self.__class__ is not other.__class__:
return NotImplemented
return self._eq(other)
__hash__ = None # For Py3 compatibility.
def __ne__(self, other):
"""
Compare two nodes for inequality.
This calls the method _eq().
"""
if self.__class__ is not other.__class__:
return NotImplemented
return not self._eq(other)
def _eq(self, other):
"""
Compare two nodes for equality.
This is called by __eq__ and __ne__. It is only called if the two nodes
have the same type. This must be implemented by the concrete subclass.
Nodes should be considered equal if they have the same structure,
ignoring the prefix string and other context information.
"""
raise NotImplementedError
def clone(self):
"""
Return a cloned (deep) copy of self.
This must be implemented by the concrete subclass.
"""
raise NotImplementedError
def post_order(self):
"""
Return a post-order iterator for the tree.
This must be implemented by the concrete subclass.
"""
raise NotImplementedError
def pre_order(self):
"""
Return a pre-order iterator for the tree.
This must be implemented by the concrete subclass.
"""
raise NotImplementedError
def set_prefix(self, prefix):
"""
Set the prefix for the node (see Leaf class).
DEPRECATED; use the prefix property directly.
"""
warnings.warn("set_prefix() is deprecated; use the prefix property",
DeprecationWarning, stacklevel=2)
self.prefix = prefix
def get_prefix(self):
"""
Return the prefix for the node (see Leaf class).
DEPRECATED; use the prefix property directly.
"""
warnings.warn("get_prefix() is deprecated; use the prefix property",
DeprecationWarning, stacklevel=2)
return self.prefix
def replace(self, new):
"""Replace this node with a new one in the parent."""
assert self.parent is not None, str(self)
assert new is not None
if not isinstance(new, list):
new = [new]
l_children = []
found = False
for ch in self.parent.children:
if ch is self:
assert not found, (self.parent.children, self, new)
if new is not None:
l_children.extend(new)
found = True
else:
l_children.append(ch)
assert found, (self.children, self, new)
self.parent.changed()
self.parent.children = l_children
for x in new:
x.parent = self.parent
self.parent = None
def get_lineno(self):
"""Return the line number which generated the invocant node."""
node = self
while not isinstance(node, Leaf):
if not node.children:
return
node = node.children[0]
return node.lineno
def changed(self):
if self.parent:
self.parent.changed()
self.was_changed = True
def remove(self):
"""
Remove the node from the tree. Returns the position of the node in its
parent's children before it was removed.
"""
if self.parent:
for i, node in enumerate(self.parent.children):
if node is self:
self.parent.changed()
del self.parent.children[i]
self.parent = None
return i
@property
def next_sibling(self):
"""
The node immediately following the invocant in their parent's children
list. If the invocant does not have a next sibling, it is None
"""
if self.parent is None:
return None
# Can't use index(); we need to test by identity
for i, child in enumerate(self.parent.children):
if child is self:
try:
return self.parent.children[i+1]
except IndexError:
return None
@property
def prev_sibling(self):
"""
The node immediately preceding the invocant in their parent's children
list. If the invocant does not have a previous sibling, it is None.
"""
if self.parent is None:
return None
# Can't use index(); we need to test by identity
for i, child in enumerate(self.parent.children):
if child is self:
if i == 0:
return None
return self.parent.children[i-1]
def leaves(self):
for child in self.children:
for x in child.leaves():
yield x
def depth(self):
if self.parent is None:
return 0
return 1 + self.parent.depth()
def get_suffix(self):
"""
Return the string immediately following the invocant node. This is
effectively equivalent to node.next_sibling.prefix
"""
next_sib = self.next_sibling
if next_sib is None:
return u""
return next_sib.prefix
if sys.version_info < (3, 0):
def __str__(self):
return unicode(self).encode("ascii")
class Node(Base):
"""Concrete implementation for interior nodes."""
def __init__(self,type, children,
context=None,
prefix=None,
fixers_applied=None):
"""
Initializer.
Takes a type constant (a symbol number >= 256), a sequence of
child nodes, and an optional context keyword argument.
As a side effect, the parent pointers of the children are updated.
"""
assert type >= 256, type
self.type = type
self.children = list(children)
for ch in self.children:
assert ch.parent is None, repr(ch)
ch.parent = self
if prefix is not None:
self.prefix = prefix
if fixers_applied:
self.fixers_applied = fixers_applied[:]
else:
self.fixers_applied = None
def __repr__(self):
"""Return a canonical string representation."""
return "%s(%s, %r)" % (self.__class__.__name__,
type_repr(self.type),
self.children)
def __unicode__(self):
"""
Return a pretty string representation.
This reproduces the input source exactly.
"""
return u"".join(map(unicode, self.children))
if sys.version_info > (3, 0):
__str__ = __unicode__
def _eq(self, other):
"""Compare two nodes for equality."""
return (self.type, self.children) == (other.type, other.children)
def clone(self):
"""Return a cloned (deep) copy of self."""
return Node(self.type, [ch.clone() for ch in self.children],
fixers_applied=self.fixers_applied)
def post_order(self):
"""Return a post-order iterator for the tree."""
for child in self.children:
for node in child.post_order():
yield node
yield self
def pre_order(self):
"""Return a pre-order iterator for the tree."""
yield self
for child in self.children:
for node in child.pre_order():
yield node
def _prefix_getter(self):
"""
The whitespace and comments preceding this node in the input.
"""
if not self.children:
return ""
return self.children[0].prefix
def _prefix_setter(self, prefix):
if self.children:
self.children[0].prefix = prefix
prefix = property(_prefix_getter, _prefix_setter)
def set_child(self, i, child):
"""
Equivalent to 'node.children[i] = child'. This method also sets the
child's parent attribute appropriately.
"""
child.parent = self
self.children[i].parent = None
self.children[i] = child
self.changed()
def insert_child(self, i, child):
"""
Equivalent to 'node.children.insert(i, child)'. This method also sets
the child's parent attribute appropriately.
"""
child.parent = self
self.children.insert(i, child)
self.changed()
def append_child(self, child):
"""
Equivalent to 'node.children.append(child)'. This method also sets the
child's parent attribute appropriately.
"""
child.parent = self
self.children.append(child)
self.changed()
class Leaf(Base):
"""Concrete implementation for leaf nodes."""
# Default values for instance variables
_prefix = "" # Whitespace and comments preceding this token in the input
lineno = 0 # Line where this token starts in the input
column = 0 # Column where this token tarts in the input
def __init__(self, type, value,
context=None,
prefix=None,
fixers_applied=[]):
"""
Initializer.
Takes a type constant (a token number < 256), a string value, and an
optional context keyword argument.
"""
assert 0 <= type < 256, type
if context is not None:
self._prefix, (self.lineno, self.column) = context
self.type = type
self.value = value
if prefix is not None:
self._prefix = prefix
self.fixers_applied = fixers_applied[:]
def __repr__(self):
"""Return a canonical string representation."""
return "%s(%r, %r)" % (self.__class__.__name__,
self.type,
self.value)
def __unicode__(self):
"""
Return a pretty string representation.
This reproduces the input source exactly.
"""
return self.prefix + unicode(self.value)
if sys.version_info > (3, 0):
__str__ = __unicode__
def _eq(self, other):
"""Compare two nodes for equality."""
return (self.type, self.value) == (other.type, other.value)
def clone(self):
"""Return a cloned (deep) copy of self."""
return Leaf(self.type, self.value,
(self.prefix, (self.lineno, self.column)),
fixers_applied=self.fixers_applied)
def leaves(self):
yield self
def post_order(self):
"""Return a post-order iterator for the tree."""
yield self
def pre_order(self):
"""Return a pre-order iterator for the tree."""
yield self
def _prefix_getter(self):
"""
The whitespace and comments preceding this token in the input.
"""
return self._prefix
def _prefix_setter(self, prefix):
self.changed()
self._prefix = prefix
prefix = property(_prefix_getter, _prefix_setter)
def convert(gr, raw_node):
"""
Convert raw node information to a Node or Leaf instance.
This is passed to the parser driver which calls it whenever a reduction of a
grammar rule produces a new complete node, so that the tree is build
strictly bottom-up.
"""
type, value, context, children = raw_node
if children or type in gr.number2symbol:
# If there's exactly one child, return that child instead of
# creating a new node.
if len(children) == 1:
return children[0]
return Node(type, children, context=context)
else:
return Leaf(type, value, context=context)
class BasePattern(object):
"""
A pattern is a tree matching pattern.
It looks for a specific node type (token or symbol), and
optionally for a specific content.
This is an abstract base class. There are three concrete
subclasses:
- LeafPattern matches a single leaf node;
- NodePattern matches a single node (usually non-leaf);
- WildcardPattern matches a sequence of nodes of variable length.
"""
# Defaults for instance variables
type = None # Node type (token if < 256, symbol if >= 256)
content = None # Optional content matching pattern
name = None # Optional name used to store match in results dict
def __new__(cls, *args, **kwds):
"""Constructor that prevents BasePattern from being instantiated."""
assert cls is not BasePattern, "Cannot instantiate BasePattern"
return object.__new__(cls)
def __repr__(self):
args = [type_repr(self.type), self.content, self.name]
while args and args[-1] is None:
del args[-1]
return "%s(%s)" % (self.__class__.__name__, ", ".join(map(repr, args)))
def optimize(self):
"""
A subclass can define this as a hook for optimizations.
Returns either self or another node with the same effect.
"""
return self
def match(self, node, results=None):
"""
Does this pattern exactly match a node?
Returns True if it matches, False if not.
If results is not None, it must be a dict which will be
updated with the nodes matching named subpatterns.
Default implementation for non-wildcard patterns.
"""
if self.type is not None and node.type != self.type:
return False
if self.content is not None:
r = None
if results is not None:
r = {}
if not self._submatch(node, r):
return False
if r:
results.update(r)
if results is not None and self.name:
results[self.name] = node
return True
def match_seq(self, nodes, results=None):
"""
Does this pattern exactly match a sequence of nodes?
Default implementation for non-wildcard patterns.
"""
if len(nodes) != 1:
return False
return self.match(nodes[0], results)
def generate_matches(self, nodes):
"""
Generator yielding all matches for this pattern.
Default implementation for non-wildcard patterns.
"""
r = {}
if nodes and self.match(nodes[0], r):
yield 1, r
class LeafPattern(BasePattern):
def __init__(self, type=None, content=None, name=None):
"""
Initializer. Takes optional type, content, and name.
The type, if given must be a token type (< 256). If not given,
this matches any *leaf* node; the content may still be required.
The content, if given, must be a string.
If a name is given, the matching node is stored in the results
dict under that key.
"""
if type is not None:
assert 0 <= type < 256, type
if content is not None:
assert isinstance(content, basestring), repr(content)
self.type = type
self.content = content
self.name = name
def match(self, node, results=None):
"""Override match() to insist on a leaf node."""
if not isinstance(node, Leaf):
return False
return BasePattern.match(self, node, results)
def _submatch(self, node, results=None):
"""
Match the pattern's content to the node's children.
This assumes the node type matches and self.content is not None.
Returns True if it matches, False if not.
If results is not None, it must be a dict which will be
updated with the nodes matching named subpatterns.
When returning False, the results dict may still be updated.
"""
return self.content == node.value
class NodePattern(BasePattern):
wildcards = False
def __init__(self, type=None, content=None, name=None):
"""
Initializer. Takes optional type, content, and name.
The type, if given, must be a symbol type (>= 256). If the
type is None this matches *any* single node (leaf or not),
except if content is not None, in which it only matches
non-leaf nodes that also match the content pattern.
The content, if not None, must be a sequence of Patterns that
must match the node's children exactly. If the content is
given, the type must not be None.
If a name is given, the matching node is stored in the results
dict under that key.
"""
if type is not None:
assert type >= 256, type
if content is not None:
assert not isinstance(content, basestring), repr(content)
content = list(content)
for i, item in enumerate(content):
assert isinstance(item, BasePattern), (i, item)
if isinstance(item, WildcardPattern):
self.wildcards = True
self.type = type
self.content = content
self.name = name
def _submatch(self, node, results=None):
"""
Match the pattern's content to the node's children.
This assumes the node type matches and self.content is not None.
Returns True if it matches, False if not.
If results is not None, it must be a dict which will be
updated with the nodes matching named subpatterns.
When returning False, the results dict may still be updated.
"""
if self.wildcards:
for c, r in generate_matches(self.content, node.children):
if c == len(node.children):
if results is not None:
results.update(r)
return True
return False
if len(self.content) != len(node.children):
return False
for subpattern, child in zip(self.content, node.children):
if not subpattern.match(child, results):
return False
return True
class WildcardPattern(BasePattern):
"""
A wildcard pattern can match zero or more nodes.
This has all the flexibility needed to implement patterns like:
.* .+ .? .{m,n}
(a b c | d e | f)
(...)* (...)+ (...)? (...){m,n}
except it always uses non-greedy matching.
"""
def __init__(self, content=None, min=0, max=HUGE, name=None):
"""
Initializer.
Args:
content: optional sequence of subsequences of patterns;
if absent, matches one node;
if present, each subsequence is an alternative [*]
min: optinal minumum number of times to match, default 0
max: optional maximum number of times tro match, default HUGE
name: optional name assigned to this match
[*] Thus, if content is [[a, b, c], [d, e], [f, g, h]] this is
equivalent to (a b c | d e | f g h); if content is None,
this is equivalent to '.' in regular expression terms.
The min and max parameters work as follows:
min=0, max=maxint: .*
min=1, max=maxint: .+
min=0, max=1: .?
min=1, max=1: .
If content is not None, replace the dot with the parenthesized
list of alternatives, e.g. (a b c | d e | f g h)*
"""
assert 0 <= min <= max <= HUGE, (min, max)
if content is not None:
content = tuple(map(tuple, content)) # Protect against alterations
# Check sanity of alternatives
assert len(content), repr(content) # Can't have zero alternatives
for alt in content:
assert len(alt), repr(alt) # Can have empty alternatives
self.content = content
self.min = min
self.max = max
self.name = name
def optimize(self):
"""Optimize certain stacked wildcard patterns."""
subpattern = None
if (self.content is not None and
len(self.content) == 1 and len(self.content[0]) == 1):
subpattern = self.content[0][0]
if self.min == 1 and self.max == 1:
if self.content is None:
return NodePattern(name=self.name)
if subpattern is not None and self.name == subpattern.name:
return subpattern.optimize()
if (self.min <= 1 and isinstance(subpattern, WildcardPattern) and
subpattern.min <= 1 and self.name == subpattern.name):
return WildcardPattern(subpattern.content,
self.min*subpattern.min,
self.max*subpattern.max,
subpattern.name)
return self
def match(self, node, results=None):
"""Does this pattern exactly match a node?"""
return self.match_seq([node], results)
def match_seq(self, nodes, results=None):
"""Does this pattern exactly match a sequence of nodes?"""
for c, r in self.generate_matches(nodes):
if c == len(nodes):
if results is not None:
results.update(r)
if self.name:
results[self.name] = list(nodes)
return True
return False
def generate_matches(self, nodes):
"""
Generator yielding matches for a sequence of nodes.
Args:
nodes: sequence of nodes
Yields:
(count, results) tuples where:
count: the match comprises nodes[:count];
results: dict containing named submatches.
"""
if self.content is None:
# Shortcut for special case (see __init__.__doc__)
for count in xrange(self.min, 1 + min(len(nodes), self.max)):
r = {}
if self.name:
r[self.name] = nodes[:count]
yield count, r
elif self.name == "bare_name":
yield self._bare_name_matches(nodes)
else:
# The reason for this is that hitting the recursion limit usually
# results in some ugly messages about how RuntimeErrors are being
# ignored.
save_stderr = sys.stderr
sys.stderr = StringIO()
try:
for count, r in self._recursive_matches(nodes, 0):
if self.name:
r[self.name] = nodes[:count]
yield count, r
except RuntimeError:
# We fall back to the iterative pattern matching scheme if the recursive
# scheme hits the recursion limit.
for count, r in self._iterative_matches(nodes):
if self.name:
r[self.name] = nodes[:count]
yield count, r
finally:
sys.stderr = save_stderr
def _iterative_matches(self, nodes):
"""Helper to iteratively yield the matches."""
nodelen = len(nodes)
if 0 >= self.min:
yield 0, {}
results = []
# generate matches that use just one alt from self.content
for alt in self.content:
for c, r in generate_matches(alt, nodes):
yield c, r
results.append((c, r))
# for each match, iterate down the nodes
while results:
new_results = []
for c0, r0 in results:
# stop if the entire set of nodes has been matched
if c0 < nodelen and c0 <= self.max:
for alt in self.content:
for c1, r1 in generate_matches(alt, nodes[c0:]):
if c1 > 0:
r = {}
r.update(r0)
r.update(r1)
yield c0 + c1, r
new_results.append((c0 + c1, r))
results = new_results
def _bare_name_matches(self, nodes):
"""Special optimized matcher for bare_name."""
count = 0
r = {}
done = False
max = len(nodes)
while not done and count < max:
done = True
for leaf in self.content:
if leaf[0].match(nodes[count], r):
count += 1
done = False
break
r[self.name] = nodes[:count]
return count, r
def _recursive_matches(self, nodes, count):
"""Helper to recursively yield the matches."""
assert self.content is not None
if count >= self.min:
yield 0, {}
if count < self.max:
for alt in self.content:
for c0, r0 in generate_matches(alt, nodes):
for c1, r1 in self._recursive_matches(nodes[c0:], count+1):
r = {}
r.update(r0)
r.update(r1)
yield c0 + c1, r
class NegatedPattern(BasePattern):
def __init__(self, content=None):
"""
Initializer.
The argument is either a pattern or None. If it is None, this
only matches an empty sequence (effectively '$' in regex
lingo). If it is not None, this matches whenever the argument
pattern doesn't have any matches.
"""
if content is not None:
assert isinstance(content, BasePattern), repr(content)
self.content = content
def match(self, node):
# We never match a node in its entirety
return False
def match_seq(self, nodes):
# We only match an empty sequence of nodes in its entirety
return len(nodes) == 0
def generate_matches(self, nodes):
if self.content is None:
# Return a match if there is an empty sequence
if len(nodes) == 0:
yield 0, {}
else:
# Return a match if the argument pattern has no matches
for c, r in self.content.generate_matches(nodes):
return
yield 0, {}
def generate_matches(patterns, nodes):
"""
Generator yielding matches for a sequence of patterns and nodes.
Args:
patterns: a sequence of patterns
nodes: a sequence of nodes
Yields:
(count, results) tuples where:
count: the entire sequence of patterns matches nodes[:count];
results: dict containing named submatches.
"""
if not patterns:
yield 0, {}
else:
p, rest = patterns[0], patterns[1:]
for c0, r0 in p.generate_matches(nodes):
if not rest:
yield c0, r0
else:
for c1, r1 in generate_matches(rest, nodes[c0:]):
r = {}
r.update(r0)
r.update(r1)
yield c0 + c1, r
| Python |
"""A bottom-up tree matching algorithm implementation meant to speed
up 2to3's matching process. After the tree patterns are reduced to
their rarest linear path, a linear Aho-Corasick automaton is
created. The linear automaton traverses the linear paths from the
leaves to the root of the AST and returns a set of nodes for further
matching. This reduces significantly the number of candidate nodes."""
__author__ = "George Boutsioukis <gboutsioukis@gmail.com>"
import logging
import itertools
from collections import defaultdict
from . import pytree
from .btm_utils import reduce_tree
class BMNode(object):
"""Class for a node of the Aho-Corasick automaton used in matching"""
count = itertools.count()
def __init__(self):
self.transition_table = {}
self.fixers = []
self.id = next(BMNode.count)
self.content = ''
class BottomMatcher(object):
"""The main matcher class. After instantiating the patterns should
be added using the add_fixer method"""
def __init__(self):
self.match = set()
self.root = BMNode()
self.nodes = [self.root]
self.fixers = []
self.logger = logging.getLogger("RefactoringTool")
def add_fixer(self, fixer):
"""Reduces a fixer's pattern tree to a linear path and adds it
to the matcher(a common Aho-Corasick automaton). The fixer is
appended on the matching states and called when they are
reached"""
self.fixers.append(fixer)
tree = reduce_tree(fixer.pattern_tree)
linear = tree.get_linear_subpattern()
match_nodes = self.add(linear, start=self.root)
for match_node in match_nodes:
match_node.fixers.append(fixer)
def add(self, pattern, start):
"Recursively adds a linear pattern to the AC automaton"
#print("adding pattern", pattern, "to", start)
if not pattern:
#print("empty pattern")
return [start]
if isinstance(pattern[0], tuple):
#alternatives
#print("alternatives")
match_nodes = []
for alternative in pattern[0]:
#add all alternatives, and add the rest of the pattern
#to each end node
end_nodes = self.add(alternative, start=start)
for end in end_nodes:
match_nodes.extend(self.add(pattern[1:], end))
return match_nodes
else:
#single token
#not last
if pattern[0] not in start.transition_table:
#transition did not exist, create new
next_node = BMNode()
start.transition_table[pattern[0]] = next_node
else:
#transition exists already, follow
next_node = start.transition_table[pattern[0]]
if pattern[1:]:
end_nodes = self.add(pattern[1:], start=next_node)
else:
end_nodes = [next_node]
return end_nodes
def run(self, leaves):
"""The main interface with the bottom matcher. The tree is
traversed from the bottom using the constructed
automaton. Nodes are only checked once as the tree is
retraversed. When the automaton fails, we give it one more
shot(in case the above tree matches as a whole with the
rejected leaf), then we break for the next leaf. There is the
special case of multiple arguments(see code comments) where we
recheck the nodes
Args:
The leaves of the AST tree to be matched
Returns:
A dictionary of node matches with fixers as the keys
"""
current_ac_node = self.root
results = defaultdict(list)
for leaf in leaves:
current_ast_node = leaf
while current_ast_node:
current_ast_node.was_checked = True
for child in current_ast_node.children:
# multiple statements, recheck
if isinstance(child, pytree.Leaf) and child.value == u";":
current_ast_node.was_checked = False
break
if current_ast_node.type == 1:
#name
node_token = current_ast_node.value
else:
node_token = current_ast_node.type
if node_token in current_ac_node.transition_table:
#token matches
current_ac_node = current_ac_node.transition_table[node_token]
for fixer in current_ac_node.fixers:
if not fixer in results:
results[fixer] = []
results[fixer].append(current_ast_node)
else:
#matching failed, reset automaton
current_ac_node = self.root
if (current_ast_node.parent is not None
and current_ast_node.parent.was_checked):
#the rest of the tree upwards has been checked, next leaf
break
#recheck the rejected node once from the root
if node_token in current_ac_node.transition_table:
#token matches
current_ac_node = current_ac_node.transition_table[node_token]
for fixer in current_ac_node.fixers:
if not fixer in results.keys():
results[fixer] = []
results[fixer].append(current_ast_node)
current_ast_node = current_ast_node.parent
return results
def print_ac(self):
"Prints a graphviz diagram of the BM automaton(for debugging)"
print("digraph g{")
def print_node(node):
for subnode_key in node.transition_table.keys():
subnode = node.transition_table[subnode_key]
print("%d -> %d [label=%s] //%s" %
(node.id, subnode.id, type_repr(subnode_key), str(subnode.fixers)))
if subnode_key == 1:
print(subnode.content)
print_node(subnode)
print_node(self.root)
print("}")
# taken from pytree.py for debugging; only used by print_ac
_type_reprs = {}
def type_repr(type_num):
global _type_reprs
if not _type_reprs:
from .pygram import python_symbols
# printing tokens is possible but not as useful
# from .pgen2 import token // token.__dict__.items():
for name, val in python_symbols.__dict__.items():
if type(val) == int: _type_reprs[val] = name
return _type_reprs.setdefault(type_num, type_num)
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Fixer that turns <> into !=."""
# Local imports
from .. import pytree
from ..pgen2 import token
from .. import fixer_base
class FixNe(fixer_base.BaseFix):
# This is so simple that we don't need the pattern compiler.
_accept_type = token.NOTEQUAL
def match(self, node):
# Override
return node.value == u"<>"
def transform(self, node, results):
new = pytree.Leaf(token.NOTEQUAL, u"!=", prefix=node.prefix)
return new
| Python |
"""Fixer for generator.throw(E, V, T).
g.throw(E) -> g.throw(E)
g.throw(E, V) -> g.throw(E(V))
g.throw(E, V, T) -> g.throw(E(V).with_traceback(T))
g.throw("foo"[, V[, T]]) will warn about string exceptions."""
# Author: Collin Winter
# Local imports
from .. import pytree
from ..pgen2 import token
from .. import fixer_base
from ..fixer_util import Name, Call, ArgList, Attr, is_tuple
class FixThrow(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
power< any trailer< '.' 'throw' >
trailer< '(' args=arglist< exc=any ',' val=any [',' tb=any] > ')' >
>
|
power< any trailer< '.' 'throw' > trailer< '(' exc=any ')' > >
"""
def transform(self, node, results):
syms = self.syms
exc = results["exc"].clone()
if exc.type is token.STRING:
self.cannot_convert(node, "Python 3 does not support string exceptions")
return
# Leave "g.throw(E)" alone
val = results.get(u"val")
if val is None:
return
val = val.clone()
if is_tuple(val):
args = [c.clone() for c in val.children[1:-1]]
else:
val.prefix = u""
args = [val]
throw_args = results["args"]
if "tb" in results:
tb = results["tb"].clone()
tb.prefix = u""
e = Call(exc, args)
with_tb = Attr(e, Name(u'with_traceback')) + [ArgList([tb])]
throw_args.replace(pytree.Node(syms.power, with_tb))
else:
throw_args.replace(Call(exc, args))
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Fixer for apply().
This converts apply(func, v, k) into (func)(*v, **k)."""
# Local imports
from .. import pytree
from ..pgen2 import token
from .. import fixer_base
from ..fixer_util import Call, Comma, parenthesize
class FixApply(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
power< 'apply'
trailer<
'('
arglist<
(not argument<NAME '=' any>) func=any ','
(not argument<NAME '=' any>) args=any [','
(not argument<NAME '=' any>) kwds=any] [',']
>
')'
>
>
"""
def transform(self, node, results):
syms = self.syms
assert results
func = results["func"]
args = results["args"]
kwds = results.get("kwds")
prefix = node.prefix
func = func.clone()
if (func.type not in (token.NAME, syms.atom) and
(func.type != syms.power or
func.children[-2].type == token.DOUBLESTAR)):
# Need to parenthesize
func = parenthesize(func)
func.prefix = ""
args = args.clone()
args.prefix = ""
if kwds is not None:
kwds = kwds.clone()
kwds.prefix = ""
l_newargs = [pytree.Leaf(token.STAR, u"*"), args]
if kwds is not None:
l_newargs.extend([Comma(),
pytree.Leaf(token.DOUBLESTAR, u"**"),
kwds])
l_newargs[-2].prefix = u" " # that's the ** token
# XXX Sometimes we could be cleverer, e.g. apply(f, (x, y) + t)
# can be translated into f(x, y, *t) instead of f(*(x, y) + t)
#new = pytree.Node(syms.power, (func, ArgList(l_newargs)))
return Call(func, l_newargs, prefix=prefix)
| Python |
"""Fixer for import statements.
If spam is being imported from the local directory, this import:
from spam import eggs
Becomes:
from .spam import eggs
And this import:
import spam
Becomes:
from . import spam
"""
# Local imports
from .. import fixer_base
from os.path import dirname, join, exists, sep
from ..fixer_util import FromImport, syms, token
def traverse_imports(names):
"""
Walks over all the names imported in a dotted_as_names node.
"""
pending = [names]
while pending:
node = pending.pop()
if node.type == token.NAME:
yield node.value
elif node.type == syms.dotted_name:
yield "".join([ch.value for ch in node.children])
elif node.type == syms.dotted_as_name:
pending.append(node.children[0])
elif node.type == syms.dotted_as_names:
pending.extend(node.children[::-2])
else:
raise AssertionError("unkown node type")
class FixImport(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
import_from< 'from' imp=any 'import' ['('] any [')'] >
|
import_name< 'import' imp=any >
"""
def start_tree(self, tree, name):
super(FixImport, self).start_tree(tree, name)
self.skip = "absolute_import" in tree.future_features
def transform(self, node, results):
if self.skip:
return
imp = results['imp']
if node.type == syms.import_from:
# Some imps are top-level (eg: 'import ham')
# some are first level (eg: 'import ham.eggs')
# some are third level (eg: 'import ham.eggs as spam')
# Hence, the loop
while not hasattr(imp, 'value'):
imp = imp.children[0]
if self.probably_a_local_import(imp.value):
imp.value = u"." + imp.value
imp.changed()
else:
have_local = False
have_absolute = False
for mod_name in traverse_imports(imp):
if self.probably_a_local_import(mod_name):
have_local = True
else:
have_absolute = True
if have_absolute:
if have_local:
# We won't handle both sibling and absolute imports in the
# same statement at the moment.
self.warning(node, "absolute and local imports together")
return
new = FromImport(u".", [imp])
new.prefix = node.prefix
return new
def probably_a_local_import(self, imp_name):
if imp_name.startswith(u"."):
# Relative imports are certainly not local imports.
return False
imp_name = imp_name.split(u".", 1)[0]
base_path = dirname(self.filename)
base_path = join(base_path, imp_name)
# If there is no __init__.py next to the file its not in a package
# so can't be a relative import.
if not exists(join(dirname(base_path), "__init__.py")):
return False
for ext in [".py", sep, ".pyc", ".so", ".sl", ".pyd"]:
if exists(base_path + ext):
return True
return False
| Python |
"""Fixer for 'raise E, V, T'
raise -> raise
raise E -> raise E
raise E, V -> raise E(V)
raise E, V, T -> raise E(V).with_traceback(T)
raise E, None, T -> raise E.with_traceback(T)
raise (((E, E'), E''), E'''), V -> raise E(V)
raise "foo", V, T -> warns about string exceptions
CAVEATS:
1) "raise E, V" will be incorrectly translated if V is an exception
instance. The correct Python 3 idiom is
raise E from V
but since we can't detect instance-hood by syntax alone and since
any client code would have to be changed as well, we don't automate
this.
"""
# Author: Collin Winter
# Local imports
from .. import pytree
from ..pgen2 import token
from .. import fixer_base
from ..fixer_util import Name, Call, Attr, ArgList, is_tuple
class FixRaise(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
raise_stmt< 'raise' exc=any [',' val=any [',' tb=any]] >
"""
def transform(self, node, results):
syms = self.syms
exc = results["exc"].clone()
if exc.type == token.STRING:
msg = "Python 3 does not support string exceptions"
self.cannot_convert(node, msg)
return
# Python 2 supports
# raise ((((E1, E2), E3), E4), E5), V
# as a synonym for
# raise E1, V
# Since Python 3 will not support this, we recurse down any tuple
# literals, always taking the first element.
if is_tuple(exc):
while is_tuple(exc):
# exc.children[1:-1] is the unparenthesized tuple
# exc.children[1].children[0] is the first element of the tuple
exc = exc.children[1].children[0].clone()
exc.prefix = u" "
if "val" not in results:
# One-argument raise
new = pytree.Node(syms.raise_stmt, [Name(u"raise"), exc])
new.prefix = node.prefix
return new
val = results["val"].clone()
if is_tuple(val):
args = [c.clone() for c in val.children[1:-1]]
else:
val.prefix = u""
args = [val]
if "tb" in results:
tb = results["tb"].clone()
tb.prefix = u""
e = exc
# If there's a traceback and None is passed as the value, then don't
# add a call, since the user probably just wants to add a
# traceback. See issue #9661.
if val.type != token.NAME or val.value != u"None":
e = Call(exc, args)
with_tb = Attr(e, Name(u'with_traceback')) + [ArgList([tb])]
new = pytree.Node(syms.simple_stmt, [Name(u"raise")] + with_tb)
new.prefix = node.prefix
return new
else:
return pytree.Node(syms.raise_stmt,
[Name(u"raise"), Call(exc, args)],
prefix=node.prefix)
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Fixer for print.
Change:
'print' into 'print()'
'print ...' into 'print(...)'
'print ... ,' into 'print(..., end=" ")'
'print >>x, ...' into 'print(..., file=x)'
No changes are applied if print_function is imported from __future__
"""
# Local imports
from .. import patcomp
from .. import pytree
from ..pgen2 import token
from .. import fixer_base
from ..fixer_util import Name, Call, Comma, String, is_tuple
parend_expr = patcomp.compile_pattern(
"""atom< '(' [atom|STRING|NAME] ')' >"""
)
class FixPrint(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
simple_stmt< any* bare='print' any* > | print_stmt
"""
def transform(self, node, results):
assert results
bare_print = results.get("bare")
if bare_print:
# Special-case print all by itself
bare_print.replace(Call(Name(u"print"), [],
prefix=bare_print.prefix))
return
assert node.children[0] == Name(u"print")
args = node.children[1:]
if len(args) == 1 and parend_expr.match(args[0]):
# We don't want to keep sticking parens around an
# already-parenthesised expression.
return
sep = end = file = None
if args and args[-1] == Comma():
args = args[:-1]
end = " "
if args and args[0] == pytree.Leaf(token.RIGHTSHIFT, u">>"):
assert len(args) >= 2
file = args[1].clone()
args = args[3:] # Strip a possible comma after the file expression
# Now synthesize a print(args, sep=..., end=..., file=...) node.
l_args = [arg.clone() for arg in args]
if l_args:
l_args[0].prefix = u""
if sep is not None or end is not None or file is not None:
if sep is not None:
self.add_kwarg(l_args, u"sep", String(repr(sep)))
if end is not None:
self.add_kwarg(l_args, u"end", String(repr(end)))
if file is not None:
self.add_kwarg(l_args, u"file", file)
n_stmt = Call(Name(u"print"), l_args)
n_stmt.prefix = node.prefix
return n_stmt
def add_kwarg(self, l_nodes, s_kwd, n_expr):
# XXX All this prefix-setting may lose comments (though rarely)
n_expr.prefix = u""
n_argument = pytree.Node(self.syms.argument,
(Name(s_kwd),
pytree.Leaf(token.EQUAL, u"="),
n_expr))
if l_nodes:
l_nodes.append(Comma())
n_argument.prefix = u" "
l_nodes.append(n_argument)
| Python |
"""Fixer that changes input(...) into eval(input(...))."""
# Author: Andre Roberge
# Local imports
from .. import fixer_base
from ..fixer_util import Call, Name
from .. import patcomp
context = patcomp.compile_pattern("power< 'eval' trailer< '(' any ')' > >")
class FixInput(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
power< 'input' args=trailer< '(' [any] ')' > >
"""
def transform(self, node, results):
# If we're already wrapped in a eval() call, we're done.
if context.match(node.parent.parent):
return
new = node.clone()
new.prefix = u""
return Call(Name(u"eval"), [new], prefix=node.prefix)
| Python |
"""Fixer that changes 'a ,b' into 'a, b'.
This also changes '{a :b}' into '{a: b}', but does not touch other
uses of colons. It does not touch other uses of whitespace.
"""
from .. import pytree
from ..pgen2 import token
from .. import fixer_base
class FixWsComma(fixer_base.BaseFix):
explicit = True # The user must ask for this fixers
PATTERN = """
any<(not(',') any)+ ',' ((not(',') any)+ ',')* [not(',') any]>
"""
COMMA = pytree.Leaf(token.COMMA, u",")
COLON = pytree.Leaf(token.COLON, u":")
SEPS = (COMMA, COLON)
def transform(self, node, results):
new = node.clone()
comma = False
for child in new.children:
if child in self.SEPS:
prefix = child.prefix
if prefix.isspace() and u"\n" not in prefix:
child.prefix = u""
comma = True
else:
if comma:
prefix = child.prefix
if not prefix:
child.prefix = u" "
comma = False
return new
| Python |
"""Adjust some old Python 2 idioms to their modern counterparts.
* Change some type comparisons to isinstance() calls:
type(x) == T -> isinstance(x, T)
type(x) is T -> isinstance(x, T)
type(x) != T -> not isinstance(x, T)
type(x) is not T -> not isinstance(x, T)
* Change "while 1:" into "while True:".
* Change both
v = list(EXPR)
v.sort()
foo(v)
and the more general
v = EXPR
v.sort()
foo(v)
into
v = sorted(EXPR)
foo(v)
"""
# Author: Jacques Frechet, Collin Winter
# Local imports
from .. import fixer_base
from ..fixer_util import Call, Comma, Name, Node, BlankLine, syms
CMP = "(n='!=' | '==' | 'is' | n=comp_op< 'is' 'not' >)"
TYPE = "power< 'type' trailer< '(' x=any ')' > >"
class FixIdioms(fixer_base.BaseFix):
explicit = True # The user must ask for this fixer
PATTERN = r"""
isinstance=comparison< %s %s T=any >
|
isinstance=comparison< T=any %s %s >
|
while_stmt< 'while' while='1' ':' any+ >
|
sorted=any<
any*
simple_stmt<
expr_stmt< id1=any '='
power< list='list' trailer< '(' (not arglist<any+>) any ')' > >
>
'\n'
>
sort=
simple_stmt<
power< id2=any
trailer< '.' 'sort' > trailer< '(' ')' >
>
'\n'
>
next=any*
>
|
sorted=any<
any*
simple_stmt< expr_stmt< id1=any '=' expr=any > '\n' >
sort=
simple_stmt<
power< id2=any
trailer< '.' 'sort' > trailer< '(' ')' >
>
'\n'
>
next=any*
>
""" % (TYPE, CMP, CMP, TYPE)
def match(self, node):
r = super(FixIdioms, self).match(node)
# If we've matched one of the sort/sorted subpatterns above, we
# want to reject matches where the initial assignment and the
# subsequent .sort() call involve different identifiers.
if r and "sorted" in r:
if r["id1"] == r["id2"]:
return r
return None
return r
def transform(self, node, results):
if "isinstance" in results:
return self.transform_isinstance(node, results)
elif "while" in results:
return self.transform_while(node, results)
elif "sorted" in results:
return self.transform_sort(node, results)
else:
raise RuntimeError("Invalid match")
def transform_isinstance(self, node, results):
x = results["x"].clone() # The thing inside of type()
T = results["T"].clone() # The type being compared against
x.prefix = u""
T.prefix = u" "
test = Call(Name(u"isinstance"), [x, Comma(), T])
if "n" in results:
test.prefix = u" "
test = Node(syms.not_test, [Name(u"not"), test])
test.prefix = node.prefix
return test
def transform_while(self, node, results):
one = results["while"]
one.replace(Name(u"True", prefix=one.prefix))
def transform_sort(self, node, results):
sort_stmt = results["sort"]
next_stmt = results["next"]
list_call = results.get("list")
simple_expr = results.get("expr")
if list_call:
list_call.replace(Name(u"sorted", prefix=list_call.prefix))
elif simple_expr:
new = simple_expr.clone()
new.prefix = u""
simple_expr.replace(Call(Name(u"sorted"), [new],
prefix=simple_expr.prefix))
else:
raise RuntimeError("should not have reached here")
sort_stmt.remove()
btwn = sort_stmt.prefix
# Keep any prefix lines between the sort_stmt and the list_call and
# shove them right after the sorted() call.
if u"\n" in btwn:
if next_stmt:
# The new prefix should be everything from the sort_stmt's
# prefix up to the last newline, then the old prefix after a new
# line.
prefix_lines = (btwn.rpartition(u"\n")[0], next_stmt[0].prefix)
next_stmt[0].prefix = u"\n".join(prefix_lines)
else:
assert list_call.parent
assert list_call.next_sibling is None
# Put a blank line after list_call and set its prefix.
end_line = BlankLine()
list_call.parent.append_child(end_line)
assert list_call.next_sibling is end_line
# The new prefix should be everything up to the first new line
# of sort_stmt's prefix.
end_line.prefix = btwn.rpartition(u"\n")[0]
| Python |
# Copyright 2007 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Fixer for StandardError -> Exception."""
# Local imports
from .. import fixer_base
from ..fixer_util import Name
class FixStandarderror(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
'StandardError'
"""
def transform(self, node, results):
return Name(u"Exception", prefix=node.prefix)
| Python |
"""Fix incompatible renames
Fixes:
* sys.maxint -> sys.maxsize
"""
# Author: Christian Heimes
# based on Collin Winter's fix_import
# Local imports
from .. import fixer_base
from ..fixer_util import Name, attr_chain
MAPPING = {"sys": {"maxint" : "maxsize"},
}
LOOKUP = {}
def alternates(members):
return "(" + "|".join(map(repr, members)) + ")"
def build_pattern():
#bare = set()
for module, replace in MAPPING.items():
for old_attr, new_attr in replace.items():
LOOKUP[(module, old_attr)] = new_attr
#bare.add(module)
#bare.add(old_attr)
#yield """
# import_name< 'import' (module=%r
# | dotted_as_names< any* module=%r any* >) >
# """ % (module, module)
yield """
import_from< 'from' module_name=%r 'import'
( attr_name=%r | import_as_name< attr_name=%r 'as' any >) >
""" % (module, old_attr, old_attr)
yield """
power< module_name=%r trailer< '.' attr_name=%r > any* >
""" % (module, old_attr)
#yield """bare_name=%s""" % alternates(bare)
class FixRenames(fixer_base.BaseFix):
BM_compatible = True
PATTERN = "|".join(build_pattern())
order = "pre" # Pre-order tree traversal
# Don't match the node if it's within another match
def match(self, node):
match = super(FixRenames, self).match
results = match(node)
if results:
if any(match(obj) for obj in attr_chain(node, "parent")):
return False
return results
return False
#def start_tree(self, tree, filename):
# super(FixRenames, self).start_tree(tree, filename)
# self.replace = {}
def transform(self, node, results):
mod_name = results.get("module_name")
attr_name = results.get("attr_name")
#bare_name = results.get("bare_name")
#import_mod = results.get("module")
if mod_name and attr_name:
new_attr = unicode(LOOKUP[(mod_name.value, attr_name.value)])
attr_name.replace(Name(new_attr, prefix=attr_name.prefix))
| Python |
# Copyright 2007 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Fixer that changes xrange(...) into range(...)."""
# Local imports
from .. import fixer_base
from ..fixer_util import Name, Call, consuming_calls
from .. import patcomp
class FixXrange(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
power<
(name='range'|name='xrange') trailer< '(' args=any ')' >
rest=any* >
"""
def start_tree(self, tree, filename):
super(FixXrange, self).start_tree(tree, filename)
self.transformed_xranges = set()
def finish_tree(self, tree, filename):
self.transformed_xranges = None
def transform(self, node, results):
name = results["name"]
if name.value == u"xrange":
return self.transform_xrange(node, results)
elif name.value == u"range":
return self.transform_range(node, results)
else:
raise ValueError(repr(name))
def transform_xrange(self, node, results):
name = results["name"]
name.replace(Name(u"range", prefix=name.prefix))
# This prevents the new range call from being wrapped in a list later.
self.transformed_xranges.add(id(node))
def transform_range(self, node, results):
if (id(node) not in self.transformed_xranges and
not self.in_special_context(node)):
range_call = Call(Name(u"range"), [results["args"].clone()])
# Encase the range call in list().
list_call = Call(Name(u"list"), [range_call],
prefix=node.prefix)
# Put things that were after the range() call after the list call.
for n in results["rest"]:
list_call.append_child(n)
return list_call
P1 = "power< func=NAME trailer< '(' node=any ')' > any* >"
p1 = patcomp.compile_pattern(P1)
P2 = """for_stmt< 'for' any 'in' node=any ':' any* >
| comp_for< 'for' any 'in' node=any any* >
| comparison< any 'in' node=any any*>
"""
p2 = patcomp.compile_pattern(P2)
def in_special_context(self, node):
if node.parent is None:
return False
results = {}
if (node.parent.parent is not None and
self.p1.match(node.parent.parent, results) and
results["node"] is node):
# list(d.keys()) -> list(d.keys()), etc.
return results["func"].value in consuming_calls
# for ... in d.iterkeys() -> for ... in d.keys(), etc.
return self.p2.match(node.parent, results) and results["node"] is node
| Python |
# Copyright 2006 Google, Inc. All Rights Reserved.
# Licensed to PSF under a Contributor Agreement.
"""Fixer that turns 'long' into 'int' everywhere.
"""
# Local imports
from lib2to3 import fixer_base
from lib2to3.fixer_util import is_probably_builtin
class FixLong(fixer_base.BaseFix):
BM_compatible = True
PATTERN = "'long'"
def transform(self, node, results):
if is_probably_builtin(node):
node.value = u"int"
node.changed()
| Python |
# Copyright 2008 Armin Ronacher.
# Licensed to PSF under a Contributor Agreement.
"""Fixer that cleans up a tuple argument to isinstance after the tokens
in it were fixed. This is mainly used to remove double occurrences of
tokens as a leftover of the long -> int / unicode -> str conversion.
eg. isinstance(x, (int, long)) -> isinstance(x, (int, int))
-> isinstance(x, int)
"""
from .. import fixer_base
from ..fixer_util import token
class FixIsinstance(fixer_base.BaseFix):
BM_compatible = True
PATTERN = """
power<
'isinstance'
trailer< '(' arglist< any ',' atom< '('
args=testlist_gexp< any+ >
')' > > ')' >
>
"""
run_order = 6
def transform(self, node, results):
names_inserted = set()
testlist = results["args"]
args = testlist.children
new_args = []
iterator = enumerate(args)
for idx, arg in iterator:
if arg.type == token.NAME and arg.value in names_inserted:
if idx < len(args) - 1 and args[idx + 1].type == token.COMMA:
iterator.next()
continue
else:
new_args.append(arg)
if arg.type == token.NAME:
names_inserted.add(arg.value)
if new_args and new_args[-1].type == token.COMMA:
del new_args[-1]
if len(new_args) == 1:
atom = testlist.parent
new_args[0].prefix = atom.prefix
atom.replace(new_args[0])
else:
args[:] = new_args
node.changed()
| Python |
Subsets and Splits
SQL Console for ajibawa-2023/Python-Code-Large
Provides a useful breakdown of language distribution in the training data, showing which languages have the most samples and helping identify potential imbalances across different language groups.