CT-ADE
Collection
2 items • Updated • 1
Dataset Preview
The full dataset viewer is not available (click to read why). Only showing a preview of the rows.
The dataset generation failed because of a cast error
Error code: DatasetGenerationCastError
Exception: DatasetGenerationCastError
Message: An error occurred while generating the dataset
All the data files must have the same columns, but at some point there are 27 new columns ({'frequency_Infections and infestations', 'frequency_Reproductive system and breast disorders', 'frequency_Pregnancy, puerperium and perinatal conditions', 'frequency_Ear and labyrinth disorders', 'frequency_Skin and subcutaneous tissue disorders', 'frequency_Surgical and medical procedures', 'frequency_Investigations', 'frequency_Blood and lymphatic system disorders', 'frequency_Renal and urinary disorders', 'frequency_Gastrointestinal disorders', 'frequency_Metabolism and nutrition disorders', 'frequency_Cardiac disorders', 'frequency_Injury, poisoning and procedural complications', 'frequency_Social circumstances', 'frequency_Respiratory, thoracic and mediastinal disorders', 'frequency_Psychiatric disorders', 'frequency_Immune system disorders', 'frequency_Musculoskeletal and connective tissue disorders', 'frequency_Product issues', 'frequency_Neoplasms benign, malignant and unspecified (incl cysts and polyps)', 'frequency_Congenital, familial and genetic disorders', 'frequency_General disorders and administration site conditions', 'frequency_Endocrine disorders', 'frequency_Nervous system disorders', 'frequency_Eye disorders', 'frequency_Hepatobiliary disorders', 'frequency_Vascular disorders'}) and 38 missing columns ({'label_Congenital, familial and genetic disorders', 'phase', 'healthy_volunteers', 'label_Social circumstances', 'label_Hepatobiliary disorders', 'drug_info_source', 'label_Blood and lymphatic system disorders', 'label_Gastrointestinal disorders', 'group_description', 'label_Infections and infestations', 'ade_num_at_risk', 'label_Skin and subcutaneous tissue disorders', 'label_Reproductive system and breast disorders', 'age', 'eligibility_criteria', 'label_Psychiatric disorders', 'label_Endocrine disorders', 'label_Renal and urinary disorders', 'label_Respiratory, thoracic and mediastinal disorders', 'label_Ear and labyrinth disorders', 'label_Injury, poisoning and procedural complications', 'label_Pregnancy, puerperium and perinatal conditions', 'label_Immune system disorders', 'atc_code', 'label_Nervous system disorders', 'label_Eye disorders', 'label_General disorders and administration site conditions', 'gender', 'label_Vascular disorders', 'intervention_name', 'label_Investigations', 'label_Metabolism and nutrition disorders', 'label_Cardiac disorders', 'label_Surgical and medical procedures', 'smiles', 'label_Neoplasms benign, malignant and unspecified (incl cysts and polyps)', 'label_Product issues', 'label_Musculoskeletal and connective tissue disorders'}).
This happened while the csv dataset builder was generating data using
hf://datasets/anthonyyazdaniml/CT-ADE-SOC/train_frequencies.csv (at revision 4019abf3f37a5e1b2de499081aba1ef2993bf90d)
Please either edit the data files to have matching columns, or separate them into different configurations (see docs at https://hf.co/docs/hub/datasets-manual-configuration#multiple-configurations)
Traceback: Traceback (most recent call last):
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1870, in _prepare_split_single
writer.write_table(table)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/arrow_writer.py", line 622, in write_table
pa_table = table_cast(pa_table, self._schema)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/table.py", line 2292, in table_cast
return cast_table_to_schema(table, schema)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/table.py", line 2240, in cast_table_to_schema
raise CastError(
datasets.table.CastError: Couldn't cast
nctid: string
group_id: string
frequency_Blood and lymphatic system disorders: double
frequency_Cardiac disorders: double
frequency_Congenital, familial and genetic disorders: double
frequency_Ear and labyrinth disorders: double
frequency_Endocrine disorders: double
frequency_Eye disorders: double
frequency_Gastrointestinal disorders: double
frequency_General disorders and administration site conditions: double
frequency_Hepatobiliary disorders: double
frequency_Immune system disorders: double
frequency_Infections and infestations: double
frequency_Injury, poisoning and procedural complications: double
frequency_Investigations: double
frequency_Metabolism and nutrition disorders: double
frequency_Musculoskeletal and connective tissue disorders: double
frequency_Neoplasms benign, malignant and unspecified (incl cysts and polyps): double
frequency_Nervous system disorders: double
frequency_Pregnancy, puerperium and perinatal conditions: double
frequency_Psychiatric disorders: double
frequency_Renal and urinary disorders: double
frequency_Reproductive system and breast disorders: double
frequency_Respiratory, thoracic and mediastinal disorders: double
frequency_Skin and subcutaneous tissue disorders: double
frequency_Social circumstances: double
frequency_Surgical and medical procedures: double
frequency_Vascular disorders: double
frequency_Product issues: double
-- schema metadata --
pandas: '{"index_columns": [{"kind": "range", "name": null, "start": 0, "' + 5434
to
{'nctid': Value(dtype='string', id=None), 'group_id': Value(dtype='string', id=None), 'healthy_volunteers': Value(dtype='string', id=None), 'gender': Value(dtype='string', id=None), 'age': Value(dtype='string', id=None), 'phase': Value(dtype='string', id=None), 'ade_num_at_risk': Value(dtype='int64', id=None), 'eligibility_criteria': Value(dtype='string', id=None), 'group_description': Value(dtype='string', id=None), 'drug_info_source': Value(dtype='string', id=None), 'intervention_name': Value(dtype='string', id=None), 'smiles': Value(dtype='string', id=None), 'atc_code': Value(dtype='string', id=None), 'label_Blood and lymphatic system disorders': Value(dtype='float64', id=None), 'label_Cardiac disorders': Value(dtype='float64', id=None), 'label_Congenital, familial and genetic disorders': Value(dtype='float64', id=None), 'label_Ear and labyrinth disorders': Value(dtype='float64', id=None), 'label_Endocrine disorders': Value(dtype='float64', id=None), 'label_Eye disorders': Value(dtype='float64', id=None), 'label_Gastrointestinal disorders': Value(dtype='float64', id=None), 'label_General disorders and administration site conditions': Value(dtype='float64', id=None), 'label_Hepatobiliary disorders': Value(dtype='float64', id=None), 'label_Immune system disorders': Value(dtype='float64', id=None), 'label_Infections and infestations': Value(dtype='float64', id=None), 'label_Injury, poisoning and procedural complications': Value(dtype='float64', id=None), 'label_Investigations': Value(dtype='float64', id=None), 'label_Metabolism and nutrition disorders': Value(dtype='float64', id=None), 'label_Musculoskeletal and connective tissue disorders': Value(dtype='float64', id=None), 'label_Neoplasms benign, malignant and unspecified (incl cysts and polyps)': Value(dtype='float64', id=None), 'label_Nervous system disorders': Value(dtype='float64', id=None), 'label_Pregnancy, puerperium and perinatal conditions': Value(dtype='float64', id=None), 'label_Psychiatric disorders': Value(dtype='float64', id=None), 'label_Renal and urinary disorders': Value(dtype='float64', id=None), 'label_Reproductive system and breast disorders': Value(dtype='float64', id=None), 'label_Respiratory, thoracic and mediastinal disorders': Value(dtype='float64', id=None), 'label_Skin and subcutaneous tissue disorders': Value(dtype='float64', id=None), 'label_Social circumstances': Value(dtype='float64', id=None), 'label_Surgical and medical procedures': Value(dtype='float64', id=None), 'label_Vascular disorders': Value(dtype='float64', id=None), 'label_Product issues': Value(dtype='float64', id=None)}
because column names don't match
During handling of the above exception, another exception occurred:
Traceback (most recent call last):
File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 1438, in compute_config_parquet_and_info_response
parquet_operations = convert_to_parquet(builder)
File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 1050, in convert_to_parquet
builder.download_and_prepare(
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 924, in download_and_prepare
self._download_and_prepare(
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1000, in _download_and_prepare
self._prepare_split(split_generator, **prepare_split_kwargs)
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1741, in _prepare_split
for job_id, done, content in self._prepare_split_single(
File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1872, in _prepare_split_single
raise DatasetGenerationCastError.from_cast_error(
datasets.exceptions.DatasetGenerationCastError: An error occurred while generating the dataset
All the data files must have the same columns, but at some point there are 27 new columns ({'frequency_Infections and infestations', 'frequency_Reproductive system and breast disorders', 'frequency_Pregnancy, puerperium and perinatal conditions', 'frequency_Ear and labyrinth disorders', 'frequency_Skin and subcutaneous tissue disorders', 'frequency_Surgical and medical procedures', 'frequency_Investigations', 'frequency_Blood and lymphatic system disorders', 'frequency_Renal and urinary disorders', 'frequency_Gastrointestinal disorders', 'frequency_Metabolism and nutrition disorders', 'frequency_Cardiac disorders', 'frequency_Injury, poisoning and procedural complications', 'frequency_Social circumstances', 'frequency_Respiratory, thoracic and mediastinal disorders', 'frequency_Psychiatric disorders', 'frequency_Immune system disorders', 'frequency_Musculoskeletal and connective tissue disorders', 'frequency_Product issues', 'frequency_Neoplasms benign, malignant and unspecified (incl cysts and polyps)', 'frequency_Congenital, familial and genetic disorders', 'frequency_General disorders and administration site conditions', 'frequency_Endocrine disorders', 'frequency_Nervous system disorders', 'frequency_Eye disorders', 'frequency_Hepatobiliary disorders', 'frequency_Vascular disorders'}) and 38 missing columns ({'label_Congenital, familial and genetic disorders', 'phase', 'healthy_volunteers', 'label_Social circumstances', 'label_Hepatobiliary disorders', 'drug_info_source', 'label_Blood and lymphatic system disorders', 'label_Gastrointestinal disorders', 'group_description', 'label_Infections and infestations', 'ade_num_at_risk', 'label_Skin and subcutaneous tissue disorders', 'label_Reproductive system and breast disorders', 'age', 'eligibility_criteria', 'label_Psychiatric disorders', 'label_Endocrine disorders', 'label_Renal and urinary disorders', 'label_Respiratory, thoracic and mediastinal disorders', 'label_Ear and labyrinth disorders', 'label_Injury, poisoning and procedural complications', 'label_Pregnancy, puerperium and perinatal conditions', 'label_Immune system disorders', 'atc_code', 'label_Nervous system disorders', 'label_Eye disorders', 'label_General disorders and administration site conditions', 'gender', 'label_Vascular disorders', 'intervention_name', 'label_Investigations', 'label_Metabolism and nutrition disorders', 'label_Cardiac disorders', 'label_Surgical and medical procedures', 'smiles', 'label_Neoplasms benign, malignant and unspecified (incl cysts and polyps)', 'label_Product issues', 'label_Musculoskeletal and connective tissue disorders'}).
This happened while the csv dataset builder was generating data using
hf://datasets/anthonyyazdaniml/CT-ADE-SOC/train_frequencies.csv (at revision 4019abf3f37a5e1b2de499081aba1ef2993bf90d)
Please either edit the data files to have matching columns, or separate them into different configurations (see docs at https://hf.co/docs/hub/datasets-manual-configuration#multiple-configurations)Need help to make the dataset viewer work? Make sure to review how to configure the dataset viewer, and open a discussion for direct support.
nctid string | group_id string | healthy_volunteers string | gender string | age string | phase string | ade_num_at_risk int64 | eligibility_criteria string | group_description string | drug_info_source string | intervention_name string | smiles string | atc_code string | label_Blood and lymphatic system disorders float64 | label_Cardiac disorders float64 | label_Congenital, familial and genetic disorders float64 | label_Ear and labyrinth disorders float64 | label_Endocrine disorders float64 | label_Eye disorders float64 | label_Gastrointestinal disorders float64 | label_General disorders and administration site conditions float64 | label_Hepatobiliary disorders float64 | label_Immune system disorders float64 | label_Infections and infestations float64 | label_Injury, poisoning and procedural complications float64 | label_Investigations float64 | label_Metabolism and nutrition disorders float64 | label_Musculoskeletal and connective tissue disorders float64 | label_Neoplasms benign, malignant and unspecified (incl cysts and polyps) float64 | label_Nervous system disorders float64 | label_Pregnancy, puerperium and perinatal conditions float64 | label_Psychiatric disorders float64 | label_Renal and urinary disorders float64 | label_Reproductive system and breast disorders float64 | label_Respiratory, thoracic and mediastinal disorders float64 | label_Skin and subcutaneous tissue disorders float64 | label_Social circumstances float64 | label_Surgical and medical procedures float64 | label_Vascular disorders float64 | label_Product issues float64 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
NCT00000134 | NCT00000134_EG000 | No | All | Adult | Older Adult | Phase 3 | 88 | inclusion criteria: Males and females eligible for the CRRT must have been age 18 years or older and have had AIDS and CMV retinitis. They must have had active CMV despite a minimum of 28 days of previous treatment with an anti-CMV drug. Furthermore, they must have had an absolute neutrophil count greater than or equal... | intravenous foscarnet reinduction at 90 mg/kg twice daily for 2 weeks, followed by maintenance therapy at 120 mg/kg/day
Foscarnet: intravenous foscarnet induction at 90 mg/kg twice daily for 2 weeks, followed by maintenance therapy at 120 mg/kg/day | ChEMBL:CHEMBL666 | DrugBank:DB00529 | PubChem:3415 | Foscarnet | O=C(O)P(=O)(O)O | J05AD01 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000134 | NCT00000134_EG001 | No | All | Adult | Older Adult | Phase 3 | 93 | inclusion criteria: Males and females eligible for the CRRT must have been age 18 years or older and have had AIDS and CMV retinitis. They must have had active CMV despite a minimum of 28 days of previous treatment with an anti-CMV drug. Furthermore, they must have had an absolute neutrophil count greater than or equal... | intravenous ganciclovir reinduction at 5 mg/kg twice daily for 2 weeks followed by maintenance at 10 mg/kg/day
Ganciclovir: intravenous ganciclovir induction at 5 mg/kg twice daily for 2 weeks followed by maintenance at 10 mg/kg/day | ChEMBL:CHEMBL182 | DrugBank:DB01004 | PubChem:135398740 | Ganciclovir | Nc1nc2c(ncn2COC(CO)CO)c(=O)[nH]1 | J05AB06 | S01AD09 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000142 | NCT00000142_EG000 | No | All | Child | Adult | Older Adult | Phase 2 | Phase 3 | 26 | Inclusion criteria:
diagnosis of AIDS according to the Centers for Disease Control and Prevention (CDC)
13 years or older
Diagnosis of CMV (cytomegalovirus) retinitis as determined by a SOCA-certified Ophthalmologist.
At least one lesion whose size is one-quarter disc area or more that can be photographed.
Visual acui... | IV (in the vein) treatment deferred until retinitis progressed, either:
5 mg/kg IV (in the vein) of body weight once weekly for two weeks, then maintenance therapy with cidofovir, 3mg/kg once every 2 weeks, or
5mg/kg IV (in the vein) once weekly for 2 weeks, then maintenance therapy with cidofovir, 5mg/kg once every ... | ChEMBL:CHEMBL152 | DrugBank:DB00369 | PubChem:60613 | Cidofovir | Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | J05AB12 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000142 | NCT00000142_EG001 | No | All | Child | Adult | Older Adult | Phase 2 | Phase 3 | 26 | Inclusion criteria:
diagnosis of AIDS according to the Centers for Disease Control and Prevention (CDC)
13 years or older
Diagnosis of CMV (cytomegalovirus) retinitis as determined by a SOCA-certified Ophthalmologist.
At least one lesion whose size is one-quarter disc area or more that can be photographed.
Visual acui... | 5 mg/kg IV (in the vein) of body weight once weekly for two weeks, then maintenance therapy with cidofovir, 3mg/kg once every 2 weeks
Cidofovir: Three groups:
the deferral group, treatment deferred until retinitis progressed
Low-dose cidofovir group, 5 mg/kg of body weight once weekly for two weeks, then maintenance ... | ChEMBL:CHEMBL152 | DrugBank:DB00369 | PubChem:60613 | Cidofovir | Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | J05AB12 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000142 | NCT00000142_EG002 | No | All | Child | Adult | Older Adult | Phase 2 | Phase 3 | 12 | Inclusion criteria:
diagnosis of AIDS according to the Centers for Disease Control and Prevention (CDC)
13 years or older
Diagnosis of CMV (cytomegalovirus) retinitis as determined by a SOCA-certified Ophthalmologist.
At least one lesion whose size is one-quarter disc area or more that can be photographed.
Visual acui... | 5mg/kg IV (in the vein) once weekly for 2 weeks, then maintenance therapy with cidofovir, 5mg/kg once every two weeks.
Cidofovir: Three groups:
the deferral group, treatment deferred until retinitis progressed
Low-dose cidofovir group, 5 mg/kg of body weight once weekly for two weeks, then maintenance therapy with ci... | ChEMBL:CHEMBL152 | DrugBank:DB00369 | PubChem:60613 | Cidofovir | Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | J05AB12 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000143 | NCT00000143_EG001 | No | All | Child | Adult | Older Adult | Phase 3 | 61 | Inclusion criteria:
Age 13 years or older
Diagnosis of AIDS according to current Centers for Disease Control and Prevention (CDC) definition
Diagnosis of active CMV retinitis by a SOCA-certified ophthalmologist (involvement of any zone or amount of retina is allowed)
Best corrected visual acuity of 20/100 or better in... | cidofovir intravenous (IV) start off with 5 mg/kg once weekly for two doses then followed by 5 mg/kg every other week
Cidofovir intravenous: intravenous, 5 mg/kg once weekly for two doses, followed by 5 mg/kg every other week | ChEMBL:CHEMBL152 | DrugBank:DB00369 | PubChem:60613 | Cidofovir | Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | J05AB12 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000378 | NCT00000378_EG000 | No | All | Adult | Older Adult | Phase 4 | 58 | Inclusion Criteria:
-
Patients must have:
Unipolar major depression (per Diagnostic and Statistical Manuel-IV criteria) with or without melancholia.
Exclusion Criteria:
-
Patients with the following symptoms or conditions are excluded:
Psychotic or atypical subtype of unipolar major depression. | patients randomized to sertraline 12 week trial does up to 200mgs
Sertraline: 12 week trial dose up to 200mgs | ChEMBL:CHEMBL809 | DrugBank:DB01104 | PubChem:68617 | Sertraline | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 | N06AB06 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000378 | NCT00000378_EG001 | No | All | Adult | Older Adult | Phase 4 | 52 | Inclusion Criteria:
-
Patients must have:
Unipolar major depression (per Diagnostic and Statistical Manuel-IV criteria) with or without melancholia.
Exclusion Criteria:
-
Patients with the following symptoms or conditions are excluded:
Psychotic or atypical subtype of unipolar major depression. | patients randomized to nortriptyline dose adjusted to therapeutic level
Nortriptyline: 12 week trial dose adjusted to therapeutic level | ChEMBL:CHEMBL445 | DrugBank:DB00540 | PubChem:4543 | Nortriptyline | CNCCC=C1c2ccccc2CCc2ccccc21 | N06AA10 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000575 | NCT00000575_EG000 | No | All | Child | Phase 3 | 311 | Inclusion criteria:
Age 5 to 12 years at time of screening
Chronic asthma as evidenced by one or more of the following historical findings for at least 6 months during the past year:
Asthma symptoms at least 2 times per week
2 or more usages per week of an inhaled bronchodilator
Daily asthma medication
Current asthma ... | Budesonide (Pulmicort), two 100 microgram puffs bid + two microgram puffs albuterol (Ventolin) prn | ChEMBL:CHEMBL1370 | DrugBank:DB01222 | PubChem:5281004 | PubChem:63006 | Budesonide | CCCC1OC2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)C2(C(=O)CO)O1 | A07EA06 | D07AC09 | R01AD05 | R03AK07 | R03AK12 | R03AL11 | R03BA02 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000575 | NCT00000575_EG001 | No | All | Child | Phase 3 | 312 | Inclusion criteria:
Age 5 to 12 years at time of screening
Chronic asthma as evidenced by one or more of the following historical findings for at least 6 months during the past year:
Asthma symptoms at least 2 times per week
2 or more usages per week of an inhaled bronchodilator
Daily asthma medication
Current asthma ... | Nedocromil (Tilade), four 2 mg puffs bid + two 90 microgram puffs albuterol prn | ChEMBL:CHEMBL746 | DrugBank:DB00716 | PubChem:50294 | Nedocromil | CCCc1c2oc(C(=O)O)cc(=O)c2cc2c(=O)cc(C(=O)O)n(CC)c12 | R01AC07 | R03BC03 | S01GX04 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000620 | NCT00000620_EG000 | No | All | Adult | Older Adult | Phase 3 | 5,128 | Inclusion Criteria:
Diagnosed with type 2 diabetes mellitus, as determined by the new American Diabetes Association guidelines, which include a fasting plasma glucose level greater than 126 mg/dl (7.0 mmol/l), or a 2-hour postload value in the oral glucose tolerance test of greater than 200 mg/dl, with confirmation by... | Open label administration of oral anti-hyperglycemic agents and/or insulin in combination with dietary/lifestyle advice as needed to achieve glycated hemoglobin (HbA1c) levels <6.0%. Anti-hyperglycemic agents include multiple drugs including insulins and oral anti-hyperglycemic agents as needed to reach Glycemia Trial ... | ChEMBL:CHEMBL1566 | DrugBank:DB00284 | ACARBOSE | [H]C(=O)[C@H](O)[C@@H](O)[C@]([H])(O[C@@]1([H])O[C@H](CO)[C@@]([H])(O[C@H]2O[C@H](C)[C@@H](N[C@@]3([H])C=C(CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O)[C@H](O)CO | A10BD17 | A10BF01 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00000620 | NCT00000620_EG001 | No | All | Adult | Older Adult | Phase 3 | 5,123 | Inclusion Criteria:
Diagnosed with type 2 diabetes mellitus, as determined by the new American Diabetes Association guidelines, which include a fasting plasma glucose level greater than 126 mg/dl (7.0 mmol/l), or a 2-hour postload value in the oral glucose tolerance test of greater than 200 mg/dl, with confirmation by... | Open label administration of oral anti-hyperglycemic agents and/or insulin in combination with dietary/lifestyle advice as needed to achieve glycated hemoglobin (HbA1c) levels of 7.0 to 7.9%. Anti-hyperglycemic agents include multiple drugs including insulins and oral anti-hyperglycemic agents as needed to reach Glycem... | ChEMBL:CHEMBL1566 | DrugBank:DB00284 | ACARBOSE | [H]C(=O)[C@H](O)[C@@H](O)[C@]([H])(O[C@@]1([H])O[C@H](CO)[C@@]([H])(O[C@H]2O[C@H](C)[C@@H](N[C@@]3([H])C=C(CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O)[C@H](O)CO | A10BD17 | A10BF01 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00001596 | NCT00001596_EG000 | No | All | Adult | Older Adult | Phase 2 | 23 | INCLUSION CRITERIA
For the portion of the protocol involving continuations of pirfenidone treatment, the criteria are simply previous enrollment in 97-HG-0085.
For enrollment in the new clinical trial, the inclusion criteria involve enrollment in protocol 95-HG-0193, "Clinical and Basic Investigations into Hermansky-... | Subjects received pirfenidone 801 mg (3 pills of 267 mg each), three times daily. | ChEMBL:CHEMBL1256391 | DrugBank:DB04951 | PubChem:25145077 | PubChem:40632 | Pirfenidone | Cc1ccc(=O)n(-c2ccccc2)c1 | L04AX05 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 |
NCT00002850 | NCT00002850_EG001 | No | All | Adult | Older Adult | Phase 3 | 76 | Inclusion:
Patient must have a diagnosis of multiple myeloma confirmed by the presence of:
Bone marrow plasmacytosis with >10% abnormal plasma cells or multiple biopsy-proven plasmacytomas, and at least one of the criteria below must be documented:
Myeloma protein in the serum
Myeloma protein in the urine (free mono... | trimethoprim-sulfamethoxazole: Begin oral Trimethoprim-sulfamethoxazole when they start chemotherapy for multiple myeloma. Assigned treatment consists of TMP-SMX (Septra® or Bactrim®) 1 DS tablet [TMP-SMX DS = 160 mg trimethoprim and 800 mg sulfamethoxazole] every 12 hours for two months.. | ChEMBL:CHEMBL443 | DrugBank:DB01015 | PubChem:5329 | Sulfamethoxazole | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 | G01AE10 | J01EC01 | J01EE01 | J04AM08 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00002975 | NCT00002975_EG000 | No | All | Child | Adult | Older Adult | Phase 2 | 180 | DISEASE CHARACTERISTICS:
Diagnosis of 1 of the following:
Actinic keratoses
Histologically proven superficial or nodular basal cell carcinoma (BCC), squamous cell carcinoma in situ (Bowen's disease), or microinvasive squamous cell carcinoma
No nodular BCC greater than 4 mm thick that will not be surgically removed
No... | 4-6h and 18-24h, 20%, ALA application of superficial and nodular epidermally-derived lesions using ca 633 nm laser irradiation | DrugBank:DB00855 | PubChem:137 | Aminolevulinic Acid | NCC(=O)CCC(=O)O | L01XD04 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00004146 | NCT00004146_EG000 | No | All | Adult | Older Adult | Phase 2 | 55 | Inclusion Criteria:
Patients must have histologically confirmed supratentorial grade IV astrocytoma (glioblastoma multiforme)
Patients must have measurable or non-measurable tumor on the post operative, pretreatment MRI/CT scan (within two weeks of starting treatment)
Patients must not have received prior radiation th... | CAI with RT
carboxyamidotriazole :
CAI : CAI 250 mg PO plus RT followed by 4wks CAI alone followed by 8wks CAI then MRI if stable or better continue until progression and then follow for survival
radiation therapy : | DrugBank:DB11960 | PubChem:108144 | Carboxyamidotriazole | NC(=O)c1nnn(Cc2cc(Cl)c(C(=O)c3ccc(Cl)cc3)c(Cl)c2)c1N | null | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 |
NCT00004563 | NCT00004563_EG000 | No | All | Adult | Older Adult | Phase 3 | 79 | Inclusion Criteria:
Patients with limited or diffuse systemic scleroderma if they had evidence of active alveolitis on examination of bronchoalveolar-lavage (BAL) fluid (defined as neutrophilia of ≥3 percent, eosinophilia of ≥2 percent, or both)on thoracic high-resolution computed tomography (CT), any ground-glass opa... | Cyclophosphamide (Cytoxan, Bristol-Myers Squibb) was initiated with a dose of 1 mg per kilogram of body weight per day (to the nearest 25 mg). The doses were increased monthly by one capsule up to 2 mg per kilogram.
Cyclophosphamide: Cyclophosphamide (Cytoxan, Bristol-Myers Squibb) was initiated with a dose of 1 mg pe... | ChEMBL:CHEMBL88 | DrugBank:DB00531 | PubChem:2907 | Cyclophosphamide | O=P1(N(CCCl)CCCl)NCCCO1 | L01AA01 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 |
NCT00004978 | NCT00004978_EG000 | No | All | Adult | Older Adult | Phase 3 | 2,071 | Inclusion Criteria:
HIV positive
Have a CD4 cell count of 300 cells/mm3 or more within 45 days of study entry
Are on combination anti-HIV therapy or are beginning anti-HIV therapy at the time of study entry
Are at least 18 years old
Exclusion Criteria:
Have received IL-2 before
Have cancer requiring chemotherapy
Hav... | Subcutaneous recombinant interleukin-2 (rIL-2) therapy | ChEMBL:CHEMBL115 | DrugBank:DB00224 | PubChem:5362440 | Indinavir | CC(C)(C)NC(=O)[C@@H]1CN(Cc2cccnc2)CCN1C[C@@H](O)C[C@@H](Cc1ccccc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O | J05AE02 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00005879 | NCT00005879_EG001 | Accepts Healthy Volunteers | Female | Adult | Older Adult | Phase 2 | 98 | DISEASE CHARACTERISTICS:
Current random fine needle breast aspiration (FNA) evidence of 1 of the following:
Hyperplasia with atypia
Hyperplasia without atypia but with a 10-year modified Gail risk of at least 4%
Hyperplasia without atypia but with a BRCAPRO risk of at least 25%
Hyperplasia without atypia but with a k... | LY353381, 20 mg daily
arzoxifene: one tablet daily | ChEMBL:CHEMBL226267 | DrugBank:DB06249 | PubChem:179337 | Arzoxifene | COc1ccc(-c2sc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | 0 | 1 | 0 | 0 |
NCT00005901 | NCT00005901_EG000 | No | All | Child | Phase 3 | 19 | INCLUSION CRITERIA:
Children enrolled in this study will be limited to those with Sillence types III and IV OI, as determined by clinical and genetic criteria.
Most of the children who will be included in this study are already enrolled in the protocols Evaluation and Intervention for Ambulation, Growth, and Basilar ... | Subjects who received Pamidronate every 3 months for 3 years. | ChEMBL:CHEMBL834 | DrugBank:DB00282 | PubChem:4674 | PAMIDRONIC ACID | NCCC(O)(P(=O)(O)O)P(=O)(O)O | M05BA03 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00005901 | NCT00005901_EG001 | No | All | Child | Phase 3 | 15 | INCLUSION CRITERIA:
Children enrolled in this study will be limited to those with Sillence types III and IV OI, as determined by clinical and genetic criteria.
Most of the children who will be included in this study are already enrolled in the protocols Evaluation and Intervention for Ambulation, Growth, and Basilar ... | Subjects who received Pamidronate every 6 months for 3 years. | ChEMBL:CHEMBL834 | DrugBank:DB00282 | PubChem:4674 | PAMIDRONIC ACID | NCCC(O)(P(=O)(O)O)P(=O)(O)O | M05BA03 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 |
NCT00005906 | NCT00005906_EG000 | No | Female | Adult | Older Adult | Phase 2 | 4 | INCLUSION CRITERIA:
Patients enrolled in the lymphangioleiomyomatosis natural history protocol who have symptoms associated with one of the following:
lymphangioleiomyomas
chylous pleural effusions
peripheral lymph-edema
chyloptysis
protein-losing enteropathy
chyluria
Patients will be included in this protocol if sy... | Patients with lymphangioleiomyomatosis and lymphatic tumors causing chylous effusions and abdominal pain | ChEMBL:CHEMBL1680 | PubChem:122173801 | PubChem:155903738 | PubChem:383414 | PubChem:44311916 | PubChem:44420813 | PubChem:448601 | PubChem:6400441 | PubChem:86289069 | PubChem:90488715 | Mycapssa | CC(O)C(CO)NC(=O)C1CSSCC(NC(=O)C(N)Cc2ccccc2)C(=O)NC(Cc2ccccc2)C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CCCCN)C(=O)NC(C(C)O)C(=O)N1 | H01CB02 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00006101 | NCT00006101_EG000 | No | Male | Adult | Older Adult | Phase 2 | 38 | Criteria for Eligibility
Men between the ages of 35 and 70 with family history of prostate cancer, i.e., prostate cancer diagnosed in two first degree relatives before the age of 70 years. (First degree relatives include a brother, father, and son.) There will be occasions in which a second or even third degree relati... | 500mg/d for 12 months
eflornithine: Take 500mg of DFMO per day for 12 months | ChEMBL:CHEMBL830 | DrugBank:DB06243 | PubChem:3009 | Eflornithine | NCCCC(N)(C(=O)O)C(F)F | D11AX16 | P01CX03 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00006244 | NCT00006244_EG000 | No | All | Adult | Older Adult | Phase 2 | 36 | Inclusion Criteria:
Patient must be less than 70 years old
Patients with advanced Multiple Myeloma that meet the eligibility requirements for mobilization/debulking with Cytoxan/VP-16/G-CSF, Cytoxan/Taxol/G-CSF, or Cytoxan/G-CSF (according to protocol 506.03); if clinically indicated a lower dose of cytoxan than 4g/m2... | Patients receive melphalan IV over 2-3 hours on day -2 and an infusion of IL-2-treated autologous or syngeneic peripheral blood stem cells on day 0. Beginning on day 0, patients also receive IL-2 IV continuously over 5 days followed by 2 days off. Treatment with IL-2 repeats weekly for 4 weeks. Beginning 1 month later,... | ChEMBL:CHEMBL429405 | ChEMBL:CHEMBL852 | DrugBank:DB01042 | PubChem:460612 | Melphalan | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O | L01AA03 | 1 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00008385 | NCT00008385_EG001 | No | All | Adult | Older Adult | Phase 3 | 865 | RUN-IN PERIOD:
Inclusion Criteria:
Histologically confirmed, completely resected stage IA (pT1, N0) or IB (pT2, N0) non-small lung cancer (except carcinoid)*
Completion of treatment for stage I lung cancer within the past 6 to 36 months and currently disease free
At least one mediastinal lymph node sampled at resect... | Participants receive oral selenium yeast daily for 6 months. Treatment repeats every 6 months for 8 courses for a total of 4 years in the absence of unacceptable toxicity.
selenium: Given orally | DrugBank:DB11135 | PubChem:6326970 | Selenium | [Se] | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 |
NCT00009945 | NCT00009945_EG000 | No | Female | Adult | Older Adult | Phase 3 | 1,612 | Eligibility
Patients must have undergone either a total mastectomy or a lumpectomy with either an axillary dissection or sentinel node biopsy. If any sentinel node is histologically positive by H & E, or histologically suspicious on H & E and confirmed positive by immunohistochemistry (IHC), then the patient must have... | Clodronate | ChEMBL:CHEMBL12318 | DrugBank:DB00720 | PubChem:25419 | CLODRONIC ACID | O=P(O)(O)C(Cl)(Cl)P(=O)(O)O | M05BA02 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00010439 | NCT00010439_EG000 | No | All | Child | Phase 2 | 10 | Eligibility Criteria:
5-14 years of age
Weight 20 kg or greater
History of one or more atraumatic fracture
Sexual development no greater than Tanner II
Osteoporosis by DXA (Diagnosis of high-turnover osteoporosis with no underlying cause (e.g., malignancy, hyperthyroidism, hyperparathyroidism, or vitamin D intoxicatio... | Ten children will take alendronate 35mg or 70mg weekly depending upon the body weight for 12 months. Patients will also take calcium supplement daily. | ChEMBL:CHEMBL870 | DrugBank:DB00630 | PubChem:2088 | ALENDRONIC ACID | NCCCC(O)(P(=O)(O)O)P(=O)(O)O | M05BA04 | M05BB03 | M05BB05 | M05BB06 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00016354 | NCT00016354_EG000 | No | All | Adult | Older Adult | Phase 1 | 19 | DISEASE CHARACTERISTICS:
Histologically confirmed malignancy
Metastatic or unresectable
No effective standard curative or palliative measures exist
No known CNS or brain metastasis
PATIENT CHARACTERISTICS:
Age:
18 and over
Performance status:
ECOG 0-1
Life expectancy:
Not specified
Hematopoietic:
Absolute ne... | BPU, administered over a dose range of 5-320 mg | PubChem:19851629 | Benzoylphenylurea | NC(=O)N(C(=O)c1ccccc1)c1ccccc1 | null | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 |
NCT00019747 | NCT00019747_EG000 | No | All | Adult | Older Adult | Phase 2 | 23 | DISEASE CHARACTERISTICS:
Diagnosis of recurrent or metastatic colorectal carcinoma previously resected within 12 weeks of study entry
Surgical resection combined with radiofrequency ablation allowed
PATIENT CHARACTERISTICS:
Age:
18 and over
Performance status:
Not specified
Life expectancy:
Not specified
Hema... | Patients receive oral thalidomide 100 mg at bedtime once daily for 4 weeks, then progresses to 200 mg at bedtime for 4 weeks, then progresses to 300 mg at bedtime (maintenance dose). | ChEMBL:CHEMBL468 | DrugBank:DB01041 | PubChem:5426 | Thalidomide | O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1 | L04AX02 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 |
NCT00022672 | NCT00022672_EG001 | No | Female | Adult | Older Adult | Phase 3 | 104 | Inclusion Criteria:
postmenopausal women;
metastatic breast cancer suitable for endocrine therapy;
positive hormone receptor status;
Human epidermal growth factor receptor 2 (HER2) overexpression.
Exclusion Criteria:
patients on hormone replacement therapy;
previous chemotherapy for metastatic disease;
uncontrolled ... | 1 mg oral dose of anastrozole every day for 24 Months in the Main phase. | ChEMBL:CHEMBL1399 | DrugBank:DB01217 | PubChem:2187 | Anastrozole | CC(C)(C#N)c1cc(Cn2cncn2)cc(C(C)(C)C#N)c1 | L02BG03 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 |
NCT00031447 | NCT00031447_EG001 | No | All | Child | Phase 3 | 15 | Inclusion Criteria:
Isolation by viral culture of herpes simplex virus (HSV)-1or HSV-2 from cutaneous lesions, conjunctivae, or oropharynx. Detection of HSV at any of these sites is sufficient, and the presence of skin lesions is not required for study enrollment.
Normal cerebrospinal fluid (CSF) indices (<22 white bl... | Oral suspension 300 mg/m^2/dose TID for 6 months. | ChEMBL:CHEMBL184 | DrugBank:DB00787 | PubChem:135398513 | Acyclovir | Nc1nc2c(ncn2COCCO)c(=O)[nH]1 | D06BB03 | D06BB53 | J05AB01 | S01AD03 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00031460 | NCT00031460_EG000 | No | All | Child | Phase 3 | 24 | Inclusion Criteria:
Viral Culture:
If cutaneous lesions are present, then isolation of Herpes Simplex Virus (HSV)-1 or HSV-2 by viral culture from any site (skin, oropharynx, cerebral spinal fluid [CSF], urine, etc.) will be required for study entry.
If cutaneous lesions are not present, then viral isolation by cultu... | Oral suspension 300 mg/m^2/dose TID for 6 months. | ChEMBL:CHEMBL184 | DrugBank:DB00787 | PubChem:135398513 | Acyclovir | Nc1nc2c(ncn2COCCO)c(=O)[nH]1 | D06BB03 | D06BB53 | J05AB01 | S01AD03 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00033917 | NCT00033917_EG000 | Accepts Healthy Volunteers | All | Child | Phase 3 | 209 | Preterm infants < 1250 g birth weight
Admitted to participating institution < 6 hrs of age
No evidence for congenital malformations
Cranial US at 6 postnatal hours without evidence of Grades III - IV intraventricular hemorrhage | Those subjects with no evidence for intraventricular hemorrhage (IVH) at 6 - 12 postnatal hours. These subjects were randomized to early low-dose indomethacin (0.1 mg/kg/d for 3 doses). | ChEMBL:CHEMBL6 | DrugBank:DB00328 | PubChem:3715 | Indomethacin | COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c1ccc(Cl)cc1 | C01EB03 | M01AB01 | M01AB51 | M02AA23 | S01BC01 | S01CC02 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00040443 | NCT00040443_EG000 | No | All | Adult | Older Adult | Phase 2 | 84 | Inclusion criteria
Clinical diagnosis of mild cognitive impairment
Good general health with no additional diseases that would interfere with the study.
Exclusion criteria
Any significant neurologic disease (other than suspected incipient Alzheimer's disease), such as Parkinson's disease, stroke, TIA's, multi-infarct... | CX516 - 900 mg (3 X 300 mg)
CX516 (Ampalex®) | DrugBank:DB06247 | PubChem:148184 | CX516 | O=C(c1ccc2nccnc2c1)N1CCCCC1 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 |
NCT00041392 | NCT00041392_EG000 | No | All | Adult | Older Adult | Phase 2 | 198 | Inclusion Criteria:
Coronary heart disease
Exclusion Criteria:
Early dementia
History of psychiatric illness | 100 mg/kg magnesium | DrugBank:DB14513 | PubChem:5462224 | Magnesium | [MgH2] | null | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 |
NCT00041392 | NCT00041392_EG001 | No | All | Adult | Older Adult | Phase 2 | 191 | Inclusion Criteria:
Coronary heart disease
Exclusion Criteria:
Early dementia
History of psychiatric illness | 100 mg/kg 0.9 % saline | ChEMBL:CHEMBL1200574 | DrugBank:DB09153 | PubChem:5234 | SODIUM CHLORIDE | [Cl-].[Na+] | A12CA01 | B05CB01 | B05XA03 | S01XA03 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 |
NCT00045487 | NCT00045487_EG000 | No | All | Adult | Older Adult | Phase 2 | 41 | Inclusion Criteria:
Patients must have histologically or cytologically confirmed diagnosis of advanced renal cell carcinoma (RCC). Papillary RCC is permitted only if immunohistochemical evidence of strong (2-3+) EGFR expression.
Disease that is recurrent or refractory to IL-2 or IFN-based therapy or new diagnosis in p... | Once-daily oral administration for 4 weeks. | ChEMBL:CHEMBL553 | DrugBank:DB00530 | PubChem:176870 | Erlotinib | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1 | L01EB02 | L01XE03 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 |
NCT00045734 | NCT00045734_EG000 | No | All | Adult | Older Adult | Phase 2 | 22 | Inclusion Criteria:
Histologically confirmed meningioma
Benign, malignant, or atypical disease
Neurofibromatosis (NF) type 1 or 2 allowed
Hemangiopericytoma allowed
Unequivocal evidence of tumor recurrence or progression by MRI or CT scan (on steroid dosage that is stable for at least 5 days)
Evaluable residual disea... | Patients receive oral imatinib mesylate once or twice daily. Courses repeat every 4 weeks in the absence of disease progression or unacceptable toxicity.
Other: pharmacological study/ laboratory biomarker analysis
imatinib mesylate: Given orally
laboratory biomarker analysis: Correlative studies
pharmacological stu... | ChEMBL:CHEMBL941 | DrugBank:DB00619 | PubChem:5291 | Imatinib | Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1 | L01EA01 | L01XE01 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00047697 | NCT00047697_EG000 | No | All | Child | Phase 2 | 34 | Inclusion Criteria:
Autism Spectrum Disorder (ASD)
Asperger's Disorder
IQ of 75 or above
Baseline assessment tests within the acceptable range
Exclusion Criteria:
Bipolar disorder, schizophrenia, schizoaffective disorder, or psychotic disorder
Seizure disorder requiring the use of anticonvulsant medications
Congenit... | 5 mg of donepezil for 4 weeks, followed by 10 mg of donepezil for 6 weeks. | ChEMBL:CHEMBL502 | DrugBank:DB00843 | PubChem:3152 | Donepezil | COc1cc2c(cc1OC)C(=O)C(CC1CCN(Cc3ccccc3)CC1)C2 | N06DA02 | N06DA52 | N06DA53 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00048815 | NCT00048815_EG000 | No | All | Adult | Older Adult | Not Applicable | 24 | Inclusion Criteria:
Minor Depression symptoms for at least 6 months
Endorse one of the DSM-IV "A" criteria for MDD and at least one other symptom of MDD or endorse both of the "A" criteria for MDD
Global Assessment of Functioning (GAF) score < 70
Short form health survey (SF-36) social functioning score <= 75% or an e... | Subjects in this arm received 20mg/day of citalopram taken orally for 12 weeks. | ChEMBL:CHEMBL1508 | ChEMBL:CHEMBL549 | DrugBank:DB00215 | DrugBank:DB01175 | PubChem:146570 | PubChem:2771 | Citalopram | CN(C)CCCC1(c2ccc(F)cc2)OCc2cc(C#N)ccc21 | N06AB04 | N06AB10 | 0 | 1 | 0 | 1 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 1 | 1 | 0 | 1 | 0 | 0 | 0 | 0 |
NCT00048815 | NCT00048815_EG001 | No | All | Adult | Older Adult | Not Applicable | 26 | Inclusion Criteria:
Minor Depression symptoms for at least 6 months
Endorse one of the DSM-IV "A" criteria for MDD and at least one other symptom of MDD or endorse both of the "A" criteria for MDD
Global Assessment of Functioning (GAF) score < 70
Short form health survey (SF-36) social functioning score <= 75% or an e... | Subjects in this arm received 810 mg/day of St. John's Wort taken orally (in three tablets of 270mg each) for 12 weeks. | PubChem:13337332 | PubChem:9548591 | Hypericum | CC1(C)SC2C(NC=O)C(=O)N2C1C(=O)O | null | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 1 | 1 | 0 | 1 | 0 | 0 | 0 | 0 |
NCT00050622 | NCT00050622_EG002 | No | All | Child | Not Applicable | 153 | Inclusion Criteria:
Attention Deficit Hyperactivity Disorder
IQ >= 80
Exclusion Criteria:
History of seizures or other neurological problems
Medical history that would involve considerable risk in taking stimulant medication
History or concurrent diagnosis of any of the following disorders: pervasive developmental d... | 0.3 mg/kg MPH, No BMOD | ChEMBL:CHEMBL796 | DrugBank:DB00422 | DrugBank:DB06701 | PubChem:10657292 | PubChem:154101 | PubChem:4158 | Methylphenidate | COC(=O)C(c1ccccc1)C1CCCCN1 | N06BA04 | N06BA11 | N06BA15 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00052442 | NCT00052442_EG000 | No | All | Adult | Older Adult | Phase 1 | Phase 2 | 16 | DISEASE CHARACTERISTICS:
Histologically confirmed Hodgkin's lymphoma or, using the World Health Organization (WHO) classification, aggressive non-Hodgkin's lymphoma including:
Large B- or T-cell lymphomas (including transformed lymphomas)
Mantle cell lymphoma
Immunoblastic lymphoma
At least 1 unidimensionally measur... | Pralatrexate 135 mg/m^2 administered as an IV infusion over one hour into a side arm of a running intravenous infusion of normal saline for 1/2 weeks. | ChEMBL:CHEMBL1201746 | DrugBank:DB06813 | PubChem:148121 | Pralatrexate | C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 | L01BA05 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00052442 | NCT00052442_EG001 | No | All | Adult | Older Adult | Phase 1 | Phase 2 | 3 | DISEASE CHARACTERISTICS:
Histologically confirmed Hodgkin's lymphoma or, using the World Health Organization (WHO) classification, aggressive non-Hodgkin's lymphoma including:
Large B- or T-cell lymphomas (including transformed lymphomas)
Mantle cell lymphoma
Immunoblastic lymphoma
At least 1 unidimensionally measur... | Pralatrexate 30 mg/m^2 administered as an IV infusion over 15 minutes into a side arm of a running intravenous infusion of normal saline for 3/4 weeks. | ChEMBL:CHEMBL1201746 | DrugBank:DB06813 | PubChem:148121 | Pralatrexate | C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 | L01BA05 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00052442 | NCT00052442_EG003 | No | All | Adult | Older Adult | Phase 1 | Phase 2 | 11 | DISEASE CHARACTERISTICS:
Histologically confirmed Hodgkin's lymphoma or, using the World Health Organization (WHO) classification, aggressive non-Hodgkin's lymphoma including:
Large B- or T-cell lymphomas (including transformed lymphomas)
Mantle cell lymphoma
Immunoblastic lymphoma
At least 1 unidimensionally measur... | Pralatrexate 45 mg/m^2 administered as an IV infusion over 15 minutes into a side arm of a running intravenous infusion of normal saline for 6/7 weeks. | ChEMBL:CHEMBL1201746 | DrugBank:DB06813 | PubChem:148121 | Pralatrexate | C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 | L01BA05 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00053846 | NCT00053846_EG000 | No | All | Adult | Older Adult | Phase 2 | Phase 3 | 213 | DISEASE CHARACTERISTICS:
Diagnosis of cancer
Treatment includes the following scenarios:
May have had prior chemotherapy course(s)
Scheduled to receive at least 2 courses of chemotherapy
Courses may include multiple treatment days such as days 1-5 or day 1-day 8 regimens and may include oral regimens
Dyspnea as a... | buspirone hydrochloride: The dose of buspirone will be 10 mg taken by mouth at bedtime for 3 days, then twice each day, in the morning and at bedtime for the remainder of the 28 day study period | PubChem:36431 | Buspirone Hydrochloride | Cl.O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCN(c2ncccn2)CC1 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00054756 | NCT00054756_EG000 | No | All | Child | Adult | Older Adult | Phase 2 | 96 | DIAGNOSTIC STUDY PROTOCOL
Inclusion Criteria:
-All adults and children requiring dynamic testing of the hypothalamic-pituitary axis for the evaluation of pituitary reserve, inconsistent thyroid function test, inappropriate TSH secretion, or pre-and post-operative evaluation of pituitary adenomas (glycoprotein hormone... | Subjects receiving TRH (Thyrotropin Releasing Hormone) | ChEMBL:CHEMBL1472 | DrugBank:DB09421 | PubChem:129360500 | PubChem:131841495 | PubChem:32281 | PubChem:638678 | Protirelin | NC(=O)C1CCCN1C(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1 | V04CJ02 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00056407 | NCT00056407_EG001 | No | Male | Adult | Older Adult | Phase 3 | 4,105 | Inclusion criteria:
Informed consent to participate in study.
Have had a single negative prostate biopsy within 6 months prior to enrollment in study.
Have a PSA (prostate specific antigen) between 2.5 and 10 if 50-60 years of age; or a PSA between 3.0 and 10 if over age 60.
Ability and will to participate in study fo... | Dutasteride 0.5 milligrams (mg), repeat oral once daily dosing for 4 years. Dutasteride supplied as gelatin capsule. | ChEMBL:CHEMBL1200969 | DrugBank:DB01126 | PubChem:6918296 | Dutasteride | [H][C@@]12CC[C@@]3([H])NC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])C(=O)Nc1cc(C(F)(F)F)ccc1C(F)(F)F | G04CA52 | G04CB02 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00056498 | NCT00056498_EG000 | No | All | Adult | Older Adult | Phase 4 | 30 | Inclusion Criteria:
DSM-IV criteria for schizophrenia or schizoaffective disorder
Current clozapine treatment
Moderate illness severity and inadequate positive symptom response to clozapine treatment
6 month period of clozapine treatment with documented clozapine blood level greater than or equal to 350 ng/ml or cloza... | Participants assigned to risperidone | ChEMBL:CHEMBL85 | DrugBank:DB00734 | PubChem:5073 | Risperidone | Cc1nc2n(c(=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CCCC2 | N05AX08 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
NCT00057876 | NCT00057876_EG000 | No | All | Adult | Older Adult | Phase 3 | 35 | Inclusion Criteria:
Histologically or cytologically confirmed adenocarcinoma of the pancreas
Locally advanced or regional (encompassable within the same radiotherapy portals)
Adenosquamous cancers are allowed
Unresectable disease
Measurable and/or non-measurable disease as determined by computed tomography (CT) scan ... | Induction: Patients will receive the first cycle of gemcitabine 1000 mg/m² intravenously once per week for 6 weeks followed by 1 week rest.
Consolidation: Following the week of rest, treatment will resume with 1000 mg/m² administered intravenously once per week for 3 weeks, followed by 1 week rest, for 5 (4-week) cycl... | ChEMBL:CHEMBL888 | DrugBank:DB00441 | PubChem:60750 | Gemcitabine | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)c(=O)n1 | L01BC05 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
End of preview.
CT-ADE-SOC Dataset
Overview
The CT-ADE-SOC is a multilabel classification dataset designed for predicting adverse drug events (ADEs) at the System Organ Class (SOC) level of the MedDRA ontology using clinical trial data.
Key Features
- Instances: 15'197
- Unique Drugs: 2'474
- Annotations: System Organ Class (SOC) level of MedDRA
Dataset Splits
- Train: 12'419 instances
- Validation: 1'518 instances
- Test: 1'260 instances
Citation
@article{yazdani2025evaluation,
title={An Evaluation Benchmark for Adverse Drug Event Prediction from Clinical Trial Results},
author={Yazdani, Anthony and Bornet, Alban and Khlebnikov, Philipp and Zhang, Boya and Rouhizadeh, Hossein and Amini, Poorya and Teodoro, Douglas},
journal={Scientific Data},
volume={12},
number={1},
pages={1--12},
year={2025},
publisher={Nature Publishing Group}
}
For more details, visit the GitHub repository.
- Downloads last month
- 16