Unnamed: 0
int64
0
15.9k
cleaned_code
stringlengths
67
124k
cleaned_prompt
stringlengths
168
30.3k
5,800
<ASSISTANT_TASK:> Python Code: import numpy as np A = np.array([[56.0, 0.0, 4.4, 68.0], [1.2,104.0,52.0,8.0], [1.8,135.0,99.0,0.9]]) print(A) cal = A.sum(axis=0) print(cal) percentage = 100*A/cal.reshape(1,4) print(percentage) import numpy as np a = np.random.randn(5) print(a) print(a.shape) print(a.T) print(np.dot(a,a.T)) a = np.random.randn(5,1) print(a) print(a.T) print(np.dot(a,a.T)) A = np.random.randn(4,3) B = np.sum(A, axis = 1, keepdims = True) print(B.shape) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 15 Note on numpy
5,801
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'snu', 'sandbox-3', 'atmoschem') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.chemistry_scheme_scope') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "troposhere" # "stratosphere" # "mesosphere" # "mesosphere" # "whole atmosphere" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.basic_approximations') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.prognostic_variables_form') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "3D mass/mixing ratio for gas" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.number_of_tracers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.family_approach') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.coupling_with_chemical_reactivity') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Operator splitting" # "Integrated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_advection_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_physical_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_chemistry_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_alternate_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.integrated_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.integrated_scheme_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Implicit" # "Semi-implicit" # "Semi-analytic" # "Impact solver" # "Back Euler" # "Newton Raphson" # "Rosenbrock" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.turbulence') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.convection') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.precipitation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.emissions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.gas_phase_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.tropospheric_heterogeneous_phase_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.stratospheric_heterogeneous_phase_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.photo_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.aerosols') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.global_mean_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.regional_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.trend_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.matches_atmosphere_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.is_adaptive_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.transport.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.transport.use_atmospheric_transport') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.transport.transport_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.sources') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Vegetation" # "Soil" # "Sea surface" # "Anthropogenic" # "Biomass burning" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Climatology" # "Spatially uniform mixing ratio" # "Spatially uniform concentration" # "Interactive" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.prescribed_climatology_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.prescribed_spatially_uniform_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.interactive_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.other_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.sources') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Aircraft" # "Biomass burning" # "Lightning" # "Volcanos" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Climatology" # "Spatially uniform mixing ratio" # "Spatially uniform concentration" # "Interactive" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.prescribed_climatology_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.prescribed_spatially_uniform_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.interactive_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.other_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.concentrations.prescribed_lower_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.concentrations.prescribed_upper_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "HOx" # "NOy" # "Ox" # "Cly" # "HSOx" # "Bry" # "VOCs" # "isoprene" # "H2O" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_bimolecular_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_termolecular_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_tropospheric_heterogenous_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_stratospheric_heterogenous_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_advected_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_steady_state_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.interactive_dry_deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.wet_deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.wet_oxidation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.gas_phase_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Cly" # "Bry" # "NOy" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.aerosol_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sulphate" # "Polar stratospheric ice" # "NAT (Nitric acid trihydrate)" # "NAD (Nitric acid dihydrate)" # "STS (supercooled ternary solution aerosol particule))" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.number_of_steady_state_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.sedimentation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.coagulation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.gas_phase_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.aerosol_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sulphate" # "Nitrate" # "Sea salt" # "Dust" # "Ice" # "Organic" # "Black carbon/soot" # "Polar stratospheric ice" # "Secondary organic aerosols" # "Particulate organic matter" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.number_of_steady_state_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.interactive_dry_deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.coagulation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.number_of_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.photolysis.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Offline (clear sky)" # "Offline (with clouds)" # "Online" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.photolysis.environmental_conditions') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Chemistry Scheme Scope Step7: 1.4. Basic Approximations Step8: 1.5. Prognostic Variables Form Step9: 1.6. Number Of Tracers Step10: 1.7. Family Approach Step11: 1.8. Coupling With Chemical Reactivity Step12: 2. Key Properties --&gt; Software Properties Step13: 2.2. Code Version Step14: 2.3. Code Languages Step15: 3. Key Properties --&gt; Timestep Framework Step16: 3.2. Split Operator Advection Timestep Step17: 3.3. Split Operator Physical Timestep Step18: 3.4. Split Operator Chemistry Timestep Step19: 3.5. Split Operator Alternate Order Step20: 3.6. Integrated Timestep Step21: 3.7. Integrated Scheme Type Step22: 4. Key Properties --&gt; Timestep Framework --&gt; Split Operator Order Step23: 4.2. Convection Step24: 4.3. Precipitation Step25: 4.4. Emissions Step26: 4.5. Deposition Step27: 4.6. Gas Phase Chemistry Step28: 4.7. Tropospheric Heterogeneous Phase Chemistry Step29: 4.8. Stratospheric Heterogeneous Phase Chemistry Step30: 4.9. Photo Chemistry Step31: 4.10. Aerosols Step32: 5. Key Properties --&gt; Tuning Applied Step33: 5.2. Global Mean Metrics Used Step34: 5.3. Regional Metrics Used Step35: 5.4. Trend Metrics Used Step36: 6. Grid Step37: 6.2. Matches Atmosphere Grid Step38: 7. Grid --&gt; Resolution Step39: 7.2. Canonical Horizontal Resolution Step40: 7.3. Number Of Horizontal Gridpoints Step41: 7.4. Number Of Vertical Levels Step42: 7.5. Is Adaptive Grid Step43: 8. Transport Step44: 8.2. Use Atmospheric Transport Step45: 8.3. Transport Details Step46: 9. Emissions Concentrations Step47: 10. Emissions Concentrations --&gt; Surface Emissions Step48: 10.2. Method Step49: 10.3. Prescribed Climatology Emitted Species Step50: 10.4. Prescribed Spatially Uniform Emitted Species Step51: 10.5. Interactive Emitted Species Step52: 10.6. Other Emitted Species Step53: 11. Emissions Concentrations --&gt; Atmospheric Emissions Step54: 11.2. Method Step55: 11.3. Prescribed Climatology Emitted Species Step56: 11.4. Prescribed Spatially Uniform Emitted Species Step57: 11.5. Interactive Emitted Species Step58: 11.6. Other Emitted Species Step59: 12. Emissions Concentrations --&gt; Concentrations Step60: 12.2. Prescribed Upper Boundary Step61: 13. Gas Phase Chemistry Step62: 13.2. Species Step63: 13.3. Number Of Bimolecular Reactions Step64: 13.4. Number Of Termolecular Reactions Step65: 13.5. Number Of Tropospheric Heterogenous Reactions Step66: 13.6. Number Of Stratospheric Heterogenous Reactions Step67: 13.7. Number Of Advected Species Step68: 13.8. Number Of Steady State Species Step69: 13.9. Interactive Dry Deposition Step70: 13.10. Wet Deposition Step71: 13.11. Wet Oxidation Step72: 14. Stratospheric Heterogeneous Chemistry Step73: 14.2. Gas Phase Species Step74: 14.3. Aerosol Species Step75: 14.4. Number Of Steady State Species Step76: 14.5. Sedimentation Step77: 14.6. Coagulation Step78: 15. Tropospheric Heterogeneous Chemistry Step79: 15.2. Gas Phase Species Step80: 15.3. Aerosol Species Step81: 15.4. Number Of Steady State Species Step82: 15.5. Interactive Dry Deposition Step83: 15.6. Coagulation Step84: 16. Photo Chemistry Step85: 16.2. Number Of Reactions Step86: 17. Photo Chemistry --&gt; Photolysis Step87: 17.2. Environmental Conditions
5,802
<ASSISTANT_TASK:> Python Code: matplotlib inline import pandas as pd import numpy as np from numpy import log import statsmodels.formula.api as smf data = pd.read_csv("trade_data.csv") data.head() data.columns formula = "log(value) ~ log(egdp) + log(igdp) + log(dist)" model = smf.ols(formula, data) result = model.fit(cov_type='HC1') print(result.summary()) data2 = data[['value', 'egdp', 'igdp', 'dist']] data2 = data2.dropna() y = np.asarray(np.log(data2.value)) X = np.ones((len(y), 4)) X[:, 1] = log(data2.egdp) X[:, 2] = log(data2.igdp) X[:, 3] = log(data2.dist) # Derive betahat using the expression from the lectures print(betahat) # Derive R^2 using y, Py, etc. as defined in the lecture print(Rsq) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: First we read in the data. Step2: Let's see what it looks like. Step3: Let's get a full list of columns. Step4: Let's regress 'value' on 'egdp', 'igdp' and 'dist', all in logs. To do this we make a formula object. Step5: Replication using Projection Step6: Now reproduce the coefficients by computing $\hat \beta$, using the matrix expression given in the lectures. Step7: Next replicate the value for $R^2$ produced in the table above using the formula given in the lecture slides.
5,803
<ASSISTANT_TASK:> Python Code: import nengo import numpy as np import cPickle from nengo_extras.data import load_mnist from nengo_extras.vision import Gabor, Mask from matplotlib import pylab import matplotlib.pyplot as plt import matplotlib.animation as animation import random import scipy.ndimage # --- load the data img_rows, img_cols = 28, 28 (X_train, y_train), (X_test, y_test) = load_mnist() X_train = 2 * X_train - 1 # normalize to -1 to 1 X_test = 2 * X_test - 1 # normalize to -1 to 1 temp = np.diag([1]*10) ZERO = temp[0] ONE = temp[1] TWO = temp[2] THREE= temp[3] FOUR = temp[4] FIVE = temp[5] SIX = temp[6] SEVEN =temp[7] EIGHT= temp[8] NINE = temp[9] labels =[ZERO,ONE,TWO,THREE,FOUR,FIVE,SIX,SEVEN,EIGHT,NINE] dim =28 label_weights = cPickle.load(open("label_weights1000.p", "rb")) activity_to_img_weights = cPickle.load(open("activity_to_img_weights1000.p", "rb")) identity_after_encoder_weights = cPickle.load(open("identity_after_encoder_weights1000.p", "r")) #rotated_after_encoder_weights_5000 = cPickle.load(open("rotated_after_encoder_weights_5000.p", "r")) #rotation_weights = cPickle.load(open("rotation_weights_clockwise5000.p","rb")) #label_weights = cPickle.load(open("label_weights_rot_enc5000.p", "rb")) #activity_to_img_weights = cPickle.load(open("activity_to_img_weights_rot_enc5000.p", "r")) #rotated_after_encoder_weights = cPickle.load(open("rotated_counter_after_encoder_weights_rot_enc5000.p", "r")) rng = np.random.RandomState(9) n_hid = 1000 model = nengo.Network(seed=3) with model: #Stimulus only shows for brief period of time stim = nengo.Node(lambda t: THREE if t < 0.1 else 0) #nengo.processes.PresentInput(labels,1))# ens_params = dict( eval_points=X_train, neuron_type=nengo.LIF(), intercepts=nengo.dists.Choice([-0.5]), max_rates=nengo.dists.Choice([100]), ) # linear filter used for edge detection as encoders, more plausible for human visual system encoders = Gabor().generate(n_hid, (11, 11), rng=rng) encoders = Mask((28, 28)).populate(encoders, rng=rng, flatten=True) ens = nengo.Ensemble(n_hid, dim**2, seed=3, encoders=encoders, **ens_params) #Recurrent connection on the neurons of the ensemble to maintain the image nengo.Connection(ens.neurons, ens.neurons, transform = identity_after_encoder_weights.T, synapse=0.2) #Can't just connect neurons to neurons #nengo.Connection(ens.neurons, ens.neurons, synapse=0.2) #Connect stimulus to ensemble, transform using learned weight matrices nengo.Connection(stim, ens, transform = np.dot(label_weights,activity_to_img_weights).T, synapse=0.1) #Collect output, use synapse for smoothing probe = nengo.Probe(ens.neurons,synapse=0.1) sim = nengo.Simulator(model) sim.run(5) '''Animation for Probe output''' fig = plt.figure() output_acts = [] for act in sim.data[probe]: output_acts.append(np.dot(act,activity_to_img_weights)) def updatefig(i): im = pylab.imshow(np.reshape(output_acts[i],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r'),animated=True) return im, ani = animation.FuncAnimation(fig, updatefig, interval=0.1, blit=True) plt.show() print(len(sim.data[probe])) plt.subplot(161) plt.title("100") pylab.imshow(np.reshape(output_acts[100],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.subplot(162) plt.title("500") pylab.imshow(np.reshape(output_acts[500],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.subplot(163) plt.title("1000") pylab.imshow(np.reshape(output_acts[1000],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.subplot(164) plt.title("1500") pylab.imshow(np.reshape(output_acts[1500],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.subplot(165) plt.title("2000") pylab.imshow(np.reshape(output_acts[2000],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.subplot(166) plt.title("2500") pylab.imshow(np.reshape(output_acts[2500],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.show() #The filename includes the number of neurons and which digit is being rotated filename = "mental_rotation_output_ONE_" + str(n_hid) + ".p" cPickle.dump(sim.data[probe], open( filename , "wb" ) ) testing = np.dot(ONE,np.dot(label_weights,activity_to_img_weights)) plt.subplot(121) pylab.imshow(np.reshape(testing,(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) #Get image testing = np.dot(ONE,np.dot(label_weights,activity_to_img_weights)) #Get activity of image _, testing_act = nengo.utils.ensemble.tuning_curves(ens, sim, inputs=testing) #Get rotated encoder outputs testing_rotate = np.dot(testing_act,rotated_after_encoder_weights) #Get activities testing_rotate = ens.neuron_type.rates(testing_rotate, sim.data[ens].gain, sim.data[ens].bias) for i in range(5): testing_rotate = np.dot(testing_rotate,rotated_after_encoder_weights) testing_rotate = ens.neuron_type.rates(testing_rotate, sim.data[ens].gain, sim.data[ens].bias) #testing_rotate = np.dot(testing_rotate,rotation_weights) testing_rotate = np.dot(testing_rotate,activity_to_img_weights) plt.subplot(122) pylab.imshow(np.reshape(testing_rotate,(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.show() plt.subplot(121) pylab.imshow(np.reshape(X_train[0],(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) #Get activity of image _, testing_act = nengo.utils.ensemble.tuning_curves(ens, sim, inputs=X_train[0]) testing_rotate = np.dot(testing_act,activity_to_img_weights) plt.subplot(122) pylab.imshow(np.reshape(testing_rotate,(dim, dim), 'F').T, cmap=plt.get_cmap('Greys_r')) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load the MNIST database Step2: Each digit is represented by a one hot vector where the index of the 1 represents the number Step3: Load the saved weight matrices that were created by trainging the model Step4: The network where the mental imagery occurs Step5: The following is not part of the brain model, it is used to view the output for the ensemble Step6: Pickle the probe's output if it takes a long time to run Step7: Testing
5,804
<ASSISTANT_TASK:> Python Code: # Load library import numpy as np import pandas as pd # Create feature matrix X = np.array([[1, 2], [6, 3], [8, 4], [9, 5], [np.nan, 4]]) # Remove observations with missing values X[~np.isnan(X).any(axis=1)] # Load data as a data frame df = pd.DataFrame(X, columns=['feature_1', 'feature_2']) # Remove observations with missing values df.dropna() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create Data Frame Step2: Drop Missing Values Using NumPy Step3: Drop Missing Values Using pandas
5,805
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import numpy as np from IPython.html.widgets import interact, interactive, fixed from IPython.display import display def random_line(m, x, b, sigma, size=10): Create a line y = m*x + b + N(0,sigma**2) between x=[-1.0,1.0] Parameters ---------- m : float The slope of the line. b : float The y-intercept of the line. sigma : float The standard deviation of the y direction normal distribution noise. size : int The number of points to create for the line. Returns ------- x : array of floats The array of x values for the line with `size` points. y : array of floats The array of y values for the lines with `size` points. y = m * x + b + N(0, sigma**2) return y m = 0.0; b = 1.0; sigma=0.0; size=3 x, y = random_line(m, b, sigma, size) assert len(x)==len(y)==size assert list(x)==[-1.0,0.0,1.0] assert list(y)==[1.0,1.0,1.0] sigma = 1.0 m = 0.0; b = 0.0 size = 500 x, y = random_line(m, b, sigma, size) assert np.allclose(np.mean(y-m*x-b), 0.0, rtol=0.1, atol=0.1) assert np.allclose(np.std(y-m*x-b), sigma, rtol=0.1, atol=0.1) def ticks_out(ax): Move the ticks to the outside of the box. ax.get_xaxis().set_tick_params(direction='out', width=1, which='both') ax.get_yaxis().set_tick_params(direction='out', width=1, which='both') def plot_random_line(m, b, sigma, size=10, color='red'): Plot a random line with slope m, intercept b and size points. # YOUR CODE HERE raise NotImplementedError() plot_random_line(5.0, -1.0, 2.0, 50) assert True # use this cell to grade the plot_random_line function # YOUR CODE HERE raise NotImplementedError() #### assert True # use this cell to grade the plot_random_line interact <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Line with Gaussian noise Step5: Write a function named plot_random_line that takes the same arguments as random_line and creates a random line using random_line and then plots the x and y points using Matplotlib's scatter function Step6: Use interact to explore the plot_random_line function using
5,806
<ASSISTANT_TASK:> Python Code: from sklearn.datasets import load_iris iris = load_iris() print(iris.data.shape) measurements = [ {'city': 'Dubai', 'temperature': 33.}, {'city': 'London', 'temperature': 12.}, {'city': 'San Francisco', 'temperature': 18.}, ] from sklearn.feature_extraction import DictVectorizer vec = DictVectorizer() vec vec.fit_transform(measurements).toarray() vec.get_feature_names() import os import pandas as pd titanic = pd.read_csv(os.path.join('datasets', 'titanic3.csv')) print(titanic.columns) titanic.head() labels = titanic.survived.values features = titanic[['pclass', 'sex', 'age', 'sibsp', 'parch', 'fare', 'embarked']] features.head() pd.get_dummies(features).head() features_dummies = pd.get_dummies(features, columns=['pclass', 'sex', 'embarked']) features_dummies.head(n=16) data = features_dummies.values import numpy as np np.isnan(data).any() from sklearn.model_selection import train_test_split from sklearn.preprocessing import Imputer train_data, test_data, train_labels, test_labels = train_test_split(data, labels, random_state=0) imp = Imputer() imp.fit(train_data) train_data_finite = imp.transform(train_data) test_data_finite = imp.transform(test_data) from sklearn.dummy import DummyClassifier clf = DummyClassifier('most_frequent') clf.fit(train_data_finite, train_labels) print("Prediction accuracy: %f" % clf.score(test_data_finite, test_labels)) # %load solutions/10_titanic.py <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: These features are Step2: Derived Features Step3: Here is a broad description of the keys and what they mean Step4: We clearly want to discard the "boat" and "body" columns for any classification into survived vs not survived as they already contain this information. The name is unique to each person (probably) and also non-informative. For a first try, we will use "pclass", "sibsp", "parch", "fare" and "embarked" as our features Step5: The data now contains only useful features, but they are not in a format that the machine learning algorithms can understand. We need to transform the strings "male" and "female" into binary variables that indicate the gender, and similarly for "embarked". Step6: This transformation successfully encoded the string columns. However, one might argue that the class is also a categorical variable. We can explicitly list the columns to encode using the columns parameter, and include pclass Step7: With all of the hard data loading work out of the way, evaluating a classifier on this data becomes straightforward. Setting up the simplest possible model, we want to see what the simplest score can be with DummyClassifier. Step8: Exercise
5,807
<ASSISTANT_TASK:> Python Code: import sys sys.path.append('../') import cPickle as pickle import re import glob import os from generators import DataLoader import time import holoviews as hv import theano import theano.tensor as T import numpy as np import pandas as p import lasagne as nn from utils import hms, architecture_string, get_img_ids_from_iter %pylab inline rcParams['figure.figsize'] = 16, 6 # rcParams['text.color'] = 'red' # rcParams['xtick.color'] = 'red' # rcParams['ytick.color'] = 'red' np.set_printoptions(precision=3) np.set_printoptions(suppress=True) dump_path = '../dumps/2015_07_17_123003.pkl' model_data = pickle.load(open(dump_path, 'rb')) # Let's set the in and output layers to some local vars. l_out = model_data['l_out'] l_ins = model_data['l_ins'] chunk_size = model_data['chunk_size'] * 2 batch_size = model_data['batch_size'] #print "Batch size: %i." % batch_size #print "Chunk size: %i." % chunk_size output = nn.layers.get_output(l_out, deterministic=True) input_ndims = [len(nn.layers.get_output_shape(l_in)) for l_in in l_ins] xs_shared = [nn.utils.shared_empty(dim=ndim) for ndim in input_ndims] idx = T.lscalar('idx') givens = {} for l_in, x_shared in zip(l_ins, xs_shared): givens[l_in.input_var] = x_shared[idx * batch_size:(idx + 1) * batch_size] compute_output = theano.function( [idx], output, givens=givens, on_unused_input='ignore' ) # Do transformations per patient instead? if 'paired_transfos' in model_data: paired_transfos = model_data['paired_transfos'] else: paired_transfos = False #print paired_transfos train_labels = p.read_csv('../data/new_trainLabels.csv') print train_labels.head(20) # Get all patient ids. patient_ids = sorted(set(get_img_ids_from_iter(train_labels.image))) num_chunks = int(np.ceil((2 * len(patient_ids)) / float(chunk_size))) # Where all the images are located: # it looks for [img_dir]/[patient_id]_[left or right].jpeg img_dir = '../test_resized/' data_loader = DataLoader() new_dataloader_params = model_data['data_loader_params'] new_dataloader_params.update({'images_test': patient_ids}) new_dataloader_params.update({'labels_test': train_labels.level.values}) new_dataloader_params.update({'prefix_train': img_dir}) data_loader.set_params(new_dataloader_params) def do_pred(test_gen): outputs = [] for e, (xs_chunk, chunk_shape, chunk_length) in enumerate(test_gen()): num_batches_chunk = int(np.ceil(chunk_length / float(batch_size))) print "Chunk %i/%i" % (e + 1, num_chunks) print " load data onto GPU" for x_shared, x_chunk in zip(xs_shared, xs_chunk): x_shared.set_value(x_chunk) print " compute output in batches" outputs_chunk = [] for b in xrange(num_batches_chunk): out = compute_output(b) outputs_chunk.append(out) outputs_chunk = np.vstack(outputs_chunk) outputs_chunk = outputs_chunk[:chunk_length] outputs.append(outputs_chunk) return np.vstack(outputs), xs_chunk no_transfo_params = model_data['data_loader_params']['no_transfo_params'] #print no_transfo_params # The default gen with "no transfos". test_gen = lambda: data_loader.create_fixed_gen( data_loader.images_test[:128*2], chunk_size=chunk_size, prefix_train=img_dir, prefix_test=img_dir, transfo_params=no_transfo_params, paired_transfos=paired_transfos, ) %%time outputs_orig, chunk_orig = do_pred(test_gen) d={} for i,patient in zip(range(0,outputs_orig.shape[0],2),patient_ids): a=hv.RGB.load_image('../test_resized//'+str(patient)+'_left.jpeg') b=hv.RGB.load_image('../test_resized//'+str(patient)+'_right.jpeg') a=a + hv.Bars(outputs_orig[i]) b=b+hv.Bars(outputs_orig[i+1]) d[patient] = (a+b).cols(2) hv.notebook_extension() result=hv.HoloMap(d) result <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We're going to test on some train images, so loading the training set labels. Step2: Using the DataLoader to set up the parameters, you could replace it with something much simpler. Step3: The next function is going to iterate over a test generator to get the outputs. Step4: We get the default "no transformation" parameters for the model. Step5: And set up the test generator on the first 256 patients of the training set (512 images). Step6: Then we can get some predictions. Step7: Legend
5,808
<ASSISTANT_TASK:> Python Code: %matplotlib inline import numpy as np import pandas as pd import matplotlib.pyplot as plt import matplotlib as mpl import seaborn as sns from matplotlib.ticker import LinearLocator sns.set_style('whitegrid') mpl.rcParams['font.size'] = 16 mpl.rcParams['axes.labelsize'] = 16 mpl.rcParams['xtick.labelsize'] = 14 mpl.rcParams['ytick.labelsize'] = 14 from VHM import VHM_flexible import brewer2mpl setblue = brewer2mpl.get_map('Greys', 'Sequential', 6, reverse = True).mpl_colors data = pd.read_csv("/media/DATA/Githubs/project_breach_pdm_application/data/data_brach_case_nete.csv", parse_dates=True, index_col=0) data.head() # Parameters umax =280.0 uevap = 150.0 c1s = 1.8 c2s = 0.4 c3s = 1.0 c1o = -3.9 c2o = 1.59 c3o = 0.0 c4o = 0.0 c1i = -2.7 c2i = 1. c3i = 0.0 c4i = 0.0 nso = 50 nsi = 50 Kg = 2400.0 Ki =120.0 Ko =10.0 # Define the constants area = 361. timestep = 1. # Define the initial conditions u = 170.0 qg =1.0 cg =0.0 qo =0.0 co =0.0 qi =1.0 ci =0.0 pars = [umax,uevap,c1s,c2s,c3s,c1o,c2o,c3o,c4o,c1i,c2i,c3i,c4i,nso,nsi,Kg,Ki,Ko] constants = [area,timestep] init_conditions = [u, qg, cg, qo, co, qi, ci] structure_options=['relative', 'nonlinear', True, True, '211'] rain = data['rain'].values pet = data['evapotranspiration'].values vhm_output = VHM_flexible(pars, constants, init_conditions, structure_options, rain, pet) outflows, fractions, moisture = vhm_output # create dataframe with data['modtot'] = outflows[:, 0] data['modover'] = outflows[:, 1] data['modinter'] = outflows[:, 2] data['modbase'] = outflows[:, 3] data['fracover'] = fractions[:, 0] data['fracinter'] = fractions[:, 1] data['fracbase'] = fractions[:, 2] data['fracsoil'] = fractions[:, 3] data['fractotal'] = data['fracover'] + data['fracinter'] + data['fracbase'] + data['fracsoil'] data['soil'] = moisture data2plot = data['2003':'2005'] fig, axs = plt.subplots(1, 1, figsize=(14, 6), sharex=True) axs.plot(data2plot.index, data2plot['modtot'], label='modelled') axs.plot(data2plot.index, data2plot['meas'], label='observed') axs.set_ylabel("flow ($m^3s^{-1}$)") axs.yaxis.labelpad = 15 axs.xaxis.set_major_locator( mpl.dates.MonthLocator(interval = 12)) axs.xaxis.set_major_formatter( mpl.dates.DateFormatter('%d %b \n %Y')) axs.tick_params(axis = 'x', pad = 15, direction='out') # y-axis axs.tick_params(axis = 'y', pad = 5, direction='out') #remove spines axs.spines['bottom'].set_visible(False) axs.spines['top'].set_visible(False) # set grid axs.grid(which='both', axis='both', color='0.7', linestyle='--', linewidth=0.8) # line colors of the plots axs.lines[0].set_color(setblue[0]) axs.lines[1].set_color(setblue[2]) # line widths for line in axs.lines: line.set_linewidth(1.2) axs.legend(loc='upper right', fontsize=16, ncol=2, bbox_to_anchor=(1., 1.1)) #plt.savefig('vhm_flow_example.pdf', dpi=300) #plt.savefig('vhm_flow_example.png', dpi=300) overf = pd.read_csv("Filter_Overlandflow3.txt", index_col=0, sep='\t', parse_dates=True, dayfirst=True) overf.columns = ['overland flow'] interf = pd.read_csv("Filter_Interflow3.txt", index_col=0, sep='\t', parse_dates=True, dayfirst=True) interf.columns = ['interflow'] basef = pd.read_csv("Filter_Baseflow3.txt", index_col=0, sep='\t', parse_dates=True, dayfirst=True) basef.columns = ['baseflow'] subflow_data = overf.join(interf).join(basef) subflow2plot = subflow_data['2003':'2005'] fig, axs = plt.subplots(3, 1, figsize=(14, 6), sharex=True) fig.subplots_adjust(hspace = 0.2) #first plot axs[0].plot(data2plot.index, data2plot['modover'], label='subflow modelled') axs[0].plot(subflow2plot.index, subflow2plot['overland flow'].values, label='subflow seperation') axs[0].set_ylabel("overland flow \n ($m^3s^{-1}$)") axs[0].yaxis.labelpad = 15 #second plot axs[1].plot(data2plot.index, data2plot['modinter']) axs[1].plot(subflow2plot.index, subflow2plot['interflow'].values) axs[1].yaxis.tick_right() axs[1].yaxis.set_label_position("right") axs[1].set_ylabel("interflow \n ($m^3s^{-1}$)") axs[1].yaxis.labelpad = 15 # third plot axs[2].plot(data2plot.index, data2plot['modbase']) axs[2].plot(subflow2plot.index, subflow2plot['baseflow'].values) axs[2].xaxis.set_major_locator( mpl.dates.MonthLocator(interval = 12)) axs[2].xaxis.set_major_formatter( mpl.dates.DateFormatter('%d %b \n %Y')) axs[2].tick_params(axis = 'x', pad = 15, direction='out') axs[2].set_ylabel("baseflow \n($m^3s^{-1}$)") axs[2].yaxis.labelpad = 10 #editing of the style: for ax in axs: # y-axis ax.tick_params(axis = 'y', pad = 5, direction='out') ax.yaxis.set_major_locator(LinearLocator(3)) #remove spines ax.spines['bottom'].set_visible(False) ax.spines['top'].set_visible(False) # set grid ax.grid(which='both', axis='both', color='0.7', linestyle='--', linewidth=0.8) # line colors of the plots ax.lines[0].set_color(setblue[0]) ax.lines[1].set_color(setblue[2]) # line widths for line in ax.lines: line.set_linewidth(1.2) # remove ticklabels if redundant if not ax.is_last_row(): ax.set_xlabel('') plt.setp(axs[1].get_xminorticklabels(), visible=False) plt.setp(axs[1].get_xmajorticklabels(), visible=False) plt.setp(axs[1].get_xminorticklabels(), visible=False) temp = axs[0] temp.legend(loc='upper right', fontsize=16, ncol=2, bbox_to_anchor=(1., 1.4)) fig.savefig('vhm_subflow_example.pdf') fig.savefig('vhm_subflow_example.png') fig, axs = plt.subplots(1, 1, figsize=(14, 6), sharex=True) axs.plot(data2plot.index, data2plot['fracover'],'-', label='fraction overland flow') axs.plot(data2plot.index, data2plot['fracinter'],'-.', label='fraction interflow') axs.plot(data2plot.index, data2plot['fracbase'],':', label='fraction base flow') axs.plot(data2plot.index, data2plot['fracsoil'],'-', label='fraction infiltration') axs.plot(data2plot.index, data2plot['fractotal'],'-', label='total fractions') axs.set_ylabel("fractions") axs.yaxis.labelpad = 15 axs.xaxis.set_major_locator( mpl.dates.MonthLocator(interval = 12)) axs.xaxis.set_major_formatter( mpl.dates.DateFormatter('%d %b \n %Y')) axs.tick_params(axis = 'x', pad = 15, direction='out') # y-axis axs.tick_params(axis = 'y', pad = 5, direction='out') axs.yaxis.set_ticks([0,0.5,1.]) axs.set_ylim([0., 1.05]) #remove spines axs.spines['bottom'].set_visible(False) axs.spines['top'].set_visible(False) # set grid axs.grid(which='both', axis='both', color='0.7', linestyle='--', linewidth=0.8) # line colors of the plots axs.lines[0].set_color(setblue[0]) axs.lines[1].set_color(setblue[0]) axs.lines[2].set_color(setblue[1]) axs.lines[3].set_color(setblue[1]) axs.lines[4].set_color(setblue[3]) # line widths for line in axs.lines: line.set_linewidth(1.2) axs.legend(loc='upper right', fontsize=16, ncol=3, bbox_to_anchor=(1., 0.95)) #plt.savefig('vhm_fractions_example_noante.pdf', dpi=300) #plt.savefig('vhm_fractions_example_noante.png', dpi=300) fig, axs = plt.subplots(1, 1, figsize=(14, 6), sharex=True) axs.plot(data2plot.index, data2plot['soil'],'-') axs.set_ylabel(r"soil moisture ($mm$)") axs.yaxis.labelpad = 15 axs.xaxis.set_major_locator( mpl.dates.MonthLocator(interval = 12)) axs.xaxis.set_major_formatter( mpl.dates.DateFormatter('%d %b \n %Y')) axs.tick_params(axis = 'x', pad = 15, direction='out') # y-axis axs.tick_params(axis = 'y', pad = 5, direction='out') #remove spines axs.spines['bottom'].set_visible(False) axs.spines['top'].set_visible(False) # set grid axs.grid(which='both', axis='both', color='0.7', linestyle='--', linewidth=0.8) # line colors of the plots axs.lines[0].set_color(setblue[0]) # line widths for line in axs.lines: line.set_linewidth(1.2) #plt.savefig('vhm_moisture_example.pdf', dpi=300) #plt.savefig('vhm_moisture_example.png', dpi=300) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load observations Step2: Model simulation Step3: Structural options Step4: Run the model Step5: Focus on a subperiod to plot Step6: Plot the model output and observations to evaluate the fit Step7: Plot modelled and filtered subflows in function of time Step8: Plot fractions in time overview Step9: Soil moisture plot
5,809
<ASSISTANT_TASK:> Python Code: cities = ["Bristol", "London", "Manchester", "Edinburgh", "Belfast", "York"] print("The position of Manchester in the list is: " + str(cities.???('Manchester'))) print("The position of Manchester in the list is: " + str(cities.index('Manchester'))) print(cities[2 + ???]) print(cities[2 + 2]) print(cities[???]) print(cities[-2]) print(cities[???]) print(cities[6]) #anything above five would do it temperatures = [15.6, 16.5, 13.4, 14.0, 15.2, 14.8] print(temperatures[???]) print(temperatures[1:4]) print(temperatures[???]) print(temperatures[???]) print(temperatures[4:6]) print(temperatures[-3:-1]) city="Manchester" # Use this to start the solution... #your code here city="Manchester" # Use this to get the solution... index = cities.index(city) print("The average temperature in " + cities[index] + " is " + str(temperatures[index]) + " degrees.") ??? city="Belfast" index = cities.index(city) print("The average temperature in " + cities[index] + " is " + str(temperatures[index]) + " degrees.") list1 = [1, 2, 3] list2 = [4, 5, 6] print( ??? ) print ( list1 + list2 ) print( ??? ) print( list1+[list2]) list1 = [1, 2, 3] list2 = [4, 5, 6] list3 = ??? list3.??? print(list3) list3 = list1+list2 list3.reverse() print(list3) list1.??? list2.??? print( list1+list2 ) list1.reverse() list2.reverse() print( list1+list2 ) list1.??? list2.??? print( list1+list2 ) list1.remove(1) list2.remove(4) print( list1+list2 ) cities = { 'San Francisco': [37.77, -122.43, 'SFO'], 'London': [51.51, -0.08, 'LDN'], 'Paris': [48.86,2.29, 'PAR'], 'Beijing': [39.92,116.40 ,'BEI'], } cities = ??? cities = { 'San Francisco': [37.77, -122.43, 'SFO'], 'London': [51.51, -0.08, 'LDN'], 'Paris': [48.86,2.29, 'PAR'], 'Beijing': [39.92,116.40 ,'BEI'], 'Chennai': [13.08, 80.27,'MAA'] } print(???) print("The airport code for Chennai is " + cities["Chennai"][2]) print(cities['Berlin']) print(cities.get('Berlin')) #Berlin is not in the dict. #The first code block above returns an error because Berlin is missing #The second does not because it uses the .get method which handles the error for us (returning a None value) #This second method is 'safer' because of how it handles this error #compare to use using the two different methods for London print(cities['London']) print(cities.get('London')) print(cities.get('London')) for k, v in cities.items(): print(k) for k, v in cities.items(): print("The city of " + str(k) + " has an airport code of " + str(v[2]) ) for ??? in cities.???: print(??? + " is at latitude " + str(???)) for city, latitude in cities.items(): print(city + " is at latitude " + str(latitude[0])) for c in ???: print(???) for c in cities.items(): print(c) citiesB = [ {'name': 'San Francisco', 'position': [37.77, -122.43], 'airport': 'SFO'}, {'name': 'London', 'position': [51.51, -0.08], 'airport': 'LDN'}, {'name': 'Paris', 'position': [48.86, 2.29], 'airport': 'PAR'}, {'name': 'Beijing', 'position': [39.92, 116.40], 'airport': 'BEI'} ] for ??? in citiesB.???: print(??? + " is at latitude " + str(???)) citiesB = [ {'name': 'San Francisco', 'position': [37.77, -122.43], 'airport': 'SFO'}, {'name': 'London', 'position': [51.51, -0.08], 'airport': 'LDN'}, {'name': 'Paris', 'position': [48.86, 2.29], 'airport': 'PAR'}, {'name': 'Beijing', 'position': [39.92, 116.40], 'airport': 'BEI'} ] for city in citiesB: print(city['name'] + " is at latitude " + str(city['position'][0])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: b) Replace the ??? so that it prints the position of Manchester in the list Step2: c) Replace the ??? so that it prints Belfast Step3: d) Use a negative index to print Belfast Step4: e) Force Python to generate a list index out of range error. NB Step5: f) Think about what the next line creates, then run the code. Step6: g) What would you change ??? to, to return [16.5, 13.4, 14.0]? Step7: h) What are two different ways of getting [15.2, 14.8] from the temperatures list? Step8: i) Notice that the list of temperatures is the same length as the list of cities, that's because these are (roughly) average temperatures for each city! Given this, how do you print Step9: Now copy+paste your code and change only one thing in order to print out Step10: 1.2 Manipulating Multiple Lists Step11: j) How do you get Python to print Step12: k) How to you get Python to print Step13: Let's re-set the lists (run the next code block) Step14: l) How would you print out Step15: m) How would you print out Step16: n) How would you print out [3, 2, 6, 5] with a permanent change to the list (not slicing)? NB Step17: Dictionaries Step18: a) Add a record to the dictionary for Chennai (data here) Step19: b) In one line of code, print out the airport code for Chennai Step20: c) Check you understand the difference between the following two blocks of code by running them, checking the output and editing them (e.g. try the code again, but replacing Berlin with London) Step21: d) Adapting the code below, print out the city name and airport code for every city in our Atlas. Step22: Loops Step23: b) Print out every city on a separate line using a for loop Step24: c) Now print using a loop this new data structure
5,810
<ASSISTANT_TASK:> Python Code: from impact.core.features import BaseAnalyteFeature, BaseAnalyteFeatureFactory class ODNormalizedData(BaseAnalyteFeature): # The constructor should accept all required analytes as parameters def __init__(self, biomass, reporter): self.biomass = biomass self.reporter = reporter self.normalized_data = None # This data property assures that the data is returned, or calculated as needed @property def data(self): if self.normalized_data is None: self.calculate() return self.normalized_data # This is where the property is actually calculated and set def calculate(self): self.normalized_data = self.reporter.data_vector/self.biomass.data_vector # The feature factory watches for those analytes class ODNormalizedDataFactory(BaseAnalyteFeatureFactory): # define what the feature requires = ['biomass','reporter'] name = 'od_normalized_data' # constructor should initialize variables until all required analytes are present, # this will ensure that despite the order analytes are added, feature will be calculated appropriately def __init__(self): self.biomass = None self.reporter = None # define how to handle new analytes def add_analyte_data(self, analyte_data): if analyte_data.trial_identifier.analyte_type == 'reporter': self.reporter = analyte_data elif analyte_data.trial_identifier.analyte_type == 'biomass': self.biomass = analyte_data if self.reporter is not None and self.biomass is not None: setattr(analyte_data,self.name,ODNormalizedData(biomass,reporter)) import impact.core.SingleTrial as SingleTrial SingleTrial.register_feature(ODNormalizedDataFactory) from impact.core.AnalyteData import Biomass, Reporter from impact.core.TrialIdentifier import ReplicateTrialIdentifier as TI t = [0,1,2,3,4] biomass_data = [0.1,0.2,0.4,0.8,0.8] reporter_data = [1000,2000,3000,4000,5000] biomass = Biomass() biomass.time_vector = t biomass.data_vector = biomass_data ti = TI() ti.analyte_name = 'OD' ti.analyte_type = 'biomass' biomass.trial_identifier = ti reporter = Reporter() reporter.time_vector = t reporter.data_vector = reporter_data ti = TI() ti.analyte_name = 'gfp' ti.analyte_type = 'reporter' reporter.trial_identifier = ti trial = SingleTrial() trial.add_analyte_data(biomass) trial.add_analyte_data(reporter) import numpy as np calculated_data = trial.analyte_dict['gfp'].od_normalized_data.data expected_data = np.array(reporter_data)/biomass_data print(calculated_data) print(expected_data) print(all(calculated_data==expected_data)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Then, we can build our features Step2: Finally, we register the feature Step3: and test it
5,811
<ASSISTANT_TASK:> Python Code: # run this once per session to bring in a required library !pip --quiet install sparqlwrapper | grep -v 'already satisfied' from SPARQLWrapper import SPARQLWrapper, JSON import pandas as pd import io import requests # This function shows how to use rdflib to query a REMOTE sparql dataset q1 = SELECT distinct ?prop ?type1 ?type2 WHERE { ?type1 rdfs:subClassOf* <https://schema.org/Organization> . ?type2 rdfs:subClassOf* <https://schema.org/Person> . ?prop <https://schema.org/domainIncludes> ?type1 . ?prop <https://schema.org/domainIncludes> ?type2 . } pd.set_option('display.max_colwidth', None) # data wd_endpoint = 'https://query.wikidata.org/sparql' sdo_endpoint = "https://dydra.com/danbri/schema-org-v11/sparql" # utility function def df_from_query(querystring=q1, endpoint=sdo_endpoint): sparql = SPARQLWrapper(endpoint) sparql.setQuery(querystring) sparql.setReturnFormat(JSON) results = sparql.query().convert() return( pd.json_normalize(results['results']['bindings']) ) # This shows how to use rdflib to query a LOCAL sparql dataset # TODO: Need a function that loads https://webschemas.org/version/latest/schemaorg-current-https.nt into a named graph SPARQL store import rdflib import json from collections import Counter from rdflib import Graph, plugin, ConjunctiveGraph from rdflib.serializer import Serializer def toDF(result): return pd.DataFrame(result, columns=result.vars) # Fetch Schema.org definitions sdo_current_https_url = "https://webschemas.org/version/latest/schemaorg-current-https.nq" sdo_all_https_url = "https://webschemas.org/version/latest/schemaorg-all-https.nq" # TODO - is this the only way to figure out what is in the attic? except both files use same NG URL g = ConjunctiveGraph(store="IOMemory") g.parse( sdo_all_https_url, format="nquads", publicID="https://schema.org/") #g.parse( sdo_current_https_url, format="nquads", publicID="https://schema.org/") result = toDF( g.query("select * where { GRAPH ?g { ?article_type rdfs:subClassOf <https://schema.org/NewsArticle> ; rdfs:label ?label }}") ) result toDF( g.query("select * where { ?attic_term <https://schema.org/isPartOf> <https://attic.schema.org> ; rdfs:label ?label }") ) grandchild_count_query = SELECT ?child (count(?grandchild) as ?nGrandchildren) where { ?child rdfs:subClassOf <https://schema.org/Thing> . OPTIONAL { ?grandchild rdfs:subClassOf ?child } } GROUP BY ?child order by desc(count(?grandchild)) res = g.query (grandchild_count_query) mydf = toDF( res ) #mydf.plot(kind='bar') mydf.columns # https://www.shanelynn.ie/bar-plots-in-python-using-pandas-dataframes/ mydf['nGrandchildren'] print(mydf) mydf['nGrandchildren'].plot(kind='bar') result x = df_from_query(q1) x # First we clone the entire schema.org repo, then we collect up the examples from .txt files: !git clone https://github.com/schemaorg/schemaorg !find . -name \*example\*.txt -exec ls {} \; <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: <a href="https Step3: Examples
5,812
<ASSISTANT_TASK:> Python Code: ### START CODE HERE ### (≈ 1 line of code) test = "Hello World" ### END CODE HERE ### print ("test: " + test) # GRADED FUNCTION: basic_sigmoid import math def basic_sigmoid(x): Compute sigmoid of x. Arguments: x -- A scalar Return: s -- sigmoid(x) ### START CODE HERE ### (≈ 1 line of code) s = 1/(1+math.exp(-x)) ### END CODE HERE ### return s basic_sigmoid(3) ### One reason why we use "numpy" instead of "math" in Deep Learning ### x = [1, 2, 3] basic_sigmoid(x) # you will see this give an error when you run it, because x is a vector. import numpy as np # example of np.exp x = np.array([1, 2, 3]) print(np.exp(x)) # result is (exp(1), exp(2), exp(3)) # example of vector operation x = np.array([1, 2, 3]) print (x + 3) # GRADED FUNCTION: sigmoid import numpy as np # this means you can access numpy functions by writing np.function() instead of numpy.function() def sigmoid(x): Compute the sigmoid of x Arguments: x -- A scalar or numpy array of any size Return: s -- sigmoid(x) ### START CODE HERE ### (≈ 1 line of code) s = 1/(1+np.exp(-x)) ### END CODE HERE ### return s x = np.array([1, 2, 3]) sigmoid(x) # GRADED FUNCTION: sigmoid_derivative def sigmoid_derivative(x): Compute the gradient (also called the slope or derivative) of the sigmoid function with respect to its input x. You can store the output of the sigmoid function into variables and then use it to calculate the gradient. Arguments: x -- A scalar or numpy array Return: ds -- Your computed gradient. ### START CODE HERE ### (≈ 2 lines of code) s = sigmoid(x) ds = s*(1-s) ### END CODE HERE ### return ds x = np.array([1, 2, 3]) print ("sigmoid_derivative(x) = " + str(sigmoid_derivative(x))) # GRADED FUNCTION: image2vector def image2vector(image): Argument: image -- a numpy array of shape (length, height, depth) Returns: v -- a vector of shape (length*height*depth, 1) ### START CODE HERE ### (≈ 1 line of code) v = image.reshape((image.shape[0]*image.shape[1]*image.shape[2], 1))#v.reshape((v.shape[0]*v.shape[1]*3,1)) ### END CODE HERE ### return v # This is a 3 by 3 by 2 array, typically images will be (num_px_x, num_px_y,3) where 3 represents the RGB values image = np.array([[[ 0.67826139, 0.29380381], [ 0.90714982, 0.52835647], [ 0.4215251 , 0.45017551]], [[ 0.92814219, 0.96677647], [ 0.85304703, 0.52351845], [ 0.19981397, 0.27417313]], [[ 0.60659855, 0.00533165], [ 0.10820313, 0.49978937], [ 0.34144279, 0.94630077]]]) print ("image2vector(image) = " + str(image2vector(image))) # GRADED FUNCTION: normalizeRows def normalizeRows(x): Implement a function that normalizes each row of the matrix x (to have unit length). Argument: x -- A numpy matrix of shape (n, m) Returns: x -- The normalized (by row) numpy matrix. You are allowed to modify x. ### START CODE HERE ### (≈ 2 lines of code) # Compute x_norm as the norm 2 of x. Use np.linalg.norm(..., ord = 2, axis = ..., keepdims = True) x_norm = np.linalg.norm(x, ord = 2, axis=1, keepdims=True) # Divide x by its norm. x = x/x_norm ### END CODE HERE ### return x x = np.array([ [0, 3, 4], [1, 6, 4]]) print("normalizeRows(x) = " + str(normalizeRows(x))) # GRADED FUNCTION: softmax def softmax(x): Calculates the softmax for each row of the input x. Your code should work for a row vector and also for matrices of shape (n, m). Argument: x -- A numpy matrix of shape (n,m) Returns: s -- A numpy matrix equal to the softmax of x, of shape (n,m) ### START CODE HERE ### (≈ 3 lines of code) # Apply exp() element-wise to x. Use np.exp(...). x_exp = np.exp(x) # Create a vector x_sum that sums each row of x_exp. Use np.sum(..., axis = 1, keepdims = True). x_sum = np.sum(x_exp, axis = 1, keepdims = True) # Compute softmax(x) by dividing x_exp by x_sum. It should automatically use numpy broadcasting. s = x_exp/x_sum ### END CODE HERE ### return s x = np.array([ [9, 2, 5, 0, 0], [7, 5, 0, 0 ,0]]) print("softmax(x) = " + str(softmax(x))) import time x1 = [9, 2, 5, 0, 0, 7, 5, 0, 0, 0, 9, 2, 5, 0, 0] x2 = [9, 2, 2, 9, 0, 9, 2, 5, 0, 0, 9, 2, 5, 0, 0] ### CLASSIC DOT PRODUCT OF VECTORS IMPLEMENTATION ### tic = time.process_time() dot = 0 for i in range(len(x1)): dot+= x1[i]*x2[i] toc = time.process_time() print ("dot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC OUTER PRODUCT IMPLEMENTATION ### tic = time.process_time() outer = np.zeros((len(x1),len(x2))) # we create a len(x1)*len(x2) matrix with only zeros for i in range(len(x1)): for j in range(len(x2)): outer[i,j] = x1[i]*x2[j] toc = time.process_time() print ("outer = " + str(outer) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC ELEMENTWISE IMPLEMENTATION ### tic = time.process_time() mul = np.zeros(len(x1)) for i in range(len(x1)): mul[i] = x1[i]*x2[i] toc = time.process_time() print ("elementwise multiplication = " + str(mul) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC GENERAL DOT PRODUCT IMPLEMENTATION ### W = np.random.rand(3,len(x1)) # Random 3*len(x1) numpy array tic = time.process_time() gdot = np.zeros(W.shape[0]) for i in range(W.shape[0]): for j in range(len(x1)): gdot[i] += W[i,j]*x1[j] toc = time.process_time() print ("gdot = " + str(gdot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") x1 = [9, 2, 5, 0, 0, 7, 5, 0, 0, 0, 9, 2, 5, 0, 0] x2 = [9, 2, 2, 9, 0, 9, 2, 5, 0, 0, 9, 2, 5, 0, 0] ### VECTORIZED DOT PRODUCT OF VECTORS ### tic = time.process_time() dot = np.dot(x1,x2) toc = time.process_time() print ("dot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED OUTER PRODUCT ### tic = time.process_time() outer = np.outer(x1,x2) toc = time.process_time() print ("outer = " + str(outer) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED ELEMENTWISE MULTIPLICATION ### tic = time.process_time() mul = np.multiply(x1,x2) toc = time.process_time() print ("elementwise multiplication = " + str(mul) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED GENERAL DOT PRODUCT ### tic = time.process_time() dot = np.dot(W,x1) toc = time.process_time() print ("gdot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") # GRADED FUNCTION: L1 def L1(yhat, y): Arguments: yhat -- vector of size m (predicted labels) y -- vector of size m (true labels) Returns: loss -- the value of the L1 loss function defined above ### START CODE HERE ### (≈ 1 line of code) diff = np.abs(np.subtract(yhat, y)) loss = np.sum(diff) ### END CODE HERE ### return loss yhat = np.array([.9, 0.2, 0.1, .4, .9]) y = np.array([1, 0, 0, 1, 1]) print("L1 = " + str(L1(yhat,y))) # GRADED FUNCTION: L2 def L2(yhat, y): Arguments: yhat -- vector of size m (predicted labels) y -- vector of size m (true labels) Returns: loss -- the value of the L2 loss function defined above ### START CODE HERE ### (≈ 1 line of code) diff = np.subtract(yhat, y) loss = np.sum(np.dot(diff, diff)) ### END CODE HERE ### return loss yhat = np.array([.9, 0.2, 0.1, .4, .9]) y = np.array([1, 0, 0, 1, 1]) print("L2 = " + str(L2(yhat,y))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Expected output Step3: Expected Output Step4: In fact, if $ x = (x_1, x_2, ..., x_n)$ is a row vector then $np.exp(x)$ will apply the exponential function to every element of x. The output will thus be Step5: Furthermore, if x is a vector, then a Python operation such as $s = x + 3$ or $s = \frac{1}{x}$ will output s as a vector of the same size as x. Step7: Any time you need more info on a numpy function, we encourage you to look at the official documentation. Step9: Expected Output Step11: Expected Output Step13: Expected Output Step15: Expected Output Step16: Expected Output Step18: As you may have noticed, the vectorized implementation is much cleaner and more efficient. For bigger vectors/matrices, the differences in running time become even bigger. Step20: Expected Output
5,813
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'mpi-m', 'sandbox-1', 'landice') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.ice_albedo') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "prescribed" # "function of ice age" # "function of ice density" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.atmospheric_coupling_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.oceanic_coupling_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.prognostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "ice velocity" # "ice thickness" # "ice temperature" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.grid.adaptive_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.grid.base_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.grid.resolution_limit') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.grid.projection') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.glaciers.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.glaciers.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.glaciers.dynamic_areal_extent') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.grounding_line_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "grounding line prescribed" # "flux prescribed (Schoof)" # "fixed grid size" # "moving grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.ice_sheet') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.ice_shelf') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.mass_balance.surface_mass_balance') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.mass_balance.basal.bedrock') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.mass_balance.basal.ocean') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.mass_balance.frontal.calving') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.mass_balance.frontal.melting') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.dynamics.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.dynamics.approximation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "SIA" # "SAA" # "full stokes" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.dynamics.adaptive_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.landice.ice.dynamics.timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Ice Albedo Step7: 1.4. Atmospheric Coupling Variables Step8: 1.5. Oceanic Coupling Variables Step9: 1.6. Prognostic Variables Step10: 2. Key Properties --&gt; Software Properties Step11: 2.2. Code Version Step12: 2.3. Code Languages Step13: 3. Grid Step14: 3.2. Adaptive Grid Step15: 3.3. Base Resolution Step16: 3.4. Resolution Limit Step17: 3.5. Projection Step18: 4. Glaciers Step19: 4.2. Description Step20: 4.3. Dynamic Areal Extent Step21: 5. Ice Step22: 5.2. Grounding Line Method Step23: 5.3. Ice Sheet Step24: 5.4. Ice Shelf Step25: 6. Ice --&gt; Mass Balance Step26: 7. Ice --&gt; Mass Balance --&gt; Basal Step27: 7.2. Ocean Step28: 8. Ice --&gt; Mass Balance --&gt; Frontal Step29: 8.2. Melting Step30: 9. Ice --&gt; Dynamics Step31: 9.2. Approximation Step32: 9.3. Adaptive Timestep Step33: 9.4. Timestep
5,814
<ASSISTANT_TASK:> Python Code: texts = [ "Penny bought bright blue fishes.", "Penny bought bright blue and orange fish.", "The cat ate a fish at the store.", "Penny went to the store. Penny ate a bug. Penny saw a fish.", "It meowed once at the bug, it is still meowing at the bug and the fish", "The cat is at the store. The cat is orange. The cat is meowing at the fish.", "Penny is a fish" ] Penny bought bright blue fishes tokenized - penny bought bright blue fishes "Penny bought bright blue fishes".split() from sklearn.feature_extraction.text import CountVectorizer count_vectorizer = CountVectorizer() # .fit_transfer TOKENIZES and COUNTS X = count_vectorizer.fit_transform(texts) X X.toarray() pd.DataFrame(X.toarray()) # A fish is Penny count_vectorizer.get_feature_names() pd.DataFrame(X.toarray(), columns=count_vectorizer.get_feature_names()) # We'll make a new vectorizer count_vectorizer = CountVectorizer(stop_words='english') # .fit_transfer TOKENIZES and COUNTS X = count_vectorizer.fit_transform(texts) print(count_vectorizer.get_feature_names()) pd.DataFrame(X.toarray(), columns=count_vectorizer.get_feature_names()) # This is what our normal tokenizer looks like def boring_tokenizer(str_input): words = re.sub(r"[^A-Za-z0-9\-]", " ", str_input).lower().split() return words count_vectorizer = CountVectorizer(stop_words='english', tokenizer=boring_tokenizer) X = count_vectorizer.fit_transform(texts) print(count_vectorizer.get_feature_names()) from nltk.stem.porter import PorterStemmer #it doesn't know what words are, it just chop off the ends from the words porter_stemmer = PorterStemmer() # print(porter_stemmer.stem('fishes')) print(porter_stemmer.stem('meowed')) print(porter_stemmer.stem('oranges')) print(porter_stemmer.stem('meowing')) print(porter_stemmer.stem('organge')) porter_stemmer = PorterStemmer() def stemming_tokenizer(str_input): words = re.sub(r"[^A-Za-z0-9\-]", " ", str_input).lower().split() words = [porter_stemmer.stem(word) for word in words] return words count_vectorizer = CountVectorizer(stop_words='english', tokenizer=boring_tokenizer) X = count_vectorizer.fit_transform(texts) print(count_vectorizer.get_feature_names()) pd.DataFrame(X.toarray(), columns=count_vectorizer.get_feature_names()) pd.DataFrame(X.toarray(), columns=count_vectorizer.get_feature_names()) from sklearn.feature_extraction.text import TfidfVectorizer tfidf_vectorizer = TfidfVectorizer(stop_words='english', tokenizer=stemming_tokenizer, use_idf=False, norm='l1') X = tfidf_vectorizer.fit_transform(texts) pd.DataFrame(X.toarray(), columns=tfidf_vectorizer.get_feature_names()) tfidf_vectorizer = TfidfVectorizer(stop_words='english', tokenizer=stemming_tokenizer, use_idf=False, norm='l1') X = tfidf_vectorizer.fit_transform(texts) df = pd.DataFrame(X.toarray(), columns=tfidf_vectorizer.get_feature_names()) df # Just add the columns together pd.DataFrame([df['fish'], df['meow'], df['fish'] + df['meow']], index=["fish", "meow", "fish + meow"]).T # use_idf=True is default, but I'll leave it in,idf inverse document frequency idf_vectorizer = TfidfVectorizer(stop_words='english', tokenizer=stemming_tokenizer, use_idf=True, norm='l1') X = idf_vectorizer.fit_transform(texts) idf_df = pd.DataFrame(X.toarray(), columns=idf_vectorizer.get_feature_names()) idf_df # OLD dataframe pd.DataFrame([df['fish'], df['meow'], df['fish'] + df['meow']], index=["fish", "meow", "fish + meow"]).T # NEW dataframe pd.DataFrame([idf_df['fish'], idf_df['meow'], idf_df['fish'] + idf_df['meow']], index=["fish", "meow", "fish + meow"]).T # use_idf=True is default, but I'll leave it in l2_vectorizer = TfidfVectorizer(stop_words='english', tokenizer=stemming_tokenizer, use_idf=True) X = l2_vectorizer.fit_transform(texts) l2_df = pd.DataFrame(X.toarray(), columns=l2_vectorizer.get_feature_names()) l2_df # normal TF-IDF dataframe pd.DataFrame([idf_df['fish'], idf_df['meow'], idf_df['fish'] + idf_df['meow']], index=["fish", "meow", "fish + meow"]).T # L2 norm TF-IDF dataframe pd.DataFrame([l2_df['fish'], l2_df['meow'], l2_df['fish'] + l2_df['meow']], index=["fish", "meow", "fish + meow"]).T # Initialize a vectorizer vectorizer = TfidfVectorizer(use_idf=True, tokenizer=boring_tokenizer, stop_words='english') X = vectorizer.fit_transform(texts) #fit_transform # KMeans clustering is a method of clustering. from sklearn.cluster import KMeans number_of_clusters = 2 km = KMeans(n_clusters=number_of_clusters) km.fit(X) print("Top terms per cluster:") order_centroids = km.cluster_centers_.argsort()[:, ::-1] terms = vectorizer.get_feature_names() for i in range(number_of_clusters): top_ten_words = [terms[ind] for ind in order_centroids[i, :5]] print("Cluster {}: {}".format(i, ' '.join(top_ten_words))) results = pd.DataFrame() results['text'] = texts results['category'] = km.labels_ results from sklearn.cluster import KMeans number_of_clusters = 4 km = KMeans(n_clusters=number_of_clusters) km.fit(X) print("Top terms per cluster:") order_centroids = km.cluster_centers_.argsort()[:, ::-1] terms = vectorizer.get_feature_names() for i in range(number_of_clusters): top_ten_words = [terms[ind] for ind in order_centroids[i, :5]] print("Cluster {}: {}".format(i, ' '.join(top_ten_words))) results = pd.DataFrame() results['text'] = texts results['category'] = km.labels_ results max_features: number of tokens ax=df.plot(kind='scatter',x='fish',y='penni',alpha=0.25) ax.set_xlabel("Fish") ax.set_ylabel("Penny") import matplotlib.pyplot as plt color_list=['r','b','g','y'] colors = [color_list[i]] for i in df['category'] ax.scatter(df['fish']) ax.set <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: When you process text, you have a nice long series of steps, but let's say you're interested in three things Step2: The scikit-learn package does a ton of stuff, some of which includes the above. We're going to start by playing with the CountVectorizer. Step3: Let's take a look at what it found out! Step4: Okay, that looks like trash and garbage. What's a "sparse array"?????? Step5: If we put on our Computer Goggles we see that the first sentence has the first word 3 times, the second word 1 time, the third word 1 time, etc... But we can't read it, really. It would look nicer as a dataframe. Step6: What do all of those numbers mean???? Step7: So sentence #4 has "at" once, and the first sentence has "bought" once, and the last sentence has "the" three times. But hey, those are garbage words! They're cluttering up our dataframe! We need to add stopwords! Step8: I still see meowed and meowing and fish and fishes - they seem the same, so let's lemmatize/stem them. Step9: We're going to use one that features a STEMMER - something that strips the endings off of words (or tries to, at least). This one is from nltk. Step10: Now lets look at the new version of that dataframe. Step11: TF-IDF Step12: Probably the one where fish appears three times. Step13: Now our numbers have shifted a little bit. Instead of just being a count, it's the percentage of the words. Step14: What's the highest combined? for 'fish' and 'meow'? Step15: Indices 4 and 6 (numbers 5 and 7) are tied - but meow never even appears in one of them! Step16: Let's take a look at our OLD values, then our NEW values, just for meow and fish. Step17: Notice how 'meow' increased in value because it's an infrequent term, and fish dropped in value because it's so frequent. Step18: LOOK AT HOW IMPORTANT MEOW IS. Meowing is out of this world important, because no one ever meows. Step19: 4 categories of documents
5,815
<ASSISTANT_TASK:> Python Code: %matplotlib inline # Imports from clr import AddReference AddReference("System") AddReference("QuantConnect.Common") AddReference("QuantConnect.Jupyter") AddReference("QuantConnect.Indicators") from System import * from QuantConnect import * from QuantConnect.Data.Market import TradeBar, QuoteBar from QuantConnect.Jupyter import * from QuantConnect.Indicators import * from datetime import datetime, timedelta import matplotlib.pyplot as plt import pandas as pd # Create an instance qb = QuantBook() spy = qb.AddEquity("SPY") eur = qb.AddForex("EURUSD") # Gets historical data from the subscribed assets, the last 360 datapoints with daily resolution h1 = qb.History(360, Resolution.Daily) # Plot closing prices from "SPY" h1.loc["SPY"]["close"].plot() # Gets historical data from the subscribed assets, from the last 30 days with daily resolution h2 = qb.History(timedelta(30), Resolution.Daily) # Plot high prices from "EURUSD" h2.loc["EURUSD"]["high"].plot() # Gets historical data from the subscribed assets, between two dates with daily resolution h3 = qb.History(spy.Symbol, datetime(2014,1,1), datetime.now(), Resolution.Daily) # Only fetchs historical data from a desired symbol h4 = qb.History(spy.Symbol, 360, Resolution.Daily) # or qb.History("SPY", 360, Resolution.Daily) # Only fetchs historical data from a desired symbol # When we are not dealing with equity, we must use the generic method h5 = qb.History[QuoteBar](eur.Symbol, timedelta(30), Resolution.Daily) # or qb.History[QuoteBar]("EURUSD", timedelta(30), Resolution.Daily) goog = qb.AddOption("GOOG") goog.SetFilter(-2, 2, timedelta(0), timedelta(180)) option_history = qb.GetOptionHistory(goog.Symbol, datetime(2017, 1, 4)) print option_history.GetStrikes() print option_history.GetExpiryDates() h6 = option_history.GetAllData() data = qb.GetFundamental(["AAPL","AIG","BAC","GOOG","IBM"], "ValuationRatios.PERatio") data # Example with BB, it is a datapoint indicator # Define the indicator bb = BollingerBands(30, 2) # Gets historical data of indicator bbdf = qb.Indicator(bb, "SPY", 360, Resolution.Daily) # drop undesired fields bbdf = bbdf.drop('standarddeviation', 1) # Plot bbdf.plot() # For EURUSD bbdf = qb.Indicator(bb, "EURUSD", 360, Resolution.Daily) bbdf = bbdf.drop('standarddeviation', 1) bbdf.plot() # Example with ADX, it is a bar indicator adx = AverageDirectionalIndex("adx", 14) adxdf = qb.Indicator(adx, "SPY", 360, Resolution.Daily) adxdf.plot() # For EURUSD adxdf = qb.Indicator(adx, "EURUSD", 360, Resolution.Daily) adxdf.plot() # Example with ADO, it is a tradebar indicator (requires volume in its calculation) ado = AccumulationDistributionOscillator("ado", 5, 30) adodf = qb.Indicator(ado, "SPY", 360, Resolution.Daily) adodf.plot() # For EURUSD. # Uncomment to check that this SHOULD fail, since Forex is data type is not TradeBar. # adodf = qb.Indicator(ado, "EURUSD", 360, Resolution.Daily) # adodf.plot() # SMA cross: symbol = "EURUSD" # Get History hist = qb.History[QuoteBar](symbol, 500, Resolution.Daily) # Get the fast moving average fast = qb.Indicator(SimpleMovingAverage(50), symbol, 500, Resolution.Daily) # Get the fast moving average slow = qb.Indicator(SimpleMovingAverage(200), symbol, 500, Resolution.Daily) # Remove undesired columns and rename others fast = fast.drop('rollingsum', 1).rename(columns={'simplemovingaverage': 'fast'}) slow = slow.drop('rollingsum', 1).rename(columns={'simplemovingaverage': 'slow'}) # Concatenate the information and plot df = pd.concat([hist.loc[symbol]["close"], fast, slow], axis=1).dropna(axis=0) df.plot() # Get indicator defining a lookback period in terms of timedelta ema1 = qb.Indicator(ExponentialMovingAverage(50), "SPY", timedelta(100), Resolution.Daily) # Get indicator defining a start and end date ema2 = qb.Indicator(ExponentialMovingAverage(50), "SPY", datetime(2016,1,1), datetime(2016,10,1), Resolution.Daily) ema = pd.concat([ema1, ema2], axis=1) ema.plot() rsi = RelativeStrengthIndex(14) # Selects which field we want to use in our indicator (default is Field.Close) rsihi = qb.Indicator(rsi, "SPY", 360, Resolution.Daily, Field.High) rsilo = qb.Indicator(rsi, "SPY", 360, Resolution.Daily, Field.Low) rsihi = rsihi.rename(columns={'relativestrengthindex': 'high'}) rsilo = rsilo.rename(columns={'relativestrengthindex': 'low'}) rsi = pd.concat([rsihi['high'], rsilo['low']], axis=1) rsi.plot() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Selecting Asset Data Step2: Historical Data Requests Step3: Historical Options Data Requests Step4: Get Fundamental Data Step5: Indicators
5,816
<ASSISTANT_TASK:> Python Code: import emcee import halomod import numpy as np import matplotlib.pyplot as plt from scipy.stats import norm from multiprocess import Pool import corner %matplotlib inline emcee.__version__ halomod.__version__ model = halomod.TracerHaloModel( z=0.2, transfer_model='EH', rnum=30, rmin=0.1, rmax=30, hod_model='Zehavi05', hod_params={ "M_min": 12.0, "M_1": 12.8, 'alpha': 1.05, 'central': True }, dr_table=0.1, dlnk=0.1, dlog10m=0.05 ) np.random.seed(1234) mock_data = model.corr_auto_tracer + np.random.normal(scale = 0.1 * np.abs(model.corr_auto_tracer)) mock_ngal = model.mean_tracer_den plt.plot(model.r, model.corr_auto_tracer) plt.scatter(model.r, mock_data) plt.xscale('log') plt.yscale('log') def chi_square(model, data, sigma): return np.sum(norm.logpdf(data, loc=model, scale=sigma)) fiducial_model = model.clone() def flat_to_nested_dict(dct: dict) -> dict: Convert a dct of key: value pairs into a nested dict. Keys that have dots in them indicate nested structure. def key_to_dct(key, val, dct): if '.' in key: key, parts = key.split('.', maxsplit=1) if key not in dct: dct[key] = {} key_to_dct(parts, val, dct[key]) else: dct[key] = val out = {} for k, v in dct.items(): key_to_dct(k, v, out) return out flat_to_nested_dict( { 'nested.key': 1, 'nested.key2': 2, 'non_nested': 3 } ) def log_prob(param_values, param_names, data, model, bounds=None, derived=()): # Pack parameters into a dict params = dict(zip(param_names, param_values)) # Allow for simple bounded flat priors. bounds = bounds or {} for key, val in params.items(): bound = bounds.get(key, (-np.inf, np.inf)) if not bound[0] < val < bound[1]: return (-np.inf,) + (None,)*len(derived) # Update the base model with all the parameters that are being constrained. params = flat_to_nested_dict(params) model.update(**params) ll = chi_square(model.corr_auto_tracer, data[0], 0.1 * np.abs(model.corr_auto_tracer)) ll += chi_square(model.mean_tracer_den, data[1], 1e-4) if not np.isfinite(ll): return (-np.inf, ) + (None,)*len(derived) derived = tuple(getattr(model, d) for d in derived) out = (ll,) + derived return out log_prob( [12.0, 12.8, 1.05], ['hod_params.M_min', 'hod_params.M_1', 'hod_params.alpha'], (mock_data, mock_ngal), model, derived=['satellite_fraction', 'mean_tracer_den'] ) backend = emcee.backends.HDFBackend("backend.h5") backend.reset(100, 3) blobs_dtype = [("sat_frac", float), ("tracer_den", float), ("bias_effective_tracer", float), ("corr_auto_tracer", (float, len(mock_data)))] sampler = emcee.EnsembleSampler( nwalkers = 100, ndim = 3, log_prob_fn = log_prob, kwargs = { 'param_names': ['hod_params.M_min', 'hod_params.M_1', 'hod_params.alpha'], 'data': (mock_data, mock_ngal), 'model': model, 'derived': ['satellite_fraction', 'mean_tracer_den', 'bias_effective_tracer', 'corr_auto_tracer'], }, pool = Pool(32), blobs_dtype=blobs_dtype, backend=backend ) initialpos = np.array([ fiducial_model.hod.params['M_min'], fiducial_model.hod.params['M_1'], fiducial_model.hod.params['alpha'] ]) + 1e-4 * np.random.normal(size=(sampler.nwalkers, sampler.ndim)) sampler.run_mcmc(initialpos, nsteps=10000, progress=True); flatchain = sampler.get_chain(discard=500, thin=5, flat=True) blobs = sampler.get_blobs(discard=500, thin=5, flat=True) flatchain = np.hstack(( flatchain, np.atleast_2d(blobs['sat_frac']).T, np.atleast_2d(np.log10(blobs['tracer_den'])).T, np.atleast_2d(blobs['bias_effective_tracer']).T )) np.save('flatchain', flatchain) corner.corner( flatchain, labels=[r'$M_{\rm min}$', '$M_1$', r'$\alpha$', r'$f_{\rm sat}$', r'$\log_{10}\bar{n}_g$', r'$b_{\rm eff}$'], quantiles=(0.16, 0.84), show_titles=True, #range=lim, levels=(1-np.exp(-0.5),1-np.exp(-2),1-np.exp(-4)), plot_datapoints=False, plot_density=False, fill_contours=True, color="blue", hist_kwargs={"color":"black"}, smooth=0.5, smooth1d=0.5, truths=[12., 12.8, 1.05, None, None, None], truth_color='darkgray' ); plt.savefig("default_corner.pdf") xi_out = sampler.get_blobs(discard=500, thin=5, flat=True)['corr_auto_tracer'] quantiles = np.quantile(xi_out, [0.16, 0.50, 0.84], axis=0) plt.scatter(model.r, mock_data / quantiles[1]) plt.errorbar(model.r, mock_data / quantiles[1], yerr = 0.2*np.abs(fiducial_model.corr_auto_tracer) / quantiles[1], fmt='none') plt.fill_between(model.r, quantiles[0] / quantiles[1], quantiles[2]/ quantiles[1], alpha=0.3) plt.xscale('log') plt.xlabel("r [Mpc/$h$]", fontsize=14) plt.ylabel(r"$\xi(r) / \hat{\xi}(r)$", fontsize=14); plt.savefig("residuals.pdf") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create Some Mock Data Step2: Now, let's create some mock data with some Gaussian noise Step3: Define a likelihood Step4: Define an emcee-compatible likelihood function Step6: First, we define a small utility function that will take a dictionary in which keys may be dot-paths, and converts it to a nested dictionary Step7: So, this will do the following Step8: This will enable us to pass a list of parameter names that we want updated, which could be parameters of nested models. This means our posterior function is fairly general, and can accept any model parameters to be updated Step9: We can test that the log_prob function works Step10: Notice the derived parameters Step11: On the advice of the emcee documentation, we set up some initial positions of the walkers around the solution. Step12: Now we can plot the posterior in a corner plot, along with the derived parameters, and the true input values Step13: And we're done! The posterior contains the truth to within 1-sigma.
5,817
<ASSISTANT_TASK:> Python Code: from IoTPy.agent_types.simple import f_item def f(item, M, multiples_stream, non_multiples_stream): if item%M: multiples_stream.append(item) else: non_multiples_stream.append(item) x = Stream(name='input stream') y = Stream(name='even numbers in stream x') z = Stream(name='odd numbers in stream x') f_item(func=f, in_stream=x, M=2, multiples_stream=y, non_multiples_stream=z) from IoTPy.agent_types.sink import sink_element from IoTPy.agent_types.simple import f_item # STEP 1: Define function def f(item, M, multiples_stream, non_multiples_stream): if item%M: multiples_stream.append(item) else: non_multiples_stream.append(item) # STEP 2: Declare streams and call f_item x = Stream(name='input stream') y = Stream(name='even numbers in stream x') z = Stream(name='odd numbers in stream x') f_item(func=f, in_stream=x, M=2, multiples_stream=y, non_multiples_stream=z) # STEP 3: test f_item() # Put test values in the input streams. x.extend(list(range(10))) # Execute a step run() # Look at recent values of streams. print ('recent values of stream y are') print (recent_values(y)) print ('recent values of stream z are') print (recent_values(z)) max_and_min = [0, 0] # STEP 1: Define function def g(item, max_and_min, max_stream, min_stream): if item > max_and_min[0]: max_and_min[0] = item max_stream.append(item) if item < max_and_min[1]: max_and_min[1] = item min_stream.append(item) # STEP 2: Declare streams and call f_item x = Stream(name='input stream') y = Stream(name='new maxima') z = Stream(name='new minima') f_item(func=g, in_stream=x, max_and_min=max_and_min, max_stream=y, min_stream=z) # STEP 3: test f_item() # Put test values in the input streams. x.extend([5, 4, 8, -3, -1, 10, -5, 6, 20, -12]) # Execute a step run() # Look at recent values of streams. print ('recent values of stream y are') print (recent_values(y)) print ('recent values of stream z are') print (recent_values(z)) from IoTPy.agent_types.simple import f_window x = Stream('x') y = Stream('y') def g(window, out_stream): out_stream.append(sum(window)) f_window(func=g, in_stream=x, window_size=2, step_size=1, out_stream=y) # Put test values in the input streams. x.extend(list(range(10))) # Execute a step run() # Look at recent values of streams. print ('recent values of stream y are') print (recent_values(y)) from IoTPy.agent_types.simple import join_synch w = Stream(name='w') x = Stream(name='x') y = Stream(name='y') z = Stream(name='z') def h(alist, out_stream): out_stream.append(sum(alist)) join_synch(func=h, in_streams=[w, x, y], out_stream=z) # Put test values in the input streams. w.extend(list(range(100, 110))) x.extend(list(range(0, 20, 2))) y.extend(list(range(5))) # Execute a step run() # Look at recent values of streams. print ('recent values of stream w are') print (recent_values(w)) print ('recent values of stream x are') print (recent_values(x)) print ('recent values of stream y are') print (recent_values(y)) print ('recent values of stream z are') print (recent_values(z)) from IoTPy.agent_types.simple import join_asynch def h(index_item, out_stream): index, item = index_item print (index,': ', item) out_stream.append(item) x = Stream('x') y = Stream('y') z = Stream('z') join_asynch(func=h, in_streams=[x, y], out_stream=z) # Put test values in the input streams. x.extend([10, 11]) y.extend([0, 1, 2]) # Execute a step run() # Look at recent values of streams. print ('recent values of stream z are') print (recent_values(z)) # Put test values in the input streams. x.extend([12, 13, 14]) y.extend([3]) # Execute a step run() # Look at recent values of streams. print ('recent values of stream z are') print (recent_values(z)) from IoTPy.agent_types.simple import join_timed def f(timestamped_list): print (timestamped_list) x = Stream(name='x') y = Stream(name='y') join_timed(func=f, in_streams=[x, y]) # Put test values in the input streams. x.extend([[1, 'x[0]'], [3, 'x[1]']]) y.extend([[3, 'y[0]'], [5, 'y[2]'], [5, 'y[3]']]) # Execute a step run() # Put test values in the input streams. x.append([4, 'x[2]']) run() x.append([5, 'x[3]']) run() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Second step Step2: Third step Step3: ANOTHER EXAMPLE of f_item Step4: SLIDING WINDOWS OF STREAMS Step5: Synchronous Join Step6: Asynchronous Join Step7: Time-based Join
5,818
<ASSISTANT_TASK:> Python Code: from abc import ABC, abstractmethod from collections import namedtuple Customer = namedtuple('Customer', 'name fidelity') class LineItem: def __init__(self, product, quantity, price): self.product = product self.quantity = quantity self.price = price def total(self): return self.price * self.quantity class Order: #上下文 def __init__(self, customer, cart, promotion = None): self.customer = customer self.cart = cart self.promotion = promotion def total(self): if not hasattr(self, '__total'): self.__total = sum(item.total() for item in self.cart) return self.__total def due(self): if self.promotion is None: discount = 0 else: discount = self.promotion.discount(self) return self.total() - discount def __repr__(self): fmt = '<Order total: {:.2f} due {:.2f}>' return fmt.format(self.total(), self.due()) class Promotion(ABC): @abstractmethod def discount(self, order): '''返回折扣金额(正值)''' class FidelityPromo(Promotion): '''为积分为 1000 或以上的顾客提供 5% 折扣''' def discount(self, order): return order.total() * .05 if order.customer.fidelity >= 1000 else 0 class BulkItemPromo(Promotion): '''单个商品为 20 个或以上时提供 %10 折扣''' def discount(self, order): discount = 0 for item in order.cart: if item.quantity >= 20: discount += item.total() * .1 return discount class LargeOrderPromo(Promotion): '''订单中的不同商品达到 10 个或以上时提供 %7 折扣''' def discount(self, order): distinct_items = {item.product for item in order.cart} if len(distinct_items) >= 10: return order.total() * 0.07 return 0 joe = Customer('John Doe', 0) ann = Customer('Ann Smith', 1100) # joe 积分是 0,ann 积分是 1100 cart = [LineItem('banana', 4, .5), #有 3 个商品购物车 LineItem('apple', 10, 1.5), LineItem('watermellon', 5, 5.0)] Order(joe, cart, FidelityPromo()) # fidelityPromo 没有给 joe 提供折扣 Order(ann, cart, FidelityPromo()) # ann 得到了 5% 的折扣,因为他积分大于 1000 banana_cart = [LineItem('banana', 30, .5), # 30 个香蕉和 10 个苹果 LineItem('apple', 10, 1.5)] Order(joe, banana_cart, BulkItemPromo()) # BulkItemPromo 为 joe 购买的香蕉优惠了 1.5 元 long_order = [LineItem(str(item_code), 1, 1.0) for item_code in range(10)] # 构造 10 种不同的商品 Order(joe, long_order, LargeOrderPromo()) # LargeOrderPromo 为 joe 的整个订单提供了 7% 的折扣 Order(joe, cart, LargeOrderPromo()) # from abc import ABC, abstractmethod from collections import namedtuple Customer = namedtuple('Customer', 'name fidelity') class LineItem: def __init__(self, product, quantity, price): self.product = product self.quantity = quantity self.price = price def total(self): return self.price * self.quantity class Order: #上下文 def __init__(self, customer, cart, promotion = None): self.customer = customer self.cart = cart self.promotion = promotion def total(self): if not hasattr(self, '__total'): self.__total = sum(item.total() for item in self.cart) return self.__total def due(self): if self.promotion is None: discount = 0 else: discount = self.promotion(self) # 这里修改了直接调用函数 return self.total() - discount def __repr__(self): fmt = '<Order total: {:.2f} due {:.2f}>' return fmt.format(self.total(), self.due()) def fidelity_promo(order): '''为积分为 1000 或以上的顾客提供 5% 折扣''' return order.total() * .05 if order.customer.fidelity >= 1000 else 0 def bulk_item_promo(order): '''单个商品为 20 个或以上时提供 %10 折扣''' discount = 0 for item in order.cart: if item.quantity >= 20: discount += item.total() * .1 return discount def large_order_promo(order): '''订单中的不同商品达到 10 个或以上时提供 %7 折扣''' distinct_items = {item.product for item in order.cart} if len(distinct_items) >= 10: return order.total() * 0.07 return 0 joe = Customer('John Doe', 0) ann = Customer('Ann Smith', 1100) # joe 积分是 0,ann 积分是 1100 cart = [LineItem('banana', 4, .5), #有 3 个商品购物车 LineItem('apple', 10, 1.5), LineItem('watermellon', 5, 5.0)] Order(joe, cart, fidelity_promo) # fidelityPromo 没有给 joe 提供折扣 Order(ann, cart, fidelity_promo) # ann 得到了 5% 的折扣,因为他积分大于 1000 banana_cart = [LineItem('banana', 30, .5), # 30 个香蕉和 10 个苹果 LineItem('apple', 10, 1.5)] Order(joe, banana_cart, bulk_item_promo) # BulkItemPromo 为 joe 购买的香蕉优惠了 1.5 元 long_order = [LineItem(str(item_code), 1, 1.0) for item_code in range(10)] # 构造 10 种不同的商品 Order(joe, long_order, large_order_promo) # LargeOrderPromo 为 joe 的整个订单提供了 7% 的折扣 Order(joe, cart, large_order_promo) # promos = [fidelity_promo, bulk_item_promo, large_order_promo] def best_promo(order): return max(promo(order) for promo in promos) Order(joe, long_order, best_promo) Order(joe, banana_cart, best_promo) Order(ann, cart, best_promo) promos = [globals()[name] for name in globals() if name.endswith('_promo') and name != 'best_promo'] def best_promo(order): '''选择可用的最佳折扣''' return max(promo(order) for promo in promos) import inspect import promotions promos = [func for name, func in inspect.getmembers(promotions, inspect.isfunction)] print(promos) def best_promo(order): '''选择最佳折扣''' return max(promo(order) for promo in promos) class MacroCommand: '''一个执行一组命令的命令''' def __init__(self, commands): self.commands = list(commands) # 1 def __call__(self): for command in self.commands: # 2 command() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Python 3.4 中,声明抽象基类的最简单方式是子类化 abc.ABC。我们的例子就是这么做的,从 Python 3.0 到 Python 3.3,必须在 class 语句使用 metaclas = 关键字 Step2: 用函数实现 “策略” 模式 Step3: 新的 Order 类使用更加简单,如下所示: Step4: 看到测试结果一样,并且简单了一些 Step5: 上面例子虽然可用且容易阅读,但是有些重复可能导致不易察觉的缺陷,若想添加新的促销策略,不仅要定义相应的函数,而且还要把它添到 promos 列表,我们会在接下来改进它 Step6: 另一个可行的方法是将所有的策略函数都存放在一个单独的模块中,除了 best_promo,这里我们将 3 个策略函数存放在了 promotions.py 中 Step7: inspect.getmembers 函数用户获取对象(这里是 promotions 模块)的属性,第二个参数是可选的判断条件(一个布尔值函数)。我们使用的是 inspect.isfunction,只获取模块中的函数
5,819
<ASSISTANT_TASK:> Python Code: baseDir = '/home/nick/notebook/SIPSim/dev/priming_exp/' workDir = os.path.join(baseDir, 'exp_info') otuTableFile = '/var/seq_data/priming_exp/data/otu_table.txt' otuTableSumFile = '/var/seq_data/priming_exp/data/otu_table_summary.txt' metaDataFile = '/var/seq_data/priming_exp/data/allsample_metadata_nomock.txt' #otuRepFile = '/var/seq_data/priming_exp/otusn.pick.fasta' #otuTaxFile = '/var/seq_data/priming_exp/otusn_tax/otusn_tax_assignments.txt' #genomeDir = '/home/nick/notebook/SIPSim/dev/bac_genome1210/genomes/' import glob %load_ext rpy2.ipython %%R library(ggplot2) library(dplyr) library(tidyr) library(gridExtra) library(fitdistrplus) if not os.path.isdir(workDir): os.makedirs(workDir) %%R -i otuTableFile tbl = read.delim(otuTableFile, sep='\t') # filter tbl = tbl %>% select(ends_with('.NA')) tbl %>% ncol %>% print tbl[1:4,1:4] %%R tbl.h = tbl %>% gather('sample', 'count', 1:ncol(tbl)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) tbl.h %>% head %%R -w 900 -h 400 tbl.h.s = tbl.h %>% group_by(sample) %>% summarize(total_count = sum(count)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) ggplot(tbl.h.s, aes(day, total_count, color=rep %>% as.character)) + geom_point() + facet_grid(isotope ~ treatment) + theme( text = element_text(size=16) ) %%R tbl.h.s$sample[grepl('700', tbl.h.s$sample)] %>% as.vector %>% sort %%R # bulk soil samples for gradients to simulate samples.to.use = c( "X12C.700.14.05.NA", "X12C.700.28.03.NA", "X12C.700.45.01.NA", "X13C.700.14.08.NA", "X13C.700.28.06.NA", "X13C.700.45.01.NA" ) %%R -i otuTableFile tbl = read.delim(otuTableFile, sep='\t') # filter tbl = tbl %>% select(ends_with('.NA')) tbl$OTUId = rownames(tbl) tbl %>% ncol %>% print tbl[1:4,1:4] %%R tbl.h = tbl %>% gather('sample', 'count', 1:(ncol(tbl)-1)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) tbl.h %>% head %%R -w 800 tbl.s = tbl.h %>% filter(count > 0) %>% group_by(sample, isotope, treatment, day, rep, fraction) %>% summarize(n_taxa = n()) ggplot(tbl.s, aes(day, n_taxa, color=rep %>% as.character)) + geom_point() + facet_grid(isotope ~ treatment) + theme_bw() + theme( text = element_text(size=16), axis.text.x = element_blank() ) %%R -w 800 -h 350 # filter to just target samples tbl.s.f = tbl.s %>% filter(sample %in% samples.to.use) ggplot(tbl.s.f, aes(day, n_taxa, fill=rep %>% as.character)) + geom_bar(stat='identity') + facet_grid(. ~ isotope) + labs(y = 'Number of taxa') + theme_bw() + theme( text = element_text(size=16), axis.text.x = element_blank() ) %%R message('Bulk soil total observed richness: ') tbl.s.f %>% select(-fraction) %>% as.data.frame %>% print %%R -i otuTableFile # loading OTU table tbl = read.delim(otuTableFile, sep='\t') %>% select(-ends_with('.NA')) tbl.h = tbl %>% gather('sample', 'count', 2:ncol(tbl)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) tbl.h %>% head %%R # basename of fractions samples.to.use.base = gsub('\\.[0-9]+\\.NA', '', samples.to.use) samps = tbl.h$sample %>% unique fracs = sapply(samples.to.use.base, function(x) grep(x, samps, value=TRUE)) for (n in names(fracs)){ n.frac = length(fracs[[n]]) cat(n, '-->', 'Number of fraction samples: ', n.frac, '\n') } %%R # function for getting all OTUs in a sample n.OTUs = function(samples, otu.long){ otu.long.f = otu.long %>% filter(sample %in% samples, count > 0) n.OTUs = otu.long.f$OTUId %>% unique %>% length return(n.OTUs) } num.OTUs = lapply(fracs, n.OTUs, otu.long=tbl.h) num.OTUs = do.call(rbind, num.OTUs) %>% as.data.frame colnames(num.OTUs) = c('n_taxa') num.OTUs$sample = rownames(num.OTUs) num.OTUs %%R tbl.s.f %>% as.data.frame %%R # joining with bulk soil sample summary table num.OTUs$data = 'fractions' tbl.s.f$data = 'bulk_soil' tbl.j = rbind(num.OTUs, tbl.s.f %>% ungroup %>% select(sample, n_taxa, data)) %>% mutate(isotope = gsub('X|\\..+', '', sample), sample = gsub('\\.[0-9]+\\.NA', '', sample)) tbl.j %%R -h 300 -w 800 ggplot(tbl.j, aes(sample, n_taxa, fill=data)) + geom_bar(stat='identity', position='dodge') + facet_grid(. ~ isotope, scales='free_x') + labs(y = 'Number of OTUs') + theme( text = element_text(size=16) # axis.text.x = element_text(angle=90) ) %%R -i otuTableFile tbl = read.delim(otuTableFile, sep='\t') # filter tbl = tbl %>% select(-ends_with('.NA')) tbl %>% ncol %>% print tbl[1:4,1:4] %%R tbl.h = tbl %>% gather('sample', 'count', 2:ncol(tbl)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) tbl.h %>% head %%R -h 400 tbl.h.s = tbl.h %>% group_by(sample) %>% summarize(total_seqs = sum(count)) p = ggplot(tbl.h.s, aes(total_seqs)) + theme_bw() + theme( text = element_text(size=16) ) p1 = p + geom_histogram(binwidth=200) p2 = p + geom_density() grid.arrange(p1,p2,ncol=1) %%R -w 700 -h 350 plotdist(tbl.h.s$total_seqs) %%R -w 450 -h 400 descdist(tbl.h.s$total_seqs, boot=1000) %%R f.n = fitdist(tbl.h.s$total_seqs, 'norm') f.ln = fitdist(tbl.h.s$total_seqs, 'lnorm') f.ll = fitdist(tbl.h.s$total_seqs, 'logis') #f.c = fitdist(tbl.s$count, 'cauchy') f.list = list(f.n, f.ln, f.ll) plot.legend = c('normal', 'log-normal', 'logistic') par(mfrow = c(2,1)) denscomp(f.list, legendtext=plot.legend) qqcomp(f.list, legendtext=plot.legend) %%R gofstat(list(f.n, f.ln, f.ll), fitnames=plot.legend) %%R summary(f.ln) %%R -i otuTableFile tbl = read.delim(otuTableFile, sep='\t') # filter tbl = tbl %>% select(-ends_with('.NA')) %>% select(-starts_with('X0MC')) tbl = tbl %>% gather('sample', 'count', 2:ncol(tbl)) %>% mutate(sample = gsub('^X', '', sample)) tbl %>% head %%R # summarize tbl.s = tbl %>% group_by(sample) %>% summarize(total_count = sum(count)) tbl.s %>% head(n=3) %%R -i metaDataFile tbl.meta = read.delim(metaDataFile, sep='\t') tbl.meta %>% head(n=3) %%R -w 700 tbl.j = inner_join(tbl.s, tbl.meta, c('sample' = 'Sample')) ggplot(tbl.j, aes(Density, total_count, color=rep)) + geom_point() + facet_grid(Treatment ~ Day) %%R -w 600 -h 350 ggplot(tbl.j, aes(Density, total_count)) + geom_point(aes(color=Treatment)) + geom_smooth(method='lm') + labs(x='Buoyant density', y='Total sequences') + theme_bw() + theme( text = element_text(size=16) ) %%R tbl.s = tbl %>% filter(count > 0) %>% group_by(sample) %>% summarize(n_taxa = sum(count > 0)) tbl.j = inner_join(tbl.s, tbl.meta, c('sample' = 'Sample')) tbl.j %>% head(n=3) %%R -w 900 -h 600 ggplot(tbl.j, aes(Density, n_taxa, fill=rep, color=rep)) + #geom_area(stat='identity', alpha=0.5, position='dodge') + geom_point() + geom_line() + labs(x='Buoyant density', y='Number of taxa') + facet_grid(Treatment ~ Day) + theme_bw() + theme( text = element_text(size=16), legend.position = 'none' ) %%R -i otuTableFile # loading OTU table tbl = read.delim(otuTableFile, sep='\t') # filter tbl = tbl %>% select(matches('OTUId'), ends_with('.NA')) tbl %>% ncol %>% print tbl[1:4,1:4] %%R # long table format w/ selecting samples of interest tbl.h = tbl %>% gather('sample', 'count', 2:ncol(tbl)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) %>% filter(sample %in% samples.to.use, count > 0) tbl.h %>% head %%R message('Number of samples: ', tbl.h$sample %>% unique %>% length) message('Number of OTUs: ', tbl.h$OTUId %>% unique %>% length) %%R tbl.hs = tbl.h %>% group_by(OTUId) %>% summarize( total_count = sum(count), mean_count = mean(count), median_count = median(count), sd_count = sd(count) ) %>% filter(total_count > 0) tbl.hs %>% head %%R -i workDir setwd(workDir) samps = tbl.h$sample %>% unique %>% as.vector for(samp in samps){ outFile = paste(c(samp, 'OTU.txt'), collapse='_') tbl.p = tbl.h %>% filter(sample == samp, count > 0) write.table(tbl.p, outFile, sep='\t', quote=F, row.names=F) message('Table written: ', outFile) message(' Number of OTUs: ', tbl.p %>% nrow) } p = os.path.join(workDir, '*_OTU.txt') files = glob.glob(p) baseDir = os.path.split(workDir)[0] newDirs = [os.path.split(x)[1].rstrip('.NA_OTU.txt') for x in files] newDirs = [os.path.join(baseDir, x) for x in newDirs] for newDir,f in zip(newDirs, files): if not os.path.isdir(newDir): print 'Making new directory: {}'.format(newDir) os.makedirs(newDir) else: print 'Directory exists: {}'.format(newDir) # symlinking file linkPath = os.path.join(newDir, os.path.split(f)[1]) if not os.path.islink(linkPath): os.symlink(f, linkPath) %%R -i otuTableFile tbl = read.delim(otuTableFile, sep='\t') # filter tbl = tbl %>% select(matches('OTUId'), ends_with('.NA')) tbl %>% ncol %>% print tbl[1:4,1:4] %%R # long table format w/ selecting samples of interest tbl.h = tbl %>% gather('sample', 'count', 2:ncol(tbl)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) %>% filter(sample %in% samples.to.use, count > 0) tbl.h %>% head %%R # ranks of relative abundances tbl.r = tbl.h %>% group_by(sample) %>% mutate(perc_rel_abund = count / sum(count) * 100, rank = row_number(-perc_rel_abund)) %>% unite(day_rep, day, rep, sep='-') tbl.r %>% as.data.frame %>% head(n=3) %%R -w 900 -h 350 ggplot(tbl.r, aes(rank, perc_rel_abund)) + geom_point() + # labs(x='Buoyant density', y='Number of taxa') + facet_wrap(~ day_rep) + theme_bw() + theme( text = element_text(size=16), legend.position = 'none' ) %%R -i otuTableFile tbl = read.delim(otuTableFile, sep='\t') # filter tbl = tbl %>% select(-ends_with('.NA')) %>% select(-starts_with('X0MC')) tbl = tbl %>% gather('sample', 'count', 2:ncol(tbl)) %>% mutate(sample = gsub('^X', '', sample)) tbl %>% head %%R tbl.ar = tbl %>% #mutate(fraction = gsub('.+\\.', '', sample) %>% as.numeric) %>% #mutate(treatment = gsub('(.+)\\..+', '\\1', sample)) %>% group_by(sample) %>% mutate(rel_abund = count / sum(count)) %>% summarize(abund_range = max(rel_abund) - min(rel_abund)) %>% ungroup() %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) tbl.ar %>% head(n=3) %%R -w 800 tbl.ar = tbl.ar %>% mutate(fraction = as.numeric(fraction)) ggplot(tbl.ar, aes(fraction, abund_range, fill=rep, color=rep)) + geom_point() + geom_line() + labs(x='Buoyant density', y='relative abundanc range') + facet_grid(treatment ~ day) + theme_bw() + theme( text = element_text(size=16), legend.position = 'none' ) %%R -i otuTableFile # loading OTU table tbl = read.delim(otuTableFile, sep='\t') %>% select(-ends_with('.NA')) tbl.h = tbl %>% gather('sample', 'count', 2:ncol(tbl)) %>% separate(sample, c('isotope','treatment','day','rep','fraction'), sep='\\.', remove=F) tbl.h %>% head %%R # basename of fractions samples.to.use.base = gsub('\\.[0-9]+\\.NA', '', samples.to.use) samps = tbl.h$sample %>% unique fracs = sapply(samples.to.use.base, function(x) grep(x, samps, value=TRUE)) for (n in names(fracs)){ n.frac = length(fracs[[n]]) cat(n, '-->', 'Number of fraction samples: ', n.frac, '\n') } %%R # function for getting mean OTU abundance from all fractions OTU.abund = function(samples, otu.long){ otu.rel.abund = otu.long %>% filter(sample %in% samples, count > 0) %>% ungroup() %>% group_by(sample) %>% mutate(total_count = sum(count)) %>% ungroup() %>% mutate(perc_abund = count / total_count * 100) %>% group_by(OTUId) %>% summarize(mean_perc_abund = mean(perc_abund), median_perc_abund = median(perc_abund), max_perc_abund = max(perc_abund)) return(otu.rel.abund) } ## calling function otu.rel.abund = lapply(fracs, OTU.abund, otu.long=tbl.h) otu.rel.abund = do.call(rbind, otu.rel.abund) %>% as.data.frame otu.rel.abund$sample = gsub('\\.[0-9]+$', '', rownames(otu.rel.abund)) otu.rel.abund %>% head %%R -h 600 -w 900 # plotting otu.rel.abund.l = otu.rel.abund %>% gather('abund_stat', 'value', mean_perc_abund, median_perc_abund, max_perc_abund) otu.rel.abund.l$OTUId = reorder(otu.rel.abund.l$OTUId, -otu.rel.abund.l$value) ggplot(otu.rel.abund.l, aes(OTUId, value, color=abund_stat)) + geom_point(shape='O', alpha=0.7) + scale_y_log10() + facet_grid(abund_stat ~ sample) + theme_bw() + theme( text = element_text(size=16), axis.text.x = element_blank(), legend.position = 'none' ) %%R -i workDir setwd(workDir) # each sample is a file samps = otu.rel.abund.l$sample %>% unique %>% as.vector for(samp in samps){ outFile = paste(c(samp, 'frac_OTU.txt'), collapse='_') tbl.p = otu.rel.abund %>% filter(sample == samp, mean_perc_abund > 0) write.table(tbl.p, outFile, sep='\t', quote=F, row.names=F) cat('Table written: ', outFile, '\n') cat(' Number of OTUs: ', tbl.p %>% nrow, '\n') } <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Init Step2: Loading OTU table (filter to just bulk samples) Step3: Which gradient(s) to simulate? Step4: Notes Step5: Total richness of starting (bulk-soil) community Step6: Number of taxa in all fractions corresponding to each bulk soil sample Step7: Distribution of total sequences per fraction Step8: Distribution fitting Step9: Notes Step10: Loading metadata Step11: Determining association Step12: Number of taxa along the gradient Step13: Notes Step14: For each sample, writing a table of OTU_ID and count Step15: Making directories for simulations Step16: Rank-abundance distribution for each sample Step17: Taxon abundance range for each sample-fraction Step18: Total abundance of each target taxon Step19: For each sample, writing a table of OTU_ID and count
5,820
<ASSISTANT_TASK:> Python Code: # Importing pandas and numpy import pandas as pd import numpy as np # Reading the csv file into a pandas DataFrame data = pd.read_csv('student_data.csv') # Printing out the first 10 rows of our data data[:10] # Importing matplotlib import matplotlib.pyplot as plt # Function to help us plot def plot_points(data): X = np.array(data[["gre","gpa"]]) y = np.array(data["admit"]) admitted = X[np.argwhere(y==1)] rejected = X[np.argwhere(y==0)] plt.scatter([s[0][0] for s in rejected], [s[0][1] for s in rejected], s = 25, color = 'red', edgecolor = 'k') plt.scatter([s[0][0] for s in admitted], [s[0][1] for s in admitted], s = 25, color = 'cyan', edgecolor = 'k') plt.xlabel('Test (GRE)') plt.ylabel('Grades (GPA)') # Plotting the points plot_points(data) plt.show() # Separating the ranks data_rank1 = data[data["rank"]==1] data_rank2 = data[data["rank"]==2] data_rank3 = data[data["rank"]==3] data_rank4 = data[data["rank"]==4] # Plotting the graphs plot_points(data_rank1) plt.title("Rank 1") plt.show() plot_points(data_rank2) plt.title("Rank 2") plt.show() plot_points(data_rank3) plt.title("Rank 3") plt.show() plot_points(data_rank4) plt.title("Rank 4") plt.show() # TODO: Make dummy variables for rank one_hot_data = pass # TODO: Drop the previous rank column one_hot_data = pass # Print the first 10 rows of our data one_hot_data[:10] # Making a copy of our data processed_data = one_hot_data[:] # TODO: Scale the columns # Printing the first 10 rows of our procesed data processed_data[:10] sample = np.random.choice(processed_data.index, size=int(len(processed_data)*0.9), replace=False) train_data, test_data = processed_data.iloc[sample], processed_data.drop(sample) print("Number of training samples is", len(train_data)) print("Number of testing samples is", len(test_data)) print(train_data[:10]) print(test_data[:10]) features = train_data.drop('admit', axis=1) targets = train_data['admit'] features_test = test_data.drop('admit', axis=1) targets_test = test_data['admit'] print(features[:10]) print(targets[:10]) # Activation (sigmoid) function def sigmoid(x): return 1 / (1 + np.exp(-x)) def sigmoid_prime(x): return sigmoid(x) * (1-sigmoid(x)) def error_formula(y, output): return - y*np.log(output) - (1 - y) * np.log(1-output) # TODO: Write the error term formula def error_term_formula(y, output): pass # Neural Network hyperparameters epochs = 1000 learnrate = 0.5 # Training function def train_nn(features, targets, epochs, learnrate): # Use to same seed to make debugging easier np.random.seed(42) n_records, n_features = features.shape last_loss = None # Initialize weights weights = np.random.normal(scale=1 / n_features**.5, size=n_features) for e in range(epochs): del_w = np.zeros(weights.shape) for x, y in zip(features.values, targets): # Loop through all records, x is the input, y is the target # Activation of the output unit # Notice we multiply the inputs and the weights here # rather than storing h as a separate variable output = sigmoid(np.dot(x, weights)) # The error, the target minus the network output error = error_formula(y, output) # The error term # Notice we calulate f'(h) here instead of defining a separate # sigmoid_prime function. This just makes it faster because we # can re-use the result of the sigmoid function stored in # the output variable error_term = error_term_formula(y, output) # The gradient descent step, the error times the gradient times the inputs del_w += error_term * x # Update the weights here. The learning rate times the # change in weights, divided by the number of records to average weights += learnrate * del_w / n_records # Printing out the mean square error on the training set if e % (epochs / 10) == 0: out = sigmoid(np.dot(features, weights)) loss = np.mean((out - targets) ** 2) print("Epoch:", e) if last_loss and last_loss < loss: print("Train loss: ", loss, " WARNING - Loss Increasing") else: print("Train loss: ", loss) last_loss = loss print("=========") print("Finished training!") return weights weights = train_nn(features, targets, epochs, learnrate) # Calculate accuracy on test data tes_out = sigmoid(np.dot(features_test, weights)) predictions = tes_out > 0.5 accuracy = np.mean(predictions == targets_test) print("Prediction accuracy: {:.3f}".format(accuracy)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Plotting the data Step2: Roughly, it looks like the students with high scores in the grades and test passed, while the ones with low scores didn't, but the data is not as nicely separable as we hoped it would. Maybe it would help to take the rank into account? Let's make 4 plots, each one for each rank. Step3: This looks more promising, as it seems that the lower the rank, the higher the acceptance rate. Let's use the rank as one of our inputs. In order to do this, we should one-hot encode it. Step4: TODO Step5: Splitting the data into Training and Testing Step6: Splitting the data into features and targets (labels) Step7: Training the 2-layer Neural Network Step8: TODO Step9: Calculating the Accuracy on the Test Data
5,821
<ASSISTANT_TASK:> Python Code: import numpy as np from scipy.stats import powerlaw import scipy as sp import seaborn as sns sns.set() %matplotlib inline edges =[] for line in open('facebook_combined.txt'): if line[0] != '#': # print(line.replace('\n','').split(' ')) # \n es salto de linea, .split(' ') -> separar por espacio, .split('\t') -> si esta separado por tabulación d = line.replace('\n','').split(' ') edges.append((d[0],d[1])) #print(edges) import networkx as nx G = nx.Graph() # G = nx.Graph(edges), otro modo de crear el grafo G.add_edges_from(edges) degrees = [degree for _, degree in G.degree().items()] # print(degrees) sns.distplot(degrees) e, l, s = sp.stats.powerlaw.fit(degrees) e, l, s ax = sns.distplot(sp.stats.powerlaw.rvs(e, l, s, size=100000)) import matplotlib.pyplot as plt log = np.log(degrees) plt.hist(log, log=True) a,b,l,s = sp.stats.fit(r) (a,b,l,s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Generative Network Model
5,822
<ASSISTANT_TASK:> Python Code:: import numpy as np import gpt_2_simple as gpt2 from datetime import datetime from google.colab import files from tensorflow.python.framework import ops gpt2.download_gpt2(model_name="124M") from transformers import GPT2Tokenizer tokenizer = GPT2Tokenizer.from_pretrained("gpt2") sess = gpt2.start_tf_sess() gpt2.finetune(sess, dataset= file_name, model_name=model_size, steps=200, restore_from='fresh',run_name = run_name,print_every=10,sample_every=50,save_every=50,learning_rate=0.0007) ops.reset_default_graph() sess = gpt2.start_tf_sess() gpt2.load_gpt2(sess, run_name=run_name) gpt2.generate(sess, run_name=run_name, temperature=.7, length=100, prefix=None, top_k=40, nsamples=10) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
5,823
<ASSISTANT_TASK:> Python Code: from tvb.simulator.lab import * LOG.info("Configuring...") #Initialize a Model, Coupling, and Connectivity. oscillator = models.Generic2dOscillator() white_matter = connectivity.Connectivity.from_file("connectivity_96.zip") white_matter.speed = numpy.array([4.0]) white_matter_coupling = coupling.Linear(a=0.0126) #Initialise an Integrator heunint = integrators.HeunDeterministic(dt=2 ** -4) #Initialise some Monitors with period in physical time momo = monitors.Raw() mama = monitors.TemporalAverage(period=2 ** -2) #Bundle them what_to_watch = (momo, mama) #Define the stimulus #Specify a weighting for regions to receive stimuli... white_matter.configure() nodes = [0, 7, 13, 33, 42] weighting = numpy.zeros((white_matter.number_of_regions,)) weighting[nodes] = numpy.array([2.0 ** -2, 2.0 ** -3, 2.0 ** -4, 2.0 ** -5, 2.0 ** -6]) eqn_t = equations.Gaussian() eqn_t.parameters["midpoint"] = 16.0 stimulus = patterns.StimuliRegion(temporal=eqn_t, connectivity=white_matter, weight=weighting) #Initialise Simulator -- Model, Connectivity, Integrator, Monitors, and stimulus. sim = simulator.Simulator(model=oscillator, connectivity=white_matter, coupling=white_matter_coupling, integrator=heunint, monitors=what_to_watch, stimulus=stimulus) sim.configure() #Clear the initial transient, so that the effect of the stimulus is clearer. #NOTE: this is ignored, stimuli are defined relative to each simulation call. LOG.info("Initial integration to clear transient...") for _, _ in sim(simulation_length=128): pass LOG.info("Starting simulation...") #Perform the simulation raw_data = [] raw_time = [] tavg_data = [] tavg_time = [] for raw, tavg in sim(simulation_length=64): if not raw is None: raw_time.append(raw[0]) raw_data.append(raw[1]) if not tavg is None: tavg_time.append(tavg[0]) tavg_data.append(tavg[1]) LOG.info("Finished simulation.") #Plot defaults in a few combinations #Plot the stimulus plot_pattern(sim.stimulus) #Make the lists numpy.arrays for easier use. RAW = numpy.array(raw_data) TAVG = numpy.array(tavg_data) #Plot raw time series figure(1) plot(raw_time, RAW[:, 0, :, 0]) title("Raw -- State variable 0") figure(2) plot(raw_time, RAW[:, 1, :, 0]) title("Raw -- State variable 1") #Plot temporally averaged time series figure(3) plot(tavg_time, TAVG[:, 0, :, 0]) title("Temporal average") #Show them show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Perform the simulation Step2: Plot pretty pictures of what we just did
5,824
<ASSISTANT_TASK:> Python Code: !pip install git+https://github.com/google/starthinker from starthinker.util.configuration import Configuration CONFIG = Configuration( project="", client={}, service={}, user="/content/user.json", verbose=True ) FIELDS = { 'auth_read':'user', # Credentials used for reading data. 'email':'', # Email address report was sent to. 'subject':'.*', # Regular expression to match subject. Double escape backslashes. 'dataset':'', # Existing dataset in BigQuery. 'table':'', # Name of table to be written to. 'dbm_schema':'[]', # Schema provided in JSON list format or empty list. 'is_incremental_load':False, # Append report data to table based on date column, de-duplicates. } print("Parameters Set To: %s" % FIELDS) from starthinker.util.configuration import execute from starthinker.util.recipe import json_set_fields TASKS = [ { 'email':{ 'auth':{'field':{'name':'auth_read','kind':'authentication','order':1,'default':'user','description':'Credentials used for reading data.'}}, 'read':{ 'from':'noreply-dv360@google.com', 'to':{'field':{'name':'email','kind':'string','order':1,'default':'','description':'Email address report was sent to.'}}, 'subject':{'field':{'name':'subject','kind':'string','order':2,'default':'.*','description':'Regular expression to match subject. Double escape backslashes.'}}, 'link':'https://storage.googleapis.com/.*', 'attachment':'.*' }, 'write':{ 'bigquery':{ 'dataset':{'field':{'name':'dataset','kind':'string','order':3,'default':'','description':'Existing dataset in BigQuery.'}}, 'table':{'field':{'name':'table','kind':'string','order':4,'default':'','description':'Name of table to be written to.'}}, 'schema':{'field':{'name':'dbm_schema','kind':'json','order':5,'default':'[]','description':'Schema provided in JSON list format or empty list.'}}, 'header':True, 'is_incremental_load':{'field':{'name':'is_incremental_load','kind':'boolean','order':6,'default':False,'description':'Append report data to table based on date column, de-duplicates.'}} } } } } ] json_set_fields(TASKS, FIELDS) execute(CONFIG, TASKS, force=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2. Set Configuration Step2: 3. Enter DV360 Report Emailed To BigQuery Recipe Parameters Step3: 4. Execute DV360 Report Emailed To BigQuery
5,825
<ASSISTANT_TASK:> Python Code: primeNumbers = [2, 3, 5, 7] for prime in primeNumbers: print(prime) for x in range(5): print(x) for x in range(3, 6): print(x) numbers = [ 951, 402, 984, 651, 360, 69, 408, 319, 601, 485, 980, 507, 725, 547, 544, 615, 83, 165, 141, 501, 263, 617, 865, 575, 219, 390, 984, 592, 236, 105, 942, 941, 386, 462, 47, 418, 907, 344, 236, 375, 823, 566, 597, 978, 328, 615, 953, 345, 399, 162, 758, 219, 918, 237, 412, 566, 826, 248, 866, 950, 626, 949, 687, 217, 815, 67, 104, 58, 512, 24, 892, 894, 767, 553, 81, 379, 843, 831, 445, 742, 717, 958, 609, 842, 451, 688, 753, 854, 685, 93, 857, 440, 380, 126, 721, 328, 753, 470, 743, 527 ] # Hier kommt Dein Code: for number in numbers: if number%2 == 0 and number < 237: print(number) #Lösung: added = 0 for number in numbers: added += number print(added) #Lösung: new_list = [] for elem in numbers: if elem%2 == 0: new_list.append(elem) sum(new_list) for i in range(5): print("Hello World") #Lösung l=[] for i in range(2000, 3200): if (i%7==0) and (i%5!=0): l.append(str(i)) print(','.join(l)) lst = range(45,99) lst = list(lst) index = 0 print(lst) for number in lst: lst[index] = str(number) index += 1 new_list = [] for elem in lst: if '4' in elem: elem = elem.replace('4', 'A') if '5' in elem: elem = elem.replace('5', 'B') new_list.append(elem) newnewlist <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2.Drucke alle die Zahlen von 0 bis 4 aus Step2: 3.Drucke die Zahlen 3,4,5 aus Step3: 4.Baue einen For-Loop, indem Du alle geraden Zahlen ausdruckst, die tiefer sind als 237. Step4: 5.Addiere alle Zahlen in der Liste Step5: 6.Addiere nur die Zahlen, die gerade sind Step6: 7.Drucke mit einem For Loop 5 Mal hintereinander Hello World aus Step7: 8.Entwickle ein Programm, das alle Nummern zwischen 2000 und 3200 findet, die durch 7, aber nicht durch 5 teilbar sind. Das Ergebnis sollte auf einer Zeile ausgedruckt werden. Tipp Step8: 9.Schreibe einen For Loop, der die Nummern in der folgenden Liste von int in str verwandelt. Step9: 10.Schreibe nun ein Programm, das alle Ziffern 4 mit dem Buchstaben A ersetzte, alle Ziffern 5 mit dem Buchtaben B.
5,826
<ASSISTANT_TASK:> Python Code: import helper data_dir = './data/simpsons/moes_tavern_lines.txt' text = helper.load_data(data_dir) # Ignore notice, since we don't use it for analysing the data text = text[81:] view_sentence_range = (20, 30) import numpy as np print('Dataset Stats') print('Roughly the number of unique words: {}'.format(len({word: None for word in text.split()}))) scenes = text.split('\n\n') print('Number of scenes: {}'.format(len(scenes))) sentence_count_scene = [scene.count('\n') for scene in scenes] print('Average number of sentences in each scene: {}'.format(np.average(sentence_count_scene))) sentences = [sentence for scene in scenes for sentence in scene.split('\n')] print('Number of lines: {}'.format(len(sentences))) word_count_sentence = [len(sentence.split()) for sentence in sentences] print('Average number of words in each line: {}'.format(np.average(word_count_sentence))) print() print('The sentences {} to {}:'.format(*view_sentence_range)) print('\n'.join(text.split('\n')[view_sentence_range[0]:view_sentence_range[1]])) import numpy as np import common import problem_unittests as tests def create_lookup_tables(text): Create lookup tables for vocabulary :param text: The text of tv scripts split into words :return: A tuple of dicts (vocab_to_int, int_to_vocab) vocab_to_int, int_to_vocab = common.create_lookup_tables(text) return vocab_to_int, int_to_vocab tests.test_create_lookup_tables(create_lookup_tables) def token_lookup(): Generate a dict to turn punctuation into a token. :return: Tokenize dictionary where the key is the punctuation and the value is the token x = { '.' : '||period||', ',' : '||comma||', '"' : '||quote||', '(' : '||left_bracket||', '?' : '||question_mark||', '!' : '||exclamation||', '\n' : '||new_line||', ')' : '||right_bracket||', ';' : '||semi-colon||' , '--' : '||dash_dash||' } return x tests.test_tokenize(token_lookup) # Preprocess Training, Validation, and Testing Data helper.preprocess_and_save_data(data_dir, token_lookup, create_lookup_tables) import helper import numpy as np import problem_unittests as tests int_text, vocab_to_int, int_to_vocab, token_dict = helper.load_preprocess() from distutils.version import LooseVersion import warnings import tensorflow as tf # Check TensorFlow Version assert LooseVersion(tf.__version__) >= LooseVersion('1.0'), 'Please use TensorFlow version 1.0 or newer' print('TensorFlow Version: {}'.format(tf.__version__)) # Check for a GPU if not tf.test.gpu_device_name(): warnings.warn('No GPU found. Please use a GPU to train your neural network.') else: print('Default GPU Device: {}'.format(tf.test.gpu_device_name())) def get_inputs(): Create TF Placeholders for input, targets, and learning rate. :return: Tuple (input, targets, learning rate) input_ = tf.placeholder(tf.int32, [None, None], name='input') targets = tf.placeholder(tf.int32, [None, None], name ='targets') learning_rate = tf.placeholder(tf.float32, name='learning_rate') return input_, targets, learning_rate tests.test_get_inputs(get_inputs) def get_embed(input_, n_vocab, n_embedding): Create embedding for <input_data>. :param input_: TF placeholder for text input. :param n_vocab: Number of words in vocabulary. :param n_embedding: Number of embedding dimensions :return: Embedded input. embedding = tf.Variable( tf.random_uniform( (n_vocab, n_embedding))) embed = tf.nn.embedding_lookup( embedding, input_) return embed tests.test_get_embed(get_embed) def get_init_cell(batch_size, rnn_size): Create an RNN Cell and initialize it. :param batch_size: Size of batches :param rnn_size: Size of RNNs :return: Tuple (cell, initialize state) lstms = [tf.contrib.rnn.BasicLSTMCell(rnn_size)] cell = tf.contrib.rnn.MultiRNNCell( lstms ) initial_state = cell.zero_state(batch_size, tf.float32) initial_state = tf.identity(initial_state, name="initial_state") return cell, initial_state tests.test_get_init_cell(get_init_cell) def build_rnn(cell, inputs): Create a RNN using a RNN Cell :param cell: RNN Cell :param inputs: Input text data :return: Tuple (Outputs, Final State) outputs, state = tf.nn.dynamic_rnn(cell, inputs, dtype=tf.float32) state = tf.identity(state, name="final_state") return outputs, state tests.test_build_rnn(build_rnn) def build_nn(cell, rnn_size, input_data, vocab_size, embed_dim): Build part of the neural network :param cell: RNN cell :param rnn_size: Size of rnns :param input_data: Input data :param vocab_size: Vocabulary size :param embed_dim: Number of embedding dimensions :return: Tuple (Logits, FinalState) embed = get_embed(input_data, vocab_size, embed_dim) outputs, state = build_rnn(cell, embed) logits = tf.contrib.layers.fully_connected(outputs, vocab_size, activation_fn=None, weights_initializer = tf.truncated_normal_initializer( mean = 0.0, stddev = .1), biases_initializer=tf.zeros_initializer() ) return logits, state tests.test_build_nn(build_nn) def get_batches(int_text, batch_size, seq_length): Return batches of input and target :param int_text: Text with the words replaced by their ids :param batch_size: The size of batch :param seq_length: The length of sequence :return: Batches as a Numpy array int_text = int_text[0:(len(int_text) - len(int_text) % (batch_size * seq_length))] targets = np.zeros(len(int_text)).astype(int) targets[:-1] = int_text[1:] targets[-1] = int_text[0] elements_per_batch = batch_size * seq_length num_batches = int(len(int_text) / elements_per_batch) # Build the batched data batches = np.zeros((num_batches, 2, batch_size, seq_length)).astype(int) for sequence in range(batch_size): for batch in range(num_batches): start_at = (batch * seq_length) + ( sequence * seq_length * num_batches ) # Append to inputs batches[batch, 0, sequence, :] = int_text[start_at:(start_at + seq_length)] # Append to targets batches[batch, 1, sequence, :] = targets[start_at:(start_at + seq_length)] return batches tests.test_get_batches(get_batches) num_epochs = 300 batch_size = 128 rnn_size = 256 embed_dim = 200 seq_length = 15 learning_rate = .001 show_every_n_batches = 100 save_dir = './save' from tensorflow.contrib import seq2seq train_graph = tf.Graph() with train_graph.as_default(): vocab_size = len(int_to_vocab) input_text, targets, lr = get_inputs() input_data_shape = tf.shape(input_text) cell, initial_state = get_init_cell(input_data_shape[0], rnn_size) logits, final_state = build_nn(cell, rnn_size, input_text, vocab_size, embed_dim) # Probabilities for generating words probs = tf.nn.softmax(logits, name='probs') # Loss function cost = seq2seq.sequence_loss( logits, targets, tf.ones([input_data_shape[0], input_data_shape[1]])) # Optimizer optimizer = tf.train.AdamOptimizer(lr) # Gradient Clipping gradients = optimizer.compute_gradients(cost) capped_gradients = [(tf.clip_by_value(grad, -1., 1.), var) for grad, var in gradients if grad is not None] train_op = optimizer.apply_gradients(capped_gradients) batches = get_batches(int_text, batch_size, seq_length) with tf.Session(graph=train_graph) as sess: sess.run(tf.global_variables_initializer()) for epoch_i in range(num_epochs): state = sess.run(initial_state, {input_text: batches[0][0]}) for batch_i, (x, y) in enumerate(batches): feed = { input_text: x, targets: y, initial_state: state, lr: learning_rate} train_loss, state, _ = sess.run([cost, final_state, train_op], feed) # Show every <show_every_n_batches> batches if (epoch_i * len(batches) + batch_i) % show_every_n_batches == 0: print('Epoch {:>3} Batch {:>4}/{} train_loss = {:.3f}'.format( epoch_i, batch_i, len(batches), train_loss)) # Save Model saver = tf.train.Saver() saver.save(sess, save_dir) print('Model Trained and Saved') # Save parameters for checkpoint helper.save_params((seq_length, save_dir)) import tensorflow as tf import numpy as np import helper import problem_unittests as tests _, vocab_to_int, int_to_vocab, token_dict = helper.load_preprocess() seq_length, load_dir = helper.load_params() def get_tensors(loaded_graph): Get input, initial state, final state, and probabilities tensor from <loaded_graph> :param loaded_graph: TensorFlow graph loaded from file :return: Tuple (InputTensor, InitialStateTensor, FinalStateTensor, ProbsTensor) tensors = ["input:0", "initial_state:0", "final_state:0", "probs:0"] output = [] for t in tensors: output.append( loaded_graph.get_tensor_by_name(t) ) return output[0], output[1], output[2], output[3] tests.test_get_tensors(get_tensors) def pick_word(probabilities, int_to_vocab): Pick the next word in the generated text :param probabilities: Probabilites of the next word :param int_to_vocab: Dictionary of word ids as the keys and words as the values :return: String of the predicted word return int_to_vocab[np.argmax(probabilities)] tests.test_pick_word(pick_word) gen_length = 300 # homer_simpson, moe_szyslak, or Barney_Gumble prime_word = 'homer_simpson' loaded_graph = tf.Graph() with tf.Session(graph=loaded_graph) as sess: # Load saved model loader = tf.train.import_meta_graph(load_dir + '.meta') loader.restore(sess, load_dir) # Get Tensors from loaded model input_text, initial_state, final_state, probs = get_tensors(loaded_graph) # Sentences generation setup gen_sentences = [prime_word + ':'] prev_state = sess.run(initial_state, {input_text: np.array([[1]])}) # Generate sentences for n in range(gen_length): # Dynamic Input dyn_input = [[vocab_to_int[word] for word in gen_sentences[-seq_length:]]] dyn_seq_length = len(dyn_input[0]) # Get Prediction probabilities, prev_state = sess.run( [probs, final_state], {input_text: dyn_input, initial_state: prev_state}) pred_word = pick_word(probabilities[dyn_seq_length-1], int_to_vocab) gen_sentences.append(pred_word) # Remove tokens tv_script = ' '.join(gen_sentences) for key, token in token_dict.items(): ending = ' ' if key in ['\n', '(', '"'] else '' tv_script = tv_script.replace(' ' + token.lower(), key) tv_script = tv_script.replace('\n ', '\n') tv_script = tv_script.replace('( ', '(') print(tv_script) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Explore the Data Step3: Preprocessing Step5: Tokenize Punctuation Step6: Preprocess all the data and save it Step7: Check Point Step8: Build the Neural Network Step10: Input Step12: Word Embedding Step14: Build RNN Cell and Initialize Step16: Build RNN Step18: Build the Neural Network Step20: Batches Step21: Neural Network Training Step22: Build the Graph Step23: Train Step24: Save Parameters Step25: Checkpoint Step27: Implement Generate Functions Step29: Choose Word Step30: Generate TV Script
5,827
<ASSISTANT_TASK:> Python Code: from learntools.ml_explainability.ex4 import * print("Setup Complete") import pandas as pd data = pd.read_csv('../input/hospital-readmissions/train.csv') data.columns import pandas as pd from sklearn.ensemble import RandomForestClassifier from sklearn.model_selection import train_test_split data = pd.read_csv('../input/hospital-readmissions/train.csv') y = data.readmitted base_features = [c for c in data.columns if c != "readmitted"] X = data[base_features] train_X, val_X, train_y, val_y = train_test_split(X, y, random_state=1) my_model = RandomForestClassifier(n_estimators=30, random_state=1).fit(train_X, train_y) # Your code here ____ # Run this code cell to receive credit! q_1.solution() # Your Code Here ____ # Check your answer (Run this code cell to receive credit!) q_2.solution() # Your Code Here ____ # Check your answer (Run this code cell to receive credit!) q_3.solution() # Your Code Here ____ # q_4.hint() # Check your answer (Run this code cell to receive credit!) q_4.solution() # Your Code Here ____ # q_5.hint() # Check your answer (Run this code cell to receive credit!) q_5.solution() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The Scenario Step2: Here are some quick hints at interpreting the field names Step3: Now use the following cell to create the materials for the doctors. Step4: For our idea of what to show, run the cell below. Step5: If you'd like to discuss your approach or see what others have done, we have a discussion forum here. Step 2 Step6: For our solution, run the line below. Step7: Step 3 Step8: Uncomment the relevant line below to see one solution. Step9: Step 4 Step10: For a hint, uncomment the line below. Step11: Step 5 Step12: For a hint, uncomment the line below.
5,828
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. !pip install tensorflow-io !curl -o sample.jpg -L https://storage.googleapis.com/download.tensorflow.org/example_images/320px-Felis_catus-cat_on_snow.jpg !ls -ls sample.jpg import tensorflow as tf import tensorflow_io as tfio image = tf.image.decode_jpeg(tf.io.read_file('sample.jpg')) print(image.shape, image.dtype) import matplotlib.pyplot as plt plt.figure() plt.imshow(image) plt.axis('off') plt.show() grayscale = tfio.experimental.color.rgb_to_grayscale(image) print(grayscale.shape, grayscale.dtype) # use tf.squeeze to remove last channel for plt.imshow to display: plt.figure() plt.imshow(tf.squeeze(grayscale, axis=-1), cmap='gray') plt.axis('off') plt.show() bgr = tfio.experimental.color.rgb_to_bgr(image) print(bgr.shape, bgr.dtype) plt.figure() plt.imshow(bgr) plt.axis('off') plt.show() # convert to float32 image_float32 = tf.cast(image, tf.float32) / 255.0 xyz_float32 = tfio.experimental.color.rgb_to_xyz(image_float32) # convert back uint8 xyz = tf.cast(xyz_float32 * 255.0, tf.uint8) print(xyz.shape, xyz.dtype) plt.figure() plt.imshow(xyz) plt.axis('off') plt.show() ycbcr = tfio.experimental.color.rgb_to_ycbcr(image) print(ycbcr.shape, ycbcr.dtype) plt.figure() plt.imshow(ycbcr, cmap='gray') plt.axis('off') plt.show() y, cb, cr = ycbcr[:,:,0], ycbcr[:,:,1], ycbcr[:,:,2] # Y' component plt.figure() plt.imshow(y, cmap='gray') plt.axis('off') plt.show() # Cb component plt.figure() plt.imshow(cb, cmap='gray') plt.axis('off') plt.show() # Cr component plt.figure() plt.imshow(cr, cmap='gray') plt.axis('off') plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 色空間変換 Step2: サンプル画像をダウンロードする Step3: 使い方 Step4: 画像は以下の方法で表示できます。 Step5: RGB からグレースケールに変換する Step6: RGB から BGR に変換する Step7: RGB から CIE XYZ に変換する Step8: RGB から YCbCr に変換する Step9: さらに面白いことに、YCbCrは各成分が知覚的に意味のある情報を持つY'(ルマ)、Cb(青色差クロマ)、Cr(赤色差クロマ)という成分に分解することができます。
5,829
<ASSISTANT_TASK:> Python Code: ## Augumenting functions based on Naoki Shibuya's work! Thank you! ## https://github.com/naokishibuya/car-traffic-sign-classification import cv2 import numpy as np def resizeImage(image): return cv2.resize(img, (48,48)) def random_brightness(image, ratio): hsv = cv2.cvtColor(image, cv2.COLOR_RGB2HSV) brightness = np.float64(hsv[:, :, 2]) brightness = brightness * (1.0 + np.random.uniform(-ratio, ratio)) brightness[brightness>255] = 255 brightness[brightness<0] = 0 hsv[:, :, 2] = brightness return cv2.cvtColor(hsv, cv2.COLOR_HSV2RGB) def random_rotation(image, angle): if angle == 0: return image angle = np.random.uniform(-angle, angle) rows, cols = image.shape[:2] size = cols, rows center = cols/2, rows/2 scale = 1.0 rotation = cv2.getRotationMatrix2D(center, angle, scale) return cv2.warpAffine(image, rotation, size) def random_translation(image, translation): if translation == 0: return 0 rows, cols = image.shape[:2] size = cols, rows x = np.random.uniform(-translation, translation) y = np.random.uniform(-translation, translation) trans = np.float32([[1,0,x],[0,1,y]]) return cv2.warpAffine(image, trans, size) def random_shear(image, shear): if shear == 0: return image rows, cols = image.shape[:2] size = cols, rows left, right, top, bottom = shear, cols - shear, shear, rows - shear dx = np.random.uniform(-shear, shear) dy = np.random.uniform(-shear, shear) p1 = np.float32([[left , top],[right , top ],[left, bottom]]) p2 = np.float32([[left+dx, top],[right+dx, top+dy],[left, bottom+dy]]) move = cv2.getAffineTransform(p1,p2) return cv2.warpAffine(image, move, size) def augment_image(image, brightness, angle, translation, shear): image = resizeImage(image) aug_images = [] aug_images.append(image) aug_images.append(random_brightness(image, brightness)) aug_images.append(random_rotation(image, angle)) aug_images.append(random_translation(image, translation)) aug_images.append(random_shear(image, shear)) aug_images.append(random_rotation(random_brightness(image, brightness), angle)) aug_images.append(random_translation(random_brightness(image, brightness), translation)) aug_images.append(random_shear(random_brightness(image, brightness), shear)) return aug_images import random ## our expanded dataset is stored in enh_images, enh_labels = (...) #since we need to know the start and end of the current class lower_bound = 0 upper_bound = len(enh_images) eq_images = [] eq_labels = [] #assumtion: class indizes are sorted and increasing for classindex in range(43): for position in range(lower_bound, upper_bound): if enh_labels[position] != classindex: upper_bound = position break sample_index= random.sample(range(lower_bound, upper_bound), 200) for i in sample_index: eq_images.append(enh_images[i][:]) for i in sample_index: eq_labels.append(enh_labels[i]) cnt = 0 for i in sample_index: enh_images.pop(i - cnt) enh_labels.pop(i - cnt) cnt +=1 lower_bound = upper_bound upper_bound = len(enh_images) import skimage def variable_summaries(var, summary_name): with tf.name_scope("Summary_" + str(summary_name)): tf.summary.scalar("raw", var) tf.summary.histogram('histogram', var) def convertToUINT8(x): return skimage.img_as_ubyte(x / np.amax(x)) ## Based on panmari's post. Thank you! ## https://gist.github.com/panmari/4622b78ce21e44e2d69c def VisualizeConvolutions(myTensor, sizeInfo, name): V = tf.slice(myTensor, (0, 0, 0, 0), (1, -1, -1, -1), name='slice_' + name) V = tf.reshape(V, (sizeInfo[0], sizeInfo[1], sizeInfo[2])) V = tf.transpose(V, (2, 0, 1)) V = tf.reshape(V, (-1, sizeInfo[0], sizeInfo[1], 1)) tf.summary.image(name, V, max_outputs=3) ## Add this in your graph definition to use TensorBoard's "IMAGE" Tab ## This will print the first 32 feature maps of each layer after the convolution ## as well as the original input image with tf.name_scope('Visualiz_convolutions'): img_raw = tf.slice(x_image, (0, 0, 0, 0), (1, -1, -1, -1), name='slice_raw_image') tf.summary.image("raw_image", img_raw, max_outputs=32) ## note: (width, height, output kernels) ## 48px = orig. image // 24px = feature map after maxpool VisualizeConvolutions(h_conv1, [48, 48, 96], "Conv1") VisualizeConvolutions(h_conv2, [24, 24, 96], "Conv2") VisualizeConvolutions(h_conv3, [12, 12, 48], "Conv3") logs_path = r'C:/....' cross_entropy = (...) accuracy = (...) variable_summaries(cross_entropy, 'crossentropy') variable_summaries(accuracy, 'TrainingAcc') summary_op = tf.summary.merge_all() with tf.Session() as sess: sess.run(tf.global_variables_initializer()) summary_writer = tf.summary.FileWriter(logs_path) summary_writer.add_graph(sess.graph) #Start training and logging for i in range(100): (...) _, summary = sess.run([train_step, summary_op], feed_dict={(...)}) summary_writer.add_summary(summary, i) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: With this we have expanded our dataset by factor 8. Let's look at the distribution of datapoints over all classes Step2: All preprocessing steps can be found in [ xyz .py ]. Step3: To acutally see something you need to add some lines while running your session
5,830
<ASSISTANT_TASK:> Python Code: print("Exemplo 8.9\n") from sympy import * t = symbols('t') V = 12 C = 1/2 L = 1 #Para t < 0 i0 = 0 v0 = V print("i(0):",i0,"A") print("v(0):",v0,"V") #Para t = oo i_f = V/(4 + 2) vf = V*2/(4 + 2) print("i(oo):",i_f,"A") print("v(oo):",vf,"V") #Para t > 0 #desativar fontes independentes #i = v/2 + C*dv/dt #4i + L*di/dt + v = 0 #4*(v/2 + 1/2*dv/dt) + d(v/2 + 1/2*dv/dt)/dt + v = 0 #2v + 2dv/dt + 1/2*dv/dt + 1/2*d^2v/t^2 + v = 0 #d^2v/dt^2 + 5dv/dt + 6v = 0 #s^2 + 5s + 6 = 0 s1 = -2 s2 = -3 #Raizes reais e negativas: Superamortecido #vn(t) = A1*exp(-2t) + A2*exp(-3t) #vss(t) = v(oo) = 4 #v(t) = 4 + A1*exp(-2t) + A2*exp(-3t) #dv(0)/dt = -2A1 -3A2 = ic(0)/C #ic(0) = -6 #C = 1/2 #-2A1 - 3A2 = -12 #2A1 + 3A2 = 12 #v(0) = 4 + A1 + A2 = 12 #A1 + A2 = 8 #2(8 - A2) + 3A2 = 12 A2 = -4 A1 = 12 v = A1*exp(s1*t) + A2*exp(s2*t) + vf print("Resposta completa v(t):",v,"V") #i = v/2 + C*dv/dt i = v/2 + C*diff(v,t) print("i(t):",i,"A") print("Problema Prático 8.9") s = symbols('s') C = 1/20 L = 2 Is = 3 #Para t < 0 v0 = 0 i0 = 0 print("v(0):",v0,"V") print("i(0):",i0,"A") #Para t = oo i_f = Is vf = 4*Is print("i(oo):",i_f,"A") print("v(oo):",vf,"V") #Para t > 0 dv0 = Is/C di0 = 10*Is/L print("dv(0)/dt:",dv0,"V/s") print("di(0)/dt:",di0,"A/s") #desativar fontes indep. #4i + L*di/dt - v + 10i = 0 #i = -C*dv/dt #14(-1/20*dv/dt) + 2(-1/20*d^2v/dt^2) - v = 0 #-1/10*d^2v/dt^2 - 7/10*dv/dt - v = 0 #d^2v/dt^2 + 7*dv/dt + 10v = 0 #s^2 + 7s + 10 = 0 r = solve(s**2 + 7*s + 10,s) s1,s2 = r[0],r[1] print("Raízes s1 e s2: {0} , {1}".format(s1,s2)) #Raizes reais e negativas: Superamortecido #v(t) = vf + A1*exp(-5t) + A2*exp(-2t) #v0 = A1 + A2 = -12 #A1 = -12 - A2 #dv0/dt = -5A1 -2A2 = 60 #-5A1 - 2(-12 - A1) = 60 A1 = (60-24)/(-3) A2 = -12 - A1 print("Constantes A1 e A2: {0} , {1}".format(A1,A2)) v = A1*exp(s1*t) + A2*exp(s2*t) + vf print("Resposta completa v(t):",v,"V") #3 = C*dv/dt + i i = 3 - C*diff(v,t) print("Resposta i(t):",i,"A") print("Exemplo 8.10\n") V = 7 L1 = 1/2 L2 = 1/5 #Para t < 0 i1_0 = 0 i2_0 = 0 print("i1(0):",i1_0,"A") print("i2(0):",i2_0,"A") #Para t = oo i_f = V/3 print("i(oo):",i_f,"A") #Para t > 0 #di1(0)/dt = vl/L1 di1 = V/L1 #di2(0)/dt = vl/L2 di2 = 0/L2 print("di1(0)/dt:",di1,"A/s") print("di2(0)/dt:",di2,"A/s") #desligar fontes indep. #3i1 + 1/2*di1/dt + (i1 - i2) = 0 #4i1 + 1/2*di1/dt - i2 = 0 #1/5*di2/t + i2 - i1 = 0 #4/5*di1/dt + 1/10*d^2i1/dt^2 + 4i1 + 1/2*di1/dt - i1 = 0 #d^2i1/dt^2 + 13di1/dt + 30i1 = 0 #s^2 + 13s + 30 = 0 r = solve(s**2 + 13*s + 30,s) s1,s2 = r[0],r[1] print("Raizes s1 e s2: {0} , {1}".format(s1,s2)) #raizes reais e negativas: Superamortecido #i1(t) = 7/3 + A1*exp(-10t) + A2*exp(-3t) #i1(0) = 7/3 + A1 + A2 = 0 #A1 = -7/3 - A2 #di1(0)/dt = -10A1 -3A2 = 14 #-10(-7/3 - A2) - 3A2 = 14 A2 = (14 - 70/3)/7 A1 = -7/3 - A2 print("Constantes A1 e A2: {0} , {1}".format(A1,A2)) i1 = i_f + A1*exp(s1*t) + A2*exp(s2*t) print("i1(t):",i1,"A") #V = 3i1 + L1*di1/dt + (i1 - i2) i2 = 3*i1 + L1*diff(i1,t) + i1 - V print("i2(t):",i2,"A") vo = i1 - i2 print("V0(t):",vo,"V") print("Problema Prático 8.10") V = 20 C1 = 1/2 C2 = 1/3 #Para t < 0 v1_0 = 0 v2_0 = 0 print("v1(0) e v2(0):",v1_0,"V") #Para t = oo v1_f = V v2_f = V print("v1(oo) e v2(oo):",v1_f,"V") #Para t > 0 #dv1(0)/dt = i1(0)/C1 = (V/1)/(1/2) dv1 = V/C1 #dv2(0)/dt = i2(0)/C2 = 0/C2 dv2 = 0 print("dv1(0)/dt:",dv1,"V/s") print("dv2(0)/dt:",dv2,"V/s") #desligar fontes indep. #v1/1 + C1*dv1/dt + vo/1 = 0 #vo = v1-v2 #v1 + 1/2*dv1/dt + v1-v2 = 0 #dv1/dt + 4v1 - 2v2 = 0 #v1 = 1*C2*dv2/dt + v2 #1/3*d^2v2/dt^2 + dv2/dt + 4/3*dv2/dt + 4v2 - 2v2 = 0 #d^2v2/dt^2 + 7dv2/dt + 6v2 = 0 #s^2 + 7s + 6 = 0 r = solve(s**2 + 7*s + 6,s) s1,s2 = r[0],r[1] print("Raizes para v2:",s1,s2) #raizes reais e negativas: Superamortecido #v2(t) = 20 + A1*exp(-6t) + A2*exp(-t) #v2(0) = 20 + A1 + A2 = 0 #A2 = -20 - A1 #dv2(0)/dt = -6A1 - A2 = 0 #-6A1 - (-20 - A1) = 0 A1 = 20/5 A2 = -20 - A1 print("Constantes A1 e A2:",A1,A2) v2 = v2_f + A1*exp(s1*t) + A2*exp(s2*t) print("v2(t):",v2,"V") v1 = C2*diff(v2,t) + v2 print("v1(t):",v1,"V") vo = v1 - v2 print("Resposta vo(t):",vo,"V") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Problema Prático 8.9 Step2: Exemplo 8.10 Step3: Problema Prático 8.10
5,831
<ASSISTANT_TASK:> Python Code: import os import numpy as np import mne sample_data_folder = mne.datasets.sample.data_path() sample_data_raw_file = os.path.join(sample_data_folder, 'MEG', 'sample', 'sample_audvis_filt-0-40_raw.fif') raw = mne.io.read_raw_fif(sample_data_raw_file) print(raw) print(raw.info) raw.plot_psd(fmax=50) raw.plot(duration=5, n_channels=30) # set up and fit the ICA ica = mne.preprocessing.ICA(n_components=20, random_state=97, max_iter=800) ica.fit(raw) ica.exclude = [1, 2] # details on how we picked these are omitted here ica.plot_properties(raw, picks=ica.exclude) orig_raw = raw.copy() raw.load_data() ica.apply(raw) # show some frontal channels to clearly illustrate the artifact removal chs = ['MEG 0111', 'MEG 0121', 'MEG 0131', 'MEG 0211', 'MEG 0221', 'MEG 0231', 'MEG 0311', 'MEG 0321', 'MEG 0331', 'MEG 1511', 'MEG 1521', 'MEG 1531', 'EEG 001', 'EEG 002', 'EEG 003', 'EEG 004', 'EEG 005', 'EEG 006', 'EEG 007', 'EEG 008'] chan_idxs = [raw.ch_names.index(ch) for ch in chs] orig_raw.plot(order=chan_idxs, start=12, duration=4) raw.plot(order=chan_idxs, start=12, duration=4) events = mne.find_events(raw, stim_channel='STI 014') print(events[:5]) # show the first 5 event_dict = {'auditory/left': 1, 'auditory/right': 2, 'visual/left': 3, 'visual/right': 4, 'smiley': 5, 'buttonpress': 32} fig = mne.viz.plot_events(events, event_id=event_dict, sfreq=raw.info['sfreq'], first_samp=raw.first_samp) reject_criteria = dict(mag=4000e-15, # 4000 fT grad=4000e-13, # 4000 fT/cm eeg=150e-6, # 150 µV eog=250e-6) # 250 µV epochs = mne.Epochs(raw, events, event_id=event_dict, tmin=-0.2, tmax=0.5, reject=reject_criteria, preload=True) conds_we_care_about = ['auditory/left', 'auditory/right', 'visual/left', 'visual/right'] epochs.equalize_event_counts(conds_we_care_about) # this operates in-place aud_epochs = epochs['auditory'] vis_epochs = epochs['visual'] del raw, epochs # free up memory aud_epochs.plot_image(picks=['MEG 1332', 'EEG 021']) frequencies = np.arange(7, 30, 3) power = mne.time_frequency.tfr_morlet(aud_epochs, n_cycles=2, return_itc=False, freqs=frequencies, decim=3) power.plot(['MEG 1332']) aud_evoked = aud_epochs.average() vis_evoked = vis_epochs.average() mne.viz.plot_compare_evokeds(dict(auditory=aud_evoked, visual=vis_evoked), legend='upper left', show_sensors='upper right') aud_evoked.plot_joint(picks='eeg') aud_evoked.plot_topomap(times=[0., 0.08, 0.1, 0.12, 0.2], ch_type='eeg') evoked_diff = mne.combine_evoked([aud_evoked, vis_evoked], weights=[1, -1]) evoked_diff.pick_types(meg='mag').plot_topo(color='r', legend=False) # load inverse operator inverse_operator_file = os.path.join(sample_data_folder, 'MEG', 'sample', 'sample_audvis-meg-oct-6-meg-inv.fif') inv_operator = mne.minimum_norm.read_inverse_operator(inverse_operator_file) # set signal-to-noise ratio (SNR) to compute regularization parameter (λ²) snr = 3. lambda2 = 1. / snr ** 2 # generate the source time course (STC) stc = mne.minimum_norm.apply_inverse(vis_evoked, inv_operator, lambda2=lambda2, method='MNE') # or dSPM, sLORETA, eLORETA # path to subjects' MRI files subjects_dir = os.path.join(sample_data_folder, 'subjects') # plot the STC stc.plot(initial_time=0.1, hemi='split', views=['lat', 'med'], subjects_dir=subjects_dir) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Loading data Step2: By default, ~mne.io.read_raw_fif displays some information about the file Step3: ~mne.io.Raw objects also have several built-in plotting methods; here we Step4: Preprocessing Step5: Once we're confident about which component(s) we want to remove, we pass them Step6: Detecting experimental events Step7: The resulting events array is an ordinary 3-column Step8: Event dictionaries like this one are used when extracting epochs from Step9: For paradigms that are not event-related (e.g., analysis of resting-state Step10: We'll also pass the event dictionary as the event_id parameter (so we can Step11: Next we'll pool across left/right stimulus presentations so we can compare Step12: Like ~mne.io.Raw objects, ~mne.Epochs objects also have a number of Step13: <div class="alert alert-info"><h4>Note</h4><p>Both `~mne.io.Raw` and `~mne.Epochs` objects have `~mne.Epochs.get_data` Step14: Estimating evoked responses Step15: We can also get a more detailed view of each ~mne.Evoked object using other Step16: Evoked objects can also be combined to show contrasts between conditions, Step17: Inverse modeling Step18: Finally, in order to plot the source estimate on the subject's cortical
5,832
<ASSISTANT_TASK:> Python Code: # Authors: Alexandre Gramfort <alexandre.gramfort@telecom-paristech.fr> # # License: BSD (3-clause) import numpy as np import matplotlib.pyplot as plt import mne from mne import io from mne.datasets import sample print(__doc__) data_path = sample.data_path() raw_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw.fif' event_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw-eve.fif' event_id, tmin, tmax = 1, -0.2, 0.4 # Setup for reading the raw data raw = io.read_raw_fif(raw_fname) events = mne.read_events(event_fname) # Set up pick list: EEG + MEG - bad channels (modify to your needs) raw.info['bads'] = ['MEG 2443', 'EEG 053'] # Create epochs, here for gradiometers + EOG only for simplicity epochs = mne.Epochs(raw, events, event_id, tmin, tmax, proj=True, picks=('grad', 'eog'), baseline=(None, 0), preload=True, reject=dict(grad=4000e-13, eog=150e-6)) # and order with spectral reordering # If you don't have scikit-learn installed set order_func to None from sklearn.cluster.spectral import spectral_embedding # noqa from sklearn.metrics.pairwise import rbf_kernel # noqa def order_func(times, data): this_data = data[:, (times > 0.0) & (times < 0.350)] this_data /= np.sqrt(np.sum(this_data ** 2, axis=1))[:, np.newaxis] return np.argsort(spectral_embedding(rbf_kernel(this_data, gamma=1.), n_components=1, random_state=0).ravel()) good_pick = 97 # channel with a clear evoked response bad_pick = 98 # channel with no evoked response # We'll also plot a sample time onset for each trial plt_times = np.linspace(0, .2, len(epochs)) plt.close('all') mne.viz.plot_epochs_image(epochs, [good_pick, bad_pick], sigma=.5, order=order_func, vmin=-250, vmax=250, overlay_times=plt_times, show=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set parameters Step2: Show event-related fields images
5,833
<ASSISTANT_TASK:> Python Code: # IMPORT LIBRARIES import pandas as pd, numpy as np, os, gc # LOAD AND FREQUENCY-ENCODE FE = ['EngineVersion','AppVersion','AvSigVersion','Census_OSVersion'] # LOAD AND ONE-HOT-ENCODE OHE = [ 'RtpStateBitfield','IsSxsPassiveMode','DefaultBrowsersIdentifier', 'AVProductStatesIdentifier','AVProductsInstalled', 'AVProductsEnabled', 'CountryIdentifier', 'CityIdentifier', 'GeoNameIdentifier', 'LocaleEnglishNameIdentifier', 'Processor', 'OsBuild', 'OsSuite', 'SmartScreen','Census_MDC2FormFactor', 'Census_OEMNameIdentifier', 'Census_ProcessorCoreCount', 'Census_ProcessorModelIdentifier', 'Census_PrimaryDiskTotalCapacity', 'Census_PrimaryDiskTypeName', 'Census_HasOpticalDiskDrive', 'Census_TotalPhysicalRAM', 'Census_ChassisTypeName', 'Census_InternalPrimaryDiagonalDisplaySizeInInches', 'Census_InternalPrimaryDisplayResolutionHorizontal', 'Census_InternalPrimaryDisplayResolutionVertical', 'Census_PowerPlatformRoleName', 'Census_InternalBatteryType', 'Census_InternalBatteryNumberOfCharges', 'Census_OSEdition', 'Census_OSInstallLanguageIdentifier', 'Census_GenuineStateName','Census_ActivationChannel', 'Census_FirmwareManufacturerIdentifier', 'Census_IsTouchEnabled', 'Census_IsPenCapable', 'Census_IsAlwaysOnAlwaysConnectedCapable', 'Wdft_IsGamer', 'Wdft_RegionIdentifier'] # LOAD ALL AS CATEGORIES dtypes = {} for x in FE+OHE: dtypes[x] = 'category' dtypes['MachineIdentifier'] = 'str' dtypes['HasDetections'] = 'int8' # LOAD CSV FILE df_train = pd.read_csv('../input/train.csv', usecols=dtypes.keys(), dtype=dtypes) print ('Loaded',len(df_train),'rows of TRAIN.CSV!') # DOWNSAMPLE sm = 2000000 df_train = df_train.sample(sm) print ('Only using',sm,'rows to train and validate') x=gc.collect() import math # CHECK FOR NAN def nan_check(x): if isinstance(x,float): if math.isnan(x): return True return False # FREQUENCY ENCODING def encode_FE(df,col,verbose=1): d = df[col].value_counts(dropna=False) n = col+"_FE" df[n] = df[col].map(d)/d.max() if verbose==1: print('FE encoded',col) return [n] # ONE-HOT-ENCODE ALL CATEGORY VALUES THAT COMPRISE MORE THAN # "FILTER" PERCENT OF TOTAL DATA AND HAS SIGNIFICANCE GREATER THAN "ZSCORE" def encode_OHE(df, col, filter, zscore, tar='HasDetections', m=0.5, verbose=1): cv = df[col].value_counts(dropna=False) cvd = cv.to_dict() vals = len(cv) th = filter * len(df) sd = zscore * 0.5/ math.sqrt(th) #print(sd) n = []; ct = 0; d = {} for x in cv.index: try: if cv[x]<th: break sd = zscore * 0.5/ math.sqrt(cv[x]) except: if cvd[x]<th: break sd = zscore * 0.5/ math.sqrt(cvd[x]) if nan_check(x): r = df[df[col].isna()][tar].mean() else: r = df[df[col]==x][tar].mean() if abs(r-m)>sd: nm = col+'_BE_'+str(x) if nan_check(x): df[nm] = (df[col].isna()).astype('int8') else: df[nm] = (df[col]==x).astype('int8') n.append(nm) d[x] = 1 ct += 1 if (ct+1)>=vals: break if verbose==1: print('OHE encoded',col,'- Created',len(d),'booleans') return [n,d] # ONE-HOT-ENCODING from dictionary def encode_OHE_test(df,col,dt): n = [] for x in dt: n += encode_BE(df,col,x) return n # BOOLEAN ENCODING def encode_BE(df,col,val): n = col+"_BE_"+str(val) if nan_check(val): df[n] = df[col].isna() else: df[n] = df[col]==val df[n] = df[n].astype('int8') return [n] cols = []; dd = [] # ENCODE NEW for x in FE: cols += encode_FE(df_train,x) for x in OHE: tmp = encode_OHE(df_train,x,0.005,5) cols += tmp[0]; dd.append(tmp[1]) print('Encoded',len(cols),'new variables') # REMOVE OLD for x in FE+OHE: del df_train[x] print('Removed original',len(FE+OHE),'variables') x = gc.collect() from keras import callbacks from sklearn.metrics import roc_auc_score class printAUC(callbacks.Callback): def __init__(self, X_train, y_train): super(printAUC, self).__init__() self.bestAUC = 0 self.X_train = X_train self.y_train = y_train def on_epoch_end(self, epoch, logs={}): pred = self.model.predict(np.array(self.X_train)) auc = roc_auc_score(self.y_train, pred) print("Train AUC: " + str(auc)) pred = self.model.predict(self.validation_data[0]) auc = roc_auc_score(self.validation_data[1], pred) print ("Validation AUC: " + str(auc)) if (self.bestAUC < auc) : self.bestAUC = auc self.model.save("bestNet.h5", overwrite=True) return from sklearn.model_selection import train_test_split from keras.models import Sequential from keras.layers import Dense, Dropout, BatchNormalization, Activation from keras.callbacks import LearningRateScheduler from keras.optimizers import Adam #SPLIT TRAIN AND VALIDATION SET X_train, X_val, Y_train, Y_val = train_test_split( df_train[cols], df_train['HasDetections'], test_size = 0.5) # BUILD MODEL model = Sequential() model.add(Dense(100,input_dim=len(cols))) model.add(Dropout(0.4)) model.add(BatchNormalization()) model.add(Activation('relu')) model.add(Dense(100)) model.add(Dropout(0.4)) model.add(BatchNormalization()) model.add(Activation('relu')) model.add(Dense(1, activation='sigmoid')) model.compile(optimizer=Adam(lr=0.01), loss="binary_crossentropy", metrics=["accuracy"]) annealer = LearningRateScheduler(lambda x: 1e-2 * 0.95 ** x) # TRAIN MODEL model.fit(X_train,Y_train, batch_size=32, epochs = 20, callbacks=[annealer, printAUC(X_train, Y_train)], validation_data = (X_val,Y_val), verbose=2) del df_train del X_train, X_val, Y_train, Y_val x = gc.collect() # LOAD BEST SAVED NET from keras.models import load_model model = load_model('bestNet.h5') pred = np.zeros((7853253,1)) id = 1 chunksize = 2000000 for df_test in pd.read_csv('../input/test.csv', chunksize = chunksize, usecols=list(dtypes.keys())[0:-1], dtype=dtypes): print ('Loaded',len(df_test),'rows of TEST.CSV!') # ENCODE TEST cols = [] for x in FE: cols += encode_FE(df_test,x,verbose=0) for x in range(len(OHE)): cols += encode_OHE_test(df_test,OHE[x],dd[x]) # PREDICT TEST end = (id)*chunksize if end>7853253: end = 7853253 pred[(id-1)*chunksize:end] = model.predict_proba(df_test[cols]) print(' encoded and predicted part',id) id += 1 # SUBMIT TO KAGGLE df_test = pd.read_csv('../input/test.csv', usecols=['MachineIdentifier']) df_test['HasDetections'] = pred df_test.to_csv('submission.csv', index=False) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Statistically Encode Variables Step2: Example - Census_OEMModelIdentifier Step3: Predict Test and Submit to Kaggle
5,834
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License") # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. !pip install --quiet -U apache-beam import apache_beam as beam def is_perennial(plant): return plant['duration'] == 'perennial' with beam.Pipeline() as pipeline: perennials = ( pipeline | 'Gardening plants' >> beam.Create([ { 'icon': '🍓', 'name': 'Strawberry', 'duration': 'perennial' }, { 'icon': '🥕', 'name': 'Carrot', 'duration': 'biennial' }, { 'icon': '🍆', 'name': 'Eggplant', 'duration': 'perennial' }, { 'icon': '🍅', 'name': 'Tomato', 'duration': 'annual' }, { 'icon': '🥔', 'name': 'Potato', 'duration': 'perennial' }, ]) | 'Filter perennials' >> beam.Filter(is_perennial) | beam.Map(print)) import apache_beam as beam with beam.Pipeline() as pipeline: perennials = ( pipeline | 'Gardening plants' >> beam.Create([ { 'icon': '🍓', 'name': 'Strawberry', 'duration': 'perennial' }, { 'icon': '🥕', 'name': 'Carrot', 'duration': 'biennial' }, { 'icon': '🍆', 'name': 'Eggplant', 'duration': 'perennial' }, { 'icon': '🍅', 'name': 'Tomato', 'duration': 'annual' }, { 'icon': '🥔', 'name': 'Potato', 'duration': 'perennial' }, ]) | 'Filter perennials' >> beam.Filter(lambda plant: plant['duration'] == 'perennial') | beam.Map(print)) import apache_beam as beam def has_duration(plant, duration): return plant['duration'] == duration with beam.Pipeline() as pipeline: perennials = ( pipeline | 'Gardening plants' >> beam.Create([ { 'icon': '🍓', 'name': 'Strawberry', 'duration': 'perennial' }, { 'icon': '🥕', 'name': 'Carrot', 'duration': 'biennial' }, { 'icon': '🍆', 'name': 'Eggplant', 'duration': 'perennial' }, { 'icon': '🍅', 'name': 'Tomato', 'duration': 'annual' }, { 'icon': '🥔', 'name': 'Potato', 'duration': 'perennial' }, ]) | 'Filter perennials' >> beam.Filter(has_duration, 'perennial') | beam.Map(print)) import apache_beam as beam with beam.Pipeline() as pipeline: perennial = pipeline | 'Perennial' >> beam.Create(['perennial']) perennials = ( pipeline | 'Gardening plants' >> beam.Create([ { 'icon': '🍓', 'name': 'Strawberry', 'duration': 'perennial' }, { 'icon': '🥕', 'name': 'Carrot', 'duration': 'biennial' }, { 'icon': '🍆', 'name': 'Eggplant', 'duration': 'perennial' }, { 'icon': '🍅', 'name': 'Tomato', 'duration': 'annual' }, { 'icon': '🥔', 'name': 'Potato', 'duration': 'perennial' }, ]) | 'Filter perennials' >> beam.Filter( lambda plant, duration: plant['duration'] == duration, duration=beam.pvalue.AsSingleton(perennial), ) | beam.Map(print)) import apache_beam as beam with beam.Pipeline() as pipeline: valid_durations = pipeline | 'Valid durations' >> beam.Create([ 'annual', 'biennial', 'perennial', ]) valid_plants = ( pipeline | 'Gardening plants' >> beam.Create([ { 'icon': '🍓', 'name': 'Strawberry', 'duration': 'perennial' }, { 'icon': '🥕', 'name': 'Carrot', 'duration': 'biennial' }, { 'icon': '🍆', 'name': 'Eggplant', 'duration': 'perennial' }, { 'icon': '🍅', 'name': 'Tomato', 'duration': 'annual' }, { 'icon': '🥔', 'name': 'Potato', 'duration': 'PERENNIAL' }, ]) | 'Filter valid plants' >> beam.Filter( lambda plant, valid_durations: plant['duration'] in valid_durations, valid_durations=beam.pvalue.AsIter(valid_durations), ) | beam.Map(print)) import apache_beam as beam with beam.Pipeline() as pipeline: keep_duration = pipeline | 'Duration filters' >> beam.Create([ ('annual', False), ('biennial', False), ('perennial', True), ]) perennials = ( pipeline | 'Gardening plants' >> beam.Create([ { 'icon': '🍓', 'name': 'Strawberry', 'duration': 'perennial' }, { 'icon': '🥕', 'name': 'Carrot', 'duration': 'biennial' }, { 'icon': '🍆', 'name': 'Eggplant', 'duration': 'perennial' }, { 'icon': '🍅', 'name': 'Tomato', 'duration': 'annual' }, { 'icon': '🥔', 'name': 'Potato', 'duration': 'perennial' }, ]) | 'Filter plants by duration' >> beam.Filter( lambda plant, keep_duration: keep_duration[plant['duration']], keep_duration=beam.pvalue.AsDict(keep_duration), ) | beam.Map(print)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Filter Step2: Examples Step3: <table align="left" style="margin-right Step4: <table align="left" style="margin-right Step5: <table align="left" style="margin-right Step6: <table align="left" style="margin-right Step7: <table align="left" style="margin-right
5,835
<ASSISTANT_TASK:> Python Code: def safe_str(obj): return the byte string representation of obj if obj is None: return unicode("") return unicode(obj) def dedupe_pings(rdd): return rdd.filter(lambda p: p["meta/clientId"] is not None)\ .map(lambda p: (p["meta/documentId"], p))\ .reduceByKey(lambda x, y: x)\ .map(lambda x: x[1]) def dedupe_addons(rdd): return rdd.map(lambda p: (p[0] + safe_str(p[2]) + safe_str(p[3]), p))\ .reduceByKey(lambda x, y: x)\ .map(lambda x: x[1]) def clean(s): try: s = s.decode("ascii").strip() return s if len(s) > 0 else None except: return None def transform(ping): output = [] # These should not be None since we filter those out & ingestion process adds the data clientId = ping["meta/clientId"] submissionDate = dt.datetime.strptime(ping["meta/submissionDate"], "%Y%m%d") addonset = {} addons = ping["environment/addons/activeAddons"] if addons is not None: for addon, desc in addons.iteritems(): name = clean(desc.get("name", None)) if name is not None: addonset[name] = 1 persona = ping["environment/addons/persona"] if len(addonset) > 0 or persona is not None: addonarray = None if len(addonset) > 0: addonarray = json.dumps(addonset.keys()) output.append([clientId, submissionDate, addonarray, persona]) return output channels = ["nightly", "aurora", "beta", "release"] batch_date = os.environ.get('date') if batch_date: start = end = dt.datetime.strptime(batch_date, '%Y%m%d') else: start = start = dt.datetime.now() - dt.timedelta(1) day = start while day <= end: for channel in channels: print "\nchannel: " + channel + ", date: " + day.strftime("%Y%m%d") pings = get_pings(sc, app="Fennec", channel=channel, submission_date=(day.strftime("%Y%m%d"), day.strftime("%Y%m%d")), build_id=("20100101000000", "99999999999999"), fraction=1) subset = get_pings_properties(pings, ["meta/clientId", "meta/documentId", "meta/submissionDate", "environment/addons/activeAddons", "environment/addons/persona"]) subset = dedupe_pings(subset) print subset.first() rawAddons = subset.flatMap(transform) print "\nrawAddons count: " + str(rawAddons.count()) print rawAddons.first() uniqueAddons = dedupe_addons(rawAddons) print "\nuniqueAddons count: " + str(uniqueAddons.count()) print uniqueAddons.first() s3_output = "s3n://net-mozaws-prod-us-west-2-pipeline-analysis/mobile/android_addons" s3_output += "/v1/channel=" + channel + "/submission=" + day.strftime("%Y%m%d") schema = StructType([ StructField("clientid", StringType(), False), StructField("submissiondate", TimestampType(), False), StructField("addons", StringType(), True), StructField("lwt", StringType(), True) ]) grouped = sqlContext.createDataFrame(uniqueAddons, schema) grouped.coalesce(1).write.parquet(s3_output, mode="overwrite") day += dt.timedelta(1) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Take the set of pings, make sure we have actual clientIds and remove duplicate pings. Step2: We're going to dump each event from the pings. Do a little empty data sanitization so we don't get NoneType errors during the dump. We create a JSON array of active experiments as part of the dump. Step3: Create a set of events from "saved-session" UI telemetry. Output the data to CSV or Parquet.
5,836
<ASSISTANT_TASK:> Python Code: import numpy as np points_in = 0 for i in range(100): x = np.random.rand() y = np.random.rand() r = np.sqrt(x**2 + y**2) if r <= 1: points_in += 1 pi_4 = points_in/(i+1) print("pi = {}".format(pi_4 * 4.)) %matplotlib nbagg import matplotlib.pyplot as plt import matplotlib.animation as ani import numpy as np fig, ax = plt.subplots() x = np.linspace(0, 6*np.pi, 1000) y = np.sin(x) line, = ax.plot(x, y) def update(i): shift = np.pi/50 x = np.linspace(0, 6*np.pi, 1000) y = np.sin(x + i*shift) return line.set_data(x, y) anim = ani.FuncAnimation(fig, update, frames=100) plt.show() fig, ax = plt.subplots() points_in = 0 points_all = 0 def calculate_point(i): global points_in, points_all, ax x = np.random.rand() y = np.random.rand() r = np.sqrt(x**2 + y**2) if r <= 1: points_in += 1 ax.plot(x, y, 'bo') else: ax.plot(x, y, 'ro') points_all += 1 pi_4 = points_in/points_all pi = pi_4 * 4. plt.title("pi = {}".format(pi)) x = np.linspace(0, 1, 1000) y = np.sqrt(1 - x**2) plt.plot(x, y) anim = ani.FuncAnimation(fig, calculate_point, 100, interval=10) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Animations Step2: So animation plotting is based off creating a function. So in this case, we are animating a line plot. Step3: This works! Animating a 2D image is similar. Except in the animate function, you will set both x and y data.
5,837
<ASSISTANT_TASK:> Python Code: a_list = [10, 32.4, -14.2, "a", "b", [], [1,2]] for item in a_list: try: print(item * item) except TypeError: print(item + item) item = 0 try: item / item except TypeError: print(item + item) x = 0 # The bad fix first... try: x / x except: print("Bad ", x + x) # The Good fix... try: item / item except (TypeError, ZeroDivisionError): # please note the "SnakeCase". print("Good", x + x) def character_movement(x, y): where (x,y) is the position on a 2-d plane return [("start", (x, y)), ("left", (x -1, y)),("right", (x + 1, y)), ("up", (x, y - 1)), ("down", (x, y + 1))] the_map = [ [0, 0, 0], [0, 0, 0], [0, 0, 1]] # 1 denotes our character moves = character_movement(2, 2) print("Starting square = (2,2)") for (direction, position) in moves[1:]: print("Trying to move '{}' to square {}:".format(direction, position)) try: the_map[position[1]][position[0]] = 2 print(*the_map, sep="\n") print("\n") except IndexError: print("Square {}, is out of bounds. IndexError sucessfully caught.\n".format(position)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: So what’s going on here? Well, we have list which contains several different data-types. For every 'item' we try to multiply item by itself. If 'item' is a number this makes sense and so we print item * item. However, if we try to multiply a string by a string we get a TypeError, which the except statement catches. So if we receive a TypeError we try something else, in this particular case we add item to item, and thus "aa", "bb", etc get printed. Step2: In this case Python didn't receive a TypeError and thus the except block of code failed to execute. Now, we can fix this code in one of two ways Step4: The bad fix just leaves a blank except statement, this catches ALL errors. The good fix meanwhile specifically states what errors it should catch, but the code will still fail if the error is something other than Type or dividing by zero.
5,838
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np df = pd.read_csv('../data/train.csv') df.head(10) df = df.drop(['Name', 'Ticket', 'Cabin'], axis=1) df.info() df = df.dropna() df['Sex'].unique() df['Gender'] = df['Sex'].map({'female': 0, 'male':1}).astype(int) df['Embarked'].unique() df['Port'] = df['Embarked'].map({'C':1, 'S':2, 'Q':3}).astype(int) df = df.drop(['Sex', 'Embarked'], axis=1) cols = df.columns.tolist() print(cols) cols = [cols[1]] + cols[0:1] + cols[2:] df = df[cols] df.head(10) df.info() train_data = df.values from sklearn.ensemble import RandomForestClassifier model = RandomForestClassifier(n_estimators = 100) model = model.fit(train_data[0:,2:], train_data[0:,0]) df_test = pd.read_csv('../data/test.csv') df_test.head(10) df_test = df_test.drop(['Name', 'Ticket', 'Cabin'], axis=1) df_test = df_test.dropna() df_test['Gender'] = df_test['Sex'].map({'female': 0, 'male':1}) df_test['Port'] = df_test['Embarked'].map({'C':1, 'S':2, 'Q':3}) df_test = df_test.drop(['Sex', 'Embarked'], axis=1) test_data = df_test.values output = model.predict(test_data[:,1:]) result = np.c_[test_data[:,0].astype(int), output.astype(int)] df_result = pd.DataFrame(result[:,0:2], columns=['PassengerId', 'Survived']) df_result.head(10) df_result.to_csv('../results/titanic_1-0.csv', index=False) df_result.shape <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Pandas - Cleaning data Step2: We notice that the columns describe features of the Titanic passengers, such as age, sex, and class. Of particular interest is the column Survived, which describes whether or not the passenger survived. When training our model, what we are essentially doing is assessing how each feature impacts whether or not the passenger survived (or if the feature makes an impact at all). Step3: Next, we review the type of data in the columns, and their respective counts. Step4: We notice that the columns Age and Embarked have NaNs or missing values. As previously discussed, we take the approach of simply removing the rows with missing values. Step5: Question Step6: Similarly for Embarked, we review the range of values and create a new column called Port that represents, as a numerical value, where each passenger embarks from. Step7: Question Step8: We review the columns our final, processed data set. Step9: For convenience, we move the column Survived to the left-most column. We note that the left-most column is indexed as 0. Step10: In our final review of our training data, we check that (1) the column Survived is the left-most column (2) there are no NaN values, and (3) all the values are in numerical form. Step11: Finally, we convert the processed training data from a Pandas dataframe into a numerical (Numpy) array. Step12: Scikit-learn - Training the model Step13: We use the processed training data to 'train' (or 'fit') our model. The column Survived will be our second input, and the set of other features (with the column PassengerId omitted) as the first. Step14: Scikit-learn - Making predictions Step15: We then review a selection of the data. Step16: We notice that test data has columns similar to our training data, but not the column Survived. We'll use our trained model to predict values for the column Survived. Step17: We now apply the trained model to the test data (omitting the column PassengerId) to produce an output of predictions. Step18: Pandas - Preparing for submission Step19: We briefly review our predictions. Step20: Finally, we output our results to a .csv file. Step21: However, it appears that we have a problem. The Kaggle submission website expects "the solution file to have 418 predictions."
5,839
<ASSISTANT_TASK:> Python Code: class_port = titanic[['PassengerId', 'Pclass', 'Embarked']] print class_port.isnull().any() print class_port = class_port.dropna() print class_port.isnull().any() passengers_by_port_class = class_port.groupby(['Embarked', 'Pclass'], as_index=False).count() print passengers_by_port_class passengers_by_port_class['Total'] = passengers_by_port_class.groupby('Embarked')['PassengerId'].transform(sum) print passengers_by_port_class passengers_by_port_class['Percent'] = passengers_by_port_class.PassengerId * 100 / passengers_by_port_class.Total print passengers_by_port_class %pylab inline c_percents = passengers_by_port_class.loc[passengers_by_port_class['Embarked'] == 'C']['Percent'] q_percents = passengers_by_port_class.loc[passengers_by_port_class['Embarked'] == 'Q']['Percent'] s_percents = passengers_by_port_class.loc[passengers_by_port_class['Embarked'] == 'S']['Percent'] class_port_percents = pd.DataFrame.from_dict({'Cherbourg':c_percents.values, 'Queenstown':q_percents.values, 'Southampton':s_percents.values}, orient='index') class_port_percents.columns = ['1st', '2nd', '3rd'] ax = class_port_percents.plot(kind='bar', rot=0, title='Percentage of passengers in each class by port of embarkment') ax.set_xlabel('Port') sex_age_surv = titanic[['PassengerId', 'Sex', 'Age', 'Survived']] sex_age_surv_count = sex_age_surv.count() print sex_age_surv_count sex_surv = sex_age_surv[['PassengerId', 'Sex', 'Survived']] sex_surv_count = sex_surv[['PassengerId', 'Sex']].groupby('Sex').count() print sex_surv_count sex_surv_count['Survived'] = sex_surv[['Survived', 'Sex']].groupby('Sex').sum() print sex_surv_count totals = pd.Series(sex_surv_count.sum(), name='total') sex_surv_count = sex_surv_count.append(totals) sex_surv_count['SurvPerc'] = sex_surv_count.Survived * 100 / sex_surv_count.PassengerId print sex_surv_count sex_surv_count['SurvPerc'].plot(kind='bar', rot=0, title='Percentage of survivors by sex') age_surv = sex_age_surv[['PassengerId', 'Age', 'Survived']].dropna() print age_surv.Age.max() age_surv['bin'] = pd.cut(age_surv['Age'],np.arange(0,90,10), right=False) print age_surv.head() age_surv_count = age_surv[['PassengerId', 'bin']].groupby('bin').count() age_surv_count['Survived'] = age_surv[['Survived', 'bin']].groupby('bin').sum() age_surv_count['SurvPerc'] = age_surv_count.Survived * 100 / age_surv_count.PassengerId print age_surv_count ax = age_surv_count['SurvPerc'].plot(kind='bar', rot=0, title='Percentage of survivors by age') ax.set_xlabel('Age') sex_age_surv_copy = sex_age_surv.copy() sex_age_surv_copy.dropna() sex_age_surv_copy['bin'] = pd.cut(sex_age_surv['Age'],np.arange(0,90,10), right=False) print sex_age_surv_copy.head() sex_age_surv_count = sex_age_surv_copy[['PassengerId', 'Sex', 'bin']].groupby(['Sex', 'bin']).count() sex_age_surv_count['Survived'] = sex_age_surv_copy[['Survived', 'Sex', 'bin']].groupby(['Sex', 'bin']).sum() sex_age_surv_count['SurvPerc'] = sex_age_surv_count.Survived * 100 / sex_age_surv_count.PassengerId print sex_age_surv_count ax = sex_age_surv_count.loc['female']['SurvPerc'].plot() ax = sex_age_surv_count.loc['male']['SurvPerc'].plot(ax=ax, title='Percentage of female and male survivors by age') ax.legend(['Females', 'Males'], loc='best') ax.set_xlabel('Age') titanic['Has_Cabin'] = titanic.Cabin.notnull() cabin_surv = titanic[['PassengerId', 'Has_Cabin', 'Survived']].copy() cabin_surv_count = cabin_surv[['PassengerId', 'Has_Cabin']].groupby('Has_Cabin').count() print cabin_surv_count cabin_surv_count['Survived'] = cabin_surv[['Survived', 'Has_Cabin']].groupby('Has_Cabin').sum() print cabin_surv_count print titanic[['PassengerId', 'Has_Cabin', 'Pclass']].groupby(['Has_Cabin', 'Pclass']).count() class_surv = titanic[['PassengerId', 'Pclass']].copy() class_surv_count = class_surv.groupby('Pclass').count() class_surv_count['Survived'] = titanic[['Survived', 'Pclass']].groupby('Pclass').sum() print class_surv_count cabin_surv = titanic[['PassengerId', 'Has_Cabin', 'Survived']][titanic['Pclass'] == 1].copy() cabin_surv_count = cabin_surv[['PassengerId', 'Has_Cabin']].groupby('Has_Cabin').count() cabin_surv_count['Survived'] = cabin_surv[['Survived', 'Has_Cabin']].groupby('Has_Cabin').sum() cabin_surv_count['SurvPerc'] = cabin_surv_count['Survived'] * 100 / cabin_surv_count['PassengerId'] print cabin_surv_count ax = cabin_surv_count.SurvPerc.plot(kind='bar', rot=0, title='Percentage of first class survivors by cabin rental') ax.set_xlabel('Had a cabin') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We need the number of passengers for each port of embarkment and class Step2: and the total number of passengers for each port Step3: Now we can calculate the percentage of each class per port Step4: We can use a bar chart to visualize the results Step5: The graph shows that more than 90% of the passengers that embarked from Queenstown in Ireland where third class passengers, in contrast with the other ports, where third class made up for 40-55% of the total number of passengers. Step6: We do not have the age for every passenger, so we will have to take this into account when analysing the data. The rest of the data is complete. Step7: Because the Survived column can only contain 1 for yes and 0 for no, we can count all the survivors of each sex by grouping by sex and adding the Survived column. Step8: It looks like the survival rate is very biased towards the female sex Step9: We can know calculate the number of passengers in every age bin and how many of them survived Step10: The graph shows a survival rate of 60% for children below 10 years old. For the rest of the age groups, the survival rate oscillates between 30% and 45%. Step11: No females in the age group 70-80. Maybe that is one of the causes nobody survived in this bin. Now we plot female and male survival rates by age group Step12: The graph shows that for children below 10 both female and male survival rates are very similar. However, for the rest of age groups, the female survival rates are high, with the minimum around 70%, and male survival rates are low, with the maximum around 20%. Step13: And now we continue Step14: At first sight, it looks like having paid for a cabin affected the probability of survival. The problem is most cabins where occupied by fist class passengers Step15: and it looks like the passenger class also influenced survivability Step16: So, a fairer comparison could be between the 40 first class passengers that did not pay for a cabin and the rest of the same class
5,840
<ASSISTANT_TASK:> Python Code: from logic import * %psource dpll_satisfiable %psource dpll %psource min_clauses %psource moms %psource momsf %psource posit %psource zm %psource dlis %psource dlcs %psource jw %psource jw2 %psource cdcl_satisfiable %psource conflict_analysis %psource pl_binary_resolution %psource backjump %psource unit_propagation %psource TwoWLClauseDatabase %psource assign_decision_literal %psource luby %psource glucose from csp import * australia_csp = MapColoringCSP(list('RGB'), SA: WA NT Q NSW V; NT: WA Q; NSW: Q V; T: ) %time _, checks = AC3b(australia_csp, arc_heuristic=dom_j_up) f'AC3b with DOM J UP needs {checks} consistency-checks' %time backtracking_search(australia_csp, select_unassigned_variable=mrv, inference=forward_checking) australia_sat = MapColoringSAT(list('RGB'), SA: WA NT Q NSW V; NT: WA Q; NSW: Q V; T: ) %time model = dpll_satisfiable(australia_sat, branching_heuristic=no_branching_heuristic) %time model = dpll_satisfiable(australia_sat, branching_heuristic=moms) %time model = dpll_satisfiable(australia_sat, branching_heuristic=momsf) %time model = dpll_satisfiable(australia_sat, branching_heuristic=posit) %time model = dpll_satisfiable(australia_sat, branching_heuristic=zm) %time model = dpll_satisfiable(australia_sat, branching_heuristic=dlis) %time model = dpll_satisfiable(australia_sat, branching_heuristic=dlcs) %time model = dpll_satisfiable(australia_sat, branching_heuristic=jw) %time model = dpll_satisfiable(australia_sat, branching_heuristic=jw2) %time model = cdcl_satisfiable(australia_sat) {var for var, val in model.items() if val} france_csp = MapColoringCSP(list('RGBY'), AL: LO FC; AQ: MP LI PC; AU: LI CE BO RA LR MP; BO: CE IF CA FC RA AU; BR: NB PL; CA: IF PI LO FC BO; CE: PL NB NH IF BO AU LI PC; FC: BO CA LO AL RA; IF: NH PI CA BO CE; LI: PC CE AU MP AQ; LO: CA AL FC; LR: MP AU RA PA; MP: AQ LI AU LR; NB: NH CE PL BR; NH: PI IF CE NB; NO: PI; PA: LR RA; PC: PL CE LI AQ; PI: NH NO CA IF; PL: BR NB CE PC; RA: AU BO FC PA LR) %time _, checks = AC3b(france_csp, arc_heuristic=dom_j_up) f'AC3b with DOM J UP needs {checks} consistency-checks' %time backtracking_search(france_csp, select_unassigned_variable=mrv, inference=forward_checking) france_sat = MapColoringSAT(list('RGBY'), AL: LO FC; AQ: MP LI PC; AU: LI CE BO RA LR MP; BO: CE IF CA FC RA AU; BR: NB PL; CA: IF PI LO FC BO; CE: PL NB NH IF BO AU LI PC; FC: BO CA LO AL RA; IF: NH PI CA BO CE; LI: PC CE AU MP AQ; LO: CA AL FC; LR: MP AU RA PA; MP: AQ LI AU LR; NB: NH CE PL BR; NH: PI IF CE NB; NO: PI; PA: LR RA; PC: PL CE LI AQ; PI: NH NO CA IF; PL: BR NB CE PC; RA: AU BO FC PA LR) %time model = dpll_satisfiable(france_sat, branching_heuristic=no_branching_heuristic) %time model = dpll_satisfiable(france_sat, branching_heuristic=moms) %time model = dpll_satisfiable(france_sat, branching_heuristic=momsf) %time model = dpll_satisfiable(france_sat, branching_heuristic=posit) %time model = dpll_satisfiable(france_sat, branching_heuristic=zm) %time model = dpll_satisfiable(france_sat, branching_heuristic=dlis) %time model = dpll_satisfiable(france_sat, branching_heuristic=dlcs) %time model = dpll_satisfiable(france_sat, branching_heuristic=jw) %time model = dpll_satisfiable(france_sat, branching_heuristic=jw2) %time model = cdcl_satisfiable(france_sat) {var for var, val in model.items() if val} usa_csp = MapColoringCSP(list('RGBY'), WA: OR ID; OR: ID NV CA; CA: NV AZ; NV: ID UT AZ; ID: MT WY UT; UT: WY CO AZ; MT: ND SD WY; WY: SD NE CO; CO: NE KA OK NM; NM: OK TX AZ; ND: MN SD; SD: MN IA NE; NE: IA MO KA; KA: MO OK; OK: MO AR TX; TX: AR LA; MN: WI IA; IA: WI IL MO; MO: IL KY TN AR; AR: MS TN LA; LA: MS; WI: MI IL; IL: IN KY; IN: OH KY; MS: TN AL; AL: TN GA FL; MI: OH IN; OH: PA WV KY; KY: WV VA TN; TN: VA NC GA; GA: NC SC FL; PA: NY NJ DE MD WV; WV: MD VA; VA: MD DC NC; NC: SC; NY: VT MA CT NJ; NJ: DE; DE: MD; MD: DC; VT: NH MA; MA: NH RI CT; CT: RI; ME: NH; HI: ; AK: ) %time _, checks = AC3b(usa_csp, arc_heuristic=dom_j_up) f'AC3b with DOM J UP needs {checks} consistency-checks' %time backtracking_search(usa_csp, select_unassigned_variable=mrv, inference=forward_checking) usa_sat = MapColoringSAT(list('RGBY'), WA: OR ID; OR: ID NV CA; CA: NV AZ; NV: ID UT AZ; ID: MT WY UT; UT: WY CO AZ; MT: ND SD WY; WY: SD NE CO; CO: NE KA OK NM; NM: OK TX AZ; ND: MN SD; SD: MN IA NE; NE: IA MO KA; KA: MO OK; OK: MO AR TX; TX: AR LA; MN: WI IA; IA: WI IL MO; MO: IL KY TN AR; AR: MS TN LA; LA: MS; WI: MI IL; IL: IN KY; IN: OH KY; MS: TN AL; AL: TN GA FL; MI: OH IN; OH: PA WV KY; KY: WV VA TN; TN: VA NC GA; GA: NC SC FL; PA: NY NJ DE MD WV; WV: MD VA; VA: MD DC NC; NC: SC; NY: VT MA CT NJ; NJ: DE; DE: MD; MD: DC; VT: NH MA; MA: NH RI CT; CT: RI; ME: NH; HI: ; AK: ) %time model = dpll_satisfiable(usa_sat, branching_heuristic=no_branching_heuristic) %time model = dpll_satisfiable(usa_sat, branching_heuristic=moms) %time model = dpll_satisfiable(usa_sat, branching_heuristic=momsf) %time model = dpll_satisfiable(usa_sat, branching_heuristic=posit) %time model = dpll_satisfiable(usa_sat, branching_heuristic=zm) %time model = dpll_satisfiable(usa_sat, branching_heuristic=dlis) %time model = dpll_satisfiable(usa_sat, branching_heuristic=dlcs) %time model = dpll_satisfiable(usa_sat, branching_heuristic=jw) %time model = dpll_satisfiable(usa_sat, branching_heuristic=jw2) %time model = cdcl_satisfiable(usa_sat) {var for var, val in model.items() if val} zebra_csp = Zebra() zebra_csp.display(zebra_csp.infer_assignment()) %time _, checks = AC3b(zebra_csp, arc_heuristic=dom_j_up) f'AC3b with DOM J UP needs {checks} consistency-checks' zebra_csp.display(zebra_csp.infer_assignment()) %time backtracking_search(zebra_csp, select_unassigned_variable=mrv, inference=forward_checking) zebra_sat = associate('&', map(to_cnf, map(expr, filter(lambda line: line[0] not in ('c', 'p'), open('aima-data/zebra.cnf').read().splitlines())))) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=no_branching_heuristic) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=moms) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=momsf) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=posit) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=zm) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=dlis) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=dlcs) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=jw) %time model = dpll_satisfiable(zebra_sat, branching_heuristic=jw2) %time model = cdcl_satisfiable(zebra_sat) {var for var, val in model.items() if val and var.op.startswith(('Englishman', 'Japanese', 'Norwegian', 'Spaniard', 'Ukrainian'))} <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: DPLL with Branching Heuristics Step2: Each of these branching heuristics was applied only after the pure literal and the unit clause heuristic failed in selecting a splitting variable. Step3: Over the years, many types of MOMs heuristics have been proposed. Step4: Freeman’s POSIT <a name="ref-1"/>[1] version counts both the number of positive $x$ and negative $\lnot{x}$ occurrences of a given variable $x$. Step5: Zabih and McAllester’s <a name="ref-2"/>[2] version of the heuristic counts the negative occurrences $\lnot{x}$ of each given variable $x$. Step6: DLIS & DLCS Step7: Dynamic Largest Combined Sum considers the values $C_P$ and $C_N$ combined Step8: JW & JW2 Step9: The two-sided Jeroslow and Wang’s heuristic identifies the variable $x$ with the largest sum $J(x) + J(\lnot{x})$, and assigns to $x$ value true, if $J(x) \geq J(\lnot{x})$, and value false otherwise. Step10: CDCL with 1UIP Learning Scheme, 2WL Lazy Data Structure, VSIDS Branching Heuristic & Restarts Step11: Clause Learning with 1UIP Scheme Step12: 2WL Lazy Data Structure Step13: VSIDS Branching Heuristic Step14: Restarts Step15: Glucose Step16: Experimental Results Step18: Australia Step20: SAT Step21: DPLL Step22: CDCL Step24: France Step26: SAT Step27: DPLL Step28: CDCL Step30: USA Step32: SAT Step33: DPLL Step34: CDCL Step35: Zebra Puzzle Step36: SAT Step37: DPLL Step38: CDCL
5,841
<ASSISTANT_TASK:> Python Code: '{:.2f}'.format(8.499) '{:.2f}%'.format(10.12345) import re def truncate(num,decimal_places): dp = str(decimal_places) return re.sub(r'^(\d+\.\d{,'+re.escape(dp)+r'})\d*$',r'\1',str(num)) truncate(8.499,decimal_places=2) truncate(8.49,decimal_places=2) truncate(8.4,decimal_places=2) truncate(8,decimal_places=2) # make the total string size AT LEAST 9 (including digits and points), fill with zeros to the left '{:0>9}'.format(3.499) # make the total string size AT LEAST 2 (all included), fill with zeros to the left '{:0>2}'.format(3) # make the total string size AT LEAST 11 (including digits and points), fill with zeros to the RIGHT '{:<011}'.format(3.499) "{:,}".format(100000) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: format float as percentage Step2: truncate to at most 2 decimal places Step3: left padding with zeros Step4: right padding with zeros Step5: comma separators
5,842
<ASSISTANT_TASK:> Python Code: x=range(1,10) y=[1,2,3,4,0,4,3,2,1] plt.plot(x,y) # address = some data set # cars = pd.read_csv(address) # cars.columns = ['car_names','mpg','cyl','disp','hp','drat','wt','qsec','vs','am',gear',carb'] #mpg = cars['mpg'] #mpg.plot() plt.bar(x,y) #Creating bar chart from pandas object #mpg.plot(kind='bar') x=[1,2,3,4,0.5] plt.pie(x) plt.show() #plt.savefig('pie_chart.jpeg') Saves plot as jpeg in wd #plt.show() x=range(1,10) y=[1,2,3,4,0,4,3,2,1] fig=plt.figure() ax = fig.add_axes([.1, .1,1,1]) ax.plot(x,y) fig = plt.figure() ax = fig.add_axes([.1, .1,1,1]) ax.set_xlim([1,9]) ax.set_ylim([0,5]) ax.set_xticks([0,1,2,4,5,6,8,9,10]) ax.set_yticks([0,1,2,3,4,5]) ax.plot(x,y) fig = plt.figure() ax = fig.add_axes([.1, .1,1,1]) ax.set_xlim([1,9]) ax.set_ylim([0,5]) ax.grid() #seems like this takes away grid? different than tutorial ax.plot(x,y) fig = plt.figure() fig, (ax1,ax2)=plt.subplots(1,2) ax1.plot(x) ax2.plot(x,y) x = range(1,10) y= [1,2,3,4,0.5,4,3,2,1] plt.bar(x,y) wide=[0.5,0.5,0.5,0.9,0.9,0.5,0.5,0.9,0.9] color = ['salmon'] plt.bar(x, y, width=wide, color=color, align='center') z = [1,2,3,4,0.5] color_theme = ['#A9A9A9', '#FFA07A', '#B0E0E6','#FFE4CA','#BDB76B'] #hex codes plt.pie(z, colors = color_theme) plt.show() #line styles x1= range(0,10) y1=[10,9,8,7,6,5,4,3,2,1] plt.plot(x,y,ls = 'steps', lw = 5) plt.plot(x1,y1, ls = '--', lw = 10) #plot markers plt.plot(x,y,marker = '1', mew=20) plt.plot(x1,y1, marker = '+', mew=15) #functional method x= range(1,10) y=[1,2,3,4,0.5,4,3,2,1] plt.bar(x,y) plt.xlabel('your x-axis label') plt.ylabel('your y-axis label') z= [1,2,3,4,0.5] veh_type = ['bicycle', 'motorbike','car','van','stroller'] plt.pie(z, labels= veh_type) plt.show() #object oriented has ways of doing this too #uses cars dataset #didn't copy down everything #fig = plt.figure() #ax = fig.add_axes([]) #mpg.plot() #ax.set_xticks(range(32)) #ax.set_xticklabels() #ax.set_title('Title goes here') #ax.set_xlabel('car names') #ax.set_ylabel('miles/gal') #ax.legend(loc='best') #add legend plt.pie(z) plt.legend(veh_type, loc='best') plt.show() #annotate #object oriented: ax.annotate('Toyota Corolla', xy=(19,33,9), xytext=(21,35), #arrowprops = dict(facecolor='black',shrink=0.05)) #address = 'address' #df = pd.read_csv(address, index_col='Order Date', parse_dates=True) #df.head() #df2 = df.sample(n=100, random_state=25, axis=0) #plt.xlabel('Order Date') #plt.ylabel('Order Quantity') #plt.title('Superstore Sales') #df2['Order Quantity'].plot() from pandas.tools.plotting import scatter_matrix #pandas dataset import #mpg.plot(kind='hist') # or plt.hist(mpg) with plt.show() #with seaborn #sb.distplot(mpg) #scatterplots #cars.plot(kind='scatter',x='hp',y='mpg',c=['darkgray'], s=150) #sb.regplot(x='hp', y='mpg', data=cars, scatter=True) #seaborn automatically creates trend line #sb.pairplot(cars) #get subset of data using dataframes: #cars_df = pd.DataFrame((cars.ix[:,(1,3,4,6)].values), columns = ['mpg', 'disp','hp','wt']) #boxplots #cars.boxplot(column='mpg', by='am') #in seaborn #sb.boxplot(x='am', y='mpg', data=cars, palette='hls') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Plotting a line chart from a Pandas object Step2: Creating bar charts Step3: Creating a pie chart Step4: Defining elements of a plot Step5: Plot Formatting Step6: Note Step7: Create labels and annotations Step8: Time series visualizations Step9: Histograms, box plots, and scatter plots
5,843
<ASSISTANT_TASK:> Python Code: df=pd.read_csv("311-2014.csv",nrows=20000) df.head() df.columns df.info() dateutil.parser.parse('07/16/1990').month def parse_date (str_date): return dateutil.parser.parse(str_date)#dateutil is a module, import parser class, then transform a string into a python time object df['Created Date']= df['Created Date'].apply(parse_date) df.head(3) df['Complaint Type'].value_counts() # the most popular type of complaint is blocked driveway, and it was filed 2534 times df['Complaint Type'].value_counts().head(5).sort_values().plot(kind='barh') df['Borough'].value_counts() people_bronx= 1438159 people_queens= 2321580 people_manhattan=1636268 people_brooklyn= 2621793 people_staten_island= 473279 complaints_per_capita_bronx= 29610/people_bronx complaints_per_capita_bronx [x for x in list(df['Created Date'].values)]# if np.datetime64(x, 'M') == 3] date_index = pd.DatetimeIndex(df['Created Date'].values)#for dataframe, each column is a series(object), call a values method len([x for x in date_index.month if x == 3]) iterable = filter(lambda x: x == 3, list(date_index.month)) march_days = 0 for x in iterable: march_days += 1 march_days df.index=df['Created Date'] df.head() df['2015-04-01'] df['2015-04-01']['Complaint Type'].value_counts().head(3) df.resample('M').count().plot(y="Unique Key",legend=False) #http://pandas.pydata.org/pandas-docs/stable/timeseries.html#up-and-downsampling #resample is a time-based groupby, followed by a reduction method on each of its groups ax= df.groupby(df.index.month).count().plot(y='Unique Key', legend=False) ax.set_xticks([1,2,3,4,5,6,7,8,9,10,11, 12]) ax.set_xticklabels(['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec']) ax.set_ylabel("Number of Complaints") ax.set_title("311 complains filed monthly in 2015") #september has the most complaints cases filed <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: What was the most popular type of complaint, and how many times was it filed? Step2: Make a horizontal bar graph of the top 5 most frequent complaint types. Step3: Which borough has the most complaints per capita? Since it's only 5 boroughs, you can do the math manually. Step4: According to your selection of data, how many cases were filed in March? How about May? Step5: I'd like to see all of the 311 complaints called in on April 1st. Step6: What was the most popular type of complaint on April 1st? Step7: What month has the most reports filed? How many? Graph it.
5,844
<ASSISTANT_TASK:> Python Code: # Author: Martin Luessi <mluessi@nmr.mgh.harvard.edu> # # License: BSD (3-clause) import numpy as np import mne from mne import io from mne.connectivity import spectral_connectivity, seed_target_indices from mne.datasets import sample from mne.time_frequency import AverageTFR print(__doc__) data_path = sample.data_path() raw_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw.fif' event_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw-eve.fif' # Setup for reading the raw data raw = io.read_raw_fif(raw_fname) events = mne.read_events(event_fname) # Add a bad channel raw.info['bads'] += ['MEG 2443'] # Pick MEG gradiometers picks = mne.pick_types(raw.info, meg='grad', eeg=False, stim=False, eog=True, exclude='bads') # Create epochs for left-visual condition event_id, tmin, tmax = 3, -0.2, 0.5 epochs = mne.Epochs(raw, events, event_id, tmin, tmax, picks=picks, baseline=(None, 0), reject=dict(grad=4000e-13, eog=150e-6), preload=True) # Use 'MEG 2343' as seed seed_ch = 'MEG 2343' picks_ch_names = [raw.ch_names[i] for i in picks] # Create seed-target indices for connectivity computation seed = picks_ch_names.index(seed_ch) targets = np.arange(len(picks)) indices = seed_target_indices(seed, targets) # Define wavelet frequencies and number of cycles cwt_freqs = np.arange(7, 30, 2) cwt_n_cycles = cwt_freqs / 7. # Run the connectivity analysis using 2 parallel jobs sfreq = raw.info['sfreq'] # the sampling frequency con, freqs, times, _, _ = spectral_connectivity( epochs, indices=indices, method='wpli2_debiased', mode='cwt_morlet', sfreq=sfreq, cwt_freqs=cwt_freqs, cwt_n_cycles=cwt_n_cycles, n_jobs=1) # Mark the seed channel with a value of 1.0, so we can see it in the plot con[np.where(indices[1] == seed)] = 1.0 # Show topography of connectivity from seed title = 'WPLI2 - Visual - Seed %s' % seed_ch layout = mne.find_layout(epochs.info, 'meg') # use full layout tfr = AverageTFR(epochs.info, con, times, freqs, len(epochs)) tfr.plot_topo(fig_facecolor='w', font_color='k', border='k') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set parameters
5,845
<ASSISTANT_TASK:> Python Code: df['x4'] = 1 X = df.iloc[:,(0,1,2,4)].values y = df.y.values inv_XX_T = inv(X.T.dot(X)) w = inv_XX_T.dot(X.T).dot(df.y.values) w qr(inv_XX_T) X.shape #solve(X,y)##只能解方阵 def f(w,X,y): return ((X.dot(w)-y)**2/(2*1000)).sum() def grad_f(w,X,y): return (X.dot(w) - y).dot(X)/1000 w0 = np.array([100.0,100.0,100.0,100.0]) epsilon = 1e-10 alpha = 0.1 check_condition = 1 while check_condition > epsilon: w0 += -alpha*grad_f(w0,X,y) check_condition = abs(grad_f(w0,X,y)).sum() print w0 def cost_function(w,X,y): return (X.dot(w)-y)**2/2 def grad_cost_f(w,X,y): return (np.dot(X, w) - y)*X w0 = np.array([1.0, 1.0, 1.0, 1.0]) epsilon = 1e-3 alpha = 0.01 # 生成随机index,用来随机索引数据. random_index = np.arange(1000) np.random.shuffle(random_index) cost_value = np.inf #初始化目标函数值 while abs(grad_f(w0,X,y)).sum() > epsilon: for i in range(1000): w0 += -alpha*grad_cost_f(w0,X[random_index[i]],y[random_index[i]]) #检查目标函数变化趋势, 如果趋势变化达到临界值, 更新更小的步长继续计算 difference = cost_value - f(w0, X, y) if difference < 1e-10: alpha *= 0.9 cost_value = f(w0, X, y) print w0 <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: $y = Xw$ Step2: Results Step3: 梯度下降法求解 Step4: 随机梯度下降法求解
5,846
<ASSISTANT_TASK:> Python Code: %matplotlib inline from parcels import FieldSet, ParticleSet, JITParticle, Variable, AdvectionRK4 import numpy as np import matplotlib.pyplot as plt from matplotlib import cm import xarray as xr dims = [5, 4] dx, dy = 1./dims[0], 1./dims[1] dimensions = {'lat': np.linspace(0., 1., dims[0], dtype=np.float32), 'lon': np.linspace(0., 1., dims[1], dtype=np.float32)} data = {'U': np.zeros(dims, dtype=np.float32), 'V': np.zeros(dims, dtype=np.float32), 'P': np.random.rand(dims[0], dims[1])+0.1} data['P'][1, 1] = 0. fieldset = FieldSet.from_data(data, dimensions, mesh='flat') class SampleParticle(JITParticle): p = Variable('p', dtype=np.float32) def SampleP(particle, fieldset, time): particle.p = fieldset.P[time, particle.depth, particle.lat, particle.lon] pset = {} for p_interp in ['linear', 'linear_invdist_land_tracer', 'nearest', 'cgrid_tracer']: fieldset.P.interp_method = p_interp # setting the interpolation method for fieldset.P xv, yv = np.meshgrid(np.linspace(0, 1, 8), np.linspace(0, 1, 8)) pset[p_interp] = ParticleSet(fieldset, pclass=SampleParticle, lon=xv.flatten(), lat=yv.flatten()) pset[p_interp].execute(SampleP, endtime=1, dt=1) fig, ax = plt.subplots(1, 4, figsize=(18, 5)) for i, p in enumerate(pset.keys()): data = fieldset.P.data[0, :, :] data[1, 1] = np.nan x = np.linspace(-dx/2, 1+dx/2, dims[0]+1) y = np.linspace(-dy/2, 1+dy/2, dims[1]+1) if p == 'cgrid_tracer': for lat in fieldset.P.grid.lat: ax[i].axhline(lat, color='k', linestyle='--') for lon in fieldset.P.grid.lon: ax[i].axvline(lon, color='k', linestyle='--') ax[i].pcolormesh(y, x, data, vmin=0.1, vmax=1.1) ax[i].scatter(pset[p].lon, pset[p].lat, c=pset[p].p, edgecolors='k', s=50, vmin=0.1, vmax=1.1) xp, yp = np.meshgrid(fieldset.P.lon, fieldset.P.lat) ax[i].plot(xp, yp, 'kx') ax[i].set_title("Using interp_method='%s'" % p) plt.show() plt.scatter(pset['linear'].lon, pset['linear'].lat, c=pset['linear_invdist_land_tracer'].p-pset['linear'].p, edgecolors='k', s=50, cmap=cm.bwr, vmin=-0.25, vmax=0.25) plt.colorbar() plt.title("Difference between 'interp_method=linear' and 'interp_method=linear_invdist_land_tracer'") plt.show() def calc_p(t, y, x): return 10*t+x+0.2*y dims = [2, 4, 5] dimensions = {'lon': np.linspace(0., 1., dims[2], dtype=np.float32), 'lat': np.linspace(0., 1., dims[1], dtype=np.float32), 'time': np.arange(dims[0], dtype=np.float32)} p = np.zeros(dims, dtype=np.float32) for i, x in enumerate(dimensions['lon']): for j, y in enumerate(dimensions['lat']): for n, t in enumerate(dimensions['time']): p[n, j, i] = calc_p(t, y, x) data = {'U': 0.5*np.ones(dims, dtype=np.float32), 'V': np.zeros(dims, dtype=np.float32), 'P': p} fieldset = FieldSet.from_data(data, dimensions, mesh='flat') xv, yv = np.meshgrid(np.arange(0, 1, 0.5), np.arange(0, 1, 0.5)) class SampleParticle(JITParticle): p = Variable('p', dtype=np.float32) pset = ParticleSet(fieldset, pclass=SampleParticle, lon=xv.flatten(), lat=yv.flatten()) def SampleP(particle, fieldset, time): offset sampling by dt particle.p = fieldset.P[time+particle.dt, particle.depth, particle.lat, particle.lon] kernels = AdvectionRK4 + pset.Kernel(SampleP) # Note that the order of concatenation matters here! pfile = pset.ParticleFile("interpolation_offset.nc", outputdt=1) pset.execute(kernels, endtime=1, dt=1, output_file=pfile) pfile.close() for p in pset: assert np.isclose(p.p, calc_p(p.time, p.lat, p.lon)) ds = xr.open_dataset("interpolation_offset.nc").isel(obs=1) for i in range(len(ds['p'])): assert np.isclose(ds['p'].values[i], calc_p(float(ds['time'].values[i])/1e9, ds['lat'].values[i], ds['lon'].values[i])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We create a small 2D grid where P is a tracer that we want to interpolate. In each grid cell, P has a random value between 0.1 and 1.1. We then set P[1,1] to 0, which for Parcels specifies that this is a land cell Step2: We create a Particle class that can sample this field Step3: Now, we perform four different interpolation on P, which we can control by setting fieldset.P.interp_method. Note that this can always be done after the FieldSet creation. We store the results of each interpolation method in an entry in the dictionary pset. Step4: And then we can show each of the four interpolation methods, by plotting the interpolated values on the Particle locations (circles) on top of the Field values (background colors) Step5: The white box is here the 'land' point where the tracer is set to zero and the crosses are the locations of the grid points. As you see, the interpolated value is always equal to the field value if the particle is exactly on the grid point (circles on crosses). Step6: So in summary, Parcels has four different interpolation schemes for tracers Step7: Let's define a simple FieldSet with two timesteps, a 0.5 m/s zonal velocity and no meridional velocity. Step8: Now create four particles and a Sampling class so we can sample the Field P Step10: The key now is that we need to create a sampling Kernel where the Field P is sampled at time+particle.dt and that we concatenate this kernel after the AdvectionRK4 Kernel Step11: We can now run these kernels on the ParticleSet Step12: And we can check whether the Particle.p values indeed are consistent with the calc_p() values Step13: And the same for the netcdf file (note that we need to convert time from nanoseconds to seconds)
5,847
<ASSISTANT_TASK:> Python Code: !pip install git+https://github.com/google/starthinker from starthinker.util.configuration import Configuration CONFIG = Configuration( project="", client={}, service={}, user="/content/user.json", verbose=True ) FIELDS = { 'account':'', 'auth_cm':'user', # Credentials used for CM. 'floodlight_activity_id':'', 'auth_bigquery':'user', # Credentials for BigQuery. 'floodlight_conversion_type':'encryptedUserId', # Must match the values specifed in the last column. 'encryption_entity_id':'', # Typically the same as the account id. 'encryption_entity_type':'DCM_ACCOUNT', 'encryption_entity_source':'DATA_TRANSFER', 'dataset':'Source containing the conversion data.', 'table':'Source containing the conversion data.', 'legacy':False, # Matters if source is a view. } print("Parameters Set To: %s" % FIELDS) from starthinker.util.configuration import execute from starthinker.util.recipe import json_set_fields TASKS = [ { 'conversion_upload':{ 'auth':{'field':{'name':'auth_cm','kind':'authentication','order':1,'default':'user','description':'Credentials used for CM.'}}, 'account_id':{'field':{'name':'account','kind':'string','order':0,'default':''}}, 'activity_id':{'field':{'name':'floodlight_activity_id','kind':'integer','order':1,'default':''}}, 'conversion_type':{'field':{'name':'floodlight_conversion_type','kind':'choice','order':2,'choices':['encryptedUserId','encryptedUserIdCandidates','dclid','gclid','matchId','mobileDeviceId'],'default':'encryptedUserId','description':'Must match the values specifed in the last column.'}}, 'encryptionInfo':{ 'encryptionEntityId':{'field':{'name':'encryption_entity_id','kind':'integer','order':3,'default':'','description':'Typically the same as the account id.'}}, 'encryptionEntityType':{'field':{'name':'encryption_entity_type','kind':'choice','order':4,'choices':['ADWORDS_CUSTOMER','DBM_ADVERTISER','DBM_PARTNER','DCM_ACCOUNT','DCM_ADVERTISER','DFP_NETWORK_CODE'],'default':'DCM_ACCOUNT'}}, 'encryptionSource':{'field':{'name':'encryption_entity_source','kind':'choice','order':5,'choices':['AD_SERVING','DATA_TRANSFER'],'default':'DATA_TRANSFER'}} }, 'from':{ 'bigquery':{ 'auth':{'field':{'name':'auth_bigquery','kind':'authentication','order':1,'default':'user','description':'Credentials for BigQuery.'}}, 'dataset':{'field':{'name':'dataset','kind':'string','order':6,'default':'Source containing the conversion data.'}}, 'table':{'field':{'name':'table','kind':'string','order':7,'default':'Source containing the conversion data.'}}, 'legacy':{'field':{'name':'legacy','kind':'boolean','order':8,'default':False,'description':'Matters if source is a view.'}} } } } } ] json_set_fields(TASKS, FIELDS) execute(CONFIG, TASKS, force=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2. Set Configuration Step2: 3. Enter CM360 Conversion Upload From BigQuery Recipe Parameters Step3: 4. Execute CM360 Conversion Upload From BigQuery
5,848
<ASSISTANT_TASK:> Python Code: %%writefile Snakefile rule: input: 'fileA.txt' output: 'fileB.txt' shell: 'cp fileA.txt fileB.txt' %%sh snakemake fileB.txt %%writefile -a Snakefile rule: output: 'fileA.txt' shell: 'touch fileA.txt' %%sh snakemake %%sh snakemake --dag | dot | display snakemake --dag | dot -Tsvg > dag0.svg %%writefile Snakefile rule copy_A_to_B: input: 'fileA.txt' output: 'fileB.txt' shell: 'cp {input} {output}' rule create_A: output: 'fileA.txt' shell: 'touch fileA.txt' %%sh snakemake --dag | dot | display snakemake --dag | dot -Tsvg > dag1.svg %%writefile Snakefile rule copy_to_new_folder: input: 'original_data/file{id}.txt' output: 'new_data/file{id}.txt' shell: 'cp {input} {output}' rule create_file: output: 'original_data/file{id}.txt' shell: 'touch {output}' %%sh snakemake new_data/fileZ.txt --dag | dot | display snakemake new_data/fileZ.txt --dag | dot -Tsvg > dag2.svg snakemake new_data/fileZ.txt %%writefile Snakefile rule all: input: expand('new_data/file{id}.txt', id=range(10)) rule copy_to_new_folder: input: 'original_data/file{id}.txt' output: 'new_data/file{id}.txt' shell: 'cp {input} {output}' rule create_file: output: 'original_data/file{id}.txt' shell: 'touch {output}' %%sh snakemake --dag | dot | display snakemake --dag | dot -Tsvg > dag3.svg %%writefile generate_data.py import sys import numpy as np def generate_random_data(output_filename): # write a random number in an output file with open(output_filename, "w") as f: f.write(np.random.random()) # extracting the output filename from the command line parameters provided output_filename = sys.argv[1] generate_random_data(output_filename) %%writefile Snakefile rule all: input: expand('new_data/file{id}.txt', id=range(10)) rule copy_to_new_folder: input: 'original_data/file{id}.txt' output: 'new_data/file{id}.txt' shell: 'cp {input} {output}' rule generate_data: output: 'original_data/file{id}.txt' run: 'generate_data.py {output}' %%sh snakemake --dag | dot | display snakemake --dag | dot -Tsvg > dag4.svg # imports for data handling and visualization from quantities import Hz, ms from elephant.spike_train_generation import homogeneous_poisson_process, compound_poisson_process import neo import numpy as np import matplotlib.pyplot as plt spiketrain = homogeneous_poisson_process(20*Hz, 0*ms, 1000*ms) print('The spiketrain', spiketrain) print('Spiketrain attributes and physical units') print(['{}: {}'.format(att, getattr(spiketrain, att)) for att in ['t_start', 't_stop', 'sampling_rate', 'annotations']]) print(['{}: {}'.format(att, getattr(spiketrain, att).units.dimensionality) for att in ['t_start', 't_stop', 'sampling_rate']]) import neo import quantities as pq from elephant.spike_train_generation import homogeneous_poisson_process, compound_poisson_process def generate_data(output_file, n=10): with neo.io.NixIO(output_file, 'ow') as io: # generate neo structure block = neo.Block(experiment='poisson') block.segments.append(neo.Segment(name='trial 1')) # generate correlated spike trains sts = compound_poisson_process(rate=5*pq.Hz, A=[0]+[0.90]+[0]*9+[0.1], t_stop=10*pq.s) # add background poisson spike trains for i in range(89): sts.append(homogeneous_poisson_process(rate=5*pq.Hz, t_stop=10*pq.s)) block.segments[0].spiketrains.extend(sts) block.create_relationship() io.write_block(block) generate_data('original_data/example_dataset.nix') %%writefile generate_poisson.py import sys import neo import quantities as pq from quantities import Hz, ms from elephant.spike_train_generation import homogeneous_poisson_process, compound_poisson_process def generate_data(output_file, n=10): with neo.io.NixIO(output_file, 'ow') as io: # generate neo structure block = neo.Block(experiment='poisson') block.segments.append(neo.Segment(name='trial 1')) # generate correlated spike trains sts = compound_poisson_process(rate=5*pq.Hz, A=[0]+[0.90]+[0]*9+[0.1], t_stop=10*pq.s) # add background poisson spike trains for i in range(89): sts.append(homogeneous_poisson_process(rate=5*pq.Hz, t_stop=10*pq.s)) block.segments[0].spiketrains.extend(sts) block.create_relationship() io.write_block(block) if __name__=='__main__': generate_data(*sys.argv[1:]) %%sh python generate_poisson.py original_data/example_dataset.nix %%writefile Snakefile rule all: input: expand('original_data/dataset{id}.nix', id=range(10)) rule generate_data: output: 'original_data/dataset{id,[0-9]}.nix' shell: 'python generate_poisson.py {output}' %%sh snakemake -pr %%sh snakemake --dag | dot | display snakemake --dag | dot -Tsvg > dag5.svg %%writefile plot_data.py import sys import numpy as np import neo import matplotlib.pyplot as plt def plot_data(data_filename, plot_filename): # opening the data file with neo.io.NixIO(data_filename, 'ro') as io: block = io.read_block() # plot spiketrains for i, spiketrain in enumerate(block.segments[0].spiketrains): plt.plot(spiketrain, [i]*len(spiketrain), 'C0.') # this is for later steps in the analysis: plot patterns if already detected if 'pattern' in spiketrain.annotations: pattern_spikes = spiketrain[np.where(spiketrain.annotations['pattern'])] plt.plot(pattern_spikes, [i]*len(pattern_spikes), 'r.') plt.xlabel('Time [{}]'.format(spiketrain[0].units.dimensionality.latex)) plt.ylabel('Spiketrains') plt.savefig(plot_filename) if __name__=='__main__': plot_data(*sys.argv[1:]) from plot_data import plot_data plot_data('original_data/dataset2.nix', 'original_data/dataset2.png') %%writefile -a Snakefile rule plot_data: input: '{folder}/dataset{id}.nix' output: '{folder}/dataset{id}.png' shell: 'python plot_data.py {input} {output}' %%sh snakemake original_data/dataset0.png %%writefile run_spade.py import sys import numpy as np import neo import quantities as pq import elephant.spade def clean_nix_annotations(block): '''helper function needed for neo 0.7.1''' # removing unnessesary annotations to permit block to be saved again via nix objs = [block] + block.filter(data=True, container=True) for obj in objs: if 'nix_name' in obj.annotations: obj.annotations.pop('nix_name') if 'neo_name' in obj.annotations: obj.annotations.pop('neo_name') def run_spade(data_filename, output_filename): # loading dataset with neo.io.get_io(data_filename, 'rw') as io: block = io.read_block() spiketrains = block.segments[0].spiketrains # run spade analysis patterns = elephant.spade.spade( data=spiketrains, binsize=1*pq.ms, winlen=1, dither=5*pq.ms, min_spikes=3, n_surr=10, psr_param=[0,0,3], output_format='patterns')['patterns'] # convert first pattern into annotations of spiketrains # default: no spike belongs to any pattern for spiketrain in spiketrains: spiketrain.annotate(pattern=np.array([False]*len(spiketrain))) # convert first detected pattern to annotations of spiketrains for pattern_id, pattern in enumerate(patterns): neurons = pattern['neurons'] times = pattern['times'] lags = pattern['lags'] for n, neuron in enumerate(neurons): if n == 0: pattern_times = times else: pattern_times = times + lags[n-1] for pattern_time in pattern_times: spike_idx = np.abs(spiketrains[neuron]-pattern_time).argmin() spiketrains[neuron].annotations['pattern'][spike_idx] = True # overwrite original neo file clean_nix_annotations(block) with neo.io.NixIO(output_filename, 'ow') as io2: io2.write_block(block) if __name__=='__main__': run_spade(*sys.argv[1:]) %%writefile -a Snakefile rule run_spade: input: 'original_data/dataset{id}.nix' output: 'results/dataset{id}.nix' shell: 'python run_spade.py {input} {output}' %%sh snakemake results/dataset0.nix %%writefile convert_to_nix.py import sys import neo import quantities as pq def convert_data_to_nix(input_filename, nix_filename): print(input_filename) '''extracting first seconds of first spiketrains into separate nix file''' io = neo.io.BlackrockIO(input_filename) original_block = io.read_block() # Extracting spiketrain and append to new block block = neo.Block(experiment='monkey') block.segments.append(neo.Segment(name='first seconds of recording')) new_spiketrains = [st.time_slice(0*pq.s,10*pq.s) for st in original_block.segments[-1].spiketrains[:100]] block.segments[0].spiketrains = new_spiketrains # save new block with neo.io.NixIO(nix_filename, 'ow') as io2: io2.write_block(block) if __name__=='__main__': convert_data_to_nix(*sys.argv[1:]) %%writefile -a Snakefile rule download_data: output: nev = 'original_data/dataset10.nev', ns2 = 'original_data/dataset10.ns2' shell: ''' wget -O {output.nev} https://web.gin.g-node.org/INT/multielectrode_grasp/raw/24cd5caee3ae79066ca37844cab931d04dcad977/datasets/i140703-001-03.nev wget -O {output.ns2} https://web.gin.g-node.org/INT/multielectrode_grasp/raw/24cd5caee3ae79066ca37844cab931d04dcad977/datasets/i140703-001.ns2 ''' rule convert_to_nix: input: '{filename}.nev', '{filename}.ns2' output: '{filename}.nix' shell: 'python convert_to_nix.py {wildcards.filename} {output}' rule run_complete: input: expand('results/dataset{id}.png', id=range(11)) %%sh snakemake run_complete %%sh snakemake run_complete --dag | dot | display snakemake run_complete --dag | dot -Tsvg > run_complete.svg <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: For snakemake the workflow definition needs to be specified in a Snakefile and can be executed by calling snakemake in a terminal in the same location as the Snakefile. Here the example rule above has been exported into a Snakefile using the %%writefile jupyter magic command. Step2: This fails with snakemake complaining about Step3: And ask snakemake again to generate the fileB.txt for us Step4: Internally snakemake is first resolving the set of rules into a directed acyclic graph (dag) to determine in which order the rules need to be executed. We can generate a visualization of the workflow using the --dag flag in combination with dot and display (for local notebook instances) or save the graph as svg (e.g. for remote instances). Step5: The resulting graph shows the dependencies between the two rules, which were automatically enumerated. The line style (continuous/dashed) indicated whether the rules were already executed or not. Step6: Here we already used a different notation to specify in the shell command cp {input} {output} instead of explicitly repeating the input and output filenames. These placeholders will be substituted by snakemake during execution by the filenames defined as input / output. We can use the same notation to generalize the required input of the rule depending on the output, e.g., we permit the copy rule to work for arbitrary files having a certain naming scheme. Here a new folder new_folder is automatically generated for the copied files. Step7: For running the workflow now, we need to specify which file we actually need as a final result and snakemake takes care of the individual steps to generate that file. We specify the desired output file as a snakemake argument Step8: To generate a set of output files, we can either request these individually when running snakemake, e.g. using snakemake -np new_folder/file{0,1,2,3,4,5,6,7,8,9}.txt. In case the workflow output is not being changed frequently, it is also possible to add a final rule (conventionally named 'all'), which requests all desired output files of the workflow Step9: Here I used the snakemake function expand, which extends a given statement (here new_folder_file{id}.txt) for all combinations of parameters provided (here id values from 0 to 10). This permits to easily applied a set of rules to a number of different files. Step10: The corresponding snakemake rule now needs to provide the argument to the generate_data.py script Step11: Additional features worth having a look at Step12: Neo and Elephant are handling physical units consistently during the analysis by using the Python module quantities. This also requires parameters to be supplied in the correct dimension, such that the physical units can be matched during analysis. In general Neo objects capture all minimal information relevant for the interpretation of the data. In case of the spiketrain, this encompasses the start and stop times of recording/spike extraction as well the sampling rate and potential custom annotations in form of a dictionary. Step13: An a first rule in our new workflow, let's generate multiple datasets with spiking activity and save them for future analysis steps. From the variety of file formats supported by Neo NIX has an hdf5 backend. Let's implement a virtual expiment, generating 100 Poisson spiketrains stored in the NIX framework Step14: We export this piece of code into a standalone script so we can use it in the snakemake workflow Step15: The first rule in the workflow knows how to utilize the script to generate 10 new datasets. We limit the ids of the generated datasets from 0 to 9 to be able to use higher ids for different datasets. Step16: And running the workflow. The output files should appear here. Have a look at the shell output of snakemake. It should list the number and type of jobs which are going to be run and the wildcards and status of each job. Step17: To visualize the generated data, we implement a utility script to load the data and a second script plot the data using Matplotlib. Step18: Now we can visualize the previously generated data. The introduced correlation should be visible already by eye in this arrangement of the spiketrains. In case of random reordering however this looks different. Step19: For the context of this analysis we teach snakemake how to go from arbitraty datasets in the nix format to a plot of the data. Now the exact data location of the nix file is not relevant any more since we introduced an additional folder wildcard. Step20: Running SPADE Step21: We add a rule to the snakemake workflow for runnig spade Step22: Now we can run spade by simply requesting the analysis result from snakemake Step23: Apply analysis to experimental data <img src=https Step24: For fetching the data we directly download the data using wget. A more elegant version would involve installation of git annex or the gin client to be consistent with the version management handled by gin. We also add a generic rule which permits the conversion of BlackRock files to nix files while cropping only a selection of the data. The final rule run_complete requests visualizations of all analysis runs and therefore triggers the whole workflow. Step25: The whole workflow encompasses now artificial data generation as well as retrieval of experimental data as well as a common analysis and visualization.
5,849
<ASSISTANT_TASK:> Python Code: import datetime print(datetime.datetime.now()) %pylab inline !ls #Example of how to compute the sum of two lists def add(x,y): add=0 for element_x in x: add=add+element_x for element_y in y: add=add+element_y return add my_list = range(0,100) print(my_list) %timeit -n10 sum_1=add(my_list,my_list) #I compute 10 iterations #Example using numpy arrays my_array = np.arange(0,100,1) print(my_array) %timeit -n10 np.sum(my_array+my_array) #I compute 10 iterations #%load ex1.py #my_list = [[1,2],[3,4]] #my_array=np.arange(1,5,1) #my_array=my_array.reshape(2,2) #In this example we will split a random array into three different categories taking advantage of the numpy masks #We generate an array with 1000 random elements in the interval [0,1) my_array = np.random.random(1000) %time mask = [np.logical_and(my_array>i/3.,my_array<(i+1)/3.) for i in range(0,3)] print(len(my_array[mask[0]]), len(my_array[mask[1]]), len(my_array[mask[2]])) #This is a very simple implementation. #Maybe sorting the list first or using a matrix instead of lists it would be faster %time #Use %%time for python2.x arr1=[] arr2=[] arr3=[] for element in my_array: if(element>0 and element<1./3.): arr1.append(element) if(element>1./3. and element<2./3.): arr2.append(element) else: arr3.append(element) #First we are going to set up the plots to be SVGs instead of the default PNGs ### Uncomment this cell to use SVG #%config InlineBackend.figure_formats = {'svg',} #We will sample the function in 100 points from 0 to pi x = np.linspace(0,np.pi,100) #We compute the sine of the numpy array x y = np.sin(x) #We make the plot (it automatically generates the figure) plt.plot(x,y,'-',color='green',label='$\sin(x)$') #We add the label to the X and Y axes plt.xlabel('$x$') plt.ylabel('$\sin(x)$') #We generate the legend plt.legend() #We change the limits of the X and Y axes plt.xlim(-0.05,np.pi+0.05) plt.ylim(-0.05,1.05) #plt.hist2d # %load ex2.py def ex2(): rs = np.random.RandomState(112) x=np.linspace(0,10,11) y=np.linspace(0,10,11) X,Y = np.meshgrid(x,y) X=X.flatten() Y=Y.flatten() weights=np.random.random(len(X)) plt.hist2d(X,Y,weights=weights); #The semicolon here avoids that Jupyter shows the resulting arrays ex2() #First let's import seaborn (a warning will appear because it conflicts with %pylab inline) import seaborn as sns #Compare with matplotlib style (you can still use the same commands but they will render in seaborn style) #We make the plot (it automatically generates the figure) plt.plot(x,y,'-',color='green',label='$\sin(x)$') #We add the label to the X and Y axes plt.xlabel('$x$') plt.ylabel('$\sin(x)$') #We generate the legend plt.legend() #We change the limits of the X and Y axes plt.xlim(-0.05,np.pi+0.05) plt.ylim(-0.05,1.05) #sns.jointplot() # %load ex3.py def ex3(): rs = np.random.RandomState(112) x=np.linspace(0,10,11) y=np.linspace(0,10,11) X,Y = np.meshgrid(x,y) X=X.flatten() Y=Y.flatten() weights=np.random.random(len(X)) sns.jointplot(X,Y,kind='hex',joint_kws={'C':weights}); #The semicolon here avoids that Jupyter shows the resulting arrays ex3() #We import the package needed to read the file import astropy.io.fits as fits path = './downloaded_data/LSST_i_trimmed.fits.gz' #We open the file and it gives us an hdulist hdulist = fits.open(path) #We can check what this hdulist has using print print(hdulist) #We are going to see what is in the image, we use imshow and select a gray colormap #we also select a minimum of 0 in the colorbar (vmin) and a maximum of 250 (vmax) plt.imshow(hdulist[0].data,vmin=0,vmax=250,cmap='gray') #Show the colorbar plt.colorbar() #Importing astropy.table import astropy.table #reading the table. In a multi-hdu file we can specify the hdu with read(path,hdu=num_hdu) table = astropy.table.Table.read(path) #we show the contents of the table table #We print the purity column of the table print(table['purity']) plt.hist # %load ex4.py def ex4(): masks = [np.logical_and(table['purity']>i/4.,table['purity']<(i+1)/4.) for i in range(0,4)] for i in range(0,4): label = str(i/4.)+' < purity < '+str((i+1)/4.) plt.hist(table['snr_iso'][masks[i]],range=(0,20),bins=40, label=label, alpha=0.5, normed=True) plt.legend() plt.figure() for i in range(0,4): label = str(i/4.)+' < purity < '+str((i+1)/4.) plt.hist(table['snr_grpf'][masks[i]],range=(0,20),bins=40, label=label, alpha=0.5, normed=True) plt.legend() ex4() #We are going to use some columns of the table above to produce a useful pairplot #We make use of numpy masks! selection = np.empty(len(table['snr_grpf']),dtype='a20') mask_03 = table['purity']<=0.3 mask_06 = np.logical_and(table['purity']>0.3,table['purity']<=0.6) mask_09 = np.logical_and(table['purity']>0.6,table['purity']<=0.9) mask_1 = table['purity']>0.9 selection[mask_03]="purity<=0.3" selection[mask_06]="0.3<purity<=0.6" selection[mask_09]="0.6<purity<=0.9" selection[mask_1]="purity>0.9" #We require the values dg1 and dg2 to be finite in order that seaborn creates automatically the histograms masked_array = np.logical_not(np.logical_or(np.isinf(table['dg1_grp']),np.isinf(table['dg2_grp']))) #We are going to plot just 1000 points nobj=500 #We will use certain columns of the table cols = [selection[masked_array][0:nobj],table['dg1_grp'][masked_array][0:nobj], \ table['dg2_grp'][masked_array][0:nobj],table['e1'][masked_array][0:nobj], \ table['e2'][masked_array][0:nobj]] new_table = astropy.table.Table(cols,names=('selection','dg1_grp','dg2_grp','e1','e2')) #Seaborn pairplot requires a pandas data frame df = new_table.to_pandas() sns.pairplot(df, hue='selection') #We are going to check the correlations using heatmap corr = df.corr() sns.heatmap(corr) import astropy.units as u x = 10*u.km x.to(u.imperial.mile) + 10*u.Mpc #We read a quasar-catalog data table quasar_table = astropy.table.Table.read('./downloaded_data/quasar_table.fits') #We import speclite to compute magnitudes import speclite import speclite.filters sdss = speclite.filters.load_filters('sdss2010-*') #Spectrum of quasar #40 wave = np.load('./downloaded_data/wave.npy') #No units included but units are Angstroms flux = np.load('./downloaded_data/flux.npy') #It comes without units but they're 1e-17 erg/cm**2/s/AA #We use get magnitudes to compute the magnitudes. If the units are not included, it assumes (erg/cm**2/s/AA, AA)<-(flux, wave) mags = sdss.get_ab_magnitudes(flux*1e-17*u.erg/u.cm**2/u.s/u.AA,wave*u.AA) #If we don't use the correct units... mags_wrong = sdss.get_ab_magnitudes(flux,wave) mags_boss = np.hstack(quasar_table['PSFMAG_%d' %f][40] for f in range(0,5)) print(mags) print(mags_boss) print(mags_wrong) #Now we are going to prepare a Boosted decision tree photo-z estimator from sklearn.ensemble import GradientBoostingRegressor #Prepare the training array mags = np.vstack([quasar_table['PSFMAG_%d' % f] for f in range(0,5)]).T z = quasar_table['Z_VI'] print(len(z)) #train on 20% of the points mag_train = mags[::5] z_train = z[::5] print(len(z_train)) #test on 5% of the points mag_test = mags[::18] z_test = z[::18] #Set up the tree clf = GradientBoostingRegressor(n_estimators=500, learning_rate=0.1,max_depth=3, random_state=0) #Train the tree clf.fit(mag_train, z_train) #Test it! z_fit_train = clf.predict(mag_train) z_fit = clf.predict(mag_test) #Compute rms in the training set and test set rms_train = np.mean(np.sqrt((z_fit_train - z_train) ** 2)) rms_test = np.mean(np.sqrt((z_fit - z_test) ** 2)) plt.scatter(z_test,z_fit, color='k', s=0.1) plt.plot([-0.1, 6], [-0.1, 6], ':k') plt.text(0.04, 5, "rms = %.3f" % (rms_test)) plt.xlabel('$z_{true}$') plt.ylabel('$z_{fit}$') # %load ex6.py def ex6(): colors = np.vstack([quasar_table['PSFMAG_%d' % f]-quasar_table['PSFMAG_%d' % (f+1)] for f in range(0,4)]).T color_train = colors[::5] color_test = colors[::18] clf.fit(color_train, z_train) #Test it! z_fit_train = clf.predict(color_train) z_fit = clf.predict(color_test) #Compute rms in the training set and test set rms_train = np.mean(np.sqrt((z_fit_train - z_train) ** 2)) rms_test = np.mean(np.sqrt((z_fit - z_test) ** 2)) plt.scatter(z_test,z_fit, color='k', s=0.1) plt.plot([-0.1, 6], [-0.1, 6], ':k') plt.text(0.04, 5, "rms = %.3f" % (rms_test)) plt.xlabel('$z_{true}$') plt.ylabel('$z_{fit}$') ex6() # %load opt_ex1.py # %load opt_nn.py import randomfield %time generator = randomfield.Generator(8, 128, 1024, grid_spacing_Mpc_h=1.0, verbose=True) delta = generator.generate_delta_field(smoothing_length_Mpc_h=2.0, seed=123, show_plot=True) %%time #Let's compute a simple version of the correlation function in the direction of the direction of the line-of-sight corr = np.zeros(delta.shape[2]) for i in range(1,delta.shape[2]-1): corr[i]=np.sum(delta[:,:,i:]*delta[:,:,:-i])/(delta.shape[0]*delta.shape[1]*(delta.shape[2]-1)) r = np.linspace(0,delta.shape[2],delta.shape[2]+1) plt.plot(r[1:-1],r[1:-1]**2*corr[1:]) plt.xlim(0,200) plt.xlabel(r'$r_{\parallel}$ [Mpc h$^{-1}$]') plt.ylabel(r'$r_{\parallel}^{2}*\xi_{\parallel}(r_{\parallel})$ [Mpc$^{2}$ h$^{-2}$]') plt.ylim(-4500,300); def plot_sky(ra, dec, data=None, nside=4, label='', projection='eck4', cmap=plt.get_cmap('jet'), norm=None, hide_galactic_plane=False, healpy=False): from mpl_toolkits.basemap import Basemap from matplotlib.collections import PolyCollection from astropy.coordinates import SkyCoord ra=ra.to(u.deg).value dec=dec.to(u.deg).value if(healpy): import healpy as hp # get pixel area in degrees pixel_area = hp.pixelfunc.nside2pixarea(nside, degrees=True) # find healpixels associated with input vectors pixels = hp.ang2pix(nside, 0.5*np.pi-np.radians(dec), np.radians(ra)) # find unique pixels unique_pixels = np.unique(pixels) # count number of points in each pixel bincounts = np.bincount(pixels) # if no data provided, show counts per sq degree # otherwise, show mean per pixel if data is None: values = bincounts[unique_pixels]/pixel_area else: weighted_counts = np.bincount(pixels, weights=data) values = weighted_counts[unique_pixels]/bincounts[unique_pixels] # find pixel boundaries corners = hp.boundaries(nside, unique_pixels, step=1) corner_theta, corner_phi = hp.vec2ang(corners.transpose(0,2,1)) corner_ra, corner_dec = np.degrees(corner_phi), np.degrees(np.pi/2-corner_theta) # set up basemap m = Basemap(projection=projection, lon_0=-90, resolution='c', celestial=True) m.drawmeridians(np.arange(0, 360, 30), labels=[0,0,1,0], labelstyle='+/-') m.drawparallels(np.arange(-90, 90, 15), labels=[1,0,0,0], labelstyle='+/-') m.drawmapboundary() # convert sky coords to map coords x,y = m(corner_ra, corner_dec) # regroup into pixel corners verts = np.array([x.reshape(-1,4), y.reshape(-1,4)]).transpose(1,2,0) # Make the collection and add it to the plot. coll = PolyCollection(verts, array=values, cmap=cmap, norm=norm, edgecolors='none') plt.gca().add_collection(coll) plt.gca().autoscale_view() if not hide_galactic_plane: # generate vector in galactic coordinates and convert to equatorial coordinates galactic_l = np.linspace(0, 2*np.pi, 1000) galactic_plane = SkyCoord(l=galactic_l*u.radian, b=np.zeros_like(galactic_l)*u.radian, frame='galactic').fk5 # project to map coordinates galactic_x, galactic_y = m(galactic_plane.ra.degree, galactic_plane.dec.degree) m.scatter(galactic_x, galactic_y, marker='.', s=2, c='k') # Add a colorbar for the PolyCollection plt.colorbar(coll, orientation='horizontal', pad=0.01, aspect=40, label=label) else: nx, ny = nside, nside ra_bins = numpy.linspace(-180, 180, nx+1) cth_bins = numpy.linspace(-1., 1., ny+1) ra[ra>180]=ra[ra>180]-360 density, _, _ = numpy.histogram2d(ra, np.sin(dec*np.pi/180.), [ra_bins, cth_bins]) ra_bins_2d, cth_bins_2d = numpy.meshgrid(ra_bins, cth_bins) m = Basemap(projection=projection, lon_0=0, resolution='l', celestial=True) m.drawmeridians(np.arange(0, 360, 60), labels=[0,0,1,0], labelstyle='+/-') m.drawparallels(np.arange(-90, 90, 15), labels=[1,0,0,0], labelstyle='+/-') m.drawmapboundary() xs, ys = m(ra_bins_2d, np.arcsin(cth_bins_2d)*180/np.pi) pcm = plt.pcolormesh(xs, ys, density) plt.colorbar(pcm,orientation='horizontal', pad=0.04, label=label) if not hide_galactic_plane: # generate vector in galactic coordinates and convert to equatorial coordinates galactic_l = np.linspace(0, 2*np.pi, 1000) galactic_plane = SkyCoord(l=galactic_l*u.radian, b=np.zeros_like(galactic_l)*u.radian, frame='galactic').fk5 # project to map coordinates galactic_x, galactic_y = m(galactic_plane.ra.degree, galactic_plane.dec.degree) m.scatter(galactic_x, galactic_y, marker='.', s=2, c='k') ra = 360*np.random.random(10000)*u.deg dec = np.arcsin(-1+2*np.random.random(10000))*180/np.pi*u.deg plot_sky(ra,dec,healpy=False, nside=16, projection='eck4', label='Galaxies per pixel') # %load ex7.py def ex7(): plot_sky(quasar_table['RA']*u.deg,quasar_table['DEC']*u.deg,nside=128, healpy=False) ex7() from astropy.cosmology import Planck15 print(Planck15.__doc__) z=np.logspace(-4,4,30) om=Planck15.Om(z) ob=Planck15.Ob(z) plt.plot(z,om,label=r'$\Omega_{m}(z)$') plt.plot(z,ob,label=r'$\Omega_{b}(z)$') plt.legend(loc=2) plt.xscale('log') plt.xlabel(r'$z$') plt.ylabel(r'$\Omega(z)$') h=Planck15.H(z) plt.plot(z,h,label=r'$H(z)$') plt.legend(loc=2) plt.xscale('log') plt.yscale('log') plt.xlabel(r'$z$') plt.ylabel(r'$H(z)$ %s' % h.unit) from astropy.cosmology import z_at_value z_at_value(Planck15.comoving_distance, 1200 *u.Mpc) from astropy.cosmology import w0waCDM cosmo = w0waCDM(H0=75*u.km/u.s/u.Mpc,Om0=0.3,Ode0=0.7,w0=-1.2,wa=-3,Neff=4,Ob0=0.044,m_nu=1e-5*u.eV) h_cosmo = cosmo.H(z) plt.plot(z,h_cosmo, label='Random cosmology') plt.plot(z,h, label='Planck15') plt.legend(loc=2) plt.xscale('log') plt.yscale('log') plt.xlabel(r'$z$') plt.ylabel(r'$H(z)$ %s' % h.unit) plt.plot(z,h_cosmo/h-1) plt.legend(loc=2) plt.xscale('log') plt.yscale('log') plt.xlabel(r'$z$') plt.ylabel(r'$H_{cosmo}(z)/H_{Planck15}(z)$') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: More info on notebooks and cells is here. Step2: The magic %pylab sets up the interactive namespace from numpy and matplotlib and inline adds the plots to the notebook. These plots are rendered in PNG format by default. Step3: Advanced magic commands Step4: The improvement is especially significant when you have to use vectors or matrices Step5: A very useful feature of numpy are masks and masked arrays. You can easily select all the values of a vector or an array that fulfill certain condition using a mask. Step6: Let's compare to a traditional brute-force approach Step7: 4) Plotting Step8: Exercise Step9: 4.2) Seaborn (https Step10: Warning messages Step11: Exercise Step12: 5) Use interactive documentation Step13: Now we are going to use astropy.table to read the BinaryTableHDU. We could also read it using hdulist[1].data but let's make use of this nice package Step14: We can also select any column by simply using table['NAME_OF_THE_COLUMN'] Step15: Exercise Step16: Exercise Step17: 7) Keep track of the units. Use astropy.units Step18: Let's see an example where some units are assumed Step19: 8) A complete example Step20: Exercise Step21: Optional exercise Step22: 8.b) Extra Step23: 9) Create a lognormal simulation and compute its correlation function Step24: We will try to calculate the correlation function in the direction of the line-of-sight Step25: 10) Create sky plots Step26: Exercise Step27: 11) Using astropy.cosmology (http
5,850
<ASSISTANT_TASK:> Python Code: from straightline_utils import * %matplotlib inline from matplotlib import rcParams rcParams['savefig.dpi'] = 100 (x,y,sigmay) = get_data_no_outliers() plot_yerr(x, y, sigmay) def straight_line_log_likelihood(x, y, sigmay, m, b): ''' Returns the log-likelihood of drawing data values *y* at known values *x* given Gaussian measurement noise with standard deviation with known *sigmay*, where the "true" y values are *y_t = m * x + b* x: list of x coordinates y: list of y coordinates sigmay: list of y uncertainties m: scalar slope b: scalar line intercept Returns: scalar log likelihood ''' return (np.sum(np.log(1./(np.sqrt(2.*np.pi) * sigmay))) + np.sum(-0.5 * (y - (m*x + b))**2 / sigmay**2)) def straight_line_log_prior(m, b): return 0. def straight_line_log_posterior(x,y,sigmay, m,b): return (straight_line_log_likelihood(x,y,sigmay, m,b) + straight_line_log_prior(m, b)) # Evaluate log P(m,b | x,y,sigmay) on a grid. # Set up grid mgrid = np.linspace(mlo, mhi, 100) bgrid = np.linspace(blo, bhi, 101) log_posterior = np.zeros((len(mgrid),len(bgrid))) # Evaluate log probability on grid for im,m in enumerate(mgrid): for ib,b in enumerate(bgrid): log_posterior[im,ib] = straight_line_log_posterior(x, y, sigmay, m, b) # Convert to probability density and plot posterior = np.exp(log_posterior - log_posterior.max()) plt.imshow(posterior, extent=[blo,bhi, mlo,mhi],cmap='Blues', interpolation='nearest', origin='lower', aspect=(bhi-blo)/(mhi-mlo), vmin=0, vmax=1) plt.contour(bgrid, mgrid, posterior, pdf_contour_levels(posterior), colors='k') i = np.argmax(posterior) i,j = np.unravel_index(i, posterior.shape) print 'Grid maximum posterior values:', bgrid[i], mgrid[j] plt.title('Straight line: posterior PDF for parameters'); #plt.plot(b_ls, m_ls, 'w+', ms=12, mew=4); plot_mb_setup(); # Linear algebra: weighted least squares N = len(x) A = np.zeros((N,2)) A[:,0] = 1. / sigmay A[:,1] = x / sigmay b = y / sigmay theta,nil,nil,nil = np.linalg.lstsq(A, b) plot_yerr(x, y, sigmay) b_ls,m_ls = theta print 'Least Squares (maximum likelihood) estimator:', b_ls,m_ls plot_line(m_ls, b_ls); def straight_line_posterior(x, y, sigmay, m, b): return np.exp(straight_line_log_posterior(x, y, sigmay, m, b)) # initial m, b m,b = 2, 0 # step sizes mstep, bstep = 0.1, 10. # how many steps? nsteps = 10000 chain = [] probs = [] naccept = 0 print 'Running MH for', nsteps, 'steps' # First point: L_old = straight_line_log_likelihood(x, y, sigmay, m, b) p_old = straight_line_log_prior(m, b) prob_old = np.exp(L_old + p_old) for i in range(nsteps): # step mnew = m + np.random.normal() * mstep bnew = b + np.random.normal() * bstep # evaluate probabilities # prob_new = straight_line_posterior(x, y, sigmay, mnew, bnew) L_new = straight_line_log_likelihood(x, y, sigmay, mnew, bnew) p_new = straight_line_log_prior(mnew, bnew) prob_new = np.exp(L_new + p_new) if (prob_new / prob_old > np.random.uniform()): # accept m = mnew b = bnew L_old = L_new p_old = p_new prob_old = prob_new naccept += 1 else: # Stay where we are; m,b stay the same, and we append them # to the chain below. pass chain.append((b,m)) probs.append((L_old,p_old)) print 'Acceptance fraction:', naccept/float(nsteps) # Pull m and b arrays out of the Markov chain and plot them: mm = [m for b,m in chain] bb = [b for b,m in chain] # Scatterplot of m,b posterior samples plt.clf() plt.contour(bgrid, mgrid, posterior, pdf_contour_levels(posterior), colors='k') plt.gca().set_aspect((bhi-blo)/(mhi-mlo)) plt.plot(bb, mm, 'b.', alpha=0.1) plot_mb_setup() plt.show() # 1 and 2D marginalised distributions: import triangle triangle.corner(chain, labels=['b','m'], range=[(blo,bhi),(mlo,mhi)],quantiles=[0.16,0.5,0.84], show_titles=True, title_args={"fontsize": 12}, plot_datapoints=True, fill_contours=True, levels=[0.68, 0.95], color='b', bins=40, smooth=1.0); plt.show() # Traces, for convergence inspection: plt.clf() plt.subplot(2,1,1) plt.plot(mm, 'k-') plt.ylim(mlo,mhi) plt.ylabel('m') plt.subplot(2,1,2) plt.plot(bb, 'k-') plt.ylabel('b') plt.ylim(blo,bhi) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Bayesian Solution Step2: Short Cut #1 Step3: Similarly, one can derived expressions for the uncertainty for of the least squares fit parameters, c.f. Ivezic Ch. 8.2. These expressions can be thought of as propagating the data error into parameter errors (using standard error propagation, i.e. chain rule).
5,851
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd Construtor padrão pd.Series( name="Compras", index=["Leite", "Ovos", "Carne", "Arroz", "Feijão"], data=[2, 12, 1, 5, 2] ) Construtor padrão: dados desconhecidos pd.Series( name="Compras", index=["Leite", "Ovos", "Carne", "Arroz", "Feijão"] ) Construtor padrão: valor padrão pd.Series( name="Compras", index=["Leite", "Ovos", "Carne", "Arroz", "Feijão"], data="fill here" ) Recebendo um Dicionário s = pd.Series({"Leite": 2, "Ovos": 12, "Carne": 1, "Arroz": 5, "Feijão": 2}) s.name = "Compras" s Recebendo uma Lista s = pd.Series([2, 12, 1, 5, 2]) s editando parâmetros s.name="Compras" s.index=["Leite", "Ovos", "Carne", "Arroz", "Feijão"] s Ordenação: Índices s.sort_index() Ordenação: Dados s.sort_values(ascending=False) Construtor padrão pd.DataFrame( index=["Leite", "Ovos", "Carne", "Arroz", "Feijão"], columns=["quantidade", "unidade"], data=[ [ 2, "L"], [12, "Ud"], [ 1, "Kg"], [ 5, "Kg"], [ 2, "Kg"] ] ) Construtor padrão: dados desconhecidos pd.DataFrame( index=["Leite", "Ovos", "Carne", "Arroz", "Feijão"], columns=["quantidade", "unidade"] ) Construtor padrão: valor padrão pd.DataFrame( index=["Leite", "Ovos", "Carne", "Arroz", "Feijão"], columns=["quantidade", "unidade"], data="?" ) Recebendo um Dicionário pd.DataFrame( { "quantidade": { "Leite": 2, "Ovos": 12, "Carne": 1, "Arroz": 5, "Feijão": 2 }, "unidade": { "Leite": "L", "Ovos": "Ud", "Carne": "Kg", "Arroz": "Kg", "Feijão": "Kg" } } ) Recebendo um Dicionário de Series index = ["Leite", "Ovos", "Carne", "Arroz", "Feijão"] pd.DataFrame( { "quantidade": pd.Series(index=index, data=[2, 12, 1, 5, 2]), "unidade": pd.Series(index=index, data=["L", "Ud", "Kg", "Kg", "Kg"]) } ) Recebendo um vetor de Series index = ["Leite", "Ovos", "Carne", "Arroz", "Feijão"] df = pd.DataFrame( [ pd.Series(name="quantidade", index=index, data=[2, 12, 1, 5, 2]), pd.Series(name="unidade", index=index, data=["L", "Ud", "Kg", "Kg", "Kg"]) ] ) df Transpondo para ajustar a Tabela df = df.T df editando parâmetros df.index = ["Leite tipo A", "Ovos Orgânicos", "Patinho", "Arroz Arbóreo", "Feijão Preto"] df.columns = ["Quantidade", "Unidade"] df Ordenação: Índices df.sort_index() Ordenação: Dados df.sort_values(by="Unidade", ascending=False) index = pd.Index(data=["Leite", "Ovos", "Carne", "Arroz", "Feijão"], name="Itens") index sq = pd.Series(index=index, data=[2, 12, 1, 5, 2]).sort_values() sq su = pd.Series(index=index, data=["L", "Ud", "Kg", "Kg", "Kg"]).sort_index() su df = pd.DataFrame({"Quantidade": sq, "Unidade": su}).sort_values(by="Unidade") df df["Preço p/ Ud"] = [5.00, 29.99, 6.50, 3.30, 0.50] df["Preço Total"] = [25.00, 29.99, 13.00, 6.60, 6.00] df sq sq[2] sq[5:2:-1] sq["Leite"] sq["Leite":"Arroz"] df df["Unidade"] df.Quantidade Uma Coluna do DataFrame é uma Series df["Preço Total"][2] Acesso a mais de uma Coluna df[["Preço Total", "Quantidade"]] acesso às Linhas: método 'loc' df.loc["Leite"] acesso ao item: método 'loc' df.loc["Ovos", "Preço Total"] acesso ao item: método 'iloc' df.iloc[4, 3] acesso por slice: método 'loc' df.loc["Leite":, "Preço p/ Ud":] acesso por slice: método 'iloc' df.iloc[3:, 2:] Atribuir Valores em 'slices' levanta warnings df["Unidade"][[0, 2]] = "Pacote" df Deve-se usar 'loc' ou 'iloc' df.loc["Carne", "Unidade"] = "Kilograma" df.iloc[3, 1] = "Litro" df mask => array de bool sq > 2 mask => array de bool df > 2 atribuição de valores em uma cópia s_tmp = sq.copy() s_tmp s_tmp[s_tmp == 2] s_tmp[s_tmp == 2] = 3 s_tmp atribuição de valores em uma cópia df_tmp = df[["Preço p/ Ud", "Preço Total"]].copy() df_tmp mask mask = (df_tmp > 5) & (df_tmp < 10) mask df_tmp[mask] tmp2 = df_tmp.copy() tmp2[mask] = "?" tmp2 s_tmp[s_tmp == 2] = 3 s_tmp df = pd.DataFrame( index=pd.Index(data=["Leite", "Ovos", "Carne", "Arroz", "Feijão"], name="Itens"), columns=["Unidade", "Quantidade", "Preço Unitário"], data=np.array([ ["Litro", "Dúzia", "Kilograma", "Kilograma", "Kilograma"], [4, 3, 1, 5, 2], [3.00, 6.50, 25.90, 5.00, 3.80] ]).T, ) df verificando dtypes df.dtypes Conversão necessária pois o pandas interp´reta 'mixed types' como strings df[["Quantidade", "Preço Unitário"]] = df[["Quantidade", "Preço Unitário"]].astype(float) df verificando dtypes df.dtypes df["Preço Unitário"] += 1. df df["Preço Unitário"] *= 0.90 df df["Preço Total"] = df["Preço Unitário"] * df["Quantidade"] df df["Preço Médio Por Kg"] = np.nan df mask = df["Unidade"] == "Kilograma" df[mask] df.loc[mask, "Preço Médio Por Kg"] = (df.loc[mask, "Preço Unitário"] / df.loc[mask, "Quantidade"]).sum() df df.fillna(0) df.sum() df.mean() df.std() df.median() df.mode() cols=["c1", "c2", "c3", "c4", "c5"] data = np.random.rand(100, 5) data *= np.array([ 10, 20, 30, 40, 50]) data += np.array([100, 200, 300, 400, 500]) data = np.ceil(data) df = pd.DataFrame(columns=cols, data=data) df.head(10) descrevendo as distribuições dos dados df.describe() mesma coisa, manipulando os percentis df.describe(percentiles=[0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9]) Verificando os valores únicos de C3 df.c3.unique() Verificando a frequencia dos valores únicos de C3 df.c3.value_counts() Não altere esse valor, pois ele permite que toda a geração aleatória seja igual para todos np.random.seed(123456789) Dataset Original, já criado para a solução media = 150 sigma = 10 serie = pd.Series(np.random.randn(1000)) * sigma + media accum = pd.DataFrame( index=range(2600), columns=["original"], data=serie ) accum.head().append(accum.tail()) Escreva a a Solução Aqui Escreva a a Solução Aqui Escreva a a Solução Aqui Escreva a a Solução Aqui classes = ["Leite", "Ovos", "Carne", "Arroz", "Feijão"] labels = pd.Series(np.random.choice(classes, 100)) Escreva a a Solução Aqui <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step9: Construção Step20: DataFrame Step21: Acessando valores Step22: Slicing Step30: DataFrame Step33: * Atribuição de Valores em DataFrames Step36: Masks Step38: Aplicação Step41: * DataFame Step45: Operações Vetoriais Step46: Manipulações Numéricas Step47: * Desconto de 10% no Preço Unitário Step48: * Cálculo do Preço Total por Item Step49: * Cálculo do Preço por Kg Step50: * Preenchendo NaNs Step51: * Soma Step52: * Média Step53: * Desvio Padrão Step54: * Mediana Step55: * Moda (valores mais frequentes) Step56: Análise de Dados Step61: Descrição dos dados Step63: Desafio 1 Step65: Dataset Original Step66: O Acumulador Step68: Inserção de dados Step70: [ B ] Elementos de outra distribuição Step72: [ C ] Elementos Próximos à média Step74: Avaliação das Séries Step75: Desafio 2 Step77: Dataset Codificado
5,852
<ASSISTANT_TASK:> Python Code: import numpy as np from matplotlib import pyplot as plt # # get Stull's c_1 and c_2 from fundamental constants # c=2.99792458e+08 #m/s -- speed of light in vacuum h=6.62606876e-34 #J s -- Planck's constant kb=1.3806503e-23 # J/K -- Boltzman's constant c=3.e8 #speed of light in vacuum (m/s) c1=2.*h*c**2.*np.pi c2=h*c/kb sigma=2.*np.pi**5.*kb**4./(15*h**3.*c**2.) def planckwavelen(wavel,Temp): Calculate the blackbody radiant exitence (Stull 2.13) Parameters ---------- wavel: float or array wavelength (meters) Temp: float temperature (K) Returns ------- Elambda: float or arr monochromatic radiant exitence (W/m^2/m) Elambda=c1/(wavel**5.*(np.exp(c2/(wavel*Temp)) -1)) return Elambda Temp = 300. SBflux = sigma*Temp**4. print('stefan-boltzman says flux is {:8.3f} W/m^2'.format(SBflux)) # # get wavelength in meters between 0.1 and 500 microns # npoints = 10000 wavelengths=np.linspace(0.1,500.,npoints)*1.e-6 flux = planckwavelen(wavelengths,Temp) avg_flux = (flux[1:] + flux[:-1])/2. integral = np.sum(avg_flux*np.diff(wavelengths)) print('numerically integrated flux is: {:8.3f} W/m^2'.format(integral)) %matplotlib inline fig,ax = plt.subplots(1,1) # # change units from meters to microns to get prettier numbers # ax.semilogx(wavelengths*1.e6,flux*1.e-6) _=ax.set(xlim=(1,100),xlabel="wavelength ($\mu m$)",ylabel=r"$E^*_\lambda\ (W/m^2/\mu m$)", title='Radiant exitence for Temp = 300 K') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Day 3 Planck problem Step2: so good agreement with 10000 points -- make a plot as well
5,853
<ASSISTANT_TASK:> Python Code: %matplotlib inline from __future__ import division import numpy as np import matplotlib.pyplot as plt np.random.seed(1) D = np.random.rand(100,100) ## This is not symmetric, so we make it symmetric D = (D+D.T)/2 print (D) import math N_steps = 10000 def L(sigma): s=0 for i in range(0, len(sigma)-1): s+=D[sigma[i], sigma[i+1]] return s def propose(sigma): r = np.random.choice(len(sigma), 2) rs = np.sort(r) j,k=rs[0],rs[1] x=(sigma[j:k])#.reverse() x=x[::-1] x0= sigma[:j] x1 = sigma[k:] y=np.concatenate((x0,x,x1)) return y def pi(sigma,T): return math.exp(-L(sigma)/T) def metropolis(sigma,T,L_0): sigma_n = propose(sigma) L_n = L(sigma_n) pi_ab = math.exp(-(L_n-L_0)/T) q = min(1, pi_ab) b = np.random.uniform(size=1) if (b<q): return sigma_n else: return sigma sigma_0 = np.random.choice(100,100) L_0 = L(sigma_0) print sigma_0 T = [0.05,10] def plotter(t): L_history = [] sigma_history = [] sigma_0 = np.random.choice(100,100) L_0 = L(sigma_0) L_history.append(L_0) sigma_history.append(sigma_0) sigma = metropolis(sigma_0,t,L_0) for i in range(1, N_steps): sigma_t = metropolis(sigma_history[i-1],t,L_history[i-1]) L_1 = L(sigma_t) L_history.append(L_1) sigma_history.append(sigma_t) plt.figure(0) plt.hist(L_history, 20) #plt.xlim(min(L_history)-25, max(L_history)+0.5) plt.xlabel('Length') plt.ylabel('Frequency') plt.title('Frequency of L') plt.figure(1) plt.plot(range(1, N_steps+1),L_history) plt.ylim(min(L_history), max(L_history)) plt.xlabel('N_steps') plt.ylabel('L') plt.title('Variation of L with N_steps') return L_history L_t0=plotter(T[0]) L_t1= plotter(T[1]) from scipy.signal import correlate def autocorr(x): xunbiased = x-np.mean(x) xnorm = np.sum(xunbiased**2) acor = np.correlate(xunbiased, xunbiased, "same")/xnorm #result = correlate(x, x, mode='full') #result /= result[result.argmax()] acor = acor[len(acor)/2:] return acor#result[result.size/2:] cov_t0 = autocorr(L_t0) cov_t1 = autocorr(L_t1) plt.plot(cov_t0) plt.ylabel('Autocorrelation') plt.xlabel('N_steps') plt.title('Autocorrelation of L_i for T=0.05') plt.plot(cov_t1) plt.ylabel('Autocorrelation') plt.xlabel('N_steps') plt.title('Autocorrelation of L_i for T=10') k_a=0.2 k_b=0.2 k_p=0.5 P = np.matrix([[1-k_a-k_b, k_a ,k_b, 0, 0, 0], [k_a, 1-k_a-k_b, 0, k_b, 0, 0], [k_b, 0, 1-k_a-k_b, k_a, 0, 0], [0, k_b, k_a, 1-k_a-k_b-k_p, k_p, 0], [0, 0, 0, 0, 0, 1], [0, 0, 0, 1, 0, 0]]) Q=P[1:5,1:5] iq = np.eye(4)-Q iqi = np.linalg.inv(iq) print(iq) print(iqi) print 'U={}'.format(iqi[:,-1]) u=iqi[:,-1] PP = {} states = ['phi', 'alpha', 'beta', 'ab', 'pol', 'd'] PP['phi']= [1-k_a-k_b, k_a ,k_b, 0, 0, 0] PP['alpha'] = [k_a, 1-k_a-k_b, 0, k_b, 0, 0] PP['beta'] = [k_b, 0, 1-k_a-k_b, k_a, 0, 0] PP['ab']= [0, k_b, k_a, 1-k_a-k_b-k_p, k_p, 0] PP['pol']= [0, 0, 0, 0, 0, 1] PP['d']= [0, 0, 0, 1, 0, 0] def h(x): s=0 ht=0 cc=0 for j in range(1,100): new_state=x for i in range(1,10000): old_state=new_state probs = PP[old_state] z=np.random.choice(6, 1, p=probs) new_state = states[z[0]] s+=z[0] if new_state=='d': ht+=i cc+=1 break else: continue return s/1000, ht/cc print('Simulation: {}\t Calculation: {}'.format(h('alpha')[1],u[0])) print('Simulation: {}\t Calculation: {}'.format(h('beta')[1],u[1])) print('Simulation: {}\t Calculation: {}'.format(h('ab')[1],u[2])) print('Simulation: {}\t Calculation: {}'.format(h('pol')[1],u[3])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: T = 0.05 Step2: T=10 Step3: Correlation plots Step4: Result Step5: $\alpha$ Step6: $\beta$ Step7: $\alpha+\beta$ Step8: pol
5,854
<ASSISTANT_TASK:> Python Code: labVersion = 'cs190_week4_v_1_3' # Data for manual OHE # Note: the first data point does not include any value for the optional third feature sampleOne = [(0, 'mouse'), (1, 'black')] sampleTwo = [(0, 'cat'), (1, 'tabby'), (2, 'mouse')] sampleThree = [(0, 'bear'), (1, 'black'), (2, 'salmon')] sampleDataRDD = sc.parallelize([sampleOne, sampleTwo, sampleThree]) # TODO: Replace <FILL IN> with appropriate code sampleOHEDictManual = {} sampleOHEDictManual[(0,'bear')] = 0 sampleOHEDictManual[(0,'cat')] = 1 sampleOHEDictManual[(0,'mouse')] = 2 sampleOHEDictManual[(1,'black')] = 3 sampleOHEDictManual[(1,'tabby')] = 4 sampleOHEDictManual[(2,'mouse')] = 5 sampleOHEDictManual[(2,'salmon')] = 6 # TEST One-hot-encoding (1a) from test_helper import Test Test.assertEqualsHashed(sampleOHEDictManual[(0,'bear')], 'b6589fc6ab0dc82cf12099d1c2d40ab994e8410c', "incorrect value for sampleOHEDictManual[(0,'bear')]") Test.assertEqualsHashed(sampleOHEDictManual[(0,'cat')], '356a192b7913b04c54574d18c28d46e6395428ab', "incorrect value for sampleOHEDictManual[(0,'cat')]") Test.assertEqualsHashed(sampleOHEDictManual[(0,'mouse')], 'da4b9237bacccdf19c0760cab7aec4a8359010b0', "incorrect value for sampleOHEDictManual[(0,'mouse')]") Test.assertEqualsHashed(sampleOHEDictManual[(1,'black')], '77de68daecd823babbb58edb1c8e14d7106e83bb', "incorrect value for sampleOHEDictManual[(1,'black')]") Test.assertEqualsHashed(sampleOHEDictManual[(1,'tabby')], '1b6453892473a467d07372d45eb05abc2031647a', "incorrect value for sampleOHEDictManual[(1,'tabby')]") Test.assertEqualsHashed(sampleOHEDictManual[(2,'mouse')], 'ac3478d69a3c81fa62e60f5c3696165a4e5e6ac4', "incorrect value for sampleOHEDictManual[(2,'mouse')]") Test.assertEqualsHashed(sampleOHEDictManual[(2,'salmon')], 'c1dfd96eea8cc2b62785275bca38ac261256e278', "incorrect value for sampleOHEDictManual[(2,'salmon')]") Test.assertEquals(len(sampleOHEDictManual.keys()), 7, 'incorrect number of keys in sampleOHEDictManual') import numpy as np from pyspark.mllib.linalg import SparseVector # TODO: Replace <FILL IN> with appropriate code aDense = np.array([0., 3., 0., 4.]) aSparse = SparseVector(4, [[1, 3], [3., 4.]]) bDense = np.array([0., 0., 0., 1.]) bSparse = SparseVector(4, [(3, 1.)]) w = np.array([0.4, 3.1, -1.4, -.5]) print aDense.dot(w) print aSparse.dot(w) print bDense.dot(w) print bSparse.dot(w) # TEST Sparse Vectors (1b) Test.assertTrue(isinstance(aSparse, SparseVector), 'aSparse needs to be an instance of SparseVector') Test.assertTrue(isinstance(bSparse, SparseVector), 'aSparse needs to be an instance of SparseVector') Test.assertTrue(aDense.dot(w) == aSparse.dot(w), 'dot product of aDense and w should equal dot product of aSparse and w') Test.assertTrue(bDense.dot(w) == bSparse.dot(w), 'dot product of bDense and w should equal dot product of bSparse and w') # Reminder of the sample features # sampleOne = [(0, 'mouse'), (1, 'black')] # sampleTwo = [(0, 'cat'), (1, 'tabby'), (2, 'mouse')] # sampleThree = [(0, 'bear'), (1, 'black'), (2, 'salmon')] # TODO: Replace <FILL IN> with appropriate code sampleOneOHEFeatManual = SparseVector(7, [(2, 1.), (3, 1.)]) sampleTwoOHEFeatManual = SparseVector(7, [(1, 1.), (4, 1.), (5, 1.)]) sampleThreeOHEFeatManual = SparseVector(7, [(0, 1.), (3, 1.), (6, 1.)]) # TEST OHE Features as sparse vectors (1c) Test.assertTrue(isinstance(sampleOneOHEFeatManual, SparseVector), 'sampleOneOHEFeatManual needs to be a SparseVector') Test.assertTrue(isinstance(sampleTwoOHEFeatManual, SparseVector), 'sampleTwoOHEFeatManual needs to be a SparseVector') Test.assertTrue(isinstance(sampleThreeOHEFeatManual, SparseVector), 'sampleThreeOHEFeatManual needs to be a SparseVector') Test.assertEqualsHashed(sampleOneOHEFeatManual, 'ecc00223d141b7bd0913d52377cee2cf5783abd6', 'incorrect value for sampleOneOHEFeatManual') Test.assertEqualsHashed(sampleTwoOHEFeatManual, '26b023f4109e3b8ab32241938e2e9b9e9d62720a', 'incorrect value for sampleTwoOHEFeatManual') Test.assertEqualsHashed(sampleThreeOHEFeatManual, 'c04134fd603ae115395b29dcabe9d0c66fbdc8a7', 'incorrect value for sampleThreeOHEFeatManual') # TODO: Replace <FILL IN> with appropriate code def oneHotEncoding(rawFeats, OHEDict, numOHEFeats): Produce a one-hot-encoding from a list of features and an OHE dictionary. Note: You should ensure that the indices used to create a SparseVector are sorted. Args: rawFeats (list of (int, str)): The features corresponding to a single observation. Each feature consists of a tuple of featureID and the feature's value. (e.g. sampleOne) OHEDict (dict): A mapping of (featureID, value) to unique integer. numOHEFeats (int): The total number of unique OHE features (combinations of featureID and value). Returns: SparseVector: A SparseVector of length numOHEFeats with indicies equal to the unique identifiers for the (featureID, value) combinations that occur in the observation and with values equal to 1.0. myList = [OHEDict[f] for f in rawFeats] sortedMyList = sorted(myList) valueList = [1 for f in rawFeats] return SparseVector(numOHEFeats, sortedMyList, valueList) # Calculate the number of features in sampleOHEDictManual numSampleOHEFeats = len(sampleOHEDictManual) # Run oneHotEnoding on sampleOne sampleOneOHEFeat = oneHotEncoding(sampleOne, sampleOHEDictManual, numSampleOHEFeats) print sampleOneOHEFeat # TEST Define an OHE Function (1d) Test.assertTrue(sampleOneOHEFeat == sampleOneOHEFeatManual, 'sampleOneOHEFeat should equal sampleOneOHEFeatManual') Test.assertEquals(sampleOneOHEFeat, SparseVector(7, [2,3], [1.0,1.0]), 'incorrect value for sampleOneOHEFeat') Test.assertEquals(oneHotEncoding([(1, 'black'), (0, 'mouse')], sampleOHEDictManual, numSampleOHEFeats), SparseVector(7, [2,3], [1.0,1.0]), 'incorrect definition for oneHotEncoding') # TODO: Replace <FILL IN> with appropriate code sampleOHEData = sampleDataRDD.map(lambda x : oneHotEncoding(x, sampleOHEDictManual, len(sampleOHEDictManual))) print sampleOHEData.collect() # TEST Apply OHE to a dataset (1e) sampleOHEDataValues = sampleOHEData.collect() Test.assertTrue(len(sampleOHEDataValues) == 3, 'sampleOHEData should have three elements') Test.assertEquals(sampleOHEDataValues[0], SparseVector(7, {2: 1.0, 3: 1.0}), 'incorrect OHE for first sample') Test.assertEquals(sampleOHEDataValues[1], SparseVector(7, {1: 1.0, 4: 1.0, 5: 1.0}), 'incorrect OHE for second sample') Test.assertEquals(sampleOHEDataValues[2], SparseVector(7, {0: 1.0, 3: 1.0, 6: 1.0}), 'incorrect OHE for third sample') # TODO: Replace <FILL IN> with appropriate code sampleDistinctFeats = (sampleDataRDD. flatMap(lambda x : x).distinct()) # TEST Pair RDD of (featureID, category) (2a) Test.assertEquals(sorted(sampleDistinctFeats.collect()), [(0, 'bear'), (0, 'cat'), (0, 'mouse'), (1, 'black'), (1, 'tabby'), (2, 'mouse'), (2, 'salmon')], 'incorrect value for sampleDistinctFeats') # TODO: Replace <FILL IN> with appropriate code sampleOHEDict = (sampleDistinctFeats. zipWithIndex().collectAsMap()) print sampleOHEDict # TEST OHE Dictionary from distinct features (2b) Test.assertEquals(sorted(sampleOHEDict.keys()), [(0, 'bear'), (0, 'cat'), (0, 'mouse'), (1, 'black'), (1, 'tabby'), (2, 'mouse'), (2, 'salmon')], 'sampleOHEDict has unexpected keys') Test.assertEquals(sorted(sampleOHEDict.values()), range(7), 'sampleOHEDict has unexpected values') # TODO: Replace <FILL IN> with appropriate code def createOneHotDict(inputData): Creates a one-hot-encoder dictionary based on the input data. Args: inputData (RDD of lists of (int, str)): An RDD of observations where each observation is made up of a list of (featureID, value) tuples. Returns: dict: A dictionary where the keys are (featureID, value) tuples and map to values that are unique integers. return (inputData.flatMap(lambda x : x).distinct().zipWithIndex().collectAsMap()) sampleOHEDictAuto = createOneHotDict(sampleDataRDD) print sampleOHEDictAuto # TEST Automated creation of an OHE dictionary (2c) Test.assertEquals(sorted(sampleOHEDictAuto.keys()), [(0, 'bear'), (0, 'cat'), (0, 'mouse'), (1, 'black'), (1, 'tabby'), (2, 'mouse'), (2, 'salmon')], 'sampleOHEDictAuto has unexpected keys') Test.assertEquals(sorted(sampleOHEDictAuto.values()), range(7), 'sampleOHEDictAuto has unexpected values') # Run this code to view Criteo's agreement from IPython.lib.display import IFrame IFrame("http://labs.criteo.com/downloads/2014-kaggle-display-advertising-challenge-dataset/", 600, 350) # TODO: Replace <FILL IN> with appropriate code # Just replace <FILL IN> with the url for dac_sample.tar.gz import glob import os.path import tarfile import urllib import urlparse # Paste url, url should end with: dac_sample.tar.gz url = 'http://labs.criteo.com/wp-content/uploads/2015/04/dac_sample.tar.gz' url = url.strip() baseDir = os.path.join('data') inputPath = os.path.join('cs190', 'dac_sample.txt') fileName = os.path.join(baseDir, inputPath) inputDir = os.path.split(fileName)[0] def extractTar(check = False): # Find the zipped archive and extract the dataset tars = glob.glob('dac_sample*.tar.gz*') if check and len(tars) == 0: return False if len(tars) > 0: try: tarFile = tarfile.open(tars[0]) except tarfile.ReadError: if not check: print 'Unable to open tar.gz file. Check your URL.' return False tarFile.extract('dac_sample.txt', path=inputDir) print 'Successfully extracted: dac_sample.txt' return True else: print 'You need to retry the download with the correct url.' print ('Alternatively, you can upload the dac_sample.tar.gz file to your Jupyter root ' + 'directory') return False if os.path.isfile(fileName): print 'File is already available. Nothing to do.' elif extractTar(check = True): print 'tar.gz file was already available.' elif not url.endswith('dac_sample.tar.gz'): print 'Check your download url. Are you downloading the Sample dataset?' else: # Download the file and store it in the same directory as this notebook try: urllib.urlretrieve(url, os.path.basename(urlparse.urlsplit(url).path)) except IOError: print 'Unable to download and store: {0}'.format(url) extractTar() import os.path baseDir = os.path.join('data') inputPath = os.path.join('cs190', 'dac_sample.txt') fileName = os.path.join(baseDir, inputPath) if os.path.isfile(fileName): rawData = (sc .textFile(fileName, 2) .map(lambda x: x.replace('\t', ','))) # work with either ',' or '\t' separated data print rawData.take(1) # TODO: Replace <FILL IN> with appropriate code weights = [.8, .1, .1] seed = 42 # Use randomSplit with weights and seed rawTrainData, rawValidationData, rawTestData = rawData.randomSplit(weights, seed) # Cache the data rawTrainData.cache() rawValidationData.cache() rawTestData.cache() nTrain = rawTrainData.count() nVal = rawValidationData.count() nTest = rawTestData.count() print nTrain, nVal, nTest, nTrain + nVal + nTest print rawData.take(1) # TEST Loading and splitting the data (3a) Test.assertTrue(all([rawTrainData.is_cached, rawValidationData.is_cached, rawTestData.is_cached]), 'you must cache the split data') Test.assertEquals(nTrain, 79911, 'incorrect value for nTrain') Test.assertEquals(nVal, 10075, 'incorrect value for nVal') Test.assertEquals(nTest, 10014, 'incorrect value for nTest') # TODO: Replace <FILL IN> with appropriate code def parsePoint(point): Converts a comma separated string into a list of (featureID, value) tuples. Note: featureIDs should start at 0 and increase to the number of features - 1. Args: point (str): A comma separated string where the first value is the label and the rest are features. Returns: list: A list of (featureID, value) tuples. mypoints = point.split(',') return [(i, item) for i, item in enumerate(mypoints[1:])] parsedTrainFeat = rawTrainData.map(parsePoint) numCategories = (parsedTrainFeat .flatMap(lambda x: x) .distinct() .map(lambda x: (x[0], 1)) .reduceByKey(lambda x, y: x + y) .sortByKey() .collect()) print numCategories[2][1] # TEST Extract features (3b) Test.assertEquals(numCategories[2][1], 855, 'incorrect implementation of parsePoint') Test.assertEquals(numCategories[32][1], 4, 'incorrect implementation of parsePoint') # TODO: Replace <FILL IN> with appropriate code ctrOHEDict = createOneHotDict(parsedTrainFeat) numCtrOHEFeats = len(ctrOHEDict.keys()) print numCtrOHEFeats print ctrOHEDict[(0, '')] # TEST Create an OHE dictionary from the dataset (3c) Test.assertEquals(numCtrOHEFeats, 233286, 'incorrect number of features in ctrOHEDict') Test.assertTrue((0, '') in ctrOHEDict, 'incorrect features in ctrOHEDict') from pyspark.mllib.regression import LabeledPoint # TODO: Replace <FILL IN> with appropriate code def parseOHEPoint(point, OHEDict, numOHEFeats): Obtain the label and feature vector for this raw observation. Note: You must use the function `oneHotEncoding` in this implementation or later portions of this lab may not function as expected. Args: point (str): A comma separated string where the first value is the label and the rest are features. OHEDict (dict of (int, str) to int): Mapping of (featureID, value) to unique integer. numOHEFeats (int): The number of unique features in the training dataset. Returns: LabeledPoint: Contains the label for the observation and the one-hot-encoding of the raw features based on the provided OHE dictionary. parsedPoints = parsePoint(point) label = point.split(',')[0] features = oneHotEncoding(parsedPoints, OHEDict, numOHEFeats) return LabeledPoint(label, features) OHETrainData = rawTrainData.map(lambda point: parseOHEPoint(point, ctrOHEDict, numCtrOHEFeats)) OHETrainData.cache() print OHETrainData.take(1) # Check that oneHotEncoding function was used in parseOHEPoint backupOneHot = oneHotEncoding oneHotEncoding = None withOneHot = False try: parseOHEPoint(rawTrainData.take(1)[0], ctrOHEDict, numCtrOHEFeats) except TypeError: withOneHot = True oneHotEncoding = backupOneHot # TEST Apply OHE to the dataset (3d) numNZ = sum(parsedTrainFeat.map(lambda x: len(x)).take(5)) numNZAlt = sum(OHETrainData.map(lambda lp: len(lp.features.indices)).take(5)) Test.assertEquals(numNZ, numNZAlt, 'incorrect implementation of parseOHEPoint') Test.assertTrue(withOneHot, 'oneHotEncoding not present in parseOHEPoint') def bucketFeatByCount(featCount): Bucket the counts by powers of two. for i in range(11): size = 2 ** i if featCount <= size: return size return -1 featCounts = (OHETrainData .flatMap(lambda lp: lp.features.indices) .map(lambda x: (x, 1)) .reduceByKey(lambda x, y: x + y)) featCountsBuckets = (featCounts .map(lambda x: (bucketFeatByCount(x[1]), 1)) .filter(lambda (k, v): k != -1) .reduceByKey(lambda x, y: x + y) .collect()) print featCountsBuckets import matplotlib.pyplot as plt x, y = zip(*featCountsBuckets) x, y = np.log(x), np.log(y) def preparePlot(xticks, yticks, figsize=(10.5, 6), hideLabels=False, gridColor='#999999', gridWidth=1.0): Template for generating the plot layout. plt.close() fig, ax = plt.subplots(figsize=figsize, facecolor='white', edgecolor='white') ax.axes.tick_params(labelcolor='#999999', labelsize='10') for axis, ticks in [(ax.get_xaxis(), xticks), (ax.get_yaxis(), yticks)]: axis.set_ticks_position('none') axis.set_ticks(ticks) axis.label.set_color('#999999') if hideLabels: axis.set_ticklabels([]) plt.grid(color=gridColor, linewidth=gridWidth, linestyle='-') map(lambda position: ax.spines[position].set_visible(False), ['bottom', 'top', 'left', 'right']) return fig, ax # generate layout and plot data fig, ax = preparePlot(np.arange(0, 10, 1), np.arange(4, 14, 2)) ax.set_xlabel(r'$\log_e(bucketSize)$'), ax.set_ylabel(r'$\log_e(countInBucket)$') plt.scatter(x, y, s=14**2, c='#d6ebf2', edgecolors='#8cbfd0', alpha=0.75) pass # TODO: Replace <FILL IN> with appropriate code def oneHotEncoding(rawFeats, OHEDict, numOHEFeats): Produce a one-hot-encoding from a list of features and an OHE dictionary. Note: If a (featureID, value) tuple doesn't have a corresponding key in OHEDict it should be ignored. Args: rawFeats (list of (int, str)): The features corresponding to a single observation. Each feature consists of a tuple of featureID and the feature's value. (e.g. sampleOne) OHEDict (dict): A mapping of (featureID, value) to unique integer. numOHEFeats (int): The total number of unique OHE features (combinations of featureID and value). Returns: SparseVector: A SparseVector of length numOHEFeats with indicies equal to the unique identifiers for the (featureID, value) combinations that occur in the observation and with values equal to 1.0. myList = [OHEDict[f] for f in rawFeats if f in OHEDict] sortedMyList = sorted(myList) valueList = [1 for f in rawFeats if f in OHEDict] return SparseVector(numOHEFeats, sortedMyList, valueList) OHEValidationData = rawValidationData.map(lambda point: parseOHEPoint(point, ctrOHEDict, numCtrOHEFeats)) OHEValidationData.cache() print OHEValidationData.take(1) # TEST Handling unseen features (3e) numNZVal = (OHEValidationData .map(lambda lp: len(lp.features.indices)) .sum()) Test.assertEquals(numNZVal, 372080, 'incorrect number of features') from pyspark.mllib.classification import LogisticRegressionWithSGD # fixed hyperparameters numIters = 50 stepSize = 10. regParam = 1e-6 regType = 'l2' includeIntercept = True # TODO: Replace <FILL IN> with appropriate code model0 = LogisticRegressionWithSGD.train(OHETrainData, numIters, stepSize, regParam=regParam, regType=regType, intercept=includeIntercept) sortedWeights = sorted(model0.weights) print sortedWeights[:5], model0.intercept # TEST Logistic regression (4a) Test.assertTrue(np.allclose(model0.intercept, 0.56455084025), 'incorrect value for model0.intercept') Test.assertTrue(np.allclose(sortedWeights[0:5], [-0.45899236853575609, -0.37973707648623956, -0.36996558266753304, -0.36934962879928263, -0.32697945415010637]), 'incorrect value for model0.weights') # TODO: Replace <FILL IN> with appropriate code from math import log def computeLogLoss(p, y): Calculates the value of log loss for a given probabilty and label. Note: log(0) is undefined, so when p is 0 we need to add a small value (epsilon) to it and when p is 1 we need to subtract a small value (epsilon) from it. Args: p (float): A probabilty between 0 and 1. y (int): A label. Takes on the values 0 and 1. Returns: float: The log loss value. epsilon = 10e-12 logLoss = None # For undefined values of log(p) if p == 0: p += epsilon elif p == 1: p -= epsilon if y == 1: logLoss = -log(p) else: logLoss = -log(1-p) return logLoss print computeLogLoss(.5, 1) print computeLogLoss(.5, 0) print computeLogLoss(.99, 1) print computeLogLoss(.99, 0) print computeLogLoss(.01, 1) print computeLogLoss(.01, 0) print computeLogLoss(0, 1) print computeLogLoss(1, 1) print computeLogLoss(1, 0) # TEST Log loss (4b) Test.assertTrue(np.allclose([computeLogLoss(.5, 1), computeLogLoss(.01, 0), computeLogLoss(.01, 1)], [0.69314718056, 0.0100503358535, 4.60517018599]), 'computeLogLoss is not correct') Test.assertTrue(np.allclose([computeLogLoss(0, 1), computeLogLoss(1, 1), computeLogLoss(1, 0)], [25.3284360229, 1.00000008275e-11, 25.3284360229]), 'computeLogLoss needs to bound p away from 0 and 1 by epsilon') # TODO: Replace <FILL IN> with appropriate code # Note that our dataset has a very high click-through rate by design # In practice click-through rate can be one to two orders of magnitude lower classOneFracTrain = OHETrainData.map(lambda x : x.label).reduce(lambda x, y: x + y) / OHETrainData.count() print classOneFracTrain logLossTrBase = OHETrainData.map(lambda x : computeLogLoss(classOneFracTrain, x.label)).sum() / OHETrainData.count() print 'Baseline Train Logloss = {0:.3f}\n'.format(logLossTrBase) # TEST Baseline log loss (4c) Test.assertTrue(np.allclose(classOneFracTrain, 0.22717773523), 'incorrect value for classOneFracTrain') Test.assertTrue(np.allclose(logLossTrBase, 0.535844), 'incorrect value for logLossTrBase') # TODO: Replace <FILL IN> with appropriate code from math import exp # exp(-t) = e^-t def getP(x, w, intercept): Calculate the probability for an observation given a set of weights and intercept. Note: We'll bound our raw prediction between 20 and -20 for numerical purposes. Args: x (SparseVector): A vector with values of 1.0 for features that exist in this observation and 0.0 otherwise. w (DenseVector): A vector of weights (betas) for the model. intercept (float): The model's intercept. Returns: float: A probability between 0 and 1. rawPrediction = x.dot(w) + intercept # Bound the raw prediction value rawPrediction = min(rawPrediction, 20) rawPrediction = max(rawPrediction, -20) return 1. / (1. + exp(-rawPrediction)) trainingPredictions = OHETrainData.map(lambda x : getP(x.features, model0.weights, model0.intercept)) print trainingPredictions.take(5) # TEST Predicted probability (4d) Test.assertTrue(np.allclose(trainingPredictions.sum(), 18135.4834348), 'incorrect value for trainingPredictions') # TODO: Replace <FILL IN> with appropriate code def evaluateResults(model, data): Calculates the log loss for the data given the model. Args: model (LogisticRegressionModel): A trained logistic regression model. data (RDD of LabeledPoint): Labels and features for each observation. Returns: float: Log loss for the data. return data.map(lambda x : computeLogLoss(getP(x.features, model.weights, model.intercept), x.label)).sum() / data.count() logLossTrLR0 = evaluateResults(model0, OHETrainData) print ('OHE Features Train Logloss:\n\tBaseline = {0:.3f}\n\tLogReg = {1:.3f}' .format(logLossTrBase, logLossTrLR0)) # TEST Evaluate the model (4e) Test.assertTrue(np.allclose(logLossTrLR0, 0.456903), 'incorrect value for logLossTrLR0') # TODO: Replace <FILL IN> with appropriate code logLossValBase = OHEValidationData.map(lambda x : computeLogLoss(classOneFracTrain, x.label)).sum() / OHEValidationData.count() logLossValLR0 = evaluateResults(model0, OHEValidationData) print ('OHE Features Validation Logloss:\n\tBaseline = {0:.3f}\n\tLogReg = {1:.3f}' .format(logLossValBase, logLossValLR0)) # TEST Validation log loss (4f) Test.assertTrue(np.allclose(logLossValBase, 0.527603), 'incorrect value for logLossValBase') Test.assertTrue(np.allclose(logLossValLR0, 0.456957), 'incorrect value for logLossValLR0') labelsAndScores = OHEValidationData.map(lambda lp: (lp.label, getP(lp.features, model0.weights, model0.intercept))) labelsAndWeights = labelsAndScores.collect() labelsAndWeights.sort(key=lambda (k, v): v, reverse=True) labelsByWeight = np.array([k for (k, v) in labelsAndWeights]) length = labelsByWeight.size truePositives = labelsByWeight.cumsum() numPositive = truePositives[-1] falsePositives = np.arange(1.0, length + 1, 1.) - truePositives truePositiveRate = truePositives / numPositive falsePositiveRate = falsePositives / (length - numPositive) # Generate layout and plot data fig, ax = preparePlot(np.arange(0., 1.1, 0.1), np.arange(0., 1.1, 0.1)) ax.set_xlim(-.05, 1.05), ax.set_ylim(-.05, 1.05) ax.set_ylabel('True Positive Rate (Sensitivity)') ax.set_xlabel('False Positive Rate (1 - Specificity)') plt.plot(falsePositiveRate, truePositiveRate, color='#8cbfd0', linestyle='-', linewidth=3.) plt.plot((0., 1.), (0., 1.), linestyle='--', color='#d6ebf2', linewidth=2.) # Baseline model pass from collections import defaultdict import hashlib def hashFunction(numBuckets, rawFeats, printMapping=False): Calculate a feature dictionary for an observation's features based on hashing. Note: Use printMapping=True for debug purposes and to better understand how the hashing works. Args: numBuckets (int): Number of buckets to use as features. rawFeats (list of (int, str)): A list of features for an observation. Represented as (featureID, value) tuples. printMapping (bool, optional): If true, the mappings of featureString to index will be printed. Returns: dict of int to float: The keys will be integers which represent the buckets that the features have been hashed to. The value for a given key will contain the count of the (featureID, value) tuples that have hashed to that key. mapping = {} for ind, category in rawFeats: featureString = category + str(ind) mapping[featureString] = int(int(hashlib.md5(featureString).hexdigest(), 16) % numBuckets) if(printMapping): print mapping sparseFeatures = defaultdict(float) for bucket in mapping.values(): sparseFeatures[bucket] += 1.0 return dict(sparseFeatures) # Reminder of the sample values: # sampleOne = [(0, 'mouse'), (1, 'black')] # sampleTwo = [(0, 'cat'), (1, 'tabby'), (2, 'mouse')] # sampleThree = [(0, 'bear'), (1, 'black'), (2, 'salmon')] # TODO: Replace <FILL IN> with appropriate code # Use four buckets sampOneFourBuckets = hashFunction(4, sampleOne, True) sampTwoFourBuckets = hashFunction(4, sampleTwo, True) sampThreeFourBuckets = hashFunction(4, sampleThree, True) # Use one hundred buckets sampOneHundredBuckets = hashFunction(100, sampleOne, True) sampTwoHundredBuckets = hashFunction(100, sampleTwo, True) sampThreeHundredBuckets = hashFunction(100, sampleThree, True) print '\t\t 4 Buckets \t\t\t 100 Buckets' print 'SampleOne:\t {0}\t\t {1}'.format(sampOneFourBuckets, sampOneHundredBuckets) print 'SampleTwo:\t {0}\t\t {1}'.format(sampTwoFourBuckets, sampTwoHundredBuckets) print 'SampleThree:\t {0}\t {1}'.format(sampThreeFourBuckets, sampThreeHundredBuckets) # TEST Hash function (5a) Test.assertEquals(sampOneFourBuckets, {2: 1.0, 3: 1.0}, 'incorrect value for sampOneFourBuckets') Test.assertEquals(sampThreeHundredBuckets, {72: 1.0, 5: 1.0, 14: 1.0}, 'incorrect value for sampThreeHundredBuckets') # TODO: Replace <FILL IN> with appropriate code def parseHashPoint(point, numBuckets): Create a LabeledPoint for this observation using hashing. Args: point (str): A comma separated string where the first value is the label and the rest are features. numBuckets: The number of buckets to hash to. Returns: LabeledPoint: A LabeledPoint with a label (0.0 or 1.0) and a SparseVector of hashed features. parsedPoints = parsePoint(point) label = point.split(',')[0] features = hashFunction(numBuckets, parsedPoints, printMapping=False) return LabeledPoint(label, SparseVector(numBuckets, features)) numBucketsCTR = 2 ** 15 hashTrainData = rawTrainData.map(lambda x : parseHashPoint(x, numBucketsCTR)) hashTrainData.cache() hashValidationData = rawValidationData.map(lambda x : parseHashPoint(x, numBucketsCTR)) hashValidationData.cache() hashTestData = rawTestData.map(lambda x : parseHashPoint(x, numBucketsCTR)) hashTestData.cache() print hashTrainData.take(1) # TEST Creating hashed features (5b) hashTrainDataFeatureSum = sum(hashTrainData .map(lambda lp: len(lp.features.indices)) .take(20)) hashTrainDataLabelSum = sum(hashTrainData .map(lambda lp: lp.label) .take(100)) hashValidationDataFeatureSum = sum(hashValidationData .map(lambda lp: len(lp.features.indices)) .take(20)) hashValidationDataLabelSum = sum(hashValidationData .map(lambda lp: lp.label) .take(100)) hashTestDataFeatureSum = sum(hashTestData .map(lambda lp: len(lp.features.indices)) .take(20)) hashTestDataLabelSum = sum(hashTestData .map(lambda lp: lp.label) .take(100)) Test.assertEquals(hashTrainDataFeatureSum, 772, 'incorrect number of features in hashTrainData') Test.assertEquals(hashTrainDataLabelSum, 24.0, 'incorrect labels in hashTrainData') Test.assertEquals(hashValidationDataFeatureSum, 776, 'incorrect number of features in hashValidationData') Test.assertEquals(hashValidationDataLabelSum, 16.0, 'incorrect labels in hashValidationData') Test.assertEquals(hashTestDataFeatureSum, 774, 'incorrect number of features in hashTestData') Test.assertEquals(hashTestDataLabelSum, 23.0, 'incorrect labels in hashTestData') # TODO: Replace <FILL IN> with appropriate code def computeSparsity(data, d, n): Calculates the average sparsity for the features in an RDD of LabeledPoints. Args: data (RDD of LabeledPoint): The LabeledPoints to use in the sparsity calculation. d (int): The total number of features. n (int): The number of observations in the RDD. Returns: float: The average of the ratio of features in a point to total features. return float(data.map(lambda x: len(x.features.indices)).sum()) / d / n averageSparsityHash = computeSparsity(hashTrainData, numBucketsCTR, nTrain) averageSparsityOHE = computeSparsity(OHETrainData, numCtrOHEFeats, nTrain) print 'Average OHE Sparsity: {0:.7e}'.format(averageSparsityOHE) print 'Average Hash Sparsity: {0:.7e}'.format(averageSparsityHash) # TEST Sparsity (5c) Test.assertTrue(np.allclose(averageSparsityOHE, 1.6717677e-04), 'incorrect value for averageSparsityOHE') Test.assertTrue(np.allclose(averageSparsityHash, 1.1805561e-03), 'incorrect value for averageSparsityHash') numIters = 500 regType = 'l2' includeIntercept = True # Initialize variables using values from initial model training bestModel = None bestLogLoss = 1e10 # TODO: Replace <FILL IN> with appropriate code stepSizes = [1, 10] regParams = [1e-6, 1e-3] for stepSize in stepSizes: for regParam in regParams: model = (LogisticRegressionWithSGD .train(hashTrainData, numIters, stepSize, regParam=regParam, regType=regType, intercept=includeIntercept)) logLossVa = evaluateResults(model, hashValidationData) print ('\tstepSize = {0:.1f}, regParam = {1:.0e}: logloss = {2:.3f}' .format(stepSize, regParam, logLossVa)) if (logLossVa < bestLogLoss): bestModel = model bestLogLoss = logLossVa print ('Hashed Features Validation Logloss:\n\tBaseline = {0:.3f}\n\tLogReg = {1:.3f}' .format(logLossValBase, bestLogLoss)) # TEST Logistic model with hashed features (5d) Test.assertTrue(np.allclose(bestLogLoss, 0.4481683608), 'incorrect value for bestLogLoss') from matplotlib.colors import LinearSegmentedColormap # Saved parameters and results. Eliminate the time required to run 36 models stepSizes = [3, 6, 9, 12, 15, 18] regParams = [1e-7, 1e-6, 1e-5, 1e-4, 1e-3, 1e-2] logLoss = np.array([[ 0.45808431, 0.45808493, 0.45809113, 0.45815333, 0.45879221, 0.46556321], [ 0.45188196, 0.45188306, 0.4518941, 0.4520051, 0.45316284, 0.46396068], [ 0.44886478, 0.44886613, 0.44887974, 0.44902096, 0.4505614, 0.46371153], [ 0.44706645, 0.4470698, 0.44708102, 0.44724251, 0.44905525, 0.46366507], [ 0.44588848, 0.44589365, 0.44590568, 0.44606631, 0.44807106, 0.46365589], [ 0.44508948, 0.44509474, 0.44510274, 0.44525007, 0.44738317, 0.46365405]]) numRows, numCols = len(stepSizes), len(regParams) logLoss = np.array(logLoss) logLoss.shape = (numRows, numCols) fig, ax = preparePlot(np.arange(0, numCols, 1), np.arange(0, numRows, 1), figsize=(8, 7), hideLabels=True, gridWidth=0.) ax.set_xticklabels(regParams), ax.set_yticklabels(stepSizes) ax.set_xlabel('Regularization Parameter'), ax.set_ylabel('Step Size') colors = LinearSegmentedColormap.from_list('blue', ['#0022ff', '#000055'], gamma=.2) image = plt.imshow(logLoss,interpolation='nearest', aspect='auto', cmap = colors) pass # TODO: Replace <FILL IN> with appropriate code # Log loss for the best model from (5d) logLossTest = evaluateResults(bestModel, hashTestData) # Log loss for the baseline model logLossTestBaseline = hashTestData.map(lambda x: computeLogLoss(classOneFracTrain, x.label)).sum() / hashTestData.count() print ('Hashed Features Test Log Loss:\n\tBaseline = {0:.3f}\n\tLogReg = {1:.3f}' .format(logLossTestBaseline, logLossTest)) # TEST Evaluate on the test set (5e) Test.assertTrue(np.allclose(logLossTestBaseline, 0.537438), 'incorrect value for logLossTestBaseline') Test.assertTrue(np.allclose(logLossTest, 0.455616931), 'incorrect value for logLossTest') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Part 1 Step2: (1b) Sparse vectors Step3: (1c) OHE features as sparse vectors Step5: (1d) Define a OHE function Step6: (1e) Apply OHE to a dataset Step7: Part 2 Step8: (2b) OHE Dictionary from distinct features Step10: (2c) Automated creation of an OHE dictionary Step11: Part 3 Step12: (3a) Loading and splitting the data Step14: (3b) Extract features Step15: (3c) Create an OHE dictionary from the dataset Step17: (3d) Apply OHE to the dataset Step20: Visualization 1 Step22: (3e) Handling unseen features Step23: Part 4 Step25: (4b) Log loss Step26: (4c) Baseline log loss Step28: (4d) Predicted probability Step30: (4e) Evaluate the model Step31: (4f) Validation log loss Step32: Visualization 2 Step34: Part 5 Step36: (5b) Creating hashed features Step38: (5c) Sparsity Step39: (5d) Logistic model with hashed features Step40: Visualization 3 Step41: (5e) Evaluate on the test set
5,855
<ASSISTANT_TASK:> Python Code: from jyquickhelper import add_notebook_menu add_notebook_menu(header="Plan") from pyquickhelper.loghelper import fLOG fLOG(OutputPrint=False) # by default fLOG("not printed") fLOG(OutputPrint=True) fLOG("printed") from pyquickhelper.loghelper import run_cmd out,err=run_cmd("help", wait=True, shell=True) print(out) from pyquickhelper.ipythonhelper import open_html_form params= {"module":"", "version":"v..."} open_html_form(params, "fill the fields", "form1") form1 from jyquickhelper.helper_in_notebook import set_notebook_name_theNotebook set_notebook_name_theNotebook() import os path = os.path.join(os.path.abspath(os.path.dirname(theNotebook)), "..") from pyquickhelper.filehelper import explore_folder d,f =explore_folder(path) [ os.path.split(_)[-1] for _ in f[:5]] <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Log, run_cmd Step2: The function run_cmd runs a command line and returns the standard output and error Step3: Ask something to the user in a notebook Step4: Explore a folder
5,856
<ASSISTANT_TASK:> Python Code: %%capture from Q_tool_devo import Q8; U=Q8([1,2,-3,4]) V=Q8([4,-2,3,1]) R=Q8([5,6,7,-8]) print(U) print(R) def rotate_R_by_U(R, U): Given a space-time number R, rotate it by Q. return U.triple_product(R, U.invert()) R_rotated = rotate_R_by_U(R,U) print(R_rotated) print(R_rotated.reduce()) print(R.norm_squared()) print(R_rotated.norm_squared()) print(R_rotated.norm_squared().reduce()) print(R.square().reduce()) print(R_rotated.square()) print(R_rotated.square().reduce()) product_UV = rotate_R_by_U(R, V.product(U)) product_rotations = rotate_R_by_U(rotate_R_by_U(R, V), U) print(product_UV) print(product_rotations) print(product_UV.reduce()) print(product_rotations.reduce()) R_boosted=R.boost(0.01,0.02, 0.003) print("boosted: {}".format(R_boosted.reduce())) print(R.square().reduce()) print(R_boosted.square()) print(R_boosted.square().reduce()) print(R.norm_squared().reduce()) print(R_boosted.norm_squared()) print(R_boosted.norm_squared().reduce()) R_rotated_and_boosted = R_rotated.boost(0.01,0.02, 0.003) print("rotated and boosted: {}".format(R_rotated_and_boosted.reduce())) print(R.square().reduce()) print(R_rotated_and_boosted.square()) print(R_rotated_and_boosted.square().reduce()) print(R.norm_squared().reduce()) print(R_rotated_and_boosted.norm_squared()) print(R_rotated_and_boosted.norm_squared().reduce()) print(R.product(U).dif(U.product(R))) print(R.vahlen_conj().product(U.vahlen_conj()).dif(U.vahlen_conj().product(R.vahlen_conj()))) print(R.vahlen_conj("'").product(U.vahlen_conj("'")).dif(U.vahlen_conj("'").product(R.vahlen_conj("'")))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Use the Q8 class that places these 4 numbers in 8 slots like so Step3: If you are unfamiliar with this notation, the $I^2 = -1,\, i^3=-i,\, j^3=-j,\, k^3=-k$. Only positive numbers are used, with additive inverse put in these placeholders. Step4: Should we expect the first term to change? Look into the triple product first term where I use Capital variable for 3-vectors to simplify the presentation Step5: The first term does change! At least in the non-reduced Q8 format, there is a change because it is composed of the positive and negative terms we saw in the algebra problem. For example, there is the vector identity W.WxR=0. The cross product makes a vector that is 90 degrees to both W and R. The dot product of that cross product with W is zero because nothing is in the direction of W anymore. This shows up algebraically because the 6 terms of the cross product have three positive terms and three negative terms that exactly cancel when dotted to W. But the values remain in the $I^0$ and $I^2$ terms until Q8 is reduced. Step6: If squared, the reduced interval should be the same too Step7: But what should we make of these non-reduced calculations? Here is my speculation. In classical physics, one always, always, always uses the reduced form of a Q8 quaternion measurement. Classical physics involves one thing doing something. Physics gets odd when dealing with relativistic quantum feild theory. That is a rare sport played only when a one packet of protons collides with another inside an atom smasher. In those entirely odd situations, one must start thinking about multiple particles because we cannot know what happened, there is too much energy around, so we sum over all possible histories. Step8: This looks well-behaved because the the U and V if the U and V form a product before being applied, it results in the same answer as doing one after the other. I was a bit surprised this work without having to reduce the results. Step9: The reduced interval is $124 \,I^2$, whether boosted or not. The norm will shrink because all the number are a little smaller, no longer quite (5, 6, 7, 8). Step10: Rotations in Space and Time Step11: Because of the rotation, the z value was larger. It is a safe bet that the norm turns out to be smaller as happened before Step12: Ratios at Work
5,857
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'miroc', 'sandbox-3', 'aerosol') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.scheme_scope') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "troposhere" # "stratosphere" # "mesosphere" # "mesosphere" # "whole atmosphere" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.basic_approximations') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.prognostic_variables_form') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "3D mass/volume ratio for aerosols" # "3D number concenttration for aerosols" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.number_of_tracers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.family_approach') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses atmospheric chemistry time stepping" # "Specific timestepping (operator splitting)" # "Specific timestepping (integrated)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.split_operator_advection_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.split_operator_physical_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.integrated_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.timestep_framework.integrated_scheme_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Implicit" # "Semi-implicit" # "Semi-analytic" # "Impact solver" # "Back Euler" # "Newton Raphson" # "Rosenbrock" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.meteorological_forcings.variables_3D') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.meteorological_forcings.variables_2D') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.meteorological_forcings.frequency') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.resolution.is_adaptive_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.global_mean_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.regional_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.key_properties.tuning_applied.trend_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses Atmospheric chemistry transport scheme" # "Specific transport scheme (eulerian)" # "Specific transport scheme (semi-lagrangian)" # "Specific transport scheme (eulerian and semi-lagrangian)" # "Specific transport scheme (lagrangian)" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.mass_conservation_scheme') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses Atmospheric chemistry transport scheme" # "Mass adjustment" # "Concentrations positivity" # "Gradients monotonicity" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.transport.convention') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Uses Atmospheric chemistry transport scheme" # "Convective fluxes connected to tracers" # "Vertical velocities connected to tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Prescribed (climatology)" # "Prescribed CMIP6" # "Prescribed above surface" # "Interactive" # "Interactive above surface" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.sources') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Vegetation" # "Volcanos" # "Bare ground" # "Sea surface" # "Lightning" # "Fires" # "Aircraft" # "Anthropogenic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.prescribed_climatology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Interannual" # "Annual" # "Monthly" # "Daily" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.prescribed_climatology_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.prescribed_spatially_uniform_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.interactive_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.other_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.emissions.other_method_characteristics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_lower_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_upper_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_fields_mmr') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.concentrations.prescribed_fields_aod_plus_ccn') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.absorption.black_carbon') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.absorption.dust') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.absorption.organics') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.mixtures.external') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.mixtures.internal') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.mixtures.mixing_rule') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.impact_of_h2o.size') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.impact_of_h2o.internal_mixture') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.impact_of_h2o.external_mixture') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.radiative_scheme.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.radiative_scheme.shortwave_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.radiative_scheme.longwave_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.twomey') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.twomey_minimum_ccn') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.drizzle') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.cloud_lifetime') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.optical_radiative_properties.cloud_interactions.longwave_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Dry deposition" # "Sedimentation" # "Wet deposition (impaction scavenging)" # "Wet deposition (nucleation scavenging)" # "Coagulation" # "Oxidation (gas phase)" # "Oxidation (in cloud)" # "Condensation" # "Ageing" # "Advection (horizontal)" # "Advection (vertical)" # "Heterogeneous chemistry" # "Nucleation" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Radiation" # "Land surface" # "Heterogeneous chemistry" # "Clouds" # "Ocean" # "Cryosphere" # "Gas phase chemistry" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.gas_phase_precursors') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "DMS" # "SO2" # "Ammonia" # "Iodine" # "Terpene" # "Isoprene" # "VOC" # "NOx" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Bulk" # "Modal" # "Bin" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.aerosol.model.bulk_scheme_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sulphate" # "Nitrate" # "Sea salt" # "Dust" # "Ice" # "Organic" # "Black carbon / soot" # "SOA (secondary organic aerosols)" # "POM (particulate organic matter)" # "Polar stratospheric ice" # "NAT (Nitric acid trihydrate)" # "NAD (Nitric acid dihydrate)" # "STS (supercooled ternary solution aerosol particule)" # "Other: [Please specify]" # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Scheme Scope Step7: 1.4. Basic Approximations Step8: 1.5. Prognostic Variables Form Step9: 1.6. Number Of Tracers Step10: 1.7. Family Approach Step11: 2. Key Properties --&gt; Software Properties Step12: 2.2. Code Version Step13: 2.3. Code Languages Step14: 3. Key Properties --&gt; Timestep Framework Step15: 3.2. Split Operator Advection Timestep Step16: 3.3. Split Operator Physical Timestep Step17: 3.4. Integrated Timestep Step18: 3.5. Integrated Scheme Type Step19: 4. Key Properties --&gt; Meteorological Forcings Step20: 4.2. Variables 2D Step21: 4.3. Frequency Step22: 5. Key Properties --&gt; Resolution Step23: 5.2. Canonical Horizontal Resolution Step24: 5.3. Number Of Horizontal Gridpoints Step25: 5.4. Number Of Vertical Levels Step26: 5.5. Is Adaptive Grid Step27: 6. Key Properties --&gt; Tuning Applied Step28: 6.2. Global Mean Metrics Used Step29: 6.3. Regional Metrics Used Step30: 6.4. Trend Metrics Used Step31: 7. Transport Step32: 7.2. Scheme Step33: 7.3. Mass Conservation Scheme Step34: 7.4. Convention Step35: 8. Emissions Step36: 8.2. Method Step37: 8.3. Sources Step38: 8.4. Prescribed Climatology Step39: 8.5. Prescribed Climatology Emitted Species Step40: 8.6. Prescribed Spatially Uniform Emitted Species Step41: 8.7. Interactive Emitted Species Step42: 8.8. Other Emitted Species Step43: 8.9. Other Method Characteristics Step44: 9. Concentrations Step45: 9.2. Prescribed Lower Boundary Step46: 9.3. Prescribed Upper Boundary Step47: 9.4. Prescribed Fields Mmr Step48: 9.5. Prescribed Fields Aod Plus Ccn Step49: 10. Optical Radiative Properties Step50: 11. Optical Radiative Properties --&gt; Absorption Step51: 11.2. Dust Step52: 11.3. Organics Step53: 12. Optical Radiative Properties --&gt; Mixtures Step54: 12.2. Internal Step55: 12.3. Mixing Rule Step56: 13. Optical Radiative Properties --&gt; Impact Of H2o Step57: 13.2. Internal Mixture Step58: 13.3. External Mixture Step59: 14. Optical Radiative Properties --&gt; Radiative Scheme Step60: 14.2. Shortwave Bands Step61: 14.3. Longwave Bands Step62: 15. Optical Radiative Properties --&gt; Cloud Interactions Step63: 15.2. Twomey Step64: 15.3. Twomey Minimum Ccn Step65: 15.4. Drizzle Step66: 15.5. Cloud Lifetime Step67: 15.6. Longwave Bands Step68: 16. Model Step69: 16.2. Processes Step70: 16.3. Coupling Step71: 16.4. Gas Phase Precursors Step72: 16.5. Scheme Type Step73: 16.6. Bulk Scheme Species
5,858
<ASSISTANT_TASK:> Python Code: from sklearn import preprocessing import matplotlib.pyplot as plt import numpy as np import pandas as pd # Encode text values to dummy variables(i.e. [1,0,0],[0,1,0],[0,0,1] for red,green,blue) def encode_text_dummy(df,name): dummies = pd.get_dummies(df[name]) for x in dummies.columns: dummy_name = "{}-{}".format(name,x) df[dummy_name] = dummies[x] df.drop(name, axis=1, inplace=True) # Encode text values to indexes(i.e. [1],[2],[3] for red,green,blue). def encode_text_index(df,name): le = preprocessing.LabelEncoder() df[name] = le.fit_transform(df[name]) return le.classes_ # Encode a numeric column as zscores def encode_numeric_zscore(df,name,mean=None,sd=None): if mean is None: mean = df[name].mean() if sd is None: sd = df[name].std() df[name] = (df[name]-mean)/sd # Convert all missing values in the specified column to the median def missing_median(df, name): med = df[name].median() df[name] = df[name].fillna(med) # Convert a Pandas dataframe to the x,y inputs that TensorFlow needs def to_xy(df,target): result = [] for x in df.columns: if x != target: result.append(x) # find out the type of the target column. Is it really this hard? :( target_type = df[target].dtypes target_type = target_type[0] if hasattr(target_type, '__iter__') else target_type print(target_type) # Encode to int for classification, float otherwise. TensorFlow likes 32 bits. if target_type in (np.int64, np.int32): # Classification return df.as_matrix(result).astype(np.float32),df.as_matrix([target]).astype(np.int32) else: # Regression return df.as_matrix(result).astype(np.float32),df.as_matrix([target]).astype(np.float32) # Nicely formatted time string def hms_string(sec_elapsed): h = int(sec_elapsed / (60 * 60)) m = int((sec_elapsed % (60 * 60)) / 60) s = sec_elapsed % 60 return "{}:{:>02}:{:>05.2f}".format(h, m, s) # Regression chart, we will see more of this chart in the next class. def chart_regression(pred,y): t = pd.DataFrame({'pred' : pred.flatten(), 'y' : y_test.flatten()}) t.sort_values(by=['y'],inplace=True) a = plt.plot(t['y'].tolist(),label='expected') b = plt.plot(t['pred'].tolist(),label='prediction') plt.ylabel('output') plt.legend() plt.show() import os import pandas as pd from sklearn.cross_validation import train_test_split import tensorflow.contrib.learn as skflow import numpy as np path = "./data/" filename = os.path.join(path,"iris.csv") df = pd.read_csv(filename,na_values=['NA','?']) # Encode feature vector encode_numeric_zscore(df,'petal_w') encode_numeric_zscore(df,'petal_l') encode_numeric_zscore(df,'sepal_w') encode_numeric_zscore(df,'sepal_l') species = encode_text_index(df,"species") num_classes = len(species) # Create x & y for training # Create the x-side (feature vectors) of the training x, y = to_xy(df,'species') # Split into train/test x_train, x_test, y_train, y_test = train_test_split( x, y, test_size=0.25, random_state=45) # as much as I would like to use 42, it gives a perfect result, and a boring confusion matrix! # Create a deep neural network with 3 hidden layers of 10, 20, 10 classifier = skflow.TensorFlowDNNClassifier(hidden_units=[20, 10, 5], n_classes=num_classes, steps=10000) # Early stopping early_stop = skflow.monitors.ValidationMonitor(x_test, y_test, early_stopping_rounds=200, print_steps=50, n_classes=num_classes) # Fit/train neural network classifier.fit(x_train, y_train, monitor=early_stop) from sklearn import metrics # Evaluate success using accuracy pred = classifier.predict(x_test) score = metrics.accuracy_score(y_test, pred) print("Accuracy score: {}".format(score)) pred = classifier.predict_proba(x_test) np.set_printoptions(precision=4) print("Numpy array of predictions") print(pred[0:5]) print("As percent probability") (pred[0:5]*100).astype(int) score = metrics.log_loss(y_test, pred) print("Log loss score: {}".format(score)) %matplotlib inline from matplotlib.pyplot import figure, show from numpy import arange, sin, pi t = arange(0.0, 5.0, 0.00001) #t = arange(1.0, 5.0, 0.00001) # computer scientists #t = arange(0.0, 1.0, 0.00001) # data scientists fig = figure(1,figsize=(12, 10)) ax1 = fig.add_subplot(211) ax1.plot(t, np.log(t)) ax1.grid(True) ax1.set_ylim((-8, 1.5)) ax1.set_xlim((-0.1, 2)) ax1.set_xlabel('x') ax1.set_ylabel('y') ax1.set_title('log(x)') show() import tensorflow.contrib.learn as skflow from sklearn.cross_validation import train_test_split import pandas as pd import os import numpy as np from sklearn import metrics from scipy.stats import zscore path = "./data/" filename_read = os.path.join(path,"auto-mpg.csv") df = pd.read_csv(filename_read,na_values=['NA','?']) # create feature vector missing_median(df, 'horsepower') df.drop('name',1,inplace=True) encode_numeric_zscore(df, 'horsepower') encode_numeric_zscore(df, 'weight') encode_numeric_zscore(df, 'cylinders') encode_numeric_zscore(df, 'displacement') encode_numeric_zscore(df, 'acceleration') encode_text_dummy(df, 'origin') # Encode to a 2D matrix for training x,y = to_xy(df,'mpg') # Split into train/test x_train, x_test, y_train, y_test = train_test_split( x, y, test_size=0.20, random_state=42) # Create a deep neural network with 3 hidden layers of 50, 25, 10 regressor = skflow.TensorFlowDNNRegressor(hidden_units=[50, 25, 10], steps=5000) # Early stopping early_stop = skflow.monitors.ValidationMonitor(x_test, y_test, early_stopping_rounds=200, print_steps=50) # Fit/train neural network regressor.fit(x_train, y_train, monitor=early_stop) pred = regressor.predict(x_test) # Measure MSE error. score = metrics.mean_squared_error(pred,y_test) print("Final score (MSE): {}".format(score)) # Measure RMSE error. RMSE is common for regression. score = np.sqrt(metrics.mean_squared_error(pred,y_test)) print("Final score (RMSE): {}".format(score)) import tensorflow.contrib.learn as skflow import pandas as pd import os import numpy as np from sklearn import metrics from scipy.stats import zscore from sklearn.cross_validation import KFold path = "./data/" filename_read = os.path.join(path,"auto-mpg.csv") filename_write = os.path.join(path,"auto-mpg-out-of-sample.csv") df = pd.read_csv(filename_read,na_values=['NA','?']) # create feature vector missing_median(df, 'horsepower') df.drop('name',1,inplace=True) encode_numeric_zscore(df, 'horsepower') encode_numeric_zscore(df, 'weight') encode_numeric_zscore(df, 'cylinders') encode_numeric_zscore(df, 'displacement') encode_numeric_zscore(df, 'acceleration') encode_text_dummy(df, 'origin') # Shuffle np.random.seed(42) df = df.reindex(np.random.permutation(df.index)) df.reset_index(inplace=True, drop=True) # Encode to a 2D matrix for training x,y = to_xy(df,'mpg') # Cross validate kf = KFold(len(x), n_folds=5) oos_y = [] oos_pred = [] fold = 1 for train, test in kf: print("Fold #{}".format(fold)) fold+=1 x_train = x[train] y_train = y[train] x_test = x[test] y_test = y[test] # Create a deep neural network with 3 hidden layers of 10, 20, 10 regressor = skflow.TensorFlowDNNRegressor(hidden_units=[10, 20, 10], steps=500) # Early stopping early_stop = skflow.monitors.ValidationMonitor(x_test, y_test, early_stopping_rounds=200, print_steps=50) # Fit/train neural network regressor.fit(x_train, y_train, monitor=early_stop) # Add the predictions to the oos prediction list pred = regressor.predict(x_test) oos_y.append(y_test) oos_pred.append(pred) # Measure accuracy score = np.sqrt(metrics.mean_squared_error(pred,y_test)) print("Fold score (RMSE): {}".format(score)) # Build the oos prediction list and calculate the error. oos_y = np.concatenate(oos_y) oos_pred = np.concatenate(oos_pred) score = np.sqrt(metrics.mean_squared_error(oos_pred,oos_y)) print("Final, out of sample score (RMSE): {}".format(score)) # Write the cross-validated prediction oos_y = pd.DataFrame(oos_y) oos_pred = pd.DataFrame(oos_pred) oosDF = pd.concat( [df, oos_y, oos_pred],axis=1 ) oosDF.to_csv(filename_write,index=False) import tensorflow.contrib.learn as skflow from sklearn.cross_validation import train_test_split import pandas as pd import os import numpy as np from sklearn import metrics from scipy.stats import zscore from sklearn.cross_validation import KFold path = "./data/" filename_read = os.path.join(path,"auto-mpg.csv") filename_write = os.path.join(path,"auto-mpg-holdout.csv") df = pd.read_csv(filename_read,na_values=['NA','?']) # create feature vector missing_median(df, 'horsepower') df.drop('name',1,inplace=True) encode_numeric_zscore(df, 'horsepower') encode_numeric_zscore(df, 'weight') encode_numeric_zscore(df, 'cylinders') encode_numeric_zscore(df, 'displacement') encode_numeric_zscore(df, 'acceleration') encode_text_dummy(df, 'origin') # Shuffle np.random.seed(42) df = df.reindex(np.random.permutation(df.index)) df.reset_index(inplace=True, drop=True) # Encode to a 2D matrix for training x,y = to_xy(df,'mpg') # Keep a 10% holdout x_main, x_holdout, y_main, y_holdout = train_test_split( x, y, test_size=0.10) # Cross validate kf = KFold(len(x_main), n_folds=5) oos_y = [] oos_pred = [] fold = 1 for train, test in kf: print("Fold #{}".format(fold)) fold+=1 x_train = x_main[train] y_train = y_main[train] x_test = x_main[test] y_test = y_main[test] # Create a deep neural network with 3 hidden layers of 10, 20, 10 regressor = skflow.TensorFlowDNNRegressor(hidden_units=[10, 20, 10], steps=500) # Early stopping early_stop = skflow.monitors.ValidationMonitor(x_test, y_test, early_stopping_rounds=200, print_steps=50) # Fit/train neural network regressor.fit(x_train, y_train, monitor=early_stop) # Add the predictions to the OOS prediction list pred = regressor.predict(x_test) oos_y.append(y_test) oos_pred.append(pred) # Measure accuracy score = np.sqrt(metrics.mean_squared_error(pred,y_test)) print("Fold score (RMSE): {}".format(score)) # Build the oos prediction list and calculate the error. oos_y = np.concatenate(oos_y) oos_pred = np.concatenate(oos_pred) score = np.sqrt(metrics.mean_squared_error(oos_pred,oos_y)) print() print("Cross-validated score (RMSE): {}".format(score)) # Write the cross-validated prediction holdout_pred = regressor.predict(x_holdout) score = np.sqrt(metrics.mean_squared_error(holdout_pred,y_holdout)) print("Holdout score (RMSE): {}".format(score)) %matplotlib inline from matplotlib.pyplot import figure, show from numpy import arange import tensorflow.contrib.learn as skflow import pandas as pd import os import numpy as np import tensorflow as tf from sklearn import metrics from scipy.stats import zscore import matplotlib.pyplot as plt path = "./data/" filename_read = os.path.join(path,"auto-mpg.csv") df = pd.read_csv(filename_read,na_values=['NA','?']) # create feature vector missing_median(df, 'horsepower') df.drop('name',1,inplace=True) encode_numeric_zscore(df, 'horsepower') encode_numeric_zscore(df, 'weight') encode_numeric_zscore(df, 'cylinders') encode_numeric_zscore(df, 'displacement') encode_numeric_zscore(df, 'acceleration') encode_text_dummy(df, 'origin') # Encode to a 2D matrix for training x,y = to_xy(df,'mpg') # Split into train/test x_train, x_test, y_train, y_test = train_test_split( x, y, test_size=0.25, random_state=42) # Create a deep neural network with 3 hidden layers of 50, 25, 10 regressor = skflow.TensorFlowDNNRegressor( hidden_units=[50, 25, 10], batch_size = 32, optimizer='SGD', learning_rate=0.01, steps=5000) # Early stopping early_stop = skflow.monitors.ValidationMonitor(x_test, y_test, early_stopping_rounds=200, print_steps=50) # Fit/train neural network regressor.fit(x_train, y_train, monitor=early_stop) # Measure RMSE error. RMSE is common for regression. pred = regressor.predict(x_test) score = np.sqrt(metrics.mean_squared_error(pred,y_test)) print("Final score (RMSE): {}".format(score)) # Plot the chart chart_regression(pred,y_test) import multiprocessing print("Your system has {} cores.".format(multiprocessing.cpu_count())) %matplotlib inline from matplotlib.pyplot import figure, show from numpy import arange import tensorflow.contrib.learn as skflow import pandas as pd import os import numpy as np import tensorflow as tf from sklearn import metrics from scipy.stats import zscore from sklearn.grid_search import GridSearchCV import multiprocessing import time from sklearn.cross_validation import train_test_split import matplotlib.pyplot as plt def main(): path = "./data/" filename_read = os.path.join(path,"auto-mpg.csv") df = pd.read_csv(filename_read,na_values=['NA','?']) start_time = time.time() # create feature vector missing_median(df, 'horsepower') df.drop('name',1,inplace=True) encode_numeric_zscore(df, 'horsepower') encode_numeric_zscore(df, 'weight') encode_numeric_zscore(df, 'cylinders') encode_numeric_zscore(df, 'displacement') encode_numeric_zscore(df, 'acceleration') encode_text_dummy(df, 'origin') # Encode to a 2D matrix for training x,y = to_xy(df,'mpg') # Split into train/test x_train, x_test, y_train, y_test = train_test_split( x, y, test_size=0.25, random_state=42) # The hyperparameters specified here will be searched. Every combination. param_grid = { 'learning_rate': [0.1, 0.01, 0.001], 'batch_size': [8, 16, 32] } # Create a deep neural network. The hyperparameters specified here remain fixed. model = skflow.TensorFlowDNNRegressor( hidden_units=[50, 25, 10], batch_size = 32, optimizer='SGD', steps=5000) # Early stopping early_stop = skflow.monitors.ValidationMonitor(x_test, y_test, early_stopping_rounds=200, print_steps=50) # Startup grid search threads = 1 #multiprocessing.cpu_count() print("Using {} cores.".format(threads)) regressor = GridSearchCV(model, verbose=True, n_jobs=threads, param_grid=param_grid,fit_params={'monitor':early_stop}) # Fit/train neural network regressor.fit(x_train, y_train) # Measure RMSE error. RMSE is common for regression. pred = regressor.predict(x_test) score = np.sqrt(metrics.mean_squared_error(pred,y_test)) print("Final score (RMSE): {}".format(score)) print("Final options: {}".format(regressor.best_params_)) # Plot the chart chart_regression(pred,y_test) elapsed_time = time.time() - start_time print("Elapsed time: {}".format(hms_string(elapsed_time))) # Allow windows to multi-thread (unneeded on advanced OS's) # See: https://docs.python.org/2/library/multiprocessing.html if __name__ == '__main__': main() %matplotlib inline from matplotlib.pyplot import figure, show from numpy import arange import tensorflow.contrib.learn as skflow import pandas as pd import os import numpy as np import tensorflow as tf from sklearn import metrics from scipy.stats import zscore from scipy.stats import randint as sp_randint from sklearn.grid_search import RandomizedSearchCV import multiprocessing import time from sklearn.cross_validation import train_test_split import matplotlib.pyplot as plt def main(): path = "./data/" filename_read = os.path.join(path,"auto-mpg.csv") df = pd.read_csv(filename_read,na_values=['NA','?']) start_time = time.time() # create feature vector missing_median(df, 'horsepower') df.drop('name',1,inplace=True) encode_numeric_zscore(df, 'horsepower') encode_numeric_zscore(df, 'weight') encode_numeric_zscore(df, 'cylinders') encode_numeric_zscore(df, 'displacement') encode_numeric_zscore(df, 'acceleration') encode_text_dummy(df, 'origin') # Encode to a 2D matrix for training x,y = to_xy(df,'mpg') # Split into train/test x_train, x_test, y_train, y_test = train_test_split( x, y, test_size=0.25, random_state=42) # The hyperparameters specified here will be searched. A random sample will be searched. param_dist = { 'learning_rate': [0.1, 0.01, 0.001], 'batch_size': sp_randint(4, 32), } model = skflow.TensorFlowDNNRegressor( hidden_units=[50, 25, 10], batch_size = 32, optimizer='SGD', steps=5000) # Early stopping early_stop = skflow.monitors.ValidationMonitor(x_test, y_test, early_stopping_rounds=200, print_steps=50) # Random search threads = 1 #multiprocessing.cpu_count() print("Using {} cores.".format(threads)) regressor = RandomizedSearchCV(model, verbose=True, n_iter = 10, n_jobs=threads, param_distributions=param_dist, fit_params={'monitor':early_stop}) # Fit/train neural network regressor.fit(x_train, y_train) # Measure RMSE error. RMSE is common for regression. pred = regressor.predict(x_test) score = np.sqrt(metrics.mean_squared_error(pred,y_test)) print("Final score (RMSE): {}".format(score)) print("Final options: {}".format(regressor.best_params_)) # Plot the chart chart_regression(pred,y_test) elapsed_time = time.time() - start_time print("Elapsed time: {}".format(hms_string(elapsed_time))) # Allow windows to multi-thread (unneeded on advanced OS's) # See: https://docs.python.org/2/library/multiprocessing.html if __name__ == '__main__': main() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Training with a Validation Set and Early Stopping Step2: Calculate Classification Accuracy Step3: Calculate Classification Log Loss Step4: Log loss is calculated as follows Step5: Evaluating Regression Results Step6: Mean Square Error Step7: Root Mean Square Error Step8: Training with Cross Validation Step9: Training with Cross Validation and a Holdout Set Step10: How Kaggle Competitions are Scored Step11: Grid Search Step12: The following code performs a grid search. Your system is queried for the number of cores available they are used to scan through the combinations of hyperparameters that you specify. Step13: The best combination of hyperparameters are displayed.
5,859
<ASSISTANT_TASK:> Python Code: !pip install "thinc>=8.0.0a0" transformers torch "ml_datasets>=0.2.0a0" "tqdm>=4.41" from thinc.api import prefer_gpu, use_pytorch_for_gpu_memory is_gpu = prefer_gpu() print("GPU:", is_gpu) if is_gpu: use_pytorch_for_gpu_memory() CONFIG = [model] @layers = "TransformersTagger.v1" starter = "bert-base-multilingual-cased" [optimizer] @optimizers = "Adam.v1" [optimizer.learn_rate] @schedules = "warmup_linear.v1" initial_rate = 0.01 warmup_steps = 3000 total_steps = 6000 [loss] @losses = "SequenceCategoricalCrossentropy.v1" [training] batch_size = 128 words_per_subbatch = 2000 n_epoch = 10 from typing import Optional, List import numpy from thinc.types import Ints1d, Floats2d from dataclasses import dataclass import torch from transformers import BatchEncoding, TokenSpan @dataclass class TokensPlus: batch_size: int tok2wp: List[Ints1d] input_ids: torch.Tensor token_type_ids: torch.Tensor attention_mask: torch.Tensor def __init__(self, inputs: List[List[str]], wordpieces: BatchEncoding): self.input_ids = wordpieces["input_ids"] self.attention_mask = wordpieces["attention_mask"] self.token_type_ids = wordpieces["token_type_ids"] self.batch_size = self.input_ids.shape[0] self.tok2wp = [] for i in range(self.batch_size): spans = [wordpieces.word_to_tokens(i, j) for j in range(len(inputs[i]))] self.tok2wp.append(self.get_wp_starts(spans)) def get_wp_starts(self, spans: List[Optional[TokenSpan]]) -> Ints1d: Calculate an alignment mapping each token index to its first wordpiece. alignment = numpy.zeros((len(spans)), dtype="i") for i, span in enumerate(spans): if span is None: raise ValueError( "Token did not align to any wordpieces. Was the tokenizer " "run with is_split_into_words=True?" ) else: alignment[i] = span.start return alignment def test_tokens_plus(name: str="bert-base-multilingual-cased"): from transformers import AutoTokenizer inputs = [ ["Our", "band", "is", "called", "worlthatmustbedivided", "!"], ["We", "rock", "!"] ] tokenizer = AutoTokenizer.from_pretrained(name) wordpieces = tokenizer( inputs, is_split_into_words=True, add_special_tokens=True, return_token_type_ids=True, return_attention_mask=True, return_length=True, return_tensors="pt", padding="longest" ) tplus = TokensPlus(inputs, wordpieces) assert len(tplus.tok2wp) == len(inputs) == len(tplus.input_ids) for i, align in enumerate(tplus.tok2wp): assert len(align) == len(inputs[i]) for j in align: assert j >= 0 and j < tplus.input_ids.shape[1] test_tokens_plus() import thinc from thinc.api import Model from transformers import AutoTokenizer @thinc.registry.layers("transformers_tokenizer.v1") def TransformersTokenizer(name: str) -> Model[List[List[str]], TokensPlus]: def forward(model, inputs: List[List[str]], is_train: bool): tokenizer = model.attrs["tokenizer"] wordpieces = tokenizer( inputs, is_split_into_words=True, add_special_tokens=True, return_token_type_ids=True, return_attention_mask=True, return_length=True, return_tensors="pt", padding="longest" ) return TokensPlus(inputs, wordpieces), lambda d_tokens: [] return Model("tokenizer", forward, attrs={"tokenizer": AutoTokenizer.from_pretrained(name)}) from typing import List, Tuple, Callable from thinc.api import ArgsKwargs, torch2xp, xp2torch from thinc.types import Floats2d def convert_transformer_inputs(model, tokens: TokensPlus, is_train): kwargs = { "input_ids": tokens.input_ids, "attention_mask": tokens.attention_mask, "token_type_ids": tokens.token_type_ids, } return ArgsKwargs(args=(), kwargs=kwargs), lambda dX: [] def convert_transformer_outputs( model: Model, inputs_outputs: Tuple[TokensPlus, Tuple[torch.Tensor]], is_train: bool ) -> Tuple[List[Floats2d], Callable]: tplus, trf_outputs = inputs_outputs wp_vectors = torch2xp(trf_outputs[0]) tokvecs = [wp_vectors[i, idx] for i, idx in enumerate(tplus.tok2wp)] def backprop(d_tokvecs: List[Floats2d]) -> ArgsKwargs: # Restore entries for BOS and EOS markers d_wp_vectors = model.ops.alloc3f(*trf_outputs[0].shape, dtype="f") for i, idx in enumerate(tplus.tok2wp): d_wp_vectors[i, idx] += d_tokvecs[i] return ArgsKwargs( args=(trf_outputs[0],), kwargs={"grad_tensors": xp2torch(d_wp_vectors)}, ) return tokvecs, backprop import thinc from thinc.api import PyTorchWrapper from transformers import AutoModel @thinc.registry.layers("transformers_model.v1") def Transformer(name: str) -> Model[TokensPlus, List[Floats2d]]: return PyTorchWrapper( AutoModel.from_pretrained(name), convert_inputs=convert_transformer_inputs, convert_outputs=convert_transformer_outputs, ) from thinc.api import chain, with_array, Softmax @thinc.registry.layers("TransformersTagger.v1") def TransformersTagger(starter: str, n_tags: int = 17) -> Model[List[List[str]], List[Floats2d]]: return chain( TransformersTokenizer(starter), Transformer(starter), with_array(Softmax(n_tags)), ) from thinc.api import Config, registry C = registry.resolve(Config().from_str(CONFIG)) model = C["model"] optimizer = C["optimizer"] calculate_loss = C["loss"] cfg = C["training"] import ml_datasets (train_X, train_Y), (dev_X, dev_Y) = ml_datasets.ud_ancora_pos_tags() train_Y = list(map(model.ops.asarray, train_Y)) # convert to cupy if needed dev_Y = list(map(model.ops.asarray, dev_Y)) # convert to cupy if needed model.initialize(X=train_X[:5], Y=train_Y[:5]) def minibatch_by_words(pairs, max_words): pairs = list(zip(*pairs)) pairs.sort(key=lambda xy: len(xy[0]), reverse=True) batch = [] for X, Y in pairs: batch.append((X, Y)) n_words = max(len(xy[0]) for xy in batch) * len(batch) if n_words >= max_words: yield batch[:-1] batch = [(X, Y)] if batch: yield batch def evaluate_sequences(model, Xs: List[Floats2d], Ys: List[Floats2d], batch_size: int) -> float: correct = 0.0 total = 0.0 for X, Y in model.ops.multibatch(batch_size, Xs, Ys): Yh = model.predict(X) for yh, y in zip(Yh, Y): correct += (y.argmax(axis=1) == yh.argmax(axis=1)).sum() total += y.shape[0] return float(correct / total) from tqdm.notebook import tqdm from thinc.api import fix_random_seed fix_random_seed(0) for epoch in range(cfg["n_epoch"]): batches = model.ops.multibatch(cfg["batch_size"], train_X, train_Y, shuffle=True) for outer_batch in tqdm(batches, leave=False): for batch in minibatch_by_words(outer_batch, cfg["words_per_subbatch"]): inputs, truths = zip(*batch) inputs = list(inputs) guesses, backprop = model(inputs, is_train=True) backprop(calculate_loss.get_grad(guesses, truths)) model.finish_update(optimizer) optimizer.step_schedules() score = evaluate_sequences(model, dev_X, dev_Y, cfg["batch_size"]) print(epoch, f"{score:.3f}") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: First, let's use Thinc's prefer_gpu helper to make sure we're performing operations on GPU if available. The function should be called right after importing Thinc, and it returns a boolean indicating whether the GPU has been activated. If we're on GPU, we can also call use_pytorch_for_gpu_memory to route cupy's memory allocation via PyTorch, so both can play together nicely. Step3: Overview Step5: Defining the model Step6: The wrapped tokenizer will take a list-of-lists as input (the texts) and will output a TokensPlus object containing the fully padded batch of tokens. The wrapped transformer will take a list of TokensPlus objects and will output a list of 2-dimensional arrays. Step7: The forward pass takes the model and a list-of-lists of strings and outputs the TokensPlus dataclass. It also outputs a dummy callback function, to meet the API contract for Thinc models. Even though there's no way we can meaningfully "backpropagate" this layer, we need to make sure the function has the right signature, so that it can be used interchangeably with other layers. Step8: The input and output transformation functions give you full control of how data is passed into and out of the underlying PyTorch model, so you can work with PyTorch layers that expect and return arbitrary objects. Putting it all together, we now have a nice layer that is configured with the name of a transformer model, that acts as a function mapping tokenized input into feature vectors. Step9: We can now combine the TransformersTokenizer and Transformer into a feed-forward network using the chain combinator. The with_array layer transforms a sequence of data into a contiguous 2d array on the way into and Step10: Training the model Step11: We’ve prepared a separate package ml-datasets with loaders for some common datasets, including the AnCora data. If we're using a GPU, calling ops.asarray on the outputs ensures that they're converted to cupy arrays (instead of numpy arrays). Calling Model.initialize with a batch of inputs and outputs allows Thinc to infer the missing dimensions. Step12: Helper functions for training and evaluation Step13: The training loop
5,860
<ASSISTANT_TASK:> Python Code: DON'T MODIFY ANYTHING IN THIS CELL import helper data_dir = 'data/simpsons/moes_tavern_lines.txt' text = helper.load_data(data_dir) # Ignore notice, since we don't use it for analysing the data text = text[81:] text[0:500] view_sentence_range = (0, 10) DON'T MODIFY ANYTHING IN THIS CELL import numpy as np print('Dataset Stats') print('Roughly the number of unique words: {}'.format(len({word: None for word in text.split()}))) scenes = text.split('\n\n') print('Number of scenes: {}'.format(len(scenes))) sentence_count_scene = [scene.count('\n') for scene in scenes] print('Average number of sentences in each scene: {}'.format(np.average(sentence_count_scene))) sentences = [sentence for scene in scenes for sentence in scene.split('\n')] print('Number of lines: {}'.format(len(sentences))) word_count_sentence = [len(sentence.split()) for sentence in sentences] print('Average number of words in each line: {}'.format(np.average(word_count_sentence))) print() print('The sentences {} to {}:'.format(*view_sentence_range)) print('\n'.join(text.split('\n')[view_sentence_range[0]:view_sentence_range[1]])) import numpy as np import problem_unittests as tests from collections import Counter def create_lookup_tables(text): Create lookup tables for vocabulary :param text: The text of tv scripts split into words :return: A tuple of dicts (vocab_to_int, int_to_vocab) counts = Counter(text) vocab = sorted(counts, key=counts.get, reverse=True) vocab_to_int = {word: ii for ii, word in enumerate(vocab, 1)} int_to_vocab = {ii: word for ii, word in enumerate(vocab, 1)} return (vocab_to_int, int_to_vocab) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_create_lookup_tables(create_lookup_tables) def token_lookup(): Generate a dict to turn punctuation into a token. :return: Tokenize dictionary where the key is the punctuation and the value is the token # TODO: Implement Function punct_list = {'.': '||period||', ',': '||comma||', '"': '||quotation_mark||', ';': '||semicolon||', '!': '||exclamation_mark||', '?': '||question_mark||', '(': '||left_parentheses||', ')': '||right_parentheses||', '--': '||dash||', '\n': '||return||'} return punct_list DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_tokenize(token_lookup) DON'T MODIFY ANYTHING IN THIS CELL # Preprocess Training, Validation, and Testing Data helper.preprocess_and_save_data(data_dir, token_lookup, create_lookup_tables) DON'T MODIFY ANYTHING IN THIS CELL import helper import numpy as np import problem_unittests as tests int_text, vocab_to_int, int_to_vocab, token_dict = helper.load_preprocess() len(int_text) DON'T MODIFY ANYTHING IN THIS CELL from distutils.version import LooseVersion import warnings import tensorflow as tf # Check TensorFlow Version assert LooseVersion(tf.__version__) >= LooseVersion('1.0'), 'Please use TensorFlow version 1.0 or newer' print('TensorFlow Version: {}'.format(tf.__version__)) # Check for a GPU if not tf.test.gpu_device_name(): warnings.warn('No GPU found. Please use a GPU to train your neural network.') else: print('Default GPU Device: {}'.format(tf.test.gpu_device_name())) def get_inputs(): Create TF Placeholders for input, targets, and learning rate. :return: Tuple (input, targets, learning rate) inputs = tf.placeholder(tf.int32, [None, None], name='input') targets = tf.placeholder(tf.int32, [None, None], name='targets') learning_rate = tf.placeholder(tf.float32, name='learning_rate') return (inputs, targets, learning_rate) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_inputs(get_inputs) def get_init_cell(batch_size, rnn_size): Create an RNN Cell and initialize it. :param batch_size: Size of batches :param rnn_size: Size of RNNs :return: Tuple (cell, initialize state) lstm = tf.contrib.rnn.BasicLSTMCell(rnn_size) cell = tf.contrib.rnn.MultiRNNCell([lstm] * 2) initial_state = cell.zero_state(batch_size, tf.float32) initial_state = tf.identity(initial_state, name= "initial_state") return (cell, initial_state) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_init_cell(get_init_cell) def get_embed(input_data, vocab_size, embed_dim): Create embedding for <input_data>. :param input_data: TF placeholder for text input. :param vocab_size: Number of words in vocabulary. :param embed_dim: Number of embedding dimensions :return: Embedded input. embedding = tf.Variable(tf.truncated_normal((vocab_size, embed_dim), stddev=0.25)) embed = tf.nn.embedding_lookup(embedding, input_data) return embed DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_embed(get_embed) def build_rnn(cell, inputs): Create a RNN using a RNN Cell :param cell: RNN Cell :param inputs: Input text data :return: Tuple (Outputs, Final State) outputs, final_state = tf.nn.dynamic_rnn(cell, inputs, dtype=tf.float32) final_state = tf.identity(final_state, name="final_state") return outputs, final_state DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_build_rnn(build_rnn) def build_nn(cell, rnn_size, input_data, vocab_size): Build part of the neural network :param cell: RNN cell :param rnn_size: Size of rnns :param input_data: Input data :param vocab_size: Vocabulary size :return: Tuple (Logits, FinalState) inputs = get_embed(input_data, vocab_size, rnn_size) outputs, final_state = build_rnn(cell, inputs) logits = tf.contrib.layers.fully_connected(outputs, vocab_size, activation_fn=None) return logits, final_state DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_build_nn(build_nn) def get_batches(int_text, batch_size, seq_length): Return batches of input and target :param int_text: Text with the words replaced by their ids :param batch_size: The size of batch :param seq_length: The length of sequence :return: Batches as a Numpy array slice_size = batch_size * seq_length n_batches = len(int_text) // slice_size # We will drop the last few words to keep the batches in equal size used_data = int_text[0:n_batches * slice_size + 1] batches = [] for i in range(n_batches): input_batch = [] target_batch = [] for j in range(batch_size): start_idx = i * batch_size + j * seq_length end_idx = i * batch_size + (j + 1) * seq_length input_batch.append(used_data[start_idx: end_idx]) target_batch.append(used_data[start_idx + 1: end_idx + 1]) batches.append([input_batch, target_batch]) return np.array(batches) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_batches(get_batches) # Number of Epochs num_epochs = 50 # Batch Size batch_size = 128 # RNN Size rnn_size = 1024 # Sequence Length seq_length = 16 # Learning Rate learning_rate = 0.001 # Show stats for every n number of batches show_every_n_batches = 11 DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE save_dir = './save' DON'T MODIFY ANYTHING IN THIS CELL from tensorflow.contrib import seq2seq train_graph = tf.Graph() with train_graph.as_default(): vocab_size = len(int_to_vocab) input_text, targets, lr = get_inputs() input_data_shape = tf.shape(input_text) cell, initial_state = get_init_cell(input_data_shape[0], rnn_size) logits, final_state = build_nn(cell, rnn_size, input_text, vocab_size) # Probabilities for generating words probs = tf.nn.softmax(logits, name='probs') # Loss function cost = seq2seq.sequence_loss( logits, targets, tf.ones([input_data_shape[0], input_data_shape[1]]) ) # Optimizer optimizer = tf.train.AdamOptimizer(lr) # Gradient Clipping gradients = optimizer.compute_gradients(cost) capped_gradients = [(tf.clip_by_value(grad, -1., 1.), var) for grad, var in gradients] train_op = optimizer.apply_gradients(capped_gradients) DON'T MODIFY ANYTHING IN THIS CELL batches = get_batches(int_text, batch_size, seq_length) with tf.Session(graph=train_graph) as sess: sess.run(tf.global_variables_initializer()) for epoch_i in range(num_epochs): state = sess.run(initial_state, {input_text: batches[0][0]}) for batch_i, (x, y) in enumerate(batches): feed = { input_text: x, targets: y, initial_state: state, lr: learning_rate} train_loss, state, _ = sess.run([cost, final_state, train_op], feed) # Show every <show_every_n_batches> batches if (epoch_i * len(batches) + batch_i) % show_every_n_batches == 0: print('Epoch {:>3} Batch {:>4}/{} train_loss = {:.3f}'.format( epoch_i, batch_i, len(batches), train_loss)) # Save Model saver = tf.train.Saver() saver.save(sess, save_dir) print('Model Trained and Saved') DON'T MODIFY ANYTHING IN THIS CELL # Save parameters for checkpoint helper.save_params((seq_length, save_dir)) DON'T MODIFY ANYTHING IN THIS CELL import tensorflow as tf import numpy as np import helper import problem_unittests as tests _, vocab_to_int, int_to_vocab, token_dict = helper.load_preprocess() seq_length, load_dir = helper.load_params() def get_tensors(loaded_graph): Get input, initial state, final state, and probabilities tensor from <loaded_graph> :param loaded_graph: TensorFlow graph loaded from file :return: Tuple (InputTensor, InitialStateTensor, FinalStateTensor, ProbsTensor) inputs = loaded_graph.get_tensor_by_name("input:0") initial_state = loaded_graph.get_tensor_by_name("initial_state:0") final_state = loaded_graph.get_tensor_by_name("final_state:0") probs = loaded_graph.get_tensor_by_name("probs:0") return (inputs, initial_state, final_state, probs) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_tensors(get_tensors) from random import randint def pick_word(probabilities, int_to_vocab): Pick the next word in the generated text :param probabilities: Probabilites of the next word :param int_to_vocab: Dictionary of word ids as the keys and words as the values :return: String of the predicted word return int_to_vocab[np.argmax(probabilities)] DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_pick_word(pick_word) gen_length = 300 # homer_simpson, moe_szyslak, or Barney_Gumble prime_word = 'moe_szyslak' DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE loaded_graph = tf.Graph() with tf.Session(graph=loaded_graph) as sess: # Load saved model loader = tf.train.import_meta_graph(load_dir + '.meta') loader.restore(sess, load_dir) # Get Tensors from loaded model input_text, initial_state, final_state, probs = get_tensors(loaded_graph) # Sentences generation setup gen_sentences = [prime_word + ':'] prev_state = sess.run(initial_state, {input_text: np.array([[1]])}) # Generate sentences for n in range(gen_length): # Dynamic Input dyn_input = [[vocab_to_int[word] for word in gen_sentences[-seq_length:]]] dyn_seq_length = len(dyn_input[0]) # Get Prediction probabilities, prev_state = sess.run( [probs, final_state], {input_text: dyn_input, initial_state: prev_state}) pred_word = pick_word(probabilities[dyn_seq_length-1], int_to_vocab) gen_sentences.append(pred_word) # Remove tokens tv_script = ' '.join(gen_sentences) for key, token in token_dict.items(): ending = ' ' if key in ['\n', '(', '"'] else '' tv_script = tv_script.replace(' ' + token.lower(), key) tv_script = tv_script.replace('\n ', '\n') tv_script = tv_script.replace('( ', '(') print(tv_script) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: TV Script Generation Step3: Explore the Data Step6: Implement Preprocessing Functions Step9: Tokenize Punctuation Step11: Preprocess all the data and save it Step13: Check Point Step15: Build the Neural Network Step18: Input Step21: Build RNN Cell and Initialize Step24: Word Embedding Step27: Build RNN Step30: Build the Neural Network Step33: Batches Step35: Neural Network Training Step37: Build the Graph Step39: Train Step41: Save Parameters Step43: Checkpoint Step46: Implement Generate Functions Step49: Choose Word Step51: Generate TV Script
5,861
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np # Creating a series (with different type of data) s1 = pd.Series([34, 'Material', 4*np.pi, 'Reactor', [100,250,500,750], 'kW']) s1 # Creating a series with specified index lt = [34, 'Material', 4*np.pi, 'Reactor', [100,250,500,750], 'kW'] s2 = pd.Series(lt, index = ['b1', 'r1', 'solid angle', 18, 'reactor power', 'unit']) s2 s1[3], s2['solid angle'] pop_cities = {'Kuala Lumpur':1588750, 'Seberang Perai':818197, 'Kajang':795522, 'Klang':744062, 'Subang Jaya':708296} cities = pd.Series(pop_cities) cities cities.order(ascending=False) cities # Sorting with descending values cities.sort(ascending=False) cities cities # cities with population less than 800,000 cities[cities<800000] # cities with population between 750,000 and 800,000 cities[cities<800000][cities>750000] # Creating a DataFrame by passing a 2-D numpy array of random number # Creating first the date-time index using date_range function # and checking it. dates = pd.date_range('20140801', periods = 8, freq = 'D') dates # Creating the column names as list Kedai = ['Kedai A', 'Kedai B', 'Kedai C', 'Kedai D', 'Kedai E'] # Creating the DataFrame with specified rows and columns df = pd.DataFrame(np.random.randn(8,5),index=dates,columns=Kedai) df df.head() # Displaying the first five (default) rows df.head(3) # Displaying the first three (specified) rows df.tail(2) # Displaying the last two (specified) rows df.index # Showing the index of rows df.columns # Showing the fields of columns df.values # Showing the data only in its original 2-D array df.describe() # Simple statistical data for each column df.T # Transposing the DataFrame (index becomes column and vice versa) df.sort_index(axis=1,ascending=False) # Sorting with descending column df.sort(columns='Kedai D') # Sorting according to ascending specific column df['Kedai A'] # Extract specific column (using python list syntax) df['Kedai A'][2:4] # Slicing specific column (using python list syntax) df[2:4] # Slicing specific row data (using python list syntax) # Slicing specific index range df['2014-08-03':'2014-08-05'] # Slicing specific index range for a particular column df['2014-08-03':'2014-08-05']['Kedai B'] # Using the loc() function # Slicing specific index and column ranges df.loc['2014-08-03':'2014-08-05','Kedai B':'Kedai D'] # Slicing specific index range with specific column names df.loc['2014-08-03':'2014-08-05',['Kedai B','Kedai D']] # Possibly not yet to have something like this df.loc[['2014-08-01','2014-08-03':'2014-08-05'],['Kedai B','Kedai D']] # Using the iloc() function df.iloc[3] # Specific row location df.iloc[:,3] # Specific column location (all rows) df.iloc[2:4,1:3] # Python like slicing for range df.iloc[[2,4],[1,3]] # Slicing with python like list # Conditionals on the data df>0 # Array values > 0 OR df[df>0] # Directly getting the value df[df['Kedai B']<0] # With reference to specific value in a column (e.g. Kedai B) df2 = df.copy() # Made a copy of a database df2 # Adding column df2['Tambah'] = ['satu','satu','dua','tiga','empat','tiga','lima','enam'] df2 # Adding row using append() function. The previous loc() is possibly deprecated. # Assign a new name to the new row (with the same format) new_row_name = pd.date_range('20140809', periods = 1, freq = 'D') # Appending new row with new data df2.append(list(np.random.randn(5))+['sembilan']) # Renaming the new row (here actually is a reassignment) df2 = df2.rename(index={10: new_row_name[0]}) df2 # Assigning new data to a row df2.loc['2014-08-05'] = list(np.random.randn(5))+['tujuh'] df2 # Assigning new data to a specific element df2.loc['2014-08-05','Tambah'] = 'lapan' df2 # Using the isin() function (returns boolean data frame) df2.isin(['satu','tiga']) # Select specific row based on additonal column df2[df2['Tambah'].isin(['satu','tiga'])] # Use previous command - select certain column based on selected additional column df2[df2['Tambah'].isin(['satu','tiga'])].loc[:,'Kedai B':'Kedai D'] # Select > 0 from previous cell... (df2[df2['Tambah'].isin(['satu','tiga'])].loc[:,'Kedai B':'Kedai D']>0) df.mean() # Statistical mean (column) - same as df.mean(0), 0 means column df.mean(1) # Statistical mean (row) - 1 means row df.mean()['Kedai C':'Kedai E'] # Statistical mean (range of columns) df.max() # Statistical max (column) df.max()['Kedai C'] # Statistical max (specific column) df.max(1)['2014-08-04':'2014-08-07'] # Statistical max (specific row) df.max(1)[dates[3]] # Statistical max (specific row by variable) df.apply(lambda x: x.max() - x.min()) # Operating array values with function df.apply(lambda z: np.log(z)) # Operating array values with function df3 = df.copy() df3[r'Kedai A^2/Kedai E'] = df3['Kedai A']**2/df3['Kedai E'] df3 df4 = df.copy() df4 pieces = [df4[6:], df4[3:6], df4[:3]] # split row 2+3+3 pieces df5 = pd.concat(pieces) # concantenate (rearrange/combine) df5 df4+df5 # Operation between tables with original index sequence df0 = df.loc[:,'Kedai A':'Kedai C'] # Slicing and extracting columns pd.concat([df4, df0], axis = 1) # Concatenating columns (axis = 1 -> refers to column) df_add = df.copy() # Simple auto plotting %matplotlib inline df_add.cumsum().plot() # Reposition the legend import matplotlib.pyplot as plt df_add.cumsum().plot() plt.legend(bbox_to_anchor=[1.3, 1]) df_add.cumsum().plot(kind='bar') plt.legend(bbox_to_anchor=[1.3, 1]) df_add.cumsum().plot(kind='barh', stacked=True) df_add.cumsum().plot(kind='hist', alpha=0.5) df_add.cumsum().plot(kind='area', alpha=0.4, stacked=False) plt.legend(bbox_to_anchor=[1.3, 1]) # Plotting a 3D bar plot from mpl_toolkits.mplot3d import Axes3D import numpy as np # Convert the time format into ordinary strings time_series = pd.Series(df.index.format()) fig = plt.figure(figsize=(8,6)) ax = fig.add_subplot(111, projection='3d') # Plotting the bar graph column by column for c, z in zip(['r', 'g', 'b', 'y','m'], np.arange(len(df.columns))): xs = df.index ys = df.values[:,z] ax.bar(xs, ys, zs=z, zdir='y', color=c, alpha=0.5) ax.set_zlabel('Z') ax.set_xticklabels(time_series, va = 'baseline', ha = 'right', rotation = 15) ax.set_yticks(np.arange(len(df.columns))) ax.set_yticklabels(df.columns, va = 'center', ha = 'left', rotation = -42) ax.view_init(30, -30) fig.tight_layout() # Export data to a csv file but separated with < TAB > rather than comma # the default separation is with comma df.to_csv('Tutorial8/Kedai.txt', sep='\t') # Export to Excel file df.to_excel('Tutorial8/Kedai.xlsx', sheet_name = 'Tarikh', index = True) # Importing data from csv file (without header) from_file = pd.read_csv('Tutorial8/Malaysian_Town.txt',sep='\t',header=None) from_file.head() # Importing data from Excel file (with header (the first row) that became the column names) from_excel = pd.read_excel('Tutorial8/Malaysian_Town.xlsx','Sheet1') from_excel.head() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 8.1 Data Structures Step2: The index of a Series can be specified during its creation and giving it a similar function to a dictionary. Step3: Data can be extracted by specifying the element position or index (similar to list/dictionary). Step4: Series can also be constructed from a dictionary. Step5: The elements can be sort using the <span style="color Step6: Another sorting function is the <span style="color Step7: Conditions can be applied to the elements. Step8: A DataFrame is a 2-dimensional data structure with named rows and columns. It is similar to R's data.frame object and function like a spreadsheet. DataFrame can be considered to be made of series of Series data according to the column names. DataFrame can be created by passing a 2-dimensional array of data and specifying the rows and columns names. Step9: Some of the useful functions that can be applied to a DataFrame include Step10: NaN means empty, missing data or unavailable. Step11: 8.2 Data Operations Step12: Other statistical functions can be checked by typing df.< TAB >. Step13: Replacing, rearranging and operations of data between columns can be done much like spreadsheet. Step14: Tables can be split, rearranged and combined. Step15: 8.3 Plotting Functions Step16: In the above example, repositioning the legend requires the legend function in <span style="color Step17: A 3-dimensional plot can be projected on a canvas but requires the <span style="color Step18: 8.4 Reading And Writing Data To File
5,862
<ASSISTANT_TASK:> Python Code: import os import struct import numpy as np def load_mnist(path, kind='train'): Load MNIST data from `path` labels_path = os.path.join(path, '%s-labels-idx1-ubyte' % kind) images_path = os.path.join(path, '%s-images-idx3-ubyte' % kind) with open(labels_path, 'rb') as lbpath: magic, n = struct.unpack('>II', lbpath.read(8)) labels = np.fromfile(lbpath, dtype=np.uint8) with open(images_path, 'rb') as imgpath: magic, num, rows, cols = struct.unpack(">IIII", imgpath.read(16)) images = np.fromfile(imgpath, dtype=np.uint8).reshape(len(labels), 784) return images, labels X_train, y_train = load_mnist('mnist', kind='train') print('Rows: %d, columns: %d' % (X_train.shape[0], X_train.shape[1])) X_test, y_test = load_mnist('mnist', kind='t10k') print('Rows: %d, columns: %d' % (X_test.shape[0], X_test.shape[1])) import matplotlib.pyplot as plt %matplotlib inline %config InlineBackend.figure_format = 'retina' fig, ax = plt.subplots(nrows=2, ncols=5, sharex=True, sharey=True,) ax = ax.flatten() for i in range(10): img = X_train[y_train == i][0].reshape(28, 28) ax[i].imshow(img, cmap='Greys', interpolation='nearest') ax[0].set_xticks([]) ax[0].set_yticks([]) plt.tight_layout() plt.show() fig, ax = plt.subplots(nrows=5, ncols=5, sharex=True, sharey=True,) ax = ax.flatten() for i in range(25): img = X_train[y_train == 4][i].reshape(28, 28) ax[i].imshow(img, cmap='Greys', interpolation='nearest') ax[0].set_xticks([]) ax[0].set_yticks([]) plt.tight_layout() plt.show() from sklearn.tree import DecisionTreeClassifier from sklearn.ensemble import RandomForestClassifier tree10 = DecisionTreeClassifier(criterion='entropy', max_depth=10, random_state=0) tree100 = DecisionTreeClassifier(criterion='entropy', max_depth=100, random_state=0) rf10 = RandomForestClassifier(criterion='entropy', n_estimators=10, random_state=1) rf100 = RandomForestClassifier(criterion='entropy', n_estimators=100, random_state=1) labeled_models = [ ('decision tree depth 10', tree10), ('decision tree depth 100', tree100), ('random forest 10 estimators', rf10), ('random forest 100 estimators', rf100), ] import time import subprocess def say_done(label): subprocess.call("say 'done with {}'".format(label), shell=True) for label, model in labeled_models: before = time.time() model.fit(X_train, y_train) after = time.time() print("{} fit the dataset in {:.1f} seconds".format(label, after - before)) say_done(label) from sklearn.metrics import accuracy_score for label, model in labeled_models: print("{} training fit: {:.3f}".format(label, accuracy_score(y_train, model.predict(X_train)))) print("{} test accuracy: {:.3f}".format(label, accuracy_score(y_test, model.predict(X_test)))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Chapter 12 Step2: Show a bunch of 4s Step3: Classifying with tree based models
5,863
<ASSISTANT_TASK:> Python Code: def n_divide(n): pass n_divide(10) def sen2word(xs): pass sen2word("I am learning Python. It's quite interesting.") def fibo(n): pass fibo(5) def second(t): return t[1] def sort_notes(xs): pass L = [("Lee", 45), ("Kim", 30), ("Kang", 70), ("Park", 99), ("Cho", 65)] sort_notes(L) def num_sum(xs): pass L = [5, 'abc', 2, [2,3]] num_sum(L) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 연습 2 Step2: 연습 3 Step3: 연습 4 Step4: 연습 5
5,864
<ASSISTANT_TASK:> Python Code: import numpy as np import tensorflow as tf with open('../sentiment_network/reviews.txt', 'r') as f: reviews = f.read() with open('../sentiment_network/labels.txt', 'r') as f: labels = f.read() reviews[:2000] from string import punctuation all_text = ''.join([c for c in reviews if c not in punctuation]) reviews = all_text.split('\n') all_text = ' '.join(reviews) words = all_text.split() all_text[:2000] words[:100] from collections import Counter counts = Counter(words) vocab = sorted(counts, key=counts.get, reverse=True) vocab_to_int = {word: ii for ii, word in enumerate(vocab, 1)} reviews_ints = [] for each in reviews: reviews_ints.append([vocab_to_int[word] for word in each.split()]) labels = labels.split('\n') labels = np.array([1 if each == 'positive' else 0 for each in labels]) print(labels[:5]) review_lens = Counter([len(x) for x in reviews_ints]) print("Zero-length reviews: {}".format(review_lens[0])) print("Maximum review length: {}".format(max(review_lens))) non_zero_idx = [ii for ii, review in enumerate(reviews_ints) if len(review) != 0] len(non_zero_idx) reviews_ints[-1] reviews_ints = [reviews_ints[ii] for ii in non_zero_idx] labels = np.array([labels[ii] for ii in non_zero_idx]) print(len(reviews_ints)) print(len(labels)) seq_len = 200 features = np.zeros((len(reviews_ints), seq_len), dtype=int) for i, row in enumerate(reviews_ints): features[i, -len(row):] = np.array(row)[:seq_len] features[:10,:100] split_frac = 0.8 split_idx = int(len(features)*0.8) train_x, val_x = features[:split_idx], features[split_idx:] train_y, val_y = labels[:split_idx], labels[split_idx:] test_idx = int(len(val_x)*0.5) val_x, test_x = val_x[:test_idx], val_x[test_idx:] val_y, test_y = val_y[:test_idx], val_y[test_idx:] print("\t\t\tFeature Shapes:") print("Train set: \t\t{}".format(train_x.shape), "\nValidation set: \t{}".format(val_x.shape), "\nTest set: \t\t{}".format(test_x.shape)) print(features.shape) print(labels.shape) lstm_size = 256 lstm_layers = 1 batch_size = 500 learning_rate = 0.001 n_words = len(vocab_to_int) # Create the graph object graph = tf.Graph() # Add nodes to the graph with graph.as_default(): inputs_ = tf.placeholder(tf.int32, [None, None], name='inputs') labels_ = tf.placeholder(tf.int32, [None, None], name='labels') keep_prob = tf.placeholder(tf.float32, name='keep_prob') # Size of the embedding vectors (number of units in the embedding layer) embed_size = 300 print(n_words) with graph.as_default(): embedding = tf.Variable(tf.random_uniform((n_words, embed_size), -1, 1)) embed = tf.nn.embedding_lookup(embedding, inputs_) with graph.as_default(): # Your basic LSTM cell lstm = tf.contrib.rnn.BasicLSTMCell(lstm_size) # Add dropout to the cell drop = tf.contrib.rnn.DropoutWrapper(lstm, output_keep_prob=keep_prob) # Stack up multiple LSTM layers, for deep learning cell = tf.contrib.rnn.MultiRNNCell([drop] * lstm_layers) # Getting an initial state of all zeros initial_state = cell.zero_state(batch_size, tf.float32) with graph.as_default(): outputs, final_state = tf.nn.dynamic_rnn(cell, embed, initial_state=initial_state) with graph.as_default(): predictions = tf.contrib.layers.fully_connected(outputs[:, -1], 1, activation_fn=tf.sigmoid) cost = tf.losses.mean_squared_error(labels_, predictions) optimizer = tf.train.AdamOptimizer(learning_rate).minimize(cost) with graph.as_default(): correct_pred = tf.equal(tf.cast(tf.round(predictions), tf.int32), labels_) accuracy = tf.reduce_mean(tf.cast(correct_pred, tf.float32)) def get_batches(x, y, batch_size=100): n_batches = len(x)//batch_size x, y = x[:n_batches*batch_size], y[:n_batches*batch_size] for ii in range(0, len(x), batch_size): yield x[ii:ii+batch_size], y[ii:ii+batch_size] epochs = 10 with graph.as_default(): saver = tf.train.Saver() with tf.Session(graph=graph) as sess: sess.run(tf.global_variables_initializer()) iteration = 1 for e in range(epochs): state = sess.run(initial_state) for ii, (x, y) in enumerate(get_batches(train_x, train_y, batch_size), 1): feed = {inputs_: x, labels_: y[:, None], keep_prob: 0.5, initial_state: state} loss, state, _ = sess.run([cost, final_state, optimizer], feed_dict=feed) if iteration%5==0: print("Epoch: {}/{}".format(e, epochs), "Iteration: {}".format(iteration), "Train loss: {:.3f}".format(loss)) if iteration%25==0: val_acc = [] val_state = sess.run(cell.zero_state(batch_size, tf.float32)) for x, y in get_batches(val_x, val_y, batch_size): feed = {inputs_: x, labels_: y[:, None], keep_prob: 1, initial_state: val_state} batch_acc, val_state = sess.run([accuracy, final_state], feed_dict=feed) val_acc.append(batch_acc) print("Val acc: {:.3f}".format(np.mean(val_acc))) iteration +=1 saver.save(sess, "checkpoints/sentiment.ckpt") test_acc = [] with tf.Session(graph=graph) as sess: saver.restore(sess, tf.train.latest_checkpoint('checkpoints')) test_state = sess.run(cell.zero_state(batch_size, tf.float32)) for ii, (x, y) in enumerate(get_batches(test_x, test_y, batch_size), 1): feed = {inputs_: x, labels_: y[:, None], keep_prob: 1, initial_state: test_state} batch_acc, test_state = sess.run([accuracy, final_state], feed_dict=feed) test_acc.append(batch_acc) print("Test accuracy: {:.3f}".format(np.mean(test_acc))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Data preprocessing Step2: Encoding the words Step3: Encoding the labels Step4: Okay, a couple issues here. We seem to have one review with zero length. And, the maximum review length is way too many steps for our RNN. Let's truncate to 200 steps. For reviews shorter than 200, we'll pad with 0s. For reviews longer than 200, we can truncate them to the first 200 characters. Step5: Turns out its the final review that has zero length. But that might not always be the case, so let's make it more general. Step6: Exercise Step7: Training, Validation, Test Step8: With train, validation, and text fractions of 0.8, 0.1, 0.1, the final shapes should look like Step9: For the network itself, we'll be passing in our 200 element long review vectors. Each batch will be batch_size vectors. We'll also be using dropout on the LSTM layer, so we'll make a placeholder for the keep probability. Step10: Embedding Step11: LSTM cell Step12: RNN forward pass Step13: Output Step14: Validation accuracy Step15: Batching Step16: Training Step17: Testing
5,865
<ASSISTANT_TASK:> Python Code: # only for the notebook %matplotlib inline # only in the ipython shell # %matplotlib import matplotlib.pyplot as plt # Make the size and fonts larger for this presentation plt.rcParams['figure.figsize'] = (10, 8) plt.rcParams['font.size'] = 16 plt.rcParams['lines.linewidth'] = 2 import numpy as np x = np.linspace(0, 1, 100) # 100 numbers from 0 to 1 plt.plot(x, x**2) # If not interactive, e.g. in a script: # plt.show() t = np.linspace(0, 2 * np.pi) # 50 points between 0 and 2π plt.plot(t, np.sin(t)); plt.plot(t, np.sin(t), '--'); plt.plot(t, np.sin(t), 'go') # plt.plot(t, np.sin(t), color='green', marker='o', linestyle=''); # same thing! # new in matplotlib 2.0, all colors of the color rotation available as C<N> x = np.linspace(0, 1, 100) for n in range(9): plt.plot(x**(n + 1), color='C{}'.format(n)) plt.plot(t, np.sin(t)) plt.xlim(0, 2*np.pi) plt.ylim(-1.2, 1.2); with plt.xkcd(): plt.title('Axes with labels') plt.plot(t, np.sin(t)) plt.xlabel('t / s') plt.ylabel('U / V') plt.ylim(-1.1, 1.1) plt.xlim(0, 2*np.pi) plt.plot(t, np.sin(t)) title_font = {'fontsize': 24, 'fontweight': 'bold', 'family': 'serif'} axes_font = {'fontsize': 18, 'fontstyle': 'italic'} plt.xlabel('t / s', axes_font) plt.ylabel('U / V', axes_font) plt.title('Always label your plots!', title_font); plt.plot(t, np.sin(t)) plt.xlabel(r'$t / \mathrm{s}$') # leading r means "raw", so that '\' is handled correctly plt.ylabel(r"$\int_0^t \cos(t') \, \mathrm{d}t'$"); plt.plot(t, np.sin(t), label=r'$\sin(t)$') plt.plot(t, np.cos(t), label=r'$\cos(t)$') plt.legend() #plt.legend(loc='upper center') None # only to avoid cluttering the notebook plt.plot(t, np.sin(t)) plt.grid() x = np.linspace(0, 10) # x = np.logspace(-1, 2, 100) plt.plot(x, np.exp(-x)) plt.yscale('log') # plt.xscale('log') x = np.linspace(0, 2*np.pi) plt.plot(x, np.sin(x)) plt.xlim(0, 2*np.pi) # First argument: position, second argument: labels plt.xticks( np.arange(0, 2*np.pi + 0.1, np.pi/2), [r"$0$", r"$\frac{1}{4}\tau$", r"$\frac{1}{2}\tau$", r"$\frac{3}{4}\tau$", r"$\tau$"] ) plt.title(r"$\tau$ FTW!") # https://tauday.com/tau-manifesto None months = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'] plt.bar(np.arange(12), np.random.rand(12)) plt.xticks( np.arange(12), months, rotation=45, rotation_mode='anchor', horizontalalignment='right', # or ha verticalalignment='top', # or va ); x = np.linspace(0, 1) plt.plot(x, x**2, label=r'$x^2$') plt.plot(x, x**4) plt.plot(x, x**6, 'o', label=r'$x^6$') plt.legend(loc='best'); x = np.linspace(0, 2*np.pi) # subplot arguments: # of rows, # of columns, plot index (row * (#cols) + col) plt.subplot(2, 1, 1) plt.plot(x, x**2) plt.xlim(0, 2*np.pi) plt.subplot(2, 1, 2) plt.plot(x, np.sin(x)) plt.xlim(0, 2*np.pi); def poisson(x, k): return np.exp(-x)*x**k / np.math.factorial(k) x = np.linspace(0, 12, 40) y = poisson(x, 2) y_noise = y + np.random.normal(0, 0.01, len(y)) z = np.linspace(0, 12, 100) gridspec = {'height_ratios': [2, 1]} fig, (ax1, ax2) = plt.subplots(2, sharex=True, gridspec_kw=gridspec) ax1.plot(x, y_noise, 'ko') ax1.plot(z, poisson(z, 2)) ax1.set_ylim(-0.05, 0.30) ax1.set_ylabel('Flux') ax1.set_yticks(ax1.get_yticks()[1:]) # remove bottom y-tick ax2.plot(x, y_noise - y, 'ko') ax2.axhline(y=0, color='black', linestyle='--', linewidth=1) ax2.set_xlabel('Energy') ax2.set_ylim(-0.03, 0.04) ax2.set_ylabel('Residuals') ax2.set_yticks(ax2.get_yticks()[:-2]) # remove top y-tick fig.subplots_adjust(hspace=0) fig.suptitle('\nFake Spectrum', fontweight='bold'); x = np.linspace(0, 2*np.pi) plt.subplot(2, 1, 1) plt.plot(x, x**2) plt.xlim(0, 2*np.pi) plt.title(r"$f(x)=x^2$") plt.subplot(2, 1, 2) plt.plot(x, np.sin(x)) plt.xlim(0, 2*np.pi) plt.title(r"$f(x)=\sin(x)$") plt.tight_layout() # try commenting this line out! plt.plot(x, x**2) plt.title("Outer Plot") # axes coordinates: (0,0) is lower left, (1,1) upper right plt.axes([0.2, 0.45, 0.3, 0.3]) plt.plot(x, x**3) plt.title("Inner Plot"); x = np.linspace(0, 2*np.pi, 10) errX = np.random.normal(0, 0.4, 10) errY = np.random.normal(0, 0.4, 10) plt.errorbar(x + errX, x + errY, xerr=0.4, yerr=errY, fmt='o'); x = np.linspace(0, 1, 10) plt.errorbar( x, np.sin(2 * np.pi * x), yerr=[np.full_like(x, 0.5), np.full_like(x, 0.1)], linestyle='', marker='o', ) bins = np.logspace(2, 4, 15) x = (bins[:-1] + bins[1:]) / 2 y = x**(-2.7) yerr = y * 0.3 y += np.random.normal(0, yerr) # mask for which points are upper limits uplims = np.full_like(x, False) # last points are only upper limits y[-3:] += 3 * y[-3:] yerr[-3:] = 0.3 * y[-3:] # yerr determines length of limit arrow uplims[-3:] = True plt.errorbar( x, y, xerr=np.diff(bins/2), yerr=yerr, uplims=uplims, ls='none', ) plt.xlabel('$E \ / \ \mathrm{GeV}$') plt.ylabel('$Flux \ / \ \mathrm{GeV}^{-1} \mathrm{s}^{-1} \mathrm{m}^{-2} \mathrm{sr}^{-1}$') plt.xscale('log') plt.yscale('log') r = np.linspace(0, 10, 50) # r = np.linspace(0, 10, 1000) theta = 2*np.pi*r plt.polar(theta, r); # Generate random data: x = np.random.normal(0, 1, 1000) plt.hist(x, bins=25); x1 = np.random.normal(-1, 1, 1000) x2 = np.random.normal(1, 1, 1000) bin_edges = np.linspace(-6, 6, 51) # 50 bins between -6 and 6 plt.hist(x1, bins=bin_edges, histtype='step', label='x1') plt.hist(x2, bins=bin_edges, histtype='step', label='x2') plt.legend(); mean = [2, 1] cov = [[9, 2], [2, 4]] x, y = np.random.multivariate_normal(mean, cov, size=10000).T plt.hist2d(x, y) # plt.hist2d(x, y, bins=50) # plt.hist2d(x, y, bins=[25, 50], range=[[-10, 14], [-5, 7]]) plt.colorbar(label='Counts'); from matplotlib.colors import LogNorm plt.hist2d(x, y, bins=50, norm=LogNorm()) plt.colorbar(); x1, y1 = np.random.multivariate_normal([1, 1], [[1, 0], [0, 1]], 1000).T x2, y2 = np.random.multivariate_normal([-1, -1], [[1, 0], [0, 1]], 1000).T plt.scatter(x1, y1) plt.scatter(x2, y2); x = np.append(x1, x2) y = np.append(y1, y2) s = np.random.uniform(5, 50, 2000) label = np.append(np.ones_like(x1), np.zeros_like(x2)) plt.scatter(x, y, c=label, s=s); import matplotlib.pyplot as plt import numpy as np t = np.linspace(0, 2*np.pi, 1000) fig, (ax1, ax2) = plt.subplots(2, 1) # note that plot is now a method of ax1, not the global plt object ax1.plot(t, np.sin(t), 'r-') ax1.set_title(r"$f(t)=\sin(t)$") # use object-oriented get/set syntax ax1.set_xlabel("$t$") ax1.set_xlim(0, 2*np.pi) ax1.set_ylim(-1.1, 1.1) ax2.plot(t, np.cos(t), 'b-') ax2.set_title(r"$f(t)=\cos(t)$") ax2.set_xlabel("$t$") ax2.set_xlim(0, 2*np.pi) ax2.set_ylim(-1.1, 1.1) fig.tight_layout() from datetime import datetime, timedelta # constants for ordinal and mjd date representation MJD_EPOCH = datetime(1858, 11, 17) ORDINAL_EPOCH = datetime(1, 1, 1) def ordinal_to_mjd(ordinal): ''' Converts ordinal date (days since 0001-01-01T00:00) to MJD (days since 1858-11-17T00:00)''' return ordinal - (MJD_EPOCH - ORDINAL_EPOCH).total_seconds() / 86400 # create some random "Crab nebula" data n_on = np.random.poisson(60, 25) n_off = np.random.poisson(30, 25) n_signal = n_on - 0.2 * n_off n_signal_err = np.sqrt(n_on + 0.2**2 * n_off) # create some dates dates = [datetime(2017, 1, 1) + timedelta(days=i) for i in range(25)] fig = plt.figure() ax = fig.add_subplot(1, 1, 1) ax.errorbar(dates, n_signal, yerr=n_signal_err, ls='') ax.axhline(n_signal.mean(), color='C1') ax.set_ylim(0, 80) ax.set_ylabel(r'Signal Rate / $\mathrm{h}^{-1}$') fig.autofmt_xdate() # create a second axis, using the same y-axis ax_mjd = ax.twiny() # set its xlims to the same values of the date axis, but convert to mjd ax_mjd.set_xlim(*map(ordinal_to_mjd, ax.get_xlim())) ax_mjd.set_xlabel('MJD') fig.tight_layout() print(plt.style.available) from scipy import stats def plot_stuff(): plt.subplot(2, 2, 1) x = np.linspace(-1, 1, 1000) plt.plot(x, np.sin(50*x**3)/(x)) plt.grid() plt.subplot(2, 2, 2) x = np.linspace(-1, 1, 10) y = np.exp(-2.2*x) + np.random.normal(0, 0.1, 10) yerr = np.random.normal(0, 0.2, 10) plt.errorbar(x, y, yerr, fmt='o', capsize=3) plt.yscale('log') plt.subplot(2, 2, 3) x = stats.skewnorm.rvs(10, size=1000) plt.hist(x, bins=50) plt.subplot(2, 2, 4) x, y = np.mgrid[-1:1:.01, -1:1:.01] pos = np.dstack((x, y)) z = stats.multivariate_normal([0.1, 0.3], [[0.2, 0.3], [0.1, 0.4]]) plt.contourf(x, y, z.pdf(pos)) for plot_style in ['classic', 'bmh', 'fivethirtyeight', 'ggplot', 'seaborn']: plt.figure() with plt.style.context(plot_style): # use context manager so that changes are temporary plot_stuff() plt.suptitle('Plot Style: ' + plot_style, fontweight='bold') pwd() x = np.linspace(-5, 5) plt.plot(x, x**3, marker='s') plt.title("My Awesome Plot") # save in current directory; extension determines file type plt.savefig('awesome_plot.pdf') plt.savefig('awesome_plot.eps') plt.savefig('awesome_plot.png', dpi=300) # bitmap graphics; don't use me for publications! plt.savefig('awesome_plot.jpg', dpi=300) # bitmap graphics; don't use me either! # relative path with subdirectory # plt.savefig('build/awesome_plot.pdf') # absolute path # plt.saveig('/path/to/output/directory/awesome_plot.pdf') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: In order to work with Matplotlib, the library must be imported first. So we do not have to type so much, we give it a shorter name Step2: Matplotlib works best with numpy arrays, so we import numpy as well Step3: <a id=line_plots></a> Step4: <a id=different_styles></a> Step5: All styles and colors Step6: <a id=plot_labels></a> Step7: A side note on units Step8: <a id=latex_labels></a> Step9: <a id=legends></a> Step10: <a id=grids></a> Step11: <a id=axis_scales></a> Step12: <a id=ticks></a> Step13: <a id=multiple_lines></a> Step14: Remember Step15: <a id=shared_axes></a> Step16: <a id=tight_layout></a> Step17: <a id=inset_plots></a> Step18: <a id=error_bars></a> Step19: <a id=asym_errors></a> Step20: <a id=upper_limits></a> Step21: <a id=polar_plots></a> Step22: <a id=histograms></a> Step23: <a id=hist2d></a> Step24: Colormaps Step25: <a id=oo_syntax></a> Step26: <a id="mjd"></a> Step27: <a id=publication_plots></a> Step28: <a id=save_figures></a>
5,866
<ASSISTANT_TASK:> Python Code: import numpy as np # useful for many scientific computing in Python import pandas as pd # primary data structure library from PIL import Image # converting images into arrays df_can = pd.read_excel('https://ibm.box.com/shared/static/lw190pt9zpy5bd1ptyg2aw15awomz9pu.xlsx', sheet_name='Canada by Citizenship', skiprows=range(20), skipfooter=2) print('Data downloaded and read into a dataframe!') df_can.head() # print the dimensions of the dataframe print(df_can.shape) # clean up the dataset to remove unnecessary columns (eg. REG) df_can.drop(['AREA','REG','DEV','Type','Coverage'], axis = 1, inplace = True) # let's rename the columns so that they make sense df_can.rename (columns = {'OdName':'Country', 'AreaName':'Continent','RegName':'Region'}, inplace = True) # for sake of consistency, let's also make all column labels of type string df_can.columns = list(map(str, df_can.columns)) # set the country name as index - useful for quickly looking up countries using .loc method df_can.set_index('Country', inplace = True) # add total column df_can['Total'] = df_can.sum (axis = 1) # years that we will be using in this lesson - useful for plotting later on years = list(map(str, range(1980, 2014))) print ('data dimensions:', df_can.shape) %matplotlib inline import matplotlib as mpl import matplotlib.pyplot as plt import matplotlib.patches as mpatches # needed for waffle Charts mpl.style.use('ggplot') # optional: for ggplot-like style # check for latest version of Matplotlib print ('Matplotlib version: ', mpl.__version__) # >= 2.0.0 # let's create a new dataframe for these three countries df_dsn = df_can.loc[['Denmark', 'Norway', 'Sweden'], :] # let's take a look at our dataframe df_dsn # compute the proportion of each category with respect to the total total_values = sum(df_dsn['Total']) category_proportions = [(float(value) / total_values) for value in df_dsn['Total']] # print out proportions for i, proportion in enumerate(category_proportions): print (df_dsn.index.values[i] + ': ' + str(proportion)) width = 40 # width of chart height = 10 # height of chart total_num_tiles = width * height # total number of tiles print ('Total number of tiles is ', total_num_tiles) # compute the number of tiles for each catagory tiles_per_category = [round(proportion * total_num_tiles) for proportion in category_proportions] # print out number of tiles per category for i, tiles in enumerate(tiles_per_category): print (df_dsn.index.values[i] + ': ' + str(tiles)) # initialize the waffle chart as an empty matrix waffle_chart = np.zeros((height, width)) # define indices to loop through waffle chart category_index = 0 tile_index = 0 # populate the waffle chart for col in range(width): for row in range(height): tile_index += 1 # if the number of tiles populated for the current category is equal to its corresponding allocated tiles... if tile_index > sum(tiles_per_category[0:category_index]): # ...proceed to the next category category_index += 1 # set the class value to an integer, which increases with class waffle_chart[row, col] = category_index print ('Waffle chart populated!') waffle_chart # instantiate a new figure object fig = plt.figure() # use matshow to display the waffle chart colormap = plt.cm.coolwarm plt.matshow(waffle_chart, cmap=colormap) plt.colorbar() # instantiate a new figure object fig = plt.figure() # use matshow to display the waffle chart colormap = plt.cm.coolwarm plt.matshow(waffle_chart, cmap=colormap) plt.colorbar() # get the axis ax = plt.gca() # set minor ticks ax.set_xticks(np.arange(-.5, (width), 1), minor=True) ax.set_yticks(np.arange(-.5, (height), 1), minor=True) # add gridlines based on minor ticks ax.grid(which='minor', color='w', linestyle='-', linewidth=2) plt.xticks([]) plt.yticks([]) # instantiate a new figure object fig = plt.figure() # use matshow to display the waffle chart colormap = plt.cm.coolwarm plt.matshow(waffle_chart, cmap=colormap) plt.colorbar() # get the axis ax = plt.gca() # set minor ticks ax.set_xticks(np.arange(-.5, (width), 1), minor=True) ax.set_yticks(np.arange(-.5, (height), 1), minor=True) # add gridlines based on minor ticks ax.grid(which='minor', color='w', linestyle='-', linewidth=2) plt.xticks([]) plt.yticks([]) # compute cumulative sum of individual categories to match color schemes between chart and legend values_cumsum = np.cumsum(df_dsn['Total']) total_values = values_cumsum[len(values_cumsum) - 1] # create legend legend_handles = [] for i, category in enumerate(df_dsn.index.values): label_str = category + ' (' + str(df_dsn['Total'][i]) + ')' color_val = colormap(float(values_cumsum[i])/total_values) legend_handles.append(mpatches.Patch(color=color_val, label=label_str)) # add legend to chart plt.legend(handles=legend_handles, loc='lower center', ncol=len(df_dsn.index.values), bbox_to_anchor=(0., -0.2, 0.95, .1) ) def create_waffle_chart(categories, values, height, width, colormap, value_sign=''): # compute the proportion of each category with respect to the total total_values = sum(values) category_proportions = [(float(value) / total_values) for value in values] # compute the total number of tiles total_num_tiles = width * height # total number of tiles print ('Total number of tiles is', total_num_tiles) # compute the number of tiles for each catagory tiles_per_category = [round(proportion * total_num_tiles) for proportion in category_proportions] # print out number of tiles per category for i, tiles in enumerate(tiles_per_category): print (df_dsn.index.values[i] + ': ' + str(tiles)) # initialize the waffle chart as an empty matrix waffle_chart = np.zeros((height, width)) # define indices to loop through waffle chart category_index = 0 tile_index = 0 # populate the waffle chart for col in range(width): for row in range(height): tile_index += 1 # if the number of tiles populated for the current category # is equal to its corresponding allocated tiles... if tile_index > sum(tiles_per_category[0:category_index]): # ...proceed to the next category category_index += 1 # set the class value to an integer, which increases with class waffle_chart[row, col] = category_index # instantiate a new figure object fig = plt.figure() # use matshow to display the waffle chart colormap = plt.cm.coolwarm plt.matshow(waffle_chart, cmap=colormap) plt.colorbar() # get the axis ax = plt.gca() # set minor ticks ax.set_xticks(np.arange(-.5, (width), 1), minor=True) ax.set_yticks(np.arange(-.5, (height), 1), minor=True) # add dridlines based on minor ticks ax.grid(which='minor', color='w', linestyle='-', linewidth=2) plt.xticks([]) plt.yticks([]) # compute cumulative sum of individual categories to match color schemes between chart and legend values_cumsum = np.cumsum(values) total_values = values_cumsum[len(values_cumsum) - 1] # create legend legend_handles = [] for i, category in enumerate(categories): if value_sign == '%': label_str = category + ' (' + str(values[i]) + value_sign + ')' else: label_str = category + ' (' + value_sign + str(values[i]) + ')' color_val = colormap(float(values_cumsum[i])/total_values) legend_handles.append(mpatches.Patch(color=color_val, label=label_str)) # add legend to chart plt.legend( handles=legend_handles, loc='lower center', ncol=len(categories), bbox_to_anchor=(0., -0.2, 0.95, .1) ) width = 40 # width of chart height = 10 # height of chart categories = df_dsn.index.values # categories values = df_dsn['Total'] # correponding values of categories colormap = plt.cm.coolwarm # color map class create_waffle_chart(categories, values, height, width, colormap) # install wordcloud !conda install -c conda-forge wordcloud==1.4.1 --yes # import package and its set of stopwords from wordcloud import WordCloud, STOPWORDS print ('Wordcloud is installed and imported!') # download file and save as alice_novel.txt !wget --quiet https://ibm.box.com/shared/static/m54sjtrshpt5su20dzesl5en9xa5vfz1.txt -O alice_novel.txt # open the file and read it into a variable alice_novel alice_novel = open('alice_novel.txt', 'r').read() print ('File downloaded and saved!') stopwords = set(STOPWORDS) # instantiate a word cloud object alice_wc = WordCloud( background_color='white', max_words=2000, stopwords=stopwords ) # generate the word cloud alice_wc.generate(alice_novel) # display the word cloud plt.imshow(alice_wc, interpolation='bilinear') plt.axis('off') plt.show() fig = plt.figure() fig.set_figwidth(14) # set width fig.set_figheight(18) # set height # display the cloud plt.imshow(alice_wc, interpolation='bilinear') plt.axis('off') plt.show() stopwords.add('said') # add the words said to stopwords # re-generate the word cloud alice_wc.generate(alice_novel) # display the cloud fig = plt.figure() fig.set_figwidth(14) # set width fig.set_figheight(18) # set height plt.imshow(alice_wc, interpolation='bilinear') plt.axis('off') plt.show() # download image !wget --quiet https://ibm.box.com/shared/static/3mpxgaf6muer6af7t1nvqkw9cqj85ibm.png -O alice_mask.png # save mask to alice_mask alice_mask = np.array(Image.open('alice_mask.png')) print('Image downloaded and saved!') fig = plt.figure() fig.set_figwidth(14) # set width fig.set_figheight(18) # set height plt.imshow(alice_mask, cmap=plt.cm.gray, interpolation='bilinear') plt.axis('off') plt.show() # instantiate a word cloud object alice_wc = WordCloud(background_color='white', max_words=2000, mask=alice_mask, stopwords=stopwords) # generate the word cloud alice_wc.generate(alice_novel) # display the word cloud fig = plt.figure() fig.set_figwidth(14) # set width fig.set_figheight(18) # set height plt.imshow(alice_wc, interpolation='bilinear') plt.axis('off') plt.show() df_can.head() total_immigration = df_can['Total'].sum() total_immigration max_words = 90 word_string = '' for country in df_can.index.values: # check if country's name is a single-word name if len(country.split(' ')) == 1: repeat_num_times = int(df_can.loc[country, 'Total']/float(total_immigration)*max_words) word_string = word_string + ((country + ' ') * repeat_num_times) # display the generated text word_string # create the word cloud wordcloud = WordCloud(background_color='white').generate(word_string) print('Word cloud created!') # display the cloud fig = plt.figure() fig.set_figwidth(14) fig.set_figheight(18) plt.imshow(wordcloud, interpolation='bilinear') plt.axis('off') plt.show() # install seaborn !pip install seaborn # import library import seaborn as sns print('Seaborn installed and imported!') # we can use the sum() method to get the total population per year df_tot = pd.DataFrame(df_can[years].sum(axis=0)) # change the years to type float (useful for regression later on) df_tot.index = map(float,df_tot.index) # reset the index to put in back in as a column in the df_tot dataframe df_tot.reset_index(inplace = True) # rename columns df_tot.columns = ['year', 'total'] # view the final dataframe df_tot.head() import seaborn as sns ax = sns.regplot(x='year', y='total', data=df_tot) import seaborn as sns ax = sns.regplot(x='year', y='total', data=df_tot, color='green') import seaborn as sns ax = sns.regplot(x='year', y='total', data=df_tot, color='green', marker='+') plt.figure(figsize=(15, 10)) ax = sns.regplot(x='year', y='total', data=df_tot, color='green', marker='+') plt.figure(figsize=(15, 10)) ax = sns.regplot(x='year', y='total', data=df_tot, color='green', marker='+', scatter_kws={'s': 200}) ax.set(xlabel='Year', ylabel='Total Immigration') # add x- and y-labels ax.set_title('Total Immigration to Canada from 1980 - 2013') # add title plt.figure(figsize=(15, 10)) sns.set(font_scale=1.5) ax = sns.regplot(x='year', y='total', data=df_tot, color='green', marker='+', scatter_kws={'s': 200}) ax.set(xlabel='Year', ylabel='Total Immigration') ax.set_title('Total Immigration to Canada from 1980 - 2013') plt.figure(figsize=(15, 10)) sns.set(font_scale=1.5) sns.set_style('ticks') # change background to white background ax = sns.regplot(x='year', y='total', data=df_tot, color='green', marker='+', scatter_kws={'s': 200}) ax.set(xlabel='Year', ylabel='Total Immigration') ax.set_title('Total Immigration to Canada from 1980 - 2013') plt.figure(figsize=(15, 10)) sns.set(font_scale=1.5) sns.set_style('whitegrid') ax = sns.regplot(x='year', y='total', data=df_tot, color='green', marker='+', scatter_kws={'s': 200}) ax.set(xlabel='Year', ylabel='Total Immigration') ax.set_title('Total Immigration to Canada from 1980 - 2013') ### type your answer here import folium folium.Map(location=[-40.4637, -3.7492], zoom_start=6, tiles='Stamen Toner') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Let's download and import our primary Canadian Immigration dataset using pandas read_excel() method. Normally, before we can do that, we would need to download a module which pandas requires to read in excel files. This module is xlrd. For your convenience, we have pre-installed this module, so you would not have to worry about that. Otherwise, you would need to run the following line of code to install the xlrd module Step2: Let's take a look at the first five items in our dataset Step3: Let's find out how many entries there are in our dataset Step4: Clean up data. We will make some modifications to the original dataset to make it easier to create our visualizations. Refer to Introduction to Matplotlib and Line Plots and Area Plots, Histograms, and Bar Plots for a detailed description of this preprocessing. Step5: Visualizing Data using Matplotlib<a id="4"></a> Step6: Waffle Charts <a id="6"></a> Step7: Unfortunately, unlike R, waffle charts are not built into any of the Python visualization libraries. Therefore, we will learn how to create them from scratch. Step 1. The first step into creating a waffle chart is determing the proportion of each category with respect to the total. Step8: Step 2. The second step is defining the overall size of the waffle chart. Step9: Step 3. The third step is using the proportion of each category to determe it respective number of tiles Step10: Based on the calculated proportions, Denmark will occupy 129 tiles of the waffle chart, Norway will occupy 77 tiles, and Sweden will occupy 194 tiles. Step 4. The fourth step is creating a matrix that resembles the waffle chart and populating it. Step11: Let's take a peek at how the matrix looks like. Step12: As expected, the matrix consists of three categories and the total number of each category's instances matches the total number of tiles allocated to each category. Step 5. Map the waffle chart matrix into a visual. Step13: Step 6. Prettify the chart. Step14: Step 7. Create a legend and add it to chart. Step15: And there you go! What a good looking delicious waffle chart, don't you think? Step16: Now to create a waffle chart, all we have to do is call the function create_waffle_chart. Let's define the input parameters Step17: And now let's call our function to create a waffle chart. Step18: There seems to be a new Python package for generating waffle charts called PyWaffle, but it looks like the repository is still being built. But feel free to check it out and play with it. Step19: Word clouds are commonly used to perform high-level analysis and visualization of text data. Accordinly, let's digress from the immigration dataset and work with an example that involves analyzing text data. Let's try to analyze a short novel written by Lewis Carroll titled Alice's Adventures in Wonderland. Let's go ahead and download a .txt file of the novel. Step20: Next, let's use the stopwords that we imported from word_cloud. We use the function set to remove any redundant stopwords. Step21: Create a word cloud object and generate a word cloud. For simplicity, let's generate a word cloud using only the first 2000 words in the novel. Step22: Awesome! Now that the word cloud is created, let's visualize it. Step23: Interesting! So in the first 2000 words in the novel, the most common words are Alice, said, little, Queen, and so on. Let's resize the cloud so that we can see the less frequent words a little better. Step24: Much better! However, said isn't really an informative word. So let's add it to our stopwords and re-generate the cloud. Step25: Excellent! This looks really interesting! Another cool thing you can implement with the word_cloud package is superimposing the words onto a mask of any shape. Let's use a mask of Alice and her rabbit. We already created the mask for you, so let's go ahead and download it and call it alice_mask.png. Step26: Let's take a look at how the mask looks like. Step27: Shaping the word cloud according to the mask is straightforward using word_cloud package. For simplicity, we will continue using the first 2000 words in the novel. Step28: Really impressive! Step29: And what was the total immigration from 1980 to 2013? Step30: Using countries with single-word names, let's duplicate each country's name based on how much they contribute to the total immigration. Step31: We are not dealing with any stopwords here, so there is no need to pass them when creating the word cloud. Step32: According to the above word cloud, it looks like the majority of the people who immigrated came from one of 15 countries that are displayed by the word cloud. One cool visual that you could build, is perhaps using the map of Canada and a mask and superimposing the word cloud on top of the map of Canada. That would be an interesting visual to build! Step33: Create a new dataframe that stores that total number of landed immigrants to Canada per year from 1980 to 2013. Step34: With seaborn, generating a regression plot is as simple as calling the regplot function. Step35: This is not magic; it is seaborn! You can also customize the color of the scatter plot and regression line. Let's change the color to green. Step36: You can always customize the marker shape, so instead of circular markers, let's use '+'. Step37: Let's blow up the plot a little bit so that it is more appealing to the sight. Step38: And let's increase the size of markers so they match the new size of the figure, and add a title and x- and y-labels. Step39: And finally increase the font size of the tickmark labels, the title, and the x- and y-labels so they don't feel left out! Step40: Amazing! A complete scatter plot with a regression fit with 5 lines of code only. Isn't this really amazing? Step41: Or to a white background with gridlines. Step42: Question
5,867
<ASSISTANT_TASK:> Python Code: # get package versions from pkg_resources import require print 'Package versions' print '----------------' print require('genometools')[0] print require('goparser')[0] gene_annotation_file = 'Homo_sapiens.GRCh38.82.gtf.gz' protein_coding_gene_file = 'protein_coding_genes_human.tsv' go_annotation_file = 'gene_association.goa_human.149.gz' go_ontology_file = 'go-basic_2015-10-12.obo' # download gene annotations !curl -o "$gene_annotation_file" \ "ftp://ftp.ensembl.org/pub/release-82/gtf/homo_sapiens/Homo_sapiens.GRCh38.82.gtf.gz" # download UniProt-GOA GO annotation file !curl -o "$go_annotation_file" \ "ftp://ftp.ebi.ac.uk/pub/databases/GO/goa/old/HUMAN/gene_association.goa_human.149.gz" # look at which version of the Gene Ontology was used for the GO annotation file # (answer: 2015-10-12) !gunzip -c "$go_annotation_file" | head -n 12 # download gene ontology file !curl -o "$go_ontology_file" \ http://viewvc.geneontology.org/viewvc/GO-SVN/ontology-releases/2015-10-12/go-basic.obo?revision=29122 # generate list of human protein-coding genes species = 'human' !gunzip -c $gene_annotation_file | \ extract_protein_coding_genes.py -s $species -o $protein_coding_gene_file import sys from genometools import misc from goparser import GOParser # configure a logger that prints to stdout misc.configure_logger('goparser',log_stream=sys.stdout) # instantiate a GOParser object P = GOParser() # parse the ontology (.obo) file from the Gene Ontology Consortium P.parse_ontology(go_ontology_file) # parse the GO annotation (.gaf) file from the UniProt-GOA database # --- only include annotations with certain evidence codes select_evidence = ['IDA','IGI','IMP','ISO','ISS','IC','NAS','TAS'] P.parse_annotations(go_annotation_file,protein_coding_gene_file,\ select_evidence=select_evidence) term = P.get_term_by_name('canonical Wnt signaling pathway') print 'Term name:' print '----------' print term.get_pretty_format() print term_id = term.id term_name = term.name annotated_genes = P.get_goterm_genes(term_id) print 'Genes annotated with GO term "%s", %s:' %(term_id,term_name) print '------------------------------------------------------------------------' print 'Total number of genes: %d' %(len(annotated_genes)) print ', '.join(sorted(annotated_genes)) associated_terms = P.get_gene_goterms('MYC') print 'GO terms associated with MYC:' print '-----------------------------' print '\n'.join(sorted([t.get_pretty_format() for t in associated_terms])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Download all required data Step2: Extract list of human protein-coding genes Step3: Parse human GO annotations Step4: Get information about a specific GO term Step5: Find all GO terms that the MYC gene is annotated with
5,868
<ASSISTANT_TASK:> Python Code: %%capture --no-stderr !pip3 install kfp --upgrade import kfp.components as comp bigquery_query_op = comp.load_component_from_url( 'https://raw.githubusercontent.com/kubeflow/pipelines/01a23ae8672d3b18e88adf3036071496aca3552d/components/gcp/bigquery/query/component.yaml') help(bigquery_query_op) QUERY = 'SELECT * FROM `bigquery-public-data.stackoverflow.posts_questions` LIMIT 10' # Required Parameters PROJECT_ID = '<Please put your project ID here>' GCS_WORKING_DIR = 'gs://<Please put your GCS path here>' # No ending slash # Optional Parameters EXPERIMENT_NAME = 'Bigquery -Query' OUTPUT_PATH = '{}/bigquery/query/questions.csv'.format(GCS_WORKING_DIR) import kfp.dsl as dsl import json @dsl.pipeline( name='Bigquery query pipeline', description='Bigquery query pipeline' ) def pipeline( query=QUERY, project_id = PROJECT_ID, dataset_id='', table_id='', output_gcs_path=OUTPUT_PATH, dataset_location='US', job_config='' ): bigquery_query_op( query=query, project_id=project_id, dataset_id=dataset_id, table_id=table_id, output_gcs_path=output_gcs_path, dataset_location=dataset_location, job_config=job_config) pipeline_func = pipeline pipeline_filename = pipeline_func.__name__ + '.zip' import kfp.compiler as compiler compiler.Compiler().compile(pipeline_func, pipeline_filename) #Specify pipeline argument values arguments = {} #Get or create an experiment and submit a pipeline run import kfp client = kfp.Client() experiment = client.create_experiment(EXPERIMENT_NAME) #Submit a pipeline run run_name = pipeline_func.__name__ + ' run' run_result = client.run_pipeline(experiment.id, run_name, pipeline_filename, arguments) !gsutil cat $OUTPUT_PATH <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load the component using KFP SDK Step2: Sample Step3: Set sample parameters Step4: Run the component as a single pipeline Step5: Compile the pipeline Step6: Submit the pipeline for execution Step7: Inspect the output
5,869
<ASSISTANT_TASK:> Python Code: %matplotlib inline from matplotlib import rcParams import matplotlib.pyplot as plt import pandas as pd import nilmtk from nilmtk import DataSet, MeterGroup plt.style.use('ggplot') rcParams['figure.figsize'] = (13, 10) redd = DataSet('/data/redd.h5') elec = redd.buildings[1].elec elec elec.nested_metergroups() elec.mains() elec.mains().power_series_all_data().head() elec.submeters() elec.proportion_of_energy_submetered() mains = elec.mains() mains.available_ac_types('power') elec.submeters().available_ac_types('power') next(elec.load()) elec.mains().total_energy() # returns kWh energy_per_meter = elec.submeters().energy_per_meter() # kWh, again energy_per_meter # energy_per_meter is a DataFrame where each row is a # power type ('active', 'reactive' or 'apparent'). # All appliance meters in REDD are record 'active' so just select # the 'active' row: energy_per_meter = energy_per_meter.loc['active'] more_than_20 = energy_per_meter[energy_per_meter > 20] more_than_20 instances = more_than_20.index instances fraction = elec.submeters().fraction_per_meter().dropna() # Create convenient labels labels = elec.get_labels(fraction.index) plt.figure(figsize=(10,30)) fraction.plot(kind='pie', labels=labels); elec.draw_wiring_graph() elec.meters_directly_downstream_of_mains() #sns.set_palette("Set3", n_colors=12) # Set a threshold to remove residual power noise when devices are off elec.plot_when_on(on_power_threshold = 40) fridge_meter = elec['fridge'] fridge_meter.upstream_meter() # happens to be the mains meter group! fridge_meter.device fridge_meter.dominant_appliance() fridge_meter.total_energy() # kWh fridge_meter.plot() good_sections = fridge_meter.good_sections(full_results=True) # specifying full_results=False would give us a simple list of # TimeFrames. But we want the full GoodSectionsResults object so we can # plot the good sections... good_sections.plot() good_sections.combined() fridge_meter.dropout_rate() import nilmtk nilmtk.global_meter_group.select_using_appliances(type='washer dryer') elec.select_using_appliances(type=['fridge', 'microwave']) nilmtk.global_meter_group.select_using_appliances(category='heating') nilmtk.global_meter_group.select_using_appliances(building=1, category='single-phase induction motor') nilmtk.global_meter_group.select_using_appliances(building=2, category='laundry appliances') elec.select(device_model='REDD_whole_house') elec.select(sample_period=3) elec['fridge'] elec.select_using_appliances(type='fridge') elec['light', 2] import nilmtk nilmtk.global_meter_group[{'dataset': 'REDD', 'building': 1, 'type': 'fridge', 'instance': 1}] elec[1] from nilmtk.elecmeter import ElecMeterID # ElecMeterID is a namedtuple for uniquely identifying each ElecMeter nilmtk.global_meter_group[ElecMeterID(instance=8, building=1, dataset='REDD')] elec[[ElecMeterID(instance=3, building=1, dataset='REDD'), ElecMeterID(instance=4, building=1, dataset='REDD')]] elec[ElecMeterID(instance=(3,4), building=1, dataset='REDD')] elec[ElecMeterID(instance=0, building=1, dataset='REDD')] elec.mains() == elec[ElecMeterID(instance=0, building=1, dataset='REDD')] redd.set_window(start='2011-04-21', end='2011-04-22') elec.plot(); plt.xlabel("Time"); from pandas.plotting import autocorrelation_plot elec.mains().plot_autocorrelation(); fridges_restricted = nilmtk.global_meter_group.select_using_appliances(type='fridge') daily_energy = pd.Series([meter.average_energy_per_period(offset_alias='D') for meter in fridges_restricted.meters]) # daily_energy.plot(kind='hist'); # plt.title('Histogram of daily fridge energy'); # plt.xlabel('energy (kWh)'); # plt.ylabel('occurences'); # plt.legend().set_visible(False) daily_energy correlation_df = elec.pairwise_correlation() correlation_df <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Note that there are two nested MeterGroups Step2: Putting these meters into a MeterGroup allows us to easily sum together the power demand recorded by both meters to get the total power demand for the entire appliance (but it's also very easy to see the individual meter power demand too). Step3: We can easily get the power data for both mains meters summed together Step4: Stats for MeterGroups Step5: Note that NILMTK has raised a warning that Mains uses a different type of power measurement than all the submeters, so it's not an entirely accurate comparison. Which raises the question Step6: Total Energy Step7: Energy per submeter Step8: column headings are the ElecMeter instance numbers. Step9: Plot fraction of energy consumption of each appliance Step10: Draw wiring diagram Step11: It's not very pretty but it shows that meters (1,2) (the site meters) are upstream of all other meters. Step12: Plot appliances when they are in use Step13: Stats and info for individual meters Step14: Get upstream meter Step15: Metadata about the class of meter Step16: Dominant appliance Step17: Total energy Step18: Get good sections Step19: We can automatically identify the 'good sections' (i.e. the sections where every pair of consecutive samples is less than max_sample_period specified in the dataset metadata) Step20: The blue chunks show where the data is good. The white gap is the large gap seen in the raw power data. There are lots of smaller gaps that we cannot see at this zoom level. Step21: Dropout rate Step22: Note that the dropout rate has gone down (which is good!) now that we are ignoring the gaps. This value is probably more representative of the performance of the wireless system. Step23: Or select multiple appliance types Step24: Or all appliances in the 'heating' category Step25: Or all appliances in building 1 with a single-phase induction motor(!) Step26: (NILMTK imports the 'common metadata' from the NILM Metadata project, which includes a wide range of different category taxonomies) Step27: Select a group of meters from properties of the meters (not the appliances) Step28: Select a single meter from a MeterGroup Step29: Appliances are uniquely identified within a building by a type (fridge, kettle, television, etc.) and an instance number. If we do not specify an instance number then ElecMeter retrieves instance 1 (instance numbering starts from 1). If you want a different instance then just do this Step30: To uniquely identify an appliance in nilmtk.global_meter_group then we must specify the dataset name, building instance number, appliance type and appliance instance in a dict Step31: Search for a meter using details of the ElecMeter Step32: Instance numbering Step33: Select nested MeterGroup Step34: We can also specify the mains by asking for meter instance 0 Step35: which is equivalent to elec.mains() Step36: Plot sub-metered data for a single day Step37: Autocorrelation Plot Step38: Daily energy consumption across fridges in the dataset Step39: Correlation dataframe of the appliances
5,870
<ASSISTANT_TASK:> Python Code: from threeML import * from threeML.analysis_results import * from threeML.io.progress_bar import progress_bar from jupyterthemes import jtplot %matplotlib inline jtplot.style(context="talk", fscale=1, ticks=True, grid=False) import matplotlib.pyplot as plt plt.style.use("mike") import astropy.units as u gen_function = Line(a=0.0, b=2) + Gaussian(F=30.0, mu=25.0, sigma=1) # Generate a dataset using the line and a gaussian. # constant 20% error x = np.linspace(0, 50, 50) xy = XYLike.from_function( "sim_data", function=gen_function, x=x, yerr=0.2 * gen_function(x) ) xy.plot() fitfun = Line() + Gaussian() fitfun.a_1.bounds = (-10, 10.0) fitfun.b_1.bounds = (-100, 100.0) fitfun.F_2 = 25.0 fitfun.F_2.bounds = (1e-3, 200.0) fitfun.mu_2 = 25.0 fitfun.mu_2.bounds = (0.0, 100.0) fitfun.sigma_2.bounds = (1e-3, 10.0) model = Model(PointSource("fake", 0.0, 0.0, fitfun)) data = DataList(xy) jl = JointLikelihood(model, DataList(xy)) _ = jl.fit() jl.get_errors(); ar = jl.results ar.display() ar.display("hpd") ar.analysis_type ar.covariance_matrix ar.get_point_source_flux(1*u.keV, .1*u.MeV) ar.optimized_model ar.write_to("test_mle.fits", overwrite=True) import astropy.io.fits as fits ar_fits = fits.open('test_mle.fits') ar_fits.info() ar_reloaded = load_analysis_results("test_mle.fits") ar_reloaded.get_statistic_frame() ar_reloaded.get_data_frame() from threeML.analysis_results import AnalysisResultsSet analysis_set = AnalysisResultsSet([ar, ar_reloaded]) # index as time bins analysis_set.set_bins("testing", [-1, 1], [3, 5], unit="s") # write to disk analysis_set.write_to("analysis_set_test.fits", overwrite=True) analysis_set = load_analysis_results("analysis_set_test.fits") analysis_set[0].display() p1 = ar.get_variates("fake.spectrum.main.composite.a_1") p2 = ar.get_variates("fake.spectrum.main.composite.b_1") print("Propagating a+b, with a and b respectively:") print(p1) print(p2) print("\nThis is the result (with errors):") res = p1 + p2 print(res) print(res.equal_tail_interval()) print("\nThis is 50 * a/a:") print(50 * p1/p1) print("\nThis is arcsinh(a + 5*b) / np.log10(b) (why not?)") print(np.arcsinh(p1 + 5 * p2) / np.log10(p2)) print("\nRatio a/b:") print(p2 / p1) def my_function(x, a, b): return b * x ** a print("\nPropagating using a custom function:") print(my_function(2.3, p1, p2)) def go(fitfun, ar, model): fig, ax = plt.subplots() # Gather the parameter variates arguments = {} for par in fitfun.parameters.values(): if par.free: this_name = par.name this_variate = ar.get_variates(par.path) # Do not use more than 1000 values (would make computation too slow for nothing) if len(this_variate) > 1000: this_variate = np.random.choice(this_variate, size=1000) arguments[this_name] = this_variate # Prepare the error propagator function pp = ar.propagate( ar.optimized_model.fake.spectrum.main.shape.evaluate_at, **arguments ) # You can just use it as: print(pp(5.0)) # Make the plot energies = np.linspace(0, 50, 100) low_curve = np.zeros_like(energies) middle_curve = np.zeros_like(energies) hi_curve = np.zeros_like(energies) free_parameters = model.free_parameters with progress_bar(len(energies), title="Propagating errors") as p: with use_astromodels_memoization(False): for i, e in enumerate(energies): this_flux = pp(e) low_bound, hi_bound = this_flux.equal_tail_interval() low_curve[i], middle_curve[i], hi_curve[i] = ( low_bound, this_flux.median, hi_bound, ) p.increase() ax.plot(energies, middle_curve, "--", color="black") ax.fill_between(energies, low_curve, hi_curve, alpha=0.5, color="blue") go(fitfun, ar, model) for parameter in ar.optimized_model: model[parameter.path].value = parameter.value model.fake.spectrum.main.composite.a_1.set_uninformative_prior(Uniform_prior) model.fake.spectrum.main.composite.b_1.set_uninformative_prior(Uniform_prior) model.fake.spectrum.main.composite.F_2.set_uninformative_prior(Log_uniform_prior) model.fake.spectrum.main.composite.mu_2.set_uninformative_prior(Uniform_prior) model.fake.spectrum.main.composite.sigma_2.set_uninformative_prior(Log_uniform_prior) bs = BayesianAnalysis(model, data) samples = bs.sample(20, 100, 1000) ar2 = bs.results ar2.write_to("test_bayes.fits", overwrite=True) ar2_reloaded = load_analysis_results("test_bayes.fits") np.allclose(ar2_reloaded.samples, ar2.samples) #ar2.corner_plot(); # with chain consumer (pretty!) ar2.corner_plot_cc(); ar2.get_data_frame("equal tail") ar2.get_data_frame("hpd") p1 = ar2.get_variates("fake.spectrum.main.composite.a_1") p2 = ar2.get_variates("fake.spectrum.main.composite.b_1") print(p1) print(p2) res = p1 + p2 print(res) go(fitfun, ar2, model) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Let's take a look at what we can do with an AR. First, we will simulate some data. Step2: MLE Results Step3: We can get our errors as always, but the results cannot be propagated (error propagation assumes Gaussian errors, i.e., symmetric errors) Step4: We need to get the AnalysisResults object that is created after a fit is performed. The AR object is a member of the JointLikelihood object Step5: We can display the results of the analysis. Note, when a fit is performed, the post display is actaully from the internal AR. Step6: By default, the equal tail intervals are displayed. We can instead display highest posterior densities (equal in the MLE case) Step7: The AR stores several properties from the analysis Step8: Saving results to disk Step9: The FITS file can be examines with any normal FITS reader. Step10: However, to easily pull the results back into the 3ML framework, we use the ${\tt load_analysis_results}$ function Step11: You can get a DataFrame with the saved results Step12: Analysis Result Sets Step13: Error propagation Step14: The propagation accounts for covariances. For example this Step15: You can use arbitrary (np) functions Step16: Errors can become asymmetric. For example, the ratio of two gaussians is Step17: You can always use it with arbitrary functions Step18: This is an example of an error propagation to get the plot of the model with its errors Step19: Bayesian Analysis Results Step20: Again, we grab the results from the BayesianAnalysis object Step21: We can write and read the results to/from a file Step22: The AR holds the posterior samples from the analysis. We can see the saved and live reults are the same Step23: NOTE Step24: We can return pandas DataFrames with equal tail or HPD results. Step25: Error propagation operates the same way. Internally, the process is the same as the MLE results, however, the samples are those of the posterior rather than the (assumed) covariance matrix. Step26: To demonstrate how the two objects (MLE and Bayes) are the same, we see that our plotting function written for the MLE result works on our Bayesian results seamlessly.
5,871
<ASSISTANT_TASK:> Python Code: import DBELA from rmtk.vulnerability.common import utils %matplotlib inline building_model_file = "../../../../../rmtk_data/DBELA/bare_frames.csv" damage_model_file = "../../../../../rmtk_data/damage_model_dbela_low_code.csv" no_assets = 100 building_class_model = DBELA.read_building_class_model(building_model_file) assets = DBELA.generate_assets(building_class_model, no_assets) damage_model = utils.read_damage_model(damage_model_file) capacity_curves = DBELA.generate_capacity_curves(assets, damage_model) utils.plot_capacity_curves(capacity_curves) gamma = 1.2 yielding_point_index = 1.0 capacity_curves = utils.add_information(capacity_curves, "gamma", "value", gamma) capacity_curves = utils.add_information(capacity_curves, "yielding point", "point", yielding_point_index) output_file = "../../../../../rmtk_data/capacity_curves_dbela.csv" utils.save_SdSa_capacity_curves(capacity_curves, output_file) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load geometric and material properties Step2: Number of samples Step3: Generate the capacity curves Step4: Plot the capacity curves Step5: Include additional information Step6: Save capacity curves
5,872
<ASSISTANT_TASK:> Python Code: recent_grads = pd.read_csv('recent-grads.csv') recent_grads.head() recent_grads.tail() recent_grads.describe() recent_grads.shape recent_grads.shape[0] - recent_grads.dropna().shape[0] from pandas.tools.plotting import scatter_matrix scatter_matrix(recent_grads[['ShareWomen', 'Unemployment_rate']], figsize=(12,8)) plt.show() sns.pairplot(recent_grads[['ShareWomen', 'Unemployment_rate']].dropna(), size=4) sns.plt.show() grads_eng_share = recent_grads[recent_grads['Major_category'] == 'Engineering'] grads_eng_share['ShareMen'] = 1 - grads_eng_share['ShareWomen'] grads_eng_share = grads_eng_share.set_index('Major') grads_eng_share = grads_eng_share[['ShareMen', 'ShareWomen']] grads_eng_share.head() grads_eng_share.plot(kind='bar', figsize=(12,12)) plt.show() grads_eng_num = recent_grads[recent_grads['Major_category'] == 'Engineering'] grads_eng_num.head() grads_eng_num = grads_eng_num.set_index('Major') grads_eng_num = grads_eng_num[['Men', 'Women']] grads_eng_num.head() grads_eng_num.plot(kind='bar', stacked=True, figsize=(12,12)) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: how many rows contain null values? Step2: Data Visualization Step3: Let's compare the share of men and women in engineering major. Step4: from the plot above, we found most students in engineering major are male.
5,873
<ASSISTANT_TASK:> Python Code: %matplotlib inline import inspect, sys # check pydov path import pydov from pydov.search.interpretaties import GeotechnischeCoderingSearch itp = GeotechnischeCoderingSearch() itp.get_description() fields = itp.get_fields() # print available fields for f in fields.values(): print(f['name']) fields['Datum'] from pydov.util.location import Within, Box df = itp.search(location=Within(Box(108281, 197850, 108282, 197851))) df.head() for pkey_interpretatie in set(df.pkey_interpretatie): print(pkey_interpretatie) [i for i,j in inspect.getmembers(sys.modules['owslib.fes'], inspect.isclass) if 'Property' in i] from owslib.fes import And, PropertyIsGreaterThan, PropertyIsEqualTo from pydov.util.location import WithinDistance, Point query = And([PropertyIsEqualTo(propertyname='Betrouwbaarheid', literal='goed'), PropertyIsGreaterThan(propertyname='diepte_tot_m', literal='20'), ]) df = itp.search(query=query, location=WithinDistance(Point(153145, 206930), 1000)) df.head() for pkey_interpretatie in set(df.pkey_interpretatie): print(pkey_interpretatie) from owslib.fes import PropertyIsEqualTo query = PropertyIsEqualTo( propertyname='Type_proef', literal='Boring') df = itp.search( location=Within(Box(153145, 206930, 154145, 207930)), query=query ) df.head() for pkey_interpretatie in set(df.pkey_interpretatie): print(pkey_interpretatie) from owslib.fes import And, PropertyIsEqualTo, PropertyIsLessThan query = And([PropertyIsEqualTo(propertyname='gemeente', literal='Antwerpen'), PropertyIsLessThan(propertyname='Datum', literal='2010-01-01')] ) df = itp.search(query=query, return_fields=('pkey_interpretatie', 'Datum')) df.head() query = PropertyIsEqualTo( propertyname='gemeente', literal='Leuven') df = itp.search(query=query, return_fields=('pkey_interpretatie', 'pkey_boring', 'x', 'y', 'Z_mTAW', 'gemeente', 'Auteurs', 'Proefnummer')) df.head() # import the necessary modules (not included in the requirements of pydov!) import folium from folium.plugins import MarkerCluster from pyproj import Transformer # convert the coordinates to lat/lon for folium def convert_latlon(x1, y1): transformer = Transformer.from_crs("epsg:31370", "epsg:4326", always_xy=True) x2,y2 = transformer.transform(x1, y1) return x2, y2 df['lon'], df['lat'] = zip(*map(convert_latlon, df['x'], df['y'])) # convert to list loclist = df[['lat', 'lon']].values.tolist() # initialize the Folium map on the centre of the selected locations, play with the zoom until ok fmap = folium.Map(location=[df['lat'].mean(), df['lon'].mean()], zoom_start=12) marker_cluster = MarkerCluster().add_to(fmap) for loc in range(0, len(loclist)): folium.Marker(loclist[loc], popup=df['Proefnummer'][loc]).add_to(marker_cluster) fmap <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Get information about the datatype 'Geotecnische codering' Step2: A description is provided for the 'Geotechnische codering' datatype Step3: The different fields that are available for objects of the 'Geotechnische codering' datatype can be requested with the get_fields() method Step4: You can get more information of a field by requesting it from the fields dictionary Step5: Example use cases Step6: The dataframe contains one 'Geotechnische codering' interpretation where ten layers ('laag') were identified. The available data are flattened to represent unique attributes per row of the dataframe. Step7: Get 'Geotechnische codering' with specific properties within a distance from a point Step8: In this example we build a query using the PropertyIsGreaterThan and PropertyIsEqualTo operators to find all interpretations that are at least 20 m deep, that are deemed appropriate for a range of 1 km from a defined point Step9: Once again we can use the pkey_interpretatie as a permanent link to the information of these interpretations Step10: Get 'Geotechnische codering' in a bounding box based on specific properties Step11: We can look at one of the interpretations in a webbrowser using its pkey_interpretatie Step12: Get 'Geotechnische codering' based on fields not available in the standard output dataframe Step13: Get 'Geotechnische codering' data, returning fields not available in the standard output dataframe Step14: Visualize results
5,874
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import numpy as np from scipy.integrate import odeint from IPython.html.widgets import interact, fixed def lorentz_derivs(yvec, t, sigma, rho, beta): Compute the the derivatives for the Lorentz system at yvec(t). # YOUR CODE HERE raise NotImplementedError() assert np.allclose(lorentz_derivs((1,1,1),0, 1.0, 1.0, 2.0),[0.0,-1.0,-1.0]) def solve_lorentz(ic, max_time=4.0, sigma=10.0, rho=28.0, beta=8.0/3.0): Solve the Lorenz system for a single initial condition. Parameters ---------- ic : array, list, tuple Initial conditions [x,y,z]. max_time: float The max time to use. Integrate with 250 points per time unit. sigma, rho, beta: float Parameters of the differential equation. Returns ------- soln : np.ndarray The array of the solution. Each row will be the solution vector at that time. t : np.ndarray The array of time points used. # YOUR CODE HERE raise NotImplementedError() assert True # leave this to grade solve_lorenz N = 5 colors = plt.cm.hot(np.linspace(0,1,N)) for i in range(N): # To use these colors with plt.plot, pass them as the color argument print(colors[i]) def plot_lorentz(N=10, max_time=4.0, sigma=10.0, rho=28.0, beta=8.0/3.0): Plot [x(t),z(t)] for the Lorenz system. Parameters ---------- N : int Number of initial conditions and trajectories to plot. max_time: float Maximum time to use. sigma, rho, beta: float Parameters of the differential equation. # YOUR CODE HERE raise NotImplementedError() plot_lorentz() assert True # leave this to grade the plot_lorenz function # YOUR CODE HERE raise NotImplementedError() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Lorenz system Step4: Write a function solve_lorenz that solves the Lorenz system above for a particular initial condition $[x(0),y(0),z(0)]$. Your function should return a tuple of the solution array and time array. Step6: Write a function plot_lorentz that Step7: Use interact to explore your plot_lorenz function with
5,875
<ASSISTANT_TASK:> Python Code: import datapot as dp datapot = dp.DataPot() from datapot.utils import csv_to_jsonlines csv_to_jsonlines('../data/transactions.csv', '../data/transactions.jsonlines') ftr = open('../data/transactions.jsonlines') datapot.detect(ftr, limit=100) datapot.fit(ftr) datapot datapot.remove_transformer('merchant_id', 0) data = datapot.transform(ftr) data.head() data.columns <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Let's call the fit method. It automatically finds appropriate transformers for the fields of jsonlines file. The parameter 'limit' means how many objects will be used to detect the right transformers. Step2: Let's remove the SVDOneHotTransformer
5,876
<ASSISTANT_TASK:> Python Code: import pandas as pd df = pd.DataFrame([["A", "Z-Y"], ["B", "X"], ["C", "W-U-V"]], index=[1,2,3], columns=['var1', 'var2']) def g(df): return df.join(pd.DataFrame(df.var2.str.split('-', expand=True).stack().reset_index(level=1, drop=True),columns=['var2 '])).\ drop('var2',1).rename(columns=str.strip).reset_index(drop=True) result = g(df.copy()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
5,877
<ASSISTANT_TASK:> Python Code: import string import os import time import pickle import json import re import wikipedia import nltk import numpy as np from nltk.corpus import stopwords from nltk.stem.porter import PorterStemmer from sklearn.feature_extraction.text import TfidfVectorizer from sklearn.manifold import TSNE from sklearn.preprocessing import normalize from sklearn.decomposition import TruncatedSVD nltk.download('punkt') nltk.download('stopwords') main = wikipedia.page('Wikipedia:Vital articles') #https://en.wikipedia.org/wiki/Wikipedia:1,000_core_topics #https://en.wikipedia.org/wiki/User:West.andrew.g/2016_Popular_pages token_dict = {} for i, article in enumerate(main.links): if article not in token_dict: if i%20==0: print "getting text for article %d/%d : %s"%(i, len(main.links), article) try: text = wikipedia.page(article) token_dict[article] = text.content except: print " ==> error processing "+article pickle.dump(token_dict, open('fulltext_WikiVitalArticles.p', 'wb')) token_dict = pickle.load(open('fulltext_WikiVitalArticles.p', 'rb')) def tokenize(text): text = text.lower() # lower case text = re.sub(r"[%s\n\t]+"%string.punctuation, ' ', text) # remove punctuation text = re.sub(r"[ ]+", " ", text) # remove extra spaces text = text.translate(string.punctuation) # punctuation tokens = nltk.word_tokenize(text) tokens = [t for t in tokens if not t in stopwords.words('english')] # stopwords stems = [PorterStemmer().stem(t) for t in tokens] return stems # calculate tfidf (might take a while) print("calculating tf-idf") tfidf = TfidfVectorizer(tokenizer=tokenize, stop_words='english') tfs = tfidf.fit_transform(token_dict.values()) print("reducing tf-idf to 500 dim") tfs_reduced = TruncatedSVD(n_components=500, random_state=0).fit_transform(tfs) print("done") pickle.dump(tfs_reduced, open('tfidf_WikiVitalArticles.p', 'wb')) tfs_reduced = pickle.load(open('tfidf_WikiVitalArticles.p', 'rb')) # calculate t-SNE tsne = TSNE(n_components=2, perplexity=50, verbose=2).fit_transform(tfs_reduced) # save to json file x_axis, y_axis = tsne[:, 0], tsne[:, 1] x_norm = (x_axis-np.min(x_axis)) / (np.max(x_axis) - np.min(x_axis)) y_norm = (y_axis-np.min(y_axis)) / (np.max(y_axis) - np.min(y_axis)) data = {"x":[float(x) for x in x_norm.tolist()], "y":[float(y) for y in y_norm.tolist()], "names":token_dict.keys()} with open('tsne_wikiVitalArticles.json', 'w') as outfile: json.dump(data, outfile) nx, ny = 32, 31 import rasterfairy grid_assignment = rasterfairy.transformPointCloud2D(tsne[0:nx*ny, :], target=(nx, ny))[0] grid_sorted = sorted(range(len(grid_assignment)), key=lambda k: grid_assignment[k][1]*nx + grid_assignment[k][0]) keys = list(token_dict.keys()) links_grid = [[0 for x in range(nx)] for y in range(ny)] for i, g in enumerate(grid_assignment): links_grid[int(g[1])][int(g[0])] = keys[i] table_html = '<table>\n' for row in links_grid: table_html += '\t<tr>\n' for col in row: table_html += '\t\t<td><a href=\"https://en.wikipedia.org/wiki/%s\">%s</a></td>\n' % (col, col) table_html += '\t</tr>\n' table_html += '</table>\n' html = ''' <head> <style> body { padding-top: 80px; text-align: center; font-family: monaco, monospace; background-size: cover; } table { text-align: center; } tr { background-color:#ff0; } td { padding:10px; } </style> </head> <body> %s </body> ''' % table_html with open('index.html', 'wb') as text_file: #text_file.write(html.encode('utf-8')) text_file.write(html.encode('utf-8')) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: In this example, we are going to cluster all of the links found in the Wikipedia page "Vital articles." First, we will open the page in main, then add all of the raw text of the articles into a dictionary called token_dict. Step2: You can save the text to disk in the following cell. Step3: later you can retrieve it like this Step4: The next sell will calculate the SVD decomposition of the tf-idf matrix. Step5: You can save the calculation to disk in the following cell. Step6: You can load it back later like this Step7: Now calculate t-SNE on the reduced feature vectors and normalize to (0,1). Step8: Save to json for future-keeping. Step9: We can also convert the t-SNE to an nx by ny grid assignment. Step10: The next cell will create an HTML file with the gridded wikipedia articles arranged by similarity.
5,878
<ASSISTANT_TASK:> Python Code: import sys def something_dangerous(x): print("computing reciprocal of", x) return 1 / x try: for x in [2, 1, 0, -1]: print("1/{} = {}".format(x, something_dangerous(x))) except ArithmeticError as error: print("Something went terribly wrong:", error) input_list = [2, 1, 0, -1] reciprocals = [something_dangerous(item) for item in input_list] print("The reciprocal of", input_list, "is", reciprocals) try: reciprocals = [something_dangerous(item) for item in input_list] except ArithmeticError as error: print("Something went terribly wrong:", error) else: print("The reciprocal of\n\t", input_list, "\nis\n\t", reciprocals) import math def something_safe(x): try: return something_dangerous(x) except ArithmeticError as error: return math.nan reciprocals = [something_safe(item) for item in input_list] print("The reciprocal of\n\t", input_list, "\nis\n\t", reciprocals) square_roots = [math.sqrt(item) for item in reciprocals] def safe_sqrt(x): try: return math.sqrt(x) except ValueError as error: return math.nan [safe_sqrt(item) for item in reciprocals] def secure_function(dangerous_function): def something_safe(x): A safer version of something dangerous. try: return dangerous_function(x) except (ArithmeticError, ValueError): return math.nan return something_safe safe_sqrt = secure_function(math.sqrt) print("⎷2 =", safe_sqrt(2)) print("⎷-1 =", safe_sqrt(-1)) print() help(safe_sqrt) import functools def secure_function(dangerous_function): Create a function that doesn't raise ValueErrors. @functools.wraps(dangerous_function) def something_safe(x): A safer version of something dangerous. try: return dangerous_function(x) except (ArithmeticError, ValueError): return math.nan return something_safe safe_sqrt = secure_function(math.sqrt) help(safe_sqrt) something_safe = secure_function(something_dangerous) [safe_sqrt(something_safe(item)) for item in input_list] class Fail: Keep track of failures. def __init__(self, exception, trace): self.exception = exception self.trace = trace def extend_trace(self, f): Grow a stack trace. self.trace.append(f) return self def __str__(self): return "Fail in " + " -> ".join( f.__name__ for f in reversed(self.trace)) \ + ":\n\t" + type(self.exception).__name__ \ + ": " + str(self.exception) def secure_function(dangerous_function): Create a function that doesn't raise ValueErrors. @functools.wraps(dangerous_function) def something_safe(x): A safer version of something dangerous. if isinstance(x, Fail): return x.extend_trace(dangerous_function) try: return dangerous_function(x) except Exception as error: return Fail(error, [dangerous_function]) return something_safe @secure_function def reciprocal(x): return 1 / x @secure_function def square_root(x): return math.sqrt(x) reciprocals = map(reciprocal, input_list) square_roots = map(square_root, reciprocals) for x, result in zip(input_list, square_roots): print("sqrt( 1 /", x, ") =", result) import noodles import math from noodles.tutorial import display_workflows @noodles.maybe def reciprocal(x): return 1 / x @noodles.maybe def square_root(x): return math.sqrt(x) results = [square_root(reciprocal(x)) for x in [2, 1, 0, -1]] for result in results: print(str(result)) @noodles.schedule @noodles.maybe def add(a, b): return a + b workflow = add(noodles.schedule(reciprocal)(0), noodles.schedule(square_root)(-1)) display_workflows(arithmetic=workflow, prefix='errors') result = noodles.run_single(workflow) print(result) !stat -t -c '%A %10s %n' /dev/null !stat -t -c '%A %10s %n' does-not-exist from subprocess import run, PIPE, CalledProcessError @noodles.schedule @noodles.maybe def stat_file(filename): p = run(['stat', '-t', '-c', '%A %10s %n', filename], check=True, stdout=PIPE, stderr=PIPE) return p.stdout.decode().strip() files = ['/dev/null', 'does-not-exist', '/home', '/usr/bin/python3'] workflow = noodles.gather_all(stat_file(f) for f in files) display_workflows(stat=workflow, prefix='errors') result = noodles.run_parallel(workflow, n_threads=4) for file, stat in zip(files, result): print('stat {:18} -> {}'.format( file, stat if not noodles.failed(stat) else 'failed: ' + stat.exception.stderr.decode().strip())) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: This shows how exceptions are raised and caught, but this approach is somewhat limited. Suppose now, that we weren't expecting this expected unexpected behaviour and we wanted to compute everything before displaying our results. Step2: Ooops! Let's fix that. Step3: That's also not what we want. We wasted all this time computing nice reciprocals of numbers, only to find all of our results being thrown away because of one stupid zero in the input list. We can fix this. Step4: That's better! We skipped right over the error and continued to more interesting results. So how are we going to make this solution more generic? Subsequent functions may not know how to handle that little nan in our list. Step5: Hmmmpf. There we go again. Step7: This seems Ok, but there are two problems here. For one, it feels like we're doing too much work! We have a repeating code pattern here. That's always a moment to go back and consider making parts of our code more generic. At the same time, this is when we need some more advanced Python concepts to get us out of trouble. We're going to define a function in a function! Step8: Consider what happens here. The function secure_function takes a function something_dangerous as an argument and returns a new function something_safe. This new function executes something_dangerous within a try-except block to deal with the possibility of failure. Let's see how this works. Step11: Ok, so that works! However, the documentation of safe_sqrt is not yet very useful. There is a nice library routine that may help us here Step12: Now it is very easy to also rewrite our function computing the reciprocals safely Step15: There is a second problem to this approach, which is a bit more subtle. How do we know where the error occured? We got two values of nan and are desperate to find out what went wrong. We'll need a little class to capture all aspects of failure. Step18: We will adapt our earlier design for secure_function. If the given argument is a Fail, we don't even attempt to run the next function. In stead, we extend the trace of the failure, so that we can see what happened later on. Step19: Now we can rewrite our little program entirely from scratch Step20: See how we retain a trace of the functions that were involved in creating the failed state, even though the execution of that produced those values is entirely decoupled. This is exactly what we need to trace errors in Noodles. Step21: The maybe decorator works well together with schedule. The following workflow is full of errors! Step22: Both the reciprocal and the square root functions will fail. Noodles is smart enough to report on both errors.` Step23: Example Step24: If a file does note exist, stat returns an error-code of 1. Step25: We can wrap the execution of the stat command in a helper function. Step26: The run function runs the given command and returns a CompletedProcess object. The check=True argument enables checking for return value of the child process. If the return value is any other then 0, a CalledProcessError is raised. Because we decorated our function with noodles.maybe, such an error will be caught and a Fail object will be returned. Step27: We can now run this workflow and print the output in a table.
5,879
<ASSISTANT_TASK:> Python Code: %load_ext sql %sql sqlite:// %%sql drop table if exists product; create table product( pname varchar primary key, -- имя продукта price money, -- цена продукта category varchar, -- категория manufacturer varchar NOT NULL -- производитель ); insert into product values('Пряник', 19.99, 'Еда', 'Тульский пряник'); insert into product values('Тетрадь', 29.99, 'Канцелярия', 'Эксмо'); insert into product values('Печенье', 149.99, 'Еда', 'WagonWiels'); insert into product values('Планшет', 203.99, 'Техника', 'Zua'); %sql select * from product; %%sql SELECT * from Product WHERE category = 'Канцелярия' and manufacturer = 'Эксмо' %%sql SELECT Pname, Price, Manufacturer FROM Product; %%sql SELECT Pname, Price, Manufacturer FROM Product WHERE category='Еда'; %%sql SELECT p.manufacturer, p.pname, p.price FROM (SELECT distinct p0.category FROM Product p0 WHERE p0.price < 20.00) cp, -- this is a nested query! Product p WHERE p.category = cp.category and p.price > 20.00 %sql select * from product; %%sql SELECT * FROM product where category LIKE '%да%' %sql SELECT category from product; %%sql -- чтобы убрать дубли используйте слово DISTINCT SELECT DISTINCT category from product; %%sql -- сортировка результатов -- сортировка по умолчанию - ascending SELECT pname, price, manufacturer FROM Product WHERE price > 50 ORDER BY price, pname %%sql -- сортировка результатов -- тип сортировки каждого компонента определяется индивидуально SELECT price, manufacturer FROM Product ORDER BY manufacturer ASC, price DESC %%sql drop table if exists product; -- This needs to be dropped if exists, see why further down! drop table if exists company; create table company ( cname varchar primary key, -- company name uniquely identifies the company. stockprice money, -- stock price is in money country varchar); -- country is just a string insert into company values ('Тульский пряник', 25.0, 'Россия'); insert into company values ('Эксмо', 65.0, 'Россия'); insert into company values ('Zua', 15.0, 'Китай'); %sql select * from company; %%sql drop table if exists product; pragma foreign_keys = ON; -- WARNING by default off in sqlite create table product( pname varchar primary key, -- name of the product price money, -- price of the product category varchar, -- category manufacturer varchar, -- manufacturer foreign key (manufacturer) references company(cname)); insert into product values('Пряник', 19.99, 'Еда', 'Тульский пряник'); insert into product values('Тетрадь', 29.99, 'Канцелярия', 'Эксмо'); insert into product values('Печенье', 149.99, 'Еда', 'Тульский пряник'); insert into product values('Планшет', 203.99, 'Техника', 'Zua'); try: %sql insert into product values('MultiTouch', 203.99, 'Household', 'Google'); except Exception as e: print (e) print ("Rejected!") %%sql -- the update is rejected! select * from product; try: %sql delete from company where cname = 'Zua'; except Exception as e: print (e) print ("Disallowed!") %%sql SELECT pname, price FROM product, company where manufacturer=cname and country='Россия' and price <= 200; %%sql -- Часть 1: выбрать все компании из России SELECT distinct cname -- нужна ли нам уникальность? from company where country='Россия'; %%sql -- Part 2: Продукты до 200 select distinct pname, price, manufacturer from product where price <= 200; %%sql -- Объединение как cross join SELECT * FROM (SELECT DISTINCT pname, price, manufacturer FROM product WHERE price <= 200) CheapProducts, (SELECT DISTINCT cname FROM company WHERE country='Россия') JapaneseProducts; %%sql -- Фильтруем cross join SELECT DISTINCT pname, price FROM (SELECT DISTINCT pname, price, manufacturer FROM product WHERE price <= 200) CheapProducts, (SELECT distinct cname FROM company WHERE country='Россия') JapaneseProducts WHERE cname = manufacturer; %%sql -- duplicate answer SELECT Country FROM Product, Company WHERE Manufacturer=CName AND Category='Еда'; <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Давайте создадим таблицу, заполним ее и сделаем какой-нибудь запрос! Step2: Посмотрим на полученную таблицу. Step3: Немного SQL терминологии Step4: Посмотрим на примеры проекции, то есть получим только несколько атрибутов запроса. Step5: На выходе все еще таблица и ее схема - Step6: На выходе запроса к таблице - снова таблица Step7: Небольшие детали Step8: LIKE Step9: Убрать дубли Step10: Сортировка результатов Step11: Соединения - JOIN Step12: Внешние ключи Step13: Внешние ключи являются ограничениями таблицы Step14: Внешние ключи и удаление Step15: Второй вариант Step16: Другой вариант написания запроса. Step17: Примечания
5,880
<ASSISTANT_TASK:> Python Code: import tensorflow as tf import numpy as np import tensorflow_hub as hub import tensorflow_datasets as ds ## general checks print("Tensor Flow Version : {}".format(tf.__version__)) print("Eager Mode : {}".format(tf.executing_eagerly())) print("Hub Version : {}".format(hub.__version__)) print("GPU availablility : {}".format(True if tf.config.experimental.list_physical_devices("GPU") else False)) ## check if the dataset holds the imdb dataset or not "imdb_reviews" in ds.list_builders() ## Load the dataset if "imdb_reviews" in ds.list_builders(): imdb_ds = ds.load("imdb_reviews") for key,value in imdb_ds.items(): print(key, value) ### Using TF DS to split the training data into 60:40 validation dataset. if "imdb_reviews" in ds.list_builders(): train_data, validation_data, test_data = ds.load(name="imdb_reviews",split=('train[:60]','train[60:]','test'),as_supervised=True) type(train_data) ## Explore the data set train_examples_batch, train_labels_batch = next(iter(train_data.batch(10))) train_examples_batch train_labels_batch ## Embedding the word from TF Hub pre-build BoW embedding = "https://tfhub.dev/google/tf2-preview/gnews-swivel-20dim/1" hub_layer = hub.KerasLayer(embedding,trainable=True,input_shape=[],dtype=tf.string) hub_layer(train_examples_batch[:3]) ### Define the layers model = tf.keras.Sequential(name='IMDBSEQModel') model.add(hub_layer) model.add(tf.keras.layers.Dense(16, activation='relu')) model.add(tf.keras.layers.Dense(1)) model.summary() ### Define the Loss Function and optimizer model.compile(optimizer='adam',loss=tf.keras.losses.BinaryCrossentropy(from_logits=True), metrics=['accuracy']) history = model.fit(train_data.shuffle(10000).batch(512), epochs=20, validation_data=validation_data.batch(512), verbose=1) results = model.evaluate(test_data.batch(512),verbose=2) for name, value in zip(model.metrics_names, results): print("{} {}".format(name,value)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: IMDB Movie Review Step2: Step 2 Step3: Step 3 Step4: Step 4
5,881
<ASSISTANT_TASK:> Python Code: !pip install git+https://github.com/google/starthinker from starthinker.util.configuration import Configuration CONFIG = Configuration( project="", client={}, service={}, user="/content/user.json", verbose=True ) FIELDS = { 'auth_read':'user', # Credentials used for reading data. 'sheet':'', # Either sheet url or sheet name. 'tab':'', # Name of the tab where to put the data. 'range':'', # Range in the sheet to place the data, leave blank for whole sheet. 'dataset':'', # Existing BigQuery dataset. 'query':'', # Query to pull data from the table. 'legacy':True, # Use Legacy SQL } print("Parameters Set To: %s" % FIELDS) from starthinker.util.configuration import execute from starthinker.util.recipe import json_set_fields TASKS = [ { 'bigquery':{ 'auth':{'field':{'name':'auth_read','kind':'authentication','order':1,'default':'user','description':'Credentials used for reading data.'}}, 'from':{ 'auth':'service', 'dataset':{'field':{'name':'dataset','kind':'string','order':4,'default':'','description':'Existing BigQuery dataset.'}}, 'query':{'field':{'name':'query','kind':'text','order':5,'default':'','description':'Query to pull data from the table.'}}, 'legacy':{'field':{'name':'legacy','kind':'boolean','order':6,'default':True,'description':'Use Legacy SQL'}} }, 'to':{ 'sheet':{'field':{'name':'sheet','kind':'string','order':1,'default':'','description':'Either sheet url or sheet name.'}}, 'tab':{'field':{'name':'tab','kind':'string','order':2,'default':'','description':'Name of the tab where to put the data.'}}, 'range':{'field':{'name':'range','kind':'string','order':3,'default':'','description':'Range in the sheet to place the data, leave blank for whole sheet.'}} } } } ] json_set_fields(TASKS, FIELDS) execute(CONFIG, TASKS, force=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2. Set Configuration Step2: 3. Enter BigQuery Query to Sheet Recipe Parameters Step3: 4. Execute BigQuery Query to Sheet
5,882
<ASSISTANT_TASK:> Python Code: import rebound sim = rebound.Simulation() sim.add(m=1) sim.add(m=0.1, e=0.041, a=0.4, inc=0.2, f=0.43, Omega=0.82, omega=2.98) sim.add(m=1e-3, e=0.24, a=1.0, pomega=2.14) sim.add(m=1e-3, e=0.24, a=1.5, omega=1.14, l=2.1) sim.add(a=-2.7, e=1.4, f=-1.5,omega=-0.7) # hyperbolic orbit %matplotlib inline fig = rebound.OrbitPlot(sim) fig = rebound.OrbitPlot(sim, unitlabel="[AU]", color=True, periastron=True) fig = rebound.OrbitPlot(sim, unitlabel="[AU]", periastron=True, lw=2) from IPython.display import display, clear_output import matplotlib.pyplot as plt sim.move_to_com() for i in range(3): sim.integrate(sim.t+0.31) fig = rebound.OrbitPlot(sim,color=True,unitlabel="[AU]",lim=2.) display(fig) plt.close(fig) clear_output(wait=True) fig = rebound.OrbitPlot(sim,slices=True,color=True,unitlabel="[AU]",lim=2.,limz=0.36) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: To plot these initial orbits in the $xy$-plane, we can simply call the OrbitPlot function and give it the simulation as an argument. Step2: Note that the OrbitPlot function chooses reasonable limits for the axes for you. There are various ways to customize the plot. Have a look at the arguments used in the following examples, which are pretty much self-explanatory (if in doubt, check the documentation!). Step3: Note that all orbits are draw with respect to the center of mass of all interior particles. This coordinate system is known as Jacobi coordinates. It requires that the particles are sorted by ascending semi-major axis within the REBOUND simulation's particle array. Step4: To get an idea of the three dimensional distribution of orbits, use the slices=True option. This will plot the orbits three times, from different perspectives. You can adjust the dimensions in the z direction using the limz keyword.
5,883
<ASSISTANT_TASK:> Python Code: %matplotlib inline from pydov.types.fields import XmlField, XsdType from pydov.types.abstract import AbstractDovSubType from pydov.types.sondering import Sondering class Techniek(AbstractDovSubType): rootpath = './/sondering/sondeonderzoek/penetratietest/technieken' fields = [ XmlField(name='techniek_diepte_van', source_xpath='/diepte_van', definition='Enkel van toepassing voor het plaatsen van voerbuizen - ' '(code V) of het boren door een harde laag (code B).', datatype='float'), XmlField(name='techniek_diepte', source_xpath='/diepte_techniek', definition='Diepte waarop techniek toegepast werd.', datatype='float'), XmlField(name='techniek', source_xpath='/techniek', definition='De gebruikte techniek.', datatype='string', xsd_type=XsdType( xsd_schema='https://www.dov.vlaanderen.be/xdov/schema/latest/xsd/kern/sondering/SonderingDataCodes.xsd', typename='SondeerTechniekEnumType')), XmlField(name='techniek_andere', source_xpath='/techniek_andere', definition="De gebruikte techniek (enkel van toepassing indien de techniek = 'andere').", datatype='string') ] class SonderingTechnieken(Sondering): subtypes = [Techniek] from pydov.search.sondering import SonderingSearch cpts = SonderingSearch(objecttype=SonderingTechnieken) cpts.get_fields()['techniek'] from pydov.util.location import WithinDistance, Point df = cpts.search(location=WithinDistance(Point(150000, 150000), 10000, 'meter')) df['techniek_label'] = df['techniek'].map(cpts.get_fields()['techniek']['values']) df.head() from pydov.types.fields import XmlField, XsdType from pydov.types.boring import Boring class BoringMethodeXyz(Boring): __generiekeDataCodes = 'https://www.dov.vlaanderen.be/xdov/schema/latest/xsd/kern/generiek/GeneriekeDataCodes.xsd' fields = Boring.extend_fields([ XmlField(name='methode_xy', source_xpath='/boring/xy/methode_opmeten', definition='Methode waarop de x en y-coordinaat opgemeten werden.', datatype='string', xsd_type=XsdType( xsd_schema=__generiekeDataCodes, typename='MethodeOpmetenXyEnumType')), XmlField(name='betrouwbaarheid_xy', source_xpath='/boring/xy/betrouwbaarheid', definition='Betrouwbaarheid van het opmeten van de x en y-coordinaat.', datatype='string', xsd_type=XsdType( xsd_schema=__generiekeDataCodes, typename='BetrouwbaarheidXyzEnumType')), XmlField(name='methode_mv', source_xpath='/boring/oorspronkelijk_maaiveld/methode_opmeten', definition='Methode waarop de Z-coördinaat van het maaiveld opgemeten werd.', datatype='string', xsd_type=XsdType( xsd_schema=__generiekeDataCodes, typename='MethodeOpmetenZEnumType')), XmlField(name='betrouwbaarheid_mv', source_xpath='/boring/oorspronkelijk_maaiveld/betrouwbaarheid', definition='Betrouwbaarheid van het opmeten van de z-coordinaat van het maaiveld.', datatype='string', xsd_type=XsdType( xsd_schema=__generiekeDataCodes, typename='BetrouwbaarheidXyzEnumType')), XmlField(name='aanvangspeil_mtaw', source_xpath='/boring/aanvangspeil/waarde', definition='Hoogte in mTAW van het startpunt van de boring (boortafel, bouwput etc).', datatype='float'), XmlField(name='methode_aanvangspeil', source_xpath='/boring/aanvangspeil/methode_opmeten', definition='Methode waarop de Z-coördinaat van het aanvangspeil opgemeten werd.', datatype='string', xsd_type=XsdType( xsd_schema=__generiekeDataCodes, typename='MethodeOpmetenZEnumType')), XmlField(name='betrouwbaarheid_aanvangspeil', source_xpath='/boring/aanvangspeil/betrouwbaarheid', definition='Betrouwbaarheid van het opmeten van de z-coordinaat van het aanvangspeil.', datatype='string', xsd_type=XsdType( xsd_schema=__generiekeDataCodes, typename='MethodeOpmetenZEnumType')), ]) from pydov.search.boring import BoringSearch bs = BoringSearch(objecttype=BoringMethodeXyz) bs.get_fields()['mv_mtaw'] from pydov.util.location import WithinDistance, Point df = bs.search(location=WithinDistance(Point(150000, 150000), 10000, 'meter'), return_fields=('pkey_boring', 'boornummer', 'x', 'y', 'methode_xy', 'betrouwbaarheid_xy', 'mv_mtaw', 'methode_mv', 'betrouwbaarheid_mv', 'aanvangspeil_mtaw', 'methode_aanvangspeil', 'betrouwbaarheid_aanvangspeil', 'start_boring_mtaw')) df.head() df_plot = df.groupby('methode_xy').size().sort_values() ax = df_plot.plot.barh() ax.set_xlabel("count"); ax.set_title("Number of boreholes per coordinate digitization method"); df_plot = df.groupby('methode_mv').size().sort_values() ax = df_plot.plot.barh() ax.set_xlabel("count"); ax.set_title("Number of boreholes per height digitization method"); df_plot = df.groupby('methode_aanvangspeil').size().sort_values() ax = df_plot.plot.barh() ax.set_xlabel("count"); ax.set_title("Number of boreholes per `aanvangspeil` digitization method"); from pydov.types.fields import XmlField, XsdType from pydov.types.abstract import AbstractDovSubType from pydov.types.grondwaterfilter import GrondwaterFilter class Gxg(AbstractDovSubType): rootpath = './/filtermeting/gxg' fields = [ XmlField(name='gxg_jaar', source_xpath='/jaar', definition='jaar (hydrologisch jaar voor lg3 en hg3, kalenderjaar voor vg3)', datatype='integer'), XmlField(name='gxg_hg3', source_xpath='/hg3', definition='gemiddelde van de drie hoogste grondwaterstanden in een hydrologisch ' 'jaar (1 april t/m 31 maart) bij een meetfrequentie van tweemaal per maand', datatype='float'), XmlField(name='gxg_lg3', source_xpath='/lg3', definition='gemiddelde van de drie laagste grondwaterstanden in een hydrologisch jaar ' '(1 april t/m 31 maart) bij een meetfrequentie van tweemaal per maand', datatype='float'), XmlField(name='gxg_vg3', source_xpath='/vg3', definition='gemiddelde van de grondwaterstanden op 14 maart, 28 maart en 14 april in ' 'een bepaald kalenderjaar', datatype='float') ] class GrondwaterFilterGxg(GrondwaterFilter): subtypes = [Gxg] from pydov.search.grondwaterfilter import GrondwaterFilterSearch from owslib.fes import PropertyIsEqualTo fs = GrondwaterFilterSearch(objecttype=GrondwaterFilterGxg) fs.get_fields()['gxg_vg3'] df = fs.search( query=PropertyIsEqualTo('pkey_filter', 'https://www.dov.vlaanderen.be/data/filter/1999-009146') ) df.head() from pydov.types.abstract import AbstractDovSubType from pydov.types.boring import Boring class Kleur(AbstractDovSubType): rootpath = './/boring/details/kleur' fields = [ XmlField(name='diepte_kleur_van', source_xpath='/van', definition='Bovenkant van de laag met een bepaalde bekisting, in meter.', datatype='float'), XmlField(name='diepte_kleur_tot', source_xpath='/tot', definition='Onderkant van de laag met een bepaalde bekisting, in meter.', datatype='float'), XmlField(name='kleur', source_xpath='/kleur', definition='Grondkleur voor het diepte-interval', datatype='string') ] class BoringKleur(Boring): subtypes = [Kleur] from pydov.search.boring import BoringSearch from owslib.fes import PropertyIsEqualTo bs = BoringSearch(objecttype=BoringKleur) bs.get_fields()['kleur'] df = bs.search( query=PropertyIsEqualTo('pkey_boring', 'https://www.dov.vlaanderen.be/data/boring/2004-103984') ) df.head() from pydov.types.fields import XmlField from owslib.fes import PropertyIsEqualTo from pydov.search.grondmonster import GrondmonsterSearch from pydov.types.grondmonster import Grondmonster class GlauconietWaarden(Grondmonster): fields = Grondmonster.extend_fields([ XmlField(name='glauconiet_gt500', source_xpath='/grondmonster/observatieData/observatie[' 'parameter="GLAUCONIET_GT500"]/' 'waarde_numeriek', definition='Glauconiet fractie groter 500 micron (%)', datatype='float'), XmlField(name='glauconiet_tss', source_xpath='/grondmonster/observatieData/observatie[' 'parameter="GLAUCONIET_TSS"]/' 'waarde_numeriek', definition='Glauconiet fractie kleiner 500micron en groter 63micron (%)', datatype='float'), XmlField(name='glauconiet_kl63', source_xpath='/grondmonster/observatieData/observatie[' 'parameter="GLAUCONIET_KL63"]/' 'waarde_numeriek', definition='Glauconiet fractie kleiner 63micron (%)', datatype='float') ]) gm = GrondmonsterSearch(objecttype=GlauconietWaarden) df = gm.search( query=PropertyIsEqualTo( propertyname='pkey_grondmonster', literal='https://www.dov.vlaanderen.be/data/grondmonster/2017-172111') ) df.head() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: While performing CPT measurements, different techniques can be used. Since these can have an impact on the results, it can be interesting to download this additional information in order to better comprehend the CPT data. Step2: A new subtype has to be a subclass of the AbstractDovSubType class and implement two class variables Step3: In order to be able to use this subtype in a search query, we have to create a subclass of the original main type (Sondering) and register our new subtype Step4: The next step is to instantiate the SonderingSearch class with our newly created type Step5: If everything worked out, you should be able to see the new fields in the get_fields output Step6: Querying is exactly the same as with the default Sondering type Step7: One can use the values from the XSD type to add a human-readably column with the different techniques Step8: Adding location and height details to Boring dataframe Step9: When instantiating our BoringSearch object, we now explicitly set our new type as objecttype to search Step10: Searching for boreholes remains exactly the same, but will reveal the extra information in the output dataframe Step11: Listing GxG for GrondwaterFilters Step12: Adding color to the Borehole dataframe Step13: List all glauconite fields for Grondmonsters
5,884
<ASSISTANT_TASK:> Python Code: # This is regular Python comment inside Jupyter "Code" cell. # You can easily run "Hello world" in the "Code" cell (focus on the cell and press Shift+Enter): print("Hello world!") %%bash echo "Current directory is: "; pwd echo "List of files in the current directory is: "; ls # Module import under custom name import numpy as np # You've started asking questions about it np? %%bash head -n 8 '../DATA/FASTQ/K562_B-bulk_R1.fastq' %%bash head -n 8 '../DATA/FASTQ/K562_B-bulk_R2.fastq' %%bash ls ../GENOMES/HG19_FASTA #%%bash #bowtie2-build /home/jovyan/GENOMES/HG19_FASTA/chr1.fa /home/jovyan/GENOMES/HG19_IND/hg19_chr1 #Time consuming step %%bash ls ../GENOMES/HG19_IND import os from hiclib import mapping from mirnylib import h5dict, genome %%bash which bowtie2 # Bowtie 2 path %%bash pwd # Current working directory path # Setting parameters and environmental variables bowtie_path = '/opt/conda/bin/bowtie2' enzyme = 'DpnII' bowtie_index_path = '/home/jovyan/GENOMES/HG19_IND/hg19_chr1' fasta_path = '/home/jovyan/GENOMES/HG19_FASTA/' chrms = ['1'] # Reading the genome genome_db = genome.Genome(fasta_path, readChrms=chrms) # Creating directories for further data processing if not os.path.exists('tmp/'): os.mkdir('tmp/', exists_) if not os.path.exists('../DATA/SAM/'): os.mkdir('../DATA/SAM/') # Set parameters for iterative mapping min_seq_len = 25 len_step = 5 nthreads = 2 temp_dir = 'tmp' bowtie_flags = '--very-sensitive' infile1 = '/home/jovyan/DATA/FASTQ1/K562_B-bulk_R1.fastq' infile2 = '/home/jovyan/DATA/FASTQ1/K562_B-bulk_R2.fastq' out1 = '/home/jovyan/DATA/SAM/K562_B-bulk_R1.chr1.sam' out2 = '/home/jovyan/DATA/SAM/K562_B-bulk_R2.chr1.sam' # Iterative mapping itself. Time consuming step! mapping.iterative_mapping( bowtie_path = bowtie_path, bowtie_index_path = bowtie_index_path, fastq_path = infile1, out_sam_path = out1, min_seq_len = min_seq_len, len_step = len_step, nthreads = nthreads, temp_dir = temp_dir, bowtie_flags = bowtie_flags) mapping.iterative_mapping( bowtie_path = bowtie_path, bowtie_index_path = bowtie_index_path, fastq_path = infile2, out_sam_path = out2, min_seq_len = min_seq_len, len_step = len_step, nthreads = nthreads, temp_dir = temp_dir, bowtie_flags = bowtie_flags) %%bash ls /home/jovyan/DATA/SAM/ %%bash head -n 10 /home/jovyan/DATA/SAM/K562_B-bulk_R1.chr1.sam.25 # Create the directory for output if not os.path.exists('../DATA/HDF5/'): os.mkdir('../DATA/HDF5/') # Define file name for output out = '/home/jovyan/DATA/HDF5/K562_B-bulk.fragments.hdf5' # Open output file mapped_reads = h5dict.h5dict(out) # Parse mapping data and write to output file mapping.parse_sam( sam_basename1 = out1, sam_basename2 = out2, out_dict = mapped_reads, genome_db = genome_db, enzyme_name = enzyme, save_seqs = False, keep_ids = False) %%bash ls /home/jovyan/DATA/HDF5/ import h5py # Reading the file a = h5py.File('/home/jovyan/DATA/HDF5/K562_B-bulk.fragments.hdf5') # "a" variable has dictionary-like structure, we can view its keys, for example: list( a.keys() ) # Mapping positions for forward reads are stored under 'cuts1' key: a['cuts1'].value from hiclib import fragmentHiC inp = '/home/jovyan/DATA/HDF5/K562_B-bulk.fragments.hdf5' out = '/home/jovyan/DATA/HDF5/K562_B-bulk.fragments_filtered.hdf5' # Create output file fragments = fragmentHiC.HiCdataset( filename = out, genome = genome_db, maximumMoleculeLength= 500, mode = 'w') # Parse input data fragments.parseInputData( dictLike=inp) # Filtering fragments.filterRsiteStart(offset=5) # reads map too close to restriction site fragments.filterDuplicates() # remove PCR duplicates fragments.filterLarge() # remove too large restriction fragments fragments.filterExtreme(cutH=0.005, cutL=0) # remove fragments with too high and low counts # Some hidden filteres were also applied, we can check them all: fragments.printMetadata() import pandas as pd df_stat = pd.DataFrame(list(fragments.metadata.items()), columns=['Feature', 'Count']) df_stat df_stat['Ratio of total'] = 100*df_stat['Count']/df_stat.loc[2,'Count'] df_stat # Define file name for binned data. Note "{}" prepared for string formatting out_bin = '/home/jovyan/DATA/HDF5/K562_B-bulk.binned_{}.hdf5' res_kb = [100, 20] # Several resolutions in Kb for res in res_kb: print(res) outmap = out_bin.format(str(res)+'kb') # String formatting fragments.saveHeatmap(outmap, res*1000) # Save heatmap del fragments # delete unwanted object # Importing visualisation modules import matplotlib as mpl import matplotlib.pyplot as plt import seaborn as sns sns.set_style('ticks') %matplotlib inline from hiclib.binnedData import binnedDataAnalysis res = 100 # Resolution in Kb # prepare to read the data data_hic = binnedDataAnalysis(resolution=res*1000, genome=genome_db) # read the data data_hic.simpleLoad('/home/jovyan/DATA/HDF5/K562_B-bulk.binned_{}.hdf5'.format(str(res)+'kb'),'hic') mtx = data_hic.dataDict['hic'] # show heatmap plt.figure(figsize=[15,15]) plt.imshow(mtx[0:200, 0:200], cmap='jet', interpolation='None') # Additional data filtering data_hic.removeDiagonal() data_hic.removePoorRegions() data_hic.removeZeros() data_hic.iterativeCorrectWithoutSS(force=True) data_hic.restoreZeros() mtx = data_hic.dataDict['hic'] plt.figure(figsize=[15,15]) plt.imshow(mtx[200:500, 200:500], cmap='jet', interpolation='None') # Load compartments computed previously based on K562 dataset from Rao et al. 2014 eig = np.loadtxt('/home/jovyan/DATA/ANNOT/comp_K562_100Kb_chr1.tsv') eig from matplotlib import gridspec bgn = 0 end = 500 fig = plt.figure(figsize=(10,10)) gs = gridspec.GridSpec(2, 1, height_ratios=[20,2]) gs.update(wspace=0.0, hspace=0.0) ax = plt.subplot(gs[0,0]) ax.matshow(mtx[bgn:end, bgn:end], cmap='jet', origin='lower', aspect='auto') ax.set_xticks([]) ax.set_yticks([]) axl = plt.subplot(gs[1,0]) plt.plot(range(end-bgn), eig[bgn:end] ) plt.xlim(0, end-bgn) plt.xlabel('Eigenvector values') ticks = range(bgn, end+1, 100) ticklabels = ['{} Kb'.format(x) for x in ticks] plt.xticks(ticks, ticklabels) print('') mtx_Rao = np.genfromtxt('../DATA/ANNOT/Rao_K562_chr1.csv', delimiter=',') bgn = 0 end = 500 fig = plt.figure(figsize=(10,10)) gs = gridspec.GridSpec(2, 1, height_ratios=[20,2]) gs.update(wspace=0.0, hspace=0.0) ax = plt.subplot(gs[0,0]) ax.matshow(mtx_Rao[bgn:end, bgn:end], cmap='jet', origin='lower', aspect='auto', vmax=1000) ax.set_xticks([]) ax.set_yticks([]) axl = plt.subplot(gs[1,0]) plt.plot(range(end-bgn), eig[bgn:end] ) plt.xlim(0, end-bgn) plt.xlabel('Eigenvector values') ticks = range(bgn, end+1, 100) ticklabels = ['{} Kb'.format(x) for x in ticks] plt.xticks(ticks, ticklabels) print('') # Import Python package import lavaburst good_bins = mtx.astype(bool).sum(axis=0) > 1 # We have to mask rows/cols if data is missing gam=[0.15, 0.25, 0.5, 0.75, 1.0] # set of parameters gamma for TADs calling segments_dict = {} for gam_current in gam: print(gam_current) S = lavaburst.scoring.armatus_score(mtx, gamma=gam_current, binmask=good_bins) model = lavaburst.model.SegModel(S) segments = model.optimal_segmentation() # Positions of TADs for input matrix segments_dict[gam_current] = segments.copy() A = mtx.copy() good_bins = A.astype(bool).sum(axis=0) > 0 At = lavaburst.utils.tilt_heatmap(mtx, n_diags=100) start_tmp = 0 end_tmp = 500 f = plt.figure(figsize=(20, 6)) ax = f.add_subplot(111) blues = sns.cubehelix_palette(0.4, gamma=0.5, rot=-0.3, dark=0.1, light=0.9, as_cmap=True) ax.matshow(np.log(At[start_tmp: end_tmp]), cmap=blues) cmap = mpl.cm.get_cmap('brg') gammas = segments_dict.keys() for n, gamma in enumerate(gammas): segments = segments_dict[gamma] for a in segments[:-1]: if a[1]<start_tmp or a[0]>end_tmp: continue ax.plot([a[0]-start_tmp, a[0]+(a[1]-a[0])/2-start_tmp], [0, -(a[1]-a[0])], c=cmap(n/len(gammas)), alpha=0.5) ax.plot([a[0]+(a[1]-a[0])/2-start_tmp, a[1]-start_tmp], [-(a[1]-a[0]), 0], c=cmap(n/len(gammas)), alpha=0.5) a = segments[-1] ax.plot([a[0]-start_tmp, a[0]+(a[1]-a[0])/2-start_tmp], [0, -(a[1]-a[0])], c=cmap(n/len(gammas)), alpha=0.5, label=gamma) ax.plot([a[0]+(a[1]-a[0])/2-start_tmp, a[1]-start_tmp], [-(a[1]-a[0]), 0], c=cmap(n/len(gammas)), alpha=0.5) ax.set_xlim([0,end_tmp-start_tmp]) ax.set_ylim([100,-100]) ax.legend(bbox_to_anchor=(1.1, 1.05)) ax.set_aspect(0.5) #Let's check what are median TAD sized with different parameters: for gam_current in gam: segments = segments_dict[gam_current] tad_lens = segments[:,1]-segments[:,0] good_lens = (tad_lens>=200/res)&(tad_lens<100) print(res*1000*np.mean(tad_lens[good_lens])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: There are also other types of cells, for example, "Markdown". Double click this cell to view raw Markdown markup content. Step2: If you are not sure about the function, class or variable then use its name with '?' at the end to get available documentation. Here is an example for common module numpy Step3: OK, it seems that now we are ready to start our Hi-C data analysis! I've placed Go top shortcut for you in each section so that you can navigate quickly throughout the notebook. Step4: 1.2 Genome Step5: For Hi-C data mapping we will use hiclib. It utilizes bowtie 2 read mapping software. Bowtie 2 indexes the genome prior to reads mapping in order to reduce memory usage. Usually, you have to run genome indexing, but I've already done this time-consuming step. That's why code for this step is included but commented. Step6: 1.3 Iterative mapping Step7: Then we need to set some parameters and prepare our environment Step8: Let's take a look at .sam files that were created during iterative mapping Step9: 1.4 Making sense of mapping output Step10: Let's take a look at the created file Step11: <a id="filtering"></a> Step12: Nice visualisation of the data Step13: <a id="binning"></a> Step14: <a id="visualisation"></a> Step15: <a id="correction"></a> Step16: <a id="meta"></a> Step17: Seems to be nothing special with compartments. What if we had much better coverage by reads? Let's take a look at the dataset from Rao et al. 2014, GEO GSE63525, HIC069 Step18: 7.2 Topologically associating domains (TADs)
5,885
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np from sklearn import preprocessing from sklearn.model_selection import train_test_split from sklearn.model_selection import cross_val_score from sklearn.feature_selection import RFE from sklearn.svm import SVR from sklearn.svm import LinearSVC from sklearn.svm import LinearSVR import seaborn as sns import matplotlib.pylab as pl %matplotlib inline #import matplotlib.pyplot as plt ## 2015 df_app_2015 = pd.read_csv('data/LoanStats3d_securev1.csv.zip', compression='zip', low_memory=False,\ header=1) df_app_2015.loan_status.unique() df_app_2015.head(5) df_app_2015['delinq_amnt'].unique() df_app_2015.info(max_cols=111) df_app_2015.groupby('title').loan_amnt.mean() df_app_2015.groupby('purpose').loan_amnt.mean() df_app_2015['emp_length'].unique() ## selected columns df = df_app_2015.ix[:, ['loan_status','loan_amnt', 'int_rate', 'grade', 'sub_grade',\ 'purpose',\ 'annual_inc', 'emp_length', 'home_ownership',\ 'fico_range_low','fico_range_high',\ 'num_actv_bc_tl', 'tot_cur_bal', 'mort_acc','num_actv_rev_tl',\ 'pub_rec_bankruptcies','dti' ]] df.head(3) len(df.dropna()) df.shape df.loan_status.unique() len(df[df['loan_status']=='Fully Paid']) len(df[df['loan_status']=='Default']) len(df[df['loan_status']=='Charged Off']) len(df[df['loan_status']=='Late (31-120 days)']) df.info() df.loan_status.unique() ## Convert applicable fields to numeric (I only select "Interest Rate" to use for this analysis) df.ix[:,'int_rate'] = df.ix[:,['int_rate']]\ .applymap(lambda e: pd.to_numeric(str(e).rstrip()[:-1], errors='coerce')) df.info() df = df.rename(columns={"int_rate": "int_rate(%)"}) df.head(3) #len(df.dropna(thresh= , axis=1).columns) df.describe() # 1. Loan Amount distribution # # create plots and histogram to visualize total loan amounts fig = pl.figure(figsize=(8,10)) ax1 = fig.add_subplot(211) ax1.plot(range(len(df)), sorted(df.loan_amnt), '.', color='purple') ax1.set_xlabel('Loan Applicant Count') ax1.set_ylabel('Loan Amount ($)') ax1.set_title('Fig 1a - Sorted Issued Loan Amount (2015)', size=15) # all_ histogram # pick upper bound 900 to exclude too large numbers ax2 = fig.add_subplot(212) ax2.hist(df.loan_amnt, range=(df.loan_amnt.min(), 36000), color='purple') ax2.set_xlabel('Loan Amount -$', size=12) ax2.set_ylabel('Counts',size=12) ax2.set_title('Fig 1b - Sorted Issued Loan Amount (2015)', size=15) inc_75 = df.describe().loc['75%', 'annual_inc'] count_75 = int(len(df)*0.75) # 2. Applicant Anual Income Distribution fig = pl.figure(figsize=(8,16)) ax0 = fig.add_subplot(311) ax0.plot(range(len(df.annual_inc)), sorted(df.annual_inc), '.', color='blue') ax0.set_xlabel('Loan Applicant Count') ax0.set_ylabel('Applicant Annual Income ($)') ax0.set_title('Fig 2a - Sorted Applicant Annual Income-all ($) (2015)', size=15) # use 75% quantile to plot the graph and histograms -- excluding extreme values inc_75 = df.describe().loc['75%', 'annual_inc'] inc_below75 = df.annual_inc[df.annual_inc <= inc_75] count_75 = int(len(df)*0.75) ax1 = fig.add_subplot(312) ax1.plot(range(count_75), sorted(df.annual_inc)[:count_75], '.', color='blue') ax1.set_xlabel('Loan Applicant Count') ax1.set_ylabel('Applicant Annual Income ($)') ax1.set_title('Fig 2b - Sorted Applicant Annual Income-75% ($) (2015)',size=15) # all_ histogram # pick upper bound 900 to exclude too large numbers ax2 = fig.add_subplot(313) ax2.hist(df.annual_inc, range=(df.annual_inc.min(), inc_75), color='blue') ax2.set_xlabel('Applicant Annual Income -$', size=12) ax2.set_ylabel('Counts',size=12) ax2.set_title('Fig 2c - Sorted Applicant Income-75% ($) (2015)',size=15) 4.600000e+04 # 3. Loan amount and Applicant Annual Income # View all pl.figure(figsize=(6,4)) pl.plot(df.annual_inc, df.loan_amnt, '.') pl.ylim(0, 40000) pl.xlim(0, 0.2e7) # df.annual_inc.max() pl.title('Fig 3a - Loan Amount VS Applicant Annual Income_all', size=15) pl.ylabel('Loan Amount ($)', size=15) pl.xlabel('Applicant Annual Income ($)', size=15) # 3b pl.figure(figsize=(6,4)) pl.plot(df.annual_inc, df.loan_amnt, '.') pl.ylim(0, 40000) pl.xlim(0, inc_75) pl.title('Fig 3b - Loan Amount VS Applicant Annual Income_75%', size=15) pl.ylabel('Loan Amount ($)', size=15) pl.xlabel('Applicant Annual Income ($)', size=15) pl.plot(np.log(df.annual_inc), np.log(df.loan_amnt), '.') # 4. Average loan amount groupby grade mean_loan_grade = df.groupby('grade')['loan_amnt'].mean() mean_loan_grade sum_loan_grade = df.groupby('grade')['loan_amnt'].sum() sum_loan_grade fig = pl.figure(figsize=(8,12)) #16,5 ax0 = fig.add_subplot(211) ax0.plot(range(len(mean_loan_grade)), mean_loan_grade, 'o', color='blue') ax0.set_ylim(0, 23000) ax0.set_xlim(-0.5, len(mean_loan_grade)) ax0.set_xticks(range(len(mean_loan_grade))) ax0.set_xticklabels(('A','B','C','D','E','F','G')) ax0.set_xlabel('Grade') ax0.set_ylabel('Average Loan Amount ($)') ax0.set_title('Fig 4a - Average Loan Amount by Grade ($) (2015)', size=15) ax1 = fig.add_subplot(212) ax1.plot(range(len(sum_loan_grade)), sum_loan_grade, 'o', color='brown') ax1.set_ylim(0, 2.3e9) ax1.set_xlim(-0.5, len(sum_loan_grade)) ax1.set_xticks(range(len(sum_loan_grade))) ax1.set_xticklabels(('A','B','C','D','E','F','G')) ax1.set_xlabel('Grade') ax1.set_ylabel('Total Loan Amount ($)') ax1.set_title('Fig 4b - Total Loan Amount by Grade ($) (2015)', size=15) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Columns Interested Step2: Decriptive Analyss Step3: Fig 1a shows the sorted issued loan amounts from low to high.<br/> Step4: Fig 2a and Fig 2b both show the sorted applicant annual income from low to high. The former indicates extreme values, and the latter plots only those values below the 75% quantile, which looks more sensible.<br/> Step5: Fig 3a shows the approved loan amount against the applicants' annual income. <br/> Step6: Fig 3b is plot of the loan amount VS applicant annual income with all extreme income amounts being excluded.
5,886
<ASSISTANT_TASK:> Python Code: %matplotlib inline %config InlineBackend.figure_format = 'svg' import numpy as np from exact_solvers import acoustics, acoustics_demos from IPython.display import IFrame, HTML, Image %matplotlib inline %config InlineBackend.figure_format = 'svg' import numpy as np from exact_solvers import acoustics, acoustics_demos from IPython.display import IFrame acoustics_demos.decompose_q_interactive() acoustics_demos.char_solution_interactive() Image('figures/acoustics_xt_plane.png', width=350) # Initial data for Riemann problem rho = 0.5 # density bulk = 2. # bulk modulus ql = np.array([3,2]) # Left state qr = np.array([3,-2]) # Right state # Calculated parameters c = np.sqrt(bulk/rho) # calculate sound speed Z = np.sqrt(bulk*rho) # calculate impedance print("With density rho = %g, bulk modulus K = %g" \ % (rho,bulk)) print("We compute: sound speed c = %g, impedance Z = %g \n" \ % (c,Z)) # Call and print Riemann solution states, speeds, reval = \ acoustics.exact_riemann_solution(ql ,qr, [rho, bulk]) print("The states ql, qm and qr are: ") print(states, "\n") print("The left and right wave speeds are:") print(speeds) acoustics_demos.interactive_phase_plane(ql,qr,rho,bulk) ql = np.array([5,0]) qr = np.array([1,0]) rho = 1.0 bulk = 4.0 acoustics_demos.riemann_plot_pplane(ql,qr,rho,bulk) ql = np.array([2,1]) qr = np.array([2,-1]) rho = 1.0 bulk = 1.5 acoustics_demos.riemann_plot_pplane(ql,qr,rho,bulk) IFrame(src='phase_plane/acoustics_small_notitle.html', width=980, height=340) anim = acoustics_demos.bump_animation(numframes = 50) HTML(anim) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: In this chapter we consider our first system of hyperbolic conservation laws. We study the acoustics equations that were introduced briefly in Introduction. We first describe the physical context of this system and then investigate its characteristic structure and the solution to the Riemann problem. This system is described in more detail in Chapter 3 of <cite data-cite="fvmhp"><a href="riemann.html#fvmhp">(LeVeque 2002)</a></cite>. Step2: In the second and third steps, we evolve the characteristic variables $w$ and then transform back to the original variables. We take as initial pressure a Gaussian, with zero initial velocity. We visualize this below, where the time evolution in the characteristic variables is shown in the first plot, and the time evolution of the velocity is shown in the second plot. Step3: In the live notebook, you can advance the above solutions in time and select which of the two characteristic variables to display. Step4: The three constant states are related by the jumps Step5: One way to visualize the Riemann solution for a system of two equations is by looking at the $p-u$ phase plane. In the figure below, we show the two initial conditions of the Riemann problem $q_\ell$ and $q_r$ as points in the phase space; the lines passing through these points correspond to the eigenvectors, $r_1$ and $r_2$. Step6: Note that the eigenvectors are given in terms of the impedance $Z$, which depends on the density $\rho$ Step7: We can also observe the structure of the solution in the phase plane. In the second plot, we show the structure of the solution in the phase plane. Step8: We again show the Riemann solution in space and in the phase plane, where the symmetry is also evident. Step9: Gaussian initial condition
5,887
<ASSISTANT_TASK:> Python Code: %%file my_first_test.py def f(a): return a def test_a(): assert f(1) == 1 !ls *.py !py.test !py.test -q !py.test -v %%file my_second_test.py def f(a): return a def test_a(): assert f(1) == 1 def test_b(): assert f(2) == 1 def test_c(): assert f(3) == 1 + 1 + 1 !py.test -v %%file my_third_test.py import pytest def h(n): if n < 0: raise ValueError("Negative value detected") return n def test_h(): assert h(1) == 1 def test_exception_h(): with pytest.raises(ValueError): h(-1) !py.test -v my_third_test.py %%file my_first_fixture.py import pytest def g(a): return 2 * a @pytest.fixture def numbers(): return 42 def test_g(numbers): assert g(numbers) == numbers + numbers def test_2g(numbers): assert g(2*numbers) == 4 * numbers !py.test -v my_first_fixture.py %%file my_parametrized_fixture.py import pytest def g(a): return 2 * a @pytest.fixture(params=[10, 50, 100]) def numbers(request): return request.param def test_g(numbers): assert g(numbers) == numbers + numbers def test_2g(numbers): assert g(2*numbers) == 4 * numbers !py.test -v my_parametrized_fixture.py %%file my_combined_fixture.py import pytest def w(a): if a == -50: raise ValueError("The value cannot be -50") return a @pytest.fixture(params=[10, 50, 100]) def numbers(request): return request.param @pytest.fixture(params=[-1, 1]) def sign(request): return request.param def test_w(numbers, sign): value = numbers * sign assert w(value) == value !py.test -v my_combined_fixture.py # Depending on where you are at this point do not run this %cd ../euclid/ !make clean !tree # %load tests/conftest.py #!/usr/bin/env python import pytest import numpy as np @pytest.fixture def simplearray(): Basic fixture: a simple numpy array for general testing purposes return np.array([1, 2, 3]) @pytest.fixture(params=[10, 100, 1000]) def arraysize(request): Parametrized fixture: a numpy array with a varying size The parameters should be set as a list under the `params` keyword Then in the fixture definition, the `request` argument must be used in order to retrieve the parameters return np.arange(request.param) @pytest.fixture(params=[np.int32, np.int64, np.float32, np.float64]) def dtypes(request): Parametrized fixture: returns numpy data types More information on fixtures can be found on http://pytest.org/latest/fixture.html and http://pytest.org/latest/builtin.html#_pytest.python.fixture return request.param # %load tests/test_mytrigo.py #!/usr/bin/env python import pytest import numpy as np from numpy.testing import assert_almost_equal from euclid.maths import trigo, trigonp def test_trigo_simple(): The simplest test: assert <condition that should be met> assert trigo(10) == 1 def test_trigo_simple_fail(): Catching a specific Exception with pytest.raises(Exception): <call that should raise the exception> with pytest.raises(ValueError): trigo(-40) def test_trigonp_simple(simplearray): Using a simple fixture from the conftest.py file. The fixture to be used in the test should be given as argument of the test: here a basic numpy array The fixture is then called during the test. It avoids hardcoding the same array for every test. In this specific test, since the equality test "==" on numpy arrays returns an array of booleans, one must check that all the elements are `True` with the np.all() method. However due to floating point errors in the calculation of trigonp, the returned values are not always equal to one. Thus the use np.allclose() allows for some tiny departure around the checked value. assert np.allclose(trigonp(simplearray), np.ones_like(simplearray, dtype=float)) def test_trigonp_size(arraysize): This time, the fixture `arraysize` takes several parameters in input (see conftest.py) This means that every test using the fixture will be run for every parameter of the fixture. In this case the test will be on arrays with different size. Moreover, we introduce here test triggers provided in the `numpy.testing` submodule. The various numpy assert methods can be parametrized in many ways to ensure both the precision and the accuracy of the tests. assert_almost_equal(trigonp(arraysize), np.ones_like(arraysize, dtype=float)) def test_trigonp_dtype(simplearray, dtypes): Various fixtures can be used for a given test. Again they need to be mentioned as arguments of the tests. Here we test the method on the `simplearray` and different data types `dtypes`. assert_almost_equal(trigonp(simplearray), np.ones_like(simplearray, dtype=dtypes)) def test_trigonp_dim_and_dtype(arraysize, dtypes): In the specific case where several fixtures are parametrized, the a single test will be run for each combination of the full parameter set. Here we test both the array size and the data type, and for each size of array, all data types will be tested, that is 3 size x 4 dtype = 12 combinations assert_almost_equal(trigonp(arraysize), np.ones_like(arraysize, dtype=dtypes)) !make test # or !py.test -v !py.test --cov euclid/ from IPython.core.display import HTML HTML(open('../styles/notebook.css', 'r').read()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The file has been saved in the current directory Step2: Launching pytest is as easy as move to the right directory and using the command line Step3: To get less information, use the quick option -q Step4: To get more information of which test has been run, use the verbose option -v Step5: The basic test test_a has passed. Step6: We see pytest has collected and run 4 items, 1 from the first file, and 3 from the second. Step7: Using fixtures Step8: Extended fixtures Step9: Two tests have been written but pytest has collected 6 items, meaning 3 items per test. Using the verbose option, one can see at the end of each test which parameter of the fixture has been used for this given test. Step10: numbers has 3 parameters, sign has 2 parameters, hence the simultaneous use of these fixtures probes 3 x 2 = 6 combinations of parameters. As expected, the test has failed for the -50 value. Step11: This directory contains a Makefile with three utility commands Step12: In order to visualize the arborescence of the module and test directory, I recommend using the Linux utility tree which can be install in the VM with Step16: Except from the Makefile, there are two directories, the module euclid and the test directory tests. Step23: conftest.py contains 3 fixtures Step24: test_mytrigo.py contains 6 tests, some of which rely on 2 fixtures. However, as mentioned, the fixtures can be used without being imported. Step25: These tests summarize well all the properties explained in the previous paragraphs Step26: One can see that hello.py and mytime.py are not covered by tests.
5,888
<ASSISTANT_TASK:> Python Code: # Get ftp://ftp.ncbi.nlm.nih.gov/gene/DATA/gene2go.gz from goatools.base import download_ncbi_associations gene2go = download_ncbi_associations() from goatools.associations import read_ncbi_gene2go geneid2gos_human = read_ncbi_gene2go(gene2go, taxids=[9606]) geneid2gos_fly = read_ncbi_gene2go(gene2go, taxids=[7227]) from collections import defaultdict, namedtuple taxid2asscs = defaultdict(lambda: defaultdict(lambda: defaultdict(set))) geneid2gos_all = read_ncbi_gene2go( gene2go, taxids=[9606, 7227], taxid2asscs=taxid2asscs) from goatools.test_data.genes_NCBI_9606_ProteinCoding import GeneID2nt as GeneID2nt_human from goatools.test_data.genes_NCBI_7227_ProteinCoding import GeneID2nt as GeneID2nt_fly lst = [ (9606, GeneID2nt_human), (7227, GeneID2nt_fly) ] cov_data = [] NtCov = namedtuple("NtCov", "taxid num_GOs num_covgenes coverage num_allgenes") for taxid, pcGeneID2nt in lst: # Get GeneID2GOs association for current species geneid2gos = taxid2asscs[taxid]['GeneID2GOs'] # Restrict GeneID2GOs to only protein-coding genes for this report pcgene_w_gos = set(geneid2gos.keys()).intersection(set(pcGeneID2nt.keys())) num_pcgene_w_gos = len(pcgene_w_gos) num_pc_genes = len(pcGeneID2nt) # Number of GO terms annotated to protein-coding genes gos_pcgenes = set() for geneid in pcgene_w_gos: gos_pcgenes |= geneid2gos[geneid] # Print report data cov_data.append(NtCov( taxid = taxid, num_GOs = len(gos_pcgenes), num_covgenes = num_pcgene_w_gos, coverage = 100.0*num_pcgene_w_gos/num_pc_genes, num_allgenes = num_pc_genes)) from __future__ import print_function print(" taxid GOs GeneIDs Coverage") print("------ ------ ------- ----------------------") fmtstr = "{TAXID:>6} {N:>6,} {M:>7,} {COV:2.0f}% GO coverage of {TOT:,} protein-coding genes" for nt in cov_data: print(fmtstr.format( TAXID = nt.taxid, N = nt.num_GOs, M = nt.num_covgenes, COV = nt.coverage, TOT = nt.num_allgenes)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2. Read associations Step2: 2b. Or you can read 'gene2go' once and load all species... Step3: 3. Import protein-coding information for human and fly Step4: 4. Calculate Gene Ontology coverage Step5: 5 Report Gene Ontology coverage for human and fly
5,889
<ASSISTANT_TASK:> Python Code: %%file consumer.py import sys import socket from collections import Counter HOST = sys.argv[1] PORT = int(sys.argv[2]) s = socket.socket() s.bind((HOST, PORT)) s.listen(4) connection, address = s.accept() c = Counter() while True: line = connection.recv(64) words = line.split() if words: c.update(words) print(c.most_common(5)) %%file client.py import socket import time import sys HOST = sys.argv[1] PORT = int(sys.argv[2]) s = socket.socket() s.connect((HOST, PORT)) while True: for line in open('data/Ulysses.txt'): s.sendall(str.encode(line)) time.sleep(1) from pyspark import SparkContext sc = SparkContext('local[*]') lines = sc.textFile('data/Ulysses.txt') counts = (lines.flatMap(lambda line: line.split()) .map(lambda word: (word, 1)) .reduceByKey(lambda x,y: x+ y)) counts.takeOrdered(5, key=lambda x: -x[1]) %%file file_consumer.py import sys from pyspark import SparkContext from pyspark.streaming import StreamingContext sc = SparkContext('local[*]') sc.setLogLevel("WARN") ssc = StreamingContext(sc, 2) lines = ssc.textFileStream(sys.argv[1]) counts = (lines.flatMap(lambda line: line.split()) .map(lambda word: (word, 1)) .reduceByKey(lambda x,y: x+ y)) counts.pprint() ssc.start() ssc.awaitTermination() %%file socket_consumer.py import sys from pyspark import SparkContext from pyspark.streaming import StreamingContext sc = SparkContext('local[*]') sc.setLogLevel("WARN") ssc = StreamingContext(sc, 2) lines = ssc.socketTextStream(sys.argv[1], int(sys.argv[2])) counts = (lines.flatMap(lambda line: line.split()) .map(lambda word: (word, 1)) .reduceByKey(lambda x,y: x+ y)) counts.pprint() ssc.start() ssc.awaitTermination() %%file stateful_socket_consumer.py import sys from pyspark import SparkContext from pyspark.streaming import StreamingContext def updateFunc(new, last): if last is None: last = 0 return sum(new) + last sc = SparkContext('local[*]') sc.setLogLevel("WARN") ssc = StreamingContext(sc, 2) ssc.checkpoint("checkpoint") lines = ssc.socketTextStream(sys.argv[1], int(sys.argv[2])) counts = (lines.flatMap(lambda line: line.split()) .map(lambda word: (word, 1)) .updateStateByKey(updateFunc) .transform(lambda x: x.sortByKey())) counts.pprint() ssc.start() ssc.awaitTermination() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Producer sends data to server for processing Step2: Using Spark Streaming Step3: Monitor a directory for new or renamed files Step4: Usage Step5: Usage
5,890
<ASSISTANT_TASK:> Python Code: %matplotlib inline from load_environment import * # python file with imports and basics to set up this computing environment f0 = np.average(data[:32], axis=0) plt.imshow(f0); plt.title("Average of First 32 Frames"); plt.show() plt.subplot(121) f41 = data[41] plt.imshow(f41); plt.title("Unprocessed Fluorescence") plt.subplot(122) plt.imshow((f41-f0)/f0); plt.title("Relative Fluorescence"); plt.show() cpy = data[32:].copy() # Not to ruin future experiments on the original data plt.subplot(131); plt.imshow(cpy.max(axis=0)); plt.title("Maximum F"); for f in cpy: f = (f-f0)/f0 maxFluorescence = cpy.max(axis=0) plt.subplot(132); plt.imshow(maxFluorescence); plt.title("Maximum $\Delta F$"); plt.subplot(133); plt.imshow(np.average(cpy, axis=0)); plt.title("Temporal Mean"); plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: First we will take a look at the fluorescence "base line" Step2: Now compare the fluorescence of a regular signal to its relative fluorescence Step3: Now lets compare the maximum of each individual time signal within the relative fluorescences with the maximum of the regular data and the signal mean
5,891
<ASSISTANT_TASK:> Python Code: from jyquickhelper import add_notebook_menu add_notebook_menu() %matplotlib inline try: import mkl mkl.set_num_threads(1) except ModuleNotFoundError as e: print('mkl not found', e) import os os.environ['MKL_NUM_THREADS']='1' # int nb = 0; # for(auto it = values.begin(); it != values.end(); ++it) # if (*it >= th) nb++; // this line changes # if (*it >= th) nb++; // and is repeated 10 times inside the loop. # // ... 10 times # return nb; from cpyquickhelper.numbers.cbenchmark_dot import measure_scenario_A, measure_scenario_B from cpyquickhelper.numbers.cbenchmark_dot import measure_scenario_C, measure_scenario_D from cpyquickhelper.numbers.cbenchmark_dot import measure_scenario_E, measure_scenario_F from cpyquickhelper.numbers.cbenchmark_dot import measure_scenario_G, measure_scenario_H from cpyquickhelper.numbers.cbenchmark_dot import measure_scenario_I, measure_scenario_J import pandas def test_benchmark(label, values, th, repeat=10, number=20): funcs = [(k, v) for k, v in globals().copy().items() if k.startswith("measure_scenario")] rows = [] for k, v in funcs: exe = v(values, th, repeat, number) d = exe.todict() d['doc'] = v.__doc__.split('``')[1] d['label'] = label d['name'] = k rows.append(d) df = pandas.DataFrame(rows) return df test_benchmark("sorted", list(range(10)), 5) values = list(range(100000)) df_sorted = test_benchmark("sorted", values, len(values)//2, repeat=200) df_sorted import random random.shuffle(values) values = values.copy() values[:10] df_shuffled = test_benchmark("shuffled", values, len(values)//2, repeat=200) df_shuffled df = pandas.concat([df_sorted, df_shuffled]) dfg = df[["doc", "label", "average"]].pivot("doc", "label", "average") ax = dfg.plot.bar(rot=30) labels = [l.get_text() for l in ax.get_xticklabels()] ax.set_xticklabels(labels, ha='right') ax.set_title("Comparison of all implementations"); sdf = df[["doc", "label", "average"]] dfg2 = sdf[sdf.doc.str.contains('[?^]')].pivot("doc", "label", "average") ax = dfg2.plot.bar(rot=30) labels = [l.get_text() for l in ax.get_xticklabels()] ax.set_xticklabels(labels, ha='right') ax.set_title("Comparison of implementations using ? :"); sdf = df[["doc", "label", "average"]] dfg2 = sdf[sdf.doc.str.contains('if')].pivot("doc", "label", "average") ax = dfg2.plot.bar(rot=30) labels = [l.get_text() for l in ax.get_xticklabels()] ax.set_xticklabels(labels, ha='right') ax.set_ylim([0.0004, 0.0020]) ax.set_title("Comparison of implementations using tests"); # float vector_dot_product_pointer(const float *p1, const float *p2, size_t size) # { # float sum = 0; # const float * end1 = p1 + size; # for(; p1 != end1; ++p1, ++p2) # sum += *p1 * *p2; # return sum; # } # # # float vector_dot_product(py::array_t<float> v1, py::array_t<float> v2) # { # if (v1.ndim() != v2.ndim()) # throw std::runtime_error("Vector v1 and v2 must have the same dimension."); # if (v1.ndim() != 1) # throw std::runtime_error("Vector v1 and v2 must be vectors."); # return vector_dot_product_pointer(v1.data(0), v2.data(0), v1.shape(0)); # } %matplotlib inline import numpy def simple_dot(values): return numpy.dot(values, values) values = list(range(10000000)) values = numpy.array(values, dtype=numpy.float32) vect = values / numpy.max(values) simple_dot(vect) vect.dtype from timeit import Timer def measure_time(stmt, context, repeat=10, number=50): tim = Timer(stmt, globals=context) res = numpy.array(tim.repeat(repeat=repeat, number=number)) mean = numpy.mean(res) dev = numpy.mean(res ** 2) dev = (dev - mean**2) ** 0.5 return dict(average=mean, deviation=dev, min_exec=numpy.min(res), max_exec=numpy.max(res), repeat=repeat, number=number, size=context['values'].shape[0]) measure_time("simple_dot(values)", context=dict(simple_dot=simple_dot, values=vect)) res = [] for i in range(10, 200000, 2500): t = measure_time("simple_dot(values)", repeat=100, context=dict(simple_dot=simple_dot, values=vect[:i].copy())) res.append(t) import pandas dot = pandas.DataFrame(res) dot.tail() res = [] for i in range(100000, 10000000, 1000000): t = measure_time("simple_dot(values)", repeat=10, context=dict(simple_dot=simple_dot, values=vect[:i].copy())) res.append(t) huge_dot = pandas.DataFrame(res) huge_dot.head() import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0]) huge_dot.plot(x='size', y="average", ax=ax[1], logy=True) ax[0].set_title("numpy dot product execution time"); ax[1].set_title("numpy dot product execution time"); def simple_dot_einsum(values): return numpy.einsum('i,i->', values, values) values = list(range(10000000)) values = numpy.array(values, dtype=numpy.float32) vect = values / numpy.max(values) simple_dot_einsum(vect) measure_time("simple_dot_einsum(values)", context=dict(simple_dot_einsum=simple_dot_einsum, values=vect)) res = [] for i in range(10, 200000, 2500): t = measure_time("simple_dot_einsum(values)", repeat=100, context=dict(simple_dot_einsum=simple_dot_einsum, values=vect[:i].copy())) res.append(t) import pandas einsum_dot = pandas.DataFrame(res) einsum_dot.tail() import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 1, figsize=(7,4)) dot.plot(x='size', y="average", ax=ax, label="numpy.dot", logy=True) einsum_dot.plot(x='size', y="average", ax=ax, logy=True,label="numpy.einsum") ax.set_title("numpy einsum / dot dot product execution time"); from cpyquickhelper.numbers.cbenchmark_dot import empty_vector_dot_product empty_vector_dot_product(vect, vect) def empty_c11_dot(vect): return empty_vector_dot_product(vect, vect) measure_time("empty_c11_dot(values)", context=dict(empty_c11_dot=empty_c11_dot, values=vect), repeat=10) from cpyquickhelper.numbers.cbenchmark_dot import vector_dot_product vector_dot_product(vect, vect) def c11_dot(vect): return vector_dot_product(vect, vect) measure_time("c11_dot(values)", context=dict(c11_dot=c11_dot, values=vect), repeat=10) res = [] for i in range(10, 200000, 2500): t = measure_time("c11_dot(values)", repeat=10, context=dict(c11_dot=c11_dot, values=vect[:i].copy())) res.append(t) import pandas cus_dot = pandas.DataFrame(res) cus_dot.tail() fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0], label="numpy") cus_dot.plot(x='size', y="average", ax=ax[0], label="pybind11") dot.plot(x='size', y="average", ax=ax[1], label="numpy", logy=True) cus_dot.plot(x='size', y="average", ax=ax[1], label="pybind11") ax[0].set_title("numpy and custom dot product execution time"); ax[1].set_title("numpy and custom dot product execution time"); from cpyquickhelper.numbers.direct_blas_lapack import cblas_sdot def blas_dot(vect): return cblas_sdot(vect, vect) measure_time("blas_dot(values)", context=dict(blas_dot=blas_dot, values=vect), repeat=10) res = [] for i in range(10, 200000, 2500): t = measure_time("blas_dot(values)", repeat=10, context=dict(blas_dot=blas_dot, values=vect[:i].copy())) res.append(t) import pandas blas_dot = pandas.DataFrame(res) blas_dot.tail() fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0], label="numpy") cus_dot.plot(x='size', y="average", ax=ax[0], label="pybind11") blas_dot.plot(x='size', y="average", ax=ax[0], label="blas") dot.plot(x='size', y="average", ax=ax[1], label="numpy", logy=True) cus_dot.plot(x='size', y="average", ax=ax[1], label="pybind11") blas_dot.plot(x='size', y="average", ax=ax[1], label="blas") ax[0].set_title("numpy and custom dot product execution time"); ax[1].set_title("numpy and custom dot product execution time"); # float vector_dot_product_pointer16(const float *p1, const float *p2) # { # float sum = 0; # # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # sum += *(p1++) * *(p2++); # # return sum; # } # # #define BYN 16 # # float vector_dot_product_pointer16(const float *p1, const float *p2, size_t size) # { # float sum = 0; # size_t i = 0; # if (size >= BYN) { # size_t size_ = size - BYN; # for(; i < size_; i += BYN, p1 += BYN, p2 += BYN) # sum += vector_dot_product_pointer16(p1, p2); # } # for(; i < size; ++p1, ++p2, ++i) # sum += *p1 * *p2; # return sum; # } # # float vector_dot_product16(py::array_t<float> v1, py::array_t<float> v2) # { # if (v1.ndim() != v2.ndim()) # throw std::runtime_error("Vector v1 and v2 must have the same dimension."); # if (v1.ndim() != 1) # throw std::runtime_error("Vector v1 and v2 must be vectors."); # return vector_dot_product_pointer16(v1.data(0), v2.data(0), v1.shape(0)); # } from cpyquickhelper.numbers.cbenchmark_dot import vector_dot_product16 vector_dot_product16(vect, vect) def c11_dot16(vect): return vector_dot_product16(vect, vect) measure_time("c11_dot16(values)", context=dict(c11_dot16=c11_dot16, values=vect), repeat=10) res = [] for i in range(10, 200000, 2500): t = measure_time("c11_dot16(values)", repeat=10, context=dict(c11_dot16=c11_dot16, values=vect[:i].copy())) res.append(t) cus_dot16 = pandas.DataFrame(res) cus_dot16.tail() fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0], label="numpy") cus_dot.plot(x='size', y="average", ax=ax[0], label="pybind11") cus_dot16.plot(x='size', y="average", ax=ax[0], label="pybind11x16") dot.plot(x='size', y="average", ax=ax[1], label="numpy", logy=True) cus_dot.plot(x='size', y="average", ax=ax[1], label="pybind11") cus_dot16.plot(x='size', y="average", ax=ax[1], label="pybind11x16") ax[0].set_title("numpy and custom dot product execution time"); ax[1].set_title("numpy and custom dot product execution time"); # float vector_dot_product_pointer16_nofcall(const float *p1, const float *p2, size_t size) # { # float sum = 0; # const float * end = p1 + size; # if (size >= BYN) { # #if(BYN != 16) # #error "BYN must be equal to 16"; # #endif # unsigned int size_ = (unsigned int) size; # size_ = size_ >> 4; // division by 16=2^4 # size_ = size_ << 4; // multiplication by 16=2^4 # const float * end_ = p1 + size_; # for(; p1 != end_;) # { # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # sum += *p1 * *p2; ++p1, ++p2; # } # } # for(; p1 != end; ++p1, ++p2) # sum += *p1 * *p2; # return sum; # } # # float vector_dot_product16_nofcall(py::array_t<float> v1, py::array_t<float> v2) # { # if (v1.ndim() != v2.ndim()) # throw std::runtime_error("Vector v1 and v2 must have the same dimension."); # if (v1.ndim() != 1) # throw std::runtime_error("Vector v1 and v2 must be vectors."); # return vector_dot_product_pointer16_nofcall(v1.data(0), v2.data(0), v1.shape(0)); # } from cpyquickhelper.numbers.cbenchmark_dot import vector_dot_product16_nofcall vector_dot_product16_nofcall(vect, vect) def c11_dot16_nofcall(vect): return vector_dot_product16_nofcall(vect, vect) measure_time("c11_dot16_nofcall(values)", context=dict(c11_dot16_nofcall=c11_dot16_nofcall, values=vect), repeat=10) res = [] for i in range(10, 200000, 2500): t = measure_time("c11_dot16_nofcall(values)", repeat=10, context=dict(c11_dot16_nofcall=c11_dot16_nofcall, values=vect[:i].copy())) res.append(t) cus_dot16_nofcall = pandas.DataFrame(res) cus_dot16_nofcall.tail() fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0], label="numpy") cus_dot.plot(x='size', y="average", ax=ax[0], label="pybind11") cus_dot16.plot(x='size', y="average", ax=ax[0], label="pybind11x16") cus_dot16_nofcall.plot(x='size', y="average", ax=ax[0], label="pybind11x16_nofcall") dot.plot(x='size', y="average", ax=ax[1], label="numpy", logy=True) cus_dot.plot(x='size', y="average", ax=ax[1], label="pybind11") cus_dot16.plot(x='size', y="average", ax=ax[1], label="pybind11x16") cus_dot16_nofcall.plot(x='size', y="average", ax=ax[1], label="pybind11x16_nofcall") ax[0].set_title("numpy and custom dot product execution time"); ax[1].set_title("numpy and custom dot product execution time"); # #include <xmmintrin.h> # # float vector_dot_product_pointer16_sse(const float *p1, const float *p2) # { # __m128 c1 = _mm_load_ps(p1); # __m128 c2 = _mm_load_ps(p2); # __m128 r1 = _mm_mul_ps(c1, c2); # # p1 += 4; # p2 += 4; # # c1 = _mm_load_ps(p1); # c2 = _mm_load_ps(p2); # r1 = _mm_add_ps(r1, _mm_mul_ps(c1, c2)); # # p1 += 4; # p2 += 4; # # c1 = _mm_load_ps(p1); # c2 = _mm_load_ps(p2); # r1 = _mm_add_ps(r1, _mm_mul_ps(c1, c2)); # # p1 += 4; # p2 += 4; # # c1 = _mm_load_ps(p1); # c2 = _mm_load_ps(p2); # r1 = _mm_add_ps(r1, _mm_mul_ps(c1, c2)); # # float r[4]; # _mm_store_ps(r, r1); # # return r[0] + r[1] + r[2] + r[3]; # } from cpyquickhelper.numbers.cbenchmark_dot import vector_dot_product16_sse vector_dot_product16_sse(vect, vect) def c11_dot16_sse(vect): return vector_dot_product16_sse(vect, vect) measure_time("c11_dot16_sse(values)", context=dict(c11_dot16_sse=c11_dot16_sse, values=vect), repeat=10) res = [] for i in range(10, 200000, 2500): t = measure_time("c11_dot16_sse(values)", repeat=10, context=dict(c11_dot16_sse=c11_dot16_sse, values=vect[:i].copy())) res.append(t) cus_dot16_sse = pandas.DataFrame(res) cus_dot16_sse.tail() fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0], label="numpy") cus_dot16_sse.plot(x='size', y="average", ax=ax[0], label="pybind11x16_sse") dot.plot(x='size', y="average", ax=ax[1], label="numpy", logy=True) cus_dot16_sse.plot(x='size', y="average", ax=ax[1], label="pybind11x16_sse") cus_dot.plot(x='size', y="average", ax=ax[1], label="pybind11") cus_dot16.plot(x='size', y="average", ax=ax[1], label="pybind11x16") ax[0].set_title("numpy and custom dot product execution time"); ax[1].set_title("numpy and custom dot product execution time"); import platform platform.processor() import numpy values = numpy.array(list(range(10000000)), dtype=numpy.float32) vect = values / numpy.max(values) from cpyquickhelper.numbers.cbenchmark_dot import vector_dot_product16_avx512 vector_dot_product16_avx512(vect, vect) def c11_dot16_avx512(vect): return vector_dot_product16_avx512(vect, vect) measure_time("c11_dot16_avx512(values)", context=dict(c11_dot16_avx512=c11_dot16_avx512, values=vect), repeat=10) res = [] for i in range(10, 200000, 2500): t = measure_time("c11_dot16_avx512(values)", repeat=10, context=dict(c11_dot16_avx512=c11_dot16_avx512, values=vect[:i].copy())) res.append(t) cus_dot16_avx512 = pandas.DataFrame(res) cus_dot16_avx512.tail() fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0], label="numpy") cus_dot16.plot(x='size', y="average", ax=ax[0], label="pybind11x16") cus_dot16_sse.plot(x='size', y="average", ax=ax[0], label="pybind11x16_sse") cus_dot16_avx512.plot(x='size', y="average", ax=ax[0], label="pybind11x16_avx512") dot.plot(x='size', y="average", ax=ax[1], label="numpy", logy=True) cus_dot16.plot(x='size', y="average", ax=ax[1], label="pybind11x16") cus_dot16_sse.plot(x='size', y="average", ax=ax[1], label="pybind11x16_sse") cus_dot16_avx512.plot(x='size', y="average", ax=ax[1], label="pybind11x16_avx512") cus_dot.plot(x='size', y="average", ax=ax[1], label="pybind11") ax[0].set_title("numpy and custom dot product execution time"); ax[1].set_title("numpy and custom dot product execution time"); from cpyquickhelper.numbers.cbenchmark import get_simd_available_option get_simd_available_option() from cpyquickhelper.numbers.cbenchmark_dot import vector_dot_product_openmp vector_dot_product_openmp(vect, vect, 2) vector_dot_product_openmp(vect, vect, 4) def c11_dot_openmp2(vect): return vector_dot_product_openmp(vect, vect, nthreads=2) def c11_dot_openmp4(vect): return vector_dot_product_openmp(vect, vect, nthreads=4) measure_time("c11_dot_openmp2(values)", context=dict(c11_dot_openmp2=c11_dot_openmp2, values=vect), repeat=10) measure_time("c11_dot_openmp4(values)", context=dict(c11_dot_openmp4=c11_dot_openmp4, values=vect), repeat=10) res = [] for i in range(10, 200000, 2500): t = measure_time("c11_dot_openmp2(values)", repeat=10, context=dict(c11_dot_openmp2=c11_dot_openmp2, values=vect[:i].copy())) res.append(t) cus_dot_openmp2 = pandas.DataFrame(res) cus_dot_openmp2.tail() res = [] for i in range(10, 200000, 2500): t = measure_time("c11_dot_openmp4(values)", repeat=10, context=dict(c11_dot_openmp4=c11_dot_openmp4, values=vect[:i].copy())) res.append(t) cus_dot_openmp4 = pandas.DataFrame(res) cus_dot_openmp4.tail() fig, ax = plt.subplots(1, 2, figsize=(14,4)) dot.plot(x='size', y="average", ax=ax[0], label="numpy") cus_dot16.plot(x='size', y="average", ax=ax[0], label="pybind11x16") cus_dot16_sse.plot(x='size', y="average", ax=ax[0], label="pybind11x16_sse") cus_dot_openmp2.plot(x='size', y="average", ax=ax[0], label="cus_dot_openmp2") cus_dot_openmp4.plot(x='size', y="average", ax=ax[0], label="cus_dot_openmp4") dot.plot(x='size', y="average", ax=ax[1], label="numpy", logy=True) cus_dot16.plot(x='size', y="average", ax=ax[1], label="pybind11x16") cus_dot16_sse.plot(x='size', y="average", ax=ax[1], label="pybind11x16_sse") cus_dot_openmp2.plot(x='size', y="average", ax=ax[1], label="cus_dot_openmp2") cus_dot_openmp4.plot(x='size', y="average", ax=ax[1], label="cus_dot_openmp4") cus_dot.plot(x='size', y="average", ax=ax[1], label="pybind11") ax[0].set_title("numpy and custom dot product execution time"); ax[1].set_title("numpy and custom dot product execution time"); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: numpy is multithreaded. For an accurate comparison, this needs to be disabled. This can be done as follows or by setting environment variable MKL_NUM_THREADS=1. Step2: First experiment Step3: The third line is also repeated 10 times to avoid the loop being too significant. Step4: Times are not very conclusive on such small lists. Step5: The article some implementations will be slower if the values are not sorted. Step6: It seems that inline tests (cond ? value1 Step7: sorted, not sorted does not seem to have a real impact in this case. It shows branching really slows down the execution of a program. Branching happens whenever the program meets a loop condition or a test. Iterator *it are faster than accessing an array with notation [i] which adds a cost due to an extra addition. Step8: numpy vs C++ Step9: numpy.einsum Step10: The function einsum is slower (see Einsum - Einstein summation in deep learning appears to be slower but it is usually faster when it comes to chain operations as it reduces the number of intermediate allocations to do. Step11: Very small. It should not pollute our experiments. Step12: Pretty slow. Let's see what it does to compute dot product 16 by 16. Step13: Use of branching Step14: We are far from numpy but the branching has clearly a huge impact and the fact the loop condition is evaluated only every 16 iterations does not explain this gain. Next experiment with SSE instructions. Step15: Weird, branching did not happen when the code is not inside a separate function. Step16: Better even though it is still slower than numpy. It is closer. Maybe the compilation option are not optimized, numpy was also compiled with the Intel compiler. To be accurate, multi-threading must be disabled on numpy side. That's the purpose of the first two lines. Step17: If the time is the same, it means that options AVX512 are not available. Step18: Last call with OpenMP
5,892
<ASSISTANT_TASK:> Python Code: %matplotlib inline import pandas as pd import matplotlib.pyplot as plt import seaborn as sns plt.rcParams['figure.figsize'] = (20.0, 10.0) df = pd.read_csv('../../../datasets/movie_metadata.csv') df.head() # split each movie's genre list, then form a set from the unwrapped list of all genres categories = set([s for genre_list in df.genres.unique() for s in genre_list.split("|")]) # one-hot encode each movie's classification for cat in categories: df[cat] = df.genres.transform(lambda s: int(cat in s)) # drop other columns df = df[['director_name','genres','duration'] + list(categories)] df.head() # convert from wide to long format and remove null classificaitons df = pd.melt(df, id_vars=['duration'], value_vars = list(categories), var_name = 'Category', value_name = 'Count') df = df.loc[df.Count>0] # add an indicator whether a movie is short or long, split at 100 minutes runtime df['islong'] = df.duration.transform(lambda x: int(x > 100)) # sort in descending order #df = df.loc[df.groupby('Category').transform(sum).sort_values('Count', ascending=False).index] df.head() p = sns.countplot(data=df, x = 'Category') p = sns.countplot(data=df, x = 'Category', hue = 'islong') p = sns.countplot(data=df, y = 'Category', hue = 'islong') p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.5) p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = 'deep') p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = 'muted') p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = 'pastel') p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = 'bright') p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = 'dark') p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = 'colorblind') p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = ((50/255, 132/255.0, 191/255.0), (255/255.0, 232/255.0, 0/255.0))) p = sns.countplot(data=df, y = 'Category', hue = 'islong', saturation=.9, palette = 'Dark2') help(sns.color_palette) help(sns.countplot) p = sns.countplot(data=df, x = 'Category') plt.text(9,2000, "Color Palettes", fontsize = 95, color='black', fontstyle='italic') p.get_figure().savefig('../../figures/colors.png') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: For the bar plot, let's look at the number of movies in each category, allowing each movie to be counted more than once. Step2: Basic plot Step3: color by a category Step4: make plot horizontal Step5: Saturation Step6: Various palettes
5,893
<ASSISTANT_TASK:> Python Code: from __future__ import division import numpy as np from scipy.sparse import diags from scipy.sparse.linalg import svds, eigs import matplotlib.pyplot as plt %matplotlib notebook def pseudo_spec(x, y, mat_A): Compute the pseudospectra of `mat_A` around the point $x + iy ps_spec = np.zeros_like(x) for row in range(npts): for col in range(npts): z_num = x[row, col] + 1j*y[row, col] sv_min = np.min(svds((mat_A - z_num*np.eye(N)), k=10, which='SM', return_singular_vectors=False)) ps_spec[row, col] = sv_min return ps_spec def plot_pseudo_spec(x, y, mat_A, ps_spec, levels=8): Plot the pseudospectra and eigenvalues for matrix `mat_A` n_eigs = np.shape(mat_A)[0] - 2 vals = eigs(mat_A, k=n_eigs, which='SM', return_eigenvectors=False) ps_spec[np.isnan(ps_spec)] = 0 plt.plot(np.real(vals), np.imag(vals), 'k.') plt.contourf(x, y, ps_spec, levels, cmap="YlGnBu_r") C = plt.contour(x, y, ps_spec, levels, colors='k') plt.axis('image') return C npts = 51 N = 200 x1, y1 = np.mgrid[-1:1:npts*1j, -1:1:npts*1j] A1 = diags([1.], [1], shape=(N, N)) ps_spec1 = pseudo_spec(x1, y1, A1) plt.figure(figsize=(8,8)) plot_pseudo_spec(x1, y1, A1, ps_spec1) plt.show() x2, y2 = np.mgrid[-2:2:npts*1j, -2:2:npts*1j] A2 = diags([1.], [1], shape=(N, N)) ps_spec2 = pseudo_spec(x2, y2, A2) plt.figure(figsize=(8,8)) plot_pseudo_spec(x2, y2, A2, ps_spec2) plt.show() x3, y3 = np.mgrid[-4:4:npts*1j, -4:4:npts*1j] A3 = diags([-1., 1., 1., 1, 1], [-1, 0, 1, 2, 3], shape=(N, N)) ps_spec3 = pseudo_spec(x3, y3, A3) plt.figure(figsize=(8,8)) plot_pseudo_spec(x3, y3, A3, ps_spec3) plt.show() x4, y4 = np.mgrid[-1:2:npts*1j, -1.5:1.5:npts*1j] diag_0 = [k/N for k in range(1,N+1)] diag_1 = [1 for k in range(N-1)] A4 = diags([diag_0, diag_1], [0, 1], shape=(N, N)) ps_spec4 = pseudo_spec(x4, y4, A4) plt.figure(figsize=(8,8)) plot_pseudo_spec(x4, y4, A4, ps_spec4) plt.show() from IPython.core.display import HTML def css_styling(): styles = open('./styles/custom_barba.css', 'r').read() return HTML(styles) css_styling() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Pseudospectra of matrices Step3: 1. Jordan block Step4: 2. Limacon Step5: 3. Grcar matrix Step6: 4. Wilkinson matrix
5,894
<ASSISTANT_TASK:> Python Code: from sklearn.model_selection import train_test_split import seaborn as sns import os import shutil import pandas as pd %matplotlib inline df = pd.read_csv('list.txt', sep=' ') df.ix[2000:2005] train_cat = df[df['SPECIES'] == 1] train_dog = df[df['SPECIES'] == 2] x = ['cat', 'dog'] y = [len(train_cat), len(train_dog)] ax = sns.barplot(x=x, y=y) mytrain, myvalid = train_test_split(df, test_size=0.1) print len(mytrain), len(myvalid) mytrain_cat = mytrain[mytrain['SPECIES'] == 1] mytrain_dog = mytrain[mytrain['SPECIES'] == 2] myvalid_cat = myvalid[myvalid['SPECIES'] == 1] myvalid_dog = myvalid[myvalid['SPECIES'] == 2] x = ['mytrain_cat', 'mytrain_dog', 'myvalid_cat', 'myvalid_dog'] y = [len(mytrain_cat), len(mytrain_dog), len(myvalid_cat), len(myvalid_dog)] ax = sns.barplot(x=x, y=y) def remove_and_create_class(dirname): if os.path.exists(dirname): shutil.rmtree(dirname) os.mkdir(dirname) os.mkdir(dirname+'/cat') os.mkdir(dirname+'/dog') remove_and_create_class('mytrain_ox') remove_and_create_class('myvalid_ox') for filename in mytrain_cat['IMAGE']: os.symlink('../../images/'+filename+'.jpg', 'mytrain_ox/cat/'+filename+'.jpg') for filename in mytrain_dog['IMAGE']: os.symlink('../../images/'+filename+'.jpg', 'mytrain_ox/dog/'+filename+'.jpg') for filename in myvalid_cat['IMAGE']: os.symlink('../../images/'+filename+'.jpg', 'myvalid_ox/cat/'+filename+'.jpg') for filename in myvalid_dog['IMAGE']: os.symlink('../../images/'+filename+'.jpg', 'myvalid_ox/dog/'+filename+'.jpg') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Visualize the size of the original train dataset. Step2: Shuffle and split the train filenames Step3: Visualize the size of the processed train dataset Step4: Create symbolic link of images
5,895
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'miroc', 'nicam16-7s', 'atmos') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.model_family') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "AGCM" # "ARCM" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.basic_approximations') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "primitive equations" # "non-hydrostatic" # "anelastic" # "Boussinesq" # "hydrostatic" # "quasi-hydrostatic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.horizontal_resolution_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.range_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.high_top') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.timestepping.timestep_dynamics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.timestepping.timestep_shortwave_radiative_transfer') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.timestepping.timestep_longwave_radiative_transfer') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.orography.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "present day" # "modified" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.orography.changes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "related to ice sheets" # "related to tectonics" # "modified mean" # "modified variance if taken into account in model (cf gravity waves)" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.scheme_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "spectral" # "fixed grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.scheme_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "finite elements" # "finite volumes" # "finite difference" # "centered finite difference" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.scheme_order') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "second" # "third" # "fourth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.horizontal_pole') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "filter" # "pole rotation" # "artificial island" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.grid_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Gaussian" # "Latitude-Longitude" # "Cubed-Sphere" # "Icosahedral" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.vertical.coordinate_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "isobaric" # "sigma" # "hybrid sigma-pressure" # "hybrid pressure" # "vertically lagrangian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.timestepping_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Adams-Bashforth" # "explicit" # "implicit" # "semi-implicit" # "leap frog" # "multi-step" # "Runge Kutta fifth order" # "Runge Kutta second order" # "Runge Kutta third order" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.prognostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "surface pressure" # "wind components" # "divergence/curl" # "temperature" # "potential temperature" # "total water" # "water vapour" # "water liquid" # "water ice" # "total water moments" # "clouds" # "radiation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.top_boundary.top_boundary_condition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "sponge layer" # "radiation boundary condition" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.top_boundary.top_heat') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.top_boundary.top_wind') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.lateral_boundary.condition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "sponge layer" # "radiation boundary condition" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.diffusion_horizontal.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.diffusion_horizontal.scheme_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "iterated Laplacian" # "bi-harmonic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Heun" # "Roe and VanLeer" # "Roe and Superbee" # "Prather" # "UTOPIA" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.scheme_characteristics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Eulerian" # "modified Euler" # "Lagrangian" # "semi-Lagrangian" # "cubic semi-Lagrangian" # "quintic semi-Lagrangian" # "mass-conserving" # "finite volume" # "flux-corrected" # "linear" # "quadratic" # "quartic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.conserved_quantities') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "dry mass" # "tracer mass" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.conservation_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "conservation fixer" # "Priestley algorithm" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "VanLeer" # "Janjic" # "SUPG (Streamline Upwind Petrov-Galerkin)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.scheme_characteristics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "2nd order" # "4th order" # "cell-centred" # "staggered grid" # "semi-staggered grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.scheme_staggering_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Arakawa B-grid" # "Arakawa C-grid" # "Arakawa D-grid" # "Arakawa E-grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.conserved_quantities') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Angular momentum" # "Horizontal momentum" # "Enstrophy" # "Mass" # "Total energy" # "Vorticity" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.conservation_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "conservation fixer" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.aerosols') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "sulphate" # "nitrate" # "sea salt" # "dust" # "ice" # "organic" # "BC (black carbon / soot)" # "SOA (secondary organic aerosols)" # "POM (particulate organic matter)" # "polar stratospheric ice" # "NAT (nitric acid trihydrate)" # "NAD (nitric acid dihydrate)" # "STS (supercooled ternary solution aerosol particle)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.spectral_integration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "wide-band model" # "correlated-k" # "exponential sum fitting" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.transport_calculation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "two-stream" # "layer interaction" # "bulk" # "adaptive" # "multi-stream" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.spectral_intervals') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_GHG.greenhouse_gas_complexity') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CO2" # "CH4" # "N2O" # "CFC-11 eq" # "CFC-12 eq" # "HFC-134a eq" # "Explicit ODSs" # "Explicit other fluorinated gases" # "O3" # "H2O" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_GHG.ODS') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CFC-12" # "CFC-11" # "CFC-113" # "CFC-114" # "CFC-115" # "HCFC-22" # "HCFC-141b" # "HCFC-142b" # "Halon-1211" # "Halon-1301" # "Halon-2402" # "methyl chloroform" # "carbon tetrachloride" # "methyl chloride" # "methylene chloride" # "chloroform" # "methyl bromide" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_GHG.other_flourinated_gases') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "HFC-134a" # "HFC-23" # "HFC-32" # "HFC-125" # "HFC-143a" # "HFC-152a" # "HFC-227ea" # "HFC-236fa" # "HFC-245fa" # "HFC-365mfc" # "HFC-43-10mee" # "CF4" # "C2F6" # "C3F8" # "C4F10" # "C5F12" # "C6F14" # "C7F16" # "C8F18" # "c-C4F8" # "NF3" # "SF6" # "SO2F2" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_ice.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_ice.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "bi-modal size distribution" # "ensemble of ice crystals" # "mean projected area" # "ice water path" # "crystal asymmetry" # "crystal aspect ratio" # "effective crystal radius" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_ice.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_liquid.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_liquid.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "cloud droplet number concentration" # "effective cloud droplet radii" # "droplet size distribution" # "liquid water path" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_liquid.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "geometric optics" # "Mie theory" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_inhomogeneity.cloud_inhomogeneity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Monte Carlo Independent Column Approximation" # "Triplecloud" # "analytic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_aerosols.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_aerosols.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "number concentration" # "effective radii" # "size distribution" # "asymmetry" # "aspect ratio" # "mixing state" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_aerosols.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_gases.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.spectral_integration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "wide-band model" # "correlated-k" # "exponential sum fitting" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.transport_calculation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "two-stream" # "layer interaction" # "bulk" # "adaptive" # "multi-stream" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.spectral_intervals') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_GHG.greenhouse_gas_complexity') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CO2" # "CH4" # "N2O" # "CFC-11 eq" # "CFC-12 eq" # "HFC-134a eq" # "Explicit ODSs" # "Explicit other fluorinated gases" # "O3" # "H2O" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_GHG.ODS') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CFC-12" # "CFC-11" # "CFC-113" # "CFC-114" # "CFC-115" # "HCFC-22" # "HCFC-141b" # "HCFC-142b" # "Halon-1211" # "Halon-1301" # "Halon-2402" # "methyl chloroform" # "carbon tetrachloride" # "methyl chloride" # "methylene chloride" # "chloroform" # "methyl bromide" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_GHG.other_flourinated_gases') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "HFC-134a" # "HFC-23" # "HFC-32" # "HFC-125" # "HFC-143a" # "HFC-152a" # "HFC-227ea" # "HFC-236fa" # "HFC-245fa" # "HFC-365mfc" # "HFC-43-10mee" # "CF4" # "C2F6" # "C3F8" # "C4F10" # "C5F12" # "C6F14" # "C7F16" # "C8F18" # "c-C4F8" # "NF3" # "SF6" # "SO2F2" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_ice.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_ice.physical_reprenstation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "bi-modal size distribution" # "ensemble of ice crystals" # "mean projected area" # "ice water path" # "crystal asymmetry" # "crystal aspect ratio" # "effective crystal radius" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_ice.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_liquid.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_liquid.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "cloud droplet number concentration" # "effective cloud droplet radii" # "droplet size distribution" # "liquid water path" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_liquid.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "geometric optics" # "Mie theory" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_inhomogeneity.cloud_inhomogeneity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Monte Carlo Independent Column Approximation" # "Triplecloud" # "analytic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_aerosols.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_aerosols.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "number concentration" # "effective radii" # "size distribution" # "asymmetry" # "aspect ratio" # "mixing state" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_aerosols.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_gases.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Mellor-Yamada" # "Holtslag-Boville" # "EDMF" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "TKE prognostic" # "TKE diagnostic" # "TKE coupled with water" # "vertical profile of Kz" # "non-local diffusion" # "Monin-Obukhov similarity" # "Coastal Buddy Scheme" # "Coupled with convection" # "Coupled with gravity waves" # "Depth capped at cloud base" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.closure_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.counter_gradient') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "mass-flux" # "adjustment" # "plume ensemble" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.scheme_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CAPE" # "bulk" # "ensemble" # "CAPE/WFN based" # "TKE/CIN based" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vertical momentum transport" # "convective momentum transport" # "entrainment" # "detrainment" # "penetrative convection" # "updrafts" # "downdrafts" # "radiative effect of anvils" # "re-evaporation of convective precipitation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.microphysics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "tuning parameter based" # "single moment" # "two moment" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "mass-flux" # "cumulus-capped boundary layer" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.scheme_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "same as deep (unified)" # "included in boundary layer turbulence" # "separate diagnosis" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "convective momentum transport" # "entrainment" # "detrainment" # "penetrative convection" # "re-evaporation of convective precipitation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.microphysics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "tuning parameter based" # "single moment" # "two moment" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_precipitation.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_precipitation.hydrometeors') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "liquid rain" # "snow" # "hail" # "graupel" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_cloud_microphysics.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_cloud_microphysics.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "mixed phase" # "cloud droplets" # "cloud ice" # "ice nucleation" # "water vapour deposition" # "effect of raindrops" # "effect of snow" # "effect of graupel" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.atmos_coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "atmosphere_radiation" # "atmosphere_microphysics_precipitation" # "atmosphere_turbulence_convection" # "atmosphere_gravity_waves" # "atmosphere_solar" # "atmosphere_volcano" # "atmosphere_cloud_simulator" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.uses_separate_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "entrainment" # "detrainment" # "bulk cloud" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.prognostic_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.diagnostic_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.prognostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "cloud amount" # "liquid" # "ice" # "rain" # "snow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.optical_cloud_properties.cloud_overlap_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "random" # "maximum" # "maximum-random" # "exponential" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.optical_cloud_properties.cloud_inhomogeneity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.function_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.function_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.convection_coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "coupled with deep" # "coupled with shallow" # "not coupled with convection" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.function_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.function_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.convection_coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "coupled with deep" # "coupled with shallow" # "not coupled with convection" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.isscp_attributes.top_height_estimation_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "no adjustment" # "IR brightness" # "visible optical depth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.isscp_attributes.top_height_direction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "lowest altitude level" # "highest altitude level" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.run_configuration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Inline" # "Offline" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.number_of_grid_points') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.number_of_sub_columns') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.number_of_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.frequency') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "surface" # "space borne" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.gas_absorption') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.effective_radius') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.lidar_inputs.ice_types') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "ice spheres" # "ice non-spherical" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.lidar_inputs.overlap') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "max" # "random" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.sponge_layer') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Rayleigh friction" # "Diffusive sponge layer" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "continuous spectrum" # "discrete spectrum" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.subgrid_scale_orography') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "effect on drag" # "effect on lifting" # "enhanced topography" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.source_mechanisms') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "linear mountain waves" # "hydraulic jump" # "envelope orography" # "low level flow blocking" # "statistical sub-grid scale variance" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.calculation_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "non-linear calculation" # "more than two cardinal directions" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.propagation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "linear theory" # "non-linear theory" # "includes boundary layer ducting" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.dissipation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "total wave" # "single wave" # "spectral" # "linear" # "wave saturation vs Richardson number" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.source_mechanisms') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "convection" # "precipitation" # "background spectrum" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.calculation_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "spatially dependent" # "temporally dependent" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.propagation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "linear theory" # "non-linear theory" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.dissipation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "total wave" # "single wave" # "spectral" # "linear" # "wave saturation vs Richardson number" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_pathways.pathways') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "SW radiation" # "precipitating energetic particles" # "cosmic rays" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_constant.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed" # "transient" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_constant.fixed_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_constant.transient_characteristics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed" # "transient" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.fixed_reference_date') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.transient_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.computation_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Berger 1978" # "Laskar 2004" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.insolation_ozone.solar_ozone_impact') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.volcanos.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.volcanos.volcanoes_treatment.volcanoes_implementation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "high frequency solar constant anomaly" # "stratospheric aerosols optical thickness" # "Other: [Please specify]" # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Model Family Step7: 1.4. Basic Approximations Step8: 2. Key Properties --&gt; Resolution Step9: 2.2. Canonical Horizontal Resolution Step10: 2.3. Range Horizontal Resolution Step11: 2.4. Number Of Vertical Levels Step12: 2.5. High Top Step13: 3. Key Properties --&gt; Timestepping Step14: 3.2. Timestep Shortwave Radiative Transfer Step15: 3.3. Timestep Longwave Radiative Transfer Step16: 4. Key Properties --&gt; Orography Step17: 4.2. Changes Step18: 5. Grid --&gt; Discretisation Step19: 6. Grid --&gt; Discretisation --&gt; Horizontal Step20: 6.2. Scheme Method Step21: 6.3. Scheme Order Step22: 6.4. Horizontal Pole Step23: 6.5. Grid Type Step24: 7. Grid --&gt; Discretisation --&gt; Vertical Step25: 8. Dynamical Core Step26: 8.2. Name Step27: 8.3. Timestepping Type Step28: 8.4. Prognostic Variables Step29: 9. Dynamical Core --&gt; Top Boundary Step30: 9.2. Top Heat Step31: 9.3. Top Wind Step32: 10. Dynamical Core --&gt; Lateral Boundary Step33: 11. Dynamical Core --&gt; Diffusion Horizontal Step34: 11.2. Scheme Method Step35: 12. Dynamical Core --&gt; Advection Tracers Step36: 12.2. Scheme Characteristics Step37: 12.3. Conserved Quantities Step38: 12.4. Conservation Method Step39: 13. Dynamical Core --&gt; Advection Momentum Step40: 13.2. Scheme Characteristics Step41: 13.3. Scheme Staggering Type Step42: 13.4. Conserved Quantities Step43: 13.5. Conservation Method Step44: 14. Radiation Step45: 15. Radiation --&gt; Shortwave Radiation Step46: 15.2. Name Step47: 15.3. Spectral Integration Step48: 15.4. Transport Calculation Step49: 15.5. Spectral Intervals Step50: 16. Radiation --&gt; Shortwave GHG Step51: 16.2. ODS Step52: 16.3. Other Flourinated Gases Step53: 17. Radiation --&gt; Shortwave Cloud Ice Step54: 17.2. Physical Representation Step55: 17.3. Optical Methods Step56: 18. Radiation --&gt; Shortwave Cloud Liquid Step57: 18.2. Physical Representation Step58: 18.3. Optical Methods Step59: 19. Radiation --&gt; Shortwave Cloud Inhomogeneity Step60: 20. Radiation --&gt; Shortwave Aerosols Step61: 20.2. Physical Representation Step62: 20.3. Optical Methods Step63: 21. Radiation --&gt; Shortwave Gases Step64: 22. Radiation --&gt; Longwave Radiation Step65: 22.2. Name Step66: 22.3. Spectral Integration Step67: 22.4. Transport Calculation Step68: 22.5. Spectral Intervals Step69: 23. Radiation --&gt; Longwave GHG Step70: 23.2. ODS Step71: 23.3. Other Flourinated Gases Step72: 24. Radiation --&gt; Longwave Cloud Ice Step73: 24.2. Physical Reprenstation Step74: 24.3. Optical Methods Step75: 25. Radiation --&gt; Longwave Cloud Liquid Step76: 25.2. Physical Representation Step77: 25.3. Optical Methods Step78: 26. Radiation --&gt; Longwave Cloud Inhomogeneity Step79: 27. Radiation --&gt; Longwave Aerosols Step80: 27.2. Physical Representation Step81: 27.3. Optical Methods Step82: 28. Radiation --&gt; Longwave Gases Step83: 29. Turbulence Convection Step84: 30. Turbulence Convection --&gt; Boundary Layer Turbulence Step85: 30.2. Scheme Type Step86: 30.3. Closure Order Step87: 30.4. Counter Gradient Step88: 31. Turbulence Convection --&gt; Deep Convection Step89: 31.2. Scheme Type Step90: 31.3. Scheme Method Step91: 31.4. Processes Step92: 31.5. Microphysics Step93: 32. Turbulence Convection --&gt; Shallow Convection Step94: 32.2. Scheme Type Step95: 32.3. Scheme Method Step96: 32.4. Processes Step97: 32.5. Microphysics Step98: 33. Microphysics Precipitation Step99: 34. Microphysics Precipitation --&gt; Large Scale Precipitation Step100: 34.2. Hydrometeors Step101: 35. Microphysics Precipitation --&gt; Large Scale Cloud Microphysics Step102: 35.2. Processes Step103: 36. Cloud Scheme Step104: 36.2. Name Step105: 36.3. Atmos Coupling Step106: 36.4. Uses Separate Treatment Step107: 36.5. Processes Step108: 36.6. Prognostic Scheme Step109: 36.7. Diagnostic Scheme Step110: 36.8. Prognostic Variables Step111: 37. Cloud Scheme --&gt; Optical Cloud Properties Step112: 37.2. Cloud Inhomogeneity Step113: 38. Cloud Scheme --&gt; Sub Grid Scale Water Distribution Step114: 38.2. Function Name Step115: 38.3. Function Order Step116: 38.4. Convection Coupling Step117: 39. Cloud Scheme --&gt; Sub Grid Scale Ice Distribution Step118: 39.2. Function Name Step119: 39.3. Function Order Step120: 39.4. Convection Coupling Step121: 40. Observation Simulation Step122: 41. Observation Simulation --&gt; Isscp Attributes Step123: 41.2. Top Height Direction Step124: 42. Observation Simulation --&gt; Cosp Attributes Step125: 42.2. Number Of Grid Points Step126: 42.3. Number Of Sub Columns Step127: 42.4. Number Of Levels Step128: 43. Observation Simulation --&gt; Radar Inputs Step129: 43.2. Type Step130: 43.3. Gas Absorption Step131: 43.4. Effective Radius Step132: 44. Observation Simulation --&gt; Lidar Inputs Step133: 44.2. Overlap Step134: 45. Gravity Waves Step135: 45.2. Sponge Layer Step136: 45.3. Background Step137: 45.4. Subgrid Scale Orography Step138: 46. Gravity Waves --&gt; Orographic Gravity Waves Step139: 46.2. Source Mechanisms Step140: 46.3. Calculation Method Step141: 46.4. Propagation Scheme Step142: 46.5. Dissipation Scheme Step143: 47. Gravity Waves --&gt; Non Orographic Gravity Waves Step144: 47.2. Source Mechanisms Step145: 47.3. Calculation Method Step146: 47.4. Propagation Scheme Step147: 47.5. Dissipation Scheme Step148: 48. Solar Step149: 49. Solar --&gt; Solar Pathways Step150: 50. Solar --&gt; Solar Constant Step151: 50.2. Fixed Value Step152: 50.3. Transient Characteristics Step153: 51. Solar --&gt; Orbital Parameters Step154: 51.2. Fixed Reference Date Step155: 51.3. Transient Method Step156: 51.4. Computation Method Step157: 52. Solar --&gt; Insolation Ozone Step158: 53. Volcanos Step159: 54. Volcanos --&gt; Volcanoes Treatment
5,896
<ASSISTANT_TASK:> Python Code: label_map = list('abcdefghij') fig,axes = pl.subplots(3,3,figsize=(5,5),sharex=True,sharey=True) with h5py.File(cache_file, 'r') as f: for i in range(9): ax = axes.flat[i] idx = np.random.randint(f['test']['images'].shape[0]) ax.imshow(f['test']['images'][idx], cmap='Greys', interpolation='nearest') ax.set_title(label_map[int(f['test']['labels'][idx])]) # Solution: with h5py.File(cache_file, 'r') as f: # get a unique list of the classes classes = np.unique(f['test']['labels']) classes.sort() nclasses = len(classes) images = f['test']['images'][:] for i,cls in enumerate(classes): fig,ax = pl.subplots(1,1,figsize=(2,2)) mean_img = images[f['test']['labels'][:] == cls].mean(axis=0) # select all images for a given class, take mean ax.imshow(mean_img, cmap='Greys', interpolation='nearest') # greyscale colormap, no interpolation ax.set_title(label_map[i]) def randomize(data, labels): permutation = np.random.permutation(labels.shape[0]) shuffled_data = data[permutation] shuffled_labels = labels[permutation] return shuffled_data, shuffled_labels with h5py.File(cache_file, 'r') as f: train_dataset, train_labels = randomize(f['train']['images'][:], f['train']['labels'][:]) test_dataset, test_labels = randomize(f['test']['images'][:], f['test']['labels'][:]) np.histogram(train_labels, bins=np.arange(0,nclasses+1,1)) np.histogram(test_labels, bins=np.arange(0,nclasses+1,1)) n_overlaps = [] # the data has been randomize, so let's just check the first 100 images and assume that # is a representative sample for test_img in test_dataset[:100]: diff = (train_dataset - test_img[None]).sum(axis=-1).sum(axis=-1) n_overlap = (diff == 0).sum() n_overlaps.append(n_overlap) print("Typical overlap:", np.median(n_overlaps)) pl.hist(n_overlaps) n_overlaps = [] threshold = 1E-2 # define an arbitrary threshold -- play with this # the data has been randomize, so let's just check the first 100 images and assume that # is a representative sample for test_img in test_dataset[:100]: diff = (train_dataset - test_img[None]).sum(axis=-1).sum(axis=-1) n_overlap = (np.abs(diff) < threshold).sum() n_overlaps.append(n_overlap) model = LogisticRegression() image_size = train_dataset.shape[-1] subset = 50 # replace with 100, 1000, 5000 idx = np.random.choice(np.arange(train_dataset.shape[0]), size=subset) train_subset_data = train_dataset[idx].reshape(subset, image_size*image_size) train_subset_labels = train_labels[idx] model.fit(train_subset_data, train_subset_labels) predict_labels = model.predict(test_dataset.reshape(test_dataset.shape[0], image_size*image_size)) (predict_labels != test_labels).sum() / float(test_labels.size) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Problem 2 Step2: Problem 3 Step3: Problem 4 Step4: OK, so there are about 50000 in each class in the training set Step5: And about 1870 in each class in the test set Step6: What about near duplicates between datasets? (images that are almost identical) Step7: Problem 6
5,897
<ASSISTANT_TASK:> Python Code: from pyspark.sql import SQLContext sqlContext = SQLContext(sc) import pandas as pd from sklearn.datasets import load_iris data = pd.DataFrame(data=load_iris().data, columns=['sepal_length', 'sepal_width', 'petal_length', 'petal_width']) data.head() from sklearn.preprocessing import Binarizer binarizer = Binarizer(threshold=5) binarizer.fit_transform(data.sepal_length.reshape(-1, 1)) df = sqlContext.createDataFrame(data) from pyspark.ml.feature import Binarizer binarizer = Binarizer(threshold=5.0, inputCol='sepal_length', outputCol='sepal_length_bin') binarizer.transform(df).show(5) # Import data from sklearn.datasets import fetch_20newsgroups categories = ['rec.autos', 'rec.sport.baseball', 'comp.graphics', 'comp.sys.mac.hardware', 'sci.space', 'sci.crypt', 'talk.politics.guns', 'talk.religion.misc'] newsgroup = fetch_20newsgroups(subset='train', categories=categories, shuffle=True, random_state=42) print newsgroup.data[0] # Create pandas DataFrames for values and targets import pandas as pd pdf_newsgroup = pd.DataFrame(data=newsgroup.data, columns=['news']) # Texts pdf_newsgroup_target = pd.DataFrame(data=newsgroup.target, columns=['target']) # Targets from pyspark.sql import SQLContext sqlContext = SQLContext(sc) df_newsgroup = sqlContext.createDataFrame(pd.concat([pdf_newsgroup, pdf_newsgroup_target], axis=1)) df_newsgroup.printSchema() df_newsgroup.show(3) from sklearn.cross_validation import train_test_split X_train, X_test, y_train, y_test = train_test_split(newsgroup.data, newsgroup.target, train_size=0.8, random_state=42) (df_train, df_test) = df_newsgroup.randomSplit([0.8, 0.2]) # Tokenizing and Occurrence Counts from sklearn.feature_extraction.text import CountVectorizer count_vect = CountVectorizer() X_train_counts = count_vect.fit_transform(X_train) # TF-IDF from sklearn.feature_extraction.text import TfidfTransformer tfidf_transformer = TfidfTransformer() X_train_tfidf = tfidf_transformer.fit_transform(X_train_counts) # Tokenizing from pyspark.ml.feature import Tokenizer tokenizer = Tokenizer(inputCol='news', outputCol='news_words') df_train_words = tokenizer.transform(df_train) # Hashing Term-Frequency from pyspark.ml.feature import HashingTF hashing_tf = HashingTF(inputCol=tokenizer.getOutputCol(), outputCol='news_tf', numFeatures=10000) df_train_tf = hashing_tf.transform(df_train_words) # Inverse Document Frequency from pyspark.ml.feature import IDF idf = IDF(inputCol=hashing_tf.getOutputCol(), outputCol="news_tfidf") idf_model = idf.fit(df_train_tf) # fit to build the model on all the data, and then apply it line by line df_train_tfidf = idf_model.transform(df_train_tf) df_train_tfidf.show(5) # Training a Decision Tree on training set from sklearn.tree import DecisionTreeClassifier clf = DecisionTreeClassifier(max_depth=10).fit(X_train_tfidf, y_train) # Transform test set X_test_counts = count_vect.transform(X_test) X_test_tfidf = tfidf_transformer.transform(X_test_counts) # Predictions on the test set y_test_pred = clf.predict(X_test_tfidf) # Indexing the target from pyspark.ml.feature import StringIndexer string_indexer = StringIndexer(inputCol='target', outputCol='target_indexed') string_indexer_model = string_indexer.fit(df_train_tfidf) df_train_final = string_indexer_model.transform(df_train_tfidf) # Training a Decision Tree on training set from pyspark.ml.classification import DecisionTreeClassifier dt = DecisionTreeClassifier(featuresCol=idf.getOutputCol(), labelCol=string_indexer.getOutputCol()) dt_model = dt.fit(df_train_final) # Transform the test set df_test_words = tokenizer.transform(df_test) df_test_tf = hashing_tf.transform(df_test_words) df_test_tfidf = idf_model.transform(df_test_tf) df_test_final = string_indexer_model.transform(df_test_tfidf) # Preditions on the test set df_test_pred = dt_model.transform(df_test_final) df_test_pred.select('news', 'target', 'prediction', 'probability').show(5) from sklearn.feature_extraction.text import CountVectorizer, TfidfTransformer from sklearn.tree import DecisionTreeClassifier from sklearn.pipeline import Pipeline # Instanciate a Pipeline text_clf = Pipeline([('vect', CountVectorizer()), ('tfidf', TfidfTransformer()), ('clf', DecisionTreeClassifier(max_depth=10)), ]) # Transform the data and train the classifier on the training set text_clf = text_clf.fit(X_train, y_train) # Transform the data and perform predictions on the test set y_test_pred = text_clf.predict(X_test) from pyspark.ml.feature import Tokenizer, HashingTF, IDF, StringIndexer from pyspark.ml.classification import DecisionTreeClassifier from pyspark.ml import Pipeline # Instanciate all the Estimators and Transformers necessary tokenizer = Tokenizer(inputCol='news', outputCol='news_words') hashing_tf = HashingTF(inputCol=tokenizer.getOutputCol(), outputCol='news_tf', numFeatures=10000) idf = IDF(inputCol=hashing_tf.getOutputCol(), outputCol="news_tfidf") string_indexer = StringIndexer(inputCol='target', outputCol='target_indexed') dt = DecisionTreeClassifier(featuresCol=idf.getOutputCol(), labelCol=string_indexer.getOutputCol(), maxDepth=10) # Instanciate a Pipeline pipeline = Pipeline(stages=[tokenizer, hashing_tf, idf, string_indexer, dt]) # Transform the data and train the classifier on the training set pipeline_model = pipeline.fit(df_train) # Transform the data and perform predictions on the test set df_test_pred = pipeline_model.transform(df_test) df_test_pred.show(5) from sklearn.metrics import precision_score # Evaluate the predictions done on the test set precision_score(y_test_pred, y_test, average='micro') from pyspark.ml.evaluation import MulticlassClassificationEvaluator # Instanciate a MulticlassClassificationEvaluator with precision metric evaluator = MulticlassClassificationEvaluator(predictionCol='prediction', labelCol='target_indexed', metricName='precision') # Evaluate the predictions done on the test set evaluator.evaluate(df_test_pred) from sklearn.grid_search import GridSearchCV # Create the parameters grid parameters = {'tfidf__use_idf': (True, False), 'clf__max_depth': (10, 20) } # Instanciate a GridSearchCV object with the pipeline, the parameters grid and the scoring function gs_clf = GridSearchCV(text_clf, parameters, score_func=precision_score, n_jobs=-1) # Transform the data and train the classifier on the training set gs_clf = gs_clf.fit(X_train, y_train) # Transform the data and perform predictions on the test set y_test_pred = gs_clf.predict(X_test) # Evaluate the predictions done on the test set precision_score(y_test_pred, y_test, average='micro') from pyspark.ml.tuning import ParamGridBuilder from pyspark.ml.tuning import CrossValidator # Instanciation of a ParamGridBuilder grid = (ParamGridBuilder() .baseOn([evaluator.metricName, 'precision']) .addGrid(dt.maxDepth, [10, 20]) .build()) # Instanciation of a CrossValidator cv = CrossValidator(estimator=pipeline, estimatorParamMaps=grid, evaluator=evaluator) # Transform the data and train the classifier on the training set cv_model = cv.fit(df_train) # Transform the data and perform predictions on the test set df_test_pred = cv_model.transform(df_test) # Evaluate the predictions done on the test set evaluator.evaluate(df_test_pred) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Initial example Step2: Spark ML Step3: Load Newsgroup Data Step4: Spark ML Step5: Train-Test Split Step6: Spark Step7: Feature engineering Step8: Spark ML Step9: Modelling & Prediction Step10: Spark ML Step11: Pipeline Step12: Spark ML Step13: Model Evaluation Step14: Spark ML Step15: Scores are different mainly because default parameters are not the same in scikit-learn and Spark ML Step16: Spark ML
5,898
<ASSISTANT_TASK:> Python Code: import numpy as np from scipy.special import binom import matplotlib.pylab as plt from scipy.misc import factorial as fact %matplotlib inline def binomial(p, n, k): return binom(n, k) * p ** k * (1 - p) ** (n-k) p = 4. / 100 np.sum(binomial(p, 150, np.arange(5))) np.sum(binomial(p, 150, np.arange(5, 10))) plt.bar(np.arange(20), binomial(p, 150, np.arange(20))) plt.bar(np.arange(5), binomial(p, 150, np.arange(5))) plt.bar(np.arange(5, 10), binomial(p, 150, np.arange(5,10))) plt.xlabel('# defectives') plt.ylabel('P(X=k)') def not_same_birthday(q): return np.prod((365 - np.arange(q))/ 365) q = 45 p = np.empty(q - 1) for i in range(1, q): p[i - 1] = 1 - not_same_birthday(i) plt.plot(np.arange(1, q), p) plt.plot(23, 1 - not_same_birthday(23), 'r+', label='23 people') plt.grid() plt.ylabel('Probability') plt.xlabel('q') plt.legend() 1 - not_same_birthday(23) import itertools x = [1, 2, 3, 4, 5, 6] omega = set([p for p in itertools.product(x, repeat=3)]) print(r'Omega has', len(omega), 'elements and they are:') print(omega) g = binomial(1 / 6, 3, np.arange(4)) * np.array([-30, 50, 75, 100]) np.sum(g) plt.bar(np.arange(4), g) plt.plot([-.5, 3.5], np.ones(2) * np.sum(g), 'r') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Exercise 1. Step2: b. Step3: Exercise 2. Step4: Exercise 3. Step5: X would be -30 when the sample $\omega$ has no 6s, 50 when has one, 75 when it has two, and 100 when it has three. The probability distribution of such variable would be the binomial with $p = 1 / 6$, $n=3$ and $k$ the number of 6s.
5,899
<ASSISTANT_TASK:> Python Code: num_friends_good = [49,41,40,25,21,21,19,19,18,18,16,15,15,15,15,14,14,13,13,13,13,12,12,11,10,10,10,10,10,10,10,10,10,10,10,10,10,10,10,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,8,8,8,8,8,8,8,8,8,8,8,8,8,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,6,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1] daily_minutes_good = [68.77,51.25,52.08,38.36,44.54,57.13,51.4,41.42,31.22,34.76,54.01,38.79,47.59,49.1,27.66,41.03,36.73,48.65,28.12,46.62,35.57,32.98,35,26.07,23.77,39.73,40.57,31.65,31.21,36.32,20.45,21.93,26.02,27.34,23.49,46.94,30.5,33.8,24.23,21.4,27.94,32.24,40.57,25.07,19.42,22.39,18.42,46.96,23.72,26.41,26.97,36.76,40.32,35.02,29.47,30.2,31,38.11,38.18,36.31,21.03,30.86,36.07,28.66,29.08,37.28,15.28,24.17,22.31,30.17,25.53,19.85,35.37,44.6,17.23,13.47,26.33,35.02,32.09,24.81,19.33,28.77,24.26,31.98,25.73,24.86,16.28,34.51,15.23,39.72,40.8,26.06,35.76,34.76,16.13,44.04,18.03,19.65,32.62,35.59,39.43,14.18,35.24,40.13,41.82,35.45,36.07,43.67,24.61,20.9,21.9,18.79,27.61,27.21,26.61,29.77,20.59,27.53,13.82,33.2,25,33.1,36.65,18.63,14.87,22.2,36.81,25.53,24.62,26.25,18.21,28.08,19.42,29.79,32.8,35.99,28.32,27.79,35.88,29.06,36.28,14.1,36.63,37.49,26.9,18.58,38.48,24.48,18.95,33.55,14.24,29.04,32.51,25.63,22.22,19,32.73,15.16,13.9,27.2,32.01,29.27,33,13.74,20.42,27.32,18.23,35.35,28.48,9.08,24.62,20.12,35.26,19.92,31.02,16.49,12.16,30.7,31.22,34.65,13.13,27.51,33.2,31.57,14.1,33.42,17.44,10.12,24.42,9.82,23.39,30.93,15.03,21.67,31.09,33.29,22.61,26.89,23.48,8.38,27.81,32.35,23.84] alpha, beta = 22.9475, 0.90386 %matplotlib inline import matplotlib.pyplot as plt plt.scatter(num_friends_good, daily_minutes_good) plt.plot(num_friends_good, [alpha + beta*i for i in num_friends_good], 'b-') plt.xlabel('# of friends', fontsize = 20) plt.ylabel('minutes per day', fontsize = 20) plt.title('simple linear regression model', fontsize = 20) plt.show() # https://github.com/computational-class/machinelearninginaction/blob/master/Ch08/regression.py import pandas as pd import random dat = pd.read_csv('../data/ex0.txt', sep = '\t', names = ['x1', 'x2', 'y']) dat['x3'] = [yi*.3 + .5*random.random() for yi in dat['y']] dat.head() from numpy import mat, linalg, corrcoef def standRegres(xArr,yArr): xMat = mat(xArr); yMat = mat(yArr).T xTx = xMat.T*xMat if linalg.det(xTx) == 0.0: print("This matrix is singular, cannot do inverse") return ws = xTx.I * (xMat.T*yMat) return ws xs = [[dat.x1[i], dat.x2[i], dat.x3[i]] for i in dat.index] y = dat.y print(xs[:2]) ws = standRegres(xs, y) print(ws) xMat=mat(xs) yMat=mat(y) yHat = xMat*ws xCopy=xMat.copy() xCopy.sort(0) yHat=xCopy*ws fig = plt.figure() ax = fig.add_subplot(111) ax.scatter(xMat[:,1].flatten().A[0], yMat.T[:,0].flatten().A[0]) ax.plot(xCopy[:,1],yHat, 'r-') plt.ylim(0, 5) plt.show() yHat = xMat*ws corrcoef(yHat.T, yMat) import statsmodels.api as sm import statsmodels.formula.api as smf dat = pd.read_csv('ex0.txt', sep = '\t', names = ['x1', 'x2', 'y']) dat['x3'] = [yi*.3 - .1*random.random() for yi in y] dat.head() results = smf.ols('y ~ x2 + x3', data=dat).fit() results.summary() fig = plt.figure(figsize=(12,8)) fig = sm.graphics.plot_partregress_grid(results, fig = fig) plt.show() import numpy as np X = np.array(num_friends_good) X = sm.add_constant(X, prepend=False) mod = sm.OLS(daily_minutes_good, X) res = mod.fit() print(res.summary()) fig = plt.figure(figsize=(6,8)) fig = sm.graphics.plot_partregress_grid(res, fig = fig) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Of course, we need a better way to figure out how well we’ve fit the data than staring at the graph. Step2: Doing Statistics with statsmodels