Unnamed: 0
int64
0
15.9k
cleaned_code
stringlengths
67
124k
cleaned_prompt
stringlengths
168
30.3k
11,900
<ASSISTANT_TASK:> Python Code: ### START CODE HERE ### (≈ 1 line of code) test = "Hello World" ### END CODE HERE ### print ("test: " + test) # GRADED FUNCTION: basic_sigmoid import math import numpy as np def basic_sigmoid(x): Compute sigmoid of x. Arguments: x -- A scalar Return: s -- sigmoid(x) ### START CODE HERE ### (≈ 1 line of code) s = math.exp(-1 * x) s = 1 / (1 + s) ### END CODE HERE ### return s basic_sigmoid(3) ### One reason why we use "numpy" instead of "math" in Deep Learning ### x = [1, 2, 3] basic_sigmoid(x) # you will see this give an error when you run it, because x is a vector. import numpy as np # example of np.exp x = np.array([1, 2, 3]) print(np.exp(x)) # result is (exp(1), exp(2), exp(3)) # example of vector operation x = np.array([1, 2, 3]) print (x + 3) # GRADED FUNCTION: sigmoid import numpy as np # this means you can access numpy functions by writing np.function() instead of numpy.function() def sigmoid(x): Compute the sigmoid of x Arguments: x -- A scalar or numpy array of any size Return: s -- sigmoid(x) ### START CODE HERE ### (≈ 1 line of code) #s = np.exp(np.multiply(-1, x)) #s = np.divide(1, np.add(1, s)) s = 1 / (1 + np.exp(-x)) ### END CODE HERE ### return s x = np.array([1, 2, 3]) sigmoid(x) # GRADED FUNCTION: sigmoid_derivative def sigmoid_derivative(x): Compute the gradient (also called the slope or derivative) of the sigmoid function with respect to its input x. You can store the output of the sigmoid function into variables and then use it to calculate the gradient. Arguments: x -- A scalar or numpy array Return: ds -- Your computed gradient. ### START CODE HERE ### (≈ 2 lines of code) s = sigmoid(x) ds = s * (1 - s) ### END CODE HERE ### return ds x = np.array([1, 2, 3]) print ("sigmoid_derivative(x) = " + str(sigmoid_derivative(x))) # GRADED FUNCTION: image2vector def image2vector(image): Argument: image -- a numpy array of shape (length, height, depth) Returns: v -- a vector of shape (length*height*depth, 1) ### START CODE HERE ### (≈ 1 line of code) v = None ### END CODE HERE ### return v # This is a 3 by 3 by 2 array, typically images will be (num_px_x, num_px_y,3) where 3 represents the RGB values image = np.array([[[ 0.67826139, 0.29380381], [ 0.90714982, 0.52835647], [ 0.4215251 , 0.45017551]], [[ 0.92814219, 0.96677647], [ 0.85304703, 0.52351845], [ 0.19981397, 0.27417313]], [[ 0.60659855, 0.00533165], [ 0.10820313, 0.49978937], [ 0.34144279, 0.94630077]]]) print ("image2vector(image) = " + str(image2vector(image))) # GRADED FUNCTION: normalizeRows def normalizeRows(x): Implement a function that normalizes each row of the matrix x (to have unit length). Argument: x -- A numpy matrix of shape (n, m) Returns: x -- The normalized (by row) numpy matrix. You are allowed to modify x. ### START CODE HERE ### (≈ 2 lines of code) # Compute x_norm as the norm 2 of x. Use np.linalg.norm(..., ord = 2, axis = ..., keepdims = True) x_norm = None # Divide x by its norm. x = None ### END CODE HERE ### return x x = np.array([ [0, 3, 4], [1, 6, 4]]) print("normalizeRows(x) = " + str(normalizeRows(x))) # GRADED FUNCTION: softmax def softmax(x): Calculates the softmax for each row of the input x. Your code should work for a row vector and also for matrices of shape (n, m). Argument: x -- A numpy matrix of shape (n,m) Returns: s -- A numpy matrix equal to the softmax of x, of shape (n,m) ### START CODE HERE ### (≈ 3 lines of code) # Apply exp() element-wise to x. Use np.exp(...). x_exp = None # Create a vector x_sum that sums each row of x_exp. Use np.sum(..., axis = 1, keepdims = True). x_sum = None # Compute softmax(x) by dividing x_exp by x_sum. It should automatically use numpy broadcasting. s = None ### END CODE HERE ### return s x = np.array([ [9, 2, 5, 0, 0], [7, 5, 0, 0 ,0]]) print("softmax(x) = " + str(softmax(x))) import time x1 = [9, 2, 5, 0, 0, 7, 5, 0, 0, 0, 9, 2, 5, 0, 0] x2 = [9, 2, 2, 9, 0, 9, 2, 5, 0, 0, 9, 2, 5, 0, 0] ### CLASSIC DOT PRODUCT OF VECTORS IMPLEMENTATION ### tic = time.process_time() dot = 0 for i in range(len(x1)): dot+= x1[i]*x2[i] toc = time.process_time() print ("dot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC OUTER PRODUCT IMPLEMENTATION ### tic = time.process_time() outer = np.zeros((len(x1),len(x2))) # we create a len(x1)*len(x2) matrix with only zeros for i in range(len(x1)): for j in range(len(x2)): outer[i,j] = x1[i]*x2[j] toc = time.process_time() print ("outer = " + str(outer) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC ELEMENTWISE IMPLEMENTATION ### tic = time.process_time() mul = np.zeros(len(x1)) for i in range(len(x1)): mul[i] = x1[i]*x2[i] toc = time.process_time() print ("elementwise multiplication = " + str(mul) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC GENERAL DOT PRODUCT IMPLEMENTATION ### W = np.random.rand(3,len(x1)) # Random 3*len(x1) numpy array tic = time.process_time() gdot = np.zeros(W.shape[0]) for i in range(W.shape[0]): for j in range(len(x1)): gdot[i] += W[i,j]*x1[j] toc = time.process_time() print ("gdot = " + str(gdot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") x1 = [9, 2, 5, 0, 0, 7, 5, 0, 0, 0, 9, 2, 5, 0, 0] x2 = [9, 2, 2, 9, 0, 9, 2, 5, 0, 0, 9, 2, 5, 0, 0] ### VECTORIZED DOT PRODUCT OF VECTORS ### tic = time.process_time() dot = np.dot(x1,x2) toc = time.process_time() print ("dot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED OUTER PRODUCT ### tic = time.process_time() outer = np.outer(x1,x2) toc = time.process_time() print ("outer = " + str(outer) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED ELEMENTWISE MULTIPLICATION ### tic = time.process_time() mul = np.multiply(x1,x2) toc = time.process_time() print ("elementwise multiplication = " + str(mul) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED GENERAL DOT PRODUCT ### tic = time.process_time() dot = np.dot(W,x1) toc = time.process_time() print ("gdot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") # GRADED FUNCTION: L1 def L1(yhat, y): Arguments: yhat -- vector of size m (predicted labels) y -- vector of size m (true labels) Returns: loss -- the value of the L1 loss function defined above ### START CODE HERE ### (≈ 1 line of code) loss = None ### END CODE HERE ### return loss yhat = np.array([.9, 0.2, 0.1, .4, .9]) y = np.array([1, 0, 0, 1, 1]) print("L1 = " + str(L1(yhat,y))) # GRADED FUNCTION: L2 def L2(yhat, y): Arguments: yhat -- vector of size m (predicted labels) y -- vector of size m (true labels) Returns: loss -- the value of the L2 loss function defined above ### START CODE HERE ### (≈ 1 line of code) loss = None ### END CODE HERE ### return loss yhat = np.array([.9, 0.2, 0.1, .4, .9]) y = np.array([1, 0, 0, 1, 1]) print("L2 = " + str(L2(yhat,y))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Expected output Step3: Expected Output Step4: In fact, if $ x = (x_1, x_2, ..., x_n)$ is a row vector then $np.exp(x)$ will apply the exponential function to every element of x. The output will thus be Step5: Furthermore, if x is a vector, then a Python operation such as $s = x + 3$ or $s = \frac{1}{x}$ will output s as a vector of the same size as x. Step7: Any time you need more info on a numpy function, we encourage you to look at the official documentation. Step9: Expected Output Step11: Expected Output Step13: Expected Output Step15: Expected Output Step16: Expected Output Step18: As you may have noticed, the vectorized implementation is much cleaner and more efficient. For bigger vectors/matrices, the differences in running time become even bigger. Step20: Expected Output
11,901
<ASSISTANT_TASK:> Python Code: import sys _CATAPULT_PATH=os.path.join(os.path.abspath(''), '..', '..', '..') _DASHBOARD_PATH=os.path.join(_CATAPULT_PATH, 'dashboard') # Set up the environment so that we can import the modules in the # Dashboard codebase. sys.path.insert(0, _CATAPULT_PATH) sys.path.insert(0, _DASHBOARD_PATH) import dashboard # Include all the paths needed for testing for path in dashboard.PathsForTesting(): sys.path.insert(0, path) from dashboard.common import clustering_change_detector as ccd import pandas as pd import numpy as np import statsmodels as sm import numba as nb import matplotlib.pyplot as plt # Create a random dataset from some normal distributions. measurements = np.concatenate( (np.random.normal(100, 5, 50), np.random.normal(20, 5, 50), np.random.normal(100, 5, 50)), axis=None) commits = np.arange(1000,1150,dtype=np.int64) frame = pd.DataFrame(measurements, columns=['measurement'], index=commits) frame # We then create a column of estimates. First, we'll do it with # the pure Python implementation, and time it. def create_estimates(measurements): results = np.array( [ccd.Estimator(measurements, i) for i in range(len(measurements))]) return results estimates=create_estimates(measurements) frame['estimates'] = estimates frame['probability'] = estimates / np.nanmax(estimates) %timeit create_estimates(measurements) fig, axes = plt.subplots(2, 1, sharex=True) frame['measurement'].plot.line(ax=axes[0], title='Measurements') frame['probability'].plot.line(ax=axes[1], title='Probabilities',color='r') # We need to convert the measurements into a Python list # because the pure Python implementation can only work with # those native objects. inputs = list(measurements) result = ccd.ClusterAndFindSplit(inputs) # WARNING: Running this might take a while depending on how # capable your machine is. %timeit ccd.ClusterAndFindSplit(inputs) print(result) # TODO(dberris): Implement the purely vectorized versions here. # TODO(dberris): Implement a GPU-accelerated versions here. <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: From this point on we can use ccd to refer to our clustering change detector implementation in the Dashboard. Here we can use all sorts of utilities that we can also analyse. The first one we'll use is the estimator implementation Step2: Let's now visualize the data, showing the probabilities along the range of values we've encountered. Step3: As we can see in the charts above, we can now see how the estimator works for finding where change points could be based on how the particular point partitions the space. While that's interesting, we still need to check which/whether these high-probability change points partition the space nicely (or in a statistically significant way). Step4: Alternative A Step5: Alternative B
11,902
<ASSISTANT_TASK:> Python Code: import seaborn as sns import pandas as pd import numpy as np from pandasql import PandaSQL pdsql = PandaSQL() tips = sns.load_dataset('tips') tips.head() pdsql("SELECT * FROM tips LIMIT 5;") pdsql("SELECT * FROM tips WHERE sex='Female' LIMIT 5;") pdsql("SELECT tip, sex, size FROM tips WHERE total_bill< 10 LIMIT 5;") query = SELECT * FROM tips WHERE sex='Female' and smoker='Yes' ORDER BY total_bill ASC LIMIT 5; pdsql(query) query = SELECT count(*) AS count, max(tip) AS max, min(tip) AS min FROM tips WHERE size > 1 GROUP BY sex, day HAVING max < 6 ORDER BY count DESC LIMIT 5; pdsql(query) student = pd.read_csv('data/student.txt') student cls = pd.read_csv('data/class.txt') cls major = pd.read_csv('data/major.txt') major student_cls = pd.read_csv('data/student_class.txt') student_cls query = SELECT s.first, s.last, m.name FROM student s INNER JOIN major m ON s.major_id = m.major_id; pdsql(query) query = SELECT s.first, s.last, m.name FROM student s LEFT OUTER JOIN major m ON s.major_id = m.major_id; pdsql(query) query = SELECT s.first, s.last, m.name FROM student s LEFT JOIN major m ON s.major_id = m.major_id UNION All SELECT s.first, s.last, m.name FROM major m LEFT JOIN student s ON s.major_id = m.major_id WHERE s.major_id IS NULL; pdsql(query) query = SELECT s.first, s.last, c.code, c.name, c.credits FROM student s INNER JOIN student_cls sc ON s.student_id = sc.student_id INNER JOIN cls c ON c.class_id = sc.class_id; pdsql(query) query = SELECT s.first, s.last, c.code, c.name, c.credits FROM student s LEFT OUTER JOIN student_cls sc ON s.student_id = sc.student_id LEFT OUTER JOIN cls c ON c.class_id = sc.class_id; pdsql(query) import sqlite3 c = sqlite3.connect('data/Chinook_Sqlite.sqlite') list(c.execute("SELECT name FROM sqlite_master WHERE type='table';")) list(c.execute("PRAGMA table_info(Album);")) t = ['%rock%'] list(c.execute("SELECT * FROM Album WHERE Title like ? LIMIT 5;", t)) t = ["'%rock%'"] list(c.execute("SELECT * FROM Album WHERE Title like %s LIMIT 5;" % t[0])) def encode(text, offset): Caesar cipher of text with given offset. from string import ascii_lowercase, ascii_uppercase tbl = dict(zip(map(ord, ascii_lowercase + ascii_uppercase), ascii_lowercase[offset:] + ascii_lowercase[:offset] + ascii_uppercase[offset:] + ascii_uppercase[:offset])) return text.translate(tbl) c.create_function("encode", 2, encode) list(c.execute("SELECT Title, encode(Title, 3) FROM Album limit 5;")) class CV: Aggregate UDF for coefficient of varation in %. def __init__(self): self.s = [] def step(self, value): self.s.append(value) def finalize(self): if len(self.s) < 2: return 0 else: return 100.0*np.std(self.s)/np.mean(self.s) c.create_aggregate("cv", 1, CV) list(c.execute("PRAGMA table_info(Invoice);")) list(c.execute("SELECT cv(Total) from Invoice limit 10;")) c.close() import warnings with warnings.catch_warnings(): warnings.simplefilter('ignore') %load_ext sql %config SqlMagic %config SqlMagic.displaylimit=10 %sql sqlite:///data/Chinook_Sqlite.sqlite %sql SELECT * from Album LIMIT 5; %sql SELECT * from Artist LIMIT 5; %%sql SELECT Artist.Name, Album.Title FROM Album INNER JOIN Artist on Album.ArtistId = Artist.ArtistId ORDER BY Artist.Name ASC LIMIT 5; result = %sql SELECT * from Album; type(result) result[2:4] artist_id = 10 %sql select * from Artist where ArtistId < :artist_id; word = '%rock%' %sql select * from Album WHERE Title LIKE :word; df = result.DataFrame() df.head(5) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Using SQL for Queries Step3: Ordering Step5: Aggregate queries Step6: Joins Step8: Matching students and majors Step10: Left outer join Step12: Emulating a full outer join with UNION ALL Step14: Using linker tables to match students to classes (a MANY TO MANY join) Step16: Same thing but including students with no majors Step17: Using SQLite3 Step18: SQLite specific commands to get metadata Step19: What are the columns of the table "Album"? Step20: Standard SQL statements with parameter substitution Step21: Not this Step23: User defined functions Step25: An aggregate UDF Step26: Using SQL magic functions Step27: Configuring the SqlMagic extension Step28: Connect to SQLite3 database Step29: Other databases Step30: Cell magic Step31: You can assign results of queries to Python names Step32: Resutls behave like lists Step33: You can use Python variables in your queires. Step34: Convert to pandas dataframe
11,903
<ASSISTANT_TASK:> Python Code: #------Library loading------ # numpy for matrix computations import numpy as np; import numpy.ma as ma # system libraries import sys # plotting libraries %matplotlib inline import matplotlib.pylab as plt from matplotlib.patches import Circle, Ellipse # Generalized Multiparticle Mie import sys.path.append('../') import py_gmm # building the optical constant database eps_db_out=py_gmm.mat.generate_eps_db('../epsilon/',ext='*.edb') eps_files,eps_names,eps_db=eps_db_out['eps_files'],eps_db_out['eps_names'],eps_db_out['eps_db'] # sphere radius (in nm) v_r = np.array([ 40., 40.]) # sphere position (in nm) m_xyz = np.array([[ -42.5, 0. , 0. ], [ 42.5, 0. , 0. ]]) # how many spheres in the target? We guess it from the length of the radius vector ns = len(v_r) # sphere composition, calling the names contained in "eps_names", just populated above target_comp= np.array(['eAgPalikSTDf','eAuJCSTDf']) # vector containing the optical constants names # refractive index of the environment n_matrix = 1.33 # water # Euler angles: (alpha,beta,gamma)=(0,0,0) means a z-directed, x-polarized plane wave alpha = 0.0 # azimuth beta = 0.0 # polar gamma = 0.0 # polarization # Wavelengths for the specrum computation wl_min = 300 wl_max = 800 n_wl = 250 v_wl = np.linspace(wl_min,wl_max,n_wl) # Wavelength for the local field computation v_wl_lf = [430.0,630] # resonance wavelengths n_stop=10 # maximum multipolar expansion order f_int=0.0; # interaction cutoff (normally set to zero to have full interactions) lf_ratio=300; # plot sphere local field contribution up to a distance equal to d=lf_ratio*r_sphere qs_flag='no' # retarded simulation n_E = 400 # local field plotting grid resolution # target plot fig = plt.figure(num=1,figsize=(10,10)) # setting the figure size ax = fig.add_subplot(1, 1, 1, aspect='equal') # creating the plotting axis # plot bounds and eliminating x and y ticks plt.xlim(-1.1*(-m_xyz[0,0]+v_r[0]),1.1*(m_xyz[1,0]+v_r[ns-1])) plt.ylim(-1.1*(v_r[0]),1.1*(v_r[0])) plt.xticks([]) plt.yticks([]) # plotting the target v_color = ['0.6','y'] for c,r,col in zip(m_xyz,v_r,v_color): c0=c[0];c1=c[1]; ax.add_patch(Circle((c0,c1),r,color=col)) # computing the expansion coefficients and cross sections with a loop m_abcd_ext_sca_abs = [] # list to be filled with the output for wl in v_wl: # retrieving optical constants at wl from the database e_list=py_gmm.mat.db_to_eps(wl,eps_db,target_comp); m_eps=np.column_stack((np.real(e_list),np.imag(e_list))); # solving the gmm problem (calculating the cross sections and the expansion coefficients) out=py_gmm.gmm_py.gmm_f2py_module.expansion_coefficients(m_xyz, # target sphere position in nm v_r, # target sphere radii in nm m_eps, # e1 and e2 for each sphere f_int, # interaction coefficient n_matrix, # environment refractive index wl, # computation wavelength alpha,beta,gamma, # euler angles for the incident pw 0, # =0 Linear, =1 Left Circular, =2 Right Circular n_stop, # maximum number for expansion coefficients qs_flag) # quasi static approximation m_abcd_ext_sca_abs.append(out) # extracting coefficients and cross section v_coeff=[];v_cext=[];v_csca=[];v_cabs=[]; for out in m_abcd_ext_sca_abs: v_coeff.append(out[0]); v_cext.append(out[1]); v_csca.append(out[2]); v_cabs.append(out[3]); # converting the lists to numpy arrays v_cext=np.array(v_cext) v_csca=np.array(v_csca) v_cabs=np.array(v_cabs) # local field for the first resonance v_field = [] for wl_lf in v_wl_lf: # optical constants e_list=py_gmm.mat.db_to_eps(wl_lf,eps_db,target_comp); m_eps=np.column_stack((np.real(e_list),np.imag(e_list))); # gmm coefficients computation out=py_gmm.gmm_py.gmm_f2py_module.expansion_coefficients(m_xyz, # target sphere position in nm v_r, # target sphere radii in nm m_eps, # e1 and e2 for each sphere f_int, # interaction coefficient n_matrix, # environment refractive index wl_lf, # computation wavelength alpha,beta,gamma, # euler angles for the incident pw 0, # =0 Linear, =1 Left Circular, =2 Right Circular n_stop, # maximum number for expansion coefficients qs_flag) # quasi static approximation v_amnbmn=out[0][:,0] # getting field expansion coefficients v_dmncmn=out[0][:,1] # local field v_emn=py_gmm.gmm_py.gmm_f2py_module.emn(n_stop)[0] # normalization coeffs # building plotting grid x_min = -1.5*(v_r[0]-m_xyz[0,0]) x_max = 1.5*(v_r[1]+m_xyz[1,0]) y_min = -1.5*v_r[0] y_max = 1.5*v_r[0] v_x=np.linspace(x_min,x_max,n_E); v_y=np.linspace(y_min,y_max,n_E); # retrieving the local field m_E=[] for x in v_x: for y in v_y: out = py_gmm.gmm_py.gmm_f2py_module.exyz("yes", # include incident local field n_stop, # maximum number for expansion coefficients 0, # =0 Linear, =1 Left Circular, =2 Right Circular lf_ratio, # plot sphere contribution up to distance d=lf_ratio*r wl_lf, # computation wavelength alpha,beta,gamma, x,y,0.0, # field computation coordinates v_amnbmn,v_dmncmn,v_emn, # expansion and normalization coefficients m_xyz,m_eps,v_r, # sphere position, composition and size n_matrix, # environment refractive index qs_flag) # quasi static approximation m_E=np.append(m_E,out[3]) m_E=np.array(m_E).reshape(n_E,n_E) v_field.append(m_E) # cross section plot f_size=25; f_size_ticks=20; plt.figure(1,figsize=(15,10)); plt.plot(v_wl,np.sum(v_cext,axis=1),'k',linewidth=3.0); plt.plot(v_wl,v_cext[:,0],'0.6', v_wl,v_cext[:,1],'y',linewidth=2.0); # plt title plt.title('AuAg dimer',fontsize=f_size) # axes labels plt.xlabel(r'wavelength (nm)', fontsize=f_size) plt.ylabel(r'C$_{ext}$', fontsize=f_size) # ticks plt.xticks(fontsize=f_size_ticks) plt.yticks(fontsize=f_size_ticks) # legend plt.legend((r'Integral C$_{ext}$', r'Ag C$_{ext}$', r'Au C$_{ext}$'),frameon=False,fontsize=f_size-5) # layout plt.tight_layout() # local field plot f_size = 25 fig = plt.figure(2,figsize=(14,10)) v_title = ['High energy resonance','Low energy resonance'] for i_E,m_E in enumerate(v_field): ax = fig.add_subplot(2, 1, i_E+1, aspect='equal') # creating the plotting axis plt.imshow(m_E.T,origin='lower',cmap='gnuplot2', aspect=(y_max-y_min)/(x_max-x_min)) # remove ticks plt.xticks([]) plt.yticks([]) # colorbar cb = plt.colorbar() cb.set_label('|E|', fontsize=f_size-5) cb.ax.tick_params(labelsize=f_size-10) plt.title(v_title[i_E],fontsize=f_size) plt.tight_layout() # sphere outlines for c,r in zip(m_xyz,v_r): # aspect rations x_ar = n_E/(x_max-x_min) y_ar = n_E/(y_max-y_min) # circle centers c0=x_ar*(c[0]-x_min) c1=y_ar*(c[1]-y_min) ax.add_patch(Ellipse((c0,c1),2.0*r*x_ar,2.0*r*y_ar,facecolor='none',edgecolor='w',linewidth=2.0)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Setting up the inputs Step2: Plane wave incident field Step3: Additional inputs for the simulation Step4: Target plot Step5: Performing the calculations Step6: Local Field Step7: Plotting the results Step8: Local field enhancement
11,904
<ASSISTANT_TASK:> Python Code: from itertools import repeat from sympy import * #from type_system import * %run ../../src/commons.py %run ./type-system.py init_printing() x,y,m,n,t,z = symbols('x y m n t z', commutative=True) alpha, beta, gamma, eta = symbols(r'\alpha \beta \gamma \eta', commutative=True) f,g = Function('f'), Function('g') ((1/(1-w[0]*z))*(1/(1-w[1]*z))).diff(z).series(z, n=6) define(f(z), z/((1-z)**2),ctor=FEq).series(z,n=10) define(f(z), 1/(1-alpha*z), ctor=FEq).series(z,n=10) define(f(z), 1/(1-(u[0]+u[1])*z), ctor=FEq).series(z,n=4) define(f(z), 1/(1-(o[0]+o[1])*z), ctor=FEq).series(z,n=4) define(f(z), z*(1/(1-z))*(1/(1-z)), ctor=FEq).series(z,n=10) define(f(z), z**3,ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), exp(z),ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), z*exp(z), ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), z**2*exp(z)/factorial(2,evaluate=False), ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), z**3*exp(z)/factorial(3, evaluate=False), ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), (exp(z)+exp(-z))/2, ctor=FEq).series(z, n=20, kernel='exponential') define(f(z), exp(m*z), ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), (exp(z)-1)/z, ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), 1/(1-z), ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), (1/(1-z))*(1/(1-z)), ctor=FEq).series(z, n=10, kernel='exponential') define(f(z), exp(z)**2, ctor=FEq).series(z, n=10, kernel='exponential') tyvar(x).gf() (tyvar(u[0]) * tyvar(u[1]) * tyvar(u[2])).gf() (tyvar(o[0]) * tyvar(o[1]) * tyvar(o[2])).gf() (tyvar(u[0]) | tyvar(u[1]) | tyvar(u[2])).gf() (tyvar(o[0]) | tyvar(o[1]) | tyvar(o[2])).gf() truth.gf() + falsehood.gf() boolean.gf() maybe(tyvar(alpha)[z]).gf() nel = 4 syms=[u[i] for i in range(nel)] occ_prb, = cp(maybe(tyvar(u[i]*z)) for i in range(nel)).gf() # here we can use the `[z]` notation too. occ_prb occupancy(occ_prb, syms, objects='unlike', boxes='unlike').series(z) occupancy(occ_prb, syms, objects='unlike', boxes='like').series(z) occupancy(occ_prb, syms, objects='like', boxes='unlike').series(z) occupancy(occ_prb, syms, objects='like', boxes='like').series(z) u_hat = symbols(r'␣_0:10') nel = 3 occ_prb, = cp(tyvar(z*(sum(u[j] for j in range(nel) if j != i))) | tyvar(u_hat[i]) for i in range(nel)).gf() occ_prb syms=[u[i] for i in range(nel)]+[u_hat[i] for i in range(nel)] occupancy(occ_prb, syms, objects='unlike', boxes='unlike').series(z) occupancy(occ_prb, syms, objects='unlike', boxes='like').series(z) occupancy(occ_prb, syms, objects='like', boxes='unlike').series(z) occupancy(occ_prb, syms, objects='like', boxes='like').series(z) occupancy_problem, = cp(maybe(du(tyvar((u[i]*z)**(j+1)) for j in range(i+1))) for i in range(3)).gf() occupancy_problem occupancy(occupancy_problem, syms=[u[i] for i in range(3)], objects='unlike', boxes='unlike').series(z) occupancy(occupancy_problem, syms=[u[i] for i in range(3)], objects='unlike', boxes='like').series(z) occupancy(occupancy_problem, syms=[u[i] for i in range(3)], objects='like', boxes='unlike').series(z) occupancy(occupancy_problem, syms=[u[i] for i in range(3)], objects='like', boxes='like').series(z) ((1+t)*(1+t+t**2)*(1+t+t**2+t**3)).series(t,n=10) # just for checking def sums_of_powers(boxes, base): p = IndexedBase('\space') return cp(cp() | tyvar(p[j]*z**(base**i)) for i in range(0,boxes) for j in [Pow(base,i,evaluate=False)] # implicit let ).gf() occupancy, = sums_of_powers(boxes=4, base=2) occupancy.series(z, n=32) occupancy, = sums_of_powers(boxes=4, base=3) occupancy.series(z, n=100) occupancy, = sums_of_powers(boxes=4, base=5) occupancy.series(z, n=200) occupancy, = sums_of_powers(boxes=4, base=7) occupancy.series(z, n=500) assert 393 == 7**0 + 7**2 + 7**3 # _.rhs.rhs.coeff(z, 393) difference = (cp() | tyvar(-gamma*z)) ones = nats * difference ones_gf, = ones.gf() ones_gf ones_gf(z,1,1,1).series(z, n=10) # check! one_gf, = (ones * difference).gf() one_gf.series(z, n=10).rhs.rhs.subs({w[0]:1, w[1]:1, gamma:1}) l = IndexedBase(r'\circ') def linear_comb_of_powers(boxes, base): return cp(lst(tyvar(Mul(l[j], z**(base**i), evaluate=False))) for i in range(boxes) for j in [Pow(base,i,evaluate=False)]).gf() occupancy, = linear_comb_of_powers(boxes=4, base=Integer(2)) occupancy.series(z, n=8) occupancy, = linear_comb_of_powers(boxes=4, base=3) occupancy.series(z, n=9) occupancy, = linear_comb_of_powers(boxes=4, base=5) occupancy.series(z, n=10) def uniform_rv(n): return tyvar(S(1)/nel) * lst(tyvar(x)) occupancy, = uniform_rv(n=10).gf() occupancy.series(x,n=10) class lst_structure_w(rec): def definition(self, alpha): me = self.me() return alpha | lst(me) def label(self): return r'\mathcal{L}_{w}' # `_s` stands for "structure" lst_structure_w(tyvar(alpha)).gf() [gf.series(alpha) for gf in _] class lst_structure(rec): def definition(self, alpha): me = self.me() return alpha | (lst(me) * me * me) def label(self): return r'\mathcal{L}_{s}' # `_s` stands for "structure" lst_structure(tyvar(alpha)).gf() _[0].series(alpha, n=10) class structure(rec): def definition(self, alpha): me = self.me() return alpha | (bin_tree(me) * me * me) def label(self): return r'\mathcal{S}' structure(tyvar(alpha)).gf() gf = _[0] gf.simplify() nel = 7 s = gf.simplify().series(alpha, n=nel).rhs.rhs [s.coeff(alpha, n=i).subs({pow(-1,S(1)/3):-1}).radsimp().powsimp() for i in range(nel)] class structure(rec): def definition(self, alpha): me = self.me() return alpha | (nnbin_tree(me) * me) def label(self): return r'\mathcal{S}' structure(tyvar(alpha)).gf() gf = _[0] gf.simplify() nel = 20 s = gf.simplify().series(alpha, n=nel).rhs.rhs [s.coeff(alpha, n=i).subs({pow(-1,S(1)/3):-1}).radsimp().powsimp() for i in range(nel)] class nn_structure(rec): def definition(self, alpha): me = self.me() return alpha * bin_tree(nnbin_tree(me)) def label(self): return r'\mathcal{L}_{s}^{+}' # `_s` stands for "structure" nn_structure(tyvar(alpha)).gf() _[0].series(alpha, n=10) class nnlst_structure(rec): def definition(self, alpha): me = self.me() return alpha * lst(nnlst(me)) def label(self): return r'\mathcal{L}_{s}^{+}' # `_s` stands for "structure" nnlst_structure(tyvar(alpha)).gf() _[0].series(alpha, n=10) class tree(rec): def definition(self, alpha): return alpha * lst(self.me()) def label(self): return r'\mathcal{T}' tree(tyvar(alpha)).gf() _[0].series(alpha, n=10) class combination(rec): def definition(self, alpha): me = self.me() return alpha | (me * me) def label(self): return r'\mathcal{C}' combination(tyvar(alpha)).gf() _[0].series(alpha, n=10) class ab_tree(rec): def definition(self, alpha, beta): me = self.me() return beta | (alpha * me * me) def label(self): return r'\mathcal{T}_{a,b}' ab_tree_gfs = ab_tree(tyvar(alpha), tyvar(beta)).gf() ab_tree_gfs ab_tree_gf = ab_tree_gfs[0] fab_eq = FEq(ab_tree_gf.lhs, ab_tree_gf.rhs.series(beta, n=20).removeO(), evaluate=False) fab_eq fab_eq(x,x) (_*alpha).expand() #with lift_to_Lambda(fab_eq) as F: B = fab_eq(x,1) A = fab_eq(1,x) A,B, (A+B).expand() ((1+x)*A).expand() class dyck(rec): def definition(self, alpha, beta): me = self.me() return cp() | (alpha * me * beta * me) def label(self): return r'\mathcal{D}' dyck_gfs = dyck(tyvar(alpha*x), tyvar(beta*x)).gf() dyck_gfs dyck_gf = dyck_gfs[0] dyck_gf.series(x,n=10) class motzkin(rec): def definition(self, alpha, beta, gamma): me = self.me() return cp() | (alpha * me * beta * me) | (gamma * me) def label(self): return r'\mathcal{M}' motzkin_gfs = motzkin(tyvar(alpha*x), tyvar(beta*x), tyvar(gamma*x),).gf() motzkin_gfs motzkin_gf = motzkin_gfs[0] motzkin_gf.series(x,n=10) motzkin_gf(x,1,1,1).series(x,n=10) class motzkin_p(rec): def definition(self, alpha, beta, gamma, eta): me = self.me() return cp() | (alpha * me * beta * me) | (gamma * me) | (eta * me) def label(self): return r'\mathcal{M}^{+}' motzkinp_gfs = motzkin_p(tyvar(alpha*x), tyvar(beta*x), tyvar(gamma*x), tyvar(eta*x),).gf() motzkinp_gfs motzkinp_gf = motzkinp_gfs[0] motzkinp_gf.series(x,n=6) motzkinp_gf(x,1,1,1,1).series(x,n=10) class fibo(rec): def definition(self, alpha, beta): me = self.me() return cp() | alpha | ((beta | (alpha * beta)) * me) def label(self): return r'\mathcal{F}' fibo_gf, = fibo(tyvar(alpha*x), tyvar(beta*x),).gf() fibo_gf fibo_gf.series(x,n=10) fibo_gf(1,x,1).series(x,n=10) lst_of_truth_gf, = lst(tyvar(x)).gf() lst_of_truth_gf.series(x, n=10, is_exp=True) lst_of_boolean_gf.series(x,n=10,is_exp=True) _.rhs.rhs.subs({w[0]:1,w[1]:1}) sum((_.rhs.rhs.coeff(x,i)/factorial(i))*x**i for i in range(1,10)) class powerset(ty): def gf_rhs(self, ty): return [exp(self.mulfactor() * gf.rhs) for gf in ty.gf()] def mulfactor(self): return 1 def label(self): return r'\mathcal{P}' powerset_of_tyvar_gf, = (2**(nnlst(tyvar(alpha)))).gf() powerset_of_tyvar_gf powerset_of_tyvar_gf.series(alpha, n=10, is_exp=True) powerset_of_tyvar_gf, = (2**(nnlst(boolean))).gf() powerset_of_tyvar_gf powerset_of_tyvar_gf.series(x, n=5, is_exp=True) _.rhs.rhs.subs({w[0]:1,w[1]:1}) powerset_of_tyvar_gf, _ = (2**(bin_tree(tyvar(alpha)))).gf() powerset_of_tyvar_gf powerset_of_tyvar_gf.series(alpha, n=10, is_exp=True) l, = (2**(2**(nnlst(tyvar(alpha))))).gf() define(l.lhs, l.rhs.ratsimp(), ctor=FEq).series(alpha,n=8,is_exp=True) class cycle(ty): def gf_rhs(self, ty): return [log(gf.rhs) for gf in ty.gf()] def label(self): return r'\mathcal{C}' cycle_of_tyvar_gf, = (~(lst(tyvar(alpha)))).gf() cycle_of_tyvar_gf cycle_of_tyvar_gf.series(alpha, n=10, is_exp=True) cycle_of_tyvar_gf, = (~(lst(boolean))).gf() cycle_of_tyvar_gf cycle_of_tyvar_gf.series(x, n=8, is_exp=True) _.rhs.rhs.subs({w[0]:1,w[1]:1}) Pstar_gf, = (2**(~(lst(tyvar(alpha))))).gf() Pstar_gf.series(alpha, n=10, is_exp=True) class ipowerset(powerset): def mulfactor(self): return -1 derangements_gf, = ((-2)**tyvar(alpha)).gf() derangements_gf.series(alpha, n=10, is_exp=True) derangements_gf, = ((-2)**nnlst(tyvar(alpha))).gf() derangements_gf.series(alpha, n=10, is_exp=True) [1,2][1:] def foldr(f, l, i): if not l: return i else: car, *cdr = l return f(car, foldr(f, cdr, i)) class arrow(ty): def label(self): return r'\rightarrow' def gf_rhs(self, alpha, beta): v = Dummy() return [foldr(lambda gf, acc: Lambda([x], acc(gf.rhs)), gfs[:-1], Lambda([x], gfs[-1].rhs))(x) for gfs in self.gfs_space()] return [foldr(lambda gf, acc: acc**gf.rhs, gfs[:-1], gfs[-1].rhs) for gfs in self.gfs_space()] arr, = arrow(boolean, boolean).gf() arr arr.series(x,n=5,is_exp=False) _.rhs.rhs.removeO().subs({w[0]:1,w[1]:1}) arr, = arrow(lst(boolean), lst(boolean)).gf() arr arr.series(x,n=5,is_exp=False) _.rhs.rhs.removeO().subs({w[0]:1,w[1]:1}) lamda_gf = lamda(tyvar(x)).gf_rhs(tyvar(x)) lamda_gf lamda_gf.rhs.series(x,n=10) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Step2: Non-commutative symbols Step3: Exponential gf recap Step4: Linear types Step5: occupancies Step6: Step7: Step8: Step9: Differences Step10: Step11:
11,905
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'messy-consortium', 'sandbox-2', 'seaice') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.model.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.model.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.variables.prognostic') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sea ice temperature" # "Sea ice concentration" # "Sea ice thickness" # "Sea ice volume per grid cell area" # "Sea ice u-velocity" # "Sea ice v-velocity" # "Sea ice enthalpy" # "Internal ice stress" # "Salinity" # "Snow temperature" # "Snow depth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.seawater_properties.ocean_freezing_point') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "TEOS-10" # "Constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.seawater_properties.ocean_freezing_point_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.target') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.simulations') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.metrics_used') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.key_parameter_values.typical_parameters') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Ice strength (P*) in units of N m{-2}" # "Snow conductivity (ks) in units of W m{-1} K{-1} " # "Minimum thickness of ice created in leads (h0) in units of m" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.key_parameter_values.additional_parameters') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.description') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.on_diagnostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.missing_processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.properties') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Energy" # "Mass" # "Salt" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.budget') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.was_flux_correction_used') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.corrected_conserved_prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.grid') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Ocean grid" # "Atmosphere Grid" # "Own Grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.grid_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Structured grid" # "Unstructured grid" # "Adaptive grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Finite differences" # "Finite elements" # "Finite volumes" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.thermodynamics_time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.dynamics_time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.layering') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Zero-layer" # "Two-layers" # "Multi-layers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.number_of_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.has_mulitple_categories') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.number_of_categories') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.category_limits') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.ice_thickness_distribution_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.other') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.has_snow_on_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.number_of_snow_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.snow_fraction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.horizontal_transport') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Incremental Re-mapping" # "Prather" # "Eulerian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.transport_in_thickness_space') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Incremental Re-mapping" # "Prather" # "Eulerian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.ice_strength_formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Hibler 1979" # "Rothrock 1975" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.redistribution') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Rafting" # "Ridging" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.rheology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Free-drift" # "Mohr-Coloumb" # "Visco-plastic" # "Elastic-visco-plastic" # "Elastic-anisotropic-plastic" # "Granular" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.enthalpy_formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pure ice latent heat (Semtner 0-layer)" # "Pure ice latent and sensible heat" # "Pure ice latent and sensible heat + brine heat reservoir (Semtner 3-layer)" # "Pure ice latent and sensible heat + explicit brine inclusions (Bitz and Lipscomb)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.thermal_conductivity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pure ice" # "Saline ice" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.heat_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Conduction fluxes" # "Conduction and radiation heat fluxes" # "Conduction, radiation and latent heat transport" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.basal_heat_flux') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Heat Reservoir" # "Thermal Fixed Salinity" # "Thermal Varying Salinity" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.fixed_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.heat_content_of_precipitation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.precipitation_effects_on_salinity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.new_ice_formation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_vertical_growth_and_melt') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_lateral_melting') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Floe-size dependent (Bitz et al 2001)" # "Virtual thin ice melting (for single-category)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_surface_sublimation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.frazil_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.has_multiple_sea_ice_salinities') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.sea_ice_salinity_thermal_impacts') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.salinity_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Prescribed salinity profile" # "Prognostic salinity profile" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.constant_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.salinity_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Prescribed salinity profile" # "Prognostic salinity profile" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.constant_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_thickness_distribution.representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Virtual (enhancement of thermal conductivity, thin ice melting)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_floe_size_distribution.representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Parameterised" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_floe_size_distribution.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.are_included') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Flocco and Feltham (2010)" # "Level-ice melt ponds" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.impacts') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Albedo" # "Freshwater" # "Heat" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.has_snow_aging') # PROPERTY VALUE(S): # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.snow_aging_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.has_snow_ice_formation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.snow_ice_formation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.redistribution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.heat_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Single-layered heat diffusion" # "Multi-layered heat diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.radiative_processes.surface_albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Delta-Eddington" # "Parameterized" # "Multi-band albedo" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.radiative_processes.ice_radiation_transmission') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Delta-Eddington" # "Exponential attenuation" # "Ice radiation transmission per category" # "Other: [Please specify]" # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 2. Key Properties --&gt; Variables Step7: 3. Key Properties --&gt; Seawater Properties Step8: 3.2. Ocean Freezing Point Value Step9: 4. Key Properties --&gt; Resolution Step10: 4.2. Canonical Horizontal Resolution Step11: 4.3. Number Of Horizontal Gridpoints Step12: 5. Key Properties --&gt; Tuning Applied Step13: 5.2. Target Step14: 5.3. Simulations Step15: 5.4. Metrics Used Step16: 5.5. Variables Step17: 6. Key Properties --&gt; Key Parameter Values Step18: 6.2. Additional Parameters Step19: 7. Key Properties --&gt; Assumptions Step20: 7.2. On Diagnostic Variables Step21: 7.3. Missing Processes Step22: 8. Key Properties --&gt; Conservation Step23: 8.2. Properties Step24: 8.3. Budget Step25: 8.4. Was Flux Correction Used Step26: 8.5. Corrected Conserved Prognostic Variables Step27: 9. Grid --&gt; Discretisation --&gt; Horizontal Step28: 9.2. Grid Type Step29: 9.3. Scheme Step30: 9.4. Thermodynamics Time Step Step31: 9.5. Dynamics Time Step Step32: 9.6. Additional Details Step33: 10. Grid --&gt; Discretisation --&gt; Vertical Step34: 10.2. Number Of Layers Step35: 10.3. Additional Details Step36: 11. Grid --&gt; Seaice Categories Step37: 11.2. Number Of Categories Step38: 11.3. Category Limits Step39: 11.4. Ice Thickness Distribution Scheme Step40: 11.5. Other Step41: 12. Grid --&gt; Snow On Seaice Step42: 12.2. Number Of Snow Levels Step43: 12.3. Snow Fraction Step44: 12.4. Additional Details Step45: 13. Dynamics Step46: 13.2. Transport In Thickness Space Step47: 13.3. Ice Strength Formulation Step48: 13.4. Redistribution Step49: 13.5. Rheology Step50: 14. Thermodynamics --&gt; Energy Step51: 14.2. Thermal Conductivity Step52: 14.3. Heat Diffusion Step53: 14.4. Basal Heat Flux Step54: 14.5. Fixed Salinity Value Step55: 14.6. Heat Content Of Precipitation Step56: 14.7. Precipitation Effects On Salinity Step57: 15. Thermodynamics --&gt; Mass Step58: 15.2. Ice Vertical Growth And Melt Step59: 15.3. Ice Lateral Melting Step60: 15.4. Ice Surface Sublimation Step61: 15.5. Frazil Ice Step62: 16. Thermodynamics --&gt; Salt Step63: 16.2. Sea Ice Salinity Thermal Impacts Step64: 17. Thermodynamics --&gt; Salt --&gt; Mass Transport Step65: 17.2. Constant Salinity Value Step66: 17.3. Additional Details Step67: 18. Thermodynamics --&gt; Salt --&gt; Thermodynamics Step68: 18.2. Constant Salinity Value Step69: 18.3. Additional Details Step70: 19. Thermodynamics --&gt; Ice Thickness Distribution Step71: 20. Thermodynamics --&gt; Ice Floe Size Distribution Step72: 20.2. Additional Details Step73: 21. Thermodynamics --&gt; Melt Ponds Step74: 21.2. Formulation Step75: 21.3. Impacts Step76: 22. Thermodynamics --&gt; Snow Processes Step77: 22.2. Snow Aging Scheme Step78: 22.3. Has Snow Ice Formation Step79: 22.4. Snow Ice Formation Scheme Step80: 22.5. Redistribution Step81: 22.6. Heat Diffusion Step82: 23. Radiative Processes Step83: 23.2. Ice Radiation Transmission
11,906
<ASSISTANT_TASK:> Python Code: # import libraries import matplotlib import IPython import numpy as np import pandas as pd import matplotlib.pyplot as plt import matplotlib as mpl import pylab import seaborn as sns import sklearn as sk %matplotlib inline ## Read the housing data! This time its not comma separated but space separated. Read up on how you can use Pandas ## to read in space separated files into a data frame housing = Read a .txt file, pay attention to how the data is separated # See if the import worked, print the first 5 lines using some in-built function. Where's your head at? housing.head() # Check if these of the variables are correlated using the visualization techniques built up in module 1! # LSTAT and MEDV would be related. The more the proportion of poor houses, the smaller the price. # Lets confirm our intuition # Scatterplot between LSTAT and MEDV sns.jointplot(housing.LSTAT,housing.MEDV,kind="reg") # Define predictor and response X = housing[['LSTAT']] Y = housing.MEDV # Load up the linear model and fit it. from sklearn.linear_model import LinearRegression lin_mod = LinearRegression() lin_mod.fit(X,Y) y_p = lin_mod.predict(X) # Plot the results. plt.scatter(X,Y,c='r') plt.plot(X,y_p,c='y') ## Now start making your own regression! # Remember the potential pitfalls we discussed. # Correlation - check the correlation of each variable with the other. Heres a correlation-map to get you # started on what predictors should be used and which ones are highly correlated and may pose a problem! corr = housing.corr() sns.heatmap(corr) plt.savefig("correl.png") # Start building your model here! # First you'll need to separate out the predictors and response X = predictors 1 through 13 Y = response = MEDV # You can reuse the lin_mod object to continue fitting to different data! <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Sci-Kit Learn, the machine learning library Step5: It seems that the predictor LSTAT is correlated with our response and will be a good base model. Lets try to build a simple linear model using just one predictor and response, (sklearn works the same way for more predictors, you just have to put them in one dataframe).
11,907
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import numpy as np import tensorflow as tf from tensorflow import keras from tensorflow.keras import layers inputs = keras.Input(shape=(784,)) # Just for demonstration purposes. img_inputs = keras.Input(shape=(32, 32, 3)) inputs.shape inputs.dtype dense = layers.Dense(64, activation="relu") x = dense(inputs) x = layers.Dense(64, activation="relu")(x) outputs = layers.Dense(10)(x) model = keras.Model(inputs=inputs, outputs=outputs, name="mnist_model") model.summary() keras.utils.plot_model(model, "my_first_model.png") keras.utils.plot_model(model, "my_first_model_with_shape_info.png", show_shapes=True) (x_train, y_train), (x_test, y_test) = keras.datasets.mnist.load_data() x_train = x_train.reshape(60000, 784).astype("float32") / 255 x_test = x_test.reshape(10000, 784).astype("float32") / 255 model.compile( loss=keras.losses.SparseCategoricalCrossentropy(from_logits=True), optimizer=keras.optimizers.RMSprop(), metrics=["accuracy"], ) history = model.fit(x_train, y_train, batch_size=64, epochs=2, validation_split=0.2) test_scores = model.evaluate(x_test, y_test, verbose=2) print("Test loss:", test_scores[0]) print("Test accuracy:", test_scores[1]) model.save("path_to_my_model") del model # Recreate the exact same model purely from the file: model = keras.models.load_model("path_to_my_model") encoder_input = keras.Input(shape=(28, 28, 1), name="img") x = layers.Conv2D(16, 3, activation="relu")(encoder_input) x = layers.Conv2D(32, 3, activation="relu")(x) x = layers.MaxPooling2D(3)(x) x = layers.Conv2D(32, 3, activation="relu")(x) x = layers.Conv2D(16, 3, activation="relu")(x) encoder_output = layers.GlobalMaxPooling2D()(x) encoder = keras.Model(encoder_input, encoder_output, name="encoder") encoder.summary() x = layers.Reshape((4, 4, 1))(encoder_output) x = layers.Conv2DTranspose(16, 3, activation="relu")(x) x = layers.Conv2DTranspose(32, 3, activation="relu")(x) x = layers.UpSampling2D(3)(x) x = layers.Conv2DTranspose(16, 3, activation="relu")(x) decoder_output = layers.Conv2DTranspose(1, 3, activation="relu")(x) autoencoder = keras.Model(encoder_input, decoder_output, name="autoencoder") autoencoder.summary() encoder_input = keras.Input(shape=(28, 28, 1), name="original_img") x = layers.Conv2D(16, 3, activation="relu")(encoder_input) x = layers.Conv2D(32, 3, activation="relu")(x) x = layers.MaxPooling2D(3)(x) x = layers.Conv2D(32, 3, activation="relu")(x) x = layers.Conv2D(16, 3, activation="relu")(x) encoder_output = layers.GlobalMaxPooling2D()(x) encoder = keras.Model(encoder_input, encoder_output, name="encoder") encoder.summary() decoder_input = keras.Input(shape=(16,), name="encoded_img") x = layers.Reshape((4, 4, 1))(decoder_input) x = layers.Conv2DTranspose(16, 3, activation="relu")(x) x = layers.Conv2DTranspose(32, 3, activation="relu")(x) x = layers.UpSampling2D(3)(x) x = layers.Conv2DTranspose(16, 3, activation="relu")(x) decoder_output = layers.Conv2DTranspose(1, 3, activation="relu")(x) decoder = keras.Model(decoder_input, decoder_output, name="decoder") decoder.summary() autoencoder_input = keras.Input(shape=(28, 28, 1), name="img") encoded_img = encoder(autoencoder_input) decoded_img = decoder(encoded_img) autoencoder = keras.Model(autoencoder_input, decoded_img, name="autoencoder") autoencoder.summary() def get_model(): inputs = keras.Input(shape=(128,)) outputs = layers.Dense(1)(inputs) return keras.Model(inputs, outputs) model1 = get_model() model2 = get_model() model3 = get_model() inputs = keras.Input(shape=(128,)) y1 = model1(inputs) y2 = model2(inputs) y3 = model3(inputs) outputs = layers.average([y1, y2, y3]) ensemble_model = keras.Model(inputs=inputs, outputs=outputs) num_tags = 12 # Number of unique issue tags num_words = 10000 # Size of vocabulary obtained when preprocessing text data num_departments = 4 # Number of departments for predictions title_input = keras.Input( shape=(None,), name="title" ) # Variable-length sequence of ints body_input = keras.Input(shape=(None,), name="body") # Variable-length sequence of ints tags_input = keras.Input( shape=(num_tags,), name="tags" ) # Binary vectors of size `num_tags` # Embed each word in the title into a 64-dimensional vector title_features = layers.Embedding(num_words, 64)(title_input) # Embed each word in the text into a 64-dimensional vector body_features = layers.Embedding(num_words, 64)(body_input) # Reduce sequence of embedded words in the title into a single 128-dimensional vector title_features = layers.LSTM(128)(title_features) # Reduce sequence of embedded words in the body into a single 32-dimensional vector body_features = layers.LSTM(32)(body_features) # Merge all available features into a single large vector via concatenation x = layers.concatenate([title_features, body_features, tags_input]) # Stick a logistic regression for priority prediction on top of the features priority_pred = layers.Dense(1, name="priority")(x) # Stick a department classifier on top of the features department_pred = layers.Dense(num_departments, name="department")(x) # Instantiate an end-to-end model predicting both priority and department model = keras.Model( inputs=[title_input, body_input, tags_input], outputs=[priority_pred, department_pred], ) keras.utils.plot_model(model, "multi_input_and_output_model.png", show_shapes=True) model.compile( optimizer=keras.optimizers.RMSprop(1e-3), loss=[ keras.losses.BinaryCrossentropy(from_logits=True), keras.losses.CategoricalCrossentropy(from_logits=True), ], loss_weights=[1.0, 0.2], ) model.compile( optimizer=keras.optimizers.RMSprop(1e-3), loss={ "priority": keras.losses.BinaryCrossentropy(from_logits=True), "department": keras.losses.CategoricalCrossentropy(from_logits=True), }, loss_weights=[1.0, 0.2], ) # Dummy input data title_data = np.random.randint(num_words, size=(1280, 10)) body_data = np.random.randint(num_words, size=(1280, 100)) tags_data = np.random.randint(2, size=(1280, num_tags)).astype("float32") # Dummy target data priority_targets = np.random.random(size=(1280, 1)) dept_targets = np.random.randint(2, size=(1280, num_departments)) model.fit( {"title": title_data, "body": body_data, "tags": tags_data}, {"priority": priority_targets, "department": dept_targets}, epochs=2, batch_size=32, ) inputs = keras.Input(shape=(32, 32, 3), name="img") x = layers.Conv2D(32, 3, activation="relu")(inputs) x = layers.Conv2D(64, 3, activation="relu")(x) block_1_output = layers.MaxPooling2D(3)(x) x = layers.Conv2D(64, 3, activation="relu", padding="same")(block_1_output) x = layers.Conv2D(64, 3, activation="relu", padding="same")(x) block_2_output = layers.add([x, block_1_output]) x = layers.Conv2D(64, 3, activation="relu", padding="same")(block_2_output) x = layers.Conv2D(64, 3, activation="relu", padding="same")(x) block_3_output = layers.add([x, block_2_output]) x = layers.Conv2D(64, 3, activation="relu")(block_3_output) x = layers.GlobalAveragePooling2D()(x) x = layers.Dense(256, activation="relu")(x) x = layers.Dropout(0.5)(x) outputs = layers.Dense(10)(x) model = keras.Model(inputs, outputs, name="toy_resnet") model.summary() keras.utils.plot_model(model, "mini_resnet.png", show_shapes=True) (x_train, y_train), (x_test, y_test) = keras.datasets.cifar10.load_data() x_train = x_train.astype("float32") / 255.0 x_test = x_test.astype("float32") / 255.0 y_train = keras.utils.to_categorical(y_train, 10) y_test = keras.utils.to_categorical(y_test, 10) model.compile( optimizer=keras.optimizers.RMSprop(1e-3), loss=keras.losses.CategoricalCrossentropy(from_logits=True), metrics=["acc"], ) # We restrict the data to the first 1000 samples so as to limit execution time # on Colab. Try to train on the entire dataset until convergence! model.fit(x_train[:1000], y_train[:1000], batch_size=64, epochs=1, validation_split=0.2) # Embedding for 1000 unique words mapped to 128-dimensional vectors shared_embedding = layers.Embedding(1000, 128) # Variable-length sequence of integers text_input_a = keras.Input(shape=(None,), dtype="int32") # Variable-length sequence of integers text_input_b = keras.Input(shape=(None,), dtype="int32") # Reuse the same layer to encode both inputs encoded_input_a = shared_embedding(text_input_a) encoded_input_b = shared_embedding(text_input_b) vgg19 = tf.keras.applications.VGG19() features_list = [layer.output for layer in vgg19.layers] feat_extraction_model = keras.Model(inputs=vgg19.input, outputs=features_list) img = np.random.random((1, 224, 224, 3)).astype("float32") extracted_features = feat_extraction_model(img) class CustomDense(layers.Layer): def __init__(self, units=32): super(CustomDense, self).__init__() self.units = units def build(self, input_shape): self.w = self.add_weight( shape=(input_shape[-1], self.units), initializer="random_normal", trainable=True, ) self.b = self.add_weight( shape=(self.units,), initializer="random_normal", trainable=True ) def call(self, inputs): return tf.matmul(inputs, self.w) + self.b inputs = keras.Input((4,)) outputs = CustomDense(10)(inputs) model = keras.Model(inputs, outputs) class CustomDense(layers.Layer): def __init__(self, units=32): super(CustomDense, self).__init__() self.units = units def build(self, input_shape): self.w = self.add_weight( shape=(input_shape[-1], self.units), initializer="random_normal", trainable=True, ) self.b = self.add_weight( shape=(self.units,), initializer="random_normal", trainable=True ) def call(self, inputs): return tf.matmul(inputs, self.w) + self.b def get_config(self): return {"units": self.units} inputs = keras.Input((4,)) outputs = CustomDense(10)(inputs) model = keras.Model(inputs, outputs) config = model.get_config() new_model = keras.Model.from_config(config, custom_objects={"CustomDense": CustomDense}) units = 32 timesteps = 10 input_dim = 5 # Define a Functional model inputs = keras.Input((None, units)) x = layers.GlobalAveragePooling1D()(inputs) outputs = layers.Dense(1)(x) model = keras.Model(inputs, outputs) class CustomRNN(layers.Layer): def __init__(self): super(CustomRNN, self).__init__() self.units = units self.projection_1 = layers.Dense(units=units, activation="tanh") self.projection_2 = layers.Dense(units=units, activation="tanh") # Our previously-defined Functional model self.classifier = model def call(self, inputs): outputs = [] state = tf.zeros(shape=(inputs.shape[0], self.units)) for t in range(inputs.shape[1]): x = inputs[:, t, :] h = self.projection_1(x) y = h + self.projection_2(state) state = y outputs.append(y) features = tf.stack(outputs, axis=1) print(features.shape) return self.classifier(features) rnn_model = CustomRNN() _ = rnn_model(tf.zeros((1, timesteps, input_dim))) units = 32 timesteps = 10 input_dim = 5 batch_size = 16 class CustomRNN(layers.Layer): def __init__(self): super(CustomRNN, self).__init__() self.units = units self.projection_1 = layers.Dense(units=units, activation="tanh") self.projection_2 = layers.Dense(units=units, activation="tanh") self.classifier = layers.Dense(1) def call(self, inputs): outputs = [] state = tf.zeros(shape=(inputs.shape[0], self.units)) for t in range(inputs.shape[1]): x = inputs[:, t, :] h = self.projection_1(x) y = h + self.projection_2(state) state = y outputs.append(y) features = tf.stack(outputs, axis=1) return self.classifier(features) # Note that you specify a static batch size for the inputs with the `batch_shape` # arg, because the inner computation of `CustomRNN` requires a static batch size # (when you create the `state` zeros tensor). inputs = keras.Input(batch_shape=(batch_size, timesteps, input_dim)) x = layers.Conv1D(32, 3)(inputs) outputs = CustomRNN()(x) model = keras.Model(inputs, outputs) rnn_model = CustomRNN() _ = rnn_model(tf.zeros((1, 10, 5))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 기능적 API Step2: 시작하기 Step3: 데이터의 모양은 784 차원 벡터로 설정됩니다. 각 샘플의 모양 만 지정되므로 배치 크기는 항상 생략됩니다. Step4: 리턴되는 inputs 에는 모델에 공급하는 입력 데이터의 모양 및 dtype 에 대한 정보가 포함됩니다. 모양은 다음과 같습니다. Step5: dtype은 다음과 같습니다. Step6: 이 inputs 객체에서 레이어를 호출하여 레이어 그래프에서 새 노드를 만듭니다. Step7: "레이어 호출" 동작은 "입력"에서 생성된 레이어로 화살표를 그리는 것과 같습니다. 입력을 dense 레이어로 "전달"하고 x를 출력으로 가져옵니다. Step8: 이 시점에서 레이어 그래프에서 입력 및 출력을 지정하여 Model을 작성할 수 있습니다. Step9: 모델 요약이 어떻게 보이는지 확인하십시오. Step10: 모델을 그래프로 플롯 할 수도 있습니다. Step11: 그리고 선택적으로 플롯 된 그래프에 각 레이어의 입력 및 출력 모양을 표시합니다. Step12: 이 그림과 코드는 거의 동일합니다. 코드 버전에서 연결 화살표는 호출 작업으로 대체됩니다. Step13: 자세한 내용은 훈련 및 평가 가이드를 참조하세요. Step14: 자세한 내용은 모델 직렬화 및 저장 가이드를 참조하세요. Step15: 여기서, 디코딩 아키텍처는 인코딩 아키텍처와 완전하게 대칭이므로 출력 형상은 입력 형상 (28, 28, 1)과 같습니다. Step16: 보시다시피, 모델은 중첩될 수 있습니다. 모델은 하위 모델을 포함할 수 있습니다(모델은 레이어와 유사하므로). 모델 중첩의 일반적인 사용 사례는 앙상블 기법(ensembling)입니다. 예를 들어, 모델 세트를 단일 모델로 앙상블하여 예측을 평균화하는 방법은 다음과 같습니다. Step17: 복잡한 그래프 토폴로지 조작 Step18: 이제 모델을 플롯합니다. Step19: 이 모델을 컴파일 할 때 각 출력에 서로 다른 손실을 할당 할 수 있습니다. 각 손실에 다른 가중치를 할당하여 총 교육 손실에 대한 기여도를 조정할 수도 있습니다. Step20: 출력 레이어의 이름이 다르므로 손실을 다음과 같이 지정할 수도 있습니다. Step21: 입력 및 목표치의 NumPy 배열 목록을 전달하여 모델을 훈련합니다. Step22: Dataset 객체에 맞춰 호출하면 ([title_data, body_data, tags_data], [priority_targets, dept_targets])와 같은 목록의 튜플 또는 ({'title' Step23: 모델을 플롯합니다. Step24: 이제 모델을 훈련합니다. Step25: 공유 레이어 Step26: 레이어 그래프에서 노드 추출 및 재사용 Step27: 다음은 그래프 데이터 구조를 쿼리하여 얻은 모델의 중간 활성화입니다. Step28: 다음 특성을 사용하여 중간 레이어 활성화의 값을 반환하는 새로운 feature-extraction 모델을 만듭니다. Step29: 이 모델은 뉴런 스타일 전송과 같은 작업에 특히 유용합니다. Step30: 사용자 정의 레이어에서 직렬화를 지원하려면, 레이어 인스턴스의 constructor 인수를 반환하는 get_config 메서드를 정의합니다. Step31: 선택적으로, config 사전이 주어진 레이어 인스턴스를 다시 작성할 때 사용되는 클래스 메서드 from_config(cls, config)를 구현합니다. from_config의 기본 구현은 다음과 같습니다. Step32: 다음 패턴 중 하나를 따르는 call 메서드를 구현하는 한 함수형 API에서 하위 클래스화된 레이어 또는 모델을 사용할 수 있습니다.
11,908
<ASSISTANT_TASK:> Python Code: # COMPLETARE LA FUNZIONE SEGUENTE def RadiceCubica(x): # DA COMPLETARE # DA COMPLETARE # DA COMPLETARE # Se non si trova la radice cubica: return "failed", "" # Funzione di test per la funzione che dovete implementare def UnitTest(): Xs = [27, -8, 57893, 1957816251, 7406961012236344616, 35.7, 'ciao'] for i,x in enumerate(Xs): msg, y = RadiceCubica(x) if msg == 'ok': print("Test ",i+1,' ok, result: ', y) else: print("Test ",i+1,' failed!') # Esegui il test UnitTest() # COMPLETARE LA FUNZIONE SEGUENTE def ApxRadiceQuadrata(x, epsilon=1e-02): # DA COMPLETARE # DA COMPLETARE # DA COMPLETARE return "failed", "", 0 # Funzione di test per la funzione che dovete implementare def UnitTest(): Xs = [25, 0.25, 123456] for i,x in enumerate(Xs): msg, y, iter = ApxRadiceQuadrata(x) if msg == 'ok': print("Test ",i+1,' ok, result: ', y, ' | iterations:', iter) else: print("Test ",i+1,' failed! | iterations:', iter) # Potete scegliere tra UnitTest() # Oppure, chiamare la funzione con un parametro alla volta #print(ApxRadiceQuadrata(0.25)) # COMPLETARE LA FUNZIONE SEGUENTE def BS_ApxRadiceQuadrata(x, epsilon=1e-02): # DA COMPLETARE # DA COMPLETARE # DA COMPLETARE return "failed", "", 0 # Funzione di test per la funzione che dovete implementare def UnitTest(): Xs = [25, 0.25, 123456, 123456789] for i,x in enumerate(Xs): print('----------- Start Test ', i+1, ' -------------') msg, y, iter = BS_ApxRadiceQuadrata(x) if msg == 'ok': print('TEST ',i+1,' ok, result: ', y, ' | iterations:', iter) else: print('TEST ',i+1,' failed! | iterations:', iter) print('----------- Test ', i+1, ' Completed -------------') # Potete scegliere tra UnitTest() # Polinomio di cui trovare la radice #def p(x): # DA COMPLETARE # Derivata prima del polinomio dato #def q(x): # DA COMPLETARE def NewtonRaphson(p, q, epsilon=1e-02): # DA COMPLETARE # DA COMPLETARE # DA COMPLETARE return 'failed', '', 0 # Test della funzione implementata NewtonRaphson(p,q) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Esercizio 2 Step2: Esercizio 3 Step3: Il Metodo di Newton Raphson
11,909
<ASSISTANT_TASK:> Python Code: import graphlab as gl import pandas as pd from datetime import datetime from sklearn.cross_validation import StratifiedKFold ## load data set from a locally saved csv file bank_marketing = gl.SFrame.read_csv('./../../../04.UCI.ML.REPO/Bank_Marketing/bank-additional/bank-additional-full.csv', delimiter=';') ## other methods of loading data sets... # data = gl.SFrame('s3://' or 'hdfs://') # data # pySpark RDD or SchemaRDD / Spark DataFrame # data = gl.SFrame.read_json('') # With a DB: configure ODBC manager / driver on the machine # data = gl.connect_odbc? # data = gl.from_sql? bank_marketing.head() gl.canvas.set_target('ipynb') bank_marketing.show() from helper_functions import * def _month_to_number(x): from dateutil import parser return parser.parse(x).strftime('%m') def _wkday_to_number(x): from dateutil import parser return parser.parse(x).strftime('%w') def _str_to_datetime(x): import datetime import pytz from dateutil import parser return parser.parse(x).strftime('%Y-%m-%d') def _unix_timestamp_to_datetime(x): import time import datetime import pytz from dateutil import parser return parser.parse(x) bank_marketing['y'] = bank_marketing['y'].apply(lambda x: 1 if x=='yes' else 0) bank_marketing['month_nr'] = bank_marketing['month'].apply(_month_to_number) bank_marketing['wkday_nr'] = bank_marketing['day_of_week'].apply(_wkday_to_number) bank_marketing['year'] = add_running_year(bank_marketing['month_nr'], 2008) bank_marketing['date'] = add_running_date(bank_marketing, 'year', 'month_nr', 'wkday_nr') bank_marketing['date'] = bank_marketing.apply(lambda row: '-'.join(map(str,(row['year'], row['month_nr'], row['date'])))) bank_marketing['date'] = bank_marketing['date'].apply(_str_to_datetime) bank_marketing['date'] = bank_marketing['date'].apply(_unix_timestamp_to_datetime) bank_marketing bank_marketing = gl.TimeSeries(bank_marketing, index='date') print 'Number of record lines [bank_marketing]: %d' % len(bank_marketing) print 'Unique calendar dates across data set [bank_marketing]: %d' % len(bank_marketing['date'].unique()) unique_dates_pct = (len(bank_marketing['date'].unique())*100/float(len(bank_marketing))) print 'Percentage of unique calendar dates across data set [bank_marketing]: %.2f%%'% unique_dates_pct bank_marketing.filter_by(2008,'year')['month_nr'].unique().sort() print 'Full Data Set [year: 2008]:' print '------------------------------' bank_marketing_2008 = bank_marketing.filter_by(2008,'year') customers = len(bank_marketing_2008[bank_marketing_2008['y']==1]) prospects = len(bank_marketing_2008[bank_marketing_2008['y']==0]) print 'Number of examples in year segment [bank_marketing]: %d' % len(bank_marketing_2008) print 'Number of existent customers: %d (%.2f%%)' % (customers, 100*customers/float(len(bank_marketing_2008))) print 'Number of prospects: %d (%.2f%%)\n' % (prospects, 100*prospects/float(len(bank_marketing_2008))) bank_marketing.filter_by(2009,'year')['month_nr'].unique().sort() print 'Full Data Set [year: 2009]:' print '------------------------------' bank_marketing_2009 = bank_marketing.filter_by(2009,'year') customers = len(bank_marketing_2009[bank_marketing_2009['y']==1]) prospects = len(bank_marketing_2009[bank_marketing_2009['y']==0]) print 'Number of examples in year segment [bank_marketing]: %d' % len(bank_marketing_2009) print 'Number of existent customers: %d (%.2f%%)' % (customers, 100*customers/float(len(bank_marketing_2009))) print 'Number of prospects: %d (%.2f%%)\n' % (prospects, 100*prospects/float(len(bank_marketing_2009))) bank_marketing.filter_by(2010,'year')['month_nr'].unique().sort() print 'Full Data Set [year: 2010]:' print '------------------------------' bank_marketing_2010 = bank_marketing.filter_by(2010,'year') customers = len(bank_marketing_2010[bank_marketing_2010['y']==1]) prospects = len(bank_marketing_2010[bank_marketing_2010['y']==0]) print 'Number of examples in year segment [bank_marketing]: %d' % len(bank_marketing_2010) print 'Number of existent customers: %d (%.2f%%)' % (customers, 100*customers/float(len(bank_marketing_2010))) print 'Number of prospects: %d (%.2f%%)' % (prospects, 100*prospects/float(len(bank_marketing_2010))) ## remove the time dimension of the problem ## transform the Timeseries object in a Numpy array bank_marketing = bank_marketing.to_sframe().remove_column('date') features = bank_marketing.column_names() bank_marketing_np = bank_marketing.to_numpy() ## provide the stratified train/test split skf = StratifiedKFold(bank_marketing['y'], n_folds=2, shuffle=True, random_state=1) for train_idx, test_idx in skf: train, test = bank_marketing_np[train_idx], bank_marketing_np[test_idx] train = pd.DataFrame(train, index=train_idx, columns=features) train = gl.SFrame(train, format='dataframe') test = pd.DataFrame(test, index=test_idx, columns=features) test = gl.SFrame(test, format='dataframe') ## restore original dtypes for attrib in features: train[attrib] = train[attrib].astype(bank_marketing[attrib].dtype()) test[attrib] = test[attrib].astype(bank_marketing[attrib].dtype()) print 'Training Data Set:' print '---------------------' train_customers = len(train[train['y']==1]) train_prospects = len(train[train['y']==0]) print 'Number of examples in training set [train]: %d' % len(train) print 'Number of existent customers: %d (%.2f%%)' % (train_customers, 100*train_customers/float(len(train))) print 'Number of prospects: %d (%.2f%%)\n' % (train_prospects, 100*train_prospects/float(len(train))) print 'Test Data Set:' print '-----------------' test_customers = len(test[test['y']==1]) test_prospects = len(test[test['y']==0]) print 'Number of examples in validation set [test]: %d' % len(test) print 'Number of existent customers: %d (%.2f%%)' % (test_customers, 100*test_customers/float(len(test))) print 'Number of prospects: %d (%.2f%%)' % (test_prospects, 100*test_prospects/float(len(test))) def calc_call_roi(contact_list, lead_score, pct_tocall): #assumptions cost_ofcall = 1.00 cust_ltv = 100.00 #customer lifetime value num_calls = int(len(contact_list) * pct_tocall) if 'lead_score' in contact_list.column_names(): contact_list.remove_column('lead_score') contact_list = contact_list.add_column(lead_score, name='lead_score') sorted_bymodel = contact_list.sort('lead_score', ascending=False) call_list = sorted_bymodel[:num_calls] num_subscriptions = len(call_list[call_list['y']==1]) roi = (num_subscriptions * cust_ltv - num_calls * cost_ofcall) / float(num_calls * cost_ofcall) return roi init_leadscores = gl.SArray([1 for _ in test]) init_roi = calc_call_roi(test, init_leadscores, 1) print 'ROI for calling all contacts [test]: %.2f%%' % init_roi num_customers = float(len(train)) numY = gl.Sketch(train['y']).frequency_count(1) print "%.2f%% of contacts in training set opened long-term deposit accounts." % (numY/num_customers * 100.0) median_age = gl.Sketch(train['age']).quantile(0.5) num_purchasing_emp_under_median_age = sum(train.apply(lambda x: 1 if x['age']<median_age and ((x['job']!='unemployed') & (x['job']!='student') & (x['job']!='unknown')) and x['y']==1 else 0)) probY_emp_under_median_age = (num_purchasing_emp_under_median_age / float(numY)) * 100.0 print "%.2f%% of the clients who opened long-term deposit accounts, were employed (but not students) and had age < %d (median)." % (probY_emp_under_median_age, median_age) target_leadscore = test.apply(lambda x: 1 if x['age']<median_age and ((x['job']!='unemployed') & (x['job']!='student') & (x['job']!='unknown')) and x['y']==1 else 0) age_targeting_roi = calc_call_roi(test, target_leadscore, 0.2) print 'ROI for targeted calls [employed (not students) and age < %d (median)] to 20%% of contacts: %.2f%%' % (median_age, age_targeting_roi) ## remove features that introduce noise in ML prediction features = train.column_names() features.remove('duration') features.remove('y') features.remove('month_nr') features.remove('wkday_nr') features.remove('year') ## GLC AutoML Classifier toolkit_model = gl.classifier.create(train, features=features, target='y') results = toolkit_model.evaluate(test) print "accuracy: %.5f, precision: %.5f, recall: %.5f" % (results['accuracy'], results['precision'], results['recall']) toolkit_model.get_feature_importance() toolkit_leadscore = toolkit_model.predict(test,output_type='probability') toolkit_roi = calc_call_roi(test, toolkit_leadscore, 0.2 ) print 'ROI for calling 20%% of highest predicted contacts: %.2f%%' % toolkit_roi import matplotlib.pyplot as plt %matplotlib inline qfeatures0 = ['emp.var.rate','cons.price.idx','cons.conf.idx','euribor3m'] plt.figure(figsize=(10,10)) subplot_idx = 1 for attrib1 in qfeatures0: for attrib2 in qfeatures0: if(attrib2 != attrib1): if subplot_idx < 5: plt.subplot(2,2,subplot_idx) plt.scatter(train[attrib1], train[attrib2]) plt.xlabel(attrib1) plt.ylabel(attrib2) plt.title('\'%s\' vs \'%s\'' % (attrib1, attrib2)) subplot_idx +=1 plt.show() ## define a quadratic transformer object quadratic_transformer = gl.feature_engineering.QuadraticFeatures(features=qfeatures0) ## fit the quadratic transformer object over the train set quadratic = gl.feature_engineering.create(train, quadratic_transformer) ## transform the train data set qtrain = quadratic.transform(train) ## remove the features that may worse our predictions qfeatures = qtrain.column_names() qfeatures.remove('duration') qfeatures.remove('y') qfeatures.remove('month_nr') qfeatures.remove('wkday_nr') qfeatures.remove('year') qtrain.head(5) new_toolkit_model = gl.classifier.create(qtrain, target='y', features=qfeatures) results = new_toolkit_model.evaluate(quadratic.transform(test)) print "accuracy: %.5f, precision: %.5f, recall: %.5f" % (results['accuracy'], results['precision'], results['recall']) print '\'newtoolkit_model\'\n[GLC AutoML Classifier wt quadratic interactions]:\n' print new_toolkit_model.get_feature_importance() print '\'toolkit_model\'\n[GLC AutoML Classifier wo quadratic interactions]:\n' print toolkit_model.get_feature_importance() ## show ROI for experimentation model newtoolkit_leadscore = new_toolkit_model.predict(quadratic.transform(test),output_type='probability') newtoolkit_roi = calc_call_roi(quadratic.transform(test), newtoolkit_leadscore, 0.2) print 'ROI for calling predicted contacts: %.2f%%' % newtoolkit_roi qtrain['age'].show() ## define a binning transformer for the age attribute of contacts age_binning_transformer = gl.feature_engineering.FeatureBinner(features='age', strategy='quantile', num_bins=12) ## fit the age binning transformer over the train set age_binning = gl.feature_engineering.create(train, age_binning_transformer) ## transform the train data set qtrain1 = age_binning.transform(qtrain) ## remove the features that may worse our predictions qfeatures1 = qtrain1.column_names() qfeatures1.remove('duration') qfeatures1.remove('y') qfeatures1.remove('month_nr') qfeatures1.remove('wkday_nr') qfeatures1.remove('year') qtrain1['age'].show() ## We create a boosted trees classifier with the enriched dataset. new_boostedtrees_model = gl.boosted_trees_classifier.create(qtrain1, target='y', features = qfeatures1, max_iterations = 100, max_depth=5, step_size=0.1, min_child_weight=0.06, random_seed=1, early_stopping_rounds=10) results = new_boostedtrees_model.evaluate(age_binning.transform(quadratic.transform(test))) print "accuracy: %.5f, precision: %.5f, recall: %.5f" % (results['accuracy'], results['precision'], results['recall']) print '\'new_boostedtrees_model\'\n[GLC Boosted Trees Classifier wt quadratic interactions,\ age grouping & hyperparams tuned]:\n' new_boostedtrees_model.get_feature_importance().print_rows(num_rows=20) print '\'newtoolkit_model\'\n[GLC AutoML Classifier wt quadratic interactions]:\n' print new_toolkit_model.get_feature_importance() ## show ROI for experimentation model test1 = age_binning.transform(quadratic.transform(test)) boostedtrees_leadscore = new_boostedtrees_model.predict(test1, output_type='probability') boostedtrees_roi = calc_call_roi(test1, boostedtrees_leadscore, 0.2) print 'ROI for calling predicted contacts: %.2f%%' % boostedtrees_roi pct_tocall = 0.2 boostedtrees_list = test1.sort('lead_score', ascending=False) num_calls = int(len(boostedtrees_list)*pct_tocall) print 'Assuming we have time and resources to call %d%% of the lead scored contact list, we\ need to make %d phone calls.\n' % (pct_tocall*100, num_calls) print 'Lead Scored Contact List:' boostedtrees_list['lead_score', 'age','campaign','euribor3m','job','loan', 'default', 'poutcome'].\ print_rows(num_rows=50, max_row_width=100) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Data Dictionary Step2: It is also important to note that the original data set has many more prospects (36548) than existent customers (4640). However, may be a bad idea to make a stratified split over this data set since we will loose that way the time dimension of the problem. In order to better check if the time dimension is important for this problem and the record provided, we need to re-create the missing calendar dates and transform the original data set in a timeseries object. Step3: The provided data set, bank_marketing, has 41188 record lines describing various customers and prospects attributes, as well as their response in the telemarketing campaign of interest. The percentage of unique calendar dates across this record is low, whereas much more people seems to response positevely as the time goes by. However, some months are missing from the data set and adding time dimension in this problem cannot help to provide better predictions. Step4: In order to evaluate our learning algorithms later, we need to make a train/test split of the bank_marketing SFrame. However, due to the class imbalance which is observed in contacts' response (it has much more prospects than original customers), we better do so in a stratified way. Step5: ROI Calculation Step6: Call everyone (assuming we have the budget & time to do so), ROI is 10.27% Step7: Lead Scoring Modeling Step8: A large proportion of customers who opened deposit accounts were employed (not students), under 38 Step9: Result Step10: The toolkit automatically evaluates several types of algorithms, including Step11: This initial model can be considered accurate given that it correctly predicts the purchasing decisions of ~90% of the contacts. However, the toolkit_model leaves room for improvement. Specifically only ~66% of predicted sales actually convert to sales. Furthermore, only ~24% of actual sales were actually predicted by the model. In order to better understand the model we can review the importance of the input features. Step12: Lead score the contact list and measure our ROI Step13: Result Step14: Next we add quadratic interactions between the four features below Step15: and re-train the GraphLab Create AutoML Classifier for this new data set qtrain. Step16: Next, we evaluate the new AutoML Classifier, new_toolkit_model, on the test data set. Step17: Note that this model is almost as accurate as the previous one, with similar precision (~66% of the predicted sales were actually converted to sales) and recall (~24% of actual sales were actually predicted by the model). However, to have a better feeling of the model just trained (newtoolkit_model) and how this differs from the previous one (toolkit_model), we can review the importance of the input features in these two cases. Step18: By comparing these two models we note that Step19: Result Step20: To group the age values of our contacts we leverage the FeatureBinner method of the feature_engineering toolkit of GraphLab Create as shown below. Step21: Lets now train a boosted trees classifier model using this enriched data set, qtrain1. We have also tweak its parameters to achieve better predictive performance. Step22: Next we evaluate the new_boostedtrees_model on the test data set. Step23: This new model (new_boostedtrees_model) is almost as accurate as the previous one, has higher precision (~66% of the predicted sales were actually converted to sales) and similar recall (~23% of actual sales were actually predicted by the model). To have a better feeling of the model just trained (newtoolkit_model) and how this differs from the previous one (new_toolkit_model), we can review the importance of the input features in these two cases. Step24: By comparing these two cases, we note that Step25: Conclusion
11,910
<ASSISTANT_TASK:> Python Code: import IPython.display as ipd ipd.Audio("../data/out_humannature_90s_stretched.mp3", rate=44100) ipd.Audio("../data/tresillo_rhythm.mp3", rate=44100) %matplotlib inline import math # Standard library imports import IPython.display as ipd, librosa, librosa.display, numpy as np, matplotlib.pyplot as plt # External libraries import pardir; pardir.pardir() # Allow imports from parent directory import bjorklund # Fork of Brian House's implementation of Bjorklund's algorithm https://github.com/brianhouse/bjorklund tresillo_rhythm = np.array([1, 0, 0, 1, 0, 0, 1, 0]) print(tresillo_rhythm) # Generate tresillo clicks sr = 44100 tresillo_click_interval = 0.25 # in seconds tresillo_click_times = np.array([i * tresillo_click_interval for i in range(len(tresillo_rhythm)) if tresillo_rhythm[i] != 0]) tresillo_clicks = librosa.clicks(times=tresillo_click_times, click_freq=2000.0, sr=sr) # Generate clicks according to the rhythm # Plot clicks and click times plt.figure(figsize=(8, 2)) librosa.display.waveplot(tresillo_clicks, sr=sr) plt.vlines(tresillo_click_times + 0.005, -1, 1, color="r") # Add tiny offset so the first line shows up plt.xticks(np.arange(0, 1.75, 0.25)) # Render clicks as audio ipd.Audio(tresillo_clicks, rate=sr) tresillo_num_pulses = np.count_nonzero(tresillo_rhythm) tresillo_num_steps = len(tresillo_rhythm) print("The tresillo rhythm has {} pulses and {} steps".format(tresillo_num_pulses, tresillo_num_steps)) def generate_rhythm_clicks(rhythm, click_interval=0.25, sr=44100): step_length_samples = int(librosa.time_to_samples(click_interval, sr=sr)) rhythm_length_samples = step_length_samples * (len(rhythm)) # Generate click times pulse_click_times, step_click_times = generate_rhythm_times(rhythm, click_interval) # Generate pulse clicks pulse_click_times = np.array([i * click_interval for i in range(len(rhythm)) if rhythm[i] != 0]) pulse_clicks = librosa.clicks(times=pulse_click_times, click_freq=2000.0, sr=sr, length=rhythm_length_samples) # Generate step clicks step_click_times = np.array([i * click_interval for i in range(len(rhythm))]) step_clicks = librosa.clicks(times=step_click_times, click_freq=1000.0, sr=sr, length=rhythm_length_samples) step_clicks = np.hstack((step_clicks, np.zeros(step_length_samples, dtype="int"))) # add last step samples # Add zeros to pulse clicks so that it's the same length as the step clicks signal pulse_clicks = np.hstack((pulse_clicks, np.zeros(len(step_clicks)-len(pulse_clicks), dtype="int"))) # Ensure proper length pulse_clicks = pulse_clicks[:rhythm_length_samples] step_clicks = step_clicks[:rhythm_length_samples] return (pulse_clicks, step_clicks) def generate_rhythm_times(rhythm, interval): pulse_times = np.array([float(i * interval) for i in range(len(rhythm)) if rhythm[i] != 0]) step_times = np.array([float(i * interval) for i in range(len(rhythm))]) return (pulse_times, step_times) # Generate the clicks tresillo_pulse_clicks, tresillo_step_clicks = generate_rhythm_clicks(tresillo_rhythm, tresillo_click_interval) tresillo_pulse_times, tresillo_step_times = generate_rhythm_times(tresillo_rhythm, tresillo_click_interval) # Tresillo as an array print(tresillo_rhythm) # Tresillo audio, plotted plt.figure(figsize=(8, 2)) librosa.display.waveplot(tresillo_pulse_clicks + tresillo_step_clicks, sr=sr) plt.vlines(tresillo_pulse_times + 0.005, -1, 1, color="r") plt.vlines(tresillo_step_times + 0.005, -0.5, 0.5, color="r") # Tresillo as audio ipd.Audio(tresillo_pulse_clicks + tresillo_step_clicks, rate=44100) # Function to calculate pulse lengths based on rhythm patterns def calculate_pulse_lengths(rhythm): pulse_lengths = np.array(([i for i,p in enumerate(rhythm) if p > 0])) pulse_lengths = np.hstack((pulse_lengths, len(rhythm))) pulse_lengths = np.array([pulse_lengths[i+1] - pulse_lengths[i] for i in range(len(pulse_lengths) - 1)]) return pulse_lengths tresillo_pulse_lengths = calculate_pulse_lengths(tresillo_rhythm) print("Tresillo pulse lengths: {}".format(tresillo_pulse_lengths)) def fibonacci(n): if n == 0 or n == 1: return n else: return fibonacci(n-1) + fibonacci(n-2) first_twenty_fibs = np.array([fibonacci(n) for n in range(20)]) plt.figure(figsize=(16,1)) plt.scatter(first_twenty_fibs, np.zeros(20), c="r") plt.axis("off") print(first_twenty_fibs) # Calculate and plot Fibonacci number ratios phi = (1 + math.sqrt(5)) / 2 # Golden ratio; 1.61803398875... fibs_ratios = np.array([first_twenty_fibs[i] / float(max(1, first_twenty_fibs[i-1])) for i in range(2,20)]) plt.plot(np.arange(len(fibs_ratios)), fibs_ratios, "r") # Plot golden ratio as a consant phis = np.empty(len(fibs_ratios)) phis.fill(phi) plt.xticks(np.arange(len(fibs_ratios))) plt.xlabel("Fibonacci index (denotes i for ith Fibonacci number)") plt.ylabel("Ratio between ith and (i-1)th Fibonacci number") plt.plot(np.arange(len(phis)), phis, "b", alpha=0.5) def find_fibonacci_index(n): phi = (1 + math.sqrt(5)) / 2 # Golden ratio; 1.61803398875... return int(math.log((n * math.sqrt(5)) + 0.5) / math.log(phi)) fib_n = 21 fib_i = find_fibonacci_index(fib_n) assert(fibonacci(fib_i) == fib_n) print("{} is the {}th Fibonacci number".format(fib_n, fib_i)) plt.figure(figsize=(8, 2)) plt.vlines(tresillo_pulse_times + 0.005, -1, 1, color="r") plt.vlines(tresillo_step_times + 0.005, -0.5, 0.5, color="r", alpha=0.5) plt.yticks([]) print("Tresillo rhythm sequence: {}".format(tresillo_rhythm)) print("Tresillo pulse lengths: {}".format(tresillo_pulse_lengths)) def fibonacci_expand_pulse_lengths(pulse_lengths): new_pulse_lengths = np.array([], dtype="int") for pulse_length in pulse_lengths: fib_i = find_fibonacci_index(pulse_length) new_pulse_length = fibonacci(fib_i + 1) new_pulse_lengths = np.hstack((new_pulse_lengths, new_pulse_length)) return new_pulse_lengths print("Expanded tresillo pulse lengths: {}".format(fibonacci_expand_pulse_lengths(tresillo_pulse_lengths))) # Function to scale pulse lengths along the Fibonacci sequence # # Note that `scale_amount` determines the direction and magnitude of the scaling. # If `scale_amount` > 0, it corresponds to a rhythmic expansion. # If `scale_amount` < 0, it corresponds to a rhythmic contraction. # If `scale_amount` == 0, the original scale is maintained and no changes are made. def fibonacci_scale_pulse_lengths(pulse_lengths, scale_amount=0): scaled_pulse_lengths = np.array([], dtype="int") for pulse_length in pulse_lengths: fib_i = find_fibonacci_index(pulse_length) # if fib_i + scale_amount < 0: # print("ERROR: Scale amount out of bounds") # return pulse_lengths scaled_pulse_length = fibonacci(max(fib_i + scale_amount, 0)) scaled_pulse_lengths = np.hstack((scaled_pulse_lengths, scaled_pulse_length)) return scaled_pulse_lengths print("Tresillo pulse lengths: {}".format(tresillo_pulse_lengths)) print("Tresillo pulse lengths expanded by 1: {}".format(fibonacci_scale_pulse_lengths(tresillo_pulse_lengths, 1))) print("Tresillo pulse lengths expanded by 2: {}".format(fibonacci_scale_pulse_lengths(tresillo_pulse_lengths, 2))) print("Tresillo pulse lengths contracted by 1: {}".format(fibonacci_scale_pulse_lengths(tresillo_pulse_lengths, -1))) # Define the functions we'll use to scale rhythms along the Fibonacci sequence def fibonacci_scale_rhythm(rhythm, scale_amount): pulse_lengths = calculate_pulse_lengths(rhythm) scaled_pulse_lengths = fibonacci_scale_pulse_lengths(pulse_lengths, scale_amount) scaled_pulse_lengths = np.array([p for p in scaled_pulse_lengths if p > 0]) scaled_rhythm = pulse_lengths_to_rhythm(scaled_pulse_lengths) return scaled_rhythm def pulse_lengths_to_rhythm(pulse_lengths): rhythm = np.array([], dtype="int") for p in pulse_lengths: pulse = np.zeros(p, dtype="int") pulse[0] = 1 rhythm = np.hstack((rhythm, pulse)) return rhythm # Scale tresillo rhythm by a variety of factors and plot the results for scale_factor, color in [(0, "r"), (1, "g"), (2, "b"), (-1, "y")]: scaled_rhythm = fibonacci_scale_rhythm(tresillo_rhythm, scale_factor) scaled_pulse_indices = np.array([p_i for p_i,x in enumerate(scaled_rhythm) if x > 0 ]) scaled_step_indices = np.array([s_i for s_i in range(len(scaled_rhythm))]) scaled_pulse_ys = np.empty(len(scaled_pulse_indices)) scaled_pulse_ys.fill(0) scaled_step_ys = np.empty(len(scaled_step_indices)) scaled_step_ys.fill(0) # plt.figure(figsize=(len([scaled_rhythm])*0.5, 1)) plt.figure(figsize=(8, 1)) if scale_factor > 0: plt.title("Tresillo rhythm expanded by {}: {}".format(abs(scale_factor), scaled_rhythm), loc="left") elif scale_factor < 0: plt.title("Tresillo rhythm contracted by {}: {}".format(abs(scale_factor), scaled_rhythm), loc="left") else: # scale_factor == 0, which means rhythm is unaltered plt.title("Tresillo rhythm: {}".format(scaled_rhythm), loc="left") # plt.scatter(scaled_pulse_indices, scaled_pulse_ys, c=color) # plt.scatter(scaled_step_indices, scaled_step_ys, c="k", alpha=0.5) # plt.grid(True) plt.vlines(scaled_pulse_indices, -1, 1, color=color) plt.vlines(scaled_step_indices, -0.5, 0.5, color=color, alpha=0.5) plt.xticks(np.arange(0, plt.xlim()[1], 1)) plt.yticks([]) # plt.xticks(np.linspace(0, 10, 41)) # Load input audio file filename = "../data/humannature_30s.mp3" y, sr = librosa.load(filename, sr=sr) plt.figure(figsize=(16,4)) librosa.display.waveplot(y, sr=sr) ipd.Audio(y, rate=sr) def estimate_tempo(y, sr, start_bpm=120.0): # Estimate tempo onset_env = librosa.onset.onset_strength(y, sr=sr) # TODO: Compare this with librosa.beat.beat_track tempo = librosa.beat.tempo(y, sr=sr, onset_envelope=onset_env, start_bpm=start_bpm) return float(tempo) tempo = estimate_tempo(y, sr) print("Tempo (calculated): {}".format(tempo)) tempo = 93.0 # Hard-coded from prior knowledge print("Tempo (hard-coded): {}".format(tempo)) # Calculate beat times def calculate_beat_times(y, sr, tempo): # Calculate params based on input T = len(y)/float(sr) # Total audio length in seconds seconds_per_beat = 60.0/tempo # Start beat at first onset rather than time 0 # TODO: Let this first onset also be user-supplied for more accurate results beat_times = np.arange(detect_first_onset_time(y, sr), T, seconds_per_beat) return beat_times # Detect first onset def detect_first_onset_time(y, sr, hop_length=1024): onset_frames = librosa.onset.onset_detect(y, sr=sr, hop_length=hop_length) onset_times = librosa.frames_to_time(onset_frames) return onset_times[0] beat_times = calculate_beat_times(y, sr, tempo) print("First 10 beat times (in seconds): {}".format(beat_times[:10])) # Listen to beat clicks (i.e. a metronome) beat_clicks = librosa.clicks(times=beat_times, sr=sr, length=len(y)) # Plot waveform and beats plt.figure(figsize=(16,4)) librosa.display.waveplot(y, sr=sr) plt.vlines(beat_times, -0.25, 0.25, color="r") ipd.Audio(y + beat_clicks, rate=sr) beats_per_measure = 4 # Calculate measure indices in samples def calculate_measure_samples(y, beat_samples, beats_per_measure): max_samples = len(y) start_sample = beat_samples[0] beat_interval = beat_samples[1] - beat_samples[0] measure_interval = beat_interval * beats_per_measure if measure_interval >= beat_interval: return np.array(beat_samples[::beats_per_measure], dtype="int") else: beat_indices = np.indices([len(beat_samples)])[0] measure_indices = np.indices([len(beat_samples)/beats_per_measure])[0] return np.interp(measure_indices, beat_indices/beats_per_measure, beat_samples) # Work in samples from here on beat_samples = librosa.time_to_samples(beat_times, sr=sr) measure_samples = calculate_measure_samples(y, beat_samples, beats_per_measure) print("First 10 measure samples: {}".format(measure_samples[:10])) measure_times = librosa.samples_to_time(measure_samples, sr=sr) print("First 10 measure times (in seconds): {}".format(measure_times[:10], sr=sr)) # Add clicks, then plot and listen plt.figure(figsize=(16, 4)) librosa.display.waveplot(y, sr=sr) plt.vlines(measure_times, -1, 1, color="r") plt.vlines(beat_times, -0.5, 0.5, color="r") measure_clicks = librosa.clicks(times=measure_times, sr=sr, click_freq=3000.0, length=len(y)) ipd.Audio(y + measure_clicks + beat_clicks, rate=sr) print("Tresillo rhythm: {}\n" "{} pulses, {} steps".format(tresillo_rhythm, tresillo_num_pulses, tresillo_num_steps)) steps_per_measure = tresillo_num_steps steps_per_measure Generating clicks for tresillo rhythm at the proper tempo and start time, to overlay onto an audio track def generate_rhythm_overlay(rhythm, measure_samples, steps_per_measure, sr): # Calculate click interval measure_length = measure_samples[1]-measure_samples[0] # click_tempo = tempo * (steps_per_measure/float(beats_per_measure)) # click_interval = 60.0/click_tempo measure_length_seconds = librosa.samples_to_time(measure_length, sr=sr) click_interval = measure_length_seconds / float(steps_per_measure) # Generate click times for single measure pulse_times_measure, step_times_measure = generate_rhythm_times(rhythm, click_interval) # Generate clicks for single measure pulse_clicks_measure, step_clicks_measure = generate_rhythm_clicks(rhythm, click_interval, sr=sr) # Concatenate clicks and click times for all measures pulse_times, step_times, pulse_clicks, step_clicks = np.array([]), np.array([]), np.array([]), np.array([]) for s in measure_samples: t = float(librosa.samples_to_time(s, sr=sr)) pulse_clicks = np.hstack((pulse_clicks, pulse_clicks_measure)) step_clicks = np.hstack((step_clicks, step_clicks_measure)) pulse_times = np.hstack((pulse_times, pulse_times_measure + t)) step_times = np.hstack((step_times, step_times_measure + t)) # Offset clicks by first onset pulse_clicks = np.hstack((np.zeros(measure_samples[0]), pulse_clicks)) step_clicks = np.hstack((np.zeros(measure_samples[0]), step_clicks)) return (pulse_times, step_times, pulse_clicks, step_clicks) Visualizing and hearing the result def overlay_rhythm_onto_audio(rhythm, audio_samples, measure_samples, sr=44100, click_colors={"measure": "r", "pulse": "r", "step": "r"}): # Get overlay data pulse_times, step_times, pulse_clicks, step_clicks = generate_rhythm_overlay(rhythm, measure_samples, len(rhythm), sr) measure_times = librosa.samples_to_time(measure_samples, sr=sr) measure_clicks = librosa.clicks(times=measure_times, sr=sr, click_freq=3000.0, length=len(audio_samples)) # Calculate max length in samples available_lengths = [len(audio_samples), len(measure_clicks), len(pulse_clicks), len(step_clicks)] length_samples = min(available_lengths) # Plot original waveform plt.figure(figsize=(16, 4)) librosa.display.waveplot(audio_samples, sr=sr, alpha=0.5) # Plot rhythm clicks plt.vlines(measure_times, -1, 1, color=click_colors["measure"]) plt.vlines(pulse_times, -0.5, 0.5, color=click_colors["pulse"]) plt.vlines(step_times, -0.25, 0.25, color=click_colors["step"], alpha=0.75) # Play both clicks together with audio track concatenated_audio_samples = ((audio_samples[:length_samples]*2.0) + (measure_clicks[:length_samples]*0.25) + (pulse_clicks[:length_samples]*0.25) + (step_clicks[:length_samples]*0.25)) audio_display = ipd.Audio(concatenated_audio_samples, rate=sr) return audio_display overlay_rhythm_onto_audio(tresillo_rhythm, y, measure_samples, sr=sr) overlay_rhythm_onto_audio(tresillo_rhythm, y, measure_samples, sr=sr, click_colors={"measure": "r", "pulse": "g", "step": "b"}) original_rhythm = tresillo_rhythm target_rhythm = fibonacci_scale_rhythm(original_rhythm, 1) # "Fibonacci scale" original rhythm by a factor of 1 print("Original rhythm: {}\n" "Target rhythm: {}".format(original_rhythm, target_rhythm)) # Calculate ratios between pulses for two rhythm sequences # NOTE: This assumes that both rhythm sequences have the same number of pulses! def calculate_pulse_ratios(original_rhythm, target_rhythm): original_pulse_lengths = calculate_pulse_lengths(original_rhythm) target_pulse_lengths = calculate_pulse_lengths(target_rhythm) num_pulses = min(len(original_pulse_lengths), len(target_pulse_lengths)) pulse_ratios = np.array([original_pulse_lengths[i]/float(target_pulse_lengths[i]) for i in range(num_pulses)]) return pulse_ratios print("Pulse ratios: {}".format(calculate_pulse_ratios(original_rhythm, target_rhythm))) # Modify a single measure def modify_measure(data, original_rhythm, target_rhythm, stretch_method): modified_data = np.array([]) # Define the rhythmic properties we'll use original_num_samples = len(data) original_num_steps = len(original_rhythm) target_num_steps = len(target_rhythm) # Get indices of steps for measure original_step_interval = original_num_samples / float(original_num_steps) original_step_indices = np.arange(0, original_num_samples, original_step_interval, dtype="int") # Get only indices of pulses based on rhythm original_pulse_indices = np.array([original_step_indices[i] for i in range(original_num_steps) if original_rhythm[i] > 0]) # Calculate pulse ratios pulse_ratios = calculate_pulse_ratios(original_rhythm, target_rhythm) # Calculate pulse lengths original_pulse_lengths = calculate_pulse_lengths(original_rhythm) target_pulse_lengths = calculate_pulse_lengths(target_rhythm) # Concatenate time-stretched versions of rhythm's pulses for i,p in enumerate(original_pulse_indices): # Get pulse sample data; samples between current and next pulse, or if it's the final pulse, # samples between pulse and end of audio pulse_start = p pulse_stop = len(data)-1 if i < len(original_pulse_indices)-1: pulse_stop = original_pulse_indices[i+1] pulse_samples = data[pulse_start:pulse_stop] # Time-stretch this step based on ratio of old to new rhythm length # TODO: Try out other methods of manipulation, such as using onset detection in addition to steps and pulses if stretch_method == "timestretch": pulse_samples = librosa.effects.time_stretch(pulse_samples, pulse_ratios[i]) elif stretch_method == "euclidean": pulse_samples = euclidean_stretch(pulse_samples, original_pulse_lengths[i], target_pulse_lengths[min(i, len(target_pulse_lengths)-1)]) else: print("ERROR: Invalid stretch method {}".format(stretch_method)) # Add the samples to our modified audio time series modified_data = np.hstack((modified_data, pulse_samples)) # Time-stretch entire measure to maintain original measure length (so that it sounds more natural) stretch_multiplier = len(modified_data)/float(len(data)) modified_data = librosa.effects.time_stretch(modified_data, stretch_multiplier) return modified_data # Euclidean stretch STUB def euclidean_stretch(pulse_samples, original_pulse_length, target_pulse_length): return pulse_samples first_measure_data = y[measure_samples[0]:measure_samples[1]] first_measure_modified = modify_measure(first_measure_data, original_rhythm, target_rhythm, stretch_method="timestretch") ipd.Audio(first_measure_modified, rate=sr) # Modify an entire audio track; basically just loops through a track's measures # and calls modify_measure() on each measure def modify_track(data, measure_samples, original_rhythm, target_rhythm, stretch_method="timestretch"): modified_track_data = np.zeros(measure_samples[0]) modified_measure_samples = np.array([], dtype="int") for i, sample in enumerate(measure_samples[:-1]): modified_measure_samples = np.hstack((modified_measure_samples, len(modified_track_data))) measure_start = measure_samples[i] measure_stop = measure_samples[i+1] measure_data = data[measure_start:measure_stop] modified_measure_data = modify_measure(measure_data, original_rhythm, target_rhythm, stretch_method) modified_track_data = np.hstack((modified_track_data, modified_measure_data)) return (modified_track_data, modified_measure_samples) # Modify the track using naive time-stretch y_modified, measure_samples_modified = modify_track(y, measure_samples, original_rhythm, target_rhythm, stretch_method="timestretch") plt.figure(figsize=(16,4)) librosa.display.waveplot(y_modified, sr=sr) ipd.Audio(y_modified, rate=sr) print(calculate_pulse_ratios(original_rhythm, target_rhythm)) overlay_rhythm_onto_audio(target_rhythm, y_modified, measure_samples, sr) print("Original rhythm: {}\n" "Target rhythm: {}".format(original_rhythm, target_rhythm)) def euclid(a, b): m = max(a, b) k = min(a, b) if k==0: return m else: return euclid(k, m%k) print("Greatest common divisor of 8 and 12 is {}".format(euclid(8, 12))) print(np.array(bjorklund.bjorklund(pulses=3, steps=8))) original_pulse = np.array([1,0,0]) target_pulse = np.array([1,0,0,0,0]) original_pulse_rhythm = np.ones(len(original_pulse), dtype="int") print(original_pulse_rhythm) target_pulse_rhythm = np.array(bjorklund.bjorklund(pulses=len(original_pulse), steps=len(target_pulse))) print(target_pulse_rhythm) print(fibonacci_scale_rhythm(tresillo_rhythm, -1)) print("In order to stretch pulse-to-pulse {} --> {}\n" "we subdivide and stretch rhythms {} --> {}".format(original_pulse, target_pulse, original_pulse_rhythm, target_pulse_rhythm)) print(calculate_pulse_ratios(original_pulse_rhythm, target_pulse_rhythm)) # Euclidean stretch for modifying a single pulse (basically time-stretching subdivisions based on Euclidean rhythms) def euclidean_stretch(pulse_samples, original_pulse_length, target_pulse_length): target_pulse_samples = np.array([]) # Return empty samples array if target pulse length < 1 if target_pulse_length < 1: return target_pulse_samples # Ensure original pulse rhythm ("opr") has length equal to or less than target_pulse_length # ... by using target pulse length # original_pulse_length = min(original_pulse_length, target_pulse_length) # ... by using divisors of original pulse length # if original_pulse_length > target_pulse_length: # # print("WARNING: original_pulse_length {} " # # "is greater than target_pulse_length {}".format(original_pulse_length, # # target_pulse_length)) # for i in range(1, original_pulse_length+1): # opl_new = int(original_pulse_length / float(i)) # if opl_new <= target_pulse_length: # original_pulse_length = opl_new # # print("original_pulse_length is now {}".format(original_pulse_length)) # break # ... by using lowest common multiple as target pulse length if original_pulse_length > target_pulse_length: # print("Target pulse length before: {}".format(target_pulse_length)) gcd = euclid(original_pulse_length, target_pulse_length) lcm = (original_pulse_length*target_pulse_length) / gcd target_pulse_length = lcm # print("Target pulse length after: {}".format(target_pulse_length)) # original_pulse_length = target_pulse_length opr = np.ones(original_pulse_length, dtype="int") # Generate target pulse rhythm ("tpr") tpr = bjorklund.bjorklund(pulses=original_pulse_length, steps=target_pulse_length) tpr_pulse_lengths = calculate_pulse_lengths(tpr) tpr_pulse_ratios = calculate_pulse_ratios(opr, tpr) # Subdivide (i.e. segment) the pulse based on original pulse length pulse_subdivision_step = int(len(pulse_samples) / float(original_pulse_length)) pulse_subdivision_indices = np.arange(0, len(pulse_samples), pulse_subdivision_step, dtype="int") pulse_subdivision_indices = pulse_subdivision_indices[:original_pulse_length] # Time-stretch each subdivision based on ratios for i,si in enumerate(pulse_subdivision_indices): subdivision_start = si subdivision_stop = len(pulse_samples) - 1 if i < len(pulse_subdivision_indices)-1: subdivision_stop = pulse_subdivision_indices[i+1] pulse_subdivision_samples = pulse_samples[subdivision_start:subdivision_stop] # Stretch the relevant subdivisions based on target pulse rhythm pulse_subdivision_samples = librosa.effects.time_stretch(pulse_subdivision_samples, tpr_pulse_ratios[i]) # Concatenate phrase target_pulse_samples = np.hstack((target_pulse_samples, pulse_subdivision_samples)) return target_pulse_samples # Modify the track y_modified, measure_samples_modified = modify_track(y, measure_samples, original_rhythm, target_rhythm, stretch_method="euclidean") plt.figure(figsize=(16,4)) librosa.display.waveplot(y_modified, sr=sr) ipd.Audio(y_modified, rate=sr) overlay_rhythm_onto_audio(target_rhythm, y_modified, measure_samples, sr) def fibonacci_stretch_track(audio_filepath, sr=44100, original_rhythm=np.array([1,0,0,1,0,0,1,0], dtype="int"), stretch_method="euclidean", stretch_factor=1, target_rhythm=None, tempo=None, beats_per_measure=4, hop_length=1024, overlay_clicks=False, render_track=True): # Load input audio y, sr = librosa.load(audio_filepath, sr=sr) # Extract rhythm features from audio if tempo is None: tempo = estimate_tempo(y, sr) beat_times = calculate_beat_times(y, sr, tempo) beat_samples = librosa.time_to_samples(beat_times, sr=sr) measure_samples = calculate_measure_samples(y, beat_samples, beats_per_measure) # Generate target rhythm if target_rhythm is None: target_rhythm = fibonacci_scale_rhythm(original_rhythm, stretch_factor) # Modify the track y_modified, measure_samples_modified = modify_track(y, measure_samples, original_rhythm, target_rhythm, stretch_method="euclidean") # Render the modified track... if render_track: if overlay_clicks: return overlay_rhythm_onto_audio(target_rhythm, y_modified, measure_samples_modified, sr) else: plt.figure(figsize=(16,4)) librosa.display.waveplot(y_modified, sr=sr) return ipd.Audio(y_modified, rate=sr) # ... or return modified track and measure samples else: return (y_modified, measure_samples_modified) # "Human Nature" stretched by a factor of 1 using default parameters fibonacci_stretch_track("../data/humannature_90s.mp3", stretch_factor=1, tempo=93.0) # "Human Nature" stretched by a factor of 2 fibonacci_stretch_track("../data/humannature_30s.mp3", tempo=93.0, stretch_factor=2, overlay_clicks=True) # "Chan Chan" stretched by a factor of -1 fibonacci_stretch_track("../data/chanchan_30s.mp3", stretch_factor=-1, tempo=78.5) # "I'm the One" stretched by a factor of 1 fibonacci_stretch_track("../data/imtheone_cropped_chance_60s.mp3", tempo=162, original_rhythm=np.array([1,0,0,0,0,1,0,0]), stretch_factor=1) # "I'm the One" in 5/4 fibonacci_stretch_track("../data/imtheone_cropped_chance_60s.mp3", tempo=162, original_rhythm=np.array([1,0,0,0,0,1,0,0]), target_rhythm=np.array([1,0,0,0,0,1,0,0,0,0]), overlay_clicks=True) # "Eine kleine Nachtmusik" with a swing feel fibonacci_stretch_track("../data/einekleinenachtmusik_30s.mp3", tempo=130, original_rhythm=np.array([1,0,1,1]), target_rhythm=np.array([1,0,0,1,0,1])) # "Chan Chan" in 5/4 fibonacci_stretch_track("../data/chanchan_30s.mp3", tempo=78.5, original_rhythm=np.array([1,0,0,1,0,0,0,0]), target_rhythm=np.array([1,0,0,0,0,1,0,0,0,0])) # Also interesting to try with [1,0,1] # "Pink + White" stretched by a factor of 1 fibonacci_stretch_track("../data/pinkandwhite_30s.mp3", beats_per_measure=6, tempo=160, # 6/8 to 4/4 using bassline rhythm original_rhythm=np.array([1,1,1,1,0,0]), target_rhythm=np.array([1,1,1,0,1,0,0,0]), # 6/8 to 4/4 using half notes # original_rhythm=np.array([1,0,0,1,0,0]), # target_rhythm=np.array([1,0,0,0,1,0,0,0]), # 6/8 to 10/8 (5/4) using Fibonacci stretch factor of 1 # original_rhythm=np.array([1,0,0,1,0,0]), # stretch_factor=1, overlay_clicks=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: You can also jump to Part 6 for more audio examples. Step2: ...and looks something like this in Western music notation Step3: Briefly Step4: Note that both the music notation and the array are symbolic representations of the rhythm; the rhythm is abstracted so that there is no information about tempo, dynamics, timbre, or other musical information. All we have is the temporal relationship between each note in the sequence (as well as the base assumption that the notes are evenly spaced). Step5: 1.2 Rhythmic properties Step6: We can listen to the pulses and steps together Step7: You can follow along with the printed array and hear that every 1 corresponds to a pulse, and every 0 to a step. Step8: Note that the tresillo rhythm's pulse lengths all fall along the Fibonacci sequence. This allows us do some pretty fun things, as we'll see in a bit. But first let's take a step back. Step9: And the first 20 numbers in the sequence are Step10: The Fibonacci sequence is closely linked to the golden ratio in many ways, including the fact that as we go up the sequence, the ratio between successive numbers gets closer and closer to the golden ratio. (If you're interested, Vijay Iyer's article Strength in numbers Step11: We can also use the golden ratio to find the index of a Fibonacci number Step12: 2.2 Using Fibonacci numbers to manipulate rhythms Step13: We might classify it as a Fibonacci rhythm, since every one of its pulse lengths is a Fibonacci number. If we wanted to expand that rhythm along the Fibonacci sequence, what would that look like? Step14: We'll also want to be able to contract rhythms along the Fibonacci sequence (i.e. choose numbers in decreasing order instead of increasing order), as well as specify how many Fibonacci numbers away we want to end up. Step15: Of course, once we have these scaled pulse lengths, we'll want to be able to convert them back into rhythms, in our original array format Step16: This is exactly the kind of rhythmic expansion and contraction that the Vijay Iyer Trio explore in their renditions of "Mystic Brew" and "Human Nature (Trio Extension)". Step17: An important feature we want to extract from the audio is tempo (i.e. the time interval between steps). Let's estimate that using the librosa.beat.tempo method (which requires us to first detect onsets, or []) Step18: <div style="color Step19: And let's listen to our extracted beats with the original audio track Step20: 3.3 From beats to measures Step21: Using beats_per_measure we can calculate the times for the start of each measure Step22: Note that we're working in samples now, as this is the unit that the audio data is actually stored in; when we loaded up the audio track, we essentially read in a large array of samples. The sample rate, which we defined as sr, tells us how many samples there are per second. Step23: We can visualize, and listen to, the measure and beat markers along with the original waveform Step24: 3.4 Putting it all together Step25: For this example, we want the rhythm to last an entire measure as well, so we'll set steps_per_measure to be the number of steps in the rhythm (in this case, 8) Step28: With these markers in place, we can now overlay the tresillo rhythm onto each measure and listen to the result Step29: The clicks for measures, pulses, and steps, overlap with each other at certain points. While you can hear this based on the fact that each click is at a different frequency, it can be hard to tell visually in the above figure. We can make this more apparent by plotting each set of clicks with a different color. Step30: You can hear that the tresillo rhythm's pulses line up with the harmonic rhythm of "Human Nature"; generally, we want to pick rhythms and audio tracks that have at least some kind of musical relationship. Step31: 4.2 Pulse ratios Step32: 4.3 Modifying measures by time-stretching Step33: You'll notice that in the part where we choose stretch methods, there's a function called euclidean_stretch that we haven't defined. We'll get to that in just a second! For now, let's just put a stub there Step34: ... so that we can hear what our modification method sounds like when applied to the first measure of "Human Nature" Step35: It doesn't sound like there's much difference between the stretched version and the original, does it? Step36: Listening to the whole track, only perceptible difference is that the last two beats of each measure are slightly faster. If we look at the pulse ratios again Step37: ... we can see that this makes sense, as we're time-stretching the first two pulses by the same amount, and then time-stretching the last pulse by a different amount. Step38: This gets to the heart of the problem Step39: Looking at the first pulses of the original rhythm and target rhythm, we want to turn Step40: The concept of Euclidean rhythms was first introduced by Godfried Toussaint in his 2004 paper The Euclidean Algorithm Generates Traditional Musical Rhythms. Step41: 5.3 Using Euclidean rhythms to subdivide pulses Step42: We want to know how much to stretch each subdivision. To do this, we'll convert these single pulses into rhythms of their own. First, we'll treat each step in the original pulse as an onset Step43: And as mentioned before, we'll use Bjorklund's algorithm to generate the target pulse's rhythm. The trick here is to use the number of steps in the original pulse as the number of pulses for the target pulse rhythm (hence the conversion to onsets earlier) Step44: You might have noticed that this rhythm is exactly the same as the rhythm produced by contracting the tresillo rhythm along the Fibonacci sequence by a factor of 1 Step45: And it's true that there is some significant overlap between Euclidean rhythms and Fibonacci rhythms. The advantage of working with Euclidean rhythms here is that they work with any number of pulses and steps, not just ones that are Fibonacci numbers. Step46: The resulting pulse ratios are Step47: ... which doesn't intuitively look like it would produce something any different from what we tried before. However, we might perceive a greater difference because Step48: Let's take a listen to how it sounds Step49: Much better! With clicks Step50: As you can hear, the modified track's rhythm is in line with the clicks, and sounds noticeably different from the original song. This is a pretty good place to end up! Step51: Now we can simply feed the function a path to an audio file (as well as any parameters we want to customize). Step52: And indeed we get the exact same result. Step53: As mentioned in part 2.2, we can contract rhythms as well using negative numbers as our stretch_factor. Let's try that with "Chan Chan" by the Buena Vista Social Club Step54: (Note that although we do end up with a perceptible difference (the song now sounds like it's in 7/8), it should actually sound like it's in 5/8, since [1 0 0 1 0 0 1 0] is getting compressed to [1 0 1 0 1]. This is an implementation detail with the Euclidean stretch method that I need to fix.) Step55: We can define both a custom target rhythm as well. In addition, neither original_rhythm nor target_rhythm have to be Fibonacci rhythms for the stretch algorithm to work (although with this implementation they do both have to have the same number of pulses). Step56: As another example, we can give a swing feel to the first movement of Mozart's "Eine kleine Nachtmusik" (K. 525), as performed by A Far Cry Step57: It works pretty decently until around 0 Step58: 6.4 Examples
11,911
<ASSISTANT_TASK:> Python Code: %pylab inline Tp = 20.0 N = 50 step = Tp/N dw = 2*pi/Tp wny = dw*N/2 print("omega_1 =", dw) print("Nyquist freq. =",wny,"rad/s =", wny/dw, '* omega_1') M = 1000 t_n=linspace(0.0,Tp,N+1) t_m=linspace(0.0,Tp,M+1) hf = 47 lf = hf - N c_hs_hf = cos(hf*dw*t_m) c_hs_lf = cos(lf*dw*t_m) c_ls_hf = cos(hf*dw*t_n) c_ls_lf = cos(lf*dw*t_n) figsize(12,2.4) figure(1);plot(t_m,c_hs_hf,'-r') ylim((-1.05,+1.05)) grid() title(r'$\cos(%+3d\omega_1t)$, continuous in red, 50 samples in blue'%(hf,)) figure(2);plot(t_m,c_hs_lf,'-r') ylim((-1.05,+1.05)) grid() title(r'$\cos(%+3d\omega_1 t)$, continuous in red, 50 samples in blue'%(lf,)) figure(1) ; plot(t_m,c_hs_hf,'-r',t_n,c_ls_hf,'ob') ylim((-1.05,+1.05));grid(); figure(2) ; plot(t_m,c_hs_lf,'-r',t_n,c_ls_lf,'ob') ylim((-1.05,+1.05));grid(); figure(3) ; grid() title('The two cosines, sampled at 2.5 points per second') figure(3) plot(t_n,c_ls_hf,'-b', linewidth=.33) plot(t_n,c_ls_lf,'xr', markersize=8) xticks((2,4,6,8,10,12,14,16,18,20)) ylim((-1.05,+1.05)); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: To be concrete, we'll use $\Delta t = 0.4$ s and a fundamental period $T_n=20$ s, hence a number of samples per period $N=50$, or $2.5$ samples per second. Step2: To the values above, we associate the fundamental frequency of the DFT and the corresponding Nyquist frequency. Step3: For comparison, we want to plot our functions also with a high Step4: The function linspace generates a vector with a start and a stop Step5: The Nyquist circular frequency is $25\Delta\omega$. Step6: First, we plot the harmonics with a high frequency sampling (visually continuous, that is). Step7: Not surprisingly, the two plots are really different. Step8: If you look at the patterns of the dots they seem, at least, very similar. What happens is aliasing!
11,912
<ASSISTANT_TASK:> Python Code: paraderos_sinlatlong = frame_2['par_subida'][frame_2['lat_subida'].isnull()& frame_2['par_subida'].notnull()].unique() paraderos_sinlatlong frame_2 = frame_2[frame_2.lat_subida.notnull()] from scipy.stats.mstats import mode f = lambda x: mode(x, axis=None)[0][0] g = lambda x: mode(x,axis=None)[1][0] aggregations = { 'tiempo_subida': "count" # Calculate two results for the 'network' column with a list } a_group = frame.groupby(['par_subida','tipo_transporte']).agg(aggregations) another_group = frame.groupby(['par_subida','par_bajada','lat_subida','tipo_transporte']).agg(aggregations) sorted_group = another_group.sort_values('tiempo_subida',ascending=False) sorted_group.head(100) sorted_group.to_csv('od.csv') another_group.head() groupie_group = frame.groupby(['par_subida','tipo_transporte']).agg({'tiempo_subida':"count"}) sorted_par_subidas = groupie_group.sort_values('tiempo_subida',ascending=False) sorted_par_subidas.to_csv('origin_.csv') sorted_par_subidas.head() groupie_group = frame.groupby(['par_bajada']).agg({'tiempo_subida':"count"}) sorted_par_bajadas = groupie_group.sort_values('tiempo_subida',ascending=False) sorted_par_bajadas.to_csv('destination_.csv') sorted_par_bajadas.head() sorted_par_subidas[sorted_par_subidas['tiempo_subida']>10].to_csv('origin_10.csv') sorted_par_bajadas[sorted_par_bajadas['tiempo_subida']>10].to_csv('destination_10.csv') with open('correct_and_wrong_indexs_alg1.pickle') as f: correct_alg1 = pickle.load(f) wrong_alg1 = pickle.load(f) with open('index_id_users.pickle') as f: users_id = pickle.load(f) correct_alg1_ids = [] wrong_alg1_ids = [] for i in range(len(correct_alg1)): correct_alg1_ids.append(users_id[i]) for i in range(len(wrong_alg1)): wrong_alg1_ids.append(users_id[i]) def write_csv_grouped_data(a_frame,name,threshold): groupie_group = a_frame.groupby(['par_bajada','tipo_transporte']).agg({'tiempo_subida':"count"}) sorted_par_bajadas = groupie_group.sort_values('tiempo_subida',ascending=False) sorted_par_bajadas[sorted_par_bajadas['tiempo_subida']>threshold].to_csv(name+'_'+str(threshold)+'_destination.csv') groupie_group = a_frame.groupby(['par_subida','tipo_transporte']).agg({'tiempo_subida':"count"}) sorted_par_subidas = groupie_group.sort_values('tiempo_subida',ascending=False) sorted_par_subidas[sorted_par_subidas['tiempo_subida']>threshold].to_csv(name+'_'+str(threshold)+'_origin.csv') return sorted_par_subidas ff = write_csv_grouped_data(frame,'',0) write_csv_grouped_data(frame_2,'',0) frame write_csv_grouped_data(frame[frame['id'].isin(wrong_alg1_ids)],'wrong_alg1',1) write_csv_grouped_data(frame[frame['id'].isin(correct_alg1_ids)],'correct_alg1',1) without_transbordors_frame = frame[frame['netapa']==1] write_csv_grouped_data(without_transbordors_frame[without_transbordors_frame['id'].isin(wrong_alg1_ids)],'wrong_alg1_wo_tr',1) write_csv_grouped_data(without_transbordors_frame[without_transbordors_frame['id'].isin(correct_alg1_ids)],'correct_alg1_wo_tr',1) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Guardar en csv viajes de los correctos e incorrectos Step2: Guardar en csv viajes de los correctos e incorrectos. sin transbordo
11,913
<ASSISTANT_TASK:> Python Code: import matplotlib.pyplot as plt %matplotlib inline import numpy as np x = np.arange(-np.pi,np.pi,0.01) # Create an array of x values from -pi to pi with 0.01 interval y = np.sin(x) # Apply sin function on all x plt.plot(x,y) plt.plot(y) x = np.arange(0,10,1) # x = 1,2,3,4,5... y = x*x # Squared x plt.plot(x,y,'bo') # plot x and y using blue circle markers plt.plot(x,y,'r+') # plot x and y using red plusses x = np.arange(-np.pi,np.pi,0.001) plt.plot(x,np.sin(x)) plt.title('y = sin(x)') # title plt.xlabel('x (radians)') # x-axis label plt.ylabel('y') # y-axis label # To plot the axis label in LaTex, we can run from matplotlib import rc ## For sans-serif font: rc('font',**{'family':'sans-serif','sans-serif':['Helvetica']}) rc('text', usetex=True) ## for Palatino and other serif fonts use: #rc('font',**{'family':'serif','serif':['Palatino']}) plt.plot(x,np.sin(x)) plt.title(r'T = sin($\theta$)') # title, the `r` in front of the string means raw string plt.xlabel(r'$\theta$ (radians)') # x-axis label, LaTex synatx should be encoded with $$ plt.ylabel('T') # y-axis label x1 = np.linspace(0.0, 5.0) x2 = np.linspace(0.0, 2.0) y1 = np.cos(2 * np.pi * x1) * np.exp(-x1) y2 = np.cos(2 * np.pi * x2) plt.subplot(2, 1, 1) plt.plot(x1, y1, '.-') plt.title('Plot 2 graph at the same time') plt.ylabel('Amplitude (Damped)') plt.subplot(2, 1, 2) plt.plot(x2, y2, '.-') plt.xlabel('time (s)') plt.ylabel('Amplitude (Undamped)') plt.plot(x,np.sin(x)) plt.savefig('plot.pdf') plt.savefig('plot.png') # To load image into this Jupyter notebook from IPython.display import Image Image("plot.png") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Line Plots Step2: Scatter Plots Step3: Plot properties Step4: Multiple plots Step5: Save figure
11,914
<ASSISTANT_TASK:> Python Code: %config InlineBackend.figure_format = 'retina' import matplotlib.pyplot as plt import numpy as np from uncertainties import unumpy as unp import pytheos as eos eta = np.linspace(1., 0.70, 7) print(eta) dorogokupets2007_pt = eos.platinum.Dorogokupets2007() help(dorogokupets2007_pt) dorogokupets2007_pt.print_equations() dorogokupets2007_pt.print_equations() dorogokupets2007_pt.print_parameters() v0 = 60.37930856339099 dorogokupets2007_pt.three_r v = v0 * (eta) temp = 3000. p = dorogokupets2007_pt.cal_p(v, temp * np.ones_like(v)) print('for T = ', temp) for eta_i, p_i in zip(eta, p): print("{0: .3f} {1: .2f}".format(eta_i, p_i)) v = dorogokupets2007_pt.cal_v(p, temp * np.ones_like(p), min_strain=0.6) print(1.-(v/v0)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 0. General note Step2: 3. Compare Step3: <img src='./tables/Dorogokupets2007_Pt.png'>
11,915
<ASSISTANT_TASK:> Python Code: import numpy as np a = np.array([1,2,3,4]) b = np.array([5, 4, 3, 2]) result = np.correlate(a, np.hstack((b[1:], b)), mode='valid') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
11,916
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt plt.style.use('seaborn-whitegrid') import numpy as np x = np.linspace(0, 10, 50) dy = 0.8 y = np.sin(x) + dy * np.random.randn(50) plt.errorbar(x, y, yerr=dy, fmt='.k'); plt.errorbar(x, y, yerr=dy, fmt='o', color='black', ecolor='lightgray', elinewidth=3, capsize=0); from sklearn.gaussian_process import GaussianProcess # define the model and draw some data model = lambda x: x * np.sin(x) xdata = np.array([1, 3, 5, 6, 8]) ydata = model(xdata) # Compute the Gaussian process fit gp = GaussianProcess(corr='cubic', theta0=1e-2, thetaL=1e-4, thetaU=1E-1, random_start=100) gp.fit(xdata[:, np.newaxis], ydata) xfit = np.linspace(0, 10, 1000) yfit, MSE = gp.predict(xfit[:, np.newaxis], eval_MSE=True) dyfit = 2 * np.sqrt(MSE) # 2*sigma ~ 95% confidence region # Visualize the result plt.plot(xdata, ydata, 'or') plt.plot(xfit, yfit, '-', color='gray') plt.fill_between(xfit, yfit - dyfit, yfit + dyfit, color='gray', alpha=0.2) plt.xlim(0, 10); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Here the fmt is a format code controlling the appearance of lines and points, and has the same syntax as the shorthand used in plt.plot, outlined in Simple Line Plots and Simple Scatter Plots. Step2: In addition to these options, you can also specify horizontal errorbars (xerr), one-sided errorbars, and many other variants. Step3: We now have xfit, yfit, and dyfit, which sample the continuous fit to our data.
11,917
<ASSISTANT_TASK:> Python Code: from flask import Flask, Response, request, json, render_template from kafka import KafkaProducer import uuid import datetime app = Flask(__name__) producer = KafkaProducer(bootstrap_servers='localhost:9092') # Default end point @app.route('/', methods = ['GET']) def api_root(): data = { "title":"IOT Back Brace REST API", "sensorReading":{ "deviceID":"5d681c54e66ff4a5654e55c6d5a5b54", "metricTypeID":6, "uomID":4, "actual":{"y":18,"p":17.50,"r":120}, "setPoints":{"y":25,"p":45,"r":10} }, "trainingReading":{ "deviceID":"5d681c54e66ff4a5654e55c6d5a5b54", "metricTypeID":6, "uomID":4, "currentPostureID":2, "actual":{"y":18,"p":17.50,"r":120}, "setPoints":{"y":25,"p":45,"r":100} } } try: print(request.headers) return render_template("index.html", data = data ) except Exception, e: return str(e) # End point for posting sensor readings. @app.route('/LumbarSensorReading', methods = ['POST']) def post_readings(): if request.headers['Content-Type'] == 'application/json': # Create readingTime readingTime = datetime.datetime.now().isoformat() # Create readingID readingID = str(uuid.uuid4()) # Add these to json object request.json['readingTime'] = readingTime request.json['readingID'] = readingID # Send to Kafka producer producer.send('LumbarSensorReadings', json.dumps(request.json)) return "JSON Message: " + json.dumps(request.json) else: return "415 Unsupported Media Type" # End point for training the Machine Learning Model @app.route('/LumbarSensorTraining', methods = ['POST']) def post_trainingData(): if request.headers['Content-Type'] == 'application/json': # Create readingTime readingTime = datetime.datetime.now().isoformat() # Create readingID readingID = str(uuid.uuid4()) # Add these to json object request.json['readingTime'] = readingTime request.json['readingID'] = readingID # Send to Kafka producer producer.send('LumbarSensorTraining', json.dumps(request.json)) print(request.headers) return "JSON Message: " + json.dumps(request.json) else: return "415 Unsupported Media Type" if __name__ == '__main__': app.run(host="0.0.0.0",debug=1) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The default end point is simply there to "document" the API if the root endpoint of the API is called with a get method. This will show the JSON objects expected by the post methods. Step2: The /LumbarSensorReading endpoint expects a POST method with a JSON object in the data payload. A unique reading identifier and the current time attributes are generated and added to the JSON packet before sending. Step3: The /LumbarSensorTraining endpoint expects a POST method with a JSON object in the data payload. A unique reading identifier and the current time attributes are generated and added to the JSON packet before sending.
11,918
<ASSISTANT_TASK:> Python Code: # install Pint if necessary try: import pint except ImportError: !pip install pint # download modsim.py if necessary from os.path import exists filename = 'modsim.py' if not exists(filename): from urllib.request import urlretrieve url = 'https://raw.githubusercontent.com/AllenDowney/ModSim/main/' local, _ = urlretrieve(url+filename, filename) print('Downloaded ' + local) # import functions from modsim from modsim import * def bike_to_wellesley(): bikeshare.olin -= 1 bikeshare.wellesley += 1 def bike_to_wellesley(state): state.olin -= 1 state.wellesley += 1 from modsim import State bikeshare = State(olin=10, wellesley=2) bike_to_wellesley(bikeshare) bikeshare1 = State(olin=10, wellesley=2) bikeshare2 = State(olin=2, wellesley=10) bike_to_wellesley(bikeshare1) bike_to_wellesley(bikeshare2) def bike_to_olin(state): Move one bike from Wellesley to Olin. state: bikeshare State object # We decrease one state variable and increase the # other, so the total number of bikes is unchanged. state.wellesley -= 1 state.olin += 1 def bike_to_olin(state): if state.wellesley == 0: return state.wellesley -= 1 state.olin += 1 bikeshare = State(olin=12, wellesley=0) bike_to_olin(bikeshare) bikeshare x = 5 x == 5 if x == 5: print('yes, x is 5') def bike_to_olin(state): if state.wellesley == 0: state.wellesley_empty += 1 return state.wellesley -= 1 state.olin += 1 bikeshare = State(olin=12, wellesley=0, wellesley_empty=0) bike_to_olin(bikeshare) bikeshare from modsim import TimeSeries, decorate def run_simulation(state, p1, p2, num_steps): Simulate the given number of time steps. state: State object p1: probability of an Olin->Wellesley customer arrival p2: probability of a Wellesley->Olin customer arrival num_steps: number of time steps results = TimeSeries() results[0] = state.olin for i in range(num_steps): step(state, p1, p2) results[i+1] = state.olin results.plot(label='Olin') decorate(title='Olin-Wellesley Bikeshare', xlabel='Time step (min)', ylabel='Number of bikes') from modsim import flip def step(state, p1, p2): Simulate one time step. state: bikeshare State object p1: probability of an Olin->Wellesley ride p2: probability of a Wellesley->Olin ride if flip(p1): bike_to_wellesley(state) if flip(p2): bike_to_olin(state) def bike_to_olin(state): Move one bike from Wellesley to Olin. state: bikeshare State object if state.wellesley == 0: state.wellesley_empty += 1 return state.wellesley -= 1 state.olin += 1 def bike_to_wellesley(state): Move one bike from Olin to Wellesley. state: bikeshare State object state.olin -= 1 state.wellesley += 1 # Solution def bike_to_wellesley(state): Move one bike from Olin to Wellesley. state: bikeshare State object if state.olin == 0: state.olin_empty += 1 return state.olin -= 1 state.wellesley += 1 # Solution bikeshare = State(olin=0, wellesley=12, olin_empty=0, wellesley_empty=0) # Solution bike_to_wellesley(bikeshare) # Solution bikeshare # Solution bikeshare = State(olin=10, wellesley=2, olin_empty=0, wellesley_empty=0) run_simulation(bikeshare, 0.3, 0.2, 60) bikeshare <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: To paraphrase two Georges, "All models are wrong, but some models are Step2: When this function is called, it modifies bikeshare. As long as there Step3: The name of the parameter is state rather than bikeshare as a Step4: Again, the argument we provide gets assigned to the parameter, so this Step5: And update them independently Step7: Changes in bikeshare1 do not affect bikeshare2, and vice versa. So Step8: Docstrings follow a conventional format Step9: The first line checks whether the number of bikes at Wellesley is zero. If so, it uses a return statement, which causes the function to end immediately, without running the rest of the statements. So if there are no bikes at Wellesley, we "return" from bike_to_olin without changing the state. Step10: The state of the system should be unchanged. Step11: No more negative bikes (at least at Wellesley). Step12: On the other hand, the following statement checks whether x is 5 and Step13: You can use the equals operator in an if statement, like this Step14: If you make a mistake and use = in an if statement, like this Step15: If a customer arrives at the Wellesley station and finds no bike Step16: We can test it by calling bike_to_olin Step17: There should be 12 bikes at Olin, no bikes at Wellesley, and one unhappy customer. Step22: Looks good! Step24: Exercise Step25: Exercise
11,919
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import os try: %tensorflow_version 2.x except Exception: pass !pip install tensorflow-io from datetime import datetime import tensorflow as tf import tensorflow_io as tfio !curl -s -OL https://github.com/coredns/coredns/releases/download/v1.6.7/coredns_1.6.7_linux_amd64.tgz !tar -xzf coredns_1.6.7_linux_amd64.tgz !curl -s -OL https://raw.githubusercontent.com/tensorflow/io/master/docs/tutorials/prometheus/Corefile !cat Corefile # Run `./coredns` as a background process. # IPython doesn't recognize `&` in inline bash cells. get_ipython().system_raw('./coredns &') !curl -s -OL https://github.com/prometheus/prometheus/releases/download/v2.15.2/prometheus-2.15.2.linux-amd64.tar.gz !tar -xzf prometheus-2.15.2.linux-amd64.tar.gz --strip-components=1 !curl -s -OL https://raw.githubusercontent.com/tensorflow/io/master/docs/tutorials/prometheus/prometheus.yml !cat prometheus.yml # Run `./prometheus` as a background process. # IPython doesn't recognize `&` in inline bash cells. get_ipython().system_raw('./prometheus &') !sudo apt-get install -y -qq dnsutils !dig @127.0.0.1 -p 9053 demo1.example.org !dig @127.0.0.1 -p 9053 demo2.example.org dataset = tfio.experimental.IODataset.from_prometheus( "coredns_dns_request_count_total", 5, endpoint="http://localhost:9090") print("Dataset Spec:\n{}\n".format(dataset.element_spec)) print("CoreDNS Time Series:") for (time, value) in dataset: # time is milli second, convert to data time: time = datetime.fromtimestamp(time // 1000) print("{}: {}".format(time, value['coredns']['localhost:9153']['coredns_dns_request_count_total'])) dataset = tfio.experimental.IODataset.from_prometheus( "go_memstats_gc_sys_bytes", 5, endpoint="http://localhost:9090") print("Time Series CoreDNS/Prometheus Comparision:") for (time, value) in dataset: # time is milli second, convert to data time: time = datetime.fromtimestamp(time // 1000) print("{}: {}/{}".format( time, value['coredns']['localhost:9153']['go_memstats_gc_sys_bytes'], value['prometheus']['localhost:9090']['go_memstats_gc_sys_bytes'])) n_steps, n_features = 2, 1 simple_lstm_model = tf.keras.models.Sequential([ tf.keras.layers.LSTM(8, input_shape=(n_steps, n_features)), tf.keras.layers.Dense(1) ]) simple_lstm_model.compile(optimizer='adam', loss='mae') n_samples = 10 dataset = tfio.experimental.IODataset.from_prometheus( "go_memstats_sys_bytes", n_samples + n_steps - 1 + 1, endpoint="http://localhost:9090") # take go_memstats_gc_sys_bytes from coredns job dataset = dataset.map(lambda _, v: v['coredns']['localhost:9153']['go_memstats_sys_bytes']) # find the max value and scale the value to [0, 1] v_max = dataset.reduce(tf.constant(0.0, tf.float64), tf.math.maximum) dataset = dataset.map(lambda v: (v / v_max)) # expand the dimension by 1 to fit n_features=1 dataset = dataset.map(lambda v: tf.expand_dims(v, -1)) # take a sliding window dataset = dataset.window(n_steps, shift=1, drop_remainder=True) dataset = dataset.flat_map(lambda d: d.batch(n_steps)) # the first value is x and the next value is y, only take 10 samples x = dataset.take(n_samples) y = dataset.skip(1).take(n_samples) dataset = tf.data.Dataset.zip((x, y)) # pass the final dataset to model.fit for training simple_lstm_model.fit(dataset.batch(1).repeat(10), epochs=5, steps_per_epoch=10) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Prometheus サーバーからメトリックを読み込む Step2: CoreDNS と Prometheus のインストールとセットアップ Step3: 次に、Prometheus サーバーをセットアップし、Prometheus を使用して、上記の9153番ポートで公開されている CoreDNS メトリックを取得します。また、構成用のprometheus.ymlファイルはダウンロードできます。 Step4: アクティビティを表示するためには、digコマンドを使用して、セットアップされている CoreDNS サーバーに対していくつかの DNS クエリを生成できます。 Step5: CoreDNS サーバーのメトリックが Prometheus サーバーによりスクレイピングされ、TensorFlow で使用する準備ができました。 Step6: データセットの仕様をさらに見てみましょう。 Step7: 作成されたDatasetは、トレーニングまたは推論のために直接tf.kerasに渡す準備ができています。 Step8: 使用するデータセットは、10 サンプルの CoreDNS の「go_memstats_sys_bytes」の値です。ただし、window = n_stepsおよびshift = 1のスライディングウィンドウが形成されるため、追加のサンプルが必要です (2 つの連続する要素の場合、最初のサンプルはxで、2 番目はyと見なされます) 。合計は10 + n_steps - 1 + 1 = 12 秒です。
11,920
<ASSISTANT_TASK:> Python Code: # Let's plot the data for each of the devices, from each of the base stations. dfs = [(origin, 'origin'), (eastern, 'eastern'), (southern, 'southern')] def plot_signal_vs_distance(device): fig = plt.figure(figsize=(9,3)) ax1 = fig.add_subplot(131) ax2 = fig.add_subplot(132) ax3 = fig.add_subplot(133) axes = [ax1, ax2, ax3] for i, (df, title) in enumerate(dfs): df.dropna().query('tracker_id=="{0}"'.format(device)).plot(x='distance', y='dB', kind='scatter', ax=axes[i]) axes[i].set_title(title) plt.tight_layout() device = '68:9E:19:11:A6:DB' plot_signal_vs_distance(device) device = 'F4:B8:5E:C4:56:22' plot_signal_vs_distance(device) # In order to have more data put together, I will concatenate the 3 data frames. device = '68:9E:19:11:A6:DB' # device = 'F4:B8:5E:C4:56:22' all_data = origin.dropna().append(eastern.dropna()).append(southern.dropna()).query('tracker_id=="{0}"'.format(device)) all_data.plot(x='distance', y='dB', kind='scatter', title='{0} data points'.format(len(all_data))) sns.violinplot(x=all_data['distance'], y=all_data['dB']) import pymc3 as pm with pm.Model() as model: # Hyperparameters for A and B # mu_a = pm.Normal('mu_A', mu=0, sd=10) # sig_a = pm.Uniform('sigma_A', lower=0, upper=10) # mu_b = pm.Normal('mu_B', mu=0, sd=10) # sig_b = pm.Uniform('sigma_B', lower=0, upper=10) # Estimate the intercepts A = pm.Normal('A', mu=-0.2, sd=3) B = pm.Normal('B', mu=-50, sd=3) # Error term err = pm.Normal('error', mu=-30, sd=10) # Model prediction: dB = A * all_data['distance'] + B + err # dB likelihood db_like = pm.Normal('dB', mu=dB, sd=10, observed=all_data['dB']) with model: start = pm.find_MAP() step = pm.NUTS() trace = pm.sample(10000, step) pm.traceplot(trace) pm.summary(trace) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Preliminary Conclusions Step2: Looking at the distribution of data points, it looks like it will be difficult for us to resolve distances less than 24 ft.
11,921
<ASSISTANT_TASK:> Python Code: def numberOfLines(S , widths ) : if(S == "") : return 0 , 0  lines , width = 1 , 0 for c in S : w = widths[ord(c ) - ord(' a ' ) ] width += w if width > 10 : lines += 1 width = w   return lines , width  S = "bbbcccdddaa " Widths =[4 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 , 1 ] print(numberOfLines(S , Widths ) ) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
11,922
<ASSISTANT_TASK:> Python Code: A = np.array([[1, 3, -2], [3, 5, 6], [2, 4, 3]]) A b = np.array([[5], [7], [8]]) b Ainv = np.linalg.inv(A) Ainv x = np.dot(Ainv, b) x np.dot(A, x) - b x, resid, rank, s = np.linalg.lstsq(A, b) x np.random.seed(0) A = np.random.randn(3, 3) A np.linalg.det(A) A = np.array([[2, 0], [-1, 1], [0, 2]]) A b = np.array([[1], [0], [-1]]) b Apinv = np.dot(np.linalg.inv(np.dot(A.T, A)), A.T) Apinv x = np.dot(Apinv, b) x np.dot(A, x) - b x, resid, rank, s = np.linalg.lstsq(A, b) x <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 위 해결 방법에는 두 가지 의문이 존재한다. 우선 역행렬이 존재하는지 어떻게 알 수 있는가? 또 두 번째 만약 미지수의 수와 방정식의 수가 다르다면 어떻게 되는가? Step2: 행렬식과 역행렬 사이에는 다음의 관계가 있다.
11,923
<ASSISTANT_TASK:> Python Code: # Versão da Linguagem Python from platform import python_version print('Versão da Linguagem Python Usada Neste Jupyter Notebook:', python_version()) # Instala o pacote !pip install -q imdb-sqlite # Instala o pacote # https://pypi.org/project/pycountry/ !pip install -q pycountry # Imports import re import time import sqlite3 import pycountry import numpy as np import pandas as pd import matplotlib.pyplot as plt import seaborn as sns from matplotlib import cm from sklearn.feature_extraction.text import CountVectorizer import warnings warnings.filterwarnings("ignore") sns.set_theme(style = "whitegrid") %%time !imdb-sqlite # Conecta no banco de dados conn = sqlite3.connect("imdb.db") # Extrai a lista de tabelas tabelas = pd.read_sql_query("SELECT NAME AS 'Table_Name' FROM sqlite_master WHERE type = 'table'", conn) # Tipo do objeto type(tabelas) # Visualiza o resultado tabelas.head() # Vamos converter o dataframe em uma lista tabelas = tabelas["Table_Name"].values.tolist() # Vamos percorrer a lista de tabelas no banco de dados e extrair o esquema de cada uma for tabela in tabelas: consulta = "PRAGMA TABLE_INFO({})".format(tabela) resultado = pd.read_sql_query(consulta, conn) print("Esquema da tabela:", tabela) display(resultado) print("-"*100) print("\n") # Cria a consulta SQL consulta1 = '''SELECT type, COUNT(*) AS COUNT FROM titles GROUP BY type''' # Extrai o resultado resultado1 = pd.read_sql_query(consulta1, conn) # Visualiza o resultado display(resultado1) # Vamos calcular o percentual para cada tipo resultado1['percentual'] = (resultado1['COUNT'] / resultado1['COUNT'].sum()) * 100 # Visualiza o resultado display(resultado1) # Vamos criar um gráfico com apenas 4 categorias: # As 3 categorias com mais títulos e 1 categoria com todo o restante # Cria um dicionário vazio others = {} # Filtra o percentual em 5% e soma o total others['COUNT'] = resultado1[resultado1['percentual'] < 5]['COUNT'].sum() # Grava o percentual others['percentual'] = resultado1[resultado1['percentual'] < 5]['percentual'].sum() # Ajusta o nome others['type'] = 'others' # Visualiza others # Filtra o dataframe de resultado resultado1 = resultado1[resultado1['percentual'] > 5] # Append com o dataframe de outras categorias resultado1 = resultado1.append(others, ignore_index = True) # Ordena o resultado resultado1 = resultado1.sort_values(by = 'COUNT', ascending = False) # Visualiza resultado1.head() # Ajusta os labels labels = [str(resultado1['type'][i])+' '+'['+str(round(resultado1['percentual'][i],2)) +'%'+']' for i in resultado1.index] # Plot # Mapa de cores # https://matplotlib.org/stable/tutorials/colors/colormaps.html cs = cm.Set3(np.arange(100)) # Cria a figura f = plt.figure() # Pie Plot plt.pie(resultado1['COUNT'], labeldistance = 1, radius = 3, colors = cs, wedgeprops = dict(width = 0.8)) plt.legend(labels = labels, loc = 'center', prop = {'size':12}) plt.title("Distribuição de Títulos", loc = 'Center', fontdict = {'fontsize':20,'fontweight':20}) plt.show() # Cria a consulta SQL consulta2 = '''SELECT genres, COUNT(*) FROM titles WHERE type = 'movie' GROUP BY genres''' # Resultado resultado2 = pd.read_sql_query(consulta2, conn) # Visualiza o resultado display(resultado2) # Converte as strings para minúsculo resultado2['genres'] = resultado2['genres'].str.lower().values # Remove valores NA (ausentes) temp = resultado2['genres'].dropna() # Vamos criar um vetor usando expressão regular para filtrar as strings # https://docs.python.org/3.8/library/re.html padrao = '(?u)\\b[\\w-]+\\b' # https://scikit-learn.org/stable/modules/generated/sklearn.feature_extraction.text.CountVectorizer.html vetor = CountVectorizer(token_pattern = padrao, analyzer = 'word').fit(temp) type(vetor) # Aplica a vetorização ao dataset sem valores NA bag_generos = vetor.transform(temp) type(bag_generos) # Retorna gêneros únicos generos_unicos = vetor.get_feature_names() # Cria o dataframe de gêneros generos = pd.DataFrame(bag_generos.todense(), columns = generos_unicos, index = temp.index) # Visualiza generos.info() # Drop da coluna n generos = generos.drop(columns = 'n', axis = 0) # Calcula o percentual generos_percentual = 100 * pd.Series(generos.sum()).sort_values(ascending = False) / generos.shape[0] # Visualiza generos_percentual.head(10) # Plot plt.figure(figsize = (16,8)) sns.barplot(x = generos_percentual.values, y = generos_percentual.index, orient = "h", palette = "terrain") plt.ylabel('Gênero') plt.xlabel("\nPercentual de Filmes (%)") plt.title('\nNúmero (Percentual) de Títulos Por Gênero\n') plt.show() # Consulta SQL consulta3 = ''' SELECT rating, genres FROM ratings JOIN titles ON ratings.title_id = titles.title_id WHERE premiered <= 2022 AND type = 'movie' ''' # Resultado resultado3 = pd.read_sql_query(consulta3, conn) # Visualiza display(resultado3) # Vamos criar uma função para retornar os genêros def retorna_generos(df): df['genres'] = df['genres'].str.lower().values temp = df['genres'].dropna() vetor = CountVectorizer(token_pattern = '(?u)\\b[\\w-]+\\b', analyzer = 'word').fit(temp) generos_unicos = vetor.get_feature_names() generos_unicos = [genre for genre in generos_unicos if len(genre) > 1] return generos_unicos # Aplica a função generos_unicos = retorna_generos(resultado3) # Visualiza generos_unicos # Cria listas vazias genero_counts = [] genero_ratings = [] # Loop for item in generos_unicos: # Retorna a contagem de filmes por gênero consulta = 'SELECT COUNT(rating) FROM ratings JOIN titles ON ratings.title_id=titles.title_id WHERE genres LIKE '+ '\''+'%'+item+'%'+'\' AND type=\'movie\'' resultado = pd.read_sql_query(consulta, conn) genero_counts.append(resultado.values[0][0]) # Retorna a avaliação de filmes por gênero consulta = 'SELECT rating FROM ratings JOIN titles ON ratings.title_id=titles.title_id WHERE genres LIKE '+ '\''+'%'+item+'%'+'\' AND type=\'movie\'' resultado = pd.read_sql_query(consulta, conn) genero_ratings.append(np.median(resultado['rating'])) # Prepara o dataframe final df_genero_ratings = pd.DataFrame() df_genero_ratings['genres'] = generos_unicos df_genero_ratings['count'] = genero_counts df_genero_ratings['rating'] = genero_ratings # Visualiza df_genero_ratings.head(20) # Drop do índice 18 (news) # Não queremos essa informação como gênero df_genero_ratings = df_genero_ratings.drop(index = 18) # Ordena o resultado df_genero_ratings = df_genero_ratings.sort_values(by = 'rating', ascending = False) # Plot # Figura plt.figure(figsize = (16,10)) # Barplot sns.barplot(y = df_genero_ratings.genres, x = df_genero_ratings.rating, orient = "h") # Textos do gráfico for i in range(len(df_genero_ratings.index)): plt.text(4.0, i + 0.25, str(df_genero_ratings['count'][df_genero_ratings.index[i]]) + " filmes") plt.text(df_genero_ratings.rating[df_genero_ratings.index[i]], i + 0.25, round(df_genero_ratings["rating"][df_genero_ratings.index[i]],2)) plt.ylabel('Gênero') plt.xlabel('Mediana da Avaliação') plt.title('\nMediana de Avaliação Por Gênero\n') plt.show() # Consulta SQL consulta4 = ''' SELECT rating AS Rating, premiered FROM ratings JOIN titles ON ratings.title_id = titles.title_id WHERE premiered <= 2022 AND type = 'movie' ORDER BY premiered ''' # Resultado resultado4 = pd.read_sql_query(consulta4, conn) display(resultado4) # Calculamos a mediana ao longo do tempo (anos) ratings = [] for year in set(resultado4['premiered']): ratings.append(np.median(resultado4[resultado4['premiered'] == year]['Rating'])) type(ratings) ratings[1:10] # Lista de anos anos = list(set(resultado4['premiered'])) anos[1:10] # Plot plt.figure(figsize = (16,8)) plt.plot(anos, ratings) plt.xlabel('\nAno') plt.ylabel('Mediana de Avaliação') plt.title('\nMediana de Avaliação dos Filmes Em Relação ao Ano de Estréia\n') plt.show() # Consulta SQL consulta5 = '''SELECT genres FROM titles ''' # Resultado resultado5 = pd.read_sql_query(consulta5, conn) display(resultado5) # Retorna gêneros únicos generos_unicos = retorna_generos(resultado5) # Visualiza o resultado generos_unicos # Agora fazemos a contagem genero_count = [] for item in generos_unicos: consulta = 'SELECT COUNT(*) COUNT FROM titles WHERE genres LIKE '+ '\''+'%'+item+'%'+'\' AND type=\'movie\' AND premiered <= 2022' resultado = pd.read_sql_query(consulta, conn) genero_count.append(resultado['COUNT'].values[0]) # Prepara o dataframe df_genero_count = pd.DataFrame() df_genero_count['genre'] = generos_unicos df_genero_count['Count'] = genero_count # Calcula os top 5 df_genero_count = df_genero_count[df_genero_count['genre'] != 'n'] df_genero_count = df_genero_count.sort_values(by = 'Count', ascending = False) top_generos = df_genero_count.head()['genre'].values # Plot # Figura plt.figure(figsize = (16,8)) # Loop e Plot for item in top_generos: consulta = 'SELECT COUNT(*) Number_of_movies, premiered Year FROM titles WHERE genres LIKE '+ '\''+'%'+item+'%'+'\' AND type=\'movie\' AND Year <=2022 GROUP BY Year' resultado = pd.read_sql_query(consulta, conn) plt.plot(resultado['Year'], resultado['Number_of_movies']) plt.xlabel('\nAno') plt.ylabel('Número de Filmes Avaliados') plt.title('\nNúmero de Filmes Avaliados Por Gênero Em Relação ao Ano de Estréia\n') plt.legend(labels = top_generos) plt.show() # Consulta SQL consulta6 = ''' SELECT runtime_minutes Runtime FROM titles WHERE type = 'movie' AND Runtime != 'NaN' ''' # Resultado resultado6 = pd.read_sql_query(consulta6, conn) display(resultado6) # Loop para cálculo dos percentis for i in range(101): val = i perc = round(np.percentile(resultado6['Runtime'].values, val), 2) print('{} percentil da duração (runtime) é: {}'.format(val, perc)) # Refazendo a consulta e retornando o filme com maior duração consulta6 = ''' SELECT runtime_minutes Runtime, primary_title FROM titles WHERE type = 'movie' AND Runtime != 'NaN' ORDER BY Runtime DESC LIMIT 1 ''' resultado6 = pd.read_sql_query(consulta6, conn) resultado6 # Consulta SQL consulta7 = ''' SELECT AVG(runtime_minutes) Runtime, genres FROM titles WHERE type = 'movie' AND runtime_minutes != 'NaN' GROUP BY genres ''' # Resultado resultado7 = pd.read_sql_query(consulta7, conn) # Retorna gêneros únicos generos_unicos = retorna_generos(resultado7) # Visualiza generos_unicos # Calcula duração por gênero genero_runtime = [] for item in generos_unicos: consulta = 'SELECT runtime_minutes Runtime FROM titles WHERE genres LIKE '+ '\''+'%'+item+'%'+'\' AND type=\'movie\' AND Runtime!=\'NaN\'' resultado = pd.read_sql_query(consulta, conn) genero_runtime.append(np.median(resultado['Runtime'])) # Prepara o dataframe df_genero_runtime = pd.DataFrame() df_genero_runtime['genre'] = generos_unicos df_genero_runtime['runtime'] = genero_runtime # Remove índice 18 (news) df_genero_runtime = df_genero_runtime.drop(index = 18) # Ordena os dados df_genero_runtime = df_genero_runtime.sort_values(by = 'runtime', ascending = False) # Plot # Tamanho da figura plt.figure(figsize = (16,8)) # Barplot sns.barplot(y = df_genero_runtime.genre, x = df_genero_runtime.runtime, orient = "h") # Loop for i in range(len(df_genero_runtime.index)): plt.text(df_genero_runtime.runtime[df_genero_runtime.index[i]], i + 0.25, round(df_genero_runtime["runtime"][df_genero_runtime.index[i]], 2)) plt.ylabel('Gênero') plt.xlabel('\nMediana de Tempo de Duração (Minutos)') plt.title('\nRelação Entre Duração e Gênero\n') plt.show() # Consulta SQL consulta8 = ''' SELECT region, COUNT(*) Number_of_movies FROM akas JOIN titles ON akas.title_id = titles.title_id WHERE region != 'None' AND type = \'movie\' GROUP BY region ''' # Resultado resultado8 = pd.read_sql_query(consulta8, conn) display(resultado8) # Shape resultado8.shape # Número de linhas resultado8.shape[0] # Listas auxiliares nomes_paises = [] contagem = [] # Loop para obter o país de acordo com a região for i in range(resultado8.shape[0]): try: coun = resultado8['region'].values[i] nomes_paises.append(pycountry.countries.get(alpha_2 = coun).name) contagem.append(resultado8['Number_of_movies'].values[i]) except: continue # Prepara o dataframe df_filmes_paises = pd.DataFrame() df_filmes_paises['country'] = nomes_paises df_filmes_paises['Movie_Count'] = contagem # Ordena o resultado df_filmes_paises = df_filmes_paises.sort_values(by = 'Movie_Count', ascending = False) # Visualiza df_filmes_paises.head(10) # Plot # Figura plt.figure(figsize = (20,8)) # Barplot sns.barplot(y = df_filmes_paises[:20].country, x = df_filmes_paises[:20].Movie_Count, orient = "h") # Loop for i in range(0,20): plt.text(df_filmes_paises.Movie_Count[df_filmes_paises.index[i]]-1, i + 0.30, round(df_filmes_paises["Movie_Count"][df_filmes_paises.index[i]],2)) plt.ylabel('País') plt.xlabel('\nNúmero de Filmes') plt.title('\nNúmero de Filmes Produzidos Por País\n') plt.show() # Consulta SQL consulta9 = ''' SELECT primary_title AS Movie_Name, genres, rating FROM titles JOIN ratings ON titles.title_id = ratings.title_id WHERE titles.type = 'movie' AND ratings.votes >= 25000 ORDER BY rating DESC LIMIT 10 ''' # Resultado top10_melhores_filmes = pd.read_sql_query(consulta9, conn) display(top10_melhores_filmes) # Consulta SQL consulta10 = ''' SELECT primary_title AS Movie_Name, genres, rating FROM titles JOIN ratings ON titles.title_id = ratings.title_id WHERE titles.type = 'movie' AND ratings.votes >= 25000 ORDER BY rating ASC LIMIT 10 ''' # Resultado top10_piores_filmes = pd.read_sql_query(consulta10, conn) display(top10_piores_filmes) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: https Step2: Agora executamos o pacote para download dos datasets. Step3: Carregando os Dados Step4: Agora começamos a Análise Exploratória dos Dados. Step5: 2- Qual o Número de Títulos Por Gênero? Step6: Usamos o Countvectorizer para converter a coluna de gêneros em um vetor one-hot encoded para contar o número de filmes em cada gênero. Step7: 3- Qual a Mediana de Avaliação dos Filmes Por Gênero? Step8: 4- Qual a Mediana de Avaliação dos Filmes Em Relação ao Ano de Estréia? Step9: 5- Qual o Número de Filmes Avaliados Por Gênero Em Relação ao Ano de Estréia? Step10: 6- Qual o Filme Com Maior Tempo de Duração? Calcule os Percentis. Step11: 'Logistics' é o filme mais longo da história (até este momento), com 857 horas (51420 minutos). Dirigido por Daniel Andersson e Erika Magnusson, o filme acompanha todo o ciclo de vida de um pedômetro (dispositivo de rastreamento de passos) em ordem cronológica reversa. Step12: 8- Qual o Número de Filmes Produzidos Por País? Step13: 9- Quais São os Top 10 Melhores Filmes? Step14: 10- Quais São os Top 10 Piores Filmes?
11,924
<ASSISTANT_TASK:> Python Code: import requests lil_response = requests.get ('https://api.spotify.com/v1/search?query=Lil&type=artist&country=US&limit=50') lil_data = lil_response.json() print(type(lil_data)) lil_data.keys() lil_data['artists'].keys() lil_artists = lil_data['artists']['items'] #check on what elements are in that list: #print (lil_artists[0]) for artist in lil_artists: print(artist['name'], "has a popularity score of", artist['popularity']) #http://stackoverflow.com/questions/2600191/how-can-i-count-the-occurrences-of-a-list-item-in-python from collections import Counter genre_list = [] for genre in lil_artists: if genre['genres'] != []: genre_list = genre['genres'] + genre_list c = Counter(genre_list) print("These are the counts for each genre:", c) #https://docs.python.org/2/library/collections.html most_common = Counter(genre_list).most_common(1) print("The most common genre is:",most_common) for artist in lil_artists: if artist['genres'] == []: print(artist['name'], "has a popularity score of", artist['popularity'], "But there are no genres listed for this artist.") else: artist_genres = artist['genres'] print(artist['name'], "has a popularity score of", artist['popularity'], "This artist is associated with", ', '.join(artist_genres)) # http://stackoverflow.com/questions/5850986/joining-elements-of-a-list-python most_popular_score = 0 most_popular_name = [] for artist in lil_artists: if artist['popularity'] > most_popular_score: most_popular_name = artist['name'] most_popular_score = artist['popularity'] print(most_popular_name, "is the most popular, with a rating of", most_popular_score) second_max_popular = 0 for artist in lil_artists: if artist['popularity'] >= second_max_popular and artist['popularity'] < most_popular_score: second_max_popular = artist['popularity'] print(artist['name'], "is the second most popular with a popularity rating of",artist['popularity'], "compared to", most_popular_name, "who has a rating of", most_popular_score) most_followers = 0 for artist in lil_artists: if artist['followers']['total'] > most_followers: most_followers = artist['followers']['total'] print(artist['name'], "has the largest number followers:", artist['followers']['total']) print("The second most popular Lils have the following amount of followers:") second_most_followers = 0 for artist in lil_artists: if artist['popularity'] >= second_max_popular and artist['popularity'] < 86: second_max_popular = artist['popularity'] if artist['followers']['total'] > second_most_followers: second_most_followers = artist['followers']['total'] print(artist['name'], artist['followers']['total']) kim_popularity = 0 for artist in lil_artists: if artist['name'] == "Lil' Kim": kim_popularity = (artist['popularity']) for artist in lil_artists: if artist['popularity'] > kim_popularity: print(artist['name'], "has a popularity of", artist['popularity'], "which is higher than that of Lil' Kim.") #for artist in lil_artists: #print(artist['name'], artist['id']) #Lil Dicky 1tqhsYv8yBBdwANFNzHtcr toptracks_Dicky_response = requests.get('https://api.spotify.com/v1/artists/1tqhsYv8yBBdwANFNzHtcr/top-tracks?country=US') toptracks_Dicky_data = toptracks_Dicky_response.json() tracks_Dicky = toptracks_Dicky_data['tracks'] print("THESE ARE THE TOP TRACKS OF LIL DICKY:") for track in tracks_Dicky: print(track['name']) #Lil Jon 7sfl4Xt5KmfyDs2T3SVSMK toptracks_Jon_response = requests.get('https://api.spotify.com/v1/artists/7sfl4Xt5KmfyDs2T3SVSMK/top-tracks?country=US') toptracks_Jon_data = toptracks_Jon_response.json() tracks_Jon = toptracks_Jon_data['tracks'] print("THESE ARE THE TOP TRACKS OF LIL JON:") for track in tracks_Jon: print(track['name']) print(tracks_Dicky[0].keys()) explicit_Dicky_count = 0 non_explicit_Dicky_count = 0 explicit_popularity_Dicky_sum = 0 non_explicit_popularity_Dicky_sum = 0 for track in tracks_Dicky: if track['explicit'] == True: explicit_Dicky_count = explicit_Dicky_count + 1 explicit_popularity_Dicky_sum = explicit_popularity_Dicky_sum + track['popularity'] else: non_explicit_Dicky_count = non_explicit_Dicky_count + 1 non_explicit_popularity_Dicky_sum = non_explicit_popularity_Dicky_sum + track['popularity'] print("The average popularity of explicit Lil Dicky songs is", explicit_popularity_Dicky_sum / explicit_Dicky_count) if non_explicit_Dicky_count == 0: print("There are no non-explicit Lil Dicky songs.") else: print("The average popularity of non-explicit Lil Dicky songs is:", non_explicit_popularity_Dicky_sum / non_explicit_Dicky_count) explicit_Jon_count = 0 non_explicit_Jon_count = 0 explicit_popularity_Jon_sum = 0 non_explicit_popularity_Jon_sum = 0 for track in tracks_Jon: if track['explicit'] == True: explicit_Jon_count = explicit_Jon_count + 1 explicit_popularity_Jon_sum = explicit_popularity_Jon_sum + track['popularity'] else: non_explicit_Jon_count = non_explicit_Jon_count + 1 non_explicit_popularity_Jon_sum = non_explicit_popularity_Jon_sum + track['popularity'] print("The average popularity of explicit Lil Jon songs is", explicit_popularity_Jon_sum / explicit_Jon_count) if non_explicit_Jon_count == 0: print("There are no non-explicit Lil Jon songs.") else: print("The average popularity of non-explicit Lil Jon songs is:", non_explicit_popularity_Jon_sum / non_explicit_Jon_count) #function writing def add(a, b): value = a + b print("the sum of", a, "and", b, "is", value) add(5, 7) add(1, 2) add(4, 55) def average_popularity(a, b): explicit_count = 0 non_explicit_count = 0 explicit_popularity_sum = 0 non_explicit_popularity_sum = 0 for track in a: if track['explicit'] == True: explicit_count = explicit_count + 1 explicit_popularity_sum = explicit_popularity_sum + track['popularity'] else: non_explicit_count = non_explicit_count + 1 non_explicit_popularity_sum = non_explicit_popularity_sum + track['popularity'] if explicit_count == 0: print("There are no explicit songs by", b) else: print("The average popularity of explicit songs by", b, "is", explicit_popularity_sum / explicit_count) if non_explicit_count == 0: print("There are no non-explicit songs by", b) else: print("The average popularity of non-explicit songs by", b, "is", non_explicit_popularity_sum / non_explicit_count) average_popularity(tracks_Dicky, "Lil Dicky") average_popularity(tracks_Jon, "Lil Jon") def explicit_minutes(a, b): explicit_milliseconds = 0 non_explicit_milliseconds = 0 for track in a: if track['explicit'] == True: explicit_milliseconds = explicit_milliseconds + track['duration_ms'] else: non_explicit_milliseconds = non_explicit_milliseconds + track['duration_ms'] if explicit_milliseconds !=0: print(b, "has", explicit_milliseconds / 6000 , "minutes of explicit music.") if non_explicit_milliseconds !=0: print(b, "has", non_explicit_milliseconds / 6000, "minutes of non-explicit music.") else: print(b, "has", "has no non-explicit music.") explicit_minutes(tracks_Dicky, "Lil Dicky") explicit_minutes(tracks_Jon, "Lil Jon") import requests biggieT_response = requests.get('https://api.spotify.com/v1/search?query=biggie&type=artist&limit=50') biggieT_data = biggieT_response.json() biggieT_artists = biggieT_data['artists']['items'] artist_count = 0 for artist in biggieT_artists: artist_count = artist_count + 1 print("There are in total", artist_count, "Biggies.") import requests import math offset_valueB = 0 biggieT_response = requests.get('https://api.spotify.com/v1/search?query=biggie&type=artist&limit=50&offset=' + str(offset_valueB) + '') biggieT_data = biggieT_response.json() biggieT_artists = biggieT_data['artists']['items'] offset_limitB = biggieT_data['artists']['total'] offset_valueL = 0 lilT_response = requests.get('https://api.spotify.com/v1/search?query=lil&type=artist&limit=50&offset=' + str(offset_valueL) + '') lilT_data = lilT_response.json() lilT_artists = lilT_data['artists']['items'] offset_limitL = lilT_data['artists']['total'] page_countB = math.ceil(offset_limitB/ 50) print("The page count for all the Biggies is:", page_countB) page_countL = math.ceil(offset_limitL/ 50) print("The page count for all the Lils is:", page_countL) print("If you made 1 request every 5 seconds, it will take", page_countL * 5, "seconds for all the Lils requests to process. Whereas for the Biggies it's", page_countB* 5, ", so the total amount of time is", page_countB*5 + page_countL*5, "seconds.") artist_count = 0 offset_value = 0 for page in range(0, 1): biggieT_response = requests.get('https://api.spotify.com/v1/search?query=biggie&type=artist&limit=50&offset=' + str(offset_valueB) + '') biggieT_data = biggieT_response.json() biggieT_artists = biggieT_data['artists']['items'] for artist in lilT_artists: artist_count = artist_count + 1 offset_value = offset_value + 50 print("There are in total", artist_count, "Biggies.") artist_count = 0 offset_value = 0 for page in range(0, 91): lilT_response = requests.get('https://api.spotify.com/v1/search?query=lil&type=artist&limit=50&offset=' + str(offset_value) + '') lilT_data = lilT_response.json() lilT_artists = lilT_data['artists']['items'] for artist in lilT_artists: artist_count = artist_count + 1 offset_value = offset_value + 50 print("There are in total", artist_count, "Lils.") # tried to solve it with a function as well, but didn't work out, gave an error message. So back to the old way. biggie50_response = requests.get('https://api.spotify.com/v1/search?query=biggie&type=artist&limit=50') biggie50_data = biggie50_response.json() biggie50_artists = biggie50_data['artists']['items'] popularity_biggie50 = 0 for artist in biggie50_artists: popularity_biggie50 = popularity_biggie50 + artist['popularity'] print("The average popularity of the top50 Biggies is", popularity_biggie50 / 50) lil50_response = requests.get('https://api.spotify.com/v1/search?query=lil&type=artist&limit=50') lil50_data = lil50_response.json() lil50_artists = lil50_data['artists']['items'] popularity_lil50 = 0 for artist in lil50_artists: popularity_lil50 = popularity_lil50 + artist['popularity'] print("The average popularity of the top50 Lils is", popularity_lil50 / 50) if popularity_biggie50 > popularity_lil50: print("The top50 Biggies are on average more popular than the top50 Lils.") if popularity_biggie50 == popularity_lil50: print("The top50 Biggies are on average as popular as the top50 Lils.") else: print("The top50 Lils are on average more popular than the top50 Biggies.") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1) With "Lil Wayne" and "Lil Kim" there are a lot of "Lil" musicians. Do a search and print a list of 50 that are playable in the USA (or the country of your choice), along with their popularity score. Step2: 2) What genres are most represented in the search results? Edit your previous printout to also display a list of their genres in the format "GENRE_1, GENRE_2, GENRE_3". If there are no genres, print "No genres listed". Step3: 3) Use a for loop to determine who BESIDES Lil Wayne has the highest popularity rating. Step4: Is it the same artist who has the largest number of followers? Step5: 4) Print a list of Lil's that are more popular than Lil' Kim. Step6: 5) Pick two of your favorite Lils to fight it out, and use their IDs to print out their top tracks. Step7: 6) Will the world explode if a musicians swears? Step8: First solution -- this felt like a lot of repeating and as if there was a more efficient way to do it. Turns out, there is! With some explanation from Soma first -- see below. Step9: Soma explaining how to write functions in 30 seconds of Lab Step10: Based on that, I re-wrote my above code using a function Step11: How many minutes of explicit songs do they have? Non-explicit? Step12: 7) Since we're talking about Lils, what about Biggies? Step13: 8) Out of the top 50 "Lil"s and the top 50 "Biggie"s, who is more popular on average?
11,925
<ASSISTANT_TASK:> Python Code: # Load libraries from sklearn.linear_model import LogisticRegression from sklearn import datasets from sklearn.preprocessing import StandardScaler # Load data with only two classes iris = datasets.load_iris() X = iris.data[:100,:] y = iris.target[:100] # Standarize features scaler = StandardScaler() X_std = scaler.fit_transform(X) # Create logistic regression object clf = LogisticRegression(random_state=0) # Train model model = clf.fit(X_std, y) # Create new observation new_observation = [[.5, .5, .5, .5]] # Predict class model.predict(new_observation) # View predicted probabilities model.predict_proba(new_observation) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load Iris Flower Dataset Step2: Standardize Features Step3: Create Logistic Regression Step4: Train Logistic Regression Step5: Create Previously Unseen Observation Step6: Predict Class Of Observation Step7: View Predicted Probabilities
11,926
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np my_series = pd.Series([1,3,5,np.nan,6,8]) my_series my_dates_index = pd.date_range('20160101', periods=6) my_dates_index df_from_dictionary = pd.DataFrame({ 'float' : 1., 'time' : pd.Timestamp('20160825'), 'series' : pd.Series(1,index=list(range(4)),dtype='float32'), 'array' : np.array([3] * 4,dtype='int32'), 'categories' : pd.Categorical(["test","train","taxes","tools"]), 'dull' : 'boring data' }) df_from_dictionary <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Basic series; default integer index Step2: datetime index Step3: sample NumPy data
11,927
<ASSISTANT_TASK:> Python Code: %matplotlib inline import pandas as pd import matplotlib.pyplot as plt import numpy as np import os from scipy import stats lambp=10 dist= stats.poisson(lambp) x= stats.poisson.rvs(mu=lambp, loc=0, size=1000000) media= np.mean(x) var= np.var(x) media2=[] for i in range (0,10001): valores = np.random.choice(x,2) media2.append(np.mean(valores)) plt.hist(media2) plt.title("n valendo 2") media = np.mean(media2) variancia = np.var(media2) print("Media:{}".format(media)) print("Variancia:{}".format(variancia)) mediaVal=[] for i in range (0,10001): valores = np.random.choice(x,4) mediaVal.append(np.mean(valores)) plt.hist(mediaVal) media = np.mean(mediaVal) plt.title("n valendo 4") variancia = np.var(mediaVal) print("Media:{}".format(media)) print("Variancia:{}".format(variancia)) media20=[] for i in range (0,10001): valores = np.random.choice(x,20) media20.append(np.mean(valores)) plt.hist(media20) plt.title("n valendo 20") media = np.mean(media20) variancia = np.var(media20) print("Media:{}".format(media)) print("Variancia:{}".format(variancia)) media50=[] for i in range (0,10001): valores = np.random.choice(x,50) media50.append(np.mean(valores)) plt.hist(media50) plt.title("n valendo 50") media = np.mean(media50) variancia = np.var(media50) print("Media:{}".format(media)) print("Variancia:{}".format(variancia)) media50=[] primeiro= [] nono = [] for i in range (0,10001): valores = np.random.choice(x,50) primeiro.append(valores[0]) nono.append(valores[9]) media50.append(np.mean(valores)) media = np.mean(media50) variancia = np.var(media50) print("Media:{}".format(media)) print("Variancia:{}".format(variancia)) plt.hist(media50) plt.title("n valendo 50") plt.show() dp1= (np.var(primeiro))**1/2 dp9=(np.var(nono))**1/2 cov = np.cov(primeiro,nono) plt.hist(primeiro) plt.title("primeiro") plt.show() plt.hist(nono) plt.title("nono") plt.show() print(cov/(dp1*dp9)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Resultado
11,928
<ASSISTANT_TASK:> Python Code: %matplotlib inline from __future__ import print_function from __future__ import division import numpy as np from matplotlib import pyplot as plt import cv2 import time images = ['hist_pics/mario-1.png', 'hist_pics/mario-2.png', 'hist_pics/mario-3.png', 'hist_pics/mario-4.png', 'hist_pics/mario-5.png', 'hist_pics/mario-6.png'] rgb = [] for image in images: i = cv2.imread(image, cv2.IMREAD_COLOR) i = cv2.cvtColor(i, cv2.COLOR_BGR2RGB) # pretty images rgb.append(i) plt.subplot(1,3,1) plt.imshow(rgb[0]); plt.subplot(1,3,2) plt.imshow(rgb[1]); plt.subplot(1,3,3) plt.imshow(rgb[2]); hsv = [] for i, image in enumerate(rgb): img = cv2.cvtColor(image, cv2.COLOR_RGB2HSV) hsv.append(img) plt.subplot(1,3,1) plt.imshow(hsv[0]); plt.subplot(1,3,2) plt.imshow(hsv[1]); plt.subplot(1,3,3) plt.imshow(hsv[2]); # let's define a mask to block out things we don't want # since our back ground is white hsv = [x,0,255] where is x is don't care # white is s=0, v=255 masks = [] for image in hsv: h,s,v = cv2.split(image) # ret,vv = cv2.threshold(v,250,255,cv2.THRESH_BINARY) # masks.append(vv) ret,ss = cv2.threshold(s,50,255,cv2.THRESH_BINARY) masks.append(ss) # ss = cv2.merge((ss,ss,ss)) plt.subplot(1,4,1) plt.imshow(masks[0], cmap = 'gray', interpolation = 'bicubic'); plt.xticks([]), plt.yticks([]) # to hide tick values on X and Y axis plt.subplot(1,4,2) plt.imshow(masks[1], cmap = 'gray', interpolation = 'bicubic'); plt.xticks([]), plt.yticks([]) # to hide tick values on X and Y axis plt.subplot(1,4,3) plt.imshow(masks[2], cmap = 'gray', interpolation = 'bicubic'); plt.xticks([]), plt.yticks([]) # to hide tick values on X and Y axis plt.colorbar(); # plt.subplot(1,4,4) # plt.imshow(masks[0]); # let's take a look at our masks and see what shows through tmp = [] for i in range(len(masks)): ret = cv2.bitwise_and(rgb[i], cv2.merge((masks[i],masks[i],masks[i]))) tmp.append(ret) plt.subplot(1,4,1) plt.imshow(tmp[0]); plt.xticks([]), plt.yticks([]) # to hide tick values on X and Y axis plt.subplot(1,4,2) plt.imshow(tmp[1]); plt.xticks([]), plt.yticks([]) # to hide tick values on X and Y axis plt.subplot(1,4,3) plt.imshow(tmp[2]); plt.xticks([]), plt.yticks([]) # to hide tick values on X and Y axis plt.subplot(1,4,4) plt.imshow(tmp[3]); plt.xticks([]), plt.yticks([]); # to hide tick values on X and Y axis class hsvHistogram(object): This class creates and holds the histogram information of a HSV image. It also is used to find our target in a given image. This class is designed to construct a 2D histogram looking a t hue and saturation, but not value. hist = None bins = None def __init__(self, bins): self.bins = bins self.kernel = np.ones((5,5),np.uint8) def calcHist(self, im_array, masks=None): Create a histogram from just images, no arrays hist = cv2.calcHist( im_array, [0, 1], masks, [self.bins, self.bins], [0,180, 0 ,256] ) self.hist = hist return hist def calcHistMask(self, im_array, masks): Create a histogram from just images and an array of masks hist = self.calcHist([im_array[0]], masks[0]) for i in range(1, len(im_array)): h = self.calcHist([im_array[i]], masks[i]) hist += h self.hist = hist return hist def normalize(self): cv2.normalize(self.hist,self.hist,0,self.bins,cv2.NORM_MINMAX) def find(self, test, threshold=3): test - target image threshold - a tunning parameter if self.hist is None: print('Need to init histogram first!') return 1 dst = cv2.calcBackProject( [test], [0, 1], self.hist, [0,180, 0 ,256], 1 ) disc = cv2.getStructuringElement(cv2.MORPH_ELLIPSE,(5,5)) cv2.filter2D(dst,-1,disc,dst) # cv2.threshold(image, low, high, method) ret, thresh = cv2.threshold(dst,threshold,255,cv2.THRESH_BINARY) # morphological/blobify -------- # thresh = cv2.erode(thresh, self.kernel) # thresh = cv2.dilate(thresh, self.kernel) thresh = cv2.morphologyEx(thresh, cv2.MORPH_OPEN, self.kernel) return thresh def plot(self): # plt.plot(np.linspace(0,180,roiHist.bins), roiHist.hist) # plt.grid(True) # plt.xlabel('Hue') plt.imshow(self.hist,interpolation = 'nearest') plt.ylabel('Hue [0-179]') plt.xlabel('Saturation [0-255]') plt.title('Histogram') plt.colorbar() roiHist = hsvHistogram(32) # roiHist.calcHist([hsv[1]], masks[1]) roiHist.calcHistMask(hsv, masks) roiHist.normalize() roiHist.plot() test_rgb = cv2.imread('hist_pics/mario-test2.jpg') # test_rgb = rgb[0] test_rgb = cv2.cvtColor(test_rgb, cv2.COLOR_BGR2RGB) # make pretty for ipython test_hsv = cv2.cvtColor(test_rgb, cv2.COLOR_RGB2HSV) # now convert to HSV plt.subplot(1,2,1) plt.imshow(test_rgb); plt.xticks([]), plt.yticks([]) plt.subplot(1,2,2) plt.imshow(test_hsv); plt.xticks([]), plt.yticks([]) thresh = roiHist.find(test_hsv, 50) thresh = cv2.merge((thresh,thresh,thresh)) # make 3 channels # plot ---------- res = cv2.bitwise_and(test_rgb,thresh) pics = np.hstack((test_rgb,thresh)) plt.imshow(pics); plt.xticks([]), plt.yticks([]); plt.imshow(res); plt.xticks([]), plt.yticks([]); test_rgb = cv2.imread('hist_pics/mario-test4.jpg') test_rgb = cv2.cvtColor(test_rgb, cv2.COLOR_BGR2RGB) # make pretty for ipython test_hsv = cv2.cvtColor(test_rgb, cv2.COLOR_RGB2HSV) # now convert to HSV thresh = roiHist.find(test_hsv, 15) thresh = cv2.merge((thresh,thresh,thresh)) # make 3 channels res = cv2.bitwise_and(test_rgb,thresh) pics = np.hstack((test_rgb,res)) plt.imshow(pics); plt.xticks([]), plt.yticks([]); test_rgb = cv2.imread('hist_pics/mario-test.png') test_rgb = cv2.cvtColor(test_rgb, cv2.COLOR_BGR2RGB) # make pretty for ipython test_hsv = cv2.cvtColor(test_rgb, cv2.COLOR_RGB2HSV) # now convert to HSV thresh = roiHist.find(test_hsv, 50) thresh = cv2.merge((thresh,thresh,thresh)) # make 3 channels res = cv2.bitwise_and(test_rgb,thresh) pics = np.hstack((test_rgb,res)) plt.imshow(pics); plt.xticks([]), plt.yticks([]); # h,s,v = cv2.split(test_hsv) # plt.subplot(1,2,1) # plt.grid(True) # plt.hist(h.ravel(), 32,[0,180], label='hue'); # plt.subplot(1,2,2) # plt.hist(s.ravel(), 32,[0,255], label='saturation'); # plt.hist(v.ravel(), 32,[0,255], label='value'); # plt.grid(True) # plt.legend(loc='upper right'); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Where's Mario? Step6: Histograms Step7: Test
11,929
<ASSISTANT_TASK:> Python Code: import pandas as pd from astropy.io import ascii, votable, misc #! mkdir ../data/Devor2008 #! curl http://iopscience.iop.org/1538-3881/135/3/850/suppdata/aj259648_mrt7.txt >> ../data/Devor2008/aj259648_mrt7.txt ! du -hs ../data/Devor2008/aj259648_mrt7.txt dat = ascii.read('../data/Devor2008/aj259648_mrt7.txt') ! head ../data/Devor2008/aj259648_mrt7.txt dat.info df = dat.to_pandas() df.head() df.columns sns.distplot(df.Per, norm_hist=False, kde=False) gi = (df.RAh == 4) & (df.RAm == 16) & (df.DEd == 28) & (df.DEm == 7) gi.sum() df[gi].T ! head ../data/Devor2008/T-Tau0-01262.lc cols = ['HJD-2400000', 'r_band', 'r_unc'] lc_raw = pd.read_csv('../data/Devor2008/T-Tau0-01262.lc', names=cols, delim_whitespace=True) lc_raw.head() lc_raw.count() sns.set_context('talk') plt.plot(lc_raw['HJD-2400000'], lc_raw.r_band, '.') plt.ylim(0.6, -0.6) plt.plot(np.mod(lc_raw['HJD-2400000'], 3.375)/3.375, lc_raw.r_band, '.', alpha=0.5) plt.xlabel('phase') plt.ylabel('$\Delta \;\; r$') plt.ylim(0.6, -0.6) plt.plot(np.mod(lc_raw['HJD-2400000'], 6.74215), lc_raw.r_band, '.') plt.ylim(0.6, -0.6) ! ls /Users/gully/Downloads/catalog/T-Tau0-* | head -n 10 lc2 = pd.read_csv('/Users/gully/Downloads/catalog/T-Tau0-00397.lc', names=cols, delim_whitespace=True) plt.plot(lc2['HJD-2400000'], lc2.r_band, '.') plt.ylim(0.6, -0.6) this_p = df.Per[df.Name == 'T-Tau0-00397'] plt.plot(np.mod(lc2['HJD-2400000'], this_p), lc2.r_band, '.', alpha=0.5) plt.xlabel('phase') plt.ylabel('$\Delta \;\; r$') plt.ylim(0.6, -0.6) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Download Data Step2: Not too big at all. Step3: Look for LkCa 4 Step4: The source is named T-Tau0-01262 Step5: The Devor et al. period is just twice the photometric period of 3.375 days.
11,930
<ASSISTANT_TASK:> Python Code: # install Pint if necessary try: import pint except ImportError: !pip install pint # download modsim.py if necessary from os.path import exists filename = 'modsim.py' if not exists(filename): from urllib.request import urlretrieve url = 'https://raw.githubusercontent.com/AllenDowney/ModSim/main/' local, _ = urlretrieve(url+filename, filename) print('Downloaded ' + local) # import functions from modsim from modsim import * from sympy import symbols, Eq, solve T, a, alpha, I, m, g, r = symbols('T a alpha I m g r') eq1 = Eq(a, -r * alpha) eq1 eq2 = Eq(T - m * g, m * a) eq2 eq3 = Eq(T * r, I * alpha) eq3 soln = solve([eq1, eq2, eq3], [T, a, alpha]) soln[T] soln[a] soln[alpha] Rmin = 8e-3 # m Rmax = 16e-3 # m Rout = 35e-3 # m mass = 50e-3 # kg L = 1 # m g = 9.8 # m / s**2 1 / (Rmax) I = mass * Rout**2 / 2 I k = (Rmax**2 - Rmin**2) / 2 / L k init = State(theta=0, omega=0, y=L, v=0) system = System(init=init, t_end=2) # Solution def slope_func(t, state, system): theta, omega, y, v = state r = np.sqrt(2*k*y + Rmin**2) alpha = mass * g * r / (I + mass * r**2) a = -r * alpha return omega, alpha, v, a # Solution slope_func(0, system.init, system) # Solution def event_func(t, state, system): theta, omega, y, v = state return y # Solution event_func(0, system.init, system) # Solution results, details = run_solve_ivp(system, slope_func, events=event_func, max_step=0.05) details.message # Solution results.tail() results.theta.plot(color='C0', label='theta') decorate(xlabel='Time (s)', ylabel='Angle (rad)') results.y.plot(color='C1', label='y') decorate(xlabel='Time (s)', ylabel='Length (m)') results.v.plot(label='velocity', color='C3') decorate(xlabel='Time (s)', ylabel='Velocity (m/s)') a = gradient(results.v) a.plot(label='acceleration', color='C4') decorate(xlabel='Time (s)', ylabel='Acceleration (m/$s^2$)') r = np.sqrt(2*k*results.y + Rmin**2) r.plot(label='radius') decorate(xlabel='Time (s)', ylabel='Radius of spooled thread (m)') import pandas as pd s = pd.date_range('2020-1', '2020-12', freq='M').to_series() list(s.dt.month_name()) pd.interval_range(start=pd.Timestamp('2017-01-01'), periods=3, freq='MS').dt <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Yo-yo Step2: The results are Step3: Rmin is the radius of the axle. Rmax is the radius of the axle plus rolled string. Step4: Based on these parameters, we can compute the moment of inertia for the yo-yo, modeling it as a solid cylinder with uniform density (see here). Step5: And we can compute k, which is the constant that determines how the radius of the spooled string decreases as it unwinds. Step6: The state variables we'll use are angle, theta, angular velocity, omega, the length of the spooled string, y, and the linear velocity of the yo-yo, v. Step7: And here's a System object with init and t_end (chosen to be longer than I expect for the yo-yo to drop 1 m). Step8: Write a slope function for this system, using these results from the book Step9: Test your slope function with the initial conditions. Step10: Notice that the initial acceleration is substantially smaller than g because the yo-yo has to start spinning before it can fall. Step11: Test your event function Step12: Then run the simulation. Step13: Check the final state. If things have gone according to plan, the final value of y should be close to 0. Step14: How long does it take for the yo-yo to fall 1 m? Does the answer seem reasonable? Step15: y should decrease and accelerate down. Step16: Plot velocity as a function of time; is the acceleration constant? Step17: We can use gradient to estimate the derivative of v. How does the acceleration of the yo-yo compare to g? Step18: And we can use the formula for r to plot the radius of the spooled thread over time.
11,931
<ASSISTANT_TASK:> Python Code: from tensorflow.examples.tutorials.mnist import input_data mnist = input_data.read_data_sets("MNIST_data/", reshape=False) X_train, y_train = mnist.train.images, mnist.train.labels X_validation, y_validation = mnist.validation.images, mnist.validation.labels X_test, y_test = mnist.test.images, mnist.test.labels assert(len(X_train) == len(y_train)) assert(len(X_validation) == len(y_validation)) assert(len(X_test) == len(y_test)) print() print("Image Shape: {}".format(X_train[0].shape)) print() print("Training Set: {} samples".format(len(X_train))) print("Validation Set: {} samples".format(len(X_validation))) print("Test Set: {} samples".format(len(X_test))) import numpy as np # Pad images with 0s X_train = np.pad(X_train, ((0,0),(2,2),(2,2),(0,0)), 'constant') X_validation = np.pad(X_validation, ((0,0),(2,2),(2,2),(0,0)), 'constant') X_test = np.pad(X_test, ((0,0),(2,2),(2,2),(0,0)), 'constant') print("Updated Image Shape: {}".format(X_train[0].shape)) import random import numpy as np import matplotlib.pyplot as plt %matplotlib inline index = random.randint(0, len(X_train)) image = X_train[index].squeeze() plt.figure(figsize=(1,1)) plt.imshow(image, cmap="gray") print(y_train[index]) from sklearn.utils import shuffle X_train, y_train = shuffle(X_train, y_train) import tensorflow as tf EPOCHS = 10 BATCH_SIZE = 128 from tensorflow.contrib.layers import flatten def LeNet(x): # Arguments used for tf.truncated_normal, randomly defines variables for the weights and biases for each layer mu = 0 sigma = 0.1 # SOLUTION: Layer 1: Convolutional. Input = 32x32x1. Output = 28x28x6. conv1_W = tf.Variable(tf.truncated_normal(shape=(5, 5, 1, 6), mean = mu, stddev = sigma)) conv1_b = tf.Variable(tf.zeros(6)) conv1 = tf.nn.conv2d(x, conv1_W, strides=[1, 1, 1, 1], padding='VALID') + conv1_b # SOLUTION: Activation. conv1 = tf.nn.relu(conv1) # SOLUTION: Pooling. Input = 28x28x6. Output = 14x14x6. conv1 = tf.nn.max_pool(conv1, ksize=[1, 2, 2, 1], strides=[1, 2, 2, 1], padding='VALID') # SOLUTION: Layer 2: Convolutional. Output = 10x10x16. conv2_W = tf.Variable(tf.truncated_normal(shape=(5, 5, 6, 16), mean = mu, stddev = sigma)) conv2_b = tf.Variable(tf.zeros(16)) conv2 = tf.nn.conv2d(conv1, conv2_W, strides=[1, 1, 1, 1], padding='VALID') + conv2_b # SOLUTION: Activation. conv2 = tf.nn.relu(conv2) # SOLUTION: Pooling. Input = 10x10x16. Output = 5x5x16. conv2 = tf.nn.max_pool(conv2, ksize=[1, 2, 2, 1], strides=[1, 2, 2, 1], padding='VALID') # SOLUTION: Flatten. Input = 5x5x16. Output = 400. fc0 = flatten(conv2) # SOLUTION: Layer 3: Fully Connected. Input = 400. Output = 120. fc1_W = tf.Variable(tf.truncated_normal(shape=(400, 120), mean = mu, stddev = sigma)) fc1_b = tf.Variable(tf.zeros(120)) fc1 = tf.matmul(fc0, fc1_W) + fc1_b # SOLUTION: Activation. fc1 = tf.nn.relu(fc1) # SOLUTION: Layer 4: Fully Connected. Input = 120. Output = 84. fc2_W = tf.Variable(tf.truncated_normal(shape=(120, 84), mean = mu, stddev = sigma)) fc2_b = tf.Variable(tf.zeros(84)) fc2 = tf.matmul(fc1, fc2_W) + fc2_b # SOLUTION: Activation. fc2 = tf.nn.relu(fc2) # SOLUTION: Layer 5: Fully Connected. Input = 84. Output = 10. fc3_W = tf.Variable(tf.truncated_normal(shape=(84, 10), mean = mu, stddev = sigma)) fc3_b = tf.Variable(tf.zeros(10)) logits = tf.matmul(fc2, fc3_W) + fc3_b return logits x = tf.placeholder(tf.float32, (None, 32, 32, 1)) y = tf.placeholder(tf.int32, (None)) one_hot_y = tf.one_hot(y, 10) rate = 0.001 logits = LeNet(x) cross_entropy = tf.nn.softmax_cross_entropy_with_logits(logits, one_hot_y) loss_operation = tf.reduce_mean(cross_entropy) optimizer = tf.train.AdamOptimizer(learning_rate = rate) training_operation = optimizer.minimize(loss_operation) correct_prediction = tf.equal(tf.argmax(logits, 1), tf.argmax(one_hot_y, 1)) accuracy_operation = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) saver = tf.train.Saver() def evaluate(X_data, y_data): num_examples = len(X_data) total_accuracy = 0 sess = tf.get_default_session() for offset in range(0, num_examples, BATCH_SIZE): batch_x, batch_y = X_data[offset:offset+BATCH_SIZE], y_data[offset:offset+BATCH_SIZE] accuracy = sess.run(accuracy_operation, feed_dict={x: batch_x, y: batch_y}) total_accuracy += (accuracy * len(batch_x)) return total_accuracy / num_examples with tf.Session() as sess: sess.run(tf.initialize_all_variables()) num_examples = len(X_train) print("Training...") print() for i in range(EPOCHS): X_train, y_train = shuffle(X_train, y_train) for offset in range(0, num_examples, BATCH_SIZE): end = offset + BATCH_SIZE batch_x, batch_y = X_train[offset:end], y_train[offset:end] sess.run(training_operation, feed_dict={x: batch_x, y: batch_y}) validation_accuracy = evaluate(X_validation, y_validation) print("EPOCH {} ...".format(i+1)) print("Validation Accuracy = {:.3f}".format(validation_accuracy)) print() saver.save(sess, './lenet2') print("Model saved") with tf.Session() as sess: saver.restore(sess, "lenet2") test_accuracy = evaluate(X_test, y_test) print("Test Accuracy = {:.3f}".format(test_accuracy)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The MNIST data that TensorFlow pre-loads comes as 28x28x1 images. Step2: Visualize Data Step3: Preprocess Data Step4: Setup TensorFlow Step5: SOLUTION Step6: Features and Labels Step7: Training Pipeline Step8: Model Evaluation Step9: Train the Model Step10: Evaluate the Model
11,932
<ASSISTANT_TASK:> Python Code: !pip install datacommons_pandas datacommons --upgrade --quiet # Import Data Commons libraries import datacommons as dc import datacommons_pandas as dcpd # Gets all Superfund sites within USA place_dcid = 'country/USA' # DCID of USA site_list = dc.get_places_in([place_dcid], 'SuperfundSite')[place_dcid] site_list[:5] # Gets stats for the listed variables from all sites in a Pandas table site_df = dcpd.build_multivariate_dataframe(site_list, ['CrsiScore_SuperfundSite', 'NaturalHazardExposureScore_SuperfundSite', 'NaturalHazardRiskScore_SuperfundSite', 'NaturalHazardRiskScore_SuperfundSite_CoastalFloodEvent', 'NaturalHazardRiskScore_SuperfundSite_DroughtEvent', 'NaturalHazardRiskScore_SuperfundSite_EarthquakeEvent', 'NaturalHazardRiskScore_SuperfundSite_ExcessiveHeatEvent', 'NaturalHazardRiskScore_SuperfundSite_ExtremeColdWindChillEvent', 'NaturalHazardRiskScore_SuperfundSite_FloodEvent', 'NaturalHazardRiskScore_SuperfundSite_HailEvent', 'NaturalHazardRiskScore_SuperfundSite_HighWindEvent', 'NaturalHazardRiskScore_SuperfundSite_HurricaneEvent', 'NaturalHazardRiskScore_SuperfundSite_LandslideEvent', 'NaturalHazardRiskScore_SuperfundSite_TornadoEvent', 'NaturalHazardRiskScore_SuperfundSite_WildfireEvent']) site_df.head() # Gets all measurement sites contained in Tar Creek tar_creek_site = 'epaSuperfundSiteId/OKD980629844' # DCID of Tar Creek measurement_sites = dc.get_places_in([tar_creek_site], 'SuperfundMeasurementSite')[tar_creek_site] # Gets stats for contaminant variables for said measurement sites tar_creek_df = dcpd.build_multivariate_dataframe( measurement_sites, [ 'Concentration_Cadmium_BodyOfWater_GroundWater', 'Concentration_DissolvedContaminant_Cadmium_BodyOfWater_GroundWater', 'Concentration_DissolvedContaminant_Iron_BodyOfWater_GroundWater', 'Concentration_DissolvedContaminant_Lead_BodyOfWater_GroundWater', 'Concentration_DissolvedContaminant_Zinc_BodyOfWater_GroundWater', 'Concentration_Iron_BodyOfWater_GroundWater', 'Concentration_Lead_BodyOfWater_GroundWater', 'Concentration_Sulfate_BodyOfWater_GroundWater', 'DissolvedOxygen_BodyOfWater_GroundWater', 'Concentration_Zinc_BodyOfWater_GroundWater', 'PotentialOfHydrogen_BodyOfWater_GroundWater', 'ElectricalConductivity_BodyOfWater_GroundWater', 'Temperature_BodyOfWater_GroundWater', 'WaterHardness_BodyOfWater_GroundWater' ]) tar_creek_df.head() # Lists properties for a sample site site_props = dc.get_property_labels([tar_creek_site], out=True)[tar_creek_site] for prop in site_props: # Gets values for a given property. pvs is dict from site-id -> list of values pvs = dc.get_property_values(site_list, prop) # Turns the list of values into a comma-separated a single-value pvs = {p: ', '.join(v) for p, v in pvs.items()} # Extends the dataframe site_df[prop] = site_df.index.map(pvs) site_df.head() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: List Superfund sites Step2: In place of USA, you can specify any US state or county. You can use place search to find the corresponding DCID, as illustrated here. Step3: Additional statistics for Tar Creek site Step4: Get non-statistical attributes
11,933
<ASSISTANT_TASK:> Python Code: NAME = "Michelle Appel" NAME2 = "Verna Dankers" NAME3 = "Yves van Montfort" EMAIL = "michelle.appel@student.uva.nl" EMAIL2 = "verna.dankers@student.uva.nl" EMAIL3 = "yves.vanmontfort@student.uva.nl" %pylab inline plt.rcParams["figure.figsize"] = [9,5] from sklearn.datasets import fetch_mldata # Fetch the data mnist = fetch_mldata('MNIST original') data, target = mnist.data, mnist.target.astype('int') # Shuffle indices = np.arange(len(data)) np.random.seed(123) np.random.shuffle(indices) data, target = data[indices].astype('float32'), target[indices] # Normalize the data between 0.0 and 1.0: data /= 255. # Split x_train, x_valid, x_test = data[:50000], data[50000:60000], data[60000: 70000] t_train, t_valid, t_test = target[:50000], target[50000:60000], target[60000: 70000] def plot_digits(data, num_cols, targets=None, shape=(28,28)): num_digits = data.shape[0] num_rows = int(num_digits/num_cols) for i in range(num_digits): plt.subplot(num_rows, num_cols, i+1) plt.imshow(data[i].reshape(shape), interpolation='none', cmap='Greys') if targets is not None: plt.title(int(targets[i])) plt.colorbar() plt.axis('off') plt.tight_layout() plt.show() plot_digits(x_train[0:40000:5000], num_cols=4, targets=t_train[0:40000:5000]) import numpy as np # 1.1.2 Compute gradient of log p(t|x;w,b) wrt w and b def logreg_gradient(x, t, w, b): Return the log likelihood of the data point's target, together with the gradient with respect to w and b. logq = np.array(np.matmul(x, w) + b) if len(logq.shape) == 1: logq = np.expand_dims(logq, 0) if len(x.shape) == 1: x = np.expand_dims(x, 0) # Calculate log z with trick mentioned above a = max(logq.flatten()) logz = a + np.log(sum([np.power(np.e, q - a) for q in logq])) logp = logq - logz zeros = np.zeros(logq.shape) zeros[:, t[0]] = 1 dq = zeros - np.power(np.e, logq - logz) # Final derivatives of the log-likelihood dL_dw = np.transpose(np.matmul(dq.T, x)) dL_db = dq return logp[:,t].squeeze(), dL_dw, dL_db.squeeze() np.random.seed(123) # scalar, 10 X 768 matrix, 10 X 1 vector w = np.random.normal(size=(28*28,10), scale=0.001) # w = np.zeros((784,10)) b = np.zeros((10,)) # test gradients, train on 1 sample logpt, grad_w, grad_b = logreg_gradient(x_train[0:1,:], t_train[0:1], w, b) print("Test gradient on one point") print("Likelihood:\t", logpt) print("\nGrad_W_ij\t",grad_w.shape,"matrix") print("Grad_W_ij[0,152:158]=\t", grad_w[152:158,0]) print("\nGrad_B_i shape\t",grad_b.shape,"vector") print("Grad_B_i=\t", grad_b.T) print("i in {0,...,9}; j in M") assert logpt.shape == (), logpt.shape assert grad_w.shape == (784, 10), grad_w.shape assert grad_b.shape == (10,), grad_b.shape # It's always good to check your gradient implementations with finite difference checking: # Scipy provides the check_grad function, which requires flat input variables. # So we write two helper functions that provide can compute the gradient and output with 'flat' weights: from scipy.optimize import check_grad np.random.seed(123) # scalar, 10 X 768 matrix, 10 X 1 vector w = np.random.normal(size=(28*28,10), scale=0.001) # w = np.zeros((784,10)) b = np.zeros((10,)) def func(w): logpt, grad_w, grad_b = logreg_gradient(x_train[0:1,:], t_train[0:1], w.reshape(784,10), b) return logpt def grad(w): logpt, grad_w, grad_b = logreg_gradient(x_train[0:1,:], t_train[0:1], w.reshape(784,10), b) return grad_w.flatten() finite_diff_error = check_grad(func, grad, w.flatten()) print('Finite difference error grad_w:', finite_diff_error) assert finite_diff_error < 1e-3, 'Your gradient computation for w seems off' def func(b): logpt, grad_w, grad_b = logreg_gradient(x_train[0:1,:], t_train[0:1], w, b) return logpt def grad(b): logpt, grad_w, grad_b = logreg_gradient(x_train[0:1,:], t_train[0:1], w, b) return grad_b.flatten() finite_diff_error = check_grad(func, grad, b) print('Finite difference error grad_b:', finite_diff_error) assert finite_diff_error < 1e-3, 'Your gradient computation for b seems off' import random def predict(x, w, b): Return the log likelihood for a datapoint's real target. logq = np.array(np.matmul(x, w) + b) if len(logq.shape) == 1: logq = np.expand_dims(logq, 0) if len(x.shape) == 1: x = np.expand_dims(x, 0) # Save number of classes k = logq.shape[1] # Calculate log z with trick mentioned above a = max(logq.flatten()) logz = a + np.log(sum([np.power(np.e, logq[:,i] - a) for i in range(k)])) logp = logq - logz return logp def sgd_iter(x_train, t_train, W, b): Go over all datapoints randomly and adapt the weights and bias terms according to the stochastic gradient descent algorithm. indices = np.arange(0, len(x_train)) random.shuffle(indices) eta = 1e-6 for i in indices: logp_train, dL_dw, dL_db = logreg_gradient(x_train[i], [t_train[i]], W, b) W = W - eta * -dL_dw b = b - eta * -dL_db predictions = [] for i in indices: logp_train = predict(x_train[i], W, b)[:, t_train[i]].squeeze() predictions.append(np.asscalar(logp_train)) return predictions, W, b # Sanity check: np.random.seed(1243) w = np.zeros((28*28, 10)) b = np.zeros(10) logp_train, W, b = sgd_iter(x_train[:5], t_train[:5], w, b) from matplotlib import pyplot as plt def test_sgd(x_train, t_train, w, b): y_train = [] y_valid = [] k = 10 for i in range(k): predictions_train, w, b = sgd_iter(x_train, t_train, w, b) # Check how well the weights generalize for the validation set predictions_valid = [predict(x, w, b)[:, t_valid[i]].squeeze() for i, x in enumerate(x_valid)] y_train.append(np.mean(predictions_train)) y_valid.append(np.mean(predictions_valid)) plt.plot(np.arange(1, k+1), y_train, label = "Training set") plt.plot(np.arange(1, k+1), y_valid, label = "Validation set") plt.legend() plt.xlabel("Iteration") plt.ylabel("Avg. log-probability") plt.show() return w, b np.random.seed(1243) w = np.zeros((28*28, 10)) b = np.zeros(10) from time import time start = time() w,b = test_sgd(x_train, t_train, w, b) end = time() print(end-start) def plot_digits(data, num_cols, targets=None, shape=(28,28)): num_digits = data.shape[0] num_rows = int(num_digits/num_cols) for i in range(num_digits): plt.subplot(num_rows, num_cols, i+1) plt.imshow(data[i].reshape(shape), interpolation='none', cmap='Greys') if targets is not None: plt.title(int(targets[i])) plt.colorbar() plt.axis('off') plt.tight_layout() plt.show() plot_digits(np.transpose(w), num_cols=5) predictions_valid = np.array([predict(x, t_valid[i], w, b) for i, x in enumerate(x_valid)]) ordered = predictions_valid.argsort() ind_worst = ordered[:8] ind_best = ordered[-8:] print("Lowest probability for the true class label") plot_digits(x_valid[ind_worst], 4, t_valid[ind_worst]) print("Highest probability for the true class label") plot_digits(x_valid[ind_best], 4, t_valid[ind_best]) # Write all helper functions here def sigmoid(x): return 1.0 / (1.0 + np.exp(-x)) def dsig(s): return np.multiply(s, (1 - s)) def calc_h(x, v, a): return sigmoid(np.matmul(v.T, x) + a).squeeze() # Write training code here: # Plot the conditional loglikelihoods for the train and validation dataset after every iteration. # Plot the weights of the first layer. def sgd_iter(x_train, t_train, V, W, a, b): Go over all datapoints randomly and adapt the weights and bias terms according to the stochastic gradient descent algorithm. indices = np.arange(0, len(x_train)) random.shuffle(indices) for i in indices: h = calc_h(x_train[i], V, a) _, dL_dw, dL_db = logreg_gradient(h, [t_train[i]], W, b) dL_dh = np.matmul(W, dL_db) dL_da = np.multiply(dL_dh, dsig(h)) dL_dv = np.multiply(np.matrix(x_train[i]).T, np.matrix(dL_da)) V = V + np.multiply(eta, dL_dv) W = W + np.multiply(eta, dL_dw) a = a + np.multiply(eta, dL_da) b = b + np.multiply(eta, dL_db) predictions = [] for i in indices: logp_train = predict(calc_h(x_train[i], V, a), W, b)[:, t_train[i]].squeeze() predictions.append(np.asscalar(logp_train)) return predictions, V, W, a, b def test_sgd(x_train, t_train, V, W, a, b): y_train = [] y_valid = [] k = 10 eta = 1e-2 for i in range(k): predictions_train, V, W, a, b = sgd_iter(x_train, t_train, V, W, a, b) # Check how well the weights generalize for the validation set predictions_valid = [predict(calc_h(x, V, a), W, b)[:, t_valid[i]].squeeze() for i, x in enumerate(x_valid)] y_train.append(np.mean(predictions_train)) y_valid.append(np.mean(predictions_valid)) plt.plot(np.arange(1, k+1), y_train, label = "Training set") plt.plot(np.arange(1, k+1), y_valid, label = "Validation set") plt.legend() plt.xlabel("Iteration") plt.ylabel("Avg. log-probability") plt.show() return V, W, a, b K = x_train.shape[1] # No. of input units L = 20 # No. of hidden units M = 10 # No. of output units # Initialize weights gaussian W = np.random.normal(loc =0, scale =1, size=(L, M)) b = np.random.uniform(size=(10,)) a = np.random.uniform(size=(L,)) V = np.random.normal(loc =0, scale =1, size=(784, L)) V, W, a, b = test_sgd(x_train, t_train, V, W, a, b) plot_digits(V.T, num_cols=5) predict_test = np.zeros(len(t_test)) # Fill predict_test with the predicted targets from your model, don't cheat :-). # YOUR CODE HERE def test_sgd_super(x_train, t_train, V, W, a, b): y_train = [] y_valid = [] k = 25 eta = 0.1 for i in range(k): _, V, W, a, b = sgd_iter(x_train, t_train, V, W, a, b) _, V, W, a, b = sgd_iter(x_valid, t_valid, V, W, a, b) for j, x in enumerate(x_test): all_classes = predict(calc_h(x, V, a), W, b).tolist()[0] predict_test[j] = all_classes.index(max(all_classes)) p = (10000 - np.sum(predict_test != t_test)) / 10000 print("Iteration {} done for eta {:.5f}, {:.2f}% correct.".format(i+1, eta, p * 100)) eta = eta * 0.75 return V, W, a, b # init all values with gaussians K = 10 L = 210 W = np.random.normal(loc =0, scale =1, size=(L, K)) b = np.random.uniform(size=(K,)) a = np.random.uniform(size=(L,)) V = np.random.normal(loc=0, scale=1, size=(28*28, L)) V, W, a, b = test_sgd_super(x_train, t_train, V, W, a, b) assert predict_test.shape == t_test.shape n_errors = np.sum(predict_test != t_test) print('Test errors: %d' % n_errors) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Lab 2 Step2: Part 1. Multiclass logistic regression Step3: MNIST consists of small 28 by 28 pixel images of written digits (0-9). We split the dataset into a training, validation and testing arrays. The variables x_train, x_valid and x_test are $N \times M$ matrices, where $N$ is the number of datapoints in the respective set, and $M = 28^2 = 784$ is the dimensionality of the data. The second set of variables t_train, t_valid and t_test contain the corresponding $N$-dimensional vector of integers, containing the true class labels. Step5: In multiclass logistic regression, the conditional probability of class label $j$ given the image $\bx$ for some datapoint is given by Step8: 1.1.3 Stochastic gradient descent (10 points) Step9: 1.2. Train Step10: 1.2.2 Visualize weights (10 points) Step11: Describe in less than 100 words why these weights minimize the loss The plot illustrates that every column j of W is `specialized' in recognising a number. The colours represent the penalty or reward of pixel intensity in data point x. Intensity in the grey area does not matter (contributes 0 to the likelihood), in the black area should be intensity if j is x's target (positive contribution) and in the white area there should not be intensity (negative contribution). If x's target follows this pattern, the likelihood of its target is maximized and thus the loss is minimized. The fuzziness in the numbers accounts for variations in handwriting. Step13: We think these images make sense Step14: 2.3.1. Explain the weights (5 points)
11,934
<ASSISTANT_TASK:> Python Code: import matplotlib.pyplot as plt import numpy as np from scipy.spatial import cKDTree from scipy.spatial.distance import cdist from metpy.interpolate.geometry import dist_2 from metpy.interpolate.points import barnes_point, cressman_point from metpy.interpolate.tools import calc_kappa def draw_circle(ax, x, y, r, m, label): th = np.linspace(0, 2 * np.pi, 100) nx = x + r * np.cos(th) ny = y + r * np.sin(th) ax.plot(nx, ny, m, label=label) np.random.seed(100) pts = np.random.randint(0, 100, (10, 2)) xp = pts[:, 0] yp = pts[:, 1] zp = xp * xp / 1000 sim_gridx = [30, 60] sim_gridy = [30, 60] grid_points = np.array(list(zip(sim_gridx, sim_gridy))) radius = 40 obs_tree = cKDTree(list(zip(xp, yp))) indices = obs_tree.query_ball_point(grid_points, r=radius) x1, y1 = obs_tree.data[indices[0]].T cress_dist = dist_2(sim_gridx[0], sim_gridy[0], x1, y1) cress_obs = zp[indices[0]] cress_val = cressman_point(cress_dist, cress_obs, radius) x2, y2 = obs_tree.data[indices[1]].T barnes_dist = dist_2(sim_gridx[1], sim_gridy[1], x2, y2) barnes_obs = zp[indices[1]] ave_spacing = np.mean((cdist(list(zip(xp, yp)), list(zip(xp, yp))))) kappa = calc_kappa(ave_spacing) barnes_val = barnes_point(barnes_dist, barnes_obs, kappa) fig, ax = plt.subplots(1, 1, figsize=(15, 10)) for i, zval in enumerate(zp): ax.plot(pts[i, 0], pts[i, 1], '.') ax.annotate(str(zval) + ' F', xy=(pts[i, 0] + 2, pts[i, 1])) ax.plot(sim_gridx, sim_gridy, '+', markersize=10) ax.plot(x1, y1, 'ko', fillstyle='none', markersize=10, label='grid 0 matches') ax.plot(x2, y2, 'ks', fillstyle='none', markersize=10, label='grid 1 matches') draw_circle(ax, sim_gridx[0], sim_gridy[0], m='k-', r=radius, label='grid 0 radius') draw_circle(ax, sim_gridx[1], sim_gridy[1], m='b-', r=radius, label='grid 1 radius') ax.annotate('grid 0: cressman {:.3f}'.format(cress_val), xy=(sim_gridx[0] + 2, sim_gridy[0])) ax.annotate('grid 1: barnes {:.3f}'.format(barnes_val), xy=(sim_gridx[1] + 2, sim_gridy[1])) ax.set_aspect('equal', 'datalim') ax.legend() fig, ax = plt.subplots(1, 1, figsize=(15, 10)) ax.annotate('grid 0: ({}, {})'.format(sim_gridx[0], sim_gridy[0]), xy=(sim_gridx[0] + 2, sim_gridy[0])) ax.plot(sim_gridx[0], sim_gridy[0], '+', markersize=10) mx, my = obs_tree.data[indices[0]].T mz = zp[indices[0]] for x, y, z in zip(mx, my, mz): d = np.sqrt((sim_gridx[0] - x)**2 + (y - sim_gridy[0])**2) ax.plot([sim_gridx[0], x], [sim_gridy[0], y], '--') xave = np.mean([sim_gridx[0], x]) yave = np.mean([sim_gridy[0], y]) ax.annotate('distance: {}'.format(d), xy=(xave, yave)) ax.annotate('({}, {}) : {} F'.format(x, y, z), xy=(x, y)) ax.set_xlim(0, 80) ax.set_ylim(0, 80) ax.set_aspect('equal', 'datalim') dists = np.array([22.803508502, 7.21110255093, 31.304951685, 33.5410196625]) values = np.array([0.064, 1.156, 3.364, 0.225]) cres_weights = (radius * radius - dists * dists) / (radius * radius + dists * dists) total_weights = np.sum(cres_weights) proportion = cres_weights / total_weights value = values * proportion val = cressman_point(cress_dist, cress_obs, radius) print('Manual cressman value for grid 1:\t', np.sum(value)) print('Metpy cressman value for grid 1:\t', val) fig, ax = plt.subplots(1, 1, figsize=(15, 10)) ax.annotate('grid 1: ({}, {})'.format(sim_gridx[1], sim_gridy[1]), xy=(sim_gridx[1] + 2, sim_gridy[1])) ax.plot(sim_gridx[1], sim_gridy[1], '+', markersize=10) mx, my = obs_tree.data[indices[1]].T mz = zp[indices[1]] for x, y, z in zip(mx, my, mz): d = np.sqrt((sim_gridx[1] - x)**2 + (y - sim_gridy[1])**2) ax.plot([sim_gridx[1], x], [sim_gridy[1], y], '--') xave = np.mean([sim_gridx[1], x]) yave = np.mean([sim_gridy[1], y]) ax.annotate('distance: {}'.format(d), xy=(xave, yave)) ax.annotate('({}, {}) : {} F'.format(x, y, z), xy=(x, y)) ax.set_xlim(40, 80) ax.set_ylim(40, 100) ax.set_aspect('equal', 'datalim') dists = np.array([9.21954445729, 22.4722050542, 27.892651362, 38.8329756779]) values = np.array([2.809, 6.241, 4.489, 2.704]) weights = np.exp(-dists**2 / kappa) total_weights = np.sum(weights) value = np.sum(values * (weights / total_weights)) print('Manual barnes value:\t', value) print('Metpy barnes value:\t', barnes_point(barnes_dist, barnes_obs, kappa)) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Generate random x and y coordinates, and observation values proportional to x * y. Step2: Set up a cKDTree object and query all of the observations within "radius" of each grid point. Step3: For grid 0, we will use Cressman to interpolate its value. Step4: For grid 1, we will use barnes to interpolate its value. Step5: Plot all of the affiliated information and interpolation values. Step6: For each point, we will do a manual check of the interpolation values by doing a step by Step7: Step through the cressman calculations. Step8: Now repeat for grid 1, except use barnes interpolation. Step9: Step through barnes calculations.
11,935
<ASSISTANT_TASK:> Python Code: from fbprophet import Prophet from sklearn.metrics import r2_score %run helper_functions.py %autosave 120 %matplotlib inline %run prophet_helper.py %run prophet_baseline_btc.py plt.style.use('fivethirtyeight') plt.rcParams["figure.figsize"] = (15,10) plt.rcParams["xtick.labelsize"] = 16 plt.rcParams["ytick.labelsize"] = 16 plt.rcParams["axes.labelsize"] = 20 plt.rcParams['legend.fontsize'] = 20 plt.style.use('fivethirtyeight') pd.set_option('display.max_colwidth', -1) import numpy as np import math from sklearn.linear_model import LinearRegression from sklearn.metrics import mean_squared_error from sklearn.metrics import r2_score df = unpickle_object("blockchain_info_df.pkl") df.head() df_btc = pd.DataFrame(df['mkt_price']) true, pred = prophet_baseline_BTC(df_btc, 30, "mkt_price") r2_score(true, pred) #we see that our baseline model just predicts 44% of the variation when predicting price plt.plot(pred) plt.plot(true) plt.legend(["Prediction", 'Actual'], loc='upper left') plt.xlabel("Prediction #") plt.ylabel("Price") plt.title("TS FB Prophet Baseline - Price Prediction"); df_btc_pct = df_btc.pct_change() df_btc_pct.rename(columns={"mkt_price": "percent_change"}, inplace=True) df_btc_pct = df_btc_pct.iloc[1:, :] print(df_btc_pct.shape) df_btc_pct.head() true_pct, pred_pct = prophet_baseline_BTC(df_btc_pct, 30, "percent_change") r2_score(true_pct, pred_pct) plt.plot(pred_pct) plt.plot(true_pct) plt.legend(["Prediction", 'Actual'], loc='upper left') plt.xlabel("Prediction #") plt.ylabel("Price") plt.title("TS FB Prophet Baseline - Price Prediction"); prices_to_be_multiplied = df.loc[pd.date_range(start="2017-01-23", end="2017-02-21"), "mkt_price"] forecast_price_lst = [] for index, price in enumerate(prices_to_be_multiplied): predicted_percent_change = 1+float(pred_pct[index]) forecasted_price = (predicted_percent_change)*price forecast_price_lst.append(forecasted_price) ground_truth_prices = df.loc[pd.date_range(start="2017-01-24", end="2017-02-22"), "mkt_price"] ground_truth_prices = list(ground_truth_prices) r2_score(ground_truth_prices, forecast_price_lst) # such an incredible result! This is what we have to beat with my nested TS model plt.plot(forecast_price_lst) plt.plot(ground_truth_prices) plt.legend(["Prediction", 'Actual'], loc='upper left') plt.xlabel("Prediction #") plt.ylabel("Price") plt.title("TS FB Prophet Baseline - Price Prediction"); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Forecasting BTC Price with Fb Prophet Step2: Let's predict percentage change! Step3: MSE IS 0.000488913299898903 Step4: we do terribly at predicting percent change! However, we know that percent change should be applied to the price of the previous day. Let's do that!
11,936
<ASSISTANT_TASK:> Python Code: import math import jax import jax.lax as lax import jax.numpy as jnp import jax.random as jrandom import optax # https://github.com/deepmind/optax import equinox as eqx def dataloader(arrays, batch_size, *, key): dataset_size = arrays[0].shape[0] assert all(array.shape[0] == dataset_size for array in arrays) indices = jnp.arange(dataset_size) while True: perm = jrandom.permutation(key, indices) (key,) = jrandom.split(key, 1) start = 0 end = batch_size while end < dataset_size: batch_perm = perm[start:end] yield tuple(array[batch_perm] for array in arrays) start = end end = start + batch_size def get_data(dataset_size, *, key): t = jnp.linspace(0, 2 * math.pi, 16) offset = jrandom.uniform(key, (dataset_size, 1), minval=0, maxval=2 * math.pi) x1 = jnp.sin(t + offset) / (1 + t) x2 = jnp.cos(t + offset) / (1 + t) y = jnp.ones((dataset_size, 1)) half_dataset_size = dataset_size // 2 x1 = x1.at[:half_dataset_size].multiply(-1) y = y.at[:half_dataset_size].set(0) x = jnp.stack([x1, x2], axis=-1) return x, y class RNN(eqx.Module): hidden_size: int cell: eqx.Module linear: eqx.nn.Linear bias: jnp.ndarray def __init__(self, in_size, out_size, hidden_size, *, key): ckey, lkey = jrandom.split(key) self.hidden_size = hidden_size self.cell = eqx.nn.GRUCell(in_size, hidden_size, key=ckey) self.linear = eqx.nn.Linear(hidden_size, out_size, use_bias=False, key=lkey) self.bias = jnp.zeros(out_size) def __call__(self, input): hidden = jnp.zeros((self.hidden_size,)) def f(carry, inp): return self.cell(inp, carry), None out, _ = lax.scan(f, hidden, input) # sigmoid because we're performing binary classification return jax.nn.sigmoid(self.linear(out) + self.bias) def main( dataset_size=10000, batch_size=32, learning_rate=3e-3, steps=200, hidden_size=16, depth=1, seed=5678, ): data_key, loader_key, model_key = jrandom.split(jrandom.PRNGKey(seed), 3) xs, ys = get_data(dataset_size, key=data_key) iter_data = dataloader((xs, ys), batch_size, key=loader_key) model = RNN(in_size=2, out_size=1, hidden_size=hidden_size, key=model_key) @eqx.filter_value_and_grad def compute_loss(model, x, y): pred_y = jax.vmap(model)(x) # Trains with respect to binary cross-entropy return -jnp.mean(y * jnp.log(pred_y) + (1 - y) * jnp.log(1 - pred_y)) # Important for efficiency whenever you use JAX: wrap everything into a single JIT # region. @eqx.filter_jit def make_step(model, x, y, opt_state): loss, grads = compute_loss(model, x, y) updates, opt_state = optim.update(grads, opt_state) model = eqx.apply_updates(model, updates) return loss, model, opt_state optim = optax.adam(learning_rate) opt_state = optim.init(model) for step, (x, y) in zip(range(steps), iter_data): loss, model, opt_state = make_step(model, x, y, opt_state) loss = loss.item() print(f"step={step}, loss={loss}") pred_ys = jax.vmap(model)(xs) num_correct = jnp.sum((pred_ys > 0.5) == ys) final_accuracy = (num_correct / dataset_size).item() print(f"final_accuracy={final_accuracy}") main() # All right, let's run the code. <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We begin by importing the usual libraries, setting up a very simple dataloader, and generating a toy dataset of spirals. Step2: Now for our model. Step3: And finally the training loop. Step4: eqx.filter_value_and_grad will calculate the gradient with respect to the first argument (model). By default it will calculate gradients for all the floating-point JAX arrays and ignore everything else. For example the model parameters will be differentiated, whilst model.hidden_size is an integer and will be left alone. If you need finer control then these defaults can be adjusted; see [equinox.filter_grad][] and [equinox.filter_value_and_grad][].
11,937
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. try: import colab !pip install --upgrade pip except: pass print('Installing TensorFlow Data Validation') !pip install --upgrade 'tensorflow_data_validation[visualization]<2' import pkg_resources import importlib importlib.reload(pkg_resources) import tensorflow as tf import tensorflow_data_validation as tfdv print('TF version:', tf.__version__) print('TFDV version:', tfdv.version.__version__) import os import tempfile, urllib, zipfile # Set up some globals for our file paths BASE_DIR = tempfile.mkdtemp() DATA_DIR = os.path.join(BASE_DIR, 'data') OUTPUT_DIR = os.path.join(BASE_DIR, 'chicago_taxi_output') TRAIN_DATA = os.path.join(DATA_DIR, 'train', 'data.csv') EVAL_DATA = os.path.join(DATA_DIR, 'eval', 'data.csv') SERVING_DATA = os.path.join(DATA_DIR, 'serving', 'data.csv') # Download the zip file from GCP and unzip it zip, headers = urllib.request.urlretrieve('https://storage.googleapis.com/artifacts.tfx-oss-public.appspot.com/datasets/chicago_data.zip') zipfile.ZipFile(zip).extractall(BASE_DIR) zipfile.ZipFile(zip).close() print("Here's what we downloaded:") !ls -R {os.path.join(BASE_DIR, 'data')} train_stats = tfdv.generate_statistics_from_csv(data_location=TRAIN_DATA) # docs-infra: no-execute tfdv.visualize_statistics(train_stats) schema = tfdv.infer_schema(statistics=train_stats) tfdv.display_schema(schema=schema) # Compute stats for evaluation data eval_stats = tfdv.generate_statistics_from_csv(data_location=EVAL_DATA) # docs-infra: no-execute # Compare evaluation data with training data tfdv.visualize_statistics(lhs_statistics=eval_stats, rhs_statistics=train_stats, lhs_name='EVAL_DATASET', rhs_name='TRAIN_DATASET') # Check eval data for errors by validating the eval data stats using the previously inferred schema. anomalies = tfdv.validate_statistics(statistics=eval_stats, schema=schema) tfdv.display_anomalies(anomalies) # Relax the minimum fraction of values that must come from the domain for feature company. company = tfdv.get_feature(schema, 'company') company.distribution_constraints.min_domain_mass = 0.9 # Add new value to the domain of feature payment_type. payment_type_domain = tfdv.get_domain(schema, 'payment_type') payment_type_domain.value.append('Prcard') # Validate eval stats after updating the schema updated_anomalies = tfdv.validate_statistics(eval_stats, schema) tfdv.display_anomalies(updated_anomalies) serving_stats = tfdv.generate_statistics_from_csv(SERVING_DATA) serving_anomalies = tfdv.validate_statistics(serving_stats, schema) tfdv.display_anomalies(serving_anomalies) options = tfdv.StatsOptions(schema=schema, infer_type_from_schema=True) serving_stats = tfdv.generate_statistics_from_csv(SERVING_DATA, stats_options=options) serving_anomalies = tfdv.validate_statistics(serving_stats, schema) tfdv.display_anomalies(serving_anomalies) # All features are by default in both TRAINING and SERVING environments. schema.default_environment.append('TRAINING') schema.default_environment.append('SERVING') # Specify that 'tips' feature is not in SERVING environment. tfdv.get_feature(schema, 'tips').not_in_environment.append('SERVING') serving_anomalies_with_env = tfdv.validate_statistics( serving_stats, schema, environment='SERVING') tfdv.display_anomalies(serving_anomalies_with_env) # Add skew comparator for 'payment_type' feature. payment_type = tfdv.get_feature(schema, 'payment_type') payment_type.skew_comparator.infinity_norm.threshold = 0.01 # Add drift comparator for 'company' feature. company=tfdv.get_feature(schema, 'company') company.drift_comparator.infinity_norm.threshold = 0.001 skew_anomalies = tfdv.validate_statistics(train_stats, schema, previous_statistics=eval_stats, serving_statistics=serving_stats) tfdv.display_anomalies(skew_anomalies) from tensorflow.python.lib.io import file_io from google.protobuf import text_format file_io.recursive_create_dir(OUTPUT_DIR) schema_file = os.path.join(OUTPUT_DIR, 'schema.pbtxt') tfdv.write_schema_text(schema, schema_file) !cat {schema_file} <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: TensorFlow Data Validation Step2: Install Data Validation packages Step3: Import TensorFlow and reload updated packages Step4: Check the versions of TensorFlow and the Data Validation before proceeding. Step5: Load the dataset Step6: Compute and visualize statistics Step7: Now let's use tfdv.visualize_statistics, which uses Facets to create a succinct visualization of our training data Step8: <!-- <img class="tfo-display-only-on-site" src="images/statistics.png"/> --> Step9: Check evaluation data for errors Step10: <!-- <img class="tfo-display-only-on-site" src="images/statistics_eval.png"/> --> Step11: Fix evaluation anomalies in the schema Step12: Hey, look at that! We verified that the training and evaluation data are now consistent! Thanks TFDV ;) Step13: We'll deal with the tips feature below. We also have an INT value in our trip seconds, where our schema expected a FLOAT. By making us aware of that difference, TFDV helps uncover inconsistencies in the way the data is generated for training and serving. It's very easy to be unaware of problems like that until model performance suffers, sometimes catastrophically. It may or may not be a significant issue, but in any case this should be cause for further investigation. Step14: Now we just have the tips feature (which is our label) showing up as an anomaly ('Column dropped'). Of course we don't expect to have labels in our serving data, so let's tell TFDV to ignore that. Step15: Check for drift and skew Step16: In this example we do see some drift, but it is well below the threshold that we've set.
11,938
<ASSISTANT_TASK:> Python Code: from pred import Predictor from pred import sequence_vector y = Predictor() y.load_data(file="Data/Training/clean_Y.csv") y.process_data(vector_function="sequence", amino_acid="Y", imbalance_function="ADASYN", random_data=0) y.supervised_training("mlp_adam") y.benchmark("Data/Benchmarks/phos.csv", "Y") y.generate_pca() y.generate_tsne() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Next we are going to load our data and generate random negative data aka gibberish data. The clean data files has negatives created from the data sets pulled from phosphoELM and dbptm. Step2: Next we vectorize the sequences, we are going to use the sequence vector. Step3: Now we can apply a data balancing function, here we are using adasyn which generates synthetic examples of the minority (in this case positive) class. Step4: Next we can check against the benchmarks pulled from dbptm. Step5: Want to explore the data some more, easily generate PCA and TSNE diagrams of the training set.
11,939
<ASSISTANT_TASK:> Python Code: def normalize(M): M_norm = np.full_like(M, 0) for i in range(np.shape(M)[0]): rev = 1 - M[i, :] if np.dot(M[i, :], M[i, :]) > np.dot(rev, rev): M_norm[i, :] = rev else: M_norm[i, :] = M[i, :] return M_norm r = np.genfromtxt("LICHeE_4ecoli_without_ref/matrices/R_all", dtype=int, delimiter=' ') x = np.genfromtxt("LICHeE_4ecoli_without_ref/matrices/X_all", dtype=int, delimiter=' ') print("%s sites" % len(r)) Ncut = 5 print("Delete zero and almost zero profiles:") good_ind = [i for i in range(np.shape(x)[0]) if not ((np.abs(r[i, :] - x[i, :]) <= Ncut).all() or (x[i, :] <= Ncut).all())] print(len(good_ind), "remained") x = x[good_ind, :] r = r[good_ind, :] f = normalize(np.divide(x, r)) draw_PCA(f) print(np.median(r, axis = 0)) r_2 = np.delete(r, [2, 6], axis=1) x_2 = np.delete(x, [2, 6], axis=1) f_2 = normalize(np.divide(x_2, r_2)) draw_PCA(f_2) def filter_by_coverage(cur_r, bad_percent, bad_samples): def filter_row(row): num_of_samples = len(row) valid = np.sum(np.array(([(min_coverage < row) & (row < max_coverage)]))) return num_of_samples - valid <= bad_samples min_coverage = np.percentile(cur_r, bad_percent, axis=0) max_coverage = np.percentile(cur_r, 100-bad_percent, axis=0) good_coverage = np.array([filter_row(row) for row in cur_r]) return good_coverage f_pca = PCA(n_components=2).fit(f).transform(f) percentiles = [25, 20, 15, 10] plt.figure(figsize=(15, 15)) for i in range(4): for j in range(4): print(i, j, end="-") plt.subplot(4, 4, i * 4 + j + 1) draw_PCA(f, filter_by_coverage(r, percentiles[i], j), f_pca) plt.tight_layout(); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Данные для смеси 4 кишечных палочек в реальной пропорции. Выравнивали на референс не из данных. Step2: Низкопокрытые образцы Step3: Как видим, изменилось не много. Так что, оставим их в покое. Step4: Переберем персентили [25, 20, 15, 10] и количество плохих образцов от 0 до 3.
11,940
<ASSISTANT_TASK:> Python Code: %matplotlib inline import numpy as np import matplotlib.pyplot as plt import matplotlib.image as mpimg import sys,os ia898path = os.path.abspath('../../') if ia898path not in sys.path: sys.path.append(ia898path) import ia898.src as ia fin = mpimg.imread('../data/lenina.pgm') nb = ia.nbshow(3) #nb.nbshow(fin,'%s'% (fin.shape,)) froi = fin[137:137+64,157:157+64] nb.nbshow(froi,'%s'% (froi.shape,)) nb.nbshow() print(froi.shape) import numpy as np fd = froi.astype(float) F = np.fft.fft2(fd) nb = ia.nbshow(2) nb.nbshow(froi) nb.nbshow(ia.dftview(F)) nb.nbshow() fx4 = np.zeros(4*np.array(froi.shape), 'uint8') fx4[::4,::4] = froi nb.nbshow(froi) nb.nbshow(fx4) nb.nbshow() fdx4 = fx4.astype(np.float) Fx4 = np.fft.fft2(fdx4) nb.nbshow(fx4) nb.nbshow(ia.dftview(Fx4)) nb.nbshow() k = np.ones((4,4)) fx4nn = ia.pconv(fdx4, k) nb.nbshow(fx4) nb.nbshow(fx4nn.astype(np.uint8)) nb.nbshow() print(fx4nn[:9,:9]) kzero = np.zeros(fx4.shape) kzero[0:4,0:4] = k K = np.fft.fft2(kzero) nb.nbshow(ia.dftview(K)) Fx4nn = K * Fx4 nb.nbshow(ia.dftview(Fx4nn)) nb.nbshow() nb.nbshow(ia.dftview(Fx4)) nb.nbshow(ia.dftview(Fx4nn)) nb.nbshow() klinear = np.array([[1,2,3,4,3,2,1]])/4. k2dlinear = klinear.T.dot(klinear) print('k2dlinear=\n',k2dlinear) fx4li = ia.pconv(fdx4, k2dlinear) nb.nbshow(fx4) nb.nbshow(fx4li.astype(np.uint8)) nb.nbshow() klizero = np.zeros(fx4.shape) klizero[0:7,0:7] = k2dlinear Klinear = np.fft.fft2(klizero) nb.nbshow(ia.dftview(Klinear)) Fx4li = Klinear * Fx4 nb.nbshow(ia.dftview(Fx4li)) nb.nbshow() nb.nbshow(ia.dftview(Fx4)) nb.nbshow(ia.dftview(Fx4li)) nb.nbshow() FI = np.zeros_like(Fx4) FI[:FI.shape[0]//8,:FI.shape[1]//8] = 1 FI[-FI.shape[0]//8:,:FI.shape[1]//8] = 1 FI[:FI.shape[0]//8,-FI.shape[1]//8:] = 1 FI[-FI.shape[0]//8:,-FI.shape[1]//8:] = 1 Fx4ideal = Fx4 * FI nb.nbshow(ia.dftview(Fx4)) nb.nbshow(ia.dftview(Fx4ideal)) nb.nbshow() nb = ia.nbshow(2) fx4ideal_c = np.fft.ifft2(Fx4ideal) print(fx4ideal_c.imag.sum()) fx4ideal= 16*fx4ideal_c.real print(fx4ideal.min(),fx4ideal.max()) print(froi.min(),froi.max()) nb.nbshow(ia.normalize(fx4ideal)) nb.nbshow() nb = ia.nbshow(3) #nb.nbshow(froi) nb.nbshow(fx4li.astype(np.uint8)) nb.nbshow(ia.normalize(fx4ideal)) nb.nbshow() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Reading and ROI selection Step2: DFT Step3: Expansion by 4 without interpolation Step4: DFT of the expansion without interpolation Step5: Filtering by mean filtering - nearest neighbor Step6: Interpretation of the mean filtering in the frequency domain Step7: Filtering by pyramidal kernel, linear interpolation Step8: Interpretation of the pyramid filtering in the frequency domain Step9: Using an ideal filter
11,941
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd # RMS Titanic data visualization code from titanic_visualizations import survival_stats from IPython.display import display %matplotlib inline # Load the dataset in_file = 'titanic_data.csv' full_data = pd.read_csv(in_file) # Print the first few entries of the RMS Titanic data display(full_data.head()) # Store the 'Survived' feature in a new variable and remove it from the dataset outcomes = full_data['Survived'] data = full_data.drop('Survived', axis = 1) # Show the new dataset with 'Survived' removed display(data.head()) def accuracy_score(truth, pred): Returns accuracy score for input truth and predictions. # Ensure that the number of predictions matches number of outcomes if len(truth) == len(pred): # Calculate and return the accuracy as a percent return "Predictions have an accuracy of {:.2f}%.".format((truth == pred).mean()*100) else: return "Number of predictions does not match number of outcomes!" # Test the 'accuracy_score' function predictions = pd.Series(np.ones(5, dtype = int)) print accuracy_score(outcomes[:5], predictions) def predictions_0(data): Model with no features. Always predicts a passenger did not survive. predictions = [] for _, passenger in data.iterrows(): # Predict the survival of 'passenger' predictions.append(0) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_0(data) print accuracy_score(outcomes, predictions) survival_stats(data, outcomes, 'Sex') def predictions_1(data): Model with one feature: - Predict a passenger survived if they are female. predictions = [] for _, passenger in data.iterrows(): # Remove the 'pass' statement below # and write your prediction conditions here predictions.append( passenger['Sex'] == 'female' ) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_1(data) print accuracy_score(outcomes, predictions) survival_stats(data, outcomes, 'Age', ["Sex == 'male'"]) def predictions_2(data): Model with two features: - Predict a passenger survived if they are female. - Predict a passenger survived if they are male and younger than 10. predictions = [] for _, passenger in data.iterrows(): # Remove the 'pass' statement below # and write your prediction conditions here predictions.append( ( passenger['Sex'] == 'female' or passenger['Age'] < 10 ) ) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_2(data) print accuracy_score(outcomes, predictions) survival_stats(data, outcomes, "Age", ["Sex == 'female'", "Pclass == 3" ] ) def predictions_3(data): Model with multiple features. Makes a prediction with an accuracy of at least 80%. predictions = [] for _, passenger in data.iterrows(): # Remove the 'pass' statement below # and write your prediction conditions here predictions.append( (passenger['Sex'] == 'female' and passenger['Pclass']<3 ) or (passenger['Sex'] == 'female' and passenger['Pclass']==3 and passenger['SibSp']<2.5 and passenger['Age']< 40 ) or (passenger['Sex'] == 'male' and passenger['Age'] < 10 and passenger['SibSp']<2.5 ) ) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_3(data) print accuracy_score(outcomes, predictions) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: From a sample of the RMS Titanic data, we can see the various features present for each passenger on the ship Step3: The very same sample of the RMS Titanic data now shows the Survived feature removed from the DataFrame. Note that data (the passenger data) and outcomes (the outcomes of survival) are now paired. That means for any passenger data.loc[i], they have the survival outcome outcome[i]. Step5: Tip Step6: Question 1 Step7: Answer Step9: Examining the survival statistics, a large majority of males did not survive the ship sinking. However, a majority of females did survive the ship sinking. Let's build on our previous prediction Step10: Question 2 Step11: Answer Step13: Examining the survival statistics, the majority of males younger than 10 survived the ship sinking, whereas most males age 10 or older did not survive the ship sinking. Let's continue to build on our previous prediction Step14: Question 3 Step15: Answer Step17: After exploring the survival statistics visualization, fill in the missing code below so that the function will make your prediction. Step18: Question 4
11,942
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd from scipy import stats import matplotlib.pyplot as plt import seaborn as sns sns.set_style('whitegrid') %pylab inline stroop_data = pd.read_csv('./stroopdata.csv') stroop_data.head() stroop_data.describe() print "Median:\n", stroop_data.median() print "\nVariance:\n", stroop_data.var() fig, axs = plt.subplots(figsize=(18, 5), ncols = 3, sharey=True) plt.figure(figsize=(8, 6)) sns.set_palette("Set2") # Fig 1 - Congruent Words - Response Time sns.boxplot(y="Congruent", data=stroop_data, ax=axs[0]).set_title("Fig 1: Congruent Words - Response Time (in seconds)") # Fig 2 - Incongruent Words - Response Time sns.boxplot(y="Incongruent", data=stroop_data, color="coral", ax=axs[1]).set_title("Fig 2: Incongruent Words - Response Time (in seconds)") # Fig 3 - Congruence vs. Incongruence sns.regplot(x="Congruent", y="Incongruent", data=stroop_data, color="m", fit_reg=False, ax=axs[2]).set_title("Fig 3: Congruence vs. Incongruence (in seconds)") # Dependent t-test for paired samples stats.ttest_rel(stroop_data["Congruent"], stroop_data["Incongruent"]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Variables Step2: Independent variable Step3: The above visualizations clearly show that the response time for the congruent words condition is much lower in comparison to the incongruent words condition.
11,943
<ASSISTANT_TASK:> Python Code: %matplotlib inline import numpy as np import time as tm import matplotlib.pyplot as plt # Discretization c1=20 # Number of grid points per dominant wavelength c2=0.5 # CFL-Number nx=2000 # Number of grid points T=10 # Total propagation time # Source Signal f0= 10 # Center frequency Ricker-wavelet q0= 1 # Maximum amplitude Ricker-Wavelet xscr = 100 # Source position (in grid points) # Receiver xrec1=400 # Position Reciever 1 (in grid points) xrec2=800 # Position Reciever 2 (in grid points) xrec3=1800 # Position Reciever 3 (in grid points) # Velocity and density modell_v = np.hstack((1000*np.ones((int(nx/2))),1500*np.ones((int(nx/2))))) rho=np.hstack((1*np.ones((int(nx/2))),1.5*np.ones((int(nx/2))))) # Init wavefields vx=np.zeros(nx) p=np.zeros(nx) vx_x=np.zeros(nx) p_x=np.zeros(nx) vx_x2=np.zeros(nx) p_x2=np.zeros(nx) vx_x3=np.zeros(nx) p_x3=np.zeros(nx) # Calculate first Lame-Paramter l=rho * modell_v * modell_v cmin=min(modell_v.flatten()) # Lowest P-wave velocity cmax=max(modell_v.flatten()) # Highest P-wave velocity fmax=2*f0 # Maximum frequency dx=cmin/(fmax*c1) # Spatial discretization (in m) dt=dx/(cmax)*c2 # Temporal discretization (in s) lampda_min=cmin/fmax # Smallest wavelength # Output model parameter: print("Model size: x:",dx*nx,"in m") print("Temporal discretization: ",dt," s") print("Spatial discretization: ",dx," m") print("Number of gridpoints per minimum wavelength: ",lampda_min/dx) x=np.arange(0,dx*nx,dx) # Space vector t=np.arange(0,T,dt) # Time vector nt=np.size(t) # Number of time steps # Plotting model fig, (ax1, ax2) = plt.subplots(1, 2) fig.subplots_adjust(wspace=0.4,right=1.6) ax1.plot(x,modell_v) ax1.set_ylabel('VP in m/s') ax1.set_xlabel('Depth in m') ax1.set_title('P-wave velocity') ax2.plot(x,rho) ax2.set_ylabel('Density in g/cm^3') ax2.set_xlabel('Depth in m') ax2.set_title('Density'); tau=np.pi*f0*(t-1.5/f0) q=q0*(1.0-2.0*tau**2.0)*np.exp(-tau**2) # Plotting source signal plt.figure(3) plt.plot(t,q) plt.title('Source signal Ricker-Wavelet') plt.ylabel('Amplitude') plt.xlabel('Time in s') plt.draw() # Init Seismograms Seismogramm=np.zeros((3,nt)); # Three seismograms # Calculation of some coefficients i_dx=1.0/(dx) print("Starting time stepping...") ## Time stepping for n in range(2,nt): # Inject source wavelet p[xscr]=p[xscr]+q[n] # Update velocity for kx in range(5,nx-4): # Calculating spatial derivative p_x[kx]=i_dx*9.0/8.0*(p[kx+1]-p[kx])-i_dx*1.0/24.0*(p[kx+2]-p[kx-1]) # Update velocity vx[kx]=vx[kx]-dt/rho[kx]*(25.0/24.0*p_x[kx]-1.0/12.0*p_x2[kx]+1.0/24.0*p_x3[kx]) # np.save old spatial derivations for Adam-Bashforth method np.copyto(p_x3,p_x2) np.copyto(p_x2,p_x) # Update pressure for kx in range(5,nx-4): # Calculating spatial derivative vx_x[kx]= i_dx*9.0/8.0*(vx[kx]-vx[kx-1])-i_dx*1.0/24.0*(vx[kx+1]-vx[kx-2]) # Update pressure p[kx]=p[kx]-l[kx]*dt*(25.0/24.0*vx_x[kx]-1.0/12.0*vx_x2[kx]+1.0/24.0*vx_x3[kx]) # np.save old spatial derivations for Adam-Bashforth method np.copyto(vx_x3,vx_x2) np.copyto(vx_x2,vx_x) # Save seismograms Seismogramm[0,n]=p[xrec1] Seismogramm[1,n]=p[xrec2] Seismogramm[2,n]=p[xrec3] print("Finished time stepping!") ## Save seismograms np.save("Seismograms/FD_1D_DX4_DT3_ABS",Seismogramm) ## Plot seismograms fig, (ax1, ax2, ax3) = plt.subplots(3, 1) fig.subplots_adjust(hspace=0.4,right=1.6, top = 2 ) ax1.plot(t,Seismogramm[0,:]) ax1.set_title('Seismogram 1') ax1.set_ylabel('Amplitude') ax1.set_xlabel('Time in s') ax1.set_xlim(0, T) ax2.plot(t,Seismogramm[1,:]) ax2.set_title('Seismogram 2') ax2.set_ylabel('Amplitude') ax2.set_xlabel('Time in s') ax2.set_xlim(0, T) ax3.plot(t,Seismogramm[2,:]) ax3.set_title('Seismogram 3') ax3.set_ylabel('Amplitude') ax3.set_xlabel('Time in s') ax3.set_xlim(0, T); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Input Parameter Step2: Preparation Step3: Create space and time vector Step4: Source signal - Ricker-wavelet Step5: Time stepping Step6: Save seismograms
11,944
<ASSISTANT_TASK:> Python Code: def fun(a,b): x = a + b print(fun(1,2)) def fun(a,b): x = a+b return(x) print(fun(1,2)) def fun2(): print(a) a=2 fun2() def fun3(): x = a+2 return(x) fun3() def fun4(): a = a+2 return(a) fun4() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: No es posible imprimir por pantalla el valor de "x" ya que solo existe dentro de la función. Para llevar a "x" a un scope superior, es decir que exista fuera de la función hay que regresar su valor utilizando la función return(), dentro de la definición de la función. Step2: Cuando se ejecuta una funcion es posible acceder a una variable de scope superior, pero no se puede modificar o utilizar, es decir solo se accede a modo de lectura. Step3: Como se observa es posible hacer lectura y usar la variable, pero no es posible reescribirla.
11,945
<ASSISTANT_TASK:> Python Code: complex_xml = os.path.join(PROJECT_ROOT, 'complex-events.xml.gz') # get just "complex events" # Q: what's complex? -- complex == no full coordinates def complex_measures(x): if x.measure: return ( # smattering of all non SNV variants (x.measure.variant_type.lower() not in {'single nucleotide variant'} and np.random.random() < 0.01) # be sure to get the rare ones or (x.measure.variant_type.lower() in {'tandem duplication', 'fusion', 'complex', 'translocation', 'inversion'}) ) return False filter_xml( input_xml=clinvar_path, output_xml=complex_xml, filter_fct=complex_measures, ) dataset = ClinVarDataset(complex_xml) def get_measures(dataset): for r in dataset: if r.measure: yield r.measure for m in get_measures(dataset): break dir(m) # just all the properties props = [ 'all_names', 'clinvar_record', # 'explicit_insertion_length', # 'has_complete_coordinates', 'hgnc_ids', 'hgvs', 'is_repeat_expansion_variant', # 'measure_xml', 'microsatellite_category', 'nsv_id', 'preferred_gene_symbols', # 'preferred_name', 'preferred_or_other_name', # 'pubmed_refs', 'rs_id', # 'sequence_location_helper', # 'toplevel_refseq_hgvs', 'variant_type', 'chr', 'vcf_alt', # 'vcf_full_coords', 'vcf_pos', 'vcf_ref' ] # replaces empty list with None measures = [[getattr(v, p) if getattr(v, p) != [] else None for p in props] for v in get_measures(dataset)] df = pd.DataFrame(measures, columns=props) df.count() set(df['variant_type']) df[df.variant_type == 'Translocation'] def get_measure_xml_for_rcv(dataset, rcv): for r in dataset: if r.accession == rcv: return r.measure.measure_xml # pretty print xml def pprint(x): print(ElementTree.tostring(x, encoding='unicode')) def print_measure_xml_for_rcv(dataset, rcv): x = get_measure_xml_for_rcv(dataset, rcv) pprint(x) xml = get_measure_xml_for_rcv(dataset, 'RCV001372309') pprint(xml) xml2 = get_measure_xml_for_rcv(dataset, 'RCV001255994') pprint(xml2) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Dataframe Step2: XML
11,946
<ASSISTANT_TASK:> Python Code: score_data = pd.read_csv("../data/indico_nyt_bitcoin.csv", index_col='time', parse_dates=[0], date_parser=lambda x: datetime.datetime.strptime(x, time_format)) score_data.head() weekly_score = score_data.resample('w', how='mean').loc['2013':].fillna(0.5) weekly_score.head() weekly_score.plot() time_format = "%Y-%m-%dT%H:%M:%S" data = pd.read_csv("../data/price.csv", names=['time', 'price'], index_col='time', parse_dates=[0], date_parser=lambda x: datetime.datetime.strptime(x[:-6], time_format)) bpi = data.resample('w', how='ohlc') bpi.index.name = 'time' bpi = pd.DataFrame(bpi['price']['close']).loc['2013':] bpi.head() trend_bpi = pd.merge(weekly_score, bpi, how='right', left_index=True, right_index=True) trend_bpi.columns = ['sentiment', 'close_price'] trend_bpi.head() trend_bpi.plot(secondary_y='close_price') trend_bpi.corr() time_format = "%Y-%m-%dT%H:%M:%SZ" alchemy_data = pd.read_csv("../data/alchemy_nyt_bitcoin.csv" , index_col='time', parse_dates=[0], date_parser=lambda x: datetime.datetime.strptime(x, time_format)) alchemy_data.head() alchemy_data.alchemy_score.plot(kind='hist') alchemy_data.describe() weekly_alchemy = alchemy_data.resample('w', how='mean').loc['2013':].fillna(0.0) weekly_alchemy.head() weekly_alchemy.plot(kind='hist') weekly_alchemy.describe() alchemy_bpi = pd.merge(weekly_alchemy, bpi, how='right', left_index=True, right_index=True) alchemy_bpi.columns = ['sentiment', 'close_price'] alchemy_bpi.head() alchemy_bpi.plot(secondary_y='close_price') merged_data = pd.merge(alchemy_bpi, weekly_score, how='right', left_index=True, right_index=True) merged_data.head() merged_data.plot(secondary_y='close_price') merged_data.corr() daily_alchemy = alchemy_data.resample('d', how='mean').loc['2013':].fillna(0.0) daily_alchemy.head() daily_price = data.resample('d', how='ohlc') daily_price.index.name = 'time' daily_price = pd.DataFrame(daily_price['price']['close']).loc['2013':] daily_price.head() daily_data = pd.merge(daily_price, daily_alchemy, how='right', left_index=True, right_index=True) daily_data.head() daily_data.plot(secondary_y='close') alchemy_bpi['avg_sentiment'] = pd.rolling_mean(alchemy_bpi.sentiment, 1) alchemy_bpi.head() alchemy_bpi['avg_shifted'] = alchemy_bpi['avg_sentiment'].shift(1) alchemy_bpi.head() alchemy_bpi['order']= 'NA' alchemy_bpi['diff'] = alchemy_bpi.sentiment - alchemy_bpi.avg_shifted alchemy_bpi.head() ## SII_diff >= diff => search interest rises this week => price rises next week alchemy_bpi.loc[alchemy_bpi['diff'] > 0,'order'] = False ## SII_diff < diff => search interest falls this week => price falls next week alchemy_bpi.loc[alchemy_bpi['diff'] < 0,'order'] = True alchemy_bpi.head() alchemy_bpi['trend'] = alchemy_bpi.close_price > alchemy_bpi.close_price.shift(1) alchemy_bpi.head() total_predict = alchemy_bpi[alchemy_bpi.order!='NA'].order.count() total_correct = alchemy_bpi[alchemy_bpi.order==alchemy_bpi.trend].order.count() print "TP+TN: %f (%d/%d)" % (total_correct/float(total_predict), total_correct, total_predict) alchemy_bpi.corr() daily_data = pd.merge(daily_price, daily_alchemy, how='right', left_index=True, right_index=True) daily_data['avg_sentiment'] = pd.rolling_mean(daily_data.alchemy_score, 1) daily_data.head() daily_data['avg_shifted'] = daily_data['avg_sentiment'].shift(3) daily_data.head() daily_data['order']= 'NA' daily_data['diff'] = daily_data.alchemy_score - daily_data.avg_shifted daily_data.head() ## SII_diff >= diff => search interest rises this week => price rises next week daily_data.loc[daily_data['diff'] > 0,'order'] = True ## SII_diff < diff => search interest falls this week => price falls next week daily_data.loc[daily_data['diff'] < 0,'order'] = False daily_data.head() daily_data['trend'] = daily_data.close > daily_data.close.shift(1) daily_data.head() total_predict = daily_data[daily_data.order!='NA'].order.count() total_correct = daily_data[daily_data.order==daily_data.trend].order.count() print "TP+TN: %f (%d/%d)" % (total_correct/float(total_predict), total_correct, total_predict) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Compute average sentiment score per week Step2: read bitcoin price data Step3: add news volume data Step4: AlchemyAPI sentiment score Step5: Daily score analysis Step6: Prediction Step7: Daily prediction
11,947
<ASSISTANT_TASK:> Python Code: %matplotlib inline from __future__ import print_function from __future__ import division import numpy as np from matplotlib import pyplot as plt from sympy import symbols, sin, cos, simplify, trigsimp, pi from math import radians as d2r from math import degrees as r2d from math import atan2, sqrt, acos, fabs class mDH(object): This uses the modified DH parameters see Craig, eqn (3.6) def __init__(self): pass def fk(self, params): t = np.eye(4) for p in params: t = t.dot(self.makeT(*p)) return t def makeT(self, a, alpha, d, theta): return np.array([ # classic DH [ cos(theta), -sin(theta), 0, a], [sin(theta)*cos(alpha), cos(theta)*cos(alpha), -sin(alpha), -d*sin(alpha)], [sin(theta)*sin(alpha), cos(theta)*sin(alpha), cos(alpha), d*cos(alpha)], [ 0, 0, 0, 1] ]) def eval(f): This allows you to simplify the trigonomic mess that kinematics can create and also substitute in some inputs in the process c = [] for row in f: r = [] for col in row: # use python symbolic toolbox to simplify the trig mess above r.append(simplify(col)) c.append(r) return np.array(c) def subs(f, m): This allows you to simplify the trigonomic mess that kinematics can create and also substitute in some inputs in the process c = [] for row in f: r = [] for col in row: r.append(col.subs(m)) c.append(r) return np.array(c) def rplot(t1, t2, t3, t4): Given the 4 joint angles (in rads), plot the arm in the x-y and w-z planes l1 = 5.75 l2 = 7.375 l3 = 3.375 ptsx = [0] ptsy = [0] # our definition is reverse or these joints t3 = -t3 t4 = -t4 # link 1 x1 = l1*cos(t2) y1 = l1*sin(t2) ptsx.append(x1) ptsy.append(y1) # link 2 x2 = x1 + l2*cos(t2 + t3) y2 = y1 + l2*sin(t2 + t3) ptsx.append(x2) ptsy.append(y2) # link 3 x3 = x2 + l3*cos(t2 + t3 + t4) y3 = y2 + l3*sin(t2 + t3 + t4) ptsx.append(x3) ptsy.append(y3) plt.subplot(1,2,1,projection='polar') plt.plot([0, t1], [0, 1.0]) plt.grid(True) plt.title('Azimuth Angle (x-y plane)') plt.subplot(1,2,2) plt.plot(ptsx, ptsy, 'b-', marker='o') plt.axis('equal') plt.grid(True) plt.title('w-z Plane') from sympy import pi t1, t2, t3, t4 = symbols('t1 t2 t3 t4') # a2, a3, a4, a5 = symbols('a2 a3 a4 a5') # t1 - base # t2 - shoulder # t3 - elbow # t4 - wrist # a2 = 2.75 # base to shoulder a2 = 0.0 a3 = 5.75 # shoulder to elbow a4 = 7.375 # elbow to wrist a5 = 3.375 # wrist to end effector # put all angles in rads # sybolic can't handle converting a symbol using d2r() # a, alpha, d, theta params = [ [ 0, 0, 0, t1], [ a3, -pi/2, 0, t2], [ a4, 0, 0, t3], [ a5, 0, 0, t4] ] # params = [ # [ 0, 0, 2.75, t1], # [ 0, pi/2, 0, t2], # [ 5.75, 0, 0, t3], # [ 7.375, 0, 0, t4], # [ 3.375, 0, 0, 0] # ] dh = mDH() al5d = dh.fk(params) al5d = eval(al5d) def printT(tt): Print out the entire T matrix R = tt[0:3,0:3] D = tt[0:3, 3] print('-'*30) print('Position:') print(' x:', D[0]) print(' y:', D[1]) print(' z:', D[2]) # R(n, o, a) print('-'*30) print('Orientation') print(' nx:', R[0,0]) print(' ny:', R[0,1]) print(' nz:', R[0,2]) print('') print(' ox:', R[1,0]) print(' oy:', R[1,1]) print(' oz:', R[1,2]) print('') print(' ax:', R[2,0]) print(' ay:', R[2,1]) print(' az:', R[2,2]) def printP(dh): dh is the forward kinematics equations matrix pos = [float(x) for x in dh[0:3, 3]] print('Pos (x,y,z): {:5.2f} {:5.2f} {:5.2f}'.format(*pos)) return pos def printDegrees(angles): angles are in radians a = [r2d(x) for x in angles] print('Angles: {:6.1f} {:6.1f} {:6.1f} {:6.1f}'.format(*a)) # the symbolic forward kinematics of our robot arm printT(al5d) # Let's set some angles simp=subs(al5d, [(t1,0.0), (t2,pi/2), (t3, pi/2), (t4, 0.0)]) printT(simp) simp=subs(al5d, [(t1,0.0),(t2,d2r(111.5)), (t3, d2r(-127)), (t4, d2r(-74.5))]) printP(simp) from math import atan2, acos, sqrt, pi, cos, sin def cosine_law(a, b, c, phase=False): if phase: angle = ((c**2 - (a**2 + b**2))/(2*a*b)) else: angle = ((c**2 - (a**2 + b**2))/(-2*a*b)) # print('cosine_law', angle) if angle > 1 or angle < -1: raise Exception('angle outside range') return acos(angle) def line(x1, y1, x2, y2): return sqrt((x2-x1)**2 + (y2-y1)**2) def mag(a, b): return sqrt(a**2 + b**2) def mag3(a, b, c): return sqrt(a**2 + b**2 + c**2) def inverse(x, y, z, orient): Azimuth angle is between x and w and lies in the x-y plane ^ x w | \ | \ | \ | \| <----------+ (z is out of the page - right hand rule) y Most of the robot arm move in the plane defined by w-z ^ z | o-----o | / \ | / E |/ +----------------> w All joint angles returned are in radians: (t1, t2, t3, t4) l1 = 5.75 l2 = 7.375 l3 = 3.375 # check workspace constraints if z < 0: raise Exception('z in ground') elif mag3(x,y,z) > (l1 + l2 + l3): raise Exception('out of reach') # get x-y plane azimuth t1 = atan2(y, x) # Now, most of the arm operates in the w-z frame w = mag(x, y) # new frame axis gamma = atan2(z, w) r = mag(z, w) c = mag(w-l3*cos(orient), z-l3*sin(orient)) t3 = cosine_law(l1, l2, c, True) d = cosine_law(l2, c, l1) e = cosine_law(c, l3, r) t4 = pi - d - e alpha = cosine_law(l1, c, l2) beta = cosine_law(c,r,l3) t2 = alpha + beta + gamma return (t1, t2, t3, t4) def checkPts(x, y, z, orient): Given a point (in inches) and orientation (in rads), this calculates the joint angles, then uses those angles to calculate the forward solution and prints out the error. It also plots the arm. angles = inverse(x, y, z, orient) a,b,c,d = angles simp=subs(al5d, [(t1, a), (t2, b), (t3, -c), (t4, -d)]) pts = printP(simp) printDegrees(angles) rplot(*angles) error = [a-b for a,b in zip((x,y,z), pts)] print('Error: {:6.3f} {:6.3f} {:6.3f}'.format(*error)) checkPts(10.75, 0, 5.75, 0.0) # 0 90 -90 0 checkPts(7.385, 0, 5.75-3.375, -pi/2) x,y,z = (7.385*cos(pi/4), 7.385*sin(pi/4), 5.75-3.375) checkPts(x,y,z, -pi/2) x,y,z = (7.385*cos(-pi/4), 7.385*sin(-pi/4), 5.75-3.375) checkPts(x,y,z, -pi/2) x,y,z = (7.385*cos(pi/2), 7.385*sin(pi/2), 5.75-3.375) checkPts(x,y,z, -pi/2) checkPts(5,0,0, -pi/2) checkPts(7,-3,0, -pi/2) checkPts(7,6,4, -pi/2) print(cos(pi-1)) print(cos(1-pi)) print(cos(1)) # let's plot cos from -pi to pi def draw(p, title): test = [] for i in range(-pi*100, pi*100): if p == pi: ans = cos(pi - i/100) elif p == -pi: ans = cos(i/100 - pi) else: ans = cos(i/100) test.append(ans) x = [x/100 for x in range(-pi*100, pi*100)] plt.plot(x,test) plt.title(title) plt.grid(True) draw(pi, 'pi') draw(-pi, '-pi') draw(0, '0') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step4: Lynx Motion AL5D Step8: The DH parameters are Step11: Inverse Kinematics Step12: Phasing
11,948
<ASSISTANT_TASK:> Python Code: from cameo import models model = models.bigg.e_coli_core.copy() model.solver = "cplex" from cameo import phenotypic_phase_plane ppp = phenotypic_phase_plane(model, variables=[model.reactions.BIOMASS_Ecoli_core_w_GAM], objective=model.reactions.EX_ac_e) ppp.plot() from cameo.strain_design.heuristic.evolutionary_based import OptGene optgene = OptGene(model) result = optgene.run(target="EX_ac_e", biomass=model.reactions.BIOMASS_Ecoli_core_w_GAM, substrate=model.metabolites.glc__D_e, max_evaluations=5000, plot=False) result result.plot(0) result.display_on_map(0, "e_coli_core.Core metabolism") from cameo.strain_design.deterministic.linear_programming import OptKnock optknock = OptKnock(model, fraction_of_optimum=0.1) result = optknock.run(max_knockouts=1, target="EX_ac_e", biomass="BIOMASS_Ecoli_core_w_GAM") result result.plot(0) result.display_on_map(0, "e_coli_core.Core metabolism") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: OptGene Step2: OptKnock Step3: Running multiple knockouts with OptKnock can take a few hours or days...
11,949
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'ncc', 'sandbox-3', 'ocean') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.model_family') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "OGCM" # "slab ocean" # "mixed layer ocean" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.basic_approximations') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Primitive equations" # "Non-hydrostatic" # "Boussinesq" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.prognostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Potential temperature" # "Conservative temperature" # "Salinity" # "U-velocity" # "V-velocity" # "W-velocity" # "SSH" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Linear" # "Wright, 1997" # "Mc Dougall et al." # "Jackett et al. 2006" # "TEOS 2010" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_functional_temp') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Potential temperature" # "Conservative temperature" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_functional_salt') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Practical salinity Sp" # "Absolute salinity Sa" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_functional_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pressure (dbars)" # "Depth (meters)" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.ocean_freezing_point') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "TEOS 2010" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.ocean_specific_heat') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.ocean_reference_density') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.reference_dates') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Present day" # "21000 years BP" # "6000 years BP" # "LGM" # "Pliocene" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.type') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.ocean_smoothing') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.source') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.nonoceanic_waters.isolated_seas') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.nonoceanic_waters.river_mouth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.range_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.is_adaptive_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.thickness_level_1') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.global_mean_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.regional_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.trend_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.scheme') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Energy" # "Enstrophy" # "Salt" # "Volume of ocean" # "Momentum" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.consistency_properties') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.corrected_conserved_prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.was_flux_correction_used') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.vertical.coordinates') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Z-coordinate" # "Z*-coordinate" # "S-coordinate" # "Isopycnic - sigma 0" # "Isopycnic - sigma 2" # "Isopycnic - sigma 4" # "Isopycnic - other" # "Hybrid / Z+S" # "Hybrid / Z+isopycnic" # "Hybrid / other" # "Pressure referenced (P)" # "P*" # "Z**" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.vertical.partial_steps') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.horizontal.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Lat-lon" # "Rotated north pole" # "Two north poles (ORCA-style)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.horizontal.staggering') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Arakawa B-grid" # "Arakawa C-grid" # "Arakawa E-grid" # "N/a" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.horizontal.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Finite difference" # "Finite volumes" # "Finite elements" # "Unstructured grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.diurnal_cycle') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Via coupling" # "Specific treatment" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.tracers.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Leap-frog + Asselin filter" # "Leap-frog + Periodic Euler" # "Predictor-corrector" # "Runge-Kutta 2" # "AM3-LF" # "Forward-backward" # "Forward operator" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.tracers.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.baroclinic_dynamics.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Preconditioned conjugate gradient" # "Sub cyling" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.baroclinic_dynamics.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Leap-frog + Asselin filter" # "Leap-frog + Periodic Euler" # "Predictor-corrector" # "Runge-Kutta 2" # "AM3-LF" # "Forward-backward" # "Forward operator" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.baroclinic_dynamics.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.barotropic.splitting') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "split explicit" # "implicit" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.barotropic.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.vertical_physics.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.momentum.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Flux form" # "Vector form" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.momentum.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.momentum.ALE') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.flux_limiter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.effective_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.passive_tracers') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Ideal age" # "CFC 11" # "CFC 12" # "SF6" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.passive_tracers_advection') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.vertical_tracers.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.vertical_tracers.flux_limiter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Eddy active" # "Eddy admitting" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.operator.direction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Horizontal" # "Isopycnal" # "Isoneutral" # "Geopotential" # "Iso-level" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.operator.order') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Harmonic" # "Bi-harmonic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.operator.discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Second order" # "Higher order" # "Flux limiter" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Space varying" # "Time + space varying (Smagorinsky)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.constant_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.variable_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.coeff_background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.coeff_backscatter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.mesoscale_closure') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.submesoscale_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.operator.direction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Horizontal" # "Isopycnal" # "Isoneutral" # "Geopotential" # "Iso-level" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.operator.order') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Harmonic" # "Bi-harmonic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.operator.discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Second order" # "Higher order" # "Flux limiter" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Space varying" # "Time + space varying (Smagorinsky)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.constant_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.variable_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.coeff_background') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.coeff_backscatter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "GM" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.constant_val') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.flux_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.added_diffusivity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.details.langmuir_cells_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure - TKE" # "Turbulent closure - KPP" # "Turbulent closure - Mellor-Yamada" # "Turbulent closure - Bulk Mixed Layer" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.closure_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure - TKE" # "Turbulent closure - KPP" # "Turbulent closure - Mellor-Yamada" # "Turbulent closure - Bulk Mixed Layer" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.closure_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.convection_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Non-penetrative convective adjustment" # "Enhanced vertical diffusion" # "Included in turbulence closure" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.tide_induced_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.double_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.shear_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure / TKE" # "Turbulent closure - Mellor-Yamada" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.profile') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure / TKE" # "Turbulent closure - Mellor-Yamada" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.profile') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.free_surface.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.free_surface.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Linear implicit" # "Linear filtered" # "Linear semi-explicit" # "Non-linear implicit" # "Non-linear filtered" # "Non-linear semi-explicit" # "Fully explicit" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.free_surface.embeded_seaice') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.type_of_bbl') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Diffusive" # "Acvective" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.lateral_mixing_coef') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.sill_overflow') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.surface_pressure') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.momentum_flux_correction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers_flux_correction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.wave_effects') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.river_runoff_budget') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.geothermal_heating') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.momentum.bottom_friction.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Linear" # "Non-linear" # "Non-linear (drag function of speed of tides)" # "Constant drag coefficient" # "None" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.momentum.lateral_friction.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Free-slip" # "No-slip" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.sunlight_penetration.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "1 extinction depth" # "2 extinction depth" # "3 extinction depth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.sunlight_penetration.ocean_colour') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.sunlight_penetration.extinction_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.fresh_water_forcing.from_atmopshere') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Freshwater flux" # "Virtual salt flux" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.fresh_water_forcing.from_sea_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Freshwater flux" # "Virtual salt flux" # "Real salt flux" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.fresh_water_forcing.forced_mode_restoring') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Model Family Step7: 1.4. Basic Approximations Step8: 1.5. Prognostic Variables Step9: 2. Key Properties --&gt; Seawater Properties Step10: 2.2. Eos Functional Temp Step11: 2.3. Eos Functional Salt Step12: 2.4. Eos Functional Depth Step13: 2.5. Ocean Freezing Point Step14: 2.6. Ocean Specific Heat Step15: 2.7. Ocean Reference Density Step16: 3. Key Properties --&gt; Bathymetry Step17: 3.2. Type Step18: 3.3. Ocean Smoothing Step19: 3.4. Source Step20: 4. Key Properties --&gt; Nonoceanic Waters Step21: 4.2. River Mouth Step22: 5. Key Properties --&gt; Software Properties Step23: 5.2. Code Version Step24: 5.3. Code Languages Step25: 6. Key Properties --&gt; Resolution Step26: 6.2. Canonical Horizontal Resolution Step27: 6.3. Range Horizontal Resolution Step28: 6.4. Number Of Horizontal Gridpoints Step29: 6.5. Number Of Vertical Levels Step30: 6.6. Is Adaptive Grid Step31: 6.7. Thickness Level 1 Step32: 7. Key Properties --&gt; Tuning Applied Step33: 7.2. Global Mean Metrics Used Step34: 7.3. Regional Metrics Used Step35: 7.4. Trend Metrics Used Step36: 8. Key Properties --&gt; Conservation Step37: 8.2. Scheme Step38: 8.3. Consistency Properties Step39: 8.4. Corrected Conserved Prognostic Variables Step40: 8.5. Was Flux Correction Used Step41: 9. Grid Step42: 10. Grid --&gt; Discretisation --&gt; Vertical Step43: 10.2. Partial Steps Step44: 11. Grid --&gt; Discretisation --&gt; Horizontal Step45: 11.2. Staggering Step46: 11.3. Scheme Step47: 12. Timestepping Framework Step48: 12.2. Diurnal Cycle Step49: 13. Timestepping Framework --&gt; Tracers Step50: 13.2. Time Step Step51: 14. Timestepping Framework --&gt; Baroclinic Dynamics Step52: 14.2. Scheme Step53: 14.3. Time Step Step54: 15. Timestepping Framework --&gt; Barotropic Step55: 15.2. Time Step Step56: 16. Timestepping Framework --&gt; Vertical Physics Step57: 17. Advection Step58: 18. Advection --&gt; Momentum Step59: 18.2. Scheme Name Step60: 18.3. ALE Step61: 19. Advection --&gt; Lateral Tracers Step62: 19.2. Flux Limiter Step63: 19.3. Effective Order Step64: 19.4. Name Step65: 19.5. Passive Tracers Step66: 19.6. Passive Tracers Advection Step67: 20. Advection --&gt; Vertical Tracers Step68: 20.2. Flux Limiter Step69: 21. Lateral Physics Step70: 21.2. Scheme Step71: 22. Lateral Physics --&gt; Momentum --&gt; Operator Step72: 22.2. Order Step73: 22.3. Discretisation Step74: 23. Lateral Physics --&gt; Momentum --&gt; Eddy Viscosity Coeff Step75: 23.2. Constant Coefficient Step76: 23.3. Variable Coefficient Step77: 23.4. Coeff Background Step78: 23.5. Coeff Backscatter Step79: 24. Lateral Physics --&gt; Tracers Step80: 24.2. Submesoscale Mixing Step81: 25. Lateral Physics --&gt; Tracers --&gt; Operator Step82: 25.2. Order Step83: 25.3. Discretisation Step84: 26. Lateral Physics --&gt; Tracers --&gt; Eddy Diffusity Coeff Step85: 26.2. Constant Coefficient Step86: 26.3. Variable Coefficient Step87: 26.4. Coeff Background Step88: 26.5. Coeff Backscatter Step89: 27. Lateral Physics --&gt; Tracers --&gt; Eddy Induced Velocity Step90: 27.2. Constant Val Step91: 27.3. Flux Type Step92: 27.4. Added Diffusivity Step93: 28. Vertical Physics Step94: 29. Vertical Physics --&gt; Boundary Layer Mixing --&gt; Details Step95: 30. Vertical Physics --&gt; Boundary Layer Mixing --&gt; Tracers Step96: 30.2. Closure Order Step97: 30.3. Constant Step98: 30.4. Background Step99: 31. Vertical Physics --&gt; Boundary Layer Mixing --&gt; Momentum Step100: 31.2. Closure Order Step101: 31.3. Constant Step102: 31.4. Background Step103: 32. Vertical Physics --&gt; Interior Mixing --&gt; Details Step104: 32.2. Tide Induced Mixing Step105: 32.3. Double Diffusion Step106: 32.4. Shear Mixing Step107: 33. Vertical Physics --&gt; Interior Mixing --&gt; Tracers Step108: 33.2. Constant Step109: 33.3. Profile Step110: 33.4. Background Step111: 34. Vertical Physics --&gt; Interior Mixing --&gt; Momentum Step112: 34.2. Constant Step113: 34.3. Profile Step114: 34.4. Background Step115: 35. Uplow Boundaries --&gt; Free Surface Step116: 35.2. Scheme Step117: 35.3. Embeded Seaice Step118: 36. Uplow Boundaries --&gt; Bottom Boundary Layer Step119: 36.2. Type Of Bbl Step120: 36.3. Lateral Mixing Coef Step121: 36.4. Sill Overflow Step122: 37. Boundary Forcing Step123: 37.2. Surface Pressure Step124: 37.3. Momentum Flux Correction Step125: 37.4. Tracers Flux Correction Step126: 37.5. Wave Effects Step127: 37.6. River Runoff Budget Step128: 37.7. Geothermal Heating Step129: 38. Boundary Forcing --&gt; Momentum --&gt; Bottom Friction Step130: 39. Boundary Forcing --&gt; Momentum --&gt; Lateral Friction Step131: 40. Boundary Forcing --&gt; Tracers --&gt; Sunlight Penetration Step132: 40.2. Ocean Colour Step133: 40.3. Extinction Depth Step134: 41. Boundary Forcing --&gt; Tracers --&gt; Fresh Water Forcing Step135: 41.2. From Sea Ice Step136: 41.3. Forced Mode Restoring
11,950
<ASSISTANT_TASK:> Python Code: a = [i*i for i in range(3)] a b = a b[1] = 'hello' b a a = [i*i for i in range(3)] a b = a[:] b[1] = 'hello' b a a = [i*i for i in range(3)] a b = a.copy() b[1] = 'hello' b a def foo(s): return s + ' on the Beach.' list(map(foo, ('sand', 'clams', 'dunes'))) a = (1, 2, 3) b = (2, 3, 4, 5) from itertools import zip_longest sum(map(sum, zip_longest(a, b, fillvalue=0))) sum((sum(a), sum(b))) sum(a + b) f'hello {sum(map(sum, zip_longest(a, b, fillvalue=0)))} world' <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Show what map() does. Step2: fstrings can handle expressions, not just variable names.
11,951
<ASSISTANT_TASK:> Python Code: import sys print(sys.version) import numpy as np np.__version__ import matplotlib as mpl from matplotlib import pyplot as plt mpl.__version__ values = np.zeros((2,50)) size = values.shape print(size) for i in range(size[1]): values[0,i] = i * 2 values[1,i] = np.sin(i / 2) print(values) np.save('np_file.npy', values) np.savetxt('txt_file.txt', np.transpose(values)) values_from_text = np.loadtxt("txt_file.txt") values_from_np = np.load("np_file.npy") print(values_from_text[0,0] == values_from_np[0,0]) print(values_from_text) values = values_from_text print(values.shape) x_0 = values[0] print(x_0) x_1 = values[:,0] print(x_1) y_1 = values[:,1] print(y_1) fig = plt.figure() plt.plot(x_1, y_1) plt.show() indices = [5,10, 15 ,20] x = values[indices,0] print(x) y = values[indices,1] print(y) fig = plt.figure() plt.plot(x, y) plt.show() indices = np.where(values[:,1] > -0.5)[0] print("indices: ",indices) x = values[indices,0] print("x: ",x) y = values[indices,1] print("y: ",y) fig = plt.figure() plt.plot(x, y) plt.show() to_sort = np.random.rand(10) print(to_sort) to_sort.sort() print(to_sort) to_sort = np.random.rand(2,10) print(to_sort) to_sort.sort(axis=1) print(to_sort) to_sort = np.random.rand(3,10) print(to_sort) #investigate the axis we want to sort after print("The axis to sort: \n",to_sort[1]) sort_indices = to_sort[1].argsort() print("The indexes after the sort: \n",sort_indices) #proceed the sort using the slicing method we just introduced to_sort = to_sort[:,sort_indices] print("The sorted full array:\n ",to_sort) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: At this point anything above python 3.5 should be ok. Step2: Notes Step3: Notes Step4: Notes Step5: Notes Step6: Notes Step7: Notes Step8: Notes Step9: Notes Step10: Notes
11,952
<ASSISTANT_TASK:> Python Code: import numpy as np import matplotlib.pyplot as plt import seaborn %matplotlib inline x = np.linspace(-6, 6, num = 1000) plt.figure(figsize = (12,8)) plt.plot(x, 1 / (1 + np.exp(-x))); # Sigmoid Function plt.title("Sigmoid Function"); tmp = [0, 0.4, 0.6, 0.8, 1.0] tmp np.round(tmp) np.array(tmp) > 0.7 dataset = [[-2.0011, 0], [-1.4654, 0], [0.0965, 0], [1.3881, 0], [3.0641, 0], [7.6275, 1], [5.3324, 1], [6.9225, 1], [8.6754, 1], [7.6737, 1]] coef = [-0.806605464, 0.2573316] for row in dataset: yhat = 1.0 / (1.0 + np.exp(- coef[0] - coef[1] * row[0])) print("yhat {0:.4f}, yhat {1}".format(yhat, round(yhat))) from sklearn.linear_model import LogisticRegression dataset X = np.array(dataset)[:, 0:1] y = np.array(dataset)[:, 1] X y clf_LR = LogisticRegression(C=1.0, penalty='l2', tol=0.0001) clf_LR.fit(X,y) clf_LR.predict(X) clf_LR.predict_proba(X) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The logistic regression equation has a very simiar representation like linear regression. The difference is that the output value being modelled is binary in nature. Step2: Making Predictions with Logistic Regression Step3: Let's say you have been provided with the coefficient Step4: Learning the Logistic Regression Model
11,953
<ASSISTANT_TASK:> Python Code: import pandas import numpy import toyplot import toyplot.pdf import toyplot.png import toyplot.svg print('Pandas version: ', pandas.__version__) print('Numpy version: ', numpy.__version__) print('Toyplot version: ', toyplot.__version__) column_names = ['MPG', 'Cylinders', 'Displacement', 'Horsepower', 'Weight', 'Acceleration', 'Model Year', 'Origin', 'Car Name'] data = pandas.read_table('auto-mpg.data', delim_whitespace=True, names=column_names, index_col=False) country_map = pandas.Series(index=[1,2,3], data=['USA', 'Europe', 'Japan']) data['Origin'] = numpy.array(country_map[data['Origin']]) average_mpg_per_year = data.pivot_table(index='Model Year', columns='Origin', values='MPG', aggfunc='mean') average_mpg_per_year average_mpg_per_year.columns canvas = toyplot.Canvas('4in', '2.6in') axes = canvas.cartesian(bounds=(41,-1,6,-43), xlabel = 'Model Year', ylabel = 'Average MPG') for column in country_map: series = average_mpg_per_year[column] x = series.index + 1900 y = numpy.array(series) axes.plot(x, y) axes.text(x[-1], y[-1], column, style={"text-anchor":"start", "-toyplot-anchor-shift":"2px"}) # It's usually best to make the y-axis 0-based. axes.y.domain.min = 0 # Toyplot is sometimes inaccurate in judging the width of labels. axes.x.domain.max = 1984 # The labels can make for odd tick placement. # Place them manually axes.x.ticks.locator = \ toyplot.locator.Explicit([1970,1974,1978,1982]) toyplot.pdf.render(canvas, 'MultiSeries.pdf') toyplot.svg.render(canvas, 'MultiSeries.svg') toyplot.png.render(canvas, 'MultiSeries.png', scale=5) average_mpg_per_year.to_csv('auto-mpg-origin-year.csv') canvas = toyplot.Canvas('4in', '2.6in') axes = canvas.cartesian(bounds=(41,-1,6,-43), xlabel = 'Model Year', ylabel = 'Average MPG') for column in ['Europe', 'Japan', 'USA']: series = average_mpg_per_year[column] x = series.index + 1900 y = numpy.array(series) axes.plot(x, y) axes.text(x[-1], y[-1], column, style={"text-anchor":"start", "-toyplot-anchor-shift":"2px"}) # It's usually best to make the y-axis 0-based. axes.y.domain.min = 0 # Toyplot is sometimes inaccurate in judging the width of labels. axes.x.domain.max = 1984 # The labels can make for odd tick placement. # Place them manually axes.x.ticks.locator = \ toyplot.locator.Explicit([1970,1974,1978,1982]) toyplot.pdf.render(canvas, 'MultiSeries_Inconsistent_Colors.pdf') toyplot.svg.render(canvas, 'MultiSeries_Inconsistent_colors.svg') toyplot.png.render(canvas, 'MultiSeries_Inconsistent_colors.png', scale=5) canvas = toyplot.Canvas('4in', '2.6in') axes = canvas.cartesian(bounds=(41,-1,6,-43), xlabel = 'Model Year', ylabel = 'Average MPG') # Create some grid lines. (Not a great idea.) axes.hlines(xrange(0,41,5), color='black') axes.vlines(xrange(1970,1983), color='black') for column in country_map: series = average_mpg_per_year[column] x = series.index + 1900 y = numpy.array(series) axes.plot(x, y) axes.text(x[-1], y[-1], column, style={"text-anchor":"start", "-toyplot-anchor-shift":"2px"}) # It's usually best to make the y-axis 0-based. axes.y.domain.min = 0 # Toyplot is sometimes inaccurate in judging the width of labels. axes.x.domain.max = 1984 # The labels can make for odd tick placement. # Place them manually axes.x.ticks.locator = \ toyplot.locator.Explicit([1970,1974,1978,1982]) toyplot.pdf.render(canvas, 'MultiSeries_Grid_Dark.pdf') toyplot.svg.render(canvas, 'MultiSeries_Grid_Dark.svg') toyplot.png.render(canvas, 'MultiSeries_Grid_Dark.png', scale=5) canvas = toyplot.Canvas('4in', '2.6in') axes = canvas.cartesian(bounds=(41,-1,6,-43), xlabel = 'Model Year', ylabel = 'Average MPG') # Create some grid lines. (Not a great idea.) axes.hlines(xrange(0,41,5), color='lightgray') axes.vlines(xrange(1970,1983), color='lightgray') for column in country_map: series = average_mpg_per_year[column] x = series.index + 1900 y = numpy.array(series) axes.plot(x, y) axes.text(x[-1], y[-1], column, style={"text-anchor":"start", "-toyplot-anchor-shift":"2px"}) # It's usually best to make the y-axis 0-based. axes.y.domain.min = 0 axes.x.domain.max = 1984 # The labels can make for odd tick placement. # Place them manually axes.x.ticks.locator = \ toyplot.locator.Explicit([1970,1974,1978,1982]) toyplot.pdf.render(canvas, 'MultiSeries_Grid_Light.pdf') toyplot.svg.render(canvas, 'MultiSeries_Grid_Light.svg') toyplot.png.render(canvas, 'MultiSeries_Grid_Light.png', scale=5) canvas = toyplot.Canvas('4in', '2.6in') axes = canvas.cartesian(bounds=(41,-1,6,-43), xlabel = 'Model Year', ylabel = 'Average MPG') # Create some grid lines. (Not a great idea.) axes.hlines(xrange(0,41,10), color='lightgray') for column in country_map: series = average_mpg_per_year[column] x = series.index + 1900 y = numpy.array(series) axes.plot(x, y) axes.text(x[-1], y[-1], column, style={"text-anchor":"start", "-toyplot-anchor-shift":"2px"}) # It's usually best to make the y-axis 0-based. axes.y.domain.min = 0 axes.x.domain.max = 1984 # The labels can make for odd tick placement. # Place them manually axes.x.ticks.locator = \ toyplot.locator.Explicit([1970,1974,1978,1982]) toyplot.pdf.render(canvas, 'MultiSeries_Grid_Light_Fewer.pdf') toyplot.svg.render(canvas, 'MultiSeries_Grid_Light_Fewer.svg') toyplot.png.render(canvas, 'MultiSeries_Grid_Light_Fewer.png', scale=5) canvas = toyplot.Canvas('4in', '2.6in') axes = canvas.cartesian(bounds=(41,-11,6,-43), xlabel = 'Model Year', ylabel = 'Average MPG') marks = {} for column in country_map: series = average_mpg_per_year[column] x = series.index + 1900 y = numpy.array(series) marks[column] = axes.plot(x, y) # It's usually best to make the y-axis 0-based. axes.y.domain.min = 0 # The labels can make for odd tick placement. # Place them manually axes.x.ticks.locator = \ toyplot.locator.Explicit([1970,1974,1978,1982]) canvas.legend([('USA', marks['USA']), ('Europe', marks['Europe']), ('Japan', marks['Japan'])], rect=('-1in', '-1.25in', '1in', '0.75in')) toyplot.pdf.render(canvas, 'Legend_Backward.pdf') toyplot.svg.render(canvas, 'Legend_Backward.svg') toyplot.png.render(canvas, 'Legend_Backward.png', scale=5) canvas = toyplot.Canvas('4in', '2.6in') axes = canvas.cartesian(bounds=(41,-11,6,-43), xlabel = 'Model Year', ylabel = 'Average MPG') marks = {} for column in country_map: series = average_mpg_per_year[column] x = series.index + 1900 y = numpy.array(series) marks[column] = axes.plot(x, y) # It's usually best to make the y-axis 0-based. axes.y.domain.min = 0 # The labels can make for odd tick placement. # Place them manually axes.x.ticks.locator = \ toyplot.locator.Explicit([1970,1974,1978,1982]) canvas.legend([('Europe', marks['Europe']), ('Japan', marks['Japan']), ('USA', marks['USA'])], rect=('-1in', '-1.25in', '1in', '0.75in')) toyplot.pdf.render(canvas, 'Legend_OK.pdf') toyplot.svg.render(canvas, 'Legend_OK.svg') toyplot.png.render(canvas, 'Legend_OK.png', scale=5) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load in the "auto" dataset. This is a fun collection of data on cars manufactured between 1970 and 1982. The source for this data can be found at https Step2: The origin column indicates the country of origin for the car manufacture. It has three numeric values, 1, 2, or 3. These indicate USA, Europe, or Japan, respectively. Replace the origin column with a string representing the country name. Step3: In this plot we are going to show the trend of the average miles per gallon (MPG) rating for subsequent model years separated by country of origin. This time period saw a significant increase in MPG driven by the U.S. fuel crisis. We can use the pivot_table feature of pandas to get this information from the data. (Excel and other spreadsheets have similar functionality.) Step4: Now use toyplot to plot this trend on a standard x-y chart. Step5: For the talk, I want to compare this to using a 3D plot. Toyplot does not yet have such silly plot capabilities, so write out the results of this pivot table to csv so we can easily load it into Excel. Step6: In one of my counterexamples, I remind the audiance to make colors consistent. Make a plot with inconsistent colors. Step7: I make a point that it is a bad idea to clutter up the canvas with non-data items like grid lines. Create a counter example that has lots of distracting lines. Step8: If you really want gridlines, you should make them very subtle so they don't interfere with the actual data. Step9: Frankly, vertical gridlines are usually not all that necessary. If you remove them, less clutter. Not going overboard on horizontal lines is also good. Step10: I personally find grid lines a bit overrated. Don't fear not having grid lines at all, as in the first example. Step11: Do it again, but at least order the legend correctly.
11,954
<ASSISTANT_TASK:> Python Code: devices = factorial_hmm.gen_devices() T = 50 np.random.seed(20) X, Y = factorial_hmm.gen_dataset(devices, T) plt.figure(figsize=(15,3.5)) plt.plot(Y) plt.figure(figsize=(15,10)) plt.imshow((X*devices).T, interpolation='None', aspect=1); plt.yticks(np.arange(len(devices)), devices); print len(devices), 2**len(devices) trace_train = [] trace_validation = [] dist_est = cde.ConditionalBinaryMADE(len(devices)+1, len(devices), H=300, num_layers=4) if USE_GPU: dist_est.cuda() dist_est.load_state_dict(torch.load('../saved/trained_hmm_params.rar')) X_hat_bootstrap, ancestry_bootstrap, ESS_bootstrap = \ factorial_hmm.run_smc(devices, Y, 500, factorial_hmm.baseline_proposal, verbose=False) Y_hat_bootstrap = np.dot(X_hat_bootstrap, devices) nn_proposal = factorial_hmm.make_nn_proposal(dist_est) X_hat_nn, ancestry_nn, ESS_nn = \ factorial_hmm.run_smc(devices, Y, 500, nn_proposal, verbose=False) Y_hat_nn = np.dot(X_hat_nn, devices) plt.hist(ESS_bootstrap, histtype='stepfilled', linewidth=2, alpha=0.5, bins=20,edgeColor='k') plt.hist(ESS_nn, histtype='stepfilled', linewidth=2, alpha=0.5, bins=20,edgeColor='k') plt.xlim([0,plt.xlim()[1]]) plt.legend(['bootstrap', 'nnsmc']) plt.title('Histogram of effective sample size of SMC filtering distribution'); plt.figure(figsize=(16,4)) plt.title('Ancestral paths for bootstrap proposals (blue) and nn (green)') plt.plot(ancestry_bootstrap.T, color=sns.color_palette()[0]); plt.plot(ancestry_nn.T, color=sns.color_palette()[1]); plt.ylim(0,ancestry_nn.shape[0]) plt.xlim(0,T-1); plt.figure(figsize=(14,3.25)) plt.plot(np.dot(X_hat_nn, devices).T, color=sns.color_palette()[1], alpha=0.1) plt.plot(np.arange(len(Y)), Y,'k--') plt.xlim([0,T-1]) plt.xlabel('Time step') plt.ylabel('Total energy usage') ANC_PRIOR = [] ANC_NN = [] def count_uniques(ancestry): K, T = ancestry.shape counts = np.empty((T,), dtype=int) for t in xrange(T): counts[t] = len(np.unique(ancestry[:,t])) return counts def run_iter(): X,Y = factorial_hmm.gen_dataset(devices, T=30) X_particles_baseline, ancestry_baseline, _ = \ factorial_hmm.run_smc(devices, Y, 100, factorial_hmm.baseline_proposal, verbose=False) print "smc complete" X_particles, ancestry_nnsmc, _ = \ factorial_hmm.run_smc(devices, Y, 500, nn_proposal, verbose=False) print "nn complete" ANC_PRIOR.append(count_uniques(ancestry_baseline)) ANC_NN.append(count_uniques(ancestry_nnsmc)) return X,Y for i in xrange(10): print "iteration", i+1 X_tmp, Y_tmp = run_iter() plt.figure(figsize=(8,3.5)) plt.plot(np.arange(len(X_tmp)), np.mean(ANC_PRIOR, 0)); plt.plot(np.arange(len(X_tmp)), np.mean(ANC_NN, 0)); plt.legend(['Bootstrap SMC', 'NN-SMC'], loc='upper left') pm = np.mean(ANC_PRIOR, 0) psd = np.std(ANC_PRIOR, 0) safe_lb = (pm - psd) * (pm - psd > 1.0) + (pm - psd <= 1.0) plt.fill_between(np.arange(len(X_tmp)), safe_lb, pm+psd, alpha=0.25, color=sns.color_palette()[0]); pm = np.mean(ANC_NN, 0) psd = np.std(ANC_NN, 0) plt.fill_between(np.arange(len(X_tmp)), pm-psd, pm+psd, alpha=0.25, color=sns.color_palette()[1]); plt.semilogy(); plt.xlabel('Time step') plt.ylabel('Surviving paths') plt.ylim(1, 100) plt.xlim(0, len(X_tmp)-1) plt.tight_layout() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Test out learned distribution inside of SMC Step2: Look at rate of path coalescence
11,955
<ASSISTANT_TASK:> Python Code: #!pip install -I "phoebe>=2.3,<2.4" import phoebe from phoebe import u # units import numpy as np import matplotlib.pyplot as plt #logger = phoebe.logger('error') b = phoebe.default_binary() print(b['irrad_frac_refl_bol']) print(b['irrad_frac_lost_bol']) print(b['irrad_frac_refl_bol@primary']) print(b['irrad_frac_lost_bol@primary@component']) b.set_value_all('irrad_frac_refl_bol', 0.9) print(b['irrad_method@compute']) b['sma@orbit'] = 4.0 b['teff@primary'] = 10000 b['teff@secondary'] = 5000 b.add_dataset('lc', times=np.linspace(0,1,101)) b.run_compute(irrad_method='none', ntriangles=700, model='refl_false') b.run_compute(irrad_method='wilson', ntriangles=700, model='refl_true') afig, mplfig = b.plot(show=True, legend=True) artists = plt.plot(b['value@times@refl_false'], b['value@fluxes@refl_true']-b['value@fluxes@refl_false'], 'r-') b.add_dataset('mesh', times=[0.2], columns=['teffs', 'intensities@lc01']) b.disable_dataset('lc01') b.run_compute(irrad_method='none', ntriangles=700, model='refl_false', overwrite=True) b.run_compute(irrad_method='wilson', ntriangles=700, model='refl_true', overwrite=True) #phoebe.logger('debug') afig, mplfig = b.plot(component='secondary', kind='mesh', model='refl_false', fc='intensities', ec='face', draw_sidebars=True, show=True) afig, mplfig = b.plot(component='secondary', kind='mesh', model='refl_true', fc='intensities', ec='face', draw_sidebars=True, show=True) afig, mplfig = b.plot(component='secondary', kind='mesh', model='refl_false', fc='teffs', ec='face', draw_sidebars=True, show=True) afig, mplfig = b.plot(component='secondary', kind='mesh', model='refl_true', fc='teffs', ec='face', draw_sidebars=True, show=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: As always, let's do imports and initialize a logger and a new bundle. Step2: Relevant Parameters Step3: In order to see the effect of reflection, let's set "irrad_frac_refl_bol" of both of our stars to 0.9 - that is 90% of the incident flux will go towards reflection and 10% will be ignored. Step4: Since reflection can be a computationally expensive process and in most cases is a low-order effect, there is a switch in the compute options that needs to be enabled in order for reflection to be taken into account. If this switch is False (which it is by default), the albedos are completely ignored and will be treated as if all incident light is lost/ignored. Step5: Reflection has the most noticeable effect when the two stars are close to each other and have a large temperature ratio. Step6: Influence on Light Curves (fluxes) Step7: Let's run models with the reflection switch both turned on and off so that we can compare the two results. We'll also override delta to be a larger number since the computation time required by delta depends largely on the number of surface elements. Step8: Influence on Meshes (Intensities)
11,956
<ASSISTANT_TASK:> Python Code: from PyDSTool import * icdict = {'x': 1, 'y': 0.4} # Initial conditions dictonnary pardict = {'k': 0.1, 'm': 0.5} # Parameters values dictionnary x_rhs = 'y' y_rhs = '-k*x/m' vardict = {'x': x_rhs, 'y': y_rhs} DSargs = args() # create an empty object instance of the args class, call it DSargs DSargs.name = 'SHM' # name our model DSargs.ics = icdict # assign the icdict to the ics attribute DSargs.pars = pardict # assign the pardict to the pars attribute DSargs.tdata = [0, 20] # declare how long we expect to integrate for DSargs.varspecs = vardict # assign the vardict dictionary to the 'varspecs' attribute of DSargs DS = Generator.Vode_ODEsystem(DSargs) help(DS ) DS.set(pars={'k': 0.3}, ics={'x': 0.4}) traj = DS.compute('demo') pts = traj.sample() %matplotlib inline plt.plot(pts['t'], pts['x'], label='x') plt.plot(pts['t'], pts['y'], label='y') plt.legend() plt.xlabel('t') def KE(pts): return 0.5*DS.pars['m']*pts['y']**2 def PE(pts): return 0.5*DS.pars['k']*pts['x']**2 total_energy = KE(pts) + PE(pts) print (total_energy) KE(traj(5.4)) # At time 5.4 pts.find(5.4) import PyDSTool as dst # Give a name to the package import numpy as np from matplotlib import pyplot as plt # we must give a name DSargs = dst.args(name='Calcium channel model') # parameters DSargs.pars = { 'vl': -60, 'vca': 120, 'i': 0, 'gl': 2, 'gca': 4, 'c': 20, 'v1': -1.2, 'v2': 18 } # auxiliary helper function(s) -- function name: ([func signature], definition) DSargs.fnspecs = {'minf': (['v'], '0.5 * (1 + tanh( (v-v1)/v2 ))') } # rhs of the differential equation, including dummy variable w DSargs.varspecs = {'v': '( i + gl * (vl - v) - gca * minf(v) * (v-vca) )/c', 'w': 'v-w' } # initial conditions DSargs.ics = {'v': 0, 'w': 0 } DSargs.tdomain = [0,30] # set the range of integration. ode = dst.Generator.Vode_ODEsystem(DSargs) # an instance of the 'Generator' class. traj = ode.compute('polarization') # integrate ODE with trajectory name : polarization / use print (traj.info(1)) to obtian the info pts = traj.sample(dt=0.1) # Data for plotting # PyPlot commands plt.plot(pts['t'], pts['v']) plt.xlabel('time') # Axes labels plt.ylabel('voltage') # ... plt.ylim([0,65]) # Range of the y axis plt.title(ode.name) # Figure title from model name plt.show() plt.clf() # Clear the figure for i, v0 in enumerate(np.linspace(-80,80,20)): ode.set( ics = { 'v': v0 } ) # Initial condition # Trajectories are called pol0, pol1, ... # sample them on the fly to create Pointset tmp tmp = ode.compute('pol%3i' % i).sample() # or specify dt option to sample to sub-sample plt.plot(tmp['t'], tmp['v']) plt.xlabel('time') plt.ylabel('voltage') plt.title(ode.name + ' multi ICs') plt.show() # Prepare the system to start close to a steady state ode.set(pars = {'i': -220} ) # Lower bound of the control parameter 'i' ode.set(ics = {'v': -170} ) # Close to one of the steady states present for i=-220 PC = dst.ContClass(ode) # Set up continuation class PCargs = dst.args(name='EQ1', type='EP-C') # 'EP-C' stands for Equilibrium Point Curve. The branch will be labeled 'EQ1'. PCargs.freepars = ['i'] # control parameter(s) (it should be among those specified in DSargs.pars) PCargs.MaxNumPoints = 450 # The following 3 parameters are set after trial-and-error PCargs.MaxStepSize = 2 PCargs.MinStepSize = 1e-5 PCargs.StepSize = 2e-2 PCargs.LocBifPoints = 'LP' # detect limit points / saddle-node bifurcations PCargs.SaveEigen = True # to tell unstable from stable branches PC.newCurve(PCargs) PC['EQ1'].forward() # Forward because we look for t>0 PC.display(['i','v'], stability=True, figure=3) # stable and unstable branches as solid and dashed curves, resp. PCargs = dst.args(name='SN1', type='LP-C') PCargs.initpoint = 'EQ1:LP2' PCargs.freepars = ['i', 'gca'] PCargs.MaxStepSize = 2 PCargs.LocBifPoints = ['CP'] PCargs.MaxNumPoints = 200 PC.newCurve(PCargs) PC['SN1'].forward() PC['SN1'].backward() PC['SN1'].display(['i','gca'], figure=4) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: First we need to declare a name that we will use for the dictionnary containing initial conditions for two variables. In the same way we need to define a dictionary for all the parameters. This leads to the following code Step2: The next step is to define the vector field of the system. Or in other words the right-hand sides of the differential equation. Step3: Those two lines are particular. They assign strings to two names. The strings happen to use name that we have mentioned already and the name we assigned where only to remeber us which string belong to which variables. Now we need to tell which variables are dynamic, with the dynamic of the string that the variable maps to. Step4: Now we need to construct the full model for PyDSTool. To do this we will need to call the 'args' class of PyDSTool Step5: All the details of this class can be found here Step6: We can interact in many ways with DS objects. In order to show all the things we can do, we can use the function 'help'. Step7: If we want to change the parameters of the ODE, we need to be careful and use the already written function. If we change it directly we could mess with the related values of other parameters. Step8: Now we can finally solve the system and obtain a trajectory http Step9: Just to finish this part, we will see how to run scripts on a DS object it order to measure quantities from the simulation. Step10: This code highlights the utility of the 'trajectory' object. We can use this object as a parametric function. Indeed it interpolates between independent variables automatically. In our example $5.4$ was not in the 'time set'. Step11: A bit further Step12: Like before we use a Generator in order to find the solution of the dynamical system. We can just note that $w$ in the code is jsut a dummy variable necessary to this version of PyDSTool (need two variables). Step13: The equation we used is bistable. One way to highlight this is with the following code Step14: We will now be interested in the bifurcation diagram and the nonlinear study, that are the main point of this package. Step15: The 'LocBifPoints' attributes tells PyCont what type of bifurcation should be tracked. In this example, because we now the result we specify that only saddle-node bifurcation should be detected. We can then compute this diagram Step16: PC['EQ1'] now consists of a "struct" data type that specifies the particular equilibrium curve we prepared the system for. The information of the equilibrium curve can be accessed via the 'info()' method. We can obtain detailed information about a particular special point calling the 'getSpecialPoint' method.
11,957
<ASSISTANT_TASK:> Python Code: import pandas #create a dataframe called "df" df = pandas.read_csv("BDHSI2016_music_reviews.csv", sep = '\t') ##I'm going to do a pre-processing step to remove digits in the text, for analytical purposes. ##If you don't understand this code right now it's ok. But challenge yourself to make sense of it! df['body'] = df['body'].apply(lambda x: ''.join([i for i in x if not i.isdigit()])) #view the dataframe #notice the metadata. The column "body" contains our text of interest. df ## Review Ex: Think back to yesterday's tutorial on Pandas. ###Use the dataframe slicing methods to print the full text of the first review. df.describe() df['score'].max() ##EX: Print the mean and the standard deviation for the score column. df['genre'].value_counts() ##EX: Print the most frequent reviewers and artists in the dataframe. #create a groupby dataframe grouped by genre df_genres = df.groupby("genre") #What kind of object is df_genres? Let's find out. df_genres #calculate the mean score by genre, print out the results df_genres['score'].mean().sort_values(ascending=False) ##EX: Print the maximum score for each genre. ##Bonus EX: Find the artist with the highest average score. Find the artist with the lowest average score. #import the function CountVectorizer from sklearn.feature_extraction.text import CountVectorizer countvec = CountVectorizer() #fit and transform our text into a DTM. Ask me about what this code does... sklearn_dtm = countvec.fit_transform(df.body) print(sklearn_dtm) print(countvec.get_feature_names()[:10]) ##EX: What word is indicated by the first row of the DTM printed above? ###Hint: Think back to the tutorial on lists, and how to slice a list. #we do the same as we did above, but covert it into a Pandas dataframe #Don't worry about understanding every line of this code dtm_df = pandas.DataFrame(countvec.fit_transform(df.body).toarray(), columns=countvec.get_feature_names(), index = df.index) #view the dtm dataframe dtm_df dtm_df.sum().sort_values(ascending=False) ##Ex: print the average number of times each word is used in a review #Print this out sorted from highest to lowest. #import the function from sklearn.feature_extraction.text import TfidfVectorizer #define out tfidfvec object tfidfvec = TfidfVectorizer() #create the dtm, but with cells weigthed by the tf-idf score. dtm_tfidf_df = pandas.DataFrame(tfidfvec.fit_transform(df.body).toarray(), columns=tfidfvec.get_feature_names(), index = df.index) #view results dtm_tfidf_df dtm_tfidf_df.max().sort_values(ascending=False)[0:20] #creat dataset with document index and genre #firs make a copy of our dtm_tfidf_df dtm_tfidf_df_genre = dtm_tfidf_df #add a GENRE column to it. Why am I making the name of the column GENRE and no genre? dtm_tfidf_df_genre['GENRE'] = df['genre'] dtm_tfidf_df_genre groupby_dtm_genre = dtm_tfidf_df_genre.groupby('GENRE').max() groupby_dtm_genre #sort the values in the Indie column. groupby_dtm_genre.loc['Indie'].sort_values(ascending=False) ##EX: do the same for Rap and Jazz genres. Compare the most distinctive words. What do you notice? <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1. Explore the Data using Pandas Step2: You can see that this provides summary statistics for numerical columns. In our case, our only numerical column is score. We can access each of these summaries statistics separately, using Pandas built-in functions. For example, we can get the max score using the syntax DataFrame[Column Name].max() Step3: What about the other columns? The columns that contain strings, not numbers? One way we can summarize these columns is by counting the unique string values in the column. We can do this using the DataFrame.value_counts() function. Step4: Groupby Step5: We now have a pandas object. We can perform most of the in-built Pandas functions on this object, but we'll see slightly different output than what we saw with a dataframe object. Step6: How is this output different that the previous time we used the DataFrame.mean() function? Step7: 2. Creating the DTM Step8: This format is called Compressed Sparse Format. How do we know what each number indicates? We can access the words themselves through the CountVectorizer function get_feature_names. Step9: It save a lot of memory to store the dtm in this format, but it is difficult to look at for a human. To illustrate the techniques in this lesson we will first convert this matrix back to a Pandas dataframe, a format we're more familiar with. For larger datasets, you will have to use the Compressed Sparse Format. Putting it into a DataFrame, however, will enable us to get more comfortable with Pandas! Step10: 3. What can we do with a DTM? Step11: We'll see further stuff we can do with a DTM in days to come. Because it is in the format of a matrix, we can perform any matrix algebra or vector manipulation on it, which enables some pretty exciting things (think vector space and Euclidean geometry). But, what do we lose when we reprsent text in this format? Step12: It's still mostly zeros. Let's look at the 20 words with highest tf-idf weights. Step13: Ok! We have successfully identified content words, without removing stop words. What else do you notice about this list? Step14: Now lets compare the words with the highest tf-idf weight for each genre.
11,958
<ASSISTANT_TASK:> Python Code: %pylab inline %matplotlib inline # import all Shogun classes from modshogun import * # use scipy for generating samples from scipy.stats import norm, laplace def sample_gaussian_vs_laplace(n=220, mu=0.0, sigma2=1, b=sqrt(0.5)): # sample from both distributions X=norm.rvs(size=n, loc=mu, scale=sigma2) Y=laplace.rvs(size=n, loc=mu, scale=b) return X,Y mu=0.0 sigma2=1 b=sqrt(0.5) n=220 X,Y=sample_gaussian_vs_laplace(n, mu, sigma2, b) # plot both densities and histograms figure(figsize=(18,5)) suptitle("Gaussian vs. Laplace") subplot(121) Xs=linspace(-2, 2, 500) plot(Xs, norm.pdf(Xs, loc=mu, scale=sigma2)) plot(Xs, laplace.pdf(Xs, loc=mu, scale=b)) title("Densities") xlabel("$x$") ylabel("$p(x)$") _=legend([ 'Gaussian','Laplace']) subplot(122) hist(X, alpha=0.5) xlim([-5,5]) ylim([0,100]) hist(Y,alpha=0.5) xlim([-5,5]) ylim([0,100]) legend(["Gaussian", "Laplace"]) _=title('Histograms') print "Gaussian vs. Laplace" print "Sample means: %.2f vs %.2f" % (mean(X), mean(Y)) print "Samples variances: %.2f vs %.2f" % (var(X), var(Y)) # turn data into Shogun representation (columns vectors) feat_p=RealFeatures(X.reshape(1,len(X))) feat_q=RealFeatures(Y.reshape(1,len(Y))) # choose kernel for testing. Here: Gaussian kernel_width=1 kernel=GaussianKernel(10, kernel_width) # create mmd instance of test-statistic mmd=QuadraticTimeMMD(kernel, feat_p, feat_q) # compute biased and unbiased test statistic (default is unbiased) mmd.set_statistic_type(BIASED) biased_statistic=mmd.compute_statistic() mmd.set_statistic_type(UNBIASED) unbiased_statistic=mmd.compute_statistic() print "%d x MMD_b[X,Y]^2=%.2f" % (len(X), biased_statistic) print "%d x MMD_u[X,Y]^2=%.2f" % (len(X), unbiased_statistic) # this is not necessary as bootstrapping is the default mmd.set_null_approximation_method(PERMUTATION) mmd.set_statistic_type(UNBIASED) # to reduce runtime, should be larger practice mmd.set_num_null_samples(100) # now show a couple of ways to compute the test # compute p-value for computed test statistic p_value=mmd.compute_p_value(unbiased_statistic) print "P-value of MMD value %.2f is %.2f" % (unbiased_statistic, p_value) # compute threshold for rejecting H_0 for a given test power alpha=0.05 threshold=mmd.compute_threshold(alpha) print "Threshold for rejecting H0 with a test power of %.2f is %.2f" % (alpha, threshold) # performing the test by hand given the above results, note that those two are equivalent if unbiased_statistic>threshold: print "H0 is rejected with confidence %.2f" % alpha if p_value<alpha: print "H0 is rejected with confidence %.2f" % alpha # or, compute the full two-sample test directly # fixed test power, binary decision binary_test_result=mmd.perform_test(alpha) if binary_test_result: print "H0 is rejected with confidence %.2f" % alpha significance_test_result=mmd.perform_test() print "P-value of MMD test is %.2f" % significance_test_result if significance_test_result<alpha: print "H0 is rejected with confidence %.2f" % alpha # precompute kernel to be faster for null sampling p_and_q=mmd.get_p_and_q() kernel.init(p_and_q, p_and_q); precomputed_kernel=CustomKernel(kernel); mmd.set_kernel(precomputed_kernel); # increase number of iterations since should be faster now mmd.set_num_null_samples(500); p_value_boot=mmd.perform_test(); print "P-value of MMD test is %.2f" % p_value_boot num_samples=500 # sample null distribution mmd.set_num_null_samples(num_samples) null_samples=mmd.sample_null() # sample alternative distribution, generate new data for that alt_samples=zeros(num_samples) for i in range(num_samples): X=norm.rvs(size=n, loc=mu, scale=sigma2) Y=laplace.rvs(size=n, loc=mu, scale=b) feat_p=RealFeatures(reshape(X, (1,len(X)))) feat_q=RealFeatures(reshape(Y, (1,len(Y)))) mmd=QuadraticTimeMMD(kernel, feat_p, feat_q) alt_samples[i]=mmd.compute_statistic() def plot_alt_vs_null(alt_samples, null_samples, alpha): figure(figsize=(18,5)) subplot(131) hist(null_samples, 50, color='blue') title('Null distribution') subplot(132) title('Alternative distribution') hist(alt_samples, 50, color='green') subplot(133) hist(null_samples, 50, color='blue') hist(alt_samples, 50, color='green', alpha=0.5) title('Null and alternative distriution') # find (1-alpha) element of null distribution null_samples_sorted=sort(null_samples) quantile_idx=int(num_samples*(1-alpha)) quantile=null_samples_sorted[quantile_idx] axvline(x=quantile, ymin=0, ymax=100, color='red', label=str(int(round((1-alpha)*100))) + '% quantile of null') _=legend() plot_alt_vs_null(alt_samples, null_samples, alpha) # optional: plot spectrum of joint kernel matrix from numpy.linalg import eig # get joint feature object and compute kernel matrix and its spectrum feats_p_q=mmd.get_p_and_q() mmd.get_kernel().init(feats_p_q, feats_p_q) K=mmd.get_kernel().get_kernel_matrix() w,_=eig(K) # visualise K and its spectrum (only up to threshold) figure(figsize=(18,5)) subplot(121) imshow(K, interpolation="nearest") title("Kernel matrix K of joint data $X$ and $Y$") subplot(122) thresh=0.1 plot(w[:len(w[w>thresh])]) _=title("Eigenspectrum of K until component %d" % len(w[w>thresh])) # threshold for eigenspectrum thresh=0.1 # compute number of eigenvalues to use num_eigen=len(w[w>thresh]) # finally, do the test, use biased statistic mmd.set_statistic_type(BIASED) #tell Shogun to use spectrum approximation mmd.set_null_approximation_method(MMD2_SPECTRUM) mmd.set_num_eigenvalues_spectrum(num_eigen) mmd.set_num_samples_spectrum(num_samples) # the usual test interface p_value_spectrum=mmd.perform_test() print "Spectrum: P-value of MMD test is %.2f" % p_value_spectrum # compare with ground truth bootstrapping mmd.set_null_approximation_method(PERMUTATION) mmd.set_num_null_samples(num_samples) p_value_boot=mmd.perform_test() print "Bootstrapping: P-value of MMD test is %.2f" % p_value_spectrum # tell Shogun to use gamma approximation mmd.set_null_approximation_method(MMD2_GAMMA) # the usual test interface p_value_gamma=mmd.perform_test() print "Gamma: P-value of MMD test is %.2f" % p_value_gamma # compare with ground truth bootstrapping mmd.set_null_approximation_method(PERMUTATION) p_value_boot=mmd.perform_test() print "Bootstrapping: P-value of MMD test is %.2f" % p_value_spectrum # type I error is false alarm, therefore sample data under H0 num_trials=50 rejections_gamma=zeros(num_trials) rejections_spectrum=zeros(num_trials) rejections_bootstrap=zeros(num_trials) num_samples=50 alpha=0.05 for i in range(num_trials): X=norm.rvs(size=n, loc=mu, scale=sigma2) Y=laplace.rvs(size=n, loc=mu, scale=b) # simulate H0 via merging samples before computing the Z=hstack((X,Y)) X=Z[:len(X)] Y=Z[len(X):] feat_p=RealFeatures(reshape(X, (1,len(X)))) feat_q=RealFeatures(reshape(Y, (1,len(Y)))) # gamma mmd=QuadraticTimeMMD(kernel, feat_p, feat_q) mmd.set_null_approximation_method(MMD2_GAMMA) mmd.set_statistic_type(BIASED) rejections_gamma[i]=mmd.perform_test(alpha) # spectrum mmd=QuadraticTimeMMD(kernel, feat_p, feat_q) mmd.set_null_approximation_method(MMD2_SPECTRUM) mmd.set_num_eigenvalues_spectrum(num_eigen) mmd.set_num_samples_spectrum(num_samples) mmd.set_statistic_type(BIASED) rejections_spectrum[i]=mmd.perform_test(alpha) # bootstrap (precompute kernel) mmd=QuadraticTimeMMD(kernel, feat_p, feat_q) p_and_q=mmd.get_p_and_q() kernel.init(p_and_q, p_and_q) precomputed_kernel=CustomKernel(kernel) mmd.set_kernel(precomputed_kernel) mmd.set_null_approximation_method(PERMUTATION) mmd.set_num_null_samples(num_samples) mmd.set_statistic_type(BIASED) rejections_bootstrap[i]=mmd.perform_test(alpha) convergence_gamma=cumsum(rejections_gamma)/(arange(num_trials)+1) convergence_spectrum=cumsum(rejections_spectrum)/(arange(num_trials)+1) convergence_bootstrap=cumsum(rejections_bootstrap)/(arange(num_trials)+1) print "Average rejection rate of H0 for Gamma is %.2f" % mean(convergence_gamma) print "Average rejection rate of H0 for Spectrum is %.2f" % mean(convergence_spectrum) print "Average rejection rate of H0 for Bootstrapping is %.2f" % mean(rejections_bootstrap) # paramters of dataset m=20000 distance=10 stretch=5 num_blobs=3 angle=pi/4 # these are streaming features gen_p=GaussianBlobsDataGenerator(num_blobs, distance, 1, 0) gen_q=GaussianBlobsDataGenerator(num_blobs, distance, stretch, angle) # stream some data and plot num_plot=1000 features=gen_p.get_streamed_features(num_plot) features=features.create_merged_copy(gen_q.get_streamed_features(num_plot)) data=features.get_feature_matrix() figure(figsize=(18,5)) subplot(121) grid(True) plot(data[0][0:num_plot], data[1][0:num_plot], 'r.', label='$x$') title('$X\sim p$') subplot(122) grid(True) plot(data[0][num_plot+1:2*num_plot], data[1][num_plot+1:2*num_plot], 'b.', label='$x$', alpha=0.5) _=title('$Y\sim q$') block_size=100 # if features are already under the streaming interface, just pass them mmd=LinearTimeMMD(kernel, gen_p, gen_q, m, block_size) # compute an unbiased estimate in linear time statistic=mmd.compute_statistic() print "MMD_l[X,Y]^2=%.2f" % statistic # note: due to the streaming nature, successive calls of compute statistic use different data # and produce different results. Data cannot be stored in memory for _ in range(5): print "MMD_l[X,Y]^2=%.2f" % mmd.compute_statistic() # data source gen_p=GaussianBlobsDataGenerator(num_blobs, distance, 1, 0) gen_q=GaussianBlobsDataGenerator(num_blobs, distance, stretch, angle) # retreive some points, store them as non-streaming data in memory data_p=gen_p.get_streamed_features(100) data_q=gen_q.get_streamed_features(data_p.get_num_vectors()) print "Number of data is %d" % data_p.get_num_vectors() # cast data in memory as streaming features again (which now stream from the in-memory data) streaming_p=StreamingRealFeatures(data_p) streaming_q=StreamingRealFeatures(data_q) # it is important to start the internal parser to avoid deadlocks streaming_p.start_parser() streaming_q.start_parser() # example to create mmd (note that m can be maximum the number of data in memory) mmd=LinearTimeMMD(GaussianKernel(10,1), streaming_p, streaming_q, data_p.get_num_vectors(), 1) print "Linear time MMD statistic: %.2f" % mmd.compute_statistic() mmd=LinearTimeMMD(kernel, gen_p, gen_q, m, block_size) print "m=%d samples from p and q" % m print "Binary test result is: " + ("Rejection" if mmd.perform_test(alpha) else "No rejection") print "P-value test result is %.2f" % mmd.perform_test() sigmas=[2**x for x in linspace(-5,5, 10)] print "Choosing kernel width from", ["{0:.2f}".format(sigma) for sigma in sigmas] combined=CombinedKernel() for i in range(len(sigmas)): combined.append_kernel(GaussianKernel(10, sigmas[i])) # mmd instance using streaming features block_size=1000 mmd=LinearTimeMMD(combined, gen_p, gen_q, m, block_size) # optmal kernel choice is possible for linear time MMD selection=MMDKernelSelectionOpt(mmd) # select best kernel best_kernel=selection.select_kernel() best_kernel=GaussianKernel.obtain_from_generic(best_kernel) print "Best single kernel has bandwidth %.2f" % best_kernel.get_width() alpha=0.05 mmd=LinearTimeMMD(best_kernel, gen_p, gen_q, m, block_size) mmd.set_null_approximation_method(MMD1_GAUSSIAN); p_value_best=mmd.perform_test(); print "Bootstrapping: P-value of MMD test with optimal kernel is %.2f" % p_value_best mmd=LinearTimeMMD(best_kernel, gen_p, gen_q, 5000, block_size) num_samples=500 # sample null and alternative distribution, implicitly generate new data for that null_samples=zeros(num_samples) alt_samples=zeros(num_samples) for i in range(num_samples): alt_samples[i]=mmd.compute_statistic() # tell MMD to merge data internally while streaming mmd.set_simulate_h0(True) null_samples[i]=mmd.compute_statistic() mmd.set_simulate_h0(False) plot_alt_vs_null(alt_samples, null_samples, alpha) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Some Formal Basics (skip if you just want code examples) Step2: Now how to compare these two sets of samples? Clearly, a t-test would be a bad idea since it basically compares mean and variance of $X$ and $Y$. But we set that to be equal. By chance, the estimates of these statistics might differ, but that is unlikely to be significant. Thus, we have to look at higher order statistics of the samples. In fact, kernel two-sample tests look at all (infinitely many) higher order moments. Step3: Quadratic Time MMD Step4: Any sub-class of <a href="http Step5: Precomputing Kernel Matrices Step6: Now let us visualise distribution of MMD statistic under $H_0 Step7: Null and Alternative Distribution Illustrated Step8: Different Ways to Approximate the Null Distribution for the Quadratic Time MMD Step9: The above plot of the Eigenspectrum shows that the Eigenvalues are decaying extremely fast. We choose the number for the approximation such that all Eigenvalues bigger than some threshold are used. In this case, we will not loose a lot of accuracy while gaining a significant speedup. For slower decaying Eigenspectrums, this approximation might be more expensive. Step10: The Gamma Moment Matching Approximation and Type I errors Step11: As we can see, the above example was kind of unfortunate, as the approximation fails badly. We check the type I error to verify that. This works similar to sampling the alternative distribution Step12: We see that Gamma basically never rejects, which is inline with the fact that the p-value was massively overestimated above. Note that for the other tests, the p-value is also not at its desired value, but this is due to the low number of samples/repetitions in the above code. Increasing them leads to consistent type I errors. Step13: We now describe the linear time MMD, as described in [1, Section 6], which is implemented in Shogun. A fast, unbiased estimate for the original MMD expression which still uses all available data can be obtained by dividing data into two parts and then compute Step14: Sometimes, one might want to use <a href="http Step15: The Gaussian Approximation to the Null Distribution Step16: Kernel Selection for the MMD -- Overview Step17: Now perform two-sample test with that kernel Step18: For the linear time MMD, the null and alternative distributions look different than for the quadratic time MMD as plotted above. Let's sample them (takes longer, reduce number of samples a bit). Note how we can tell the linear time MMD to smulate the null hypothesis, which is necessary since we cannot permute by hand as samples are not in memory) Step19: And visualise again. Note that both null and alternative distribution are Gaussian, which allows the fast null distribution approximation and the optimal kernel selection
11,959
<ASSISTANT_TASK:> Python Code: import pypsa, numpy as np # marginal costs in EUR/MWh marginal_costs = {"Wind": 0, "Hydro": 0, "Coal": 30, "Gas": 60, "Oil": 80} # power plant capacities (nominal powers in MW) in each country (not necessarily realistic) power_plant_p_nom = { "South Africa": {"Coal": 35000, "Wind": 3000, "Gas": 8000, "Oil": 2000}, "Mozambique": { "Hydro": 1200, }, "Swaziland": { "Hydro": 600, }, } # transmission capacities in MW (not necessarily realistic) transmission = { "South Africa": {"Mozambique": 500, "Swaziland": 250}, "Mozambique": {"Swaziland": 100}, } # country electrical loads in MW (not necessarily realistic) loads = {"South Africa": 42000, "Mozambique": 650, "Swaziland": 250} country = "South Africa" network = pypsa.Network() network.add("Bus", country) for tech in power_plant_p_nom[country]: network.add( "Generator", "{} {}".format(country, tech), bus=country, p_nom=power_plant_p_nom[country][tech], marginal_cost=marginal_costs[tech], ) network.add("Load", "{} load".format(country), bus=country, p_set=loads[country]) # Run optimisation to determine market dispatch network.lopf() # print the load active power (P) consumption network.loads_t.p # print the generator active power (P) dispatch network.generators_t.p # print the clearing price (corresponding to gas) network.buses_t.marginal_price network = pypsa.Network() countries = ["Mozambique", "South Africa"] for country in countries: network.add("Bus", country) for tech in power_plant_p_nom[country]: network.add( "Generator", "{} {}".format(country, tech), bus=country, p_nom=power_plant_p_nom[country][tech], marginal_cost=marginal_costs[tech], ) network.add("Load", "{} load".format(country), bus=country, p_set=loads[country]) # add transmission as controllable Link if country not in transmission: continue for other_country in countries: if other_country not in transmission[country]: continue # NB: Link is by default unidirectional, so have to set p_min_pu = -1 # to allow bidirectional (i.e. also negative) flow network.add( "Link", "{} - {} link".format(country, other_country), bus0=country, bus1=other_country, p_nom=transmission[country][other_country], p_min_pu=-1, ) network.lopf() network.loads_t.p network.generators_t.p network.links_t.p0 # print the clearing price (corresponding to water in Mozambique and gas in SA) network.buses_t.marginal_price # link shadow prices network.links_t.mu_lower network = pypsa.Network() countries = ["Swaziland", "Mozambique", "South Africa"] for country in countries: network.add("Bus", country) for tech in power_plant_p_nom[country]: network.add( "Generator", "{} {}".format(country, tech), bus=country, p_nom=power_plant_p_nom[country][tech], marginal_cost=marginal_costs[tech], ) network.add("Load", "{} load".format(country), bus=country, p_set=loads[country]) # add transmission as controllable Link if country not in transmission: continue for other_country in countries: if other_country not in transmission[country]: continue # NB: Link is by default unidirectional, so have to set p_min_pu = -1 # to allow bidirectional (i.e. also negative) flow network.add( "Link", "{} - {} link".format(country, other_country), bus0=country, bus1=other_country, p_nom=transmission[country][other_country], p_min_pu=-1, ) network.lopf() network.loads_t.p network.generators_t.p network.links_t.p0 # print the clearing price (corresponding to hydro in S and M, and gas in SA) network.buses_t.marginal_price # link shadow prices network.links_t.mu_lower country = "South Africa" network = pypsa.Network() network.add("Bus", country) for tech in power_plant_p_nom[country]: network.add( "Generator", "{} {}".format(country, tech), bus=country, p_nom=power_plant_p_nom[country][tech], marginal_cost=marginal_costs[tech], ) # standard high marginal utility consumers network.add("Load", "{} load".format(country), bus=country, p_set=loads[country]) # add an industrial load as a dummy negative-dispatch generator with marginal utility of 70 EUR/MWh for 8000 MW network.add( "Generator", "{} industrial load".format(country), bus=country, p_max_pu=0, p_min_pu=-1, p_nom=8000, marginal_cost=70, ) network.lopf() network.loads_t.p # NB only half of industrial load is served, because this maxes out # Gas. Oil is too expensive with a marginal cost of 80 EUR/MWh network.generators_t.p network.buses_t.marginal_price country = "South Africa" network = pypsa.Network() # snapshots labelled by [0,1,2,3] network.set_snapshots(range(4)) network.add("Bus", country) # p_max_pu is variable for wind for tech in power_plant_p_nom[country]: network.add( "Generator", "{} {}".format(country, tech), bus=country, p_nom=power_plant_p_nom[country][tech], marginal_cost=marginal_costs[tech], p_max_pu=([0.3, 0.6, 0.4, 0.5] if tech == "Wind" else 1), ) # load which varies over the snapshots network.add( "Load", "{} load".format(country), bus=country, p_set=loads[country] + np.array([0, 1000, 3000, 4000]), ) # specify that we consider all snapshots network.lopf(network.snapshots) network.loads_t.p network.generators_t.p network.buses_t.marginal_price country = "South Africa" network = pypsa.Network() # snapshots labelled by [0,1,2,3] network.set_snapshots(range(4)) network.add("Bus", country) # p_max_pu is variable for wind for tech in power_plant_p_nom[country]: network.add( "Generator", "{} {}".format(country, tech), bus=country, p_nom=power_plant_p_nom[country][tech], marginal_cost=marginal_costs[tech], p_max_pu=([0.3, 0.6, 0.4, 0.5] if tech == "Wind" else 1), ) # load which varies over the snapshots network.add( "Load", "{} load".format(country), bus=country, p_set=loads[country] + np.array([0, 1000, 3000, 4000]), ) # storage unit to do price arbitrage network.add( "StorageUnit", "{} pumped hydro".format(country), bus=country, p_nom=1000, max_hours=6, # energy storage in terms of hours at full power ) network.lopf(network.snapshots) network.loads_t.p network.generators_t.p network.storage_units_t.p network.storage_units_t.state_of_charge network.buses_t.marginal_price <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Single bidding zone with fixed load, one period Step2: Two bidding zones connected by transmission, one period Step3: Three bidding zones connected by transmission, one period Step4: Single bidding zone with price-sensitive industrial load, one period Step5: Single bidding zone with fixed load, several periods Step6: Single bidding zone with fixed load and storage, several periods
11,960
<ASSISTANT_TASK:> Python Code: %run ../src/LinearRegression.py %run ../src/PolynomialFeatures.py # LINEAR REGRESSION # Generate random data X = np.linspace(0,20,10)[:,np.newaxis] y = 0.1*(X**2) + np.random.normal(0,2,10)[:,np.newaxis] + 20 # Fit model to data lr = LinearRegression() lr.fit(X,y) # Predict new data x_test = np.array([0,20])[:,np.newaxis] y_predict = lr.predict(x_test) # POLYNOMIAL REGRESSION # Fit model to data poly = PolynomialFeatures(2) lr = LinearRegression() lr.fit(poly.fit_transform(X),y) # Predict new data x_pol = np.linspace(0, 20, 100)[:, np.newaxis] y_pol = lr.predict(poly.fit_transform(x_pol)) # Plot data fig = plt.figure(figsize=(14, 6)) # Plot linear regression ax1 = fig.add_subplot(1, 2, 1) plt.scatter(X,y) plt.plot(x_test, y_predict, "r") plt.xlim(0, 20) plt.ylim(0, 50) # Plot polynomial regression ax2 = fig.add_subplot(1, 2, 2) plt.scatter(X,y) plt.plot(x_pol, y_pol, "r") plt.xlim(0, 20) plt.ylim(0, 50); %run ../src/LogisticRegression.py X = np.hstack((np.random.normal(90, 2, 100), np.random.normal(110, 2, 100)))[:, np.newaxis] y = np.array([0]*100 + [1]*100)[:, np.newaxis] logr = LogisticRegression(learnrate=0.002, eps = 0.001) logr.fit(X, y) x_test = np.array([-logr.w[0]/logr.w[1]]).reshape(1,1) #np.linspace(-10, 10, 30)[:, np.newaxis] y_probs = logr.predict_proba(x_test)[:, 0:1] print("Probability:" + str(y_probs)) # Plot data fig = plt.figure(figsize=(14, 6)) # Plot sigmoid function ax1 = fig.add_subplot(1, 2, 1) t = np.linspace(-15,15,100) plt.plot(t, logr._sigmoid(t)) # Plot logistic regression ax2 = fig.add_subplot(1, 2, 2) plt.scatter(X, y) plt.scatter(x_test, y_probs, c='r') %run ../src/KNearestNeighbors.py # Generate data from 3 gaussians gaussian_1 = np.random.multivariate_normal(np.array([1, 0.0]), np.eye(2)*0.01, size=100) gaussian_2 = np.random.multivariate_normal(np.array([0.0, 1.0]), np.eye(2)*0.01, size=100) gaussian_3 = np.random.multivariate_normal(np.array([0.1, 0.1]), np.eye(2)*0.001, size=100) X = np.vstack((gaussian_1, gaussian_2, gaussian_3)) y = np.array([1]*100 + [2]*100 + [3]*100) # Fit the model knn = KNearestNeighbors(5) knn.fit(X, y) # Predict various points in space XX, YY = np.mgrid[-5:5:.2, -5:5:.2] X_test = np.hstack((XX.ravel()[:, np.newaxis], YY.ravel()[:, np.newaxis])) y_test = knn.predict(X_test) fig = plt.figure(figsize=(14, 6)) # Plot original data ax1 = fig.add_subplot(1, 2, 1) ax1.plot(X[y == 1,0], X[y == 1,1], 'bo') ax1.plot(X[y == 2,0], X[y == 2,1], 'go') ax1.plot(X[y == 3,0], X[y == 3,1], 'ro') # Plot predicted data ax2 = fig.add_subplot(1, 2, 2) ax2.contourf(XX, YY, y_test.reshape(50,50)); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Logistic regression Step2: Non-parametric models
11,961
<ASSISTANT_TASK:> Python Code: import json from itertools import chain from pprint import pprint from time import time import os import numpy as np %matplotlib inline import matplotlib.pyplot as plt from sklearn.metrics import accuracy_score from gensim.models import Word2Vec from gensim.corpora.dictionary import Dictionary os.environ['THEANO_FLAGS'] = "device=gpu1" import theano # theano.config.device = 'gpu' # Compute using GPU # theano.config.floatX = 'float32' from keras.preprocessing import sequence from keras.models import Sequential, Model from keras.layers import Input from keras.layers.embeddings import Embedding from keras.layers.recurrent import LSTM from keras.layers.core import Dense, Dropout from keras.layers.wrappers import TimeDistributed from keras.utils.visualize_util import plot np.random.seed(1337) print theano.config.device def indices_to_one_hot_encodings(index, vector_length): return [[1, 0] if i == index else [0, 1] for i in xrange(vector_length)] # Load and process treebank data treebank_file1 = open('json/OPTA-treebank-0.1.json') treebank_file2 = open('skladnica_output.json') treebank = chain(list(json.load(treebank_file1)), list(json.load(treebank_file2))) X = [] y = [] labels = [] for entry in treebank: tree = entry['parsedSent'] words = [] sentiment = None for index, node in enumerate(tree): word = node.split('\t')[1].lower() words.append(word) if node.split('\t')[10] == 'S': sentiment = index if sentiment: labels.append(words[sentiment]) X.append(words) y.append(indices_to_one_hot_encodings(sentiment, len(words))) dataset_length = len(X) slicing_point = int(dataset_length*0.9) X_train_raw = X[:slicing_point] y_train_raw = y[:slicing_point] X_test_raw = X[slicing_point+1:] y_test_raw = y[slicing_point+1:] treebank_vocabulary = set(chain(*X)) print len(treebank_vocabulary) X_train = X_train_raw y_train = labels len(X_train) + len(X_test_raw) # Przykłady z danych treningowych: for index in [2, 44, 111, 384, 69]: print ' '.join(X_train[index]), '\n', y_train[index], '\n' w2v_model = Word2Vec.load('w2v_allwiki_nkjp300_200.model') # Import w2v's dictionary to a bag-of-words model w2v_vocabulary = Dictionary() w2v_vocabulary.doc2bow(w2v_model.vocab.keys(), allow_update=True) print w2v_vocabulary.items()[:10] # Initialize dicts for representing w2v's dictionary as indices and 200-dim vectors w2indx = {v: k+1 for k, v in w2v_vocabulary.items()} w2vec = {word: w2v_model[word] for word in w2indx.keys()} w2v_vocabulary_size = len(w2indx) + 1 w2v_vocabulary_dimension = len(w2vec.values()[0]) def map_treebank_words_to_w2v_indices(treebank_data, w2indx): treebank_data_vec = [] for sentence in treebank_data: vectorized_sentence = [] for word in sentence: try: vectorized_sentence.append(w2indx[word]) except KeyError: # words absent in w2v model will be indexed as 0s vectorized_sentence.append(0) treebank_data_vec.append(vectorized_sentence) return treebank_data_vec X_train = map_treebank_words_to_w2v_indices(X_train_raw, w2indx) X_test = map_treebank_words_to_w2v_indices(X_test_raw, w2indx) print X_test[4] # Define numpy weights matrix for embedding layer embedding_weights = np.zeros((w2v_vocabulary_size , w2v_vocabulary_dimension)) for word, index in w2indx.items(): embedding_weights[index, :] = w2vec[word] # max sentence length max( len(max(X_train, key=lambda sentence: len(sentence))), len(max(X_test, key=lambda sentence: len(sentence))) ) # Normalize sequences length to 40 (will be extended with 0s) sentence_length = 40 X_train = sequence.pad_sequences(X_train, maxlen=sentence_length) X_test = sequence.pad_sequences(X_test, maxlen=sentence_length) y_train = sequence.pad_sequences(y_train_raw, maxlen=sentence_length, value=[0, 1]) y_test = sequence.pad_sequences(y_test_raw, maxlen=sentence_length, value=[0, 1]) # print X_train[2] # print y_train[2] inputs = Input(shape=(sentence_length,), dtype='int32') x = Embedding( input_dim=w2v_vocabulary_size, output_dim=w2v_vocabulary_dimension, input_length=sentence_length, mask_zero=True, weights=[embedding_weights] )(inputs) lstm_out = LSTM(200, return_sequences=True)(x) regularized_data = Dropout(0.3)(lstm_out) predictions = TimeDistributed(Dense(2, activation='sigmoid'))(regularized_data) model = Model(input=inputs, output=predictions) model.compile(loss='binary_crossentropy', optimizer='adam', metrics=['accuracy']) model.summary() from IPython.display import SVG from keras.utils.visualize_util import model_to_dot SVG(model_to_dot(model).create(prog='dot', format='svg')) # w modelu, który wykorzystaliśmy, słowa są reprezentowane jako # 200-elementowe wektory 32-bitowych liczb zmiennoprzecinkowych w2v_model['filozofia'] w2v_model['filozofia'].shape w2v_model.similarity(u'filozofia', u'inżynieria') w2v_model.similarity(u'filozofia', u'nauka') w2v_model.similarity(u'filozofia', u'literatura') # wskaż słowo niepasujące do pozostałych w2v_model.doesnt_match(['Kant', 'Leibniz', 'Derrida', 'Wittgenstein']) # Kobieta + król - mężczyzna = królowa # Medialny przykład z (Mikolov et al., 2013b) w2v_model.most_similar(positive=[u'kobieta', u'król'], negative=[u'mężczyzna']) # Paryż - Francja + Polska = Warszawa w2v_model.most_similar(positive=[u'Paryż', u'Polska'], negative=[u'Francja']) # filozofia - logika = literatura w2v_model.most_similar(positive=[u'filozofia',], negative=[u'logika']) # filozofia - postmodernizm = wiedza w2v_model.most_similar(positive=[u'filozofia',], negative=[u'postmodernizm']) batch_size = 5 n_epoch = 5 hist = model.fit(X_train, y_train, batch_size=batch_size, nb_epoch=n_epoch, validation_data=(X_test, y_test), verbose=2) # epochs = 10 # for i in range(epochs): # print('Epoch', i, '/', epochs) # model.fit # plt.rcParams['figure.figsize'] = (10,10) # axes = plt.gca() # x_min = hist.epoch[0] # x_max = hist.epoch[-1]+1 # axes.set_xlim([x_min,x_max]) # plt.scatter(hist.epoch, hist.history['acc'], color='r') # plt.plot(hist.history['acc'], color='r', label=u'Trafność mierzona na zbiorze treningowym') # plt.scatter(hist.epoch, hist.history['val_acc'], color='c') # plt.plot(hist.history['val_acc'], color='c', label=u'Trafność mierzona na zbiorze walidacyjnym') # plt.xlabel('epoki') # plt.ylabel(u'Trafność') # plt.title(u'Trafność w kolejnych epokach') # plt.legend() # plt.show() # Ułamek poprawnie sklasyfikowanych tokenów score, acc = model.evaluate(X_test, y_test, batch_size=batch_size, verbose=0) print 'Test accuracy:', acc predictions = model.predict(X_test, verbose=1) def change_encoding_word(word): return 1 if list(np.rint(word)) == [1, 0] else 0 def change_encoding(one_hot_encoded_sentence): # Switch from ndarray([[0.88, 0.11], [0.34, 0.98]]) encoding to [1, 0] encoding # and finally index number normalized_sentence = [] for word in one_hot_encoded_sentence: normalized_sentence.append(change_encoding_word(word)) return normalized_sentence def accurately_evaluated_samples(): total_accuracy = 0 for n, sentence in enumerate(predictions): index_of_sentiment = np.argmax(change_encoding(sentence)) # print change_encoding_word(y_test[n][index_of_sentiment]) total_accuracy += change_encoding_word(y_test[n][index_of_sentiment]) return total_accuracy # Ułamek tokenów-wydźwięków, które poprawnie rozpoznano jako wydźwięki float(accurately_evaluated_samples())/y_test.shape[0] hist.history score, acc = model.evaluate(X_test, y_test, batch_size=batch_size) print('Test score:', score) print('Test accuracy:', acc) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Dane pochodzą z ręcznie tagowanego treebanku (korpusu anotowanego składniowo) opracowanego przez Zespół Inżynierii Lingwistycznej IPI PAN na bazie Narodowego Korpusu Języka Polskiego (Wawer, 2015). Step2: Architektura sieci Step3: Word embeddings Step4: Różnica wektorów „Paryż” i „Francja” reprezentuje pojęcie STOLICA? Step5: Uczenie Step6: Ocena trafności Step7: Wartość bardzo przeszacowana ze względu na nierównomierną częśtość występowania klas (1 Step8: Nie wygląda imponująco, ale...
11,962
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'hammoz-consortium', 'mpiesm-1-2-ham', 'seaice') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.model.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.model.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.variables.prognostic') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sea ice temperature" # "Sea ice concentration" # "Sea ice thickness" # "Sea ice volume per grid cell area" # "Sea ice u-velocity" # "Sea ice v-velocity" # "Sea ice enthalpy" # "Internal ice stress" # "Salinity" # "Snow temperature" # "Snow depth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.seawater_properties.ocean_freezing_point') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "TEOS-10" # "Constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.seawater_properties.ocean_freezing_point_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.target') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.simulations') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.metrics_used') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.key_parameter_values.typical_parameters') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Ice strength (P*) in units of N m{-2}" # "Snow conductivity (ks) in units of W m{-1} K{-1} " # "Minimum thickness of ice created in leads (h0) in units of m" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.key_parameter_values.additional_parameters') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.description') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.on_diagnostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.missing_processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.properties') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Energy" # "Mass" # "Salt" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.budget') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.was_flux_correction_used') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.corrected_conserved_prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.grid') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Ocean grid" # "Atmosphere Grid" # "Own Grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.grid_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Structured grid" # "Unstructured grid" # "Adaptive grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Finite differences" # "Finite elements" # "Finite volumes" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.thermodynamics_time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.dynamics_time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.layering') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Zero-layer" # "Two-layers" # "Multi-layers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.number_of_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.has_mulitple_categories') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.number_of_categories') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.category_limits') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.ice_thickness_distribution_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.other') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.has_snow_on_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.number_of_snow_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.snow_fraction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.horizontal_transport') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Incremental Re-mapping" # "Prather" # "Eulerian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.transport_in_thickness_space') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Incremental Re-mapping" # "Prather" # "Eulerian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.ice_strength_formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Hibler 1979" # "Rothrock 1975" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.redistribution') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Rafting" # "Ridging" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.rheology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Free-drift" # "Mohr-Coloumb" # "Visco-plastic" # "Elastic-visco-plastic" # "Elastic-anisotropic-plastic" # "Granular" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.enthalpy_formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pure ice latent heat (Semtner 0-layer)" # "Pure ice latent and sensible heat" # "Pure ice latent and sensible heat + brine heat reservoir (Semtner 3-layer)" # "Pure ice latent and sensible heat + explicit brine inclusions (Bitz and Lipscomb)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.thermal_conductivity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pure ice" # "Saline ice" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.heat_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Conduction fluxes" # "Conduction and radiation heat fluxes" # "Conduction, radiation and latent heat transport" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.basal_heat_flux') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Heat Reservoir" # "Thermal Fixed Salinity" # "Thermal Varying Salinity" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.fixed_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.heat_content_of_precipitation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.precipitation_effects_on_salinity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.new_ice_formation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_vertical_growth_and_melt') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_lateral_melting') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Floe-size dependent (Bitz et al 2001)" # "Virtual thin ice melting (for single-category)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_surface_sublimation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.frazil_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.has_multiple_sea_ice_salinities') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.sea_ice_salinity_thermal_impacts') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.salinity_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Prescribed salinity profile" # "Prognostic salinity profile" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.constant_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.salinity_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Prescribed salinity profile" # "Prognostic salinity profile" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.constant_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_thickness_distribution.representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Virtual (enhancement of thermal conductivity, thin ice melting)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_floe_size_distribution.representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Parameterised" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_floe_size_distribution.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.are_included') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Flocco and Feltham (2010)" # "Level-ice melt ponds" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.impacts') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Albedo" # "Freshwater" # "Heat" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.has_snow_aging') # PROPERTY VALUE(S): # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.snow_aging_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.has_snow_ice_formation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.snow_ice_formation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.redistribution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.heat_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Single-layered heat diffusion" # "Multi-layered heat diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.radiative_processes.surface_albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Delta-Eddington" # "Parameterized" # "Multi-band albedo" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.radiative_processes.ice_radiation_transmission') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Delta-Eddington" # "Exponential attenuation" # "Ice radiation transmission per category" # "Other: [Please specify]" # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 2. Key Properties --&gt; Variables Step7: 3. Key Properties --&gt; Seawater Properties Step8: 3.2. Ocean Freezing Point Value Step9: 4. Key Properties --&gt; Resolution Step10: 4.2. Canonical Horizontal Resolution Step11: 4.3. Number Of Horizontal Gridpoints Step12: 5. Key Properties --&gt; Tuning Applied Step13: 5.2. Target Step14: 5.3. Simulations Step15: 5.4. Metrics Used Step16: 5.5. Variables Step17: 6. Key Properties --&gt; Key Parameter Values Step18: 6.2. Additional Parameters Step19: 7. Key Properties --&gt; Assumptions Step20: 7.2. On Diagnostic Variables Step21: 7.3. Missing Processes Step22: 8. Key Properties --&gt; Conservation Step23: 8.2. Properties Step24: 8.3. Budget Step25: 8.4. Was Flux Correction Used Step26: 8.5. Corrected Conserved Prognostic Variables Step27: 9. Grid --&gt; Discretisation --&gt; Horizontal Step28: 9.2. Grid Type Step29: 9.3. Scheme Step30: 9.4. Thermodynamics Time Step Step31: 9.5. Dynamics Time Step Step32: 9.6. Additional Details Step33: 10. Grid --&gt; Discretisation --&gt; Vertical Step34: 10.2. Number Of Layers Step35: 10.3. Additional Details Step36: 11. Grid --&gt; Seaice Categories Step37: 11.2. Number Of Categories Step38: 11.3. Category Limits Step39: 11.4. Ice Thickness Distribution Scheme Step40: 11.5. Other Step41: 12. Grid --&gt; Snow On Seaice Step42: 12.2. Number Of Snow Levels Step43: 12.3. Snow Fraction Step44: 12.4. Additional Details Step45: 13. Dynamics Step46: 13.2. Transport In Thickness Space Step47: 13.3. Ice Strength Formulation Step48: 13.4. Redistribution Step49: 13.5. Rheology Step50: 14. Thermodynamics --&gt; Energy Step51: 14.2. Thermal Conductivity Step52: 14.3. Heat Diffusion Step53: 14.4. Basal Heat Flux Step54: 14.5. Fixed Salinity Value Step55: 14.6. Heat Content Of Precipitation Step56: 14.7. Precipitation Effects On Salinity Step57: 15. Thermodynamics --&gt; Mass Step58: 15.2. Ice Vertical Growth And Melt Step59: 15.3. Ice Lateral Melting Step60: 15.4. Ice Surface Sublimation Step61: 15.5. Frazil Ice Step62: 16. Thermodynamics --&gt; Salt Step63: 16.2. Sea Ice Salinity Thermal Impacts Step64: 17. Thermodynamics --&gt; Salt --&gt; Mass Transport Step65: 17.2. Constant Salinity Value Step66: 17.3. Additional Details Step67: 18. Thermodynamics --&gt; Salt --&gt; Thermodynamics Step68: 18.2. Constant Salinity Value Step69: 18.3. Additional Details Step70: 19. Thermodynamics --&gt; Ice Thickness Distribution Step71: 20. Thermodynamics --&gt; Ice Floe Size Distribution Step72: 20.2. Additional Details Step73: 21. Thermodynamics --&gt; Melt Ponds Step74: 21.2. Formulation Step75: 21.3. Impacts Step76: 22. Thermodynamics --&gt; Snow Processes Step77: 22.2. Snow Aging Scheme Step78: 22.3. Has Snow Ice Formation Step79: 22.4. Snow Ice Formation Scheme Step80: 22.5. Redistribution Step81: 22.6. Heat Diffusion Step82: 23. Radiative Processes Step83: 23.2. Ice Radiation Transmission
11,963
<ASSISTANT_TASK:> Python Code: import ee # Trigger the authentication flow. ee.Authenticate() # Initialize the library. ee.Initialize() import matplotlib.pyplot as plt import numpy as np from scipy.stats import norm, gamma, f, chi2 import IPython.display as disp %matplotlib inline # Import the Folium library. import folium # Define a method for displaying Earth Engine image tiles to folium map. def add_ee_layer(self, ee_image_object, vis_params, name): map_id_dict = ee.Image(ee_image_object).getMapId(vis_params) folium.raster_layers.TileLayer( tiles = map_id_dict['tile_fetcher'].url_format, attr = 'Map Data &copy; <a href="https://earthengine.google.com/">Google Earth Engine</a>', name = name, overlay = True, control = True ).add_to(self) # Add EE drawing method to folium. folium.Map.add_ee_layer = add_ee_layer geoJSON = { "type": "FeatureCollection", "features": [ { "type": "Feature", "properties": {}, "geometry": { "type": "Polygon", "coordinates": [ [ [ 8.473892211914062, 49.98081240937428 ], [ 8.658599853515625, 49.98081240937428 ], [ 8.658599853515625, 50.06066538593667 ], [ 8.473892211914062, 50.06066538593667 ], [ 8.473892211914062, 49.98081240937428 ] ] ] } } ] } coords = geoJSON['features'][0]['geometry']['coordinates'] aoi = ee.Geometry.Polygon(coords) geoJSON = { "type": "FeatureCollection", "features": [ { "type": "Feature", "properties": {}, "geometry": { "type": "Polygon", "coordinates": [ [ [ 8.534317016601562, 50.021637833966786 ], [ 8.530540466308594, 49.99780882512238 ], [ 8.564186096191406, 50.00663576154257 ], [ 8.578605651855469, 50.019431940583104 ], [ 8.534317016601562, 50.021637833966786 ] ] ] } } ] } coords = geoJSON['features'][0]['geometry']['coordinates'] aoi_sub = ee.Geometry.Polygon(coords) im_coll = (ee.ImageCollection('COPERNICUS/S1_GRD_FLOAT') .filterBounds(aoi) .filterDate(ee.Date('2020-08-01'),ee.Date('2020-08-31')) .filter(ee.Filter.eq('orbitProperties_pass', 'ASCENDING')) .filter(ee.Filter.eq('relativeOrbitNumber_start', 15)) .sort('system:time_start')) import time acq_times = im_coll.aggregate_array('system:time_start').getInfo() [time.strftime('%x', time.gmtime(acq_time/1000)) for acq_time in acq_times] im_list = im_coll.toList(im_coll.size()) im1 = ee.Image(im_list.get(0)).select('VV').clip(aoi_sub) im2 = ee.Image(im_list.get(1)).select('VV').clip(aoi_sub) ratio = im1.divide(im2) url = ratio.getThumbURL({'min': 0, 'max': 10}) disp.Image(url=url, width=800) hist = ratio.reduceRegion(ee.Reducer.fixedHistogram(0, 5, 500), aoi_sub).get('VV').getInfo() mean = ratio.reduceRegion(ee.Reducer.mean(), aoi_sub).get('VV').getInfo() variance = ratio.reduceRegion(ee.Reducer.variance(), aoi_sub).get('VV').getInfo() a = np.array(hist) x = a[:, 0] y = a[:, 1] / np.sum(a[:, 1]) plt.grid() plt.plot(x, y, '.') plt.show() m = 5 plt.grid() plt.plot(x, y, '.', label='data') plt.plot(x, f.pdf(x, 2*m, 2*m) / 100, '-r', label='F-dist') plt.legend() plt.show() print(mean, m/(m-1)) print(variance, m*(2*m-1)/(m-1)**2/(m-2)) im1 = ee.Image(im_list.get(0)).select('VV').clip(aoi) im2 = ee.Image(im_list.get(1)).select('VV').clip(aoi) ratio = im1.divide(im2) location = aoi.centroid().coordinates().getInfo()[::-1] mp = folium.Map(location=location, zoom_start=12) mp.add_ee_layer(ratio, {'min': 0, 'max': 20, 'palette': ['black', 'white']}, 'Ratio') mp.add_child(folium.LayerControl()) display(mp) # Decision threshold alpha/2: dt = f.ppf(0.0005, 2*m, 2*m) # LRT statistics. q1 = im1.divide(im2) q2 = im2.divide(im1) # Change map with 0 = no change, 1 = decrease, 2 = increase in intensity. c_map = im1.multiply(0).where(q2.lt(dt), 1) c_map = c_map.where(q1.lt(dt), 2) # Mask no-change pixels. c_map = c_map.updateMask(c_map.gt(0)) # Display map with red for increase and blue for decrease in intensity. location = aoi.centroid().coordinates().getInfo()[::-1] mp = folium.Map( location=location, tiles='Stamen Toner', zoom_start=13) folium.TileLayer('OpenStreetMap').add_to(mp) mp.add_ee_layer(ratio, {'min': 0, 'max': 20, 'palette': ['black', 'white']}, 'Ratio') mp.add_ee_layer(c_map, {'min': 0, 'max': 2, 'palette': ['black', 'blue', 'red']}, 'Change Map') mp.add_child(folium.LayerControl()) display(mp) def det(im): return im.expression('b(0) * b(1)') # Number of looks. m = 5 im1 = ee.Image(im_list.get(0)).select('VV', 'VH').clip(aoi) im2 = ee.Image(im_list.get(1)).select('VV', 'VH').clip(aoi) m2logQ = det(im1).log().add(det(im2).log()).subtract( det(im1.add(im2)).log().multiply(2)).add(4*np.log(2)).multiply(-2*m) hist = m2logQ.reduceRegion( ee.Reducer.fixedHistogram(0, 20, 200), aoi).get('VV').getInfo() a = np.array(hist) x = a[:, 0] y = a[:, 1] / np.sum(a[:, 1]) plt.plot(x, y, '.', label='data') plt.plot(x, chi2.pdf(x, 2)/10, '-r', label='chi square') plt.legend() plt.grid() plt.show() geoJSON ={ "type": "FeatureCollection", "features": [ { "type": "Feature", "properties": {}, "geometry": { "type": "Polygon", "coordinates": [ [ [ -98.2122802734375, 49.769291532628515 ], [ -98.00559997558594, 49.769291532628515 ], [ -98.00559997558594, 49.88578690918283 ], [ -98.2122802734375, 49.88578690918283 ], [ -98.2122802734375, 49.769291532628515 ] ] ] } } ] } coords = geoJSON['features'][0]['geometry']['coordinates'] aoi1 = ee.Geometry.Polygon(coords) im1 = ee.Image(ee.ImageCollection('COPERNICUS/S1_GRD_FLOAT') .filterBounds(aoi1) .filterDate(ee.Date('2018-08-01'), ee.Date('2018-08-31')) .filter(ee.Filter.eq('orbitProperties_pass', 'ASCENDING')) .filter(ee.Filter.eq('relativeOrbitNumber_start', 136)) .first() .clip(aoi1)) im2 = ee.Image(ee.ImageCollection('COPERNICUS/S1_GRD_FLOAT').filterBounds(aoi1) .filterDate(ee.Date('2018-09-01'), ee.Date('2018-09-30')) .filter(ee.Filter.eq('orbitProperties_pass', 'ASCENDING')) .filter(ee.Filter.eq('relativeOrbitNumber_start', 136)) .first() .clip(aoi1)) acq_time = im1.get('system:time_start').getInfo() print( time.strftime('%x', time.gmtime(acq_time/1000)) ) acq_time = im2.get('system:time_start').getInfo() print( time.strftime('%x', time.gmtime(acq_time/1000)) ) def chi2cdf(chi2, df): ''' Chi square cumulative distribution function for df degrees of freedom using the built-in incomplete gamma function gammainc() ''' return ee.Image(chi2.divide(2)).gammainc(ee.Number(df).divide(2)) # The observed test statistic image -2logq. m2logq = det(im1).log().add(det(im2).log()).subtract( det(im1.add(im2)).log().multiply(2)).add(4*np.log(2)).multiply(-2*m) # The P value image prob(m2logQ > m2logq) = 1 - prob(m2logQ < m2logq). p_value = ee.Image.constant(1).subtract(chi2cdf(m2logq, 2)) # Project onto map. location = aoi1.centroid().coordinates().getInfo()[::-1] mp = folium.Map(location=location, zoom_start=12) mp.add_ee_layer(p_value, {'min': 0,'max': 1, 'palette': ['black', 'white']}, 'P-value') mp.add_child(folium.LayerControl()) c_map = p_value.multiply(0).where(p_value.lt(0.01), 1) crop2018 = (ee.ImageCollection('AAFC/ACI') .filter(ee.Filter.date('2018-01-01', '2018-12-01')) .first() .clip(aoi1)) mp = folium.Map(location=location, zoom_start=12) mp.add_ee_layer(crop2018, {min: 0, max: 255}, 'crop2018') mp.add_ee_layer(c_map.updateMask( c_map.gt(0)), {'min': 0, 'max': 1, 'palette': ['black', 'red']}, 'c_map') mp.add_child(folium.LayerControl()) geoJSON ={ "type": "FeatureCollection", "features": [ { "type": "Feature", "properties": {}, "geometry": { "type": "Polygon", "coordinates": [ [ [ -98.18550109863281, 49.769735012247885 ], [ -98.13949584960938, 49.769735012247885 ], [ -98.13949584960938, 49.798109268622 ], [ -98.18550109863281, 49.798109268622 ], [ -98.18550109863281, 49.769735012247885 ] ] ] } } ] } coords = geoJSON['features'][0]['geometry']['coordinates'] aoi1_sub = ee.Geometry.Polygon(coords) hist = p_value.reduceRegion(ee.Reducer.fixedHistogram(0, 1, 100), aoi1_sub).get('constant').getInfo() a = np.array(hist) x = a[:,0] y = a[:,1]/np.sum(a[:,1]) plt.plot(x, y, '.b', label='p-value') plt.ylim(0, 0.05) plt.grid() plt.legend() plt.show() c_map = p_value.multiply(0).where(p_value.lt(0.01), 1) diff = im2.subtract(im1) d_map = c_map.multiply(0) # Initialize the direction map to zero. d_map = d_map.where(det(diff).gt(0), 2) # All pos or neg def diffs are now labeled 2. d_map = d_map.where(diff.select(0).gt(0), 3) # Re-label pos def (and label some indef) to 3. d_map = d_map.where(det(diff).lt(0), 1) # Label all indef to 1. c_map = c_map.multiply(d_map) # Re-label the c_map, 0*X = 0, 1*1 = 1, 1*2= 2, 1*3 = 3. mp = folium.Map(location=location, zoom_start=12) mp.add_ee_layer(crop2018, {min: 0, max: 255}, 'crop2018') mp.add_ee_layer( c_map.updateMask(c_map.gt(0)), { 'min': 0, 'max': 3, 'palette': ['black', 'yellow', 'blue', 'red'] }, 'c_map') mp.add_child(folium.LayerControl()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Datasets and Python modules Step2: And to make use of interactive graphics, we import the folium package Step3: Part 2. Hypothesis testing Step4: This time we filter the S1 archive to get an image collection consisting of two images acquired in the month of August, 2020. Because we are interested in change detection, it is essential that the local incidence angles be the same in both images. So now we specify both the orbit pass (ASCENDING) as well the relative orbit number (15) Step5: Here are the acquisition times in the collection, formatted with Python's time module Step6: A ratio image Step7: Now we'll build the ratio of the VV bands and display it Step8: As in the first part of the Tutorial, standard GEE reducers can be used to calculate a histogram, mean and variance of the ratio image Step9: Here is a plot of the (normalized) histogram using numpy and matplotlib Step10: This looks a bit like the gamma distribution we met in Part 1 but is in fact an F probability distribution. The F distribution is defined as the ratio of two chi square distributions, see Eq. (1.12), with $m_1$ and $m_2$ degrees of freedom. The above histogram is an $F$ distribution with $m_1=2m$ and $m_2=2m$ degrees of freedom and is given by Step11: Checking the mean and variance, we get approximate agreement Step12: So what is so special about this distribution? When looking for changes between two co-registered Sentinel-1 images acquired at different times, it might seem natural to subtract one from the other and then examine the difference, much as we would do for instance with visual/infrared ground reflectance images. In the case of SAR intensity images this is not a good idea. In the difference of two uncorrelated multilook images $\langle s_1\rangle$ and $\langle s_2\rangle$ the variances add together and, from Eq. (1.21) in the first part of the Tutorial, Step13: We might guess that the bright pixels here are significant changes, for instance due to aircraft movements on the tarmac or vehicles moving on the highway. Of course ''significant'' doesn't necessarily imply ''interesting''. We already know Frankfurt has a busy airport and that a German Autobahn is always crowded. The question is, how significant are the changes in the statistical sense? Let's now try to answer that question. Step14: Most changes are within the airport or on the Autobahn. Barge movements on the Main River (upper left hand corner) are also signaled as significant changes. Note that the 'red' changes (significant increases in intensity) do not show up in the 'ratio' overlay, which displays $s_1/s_2$. Step15: and then plot its histogram, comparing it with the chi square distribution scipy.stats.chi2.pdf() with two degrees of freedom Step16: Looks pretty good. Note now that a small value of the LRT $Q$ in Eq. (2.15) corresponds to a large value of $-2\log{Q}$. Therefore the P value for a measurement $q$ is now the probability of getting the value $-2\log{q}$ Step17: This is a mixed agricultural/forest area in southern Manitoba, Canada. We'll gather two images, one from the beginning of August and one from the beginning of September, 2018. A lot of harvesting takes place in this interval, so we expect some extensive changes. Step18: Here are the acquisition times Step19: Fortunately it is possible to map the chi square cumulative distribution function over an ee.Image() so that a P value image can be calculated directly. This wasn't possible in the single band case, as the F cumulative distribution is not available on the GEE. Here are the P values Step20: The uniformly dark areas correspond to small or vanishing P values and signify change. The bright areas correspond to no change. Why they are not uniformly bright will be explained below. Now we set a significance threshold of $\alpha=0.01$ and display the significant changes, whereby 1% of them will be false positives. For reference we also show the 2018 Canada AAFC Annual Crop Inventory map, which is available as a GEE collection Step21: The major crops in the scene are soybeans (dark brown), oats (light brown), canola (light green), corn (light yellow) and winter wheat (dark gray). The wooded areas exhibit little change, while canola has evidently been extensively harvested in the interval. Step22: So the P values of no-change measurements are uniformly distributed over $[0, 1]$ (the excess of small P values at the left can be ascribed to genuine changes within the polygon). A large P value is no more indicative of no change than a small one. Of course it has to be this way. When, for example, we set a significance level of 5%, then the fraction of false positives, i.e., the fraction of P values smaller than 0.05 given $H_0$, must also be 5%. This accounts for the noisy appearance of the P value image in the no-change regions. Step23: Now we display the changes, with positive definite red, negative definite blue, and indefinite yellow
11,964
<ASSISTANT_TASK:> Python Code: import numpy as np a = np.array([1.5, -0.4, 1.3]) vals, idx = np.unique(a, return_inverse=True) b = np.zeros((a.size, vals.size)) b[np.arange(a.size), idx] = 1 <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
11,965
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import tensorflow as tf import numpy as np import tensorflow_datasets as tfds model = tf.keras.models.Sequential([ tf.keras.layers.Dense(16, activation='relu', input_shape=(4,)), tf.keras.layers.Dropout(0.2), tf.keras.layers.Dense(3) ]) model.compile(loss=tf.keras.losses.SparseCategoricalCrossentropy(from_logits=True), optimizer='adam') model.summary() def input_fn(): split = tfds.Split.TRAIN dataset = tfds.load('iris', split=split, as_supervised=True) dataset = dataset.map(lambda features, labels: ({'dense_input':features}, labels)) dataset = dataset.batch(32).repeat() return dataset for features_batch, labels_batch in input_fn().take(1): print(features_batch) print(labels_batch) import tempfile model_dir = tempfile.mkdtemp() keras_estimator = tf.keras.estimator.model_to_estimator( keras_model=model, model_dir=model_dir) keras_estimator.train(input_fn=input_fn, steps=500) eval_result = keras_estimator.evaluate(input_fn=input_fn, steps=10) print('Eval result: {}'.format(eval_result)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 케라스 모델로 추정기 생성하기 Step2: 간단한 케라스 모델 만들기 Step3: 모델을 컴파일한 후, 모델 구조를 요약해 출력할 수 있습니다. Step4: 입력 함수 만들기 Step5: input_fn이 잘 구현되었는지 확인해봅니다. Step6: tf.keras.model을 추정기로 변환하기 Step7: 추정기를 훈련한 후 평가합니다.
11,966
<ASSISTANT_TASK:> Python Code: %matplotlib inline from matplotlib import pyplot as plt import os import numpy as np os.environ['DES_BACKEND'] = 'numpy' import desolver as de import desolver.backend as D from desolver.backend import gdual_double as gdual T = 1e-3 @de.rhs_prettifier(equ_repr="[vr, -1/r**2 + r*vt**2, vt, -2*vt*vr/r]", md_repr=r$$ \begin{array}{l} \dot r = v_r \\ \dot v_r = - \frac 1{r^2} + r v_\theta^2\\ \dot \theta = v_\theta \\ \dot v_\theta = -2 \frac{v_\theta v_r}{r} \end{array} $$) def eom_kep_polar(t,y,**kwargs): return D.array([y[1], - 1 / y[0] / y[0] + y[0] * y[3]*y[3], y[3], -2*y[3]*y[1]/y[0] - T]) eom_kep_polar # The initial conditions ic = [1.,0.1,0.,1.] D.set_float_fmt('float64') float_integration = de.OdeSystem(eom_kep_polar, y0=ic, dense_output=False, t=(0, 5.), dt=0.01, rtol=1e-12, atol=1e-12, constants=dict()) float_integration.set_method("RK45") float_integration.integrate(eta=True) # Here we transform from polar to cartesian coordinates # to then plot y = float_integration.y cx = [it[0]*np.sin(it[2]) for it in y.astype(np.float64)] cy = [it[0]*np.cos(it[2]) for it in y.astype(np.float64)] plt.plot(cx,cy) plt.title("Orbit resulting from the chosen initial conditions") plt.xlabel("x") plt.ylabel("y") # Order of the Taylor Map. If we have 4 variables the number of terms in the Taylor expansion in 329 at order 7 order = 5 # We now define the initial conditions as gdual (not float) ic_g = [gdual(ic[0], "r", order), gdual(ic[1], "vr", order), gdual(ic[2], "t", order), gdual(ic[3], "vt", order)] import time start_time = time.time() D.set_float_fmt('gdual_double') gdual_integration = de.OdeSystem(eom_kep_polar, y0=ic_g, dense_output=False, t=(0, 5.), dt=0.01, rtol=1e-12, atol=1e-12, constants=dict()) gdual_integration.set_method("RK45") gdual_integration.integrate(eta=True) print("--- %s seconds ---" % (time.time() - start_time)) # We extract the last point yf = gdual_integration.y[-1] # And unpack it into some convinient names rf,vrf,tf,vtf = yf # We compute the final cartesian components xf = rf * D.sin(tf) yf = rf * D.cos(tf) # Note that you can get the latex representation of the gdual print(xf._repr_latex_()) print("xf (latex):") xf # We can extract the value of the polinomial when $\mathbf {dy} = 0$ print("Final x from the gdual integration", xf.constant_cf) print("Final y from the gdual integration", yf.constant_cf) # And check its indeed the result of the 'reference' trajectory (the lineariation point) print("\nFinal x from the float integration", cx[-1]) print("Final y from the float integration", cy[-1]) # Let us now visualize the Taylor map by creating a grid of perturbations on the initial conditions and # evaluating the map for those values Npoints = 10 # 10000 points epsilon = 1e-3 grid = np.arange(-epsilon,epsilon,2*epsilon/Npoints) nxf = [0] * len(grid)**4 nyf = [0] * len(grid)**4 i=0 import time start_time = time.time() for dr in grid: for dt in grid: for dvr in grid: for dvt in grid: nxf[i] = xf.evaluate({"dr":dr, "dt":dt, "dvr":dvr,"dvt":dvt}) nyf[i] = yf.evaluate({"dr":dr, "dt":dt, "dvr":dvr,"dvt":dvt}) i = i+1 print("--- %s seconds ---" % (time.time() - start_time)) f, axarr = plt.subplots(1,3,figsize=(15,5)) # Normal plot of the final map axarr[0].plot(nxf,nyf,'.') axarr[0].plot(cx,cy) axarr[0].set_title("The map") # Zoomed plot of the final map (equal axis) axarr[1].plot(nxf,nyf,'.') axarr[1].plot(cx,cy) axarr[1].set_xlim([cx[-1] - 0.1, cx[-1] + 0.1]) axarr[1].set_ylim([cy[-1] - 0.1, cy[-1] + 0.1]) axarr[1].set_title("Zoom") # Zoomed plot of the final map (unequal axis) axarr[2].plot(nxf,nyf,'.') axarr[2].plot(cx,cy) axarr[2].set_xlim([cx[-1] - 0.01, cx[-1] + 0.01]) axarr[2].set_ylim([cy[-1] - 0.1, cy[-1] + 0.1]) axarr[2].set_title("Stretch") #axarr[1].set_xlim([cx[-1] - 0.1, cx[-1] + 0.1]) #axarr[1].set_ylim([cy[-1] - 0.1, cy[-1] + 0.1]) # First we profile the method evaluate (note that you need to call the method 4 times to get the full state) %timeit xf.evaluate({"dr":epsilon, "dt":epsilon, "dvr":epsilon,"dvt":epsilon}) # Then we profile the Runge-Kutta 4 integrator %%timeit D.set_float_fmt('float64') float_integration = de.OdeSystem(eom_kep_polar, y0=[it + epsilon for it in ic], dense_output=False, t=(0, 5.), dt=0.01, rtol=1e-12, atol=1e-12, constants=dict()) float_integration.set_method("RK45") float_integration.integrate(eta=False) # It seems the speedup is 2-3 orders of magnitude, but did we loose precision? # We plot the error in the final result as computed by the HOTM and by the Runge-Kutta # as a function of the distance from the original initial conditions out = [] pert = np.arange(0,0.1,1e-3) for epsilon in pert: res_map_xf = xf.evaluate({"dr":epsilon, "dt":epsilon, "dvr":epsilon,"dvt":epsilon}) res_int = de.OdeSystem(eom_kep_polar, y0=[it + epsilon for it in ic], dense_output=False, t=(0, 5.), dt=0.01, rtol=1e-12, atol=1e-12, constants=dict()) res_int.set_method("RK45") res_int.integrate() res_int_x = [it.y[0]*np.sin(it.y[2]) for it in res_int] res_int_xf = res_int_x[-1] out.append(np.abs(res_map_xf - res_int_xf)) plt.semilogy(pert,out) plt.title("Error introduced by the use of the polynomial") plt.xlabel("Perturbation of the initial conditions") plt.ylabel("Error in estimating the final state (x)") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: High Order Taylor Maps I Step2: We perform the numerical integration using floats (the standard way) Step3: We perform the numerical integration using gduals (to get a HOTM) Step4: We visualize the HOTM Step5: How much faster is now to evaluate the Map rather than perform a new numerical integration?
11,967
<ASSISTANT_TASK:> Python Code: import sklearn import scipy import scipy.optimize import matplotlib.pyplot as plt import itertools import time from functools import partial import os import numpy as np from scipy.special import logsumexp np.set_printoptions(precision=3) import torch import torch.nn as nn import torchvision print("torch version {}".format(torch.__version__)) if torch.cuda.is_available(): print(torch.cuda.get_device_name(0)) print("current device {}".format(torch.cuda.current_device())) else: print("Torch cannot find GPU") use_cuda = torch.cuda.is_available() device = torch.device("cuda:0" if use_cuda else "cpu") # Fit the model usign sklearn import sklearn.datasets from sklearn.model_selection import train_test_split iris = sklearn.datasets.load_iris() X = iris["data"] y = (iris["target"] == 2).astype(np.int) # 1 if Iris-Virginica, else 0' N, D = X.shape # 150, 4 X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.33, random_state=42) from sklearn.linear_model import LogisticRegression # We set C to a large number to turn off regularization. # We don't fit the bias term to simplify the comparison below. log_reg = LogisticRegression(solver="lbfgs", C=1e5, fit_intercept=False) log_reg.fit(X_train, y_train) w_mle_sklearn = np.ravel(log_reg.coef_) print(w_mle_sklearn) # Binary cross entropy def BCE_with_logits(logits, targets): N = logits.shape[0] logits = logits.reshape(N, 1) logits_plus = np.hstack([np.zeros((N, 1)), logits]) # e^0=1 logits_minus = np.hstack([np.zeros((N, 1)), -logits]) logp1 = -logsumexp(logits_minus, axis=1) logp0 = -logsumexp(logits_plus, axis=1) logprobs = logp1 * targets + logp0 * (1 - targets) return -np.sum(logprobs) / N # Compute using numpy def sigmoid(x): return 0.5 * (np.tanh(x / 2.0) + 1) def predict_logit(weights, inputs): return np.dot(inputs, weights) # Already vectorized def predict_np(weights, inputs): return sigmoid(predict_logit(weights, inputs)) def NLL(weights, batch): X, y = batch logits = predict_logit(weights, X) return BCE_with_logits(logits, y) def NLL_grad(weights, batch): X, y = batch N = X.shape[0] mu = predict_np(weights, X) g = np.sum(np.dot(np.diag(mu - y), X), axis=0) / N return g w_np = w_mle_sklearn y_pred = predict_np(w_np, X_test) loss_np = NLL(w_np, (X_test, y_test)) grad_np = NLL_grad(w_np, (X_test, y_test)) print("params {}".format(w_np)) # print("pred {}".format(y_pred)) print("loss {}".format(loss_np)) print("grad {}".format(grad_np)) # data. By default, numpy uses double but torch uses float X_train_t = torch.tensor(X_train, dtype=torch.float) y_train_t = torch.tensor(y_train, dtype=torch.float) X_test_t = torch.tensor(X_test, dtype=torch.float) y_test_t = torch.tensor(y_test, dtype=torch.float) # parameters W = np.reshape(w_mle_sklearn, [D, 1]) # convert 1d vector to 2d matrix w_torch = torch.tensor(W, requires_grad=True, dtype=torch.float) # w_torch.requires_grad_() # binary logistic regression in one line of Pytorch def predict(X, w): y_pred = torch.sigmoid(torch.matmul(X, w))[:, 0] return y_pred # This returns Nx1 probabilities y_pred = predict(X_test_t, w_torch) # loss function is average NLL criterion = torch.nn.BCELoss(reduction="mean") loss_torch = criterion(y_pred, y_test_t) print(loss_torch) # Backprop loss_torch.backward() print(w_torch.grad) # convert to numpy. We have to "detach" the gradient tracing feature loss_torch = loss_torch.detach().numpy() grad_torch = w_torch.grad[:, 0].detach().numpy() # Test assert np.allclose(loss_np, loss_torch) assert np.allclose(grad_np, grad_torch) print("loss {}".format(loss_torch)) print("grad {}".format(grad_torch)) torch.manual_seed(0) net = nn.Sequential(nn.Linear(4, 8), nn.ReLU(), nn.Linear(8, 1)) X = torch.rand(size=(2, 4)) # batch x Din, batch=2, Din=4 out = net(X) # batch x Dout, Dout=1 print(out) print(net) for i in range(3): print(f"layer {i}") print(net[i].state_dict()) print(*[(name, param.shape) for name, param in net.named_parameters()]) print(type(net[2].bias)) print(net[2].bias) print(net[2].bias.data) print(net.state_dict()["2.bias"].data) net[2].weight.grad == None def block1(): return nn.Sequential(nn.Linear(4, 8), nn.ReLU(), nn.Linear(8, 4), nn.ReLU()) def block2(): net = nn.Sequential() for i in range(4): # Nested here net.add_module(f"block {i}", block1()) return net rgnet = nn.Sequential(block2(), nn.Linear(4, 1)) print(rgnet(X)) print(rgnet) rgnet[0][1][0].bias.data # set loss function to output squared out = rgnet(X) loss = torch.mean(out**2, dim=0) # Backprop loss.backward() print(rgnet[0][1][0].bias.grad) # We need to give the shared layer a name so that we can refer to its # parameters torch.manual_seed(0) shared = nn.Linear(8, 8) net = nn.Sequential(nn.Linear(4, 8), nn.ReLU(), shared, nn.ReLU(), shared, nn.ReLU(), nn.Linear(8, 1)) net(X) # Check whether the parameters are the same print(net[2].weight.data[0] == net[4].weight.data[0]) net[2].weight.data[0, 0] = 100 # Make sure that they are actually the same object rather than just having the # same value print(net[2].weight.data[0] == net[4].weight.data[0]) x = torch.tensor([-2, -1, 0, 1, 2], dtype=float, requires_grad=True) print(x) y = torch.pow(x, 2) print(y) y.backward(torch.ones_like(x)) print(x.grad) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Example Step2: Computing gradients by hand Step3: PyTorch code Step4: Autograd on a DNN Step5: Let's visualize the model and all the parameters in each layer. Step6: Access a specific parameter. Step7: The gradient is not defined until we call backward. Step8: Nested models Step9: Let us access the 0 element of the top level sequence, Step10: Backprop Step11: Tied parameters Step12: Other material
11,968
<ASSISTANT_TASK:> Python Code: ! echo 'hello, world!' !echo $t %%bash mkdir test_directory cd test_directory/ ls -a #удаление директории, если она не нужна ! rm -r test_directory %%cmd mkdir test_directory cd test_directory dir %%cmd rmdir test_directiory %lsmagic %pylab inline y = range(11) y plot(y) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Ниже аналоги команд для пользователей Windows Step2: удаление директории, если она не нужна (windows)
11,969
<ASSISTANT_TASK:> Python Code: import timeseries, TimeseriesDB, Similarity import cs207rbtree.RedBlackTree as Database dir(Database) demoDB = Database.connect("/tmp/test1.dbdb") demoDB.set("rahul", 81) demoDB.set("pavlos", 20) demoDB.set("sarah", 29) demoDB.set("courtney", 11) demoDB.set("andrew", 12) demoDB.set("laura", 81) demoDB.get("sarah") demoDB.get("laura") from cs207rbtree import RedBlackTree from threading import Thread from pytest import raises import portalocker import os def thread_function(num): print("FIRST FUN") db = RedBlackTree.connect("/tmp/test6.dbdb") db.set("kobe", "baby"+str(num)) print("1") db.set("rahul", "veryyoung"+str(num)) print("2") db.set("pavlos", "stillyoung"+str(num)) print("3") db.set("andy", "old"+str(num)) print("4") db.set("lisa", "ancient"+str(num)) print("5") db.commit() print("6") def thread_function2(): db = RedBlackTree.connect("/tmp/test6.dbdb") for i in ["kobe","rahul","pavlos","andy","lisa"]: print("SECOND FUNC") with raises(KeyError): print("FAILED") print(db.get(i)) os.remove('/tmp/test6.dbdb') t1 = Thread(target=thread_function, args=([1])) t2 = Thread(target=thread_function2)#, args=(2)) t1.start() t2.start() print("DONE") import time def thread_function(): print("THREAD 1") db = RedBlackTree.connect("/tmp/test6.dbdb") db.set("Laura", "Ware") time.sleep(200) print("THREAD ONE DONE SLEEPING") db.commit() print("COMMITED RESULTS") def thread_function2(): print("THREAD 2") db2 = RedBlackTree.connect("/tmp/test6.dbdb") with raises(KeyError): print(db2.get('Laura')) print("THERE") time.sleep(10) print("THREAD TWO DONE SLEEPING") print(db2.get('Laura')) os.remove('/tmp/test6.dbdb') #t1 = Thread(target=thread_function) #t2 = Thread(target=thread_function2) #t1.start() #t2.start() import multiprocessing p = multiprocessing.Process(target=thread_function) p2 = multiprocessing.Process(target=thread_function2) p.start() p2.start() print("I AM DONE") #db = RedBlackTree.connect("/tmp/test6.dbdb") #db.set("Laura", "Ware") #print("HERE") #db2 = RedBlackTree.connect("/tmp/test6.dbdb") #print(db2.get("Laura")) #print("HERE") os.remove('/tmp/test6.dbdb') db = RedBlackTree.connect("/tmp/test6.dbdb") db.set("Laura", "Ware") print("HERE") db2 = RedBlackTree.connect("/tmp/test6.dbdb") #print("CONNECTED") with raises(KeyError): print(db2.get("Laura")) db.commit() print(db2.get("Laura")) print("HERE") db.close() db2.close() from portalocker.utils import Lock from portalocker import * alock = Lock("/tmp/test6.dbdb", timeout=5) #with assertRaises(Exception): #LockException #print("HERE") alock.acquire() print("DONE") from TimeseriesDB.MessageFormatting import * import importlib import unittest from pytest import raises import numpy as np from TimeseriesDB.tsdb_error import * from TimeseriesDB import DatabaseServer from TimeseriesDB.MessageFormatting import * #Deserializer from Similarity.find_most_similar import find_most_similiar, sanity_check from TimeseriesDB.simsearch_init import initialize_simsearch_parameters from socketserver import BaseRequestHandler, ThreadingTCPServer, TCPServer from timeseries.ArrayTimeSeries import ArrayTimeSeries as ts import threading from socket import socket, AF_INET, SOCK_STREAM import sys from scipy.stats import norm import multiprocessing def query_1(): #function to compute simsearch print("QUERY1") s = socket(AF_INET, SOCK_STREAM) s.connect(('localhost', 20000)) d2 = {'op':'simsearch_id','id':12,'n_closest':2,'courtesy':'please'} s2 = serialize(json.dumps(d2)) s.send(s2) msg = s.recv(8192) ds = Deserializer() ds.append(msg) ds.ready() response = ds.deserialize() print(response) s.close() def query_2(): #function to return timeseries from id print("QUERY2") s = socket(AF_INET, SOCK_STREAM) s.connect(('localhost', 20000)) d2 = {'op':'TSfromID','id':12,'courtesy':'please'} s2 = serialize(json.dumps(d2)) s.send(s2) msg = s.recv(8192) ds = Deserializer() ds.append(msg) ds.ready() response = ds.deserialize() print(response) s.close() TCPServer.allow_reuse_address = True serv = TCPServer(('', 20000), DatabaseServer) serv.data = initialize_simsearch_parameters() serv.deserializer = Deserializer() serv_thread = threading.Thread(target=serv.serve_forever) serv_thread.setDaemon(True) serv_thread.start() p = multiprocessing.Process(target=query_1) p2 = multiprocessing.Process(target=query_2) p.start() p2.start() serv.socket.close() serv.server_close() print("DONE") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Using the Red-Black Tree Step2: Multithreadedness
11,970
<ASSISTANT_TASK:> Python Code: import mne import numpy as np from mne.datasets import sample from mne.minimum_norm import make_inverse_operator, apply_inverse data_path = sample.data_path() evokeds = mne.read_evokeds(data_path + '/MEG/sample/sample_audvis-ave.fif') left_auditory = evokeds[0].apply_baseline() fwd = mne.read_forward_solution( data_path + '/MEG/sample/sample_audvis-meg-eeg-oct-6-fwd.fif') mne.convert_forward_solution(fwd, surf_ori=True, copy=False) noise_cov = mne.read_cov(data_path + '/MEG/sample/sample_audvis-cov.fif') subject = 'sample' subjects_dir = data_path + '/subjects' trans_fname = data_path + '/MEG/sample/sample_audvis_raw-trans.fif' lh = fwd['src'][0] # Visualize the left hemisphere verts = lh['rr'] # The vertices of the source space tris = lh['tris'] # Groups of three vertices that form triangles dip_pos = lh['rr'][lh['vertno']] # The position of the dipoles dip_ori = lh['nn'][lh['vertno']] dip_len = len(dip_pos) dip_times = [0] white = (1.0, 1.0, 1.0) # RGB values for a white color actual_amp = np.ones(dip_len) # misc amp to create Dipole instance actual_gof = np.ones(dip_len) # misc GOF to create Dipole instance dipoles = mne.Dipole(dip_times, dip_pos, actual_amp, dip_ori, actual_gof) trans = mne.read_trans(trans_fname) fig = mne.viz.create_3d_figure(size=(600, 400), bgcolor=white) coord_frame = 'mri' # Plot the cortex mne.viz.plot_alignment( subject=subject, subjects_dir=subjects_dir, trans=trans, surfaces='white', coord_frame=coord_frame, fig=fig) # Mark the position of the dipoles with small red dots mne.viz.plot_dipole_locations( dipoles=dipoles, trans=trans, mode='sphere', subject=subject, subjects_dir=subjects_dir, coord_frame=coord_frame, scale=7e-4, fig=fig) mne.viz.set_3d_view(figure=fig, azimuth=180, distance=0.25) fig = mne.viz.create_3d_figure(size=(600, 400)) # Plot the cortex mne.viz.plot_alignment( subject=subject, subjects_dir=subjects_dir, trans=trans, surfaces='white', coord_frame='head', fig=fig) # Show the dipoles as arrows pointing along the surface normal mne.viz.plot_dipole_locations( dipoles=dipoles, trans=trans, mode='arrow', subject=subject, subjects_dir=subjects_dir, coord_frame='head', scale=7e-4, fig=fig) mne.viz.set_3d_view(figure=fig, azimuth=180, distance=0.1) # Compute the source estimate for the 'left - auditory' condition in the sample # dataset. inv = make_inverse_operator(left_auditory.info, fwd, noise_cov, fixed=True) stc = apply_inverse(left_auditory, inv, pick_ori=None) # Visualize it at the moment of peak activity. _, time_max = stc.get_peak(hemi='lh') brain_fixed = stc.plot(surface='white', subjects_dir=subjects_dir, initial_time=time_max, time_unit='s', size=(600, 400)) fig = mne.viz.create_3d_figure(size=(600, 400)) # Plot the cortex mne.viz.plot_alignment( subject=subject, subjects_dir=subjects_dir, trans=trans, surfaces='white', coord_frame='head', fig=fig) # Show the three dipoles defined at each location in the source space mne.viz.plot_alignment( subject=subject, subjects_dir=subjects_dir, trans=trans, fwd=fwd, surfaces='white', coord_frame='head', fig=fig) mne.viz.set_3d_view(figure=fig, azimuth=180, distance=0.1) # Make an inverse operator with loose dipole orientations inv = make_inverse_operator(left_auditory.info, fwd, noise_cov, fixed=False, loose=1.0) # Compute the source estimate, indicate that we want a vector solution stc = apply_inverse(left_auditory, inv, pick_ori='vector') # Visualize it at the moment of peak activity. _, time_max = stc.magnitude().get_peak(hemi='lh') brain_mag = stc.plot(subjects_dir=subjects_dir, initial_time=time_max, time_unit='s', size=(600, 400), overlay_alpha=0) # Set loose to 0.2, the default value inv = make_inverse_operator(left_auditory.info, fwd, noise_cov, fixed=False, loose=0.2) stc = apply_inverse(left_auditory, inv, pick_ori='vector') # Visualize it at the moment of peak activity. _, time_max = stc.magnitude().get_peak(hemi='lh') brain_loose = stc.plot(subjects_dir=subjects_dir, initial_time=time_max, time_unit='s', size=(600, 400), overlay_alpha=0) # Only retain vector magnitudes stc = apply_inverse(left_auditory, inv, pick_ori=None) # Visualize it at the moment of peak activity _, time_max = stc.get_peak(hemi='lh') brain = stc.plot(surface='white', subjects_dir=subjects_dir, initial_time=time_max, time_unit='s', size=(600, 400)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The source space Step2: Fixed dipole orientations Step3: Restricting the dipole orientations in this manner leads to the following Step4: The direction of the estimated current is now restricted to two directions Step5: When computing the source estimate, the activity at each of the three dipoles Step6: Limiting orientations, but not fixing them Step7: Discarding dipole orientation information
11,971
<ASSISTANT_TASK:> Python Code: cd .. !cat magical.freeze !cat fresh.freeze magical = [] with open("magical.freeze") as f: for l in f: magical.append(l) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) fresh = [] with open("fresh.freeze") as f: for l in f: fresh.append(l) set(magical) - set(fresh) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Comparing line by line by eye is a bit annoying, so using Python Step2: Then we can just use sets to compare Step3: Installing just those in the fresh and trying again. Installing in this order Step4: installed pyparsing Step5: installed pytz Step6: installed terminado==0.4 Step7: installed matplotlib Step8: installed param Step9: installed holoviews
11,972
<ASSISTANT_TASK:> Python Code: import seaborn as sns import numpy as np import matplotlib.pyplot as plt import torch def softmax(mtx): Compute softmax on 2D tensor alon the second dimension e = np.exp(mtx) s = np.sum(e, axis=1) return e / s[:, None] X = np.arange(18, dtype=np.float64).reshape(3, 6) X[2, 4] = float("-inf") s = softmax(X) s np.random.seed(1) sample_no, sample_len = (4, 6) data = np.zeros((sample_no, sample_len), dtype=np.float32) seq_len = np.array([4, 1, 6, 3], dtype=np.int32) mask = np.arange(sample_len) < seq_len[:, None] data[~mask] = 1 annot = np.random.random(data.shape).round(1) * 2 + 3 fig, ax = plt.subplots(1, 2, sharey=True, figsize=(12, 3)) sns.heatmap(data, ax=ax[0], cbar=False, linewidths=.5, cmap='Set3', annot=annot, xticklabels=False, yticklabels=False, annot_kws={'fontsize': 'x-large'}, fmt=".2") ax[0].set_title("Attention weights before softmax") ax[1].set_title("Attention weights after softmax") annot[~mask] = float("-inf") annot = softmax(annot) sns.heatmap(data, ax=ax[1], cbar=False, linewidths=.5, cmap='Set3', annot=annot, xticklabels=False, yticklabels=False, annot_kws={'fontsize': 'x-large'}) fig.savefig("softmax_before_after.png", dpi=100) fig, ax = plt.subplots(1, figsize=(5, 3)) annot[~mask] = float("-inf") annot = softmax(annot) sns.heatmap(data, ax=ax, cbar=False, linewidths=.5, cmap='Set3', annot=annot, xticklabels=False, yticklabels=False, annot_kws={'fontsize': 'x-large'}) fig.savefig("masked_attention_final.png", dpi=100) annot = np.random.random(data.shape).round(2) * 2 + 3 annot[~mask] = float("-inf") fig, ax = plt.subplots(1, figsize=(5.2, 3)) sns.heatmap(data, ax=ax, cbar=False, linewidths=.5, cmap='Set3', annot=annot, xticklabels=False, yticklabels=False, annot_kws={'fontsize': 'x-large'}) fig.savefig("masked_attention_inf.png", dpi=100) sample_no, sample_len = (4, 6) data = np.zeros((sample_no, sample_len), dtype=np.float32) seq_len = np.array([4, 1, 6, 3], dtype=np.int32) mask = np.arange(sample_len) < seq_len[:, None] data[~mask] = 1 fig, ax = plt.subplots(1, 2, figsize=(6, 3), gridspec_kw = {'width_ratios':[6, 1]}) sns.heatmap(data, ax=ax[0], cbar=False, linewidths=.5, cmap='Set3', xticklabels=False, yticklabels=False,) ax[0].set_title("Padded sequences") sns.heatmap(np.zeros((sample_no, 1)), annot=seq_len[:, None], ax=ax[1], cmap='Set3', cbar=False, linewidths=.5, annot_kws={'fontsize': 'x-large'}, xticklabels=False, yticklabels=False,) ax[1].set_title("Length") fig.savefig("padded_sequence.png", dpi=100) X = torch.arange(12).view(4, 3) mask = torch.zeros((4, 3), dtype=torch.uint8) # same as dtype=torch.ByteTensor mask[0, 0] = 1 mask[1, 1] = 1 mask[3, 2] = 1 X[mask] = 100 print(X) X = torch.arange(12).view(4, 3) X[~mask] = 100 print(X) X = np.random.random((4, 6)).round(1) * 2 + 3 X = torch.from_numpy(X) X_len = torch.LongTensor([4, 1, 6, 3]) maxlen = X.size(1) %%timeit mask = torch.arange(maxlen)[None, :] < X_len[:, None] %%timeit idx = torch.arange(maxlen).unsqueeze(0).expand(X.size()) len_expanded = X_len.unsqueeze(1).expand(X.size()) mask = idx < len_expanded mask X = np.random.random((4, 6)).round(1) * 2 + 3 X = torch.from_numpy(X) maxlen = X.size(1) mask = torch.arange(maxlen)[None, :] < X_len[:, None] X[~mask] = float('-inf') print(torch.softmax(X, dim=1)) X = np.random.random((4, 6)).round(1) * 2 + 3 X = torch.from_numpy(X) maxlen = X.size(1) mask = torch.arange(maxlen)[None, :] < X_len[:, None] X[~mask] = -10000 print(torch.softmax(X, dim=1)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Masking PAD symbols in attention weights Step2: Masked assignment Step3: Let's create a mask for the 'valid' symbols Step4: Now we want to compute softmax on the 'valid' elements Step5: In practice, a large negative number might work
11,973
<ASSISTANT_TASK:> Python Code: import threading import time a = '' def task_1(): global a for i in range(10): print('o', end='', flush=True) a += 'o' print(a) time.sleep(1) # Blocking -> yield to other thread def task_2(): global a for i in range(20): print('O', end='', flush=True) a += 'O' print(a) time.sleep(0.6) # Blocking -> yield to other thread thread_1 = threading.Thread(target=task_1) thread_2 = threading.Thread(target=task_2) thread_1.start() thread_2.start() print("(Both threads have started)") thread_1.join() # Wait for thread_1 to finish thread_2.join() print("\nBoth threads have finished") print(a) # This code does not work! import multiprocessing import time a = '' # Does not work because each process has its own 'a' def task_1(): global a for i in range(10): print('o', end='', flush=True) a += 'o' print(a) time.sleep(1) # Blocking -> yield to other process def task_2(): global a for i in range(20): print('O', end='', flush=True) a += 'O' print(a) time.sleep(0.6) # Blocking -> yield to other process process_1 = multiprocessing.Process(target=task_1) process_2 = multiprocessing.Process(target=task_2) process_1.start() process_2.start() print("(Both processes have started)") process_1.join() process_2.join() print("\nBoth processes have finished") print(a) import multiprocessing import time import ctypes def task_1(a): for i in range(10): print('o', end='', flush=True) a.value += 'o' time.sleep(1) # Blocking -> yield to other process def task_2(a): for i in range(20): print('O', end='', flush=True) a.value += 'O' time.sleep(0.6) # Blocking -> yield to other process manager = multiprocessing.Manager() # See https://docs.python.org/3/library/ctypes.html#module-ctypes a = manager.Value(ctypes.c_char_p, "") process_1 = multiprocessing.Process(target=task_1, args=(a,)) process_2 = multiprocessing.Process(target=task_2, args=(a,)) process_1.start() process_2.start() print("(Both processes have started)") process_1.join() process_2.join() print("\nBoth processes have finished") print(a.value) import time a = '' def task_1(): global a for i in range(20): print('o', end='', flush=True) a += 'o' yield time.sleep(0.5) def task_2(): global a for i in range(20): print('O', end='', flush=True) a += 'O' yield time.sleep(0.25) t1 = task_1() t2 = task_2() now = time.perf_counter() # Real time (not only user time) for i in range(20): t1.__next__() # Call task_1() t2.__next__() # Call task_2() elapsed = time.perf_counter() - now print(f"\nelapsed {elapsed:0.2f} seconds.") print(20*0.5 + 20*0.25) print("a =", a) import asyncio import time a = '' async def task_1(): global a for i in range(20): print('o', end='', flush=True) a += 'o' await asyncio.sleep(0.5) async def task_2(): global a for i in range(20): print('O', end='', flush=True) a += 'O' await asyncio.sleep(0.25) now = time.perf_counter() await asyncio.gather(task_1(), task_2()) elapsed = time.perf_counter() - now print(f"\nelapsed {elapsed:0.2f} seconds.") print("a =", a) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Notice that both threads share the same process memory space. Step2: But ... why a has not been modified? Why the processed do not share a? Step3: 3. "Low-level" coroutines Step4: 3. Using 'asyncio'
11,974
<ASSISTANT_TASK:> Python Code: datafile = open('./data/examp_data.txt', 'r') data = [] for row in datafile: data.append(row.strip().split(',')) data import csv datafile = open('./data/examp_data.txt', 'r') datareader = csv.reader(datafile, delimiter=',') data = [] for row in datareader: data.append(row) data import numpy data = numpy.genfromtxt('./data/examp_data.txt', delimiter = ',', skip_header=1) data import pandas as pd data = pd.read_csv('./data/examp_data.txt') data data.values <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: CSV Module Step2: Using Numpy Step3: Pandas Step4: Pandas dataframes do behave a bit differently than a lot of list based structures in Python, but we'll learn how to work with them soon. If you just want to pull the core data out of a dataframe you can do this using the values member (a member is just a variable associated with an object).
11,975
<ASSISTANT_TASK:> Python Code: import os import mne print(mne.get_config('MNE_USE_CUDA')) print(type(mne.get_config('MNE_USE_CUDA'))) try: mne.set_config('MNE_USE_CUDA', True) except TypeError as err: print(err) print(mne.get_config('missing_config_key', default='fallback value')) print(mne.get_config()) # same as mne.get_config(key=None) print(mne.get_config(key='')) mne.set_config('MNEE_USE_CUUDAA', 'false') mne.set_config('MNEE_USE_CUUDAA', None) assert 'MNEE_USE_CUUDAA' not in mne.get_config('') print(mne.get_config_path()) # make sure it's not in the JSON file (no error means our assertion held): assert mne.get_config('PATH', use_env=False) is None # but it *is* in the environment: print(mne.get_config('PATH')) mne.set_config('foo', 'bar', set_env=False) print('foo' in os.environ.keys()) mne.set_config('foo', 'bar') print('foo' in os.environ.keys()) mne.set_config('foo', None) # unsetting a key deletes var from environment print('foo' in os.environ.keys()) print(mne.get_config('MNE_LOGGING_LEVEL')) kit_data_path = os.path.join(os.path.abspath(os.path.dirname(mne.__file__)), 'io', 'kit', 'tests', 'data', 'test.sqd') raw = mne.io.read_raw_kit(kit_data_path, verbose='warning') raw = mne.io.read_raw_kit(kit_data_path, verbose='info') raw = mne.io.read_raw_kit(kit_data_path, verbose='debug') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Getting and setting configuration variables Step2: Note that the string values read from the JSON file are not parsed in any Step3: If you're unsure whether a config variable has been set, there is a Step4: There are also two convenience modes of Step5: The second convenience mode will return a Step6: It is possible to add config variables that are not part of the recognized Step7: Let's delete that config variable we just created. To unset a config Step8: Where configurations are stored Step9: However it is not a good idea to directly edit files in the Step10: Also by default, Step11: Logging Step12: The logging levels that can be set as config variables are debug, Step13: No messages were generated, because none of the messages were of severity Step14: This time, we got a few messages about extracting information from the file,
11,976
<ASSISTANT_TASK:> Python Code: import vaex import numpy as np np.warnings.filterwarnings('ignore') dstaxi = vaex.open('src/nyc_taxi2015.hdf5') # mmapped, doesn't cost extra memory dstaxi.plot_widget("pickup_longitude", "pickup_latitude", f="log", backend="ipyleaflet", shape=600) dstaxi.plot_widget("dropoff_longitude", "dropoff_latitude", f="log", backend="ipyleaflet", z="dropoff_hour", type="slice", z_shape=24, shape=400, z_relative=True, limits=[None, None, (-0.5, 23.5)]) ds = vaex.datasets.helmi_de_zeeuw.fetch() ds.plot_widget("x", "y", f="log", limits=[-20, 20]) ds.plot_widget("Lz", "E", f="log") import ipyvolume as ipv import numpy as np np.warnings.filterwarnings('ignore') ipv.example_ylm(); N = 1000 x, y, z = np.random.random((3, N)) fig = ipv.figure() scatter = ipv.scatter(x, y, z, marker='box') ipv.show() scatter.x = scatter.x + 0.1 scatter.color = "green" scatter.size = 5 scatter.color = np.random.random((N,3)) scatter.size = 2 ipv.figure() ipv.style.use('dark') quiver = ipv.quiver(*ipv.datasets.animated_stream.fetch().data[:,::,::4], size=5) ipv.animation_control(quiver, interval=200) ipv.show() ipv.style.use('light') quiver.size = np.random.random(quiver.x.shape) * 10 quiver.color = np.random.random(quiver.x.shape + (3,)) quiver.geo = "cat" # stereo quiver.geo = "arrow" N = 1000*1000 x, y, z = np.random.random((3, N)).astype('f4') ipv.figure() s = ipv.scatter(x, y, z, size=0.2) ipv.show() s.size = 0.1 #ipv.screenshot(width=2048, height=2048) plot3d = ds.plot_widget("x", "y", "z", vx="vx", vy="vy", vz="vz", backend="ipyvolume", f="log1p", shape=100, smooth_pre=0.5) plot3d.vcount_limits = [50, 100000] plot3d.backend.quiver.color = "red" import ipywidgets as widgets widgets.ColorPicker() widgets.jslink((plot3d.backend.quiver, 'color'), (_, 'value')) ipv.save("kapteyn-lunch-talk-2018.html") !open kapteyn-lunch-talk-2018.html # webrtc demo if time permits import vaex #gaia = vaex.open("ws://gaia:9000/gaia-dr1") gaia = vaex.open('/Users/maartenbreddels/datasets/gaia/gaia-dr1-minimal_f4.hdf5') %matplotlib inline f"{len(gaia):,}" ra_dec_limits = [[0, 360], [-90, 90]] gaia.set_active_fraction(0.01) gaia.plot_widget("ra", "dec", limits=ra_dec_limits) gaia.mean("phot_g_mean_mag", selection=True) gaia.plot1d("phot_g_mean_mag", selection=False, n=True, limits=[10, 22]) gaia.plot1d("phot_g_mean_mag", selection=True, show=True, n=True, limits=[10, 22]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: ipyvolume Step2: A Billion stars in the Jupyter notebook
11,977
<ASSISTANT_TASK:> Python Code: %matplotlib inline from ttim import * import numpy as np import matplotlib.pyplot as plt import pandas as pd H0 = 2.798 #initial displacement in m b = -6.1 #aquifer thickness rw1 = 0.102 #well radius of Ln-2 Well rw2 = 0.071 #well radius of observation Ln-3 Well rc1 = 0.051 #casing radius of Ln-2 Well rc2 = 0.025 #casing radius of Ln-3 Well r = 6.45 #distance from observation well to test well Q = np.pi * rc1 ** 2 * H0 print('Slug:', round(Q, 5), 'm^3') data1 = np.loadtxt('data/ln-2.txt') t1 = data1[:, 0] / 60 / 60 / 24 #convert time from seconds to days h1 = data1[:, 1] data2 = np.loadtxt('data/ln-3.txt') t2 = data2[:, 0] / 60 / 60 / 24 h2 = data2[:, 1] ml_0 = ModelMaq(kaq=10, z=[0, b], Saq=1e-4, \ tmin=1e-5, tmax=0.01) w_0 = Well(ml_0, xw=0, yw=0, rw=rw1, rc=rc1, tsandQ=[(0, -Q)], layers=0, wbstype='slug') ml_0.solve() #unknown parameters: kaq, Saq ca_0 = Calibrate(ml_0) ca_0.set_parameter(name='kaq0', initial=10) ca_0.set_parameter(name='Saq0', initial=1e-4) ca_0.series(name='Ln-2', x=0, y=0, layer=0, t=t1, h=h1) ca_0.series(name='Ln-3', x=r, y=0, layer=0, t=t2, h=h2) ca_0.fit(report=True) display(ca_0.parameters) print('RMSE:', ca_0.rmse()) hm1_0 = ml_0.head(0, 0, t1, layers=0) hm2_0 = ml_0.head(r, 0, t2, layers=0) plt.figure(figsize=(8, 5)) plt.semilogx(t1, h1/H0, '.', label='obs ln-2') plt.semilogx(t1, hm1_0[0]/H0, label='ttim ln-2') plt.semilogx(t2, h2/H0, '.', label='obs ln-3') plt.semilogx(t2, hm2_0[0]/H0, label='ttim ln-3') plt.xlabel('time(d)') plt.ylabel('h/H0') plt.legend(); ml_1 = ModelMaq(kaq=10, z=[0, b], Saq=1e-4, \ tmin=1e-5, tmax=0.01) w_1 = Well(ml_1, xw=0, yw=0, rw=rw1, res=0, rc=rc1, tsandQ=[(0, -Q)], layers=0, wbstype='slug') ml_1.solve() #unknown parameters: kaq, Saq, res ca_1 = Calibrate(ml_1) ca_1.set_parameter(name='kaq0', initial=10) ca_1.set_parameter(name='Saq0', initial=1e-4) ca_1.set_parameter_by_reference(name='res', parameter=w_1.res, initial=0) ca_1.series(name='Ln-2', x=0, y=0, layer=0, t=t1, h=h1) ca_1.series(name='Ln-3', x=r, y=0, layer=0, t=t2, h=h2) ca_1.fit(report=True) display(ca_1.parameters) print('RMSE:', ca_1.rmse()) hm1_1 = ml_1.head(0, 0, t1, layers=0) hm2_1 = ml_1.head(r, 0, t2, layers=0) plt.figure(figsize=(8, 5)) plt.semilogx(t1, h1/H0, '.', label='obs ln-2') plt.semilogx(t1, hm1_1[0]/H0, label='ttim ln-2') plt.semilogx(t2, h2/H0, '.', label='obs ln-3') plt.semilogx(t2, hm2_1[0]/H0, label='ttim ln-3') plt.xlabel('time(d)') plt.ylabel('h/H0') plt.legend(); #Determine elevations of each layer. #Thickness of each layer is set to be 0.5 m. z = np.arange(0, b, -0.5) zlay = np.append(z, b) nlay = len(zlay) - 1 Saq_2 = 1e-4 * np.ones(nlay) n = np.arange(0, 13,1) ml_2 = Model3D(kaq=10, z=zlay, Saq=Saq_2, kzoverkh=1, tmin=1e-5, tmax=0.01, \ phreatictop=True) w_2 = Well(ml_2, xw=0, yw=0, rw=rw1, tsandQ=[(0, -Q)], layers=n, rc=rc1, \ wbstype='slug') ml_2.solve() ca_2 = Calibrate(ml_2) ca_2.set_parameter(name='kaq0_12', initial=10) ca_2.set_parameter(name='Saq0_12', initial=1e-4, pmin=0) ca_2.series(name='Ln-2', x=0, y=0, layer=n, t=t1, h=h1) ca_2.series(name='Ln-3', x=r, y=0, layer=n, t=t2, h=h2) ca_2.fit(report=True) display(ca_2.parameters) print('RMSE:', ca_2.rmse()) hm1_2 = ml_2.head(0, 0, t1, layers=n) hm2_2 = ml_2.head(r, 0, t2, layers=n) plt.figure(figsize=(8, 5)) plt.semilogx(t1, h1/H0, '.', label='obs ln-2') plt.semilogx(t1, hm1_2[0]/H0, label='ttim ln-2') plt.semilogx(t2, h2/H0, '.', label='obs ln-3') plt.semilogx(t2, hm2_2[0]/H0, label='ttim ln-3') plt.xlabel('time(d)') plt.ylabel('h/H0') plt.legend(); t = pd.DataFrame(columns=['k [m/d]', 'Ss [1/m]'], \ index=['MLU', 'AQTESOLV', 'ttim-single', 'ttim-multi']) t.loc['AQTESOLV'] = [1.166, 9.368E-06] t.loc['MLU'] = [1.311, 8.197E-06] t.loc['ttim-single'] = ca_0.parameters['optimal'].values t.loc['ttim-multi'] = ca_2.parameters['optimal'].values t['RMSE'] = [0.010373, 0.009151, ca_0.rmse(), ca_1.rmse()] t <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set background parameters Step2: Slug Step3: Load data Step4: Create single layer conceptual model Step5: Calibrate with two datasets simultaneously Step6: Try adding well skin resistance res Step7: Adding well screen resistance does not improve the performance obviously. While the AIC value increases. Thus, res should be removed from the model. Step8: Calibrate with two datasets simultaneously Step9: Summary of values presented by AQTESOLV & MLU
11,978
<ASSISTANT_TASK:> Python Code: # Authors: Eric Larson <larson.eric.d@gmail.com> # Chris Holdgraf <choldgraf@gmail.com> # Adam Li <adam2392@gmail.com> # Alex Rockhill <aprockhill@mailbox.org> # Liberty Hamilton <libertyhamilton@gmail.com> # # License: BSD-3-Clause import os.path as op import numpy as np import matplotlib.pyplot as plt from matplotlib.cm import get_cmap from mne_bids import BIDSPath, read_raw_bids import mne from mne.viz import plot_alignment, snapshot_brain_montage print(__doc__) # paths to mne datasets - sample ECoG and FreeSurfer subject bids_root = mne.datasets.epilepsy_ecog.data_path() sample_path = mne.datasets.sample.data_path() subjects_dir = op.join(sample_path, 'subjects') # first define the bids path bids_path = BIDSPath(root=bids_root, subject='pt1', session='presurgery', task='ictal', datatype='ieeg', extension='vhdr') # then we'll use it to load in the sample dataset # Here we use a format (iEEG) that is only available in MNE-BIDS 0.7+, so it # will emit a warning on versions <= 0.6 raw = read_raw_bids(bids_path=bids_path, verbose=False) # Pick only the ECoG channels, removing the EKG channels raw.pick_types(ecog=True) # Load the data raw.load_data() # Then we remove line frequency interference raw.notch_filter([60], trans_bandwidth=3) # drop bad channels raw.drop_channels(raw.info['bads']) # the coordinate frame of the montage montage = raw.get_montage() print(montage.get_positions()['coord_frame']) # add fiducials to montage montage.add_mni_fiducials(subjects_dir) # now with fiducials assigned, the montage will be properly converted # to "head" which is what MNE requires internally (this is the coordinate # system with the origin between LPA and RPA whereas MNI has the origin # at the posterior commissure) raw.set_montage(montage) # Find the annotated events events, event_id = mne.events_from_annotations(raw) # Make a 25 second epoch that spans before and after the seizure onset epoch_length = 25 # seconds epochs = mne.Epochs(raw, events, event_id=event_id['onset'], tmin=13, tmax=13 + epoch_length, baseline=None) # Make evoked from the one epoch and resample evoked = epochs.average().resample(200) del epochs fig = plot_alignment(raw.info, trans='fsaverage', subject='fsaverage', subjects_dir=subjects_dir, surfaces=['pial'], coord_frame='head') mne.viz.set_3d_view(fig, azimuth=0, elevation=70) xy, im = snapshot_brain_montage(fig, raw.info) sfreq = 10 gamma_power_t = evoked.copy().filter(30, 90).apply_hilbert( envelope=True).resample(sfreq) gamma_info = gamma_power_t.info # convert from a dictionary to array to plot xy_pts = np.vstack([xy[ch] for ch in raw.info['ch_names']]) # get a colormap to color nearby points similar colors cmap = get_cmap('viridis') # create the figure of the brain with the electrode positions fig, ax = plt.subplots(figsize=(5, 5)) ax.set_title('Gamma power over time', size='large') ax.imshow(im) ax.set_axis_off() # normalize gamma power for plotting gamma_power = -100 * gamma_power_t.data / gamma_power_t.data.max() # add the time course overlaid on the positions x_line = np.linspace(-0.025 * im.shape[0], 0.025 * im.shape[0], gamma_power_t.data.shape[1]) for i, pos in enumerate(xy_pts): x, y = pos color = cmap(i / xy_pts.shape[0]) ax.plot(x_line + x, gamma_power[i] + y, linewidth=0.5, color=color) xyz_pts = np.array([dig['r'] for dig in evoked.info['dig']]) src = mne.read_source_spaces( op.join(subjects_dir, 'fsaverage', 'bem', 'fsaverage-ico-5-src.fif')) stc = mne.stc_near_sensors(gamma_power_t, trans='fsaverage', subject='fsaverage', src=src, mode='nearest', subjects_dir=subjects_dir, distance=0.02) vmin, vmid, vmax = np.percentile(gamma_power_t.data, [10, 25, 90]) clim = dict(kind='value', lims=[vmin, vmid, vmax]) brain = stc.plot(surface='pial', hemi='rh', colormap='inferno', colorbar=False, clim=clim, views=['lat', 'med'], subjects_dir=subjects_dir, size=(250, 250), smoothing_steps='nearest', time_viewer=False) brain.add_sensors(raw.info, trans='fsaverage') # You can save a movie like the one on our documentation website with: # brain.save_movie(time_dilation=1, interpolation='linear', framerate=3, # time_viewer=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load in data and perform basic preprocessing Step2: Explore the electrodes on a template brain Step3: Compute frequency features of the data Step4: Visualize the time-evolution of the gamma power on the brain Step5: We can project gamma power from the sensor data to the nearest locations on
11,979
<ASSISTANT_TASK:> Python Code: import pandas as pd # read CSV file directly from a URL and save the results data = pd.read_csv('http://www-bcf.usc.edu/~gareth/ISL/Advertising.csv', index_col=0) # display the first 5 rows data.head() data.shape # conventional way to import seaborn import seaborn as sns # allow plots to appear within the notebook %matplotlib inline sns.pairplot(data, x_vars=['TV','radio','newspaper'], y_vars='sales', size=7, aspect=0.7, kind='reg') feature_cols = ['TV', 'radio', 'newspaper'] # use the list to select a subset of the original DataFrame X = data[feature_cols] # equivalent command to do this in one line X = data[['TV', 'radio', 'newspaper']] # print the first 5 rows X.head() print(type(X)) print(X.shape) # select a Series from the DataFrame y = data['sales'] # equivalent command that works if there are no spaces in the column name y = data.sales # print the first 5 values y.head() # check the type and shape of y print(type(y)) print(y.shape) from sklearn.cross_validation import train_test_split X_train, X_test, y_train, y_test = train_test_split(X, y, random_state=1) # default split is 75% for training and 25% for testing print(X_train.shape) print(y_train.shape) print(X_test.shape) print(y_test.shape) # import model from sklearn.linear_model import LinearRegression # instantiate linreg = LinearRegression() # fit the model to the training data (learn the coefficients) linreg.fit(X_train, y_train) # print the intercept and coefficients print(linreg.intercept_) print(linreg.coef_) # pair the feature names with the coefficients list(zip(feature_cols, linreg.coef_)) y_pred = linreg.predict(X_test) print(y_pred) from sklearn import metrics import numpy as np print(np.sqrt(metrics.mean_squared_error(y_test, y_pred))) # import load_iris function from datasets module from sklearn.datasets import load_iris iris = load_iris() type(iris) # print the iris data print(iris.feature_names) print(len(iris.data)) # print integers representing the species of each observation print(iris.target) print(len(iris.target)) # print the encoding scheme for species: 0 = setosa, 1 = versicolor, 2 = virginica print(iris.target_names) X = iris.data # store response vector in "y" y = iris.target X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.4, random_state=4) print(X_train.shape) print(X_test.shape) print(y_train.shape) print(y_test.shape) from sklearn.linear_model import LogisticRegression logreg = LogisticRegression() logreg.fit(X_train, y_train) y_pred = logreg.predict(X_test) print(y_pred) print(metrics.accuracy_score(y_test, y_pred)) %matplotlib inline import numpy as np import matplotlib.pyplot as plt import seaborn; from scipy import stats import pylab as pl seaborn.set() from sklearn.datasets.samples_generator import make_blobs X, y = make_blobs(n_samples=50, centers=2, random_state=0, cluster_std=0.60) xfit = np.linspace(-1, 3.5) plt.scatter(X[:, 0], X[:, 1], c=y, s=50, cmap='spring') # Draw three lines that couple separate the data for m, b, d in [(1, 0.65, 0.33), (0.5, 1.6, 0.55), (-0.2, 2.9, 0.2)]: yfit = m * xfit + b plt.plot(xfit, yfit, '-k') plt.fill_between(xfit, yfit - d, yfit + d, edgecolor='none', color='#AAAAAA', alpha=0.4) plt.xlim(-1, 3.5); X = iris.data y = iris.target X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.4, random_state=4) print(X_train.shape) print(X_test.shape) print(y_train.shape) print(y_test.shape) from sklearn.svm import SVC clf = SVC(kernel='linear') clf.fit(X_train, y_train) y_pred=clf.predict(X_test) print(y_pred) print(metrics.accuracy_score(y_test, y_pred)) from sklearn.datasets import load_digits digits = load_digits() digits.keys() X = digits.data y = digits.target print(X.shape) print(y.shape) # set up the figure fig = plt.figure(figsize=(6, 6)) # figure size in inches fig.subplots_adjust(left=0, right=1, bottom=0, top=1, hspace=0.05, wspace=0.05) # plot the digits: each image is 8x8 pixels for i in range(64): ax = fig.add_subplot(8, 8, i + 1, xticks=[], yticks=[]) ax.imshow(digits.images[i], cmap=plt.cm.binary, interpolation='nearest') # label the image with the target value ax.text(0, 7, str(digits.target[i])) from sklearn.cross_validation import train_test_split from sklearn import metrics Xtrain, Xtest, ytrain, ytest = train_test_split(X, y, random_state=0) clf = DecisionTreeClassifier(max_depth=11) clf.fit(Xtrain, ytrain) ypred = clf.predict(Xtest) metrics.accuracy_score(ypred, ytest) plt.imshow(metrics.confusion_matrix(ypred, ytest), interpolation='nearest', cmap=plt.cm.binary) plt.grid(False) plt.colorbar() plt.xlabel("predicted label") plt.ylabel("true label"); from sklearn.ensemble import RandomForestClassifier clf = RandomForestClassifier(n_jobs=2, random_state=0) clf.fit(Xtrain, ytrain) ypred = clf.predict(Xtest) metrics.accuracy_score(ypred, ytest) plt.imshow(metrics.confusion_matrix(ypred, ytest), interpolation='nearest', cmap=plt.cm.binary) plt.grid(False) plt.colorbar() plt.xlabel("predicted label") plt.ylabel("true label"); from sklearn.datasets.samples_generator import make_blobs X, y = make_blobs(n_samples=300, centers=4, random_state=0, cluster_std=0.60) plt.scatter(X[:, 0], X[:, 1], s=50); from sklearn.cluster import KMeans est = KMeans(4) # 4 clusters est.fit(X) y_kmeans = est.predict(X) plt.scatter(X[:, 0], X[:, 1], c=y_kmeans, s=50, cmap='rainbow'); from sklearn import datasets, cluster import numpy as np import matplotlib.pyplot as plt np.random.seed(2) # load data iris = datasets.load_iris() X_iris = iris.data y_iris = iris.target k_means = cluster.KMeans(n_clusters=3) k_means.fit(X_iris) labels = k_means.labels_ # check how many of the samples were correctly labeled correct_labels = sum(y_iris == labels) print("Result: %d out of %d samples were correctly labeled." % (correct_labels, y_iris.size)) from __future__ import print_function, division %matplotlib inline import numpy as np import matplotlib.pyplot as plt from scipy import stats # use seaborn plotting style defaults np.random.seed(1) X = np.dot(np.random.random(size=(2, 2)), np.random.normal(size=(2, 200))).T plt.plot(X[:, 0], X[:, 1], 'o') plt.axis('equal'); from sklearn.decomposition import PCA pca = PCA(n_components=2) pca.fit(X) print(pca.explained_variance_) print(pca.components_) plt.plot(X[:, 0], X[:, 1], 'o', alpha=0.5) for length, vector in zip(pca.explained_variance_, pca.components_): v = vector * 3 * np.sqrt(length) plt.plot([0, v[0]], [0, v[1]], '-k', lw=3) plt.axis('equal'); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: What are the features? Step2: Linear regression Step3: Splitting X and y into training and testing sets Step4: Linear regression in scikit-learn Step5: Interpreting model coefficients Step6: Making predictions Step7: We need an evaluation metric in order to compare our predictions with the actual values! Step8: Classifications on the iris dataset Step9: Logistic regression Step10: Evaluation metric Step11: Alternatives Step12: Apply SVM to iris Step13: Supervised Learning In-Depth Step14: Motivating Random Forests Step15: Ensemble the decision tress Step16: Unsupervised learning Step17: By eye, it is relatively easy to pick out the four clusters. If you were to perform an exhaustive search for the different segmentations of the data, however, the search space would be exponential in the number of points. Fortunately, there is a well-known Expectation Maximization (EM) procedure which scikit-learn implements, so that KMeans can be solved relatively quickly. Step18: Let's use scikit-learn for K-means clustering on Iris dataset Step19: Introducing Principal Component Analysis Step20: We can see that there is a definite trend in the data. What PCA seeks to do is to find the Principal Axes in the data, and explain how important those axes are in describing the data distribution
11,980
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'pcmdi', 'sandbox-3', 'aerosol') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.scheme_scope') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "troposhere" # "stratosphere" # "mesosphere" # "mesosphere" # "whole atmosphere" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.basic_approximations') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.prognostic_variables_form') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "3D mass/volume ratio for aerosols" # "3D number concenttration for aerosols" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.number_of_tracers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.family_approach') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses atmospheric chemistry time stepping" # "Specific timestepping (operator splitting)" # "Specific timestepping (integrated)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.split_operator_advection_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.split_operator_physical_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.integrated_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.integrated_scheme_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Implicit" # "Semi-implicit" # "Semi-analytic" # "Impact solver" # "Back Euler" # "Newton Raphson" # "Rosenbrock" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.meteorological_forcings.variables_3D') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.meteorological_forcings.variables_2D') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.meteorological_forcings.frequency') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.is_adaptive_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.global_mean_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.regional_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.trend_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses Atmospheric chemistry transport scheme" # "Specific transport scheme (eulerian)" # "Specific transport scheme (semi-lagrangian)" # "Specific transport scheme (eulerian and semi-lagrangian)" # "Specific transport scheme (lagrangian)" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.mass_conservation_scheme') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses Atmospheric chemistry transport scheme" # "Mass adjustment" # "Concentrations positivity" # "Gradients monotonicity" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.convention') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses Atmospheric chemistry transport scheme" # "Convective fluxes connected to tracers" # "Vertical velocities connected to tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Prescribed (climatology)" # "Prescribed CMIP6" # "Prescribed above surface" # "Interactive" # "Interactive above surface" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.sources') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Vegetation" # "Volcanos" # "Bare ground" # "Sea surface" # "Lightning" # "Fires" # "Aircraft" # "Anthropogenic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.prescribed_climatology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Interannual" # "Annual" # "Monthly" # "Daily" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.prescribed_climatology_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.prescribed_spatially_uniform_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.interactive_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.other_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.other_method_characteristics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_lower_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_upper_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_fields_mmr') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_fields_mmr') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.absorption.black_carbon') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.absorption.dust') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.absorption.organics') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.mixtures.external') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.mixtures.internal') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.mixtures.mixing_rule') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.impact_of_h2o.size') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.impact_of_h2o.internal_mixture') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.radiative_scheme.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.radiative_scheme.shortwave_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.radiative_scheme.longwave_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.twomey') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.twomey_minimum_ccn') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.drizzle') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.cloud_lifetime') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.longwave_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Dry deposition" # "Sedimentation" # "Wet deposition (impaction scavenging)" # "Wet deposition (nucleation scavenging)" # "Coagulation" # "Oxidation (gas phase)" # "Oxidation (in cloud)" # "Condensation" # "Ageing" # "Advection (horizontal)" # "Advection (vertical)" # "Heterogeneous chemistry" # "Nucleation" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Radiation" # "Land surface" # "Heterogeneous chemistry" # "Clouds" # "Ocean" # "Cryosphere" # "Gas phase chemistry" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.gas_phase_precursors') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "DMS" # "SO2" # "Ammonia" # "Iodine" # "Terpene" # "Isoprene" # "VOC" # "NOx" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Bulk" # "Modal" # "Bin" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.bulk_scheme_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sulphate" # "Nitrate" # "Sea salt" # "Dust" # "Ice" # "Organic" # "Black carbon / soot" # "SOA (secondary organic aerosols)" # "POM (particulate organic matter)" # "Polar stratospheric ice" # "NAT (Nitric acid trihydrate)" # "NAD (Nitric acid dihydrate)" # "STS (supercooled ternary solution aerosol particule)" # "Other: [Please specify]" # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Scheme Scope Step7: 1.4. Basic Approximations Step8: 1.5. Prognostic Variables Form Step9: 1.6. Number Of Tracers Step10: 1.7. Family Approach Step11: 2. Key Properties --&gt; Software Properties Step12: 2.2. Code Version Step13: 2.3. Code Languages Step14: 3. Key Properties --&gt; Timestep Framework Step15: 3.2. Split Operator Advection Timestep Step16: 3.3. Split Operator Physical Timestep Step17: 3.4. Integrated Timestep Step18: 3.5. Integrated Scheme Type Step19: 4. Key Properties --&gt; Meteorological Forcings Step20: 4.2. Variables 2D Step21: 4.3. Frequency Step22: 5. Key Properties --&gt; Resolution Step23: 5.2. Canonical Horizontal Resolution Step24: 5.3. Number Of Horizontal Gridpoints Step25: 5.4. Number Of Vertical Levels Step26: 5.5. Is Adaptive Grid Step27: 6. Key Properties --&gt; Tuning Applied Step28: 6.2. Global Mean Metrics Used Step29: 6.3. Regional Metrics Used Step30: 6.4. Trend Metrics Used Step31: 7. Transport Step32: 7.2. Scheme Step33: 7.3. Mass Conservation Scheme Step34: 7.4. Convention Step35: 8. Emissions Step36: 8.2. Method Step37: 8.3. Sources Step38: 8.4. Prescribed Climatology Step39: 8.5. Prescribed Climatology Emitted Species Step40: 8.6. Prescribed Spatially Uniform Emitted Species Step41: 8.7. Interactive Emitted Species Step42: 8.8. Other Emitted Species Step43: 8.9. Other Method Characteristics Step44: 9. Concentrations Step45: 9.2. Prescribed Lower Boundary Step46: 9.3. Prescribed Upper Boundary Step47: 9.4. Prescribed Fields Mmr Step48: 9.5. Prescribed Fields Mmr Step49: 10. Optical Radiative Properties Step50: 11. Optical Radiative Properties --&gt; Absorption Step51: 11.2. Dust Step52: 11.3. Organics Step53: 12. Optical Radiative Properties --&gt; Mixtures Step54: 12.2. Internal Step55: 12.3. Mixing Rule Step56: 13. Optical Radiative Properties --&gt; Impact Of H2o Step57: 13.2. Internal Mixture Step58: 14. Optical Radiative Properties --&gt; Radiative Scheme Step59: 14.2. Shortwave Bands Step60: 14.3. Longwave Bands Step61: 15. Optical Radiative Properties --&gt; Cloud Interactions Step62: 15.2. Twomey Step63: 15.3. Twomey Minimum Ccn Step64: 15.4. Drizzle Step65: 15.5. Cloud Lifetime Step66: 15.6. Longwave Bands Step67: 16. Model Step68: 16.2. Processes Step69: 16.3. Coupling Step70: 16.4. Gas Phase Precursors Step71: 16.5. Scheme Type Step72: 16.6. Bulk Scheme Species
11,981
<ASSISTANT_TASK:> Python Code: import nltk from nltk.corpus import brown brown.words()[0:10] brown.tagged_words()[0:10] len(brown.words()) dir(brown) from nltk.book import * dir(text1) len(text1) from nltk import sent_tokenize, word_tokenize, pos_tag text = "Machine learning is the science of getting computers to act without being explicitly programmed. In the past decade, machine learning has given us self-driving cars, practical speech recognition, effective web search, and a vastly improved understanding of the human genome. Machine learning is so pervasive today that you probably use it dozens of times a day without knowing it. Many researchers also think it is the best way to make progress towards human-level AI. In this class, you will learn about the most effective machine learning techniques, and gain practice implementing them and getting them to work for yourself. More importantly, you'll learn about not only the theoretical underpinnings of learning, but also gain the practical know-how needed to quickly and powerfully apply these techniques to new problems. Finally, you'll learn about some of Silicon Valley's best practices in innovation as it pertains to machine learning and AI." sents = sent_tokenize(text) sents len(sents) tokens = word_tokenize(text) tokens len(tokens) tagged_tokens = pos_tag(tokens) tagged_tokens text = "this’s a sent tokenize test. this is sent two. is this sent three? sent 4 is cool! Now it’s your turn." from nltk.tokenize import sent_tokenize sent_tokenize_list = sent_tokenize(text) len(sent_tokenize_list) sent_tokenize_list import nltk.data tokenizer = nltk.data.load('tokenizers/punkt/english.pickle') tokenizer.tokenize(text) spanish_tokenizer = nltk.data.load('tokenizers/punkt/spanish.pickle') spanish_tokenizer.tokenize('Hola amigo. Estoy bien.') from nltk.tokenize import word_tokenize word_tokenize('Hello World.') word_tokenize("this's a test") from nltk.tokenize import TreebankWordTokenizer tokenizer = TreebankWordTokenizer() tokenizer.tokenize("this’s a test") # Standard word tokenizer. _word_tokenize = TreebankWordTokenizer().tokenize def word_tokenize(text): Return a tokenized copy of *text*, using NLTK's recommended word tokenizer (currently :class:`.TreebankWordTokenizer`). This tokenizer is designed to work on a sentence at a time. return _word_tokenize(text) word_tokenize("this’s a test") from nltk.tokenize import WordPunctTokenizer word_punct_tokenizer = WordPunctTokenizer() word_punct_tokenizer.tokenize('This’s a test') text = nltk.word_tokenize("Dive into NLTK: Part-of-speech tagging and POS Tagger") text nltk.pos_tag(text) nltk.help.upenn_tagset('NN.*') nltk.help.upenn_tagset('VB.*') nltk.help.upenn_tagset('JJ.*') nltk.help.upenn_tagset('CC.*') nltk.help.upenn_tagset('IN.*') nltk.help.upenn_tagset('PRP.*') nltk.help.upenn_tagset('DT.*') # Natural Language Toolkit: TnT Tagger # # Copyright (C) 2001-2013 NLTK Project # Author: Sam Huston <sjh900@gmail.com> # # URL: <http://www.nltk.org/> # For license information, see LICENSE.TXT ''' Implementation of 'TnT - A Statisical Part of Speech Tagger' by Thorsten Brants http://acl.ldc.upenn.edu/A/A00/A00-1031.pdf ''' from __future__ import print_function from math import log from operator import itemgetter from nltk.probability import FreqDist, ConditionalFreqDist from nltk.tag.api import TaggerI class TnT(TaggerI): ''' TnT - Statistical POS tagger IMPORTANT NOTES: * DOES NOT AUTOMATICALLY DEAL WITH UNSEEN WORDS - It is possible to provide an untrained POS tagger to create tags for unknown words, see __init__ function * SHOULD BE USED WITH SENTENCE-DELIMITED INPUT - Due to the nature of this tagger, it works best when trained over sentence delimited input. - However it still produces good results if the training data and testing data are separated on all punctuation eg: [,.?!] - Input for training is expected to be a list of sentences where each sentence is a list of (word, tag) tuples - Input for tag function is a single sentence Input for tagdata function is a list of sentences Output is of a similar form * Function provided to process text that is unsegmented - Please see basic_sent_chop() TnT uses a second order Markov model to produce tags for a sequence of input, specifically: argmax [Proj(P(t_i|t_i-1,t_i-2)P(w_i|t_i))] P(t_T+1 | t_T) IE: the maximum projection of a set of probabilities The set of possible tags for a given word is derived from the training data. It is the set of all tags that exact word has been assigned. To speed up and get more precision, we can use log addition to instead multiplication, specifically: argmax [Sigma(log(P(t_i|t_i-1,t_i-2))+log(P(w_i|t_i)))] + log(P(t_T+1|t_T)) The probability of a tag for a given word is the linear interpolation of 3 markov models; a zero-order, first-order, and a second order model. P(t_i| t_i-1, t_i-2) = l1*P(t_i) + l2*P(t_i| t_i-1) + l3*P(t_i| t_i-1, t_i-2) A beam search is used to limit the memory usage of the algorithm. The degree of the beam can be changed using N in the initialization. N represents the maximum number of possible solutions to maintain while tagging. It is possible to differentiate the tags which are assigned to capitalized words. However this does not result in a significant gain in the accuracy of the results.''' from nltk.corpus import treebank len(treebank.tagged_sents()) train_data = treebank.tagged_sents()[:3000] test_data = treebank.tagged_sents()[3000:] train_data[0] test_data[0] from nltk.tag import tnt tnt_pos_tagger = tnt.TnT() tnt_pos_tagger.train(train_data) tnt_pos_tagger.evaluate(test_data) import pickle f = open('tnt_pos_tagger.pickle', "w") pickle.dump(tnt_pos_tagger, f) f.close() tnt_tagger.tag(nltk.word_tokenize("this is a tnt treebank tnt tagger")) from nltk.stem.porter import PorterStemmer porter_stemmer = PorterStemmer() from nltk.stem.lancaster import LancasterStemmer lancaster_stemmer = LancasterStemmer() from nltk.stem import SnowballStemmer snowball_stemmer = SnowballStemmer("english") #from nltk.stem.api import StemmerI #api_stemmer = StemmerI() from nltk.stem.regexp import RegexpStemmer regexp_stemmer = RegexpStemmer("english") from nltk.stem.isri import ISRIStemmer isri_stemmer = ISRIStemmer() from nltk.stem.rslp import RSLPStemmer rlsp_stemmer = RSLPStemmer() if __name__ == "__main__": import doctest doctest.testmod(optionflags=doctest.NORMALIZE_WHITESPACE) words = ['maximum','presumably','multiply','provision','owed','ear','saying','crying','string','meant','cement'] porter_words = [] for word in words: porter_words.append(porter_stemmer.stem(word)) porter_words lancaster_words = [] for word in words: lancaster_words.append(lancaster_stemmer.stem(word)) lancaster_words snowball_words = [] for word in words: snowball_words.append(snowball_stemmer.stem(word)) snowball_words isri_words = [] for word in words: isri_words.append(isri_stemmer.stem(word)) isri_words rlsp_words = [] for word in words: rlsp_words.append(rlsp_stemmer.stem(word)) rlsp_words regexp_words = [] for word in words: regexp_words.append(regexp_stemmer.stem(word)) regexp_words from nltk.stem import WordNetLemmatizer wordnet_lemmatizer = WordNetLemmatizer() words_lem = ['dogs','churches','aardwolves','abaci','hardrock','attractive','are','is'] #words_lem_pos = pos_tag(words_lem) wordnet_words = [] for word in words_lem: if word == 'is' or word == 'are': # for verbs wordnet_words.append(wordnet_lemmatizer.lemmatize(word, pos='v')) else: # wordnet_words.append(wordnet_lemmatizer.lemmatize(word)) wordnet_words import nltk sentence = "At eight o'clock on Thursday morning Arthur didn't feel very good." tokens = nltk.word_tokenize(sentence) tokens tagged = nltk.pos_tag(tokens) tagged[0:6] entities = nltk.chunk.ne_chunk(tagged) entities from nltk.corpus import treebank t = treebank.parsed_sents('wsj_0001.mrg')[0] t.draw() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1. Test Brown Corpus Step2: 2. Test NLTK Book Resources Step3: 3. Sent Tokenize(sentence boundary detection, sentence segmentation), Word Tokenize and Pos Tagging Step4: 4. Sentence Tokenize and Word Tokenize Step6: Tokenizing text into words Step7: 5. Part-Of-Speech Tagging and POS Tagger Step8: TnT POS Tagger Model Step9: 6. Stemming Step10: 7. Lemmatization Step11: Some simple things you can do with NLTK
11,982
<ASSISTANT_TASK:> Python Code: # Store even numbers from 0 to 20 even_lst = [num for num in range(21) if num % 2 == 0] print(even_lst) cash_value = 20 rsu_dict = {"Max":20, "Willie":13, "Joanna":14} lst = [rsu_dict[name]*cash_value for name in rsu_dict] print(lst) my_dict = {"Ross":19, "Bernie":13, "Micah":15} cash_value = 20 # [19*20, 13*20, 15*20] cash_lst = [my_dict[key]*20 for key in my_dict] print(cash_lst) rows = 'ABC' cols = '123' vowels = ('a', 'e', 'i', 'o', 'u') sentence = 'cogito ergo sum' words = sentence.split() # Produce [A3, B2, C1] number_letter_lst = [rows[element]+cols[2-element] for element in range(3)] print(number_letter_lst) row_col_lst = [rows[i]+cols[2-i] for i in range(3)] # Produce [A1, B1, C1, A2, B2, C2, A3, B3, C3] my_lst = [r+c for c in cols for r in rows] print(my_lst) # Simply accessing rows and cols in a comprehensions [A1, A2, A3, B1, B2, B3, C1, C2, C3] # Non-Pythonic lst = [] for r in rows: for c in cols: lst.append(r+c) # Pythonic lst = [r+c for r in rows for c in cols] print(lst) # let's figure this list out with normal syntax lst = [] for r in (rows[i]+cols[i] for i in range(3)): for c in (rows[2-i]+cols[i] for i in range(3)): lst.append(r + 'x' + c) print(lst) # shortened crossed_list = [x + " x " + y for x in (rows[i]+cols[i] for i in range(3)) for y in (rows[2-i]+cols[i] for i in range(3))] print(crossed_list) x = sorted(words, key=lambda x: len(x)) print(x) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Example 2 Convert the reserved stock units (RSUs) an employee has in a company to the current cash value. Step2: Let's take a look at some values and see how we can produce certain outputs. Step3: Generators Step4: Let's try Creating
11,983
<ASSISTANT_TASK:> Python Code: %env PROJECT_ID <YOUR_PROJECT_ID> %env BUCKET_ID <YOUR_BUCKET_ID> %env REGION <REGION> %env TRAINER_PACKAGE_PATH ./census_training %env MAIN_TRAINER_MODULE census_training.train %env JOB_DIR <gs://YOUR_BUCKET_ID/xgb_job_dir> %env RUNTIME_VERSION 1.9 %env PYTHON_VERSION 3.5 ! mkdir census_training %%writefile ./census_training/train.py # [START setup] import datetime import os import subprocess from sklearn.preprocessing import LabelEncoder import pandas as pd from google.cloud import storage import xgboost as xgb # TODO: REPLACE 'BUCKET_CREATED_ABOVE' with your GCS BUCKET_ID BUCKET_ID = 'torryyang-xgb-models' # [END setup] # --------------------------------------- # 1. Add code to download the data from GCS (in this case, using the publicly hosted data). # AI Platform will then be able to use the data when training your model. # --------------------------------------- # [START download-data] census_data_filename = 'adult.data.csv' # Public bucket holding the census data bucket = storage.Client().bucket('cloud-samples-data') # Path to the data inside the public bucket data_dir = 'ml-engine/census/data/' # Download the data blob = bucket.blob(''.join([data_dir, census_data_filename])) blob.download_to_filename(census_data_filename) # [END download-data] # --------------------------------------- # This is where your model code would go. Below is an example model using the census dataset. # --------------------------------------- # [START define-and-load-data] # these are the column labels from the census data files COLUMNS = ( 'age', 'workclass', 'fnlwgt', 'education', 'education-num', 'marital-status', 'occupation', 'relationship', 'race', 'sex', 'capital-gain', 'capital-loss', 'hours-per-week', 'native-country', 'income-level' ) # categorical columns contain data that need to be turned into numerical values before being used by XGBoost CATEGORICAL_COLUMNS = ( 'workclass', 'education', 'marital-status', 'occupation', 'relationship', 'race', 'sex', 'native-country' ) # Load the training census dataset with open(census_data_filename, 'r') as train_data: raw_training_data = pd.read_csv(train_data, header=None, names=COLUMNS) # remove column we are trying to predict ('income-level') from features list train_features = raw_training_data.drop('income-level', axis=1) # create training labels list train_labels = (raw_training_data['income-level'] == ' >50K') # [END define-and-load-data] # [START categorical-feature-conversion] # Since the census data set has categorical features, we need to convert # them to numerical values. # convert data in categorical columns to numerical values encoders = {col:LabelEncoder() for col in CATEGORICAL_COLUMNS} for col in CATEGORICAL_COLUMNS: train_features[col] = encoders[col].fit_transform(train_features[col]) # [END categorical-feature-conversion] # [START load-into-dmatrix-and-train] # load data into DMatrix object dtrain = xgb.DMatrix(train_features, train_labels) # train model bst = xgb.train({}, dtrain, 20) # [END load-into-dmatrix-and-train] # --------------------------------------- # 2. Export and save the model to GCS # --------------------------------------- # [START export-to-gcs] # Export the model to a file model = 'model.bst' bst.save_model(model) # Upload the model to GCS bucket = storage.Client().bucket(BUCKET_ID) blob = bucket.blob('{}/{}'.format( datetime.datetime.now().strftime('census_%Y%m%d_%H%M%S'), model)) blob.upload_from_filename(model) # [END export-to-gcs] %%writefile ./census_training/__init__.py # Note that __init__.py can be an empty file. ! gcloud config set project $PROJECT_ID ! gcloud ml-engine jobs submit training census_training_$(date +"%Y%m%d_%H%M%S") \ --job-dir $JOB_DIR \ --package-path $TRAINER_PACKAGE_PATH \ --module-name $MAIN_TRAINER_MODULE \ --region $REGION \ --runtime-version=$RUNTIME_VERSION \ --python-version=$PYTHON_VERSION \ --scale-tier BASIC ! gsutil ls gs://$BUCKET_ID/census_* <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The data Step2: Part 2 Step3: Part 3 Step4: Submit the training job. Step5: [Optional] StackDriver Logging
11,984
<ASSISTANT_TASK:> Python Code: import hail as hl hl.init() ht = hl.import_table("gs://hail-datasets-tmp/dbSNP/GCF_000001405.25_GRCh37.p13_assembly_report.txt", no_header=True, comment="#", delimiter="\t", missing="na") field_names = ['sequence_name','sequence_role','assigned_molecule', 'assigned_molecule_location/type', 'genbank_accn', 'relationship', 'refseq_accn', 'assembly_unit', 'sequence_length', 'ucsc_style_name'] name = "dbSNP" version = "154" build = "GRCh37" n_rows = ht.count() n_partitions = ht.n_partitions() ht = ht.annotate_globals( metadata=hl.struct( name=name, version=version, reference_genome=build, n_rows=n_rows, n_partitions=n_partitions ) ) ht = ht.rename(dict(zip([f"f{i}" for i in range(10)], field_names))) ht = ht.drop("relationship").key_by("refseq_accn") ht.write("gs://hail-datasets-us/NCBI_assembly_report_p13_GRCh37.ht") ht = hl.read_table("gs://hail-datasets-us/NCBI_assembly_report_p13_GRCh37.ht") ht.describe() ht = hl.import_table("gs://hail-datasets-tmp/dbSNP/GCF_000001405.39_GRCh38.p13_assembly_report.txt", no_header=True, comment="#", delimiter="\t", missing="na") field_names = ['sequence_name','sequence_role','assigned_molecule', 'assigned_molecule_location/type', 'genbank_accn', 'relationship', 'refseq_accn', 'assembly_unit', 'sequence_length', 'ucsc_style_name'] name = "dbSNP" version = "154" build = "GRCh38" n_rows = ht.count() n_partitions = ht.n_partitions() ht = ht.annotate_globals( metadata=hl.struct( name=name, version=version, reference_genome=build, n_rows=n_rows, n_partitions=n_partitions ) ) ht = ht.rename(dict(zip([f"f{i}" for i in range(10)], field_names))) ht = ht.drop("relationship").key_by("refseq_accn") ht.write("gs://hail-datasets-us/NCBI_assembly_report_p13_GRCh38.ht") ht = hl.read_table("gs://hail-datasets-us/NCBI_assembly_report_p13_GRCh38.ht") ht.describe() mt37 = hl.import_vcf(f"gs://hail-datasets-tmp/dbSNP/dbSNP_154_GRCh37.vcf.bgz", header_file=f"gs://hail-datasets-tmp/dbSNP/dbSNP_154_GRCh37_header_only.vcf.txt", reference_genome=None, min_partitions=512) mt38 = hl.import_vcf(f"gs://hail-datasets-tmp/dbSNP/dbSNP_154_GRCh38.vcf.bgz", header_file=f"gs://hail-datasets-tmp/dbSNP/dbSNP_154_GRCh38_header_only.vcf.txt", reference_genome=None, min_partitions=512) mt37 = mt37.checkpoint(f"gs://hail-datasets-tmp/checkpoints/dbSNP_154_GRCh37_no_coding.mt", _read_if_exists=True, overwrite=False) mt38 = mt38.checkpoint(f"gs://hail-datasets-tmp/checkpoints/dbSNP_154_GRCh38_no_coding.mt", _read_if_exists=True, overwrite=False) # To get all contigs present for recoding to correct reference genome mapping contigs_present37 = mt37.aggregate_rows(hl.agg.collect_as_set(mt37.locus.contig)) contigs_present38 = mt38.aggregate_rows(hl.agg.collect_as_set(mt38.locus.contig)) # Load NCBI assembly reports with RefSeq mappings assembly37_ht = hl.read_table("gs://hail-datasets-us/NCBI_assembly_report_p13_GRCh37.ht") assembly37_ht = assembly37_ht.annotate( contig = hl.if_else(assembly37_ht.sequence_role == "unlocalized-scaffold", assembly37_ht.genbank_accn, assembly37_ht.assigned_molecule) ) assembly38_ht = hl.read_table("gs://hail-datasets-us/NCBI_assembly_report_p13_GRCh38.ht") # Map RefSeq identifiers to chromosomes for GRCh37 using the "contig" field we created in assembly report rg37 = hl.get_reference("GRCh37") refseq_to_chr37 = dict(zip(assembly37_ht.refseq_accn.collect(), assembly37_ht.contig.collect())) refseq_to_chr37 = {k: v for k, v in refseq_to_chr37.items() if k in contigs_present37 and v in rg37.contigs} # Map RefSeq identifiers to chromosomes for GRCh38 using the "ucsc_style_name" field in assembly report rg38 = hl.get_reference("GRCh38") refseq_to_chr38 = dict(zip(assembly38_ht.refseq_accn.collect(), assembly38_ht.ucsc_style_name.collect())) refseq_to_chr38 = {k: v for k, v in refseq_to_chr38.items() if k in contigs_present38 and v in rg38.contigs} recodings = { "GRCh37": refseq_to_chr37, "GRCh38": refseq_to_chr38 } # Convert array of strings like hl.array(["GnomAD:.,1,3.187e-05","TOPMED:.,1,2.389e-05"]) to a struct def arr_str_to_struct(hl_array, known_keys): _dict = hl.dict( hl_array.map( lambda x: ("_" + x.split(":")[0], x.split(":")[1].split(",").map(lambda x: hl.if_else(x == ".", hl.missing(hl.tfloat), hl.float(x)))) ) ) _struct = hl.rbind(_dict, lambda d: hl.struct(**{k: _dict.get(k) for k in known_keys})) return _struct # To get all possible keys for allele frequency arrays after loading VCF as MatrixTable # known_keys_FREQ = mt.aggregate_rows( # hl.agg.explode( # lambda x: hl.agg.collect_as_set(x), mt.info.FREQ.split("\\|").map(lambda x: x.split(":")[0]) # ) # ) known_keys = ['GENOME_DK','TWINSUK','dbGaP_PopFreq','Siberian','Chileans', 'FINRISK','HapMap','Estonian','ALSPAC','GoESP', 'TOPMED','PAGE_STUDY','1000Genomes','Korea1K','ChromosomeY', 'ExAC','Qatari','GoNL','MGP','GnomAD', 'Vietnamese','GnomAD_exomes','PharmGKB','KOREAN','Daghestan', 'HGDP_Stanford','NorthernSweden','SGDP_PRJ'] known_keys_FREQ = list(map(lambda x: f"_{x}", known_keys)) name = "dbSNP" version = "154" builds = ["GRCh37", "GRCh38"] for build in builds: mt = hl.import_vcf(f"gs://hail-datasets-tmp/{name}/{name}_{version}_{build}.vcf.bgz", header_file=f"gs://hail-datasets-tmp/{name}/{name}_{version}_{build}_header_only.vcf.txt", contig_recoding=recodings[build], skip_invalid_loci=True, reference_genome=build, min_partitions=512) # First annotation, go from str to array<str> for FREQ mt = mt.annotate_rows( info = mt.info.annotate( FREQ = hl.or_missing(hl.is_defined(mt.info.FREQ), mt.info.FREQ.split("\\|")) ) ) # Second annotation, turn array<str> into a struct for FREQ mt = mt.annotate_rows( info = mt.info.annotate( FREQ = hl.or_missing(hl.is_defined(mt.info.FREQ), arr_str_to_struct(mt.info.FREQ, known_keys_FREQ)) ) ) # Reformat clinical attributes from str to array mt = mt.annotate_rows( info = mt.info.annotate( CLNHGVS = hl.or_missing( hl.is_defined(mt.info.CLNHGVS), mt.info.CLNHGVS.split("(?:(\|)|(\,))")).map(lambda x: hl.if_else((x == "."), hl.missing(hl.tstr), x)), CLNVI = hl.or_missing( hl.is_defined(mt.info.CLNVI), mt.info.CLNVI.split("(?:(\|)|(\,))")).filter(lambda x: x != "."), CLNORIGIN = hl.or_missing( hl.is_defined(mt.info.CLNORIGIN), mt.info.CLNORIGIN.split("(?:(\|)|(\,))")).filter(lambda x: x != "."), CLNSIG = hl.or_missing( hl.is_defined(mt.info.CLNSIG), mt.info.CLNSIG.split("(?:(\|)|(\,))")).filter(lambda x: x != "."), CLNDISDB = hl.or_missing( hl.is_defined(mt.info.CLNDISDB), mt.info.CLNDISDB.split("(?:(\|)|(\,))")).filter(lambda x: x != "."), CLNDN = hl.or_missing( hl.is_defined(mt.info.CLNDN), mt.info.CLNDN.split("(?:(\|)|(\,))")).filter(lambda x: x != "."), CLNREVSTAT = hl.or_missing( hl.is_defined(mt.info.CLNREVSTAT), mt.info.CLNREVSTAT.split("(?:(\|)|(\,))")).filter(lambda x: x != "."), CLNACC = hl.or_missing( hl.is_defined(mt.info.CLNACC), mt.info.CLNACC.split("(?:(\|)|(\,))")).filter(lambda x: x != ".") ) ) mt = mt.checkpoint(f"gs://hail-datasets-tmp/checkpoints/{name}_{version}_{build}.mt", _read_if_exists=True, overwrite=False) name = "dbSNP" version = "154" builds = ["GRCh37", "GRCh38"] for build in builds: # No samples or entries in MT, just grab table with the rows mt = hl.read_matrix_table(f"gs://hail-datasets-tmp/checkpoints/{name}_{version}_{build}.mt") ht = mt.rows() ht_ba = ht.filter(hl.len(ht.alleles) <= 2) ht_ba = ht_ba.checkpoint(f"gs://hail-datasets-tmp/checkpoints/{name}_{version}_{build}_biallelic.ht", _read_if_exists=True, overwrite=False) ht_ma = ht.filter(hl.len(ht.alleles) > 2) ht_ma = ht_ma.checkpoint(f"gs://hail-datasets-tmp/checkpoints/{name}_{version}_{build}_multiallelic.ht", _read_if_exists=True, overwrite=False) ht_split = hl.split_multi(ht_ma, keep_star=True, permit_shuffle=True) ht_split = ht_split.repartition(64, shuffle=False) ht_split = ht_split.checkpoint(f"gs://hail-datasets-tmp/checkpoints/{name}_{version}_{build}_split_multiallelic.ht", _read_if_exists=True, overwrite=False) # Next, have to fix indices and union ht_split with ht_ba ht_union = ht_ba.union(ht_split, unify=True) ht_union = ht_union.annotate( a_index = hl.if_else(hl.is_missing(ht_union.a_index), 1, ht_union.a_index), was_split = hl.if_else(hl.is_missing(ht_union.was_split), False, ht_union.was_split), old_locus = hl.if_else(hl.is_missing(ht_union.old_locus), ht_union.locus, ht_union.old_locus), old_alleles = hl.if_else(hl.is_missing(ht_union.old_alleles), ht_union.alleles, ht_union.old_alleles) ) ht_union = ht_union.checkpoint(f"gs://hail-datasets-tmp/checkpoints/{name}_{version}_{build}_unioned.ht", _read_if_exists=True, overwrite=False) # Arrays for AFs start w/ ref allele in index 0, so just use a_index to get alternate AFs ht = ht_union.annotate( info = ht_union.info.annotate( FREQ = ht_union.info.FREQ.annotate( **{k: hl.or_missing(hl.is_defined(ht_union.info.FREQ[k]), ht_union.info.FREQ[k][ht_union.a_index]) for k in known_keys_FREQ} ) ) ) ht = ht.repartition(512, shuffle=True) ht = ht.checkpoint(f"gs://hail-datasets-tmp/checkpoints/{name}_{version}_{build}.ht", _read_if_exists=True, overwrite=False) n_rows = ht.count() n_partitions = ht.n_partitions() ht = ht.annotate_globals( metadata=hl.struct( name=name, version=version, reference_genome=build, n_rows=n_rows, n_partitions=n_partitions ) ) ht.write(f"gs://hail-datasets-us/{name}_{version}_{build}.ht") ht = hl.read_table(f"gs://hail-datasets-us/{name}_{version}_{build}.ht") ht.describe() print(str(hl.eval(ht.metadata)) + "\n") name = "dbSNP" version = "154" builds = ["GRCh37", "GRCh38"] for build in builds: # Write table with only rsid's ht_rsid = hl.read_table(f"gs://hail-datasets-us/{name}_{version}_{build}.ht") ht_rsid = ht_rsid.select("rsid") n_rows = ht_rsid.count() n_partitions = ht_rsid.n_partitions() ht_rsid = ht_rsid.annotate_globals( metadata=hl.struct( name=f"{name}_rsid", version=version, reference_genome=build, n_rows=n_rows, n_partitions=n_partitions ) ) ht_rsid.write(f"gs://hail-datasets-us/{name}_rsid_{version}_{build}.ht") ht_rsid = hl.read_table(f"gs://hail-datasets-us/{name}_rsid_{version}_{build}.ht") ht_rsid.describe() print(str(hl.eval(ht_rsid.metadata)) + "\n") # To check uniqueness of keys tables = ["gs://hail-datasets-us/dbSNP_rsid_154_GRCh37.ht", "gs://hail-datasets-us/dbSNP_rsid_154_GRCh38.ht"] for table in tables: ht = hl.read_table(table) ht_count = ht.count() print(f"n = {ht_count}") ht_distinct_count = ht.distinct().count() print(f"n_distinct = {ht_distinct_count}") if ht_count == ht_distinct_count: print(f"{table} rows unique\n") else: print(f"{table} rows NOT unique\n") import os import json datasets_path = os.path.abspath("../../hail/python/hail/experimental/datasets.json") with open(datasets_path, "r") as f: datasets = json.load(f) names = ["dbSNP", "dbSNP_rsid"] version = "154" builds = ["GRCh37", "GRCh38"] gcs_us_url_root = "gs://hail-datasets-us" gcs_eu_url_root = "gs://hail-datasets-eu" aws_us_url_root = "s3://hail-datasets-us-east-1" for name in names: json_entry = { "annotation_db": { "key_properties": [] }, "description": "dbSNP: Reference SNP (rs or RefSNP) Hail Table. The database includes both common and rare single-base nucleotide variation (SNV), short (=< 50bp) deletion/insertion polymorphisms, and other classes of small genetic variations.", "url": "https://www.ncbi.nlm.nih.gov/snp/docs/RefSNP_about/", "versions": [ { "reference_genome": builds[0], "url": { "aws": { "us": f"{aws_us_url_root}/{name}_{version}_{builds[0]}.ht" }, "gcp": { "eu": f"{gcs_eu_url_root}/{name}_{version}_{builds[0]}.ht", "us": f"{gcs_us_url_root}/{name}_{version}_{builds[0]}.ht" } }, "version": version }, { "reference_genome": builds[1], "url": { "aws": { "us": f"{aws_us_url_root}/{name}_{version}_{builds[1]}.ht" }, "gcp": { "eu": f"{gcs_eu_url_root}/{name}_{version}_{builds[1]}.ht", "us": f"{gcs_us_url_root}/{name}_{version}_{builds[1]}.ht" } }, "version": version } ] } if name == "dbSNP_rsid": json_entry["description"] = "dbSNP: This Hail Table contains a mapping from locus/allele pairs to Reference SNP IDs (rsID). For the full dataset, see dbSNP." datasets[name] = json_entry # Write new entries back to datasets.json config: with open(datasets_path, "w") as f: json.dump(datasets, f, sort_keys=True, ensure_ascii=False, indent=2) # Create/update schema .rst file import textwrap output_dir = os.path.abspath("../../hail/python/hail/docs/datasets/schemas") datasets_path = os.path.abspath("../../hail/python/hail/experimental/datasets.json") with open(datasets_path, "r") as f: datasets = json.load(f) names = ["dbSNP", "dbSNP_rsid"] for name in names: versions = sorted(set(dataset["version"] for dataset in datasets[name]["versions"])) if not versions: versions = [None] reference_genomes = sorted(set(dataset["reference_genome"] for dataset in datasets[name]["versions"])) if not reference_genomes: reference_genomes = [None] print(name) print(versions[0]) print(reference_genomes[0] + "\n") path = [dataset["url"]["gcp"]["us"] for dataset in datasets[name]["versions"] if all([dataset["version"] == versions[0], dataset["reference_genome"] == reference_genomes[0]])] assert len(path) == 1 path = path[0] if path.endswith(".ht"): table = hl.methods.read_table(path) table_class = "hail.Table" else: table = hl.methods.read_matrix_table(path) table_class = "hail.MatrixTable" description = table.describe(handler=lambda x: str(x)).split("\n") description = "\n".join([line.rstrip() for line in description]) template = .. _{dataset}: {dataset} {underline1} * **Versions:** {versions} * **Reference genome builds:** {ref_genomes} * **Type:** :class:`{class}` Schema ({version0}, {ref_genome0}) {underline2} .. code-block:: text {schema} context = { "dataset": name, "underline1": len(name) * "=", "version0": versions[0], "ref_genome0": reference_genomes[0], "versions": ", ".join([str(version) for version in versions]), "ref_genomes": ", ".join([str(reference_genome) for reference_genome in reference_genomes]), "underline2": len("".join(["Schema (", str(versions[0]), ", ", str(reference_genomes[0]), ")"])) * "~", "schema": textwrap.indent(description, " "), "class": table_class } with open(output_dir + f"/{name}.rst", "w") as f: f.write(template.format(**context).strip()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create Hail Tables from GRCh37 and GRCh38 assembly reports Step2: GRCh38 Step3: Create Hail Tables for dbSNP Step4: Use the function and known keys below to convert allele frequency arrays to structs Step5: Now can read in VCF files again as MatrixTables with the correct contig recodings, and reformat the allele frequency information in info.FREQ and the clinical attributes in info. Step6: Then we can just grab the rows table since we have no sample or entry information in the MatrixTable. Step7: Also write tables with only the rsID field, for smaller tables that just map [locus, alleles] to rsID. Step8: Add dbSNP to datasets API and annotation DB Step10: After adding tables to datasets.json, create .rst schema files for docs
11,985
<ASSISTANT_TASK:> Python Code: import cvxpy import numpy as np import matplotlib.pyplot as plt %matplotlib inline plt.rc("text", usetex=True) num_iters = 30 n = 20 m = 10 A = np.random.randn(m, n) b = np.random.randn(m, 1) # Initialize problem x = cvxpy.Variable(shape=(n, 1)) f = cvxpy.norm(x, 2) # Solve with CVXPY. cvxpy.Problem(cvxpy.Minimize(f), [A @ x == b]).solve(solver=cvxpy.SCS, verbose=True) cvxpy_f = f.value print ("Optimal value from CVXPY =", f.value) resid = A@x - b mu = cvxpy.Parameter(value=1, nonneg=True) penal_f = f + (mu/2.)*cvxpy.sum_squares(resid) res_conv = [] f_conv = [] for t in range(num_iters): cvxpy.Problem(cvxpy.Minimize(penal_f)).solve(solver=cvxpy.SCS) mu.value = mu.value * 2 res_conv.append(np.linalg.norm(resid.value)) f_conv.append(f.value) print("Optimal value from method of augmented Lagrangian =", f.value) plt.figure(figsize=(8, 6)) fontsize=20 plt.plot(f_conv, label="Penalty") plt.plot(np.ones(num_iters) * cvxpy_f, label="CVXPy") plt.legend(fontsize=fontsize) plt.xlabel("Number of iterations, $k$", fontsize=fontsize) plt.ylabel("Objective, $f(x_k)$", fontsize=fontsize) plt.xticks(fontsize=fontsize) plt.grid(True) _ = plt.yticks(fontsize=fontsize) plt.figure(figsize=(8, 6)) fontsize=20 plt.semilogy(res_conv) plt.xlabel("Number of iterations, $k$", fontsize=fontsize) plt.ylabel("Norm of residuals, $\|Ax_k - b\|_2$", fontsize=fontsize) plt.xticks(fontsize=fontsize) plt.grid(True) _ = plt.yticks(fontsize=fontsize) import numpy as np import matplotlib.pyplot as plt %matplotlib inline plt.rc("text", usetex=True) import cvxpy as cvx def dual_ascent(update_x, A, b, alpha, x0, lambda0, max_iter): x = x0.copy() lam = lambda0.copy() conv_x = [x] conv_lam = [lam] for i in range(max_iter): x = update_x(x, lam, A, b) lam = lam + alpha * (A @ x - b) conv_x.append(x.copy()) conv_lam.append(lam.copy()) return x, lam, conv_x, conv_lam m, n = 10, 20 A = np.random.randn(m, n) b = np.random.randn(m) P = np.random.randn(n, n) P = P.T @ P c = np.random.randn(n) spec = np.linalg.eigvalsh(P) mu = spec.min() print(mu) x = cvx.Variable(n) obj = 0.5 * cvx.quad_form(x, P) - c @ x problem = cvx.Problem(cvx.Minimize(obj), [A @ x == b]) problem.solve(verbose=True) print(np.linalg.norm(A @ x.value - b)) print(problem.value) x0 = np.random.randn(n) lam0 = np.random.randn(m) max_iter = 100000 alpha = 1e-3 def f(x): return 0.5 * x @ P @ x - c @ x def L(x, lam): return f(x) + lam @ (A @ x - b) def update_x(x, lam, A, b): return np.linalg.solve(P, c - A.T @ lam) x_da, lam_da, conv_x_da, conv_lam_da = dual_ascent(update_x, A, b, alpha, x0, lam0, max_iter) print(np.linalg.norm(A @ x_da - b)) print(0.5 * x_da @ P @ x_da - c @ x_da) plt.figure(figsize=(10, 8)) plt.plot([f(x) for x in conv_x_da], label="Objective") plt.plot(problem.value * np.ones(len(conv_x_da)), label="Traget value") # plt.yscale("log") plt.xscale("log") plt.legend(fontsize=20) plt.xlabel("\# iterations", fontsize=20) plt.xticks(fontsize=20) plt.yticks(fontsize=20) plt.grid(True) plt.plot([L(x, lam) for x, lam in zip(conv_x_da, conv_lam_da)], label="Lagrangian") plt.legend(fontsize=20) plt.xlabel("\# iterations", fontsize=20) plt.semilogy([np.linalg.norm(A @ x - b) for x in conv_x_da], label="$\|Ax - b\|_2$") plt.legend(fontsize=20) plt.xlabel("\# iterations", fontsize=20) plt.xticks(fontsize=20) plt.yticks(fontsize=20) plt.grid(True) def augmented_lagrangian(update_x, A, b, rho0, x0, lambda0, max_iter): x = x0.copy() lam = lambda0.copy() conv_x = [x] conv_lam = [lam] rho = rho0 for i in range(max_iter): x = update_x(x, lam, A, b) lam = lam + rho * (A @ x - b) conv_x.append(x.copy()) conv_lam.append(lam.copy()) return x, lam, conv_x, conv_lam def update_x_al(x, lam, A, b): return np.linalg.solve(P + rho * A.T @ A, c - A.T @ lam + A.T @ b) rho = 10 max_iter = 1000 x_al, lam_al, conv_x_al, conv_lam_al = augmented_lagrangian(update_x_al, A, b, rho, x0, lam0, max_iter) print(np.linalg.norm(A @ x_al - b)) print(0.5 * x_al @ P @ x_al - c @ x_al) plt.plot([f(x) for x in conv_x_da], label="DA") plt.plot([f(x) for x in conv_x_al], label="AL") # plt.yscale("log") plt.xscale("log") plt.legend(fontsize=20) plt.xlabel("\# iterations", fontsize=20) plt.ylabel("Objective", fontsize=20) plt.plot([L(x, lam) for x, lam in zip(conv_x_da, conv_lam_da)], label="DA") plt.plot([L(x, lam) for x, lam in zip(conv_x_al, conv_lam_al)], label="AL") plt.legend(fontsize=20) plt.xscale("log") plt.xlabel("\# iterations", fontsize=20) plt.xlabel("Lagrangian", fontsize=20) plt.semilogy([np.linalg.norm(A @ x - b) for x in conv_x_da], label="DA") plt.semilogy([np.linalg.norm(A @ x - b) for x in conv_x_al], label="AL") plt.legend(fontsize=20) plt.xscale("log") plt.xlabel("\# iterations", fontsize=20) plt.ylabel("$\|Ax - b\|_2$", fontsize=20) plt.grid(True) plt.yticks(fontsize=20) plt.xticks(fontsize=20) def admm(update_x, update_z, rho0, x0, z0, lambda0, max_iter): x = x0.copy() z = z0.copy() lam = lambda0.copy() conv_x = [x] conv_z = [z] conv_lam = [lam] rho = rho0 for i in range(max_iter): x = update_x(x, z, lam, A, b) z = update_z(x, z, lam, A, b) lam = lam + rho * (x - z) conv_x.append(x.copy()) conv_z.append(z.copy()) conv_lam.append(lam.copy()) return x, z, lam, conv_x, conv_z, conv_lam def update_x_admm(x, z, lam, A, b): n = x.shape[0] return np.linalg.solve(P + rho*np.eye(n), -lam + c + rho * z) def update_z_admm(x, z, lam, A, b): x_hat = lam / rho + x return x_hat - A.T @ np.linalg.solve(A @ A.T, A @ x_hat - b) z0 = np.random.randn(n) lam0 = np.random.randn(n) rho = 10 x_admm, z_admm, lam_admm, conv_x_admm, conv_z_admm, conv_lam_admm = admm(update_x_admm, update_z_admm, rho, x0, z0, lam0, max_iter=100) print(f(x_admm)) plt.figure(figsize=(10, 8)) plt.plot([f(x) for x in conv_x_da], label="DA") plt.plot([f(x) for x in conv_x_al], label="AL") plt.plot([f(x) for x in conv_x_admm], label="ADMM x") plt.plot([f(z) for z in conv_z_admm], label="ADMM z") # plt.yscale("log") plt.xscale("log") plt.legend(fontsize=20) plt.xlabel("\# iterations", fontsize=20) plt.ylabel("Objective", fontsize=20) plt.grid(True) plt.yticks(fontsize=20) plt.xticks(fontsize=20) plt.semilogy([np.linalg.norm(A @ x - b) for x in conv_x_da], label="DA") plt.semilogy([np.linalg.norm(A @ x - b) for x in conv_x_al], label="AL") plt.semilogy([np.linalg.norm(A @ x - b) for x in conv_x_admm], label="ADMM") plt.legend(fontsize=20) plt.xscale("log") plt.xlabel("\# iterations", fontsize=20) plt.ylabel("$\|Ax - b\|_2$", fontsize=20) plt.grid(True) plt.yticks(fontsize=20) plt.xticks(fontsize=20) plt.show() plt.semilogy([np.linalg.norm(x - z) for x, z in zip(conv_x_admm, conv_z_admm)]) plt.grid(True) plt.xlabel("\# iterations", fontsize=20) plt.ylabel("$\|x_k - z_k\|_2$", fontsize=20) plt.yticks(fontsize=20) plt.show() import scipy.optimize as scopt m, n = 10, 200 A = np.random.rand(m, n) b = np.random.rand(m) c = np.random.rand(n) scipy_linprog_conv = [] def callback_splin(cur_res): scipy_linprog_conv.append(cur_res) res = scopt.linprog(c, A_eq=A, b_eq=b, bounds=[(0, None) for i in range(n)], callback=callback_splin, method="simplex") print(res) def update_x_admm(x, z, lam, A, b): n = x.shape[0] m = A.shape[0] C = np.block([[rho * np.eye(n), A.T], [A, np.zeros((m, m))]]) rhs = np.block([-lam - c + rho * z, b]) return np.linalg.solve(C, rhs)[:n] def update_z_admm(x, z, lam, A, b): x_hat = lam / rho + x return np.clip(x_hat, 0, np.max(x_hat)) x0 = np.random.randn(n) z0 = np.random.randn(n) lam0 = np.random.randn(n) rho = 10 x_admm, z_admm, lam_admm, conv_x_admm, conv_z_admm, conv_lam_admm = admm(update_x_admm, update_z_admm, rho, x0, z0, lam0, max_iter=10000) print(c @ x_admm, res.fun) print(c @ x_admm - res.fun, np.linalg.norm(x_admm - res.x)) plt.figure(figsize=(10, 8)) plt.plot([c @ x for x in conv_x_admm[:100]], label="ADMM") plt.plot([c @ res.x for res in scipy_linprog_conv], label="Scipy") plt.legend(fontsize=20) plt.grid(True) plt.xlabel("\# iterations", fontsize=20) plt.ylabel("$c^{\\top}x_k$", fontsize=20) plt.yticks(fontsize=20) plt.xticks(fontsize=20) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Pro & Contra Step2: Модельный пример Step3: Метод модифицированной функции Лагранжа Step4: Существенная проблема Step5: Учтём, что все свойства сохранятся при аффинных преобразованиях
11,986
<ASSISTANT_TASK:> Python Code: import pandas as pd df = pd.read_csv('../data/tidy_who.csv') df.head() df.shape df.sample(10) df.describe() df['g_whoregion'].unique() df['country'].nunique() df['country'].head(3) df.country[1000:1003] df.loc[0, 'country'] df.loc[df.shape[0] - 1, 'country'] df.iloc[0, 0] df.iloc[df.shape[0] - 1, 0] df.loc[:5, 'country'] df.loc[:5, 'country':'type'] df.iloc[:5, :5] cond = df.year < 1981 df[cond].shape df[cond & (df.country == 'Argentina') & (df.type == 'rel') & (df.sex == 'm')] gr_and_it = df.country.isin(['Greece', 'Italy']) df[gr_and_it].tail() lambda x: ['country', 'g_whoregion'] df.loc[:3, lambda x: ['country', 'g_whoregion']] lambda x: x.cases > 100000 great = df.loc[lambda x: x.cases > 100000, :] great df.cases.loc[lambda x: x > 100000] great.where(great.country == 'India') great.mask(great.country == 'India') df1 = df[(df.country == 'Greece') & (df.year == 2000) & (df.age_range.isin([14, 1524]))] df1.to_csv('../data/df1.csv') df2 = pd.read_csv('../data/df1.csv') df1.index df2.index pd.read_csv('../data/df1.csv', index_col=0) df1.reset_index() df1.reset_index().index <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Loading data Step2: Selecting data Step3: Columns can also be accessed as attributes (as long as they have a valid Python name). Step4: We can select elements of a DataFrame either by label (with the .loc attribute) or by position (with the .iloc attribute). Row and column indices take the usual order (first and second place, respectively). Step5: Slicing works too. Step6: Label indexing is more natural than positional indexing (think of a function call, where keyword arguments are easier to work with than positional arguments). Step7: Often we want to select data based on certain conditions. Step8: Subsets can be selected by callable functions (returning valid indexers). Step9: So it can serve as a column indexer. Step10: The following function filters for data where the number of cases is greater than 100,000. Step11: So it can serve as a row indexer. Step12: We may want to select or mask data while preserving the original shape. Step13: Hands-on exercises Step14: Indexing Step15: We could specify that the first (unnamed) column should be used as the index (row labels). Step16: Remember we learnt set_index() in the previous section? We also have reset_index() at our disposal. Step17: And we are back to a default index for this DataFrame. The original index is stored in its own column.
11,987
<ASSISTANT_TASK:> Python Code: from psychopy import visual, core, event import numpy as np win = visual.Window() core.wait(1) win.close() # Create a window and a circle win = visual.Window() circle = visual.Circle(win, radius=0.1) # Show the circle until keypress circle.draw() win.flip() event.waitKeys() # Close the window win.close() # Parameters in the experiment nTrials = 5 reaction_times = [] # Create a window and the circle win = visual.Window() circle = visual.Circle(win, radius=0.1) # Run the trials for t in np.arange(nTrials): # Show an empty screen for 1 second win.flip() core.wait(1) # Show the circle until keypress circle.draw() win.flip() keypressed = False t0 = core.getTime() while not keypressed: k = event.getKeys() if k: reaction_times.append(core.getTime() - t0) break # Close the window win.close() print(np.array(reaction_times) * 1000) # in ms import time import matplotlib.pyplot as plt # Run nLoops iterations nLoops = 10000 loop_times = [] for i in range(nLoops): loop_times.append(time.time()) # The difference between two values are the loop-times (in microseconds) loop_dur = np.diff(loop_times) * 1000000 # Plot the results as a histogram (in milliseconds). Set the axis to [-1, +1] ms plt.hist(loop_dur, bins=100, range = (-1, 1)) plt.show() # Compute the M \pm SD of loop-time print('%.2f %.2f' % (np.mean(loop_dur), np.std(loop_dur))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Example 1 Step2: Example 2 Step3: Example 3 - Reaction time test Step4: Question from class
11,988
<ASSISTANT_TASK:> Python Code: N_people = 500 ratio_female = 0.30 proba = 0.40 def the_sd(N, p, r): N = float(N) p = float(p) r = float(r) return sqrt(1.0/N*(p*(1.0-p))/(r*(1.0-r))) def sd_func_factory(N,r): def func(p): return the_sd(N,p,r) return func f = sd_func_factory(N_people, ratio_female) f2 = sd_func_factory(N_people/2, ratio_female) p = linspace(0,0.25,5) f = sd_func_factory(N_people, ratio_female) f2 = sd_func_factory(N_people/2, ratio_female) sd = list(map(f, p)) sd2 = list(map(f2, p)) pd.DataFrame(data= {'p':p, 'sd':sd, 'sd2':sd2}) p = linspace(0,0.25,50) sd = list(map(f, p)) sd2 = list(map(f2, p)) plot (p,p, 'k') plot (p,p-sd, 'g--') plot (p,p+sd, 'g--') plot (p,p-sd2, 'r--') plot (p,p+sd2, 'r--') grid(b=True, which='major', color='k', linestyle='--') z=linspace(1.,3,100) plot(z,1. - (norm.cdf(z)-norm.cdf(-z))) grid(b=True, which='major', color='k', linestyle='--') plt.title("Probability of being beyond Z (2-sided) vs Z") number_of_tries = 1000 N_female = int (N_people * ratio_female) N_male = N_people - N_female data_male = np.random.binomial(n=1, p=proba, size=(number_of_tries, N_male)) data_female = np.random.binomial(n=1, p=proba, size=(number_of_tries, N_female)) proba_male = map(numpy.mean, data_male) proba_female = map(numpy.mean, data_female) proba_diff = list((pm-pf) for pm,pf in zip(proba_male, proba_female)) np.mean(proba_diff), np.std(proba_diff) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Closed Form Approximation Step2: Thats the one-standard deviation range about the estimator. For example Step3: that's the same relationship as a plot Step4: For reference, the 2-sided tail probabilites as a function of $z$ (the way to read it is as follows Step5: Using Monte Carlo Step6: We do some intermediate calculations... Step7: ...and then generate our random numbers... Step8: ...that we then reduce in one dimension (ie, over that people in the sample) to obtain our estimator for the probas for males and females as well as the difference. On the differences finally we look at the mean (should be zero-ish) and the standard deviation (should be consistent with the numbers above)
11,989
<ASSISTANT_TASK:> Python Code: import os import time import pandas as pd from google.cloud import aiplatform, bigquery from sklearn.compose import ColumnTransformer from sklearn.linear_model import SGDClassifier from sklearn.pipeline import Pipeline from sklearn.preprocessing import OneHotEncoder, StandardScaler REGION = "us-central1" PROJECT_ID = !(gcloud config get-value core/project) PROJECT_ID = PROJECT_ID[0] ARTIFACT_STORE = f"gs://{PROJECT_ID}-kfp-artifact-store" DATA_ROOT = f"{ARTIFACT_STORE}/data" JOB_DIR_ROOT = f"{ARTIFACT_STORE}/jobs" TRAINING_FILE_PATH = f"{DATA_ROOT}/training/dataset.csv" VALIDATION_FILE_PATH = f"{DATA_ROOT}/validation/dataset.csv" API_ENDPOINT = f"{REGION}-aiplatform.googleapis.com" os.environ["JOB_DIR_ROOT"] = JOB_DIR_ROOT os.environ["TRAINING_FILE_PATH"] = TRAINING_FILE_PATH os.environ["VALIDATION_FILE_PATH"] = VALIDATION_FILE_PATH os.environ["PROJECT_ID"] = PROJECT_ID os.environ["REGION"] = REGION !gsutil ls | grep ^{ARTIFACT_STORE}/$ || gsutil mb -l {REGION} {ARTIFACT_STORE} %%bash DATASET_LOCATION=US DATASET_ID=covertype_dataset TABLE_ID=covertype DATA_SOURCE=gs://workshop-datasets/covertype/small/dataset.csv SCHEMA=Elevation:INTEGER,\ Aspect:INTEGER,\ Slope:INTEGER,\ Horizontal_Distance_To_Hydrology:INTEGER,\ Vertical_Distance_To_Hydrology:INTEGER,\ Horizontal_Distance_To_Roadways:INTEGER,\ Hillshade_9am:INTEGER,\ Hillshade_Noon:INTEGER,\ Hillshade_3pm:INTEGER,\ Horizontal_Distance_To_Fire_Points:INTEGER,\ Wilderness_Area:STRING,\ Soil_Type:STRING,\ Cover_Type:INTEGER bq --location=$DATASET_LOCATION --project_id=$PROJECT_ID mk --dataset $DATASET_ID bq --project_id=$PROJECT_ID --dataset_id=$DATASET_ID load \ --source_format=CSV \ --skip_leading_rows=1 \ --replace \ $TABLE_ID \ $DATA_SOURCE \ $SCHEMA %%bigquery SELECT * FROM `covertype_dataset.covertype` !bq query \ -n 0 \ --destination_table covertype_dataset.training \ --replace \ --use_legacy_sql=false \ 'SELECT * \ FROM `covertype_dataset.covertype` AS cover \ WHERE \ MOD(ABS(FARM_FINGERPRINT(TO_JSON_STRING(cover))), 10) IN (1, 2, 3, 4)' !bq extract \ --destination_format CSV \ covertype_dataset.training \ $TRAINING_FILE_PATH !bq query \ -n 0 \ --destination_table covertype_dataset.validation \ --replace \ --use_legacy_sql=false \ 'SELECT * \ FROM `covertype_dataset.covertype` AS cover \ WHERE \ MOD(ABS(FARM_FINGERPRINT(TO_JSON_STRING(cover))), 10) IN (8)' !bq extract \ --destination_format CSV \ covertype_dataset.validation \ $VALIDATION_FILE_PATH df_train = pd.read_csv(TRAINING_FILE_PATH) df_validation = pd.read_csv(VALIDATION_FILE_PATH) print(df_train.shape) print(df_validation.shape) numeric_feature_indexes = slice(0, 10) categorical_feature_indexes = slice(10, 12) preprocessor = ColumnTransformer( transformers=[ ("num", StandardScaler(), numeric_feature_indexes), ("cat", OneHotEncoder(), categorical_feature_indexes), ] ) pipeline = Pipeline( [ ("preprocessor", preprocessor), ("classifier", SGDClassifier(loss="log", tol=1e-3)), ] ) num_features_type_map = { feature: "float64" for feature in df_train.columns[numeric_feature_indexes] } df_train = df_train.astype(num_features_type_map) df_validation = df_validation.astype(num_features_type_map) X_train = df_train.drop("Cover_Type", axis=1) y_train = df_train["Cover_Type"] X_validation = df_validation.drop("Cover_Type", axis=1) y_validation = df_validation["Cover_Type"] pipeline.set_params(classifier__alpha=0.001, classifier__max_iter=200) pipeline.fit(X_train, y_train) accuracy = pipeline.score(X_validation, y_validation) print(accuracy) TRAINING_APP_FOLDER = "training_app" os.makedirs(TRAINING_APP_FOLDER, exist_ok=True) %%writefile {TRAINING_APP_FOLDER}/train.py import os import subprocess import sys import fire import hypertune import numpy as np import pandas as pd import pickle from sklearn.compose import ColumnTransformer from sklearn.linear_model import SGDClassifier from sklearn.pipeline import Pipeline from sklearn.preprocessing import StandardScaler, OneHotEncoder def train_evaluate(job_dir, training_dataset_path, validation_dataset_path, alpha, max_iter, hptune): df_train = pd.read_csv(training_dataset_path) df_validation = pd.read_csv(validation_dataset_path) if not hptune: df_train = pd.concat([df_train, df_validation]) numeric_feature_indexes = slice(0, 10) categorical_feature_indexes = slice(10, 12) preprocessor = ColumnTransformer( transformers=[ ('num', StandardScaler(), numeric_feature_indexes), ('cat', OneHotEncoder(), categorical_feature_indexes) ]) pipeline = Pipeline([ ('preprocessor', preprocessor), ('classifier', SGDClassifier(loss='log',tol=1e-3)) ]) num_features_type_map = {feature: 'float64' for feature in df_train.columns[numeric_feature_indexes]} df_train = df_train.astype(num_features_type_map) df_validation = df_validation.astype(num_features_type_map) print('Starting training: alpha={}, max_iter={}'.format(alpha, max_iter)) X_train = df_train.drop('Cover_Type', axis=1) y_train = df_train['Cover_Type'] pipeline.set_params(classifier__alpha=alpha, classifier__max_iter=max_iter) pipeline.fit(X_train, y_train) if hptune: X_validation = df_validation.drop('Cover_Type', axis=1) y_validation = df_validation['Cover_Type'] accuracy = pipeline.score(X_validation, y_validation) print('Model accuracy: {}'.format(accuracy)) # Log it with hypertune hpt = hypertune.HyperTune() hpt.report_hyperparameter_tuning_metric( hyperparameter_metric_tag='accuracy', metric_value=accuracy ) # Save the model if not hptune: model_filename = 'model.pkl' with open(model_filename, 'wb') as model_file: pickle.dump(pipeline, model_file) gcs_model_path = "{}/{}".format(job_dir, model_filename) subprocess.check_call(['gsutil', 'cp', model_filename, gcs_model_path], stderr=sys.stdout) print("Saved model in: {}".format(gcs_model_path)) if __name__ == "__main__": fire.Fire(train_evaluate) %%writefile {TRAINING_APP_FOLDER}/Dockerfile FROM gcr.io/deeplearning-platform-release/base-cpu RUN pip install -U fire cloudml-hypertune scikit-learn==0.20.4 pandas==0.24.2 WORKDIR /app COPY train.py . ENTRYPOINT ["python", "train.py"] IMAGE_NAME = "trainer_image" IMAGE_TAG = "latest" IMAGE_URI = f"gcr.io/{PROJECT_ID}/{IMAGE_NAME}:{IMAGE_TAG}" os.environ["IMAGE_URI"] = IMAGE_URI !gcloud builds submit --tag $IMAGE_URI $TRAINING_APP_FOLDER TIMESTAMP = time.strftime("%Y%m%d_%H%M%S") JOB_NAME = f"forestcover_tuning_{TIMESTAMP}" JOB_DIR = f"{JOB_DIR_ROOT}/{JOB_NAME}" os.environ["JOB_NAME"] = JOB_NAME os.environ["JOB_DIR"] = JOB_DIR %%bash MACHINE_TYPE="n1-standard-4" REPLICA_COUNT=1 CONFIG_YAML=config.yaml cat <<EOF > $CONFIG_YAML studySpec: metrics: - metricId: accuracy goal: MAXIMIZE parameters: - parameterId: max_iter discreteValueSpec: values: - 10 - 20 - parameterId: alpha doubleValueSpec: minValue: 1.0e-4 maxValue: 1.0e-1 scaleType: UNIT_LINEAR_SCALE algorithm: ALGORITHM_UNSPECIFIED # results in Bayesian optimization trialJobSpec: workerPoolSpecs: - machineSpec: machineType: $MACHINE_TYPE replicaCount: $REPLICA_COUNT containerSpec: imageUri: $IMAGE_URI args: - --job_dir=$JOB_DIR - --training_dataset_path=$TRAINING_FILE_PATH - --validation_dataset_path=$VALIDATION_FILE_PATH - --hptune EOF gcloud ai hp-tuning-jobs create \ --region=$REGION \ --display-name=$JOB_NAME \ --config=$CONFIG_YAML \ --max-trial-count=5 \ --parallel-trial-count=5 echo "JOB_NAME: $JOB_NAME" def get_trials(job_name): jobs = aiplatform.HyperparameterTuningJob.list() match = [job for job in jobs if job.display_name == JOB_NAME] tuning_job = match[0] if match else None return tuning_job.trials if tuning_job else None def get_best_trial(trials): metrics = [trial.final_measurement.metrics[0].value for trial in trials] best_trial = trials[metrics.index(max(metrics))] return best_trial def retrieve_best_trial_from_job_name(jobname): trials = get_trials(jobname) best_trial = get_best_trial(trials) return best_trial best_trial = retrieve_best_trial_from_job_name(JOB_NAME) alpha = best_trial.parameters[0].value max_iter = best_trial.parameters[1].value TIMESTAMP = time.strftime("%Y%m%d_%H%M%S") JOB_NAME = f"JOB_VERTEX_{TIMESTAMP}" JOB_DIR = f"{JOB_DIR_ROOT}/{JOB_NAME}" MACHINE_TYPE="n1-standard-4" REPLICA_COUNT=1 WORKER_POOL_SPEC = f\ machine-type={MACHINE_TYPE},\ replica-count={REPLICA_COUNT},\ container-image-uri={IMAGE_URI}\ ARGS = f\ --job_dir={JOB_DIR},\ --training_dataset_path={TRAINING_FILE_PATH},\ --validation_dataset_path={VALIDATION_FILE_PATH},\ --alpha={alpha},\ --max_iter={max_iter},\ --nohptune\ !gcloud ai custom-jobs create \ --region={REGION} \ --display-name={JOB_NAME} \ --worker-pool-spec={WORKER_POOL_SPEC} \ --args={ARGS} print("The model will be exported at:", JOB_DIR) !gsutil ls $JOB_DIR MODEL_NAME = "forest_cover_classifier_2" SERVING_CONTAINER_IMAGE_URI = ( "us-docker.pkg.dev/vertex-ai/prediction/sklearn-cpu.0-20:latest" ) SERVING_MACHINE_TYPE = "n1-standard-2" uploaded_model = aiplatform.Model.upload( display_name=MODEL_NAME, artifact_uri=JOB_DIR, serving_container_image_uri=SERVING_CONTAINER_IMAGE_URI, ) endpoint = uploaded_model.deploy( machine_type=SERVING_MACHINE_TYPE, accelerator_type=None, accelerator_count=None, ) instance = [ 2841.0, 45.0, 0.0, 644.0, 282.0, 1376.0, 218.0, 237.0, 156.0, 1003.0, "Commanche", "C4758", ] endpoint.predict([instance]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Configure environment settings Step2: We now create the ARTIFACT_STORE bucket if it's not there. Note that this bucket should be created in the region specified in the variable REGION (if you have already a bucket with this name in a different region than REGION, you may want to change the ARTIFACT_STORE name so that you can recreate a bucket in REGION with the command in the cell below). Step3: Importing the dataset into BigQuery Step4: Explore the Covertype dataset Step5: Create training and validation splits Step6: Create a validation split Step7: Develop a training application Step8: Convert all numeric features to float64 Step9: Run the pipeline locally. Step10: Calculate the trained model's accuracy. Step11: Prepare the hyperparameter tuning application. Step12: Write the tuning script. Step13: Package the script into a docker image. Step14: Build the docker image. Step15: Submit an Vertex AI hyperparameter tuning job Step16: Go to the Vertex AI Training dashboard and view the progression of the HP tuning job under "Hyperparameter Tuning Jobs". Step17: You'll need to wait for the hyperparameter job to complete before being able to retrieve the best job by running the cell below. Step20: Retrain the model with the best hyperparameters Step21: Examine the training output Step22: Deploy the model to Vertex AI Prediction Step23: Uploading the trained model Step24: Deploying the uploaded model Step25: Serve predictions
11,990
<ASSISTANT_TASK:> Python Code: from zipfile import ZipFile fname = "../examples/force-save-2016.07.05-10.00.50.062.jpk-nt-force" z = ZipFile(fname) list_of_files = z.filelist for f in list_of_files: print f.filename print list_of_files[0].filename f = z.open(list_of_files[0].filename) lines = f.readlines() print lines[0] print lines[1] print lines[2] from dateutil import parser t = parser.parse(lines[0][1:]) print t _properties = {} for line in lines[1:]: key, value = line.split("=") value.strip() _properties[key] = value for p in _properties: print p," = ",_properties[p] properties = {} for line in lines[1:]: key,value = line.split("=") value = value.strip() split_key = key.split(".") d = properties if len(split_key) > 1: for s in split_key[:-1]: if d.keys().count(s): d = d[s] else: d[s] = {} d = d[s] d[split_key[-1]] = value for p in properties: print p, " = ",properties[p] properties['force-scan-series']['header']['force-settings']['force-baseline-adjust-settings'] fname = z.filelist[-25].filename print fname f = z.open(fname) lines = f.readlines() print(lines[0]) print(lines[1]) from struct import unpack fname = z.filelist[-12].filename print fname f = z.open(fname) content = f.read() print(len(content)) content[0], content[1], content[2], content[3] data = unpack(">i", content[0:4]) print data _z = ZipFile("force-save-2016.06.15-13.17.08.jpk-force") fname = _z.filelist[-13].filename print fname open header file f = _z.open(fname) lines = f.readlines() parse properties to dict properties = {} for line in lines[2:]: key,value = line.split("=") value = value.strip() split_key = key.split(".") d = properties if len(split_key) > 1: for s in split_key[:-1]: if d.keys().count(s): d = d[s] else: d[s] = {} d = d[s] d[split_key[-1]] = value read one channel's data.type property print properties['channel']['height']['data']['type'] fname = z.filelist[-25].filename print fname f = z.open(fname) lines = f.readlines() properties = {} for line in lines[2:]: key,value = line.split("=") value = value.strip() split_key = key.split(".") d = properties if len(split_key) > 1: for s in split_key[:-1]: if d.keys().count(s): d = d[s] else: d[s] = {} d = d[s] d[split_key[-1]] = value for key in properties: print key, " = ", properties[key] <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: It you can get the list of files stored in the zip archive, and you can open files using the instance's open function Step2: 2. Parse header files to dictionaries Step3: The remainder of the lines should contain properties following the syntax mentioned above. They can easily be parsed to a dictionary. Step4: 2.1 Parsing properties into tree-like dictionary Step5: 2.2 In contrast to jpk-force archives, lower level header files appear to have the same beginning with time stamp in first line Step6: 3. Read data from files Step7: According to the JPKay guys, every 4 items make one data point Step11: 3.1 How to figure out the number of items making up one data point, i.e., how to figure out the data format of the .dat files? Step12: But where is this information in a tweezer archive's header?
11,991
<ASSISTANT_TASK:> Python Code: import os import numpy as np import image_loader as im from matplotlib import pyplot as plt from skimage.transform import resize %matplotlib inline path=os.getcwd()+'/' # finds the path of the folder in which the notebook is path_train=path+'images/train/' path_test=path+'images/test/' path_real=path+'images/real_world/' def prep_datas(xset,xlabels): X=list(xset) for i in range(len(X)): X[i]=resize(X[i],(32,32,1)) #reduce the size of the image from 100X100 to 32X32. Also flattens the color levels X=np.reshape(X,(len(X),1,32,32)) # reshape the liste to have the form required by keras (theano), ie (1,32,32) X=np.array(X) #transforms it into an array Y = np.eye(2, dtype='uint8')[xlabels] # generates vectors, here of two elements as required by keras (number of classes) return X,Y training_set, training_labels = im.load_images(path_train) test_set, test_labels = im.load_images(path_test) X_train,Y_train=prep_datas(training_set,training_labels) X_test,Y_test=prep_datas(test_set,test_labels) i=11 plt.subplot(1,2,1) plt.imshow(training_set[i],cmap='gray') plt.subplot(1,2,2) plt.imshow(X_train[i][0],cmap='gray') # import the necessary packages from keras.models import Sequential from keras.layers.convolutional import Convolution2D from keras.layers.convolutional import MaxPooling2D from keras.layers.core import Activation from keras.layers.core import Flatten from keras.layers.core import Dense from keras.optimizers import SGD # this code comes from http://www.pyimagesearch.com/2016/08/01/lenet-convolutional-neural-network-in-python/ class LeNet: @staticmethod def build(width, height, depth, classes, weightsPath=None): # initialize the model model = Sequential() # first set of CONV => RELU => POOL model.add(Convolution2D(20, 5, 5, border_mode="same",input_shape=(depth, height, width))) model.add(Activation("relu")) model.add(MaxPooling2D(pool_size=(2, 2), strides=(2, 2))) # second set of CONV => RELU => POOL model.add(Convolution2D(50, 5, 5, border_mode="same")) model.add(Activation("relu")) model.add(MaxPooling2D(pool_size=(2, 2), strides=(2, 2))) # set of FC => RELU layers model.add(Flatten()) model.add(Dense(500)) model.add(Activation("relu")) # softmax classifier model.add(Dense(classes)) model.add(Activation("softmax")) # return the constructed network architecture return model model = LeNet.build(width=32, height=32, depth=1, classes=2) opt = SGD(lr=0.01)#Sochastic gradient descent with learning rate 0.01 model.compile(loss="categorical_crossentropy", optimizer=opt,metrics=["accuracy"]) model.fit(X_train, Y_train, batch_size=10, nb_epoch=300,verbose=1) y_pred = model.predict_classes(X_test) print(y_pred) print(test_labels) real_world_set=[] for i in np.arange(1,73): filename=path+'images/real_world/'+str(i)+'.png' real_world_set.append(im.deshear(filename)) fake_label=np.ones(len(real_world_set),dtype='int32') X_real,Y_real=prep_datas(real_world_set,fake_label) y_pred = model.predict_classes(X_real) f=open(path+'images/real_world/labels.txt',"r") lines=f.readlines() result=[] for x in lines: result.append((x.split(' ')[1]).replace('\n','')) f.close() result=np.array([int(x) for x in result]) result[result>1]=1 plt.plot(y_pred,'o') plt.plot(2*result,'o') plt.ylim(-0.5,2.5); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We first define a function to prepare the datas in the format of keras (theano). The function also reduces the size of the imagesfrom 100X100 to 32X32. Step2: We then load the training set and the test set and prepare them with the function prep_datas. Step3: Image before/after compression Step4: Lenet neural network Step5: We build the neural network and fit it on the training set Step6: We now compare with the real world images (with the deshear method) Step7: with the labels of Peter
11,992
<ASSISTANT_TASK:> Python Code: from urllib.request import urlretrieve from os.path import isfile, isdir from tqdm import tqdm import problem_unittests as tests import tarfile import helper import numpy as np from sklearn.preprocessing import LabelBinarizer import pickle import tensorflow as tf import random %matplotlib inline %config InlineBackend.figure_format = 'retina' cifar10_dataset_folder_path = 'cifar-10-batches-py' class DLProgress(tqdm): last_block = 0 def hook(self, block_num=1, block_size=1, total_size=None): self.total = total_size self.update((block_num - self.last_block) * block_size) self.last_block = block_num if not isfile('cifar-10-python.tar.gz'): with DLProgress(unit='B', unit_scale=True, miniters=1, desc='CIFAR-10 Dataset') as pbar: urlretrieve( 'https://www.cs.toronto.edu/~kriz/cifar-10-python.tar.gz', 'cifar-10-python.tar.gz', pbar.hook) if not isdir(cifar10_dataset_folder_path): with tarfile.open('cifar-10-python.tar.gz') as tar: tar.extractall() tar.close() tests.test_folder_path(cifar10_dataset_folder_path) # Explore the dataset batch_id = 1 sample_id = 5 helper.display_stats(cifar10_dataset_folder_path, batch_id, sample_id) def normalize(x): Normalize a list of sample image data in the range of 0 to 1 : x: List of image data. The image shape is (32, 32, 3) : return: Numpy array of normalize data return x / 255 tests.test_normalize(normalize) def one_hot_encode(x): One hot encode a list of sample labels. Return a one-hot encoded vector for each label. : x: List of sample Labels : return: Numpy array of one-hot encoded labels lb = LabelBinarizer() lb.fit(x) lb.classes_ = list(range(0, 10)) return lb.transform(x) tests.test_one_hot_encode(one_hot_encode) # Preprocess Training, Validation, and Testing Data helper.preprocess_and_save_data(cifar10_dataset_folder_path, normalize, one_hot_encode) # Load the Preprocessed Validation data valid_features, valid_labels = pickle.load(open('preprocess_validation.p', mode='rb')) import tensorflow as tf def neural_net_image_input(image_shape): Return a Tensor for a bach of image input : image_shape: Shape of the images : return: Tensor for image input. return tf.placeholder(tf.float32, shape=[None, *image_shape], name="x") def neural_net_label_input(n_classes): Return a Tensor for a batch of label input : n_classes: Number of classes : return: Tensor for label input. return tf.placeholder(tf.float32, shape=[None, n_classes], name="y") def neural_net_keep_prob_input(): Return a Tensor for keep probability : return: Tensor for keep probability. return tf.placeholder(tf.float32, name="keep_prob") tf.reset_default_graph() tests.test_nn_image_inputs(neural_net_image_input) tests.test_nn_label_inputs(neural_net_label_input) tests.test_nn_keep_prob_inputs(neural_net_keep_prob_input) def conv2d_maxpool(x_tensor, conv_num_outputs, conv_ksize, conv_strides, pool_ksize, pool_strides): Apply convolution then max pooling to x_tensor :param x_tensor: TensorFlow Tensor :param conv_num_outputs: Number of outputs for the convolutional layer :param conv_strides: Stride 2-D Tuple for convolution :param pool_ksize: kernal size 2-D Tuple for pool :param pool_strides: Stride 2-D Tuple for pool : return: A tensor that represents convolution and max pooling of x_tensor weights = tf.Variable(tf.truncated_normal([*conv_ksize, int(x_tensor.get_shape()[3]), conv_num_outputs], mean=0.0, stddev=0.05, dtype=tf.float32)) biases = tf.Variable(tf.constant(0, shape=[conv_num_outputs], dtype=tf.float32)) x = tf.nn.conv2d(x_tensor, weights, strides=[1, *conv_strides, 1], padding='SAME') x = tf.nn.bias_add(x, biases) x = tf.nn.relu(x) x = tf.nn.max_pool(x, ksize=[1, *pool_ksize, 1], strides=[1, *pool_strides, 1], padding='SAME') return x tests.test_con_pool(conv2d_maxpool) def flatten(x_tensor): Flatten x_tensor to (Batch Size, Flattened Image Size) : x_tensor: A tensor of size (Batch Size, ...), where ... are the image dimensions. : return: A tensor of size (Batch Size, Flattened Image Size). return tf.contrib.layers.flatten(x_tensor) tests.test_flatten(flatten) def fully_conn(x_tensor, num_outputs): Apply a fully connected layer to x_tensor using weight and bias : x_tensor: A 2-D tensor where the first dimension is batch size. : num_outputs: The number of output that the new tensor should be. : return: A 2-D tensor where the second dimension is num_outputs. return tf.contrib.layers.fully_connected(x_tensor, num_outputs, activation_fn=tf.nn.relu) tests.test_fully_conn(fully_conn) def output(x_tensor, num_outputs): Apply a output layer to x_tensor using weight and bias : x_tensor: A 2-D tensor where the first dimension is batch size. : num_outputs: The number of output that the new tensor should be. : return: A 2-D tensor where the second dimension is num_outputs. return tf.contrib.layers.fully_connected(x_tensor, num_outputs, activation_fn=None) tests.test_output(output) def conv_net(x, keep_prob): Create a convolutional neural network model : x: Placeholder tensor that holds image data. : keep_prob: Placeholder tensor that hold dropout keep probability. : return: Tensor that represents logits # Apply Convolution and Max Pool layers conv_num_outputs = [8*3, 16*3, 32*3] conv_ksize, conv_strides, pool_ksize, pool_strides, num_outputs = (3,3), (1,1), (2,2), (2,2), 512 conv = conv2d_maxpool(x, conv_num_outputs[0], conv_ksize, conv_strides, pool_ksize, pool_strides) conv = conv2d_maxpool(conv, conv_num_outputs[1], conv_ksize, conv_strides, pool_ksize, pool_strides) conv = conv2d_maxpool(conv, conv_num_outputs[2], conv_ksize, conv_strides, pool_ksize, pool_strides) # Apply a Flatten Layer flattened = flatten(conv) # Apply Fully Connected Layers fully = fully_conn(flattened, num_outputs) fc_layer = tf.nn.dropout(fully, keep_prob) fully = fully_conn(fc_layer, num_outputs) fc_layer = tf.nn.dropout(fully, keep_prob) return output(fully, 10) ############################## ## Build the Neural Network ## ############################## # Remove previous weights, bias, inputs, etc.. tf.reset_default_graph() # Inputs x = neural_net_image_input((32, 32, 3)) y = neural_net_label_input(10) keep_prob = neural_net_keep_prob_input() # Model logits = conv_net(x, keep_prob) # Name logits Tensor, so that is can be loaded from disk after training logits = tf.identity(logits, name='logits') # Loss and Optimizer cost = tf.reduce_mean(tf.nn.softmax_cross_entropy_with_logits(logits=logits, labels=y)) optimizer = tf.train.AdamOptimizer().minimize(cost) # Accuracy correct_pred = tf.equal(tf.argmax(logits, 1), tf.argmax(y, 1)) accuracy = tf.reduce_mean(tf.cast(correct_pred, tf.float32), name='accuracy') tests.test_conv_net(conv_net) def train_neural_network(session, optimizer, keep_probability, feature_batch, label_batch): Optimize the session on a batch of images and labels : session: Current TensorFlow session : optimizer: TensorFlow optimizer function : keep_probability: keep probability : feature_batch: Batch of Numpy image data : label_batch: Batch of Numpy label data session.run(optimizer, feed_dict={x: feature_batch, y: label_batch, keep_prob: keep_probability}) pass tests.test_train_nn(train_neural_network) def print_stats(session, feature_batch, label_batch, cost, accuracy): Print information about loss and validation accuracy : session: Current TensorFlow session : feature_batch: Batch of Numpy image data : label_batch: Batch of Numpy label data : cost: TensorFlow cost function : accuracy: TensorFlow accuracy function loss = session.run(cost, feed_dict={x: feature_batch, y: label_batch, keep_prob: 1.0}) validation_accuracy = session.run(accuracy, feed_dict={x: valid_features, y: valid_labels, keep_prob: 1.0}) print('Loss: {:>10.4f}, Accuracy: {:.4f}'.format(loss, validation_accuracy)) pass epochs = 20 batch_size = 512 keep_probability = 0.5 print('Checking the Training on a Single Batch...') with tf.Session() as sess: # Initializing the variables sess.run(tf.global_variables_initializer()) # Training cycle for epoch in range(epochs): batch_i = 1 for batch_features, batch_labels in helper.load_preprocess_training_batch(batch_i, batch_size): train_neural_network(sess, optimizer, keep_probability, batch_features, batch_labels) print('Epoch {:>2}, CIFAR-10 Batch {}: '.format(epoch + 1, batch_i), end='') print_stats(sess, batch_features, batch_labels, cost, accuracy) save_model_path = './image_classification' print('Training...') with tf.Session() as sess: # Initializing the variables sess.run(tf.global_variables_initializer()) # Training cycle for epoch in range(epochs): # Loop over all batches n_batches = 5 for batch_i in range(1, n_batches + 1): for batch_features, batch_labels in helper.load_preprocess_training_batch(batch_i, batch_size): train_neural_network(sess, optimizer, keep_probability, batch_features, batch_labels) print('Epoch {:>2}, CIFAR-10 Batch {}: '.format(epoch + 1, batch_i), end='') print_stats(sess, batch_features, batch_labels, cost, accuracy) # Save Model saver = tf.train.Saver() save_path = saver.save(sess, save_model_path) # Set batch size if not already set try: if batch_size: pass except NameError: batch_size = 64 save_model_path = './image_classification' n_samples = 4 top_n_predictions = 3 def test_model(): Test the saved model against the test dataset test_features, test_labels = pickle.load(open('preprocess_training.p', mode='rb')) loaded_graph = tf.Graph() with tf.Session(graph=loaded_graph) as sess: # Load model loader = tf.train.import_meta_graph(save_model_path + '.meta') loader.restore(sess, save_model_path) # Get Tensors from loaded model loaded_x = loaded_graph.get_tensor_by_name('x:0') loaded_y = loaded_graph.get_tensor_by_name('y:0') loaded_keep_prob = loaded_graph.get_tensor_by_name('keep_prob:0') loaded_logits = loaded_graph.get_tensor_by_name('logits:0') loaded_acc = loaded_graph.get_tensor_by_name('accuracy:0') # Get accuracy in batches for memory limitations test_batch_acc_total = 0 test_batch_count = 0 for train_feature_batch, train_label_batch in helper.batch_features_labels(test_features, test_labels, batch_size): test_batch_acc_total += sess.run( loaded_acc, feed_dict={loaded_x: train_feature_batch, loaded_y: train_label_batch, loaded_keep_prob: 1.0}) test_batch_count += 1 print('Testing Accuracy: {}\n'.format(test_batch_acc_total/test_batch_count)) # Print Random Samples random_test_features, random_test_labels = tuple(zip(*random.sample(list(zip(test_features, test_labels)), n_samples))) random_test_predictions = sess.run( tf.nn.top_k(tf.nn.softmax(loaded_logits), top_n_predictions), feed_dict={loaded_x: random_test_features, loaded_y: random_test_labels, loaded_keep_prob: 1.0}) helper.display_image_predictions(random_test_features, random_test_labels, random_test_predictions) test_model() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Get the Data Step2: Explore the Data Step4: Implement Preprocess Functions Step6: One-hot encode Step7: Randomize Data Step8: Check Point Step12: Build the network Step14: Convolution and Max Pooling Layer Step16: Flatten Layer Step18: Fully-Connected Layer Step20: Output Layer Step22: Create Convolutional Model Step24: Train the Neural Network Step26: Show Stats Step27: Hyperparameters Step28: Train on a Single CIFAR-10 Batch Step29: Fully Train the Model Step31: Checkpoint
11,993
<ASSISTANT_TASK:> Python Code: # import required modules for data preparation tasks import requests, zipfile, StringIO import pandas as pd import random import matplotlib.pyplot as plt import numpy as np %matplotlib inline import re import json import os # reads all predefined months for a year and merge into one data frame rawData = pd.DataFrame() months = ['01', '02', '03', '04', '05', '06', '07', '08', '09', '10', '11', '12'] for m in months: z = zipfile.ZipFile('cache/{y}{mo}.zip'.format(y=str(2014), mo = m)) rawData = rawData.append(pd.read_csv(z.open(z.namelist()[0]))) print "Downloaded", m # reset index of complete dataset for delays to prepare merging in next step rawData.reset_index(inplace=True) rawData.columns selectedColumns = [u'index', u'FL_DATE', u'UNIQUE_CARRIER', u'TAIL_NUM', u'FL_NUM', u'ORIGIN', u'DEST', u'CRS_DEP_TIME', u'DEP_TIME', u'DEP_DELAY', u'TAXI_OUT', u'WHEELS_OFF', u'WHEELS_ON', u'TAXI_IN', u'CRS_ARR_TIME', u'ARR_TIME', u'ARR_DELAY', u'CANCELLED', u'DIVERTED', u'CANCELLATION_CODE', u'AIR_TIME', u'DISTANCE', u'CARRIER_DELAY', u'WEATHER_DELAY', u'NAS_DELAY', u'SECURITY_DELAY', u'LATE_AIRCRAFT_DELAY', u'ORIGIN_CITY_NAME', u'DEST_CITY_NAME'] rawData = rawData[selectedColumns] z = zipfile.ZipFile('externalData/AircraftInformation.zip') # master table containing tail numbers of aircraft df_master = pd.DataFrame.from_csv(z.open('MASTER.txt')) # detailed table containing information about manufacturer, age, etc. df_aircrafts = pd.DataFrame.from_csv(z.open('ACFTREF.txt')) master = df_master[['MFR MDL CODE', 'YEAR MFR']].reset_index() aircrafts = df_aircrafts['MFR'].reset_index() master.columns = ['TAIL_NUM', 'CODE', 'YEAR'] aircrafts.columns = ['CODE', 'MFR'] joined = pd.merge(master, aircrafts, how='left', on='CODE') delayFinal = rawData[['TAIL_NUM','UNIQUE_CARRIER']] delayFinal.TAIL_NUM = delayFinal.TAIL_NUM.str.strip('N') delaymfr = pd.merge(delayFinal, joined, how='left', on=['TAIL_NUM']) rawData['AIRCRAFT_YEAR'] = delaymfr.YEAR rawData['AIRCRAFT_MFR'] = delaymfr.MFR airportLocation = pd.DataFrame.from_csv('externalData/airport_codes_with_geo_name_ids_and_nl_names-2008-04-14.csv', header=None) usAirports = airportLocation[airportLocation[4]=='US'].reset_index() # we just need a subsets of the columns (origin, latitude and longitude) usAirports = usAirports[[0, 5, 6]] usAirports.columns = ['ORIGIN', 'LAT', 'LONG'] complete2014Data = pd.merge(rawData, usAirports, how='left', on='ORIGIN') 1.0*np.sum(complete2014Data.LAT.isnull())/complete2014Data.shape[0] complete2014Data.to_csv('cache/complete2014Data.csv') # load the weather file weatherFile = os.path.join('data', 'weather_data.json') with open(weatherFile) as infile: weatherDict = json.load(infile) # extract the weather data for new york and boston out of the json file and save it in weather_df dates = [] frames = [] # create df for weather in new york for datapoint in weatherDict['JFK']: date = datapoint['date'] frames.append(pd.DataFrame(datapoint['data'], index=['%s-%s-%s' % (date[0:4], date[4:6], date[6:8])])) weather_jfk = pd.concat(frames).reset_index() # create df for weather in boston for datapoint in weatherDict['BOS']: date = datapoint['date'] frames.append(pd.DataFrame(datapoint['data'], index=['%s-%s-%s' % (date[0:4], date[4:6], date[6:8])])) weather_bos = pd.concat(frames).reset_index() # get just the departures for the John F. Kennedy airport in New York City and Logan airport in Boston jfk_delays = complete2014Data[complete2014Data.ORIGIN=='JFK'] bos_delays = complete2014Data[complete2014Data.ORIGIN=='BOS'] # merge delays with weather_df created above jfk_dalayWeather = pd.merge(jfk_delays, weather_jfk, how='left', left_on='FL_DATE', right_on = 'index') bos_dalayWeather = pd.merge(bos_delays, weather_bos, how='left', left_on='FL_DATE', right_on = 'index') jfk_bos_comparison = pd.concat([jfk_dalayWeather, bos_dalayWeather]).reset_index() # save everything in a csv jfk_bos_comparison.to_csv('cache/jfk_bos_weather_2014.csv', encoding='UTF-8') #entries to be dropped in the analysis flight_data_dropped = ['QUARTER', 'DAY_OF_MONTH', 'AIRLINE_ID', 'CARRIER', 'FL_NUM', 'TAIL_NUM'] location_data_dropped = ['ORIGIN_STATE_FIPS', 'ORIGIN_STATE_NM',\ 'ORIGIN_WAC', 'DEST_STATE_FIPS', \ 'DEST_STATE_NM', 'DEST_WAC'] departure_data_dropped = ['DEP_TIME', 'DEP_DELAY', 'DEP_DELAY_NEW', 'DEP_DEL15', 'DEP_DELAY_GROUP',\ 'DEP_TIME_BLK', 'TAXI_OUT', 'WHEELS_OFF'] arrival_data_dropped = ['WHEELS_ON', 'TAXI_IN', 'ARR_TIME', 'ARR_DELAY_NEW',\ 'ARR_DELAY_GROUP', 'ARR_TIME_BLK'] cancel_data_dropped = ['CANCELLED','CANCELLATION_CODE', 'DIVERTED'] summaries_dropped = ['CRS_ELAPSED_TIME', 'AIR_TIME', 'FLIGHTS'] cause_delay_dropped = ['CARRIER_DELAY', 'WEATHER_DELAY', 'NAS_DELAY', 'SECURITY_DELAY', 'LATE_AIRCRAFT_DELAY'] gate_return_dropped = ['FIRST_DEP_TIME', 'TOTAL_ADD_GTIME', 'LONGEST_ADD_GTIME'] diverted_data_dropped = ['DIV_AIRPORT_LANDINGS', 'DIV_REACHED_DEST', 'DIV_ACTUAL_ELAPSED_TIME', \ 'DIV_ARR_DELAY', 'DIV_DISTANCE', 'DIV1_AIRPORT', 'DIV1_WHEELS_ON', \ 'DIV1_TOTAL_GTIME', 'DIV1_LONGEST_GTIME', 'DIV1_WHEELS_OFF', \ 'DIV1_TAIL_NUM', 'DIV2_AIRPORT', 'DIV2_WHEELS_ON', \ 'DIV2_TOTAL_GTIME', 'DIV2_LONGEST_GTIME', 'DIV2_WHEELS_OFF', \ 'DIV2_TAIL_NUM', 'DIV3_AIRPORT', 'DIV3_WHEELS_ON', \ 'DIV3_TOTAL_GTIME', 'DIV3_LONGEST_GTIME', 'DIV3_WHEELS_OFF', 'DIV3_TAIL_NUM', \ 'DIV4_AIRPORT', 'DIV4_WHEELS_ON', 'DIV4_TOTAL_GTIME', 'DIV4_LONGEST_GTIME', \ 'DIV4_WHEELS_OFF', 'DIV4_TAIL_NUM', 'DIV5_AIRPORT', 'DIV5_WHEELS_ON', \ 'DIV5_TOTAL_GTIME', 'DIV5_LONGEST_GTIME', 'DIV5_WHEELS_OFF', 'DIV5_TAIL_NUM'] other_dropped = ['Unnamed: 93'] columns_dropped = flight_data_dropped + location_data_dropped + departure_data_dropped + arrival_data_dropped \ + cancel_data_dropped + summaries_dropped + cause_delay_dropped + gate_return_dropped + diverted_data_dropped \ + other_dropped def clean(data, list_col): ''' Creates a dataset by excluding undesirable columns Parameters: ----------- df: pandas.DataFrame Flight dataframe list_col: <list 'string'> Comumns to exclude from the data set ''' # security check to drop only columns that exist list_col = list(set(list_col) & set(data.columns)) res = data[(data.CANCELLED == 0) & (data.DIVERTED == 0)] res.drop(list_col, axis=1, inplace=True) res.dropna(axis = 0, inplace = True) return res %%time data2014 = clean(complete2014Data, columns_dropped) print data2014.columns df_active_airlines = pd.read_csv('data/cur_airlines.txt', header=None) df_active_airlines.columns = [['UNIQUE_CARRIER']]; df_active_airlines.head() filteredData2014 = data2014.merge(df_active_airlines, on=['UNIQUE_CARRIER', 'UNIQUE_CARRIER'], how='inner') filteredData2014.count()[0], data2014.count()[0] # save data to cache filteredData2014.to_csv('cache/linear_model_data.csv') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2.1 Get the Main Delay Data for 2014 from Downloaded zip Files Step2: The columns we now have in the dataset are Step3: However, we just need a subset of these columns for our analysis Step4: 2.2 Combine Data with External Aircraft Data Step5: We can now join these two tables based on their common ID that is saved in the column MFR MDL CODE of the master table and in the index of the aircraft table respectively. Step6: We now join this aircraft information with our delay data and extend the original dataset with the two new features Step7: 2.3 Combine Data with External Airport Location Data Step8: Just 0.7% of alll flight origins could not be located, so the merge was quite successful. Step9: 3 Creation of Data Subsets for Weather Analysis and Predictive Models Step10: 3.2 Creation of the Prediction Datasets Step11: Filtering the data for active Airlines only Step12: A quick check reveals, that filtering was not (really) necessary as all Airlines are still active today.
11,994
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import logging logging.getLogger("tensorflow").setLevel(logging.DEBUG) import tensorflow as tf from tensorflow import keras import numpy as np import pathlib # Load MNIST dataset mnist = keras.datasets.mnist (train_images, train_labels), (test_images, test_labels) = mnist.load_data() # Normalize the input image so that each pixel value is between 0 to 1. train_images = train_images / 255.0 test_images = test_images / 255.0 # Define the model architecture model = keras.Sequential([ keras.layers.InputLayer(input_shape=(28, 28)), keras.layers.Reshape(target_shape=(28, 28, 1)), keras.layers.Conv2D(filters=12, kernel_size=(3, 3), activation=tf.nn.relu), keras.layers.MaxPooling2D(pool_size=(2, 2)), keras.layers.Flatten(), keras.layers.Dense(10) ]) # Train the digit classification model model.compile(optimizer='adam', loss=keras.losses.SparseCategoricalCrossentropy(from_logits=True), metrics=['accuracy']) model.fit( train_images, train_labels, epochs=1, validation_data=(test_images, test_labels) ) converter = tf.lite.TFLiteConverter.from_keras_model(model) tflite_model = converter.convert() tflite_models_dir = pathlib.Path("/tmp/mnist_tflite_models/") tflite_models_dir.mkdir(exist_ok=True, parents=True) tflite_model_file = tflite_models_dir/"mnist_model.tflite" tflite_model_file.write_bytes(tflite_model) converter.optimizations = [tf.lite.Optimize.DEFAULT] tflite_quant_model = converter.convert() tflite_model_quant_file = tflite_models_dir/"mnist_model_quant.tflite" tflite_model_quant_file.write_bytes(tflite_quant_model) !ls -lh {tflite_models_dir} interpreter = tf.lite.Interpreter(model_path=str(tflite_model_file)) interpreter.allocate_tensors() interpreter_quant = tf.lite.Interpreter(model_path=str(tflite_model_quant_file)) interpreter_quant.allocate_tensors() test_image = np.expand_dims(test_images[0], axis=0).astype(np.float32) input_index = interpreter.get_input_details()[0]["index"] output_index = interpreter.get_output_details()[0]["index"] interpreter.set_tensor(input_index, test_image) interpreter.invoke() predictions = interpreter.get_tensor(output_index) import matplotlib.pylab as plt plt.imshow(test_images[0]) template = "True:{true}, predicted:{predict}" _ = plt.title(template.format(true= str(test_labels[0]), predict=str(np.argmax(predictions[0])))) plt.grid(False) # A helper function to evaluate the TF Lite model using "test" dataset. def evaluate_model(interpreter): input_index = interpreter.get_input_details()[0]["index"] output_index = interpreter.get_output_details()[0]["index"] # Run predictions on every image in the "test" dataset. prediction_digits = [] for test_image in test_images: # Pre-processing: add batch dimension and convert to float32 to match with # the model's input data format. test_image = np.expand_dims(test_image, axis=0).astype(np.float32) interpreter.set_tensor(input_index, test_image) # Run inference. interpreter.invoke() # Post-processing: remove batch dimension and find the digit with highest # probability. output = interpreter.tensor(output_index) digit = np.argmax(output()[0]) prediction_digits.append(digit) # Compare prediction results with ground truth labels to calculate accuracy. accurate_count = 0 for index in range(len(prediction_digits)): if prediction_digits[index] == test_labels[index]: accurate_count += 1 accuracy = accurate_count * 1.0 / len(prediction_digits) return accuracy print(evaluate_model(interpreter)) print(evaluate_model(interpreter_quant)) import tensorflow_hub as hub resnet_v2_101 = tf.keras.Sequential([ keras.layers.InputLayer(input_shape=(224, 224, 3)), hub.KerasLayer("https://tfhub.dev/google/imagenet/resnet_v2_101/classification/4") ]) converter = tf.lite.TFLiteConverter.from_keras_model(resnet_v2_101) # Convert to TF Lite without quantization resnet_tflite_file = tflite_models_dir/"resnet_v2_101.tflite" resnet_tflite_file.write_bytes(converter.convert()) # Convert to TF Lite with quantization converter.optimizations = [tf.lite.Optimize.DEFAULT] resnet_quantized_tflite_file = tflite_models_dir/"resnet_v2_101_quantized.tflite" resnet_quantized_tflite_file.write_bytes(converter.convert()) !ls -lh {tflite_models_dir}/*.tflite <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Post-training dynamic range quantization Step2: Train a TensorFlow model Step3: For the example, since you trained the model for just a single epoch, so it only trains to ~96% accuracy. Step4: Write it out to a tflite file Step5: To quantize the model on export, set the optimizations flag to optimize for size Step6: Note how the resulting file, is approximately 1/4 the size. Step7: Run the TFLite models Step8: Test the model on one image Step9: Evaluate the models Step10: Repeat the evaluation on the dynamic range quantized model to obtain Step11: In this example, the compressed model has no difference in the accuracy.
11,995
<ASSISTANT_TASK:> Python Code: import numpy as np import matplotlib.pyplot as plt import cvxopt as opt from cvxopt import blas, solvers import pandas as pd np.random.seed(123) # Turn off progress printing solvers.options['show_progress'] = False ## NUMBER OF ASSETS n_assets = 4 ## NUMBER OF OBSERVATIONS n_obs = 1000 return_vec = np.random.randn(n_assets, n_obs) plt.plot(return_vec.T, alpha=.4); plt.xlabel('time') plt.ylabel('returns'); def rand_weights(n): ''' Produces n random weights that sum to 1 ''' k = np.random.rand(n) return k / sum(k) print rand_weights(n_assets) print rand_weights(n_assets) def random_portfolio(returns): ''' Returns the mean and standard deviation of returns for a random portfolio ''' p = np.asmatrix(np.mean(returns, axis=1)) w = np.asmatrix(rand_weights(returns.shape[0])) C = np.asmatrix(np.cov(returns)) mu = w * p.T sigma = np.sqrt(w * C * w.T) # This recursion reduces outliers to keep plots pretty if sigma > 2: return random_portfolio(returns) return mu, sigma n_portfolios = 500 means, stds = np.column_stack([ random_portfolio(return_vec) for _ in xrange(n_portfolios) ]) plt.plot(stds, means, 'o', markersize=5) plt.xlabel('std') plt.ylabel('mean') plt.title('Mean and standard deviation of returns of randomly generated portfolios'); def optimal_portfolio(returns): n = len(returns) returns = np.asmatrix(returns) N = 100 mus = [10**(5.0 * t/N - 1.0) for t in range(N)] # Convert to cvxopt matrices S = opt.matrix(np.cov(returns)) pbar = opt.matrix(np.mean(returns, axis=1)) # Create constraint matrices G = -opt.matrix(np.eye(n)) # negative n x n identity matrix h = opt.matrix(0.0, (n ,1)) A = opt.matrix(1.0, (1, n)) b = opt.matrix(1.0) # Calculate efficient frontier weights using quadratic programming portfolios = [solvers.qp(mu*S, -pbar, G, h, A, b)['x'] for mu in mus] ## CALCULATE RISKS AND RETURNS FOR FRONTIER returns = [blas.dot(pbar, x) for x in portfolios] risks = [np.sqrt(blas.dot(x, S*x)) for x in portfolios] ## CALCULATE THE 2ND DEGREE POLYNOMIAL OF THE FRONTIER CURVE m1 = np.polyfit(returns, risks, 2) x1 = np.sqrt(m1[2] / m1[0]) # CALCULATE THE OPTIMAL PORTFOLIO wt = solvers.qp(opt.matrix(x1 * S), -pbar, G, h, A, b)['x'] return np.asarray(wt), returns, risks weights, returns, risks = optimal_portfolio(return_vec) plt.plot(stds, means, 'o') plt.ylabel('mean') plt.xlabel('std') plt.plot(risks, returns, 'y-o'); print weights data = get_pricing(['IBM', 'GLD', 'XOM', 'AAPL', 'MSFT', 'TLT', 'SHY'], start_date='2005-06-07', end_date='2014-01-27') data.loc['price', :, :].plot(figsize=(8,5)) plt.ylabel('price in $'); import zipline from zipline.api import (add_history, history, set_slippage, slippage, set_commission, commission, order_target_percent) from zipline import TradingAlgorithm def initialize(context): ''' Called once at the very beginning of a backtest (and live trading). Use this method to set up any bookkeeping variables. The context object is passed to all the other methods in your algorithm. Parameters context: An initialized and empty Python dictionary that has been augmented so that properties can be accessed using dot notation as well as the traditional bracket notation. Returns None ''' # Register history container to keep a window of the last 100 prices. add_history(100, '1d', 'price') # Turn off the slippage model set_slippage(slippage.FixedSlippage(spread=0.0)) # Set the commission model (Interactive Brokers Commission) set_commission(commission.PerShare(cost=0.01, min_trade_cost=1.0)) context.tick = 0 def handle_data(context, data): ''' Called when a market event occurs for any of the algorithm's securities. Parameters data: A dictionary keyed by security id containing the current state of the securities in the algo's universe. context: The same context object from the initialize function. Stores the up to date portfolio as well as any state variables defined. Returns None ''' # Allow history to accumulate 100 days of prices before trading # and rebalance every day thereafter. context.tick += 1 if context.tick < 100: return # Get rolling window of past prices and compute returns prices = history(100, '1d', 'price').dropna() returns = prices.pct_change().dropna() try: # Perform Markowitz-style portfolio optimization weights, _, _ = optimal_portfolio(returns.T) # Rebalance portfolio accordingly for stock, weight in zip(prices.columns, weights): order_target_percent(stock, weight) except ValueError as e: # Sometimes this error is thrown # ValueError: Rank(A) < p or Rank([P; A; G]) < n pass # Instantinate algorithm algo = TradingAlgorithm(initialize=initialize, handle_data=handle_data) # Run algorithm results = algo.run(data.swapaxes(2, 0, 1)) results.portfolio_value.plot() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Assume that we have 4 assets, each with a return series of length 1000. We can use numpy.random.randn to sample returns from a normal distribution. Step2: These return series can be used to create a wide range of portfolios. We will produce random weight vectors and plot those portfolios. As we want all our capital to be invested, the weights will have to sum to one. Step3: Next, let's evaluate how these random portfolios would perform by calculating the mean returns and the volatility (here we are using standard deviation). You can see that there is Step4: We calculate the return using Step5: Upon plotting these you will observe that they form a characteristic parabolic Step6: Markowitz optimization and the Efficient Frontier Step7: In yellow you can see the optimal portfolios for each of the desired returns (i.e. the mus). In addition, we get the weights for one optimal portfolio Step8: Backtesting on real market data Step9: Next, we'll create a zipline algorithm by defining two functions
11,996
<ASSISTANT_TASK:> Python Code: !pip install google-api-python-client !pip install google-cloud-vision import csv import datetime import io import json import pprint from google.api_core import retry from google.cloud import vision from google.colab import files from google_auth_oauthlib.flow import InstalledAppFlow from googleapiclient import discovery from googleapiclient import http import pandas as pd import requests print('Successfully imported Python libraries!') API_SCOPES = ['https://www.googleapis.com/auth/doubleclickbidmanager', 'https://www.googleapis.com/auth/display-video', 'https://www.googleapis.com/auth/devstorage.read_only', 'https://www.googleapis.com/auth/cloud-vision'] # Authenticate using user credentials stored in client_secrets.json client_secrets_file = files.upload() client_secrets_json = json.loads(next(iter(client_secrets_file.values()))) flow = InstalledAppFlow.from_client_config(client_secrets_json, API_SCOPES) credentials = flow.run_console() print('Success!') # Build DBM Read API service object dbm_service = discovery.build( 'doubleclickbidmanager', 'v1.1', credentials=credentials) print('DBM API service object created') # Build Google Cloud Storage Read API service object gcs_service = discovery.build('storage', 'v1', credentials=credentials) print('GCS service object created') # Create Display Video API service object display_video_service = discovery.build( 'displayvideo', 'v1', credentials=credentials) print('Display Video API service object created') PARTNER_ID = '234340' #@param {type:"string"} ADVERTISER_ID = '2436036' #@param {type:"string"} CAMPAIGN_ID = '4258803' #@param {type:"string"} # For use with legacy DBM API SDF_VERSION = '5.3' #@param {type:"string"} # For use with DV360 API SDF_VERSION_DV360 = 'SDF_VERSION_5_3' #@param {type:"string"} print('DV360 settings saved!') YOUR_NAME = 'Matt' #@param {type:"string"} # Set dates for new campaign month = datetime.datetime.today().strftime('%m') day = datetime.datetime.today().strftime('%d') year = datetime.datetime.today().strftime('%Y') month_plus30 = (datetime.datetime.today() + datetime.timedelta(days=30)).strftime('%m') day_plus30 = (datetime.datetime.today() + datetime.timedelta(days=30)).strftime('%d') year_plus30 = (datetime.datetime.today() + datetime.timedelta(days=30)).strftime('%Y') def create_campaign(YOUR_NAME): Creates a new DV360 Campaign object. campaign_name = f'{year}-{month}-{day} | {YOUR_NAME}' campaign_obj = { 'displayName': campaign_name, 'entityStatus': 'ENTITY_STATUS_ACTIVE', 'campaignGoal': { 'campaignGoalType': 'CAMPAIGN_GOAL_TYPE_ONLINE_ACTION', 'performanceGoal': { 'performanceGoalType': 'PERFORMANCE_GOAL_TYPE_CPC', 'performanceGoalAmountMicros': 1000000 } }, 'campaignFlight': { 'plannedSpendAmountMicros': 1000000, 'plannedDates': { 'startDate': { 'year': year, 'month': month, 'day': day }, 'endDate': { 'year': year_plus30, 'month': month_plus30, 'day': day_plus30 } } }, 'frequencyCap': { 'maxImpressions': 10, 'timeUnit': 'TIME_UNIT_DAYS', 'timeUnitCount': 1 } } # Create the campaign. campaign = display_video_service.advertisers().campaigns().create( advertiserId=ADVERTISER_ID, body=campaign_obj ).execute() return campaign new_campaign = create_campaign(YOUR_NAME) # Display the new campaign. CAMPAIGN_ID = new_campaign['campaignId'] print(f"\nCampaign '{new_campaign['name']}' was created." f"\nCampaign id: '{new_campaign['campaignId']}'" f"\nCampaign name: '{new_campaign['displayName']}'" f"\nCampaign status: '{new_campaign['entityStatus']}'") # Configure the sdf.download request request_body = { 'fileTypes': ['LINE_ITEM'], 'filterType': 'CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID], 'version': SDF_VERSION } # Make the request to download all SDF LineItems for your new campaign request = dbm_service.sdf().download(body=request_body) response = request.execute() # Load SDF response to Pandas DataFrame sdf_df = pd.read_csv(io.StringIO(response['lineItems'])) # Show sample (5 rows) of DataFrame sdf_df.head() targeting_template = { 'Channel Targeting - Include': '2580510;', 'Channel Targeting - Exclude': '2580509;', 'Inventory Source Targeting - Include': '1;', 'Inventory Source Targeting - Exclude': '6; 8; 9; 10; 2; 11; 12; 13; 16; 20; 23; 27; 29; 30; 31; 34; 35; 36; ' '38; 43; 46; 50; 51; 56; 60; 63; 67; 74;', 'Digital Content Labels - Exclude': 'G; PG; T;', 'Brand Safety Sensitivity Setting': 'Use custom', 'Brand Safety Custom Settings': 'Adult; Alcohol; Derogatory; Downloads & Sharing; Drugs; Gambling; ' 'Politics; Profanity; Religion; Sensitive social issues; Suggestive; ' 'Tobacco; Tragedy; Transportation Accidents; Violence; Weapons;' } # Overwrite targeting columns using 'targeting_template' sdf_df['Channel Targeting - Include'] = targeting_template[ 'Channel Targeting - Include'] sdf_df['Channel Targeting - Exclude'] = targeting_template[ 'Channel Targeting - Exclude'] sdf_df['Inventory Source Targeting - Include'] = targeting_template[ 'Inventory Source Targeting - Include'] sdf_df['Inventory Source Targeting - Exclude'] = targeting_template[ 'Inventory Source Targeting - Exclude'] sdf_df['Digital Content Labels - Exclude'] = targeting_template[ 'Digital Content Labels - Exclude'] sdf_df['Brand Safety Sensitivity Setting'] = targeting_template[ 'Brand Safety Sensitivity Setting'] sdf_df['Brand Safety Custom Settings'] = targeting_template[ 'Brand Safety Custom Settings'] # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update1_controls.csv', index=False) # Show sample (5 rows) of DataFrame sdf_df.head() # Download modified csv to local storage files.download('sdf_update1_controls.csv') print( "Success, check your downloads for a file called 'sdf_update1_controls.csv'" ) # Actually today-7 to avoid issues with collection yesterday = datetime.date.today() - datetime.timedelta(7) # Download public ERF for geolocation info request = gcs_service.objects().get_media( bucket='gdbm-public', object='entity/' + yesterday.strftime('%Y%m%d') + '.0.GeoLocation.json') response = request.execute() geolocations = json.loads(response) print('GeoLocation.json successfully downloaded \n') print("Here's a random sample of 5 entries:\n") pprint.pprint(geolocations[0:5]) # Provide a list of store locations store_locations = ['United Kingdom', 'France', 'Spain', 'Germany', 'Portugal'] # Create a new dictionary to save the country code and ID later on geo_targeting_ids = {} # Note: GeoLocation.json is over 800,000 lines for location in geolocations: if location['canonical_name'] in store_locations: geo_targeting_ids[location['country_code']] = location['id'] print(location) print(geo_targeting_ids) # Configure the sdf.download request request_body = { 'fileTypes': ['LINE_ITEM'], 'filterType': 'CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID], 'version': SDF_VERSION } # Make the request to download all SDF LineItems for your new campaign request = dbm_service.sdf().download(body=request_body) response = request.execute() # Load SDF response to Pandas DataFrame sdf_df = pd.read_csv(io.StringIO(response['lineItems'])) # Show sample (5 rows) of DataFrame sdf_df.head() for country in geo_targeting_ids: target_country = geo_targeting_ids[country] sdf_df.loc[sdf_df.Name.str.contains(country), 'Geography Targeting - Include'] = f'{target_country};' # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update2_geo.csv', index=False) # Display updated DataFrame sdf_df.head() # Download modified csv to local storage files.download('sdf_update2_geo.csv') print("Success, look for a file called 'sdf_update2_geo.csv' in your downloads folder") # Upload product feed using Colab's upload utility product_feed_csv = files.upload() contents = next(iter(product_feed_csv.values())).decode('utf-8') products = csv.DictReader(io.StringIO(contents)) image_url_list = {} # Iterate through each row and update dict() with sku:link for row in products: image_url_list[row['sku']] = row['image_link'] pprint.pprint(image_url_list) def vision_analysis(image_url): Process images using the Cloud Vision API. # Assign image URL image = vision.Image() image.source.image_uri = image_url # Instantiates a Vision client client = vision.ImageAnnotatorClient(credentials=credentials) # Performs label detection on the image file vision_response = client.label_detection(image=image) dv360_targeting_keywords = [] labels = [] for label in vision_response.label_annotations: dv360_targeting_keywords.append(label.description) label = f'{label.description} ({label.score:.2%})' labels.append(label) return dv360_targeting_keywords, labels imageslookup = {} for sku, url in image_url_list.items(): imageslookup[sku], vision_labels = vision_analysis(url) print(f'Analysis completed for: {url}') print('Labels (confidence score):') pprint.pprint(vision_labels, indent=4) print('=' * 30) print('\n\nLookup table:') pprint.pprint(imageslookup, indent=4) # Configure the sdf.download request request_body = { 'fileTypes': ['LINE_ITEM'], 'filterType': 'CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID], 'version': SDF_VERSION } request = dbm_service.sdf().download(body=request_body) response = request.execute() # Load SDF response to Pandas DataFrame sdf_df = pd.read_csv(io.StringIO(response['lineItems'])) for product in imageslookup: sdf_df.loc[sdf_df.Name.str.contains(product), 'Keyword Targeting - Include'] = ';'.join( imageslookup[product]).lower() # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update3_keywords.csv', index=False) # Show sample (5 rows) of DataFrame sdf_df.head() # Download modified csv to local storage files.download('sdf_update3_keywords.csv') print("Success, look for the file called 'sdf_update3_keywords.csv' in your downloads folder") # Define DV360 report definition (i.e. metrics and filters) report_definition = { 'params': { 'type': 'TYPE_GENERAL', 'metrics': [ 'METRIC_IMPRESSIONS', 'METRIC_CLICKS', 'METRIC_CTR', 'METRIC_REVENUE_ADVERTISER' ], 'groupBys': [ 'FILTER_ADVERTISER', 'FILTER_INSERTION_ORDER', 'FILTER_LINE_ITEM', 'FILTER_ADVERTISER_CURRENCY' ], 'filters': [{ 'type': 'FILTER_ADVERTISER', 'value': ADVERTISER_ID }], }, 'metadata': { 'title': 'DV360 Automation API-generated report', 'dataRange': 'LAST_90_DAYS', 'format': 'csv' }, 'schedule': { 'frequency': 'ONE_TIME' } } # Create new query using report definition operation = dbm_service.queries().createquery(body=report_definition).execute() pprint.pprint(operation) # Runs the given Queries.getquery request, retrying with an exponential # backoff. Returns completed operation. Will raise an exception if the # operation takes more than five hours to complete. @retry.Retry( predicate=retry.if_exception_type(Exception), initial=5, maximum=60, deadline=18000) def check_get_query_completion(getquery_request): Queries metadata to check for completion. completion_response = getquery_request.execute() pprint.pprint(completion_response) if completion_response['metadata']['running']: raise Exception('The operation has not completed.') return completion_response getquery_request = dbm_service.queries().getquery(queryId=operation['queryId']) getquery_response = check_get_query_completion(getquery_request) report_url = getquery_response['metadata'][ 'googleCloudStoragePathForLatestReport'] # Use skipfooter to remove report footer from data report_df = pd.read_csv(report_url, skipfooter=16, engine='python') report_df.head(10) # Define our 'KPIs' ctr_target = 0.15 imp_threshold = 10000 # Convert IDs to remove decimal point, then string report_df['Line Item ID'] = report_df['Line Item ID'].apply(int) poor_performers = report_df.query( 'Impressions > @imp_threshold & (Clicks / Impressions)*100 < @ctr_target') # Convert results to Python list poor_performers = list(poor_performers['Line Item ID']) print(f'There are {len(poor_performers)} LineItems with a CTR' f' < {ctr_target}% and over {imp_threshold} impressions:' f'\n{poor_performers}') # Configure the sdf.download request request_body = { 'fileTypes': ['LINE_ITEM'], 'filterType': 'CAMPAIGN_ID', 'filterIds': ['1914007'], 'version': SDF_VERSION } request = dbm_service.sdf().download(body=request_body) response = request.execute() # Load SDF response to Pandas DataFrame sdf_df = pd.read_csv(io.StringIO(response['lineItems'])) for li in poor_performers: geo = sdf_df.loc[sdf_df['Line Item Id'] == li, 'Geography Targeting - Include'].iloc[0] sdf_df.loc[sdf_df['Line Item Id'] == li, 'Bid Multipliers'] = f'(geo; {geo} 0.5;);' # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update4_bidmultipliers.csv', index=False) # Display updated DataFrame sdf_df.head() files.download('sdf_update4_bidmultipliers.csv') print('Success, your new SDF file has been downloaded') #TODO # Format today-2 in required date format yesterday = (datetime.date.today() - datetime.timedelta(2)).strftime('%Y%m%d') # Download ERF for Language.json from public GCS bucket request = gcs_service.objects().get_media( bucket='gdbm-public', object='entity/' + yesterday + '.0.Language.json') response = request.execute() languages = json.loads(response) language_targets = ['en', 'fr'] lang_targeting_ids = {} # Search language.json for language targets 'en' and 'fr' for lang in languages: if lang['code'] in language_targets: lang_targeting_ids[lang['code']] = lang['id'] print(lang) print(lang_targeting_ids) # Define targeting template targeting_template = { 'Affinity & In Market Targeting - Include': '4569529;4586809;4497529;', } # Configure the sdf.download request request_body = { 'fileTypes': ['LINE_ITEM'], 'filterType': 'CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID], 'version': SDF_VERSION } request = dbm_service.sdf().download(body=request_body) response = request.execute() # Load SDF response to Pandas DataFrame sdf_df = pd.read_csv(io.StringIO(response['lineItems'])) # Update DataFrame with Language and Audience targeting sdf_df.loc[sdf_df.Name.str.contains('GB'), 'Language Targeting - Include'] = f"{lang_targeting_ids['en']};" sdf_df.loc[sdf_df.Name.str.contains('FR'), 'Language Targeting - Include'] = f"{lang_targeting_ids['fr']};" sdf_df['Affinity & In Market Targeting - Include'] = targeting_template[ 'Affinity & In Market Targeting - Include'] # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update5_challenge.csv', index=False) # Display updated DataFrame sdf_df.head() # Download file to disk using Colab syntax files.download('sdf_update5_challenge.csv') print("Success, check your downloads for a file called 'sdf_update5_challenge.csv'") def download_sdf(request_body): Download sdf .zip, extract .csv files, load 'SDF-LineItems.csv' to Pandas DataFrame. # Create the sdfdownloadtask sdf_operation = display_video_service.sdfdownloadtasks().create( body=sdf_body).execute() print(f'Operation {sdf_operation["name"]} was created.') # Configure the operations.get request get_request = display_video_service.sdfdownloadtasks().operations().get( name=sdf_operation['name']) # Runs the given operations.get request, retrying with an exponential # backoff. Returns completed operation. Will raise an exception if the # operation takes more than five hours to complete. @retry.Retry(predicate=retry.if_exception_type(Exception), initial=5, maximum=60, deadline=18000) def check_sdf_downloadtask_completion(get_request): operation = get_request.execute() if 'done' not in operation: raise Exception('The operation has not completed.') return operation # Get current status of operation with exponential backoff retry logic operation = check_sdf_downloadtask_completion(get_request) # Check if the operation finished with an error and return if 'error' in operation: raise Exception(f'The operation finished in error with code {operation["error"]["code"]} {operation["error"]["message"]}') print('The operation completed successfully.') print('Resource {operation["response"]["resourceName"]} was created.') # Extract download file resource name to use in download request resource_name = operation['response']['resourceName'] # Configure the Media.download request dowload_request = display_video_service.media().download_media( resourceName=resource_name) output_file = f"{resource_name.replace('/','-')}.zip" # Create output stream for downloaded file outstream = io.FileIO(output_file, mode='wb') # Make downloader object downloader = http.MediaIoBaseDownload(outstream, dowload_request) # Download media file in chunks until finished download_finished = False while download_finished is False: _, download_finished = downloader.next_chunk() print(f'File downloaded to {output_file}') # Load output into a Pandas dataframe df = pd.read_csv(output_file, compression='zip') return df print('Download SDF function created') targeting_template = { 'Channel Targeting - Include': '2580510;', 'Channel Targeting - Exclude': '2580509;', 'Inventory Source Targeting - Include': '1;', 'Inventory Source Targeting - Exclude': '6; 8; 9; 10; 2; 11; 12; 13; 16; 20; 23; 27; 29; 30; 31; 34; 35; 36; ' '38; 43; 46; 50; 51; 56; 60; 63; 67; 74;', 'Digital Content Labels - Exclude': 'G; PG; T;', 'Brand Safety Sensitivity Setting': 'Use custom', 'Brand Safety Custom Settings': 'Adult; Alcohol; Derogatory; Downloads & Sharing; Drugs; Gambling; ' 'Politics; Profanity; Religion; Sensitive social issues; Suggestive; ' 'Tobacco; Tragedy; Transportation Accidents; Violence; Weapons;' } # Configure the sdfdownloadtasks.create request sdf_body = { 'version': SDF_VERSION_DV360, 'advertiserId': ADVERTISER_ID, 'parentEntityFilter': { 'fileType': ['FILE_TYPE_LINE_ITEM'], 'filterType': 'FILTER_TYPE_CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID] } } # Fetch updated SDF lineitem sdf_df = download_sdf(sdf_body) # Overwrite targeting columns using 'targeting_template' sdf_df['Channel Targeting - Include'] = targeting_template[ 'Channel Targeting - Include'] sdf_df['Channel Targeting - Exclude'] = targeting_template[ 'Channel Targeting - Exclude'] sdf_df['Inventory Source Targeting - Include'] = targeting_template[ 'Inventory Source Targeting - Include'] sdf_df['Inventory Source Targeting - Exclude'] = targeting_template[ 'Inventory Source Targeting - Exclude'] sdf_df['Digital Content Labels - Exclude'] = targeting_template[ 'Digital Content Labels - Exclude'] sdf_df['Brand Safety Sensitivity Setting'] = targeting_template[ 'Brand Safety Sensitivity Setting'] sdf_df['Brand Safety Custom Settings'] = targeting_template[ 'Brand Safety Custom Settings'] # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update1_controls.csv', index=False) # Show sample (5 rows) of DataFrame sdf_df.head() # Download modified csv to local storage files.download('sdf_update1_controls.csv') print( "Success, check your downloads for a file called 'sdf_update1_controls.csv'" ) # Actually today-7 to avoid issues with collection yesterday = datetime.date.today() - datetime.timedelta(7) # Download public ERF for geolocation info request = gcs_service.objects().get_media( bucket='gdbm-public', object='entity/' + yesterday.strftime('%Y%m%d') + '.0.GeoLocation.json') response = request.execute() geolocations = json.loads(response) print('GeoLocation.json successfully downloaded \n') print("Here's a random sample of 5 entries:\n") pprint.pprint(geolocations[0:5]) # Provide a list of store locations store_locations = ['United Kingdom', 'France', 'Spain', 'Germany', 'Portugal'] # Create a new dictionary to save the country code and ID later on geo_targeting_ids = {} # Note: GeoLocation.json is over 800,000 lines for location in geolocations: if location['canonical_name'] in store_locations: geo_targeting_ids[location['country_code']] = location['id'] print(location) print(geo_targeting_ids) # Configure the sdfdownloadtasks.create request sdf_body = { 'version': SDF_VERSION_DV360, 'advertiserId': ADVERTISER_ID, 'parentEntityFilter': { 'fileType': ['FILE_TYPE_LINE_ITEM'], 'filterType': 'FILTER_TYPE_CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID] } } sdf_df = download_sdf(sdf_body) sdf_df.head() for country in geo_targeting_ids: target_country = geo_targeting_ids[country] sdf_df.loc[sdf_df.Name.str.contains(country), 'Geography Targeting - Include'] = f'{target_country};' # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update2_geo.csv', index=False) # Display updated DataFrame sdf_df.head() # Download modified csv to local storage files.download('sdf_update2_geo.csv') print("Success, see file 'sdf_update2_geo.csv' in your downloads folder") # Upload product feed using Colab's upload utility product_feed_csv = files.upload() contents = next(iter(product_feed_csv.values())).decode('utf-8') products = csv.DictReader(io.StringIO(contents)) image_url_list = {} # Iterate through each row and update dict() with sku:link for row in products: image_url_list[row['sku']] = row['image_link'] pprint.pprint(image_url_list) def vision_analysis(image_url): Process images using the Cloud Vision API. # Assign image URL image = vision.Image() image.source.image_uri = image_url # Instantiates a Vision client client = vision.ImageAnnotatorClient(credentials=credentials) # Performs label detection on the image file response = client.label_detection(image=image) dv360_targeting_keywords = [] vision_labels = [] for label in response.label_annotations: dv360_targeting_keywords.append(label.description) label = f'{label.description} ({label.score:.2%})' vision_labels.append(label) return dv360_targeting_keywords, vision_labels print("Vision function created") imageslookup = {} for sku, url in image_url_list.items(): imageslookup[sku], vision_labels = vision_analysis(url) print(f'Analysis completed for: {url}') print('Labels (confidence score):') pprint.pprint(vision_labels, indent=4) print('=' * 30) print('\n\nLookup table:') pprint.pprint(imageslookup, indent=4) # Configure the sdfdownloadtasks.create request sdf_body = { 'version': SDF_VERSION_DV360, 'advertiserId': ADVERTISER_ID, 'parentEntityFilter': { 'fileType': ['FILE_TYPE_LINE_ITEM'], 'filterType': 'FILTER_TYPE_CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID] } } sdf_df = download_sdf(sdf_body) sdf_df.head() for product in imageslookup: sdf_df.loc[sdf_df.Name.str.contains(product), 'Keyword Targeting - Include'] = ';'.join( imageslookup[product]).lower() # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update3_keywords.csv', index=False) sdf_df.head() # Download modified csv to local storage files.download('sdf_update3_keywords.csv') print("Success, see 'sdf_update3_keywords.csv' in your downloads folder") # Define DV360 report definition (i.e. metrics and filters) report_definition = { 'params': { 'type': 'TYPE_GENERAL', 'metrics': [ 'METRIC_IMPRESSIONS', 'METRIC_CLICKS', 'METRIC_CTR', 'METRIC_REVENUE_ADVERTISER' ], 'groupBys': [ 'FILTER_ADVERTISER', 'FILTER_INSERTION_ORDER', 'FILTER_LINE_ITEM', 'FILTER_ADVERTISER_CURRENCY' ], 'filters': [{ 'type': 'FILTER_ADVERTISER', 'value': ADVERTISER_ID }], }, 'metadata': { 'title': 'DV360 Automation API-generated report', 'dataRange': 'LAST_90_DAYS', 'format': 'csv' }, 'schedule': { 'frequency': 'ONE_TIME' } } # Create new query using report definition operation = dbm_service.queries().createquery(body=report_definition).execute() pprint.pprint(operation) # Runs the given Queries.getquery request, retrying with an exponential # backoff. Returns completed operation. Will raise an exception if the # operation takes more than five hours to complete. @retry.Retry(predicate=retry.if_exception_type(Exception), initial=5, maximum=60, deadline=18000) def check_get_query_completion(getquery_request): response = getquery_request.execute() pprint.pprint(response) if response['metadata']['running']: raise Exception('The operation has not completed.') return response getquery_request = dbm_service.queries().getquery(queryId=operation['queryId']) response = check_get_query_completion(getquery_request) report_url = response['metadata']['googleCloudStoragePathForLatestReport'] # Use skipfooter to remove report footer from data report_df = pd.read_csv(report_url, skipfooter=16, engine='python') report_df.head(10) # Define our 'KPIs' ctr_target = 0.15 imp_threshold = 1000 # Convert IDs to remove decimal point, then string report_df['Line Item ID'] = report_df['Line Item ID'].apply(int) poor_performers = report_df.query( 'Impressions > @imp_threshold & (Clicks / Impressions)*100 < @ctr_target') # Convert results to Python list poor_performers = list(poor_performers['Line Item ID']) print(f'There are {len(poor_performers)} LineItems with a CTR' f' < {ctr_target}% and over {imp_threshold} impressions:' f'\n{poor_performers}') # Configure the sdfdownloadtasks.create request sdf_body = { 'version': SDF_VERSION_DV360, 'advertiserId': ADVERTISER_ID, 'parentEntityFilter': { 'fileType': ['FILE_TYPE_LINE_ITEM'], 'filterType': 'FILTER_TYPE_CAMPAIGN_ID', 'filterIds': ['1914007'] } } sdf_df = download_sdf(sdf_body) sdf_df.head() for li in poor_performers: geo = sdf_df.loc[sdf_df['Line Item Id'] == li, 'Geography Targeting - Include'].iloc[0] sdf_df.loc[sdf_df['Line Item Id'] == li, 'Bid Multipliers'] = f'(geo; {geo} 0.5;);' # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update4_bidmultipliers.csv', index=False) # Display updated DataFrame sdf_df.head() files.download('sdf_update4_bidmultipliers.csv') print('Success, your new SDF file has been downloaded') #TODO # Format today-7 in required date format yesterday = (datetime.date.today() - datetime.timedelta(7)).strftime('%Y%m%d') # Download ERF for Language.json from public GCS bucket request = gcs_service.objects().get_media( bucket='gdbm-public', object='entity/' + yesterday + '.0.Language.json') response = request.execute() languages = json.loads(response) language_targets = ['en', 'fr'] lang_targeting_ids = {} # Search language.json for language targets 'en' and 'fr' for lang in languages: if lang['code'] in language_targets: lang_targeting_ids[lang['code']] = lang['id'] print(lang) print(lang_targeting_ids) # Define targeting template targeting_template = { 'Affinity & In Market Targeting - Include': '4569529;4586809;4497529;', } # Configure the sdfdownloadtasks.create request sdf_body = { 'version': SDF_VERSION_DV360, 'advertiserId': ADVERTISER_ID, 'parentEntityFilter': { 'fileType': ['FILE_TYPE_LINE_ITEM'], 'filterType': 'FILTER_TYPE_CAMPAIGN_ID', 'filterIds': [CAMPAIGN_ID] } } sdf_df = download_sdf(sdf_body) # Update DataFrame with Language and Audience targeting sdf_df.loc[sdf_df.Name.str.contains('GB'), 'Language Targeting - Include'] = f"{lang_targeting_ids['en']};" sdf_df.loc[sdf_df.Name.str.contains('FR'), 'Language Targeting - Include'] = f"{lang_targeting_ids['fr']};" sdf_df['Affinity & In Market Targeting - Include'] = targeting_template[ 'Affinity & In Market Targeting - Include'] # Save modified dataframe to remote storage in Colab sdf_df.to_csv('sdf_update5_challenge.csv', index=False) # Display updated DataFrame sdf_df.head() # Download file to disk using Colab syntax files.download('sdf_update5_challenge.csv') print("Success, see downloads folder for file 'sdf_update5_challenge.csv'") request = display_video_service.advertisers().lineItems().list( advertiserId=ADVERTISER_ID, filter='entityStatus="ENTITY_STATUS_ACTIVE"', pageSize=1 ) response = request.execute() # Check if response is empty. if not response: print('Advertiser has no active Line Items') else: pprint.pprint(response['lineItems']) def get_active_lineitems(ADVERTISER_ID, CAMPAIGN_ID): Returns list of Lineitems with active status. list_lineitems = display_video_service.advertisers().lineItems().list( advertiserId=ADVERTISER_ID, filter=f'entityStatus="ENTITY_STATUS_ACTIVE" AND campaignId="{CAMPAIGN_ID}"', fields='lineItems(lineItemId,displayName)' # Return only two fields ).execute() active_lineitems = [li['lineItemId'] for li in list_lineitems['lineItems']] return active_lineitems # Upload product feed using Colab's upload utility product_feed_csv = files.upload() contents = next(iter(product_feed_csv.values())).decode('utf-8') products = list(csv.DictReader(io.StringIO(contents))) # Create unique list of country-codes -- set() automatically de dupes unique_country_codes = set([row['country code'] for row in products]) print(unique_country_codes) def create_insertion_order(parent_campaign_id, new_io_name): Creates a new DV360 insertion order object. # Define our new Insertion Order boilerplate new_insertion_order = { 'campaignId': parent_campaign_id, 'displayName': new_io_name, # Define naming convention 'entityStatus': 'ENTITY_STATUS_DRAFT', 'pacing': { 'pacingPeriod': 'PACING_PERIOD_DAILY', 'pacingType': 'PACING_TYPE_EVEN', 'dailyMaxMicros': '1000000' # Equiv to $1 or local currency }, 'frequencyCap': { 'unlimited': False, 'timeUnit': 'TIME_UNIT_MONTHS', 'timeUnitCount': 1, 'maxImpressions': 5 }, 'performanceGoal': { 'performanceGoalType': 'PERFORMANCE_GOAL_TYPE_CPC', 'performanceGoalAmountMicros': '1000000', # $1 CPM/CPC target }, 'bidStrategy': { 'fixedBid': { 'bidAmountMicros': '0' }, }, 'budget': { 'automationType': 'INSERTION_ORDER_AUTOMATION_TYPE_NONE', 'budgetUnit': 'BUDGET_UNIT_CURRENCY', 'budgetSegments': [{ 'budgetAmountMicros': '30000000', # Equiv to $30 or local currency 'description': 'My first segment', 'dateRange': { 'startDate': { 'year': year, 'month': month, 'day': day }, 'endDate': { 'year': year_plus30, 'month': month_plus30, 'day': day_plus30 } } }] } } # API create() request to generate new Insertion Order newinsertionorder_request = display_video_service.advertisers( ).insertionOrders().create( advertiserId=ADVERTISER_ID, body=new_insertion_order).execute() # Define patch to activate new Insertion Order afer creation patch = { 'entityStatus': 'ENTITY_STATUS_ACTIVE', } # API patch() request display_video_service.advertisers().insertionOrders().patch( advertiserId=ADVERTISER_ID, insertionOrderId=newinsertionorder_request['insertionOrderId'], updateMask='entityStatus', body=patch).execute() print(newinsertionorder_request) return newinsertionorder_request print('Insertion Order function created') def create_lineitem(parent_io_id, new_li_name): Creates a new DV360 lineitem object. # Define our new LineItem boilerplate new_lineitem = { 'advertiserId': ADVERTISER_ID, 'insertionOrderId': parent_io_id, 'displayName': new_li_name, # Define naming convention 'lineItemType': 'LINE_ITEM_TYPE_DISPLAY_DEFAULT', 'entityStatus': 'ENTITY_STATUS_DRAFT', 'flight': { 'flightDateType': 'LINE_ITEM_FLIGHT_DATE_TYPE_INHERITED', }, 'pacing': { 'pacingPeriod': 'PACING_PERIOD_DAILY', 'pacingType': 'PACING_TYPE_EVEN', 'dailyMaxMicros': '1000000' }, 'frequencyCap': { 'timeUnit': 'TIME_UNIT_MONTHS', 'timeUnitCount': 1, 'maxImpressions': 5 }, 'partnerRevenueModel': { 'markupType': 'PARTNER_REVENUE_MODEL_MARKUP_TYPE_TOTAL_MEDIA_COST_MARKUP' }, 'budget': { 'budgetAllocationType': 'LINE_ITEM_BUDGET_ALLOCATION_TYPE_UNLIMITED', 'budgetUnit': 'BUDGET_UNIT_CURRENCY' }, 'bidStrategy': { 'fixedBid': { 'bidAmountMicros': '1000000' } } } # API create() request to generate new Lineitem newlineitem_request = display_video_service.advertisers().lineItems().create( advertiserId=ADVERTISER_ID, body=new_lineitem).execute() # Define patch to activate new Line Item afer creation patch = { 'entityStatus': 'ENTITY_STATUS_ACTIVE', } # API patch() request display_video_service.advertisers().lineItems().patch( advertiserId=ADVERTISER_ID, lineItemId=newlineitem_request['lineItemId'], updateMask='entityStatus', body=patch).execute() print(newlineitem_request) return newlineitem_request print('LineItem function created') %%time for country_code in unique_country_codes: # Create() and patch() new Insertion Order io_name = f'Google Store | {country_code} | Display | Prospecting' insertionorder = create_insertion_order(CAMPAIGN_ID, io_name) for row in products: if country_code in row['country code']: # Create() and patch() new LineItem li_name = f"{row['country code']} | {row['title']} | {row['sku']}" lineitem = create_lineitem(insertionorder['insertionOrderId'], li_name) print('Process completed') # Create the page token variable. next_page_token = '' while True: # Request the targeting options list. response = display_video_service.targetingTypes().targetingOptions().list( advertiserId=ADVERTISER_ID, targetingType='TARGETING_TYPE_BROWSER', pageToken=next_page_token).execute() # Check if response is empty. if not response: print('List request returned no Targeting Options') break # Iterate over retrieved targeting options. options_dict = {} for option in response['targetingOptions']: options_dict[ option['targetingOptionId']] = option['browserDetails']['displayName'] # Break out of loop if there is no next page. if 'nextPageToken' not in response: break # Update the next page token. next_page_token = response['nextPageToken'] pprint.pprint(options_dict) # Return list of Lineitems with active status active_lineitems = get_active_lineitems(ADVERTISER_ID, CAMPAIGN_ID) # Fetch first Lineitem ID lineitem_id = active_lineitems[0] # Create a assigned targeting option object. assigned_targeting_option_obj = { 'browserDetails': { 'targetingOptionId': '500072' } } # Create the assigned targeting option. assigned_targeting_option = display_video_service.advertisers().lineItems( ).targetingTypes().assignedTargetingOptions().create( advertiserId=ADVERTISER_ID, lineItemId=f'{lineitem_id}', targetingType='TARGETING_TYPE_BROWSER', body=assigned_targeting_option_obj ).execute() # Display the new assigned targeting option. print(f"Assigned Targeting Option {assigned_targeting_option['name']} created.") # Create the page token variable. next_page_token = '' while True: # Request the targeting options list. response = display_video_service.googleAudiences().list( advertiserId=ADVERTISER_ID, filter='displayName : "Technology"', pageToken=next_page_token).execute() # Check if response is empty. if not response: print('List request returned no Targeting Options') break # Iterate over retrieved targeting options. options_dict = {} for option in response['googleAudiences']: options_dict[option['googleAudienceId']] = [ option['displayName'], option['googleAudienceType'] ] # Break out of loop if there is no next page. if 'nextPageToken' not in response: break # Update the next page token. next_page_token = response['nextPageToken'] pprint.pprint(response) google_audience_id = '92948' # Return list of Lineitems with active status active_lineitems = get_active_lineitems(ADVERTISER_ID, CAMPAIGN_ID) # Create a assigned targeting option object. assigned_targeting_option_obj = { 'audienceGroupDetails': { 'includedGoogleAudienceGroup': { 'settings': [{ 'googleAudienceId': f'{google_audience_id}' }] } } } pprint.pprint(assigned_targeting_option_obj) # Update bulk targeting for li in active_lineitems: # Create the assigned targeting option. assigned_targeting_option = display_video_service.advertisers().lineItems( ).targetingTypes().assignedTargetingOptions().create( advertiserId=ADVERTISER_ID, lineItemId=f'{li}', targetingType='TARGETING_TYPE_AUDIENCE_GROUP', body=assigned_targeting_option_obj).execute() # Display the new assigned targeting option. print(f"Targeting Option {assigned_targeting_option['name']} created.") def set_default_li_targeting(lineitem_id): Sets default LineItem targeting according to standard template. # Define 'Channels' create_channel_assigned_targetingoptions = [] for targeting_id in ['1777746835', '1778039430']: create_channel_assigned_targetingoptions.append( {'channelDetails': { 'channelId': targeting_id, 'negative': False }}) # Define 'Inventory' create_inventory_assigned_targetingoptions = [] for targeting_id in ['1']: create_inventory_assigned_targetingoptions.append( {'inventorySourceDetails': {'inventorySourceId': targeting_id}} ) # Define 'Sensitive categories' create_sensitive_cat_assigned_targetingoptions = [] sensitive_category = [ '1163177997', '1163178297', '118521027123', '118521027843', '118521028083', '118521028563', '118521028803', '1596254697' ] for targeting_id in sensitive_category: create_sensitive_cat_assigned_targetingoptions.append({ 'sensitiveCategoryExclusionDetails': { 'excludedTargetingOptionId': targeting_id } }) # Define 'Digital content labels' create_digital_content_assigned_targetingoptions = [] content_rating_tier = ['19875634320', '19875634200', '19875634080'] for targeting_id in content_rating_tier: create_digital_content_assigned_targetingoptions.append({ 'digitalContentLabelExclusionDetails': { 'excludedTargetingOptionId': targeting_id } }) # Contruct request bulk_edit_line_item_request = { 'createRequests': [ { 'targetingType': 'TARGETING_TYPE_CHANNEL', 'assignedTargetingOptions': [ create_channel_assigned_targetingoptions ] }, { 'targetingType': 'TARGETING_TYPE_INVENTORY_SOURCE', 'assignedTargetingOptions': [ create_inventory_assigned_targetingoptions ] }, { 'targetingType': 'TARGETING_TYPE_SENSITIVE_CATEGORY_EXCLUSION', 'assignedTargetingOptions': [ create_sensitive_cat_assigned_targetingoptions ] }, { 'targetingType': 'TARGETING_TYPE_DIGITAL_CONTENT_LABEL_EXCLUSION', 'assignedTargetingOptions': [ create_digital_content_assigned_targetingoptions ] }, ] } # Edit the line item targeting. bulk_request = display_video_service.advertisers().lineItems( ).bulkEditLineItemAssignedTargetingOptions( advertiserId=ADVERTISER_ID, lineItemId=lineitem_id, body=bulk_edit_line_item_request ) bulk_response = bulk_request.execute() # Check if response is empty. # If not, iterate over and display new assigned targeting options. if not bulk_response: print('Bulk edit request created no new AssignedTargetingOptions') else: for assigned_targeting_option in bulk_response[ 'createdAssignedTargetingOptions']: print(f"Targeting Option {assigned_targeting_option['name']} created.") print('Lineitem targeting function created') # Return list of Lineitems with active status active_lineitems = get_active_lineitems(ADVERTISER_ID, CAMPAIGN_ID) # Update bulk targeting for li in active_lineitems: set_default_li_targeting(li) def optimise_lineitem(lineitem_id, action): Optimises lineitem according to given parameter. lineitem_object = display_video_service.advertisers().lineItems().get( advertiserId=ADVERTISER_ID, lineItemId=lineitem_id).execute() if lineitem_object['entityStatus'] == 'ENTITY_STATUS_ACTIVE': if action == 'pause': patch = { 'entityStatus': 'ENTITY_STATUS_PAUSED', } lineitem_patched = display_video_service.advertisers().lineItems().patch( advertiserId=ADVERTISER_ID, lineItemId=lineitem_id, updateMask='entityStatus', body=patch).execute() print(f"LineItemID {lineitem_patched['name']} was paused") elif action == 'optimise': patch = {'bidStrategy': {'fixedBid': {'bidAmountMicros': '500000'},}} lineitem_patched = display_video_service.advertisers().lineItems().patch( advertiserId=ADVERTISER_ID, lineItemId=lineitem_id, updateMask='bidStrategy', body=patch).execute() print(f"{lineitem_patched['name']} was optimised") else: print("Not a valid action, must be either 'pause' or 'optimise'") else: print( f"{lineitem_object['name']} already paused/archived - no action taken") print('Optimisation function created') out_of_stock_list = [] products = csv.DictReader(io.StringIO(contents)) # Iterate through each row, checking for products where availability = 0 for row in products: if row['availability'] == '0': out_of_stock_list.append(row['sku']) # This should generate a list of 9 SKUs that are no-longer in stock print( f'Found {len(out_of_stock_list)} out-of-stock products {out_of_stock_list}') # Return list of Lineitems with active status active_lineitems = get_active_lineitems(ADVERTISER_ID, CAMPAIGN_ID) # Iterate through out-of-stock list. If sku is found in lineitem's name, perform optimisation. for product in out_of_stock_list: for key, value in active_lineitems.items(): if product in key: optimise_lineitem(value, 'pause') # Define DV360 report definition (i.e. metrics and filters) report_definition = { 'params': { 'type': 'TYPE_GENERAL', 'metrics': [ 'METRIC_IMPRESSIONS', 'METRIC_CLICKS', 'METRIC_CTR', 'METRIC_REVENUE_ADVERTISER' ], 'groupBys': [ 'FILTER_ADVERTISER', 'FILTER_INSERTION_ORDER', 'FILTER_LINE_ITEM', 'FILTER_ADVERTISER_CURRENCY' ], 'filters': [{ 'type': 'FILTER_ADVERTISER', 'value': ADVERTISER_ID }], }, 'metadata': { 'title': 'DV360 Automation API-generated report', 'dataRange': 'LAST_90_DAYS', 'format': 'csv' }, 'schedule': { 'frequency': 'ONE_TIME' } } # Create new query using report definition operation = dbm_service.queries().createquery(body=report_definition).execute() pprint.pprint(operation) # Runs the given Queries.getquery request, retrying with an exponential # backoff. Returns completed operation. Will raise an exception if the # operation takes more than five hours to complete. @retry.Retry( predicate=retry.if_exception_type(Exception), initial=5, maximum=60, deadline=18000) def check_get_query_completion(getquery_request): response = getquery_request.execute() pprint.pprint(response) if response['metadata']['running']: raise Exception('The operation has not completed.') return response getquery_request = dbm_service.queries().getquery(queryId=operation['queryId']) response = check_get_query_completion(getquery_request) # Capture report URL from response report_url = response['metadata']['googleCloudStoragePathForLatestReport'] # Use skipfooter to remove report footer from data report_df = pd.read_csv(report_url, skipfooter=16, engine='python') report_df.head(10) # Define our 'KPIs' ctr_to_pause = 0.1 ctr_to_optimise = 0.3 imp_threshold = 5000 # Convert IDs to remove decimal point, then string report_df['Line Item ID'] = report_df['Line Item ID'].apply(int) lineitems_to_pause = report_df.query('Impressions > @imp_threshold and (Clicks / Impressions)*100 < @ctr_to_pause') lineitems_to_reducebid = report_df.query('Impressions > @imp_threshold and (Clicks / Impressions)*100 > @ctr_to_pause < @ctr_to_optimise') # Convert results to Python list lineitems_to_pause = list(lineitems_to_pause['Line Item ID']) lineitems_to_reducebid = list(lineitems_to_reducebid['Line Item ID']) print(f'Found {len(lineitems_to_pause)} LineItems with a CTR' f'< {ctr_to_pause}% and > {imp_threshold} impressions:' f'{lineitems_to_pause}') print(f'Found {len(lineitems_to_reducebid)} LineItems with a CTR' f' between {ctr_to_pause}%-{ctr_to_optimise}%, and > {imp_threshold}' f'\n impressions: {lineitems_to_reducebid}') %%time if lineitems_to_pause: for lineitem in lineitems_to_pause: optimise_lineitem(str(lineitem), 'pause') if lineitems_to_reducebid: for lineitem in lineitems_to_reducebid: optimise_lineitem(str(lineitem), 'optimise') print('Optimisation completed') def upload_creative_image_asset(asset_url, click_url): Creates a new DV360 creative object. # Fetch asset from cloud storage using requests library asset = requests.get(asset_url) # Create upload object from http image url fh = io.BytesIO(asset.content) media_body = http.MediaIoBaseUpload(fh, mimetype='image/png', chunksize=1024*1024, resumable=True) # Extract filename from url path filename = str(asset_url.rsplit(sep='/', maxsplit=1)[1]) # Create the request body body = {'filename': filename} # Upload the asset asset_request = display_video_service.advertisers().assets().upload( advertiserId=ADVERTISER_ID, body=body, media_body=media_body).execute() # Display the new asset media ID print(f"Asset was created with media ID {asset_request['asset']['mediaId']}") display_name = f'{filename}'.split(sep='.')[0].lower() + ' 300x250' # Create a creative object. creative_obj = { 'displayName': f'{display_name}', 'entityStatus': 'ENTITY_STATUS_ACTIVE', 'creativeType': 'CREATIVE_TYPE_STANDARD', 'hostingSource': 'HOSTING_SOURCE_HOSTED', 'dimensions': { 'widthPixels': 300, 'heightPixels': 250 }, 'assets': [{ 'asset': { 'mediaId': asset_request['asset']['mediaId'] }, 'role': 'ASSET_ROLE_MAIN' }], 'exitEvents': [{ 'type': 'EXIT_EVENT_TYPE_DEFAULT', 'url': f'{click_url}', }] } creative_request = display_video_service.advertisers().creatives().create( advertiserId=ADVERTISER_ID, body=creative_obj ).execute() # Display the new creative ID print(f"Creative was created with ID {creative_request['creativeId']}" f" and DisplayName '{creative_request['displayName']}'") pprint.pprint(creative_request) print('Creative upload function defined') image_assets = { 'https://github.com/google/dv360-automation/blob/master/docs/images/googlestore/pixelbook.png?raw=true': 'https://store.google.com/product/google_pixelbook', 'https://github.com/google/dv360-automation/blob/master/docs/images/googlestore/googlehome.png?raw=true': 'https://store.google.com/product/google_home_hub', 'https://github.com/google/dv360-automation/blob/master/docs/images/googlestore/googlehomemini.png?raw=true': 'https://store.google.com/product/google_home_mini', 'https://github.com/google/dv360-automation/blob/master/docs/images/googlestore/pixel2.png?raw=true': 'https://store.google.com/product/pixel_2', 'https://github.com/google/dv360-automation/blob/master/docs/images/googlestore/chromecastultra.png?raw=true': 'https://store.google.com/product/chromecast_ultra' } for asset, click_url in image_assets.items(): upload_creative_image_asset(asset, click_url) #TODO %%time # Load flight information from CSV file googleairways_routes = files.upload() contents = next(iter(googleairways_routes.values())).decode('utf-8') routes = list(csv.DictReader(io.StringIO(contents))) # Create a unique set (de-duped) of cities from the routes provided unique_cities = set() for row in routes: unique_cities.add(row['airport-city']) print(unique_cities) # Create Campaign and Patch() new_campaign = create_campaign('Google Airways') print(new_campaign) # Step through each city within our unique set of cities for city in unique_cities: # Create Insertion Order and Patch() io_name = f'Flights | {city}' create_io = create_insertion_order(new_campaign['campaignId'], io_name) # Step through each route(row) of the CSV upload for row in routes: if city == row['airport-city']: # Create LineItems and Patch() li_name = f"Flight {row['flightno']} | {row['depairport-city']} to {row['arrairport-city']}" create_lis = create_lineitem(create_io['insertionOrderId'], li_name) print('Process completed') # Exclude following campaigns in the reset process protected_campaigns = ['1914007','985747'] def reset_demo_account(): Reset DV360 account to earlier state. print('Resetting DV360 account...') # Reactivate Campaigns list_campaigns = display_video_service.advertisers().campaigns().list( advertiserId=ADVERTISER_ID, filter='entityStatus="ENTITY_STATUS_ACTIVE"').execute() results = list_campaigns['campaigns'] print(f'Found {len(results)} active campaigns') for index, campaign in enumerate(results, start=1): print(f'Campaign {index} of {len(results)}') pause_campaign(campaign['campaignId']) # Reactivate LineItems list_lineitems = display_video_service.advertisers().lineItems().list( advertiserId=ADVERTISER_ID, filter='entityStatus="ENTITY_STATUS_PAUSED" AND campaignId="1914007"' ).execute() if not list_lineitems: print('No paused lineitems found') else: for index, li in enumerate(list_lineitems['lineItems'], start=1): print(f"Lineitem {index} of {len(list_lineitems['lineItems'])}") lineitem_id = li['lineItemId'] activate_lineitem(lineitem_id) print('Account reset completed') def delete_campaign(campaign_id): Updates DV360 campaign object status to deleted. if campaign_id in protected_campaigns: print(f'Campaign ID {campaign_id} not deleted (protected campaign)') else: try: display_video_service.advertisers().campaigns().delete( advertiserId=ADVERTISER_ID, campaignId=campaign_id).execute() print(f'{campaign_id} successfully deleted') except Exception: print('Could not delete campaign') def archive_campaign(campaign_id): Updates DV360 campaign object status to archived. patch = {'entityStatus': 'ENTITY_STATUS_ARCHIVED'} if campaign_id in protected_campaigns: print(f'Campaign ID {campaign_id} not archived (protected campaign)') else: archive_campaign = display_video_service.advertisers().campaigns().patch( advertiserId=ADVERTISER_ID, campaignId=campaign_id, updateMask='entityStatus', body=patch).execute() print(f'Campaign ID {campaign_id} successfully archived') def pause_campaign(campaign_id): Updates DV360 campaign object status to paused. patch = {'entityStatus': 'ENTITY_STATUS_PAUSED'} if campaign_id in protected_campaigns: print(f'Campaign ID {campaign_id} not paused (protected campaign)') else: display_video_service.advertisers().campaigns().patch( advertiserId=ADVERTISER_ID, campaignId=campaign_id, updateMask='entityStatus', body=patch).execute() print(f'Campaign ID {campaign_id} successfully paused') def activate_lineitem(lineitem_id): Updates DV360 lineitem object status to active. patch = {'entityStatus': 'ENTITY_STATUS_ACTIVE'} display_video_service.advertisers().lineItems().patch( lineItemId=lineitem_id, advertiserId=ADVERTISER_ID, updateMask='entityStatus', body=patch).execute() print(f'Lineitem ID {lineitem_id} reactivated') # @title { display-mode: "form" } #@markdown Reset DV360 account # Call main function to intialise reset procedure reset_demo_account() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 0.2 Setup your GCP project Step2: 0.4 Set DV360 account settings Step4: Create a new 'sandbox' campaign to use with the rest of the exercises Step5: 1A) SDF using DBM API (sunset) Step6: Define a boilerplate targeting template that all Line Items should adhere too Step7: Modify latest SDF LineItems file and update the columns according to the targeting template Step8: Upload the output .csv file in the DV360 UI Step9: Retrieve a list of country codes / IDs from GeoLocation.json for each of our store locations Step10: Download the latest SDF LineItems (because we've made changes since our last download) Step11: Modify the contents of the latest SDF output, then save a new CSV with updated Geo Targeting IDs Step12: Upload the output .csv file in the DV360 UI Step14: Define a function to send images to the Cloud Vision API Step15: Run our images through the function, and return a lookup table Step16: Now we have our new labels from the Vision API, we need to write these into the keywords targeting field Step18: Upload the output .csv file in the DV360 UI Step19: Download an updated SDF LineItems file, and if the LineItem ID is in the poor performers list, add a Geo bid multiplier to half the bids (0.5) Step20: Note the only rows included in the output, are those that we want to modify. Step21: Solution Step23: Upload the output .csv file in the DV360 UI Step24: Define a boilerplate targeting template that all Line Items should adhere too Step25: Modify latest SDF LineItems file and update the columns according to the targeting template Step26: Upload the output .csv file in the DV360 UI Step27: Retrieve a list of country codes / IDs from GeoLocation.json for each of our store locations Step28: Download the latest SDF LineItems (because we've made changes since our last download) Step29: Modify the contents of the latest SDF output, then save a new CSV with updated Geo Targeting IDs Step30: Upload the output .csv file in the DV360 UI Step32: Define a function to send images to the Cloud Vision API Step33: Run our images through the function, and return a lookup table (reference) Step34: View the results of our Vision analysis Step35: Download the latest SDF LineItems (because we've made changes since our last download) Step36: Now we have our new labels from the Vision API, we need to write these into the keywords targeting field Step37: Upload the output .csv file in the DV360 UI Step38: Download an updated SDF LineItems file, and if the LineItem ID is in the poor performers list, add a Geo bid multiplier to half the bids (0.5) Step39: Upload the output .csv file in the DV360 UI Step40: Solution Step42: Upload the output .csv file in the DV360 UI Step43: Upload the extended feed for Google Store's new territories Step45: Create Insertion Order template Step47: Create LineItem template Step48: Build our new campaign Step49: If successful, the result should look similar to the below in DV360 Step50: Apply individual targeting criteria to single entity Step51: Applying individual targeting criteria to multiple entities Step53: 2.3 Bulk targeting Step54: Retrieve list of active LineItems, and Apply bulk targeting Step56: 2.4 Optimisation (external trigger) Step57: Creat list of out of stock products Step58: Process optimisation Step59: 2.5 Optimisation (reporting data) Step60: Load report to Pandas DataFrame Step61: Create two lists of poorly performing LineItems Step62: Process optimisation Step64: 2.6 Creative upload Step65: Upload image creatives Step66: 2.7 Challenge Step67: Solution Step73: Link to DV360 UI
11,997
<ASSISTANT_TASK:> Python Code: #This is a notebook containing the code of blogpost http://ataspinar.com/2017/05/26/classification-with-scikit-learn/ #Although I'll also give a short description in this notebook, for a full explanation you should read the blog. # Lets import some modules for basic computation import time import pandas as pd import numpy as np import pickle # Some modules for plotting and visualizing import seaborn as sns import matplotlib.pyplot as plt from IPython.display import display # And some Machine Learning modules from scikit-learn from sklearn.decomposition import PCA from sklearn.preprocessing import StandardScaler, LabelEncoder from sklearn.linear_model import LogisticRegression from sklearn.svm import SVC from sklearn.neighbors import KNeighborsClassifier from sklearn import tree from sklearn.neural_network import MLPClassifier from sklearn.neighbors import KNeighborsClassifier from sklearn.ensemble import GradientBoostingClassifier from sklearn.gaussian_process.kernels import RBF from sklearn.ensemble import RandomForestClassifier from sklearn.naive_bayes import GaussianNB #These Classifiers have been commented out because they take too long and do not give more accuracy as the other ones. #from sklearn.ensemble import AdaBoostClassifier #from sklearn.discriminant_analysis import QuadraticDiscriminantAnalysis #from sklearn.gaussian_process import GaussianProcessClassifier dict_classifiers = { "Logistic Regression": LogisticRegression(), "Nearest Neighbors": KNeighborsClassifier(), "Linear SVM": SVC(), "Gradient Boosting Classifier": GradientBoostingClassifier(n_estimators=1000), "Decision Tree": tree.DecisionTreeClassifier(), "Random Forest": RandomForestClassifier(n_estimators=1000), "Neural Net": MLPClassifier(alpha = 1), "Naive Bayes": GaussianNB(), #"AdaBoost": AdaBoostClassifier(), #"QDA": QuadraticDiscriminantAnalysis(), #"Gaussian Process": GaussianProcessClassifier() } def batch_classify(X_train, Y_train, X_test, Y_test, no_classifiers = 5, verbose = True): This method, takes as input the X, Y matrices of the Train and Test set. And fits them on all of the Classifiers specified in the dict_classifier. The trained models, and accuracies are saved in a dictionary. The reason to use a dictionary is because it is very easy to save the whole dictionary with the pickle module. Usually, the SVM, Random Forest and Gradient Boosting Classifier take quiet some time to train. So it is best to train them on a smaller dataset first and decide whether you want to comment them out or not based on the test accuracy score. dict_models = {} for classifier_name, classifier in list(dict_classifiers.items())[:no_classifiers]: t_start = time.clock() classifier.fit(X_train, Y_train) t_end = time.clock() t_diff = t_end - t_start train_score = classifier.score(X_train, Y_train) test_score = classifier.score(X_test, Y_test) dict_models[classifier_name] = {'model': classifier, 'train_score': train_score, 'test_score': test_score, 'train_time': t_diff} if verbose: print("trained {c} in {f:.2f} s".format(c=classifier_name, f=t_diff)) return dict_models def label_encode(df, list_columns): This method one-hot encodes all column, specified in list_columns for col in list_columns: le = LabelEncoder() col_values_unique = list(df[col].unique()) le_fitted = le.fit(col_values_unique) col_values = list(df[col].values) le.classes_ col_values_transformed = le.transform(col_values) df[col] = col_values_transformed def expand_columns(df, list_columns): for col in list_columns: colvalues = df[col].unique() for colvalue in colvalues: newcol_name = "{}_is_{}".format(col, colvalue) df.loc[df[col] == colvalue, newcol_name] = 1 df.loc[df[col] != colvalue, newcol_name] = 0 df.drop(list_columns, inplace=True, axis=1) def get_train_test(df, y_col, x_cols, ratio): This method transforms a dataframe into a train and test set, for this you need to specify: 1. the ratio train : test (usually 0.7) 2. the column with the Y_values mask = np.random.rand(len(df)) < ratio df_train = df[mask] df_test = df[~mask] Y_train = df_train[y_col].values Y_test = df_test[y_col].values X_train = df_train[x_cols].values X_test = df_test[x_cols].values return df_train, df_test, X_train, Y_train, X_test, Y_test def display_dict_models(dict_models, sort_by='test_score'): cls = [key for key in dict_models.keys()] test_s = [dict_models[key]['test_score'] for key in cls] training_s = [dict_models[key]['train_score'] for key in cls] training_t = [dict_models[key]['train_time'] for key in cls] df_ = pd.DataFrame(data=np.zeros(shape=(len(cls),4)), columns = ['classifier', 'train_score', 'test_score', 'train_time']) for ii in range(0,len(cls)): df_.loc[ii, 'classifier'] = cls[ii] df_.loc[ii, 'train_score'] = training_s[ii] df_.loc[ii, 'test_score'] = test_s[ii] df_.loc[ii, 'train_time'] = training_t[ii] display(df_.sort_values(by=sort_by, ascending=False)) def display_corr_with_col(df, col): correlation_matrix = df.corr() correlation_type = correlation_matrix[col].copy() abs_correlation_type = correlation_type.apply(lambda x: abs(x)) desc_corr_values = abs_correlation_type.sort_values(ascending=False) y_values = list(desc_corr_values.values)[1:] x_values = range(0,len(y_values)) xlabels = list(desc_corr_values.keys())[1:] fig, ax = plt.subplots(figsize=(8,8)) ax.bar(x_values, y_values) ax.set_title('The correlation of all features with {}'.format(col), fontsize=20) ax.set_ylabel('Pearson correlatie coefficient [abs waarde]', fontsize=16) plt.xticks(x_values, xlabels, rotation='vertical') plt.show() filename_glass = '../datasets/glass.csv' df_glass = pd.read_csv(filename_glass) print("This dataset has nrows, ncols: {}".format(df_glass.shape)) display(df_glass.head()) display(df_glass.describe()) y_col_glass = 'Type' x_cols_glass = list(df_glass.columns.values) x_cols_glass.remove(y_col_glass) train_test_ratio = 0.7 df_train, df_test, X_train, Y_train, X_test, Y_test = get_train_test(df_glass, y_col_glass, x_cols_glass, train_test_ratio) dict_models = batch_classify(X_train, Y_train, X_test, Y_test, no_classifiers = 8) display_dict_models(dict_models) filename_mushrooms = '../datasets/mushrooms.csv' df_mushrooms = pd.read_csv(filename_mushrooms) display(df_mushrooms.head()) for col in df_mushrooms.columns.values: print(col, df_mushrooms[col].unique()) for col in df_mushrooms.columns.values: if len(df_mushrooms[col].unique()) <= 1: print("Removing column {}, which only contains the value: {}".format(col, df_mushrooms[col].unique()[0])) print("Number of rows in total: {}".format(df_mushrooms.shape[0])) print("Number of rows with missing values in column 'stalk-root': {}".format(df_mushrooms[df_mushrooms['stalk-root'] == '?'].shape[0])) df_mushrooms_dropped_rows = df_mushrooms[df_mushrooms['stalk-root'] != '?'] drop_percentage = 0.8 df_mushrooms_dropped_cols = df_mushrooms.copy(deep=True) df_mushrooms_dropped_cols.loc[df_mushrooms_dropped_cols['stalk-root'] == '?', 'stalk-root'] = np.nan for col in df_mushrooms_dropped_cols.columns.values: no_rows = df_mushrooms_dropped_cols[col].isnull().sum() percentage = no_rows / df_mushrooms_dropped_cols.shape[0] if percentage > drop_percentage: del df_mushrooms_dropped_cols[col] print("Column {} contains {} missing values. This is {} percent. Dropping this column.".format(col, no_rows, percentage)) df_mushrooms_zerofill = df_mushrooms.copy(deep = True) df_mushrooms_zerofill.loc[df_mushrooms_zerofill['stalk-root'] == '?', 'stalk-root'] = np.nan df_mushrooms_zerofill.fillna(0, inplace=True) df_mushrooms_bfill = df_mushrooms.copy(deep = True) df_mushrooms_bfill.loc[df_mushrooms_bfill['stalk-root'] == '?', 'stalk-root'] = np.nan df_mushrooms_bfill.fillna(method='bfill', inplace=True) df_mushrooms_ffill = df_mushrooms.copy(deep = True) df_mushrooms_ffill.loc[df_mushrooms_ffill['stalk-root'] == '?', 'stalk-root'] = np.nan df_mushrooms_ffill.fillna(method='ffill', inplace=True) df_mushrooms_ohe = df_mushrooms.copy(deep=True) to_be_encoded_cols = df_mushrooms_ohe.columns.values label_encode(df_mushrooms_ohe, to_be_encoded_cols) display(df_mushrooms_ohe.head()) ## Now lets do the same thing for the other dataframes df_mushrooms_dropped_rows_ohe = df_mushrooms_dropped_rows.copy(deep = True) df_mushrooms_zerofill_ohe = df_mushrooms_zerofill.copy(deep = True) df_mushrooms_bfill_ohe = df_mushrooms_bfill.copy(deep = True) df_mushrooms_ffill_ohe = df_mushrooms_ffill.copy(deep = True) label_encode(df_mushrooms_dropped_rows_ohe, to_be_encoded_cols) label_encode(df_mushrooms_zerofill_ohe, to_be_encoded_cols) label_encode(df_mushrooms_bfill_ohe, to_be_encoded_cols) label_encode(df_mushrooms_ffill_ohe, to_be_encoded_cols) y_col = 'class' to_be_expanded_cols = list(df_mushrooms.columns.values) to_be_expanded_cols.remove(y_col) df_mushrooms_expanded = df_mushrooms.copy(deep=True) label_encode(df_mushrooms_expanded, [y_col]) expand_columns(df_mushrooms_expanded, to_be_expanded_cols) display(df_mushrooms_expanded.head()) ## Now lets do the same thing for all other dataframes df_mushrooms_dropped_rows_expanded = df_mushrooms_dropped_rows.copy(deep = True) df_mushrooms_zerofill_expanded = df_mushrooms_zerofill.copy(deep = True) df_mushrooms_bfill_expanded = df_mushrooms_bfill.copy(deep = True) df_mushrooms_ffill_expanded = df_mushrooms_ffill.copy(deep = True) label_encode(df_mushrooms_dropped_rows_expanded, [y_col]) label_encode(df_mushrooms_zerofill_expanded, [y_col]) label_encode(df_mushrooms_bfill_expanded, [y_col]) label_encode(df_mushrooms_ffill_expanded, [y_col]) expand_columns(df_mushrooms_dropped_rows_expanded, to_be_expanded_cols) expand_columns(df_mushrooms_zerofill_expanded, to_be_expanded_cols) expand_columns(df_mushrooms_bfill_expanded, to_be_expanded_cols) expand_columns(df_mushrooms_ffill_expanded, to_be_expanded_cols) dict_dataframes = { "df_mushrooms_ohe": df_mushrooms_ohe, "df_mushrooms_dropped_rows_ohe": df_mushrooms_dropped_rows_ohe, "df_mushrooms_zerofill_ohe": df_mushrooms_zerofill_ohe, "df_mushrooms_bfill_ohe": df_mushrooms_bfill_ohe, "df_mushrooms_ffill_ohe": df_mushrooms_ffill_ohe, "df_mushrooms_expanded": df_mushrooms_expanded, "df_mushrooms_dropped_rows_expanded": df_mushrooms_dropped_rows_expanded, "df_mushrooms_zerofill_expanded": df_mushrooms_zerofill_expanded, "df_mushrooms_bfill_expanded": df_mushrooms_bfill_expanded, "df_mushrooms_ffill_expanded": df_mushrooms_ffill_expanded } y_col = 'class' train_test_ratio = 0.7 for df_key, df in dict_dataframes.items(): x_cols = list(df.columns.values) x_cols.remove(y_col) df_train, df_test, X_train, Y_train, X_test, Y_test = get_train_test(df, y_col, x_cols, train_test_ratio) dict_models = batch_classify(X_train, Y_train, X_test, Y_test, no_classifiers = 8, verbose=False) print() print(df_key) display_dict_models(dict_models) print("-------------------------------------------------------") GDB_params = { 'n_estimators': [100, 500, 1000], 'learning_rate': [0.5, 0.1, 0.01, 0.001], 'criterion': ['friedman_mse', 'mse', 'mae'] } df_train, df_test, X_train, Y_train, X_test, Y_test = get_train_test(df_glass, y_col_glass, x_cols_glass, 0.6) for n_est in GDB_params['n_estimators']: for lr in GDB_params['learning_rate']: for crit in GDB_params['criterion']: clf = GradientBoostingClassifier(n_estimators=n_est, learning_rate = lr, criterion = crit) clf.fit(X_train, Y_train) train_score = clf.score(X_train, Y_train) test_score = clf.score(X_test, Y_test) print("For ({}, {}, {}) - train, test score: \t {:.5f} \t-\t {:.5f}".format(n_est, lr, crit[:4], train_score, test_score)) correlation_matrix = df_glass.corr() plt.figure(figsize=(10,8)) ax = sns.heatmap(correlation_matrix, vmax=1, square=True, annot=True,fmt='.2f', cmap ='GnBu', cbar_kws={"shrink": .5}, robust=True) plt.title('Correlation matrix between the features', fontsize=20) plt.show() display_corr_with_col(df_glass, 'Type') X = df_glass[x_cols_glass].values X_std = StandardScaler().fit_transform(X) pca = PCA().fit(X_std) var_ratio = pca.explained_variance_ratio_ components = pca.components_ #print(pca.explained_variance_) plt.plot(np.cumsum(var_ratio)) plt.xlim(0,9,1) plt.xlabel('Number of Features', fontsize=16) plt.ylabel('Cumulative explained variance', fontsize=16) plt.show() ax = sns.pairplot(df_glass, hue='Type') plt.title('Pairwise relationships between the features') plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step3: http Step4: 1. The glass - dataset Step5: 1.3 Classification Step6: 2. Mushroom dataset (containing categorical data) Step7: 2.1 Preprocessing the Dataset Step8: 2.1.1 Remove columns with only 1 value Step9: 2.1.2 Handling columns with missing or incorrect values Step10: 2.1.2.2 Drop column with more than X percent missing values Step11: 2.1.2.3 Fill missing values with zero / -1 Step12: 2.1.2.4 Fill missing values with backward fill Step13: 2.1.2.5 Fill missing values with forward fill Step14: 2.2 Handling columns with categorical data Step15: 2.2.2 Expanding the columns with categorical data Step16: 2.4 Classifying the dataset Step17: 2.5 Improving upon the Classifier Step18: 3. Understanding complex datasets Step19: 3.2 Cumulative Explained Variance Step20: 3.3 Pairwise relationships between the features
11,998
<ASSISTANT_TASK:> Python Code: from sklearn.decomposition import PCA import numpy as np from matplotlib import pyplot as plt from mpl_toolkits.mplot3d import Axes3D # 3D Plotting from scipy import stats import ipywidgets # interactions %matplotlib inline np.random.seed(4) # Reproducible results mean = np.zeros(2) cov = [[1, 0.9], [0.9, 1]] data = np.random.multivariate_normal(mean, cov, size=500) xs = data[:, 0] ys = data[:, 1] plt.scatter(xs, ys, marker=".", color="blue") pca = PCA(n_components=2) pca.fit(data) axis1 = pca.components_[0] # axis of most variation axis2 = pca.components_[1] # axis of second-most variation plt.scatter(xs, ys, marker='.', color="blue") plt.plot(axis1[0] * np.arange(-4, 5), axis1[1] * np.arange(-4, 5), linewidth=4, color="red") plt.plot(axis2[0] * np.arange(-1, 2), axis2[1] * np.arange(-1, 2), linewidth=2, color="red") from ipywidgets import interact mean = np.zeros(3) cov = [[1, 0, 0], [0, 1, 0.9], [0, 0.9, 1]] # here dimension 1 is independent but dimensions 2 and 3 covary data = np.random.multivariate_normal(mean, cov, 1000) xs = data[:, 0] ys = data[:, 1] zs = data[:, 2] figure1 = plt.figure() ax1 = Axes3D(figure1) ax1.scatter(xs, ys, zs, marker='.') plt.close(figure1) # prevent double-display with interact # You must be running the Jupyter notebook for interactions to work. # It will just be a static image when viewed on GitHub or Nbviewer @interact(elev=(0, 180), azim=(0, 180)) def plot_point_cloud(elev, azim): ax1.view_init(elev=elev, azim=azim) return figure1 # Apply PCA, pick 2 highest principal components and fit data to them pca = PCA(n_components=2) pca.fit(data) axis1 = pca.components_[0] axis2 = pca.components_[1] a, b, c = np.cross(axis1, axis2) # By definition of cross product, <a, b, c> is orthogonal to the plane # spanned by axis1 and axis2 through (0, 0, 0). The plane's equation is thus: # ax + by + cz = 0 # or z = -(ax + by) / c xx, yy = np.meshgrid(np.arange(-4, 4), np.arange(-4, 4)) zz = -(a * xx + b * yy) / c figure2 = plt.figure() ax2 = Axes3D(figure2) ax2.plot_surface(xx, yy, zz, color="red", alpha=0.5) ax2.scatter(xs, ys, zs, marker='.') plt.close(figure2) @interact(elev=(0, 180), azim=(0, 180)) def plot_point_cloud(elev, azim): ax2.view_init(elev=elev, azim=azim) return figure2 from numpy.random import RandomState import matplotlib.pyplot as plt from sklearn.datasets import fetch_olivetti_faces from sklearn import decomposition # Load faces data faces = fetch_olivetti_faces(shuffle=True, random_state=RandomState(1)).data n_samples, n_features = faces.shape # Center the faces faces_centered = faces - faces.mean(axis=0) faces_centered -= faces_centered.mean(axis=1) \ .reshape(n_samples, -1) print("Dataset consists of %d faces" % n_samples) def plot_gallery(title, images, n_col=3, n_row=2): Helper function to plot images. image_shape = (64, 64) plt.figure(figsize=(2. * n_col, 2.26 * n_row)) plt.suptitle(title, size=16) for i, comp in enumerate(images): plt.subplot(n_row, n_col, i + 1) vmax = max(comp.max(), -comp.min()) plt.imshow(comp.reshape(image_shape), cmap=plt.cm.gray, interpolation='nearest', vmin=-vmax, vmax=vmax) plt.xticks([]) plt.yticks([]) plt.subplots_adjust(0.01, 0.05, 0.99, 0.93, 0.04, 0.) n_components = 6 # Plot a sample of the input data plot_gallery("Input", faces_centered[:n_components]) # Apply PCA and plot results print("Extracting the top %d components" % (n_components)) data = faces_centered # We use a variant of PCA called Randomized PCA for efficiency. It uses stochastic SVD. estimator = decomposition.RandomizedPCA(n_components=n_components, whiten=True) estimator.fit(data) plot_gallery('PCA', estimator.components_[:n_components]) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create data Step2: As you can see, most of the variation is in just one direction. We can formalize this intuition by using PCA to draw out the appropriate axes Step3: The two red lines define our new informative axis. As you can see, most of the information is stored in how far along the thicker red line the points are. Step5: Example 2
11,999
<ASSISTANT_TASK:> Python Code: running_id = 0 output = [[0]] with open("E:/output.txt") as file_open: for row in file_open.read().split("\n"): cols = row.split(",") if cols[0] == output[-1][0]: output[-1].append(cols[1]) output[-1].append(True) else: output.append(cols) output = output[1:] for row in output: if len(row) == 6: row += [datetime(2016, 5, 3, 20, 36, 8, 92165), False] output = output[1:-1] def convert_to_days(dt): day_diff = dt / np.timedelta64(1, 'D') if day_diff == 0: return 23.0 else: return day_diff df = pd.DataFrame(output, columns=["id", "advert_time", "male","age","search","brand","conversion_time","event"]) df["lifetime"] = pd.to_datetime(df["conversion_time"]) - pd.to_datetime(df["advert_time"]) df["lifetime"] = df["lifetime"].apply(convert_to_days) df["male"] = df["male"].astype(int) df["search"] = df["search"].astype(int) df["brand"] = df["brand"].astype(int) df["age"] = df["age"].astype(int) df["event"] = df["event"].astype(int) df = df.drop('advert_time', 1) df = df.drop('conversion_time', 1) df = df.set_index("id") df = df.dropna(thresh=2) df.median() ###Parametric Bayes #Shout out to Cam Davidson-Pilon ## Example fully worked model using toy data ## Adapted from http://blog.yhat.com/posts/estimating-user-lifetimes-with-pymc.html ## Note that we've made some corrections N = 2500 ##Generate some random data lifetime = pm.rweibull( 2, 5, size = N ) birth = pm.runiform(0, 10, N) censor = ((birth + lifetime) >= 10) lifetime_ = lifetime.copy() lifetime_[censor] = 10 - birth[censor] alpha = pm.Uniform('alpha', 0, 20) beta = pm.Uniform('beta', 0, 20) @pm.observed def survival(value=lifetime_, alpha = alpha, beta = beta ): return sum( (1-censor)*(log( alpha/beta) + (alpha-1)*log(value/beta)) - (value/beta)**(alpha)) mcmc = pm.MCMC([alpha, beta, survival ] ) mcmc.sample(50000, 30000) pm.Matplot.plot(mcmc) mcmc.trace("alpha")[:] censor = np.array(df["event"].apply(lambda x: 0 if x else 1).tolist()) alpha = pm.Uniform("alpha", 0,50) beta = pm.Uniform("beta", 0,50) @pm.observed def survival(value=df["lifetime"], alpha = alpha, beta = beta ): return sum( (1-censor)*(np.log( alpha/beta) + (alpha-1)*np.log(value/beta)) - (value/beta)**(alpha)) mcmc = pm.MCMC([alpha, beta, survival ] ) mcmc.sample(10000) def weibull_median(alpha, beta): return beta * ((log(2)) ** ( 1 / alpha)) plt.hist([weibull_median(x[0], x[1]) for x in zip(mcmc.trace("alpha"), mcmc.trace("beta"))]) censor = np.array(df["event"].apply(lambda x: 0 if x else 1).tolist()) alpha = pm.Uniform("alpha", 0,50) beta = pm.Uniform("beta", 0,50) @pm.observed def survival(value=df["lifetime"], alpha = alpha, beta = beta ): return sum( (1-censor)*(np.log( alpha/beta) + (alpha-1)*np.log(value/beta)) - (value/beta)**(alpha)) mcmc = pm.MCMC([alpha, beta, survival ] ) mcmc.sample(10000, burn = 3000, thin = 20) pm.Matplot.plot(mcmc) #Solution to Q5 ## Adjusting the priors impacts the overall result ## If we give a looser, less informative prior then we end up with a broader, shorter distribution ## If we give much more informative priors, then we get a tighter, taller distribution censor = np.array(df["event"].apply(lambda x: 0 if x else 1).tolist()) ## Note the narrowing of the prior alpha = pm.Normal("alpha", 1.7, 10000) beta = pm.Normal("beta", 18.5, 10000) ####Uncomment this to see the result of looser priors ## Note this ends up pretty much the same as we're already very loose #alpha = pm.Uniform("alpha", 0, 30) #beta = pm.Uniform("beta", 0, 30) @pm.observed def survival(value=df["lifetime"], alpha = alpha, beta = beta ): return sum( (1-censor)*(np.log( alpha/beta) + (alpha-1)*np.log(value/beta)) - (value/beta)**(alpha)) mcmc = pm.MCMC([alpha, beta, survival ] ) mcmc.sample(10000, burn = 5000, thin = 20) pm.Matplot.plot(mcmc) #plt.hist([weibull_median(x[0], x[1]) for x in zip(mcmc.trace("alpha"), mcmc.trace("beta"))]) medians = [weibull_median(x[0], x[1]) for x in zip(mcmc.trace("alpha"), mcmc.trace("beta"))] testing_value = 14.9 number_of_greater_samples = sum([x >= testing_value for x in medians]) 100 * (number_of_greater_samples / len(medians)) #Fitting solution cf = lifelines.CoxPHFitter() cf.fit(df, 'lifetime', event_col = 'event') cf.summary #Solution to 1 fig, axis = plt.subplots(nrows=1, ncols=1) cf.baseline_survival_.plot(ax = axis, title = "Baseline Survival") regressors = np.array([[1,45,0,0]]) survival = cf.predict_survival_function(regressors) survival.head() #Solution to plotting multiple regressors fig, axis = plt.subplots(nrows=1, ncols=1, sharex=True) regressor1 = np.array([[1,45,0,1]]) regressor2 = np.array([[1,23,1,1]]) survival_1 = cf.predict_survival_function(regressor1) survival_2 = cf.predict_survival_function(regressor2) plt.plot(survival_1,label = "45 year old male - search") plt.plot(survival_2,label = "45 year old male - display") plt.legend(loc = "upper") odds = survival_1 / survival_2 plt.plot(odds, c = "red") from pyBMA import CoxPHFitter bmaCox = CoxPHFitter.CoxPHFitter() bmaCox.fit(df, "lifetime", event_col= "event", priors= [0.5]*4) bmaCox.summary #Low probability for everything favours parsimonious models bmaCox = CoxPHFitter.CoxPHFitter() bmaCox.fit(df, "lifetime", event_col= "event", priors= [0.1]*4) bmaCox.summary #Boost probability of brand bmaCox = CoxPHFitter.CoxPHFitter() bmaCox.fit(df, "lifetime", event_col= "event", priors= [0.3, 0.9, 0.001, 0.3]) print(bmaCox.summary) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Problems Step2: Problems Step3: Problems Step4: If we want to look at covariates, we need a new approach. Step5: Once we've fit the data, we need to do something useful with it. Try to do the following things Step6: Model selection