Unnamed: 0
int64
0
15.9k
cleaned_code
stringlengths
67
124k
cleaned_prompt
stringlengths
168
30.3k
8,000
<ASSISTANT_TASK:> Python Code: import numpy as np # For numerical programming and multi-dimensional arrays from pandas import date_range # For date-rate generation from bqplot import LinearScale, Lines, Axis, Figure, DateScale, ColorScale security_1 = np.cumsum(np.random.randn(150)) + 100.0 security_2 = np.cumsum(np.random.randn(150)) + 100.0 sc_x = LinearScale() sc_y = LinearScale() line = Lines(x=np.arange(len(security_1)), y=security_1, scales={"x": sc_x, "y": sc_y}) ax_x = Axis(scale=sc_x, label="Index") ax_y = Axis(scale=sc_y, orientation="vertical", label="y-values of Security 1") Figure(marks=[line], axes=[ax_x, ax_y], title="Security 1") line.colors = ["DarkOrange"] # The opacity allows us to display the Line while featuring other Marks that may be on the Figure line.opacities = [0.5] line.stroke_width = 2.5 line.fill = "bottom" line.fill_opacities = [0.2] line.line_style = "dashed" line.interpolation = "basis" line.marker = "triangle-down" # Here we define the dates we would like to use dates = date_range(start="01-01-2007", periods=150) dt_x = DateScale() sc_y = LinearScale() time_series = Lines(x=dates, y=security_1, scales={"x": dt_x, "y": sc_y}) ax_x = Axis(scale=dt_x, label="Date") ax_y = Axis(scale=sc_y, orientation="vertical", label="Security 1") Figure(marks=[time_series], axes=[ax_x, ax_y], title="A Time Series Plot") x_dt = DateScale() y_sc = LinearScale() dates_new = date_range(start="06-01-2007", periods=150) securities = np.cumsum(np.random.randn(150, 10), axis=0) positions = np.random.randint(0, 2, size=10) # We pass the color scale and the color data to the lines line = Lines( x=dates, y=[security_1, security_2], scales={"x": x_dt, "y": y_sc}, labels=["Security 1", "Security 2"], ) ax_x = Axis(scale=x_dt, label="Date") ax_y = Axis(scale=y_sc, orientation="vertical", label="Security 1") Figure(marks=[line], axes=[ax_x, ax_y], legend_location="top-left") line.x, line.y = [dates, dates_new], [security_1, security_2] x_dt = DateScale() y_sc = LinearScale() col_sc = ColorScale(colors=["Red", "Green"]) dates_color = date_range(start="06-01-2007", periods=150) securities = 100.0 + np.cumsum(np.random.randn(150, 10), axis=0) positions = np.random.randint(0, 2, size=10) # Here we generate 10 random price series and 10 random positions # We pass the color scale and the color data to the lines line = Lines( x=dates_color, y=securities.T, scales={"x": x_dt, "y": y_sc, "color": col_sc}, color=positions, labels=["Security 1", "Security 2"], ) ax_x = Axis(scale=x_dt, label="Date") ax_y = Axis(scale=y_sc, orientation="vertical", label="Security 1") Figure(marks=[line], axes=[ax_x, ax_y], legend_location="top-left") line.color = None sc_x = LinearScale() sc_y = LinearScale() patch = Lines( x=[ [0, 2, 1.2, np.nan, np.nan, np.nan, np.nan], [0.5, 2.5, 1.7, np.nan, np.nan, np.nan, np.nan], [4, 5, 6, 6, 5, 4, 3], ], y=[ [0, 0, 1, np.nan, np.nan, np.nan, np.nan], [0.5, 0.5, -0.5, np.nan, np.nan, np.nan, np.nan], [1, 1.1, 1.2, 2.3, 2.2, 2.7, 1.0], ], fill_colors=["orange", "blue", "red"], fill="inside", stroke_width=10, close_path=True, scales={"x": sc_x, "y": sc_y}, display_legend=True, ) Figure(marks=[patch], animation_duration=1000) patch.opacities = [0.1, 0.2] patch.x = [ [2, 3, 3.2, np.nan, np.nan, np.nan, np.nan], [0.5, 2.5, 1.7, np.nan, np.nan, np.nan, np.nan], [4, 5, 6, 6, 5, 4, 3], ] patch.close_path = False <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Random Data Generation Step2: Basic Line Chart Step3: The x attribute refers to the data represented horizontally, while the y attribute refers the data represented vertically. Step4: In a similar way, we can also change any attribute after the plot has been displayed to change the plot. Run each of the cells below, and try changing the attributes to explore the different features and how they affect the plot. Step5: To switch to an area chart, set the fill attribute, and control the look with fill_opacities and fill_colors. Step6: While a Lines plot allows the user to extract the general shape of the data being plotted, there may be a need to visualize discrete data points along with this shape. This is where the markers attribute comes in. Step7: The marker attributes accepts the values square, circle, cross, diamond, square, triangle-down, triangle-up, arrow, rectangle, ellipse. Try changing the string above and re-running the cell to see how each marker type looks. Step8: Plotting Multiples Sets of Data with Lines Step9: We pass each data set as an element of a list. The colors attribute allows us to pass a specific color for each line. Step10: Similarly, we can also pass multiple x-values for multiple sets of y-values Step11: Coloring Lines according to data Step12: We can also reset the colors of the Line to their defaults by setting the color attribute to None. Step13: Patches
8,001
<ASSISTANT_TASK:> Python Code: # Level 3 example with multiple products import numpy as np import matplotlib.pyplot as plt from numpy import ma from metpy.cbook import get_test_data from metpy.io.nexrad import Level3File from metpy.plots import ctables # Helper code for making sense of these products. This is hidden from the slideshow # and eventually, in some form, will make its way into MetPy proper. def print_tab_pages(prod): print(('\n' + '-'*80 + '\n').join(prod.tab_pages)) def print_graph_pages(prod): colors = {0:'white', 3:'red', 4:'cyan'} for page in prod.graph_pages: fig, ax = plt.subplots(1, 1, figsize=(10,10)) ax.axesPatch.set_facecolor('black') for line in page: if 'color' in line: c = colors[line['color']] if 'text' in line: ax.text(line['x'], line['y'], line['text'], color=c, transform=ax.transData, verticalalignment='top', horizontalalignment='left', fontdict={'family':'monospace'}, fontsize=8) else: vecs = np.array(line['vectors']) ax.plot(vecs[:, ::2], vecs[:, 1::2], color=c) ax.set_xlim(0, 639) ax.set_ylim(511, 0) ax.set_aspect('equal', 'box') ax.xaxis.set_major_formatter(plt.NullFormatter()) ax.xaxis.set_major_locator(plt.NullLocator()) ax.yaxis.set_major_formatter(plt.NullFormatter()) ax.yaxis.set_major_locator(plt.NullLocator()) for s in ax.spines: ax.spines[s].set_color('none') def plot_prod(prod, cmap, norm, ax=None): if ax is None: ax = plt.gca() data_block = prod.sym_block[0][0] data = np.array(data_block['data']) data = prod.map_data(data) data = np.ma.array(data, mask=np.isnan(data)) if 'start_az' in data_block: az = np.array(data_block['start_az'] + [data_block['end_az'][-1]]) rng = np.linspace(0, prod.max_range, data.shape[-1] + 1) x = rng * np.sin(np.deg2rad(az[:, None])) y = rng * np.cos(np.deg2rad(az[:, None])) else: x = np.linspace(-prod.max_range, prod.max_range, data.shape[1] + 1) y = np.linspace(-prod.max_range, prod.max_range, data.shape[0] + 1) data = data[::-1] pc = ax.pcolormesh(x, y, data, cmap=cmap, norm=norm) plt.colorbar(pc, extend='both') ax.set_aspect('equal', 'datalim') ax.set_xlim(-100, 100) ax.set_ylim(-100, 100) return pc, data def plot_points(prod, ax=None): if ax is None: ax = plt.gca() data_block = prod.sym_block[0] styles = {'MDA': dict(marker='o', markerfacecolor='None', markeredgewidth=2, size='radius'), 'MDA (Elev.)': dict(marker='s', markerfacecolor='None', markeredgewidth=2, size='radius'), 'TVS': dict(marker='v', markerfacecolor='red', markersize=10), 'Storm ID': dict(text='id'), 'HDA': dict(marker='o', markersize=10, markerfacecolor='blue', alpha=0.5)} artists = [] for point in data_block: if 'type' in point: info = styles.get(point['type'], {}).copy() x,y = point['x'], point['y'] text_key = info.pop('text', None) if text_key: artists.append(ax.text(x, y, point[text_key], transform=ax.transData, clip_box=ax.bbox, **info)) artists[-1].set_clip_on(True) else: size_key = info.pop('size', None) if size_key: info['markersize'] = np.pi * point[size_key]**2 artists.append(ax.plot(x, y, **info)) def plot_tracks(prod, ax=None): if ax is None: ax = plt.gca() data_block = prod.sym_block[0] for track in data_block: if 'marker' in track: pass if 'track' in track: x,y = np.array(track['track']).T ax.plot(x, y, color='k') # Read in a bunch of NIDS products tvs = Level3File(get_test_data('nids/KOUN_SDUS64_NTVTLX_201305202016')) nmd = Level3File(get_test_data('nids/KOUN_SDUS34_NMDTLX_201305202016')) nhi = Level3File(get_test_data('nids/KOUN_SDUS64_NHITLX_201305202016')) n0q = Level3File(get_test_data('nids/KOUN_SDUS54_N0QTLX_201305202016')) nst = Level3File(get_test_data('nids/KOUN_SDUS34_NSTTLX_201305202016')) # What happens when we print one out tvs # Can print tabular (ASCII) information in the product print_tab_pages(tvs) fig = plt.figure(figsize=(20, 10)) ax = fig.add_subplot(1, 1, 1) norm, cmap = ctables.registry.get_with_boundaries('NWSReflectivity', np.arange(0, 85, 5)) pc, data = plot_prod(n0q, cmap, norm, ax) plot_points(tvs) plot_points(nmd) plot_points(nhi) plot_tracks(nst) ax.set_ylim(-20, 40) ax.set_xlim(-50, 20) import metpy.calc as mpcalc from metpy.units import units temp = 86 * units.degF press = 860. * units.mbar humidity = 40 / 100. dewpt = mpcalc.dewpoint_rh(temp, humidity).to('degF') dewpt mpcalc.lcl(press, temp, dewpt) import numpy as np pressure_levels = np.array([860., 850., 700., 500., 300.]) * units.mbar mpcalc.parcel_profile(pressure_levels, temp, dewpt) import matplotlib.pyplot as plt import numpy as np from metpy.cbook import get_test_data from metpy.calc import get_wind_components from metpy.plots import SkewT # Parse the data p, T, Td, direc, spd = np.loadtxt(get_test_data('sounding_data.txt'), usecols=(0, 2, 3, 6, 7), skiprows=4, unpack=True) u, v = get_wind_components(spd, np.deg2rad(direc)) # Create a skewT using matplotlib's default figure size fig = plt.figure(figsize=(8, 8)) skew = SkewT(fig) # Plot the data using normal plotting functions, in this case using # log scaling in Y, as dictated by the typical meteorological plot skew.plot(p, T, 'r') skew.plot(p, Td, 'g') skew.plot_barbs(p, u, v) # Add the relevant special lines skew.plot_dry_adiabats() skew.plot_moist_adiabats() skew.plot_mixing_lines() skew.ax.set_ylim(1000, 100) fig from siphon.catalog import TDSCatalog best_gfs = TDSCatalog('http://thredds.ucar.edu/thredds/catalog/grib/NCEP/GFS/Global_0p5deg/catalog.xml?dataset=grib/NCEP/GFS/Global_0p5deg/Best') best_ds = list(best_gfs.datasets.values())[0] best_ds.access_urls # Set up a class to access from siphon.ncss import NCSS ncss = NCSS(best_ds.access_urls['NetcdfSubset']) # Get today's date from datetime import datetime, timedelta now = datetime.utcnow() # Get a query object and set to get temperature for Boulder for the next 7 days query = ncss.query() query.lonlat_point(-105, 40).vertical_level(100000).time_range(now, now + timedelta(days=7)) query.variables('Temperature_isobaric').accept('netcdf4') # Get the Data data = ncss.get_data(query) list(data.variables) # Pull the variables we want from the NetCDF file temp = data.variables['Temperature_isobaric'] time = data.variables['time'] # Convert time values from numbers to datetime from netCDF4 import num2date time_vals = num2date(time[:].squeeze(), time.units) # Plot import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 1, figsize=(9, 8)) ax.plot(time_vals, temp[:].squeeze(), 'r', linewidth=2) ax.set_ylabel(temp.standard_name + ' (%s)' % temp.units) ax.set_xlabel('Forecast Time (UTC)') ax.grid(True) # Re-use the NCSS access from earlier, but make a new query query = ncss.query() query.lonlat_point(-105, 40).time(now + timedelta(hours=12)).accept('csv') query.variables('Temperature_isobaric', 'Relative_humidity_isobaric', 'u-component_of_wind_isobaric', 'v-component_of_wind_isobaric') data = ncss.get_data(query) # Pull out data with some units p = (data['vertCoord'] * units('Pa')).to('mbar') T = data['Temperature_isobaric'] * units('kelvin') Td = mpcalc.dewpoint_rh(T, data['Relative_humidity_isobaric'] / 100.) u = data['ucomponent_of_wind_isobaric'] * units('m/s') v = data['vcomponent_of_wind_isobaric'] * units('m/s') # Create a skewT using matplotlib's default figure size fig = plt.figure(figsize=(8, 8)) skew = SkewT(fig) # Plot the data using normal plotting functions, in this case using # log scaling in Y, as dictated by the typical meteorological plot skew.plot(p, T.to('degC'), 'r') skew.plot(p, Td.to('degC'), 'g') skew.plot_barbs(p[p>=100 * units.mbar], u.to('knots')[p>=100 * units.mbar], v.to('knots')[p>=100 * units.mbar]) skew.ax.set_ylim(1000, 100) skew.ax.set_title(data['date'][0]); # This code isn't actually in a MetPy release yet..... import importlib import metpy.plots.station_plot importlib.reload(metpy.plots.station_plot) station_plot = metpy.plots.station_plot.station_plot # Set up query for point data ncss = NCSS('http://thredds.ucar.edu/thredds/ncss/nws/metar/ncdecoded/Metar_Station_Data_fc.cdmr/dataset.xml') query = ncss.query() query.lonlat_box(44, 37, -98, -108).time(now - timedelta(days=2)).accept('csv') query.variables('air_temperature', 'dew_point_temperature', 'wind_from_direction', 'wind_speed') data = ncss.get_data(query) # Some unit conversions speed = data['wind_speed'] * units('m/s') data['u'],data['v'] = mpcalc.get_wind_components(speed.to('knots'), data['wind_from_direction'] * units('degree')) # Plot using basemap for now from mpl_toolkits.basemap import Basemap fig = plt.figure(figsize=(9, 9)) ax = fig.add_subplot(1, 1, 1) m = Basemap(lon_0=-105, lat_0=40, lat_ts=40, resolution='i', projection='stere', urcrnrlat=44, urcrnrlon=-98, llcrnrlat=37, llcrnrlon=-108, ax=ax) m.bluemarble() # Just an early prototype... station_plot(data, proj=m, ax=ax, layout={'NW': 'air_temperature', 'SW': 'dew_point_temperature'}, styles={'air_temperature': dict(color='r'), 'dew_point_temperature': dict(color='lightgreen')}, zorder=1); fig <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: What about the "data" content of the products? Step2: Calculations Step3: What does the LCL look like for that? Step4: Given those conditions, what does the profile of a parcel look like? Step5: Plots Step6: Siphon Step7: Ok, let's get data using NCSS Step8: "With your powers combined..." Step9: Ideas for the future
8,002
<ASSISTANT_TASK:> Python Code: import theano %matplotlib inline import sys, os sys.path.insert(1, os.path.join('../utils')) import utils; reload(utils) from utils import * from __future__ import division, print_function path = get_file('nietzsche.txt', origin="https://s3.amazonaws.com/text-datasets/nietzsche.txt") text = open(path).read() print('corpus length:', len(text)) chars = sorted(list(set(text))) vocab_size = len(chars) + 1 print('total chars:', vocab_size) chars.insert(0, "\0") ''.join(chars[1:-6]) char_indices = dict((c, i) for i, c in enumerate(chars)) indices_char = dict((i, c) for i, c in enumerate(chars)) idx = [char_indices[c] for c in text] # the 1st 10 characters: idx[:10] ''.join(indices_char[i] for i in idx[:70]) cs = 3 c1_dat = [idx[i] for i in xrange(0, len(idx)-1-cs, cs)] c2_dat = [idx[i+1] for i in xrange(0, len(idx)-1-cs, cs)] c3_dat = [idx[i+2] for i in xrange(0, len(idx)-1-cs, cs)] c4_dat = [idx[i+3] for i in xrange(0, len(idx)-1-cs, cs)] # <-- gonna predict this # we can turn these into Numpy arrays just by stacking them up together x1 = np.stack(c1_dat[:-2]) # 1st chars x2 = np.stack(c2_dat[:-2]) # 2nd chars x3 = np.stack(c3_dat[:-2]) # 3rd chars # for every 4 character peice of this - collected works # labels will just be the 4th characters y = np.stack(c4_dat[:-2]) # 1st, 2nd, 3rd chars of text x1[:4], x2[:4], x3[:4] # 4th char of text y[:3] x1.shape, y.shape # we're going to turn these into embeddings n_fac = 42 # by creating an embedding matrix def embedding_input(name, n_in, n_out): inp = Input(shape=(1,), dtype='int64', name=name) emb = Embedding(n_in, n_out, input_length=1)(inp) return inp, Flatten()(emb) c1_in, c1 = embedding_input('c1', vocab_size, n_fac) c2_in, c2 = embedding_input('c2', vocab_size, n_fac) c3_in, c3 = embedding_input('c3', vocab_size, n_fac) # c1, c2, c3 represent result of putting each char through the embedding & # getting out 42 latent vectors. <-- those are input to greenarrow. n_hidden = 256 dense_in = Dense(n_hidden, activation='relu') c1_hidden = dense_in(c1) dense_hidden = Dense(n_hidden, activation='tanh') c2_dense = dense_in(c2) # char-2 embedding thru greenarrow hidden_2 = dense_hidden(c1_hidden) # output of char-1's hidden state thru orangearrow c2_hidden = merge([c2_dense, hidden_2]) # merge the two together (default: sum) c3_dense = dense_in(c3) hidden_3 = dense_hidden(c2_hidden) c3_hidden = merge([c3_dense, hidden_3]) dense_out = Dense(vocab_size, activation='softmax') #output size: 86 <-- vocab_size c4_out = dense_out(c3_hidden) # passing in our 3 inputs & 1 output model = Model([c1_in, c2_in, c3_in], c4_out) model.summary() model.compile(loss='sparse_categorical_crossentropy', optimizer=Adam()) model.optimizer.lr=0.001 model.fit([x1, x2, x3], y, batch_size=64, nb_epoch=10) def get_next(inp): idxs = [char_indices[c] for c in inp] arrs = [np.array(i)[np.newaxis] for i in idxs] p = model.predict(arrs) i = np.argmax(p) return chars[i] get_next('phi') get_next(' th') get_next(' an') cs = 8 # use 8 characters to predict the 9th c_in_dat = [[idx[i+n] for i in xrange(0, len(idx)-1-cs, cs)] for n in range(cs)] c_out_dat = [idx[i+cs] for i in xrange(0, len(idx)-1-cs,cs)] # go thru every one of those input lists and turn into Numpy array: xs = [np.stack(c[:-2]) for c in c_in_dat] len(xs), xs[0].shape y = np.stack(c_out_dat[:-2]) # visualizing xs: [xs[n][:cs] for n in range(cs)] y[:cs] n_fac = 42 def embedding_input(name, n_in, n_out): inp = Input(shape=(1,), dtype='int64', name=name+'_in') emb = Embedding(n_in, n_out, input_length=1, name=name+'_emb')(inp) return inp, Flatten()(emb) c_ins = [embedding_input('c'+str(n), vocab_size, n_fac) for n in range(cs)] n_hidden = 256 dense_in = Dense(n_hidden, activation='relu') dense_hidden = Dense(n_hidden, activation='relu', init='identity') dense_out = Dense(vocab_size, activation='softmax') hidden = dense_in(c_ins[0][1]) for i in range(1,cs): c_dense = dense_in(c_ins[i][1]) #green arrow hidden = dense_hidden(hidden) #orange arrow hidden = merge([c_dense, hidden]) #merge the two together c_out = dense_out(hidden) model = Model([c[0] for c in c_ins], c_out) model.compile(loss='sparse_categorical_crossentropy', optimizer=Adam()) model.fit(xs, y, batch_size=64, nb_epoch=12) def get_next(inp): idxs = [np.array(char_indices[c])[np.newaxis] for c in inp] p = model.predict(idxs) return chars[np.argmax(p)] get_next('for thos') get_next('part of ') get_next('queens a') # c_in_dat = [[idx[i+n] for i in xrange(0, len(idx)-1-cs, cs)] for n in range(cs)] c_out_dat = [[idx[i+n] for i in xrange(1, len(idx)-cs, cs)] for n in range(cs)] ys = [np.stack(c[:-2]) for c in c_out_dat] [xs[n][:cs] for n in range(cs)] [ys[n][:cs] for n in range(cs)] dense_in = Dense(n_hidden, activation='relu') dense_out = Dense(vocab_size, activation='softmax', name='output') # our char1 input is moved within the diagram's loop-box; so now need # initialized input (zeros) inp1 = Input(shape=(n_fac,), name='zeros') hidden = dense_in(inp1) outs = [] for i in range(cs): c_dense = dense_in(c_ins[i][1]) hidden = dense_hidden(hidden) hidden = merge([c_dense, hidden], mode='sum') # every layer now has an output outs.append(dense_out(hidden)) # our loop is identical to before, except at the end of every loop, # we're going to append this output; so now we're going to have # 8 outputs for every sequence instead of just 1. # model now has vector of 0s: [inp1], and array of outputs: outs model = Model([inp1] + [c[0] for c in c_ins], outs) model.compile(loss='sparse_categorical_crossentropy', optimizer=Adam()) zeros = np.tile(np.zeros(n_fac), (len(xs[0]),1)) zeros.shape model.fit([zeros]+xs, ys, batch_size=64, nb_epoch=12) def get_nexts(inp): idxs = [char_indices[c] for c in inp] arrs = [np.array(i)[np.newaxis] for i in idxs] p = model.predict([np.zeros(n_fac)[np.newaxis,:]] + arrs) print(list(inp)) return [chars[np.argmax(o)] for o in p] get_nexts(' this is') get_nexts(' part of') n_hidden, n_fac, cs, vocab_size model = Sequential([ Embedding(vocab_size, n_fac, input_length=cs), SimpleRNN(n_hidden, return_sequences=True, activation='relu', inner_init='identity'), TimeDistributed(Dense(vocab_size, activation='softmax')), ]) model.summary() model.compile(loss='sparse_categorical_crossentropy', optimizer=Adam()) # just some dimensionality changes required; otherwise same x_rnn = np.stack(np.squeeze(xs), axis=1) y_rnn = np.stack(ys, axis=1) x_rnn.shape, y_rnn.shape model.fit(x_rnn, y_rnn, batch_size=64, nb_epoch=8) def get_nexts_keras(inp): idxs = [char_indices[c] for c in inp] arr = np.array(idxs)[np.newaxis,:] p = model.predict(arr)[0] print(list(inp)) return [chars[np.argmax(o)] for o in p] get_nexts_keras(' this is') bs = 64 model = Sequential([ Embedding(vocab_size, n_fac, input_length=cs, batch_input_shape=(bs,8)), BatchNormalization(), LSTM(n_hidden, return_sequences=True, stateful=True), TimeDistributed(Dense(vocab_size, activation='softmax')), ]) # dont forget to compile (accidetnly hit `M` in JNB) model.compile(loss='sparse_categorical_crossentropy', optimizer=Adam()) mx = len(x_rnn)//bs*bs model.fit(x_rnn[:mx], y_rnn[:mx], batch_size=bs, nb_epoch=4, shuffle=False) model.optimizer.lr=1e-4 model.fit(x_rnn[:mx], y_rnn[:mx], batch_size=bs, nb_epoch=4, shuffle=False) model = Sequential([ SimpleRNN(n_hidden, return_sequences=True, input_shape=(cs, vocab_size), activation='relu', inner_init='identity'), TimeDistributed(Dense(vocab_size, activation='softmax')), ]) model.compile(loss='categorical_crossentropy', optimizer=Adam()) # no embedding layer, so inputs must be onhotted too. oh_ys = [to_categorical(o, vocab_size) for o in ys] oh_y_rnn = np.stack(oh_ys, axis=1) oh_xs = [to_categorical(o, vocab_size) for o in xs] oh_x_rnn = np.stack(oh_xs, axis=1) oh_x_rnn.shape, oh_y_rnn.shape model.fit(oh_x_rnn, oh_y_rnn, batch_size=64, nb_epoch=8) def get_nexts_oh(inp): idxs = np.array([char_indices[c] for c in inp]) arr = to_categorical(idxs, vocab_size) p = model.predict(arr[np.newaxis,:])[0] print(list(inp)) return [chars[np.argmax(o)] for o in p] get_nexts_oh(' this is') n_input = vocab_size n_output = vocab_size def init_wgts(rows, cols): scale = math.sqrt(2/rows) # 1st calc Glorot number to scale weights return shared(normal(scale=scale, size=(rows, cols)).astype(np.float32)) def init_bias(rows): return shared(np.zeros(rows, dtype=np.float32)) def wgts_and_bias(n_in, n_out): return init_wgts(n_in, n_out), init_bias(n_out) def id_and_bias(n): return shared(np.eye(n, dtype=np.float32)), init_bias(n) # Theano variables t_inp = T.matrix('inp') t_outp = T.matrix('outp') t_h0 = T.vector('h0') lr = T.scalar('lr') all_args = [t_h0, t_inp, t_outp, lr] W_h = id_and_bias(n_hidden) W_x = wgts_and_bias(n_input, n_hidden) W_y = wgts_and_bias(n_hidden, n_output) w_all = list(chain.from_iterable([W_h, W_x, W_y])) def step(x, h, W_h, b_h, W_x, b_x, W_y, b_y): # Calculate the hidden activations h = nnet.relu(T.dot(x, W_x) + b_x + T.dot(h, W_h) + b_h) # Calculate the output activations y = nnet.softmax(T.dot(h, W_y) + b_y) # Return both (the 'Flatten()' is to work around a theano bug) return h, T.flatten(y, 1) [v_h, v_y], _ = theano.scan(step, sequences=t_inp, outputs_info=[t_h0, None], non_sequences=w_all) [v_h, v_y], _ = theano.scan(step, sequences=t_inp, outputs_info=[t_h0, None], non_sequences=w_all) error = nnet.categorical_crossentropy(v_y, t_outp).sum() g_all = T.grad(error, w_all) def upd_dict(wgts, grads, lr): return OrderedDict({w: w-g*lr for (w,g) in zip(wgts,grads)}) upd = upd_dict(w_all, g_all, lr) # we're finally ready to compile the function!: fn = theano.function(all_args, error, updates=upd, allow_input_downcast=True) X = oh_x_rnn Y = oh_y_rnn X.shape, Y.shape err=0.0; l_rate=0.01 for i in xrange(len(X)): err += fn(np.zeros(n_hidden), X[i], Y[i], l_rate) if i % 1000 == 999: print ("Error:{:.3f}".format(err/1000)) err=0.0 f_y = theano.function([t_h0, t_inp], v_y, allow_input_downcast=True) pred = np.argmax(f_y(np.zeros(n_hidden), X[6]), axis=1) act = np.argmax(X[6], axis=1) [indices_char[o] for o in act] [indices_char[o] for o in pred] # looking at how to use Python debugger import numpy as np import pdb err=0.; lrate=0.01 for i in range(len(np.zeros(10))): err += np.sin(lrate+np.e**i) pdb.set_trace() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Setup Step2: Sometimes it's useful to have a zero value in the dataset, eg. for padding Step3: Map from chars to indices and back again Step4: idx will be the data we use from now on -- it simply converts all the characters to their index (based on the mapping above) Step5: 3 Char Model Step6: Our inputs Step7: Our output Step8: The first 4 inputs and ouputs Step9: Will try to predict 30 from 40, 42, 29, 29 from 30, 25, 27, & etc. That's our data format. Step10: The number of latent factors to create (ie. the size of our 3 character inputs) Step11: Create and train model Step12: This is the 'green arrow' from our diagram - the layer operation from input to hidden. Step13: Our first hidden activation is simpmly this function applied to the result of the embedding of the first character. Step14: This is the 'orange arrow' from our diagram - the layer operation from hidden to hidden. Step15: Our second and third hidden activations sum up the previous hidden state (after applying dense_hidden) to the new input state. Step16: This is the 'blue arrow' from our diagram - the layer operation from hidden to hidden. Step17: The third hidden state is the input to our output layer. Step18: Test model Step19: Our first RNN Step20: For each 0 thru 7, create a list of every 8th character with that starting point. These will be the 8 inputs to our model. Step21: ^ create an array with 8 elements; ea. elem contains a list of the 0th,8th,16th,24th char, the 1st,9th,17th,25th char, etc just as before. A sequence of inputs where ea. one is offset by 1 from the previous one. Step22: So each column below is one series of 8 characters from the text. Step23: The first column in each row is the 1st 8 characters of our test. Step24: NOTE Step25: The first character of each sequence goes through dense_in(), to create our first hidden activations. Step26: Then for each successive layer we combine the output of dense_in() on the ext character with the output of dense_hidden() on the current hidden state, to create the new hidden state. Step27: Putting the final hidden state through dense_out() gives us our output Step28: So now we can create our model Step29: With 8 pieces of context instead of 3, we'd expect it to do better; and we see a loss of ~1.8 instead of ~2.0 Step30: Returning Sequences Step31: Now our y dataset looks exactly like our x dataset did before, but everything's shifted over by 1 character. Step32: We're going to pass a vector of all zeros as our starting point - here's our input layers for that Step33: Now when we fit, we add the array of zeros to the start of our inputs; our ouputs are going to be those lists of 8, offset by 1. We get 8 losses instead of 1 bc ea. one of those 8 outputs has its own loss. You'll see the model's ability to predict the 1st character from a bunch of zeros is very limited and flattens out; but predicting the 8th char with the context of 7 is much better and keeps improving. Step34: This is what a sequence model looks like. We pass in a sequence and after every character, it returns a guess. Step35: Sequence model with Keras Step36: To convert our previous ekras model into a sequence model, simply add the return_sequences=True parameter, and TimeDistributed() around our dense layer. Step37: Note 8 outputs. What TimeDistributed does is create 8 copies of the weight matrix for each output. Step38: Stateful model with Keras Step39: Since we're using a fixed batch shape, we have to ensure our inputs and outputs are an even multiple of the batch size. Step40: The LSTM model takes much longer to run than the regular RNN because it isn't in parallel Step41: One-Hot Sequence Model with Keras Step42: The 86 is the onehotted dimension; classes of characters Step43: Theano RNN Step44: Using raw theano, we have to create our weight matrices and bias vectors outselves - here are the functions we'll use to do so (using glorot initialization). Step45: We return the weights and biases together as a tuple. For the hidden weights, we'll use an identity initialization (as recommended by Hinton.) Step46: Different than Python; Theano requires us to build up a computation graph first. shared(..) basically tells Theano to keep track of something to send to the GPU later. Once you wrap smth in shared it basically belongs to Theano now. Step47: Now we're ready to create our initial weight matrices. Step48: We now need to tell Theano what happens each time we take a single step of this RNN. Step49: Now we can provide everything necessary for the scan operation, so we can set that up - we have to pass in the function to call at each step, the sequence to step through, the initial values of the outputs, and any other arguments to pass to the step function. Step50: You get this error if you accidently define step as Step51: We can now calculate our loss function, and all of our gradients, with just a couple lines of code! Step52: We even have to show Theano how to do SGD - so we set up this dictionary of updates to complete after every forward pass, which apply the standard SGD update rule to every weight. Step53: To use it, we simply loop through our input data, calling the function compiled above, and printing our progress from time to time.
8,003
<ASSISTANT_TASK:> Python Code: import os import s3fs import pandas as pd import dask.array as da import dask.dataframe as dd from distributed import Client from dask import persist, compute from dask_glm.estimators import LogisticRegression client = Client() if not os.path.exists('trip.csv'): s3 = S3FileSystem(anon=True) s3.get("dask-data/nyc-taxi/2015/yellow_tripdata_2015-01.csv", "trip.csv") ddf = dd.read_csv("trip.csv") ddf = ddf.repartition(npartitions=8) # these filter out less than 1% of the observations ddf = ddf[(ddf.trip_distance < 20) & (ddf.fare_amount < 150)] ddf = ddf.repartition(npartitions=8) df_train, df_test = ddf.random_split([0.8, 0.2], random_state=2) columns = ['VendorID', 'passenger_count', 'trip_distance', 'payment_type', 'fare_amount'] X_train, y_train = df_train[columns], df_train['tip_amount'] > 0 X_test, y_test = df_test[columns], df_test['tip_amount'] > 0 X_train, y_train, X_test, y_test = persist( X_train, y_train, X_test, y_test ) X_train.head() y_train.head() print(f"{len(X_train):,d} observations") %%time # this is a *dask-glm* LogisticRegresion, not scikit-learn lm = LogisticRegression(fit_intercept=False) lm.fit(X_train.values, y_train.values) %%time lm.score(X_train.values, y_train.values).compute() %%time lm.score(X_test.values, y_test.values).compute() from sklearn.base import TransformerMixin, BaseEstimator from sklearn.pipeline import make_pipeline class CategoricalEncoder(BaseEstimator, TransformerMixin): Encode `categories` as pandas `Categorical` Parameters ---------- categories : Dict[str, list] Mapping from column name to list of possible values def __init__(self, categories): self.categories = categories def fit(self, X, y=None): # "stateless" transformer. Don't have anything to learn here return self def transform(self, X, y=None): X = X.copy() for column, categories in self.categories.items(): X[column] = X[column].astype('category').cat.set_categories(categories) return X class StandardScaler(BaseEstimator, TransformerMixin): def __init__(self, columns=None, with_mean=True, with_std=True): self.columns = columns self.with_mean = with_mean self.with_std = with_std def fit(self, X, y=None): if self.columns is None: self.columns_ = X.columns else: self.columns_ = self.columns if self.with_mean: self.mean_ = X[self.columns_].mean(0) if self.with_std: self.scale_ = X[self.columns_].std(0) return self def transform(self, X, y=None): X = X.copy() if self.with_mean: X[self.columns_] = X[self.columns_] - self.mean_ if self.with_std: X[self.columns_] = X[self.columns_] / self.scale_ return X.values from dummy_encoder import DummyEncoder pipe = make_pipeline( CategoricalEncoder({"VendorID": [1, 2], "payment_type": [1, 2, 3, 4, 5]}), DummyEncoder(), StandardScaler(columns=['passenger_count', 'trip_distance', 'fare_amount']), LogisticRegression(fit_intercept=False) ) %%time pipe.fit(X_train, y_train.values) pipe.score(X_train, y_train.values).compute() pipe.score(X_test, y_test.values).compute() from sklearn.model_selection import GridSearchCV import dask_searchcv as dcv param_grid = { 'standardscaler__with_std': [True, False], 'logisticregression__lamduh': [.001, .01, .1, 1], } pipe = make_pipeline( CategoricalEncoder({"VendorID": [1, 2], "payment_type": [1, 2, 3, 4, 5]}), DummyEncoder(), StandardScaler(columns=['passenger_count', 'trip_distance', 'fare_amount']), LogisticRegression(fit_intercept=False) ) gs = dcv.GridSearchCV(pipe, param_grid) %%time gs.fit(X_train, y_train.values) pd.DataFrame(gs.cv_results_) gs.score(X_train, y_train.values).compute() gs.score(X_test, y_test.values).compute() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We'll setup a distributed.Client locally. In the real world you could connect to a cluster of dask-workers. Step2: For demonstration, we'll use the perennial NYC taxi cab dataset. Step3: I happen to know that some of the values in this dataset are suspect, so let's drop them. Step4: Now, we'll split our DataFrame into a train and test set, and select our feature matrix and target column (whether the passenger tipped). Step5: With our training data in hand, we fit our logistic regression. Step6: Again, following the lead of scikit-learn we can measure the performance of the estimator on the training dataset using the .score method. Step7: and on the test dataset Step8: Pipelines Step10: First let's write a little transformer to convert columns to Categoricals. Step11: We'll also want a daskified version of scikit-learn's StandardScaler, that won't eagerly Step12: Finally, I've written a dummy encoder transformer that converts categoricals Step13: So that's our pipeline. Step14: And we can score it as well. The Pipeline ensures that all of the nescessary transformations take place before calling the estimator's score method. Step15: Grid Search Step16: We'll search over two hyperparameters Step17: Now we have access to the usual attributes like cv_results_ learned by the grid search object Step18: And we can do our usual checks on model fit for the training set Step19: And the test set
8,004
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import numpy as np from scipy import integrate def trapz(f, a, b, N): Integrate the function f(x) over the range [a,b] with N points. h=(b-a)/N k=np.arange(1,N) return h*(0.5*f(a)+0.5*f(b)+f(a+k*h).sum()) f = lambda x: x**2 g = lambda x: np.sin(x) I = trapz(f, 0, 1, 1000) assert np.allclose(I, 0.33333349999999995) J = trapz(g, 0, np.pi, 1000) assert np.allclose(J, 1.9999983550656628) x,err1=integrate.quad(f,0.0,1.0) y,err2=integrate.quad(g,0.0,np.pi) print("Integral result for f: ", x) print("Trapezoidal result for f: ", I) print("Error for integral of f: ", err1) print("Integral result for g: ", y) print("Trapezoidal result for g: ", J) print("Error for integral of g: ", err2) assert True # leave this cell to grade the previous one <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Trapezoidal rule Step3: Now use scipy.integrate.quad to integrate the f and g functions and see how the result compares with your trapz function. Print the results and errors.
8,005
<ASSISTANT_TASK:> Python Code: import math import numpy as np from datetime import datetime def cart2pol(x, y): r = np.sqrt(x**2 + y**2) phi = np.arctan2(y, x) return(r, phi) from IPython.core.display import Image Image(url='https://upload.wikimedia.org/wikipedia/commons/thumb/7/78/Polar_to_cartesian.svg/1024px-Polar_to_cartesian.svg.png',width=400) x = 3 y = 4 r, phi = cart2pol(x,y) print(r,phi) def cart2pol_list(list_x, list_y): # Prepare empty lists for r and phi values r = np.empty(len(list_x)) phi = np.empty(len(list_x)) # Loop through the lists of x and y, calculating the r and phi values for i in range(len(list_x)): r[i] = np.sqrt(list_x[i]**2 + list_y[i]**2) phi[i] = np.arctan2(list_y[i], list_x[i]) return(r, phi) x_list = np.sin(np.arange(0,2*np.pi,0.1)) y_list = np.cos(np.arange(0,2*np.pi,0.1)) import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 1, figsize=(6,6)) ax.scatter(x_list,y_list) r_list, phi_list = cart2pol_list(x_list,y_list) print(r_list) print(phi_list) cart2pol_vec = np.vectorize(cart2pol) r_list_vec, phi_list_vec = cart2pol_vec(x_list, y_list) print(r_list == r_list_vec) print(phi_list == phi_list_vec) %timeit cart2pol_list(x_list, y_list) %timeit cart2pol_vec(x_list, y_list) def do_maths(start=0, num=10): pos = start big = 1000 * 1000 ave = 0 while pos < num: pos += 1 val = math.sqrt((pos - big) * (pos - big)) ave += val / num return int(ave) t0 = datetime.now() do_maths(num=30000000) dt = datetime.now() - t0 print("Done in {:,.2f} sec.".format(dt.total_seconds())) import multiprocessing t0 = datetime.now() pool = multiprocessing.Pool() processor_count = multiprocessing.cpu_count() # processor_count = 2 # we can Python to use a specific number of cores if desired print(f"Computing with {processor_count} processor(s)") tasks = [] for n in range(1, processor_count + 1): task = pool.apply_async(do_maths, (30000000 * (n - 1) / processor_count, 30000000 * n / processor_count)) tasks.append(task) pool.close() pool.join() dt = datetime.now() - t0 print("Done in {:,.2f} sec.".format(dt.total_seconds())) for t in tasks: print(t.get()) pool = multiprocessing.Pool() # Make a pool ready to recieve taks results = [] # empty list for results for n in range(1, processor_count + 1): # Loop for assigning a number of tasks result = pool.appy_async(function, (arguments)) # make a task by passing it a function and arguments results.append(result) # append the result(s) of this task to the list pool.close() # tell async there are no more tasks coming pool.join() # start running the tasks concurrently for t in results: t.get() # ret`rieve your results, You could print or assign each result to a variable HTML(html) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: As the name suggest cart2pol converts a pair of cartesian coordinates [x, y] to polar coordinates [r, phi] Step2: All well and good. However, what if we want to convert a list of cartesian coordinates to polar coordinates? Step3: These coordinates make a circle centered at [0,0] Step4: This is a bit time consuming to type out though, surely there is a better way to make our functions work for lists of inputs? Step forward vectorise Step5: Like magic! We can assure ourselves that these two methods produce the same answers Step6: But how do they perform? Step7: It is significantly faster, both for code writing and at runtime, to use vectorsie rather than manually looping through lists Step8: Note that you can recover results stored in the task list with get(). This list will be in the same order as that which you used to spawn the processes Step9: The structure of a multiproccess call is Step10: Why can't we multithread in Python?
8,006
<ASSISTANT_TASK:> Python Code: st = 'Print only the words that start with s in this sentence' #Code here st = 'Print only the words that start with s in this sentence' for word in st.split(): if word[0] == 's': print(word ) #Code Here for number in range(0,11): if number % 2 == 0: print(number) #Code in this cell l = [number for number in range(1,51) if number % 3 == 0] print(l) st = 'Print every word in this sentence that has an even number of letters' #Code in this cell st = 'Print every word in this sentence that has an even number of letters' for word in st.split(): if len(word) % 2 == 0: print(word) #Code in this cell l = range(1,101) for val in l: if val % 3 == 0 and val % 5 == 0: print ('FizzBuzz num ' + str(val)) elif val % 3 == 0: print('Fizz num ' + str(val)) elif val % 5 ==0 : print('Buzz num ' + str(val)) st = 'Create a list of the first letters of every word in this string' #Code in this cell st = 'Create a list of the first letters of every word in this string' l = [] for word in st.split(): l.append(word[0]) print(l) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Use range() to print all the even numbers from 0 to 10. Step2: Use List comprehension to create a list of all numbers between 1 and 50 that are divisible by 3. Step3: Go through the string below and if the length of a word is even print "even!" Step4: Write a program that prints the integers from 1 to 100. But for multiples of three print "Fizz" instead of the number, and for the multiples of five print "Buzz". For numbers which are multiples of both three and five print "FizzBuzz". Step5: Use List Comprehension to create a list of the first letters of every word in the string below
8,007
<ASSISTANT_TASK:> Python Code: %matplotlib inline import numpy as np import pandas as pd import statsmodels.api as sm import matplotlib.pyplot as plt np.set_printoptions(precision=4, suppress=True, linewidth=120) from pandas_datareader.data import DataReader # Get the datasets from FRED start = '1979-01-01' end = '2014-12-01' indprod = DataReader('IPMAN', 'fred', start=start, end=end) income = DataReader('W875RX1', 'fred', start=start, end=end) sales = DataReader('CMRMTSPL', 'fred', start=start, end=end) emp = DataReader('PAYEMS', 'fred', start=start, end=end) # dta = pd.concat((indprod, income, sales, emp), axis=1) # dta.columns = ['indprod', 'income', 'sales', 'emp'] # HMRMT = DataReader('HMRMT', 'fred', start='1967-01-01', end=end) # CMRMT = DataReader('CMRMT', 'fred', start='1997-01-01', end=end) # HMRMT_growth = HMRMT.diff() / HMRMT.shift() # sales = pd.Series(np.zeros(emp.shape[0]), index=emp.index) # # Fill in the recent entries (1997 onwards) # sales[CMRMT.index] = CMRMT # # Backfill the previous entries (pre 1997) # idx = sales.ix[:'1997-01-01'].index # for t in range(len(idx)-1, 0, -1): # month = idx[t] # prev_month = idx[t-1] # sales.ix[prev_month] = sales.ix[month] / (1 + HMRMT_growth.ix[prev_month].values) dta = pd.concat((indprod, income, sales, emp), axis=1) dta.columns = ['indprod', 'income', 'sales', 'emp'] dta.ix[:, 'indprod':'emp'].plot(subplots=True, layout=(2, 2), figsize=(15, 6)); # Create log-differenced series dta['dln_indprod'] = (np.log(dta.indprod)).diff() * 100 dta['dln_income'] = (np.log(dta.income)).diff() * 100 dta['dln_sales'] = (np.log(dta.sales)).diff() * 100 dta['dln_emp'] = (np.log(dta.emp)).diff() * 100 # De-mean and standardize dta['std_indprod'] = (dta['dln_indprod'] - dta['dln_indprod'].mean()) / dta['dln_indprod'].std() dta['std_income'] = (dta['dln_income'] - dta['dln_income'].mean()) / dta['dln_income'].std() dta['std_sales'] = (dta['dln_sales'] - dta['dln_sales'].mean()) / dta['dln_sales'].std() dta['std_emp'] = (dta['dln_emp'] - dta['dln_emp'].mean()) / dta['dln_emp'].std() # Get the endogenous data endog = dta.ix['1979-02-01':, 'std_indprod':'std_emp'] # Create the model mod = sm.tsa.DynamicFactor(endog, k_factors=1, factor_order=2, error_order=2) initial_res = mod.fit(method='powell', disp=False) res = mod.fit(initial_res.params) print(res.summary(separate_params=False)) fig, ax = plt.subplots(figsize=(13,3)) # Plot the factor dates = endog.index._mpl_repr() ax.plot(dates, res.factors.filtered[0], label='Factor') ax.legend() # Retrieve and also plot the NBER recession indicators rec = DataReader('USREC', 'fred', start=start, end=end) ylim = ax.get_ylim() ax.fill_between(dates[:-3], ylim[0], ylim[1], rec.values[:-4,0], facecolor='k', alpha=0.1); res.plot_coefficients_of_determination(figsize=(8,2)); usphci = DataReader('USPHCI', 'fred', start='1979-01-01', end='2014-12-01')['USPHCI'] usphci.plot(figsize=(13,3)); dusphci = usphci.diff()[1:].values def compute_coincident_index(mod, res): # Estimate W(1) spec = res.specification design = mod.ssm['design'] transition = mod.ssm['transition'] ss_kalman_gain = res.filter_results.kalman_gain[:,:,-1] k_states = ss_kalman_gain.shape[0] W1 = np.linalg.inv(np.eye(k_states) - np.dot( np.eye(k_states) - np.dot(ss_kalman_gain, design), transition )).dot(ss_kalman_gain)[0] # Compute the factor mean vector factor_mean = np.dot(W1, dta.ix['1972-02-01':, 'dln_indprod':'dln_emp'].mean()) # Normalize the factors factor = res.factors.filtered[0] factor *= np.std(usphci.diff()[1:]) / np.std(factor) # Compute the coincident index coincident_index = np.zeros(mod.nobs+1) # The initial value is arbitrary; here it is set to # facilitate comparison coincident_index[0] = usphci.iloc[0] * factor_mean / dusphci.mean() for t in range(0, mod.nobs): coincident_index[t+1] = coincident_index[t] + factor[t] + factor_mean # Attach dates coincident_index = pd.Series(coincident_index, index=dta.index).iloc[1:] # Normalize to use the same base year as USPHCI coincident_index *= (usphci.ix['1992-07-01'] / coincident_index.ix['1992-07-01']) return coincident_index fig, ax = plt.subplots(figsize=(13,3)) # Compute the index coincident_index = compute_coincident_index(mod, res) # Plot the factor dates = endog.index._mpl_repr() ax.plot(dates, coincident_index, label='Coincident index') ax.plot(usphci.index._mpl_repr(), usphci, label='USPHCI') ax.legend(loc='lower right') # Retrieve and also plot the NBER recession indicators ylim = ax.get_ylim() ax.fill_between(dates[:-3], ylim[0], ylim[1], rec.values[:-4,0], facecolor='k', alpha=0.1); from statsmodels.tsa.statespace import tools class ExtendedDFM(sm.tsa.DynamicFactor): def __init__(self, endog, **kwargs): # Setup the model as if we had a factor order of 4 super(ExtendedDFM, self).__init__( endog, k_factors=1, factor_order=4, error_order=2, **kwargs) # Note: `self.parameters` is an ordered dict with the # keys corresponding to parameter types, and the values # the number of parameters of that type. # Add the new parameters self.parameters['new_loadings'] = 3 # Cache a slice for the location of the 4 factor AR # parameters (a_1, ..., a_4) in the full parameter vector offset = (self.parameters['factor_loadings'] + self.parameters['exog'] + self.parameters['error_cov']) self._params_factor_ar = np.s_[offset:offset+2] self._params_factor_zero = np.s_[offset+2:offset+4] @property def start_params(self): # Add three new loading parameters to the end of the parameter # vector, initialized to zeros (for simplicity; they could # be initialized any way you like) return np.r_[super(ExtendedDFM, self).start_params, 0, 0, 0] @property def param_names(self): # Add the corresponding names for the new loading parameters # (the name can be anything you like) return super(ExtendedDFM, self).param_names + [ 'loading.L%d.f1.%s' % (i, self.endog_names[3]) for i in range(1,4)] def transform_params(self, unconstrained): # Perform the typical DFM transformation (w/o the new parameters) constrained = super(ExtendedDFM, self).transform_params( unconstrained[:-3]) # Redo the factor AR constraint, since we only want an AR(2), # and the previous constraint was for an AR(4) ar_params = unconstrained[self._params_factor_ar] constrained[self._params_factor_ar] = ( tools.constrain_stationary_univariate(ar_params)) # Return all the parameters return np.r_[constrained, unconstrained[-3:]] def untransform_params(self, constrained): # Perform the typical DFM untransformation (w/o the new parameters) unconstrained = super(ExtendedDFM, self).untransform_params( constrained[:-3]) # Redo the factor AR unconstraint, since we only want an AR(2), # and the previous unconstraint was for an AR(4) ar_params = constrained[self._params_factor_ar] unconstrained[self._params_factor_ar] = ( tools.unconstrain_stationary_univariate(ar_params)) # Return all the parameters return np.r_[unconstrained, constrained[-3:]] def update(self, params, transformed=True, complex_step=False): # Peform the transformation, if required if not transformed: params = self.transform_params(params) params[self._params_factor_zero] = 0 # Now perform the usual DFM update, but exclude our new parameters super(ExtendedDFM, self).update(params[:-3], transformed=True, complex_step=complex_step) # Finally, set our new parameters in the design matrix self.ssm['design', 3, 1:4] = params[-3:] # Create the model extended_mod = ExtendedDFM(endog) initial_extended_res = extended_mod.fit(maxiter=1000, disp=False) extended_res = extended_mod.fit(initial_extended_res.params, method='nm', maxiter=1000) print(extended_res.summary(separate_params=False)) extended_res.plot_coefficients_of_determination(figsize=(8,2)); fig, ax = plt.subplots(figsize=(13,3)) # Compute the index extended_coincident_index = compute_coincident_index(extended_mod, extended_res) # Plot the factor dates = endog.index._mpl_repr() ax.plot(dates, coincident_index, '-', linewidth=1, label='Basic model') ax.plot(dates, extended_coincident_index, '--', linewidth=3, label='Extended model') ax.plot(usphci.index._mpl_repr(), usphci, label='USPHCI') ax.legend(loc='lower right') ax.set(title='Coincident indices, comparison') # Retrieve and also plot the NBER recession indicators ylim = ax.get_ylim() ax.fill_between(dates[:-3], ylim[0], ylim[1], rec.values[:-4,0], facecolor='k', alpha=0.1); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Note Step2: Stock and Watson (1991) report that for their datasets, they could not reject the null hypothesis of a unit root in each series (so the series are integrated), but they did not find strong evidence that the series were co-integrated. Step3: Dynamic factors Step4: Estimates Step5: Estimated factors Step6: Post-estimation Step7: Coincident Index Step8: Below we plot the calculated coincident index along with the US recessions and the comparison coincident index USPHCI. Step9: Appendix 1 Step10: So what did we just do? Step11: Although this model increases the likelihood, it is not preferred by the AIC and BIC mesaures which penalize the additional three parameters.
8,008
<ASSISTANT_TASK:> Python Code: import numpy as np import matplotlib.pyplot as plt plt.style.use('seaborn-dark') import openmoc import openmc import openmc.mgxs as mgxs import openmc.data from openmc.openmoc_compatible import get_openmoc_geometry %matplotlib inline # 1.6% enriched fuel fuel = openmc.Material(name='1.6% Fuel') fuel.set_density('g/cm3', 10.31341) fuel.add_nuclide('U235', 3.7503e-4) fuel.add_nuclide('U238', 2.2625e-2) fuel.add_nuclide('O16', 4.6007e-2) # borated water water = openmc.Material(name='Borated Water') water.set_density('g/cm3', 0.740582) water.add_nuclide('H1', 4.9457e-2) water.add_nuclide('O16', 2.4732e-2) # zircaloy zircaloy = openmc.Material(name='Zircaloy') zircaloy.set_density('g/cm3', 6.55) zircaloy.add_nuclide('Zr90', 7.2758e-3) # Instantiate a Materials collection materials_file = openmc.Materials([fuel, water, zircaloy]) # Export to "materials.xml" materials_file.export_to_xml() # Create cylinders for the fuel and clad fuel_outer_radius = openmc.ZCylinder(x0=0.0, y0=0.0, R=0.39218) clad_outer_radius = openmc.ZCylinder(x0=0.0, y0=0.0, R=0.45720) # Create boundary planes to surround the geometry min_x = openmc.XPlane(x0=-0.63, boundary_type='reflective') max_x = openmc.XPlane(x0=+0.63, boundary_type='reflective') min_y = openmc.YPlane(y0=-0.63, boundary_type='reflective') max_y = openmc.YPlane(y0=+0.63, boundary_type='reflective') min_z = openmc.ZPlane(z0=-0.63, boundary_type='reflective') max_z = openmc.ZPlane(z0=+0.63, boundary_type='reflective') # Create a Universe to encapsulate a fuel pin pin_cell_universe = openmc.Universe(name='1.6% Fuel Pin') # Create fuel Cell fuel_cell = openmc.Cell(name='1.6% Fuel') fuel_cell.fill = fuel fuel_cell.region = -fuel_outer_radius pin_cell_universe.add_cell(fuel_cell) # Create a clad Cell clad_cell = openmc.Cell(name='1.6% Clad') clad_cell.fill = zircaloy clad_cell.region = +fuel_outer_radius & -clad_outer_radius pin_cell_universe.add_cell(clad_cell) # Create a moderator Cell moderator_cell = openmc.Cell(name='1.6% Moderator') moderator_cell.fill = water moderator_cell.region = +clad_outer_radius pin_cell_universe.add_cell(moderator_cell) # Create root Cell root_cell = openmc.Cell(name='root cell') root_cell.region = +min_x & -max_x & +min_y & -max_y root_cell.fill = pin_cell_universe # Create root Universe root_universe = openmc.Universe(universe_id=0, name='root universe') root_universe.add_cell(root_cell) # Create Geometry and set root Universe openmc_geometry = openmc.Geometry(root_universe) # Export to "geometry.xml" openmc_geometry.export_to_xml() # OpenMC simulation parameters batches = 50 inactive = 10 particles = 10000 # Instantiate a Settings object settings_file = openmc.Settings() settings_file.batches = batches settings_file.inactive = inactive settings_file.particles = particles settings_file.output = {'tallies': True} # Create an initial uniform spatial source distribution over fissionable zones bounds = [-0.63, -0.63, -0.63, 0.63, 0.63, 0.63] uniform_dist = openmc.stats.Box(bounds[:3], bounds[3:], only_fissionable=True) settings_file.source = openmc.source.Source(space=uniform_dist) # Activate tally precision triggers settings_file.trigger_active = True settings_file.trigger_max_batches = settings_file.batches * 4 # Export to "settings.xml" settings_file.export_to_xml() # Instantiate a "coarse" 2-group EnergyGroups object coarse_groups = mgxs.EnergyGroups([0., 0.625, 20.0e6]) # Instantiate a "fine" 8-group EnergyGroups object fine_groups = mgxs.EnergyGroups([0., 0.058, 0.14, 0.28, 0.625, 4.0, 5.53e3, 821.0e3, 20.0e6]) # Extract all Cells filled by Materials openmc_cells = openmc_geometry.get_all_material_cells().values() # Create dictionary to store multi-group cross sections for all cells xs_library = {} # Instantiate 8-group cross sections for each cell for cell in openmc_cells: xs_library[cell.id] = {} xs_library[cell.id]['transport'] = mgxs.TransportXS(groups=fine_groups) xs_library[cell.id]['fission'] = mgxs.FissionXS(groups=fine_groups) xs_library[cell.id]['nu-fission'] = mgxs.FissionXS(groups=fine_groups, nu=True) xs_library[cell.id]['nu-scatter'] = mgxs.ScatterMatrixXS(groups=fine_groups, nu=True) xs_library[cell.id]['chi'] = mgxs.Chi(groups=fine_groups) # Create a tally trigger for +/- 0.01 on each tally used to compute the multi-group cross sections tally_trigger = openmc.Trigger('std_dev', 1E-2) # Add the tally trigger to each of the multi-group cross section tallies for cell in openmc_cells: for mgxs_type in xs_library[cell.id]: xs_library[cell.id][mgxs_type].tally_trigger = tally_trigger # Instantiate an empty Tallies object tallies_file = openmc.Tallies() # Iterate over all cells and cross section types for cell in openmc_cells: for rxn_type in xs_library[cell.id]: # Set the cross sections domain to the cell xs_library[cell.id][rxn_type].domain = cell # Tally cross sections by nuclide xs_library[cell.id][rxn_type].by_nuclide = True # Add OpenMC tallies to the tallies file for XML generation for tally in xs_library[cell.id][rxn_type].tallies.values(): tallies_file.append(tally, merge=True) # Export to "tallies.xml" tallies_file.export_to_xml() # Run OpenMC openmc.run() # Load the last statepoint file sp = openmc.StatePoint('statepoint.082.h5') # Iterate over all cells and cross section types for cell in openmc_cells: for rxn_type in xs_library[cell.id]: xs_library[cell.id][rxn_type].load_from_statepoint(sp) nufission = xs_library[fuel_cell.id]['nu-fission'] nufission.print_xs(xs_type='micro', nuclides=['U235', 'U238']) nufission = xs_library[fuel_cell.id]['nu-fission'] nufission.print_xs(xs_type='macro', nuclides='sum') nuscatter = xs_library[moderator_cell.id]['nu-scatter'] df = nuscatter.get_pandas_dataframe(xs_type='micro') df.head(10) # Extract the 8-group transport cross section for the fuel fine_xs = xs_library[fuel_cell.id]['transport'] # Condense to the 2-group structure condensed_xs = fine_xs.get_condensed_xs(coarse_groups) condensed_xs.print_xs() df = condensed_xs.get_pandas_dataframe(xs_type='micro') df # Create an OpenMOC Geometry from the OpenMC Geometry openmoc_geometry = get_openmoc_geometry(sp.summary.geometry) # Get all OpenMOC cells in the gometry openmoc_cells = openmoc_geometry.getRootUniverse().getAllCells() # Inject multi-group cross sections into OpenMOC Materials for cell_id, cell in openmoc_cells.items(): # Ignore the root cell if cell.getName() == 'root cell': continue # Get a reference to the Material filling this Cell openmoc_material = cell.getFillMaterial() # Set the number of energy groups for the Material openmoc_material.setNumEnergyGroups(fine_groups.num_groups) # Extract the appropriate cross section objects for this cell transport = xs_library[cell_id]['transport'] nufission = xs_library[cell_id]['nu-fission'] nuscatter = xs_library[cell_id]['nu-scatter'] chi = xs_library[cell_id]['chi'] # Inject NumPy arrays of cross section data into the Material # NOTE: Sum across nuclides to get macro cross sections needed by OpenMOC openmoc_material.setSigmaT(transport.get_xs(nuclides='sum').flatten()) openmoc_material.setNuSigmaF(nufission.get_xs(nuclides='sum').flatten()) openmoc_material.setSigmaS(nuscatter.get_xs(nuclides='sum').flatten()) openmoc_material.setChi(chi.get_xs(nuclides='sum').flatten()) # Generate tracks for OpenMOC track_generator = openmoc.TrackGenerator(openmoc_geometry, num_azim=128, azim_spacing=0.1) track_generator.generateTracks() # Run OpenMOC solver = openmoc.CPUSolver(track_generator) solver.computeEigenvalue() # Print report of keff and bias with OpenMC openmoc_keff = solver.getKeff() openmc_keff = sp.k_combined[0] bias = (openmoc_keff - openmc_keff) * 1e5 print('openmc keff = {0:1.6f}'.format(openmc_keff)) print('openmoc keff = {0:1.6f}'.format(openmoc_keff)) print('bias [pcm]: {0:1.1f}'.format(bias)) openmoc_geometry = get_openmoc_geometry(sp.summary.geometry) openmoc_cells = openmoc_geometry.getRootUniverse().getAllCells() # Inject multi-group cross sections into OpenMOC Materials for cell_id, cell in openmoc_cells.items(): # Ignore the root cell if cell.getName() == 'root cell': continue openmoc_material = cell.getFillMaterial() openmoc_material.setNumEnergyGroups(coarse_groups.num_groups) # Extract the appropriate cross section objects for this cell transport = xs_library[cell_id]['transport'] nufission = xs_library[cell_id]['nu-fission'] nuscatter = xs_library[cell_id]['nu-scatter'] chi = xs_library[cell_id]['chi'] # Perform group condensation transport = transport.get_condensed_xs(coarse_groups) nufission = nufission.get_condensed_xs(coarse_groups) nuscatter = nuscatter.get_condensed_xs(coarse_groups) chi = chi.get_condensed_xs(coarse_groups) # Inject NumPy arrays of cross section data into the Material openmoc_material.setSigmaT(transport.get_xs(nuclides='sum').flatten()) openmoc_material.setNuSigmaF(nufission.get_xs(nuclides='sum').flatten()) openmoc_material.setSigmaS(nuscatter.get_xs(nuclides='sum').flatten()) openmoc_material.setChi(chi.get_xs(nuclides='sum').flatten()) # Generate tracks for OpenMOC track_generator = openmoc.TrackGenerator(openmoc_geometry, num_azim=128, azim_spacing=0.1) track_generator.generateTracks() # Run OpenMOC solver = openmoc.CPUSolver(track_generator) solver.computeEigenvalue() # Print report of keff and bias with OpenMC openmoc_keff = solver.getKeff() openmc_keff = sp.k_combined[0] bias = (openmoc_keff - openmc_keff) * 1e5 print('openmc keff = {0:1.6f}'.format(openmc_keff)) print('openmoc keff = {0:1.6f}'.format(openmoc_keff)) print('bias [pcm]: {0:1.1f}'.format(bias)) # Create a figure of the U-235 continuous-energy fission cross section fig = openmc.plot_xs('U235', ['fission']) # Get the axis to use for plotting the MGXS ax = fig.gca() # Extract energy group bounds and MGXS values to plot fission = xs_library[fuel_cell.id]['fission'] energy_groups = fission.energy_groups x = energy_groups.group_edges y = fission.get_xs(nuclides=['U235'], order_groups='decreasing', xs_type='micro') y = np.squeeze(y) # Fix low energy bound x[0] = 1.e-5 # Extend the mgxs values array for matplotlib's step plot y = np.insert(y, 0, y[0]) # Create a step plot for the MGXS ax.plot(x, y, drawstyle='steps', color='r', linewidth=3) ax.set_title('U-235 Fission Cross Section') ax.legend(['Continuous', 'Multi-Group']) ax.set_xlim((x.min(), x.max())) # Construct a Pandas DataFrame for the microscopic nu-scattering matrix nuscatter = xs_library[moderator_cell.id]['nu-scatter'] df = nuscatter.get_pandas_dataframe(xs_type='micro') # Slice DataFrame in two for each nuclide's mean values h1 = df[df['nuclide'] == 'H1']['mean'] o16 = df[df['nuclide'] == 'O16']['mean'] # Cast DataFrames as NumPy arrays h1 = h1.values o16 = o16.values # Reshape arrays to 2D matrix for plotting h1.shape = (fine_groups.num_groups, fine_groups.num_groups) o16.shape = (fine_groups.num_groups, fine_groups.num_groups) # Create plot of the H-1 scattering matrix fig = plt.subplot(121) fig.imshow(h1, interpolation='nearest', cmap='jet') plt.title('H-1 Scattering Matrix') plt.xlabel('Group Out') plt.ylabel('Group In') # Create plot of the O-16 scattering matrix fig2 = plt.subplot(122) fig2.imshow(o16, interpolation='nearest', cmap='jet') plt.title('O-16 Scattering Matrix') plt.xlabel('Group Out') plt.ylabel('Group In') # Show the plot on screen plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: First we need to define materials that will be used in the problem. We'll create three distinct materials for water, clad and fuel. Step2: With our materials, we can now create a Materials object that can be exported to an actual XML file. Step3: Now let's move on to the geometry. Our problem will have three regions for the fuel, the clad, and the surrounding coolant. The first step is to create the bounding surfaces -- in this case two cylinders and six reflective planes. Step4: With the surfaces defined, we can now create cells that are defined by intersections of half-spaces created by the surfaces. Step5: OpenMC requires that there is a "root" universe. Let us create a root cell that is filled by the pin cell universe and then assign it to the root universe. Step6: We now must create a geometry that is assigned a root universe and export it to XML. Step7: Next, we must define simulation parameters. In this case, we will use 10 inactive batches and 40 active batches each with 10,000 particles. Step8: Now we are finally ready to make use of the openmc.mgxs module to generate multi-group cross sections! First, let's define "coarse" 2-group and "fine" 8-group structures using the built-in EnergyGroups class. Step9: Now we will instantiate a variety of MGXS objects needed to run an OpenMOC simulation to verify the accuracy of our cross sections. In particular, we define transport, fission, nu-fission, nu-scatter and chi cross sections for each of the three cells in the fuel pin with the 8-group structure as our energy groups. Step10: Next, we showcase the use of OpenMC's tally precision trigger feature in conjunction with the openmc.mgxs module. In particular, we will assign a tally trigger of 1E-2 on the standard deviation for each of the tallies used to compute multi-group cross sections. Step11: Now, we must loop over all cells to set the cross section domains to the various cells - fuel, clad and moderator - included in the geometry. In addition, we will set each cross section to tally cross sections on a per-nuclide basis through the use of the MGXS class' boolean by_nuclide instance attribute. Step12: Now we a have a complete set of inputs, so we can go ahead and run our simulation. Step13: Tally Data Processing Step14: The statepoint is now ready to be analyzed by our multi-group cross sections. We simply have to load the tallies from the StatePoint into each object as follows and our MGXS objects will compute the cross sections for us under-the-hood. Step15: That's it! Our multi-group cross sections are now ready for the big spotlight. This time we have cross sections in three distinct spatial zones - fuel, clad and moderator - on a per-nuclide basis. Step16: Our multi-group cross sections are capable of summing across all nuclides to provide us with macroscopic cross sections as well. Step17: Although a printed report is nice, it is not scalable or flexible. Let's extract the microscopic cross section data for the moderator as a Pandas DataFrame . Step18: Next, we illustate how one can easily take multi-group cross sections and condense them down to a coarser energy group structure. The MGXS class includes a get_condensed_xs(...) method which takes an EnergyGroups parameter with a coarse(r) group structure and returns a new MGXS condensed to the coarse groups. We illustrate this process below using the 2-group structure created earlier. Step19: Group condensation is as simple as that! We now have a new coarse 2-group TransportXS in addition to our original 8-group TransportXS. Let's inspect the 2-group TransportXS by printing it to the screen and extracting a Pandas DataFrame as we have already learned how to do. Step20: Verification with OpenMOC Step21: Next, we we can inject the multi-group cross sections into the equivalent fuel pin cell OpenMOC geometry. Step22: We are now ready to run OpenMOC to verify our cross-sections from OpenMC. Step23: We report the eigenvalues computed by OpenMC and OpenMOC here together to summarize our results. Step24: As a sanity check, let's run a simulation with the coarse 2-group cross sections to ensure that they also produce a reasonable result. Step25: There is a non-trivial bias in both the 2-group and 8-group cases. In the case of a pin cell, one can show that these biases do not converge to <100 pcm with more particle histories. For heterogeneous geometries, additional measures must be taken to address the following three sources of bias Step26: Another useful type of illustration is scattering matrix sparsity structures. First, we extract Pandas DataFrames for the H-1 and O-16 scattering matrices. Step27: Matplotlib's imshow routine can be used to plot the matrices to illustrate their sparsity structures.
8,009
<ASSISTANT_TASK:> Python Code: %matplotlib inline import pylab import matplotlib import pandas import numpy dateparse = lambda x: pandas.datetime.strptime(x, '%Y-%m-%d') sessoes = pandas.read_csv('sessoes_democratica_org.csv',index_col=0,parse_dates=['data'], date_parser=dateparse) del sessoes['tamanho'] total0 = numpy.sum(sessoes['sessao'].map(len)) print(total0) def substitui_palavras_comuns(texto): t = texto.replace('.',' ').replace('\n',' ').replace(',',' ').replace(')',' ').replace('(',' ').replace('!',' ').replace('?',' ').replace(':',' ').replace(';',' ') t = t.replace(' de ',' ').replace(' que ',' ').replace(' do ',' ').replace(' da ',' ').replace(' sr ',' ').replace(' não ',' ').replace(' em ',' ').replace(' se ','').replace(' para',' ').replace(' os ',' ').replace(' dos ',' ').replace(' uma ',' ').replace(' um ',' ').replace(' as ',' ').replace(' dos ',' ').replace(' no ',' ').replace(' dos ',' ').replace('presidente','').replace(' na ',' ').replace(' por ','').replace('presidente','').replace(' com ',' ').replace(' ao ',' ').replace('deputado','').replace(' das ',' ').replace(' como ','').replace('governo','').replace(' ou ','').replace(' mais ',' ').replace(' assembleia ','').replace(' ser ',' ').replace(' tem ',' ') t = t.replace(' srs ','').replace(' pelo ','').replace(' mas ','').replace(' foi ','').replace('srs.','').replace('palavra','').replace(' que ','').replace(' sua ','').replace(' artigo ','').replace(' nos ','').replace(' eu ','').replace('muito','').replace('sobre ','').replace('também','').replace('proposta','').replace(' aos ',' ').replace(' esta ',' ').replace(' já ',' ') t = t.replace(' vamos ',' ').replace(' nesta ',' ').replace(' lhe ',' ').replace(' meu ',' ').replace(' eu ',' ').replace(' vai ',' ') t = t.replace(' isso ',' ').replace(' dia ',' ').replace(' discussão ',' ').replace(' dizer ',' ').replace(' seus ',' ').replace(' apenas ',' ').replace(' agora ',' ') t = t.replace(' ª ',' ').replace(' foram ',' ').replace(' pois ',' ').replace(' nem ',' ').replace(' suas ',' ').replace(' deste ',' ').replace(' quer ',' ').replace(' desta ',' ').replace(' qual ',' ') t = t.replace(' o ',' ').replace(' a ',' ').replace(' e ',' ').replace(' é ',' ').replace(' à ',' ').replace(' s ',' ') t = t.replace(' - ','').replace(' º ',' ').replace(' n ',' ').replace(' . ',' ').replace(' são ',' ').replace(' está ',' ').replace(' seu ',' ').replace(' há ',' ').replace('orador',' ').replace(' este ',' ').replace(' pela ',' ').replace(' bem ',' ').replace(' nós ',' ').replace('porque','').replace('aqui','').replace(' às ',' ').replace('ainda','').replace('todos','').replace(' só ',' ').replace('fazer',' ').replace(' sem ',' ').replace(' qualquer ',' ').replace(' quanto ',' ').replace(' pode ',' ').replace(' nosso ',' ').replace(' neste ',' ').replace(' ter ',' ').replace(' mesmo ',' ').replace(' essa ',' ').replace(' até ',' ').replace(' me ',' ').replace(' nossa ',' ').replace(' entre ',' ').replace(' nas ',' ').replace(' esse ',' ').replace(' será ',' ').replace(' isto ',' ').replace(' quando ',' ').replace(' seja ',' ').replace(' assim ',' ').replace(' quanto ',' ').replace(' pode ',' ').replace(' é ',' ') t = t.replace(' ',' ').replace(' ',' ').replace(' ',' ') return t sessoes['sessao'] = sessoes['sessao'].map(substitui_palavras_comuns) import re from collections import Counter def agrupa_palavras(texto): texto = texto.lower() #processa tudo em minusculas palavras = re.split(';|,|\n| |\(|\)|\?|\!|:',texto) # separa as palavras palavras = [x.title() for x in palavras if len(x)>0] # organiza e remove as palavras com menos de 5 caracteres return palavras def conta_palavras(sessoes): lista = sessoes['sessao'].map(agrupa_palavras) # cria uma lista de 'lista de palavras', um elemento por sessao palavras = [] for l in lista: palavras.extend(l) # junta as 'listas de palavras' todas na mesma lista return Counter(palavras).most_common(100) # conta as palavras mais frequentes x = conta_palavras(sessoes[1:100]) for (y,z) in x: print(str(str(z)+' x '+y)) total = numpy.sum(sessoes['sessao'].map(len)) print(str(total/total0*100)+' %') print(total) sessoes.to_csv('sessoes_democratica_clipped.csv') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Temos ~800 MB de dados. O servidor onde o backend do site vai funcionar apenas têm 1GB de memória, o que cria um desafio técnico. Como a útilidade do site é apenas contar palavras ou expressões que ocorrem mais em certas sessões, e não em todas as sessões ('enfermeiro' vs 'deputado'), podemos retirar essas palavras mais usuais Step2: Fazendo uma contagem ás palavras mais frequentes que ainda restam Step3: E estimando a redução de tamanho Step4: 536 MB. Nada mau. Graças a esta redução tornou-se possível fazer uma query do site funcionar em ~4 seg em vez de 30 seg pois agora os dados cabem na memória. De notar que a ordem das palavras é a mesma, mas geram-se alguns problemas contando certas expressões ('porto de mar' é agora 'porto mar', e contando 'porto mar' tambem se contam ocorrencias de '(...)Porto. Mar(...)', pois retiramos os pontos e reduzimos os espaços consecutivos a um único. Mesmo assim, o dataset é perfeitamente útil para identificar em que sessões se falou de um certo assunto.
8,010
<ASSISTANT_TASK:> Python Code: # Import libraries import tensorflow as tf import numpy as np import time import collections import os # Import MNIST data with TensorFlow from tensorflow.examples.tutorials.mnist import input_data mnist = input_data.read_data_sets(os.path.join('datasets', 'mnist'), one_hot=True) # load data in local folder train_data = mnist.train.images.astype(np.float32) train_labels = mnist.train.labels test_data = mnist.test.images.astype(np.float32) test_labels = mnist.test.labels print(train_data.shape) print(train_labels.shape) print(test_data.shape) print(test_labels.shape) # computational graph inputs batch_size = 100 d = train_data.shape[1] nc = 10 x = tf.placeholder(tf.float32,[batch_size,d]); print('x=',x,x.get_shape()) y_label = YOUR CODE HERE # computational graph variables initial = tf.truncated_normal([d,nc], stddev=0.1); W = tf.Variable(initial); print('W=',W.get_shape()) b = YOUR CODE HERE # Construct CG / output value y = YOUR CODE HERE; print('y1=',y,y.get_shape()) y += b; print('y2=',y,y.get_shape()) y = YOUR CODE HERE; print('y3=',y,y.get_shape()) # Loss cross_entropy = tf.reduce_mean(-tf.reduce_sum(YOUR CODE HERE * tf.log(YOUR CODE HERE), 1)) reg_loss = YOUR CODE HERE reg_par = 1e-3 total_loss = YOUR CODE HERE # Update CG variables / backward pass train_step = YOUR CODE HERE # Accuracy correct_prediction = YOUR CODE HERE accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) # Create test set idx = np.random.permutation(test_data.shape[0]) # rand permutation idx = idx[:batch_size] test_x, test_y = test_data[idx,:], test_labels[idx] n = train_data.shape[0] indices = collections.deque() # Running Computational Graph init = tf.initialize_all_variables() sess = tf.Session() sess.run(init) for i in range(50): # Batch extraction if len(indices) < batch_size: indices.extend(np.random.permutation(n)) # rand permutation idx = [indices.popleft() for i in range(batch_size)] # extract n_batch data batch_x, batch_y = train_data[idx,:], train_labels[idx] # Run CG for variable training _,acc_train,total_loss_o = sess.run([train_step,accuracy,total_loss], feed_dict={x: batch_x, y_label: batch_y}) print('\nIteration i=',i,', train accuracy=',acc_train,', loss=',total_loss_o) # Run CG for testset acc_test = sess.run(accuracy, feed_dict={x: test_x, y_label: test_y}) print('test accuracy=',acc_test) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1st Step Step2: Question 2 Step3: Question 3 Step4: Question 4 Step5: Question 5 Step6: Question 6 Step7: Question 7 Step8: Question 8 Step9: 2nd Step
8,011
<ASSISTANT_TASK:> Python Code: import json, shapely, fiona, os import seaborn as sns import pandas as pd import geopandas as gpd import networkx as nx import matplotlib.pyplot as plt %matplotlib inline # load the sample dataset (iris) iris = sns.load_dataset('iris') #look at it: print("Rows: ",len(iris)) iris.head() iris.species.value_counts() #Now let's plot it: ax = iris[iris.species=='setosa'].plot(kind='scatter', x='sepal_length', y='petal_length', color='steelblue', figsize=(10,6)) iris[iris.species=='virginica'].plot(kind='scatter', x='sepal_length', y='petal_length', ax=ax, color='red') iris[iris.species=='versicolor'].plot(kind='scatter', x='sepal_length', y='petal_length', ax=ax, color='orange') ax.legend(['Setosa','Virginica','Versicolor']) # First we're going to read in the default data path = gpd.datasets.get_path('naturalearth_lowres') df = gpd.read_file(path) df.head() print("Average Population per country: {0}".format(df.pop_est.mean().round())) print("Median Population per country: {0}".format(df.pop_est.median().round())) #Now let's plot it df.plot(figsize=(10,8)) # Get fancier with other libraries import geoplot fig, axes = plt.subplots(1,2) fig.set_size_inches(15,8) geoplot.cartogram(df[df['continent'] == 'Africa'], scale='pop_est', limits=(0.2, 1), figsize=(7, 8), ax=axes[0]) geoplot.cartogram(df[df['continent'] == 'South America'], scale='pop_est', limits=(0.2, 1), figsize=(7, 8), ax=axes[1]) df = gpd.read_file('data/HydrologyLine.shp') df.columns = ['layer','length','geometry'] df.head() df.plot(figsize=(15,8)) df.crs mercator = df.head(10).to_crs({'init': 'epsg:4326'}) osmp_lands = gpd.read_file('data/OSMPLands.shp') osmp_lands.head(3) ax = osmp_lands[osmp_lands.TYPE=='Conservation Easement'].plot(figsize=(15,8)) osmp_lands[osmp_lands.TYPE!='Conservation Easement'].plot(ax=ax,color='green') # geoplot.choropleth(osmp_lands, hue='PropertyID', cmap='Greens', figsize=(8, 4)) crime = gpd.read_file('data/Target_Crime_Locations.shp') crime['date'] = crime.REPORTDATE.apply(lambda x: pd.Timestamp(x).date()) crime['year'] = crime.date.apply(lambda x: x.year) crime.head() ax = crime.groupby('date').aggregate({"REPORTNUM":"count"}).cumsum().plot() ax.set_title("Amount of crime reports filed over time"); # Looks like crime is not going up in Boulder? crime.OFFENSE.value_counts() crime[crime.OFFENSE=='Trespassing'].groupby('date').aggregate('count')['OBJECTID'].cumsum().plot(figsize=(15,8)) conservation_easement = osmp_lands[osmp_lands.TYPE=='Conservation Easement'].to_crs(crime.crs) ax = conservation_easement.plot(figsize=(15,8)) crime[(crime.OFFENSE=='Trespassing') & (crime.year==2018)].plot(ax=ax, color='red', linewidth=0.01) crimes_on_osmplands = gpd.sjoin(osmp_lands.to_crs(crime.crs),crime) #Spatial join Points to polygons crimes_on_osmplands.head(2) # What crimes happpen on OSMP lands? crimes_on_osmplands.OFFENSE.value_counts() prairie = gpd.read_file('data/prairies.shp') print("Found {0} colonies".format(len(prairie))) prairie.head() prairie.head().buffer(0.001).plot() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1. Create a dataframe with Pandas Step2: 2. GeoPandas Step3: 3 Cities? Step4: Let's compare some data? Step5: Crime? Step6: <br><br><hr><br><br>
8,012
<ASSISTANT_TASK:> Python Code: def format_fasta(header, sequence): return header + '\n' + '\n'.join(re.findall('\w{,80}', sequence)) genetic_code_name = './genetic-code.txt' input_file_name = './M10051.txt' import re with open(genetic_code_name, 'r') as input_file: genetic_code_rows = input_file.readlines() genetic_code_rows splitted_genetic_code = [row.rstrip().split(',') for row in genetic_code_rows] tuple_list = [(codon, ammino_list[0]) for ammino_list in splitted_genetic_code for codon in ammino_list[1:]] tuple_list genetic_code_dict = dict(tuple_list) genetic_code_dict with open(input_file_name, 'r') as input_file: embl_str = input_file.read() print(embl_str) s = re.search('^ID\s+(\w+)', embl_str, re.M) identifier = s.group(1) identifier s = re.search('^ID.+\s+(\w+);', embl_str, re.M) organism = s.group(1) organism seq_row_list = re.findall('^(\s+\D+)\d+', embl_str, re.M) #seq_row_list seq_chunk_list = [re.findall('\w+', row) for row in seq_row_list] #seq_chunk_list nucleotide_sequence = ''.join([''.join(six_chunk_list) for six_chunk_list in seq_chunk_list]) nucleotide_sequence s = re.search('^FT\s+\/translation=\"(\w+)$', embl_str, re.M) protein_prefix = s.group(1) #protein_prefix protein_list = re.findall('^FT\s+([A-Z]+)"?$', embl_str, re.M) #protein_list protein_list[:0] = [protein_prefix] protein_sequence = ''.join([''.join(chunk) for chunk in protein_list]) protein_sequence s = re.search('^FT\s+CDS\s+(\d+)..(\d+)$', embl_str, re.M) cds_start = s.group(1) cds_end = s.group(2) cds_start cds_end cds_sequence = nucleotide_sequence[int(cds_start)-1:int(cds_end)] cds_sequence header = '>' + identifier + '-' + organism + '; len = ' + str(len(cds_sequence)) + ';' exist_codon_start = 'no' exist_codon_end = 'no' if cds_sequence[:3] == 'atg': exist_codon_start = 'yes' if cds_sequence[-3:] in ['taa', 'tga', 'tag']: exist_codon_end = 'yes' header = header + ' start = ' + exist_codon_start + ';' header = header + ' end = ' + exist_codon_end cds_sequence_fasta = format_fasta(header, cds_sequence) print(cds_sequence_fasta) codon_list = re.findall('\w{1,3}', cds_sequence) codon_list = [cds_sequence[i:i+3] for i in list(range(0, len(cds_sequence), 3))] codon_list from collections import Counter codon_frequency = Counter(codon_list).most_common() codon_frequency ammino_list = [ammino for ammino in protein_sequence] ammino_list = list(protein_sequence) ammino_list = re.findall('\w', protein_sequence) ammino_list ammino_frequency = Counter(ammino_list).most_common() ammino_frequency cds_translation1 = ''.join([genetic_code_dict[codon] for codon in codon_list[:-1]]) cds_translation1 cds_translation2 = re.sub('\w{3}', lambda x : genetic_code_dict[x.group()], cds_sequence[:-3]) cds_translation2 cds_translation1 == cds_translation2 cds_translation1 == protein_sequence <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: NOTA BENE Step2: Importazione del modulo re per utilizzare le espressioni regolari. Step3: Lettura del file del codice genetico in una lista di righe Step4: Costruzione del dizionario del codice genetico Step5: Costruire il dizionario con la funzione dict(). Step6: Lettura del file EMBL in un'unica stringa Step7: Estrazione dell'identificatore univoco e dell'organismo relativo all'entry. Step8: Estrazione dell'organismo. Step9: Estrazione della sequenza nucleotidica Step10: Estrarre dalla lista appena costruita, la lista contenente i pezzi di lunghezza 10 della sequenza nucleotidica in modo tale che l'elemento i-esimo sia una lista annidata contenente i sei pezzi di sequenza relativi all'i-esimo record della lista appena costruita. Step11: Concatenare i pezzi della lista in un'unica stringa. Step12: Estrazione della sequenza della proteina Step13: Ottenere la lista degli altri record di proteina Step14: Aggiungere in testa alla lista il prefisso trovato prima e concatenare tutti gli elementi della lista per ottenere la sequenza della proteina in un'unica stringa. Step15: Coding sequence (CDS) in formato FASTA Step16: Ottenere la sequenza della CDS. Step17: Produrre la sequenza della CDS in formato FASTA con il seguente header Step18: Distribuzione di frequenza dei codoni della CDS Step19: In alternativa (by Andrea Vignati), usare la funzione range() per creare la lista delle posizioni di inizio 0, 3, 6, 9, 12, ... dei codoni e usare una list comprehension che estragga i codoni sulla base di tali posizioni. Step20: Costruire la lista di tuple (codone, frequenza) elencate per frequenze decrescenti. Step21: Distribuzione di frequenza degli amminoacidi della proteina letta dal file EMBL Step22: Costruire la lista di tuple (amminoacido, frequenza) elencate per frequenza decrescente. Step23: Validazione della sequenza della proteina letta dal file EMBL Step24: Alternativa2 Step25: Verificare che le due alternative portano alla stessa traduzione. Step26: Verificare infine che la proteina letta dal file EMBL è uguale a quella ottenuta per traduzione della CDS.
8,013
<ASSISTANT_TASK:> Python Code: # system functions that are always useful to have import time, sys, os import pickle # basic numeric setup import numpy as np from numpy import linalg from scipy import stats # inline plotting %matplotlib inline # plotting import matplotlib from matplotlib import pyplot as plt # seed the random number generator rstate = np.random.default_rng(520) # re-defining plotting defaults from matplotlib import rcParams rcParams.update({'xtick.major.pad': '7.0'}) rcParams.update({'xtick.major.size': '7.5'}) rcParams.update({'xtick.major.width': '1.5'}) rcParams.update({'xtick.minor.pad': '7.0'}) rcParams.update({'xtick.minor.size': '3.5'}) rcParams.update({'xtick.minor.width': '1.0'}) rcParams.update({'ytick.major.pad': '7.0'}) rcParams.update({'ytick.major.size': '7.5'}) rcParams.update({'ytick.major.width': '1.5'}) rcParams.update({'ytick.minor.pad': '7.0'}) rcParams.update({'ytick.minor.size': '3.5'}) rcParams.update({'ytick.minor.width': '1.0'}) rcParams.update({'font.size': 30}) import dynesty ndim = 200 # number of dimensions C = np.identity(ndim) # set covariance to identity matrix Cinv = linalg.inv(C) # precision matrix lnorm = -0.5 * (np.log(2 * np.pi) * ndim + np.log(linalg.det(C))) # ln(normalization) # 250-D iid standard normal log-likelihood def loglikelihood(x): Multivariate normal log-likelihood. return -0.5 * np.dot(x, np.dot(Cinv, x)) + lnorm # gradient of log-likelihood *with respect to u* # i.e. d(lnl(v))/dv * dv/du where # dv/du = 1. / prior(v) def gradient(x): Gradient of multivariate normal log-likelihood. return -np.dot(Cinv, x) / stats.norm.pdf(x) # prior transform (iid standard normal prior) def prior_transform(u): Transforms our unit cube samples `u` to a standard normal prior. return stats.norm.ppf(u) # ln(evidence) lnz_truth = lnorm - 0.5 * ndim * np.log(2) print(lnz_truth) # hamiltonian slice sampling ('hslice') sampler = dynesty.NestedSampler(loglikelihood, prior_transform, ndim, nlive=50, bound='none', sample='hslice', slices=10, gradient=gradient, rstate=rstate) sampler.run_nested(dlogz=0.01) res = sampler.results from dynesty import plotting as dyplot # evidence check fig, axes = dyplot.runplot(res, color='red', lnz_truth=lnz_truth, truth_color='black', logplot=True) fig.tight_layout() # posterior check from dynesty.results import Results dims = [-1, -2, -3, -4, -5] fig, ax = plt.subplots(5, 5, figsize=(25, 25)) samps, samps_t = res.samples, res.samples[:,dims] dres = res.asdict() dres['samples'] = samps_t res = Results(dres) fg, ax = dyplot.cornerplot(res, color='red', truths=np.zeros(ndim), truth_color='black', span=[(-3.5, 3.5) for i in range(len(dims))], show_titles=True, title_kwargs={'y': 1.05}, quantiles=None, fig=(fig, ax)) dres = res.asdict() dres['samples'] = samps res = Results(dres) print(1.96 / np.sqrt(2)) # let's confirm we actually got the entire distribution from dynesty import utils weights = np.exp(res.logwt - res.logz[-1]) mu, cov = utils.mean_and_cov(samps, weights) # plot residuals from scipy.stats.kde import gaussian_kde mu_kde = gaussian_kde(mu) xgrid = np.linspace(-0.5, 0.5, 1000) mu_pdf = mu_kde.pdf(xgrid) cov_kde = gaussian_kde((cov - C).flatten()) xgrid2 = np.linspace(-0.3, 0.3, 1000) cov_pdf = cov_kde.pdf(xgrid2) plt.figure(figsize=(16, 6)) plt.subplot(1, 2, 1) plt.plot(xgrid, mu_pdf, lw=3, color='black') plt.xlabel('Mean Offset') plt.ylabel('PDF') plt.subplot(1, 2, 2) plt.plot(xgrid2, cov_pdf, lw=3, color='red') plt.xlabel('Covariance Offset') plt.ylabel('PDF') # print values print('Means (0.):', np.mean(mu), '+/-', np.std(mu)) print('Variance (0.5):', np.mean(np.diag(cov)), '+/-', np.std(np.diag(cov))) cov_up = np.triu(cov, k=1).flatten() cov_low = np.tril(cov,k=-1).flatten() cov_offdiag = np.append(cov_up[abs(cov_up) != 0.], cov_low[cov_low != 0.]) print('Covariance (0.):', np.mean(cov_offdiag), '+/-', np.std(cov_offdiag)) plt.tight_layout() # plot individual values plt.figure(figsize=(20,6)) plt.subplot(1, 3, 1) plt.plot(mu, 'k.') plt.ylabel(r'$\Delta$ Mean') plt.xlabel('Dimension') plt.ylim([-np.max(np.abs(mu)) - 0.05, np.max(np.abs(mu)) + 0.05]) plt.tight_layout() plt.subplot(1, 3, 2) dcov = np.diag(cov) - 0.5 plt.plot(dcov, 'r.') plt.ylabel(r' $\Delta$ Variance') plt.xlabel('Dimension') plt.ylim([-np.max(np.abs(dcov)) - 0.02, np.max(np.abs(dcov)) + 0.02]) plt.tight_layout() plt.subplot(1, 3, 3) dcovlow = cov_low[cov_low != 0.] dcovup = cov_up[cov_up != 0.] dcovoff = np.append(dcovlow, dcovup) plt.plot(dcovlow, 'b.', ms=1, alpha=0.3) plt.plot(dcovup, 'b.', ms=1, alpha=0.3) plt.ylabel(r' $\Delta$ Covariance') plt.xlabel('Cross-Term') plt.ylim([-np.max(np.abs(dcovoff)) - 0.02, np.max(np.abs(dcovoff)) + 0.02]) plt.tight_layout() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step4: Here we will quickly demonstrate that slice sampling is able to cope with very high-dimensional problems without the use of gradients. Our target will in this case be a 250-D uncorrelated multivariate normal distribution with an identical prior. Step5: We will use "Hamiltonian" Slice Sampling ('hslice') with our gradients to sample in high dimensions. Step6: Now let's see how our sampling went. Step7: That looks good! Obviously we can't plot the full 200x200 plot, but 5x5 subplots should do.
8,014
<ASSISTANT_TASK:> Python Code: # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. %env PROJECT_ID <PROJECT_ID> %env BUCKET_NAME <BUCKET_NAME> %env REGION us-central1 %env TRAINER_PACKAGE_PATH ./census_training %env MAIN_TRAINER_MODULE census_training.train %env JOB_DIR gs://<BUCKET_NAME>/scikit_learn_job_dir %env RUNTIME_VERSION 1.9 %env PYTHON_VERSION 3.5 ! mkdir census_training %%writefile ./census_training/train.py # [START setup] import datetime import pandas as pd from google.cloud import storage from sklearn.ensemble import RandomForestClassifier from sklearn.externals import joblib from sklearn.feature_selection import SelectKBest from sklearn.pipeline import FeatureUnion from sklearn.pipeline import Pipeline from sklearn.preprocessing import LabelBinarizer # TODO: REPLACE '<BUCKET_NAME>' with your GCS BUCKET_NAME BUCKET_NAME = '<BUCKET_NAME>' # [END setup] # --------------------------------------- # 1. Add code to download the data from GCS (in this case, using the publicly hosted data). # AI Platform will then be able to use the data when training your model. # --------------------------------------- # [START download-data] # Public bucket holding the census data bucket = storage.Client().bucket('cloud-samples-data') # Path to the data inside the public bucket blob = bucket.blob('ml-engine/sklearn/census_data/adult.data') # Download the data blob.download_to_filename('adult.data') # [END download-data] # --------------------------------------- # This is where your model code would go. Below is an example model using the census dataset. # --------------------------------------- # [START define-and-load-data] # Define the format of your input data including unused columns (These are the columns from the census data files) COLUMNS = ( 'age', 'workclass', 'fnlwgt', 'education', 'education-num', 'marital-status', 'occupation', 'relationship', 'race', 'sex', 'capital-gain', 'capital-loss', 'hours-per-week', 'native-country', 'income-level' ) # Categorical columns are columns that need to be turned into a numerical value to be used by scikit-learn CATEGORICAL_COLUMNS = ( 'workclass', 'education', 'marital-status', 'occupation', 'relationship', 'race', 'sex', 'native-country' ) # Load the training census dataset with open('./adult.data', 'r') as train_data: raw_training_data = pd.read_csv(train_data, header=None, names=COLUMNS) # Remove the column we are trying to predict ('income-level') from our features list # Convert the Dataframe to a lists of lists train_features = raw_training_data.drop('income-level', axis=1).values.tolist() # Create our training labels list, convert the Dataframe to a lists of lists train_labels = (raw_training_data['income-level'] == ' >50K').values.tolist() # [END define-and-load-data] # [START categorical-feature-conversion] # Since the census data set has categorical features, we need to convert # them to numerical values. We'll use a list of pipelines to convert each # categorical column and then use FeatureUnion to combine them before calling # the RandomForestClassifier. categorical_pipelines = [] # Each categorical column needs to be extracted individually and converted to a numerical value. # To do this, each categorical column will use a pipeline that extracts one feature column via # SelectKBest(k=1) and a LabelBinarizer() to convert the categorical value to a numerical one. # A scores array (created below) will select and extract the feature column. The scores array is # created by iterating over the COLUMNS and checking if it is a CATEGORICAL_COLUMN. for i, col in enumerate(COLUMNS[:-1]): if col in CATEGORICAL_COLUMNS: # Create a scores array to get the individual categorical column. # Example: # data = [39, 'State-gov', 77516, 'Bachelors', 13, 'Never-married', 'Adm-clerical', # 'Not-in-family', 'White', 'Male', 2174, 0, 40, 'United-States'] # scores = [0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0] # # Returns: [['State-gov']] # Build the scores array scores = [0] * len(COLUMNS[:-1]) # This column is the categorical column we want to extract. scores[i] = 1 skb = SelectKBest(k=1) skb.scores_ = scores # Convert the categorical column to a numerical value lbn = LabelBinarizer() r = skb.transform(train_features) lbn.fit(r) # Create the pipeline to extract the categorical feature categorical_pipelines.append( ('categorical-{}'.format(i), Pipeline([ ('SKB-{}'.format(i), skb), ('LBN-{}'.format(i), lbn)]))) # [END categorical-feature-conversion] # [START create-pipeline] # Create pipeline to extract the numerical features skb = SelectKBest(k=6) # From COLUMNS use the features that are numerical skb.scores_ = [1, 0, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1, 0] categorical_pipelines.append(('numerical', skb)) # Combine all the features using FeatureUnion preprocess = FeatureUnion(categorical_pipelines) # Create the classifier classifier = RandomForestClassifier() # Transform the features and fit them to the classifier classifier.fit(preprocess.transform(train_features), train_labels) # Create the overall model as a single pipeline pipeline = Pipeline([ ('union', preprocess), ('classifier', classifier) ]) # [END create-pipeline] # --------------------------------------- # 2. Export and save the model to GCS # --------------------------------------- # [START export-to-gcs] # Export the model to a file model = 'model.joblib' joblib.dump(pipeline, model) # Upload the model to GCS bucket = storage.Client().bucket(BUCKET_NAME) blob = bucket.blob('{}/{}'.format( datetime.datetime.now().strftime('census_%Y%m%d_%H%M%S'), model)) blob.upload_from_filename(model) # [END export-to-gcs] %%writefile ./census_training/__init__.py # Note that __init__.py can be an empty file. ! gcloud config set project $PROJECT_ID ! gcloud ml-engine jobs submit training census_training_$(date +"%Y%m%d_%H%M%S") \ --job-dir $JOB_DIR \ --package-path $TRAINER_PACKAGE_PATH \ --module-name $MAIN_TRAINER_MODULE \ --region $REGION \ --runtime-version=$RUNTIME_VERSION \ --python-version=$PYTHON_VERSION \ --scale-tier BASIC ! gsutil ls gs://$BUCKET_NAME/census_* <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: scikit-learn Training on AI Platform Step2: The data Step3: Part 2 Step4: Part 3 Step5: Submit the training job. Step6: [Optional] StackDriver Logging
8,015
<ASSISTANT_TASK:> Python Code: import pandas as pd star_wars = pd.read_csv('star_wars.csv', encoding='ISO=8859-1') star_wars.head(10) star_wars.columns star_wars = star_wars[pd.notnull(star_wars['RespondentID'])] star_wars.head() bool_type = { 'Yes': True, 'No': False } star_wars['Have you seen any of the 6 films in the Star Wars franchise?'] = star_wars['Have you seen any of the 6 films in the Star Wars franchise?'].map(bool_type) star_wars['Do you consider yourself to be a fan of the Star Wars film franchise?'] = star_wars['Do you consider yourself to be a fan of the Star Wars film franchise?'].map(bool_type) star_wars['Do you consider yourself to be a fan of the Star Wars film franchise?'].head() import numpy as np bool_type1 = { "Star Wars: Episode I The Phantom Menace": True, np.nan: False, "Star Wars: Episode II Attack of the Clones": True, "Star Wars: Episode III Revenge of the Sith": True, "Star Wars: Episode IV A New Hope": True, "Star Wars: Episode V The Empire Strikes Back": True, "Star Wars: Episode VI Return of the Jedi": True } for col in star_wars.columns[3:9]: star_wars[col] = star_wars[col].map(bool_type1) star_wars = star_wars.rename(columns={ 'Star Wars: Episode I The Phantom Menace': "seen_1", 'Unnamed: 4': 'seen_2', 'Unnamed: 5': 'seen_3', 'Unnamed: 6': 'seen_4', 'Unnamed: 7': 'seen_5', 'Unnamed: 8': 'seen_6' }) star_wars.head() star_wars[star_wars.columns[9:15]] = star_wars[star_wars.columns[9:15]].astype(float) star_wars.columns[9:15] star_wars = star_wars.rename(columns={ 'Please rank the Star Wars films in order of preference with 1 being your favorite film in the franchise and 6 being your least favorite film.': "ranking_1", 'Unnamed: 10': 'ranking_2', 'Unnamed: 11': 'ranking_3', 'Unnamed: 12': 'ranking_4', 'Unnamed: 13': 'ranking_5', 'Unnamed: 14': 'ranking_6' }) star_wars.columns[9:15] %matplotlib inline import matplotlib.pyplot as plt plt.bar(range(6), star_wars[star_wars.columns[9:15]].mean()) plt.bar(range(6), star_wars[star_wars.columns[3:9]].sum()) males = star_wars[star_wars["Gender"] == "Male"] females = star_wars[star_wars["Gender"] == "Female"] ## Redo the two previous analyses (find the most viewed movie and the highest-ranked movie) separately for each group ## find highest-ranked movie (lower is better) plt.bar(range(6), females[females.columns[9:15]].mean()) plt.show() plt.bar(range(6), males[males.columns[9:15]].mean()) plt.show() ## find most viewed movie (higher is better) plt.bar(range(6), females[females.columns[3:9]].mean()) plt.show() plt.bar(range(6), males[males.columns[3:9]].mean()) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We need to specify an encoding because the data set has some characters that aren't in Python's default utf-8 encoding. You can read more about character encodings on developer Joel Spolsky's blog. Step2: Some columns are currently string types, because the main values they contain are Yes and No. We can make the data a bit easier to analyze down the road by converting each column to a Boolean having only the values True, False, and NaN Step3: Change column name and bool values Step4: Now that we've cleaned up the ranking columns, we can find the highest-ranked movie more quickly Step5: The 5th movies (Episode V The Empire Strikes Back) has a highest rating (in this survey 1=best, 6=worst). "Episode III Revenge of the Sith" has a worst rate. Step6: We can figure out how many people have seen each movie just by taking the sum of the column. Earliest movies is more popular - this corresponds to ranking above (earlier have better ranking).
8,016
<ASSISTANT_TASK:> Python Code: %matplotlib inline import pandas as pd import numpy as np import matplotlib.pyplot as plt import bokeh.plotting as bkp from mpl_toolkits.axes_grid1 import make_axes_locatable # read in readmissions data provided hospital_read_df = pd.read_csv('data/cms_hospital_readmissions.csv') # deal with missing and inconvenient portions of data clean_hospital_read_df = hospital_read_df[hospital_read_df['Number of Discharges'] != 'Not Available'] clean_hospital_read_df.loc[:, 'Number of Discharges'] = clean_hospital_read_df['Number of Discharges'].astype(int) clean_hospital_read_df = clean_hospital_read_df.sort_values('Number of Discharges') # generate a scatterplot for number of discharges vs. excess rate of readmissions # lists work better with matplotlib scatterplot function x = [a for a in clean_hospital_read_df['Number of Discharges'][81:-3]] y = list(clean_hospital_read_df['Excess Readmission Ratio'][81:-3]) fig, ax = plt.subplots(figsize=(8,5)) ax.scatter(x, y,alpha=0.2) ax.fill_between([0,350], 1.15, 2, facecolor='red', alpha = .15, interpolate=True) ax.fill_between([800,2500], .5, .95, facecolor='green', alpha = .15, interpolate=True) ax.set_xlim([0, max(x)]) ax.set_xlabel('Number of discharges', fontsize=12) ax.set_ylabel('Excess rate of readmissions', fontsize=12) ax.set_title('Scatterplot of number of discharges vs. excess rate of readmissions', fontsize=14) ax.grid(True) fig.tight_layout() %matplotlib inline import pandas as pd import numpy as np import matplotlib.pyplot as plt import bokeh.plotting as bkp import scipy.stats as st from mpl_toolkits.axes_grid1 import make_axes_locatable # read in readmissions data provided hospital_read_df = pd.read_csv('data/cms_hospital_readmissions.csv') # Set-up the hypothesis test. # Get the two groups of hospitals, one with < 100 discharges and the other with > 1000 discharges. # Get the hospitals with small discharges first. # First statement deals with missing data. clean_hospital_read_df = hospital_read_df[(hospital_read_df['Number of Discharges'] != 'Not Available')] hosp_with_small_discharges = clean_hospital_read_df[clean_hospital_read_df['Number of Discharges'].astype(int) < 100] hosp_with_small_discharges = hosp_with_small_discharges[hosp_with_small_discharges['Number of Discharges'].astype(int) != 0] hosp_with_small_discharges.sort_values(by = 'Number of Discharges', ascending = False) # Now get the hospitals with relatively large discharges. hosp_with_large_discharges = clean_hospital_read_df[clean_hospital_read_df['Number of Discharges'].astype(int) > 1000] hosp_with_large_discharges = hosp_with_large_discharges[hosp_with_large_discharges['Number of Discharges'].astype(int) != 0] hosp_with_large_discharges.sort_values(by = 'Number of Discharges', ascending = False) # Now calculate the statistical significance and p-value small_hospitals = hosp_with_small_discharges['Excess Readmission Ratio'] large_hospitals = hosp_with_large_discharges['Excess Readmission Ratio'] result = st.ttest_ind(small_hospitals,large_hospitals, equal_var=False) print("Statistical significance is equal to : %6.4F, P-value is equal to: %5.14F" % (result[0],result[1])) %matplotlib inline import pandas as pd import numpy as np import matplotlib.pyplot as plt import bokeh.plotting as bkp from mpl_toolkits.axes_grid1 import make_axes_locatable # read in readmissions data provided hospital_read_df = pd.read_csv('data/cms_hospital_readmissions.csv') # deal with missing and inconvenient portions of data clean_hospital_read_df = hospital_read_df[hospital_read_df['Number of Discharges'] != 'Not Available'] clean_hospital_read_df = clean_hospital_read_df.sort_values('Number of Discharges') # generate a scatterplot for number of discharges vs. excess rate of readmissions # lists work better with matplotlib scatterplot function x = [a for a in clean_hospital_read_df['Number of Discharges'][81:-3]] y = list(clean_hospital_read_df['Excess Readmission Ratio'][81:-3]) fig, ax = plt.subplots(figsize=(8,5)) im = ax.hexbin(x, y,gridsize=20) fig.colorbar(im, ax=ax) ax.fill_between([0,350], 1.15, 2, facecolor='red', alpha = .15, interpolate=True) ax.fill_between([800,2500], .5, .95, facecolor='green', alpha = .15, interpolate=True) ax.set_xlabel('Number of discharges', fontsize=10) ax.set_ylabel('Excess rate of readmissions', fontsize=10) ax.set_title('Hexagon Bin Plot of number of discharges vs. excess rate of readmissions', fontsize=12, fontweight='bold') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Preliminary Analysis Step2: Preliminary Report Step3: Report statistical significance for α = .01
8,017
<ASSISTANT_TASK:> Python Code: import tensorflow as tf from tensorflow.examples.tutorials.mnist import input_data mnist = input_data.read_data_sets("MNIST_data/", one_hot=True, reshape=False) DO NOT MODIFY THIS CELL def fully_connected(prev_layer, num_units): Create a fully connectd layer with the given layer as input and the given number of neurons. :param prev_layer: Tensor The Tensor that acts as input into this layer :param num_units: int The size of the layer. That is, the number of units, nodes, or neurons. :returns Tensor A new fully connected layer layer = tf.layers.dense(prev_layer, num_units, activation=tf.nn.relu) return layer DO NOT MODIFY THIS CELL def conv_layer(prev_layer, layer_depth): Create a convolutional layer with the given layer as input. :param prev_layer: Tensor The Tensor that acts as input into this layer :param layer_depth: int We'll set the strides and number of feature maps based on the layer's depth in the network. This is *not* a good way to make a CNN, but it helps us create this example with very little code. :returns Tensor A new convolutional layer strides = 2 if layer_depth % 3 == 0 else 1 conv_layer = tf.layers.conv2d(prev_layer, layer_depth*4, 3, strides, 'same', activation=tf.nn.relu) return conv_layer DO NOT MODIFY THIS CELL def train(num_batches, batch_size, learning_rate): # Build placeholders for the input samples and labels inputs = tf.placeholder(tf.float32, [None, 28, 28, 1]) labels = tf.placeholder(tf.float32, [None, 10]) # Feed the inputs into a series of 20 convolutional layers layer = inputs for layer_i in range(1, 20): layer = conv_layer(layer, layer_i) # Flatten the output from the convolutional layers orig_shape = layer.get_shape().as_list() layer = tf.reshape(layer, shape=[-1, orig_shape[1] * orig_shape[2] * orig_shape[3]]) # Add one fully connected layer layer = fully_connected(layer, 100) # Create the output layer with 1 node for each logits = tf.layers.dense(layer, 10) # Define loss and training operations model_loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits(logits=logits, labels=labels)) train_opt = tf.train.AdamOptimizer(learning_rate).minimize(model_loss) # Create operations to test accuracy correct_prediction = tf.equal(tf.argmax(logits,1), tf.argmax(labels,1)) accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) # Train and test the network with tf.Session() as sess: sess.run(tf.global_variables_initializer()) for batch_i in range(num_batches): batch_xs, batch_ys = mnist.train.next_batch(batch_size) # train this batch sess.run(train_opt, {inputs: batch_xs, labels: batch_ys}) # Periodically check the validation or training loss and accuracy if batch_i % 100 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: mnist.validation.images, labels: mnist.validation.labels}) print('Batch: {:>2}: Validation loss: {:>3.5f}, Validation accuracy: {:>3.5f}'.format(batch_i, loss, acc)) elif batch_i % 25 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: batch_xs, labels: batch_ys}) print('Batch: {:>2}: Training loss: {:>3.5f}, Training accuracy: {:>3.5f}'.format(batch_i, loss, acc)) # At the end, score the final accuracy for both the validation and test sets acc = sess.run(accuracy, {inputs: mnist.validation.images, labels: mnist.validation.labels}) print('Final validation accuracy: {:>3.5f}'.format(acc)) acc = sess.run(accuracy, {inputs: mnist.test.images, labels: mnist.test.labels}) print('Final test accuracy: {:>3.5f}'.format(acc)) # Score the first 100 test images individually. This won't work if batch normalization isn't implemented correctly. correct = 0 for i in range(100): correct += sess.run(accuracy,feed_dict={inputs: [mnist.test.images[i]], labels: [mnist.test.labels[i]]}) print("Accuracy on 100 samples:", correct/100) num_batches = 800 batch_size = 64 learning_rate = 0.002 tf.reset_default_graph() with tf.Graph().as_default(): train(num_batches, batch_size, learning_rate) def fully_connected(prev_layer, num_units, is_training): Create a fully connectd layer with the given layer as input and the given number of neurons. :param prev_layer: Tensor The Tensor that acts as input into this layer :param num_units: int The size of the layer. That is, the number of units, nodes, or neurons. :returns Tensor A new fully connected layer layer = tf.layers.dense(prev_layer, num_units, use_bias = False, activation=None) layer = tf.layers.batch_normalization(layer, training=is_training) layer = tf.nn.relu(layer) return layer def conv_layer(prev_layer, layer_depth, is_training): Create a convolutional layer with the given layer as input. :param prev_layer: Tensor The Tensor that acts as input into this layer :param layer_depth: int We'll set the strides and number of feature maps based on the layer's depth in the network. This is *not* a good way to make a CNN, but it helps us create this example with very little code. :returns Tensor A new convolutional layer strides = 2 if layer_depth % 3 == 0 else 1 conv_layer = tf.layers.conv2d(prev_layer, layer_depth*4, 3, strides, 'same', use_bias=False, activation=None) conv_layer = tf.layers.batch_normalization(conv_layer, training=is_training) conv_layer = tf.nn.relu(conv_layer) return conv_layer def train(num_batches, batch_size, learning_rate): # Build placeholders for the input samples and labels inputs = tf.placeholder(tf.float32, [None, 28, 28, 1]) labels = tf.placeholder(tf.float32, [None, 10]) is_training = tf.placeholder(tf.bool) # Feed the inputs into a series of 20 convolutional layers layer = inputs for layer_i in range(1, 20): layer = conv_layer(layer, layer_i, is_training) # Flatten the output from the convolutional layers orig_shape = layer.get_shape().as_list() layer = tf.reshape(layer, shape=[-1, orig_shape[1] * orig_shape[2] * orig_shape[3]]) # Add one fully connected layer layer = fully_connected(layer, 100, is_training) # Create the output layer with 1 node for each logits = tf.layers.dense(layer, 10) # Define loss and training operations model_loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits(logits=logits, labels=labels)) with tf.control_dependencies(tf.get_collection(tf.GraphKeys.UPDATE_OPS)): train_opt = tf.train.AdamOptimizer(learning_rate).minimize(model_loss) # Create operations to test accuracy correct_prediction = tf.equal(tf.argmax(logits,1), tf.argmax(labels,1)) accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) # Train and test the network with tf.Session() as sess: sess.run(tf.global_variables_initializer()) for batch_i in range(num_batches): batch_xs, batch_ys = mnist.train.next_batch(batch_size) # train this batch sess.run(train_opt, {inputs: batch_xs, labels: batch_ys, is_training: True}) # Periodically check the validation or training loss and accuracy if batch_i % 100 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: mnist.validation.images, labels: mnist.validation.labels, is_training:False}) print('Batch: {:>2}: Validation loss: {:>3.5f}, Validation accuracy: {:>3.5f}'.format(batch_i, loss, acc)) elif batch_i % 25 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: batch_xs, labels: batch_ys, is_training:False}) print('Batch: {:>2}: Training loss: {:>3.5f}, Training accuracy: {:>3.5f}'.format(batch_i, loss, acc)) # At the end, score the final accuracy for both the validation and test sets acc = sess.run(accuracy, {inputs: mnist.validation.images, labels: mnist.validation.labels, is_training: False}) print('Final validation accuracy: {:>3.5f}'.format(acc)) acc = sess.run(accuracy, {inputs: mnist.test.images, labels: mnist.test.labels, is_training:False}) print('Final test accuracy: {:>3.5f}'.format(acc)) # Score the first 100 test images individually. This won't work if batch normalization isn't implemented correctly. correct = 0 for i in range(100): correct += sess.run(accuracy,feed_dict={inputs: [mnist.test.images[i]], labels: [mnist.test.labels[i]], is_training:False}) print("Accuracy on 100 samples:", correct/100) num_batches = 800 batch_size = 64 learning_rate = 0.002 tf.reset_default_graph() with tf.Graph().as_default(): train(num_batches, batch_size, learning_rate) def fully_connected(prev_layer, num_units): Create a fully connectd layer with the given layer as input and the given number of neurons. :param prev_layer: Tensor The Tensor that acts as input into this layer :param num_units: int The size of the layer. That is, the number of units, nodes, or neurons. :returns Tensor A new fully connected layer layer = tf.layers.dense(prev_layer, num_units, activation=tf.nn.relu) return layer def conv_layer(prev_layer, layer_depth): Create a convolutional layer with the given layer as input. :param prev_layer: Tensor The Tensor that acts as input into this layer :param layer_depth: int We'll set the strides and number of feature maps based on the layer's depth in the network. This is *not* a good way to make a CNN, but it helps us create this example with very little code. :returns Tensor A new convolutional layer strides = 2 if layer_depth % 3 == 0 else 1 in_channels = prev_layer.get_shape().as_list()[3] out_channels = layer_depth*4 weights = tf.Variable( tf.truncated_normal([3, 3, in_channels, out_channels], stddev=0.05)) bias = tf.Variable(tf.zeros(out_channels)) conv_layer = tf.nn.conv2d(prev_layer, weights, strides=[1,strides, strides, 1], padding='SAME') conv_layer = tf.nn.bias_add(conv_layer, bias) conv_layer = tf.nn.relu(conv_layer) return conv_layer def train(num_batches, batch_size, learning_rate): # Build placeholders for the input samples and labels inputs = tf.placeholder(tf.float32, [None, 28, 28, 1]) labels = tf.placeholder(tf.float32, [None, 10]) # Feed the inputs into a series of 20 convolutional layers layer = inputs for layer_i in range(1, 20): layer = conv_layer(layer, layer_i) # Flatten the output from the convolutional layers orig_shape = layer.get_shape().as_list() layer = tf.reshape(layer, shape=[-1, orig_shape[1] * orig_shape[2] * orig_shape[3]]) # Add one fully connected layer layer = fully_connected(layer, 100) # Create the output layer with 1 node for each logits = tf.layers.dense(layer, 10) # Define loss and training operations model_loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits(logits=logits, labels=labels)) train_opt = tf.train.AdamOptimizer(learning_rate).minimize(model_loss) # Create operations to test accuracy correct_prediction = tf.equal(tf.argmax(logits,1), tf.argmax(labels,1)) accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) # Train and test the network with tf.Session() as sess: sess.run(tf.global_variables_initializer()) for batch_i in range(num_batches): batch_xs, batch_ys = mnist.train.next_batch(batch_size) # train this batch sess.run(train_opt, {inputs: batch_xs, labels: batch_ys}) # Periodically check the validation or training loss and accuracy if batch_i % 100 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: mnist.validation.images, labels: mnist.validation.labels}) print('Batch: {:>2}: Validation loss: {:>3.5f}, Validation accuracy: {:>3.5f}'.format(batch_i, loss, acc)) elif batch_i % 25 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: batch_xs, labels: batch_ys}) print('Batch: {:>2}: Training loss: {:>3.5f}, Training accuracy: {:>3.5f}'.format(batch_i, loss, acc)) # At the end, score the final accuracy for both the validation and test sets acc = sess.run(accuracy, {inputs: mnist.validation.images, labels: mnist.validation.labels}) print('Final validation accuracy: {:>3.5f}'.format(acc)) acc = sess.run(accuracy, {inputs: mnist.test.images, labels: mnist.test.labels}) print('Final test accuracy: {:>3.5f}'.format(acc)) # Score the first 100 test images individually. This won't work if batch normalization isn't implemented correctly. correct = 0 for i in range(100): correct += sess.run(accuracy,feed_dict={inputs: [mnist.test.images[i]], labels: [mnist.test.labels[i]]}) print("Accuracy on 100 samples:", correct/100) num_batches = 800 batch_size = 64 learning_rate = 0.002 tf.reset_default_graph() with tf.Graph().as_default(): train(num_batches, batch_size, learning_rate) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step3: Batch Normalization using tf.layers.batch_normalization<a id="example_1"></a> Step6: We'll use the following function to create convolutional layers in our network. They are very basic Step8: Run the following cell, along with the earlier cells (to load the dataset and define the necessary functions). Step10: With this many layers, it's going to take a lot of iterations for this network to learn. By the time you're done training these 800 batches, your final test and validation accuracies probably won't be much better than 10%. (It will be different each time, but will most likely be less than 15%.) Step12: TODO Step13: TODO Step15: With batch normalization, you should now get an accuracy over 90%. Notice also the last line of the output Step17: TODO Step18: TODO
8,018
<ASSISTANT_TASK:> Python Code: import numpy as np from fasttext import FastVector # from https://stackoverflow.com/questions/21030391/how-to-normalize-array-numpy def normalized(a, axis=-1, order=2): Utility function to normalize the rows of a numpy array. l2 = np.atleast_1d(np.linalg.norm(a, order, axis)) l2[l2==0] = 1 return a / np.expand_dims(l2, axis) def make_training_matrices(source_dictionary, target_dictionary, bilingual_dictionary): Source and target dictionaries are the FastVector objects of source/target languages. bilingual_dictionary is a list of translation pair tuples [(source_word, target_word), ...]. source_matrix = [] target_matrix = [] for (source, target) in bilingual_dictionary: if source in source_dictionary and target in target_dictionary: source_matrix.append(source_dictionary[source]) target_matrix.append(target_dictionary[target]) # return training matrices return np.array(source_matrix), np.array(target_matrix) def learn_transformation(source_matrix, target_matrix, normalize_vectors=True): Source and target matrices are numpy arrays, shape (dictionary_length, embedding_dimension). These contain paired word vectors from the bilingual dictionary. # optionally normalize the training vectors if normalize_vectors: source_matrix = normalized(source_matrix) target_matrix = normalized(target_matrix) # perform the SVD product = np.matmul(source_matrix.transpose(), target_matrix) U, s, V = np.linalg.svd(product) # return orthogonal transformation which aligns source language to the target return np.matmul(U, V) fr_dictionary = FastVector(vector_file='wiki.fr.vec') ru_dictionary = FastVector(vector_file='wiki.ru.vec') fr_vector = fr_dictionary["chat"] ru_vector = ru_dictionary["кот"] print(FastVector.cosine_similarity(fr_vector, ru_vector)) ru_words = set(ru_dictionary.word2id.keys()) fr_words = set(fr_dictionary.word2id.keys()) overlap = list(ru_words & fr_words) bilingual_dictionary = [(entry, entry) for entry in overlap] # form the training matrices source_matrix, target_matrix = make_training_matrices( fr_dictionary, ru_dictionary, bilingual_dictionary) # learn and apply the transformation transform = learn_transformation(source_matrix, target_matrix) fr_dictionary.apply_transform(transform) fr_vector = fr_dictionary["chat"] ru_vector = ru_dictionary["кот"] print(FastVector.cosine_similarity(fr_vector, ru_vector)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step3: So, show me how to align two vector spaces for myself! Step4: Now we load the French and Russian word vectors, and evaluate the similarity of "chat" and "кот" Step5: "chat" and "кот" both mean "cat", so they should be highly similar; clearly the two word vector spaces are not yet aligned. To align them, we need a bilingual dictionary of French and Russian translation pairs. As it happens, this is a great opportunity to show you something truly amazing... Step6: Let's align the French vectors to the Russian vectors, using only this "free" dictionary that we acquired without any bilingual expert knowledge. Step7: Finally, we re-evaluate the similarity of "chat" and "кот"
8,019
<ASSISTANT_TASK:> Python Code: %run ../../code/version_check.py %run ../../code/eoddata.py from getpass import getpass import requests as r import xml.etree.cElementTree as etree ws = 'http://ws.eoddata.com/data.asmx' ns='http://ws.eoddata.com/Data' session = r.Session() username = getpass() password = getpass() call = 'Login' url = '/'.join((ws, call)) payload = {'Username': username, 'Password': password} response = session.get(url, params=payload, stream=True) if response.status_code == 200: root = etree.parse(response.raw).getroot() token = root.get('Token') token dir(root) for item in root.items(): print (item) for key in root.keys(): print (key) print(root.get('Message')) print(root.get('Token')) print(root.get('DataFormat')) print(root.get('Header')) print(root.get('Suffix')) def Login(session, username, password): call = 'Login' url = '/'.join((ws, call)) payload = {'Username': username, 'Password': password} response = session.get(url, params=payload, stream=True) if response.status_code == 200: root = etree.parse(response.raw).getroot() return root.get('Token') token = Login(session, username, password) token # pass in username and password eoddata = Client(username, password) token = eoddata.get_token() eoddata.close_session() print('token: {}'.format(token)) # initialise using secure credentials file eoddata = Client() token = eoddata.get_token() eoddata.close_session() print('token: {}'.format(token)) # no need to manually close the session when using a with block with (Client()) as eoddata: print('token: {}'.format(eoddata.get_token())) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Change Log Step2: Login() Step3: Get data Step4: Data inspection (Login) Step5: Helper function Step6: Usage Step7: Client function
8,020
<ASSISTANT_TASK:> Python Code: %matplotlib inline from importlib import reload import numpy as np import pandas as pd import statsmodels.api as sm import matplotlib.pyplot as plt from pandas_datareader.data import DataReader endog = DataReader('CPIAPPNS', 'fred', start='1980').asfreq('MS') endog.plot(figsize=(15, 3)); # Run the HP filter with lambda = 129600 hp_cycle, hp_trend = sm.tsa.filters.hpfilter(endog, lamb=129600) # The unobserved components model above is the local linear trend, or "lltrend", specification mod = sm.tsa.UnobservedComponents(endog, 'lltrend') print(mod.param_names) res = mod.smooth([1., 0, 1. / 129600]) print(res.summary()) ucm_trend = pd.Series(res.level.smoothed, index=endog.index) fig, ax = plt.subplots(figsize=(15, 3)) ax.plot(hp_trend, label='HP estimate') ax.plot(ucm_trend, label='UCM estimate') ax.legend(); # Construct a local linear trend model with a stochastic seasonal component of period 1 year mod = sm.tsa.UnobservedComponents(endog, 'lltrend', seasonal=12, stochastic_seasonal=True) print(mod.param_names) # Here we restrict the first three parameters to specific values with mod.fix_params({'sigma2.irregular': 1, 'sigma2.level': 0, 'sigma2.trend': 1. / 129600}): # Now we fit any remaining parameters, which in this case # is just `sigma2.seasonal` res_restricted = mod.fit() res_restricted = mod.fit_constrained({'sigma2.irregular': 1, 'sigma2.level': 0, 'sigma2.trend': 1. / 129600}) print(res_restricted.summary()) res_unrestricted = mod.fit() # Construct the smoothed level estimates unrestricted_trend = pd.Series(res_unrestricted.level.smoothed, index=endog.index) restricted_trend = pd.Series(res_restricted.level.smoothed, index=endog.index) # Construct the smoothed estimates of the seasonal pattern unrestricted_seasonal = pd.Series(res_unrestricted.seasonal.smoothed, index=endog.index) restricted_seasonal = pd.Series(res_restricted.seasonal.smoothed, index=endog.index) fig, ax = plt.subplots(figsize=(15, 3)) ax.plot(unrestricted_trend, label='MLE, with seasonal') ax.plot(restricted_trend, label='Fixed parameters, with seasonal') ax.plot(hp_trend, label='HP filter, no seasonal') ax.legend(); fig, ax = plt.subplots(figsize=(15, 3)) ax.plot(unrestricted_seasonal, label='MLE') ax.plot(restricted_seasonal, label='Fixed parameters') ax.legend(); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: To illustrate, we will use the Consumer Price Index for Apparel, which has a time-varying level and a strong seasonal component. Step2: It is well known (e.g. Harvey and Jaeger [1993]) that the HP filter output can be generated by an unobserved components model given certain restrictions on the parameters. Step3: The parameters of the unobserved components model (UCM) are written as Step4: The estimate that corresponds to the HP filter's trend estimate is given by the smoothed estimate of the level (which is $\mu_t$ in the notation above) Step5: It is easy to see that the estimate of the smoothed level from the UCM is equal to the output of the HP filter Step6: Adding a seasonal component Step7: In this case, we will continue to restrict the first three parameters as described above, but we want to estimate the value of sigma2.seasonal by maximum likelihood. Therefore, we will use the fit method along with the fix_params context manager. Step8: Alternatively, we could have simply used the fit_constrained method, which also accepts a dictionary of constraints Step9: The summary output includes all parameters, but indicates that the first three were fixed (and so were not estimated). Step10: For comparison, we construct the unrestricted maximum likelihood estimates (MLE). In this case, the estimate of the level will no longer correspond to the HP filter concept. Step11: Finally, we can retrieve the smoothed estimates of the trend and seasonal components. Step12: Comparing the estimated level, it is clear that the seasonal UCM with fixed parameters still produces a trend that corresponds very closely (although no longer exactly) to the HP filter output. Step13: Finally, the UCM with the parameter restrictions is still able to pick up the time-varying seasonal component quite well.
8,021
<ASSISTANT_TASK:> Python Code: with open('./jeter.tsv', 'r') as file: for i in range (10): print (next(file)) %pylab inline import csv import matplotlib.pyplot as plt res_s1_sup_s2 = [0 for i in range (26)] res_s2_sup_s1 = [0 for i in range (26)] res_s1_sup_other = [0 for i in range (26)] res_s2_sup_other = [0 for i in range (26)] with open('./jeter.tsv', 'r') as csvfile: reader = csv.reader(csvfile, delimiter='\t') # remove header next(reader) # iterate over rows for R in reader: s1_sup_s2 = float(R[6])*100/(float(R[5])+float(R[6])+float(R[7])) s2_sup_s1 = float(R[9])*100/(float(R[8])+float(R[9])+float(R[10])) s1_sup_other = float(R[7])*100/(float(R[5])+float(R[6])+float(R[7])) s2_sup_other = float(R[10])*100/(float(R[8])+float(R[9])+float(R[10])) for seuil in range (26): if s1_sup_s2 >= seuil: res_s1_sup_s2[seuil]+=1 if s2_sup_s1 >= seuil: res_s2_sup_s1[seuil]+=1 if s1_sup_other >= seuil: res_s1_sup_other[seuil]+=1 if s2_sup_other >= seuil: res_s2_sup_other[seuil]+=1 print (res_s1_sup_s2) print (res_s2_sup_s1) print (res_s1_sup_other) print (res_s2_sup_other) plt.figure(figsize=(20, 10)) plt.title("percentage of samples with a number of read with incorect an genotype corresponding to another sample from the same lane or a randon error") plt.xlabel("Percentage of sample") plt.ylabel("Number of read with incorrect genotype") plt.ylim(1,77869) line1 = plt.semilogy(res_s1_sup_s2, 'b', label = 'reads_sample1_supporting_sample2') line2 = plt.semilogy(res_s2_sup_s1, 'g', label = 'reads_sample2_supporting_sample1') line3 = plt.semilogy(res_s1_sup_other, 'r', label = 'reads_sample1_supporting_others') line4 = plt.semilogy(res_s2_sup_other, 'm', label = 'reads_sample2_supporting_others') plt.legend(loc='best') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Import packages Step2: Create lists to store results for different thresholds from 0 to 25% Step3: parse file and populate the list
8,022
<ASSISTANT_TASK:> Python Code: import os import mne from mne.datasets import sample from mne.minimum_norm import apply_inverse, read_inverse_operator from mne import read_evokeds data_path = sample.data_path() sample_dir = os.path.join(data_path, 'MEG', 'sample') subjects_dir = os.path.join(data_path, 'subjects') fname_evoked = data_path + '/MEG/sample/sample_audvis-ave.fif' fname_stc = os.path.join(sample_dir, 'sample_audvis-meg') stc = mne.read_source_estimate(fname_stc, subject='sample') print(stc) initial_time = 0.1 brain = stc.plot(subjects_dir=subjects_dir, initial_time=initial_time) mpl_fig = stc.plot(subjects_dir=subjects_dir, initial_time=initial_time, backend='matplotlib', verbose='error') evoked = read_evokeds(fname_evoked, condition=0, baseline=(None, 0)) evoked.pick_types(meg=True, eeg=False) fname_inv = data_path + '/MEG/sample/sample_audvis-meg-vol-7-meg-inv.fif' inv = read_inverse_operator(fname_inv) src = inv['src'] snr = 3.0 lambda2 = 1.0 / snr ** 2 method = "dSPM" # use dSPM method (could also be MNE or sLORETA) stc = apply_inverse(evoked, inv, lambda2, method) stc.crop(0.0, 0.2) print(stc) stc.plot(src, subject='sample', subjects_dir=subjects_dir) stc.plot(src, subject='sample', subjects_dir=subjects_dir, mode='glass_brain') fname_inv = data_path + '/MEG/sample/sample_audvis-meg-oct-6-meg-inv.fif' inv = read_inverse_operator(fname_inv) stc = apply_inverse(evoked, inv, lambda2, 'dSPM', pick_ori='vector') stc.plot(subject='sample', subjects_dir=subjects_dir, initial_time=initial_time) fname_cov = os.path.join(data_path, 'MEG', 'sample', 'sample_audvis-cov.fif') fname_bem = os.path.join(subjects_dir, 'sample', 'bem', 'sample-5120-bem-sol.fif') fname_trans = os.path.join(data_path, 'MEG', 'sample', 'sample_audvis_raw-trans.fif') evoked.crop(0.1, 0.1) dip = mne.fit_dipole(evoked, fname_cov, fname_bem, fname_trans)[0] dip.plot_locations(fname_trans, 'sample', subjects_dir) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Then, we read the stc from file Step2: This is a Step3: The SourceEstimate object is in fact a surface source estimate. MNE also Step4: Note that here we used initial_time=0.1, but we can also browse through Step5: Volume Source Estimates Step6: Then, we can load the precomputed inverse operator from a file. Step7: The source estimate is computed using the inverse operator and the Step8: This time, we have a different container Step9: This too comes with a convenient plot method. Step10: For this visualization, nilearn must be installed. Step11: Vector Source Estimates Step12: Dipole fits Step13: Dipoles are fit independently for each time point, so let us crop our time Step14: Finally, we can visualize the dipole.
8,023
<ASSISTANT_TASK:> Python Code: import pandas as pd names = pd.DataFrame({"name" : ["Alice","Bob","Charlie","Dennis"], "surname" : ["Doe","Smith","Sheen","Quaid"]}) names names.name.str.match("A\w+") debts = pd.DataFrame({"debtor":["D.Quaid","C.Sheen"], "amount":[100,10000]}) debts debts["surname"] = debts.debtor.str.extract("\w+\.(\w+)") debts names.merge(debts, left_on="surname", right_on="surname", how="left") names.merge(debts, left_on="surname", right_on="surname", how="right") names.merge(debts, left_on="surname", right_on="surname", how="inner") names.merge(debts, left_on="surname", right_on="surname", how="outer") names.merge(debts, left_index=True, right_index=True, how="left") lat_lon_mun = pd.read_excel("lat_lon_municipalities.xls", skiprows=2) lat_lon_mun.head() mun_codes = pd.read_excel("11codmun.xls", encoding="latin1", skiprows=1) mun_codes.head() lat_lon_mun[lat_lon_mun["Población"].str.match(".*anaria.*")] mun_codes[mun_codes["NOMBRE"].str.match(".*anaria.*")] "Valsequillo de Gran Canaria" == "Valsequillo de Gran Canaria" "Palmas de Gran Canaria (Las)" == "Palmas de Gran Canaria, Las" from fuzzywuzzy import fuzz fuzz.ratio("NEW YORK METS","NEW YORK MEATS") fuzz.ratio("Palmas de Gran Canaria (Las)","Palmas de Gran Canaria, Las") "San Millán de Yécora" == "Millán de Yécora" fuzz.ratio("San Millán de Yécora", "Millán de Yécora") fuzz.ratio("YANKEES", "NEW YORK YANKEES") fuzz.ratio("NEW YORK METS", "NEW YORK YANKEES") fuzz.partial_ratio("San Millán de Yécora", "Millán de Yécora") fuzz.partial_ratio("YANKEES", "NEW YORK YANKEES") fuzz.partial_ratio("NEW YORK METS", "NEW YORK YANKEES") s1 = "Las Palmas de Gran Canaria" s2 = "Gran Canaria, Las Palmas de" s3 = "Palmas de Gran Canaria, Las" s4 = "Palmas de Gran Canaria, (Las)" fuzz.token_sort_ratio("Las Palmas de Gran Canaria", "Palmas de Gran Canaria Las") fuzz.ratio("Las Palmas de Gran Canaria", "Palmas de Gran Canaria Las") t0 = ["Canaria,","de","Gran", "Palmas"] t1 = ["Canaria,","de","Gran", "Palmas"] + ["Las"] t2 = ["Canaria,","de","Gran", "Palmas"] + ["(Las)"] fuzz.token_sort_ratio("Palmas de Gran Canaria, Las", "Palmas de Gran Canaria, (Las)") mun_codes.shape mun_codes.head() lat_lon_mun.shape lat_lon_mun.head() df1 = mun_codes.merge(lat_lon_mun, left_on="NOMBRE", right_on="Población",how="inner") df1.head() df1["match_ratio"] = 100 df2 = mun_codes.merge(df1, left_on="NOMBRE", right_on="NOMBRE", how="left") df2.head() df3 = df2.loc[: ,["CPRO_x","CMUN_x","DC_x","NOMBRE","match_ratio"]] df3.rename(columns={"CPRO_x": "CPRO", "CMUN_x":"CMUN","DC_x":"DC"},inplace=True) df3.head() df3.loc[df3.match_ratio.isnull(),:].head() mun_names = lat_lon_mun["Población"].tolist() def approx_str_compare(x): ratio = [fuzz.ratio(x,m) for m in mun_names] res = pd.DataFrame({"ratio" : ratio, "name": mun_names}) return res.sort_values(by="ratio",ascending=False).iloc[0,:] df4 = df3.loc[df3.match_ratio.isnull(),"NOMBRE"].map(approx_str_compare) df4.map(lambda x: x["name"]) df4.map(lambda x: x["ratio"]) df6 = df3.loc[df3.match_ratio.isnull(),:] df6["match_ratio"] = df4.map(lambda x: x["ratio"]) df6["NOMBRE"] = df4.map(lambda x: x["name"]) df6.head() df7 = pd.concat([df3,df6]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Imagine I want to have a list of my friends with the amount of money I borrowed to each other, toghether with their names and surnames. Step2: To merge two dataframes we can use merge function Step3: Approximate String Matching Step4: The closeness of a match is often measured in terms of edit distance, which is the number of primitive operations necessary to convert the string into an exact match. Step5: Partial String Similarity Step6: In fact we can have the following situation Step7: partial_ratio, seeks the more appealing substring and returns its ratio Step8: Out of Order Step9: FuzzyWuzzy provides two ways to deal with this situation Step10: Token Set Step11: Example Step12: Step 2 Step13: Step 3 Step14: Step 4 Step15: Step 5 Step16: Step 6
8,024
<ASSISTANT_TASK:> Python Code: from symbulate import * %matplotlib inline die = list(range(1, 6+1)) # this is just a list of the number 1 through 6 roll = BoxModel(die, size = 2) roll.sim(100) def spam_sim(): email_type = BoxModel(["spam", "not spam"], probs=[.1, .9]).draw() if email_type == "spam": has_money = BoxModel(["money", "no money"], probs=[.3, .7]).draw() else: has_money = BoxModel(["money", "no money"], probs=[.02, .98]).draw() return email_type, has_money P = ProbabilitySpace(spam_sim) sims = P.sim(1000) sims die = list(range(1, 6+1)) # this is just a list of the number 1 through 6 roll = BoxModel(die, size = 2) sims = roll.sim(4) sims sims.get(0) sims.get(2) die = list(range(1, 6+1)) # this is just a list of the number 1 through 6 roll = BoxModel(die, size = 2) roll.sim(1000).apply(sum) n = 10 labels = list(range(n)) # remember, Python starts the index at 0, so the cards are labebeled 0, ..., 9 P = BoxModel(labels, size = n, replace = False) sims = P.sim(10000) sims def is_match(x): for i in range(n): if x[i] == labels[i]: return 'At least one match' return 'No match' sims.apply(is_match) die = list(range(1, 6+1, 1)) # this is just a list of the number 1 through 6 roll = BoxModel(die, size=2) rolls = roll.sim(10000) rolls.tabulate() rolls.apply(sum).tabulate(normalize=True) rolls.tabulate()[(2,4)] roll_sum = rolls.apply(sum).tabulate(normalize=True) roll_sum[10] + roll_sum[11] + roll_sum[12] die = list(range(1, 6+1, 1)) # this is just a list of the number 1 through 6 rolls = BoxModel(die).sim(5) rolls.tabulate(die) # Compare with rolls.tabulate() BoxModel(['a', 'b', 1, 2, 3]).sim(10).tabulate([3, 'a', 2, 'b', 1]) Heads = BoxModel(['H','T']).sim(10000).filter_eq('H') Heads len(Heads) die = list(range(1, 1+6)) # this is just a list of the number 1 through 6 sims = BoxModel(die, size=2).sim(1000).apply(sum) len(sims.filter_geq(10)) / 1000 def greater_than_or_equal_to_10(x): return x >= 10 len(sims.filter(greater_than_or_equal_to_10)) / 1000 BoxModel(['H','T']).sim(10000).count_eq('H') die = list(range(1, 6+1, 1)) # this is just a list of the number 1 through 6 roll = BoxModel(die, size = 2) rolls = roll.sim(10000) rolls.count_eq((2,4)) rolls.apply(sum).count_geq(10) / 10000 def greater_than_or_equal_to_10(x): return x >= 10 rolls.apply(sum).count(greater_than_or_equal_to_10) / 10000 rollsums = rolls.apply(sum) sum(rollsums >= 10) / 10000 mean(rollsums >= 10) die = list(range(1, 6+1, 1)) # this is just a list of the number 1 through 6 roll = BoxModel(die, size = 2) rolls = roll.sim(10000) rollsums = rolls.apply(sum) (rollsums.tabulate()[10] + rollsums.tabulate()[11] + rollsums.tabulate()[12]) /10000 (rollsums.tabulate(normalize=True)[10] + rollsums.tabulate(normalize=True)[11] + rollsums.tabulate(normalize=True)[12]) len(rollsums.filter_geq(10)) / 10000 rollsums.count_geq(10) / 10000 sum(rollsums >= 10) / 10000 mean(rollsums >= 10) rollsums = RV(roll, sum) (rollsums >= 10).sim(10000).tabulate(normalize=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: <a id='sim'></a> Step2: Caution Step3: <a id='get'></a> Step4: <a id='apply'></a> Step5: User defined functions can also be applied. Step6: <a id='tabulate'></a> Step7: Now sum the dice, and approximate the distribution of the sum using the normalize option. Step8: Individual entries of the table can be referenced using .tabulate()[label] where label represents the value of interest. Step9: By default, tabulate only tabulates those outcomes which are among the simulated values, rather than all possible outcomes. An argument can be passed to .tabulate() to tabulate all outcomes in a given list. Step10: By default, the outcomes in the table produced by .tabulate() are in alphanumeric order. A list can be passed to .tabulate() to achieve a specified order. Step11: <a id='filter'></a> Step12: Using len (length) with the filter functions is one way to count the simulated occurrences of outcomes which satisfy some criteria. Step13: In addition to .filter_eq(), the following filter functions can be used when the values are numerical. Step14: You can also define your own custom filter function. Define a function that returns True for the outcomes you want to keep, and pass the function into .filter(). For example, the following code is equivalent to using .filter_geq(10). Step15: <a id='count'></a> Step16: In addition to .count_eq(), the following count functions can be used when the values are numerical. Step17: You can also count the number of outcomes which satisfy some criteria specified by a user defined function. Define a function that returns True for the outcomes you want to keep, and pass the function into .count(). For example, the following code is equivalent to using .count_geq(10). Step18: Counting can also be accomplished by creating logical (True = 1, False = 0) values according to whether an outcome satisfies some criteria and then summing. Step19: Since a mean (average) is the sum of values divided by the number of values, changing sum to mean in the above method returns the relative frequency directly (without having to divide by the number of values). Step20: <a id='recap'></a>
8,025
<ASSISTANT_TASK:> Python Code: import geopandas as gpd import matplotlib.pyplot as plt from shapely.geometry import Polygon # X -coordinates xcoords = [29.99671173095703, 31.58196258544922, 27.738052368164062, 26.50013542175293, 26.652359008789062, 25.921663284301758, 22.90027618408203, 23.257217407226562, 23.335693359375, 22.87444305419922, 23.08465003967285, 22.565473556518555, 21.452774047851562, 21.66388702392578, 21.065969467163086, 21.67659568786621, 21.496871948242188, 22.339998245239258, 22.288192749023438, 24.539581298828125, 25.444232940673828, 25.303749084472656, 24.669166564941406, 24.689163208007812, 24.174999237060547, 23.68471908569336, 24.000761032104492, 23.57332992553711, 23.76513671875, 23.430830001831055, 23.6597900390625, 20.580928802490234, 21.320831298828125, 22.398330688476562, 23.97638702392578, 24.934917449951172, 25.7611083984375, 25.95930290222168, 26.476804733276367, 27.91069221496582, 29.1027774810791, 29.29846954345703, 28.4355525970459, 28.817358016967773, 28.459857940673828, 30.028610229492188, 29.075136184692383, 30.13492774963379, 29.818885803222656, 29.640830993652344, 30.57735824584961, 29.99671173095703] # Y -coordinates ycoords = [63.748023986816406, 62.90789794921875, 60.511383056640625, 60.44499588012695, 60.646385192871094, 60.243743896484375, 59.806800842285156, 59.91944122314453, 60.02395248413086, 60.14555358886719, 60.3452033996582, 60.211936950683594, 60.56249237060547, 61.54027557373047, 62.59798049926758, 63.02013397216797, 63.20353698730469, 63.27652359008789, 63.525691986083984, 64.79915618896484, 64.9533920288086, 65.51513671875, 65.65470886230469, 65.89610290527344, 65.79151916503906, 66.26332092285156, 66.80228424072266, 67.1570053100586, 67.4168701171875, 67.47978210449219, 67.94589233398438, 69.060302734375, 69.32611083984375, 68.71110534667969, 68.83248901367188, 68.580810546875, 68.98916625976562, 69.68568420410156, 69.9363784790039, 70.08860778808594, 69.70597076416016, 69.48533630371094, 68.90263366699219, 68.84700012207031, 68.53485107421875, 67.69471740722656, 66.90360260009766, 65.70887756347656, 65.6533203125, 64.92096710205078, 64.22373962402344, 63.748023986816406] ## CODE HERE ## # Check the content of the GeoDataFrame: print(geo.head()) ## CODE HERE ## # Plot a map of the polygon # REPLACE THE ERROR BELOW WITH YOUR OWN CODE ## CODE HERE ## ## CODE HERE ## # Check the dataframe head print(data.head()) ## CODE HERE ## # Check the geodataframe head print(geo.head()) ## CODE HERE ## ## CODE HERE ## # Check that the crs is correct (should be epsg:32735) print(data.crs) ## CODE HERE ## ## CODE HERE ## ## CODE HERE ## ## CODE HERE ## ## CODE HERE ## <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Primeiro, crie uma variável Polygon poly fora das coordenadas x e y Step2: Por último Step3: Problema 2 Step4: Próximo Step5: Por último Step6: Problem 3 Step7: Em seguida Step8: Por último Step9: Agora você deve ser capaz de imprimir as respostas para as seguintes perguntas
8,026
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import pandas as pd from sktracker import data from sktracker.trajectories import Trajectories from sktracker.io import TiffFile trajs = Trajectories(data.brownian_trajectories_generator()) trajs.show(groupby_args={'by': 'true_label'}) trajs = Trajectories(data.directed_trajectories_generator()) trajs.show(groupby_args={'by': 'true_label'}) tf = TiffFile(data.CZT_peaks()) arr = tf.asarray() print("Shape is :", arr.shape) a = arr[0, 0, 0] plt.imshow(a, interpolation='none', cmap='gray') df = pd.HDFStore(data.sample_h5()) print(df.keys()) print(df['metadata']) # Run this cell first. %load_ext autoreload %autoreload 2 <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Generate brownian or directed trajectories Step2: Get sample microscopy stack Step3: Get sample H5 file stored by sktacker.io.ObjectsIO Step4: See also
8,027
<ASSISTANT_TASK:> Python Code: import autograd.numpy as np np.set_printoptions(precision=2) import matplotlib.pyplot as plt %matplotlib inline # Number of data points N = 1000 # Dimension of each data point D = 2 # Number of clusters K = 3 pi = [0.1, 0.6, 0.3] mu = [np.array([-4, 1]), np.array([0, 0]), np.array([2, -1])] Sigma = [ np.array([[3, 0], [0, 1]]), np.array([[1, 1.0], [1, 3]]), 0.5 * np.eye(2), ] components = np.random.choice(K, size=N, p=pi) samples = np.zeros((N, D)) # For each component, generate all needed samples for k in range(K): # indices of current component in X indices = k == components # number of those occurrences n_k = indices.sum() if n_k > 0: samples[indices, :] = np.random.multivariate_normal( mu[k], Sigma[k], n_k ) colors = ["r", "g", "b", "c", "m"] for k in range(K): indices = k == components plt.scatter( samples[indices, 0], samples[indices, 1], alpha=0.4, color=colors[k % K], ) plt.axis("equal") plt.show() import sys sys.path.insert(0, "../..") from autograd.scipy.special import logsumexp import pymanopt from pymanopt import Problem from pymanopt.manifolds import Euclidean, Product, SymmetricPositiveDefinite from pymanopt.optimizers import SteepestDescent # (1) Instantiate the manifold manifold = Product([SymmetricPositiveDefinite(D + 1, k=K), Euclidean(K - 1)]) # (2) Define cost function # The parameters must be contained in a list theta. @pymanopt.function.autograd(manifold) def cost(S, v): # Unpack parameters nu = np.append(v, 0) logdetS = np.expand_dims(np.linalg.slogdet(S)[1], 1) y = np.concatenate([samples.T, np.ones((1, N))], axis=0) # Calculate log_q y = np.expand_dims(y, 0) # 'Probability' of y belonging to each cluster log_q = -0.5 * (np.sum(y * np.linalg.solve(S, y), axis=1) + logdetS) alpha = np.exp(nu) alpha = alpha / np.sum(alpha) alpha = np.expand_dims(alpha, 1) loglikvec = logsumexp(np.log(alpha) + log_q, axis=0) return -np.sum(loglikvec) problem = Problem(manifold, cost) # (3) Instantiate a Pymanopt optimizer optimizer = SteepestDescent(verbosity=1) # let Pymanopt do the rest Xopt = optimizer.run(problem).point mu1hat = Xopt[0][0][0:2, 2:3] Sigma1hat = Xopt[0][0][:2, :2] - mu1hat @ mu1hat.T mu2hat = Xopt[0][1][0:2, 2:3] Sigma2hat = Xopt[0][1][:2, :2] - mu2hat @ mu2hat.T mu3hat = Xopt[0][2][0:2, 2:3] Sigma3hat = Xopt[0][2][:2, :2] - mu3hat @ mu3hat.T pihat = np.exp(np.concatenate([Xopt[1], [0]], axis=0)) pihat = pihat / np.sum(pihat) print(mu[0]) print(Sigma[0]) print(mu[1]) print(Sigma[1]) print(mu[2]) print(Sigma[2]) print(pi[0]) print(pi[1]) print(pi[2]) print(mu1hat) print(Sigma1hat) print(mu2hat) print(Sigma2hat) print(mu3hat) print(Sigma3hat) print(pihat[0]) print(pihat[1]) print(pihat[2]) class LineSearchMoG: Back-tracking line-search that checks for close to singular matrices. def __init__( self, contraction_factor=0.5, optimism=2, sufficient_decrease=1e-4, max_iterations=25, initial_step_size=1, ): self.contraction_factor = contraction_factor self.optimism = optimism self.sufficient_decrease = sufficient_decrease self.max_iterations = max_iterations self.initial_step_size = initial_step_size self._oldf0 = None def search(self, objective, manifold, x, d, f0, df0): Function to perform backtracking line-search. Arguments: - objective objective function to optimise - manifold manifold to optimise over - x starting point on the manifold - d tangent vector at x (descent direction) - df0 directional derivative at x along d Returns: - step_size norm of the vector retracted to reach newx from x - newx next iterate suggested by the line-search # Compute the norm of the search direction norm_d = manifold.norm(x, d) if self._oldf0 is not None: # Pick initial step size based on where we were last time. alpha = 2 * (f0 - self._oldf0) / df0 # Look a little further alpha *= self.optimism else: alpha = self.initial_step_size / norm_d alpha = float(alpha) # Make the chosen step and compute the cost there. newx, newf, reset = self._newxnewf(x, alpha * d, objective, manifold) step_count = 1 # Backtrack while the Armijo criterion is not satisfied while ( newf > f0 + self.sufficient_decrease * alpha * df0 and step_count <= self.max_iterations and not reset ): # Reduce the step size alpha = self.contraction_factor * alpha # and look closer down the line newx, newf, reset = self._newxnewf( x, alpha * d, objective, manifold ) step_count = step_count + 1 # If we got here without obtaining a decrease, we reject the step. if newf > f0 and not reset: alpha = 0 newx = x step_size = alpha * norm_d self._oldf0 = f0 return step_size, newx def _newxnewf(self, x, d, objective, manifold): newx = manifold.retraction(x, d) try: newf = objective(newx) except np.linalg.LinAlgError: replace = np.asarray( [ np.linalg.matrix_rank(newx[0][k, :, :]) != newx[0][0, :, :].shape[0] for k in range(newx[0].shape[0]) ] ) x[0][replace, :, :] = manifold.random_point()[0][replace, :, :] return x, objective(x), True return newx, newf, False <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Given a data sample the de facto standard method to infer the parameters is the expectation maximisation (EM) algorithm that, in alternating so-called E and M steps, maximises the log-likelihood of the data. Step2: Once Pymanopt has finished the optimisation we can obtain the inferred parameters as follows Step3: And convince ourselves that the inferred parameters are close to the ground truth parameters. Step4: And the inferred parameters $\hat{\mathbf{\mu}}_1, \hat{\mathbf{\Sigma}}_1, \hat{\mathbf{\mu}}_2, \hat{\mathbf{\Sigma}}_2, \hat{\mathbf{\mu}}_3, \hat{\mathbf{\Sigma}}_3, \hat{\pi}_1, \hat{\pi}_2, \hat{\pi}_3$ Step7: Et voilà – this was a brief demonstration of how to do inference for MoG models by performing Manifold optimisation using Pymanopt.
8,028
<ASSISTANT_TASK:> Python Code: %matplotlib inline import sys import os import platform import numpy as np import matplotlib.pyplot as plt import flopy import flopy.utils as fputl #Set name of MODFLOW exe # assumes executable is in users path statement exe_name = 'mfusg' if platform.system() == 'Windows': exe_name = 'mfusg.exe' mfexe = exe_name modelpth = os.path.join('data') modelname = 'zaidel' #make sure modelpth directory exists if not os.path.exists(modelpth): os.makedirs(modelpth) # model dimensions nlay, nrow, ncol = 1, 1, 200 delr = 50. delc = 1. # boundary heads h1 = 23. h2 = 5. # cell centroid locations x = np.arange(0., float(ncol)*delr, delr) + delr / 2. # ibound ibound = np.ones((nlay, nrow, ncol), dtype=np.int) ibound[:, :, 0] = -1 ibound[:, :, -1] = -1 # bottom of the model botm = 25 * np.ones((nlay + 1, nrow, ncol), dtype=np.float) base = 20. for j in range(ncol): botm[1, :, j] = base #if j > 0 and j % 40 == 0: if j+1 in [40,80,120,160]: base -= 5 # starting heads strt = h1 * np.ones((nlay, nrow, ncol), dtype=np.float) strt[:, :, -1] = h2 #make the flopy model mf = flopy.modflow.Modflow(modelname=modelname, exe_name=mfexe, model_ws=modelpth) dis = flopy.modflow.ModflowDis(mf, nlay, nrow, ncol, delr=delr, delc=delc, top=botm[0, :, :], botm=botm[1:, :, :], perlen=1, nstp=1, steady=True) bas = flopy.modflow.ModflowBas(mf, ibound=ibound, strt=strt) lpf = flopy.modflow.ModflowLpf(mf, hk=0.0001, laytyp=4) oc = flopy.modflow.ModflowOc(mf, stress_period_data={(0,0): ['print budget', 'print head', 'save head', 'save budget']}) sms = flopy.modflow.ModflowSms(mf, nonlinmeth=1, linmeth=1, numtrack=50, btol=1.1, breduc=0.70, reslim = 0.0, theta=0.85, akappa=0.0001, gamma=0., amomentum=0.1, iacl=2, norder=0, level=5, north=7, iredsys=0, rrctol=0., idroptol=1, epsrn=1.e-5, mxiter=500, hclose=1.e-3, hiclose=1.e-3, iter1=50) mf.write_input() # remove any existing head files try: os.remove(os.path.join(model_ws, '{0}.hds'.format(modelname))) except: pass # run the model mf.run_model() # Create the mfusg headfile object headfile = os.path.join(modelpth, '{0}.hds'.format(modelname)) headobj = fputl.HeadFile(headfile, precision='single') times = headobj.get_times() mfusghead = headobj.get_data(totim=times[-1]) fig = plt.figure(figsize=(8,6)) fig.subplots_adjust(left=None, bottom=None, right=None, top=None, wspace=0.25, hspace=0.25) ax = fig.add_subplot(1, 1, 1) ax.plot(x, mfusghead[0, 0, :], linewidth=0.75, color='blue', label='MODFLOW-USG') ax.fill_between(x, y1=botm[1, 0, :], y2=-5, color='0.5', alpha=0.5) leg = ax.legend(loc='upper right') leg.draw_frame(False) ax.set_xlabel('Horizontal distance, in m') ax.set_ylabel('Head, in m') ax.set_ylim(-5,25); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Model parameters Step2: Create and run the MODFLOW-USG model Step3: Read the simulated MODFLOW-USG model results Step4: Plot MODFLOW-USG results
8,029
<ASSISTANT_TASK:> Python Code: import os, time import numpy as np import fitsio from glob import glob import matplotlib.pyplot as plt from astropy.table import vstack, Table, hstack MASKBITS = dict( NPRIMARY = 0x1, # not PRIMARY BRIGHT = 0x2, SATUR_G = 0x4, SATUR_R = 0x8, SATUR_Z = 0x10, ALLMASK_G = 0x20, ALLMASK_R = 0x40, ALLMASK_Z = 0x80, WISEM1 = 0x100, # WISE masked WISEM2 = 0x200, BAILOUT = 0x400, # bailed out of processing MEDIUM = 0x800, # medium-bright star GALAXY = 0x1000, # LSLGA large galaxy CLUSTER = 0x2000, # Cluster catalog source ) # Bits in the "brightblob" bitmask IN_BLOB = dict( BRIGHT = 0x1, MEDIUM = 0x2, CLUSTER = 0x4, GALAXY = 0x8, ) def gather_gaia(camera='decam'): #dr8dir = '/global/project/projectdirs/cosmo/work/legacysurvey/dr8b' dr8dir = '/Users/ioannis/work/legacysurvey/dr8c' #outdir = os.getenv('HOME') outdir = dr8dir for cam in np.atleast_1d(camera): outfile = os.path.join(outdir, 'check-gaia-{}.fits'.format(cam)) if os.path.isfile(outfile): gaia = Table.read(outfile) else: out = [] catfile = glob(os.path.join(dr8dir, cam, 'tractor', '???', 'tractor*.fits')) for ii, ff in enumerate(catfile[1:]): if ii % 100 == 0: print('{} / {}'.format(ii, len(catfile))) cc = Table(fitsio.read(ff, upper=True, columns=['BRICK_PRIMARY', 'BRICKNAME', 'BX', 'BY', 'REF_CAT', 'REF_ID', 'RA', 'DEC', 'TYPE', 'FLUX_G', 'FLUX_R', 'FLUX_Z', 'FLUX_IVAR_G', 'FLUX_IVAR_R', 'FLUX_IVAR_Z', 'BRIGHTBLOB', 'MASKBITS', 'GAIA_PHOT_G_MEAN_MAG'])) cc = cc[cc['BRICK_PRIMARY']] out.append(cc) out = vstack(out) out.write(outfile, overwrite=True) return gaia %time gaia = gather_gaia(camera='decam') idup = gaia['TYPE'] == 'DUP' assert(np.all(gaia[idup]['MASKBITS'] & MASKBITS['GALAXY'] != 0)) assert(np.all(gaia[idup]['FLUX_G'] == 0)) for band in ('G', 'R', 'Z'): assert(np.all(gaia[idup]['FLUX_{}'.format(band)] == 0)) assert(np.all(gaia[idup]['FLUX_IVAR_{}'.format(band)] == 0)) gaia[idup] ibright = np.where(((gaia['MASKBITS'] & MASKBITS['BRIGHT']) != 0) * (gaia['REF_CAT'] == 'G2') * (gaia['TYPE'] != 'DUP'))[0] #bb = (gaia['BRIGHTBLOB'][ibright] & IN_BLOB['BRIGHT'] != 0) == False #gaia[ibright][bb] #gaia[ibright] fig, (ax1, ax2) = plt.subplots(1, 2, figsize=(14, 6)) _ = ax1.hist(gaia[ibright]['GAIA_PHOT_G_MEAN_MAG'], bins=100) ax1.set_xlabel('Gaia G') ax1.set_title('MASKBITS & BRIGHT, REF_CAT==G2, TYPE!=DUP', fontsize=14) isb = np.where(gaia[ibright]['GAIA_PHOT_G_MEAN_MAG'] < 13.0)[0] isf = np.where(gaia[ibright]['GAIA_PHOT_G_MEAN_MAG'] >= 13.0)[0] print(len(isb), len(isf)) ax2.scatter(gaia['RA'][ibright][isb], gaia['DEC'][ibright][isb], s=10, color='green', label='G<13') ax2.scatter(gaia['RA'][ibright][isf], gaia['DEC'][ibright][isf], s=10, color='red', alpha=0.5, label='G>=13') ax2.legend(fontsize=14, frameon=True) ax2.set_title('MASKBITS & BRIGHT, REF_CAT==G2, TYPE!=DUP', fontsize=14) #ax.set_xlim(136.8, 137.2) #ax.set_ylim(32.4, 32.8) print(np.sum(gaia['BRIGHTBLOB'][ibright][isf] & IN_BLOB['BRIGHT'] != 0)) check = np.where(gaia['BRIGHTBLOB'][ibright][isf] & IN_BLOB['BRIGHT'] == 0)[0] # no bright targeting bit set for key in MASKBITS.keys(): print(key, np.sum(gaia['MASKBITS'][ibright][isf][check] & MASKBITS[key] != 0)) gaia[ibright][isf][check] mask = fitsio.read('decam/coadd/132/1325p325/legacysurvey-1325p325-maskbits.fits.fz') #print(mask.max()) c = plt.imshow(mask > 0, origin='lower') #plt.colorbar(c) ww = gaia['BRICKNAME'] == '1325p325' eq = [] for obj in gaia[ww]: eq.append(mask[int(obj['BY']), int(obj['BX'])] == obj['MASKBITS']) assert(np.all(eq)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Check the masking Step2: All DUPs should be in an LSLGA blob. Step3: 1) Find all bright Gaia stars. Step4: Make sure the MASKBITS values are set correctly.
8,030
<ASSISTANT_TASK:> Python Code: # Load libraries from sklearn import datasets from sklearn.preprocessing import StandardScaler from sklearn.cluster import MiniBatchKMeans # Load data iris = datasets.load_iris() X = iris.data # Standarize features scaler = StandardScaler() X_std = scaler.fit_transform(X) # Create k-mean object clustering = MiniBatchKMeans(n_clusters=3, random_state=0, batch_size=100) # Train model model = clustering.fit(X_std) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load Iris Flower Dataset Step2: Standardize Features Step3: Conduct k-Means Clustering
8,031
<ASSISTANT_TASK:> Python Code: %matplotlib notebook import urllib.request import numpy as np import simplejson as json import matplotlib.pyplot as plt import matplotlib.dates as mdates import warnings import datetime import dateutil.parser import matplotlib.cbook warnings.filterwarnings("ignore",category=matplotlib.cbook.mplDeprecation) import requests from netCDF4 import Dataset from dh_py_access.lib.dataset import dataset as dataset import dh_py_access.package_api as package_api import dh_py_access.lib.datahub as datahub np.warnings.filterwarnings('ignore') API_key = open("APIKEY").read().strip() dh=datahub.datahub_main(API_key) fmi_hirlam_surface = dataset('fmi_hirlam_surface',dh) metno_harmonie_metcoop = dataset('metno_harmonie_metcoop',dh) metno_harmonie_wind = dataset('metno_harmonie_wind_det',dh) gfs = dataset('noaa_gfs_pgrb2_global_forecast_recompute_0.25degree',dh) ## Does not look good in github ##gfs.variable_names() lon = 22 lat = 59+6./60 today = datetime.datetime.today() reft = datetime.datetime(today.year,today.month,today.day,int(today.hour/6)*6) - datetime.timedelta(hours=12) reft = reft.isoformat() ##reft = "2018-02-11T18:00:00" arg_dict = {'lon':lon,'lat':lat,'reftime_start':reft,'reftime_end':reft,'count':250} arg_dict_metno_wind_det = dict(arg_dict, **{'vars':'wind_u_z,wind_v_z,air_density_z'}) arg_dict_metno_harm_metcoop = dict(arg_dict, **{'vars':'u_wind_10m,v_wind_10m'}) arg_dict_hirlam = dict(arg_dict, **{'vars':'u-component_of_wind_height_above_ground,v-component_of_wind_height_above_ground'}) arg_dict_gfs = dict(arg_dict, **{'vars':'ugrd_m,vgrd_m','count':450}) dmw = metno_harmonie_wind.get_json_data_in_pandas(**arg_dict_metno_wind_det) dmm = metno_harmonie_metcoop.get_json_data_in_pandas(**arg_dict_metno_harm_metcoop) dhs = fmi_hirlam_surface.get_json_data_in_pandas(**arg_dict_hirlam) dgfs = gfs.get_json_data_in_pandas(**arg_dict_gfs) ## show how to filter Pandas ## dgfs[dgfs['z']==80] vel80_metno = np.array(np.sqrt(dmw[dmw['z']==80]['wind_u_z']**2 + dmw[dmw['z']==80]['wind_v_z']**2)) vel10_metno = np.array(np.sqrt(dmm['u_wind_10m']**2 + dmm['v_wind_10m']**2)) vel10_hirlam = np.array(np.sqrt(dhs['u-component_of_wind_height_above_ground']**2 + dhs['v-component_of_wind_height_above_ground']**2)) vel10_gfs = np.sqrt(dgfs[dgfs['z']==10]['ugrd_m']**2+dgfs[dgfs['z']==10]['vgrd_m']**2) vel80_gfs = np.sqrt(dgfs[dgfs['z']==80]['ugrd_m']**2+dgfs[dgfs['z']==80]['vgrd_m']**2) t_metno = [dateutil.parser.parse(i) for i in dmw[dmw['z']==80]['time']] t_metno_10 = [dateutil.parser.parse(i) for i in dmm['time']] t_hirlam = [dateutil.parser.parse(i) for i in dhs['time']] t_gfs_10 = [dateutil.parser.parse(i) for i in dgfs[dgfs['z']==10]['time']] t_gfs_80 = [dateutil.parser.parse(i) for i in dgfs[dgfs['z']==80]['time']] fig, ax = plt.subplots() days = mdates.DayLocator() daysFmt = mdates.DateFormatter('%Y-%m-%d') hours = mdates.HourLocator() ax.set_ylabel("wind speed") ax.plot(t_metno, vel80_metno, label='Metno 80m') ax.plot(t_metno_10, vel10_metno, label='Metno 10m') ax.plot(t_hirlam, vel10_hirlam, label='HIRLAM 10m') gfs_lim=67 ax.plot(t_gfs_10[:gfs_lim], vel10_gfs[:gfs_lim], label='GFS 10m') ax.plot(t_gfs_80[:gfs_lim], vel80_gfs[:gfs_lim], label='GFS 80m') ax.xaxis.set_major_locator(days) ax.xaxis.set_major_formatter(daysFmt) ax.xaxis.set_minor_locator(hours) #fig.autofmt_xdate() plt.legend() plt.grid() plt.savefig("model_comp") fig, ax = plt.subplots() ax2 = ax.twinx() days = mdates.DayLocator() daysFmt = mdates.DateFormatter('%Y-%m-%d') hours = mdates.HourLocator() ax.plot(t_metno,vel80_metno) aird80 = dmw[dmw['z']==80]['air_density_z'] ax2.plot(t_metno,aird80,c='g') ax.xaxis.set_major_locator(days) ax.xaxis.set_major_formatter(daysFmt) ax.xaxis.set_minor_locator(hours) ax.set_ylabel("wind speed") ax2.set_ylabel("air density") fig.tight_layout() #fig.autofmt_xdate() plt.savefig("density_80m") fig, ax = plt.subplots() ax2 = ax.twinx() ax2.set_ylabel("energy production") ax.set_ylabel("wind speed") ax.plot(t_metno,vel80_metno, c='b', label='wind speed') ax2.plot(t_metno,aird80*vel80_metno**3, c='r', label='energy prod w.dens') ax.xaxis.set_major_locator(days) ax.xaxis.set_major_formatter(daysFmt) ax.xaxis.set_minor_locator(hours) fig.autofmt_xdate() lines, labels = ax.get_legend_handles_labels() lines2, labels2 = ax2.get_legend_handles_labels() ax2.legend(lines + lines2, labels + labels2, loc=0) density = package_api.package_api(dh,'metno_harmonie_wind_det','air_density_z',-20,60,10,80,'full_domain_harmonie') density.make_package() density.download_package() density_data = Dataset(density.get_local_file_name()) ## biggest change of density in one location during forecast period maxval = np.nanmax(density_data.variables['air_density_z'],axis=0) minval = np.nanmin(density_data.variables['air_density_z'],axis=0) print(np.nanmax(maxval-minval),np.nanmean(maxval-minval)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: <font color='red'>Please put your datahub API key into a file called APIKEY and place it to the notebook folder or assign your API key directly to the variable API_key!</font> Step2: We use a simple dh_py_access library for controlling REST requests. Step3: dh_py_access provides some easy to use functions to list dataset metadata Step4: Initialize coordinates and reftime. Please note that more recent reftime, than computed below, may be available for particular dataset. We just use conservative example for demo Step5: Fetch data and convert to Pandas dataframe Step6: Filter out necessary data from the DataFrames Step7: We easily see that differences between models can be larger than difference of 10m to 80m winds in the same model. Step8: No let's energy production looks compared to the wind speed Step9: Finally, let's analyse how much density changes vary over the whole domain during one forecast. For this purpose, we download the whole density field with package api Step10: Maximum relative change of air density in single location is
8,032
<ASSISTANT_TASK:> Python Code: from src.parameters import ANIMALS ANIMALS from src.parameters import N_DAYS, SAMPLING_FREQUENCY print('Days: {0}'.format(N_DAYS)) print('Sampling Frequency: {0}'.format(SAMPLING_FREQUENCY)) from src.data_processing import make_epochs_dataframe days = range(1, N_DAYS + 1) epoch_info = make_epochs_dataframe(ANIMALS, days) epoch_info epoch_info.index.tolist() epoch_info.loc[epoch_info.type == 'run'] epoch_info.loc[epoch_info.type == 'run'].index.tolist() from src.data_processing import make_tetrode_dataframe tetrode_info = make_tetrode_dataframe(ANIMALS) list(tetrode_info.keys()) epoch_key = ('HPa', 6, 2) tetrode_info[epoch_key] [tetrode_info[epoch_key] for epoch_key in epoch_info.loc[ (epoch_info.type == 'sleep') & (epoch_info.day == 8)].index] from src.data_processing import make_neuron_dataframe neuron_info = make_neuron_dataframe(ANIMALS) list(neuron_info.keys()) epoch_key = ('HPa', 6, 2) neuron_info[epoch_key] from src.data_processing import get_spike_indicator_dataframe neuron_key = ('HPa', 6, 2, 1, 4) get_spike_indicator_dataframe(neuron_key, ANIMALS) neuron_info[epoch_key].index.tolist() neuron_info[epoch_key].query('area == "CA1"') neuron_info[epoch_key].query('area == "CA1"').index.tolist() pd.concat( [get_spike_indicator_dataframe(neuron_key, ANIMALS) for neuron_key in neuron_info[epoch_key].query('area == "CA1"').index], axis=1) pd.concat( [get_spike_indicator_dataframe(neuron_key, ANIMALS) for neuron_key in neuron_info[epoch_key].query('area == "CA1"').index], axis=1).values from src.data_processing import get_interpolated_position_dataframe epoch_key = ('HPa', 6, 2) get_interpolated_position_dataframe(epoch_key, ANIMALS) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: N_DAYS corresponds to the number of days of recording and SAMPLING_FREQUENCY corresponds to the sampling rate of the tetrodes recording neural activity Step2: Data Processing Module Step3: Often we use the epoch as a key to access more information about that epoch (information about the tetrodes, neuron, etc). Epoch keys are tuples with the following format Step4: This is useful if we want to filter the epoch dataframe by a particular attribute (Say we only want sessions where the animal is asleep) and use the keys to access the data for that epoch. Step5: make_tetrode_dataframe Step6: If we want to access a particular epoch we can just pass the corresponding epoch tuple. In this case, we want animal HPa, day 6, epoch 2. This returns a dataframe where each row corresponds to a tetrode for that epoch. Step7: Remember that the epoch dataframe index can be used as keys, which can be useful if we want to access a particular epoch. Step8: make_neuron_dataframe Step9: We can access the neuron dataframe for a particular epoch in the same way as the tetrodes Step10: get_spike_indicator_dataframe Step11: This information can be obtained from the neuron dataframe. The index of the neuron dataframe gives the key. Step12: Like the epoch and tetrode dataframe, this allows us to filter for certain attributes (like if we want neurons in a certain brain area) and select only those neurons. For example, if we want only CA1 neurons Step13: We can get the keys for CA1 neurons only Step14: And then get the spike indicator data for those neurons Step15: If we want the numpy array, use .values Step16: get_interpolated_position_dataframe
8,033
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt plt.rcParams['figure.dpi'] = 150 from skdaccess.framework.param_class import * from skdaccess.geo.wyoming_sounding.cache import DataFetcher sdf = DataFetcher(station_number='72493', year=2014, month=5, day_start=30, day_end=30, start_hour=12, end_hour=12) dw = sdf.output() label, data = next(dw.getIterator()) data.head() plt.figure(figsize=(5,3.75)) plt.plot(data['TEMP'],data['HGHT']); plt.ylabel('Height'); plt.xlabel('Temperature'); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create a data fetcher Step2: Access data
8,034
<ASSISTANT_TASK:> Python Code: import time import tempfile import shutil import os import numpy as np from joblib import Parallel, delayed from joblib import load, dump def griddata(gridpoints, tlayer, teff_logg_feh, method='linear', rescale=True): Do what ever it does # put a short wait. time.sleep(0.5) return np.sum(tlayer) * teff_logg_feh[0] + teff_logg_feh[1] + teff_logg_feh[2] # thing to test inputs def inside_loop(newatm, models, layer, column, gridpoints, teff_logg_feh): tlayer = np.zeros( len(models)) for inx, model in enumerate(models): tlayer[indx] = model[layer, column] # print(" for layer = {0}, column = {1}".format(layer, column)) print("[Worker %d] Layer %d and Column %d is about to griddata" % (os.getpid(), layer, column)) newatm[layer, column] = griddata(gridpoints, tlayer, teff_logg_feh, method='linear', rescale=True) layers = range(3) columns = range(2) gridpoints = 5 teff = 1000 logg = 1 feh = -0.01 model1 = np.array([[1, 2], [3, 4], [5, 6]]) model2 = np.array([[7, 8], [9, 10], [11, 12]]) models = [model1, model2, model1*2, model2*2] # random models # %%timeit newatm = np.zeros([len(layers), len(columns)]) generator = (inside_loop(newatm, models, layer, column, gridpoints, (teff, logg, feh)) for layer in layers for column in columns) for i in generator: # print(newatm) pass print(newatm) # %%timeit # Turning parallel newatm = np.zeros([len(layers), len(columns)]) print("newatm before parallel", newatm) Parallel(n_jobs=-1, verbose=1) (delayed(inside_loop)(newatm, models, layer, column, gridpoints, (teff, logg, feh)) for layer in layers for column in columns) time.sleep(0.5) print("newatm after parallel", newatm) # This runs in parallel but it does not return any data yet. # Need to memmap the results def inside_loop(newatm, models, layer, column, gridpoints, teff_logg_feh): tlayer = np.zeros( len(models)) for inx, model in enumerate(models): tlayer[indx] = model[layer, column] newatm[layer, column] = griddata(gridpoints, tlayer, teff_logg_feh, method='linear', rescale=True) def griddata(gridpoints, tlayer, teff_logg_feh, method='linear', rescale=True): Do what ever it does time.sleep(0.5) return True # thing to test inputs folder = tempfile.mkdtemp() newatm_name = os.path.join(folder, 'newatm') try: # Pre-allocate a writeable shared memory map as a container for the # results of the parallel computation newatm = np.memmap(newatm_name, dtype=model.dtype, shape=model.shape, mode='w+') # need to adjsut the shape print("newatm before parallel", newatm) Parallel(n_jobs=-1, verbose=1) (delayed(inside_loop)(newatm, models, layer, column, gridpoints, (teff, logg, feh)) for layer in layers for column in columns) time.sleep(0.5) print("newatm after parallel", newatm) finally: # deleting temp files after testing the reuslt in example try: shutil.rmtree(folder) except: print("Failed to delete: " + folder) def sum_row(input, output, i): Compute the sum of a row in input and store it in output sum_ = input[i, :].sum() print("[Worker %d] Sum for row %d is %f" % (os.getpid(), i, sum_)) output[i] = sum_ if __name__ == "__main__": rng = np.random.RandomState(42) folder = tempfile.mkdtemp() samples_name = os.path.join(folder, 'samples') sums_name = os.path.join(folder, 'sums') try: # Generate some data and an allocate an output buffer samples = rng.normal(size=(10, int(1e6))) # Pre-allocate a writeable shared memory map as a container for the # results of the parallel computation sums = np.memmap(sums_name, dtype=samples.dtype, shape=samples.shape[0], mode='w+') print("samples shape", samples.shape) # Dump the input data to disk to free the memory dump(samples, samples_name) # Release the reference on the original in memory array and replace it # by a reference to the memmap array so that the garbage collector can # release the memory before forking. gc.collect() is internally called # in Parallel just before forking. samples = load(samples_name, mmap_mode='r') # Fork the worker processes to perform computation concurrently Parallel(n_jobs=4)(delayed(sum_row)(samples, sums, i) for i in range(samples.shape[0])) # Compare the results from the output buffer with the ground truth print("Expected sums computed in the parent process:") expected_result = samples.sum(axis=1) print(expected_result) print("Actual sums computed by the worker processes:") print(sums) assert np.allclose(expected_result, sums) finally: try: shutil.rmtree(folder) except: print("Failed to delete: " + folder) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Joblib for Daniel Step3: Parallel over both loops with memapping Step5: Direct copy of Joblib memmaping example
8,035
<ASSISTANT_TASK:> Python Code: from PIL import Image import numpy as np %matplotlib inline import matplotlib import matplotlib.pyplot as plt from sklearn import datasets, svm, linear_model matplotlib.style.use('bmh') matplotlib.rcParams['figure.figsize']=(10,7) X = np.random.normal(5, 5, size=(50,1)) y0 = X[:,0]>0 y = y0.ravel()*2-1 # linear regression regr = linear_model.LinearRegression().fit(X, y) test_X=np.linspace(-10,10,100).reshape(-1,1) plt.plot(test_X, regr.predict(test_X), alpha=0.5, c='r') plt.plot([-regr.intercept_/regr.coef_[0]]*2, [-1.5,1.5], 'r--', alpha=0.2) # linear svm clf = svm.SVC(kernel="linear", C=1000) clf.fit(X,y) plt.ylim(-1.5, 1.5) plt.xlim(-5, 5) # svm 的判斷分割點 x0 = -clf.intercept_[0]/clf.coef_[0,0] x1 = (1-clf.intercept_[0])/clf.coef_[0,0] x2 = (-1-clf.intercept_[0])/clf.coef_[0,0] # or #assert (clf.n_support_ == [1,1]).all() #x1, x2 = clf.support_vectors_.ravel() plt.plot(test_X, clf.coef_[0]*test_X+clf.intercept_, 'g', alpha=0.5); plt.plot([x0]*2, [-1.5,1.5], 'g--', alpha=0.5) for x in [x1, x2]: plt.plot([x]*2, [-1.5,1.5], 'g--', alpha=0.2); plt.fill_betweenx([-1.5,1.5], [x1]*2, [x2]*2,alpha=0.1, zorder=-1, color="g") plt.plot(X, y, 'bx'); # Iris dataset X, y = datasets.load_iris(return_X_y=True) # 只取 y=0,2 以及 X 的前兩個 features X = X[y!=1, :2] y = y[y!=1] clf=svm.SVC(kernel='rbf') clf.fit(X, y) # 邊界 x_min, y_min = X.min(axis=0)-1 x_max, y_max = X.max(axis=0)+1 # 座標點 grid = np.mgrid[x_min:x_max:200j, y_min:y_max:200j] # grid.shape = (2, 200, 200) # 在座標點 算出 svm 的判斷函數 Z = clf.decision_function(grid.reshape(2, -1).T) Z = Z.reshape(grid.shape[1:]) # 畫出顏色和邊界 plt.pcolormesh(grid[0], grid[1], Z > 0, cmap=plt.cm.rainbow, alpha=0.02) plt.contour(grid[0], grid[1], Z, colors=['k', 'k', 'k'], linestyles=['--', '-', '--'], levels=[-.5, 0, .5]) # 標出 sample 點 plt.scatter(X[:,0], X[:, 1], c=y, cmap=plt.cm.rainbow, zorder=10, s=50); import gzip import pickle with gzip.open('mnist.pkl.gz', 'rb') as f: train_set, validation_set, test_set = pickle.load(f, encoding='latin1') train_X, train_y = train_set test_X, test_y = test_set #PCA from sklearn.decomposition import PCA pca = PCA(n_components=60) train_X = pca.fit_transform(train_set[0]) test_X = pca.transform(test_set[0]) # use only first 10000 samples idx = np.random.choice(np.arange(train_X.shape[0]), 30000, replace=False) train_X = train_X[idx] train_y = train_y[idx] clf = svm.SVC(decision_function_shape='ovo') %%timeit -n 1 -r 1 clf.fit(train_X, train_y) %%timeit -n 1 -r 1 print(np.mean(clf.predict(train_X) == train_y)) %%timeit -n 1 -r 1 print(np.mean(clf.predict(test_X) == test_y)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Linear SVM Step2: 簡易的 svm 實驗 Step3: Q
8,036
<ASSISTANT_TASK:> Python Code: #!pip install -I "phoebe>=2.3,<2.4" import phoebe from phoebe import u # units import numpy as np import matplotlib.pyplot as plt phoebe.devel_on() # CURRENTLY REQUIRED FOR WD-STYLE MESHING (WHICH IS EXPERIMENTAL) logger = phoebe.logger() b = phoebe.default_binary() b.set_value_all('mesh_method', 'wd') b.set_value_all('eclipse_method', 'graham') b.add_dataset('mesh', compute_times=[0, 0.5], dataset='mesh01', columns=['visibilities']) b.run_compute(irrad_method='none') afig, mplfig = b['mesh01@model'].plot(time=0.5, x='us', y='vs', show=True) afig, mplfig = b['primary@mesh01@model'].plot(time=0.0, x='us', y='vs', ec='blue', fc='gray', xlim=(-0.2,0.2), ylim=(-0.2,0.2), show=True) afig, mplfig = b['primary@mesh01@model'].plot(time=0.0, x='us', y='ws', ec='blue', fc='gray', xlim=(-0.1,0.1), ylim=(-2.75,-2.55), show=True) afig, mplfig = b['secondary@mesh01@model'].plot(time=0.0, x='us', y='ws', ec='face', fc='visibilities', show=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: As always, let's do imports and initialize a logger and a new bundle. Step2: Changing Meshing Options Step3: Adding Datasets Step4: Running Compute Step5: Plotting Step6: Now let's zoom in so we can see the layout of the triangles. Note that Wilson-Devinney uses trapezoids, but since PHOEBE uses triangles, we take each of the trapezoids and split it into two triangles. Step7: And now looking down from above. Here you can see the gaps between the surface elements (and you can also see some of the subdivision that's taking place along the limb). Step8: And see which elements are visible at the current time. This defaults to use the 'RdYlGn' colormap which will make visible elements green, partially hidden elements yellow, and hidden elements red. Note that the observer is in the positive w-direction.
8,037
<ASSISTANT_TASK:> Python Code: import Ngl,Nio #-- define variables fname = "/Users/k204045/NCL/general/data/new_data/rectilinear_grid_2D.nc" #-- data file name #-- open file and read variables f = Nio.open_file(fname,"r") #-- open data file temp = f.variables["tsurf"][0,::-1,:] #-- first time step, reverse latitude lat = f.variables["lat"][::-1] #-- reverse latitudes lon = f.variables["lon"][:] #-- all longitudes tempac = Ngl.add_cyclic(temp[:,:]) minval = 250. #-- minimum contour level maxval = 315 #-- maximum contour level inc = 5. #-- contour level spacing ncn = (maxval-minval)/inc + 1 #-- number of contour levels. wkres = Ngl.Resources() #-- generate an res object for workstation wkres.wkColorMap = "rainbow" #-- choose colormap wks_type = "png" #-- graphics output type wks = Ngl.open_wks(wks_type,"plot_contour_PyNGL",wkres) #-- open workstation res = Ngl.Resources() #-- generate an resource object for plot if hasattr(f.variables["tsurf"],"long_name"): res.tiMainString = f.variables["tsurf"].long_name #-- set main title res.vpXF = 0.1 #-- start x-position of viewport res.vpYF = 0.9 #-- start y-position of viewport res.vpWidthF = 0.7 #-- width of viewport res.vpHeightF = 0.7 #-- height of viewport res.cnFillOn = True #-- turn on contour fill. res.cnLinesOn = False #-- turn off contour lines res.cnLineLabelsOn = False #-- turn off line labels. res.cnInfoLabelOn = False #-- turn off info label. res.cnLevelSelectionMode = "ManualLevels" #-- select manual level selection mode res.cnMinLevelValF = minval #-- minimum contour value res.cnMaxLevelValF = maxval #-- maximum contour value res.cnLevelSpacingF = inc #-- contour increment res.mpGridSpacingF = 30. #-- map grid spacing res.sfXCStartV = float(min(lon)) #-- x-axis location of 1st element lon res.sfXCEndV = float(max(lon)) #-- x-axis location of last element lon res.sfYCStartV = float(min(lat)) #-- y-axis location of 1st element lat res.sfYCEndV = float(max(lat)) #-- y-axis location of last element lat res.pmLabelBarDisplayMode = "Always" #-- turn on the label bar. res.lbOrientation = "Horizontal" #-- labelbar orientation map = Ngl.contour_map(wks,tempac,res) #-- draw contours over a map. #-- end Ngl.delete_wks(wks) #-- this need to be done to close the graphics output file Ngl.end() from IPython.display import Image Image(filename='plot_contour_PyNGL.png') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Add cyclic data. Set minimum and maximum contour values although the interval. Step2: Open a workstation, here x11 window. Step3: Set resources. Step4: Draw the plot. Step5: Show the plot in this notebook.
8,038
<ASSISTANT_TASK:> Python Code: import mne import os.path as op import numpy as np from matplotlib import pyplot as plt data_path = op.join(mne.datasets.sample.data_path(), 'MEG', 'sample', 'sample_audvis_raw.fif') raw = mne.io.read_raw_fif(data_path, preload=True) raw = raw.crop(0, 10) print(raw) filt_bands = [(1, 3), (3, 10), (10, 20), (20, 60)] _, (ax, ax2) = plt.subplots(2, 1, figsize=(15, 10)) data, times = raw[0] _ = ax.plot(data[0]) for fmin, fmax in filt_bands: raw_filt = raw.copy() raw_filt.filter(fmin, fmax, fir_design='firwin') _ = ax2.plot(raw_filt[0][0][0]) ax2.legend(filt_bands) ax.set_title('Raw data') ax2.set_title('Band-pass filtered data') # Filter signal with a fairly steep filter, then take hilbert transform raw_band = raw.copy() raw_band.filter(12, 18, l_trans_bandwidth=2., h_trans_bandwidth=2., fir_design='firwin') raw_hilb = raw_band.copy() hilb_picks = mne.pick_types(raw_band.info, meg=False, eeg=True) raw_hilb.apply_hilbert(hilb_picks) print(raw_hilb[0][0].dtype) # Take the amplitude and phase raw_amp = raw_hilb.copy() raw_amp.apply_function(np.abs, hilb_picks) raw_phase = raw_hilb.copy() raw_phase.apply_function(np.angle, hilb_picks) _, (a1, a2) = plt.subplots(2, 1, figsize=(15, 10)) a1.plot(raw_band[hilb_picks[0]][0][0].real) a1.plot(raw_amp[hilb_picks[0]][0][0].real) a2.plot(raw_phase[hilb_picks[0]][0][0].real) a1.set_title('Amplitude of frequency band') a2.set_title('Phase of frequency band') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load an example dataset, the preload flag loads the data into memory now Step2: Signal processing Step3: In addition, there are functions for applying the Hilbert transform, which is Step4: Finally, it is possible to apply arbitrary functions to your data to do
8,039
<ASSISTANT_TASK:> Python Code: %matplotlib inline # All the imports from __future__ import print_function, division from math import * import random import sys import matplotlib.pyplot as plt # TODO 1: Enter your unity ID here __author__ = "<unity-id>" class O: Basic Class which - Helps dynamic updates - Pretty Prints def __init__(self, **kwargs): self.has().update(**kwargs) def has(self): return self.__dict__ def update(self, **kwargs): self.has().update(kwargs) return self def __repr__(self): show = [':%s %s' % (k, self.has()[k]) for k in sorted(self.has().keys()) if k[0] is not "_"] txt = ' '.join(show) if len(txt) > 60: show = map(lambda x: '\t' + x + '\n', show) return '{' + ' '.join(show) + '}' print("Unity ID: ", __author__) # Few Utility functions def say(*lst): Print whithout going to new line print(*lst, end="") sys.stdout.flush() def random_value(low, high, decimals=2): Generate a random number between low and high. decimals incidicate number of decimal places return round(random.uniform(low, high),decimals) def gt(a, b): return a > b def lt(a, b): return a < b def shuffle(lst): Shuffle a list random.shuffle(lst) return lst class Decision(O): Class indicating Decision of a problem def __init__(self, name, low, high): @param name: Name of the decision @param low: minimum value @param high: maximum value O.__init__(self, name=name, low=low, high=high) class Objective(O): Class indicating Objective of a problem def __init__(self, name, do_minimize=True): @param name: Name of the objective @param do_minimize: Flag indicating if objective has to be minimized or maximized O.__init__(self, name=name, do_minimize=do_minimize) class Point(O): Represents a member of the population def __init__(self, decisions): O.__init__(self) self.decisions = decisions self.objectives = None def __hash__(self): return hash(tuple(self.decisions)) def __eq__(self, other): return self.decisions == other.decisions def clone(self): new = Point(self.decisions) new.objectives = self.objectives return new class Problem(O): Class representing the cone problem. def __init__(self): O.__init__(self) # TODO 2: Code up decisions and objectives below for the problem # using the auxilary classes provided above. self.decisions = [Decision('r', 0, 10), Decision('h', 0, 20)] self.objectives = [Objective('S'), Objective('T')] @staticmethod def evaluate(point): [r, h] = point.decisions # TODO 3: Evaluate the objectives S and T for the point. return point.objectives @staticmethod def is_valid(point): [r, h] = point.decisions # TODO 4: Check if the point has valid decisions return True def generate_one(self): # TODO 5: Generate a valid instance of Point. return None cone = Problem() point = cone.generate_one() cone.evaluate(point) print(point) def populate(problem, size): population = [] # TODO 6: Create a list of points of length 'size' return population # or if ur python OBSESSED # return [problem.generate_one() for _ in xrange(size)] print(populate(cone, 5)) def crossover(mom, dad): # TODO 7: Create a new point which contains decisions from # the first half of mom and second half of dad return None pop = populate(cone,5) crossover(pop[0], pop[1]) def mutate(problem, point, mutation_rate=0.01): # TODO 8: Iterate through all the decisions in the problem # and if the probability is less than mutation rate # change the decision(randomly set it between its max and min). return None def bdom(problem, one, two): Return if one dominates two objs_one = problem.evaluate(one) objs_two = problem.evaluate(two) dominates = False # TODO 9: Return True/False based on the definition # of bdom above. return dominates def fitness(problem, population, point): dominates = 0 # TODO 10: Evaluate fitness of a point. # For this workshop define fitness of a point # as the number of points dominated by it. # For example point dominates 5 members of population, # then fitness of point is 5. return dominates def elitism(problem, population, retain_size): # TODO 11: Sort the population with respect to the fitness # of the points and return the top 'retain_size' points of the population return population[:retain_size] def ga(pop_size = 100, gens = 250): problem = Problem() population = populate(problem, pop_size) [problem.evaluate(point) for point in population] initial_population = [point.clone() for point in population] gen = 0 while gen < gens: say(".") children = [] for _ in range(pop_size): mom = random.choice(population) dad = random.choice(population) while (mom == dad): dad = random.choice(population) child = mutate(problem, crossover(mom, dad)) if problem.is_valid(child) and child not in population+children: children.append(child) population += children population = elitism(problem, population, pop_size) gen += 1 print("") return initial_population, population def plot_pareto(initial, final): initial_objs = [point.objectives for point in initial] final_objs = [point.objectives for point in final] initial_x = [i[0] for i in initial_objs] initial_y = [i[1] for i in initial_objs] final_x = [i[0] for i in final_objs] final_y = [i[1] for i in final_objs] plt.scatter(initial_x, initial_y, color='b', marker='+', label='initial') plt.scatter(final_x, final_y, color='r', marker='o', label='final') plt.title("Scatter Plot between initial and final population of GA") plt.ylabel("Total Surface Area(T)") plt.xlabel("Curved Surface Area(S)") plt.legend(loc=9, bbox_to_anchor=(0.5, -0.175), ncol=2) plt.show() initial, final = ga() plot_pareto(initial, final) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Genetic Algorithm Workshop Step11: The optimization problem Step12: Great. Now that the class and its basic methods is defined, we move on to code up the GA. Step13: Crossover Step14: Mutation Step16: Fitness Evaluation Step17: Fitness and Elitism Step18: Putting it all together and making the GA Step19: Visualize
8,040
<ASSISTANT_TASK:> Python Code: BATCH_SIZE = 64 LEARNING_RATE = 0.002 # GCS bucket for training logs and for saving the trained model # You can leave this empty for local saving, unless you are using a TPU. # TPUs do not have access to your local instance and can only write to GCS. BUCKET="" # a valid bucket name must start with gs:// training_images_file = 'gs://mnist-public/train-images-idx3-ubyte' training_labels_file = 'gs://mnist-public/train-labels-idx1-ubyte' validation_images_file = 'gs://mnist-public/t10k-images-idx3-ubyte' validation_labels_file = 'gs://mnist-public/t10k-labels-idx1-ubyte' import os, re, math, json, time import PIL.Image, PIL.ImageFont, PIL.ImageDraw import numpy as np import tensorflow as tf from matplotlib import pyplot as plt from tensorflow.python.platform import tf_logging print("Tensorflow version " + tf.__version__) try: # detect TPUs tpu = tf.distribute.cluster_resolver.TPUClusterResolver() # TPU detection tf.config.experimental_connect_to_cluster(tpu) tf.tpu.experimental.initialize_tpu_system(tpu) strategy = tf.distribute.experimental.TPUStrategy(tpu) except ValueError: # detect GPUs strategy = tf.distribute.MirroredStrategy() # for GPU or multi-GPU machines #strategy = tf.distribute.get_strategy() # default strategy that works on CPU and single GPU #strategy = tf.distribute.experimental.MultiWorkerMirroredStrategy() # for clusters of multi-GPU machines print("Number of accelerators: ", strategy.num_replicas_in_sync) # adjust batch size and learning rate for distributed computing global_batch_size = BATCH_SIZE * strategy.num_replicas_in_sync # num replcas is 8 on a single TPU or N when runing on N GPUs. learning_rate = LEARNING_RATE * strategy.num_replicas_in_sync #@title visualization utilities [RUN ME] This cell contains helper functions used for visualization and downloads only. You can skip reading it. There is very little useful Keras/Tensorflow code here. # Matplotlib config plt.rc('image', cmap='gray_r') plt.rc('grid', linewidth=0) plt.rc('xtick', top=False, bottom=False, labelsize='large') plt.rc('ytick', left=False, right=False, labelsize='large') plt.rc('axes', facecolor='F8F8F8', titlesize="large", edgecolor='white') plt.rc('text', color='a8151a') plt.rc('figure', facecolor='F0F0F0')# Matplotlib fonts MATPLOTLIB_FONT_DIR = os.path.join(os.path.dirname(plt.__file__), "mpl-data/fonts/ttf") # pull a batch from the datasets. This code is not very nice, it gets much better in eager mode (TODO) def dataset_to_numpy_util(training_dataset, validation_dataset, N): # get one batch from each: 10000 validation digits, N training digits unbatched_train_ds = training_dataset.unbatch() # This is the TF 2.0 "eager execution" way of iterating through a tf.data.Dataset for v_images, v_labels in validation_dataset: break for t_images, t_labels in unbatched_train_ds.batch(N): break validation_digits = v_images.numpy() validation_labels = v_labels.numpy() training_digits = t_images.numpy() training_labels = t_labels.numpy() # these were one-hot encoded in the dataset validation_labels = np.argmax(validation_labels, axis=1) training_labels = np.argmax(training_labels, axis=1) return (training_digits, training_labels, validation_digits, validation_labels) # create digits from local fonts for testing def create_digits_from_local_fonts(n): font_labels = [] img = PIL.Image.new('LA', (28*n, 28), color = (0,255)) # format 'LA': black in channel 0, alpha in channel 1 font1 = PIL.ImageFont.truetype(os.path.join(MATPLOTLIB_FONT_DIR, 'DejaVuSansMono-Oblique.ttf'), 25) font2 = PIL.ImageFont.truetype(os.path.join(MATPLOTLIB_FONT_DIR, 'STIXGeneral.ttf'), 25) d = PIL.ImageDraw.Draw(img) for i in range(n): font_labels.append(i%10) d.text((7+i*28,0 if i<10 else -4), str(i%10), fill=(255,255), font=font1 if i<10 else font2) font_digits = np.array(img.getdata(), np.float32)[:,0] / 255.0 # black in channel 0, alpha in channel 1 (discarded) font_digits = np.reshape(np.stack(np.split(np.reshape(font_digits, [28, 28*n]), n, axis=1), axis=0), [n, 28*28]) return font_digits, font_labels # utility to display a row of digits with their predictions def display_digits(digits, predictions, labels, title, n): plt.figure(figsize=(13,3)) digits = np.reshape(digits, [n, 28, 28]) digits = np.swapaxes(digits, 0, 1) digits = np.reshape(digits, [28, 28*n]) plt.yticks([]) plt.xticks([28*x+14 for x in range(n)], predictions) for i,t in enumerate(plt.gca().xaxis.get_ticklabels()): if predictions[i] != labels[i]: t.set_color('red') # bad predictions in red plt.imshow(digits) plt.grid(None) plt.title(title) # utility to display multiple rows of digits, sorted by unrecognized/recognized status def display_top_unrecognized(digits, predictions, labels, n, lines): idx = np.argsort(predictions==labels) # sort order: unrecognized first for i in range(lines): display_digits(digits[idx][i*n:(i+1)*n], predictions[idx][i*n:(i+1)*n], labels[idx][i*n:(i+1)*n], "{} sample validation digits out of {} with bad predictions in red and sorted first".format(n*lines, len(digits)) if i==0 else "", n) #IS_COLAB_BACKEND = 'COLAB_GPU' in os.environ # this is always set on Colab, the value is 0 or 1 depending on GPU presence #if IS_COLAB_BACKEND: # from google.colab import auth # auth.authenticate_user() # Authenticates the backend and also the TPU using your credentials so that they can access your private GCS buckets def read_label(tf_bytestring): label = tf.io.decode_raw(tf_bytestring, tf.uint8) label = tf.reshape(label, []) label = tf.one_hot(label, 10) return label def read_image(tf_bytestring): image = tf.io.decode_raw(tf_bytestring, tf.uint8) image = tf.cast(image, tf.float32)/256.0 image = tf.reshape(image, [28*28]) return image def load_dataset(image_file, label_file): imagedataset = tf.data.FixedLengthRecordDataset(image_file, 28*28, header_bytes=16) imagedataset = imagedataset.map(read_image, num_parallel_calls=16) labelsdataset = tf.data.FixedLengthRecordDataset(label_file, 1, header_bytes=8) labelsdataset = labelsdataset.map(read_label, num_parallel_calls=16) dataset = tf.data.Dataset.zip((imagedataset, labelsdataset)) return dataset def get_training_dataset(image_file, label_file, batch_size): dataset = load_dataset(image_file, label_file) dataset = dataset.cache() # this small dataset can be entirely cached in RAM, for TPU this is important to get good performance from such a small dataset dataset = dataset.shuffle(5000, reshuffle_each_iteration=True) dataset = dataset.repeat() # Mandatory for Keras for now dataset = dataset.batch(batch_size, drop_remainder=True) # drop_remainder is important on TPU, batch size must be fixed dataset = dataset.prefetch(-1) # fetch next batches while training on the current one (-1: autotune prefetch buffer size) return dataset def get_validation_dataset(image_file, label_file): dataset = load_dataset(image_file, label_file) dataset = dataset.cache() # this small dataset can be entirely cached in RAM, for TPU this is important to get good performance from such a small dataset dataset = dataset.repeat() # Mandatory for Keras for now dataset = dataset.batch(10000, drop_remainder=True) # 10000 items in eval dataset, all in one batch return dataset # instantiate the datasets training_dataset = get_training_dataset(training_images_file, training_labels_file, global_batch_size) validation_dataset = get_validation_dataset(validation_images_file, validation_labels_file) N = 24 (training_digits, training_labels, validation_digits, validation_labels) = dataset_to_numpy_util(training_dataset, validation_dataset, N) display_digits(training_digits, training_labels, training_labels, "training digits and their labels", N) display_digits(validation_digits[:N], validation_labels[:N], validation_labels[:N], "validation digits and their labels", N) font_digits, font_labels = create_digits_from_local_fonts(N) # This model trains to 99.4%— sometimes 99.5%— accuracy in 10 epochs (with a batch size of 64) def make_model(): model = tf.keras.Sequential( [ tf.keras.layers.Reshape(input_shape=(28*28,), target_shape=(28, 28, 1)), tf.keras.layers.Conv2D(filters=6, kernel_size=3, padding='same', use_bias=True, activation='relu'), tf.keras.layers.Conv2D(filters=12, kernel_size=6, padding='same', use_bias=True, activation='relu', strides=2), tf.keras.layers.Conv2D(filters=24, kernel_size=6, padding='same', use_bias=True, activation='relu', strides=2), tf.keras.layers.Flatten(), tf.keras.layers.Dense(200, use_bias=True, activation='relu'), tf.keras.layers.Dense(10, activation='softmax') ]) model.compile(optimizer='adam', # learning rate will be set by LearningRateScheduler loss='categorical_crossentropy', metrics=['accuracy']) return model with strategy.scope(): # the new way of handling distribution strategies in Tensorflow 1.14+ model = make_model() # print model layers model.summary() # set up Tensorboard logs timestamp = time.strftime("%Y-%m-%d-%H-%M-%S") log_dir=os.path.join(BUCKET, 'mnist-logs', timestamp) tb_callback = tf.keras.callbacks.TensorBoard(log_dir=log_dir, update_freq=50*global_batch_size) print("Tensorboard loggs written to: ", log_dir) EPOCHS = 10 steps_per_epoch = 60000//global_batch_size # 60,000 items in this dataset print("Step (batches) per epoch: ", steps_per_epoch) history = model.fit(training_dataset, steps_per_epoch=steps_per_epoch, epochs=EPOCHS, validation_data=validation_dataset, validation_steps=1, callbacks=[tb_callback], verbose=1) # recognize digits from local fonts probabilities = model.predict(font_digits, steps=1) predicted_labels = np.argmax(probabilities, axis=1) display_digits(font_digits, predicted_labels, font_labels, "predictions from local fonts (bad predictions in red)", N) # recognize validation digits probabilities = model.predict(validation_digits, steps=1) predicted_labels = np.argmax(probabilities, axis=1) display_top_unrecognized(validation_digits, predicted_labels, validation_labels, N, 7) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Imports Step3: TPU/GPU detection Step4: Colab-only auth for this notebook and the TPU Step5: tf.data.Dataset Step6: Let's have a look at the data Step7: Keras model Step8: Train and validate the model Step9: Visualize predictions
8,041
<ASSISTANT_TASK:> Python Code: # enable showing matplotlib image inline %matplotlib inline # autoreload module %load_ext autoreload %autoreload 2 PROJECT_ROOT = "/" def load_local_package(): import os import sys root = os.path.join(os.getcwd(), "./") sys.path.append(root) # load project root return root PROJECT_ROOT = load_local_package() prefix = "salons" def load_corpus(p): import os import json from gensim import corpora s_path = os.path.join(PROJECT_ROOT, "./data/{0}.json".format(p)) d_path = os.path.join(PROJECT_ROOT, "./data/{0}_dict.dict".format(p)) c_path = os.path.join(PROJECT_ROOT, "./data/{0}_corpus.mm".format(p)) s = [] with open(s_path, "r", encoding="utf-8") as f: s = json.load(f) d = corpora.Dictionary.load(d_path) c = corpora.MmCorpus(c_path) return s, d, c salons, dictionary, corpus = load_corpus(prefix) print(dictionary) print(corpus) from gensim import models topic_range = range(2, 5) test_rate = 0.2 def split_corpus(c, rate_or_size): import math size = 0 if isinstance(rate_or_size, float): size = math.floor(len(c) * rate_or_size) else: size = rate_or_size # simple split, not take sample randomly left = c[:-size] right = c[-size:] return left, right def calc_perplexity(m, c): import numpy as np return np.exp(-m.log_perplexity(c)) def search_model(c, rate_or_size): most = [1.0e6, None] training, test = split_corpus(c, rate_or_size) print("dataset: training/test = {0}/{1}".format(len(training), len(test))) for t in topic_range: m = models.LdaModel(corpus=training, id2word=dictionary, num_topics=t, iterations=250, passes=5) p1 = calc_perplexity(m, training) p2 = calc_perplexity(m, test) print("{0}: perplexity is {1}/{2}".format(t, p1, p2)) if p2 < most[0]: most[0] = p2 most[1] = m return most[0], most[1] perplexity, model = search_model(corpus, test_rate) print("Best model: topics={0}, perplexity={1}".format(model.num_topics, perplexity)) def calc_topic_distances(m, topic): import numpy as np def kldiv(p, q): distance = np.sum(p * np.log(p / q)) return distance # get probability of each words # https://github.com/piskvorky/gensim/blob/develop/gensim/models/ldamodel.py#L733 t = m.state.get_lambda() for i, p in enumerate(t): t[i] = t[i] / t[i].sum() base = t[topic] distances = [(i_p[0], kldiv(base, i_p[1])) for i_p in enumerate(t) if i_p[0] != topic] return distances def plot_distance_matrix(m): import numpy as np import matplotlib.pylab as plt # make distance matrix mt = [] for i in range(m.num_topics): d = calc_topic_distances(m, i) d.insert(i, (i, 0)) # distance between same topic d = [_d[1] for _d in d] mt.append(d) mt = np.array(mt) # plot matrix fig = plt.figure() ax = fig.add_subplot(1, 1, 1) ax.set_aspect("equal") plt.imshow(mt, interpolation="nearest", cmap=plt.cm.ocean) plt.yticks(range(mt.shape[0])) plt.xticks(range(mt.shape[1])) plt.colorbar() plt.show() plot_distance_matrix(model) def show_document_topics(c, m, sample_size=200, width=1): import random import numpy as np import matplotlib.pylab as plt # make document/topics matrix d_topics = [] t_documents = {} samples = random.sample(range(len(c)), sample_size) for s in samples: ts = m.__getitem__(corpus[s], -1) d_topics.append([v[1] for v in ts]) max_topic = max(ts, key=lambda x: x[1]) if max_topic[0] not in t_documents: t_documents[max_topic[0]] = [] t_documents[max_topic[0]] += [(s, max_topic[1])] d_topics = np.array(d_topics) for t in t_documents: t_documents[t] = sorted(t_documents[t], key=lambda x: x[1], reverse=True) # draw cumulative bar chart fig = plt.figure(figsize=(20, 3)) N, K = d_topics.shape indices = np.arange(N) height = np.zeros(N) bar = [] for k in range(K): color = plt.cm.coolwarm(k / K, 1) p = plt.bar(indices, d_topics[:, k], width, bottom=None if k == 0 else height, color=color) height += d_topics[:, k] bar.append(p) plt.ylim((0, 1)) plt.xlim((0, d_topics.shape[0])) topic_labels = ['Topic #{}'.format(k) for k in range(K)] plt.legend([b[0] for b in bar], topic_labels) plt.show(bar) return d_topics, t_documents document_topics, topic_documents = show_document_topics(corpus, model) num_show_ranks = 5 for t in topic_documents: print("Topic #{0} salons".format(t) + " " + "*" * 100) for i, v in topic_documents[t][:num_show_ranks]: print("{0}({1}):{2}".format(salons[i]["name"], v, salons[i]["urls"]["pc"])) def visualize_topic(m, word_count=10, fontsize_base=10): import matplotlib.pylab as plt from matplotlib.font_manager import FontProperties font = lambda s: FontProperties(fname=r'C:\Windows\Fonts\meiryo.ttc', size=s) # get words in topic topic_words = [] for t in range(m.num_topics): words = m.show_topic(t, topn=word_count) topic_words.append(words) # plot words fig = plt.figure(figsize=(8, 5)) for i, ws in enumerate(topic_words): sub = fig.add_subplot(1, m.num_topics, i + 1) plt.ylim(0, word_count + 0.5) plt.xticks([]) plt.yticks([]) plt.title("Topic #{}".format(i)) for j, (share, word) in enumerate(ws): size = fontsize_base + (fontsize_base * share * 2) w = "%s(%1.3f)" % (word, share) plt.text(0.1, word_count-j-0.5, w, ha="left", fontproperties=font(size)) plt.tight_layout() plt.show() visualize_topic(model) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load Corpus Step2: Make Topic Model Step3: Evaluate/Visualize Topic Model Step4: Check the topics in documents Step5: Visualize words in topics
8,042
<ASSISTANT_TASK:> Python Code: #!/usr/bin/env python3 # @author: R. Gowers, S. Al-Izzi, T. Pollington, R. Hill & K. Briggs import numpy as np import cvxpy as cvx def water_filling(n,a,sum_x=1): ''' Boyd and Vandenberghe, Convex Optimization, example 5.2 page 145 Water-filling. This problem arises in information theory, in allocating power to a set of n communication channels in order to maximise the total channel capacity. The variable x_i represents the transmitter power allocated to the ith channel, and log(α_i+x_i) gives the capacity or maximum communication rate of the channel. The objective is to minimise -∑log(α_i+x_i) subject to the constraint ∑x_i = 1 ''' # Declare variables and parameters x = cvx.Variable(n) alpha = cvx.Parameter(n,sign='positive') alpha.value = a # Choose objective function. Interpret as maximising the total communication rate of all the channels obj = cvx.Maximize(cvx.sum_entries(cvx.log(alpha + x))) # Declare constraints constraints = [x >= 0, cvx.sum_entries(x) - sum_x == 0] # Solve prob = cvx.Problem(obj, constraints) prob.solve() if(prob.status=='optimal'): return prob.status,prob.value,x.value else: return prob.status,np.nan,np.nan # As an example, we will solve the water filling problem with 3 buckets, each with different α np.set_printoptions(precision=3) buckets=3 alpha = np.array([0.8,1.0,1.2]) stat,prob,x=water_filling(buckets,alpha) print('Problem status: ',stat) print('Optimal communication rate = %.4g '%prob) print('Transmitter powers:\n', x) import matplotlib import matplotlib.pylab as plt %matplotlib inline matplotlib.rcParams.update({'font.size': 14}) axis = np.arange(0.5,buckets+1.5,1) index = axis+0.5 X = np.asarray(x).flatten() Y = alpha + X # to include the last data point as a step, we need to repeat it A = np.concatenate((alpha,[alpha[-1]])) X = np.concatenate((X,[X[-1]])) Y = np.concatenate((Y,[Y[-1]])) plt.xticks(index) plt.xlim(0.5,buckets+0.5) plt.ylim(0,1.5) plt.step(axis,A,where='post',label =r'$\alpha$',lw=2) plt.step(axis,Y,where='post',label=r'$\alpha + x$',lw=2) plt.legend(loc='lower right') plt.xlabel('Bucket Number') plt.ylabel('Power Level') plt.title('Water Filling Solution') plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Example Step2: To illustrate the water filling principle, we will plot $\alpha_i + x_i$ and check that this level is flat where power has been allocated
8,043
<ASSISTANT_TASK:> Python Code: # Authors: Eric Larson <larson.eric.d@gmail.com> # Sheraz Khan <sheraz@khansheraz.com> # Denis Engemann <denis.engemann@gmail.com> # # License: BSD (3-clause) import os.path as op import mne from mne.beamformer import make_lcmv, apply_lcmv_epochs from mne.connectivity import envelope_correlation from mne.preprocessing import compute_proj_ecg, compute_proj_eog data_path = mne.datasets.brainstorm.bst_resting.data_path() subjects_dir = op.join(data_path, 'subjects') subject = 'bst_resting' trans = op.join(data_path, 'MEG', 'bst_resting', 'bst_resting-trans.fif') bem = op.join(subjects_dir, subject, 'bem', subject + '-5120-bem-sol.fif') raw_fname = op.join(data_path, 'MEG', 'bst_resting', 'subj002_spontaneous_20111102_01_AUX.ds') crop_to = 60. raw = mne.io.read_raw_ctf(raw_fname, verbose='error') raw.crop(0, crop_to).pick_types(meg=True, eeg=False).load_data().resample(80) raw.apply_gradient_compensation(3) projs_ecg, _ = compute_proj_ecg(raw, n_grad=1, n_mag=2) projs_eog, _ = compute_proj_eog(raw, n_grad=1, n_mag=2, ch_name='MLT31-4407') raw.info['projs'] += projs_ecg raw.info['projs'] += projs_eog raw.apply_proj() cov = mne.compute_raw_covariance(raw) # compute before band-pass of interest raw.filter(14, 30) events = mne.make_fixed_length_events(raw, duration=5.) epochs = mne.Epochs(raw, events=events, tmin=0, tmax=5., baseline=None, reject=dict(mag=8e-13), preload=True) del raw # This source space is really far too coarse, but we do this for speed # considerations here pos = 15. # 1.5 cm is very broad, done here for speed! src = mne.setup_volume_source_space('bst_resting', pos, bem=bem, subjects_dir=subjects_dir, verbose=True) fwd = mne.make_forward_solution(epochs.info, trans, src, bem) data_cov = mne.compute_covariance(epochs) filters = make_lcmv(epochs.info, fwd, data_cov, 0.05, cov, pick_ori='max-power', weight_norm='nai') del fwd epochs.apply_hilbert() # faster to do in sensor space stcs = apply_lcmv_epochs(epochs, filters, return_generator=True) corr = envelope_correlation(stcs, verbose=True) degree = mne.connectivity.degree(corr, 0.15) stc = mne.VolSourceEstimate(degree, [src[0]['vertno']], 0, 1, 'bst_resting') brain = stc.plot( src, clim=dict(kind='percent', lims=[75, 85, 95]), colormap='gnuplot', subjects_dir=subjects_dir, mode='glass_brain') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Here we do some things in the name of speed, such as crop (which will Step2: Now we band-pass filter our data and create epochs. Step3: Compute the forward and inverse Step4: Compute label time series and do envelope correlation Step5: Compute the degree and plot it
8,044
<ASSISTANT_TASK:> Python Code: from sympy import Symbol, exp, I, pi, N, expand from sympy import init_printing init_printing() expand(exp(2*pi*I/3), complex=True) expand(exp(4*pi*I/3), complex=True) plt.figure(figsize=(4,4)) roots = np.array([[1,0], [-0.5, np.sqrt(3)/2], [-0.5, -np.sqrt(3)/2]]) plt.scatter(roots[:,0], roots[:,1], s=50, c='red') xp = np.linspace(0, 2*np.pi, 100) plt.plot(np.cos(xp), np.sin(xp), c='blue'); def newton(z, f, fprime, max_iter=100, tol=1e-6): The Newton-Raphson method. for i in range(max_iter): step = f(z)/fprime(z) if abs(step) < tol: return i, z z -= step return i, z def plot_newton_iters(p, pprime, n=200, extent=[-1,1,-1,1], cmap='hsv'): Shows how long it takes to converge to a root using the Newton-Rahphson method. m = np.zeros((n,n)) xmin, xmax, ymin, ymax = extent for r, x in enumerate(np.linspace(xmin, xmax, n)): for s, y in enumerate(np.linspace(ymin, ymax, n)): z = x + y*1j m[s, r] = newton(z, p, pprime)[0] plt.imshow(m, cmap=cmap, extent=extent) def plot_newton_basins(p, pprime, n=200, extent=[-1,1,-1,1], cmap='jet'): Shows basin of attraction for convergence to each root using the Newton-Raphson method. root_count = 0 roots = {} m = np.zeros((n,n)) xmin, xmax, ymin, ymax = extent for r, x in enumerate(np.linspace(xmin, xmax, n)): for s, y in enumerate(np.linspace(ymin, ymax, n)): z = x + y*1j root = np.round(newton(z, p, pprime)[1], 1) if not root in roots: roots[root] = root_count root_count += 1 m[s, r] = roots[root] plt.imshow(m, cmap=cmap, extent=extent) plt.grid('off') plot_newton_iters(lambda x: x**3 - 1, lambda x: 3*x**2) plt.grid('off') m = plot_newton_basins(lambda x: x**3 - 1, lambda x: 3*x**2) X = np.load('x.npy') y = np.load('y.npy') beta = np.load('b.npy') def f1(X, y): Direct translation of normal equations to code. return np.dot(np.linalg.inv(np.dot(X.T, X)), np.dot(X.T, y)) def f2(X, y): Solving normal equations wihtout matrix inversion. return np.linalg.solve(np.dot(X.T, X), np.dot(X.T, y)) %precision 3 print("X = ") print(X) # counting from 0 (so column 5 is the last column) # we can see that column 5 is a multiple of column 3 # so one approach is to simply remove this (dependent) column print("True solution\t\t", beta) print("Library function\t", np.linalg.lstsq(X, y)[0]) print("Using f1\t\t", f1(X[:, :5], y)) print("Using f2\t\t", f2(X[:, :5], y)) np.linalg.svd(X)[1] np.linalg.svd(X[:, :-1])[1] np.linalg.cond(X[:, :-1]) import sympy as sym from sympy import Matrix from numpy import linalg as la x1, x2 = sym.symbols('x1 x2') def f(x1, x2): return sym.Matrix([-x1*x2*sym.exp(-(x1**2 + x2**2)/2)]) def h(x1,x2): return x1**2+x2**2 def g(x1,x2): return 2*x1+3*x2 def characterize_cp(H): l,v = la.eig(H) if(np.all(np.greater(l,np.zeros(2)))): return("minimum") elif(np.all(np.less(l,np.zeros(2)))): return("maximum") else: return("saddle") sym.init_printing() fun = f(x1,x2) X = sym.Matrix([x1,x2]) gradf = fun.jacobian(X) sym.simplify(gradf) hessianf = gradf.jacobian(X) sym.simplify(hessianf) fcritical = sym.solve(gradf,X) for i in range(4): H = np.array(hessianf.subs([(x1,fcritical[i][0]),(x2,fcritical[i][1])])).astype(float) print(fcritical[i], characterize_cp(H)) import scipy.optimize as opt def f(x): return -x[0] * x[1] * np.exp(-(x[0]**2+x[1]**2)/2) cons = ({'type': 'eq', 'fun' : lambda x: np.array([2.0*x[0] + 3.0*x[1] - 5.0]), 'jac' : lambda x: np.array([2.0,3.0])}, {'type': 'ineq', 'fun' : lambda x: np.array([-x[0]**2.0 - x[1]**2.0 + 10.0])}) x0 = [1.5,1.5] cx = opt.minimize(f, x0, constraints=cons) x = np.linspace(-5, 5, 200) y = np.linspace(-5, 5, 200) X, Y = np.meshgrid(x, y) Z = f(np.vstack([X.ravel(), Y.ravel()])).reshape((200,200)) plt.contour(X, Y, Z) plt.plot(x, (5-2*x)/3, 'k:', linewidth=1) plt.plot(x, (10.0-x**2)**0.5, 'k:', linewidth=1) plt.plot(x, -(10.0-x**2)**0.5, 'k:', linewidth=1) plt.fill_between(x,(10-x**2)**0.5,-(10-x**2)**0.5,alpha=0.15) plt.text(cx['x'][0], cx['x'][1], 'x', va='center', ha='center', size=20, color='red') plt.axis([-5,5,-5,5]) plt.title('Contour plot of f(x) subject to constraints g(x) and h(x)') plt.xlabel('x1') plt.ylabel('x2') pass def gaussian_kernel(xs, x, h=1.0): Gaussian kernel for a shifting window centerd at x. X = xs - x try: d = xs.shape[1] except: d = 1 k = np.array([(2*np.pi*h**d)**-0.5*np.exp(-(np.dot(_.T, _)/h)**2) for _ in X]) if d != 1: k = k[:, np.newaxis] return k def flat_kernel(xs, x, h=1.0): Flat kenrel for a shifting window centerd at x. X = xs - x try: d = xs.shape[1] except: d = 1 k = np.array([1 if np.dot(_.T, _) < h else 0 for _ in X]) if d != 1: k = k[:, np.newaxis] return k def mean_shift(xs, x, kernel, max_iters=100, tol=1e-6, trace=False): Finds the local mode using mean shift algorithm. record = [] for i in range(max_iters): if trace: record.append(x) m = (kernel(xs, x)*xs).sum(axis=0)/kernel(xs, x).sum(axis=0) - x if np.sum(m**2) < tol: break x += m return i, x, np.array(record) x1 = np.load('x1d.npy') # choose kernel to evaluate kernel = flat_kernel # kernel = gaussian_kernel i1, m1, path = mean_shift(x1, 1, kernel) print(i1, m1) i2, m2, path = mean_shift(x1, -7, kernel) print(i2, m2) i3, m3, path = mean_shift(x1, 7 ,kernel) print(i3, m3) xp = np.linspace(0, 1.0, 100) plt.hist(x1, 50, histtype='step', normed=True); plt.axvline(m1, c='blue') plt.axvline(m2, c='blue') plt.axvline(m3, c='blue'); x2 = np.load('x2d.npy') # choose kernel to evaluate # kernel = flat_kernel (also OK if they use the Epanachnikov kernel since the flat is a shadow of that) kernel = gaussian_kernel i1, m1, path1 = mean_shift(x2, [0,0], kernel, trace=True) print(i1, m1) i2, m2, path2 = mean_shift(x2, [-4,5], kernel, trace=True) print(i2, m2) i3, m3, path3 = mean_shift(x2, [10,10] ,kernel, trace=True) print(i3, m3) import scipy.stats as stats # size of marekr at starting position base = 40 # set up for estimating density using gaussian_kde xmin, xmax = -6, 12 ymin,ymax = -5, 15 X, Y = np.mgrid[xmin:xmax:100j, ymin:ymax:100j] positions = np.vstack([X.ravel(), Y.ravel()]) kde = stats.gaussian_kde(x2.T) Z = np.reshape(kde(positions).T, X.shape) plt.contour(X, Y, Z) # plot data in background plt.scatter(x2[:, 0], x2[:, 1], c='grey', alpha=0.2, edgecolors='none') # path from [0,0] plt.scatter(path1[:, 0], path1[:, 1], s=np.arange(base, base+len(path1)), c='red', edgecolors='red', marker='x', linewidth=1.5) # path from [-4,5] plt.scatter(path2[:, 0], path2[:, 1], s=np.arange(base, base+len(path2)), c='blue', edgecolors='blue', marker='x', linewidth=1.5) # path from [10,10] plt.scatter(path3[:, 0], path3[:, 1], s=np.arange(base, base+len(path3)), c='green', edgecolors='green',marker='x', linewidth=1.5) plt.axis([xmin, xmax, ymin, ymax]); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step4: 1. Newton's method for functions of complex variables - stability and basins of attraction. (30 points) Step7: 2. Ill-conditioned linear problems. (20 points) Step8: Condition numbers are ratio of largest to smallest singular values Step9: One way to think about the condition number is in terms of the ratio of the largest singular value to the smallest one - so a measure of the disproportionate stretching effect of the linear transform in one direction versus another. When this is very big, it means that errors in one or more direction will be amplified greatly. This often occurs because one or more columns is "almost" dependent - i.e. it can be approximated by a linear combination of the other columns. Step13: 4. One of the goals of the course it that you will be able to implement novel algorithms from the literature. (30 points)
8,045
<ASSISTANT_TASK:> Python Code: from picamera import PiCamera, Color from time import sleep camera = PiCamera() camera.resolution = (480, 320) camera.vflip = True camera.hflip = True camera.start_preview() camera.annotate_foreground = Color('white') camera.annotate_text = "Colorswap Effect" camera.annotate_text_size = 10 camera.image_effect = 'colorswap' sleep(2) camera.capture('img/colorswap.jpg') camera.stop_preview() camera.IMAGE_EFFECTS camera.start_preview() sleep(2) cool_effects = ['none', 'watercolor', 'negative', 'emboss', 'washedout', 'solarize', 'oilpaint', 'sketch'] for effect in cool_effects: camera.image_effect = effect camera.annotate_text = "Effect: %s" % effect camera.capture('img/effect-%s.jpg' % effect) sleep(1) camera.stop_preview() camera.start_preview() sleep(2) camera.image_effect = 'none' camera.annotate_text = "" for i in range(3): camera.capture('img/frame-%s.jpg' % i) sleep(2) camera.stop_preview() camera.close() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set the camera to take a bit smaller photos (lower resolution). This will make our image processing a bit faster. Step2: One can see all the available effects by listing the camera EFFECTS Step3: Let's just loop through some interesting ones Step4: Let's grab a few more photos to do some work on. Try to move in the frame as these are taken. Step5: Now we'll clean up our camera object...
8,046
<ASSISTANT_TASK:> Python Code: !pip install "thinc>=8.0.0a0" import numpy from thinc.api import Linear, zero_init n_in = numpy.zeros((128, 16), dtype="f") n_out = numpy.zeros((128, 10), dtype="f") model = Linear(nI=n_in.shape[1], nO=n_out.shape[1], init_W=zero_init) nI = model.get_dim("nI") nO = model.get_dim("nO") print(f"Initialized model with input dimension nI={nI} and output dimension nO={nO}.") model = Linear(init_W=zero_init) print(f"Initialized model with no input/ouput dimensions.") X = numpy.zeros((128, 16), dtype="f") Y = numpy.zeros((128, 10), dtype="f") model.initialize(X=X, Y=Y) nI = model.get_dim("nI") nO = model.get_dim("nO") print(f"Initialized model with input dimension nI={nI} and output dimension nO={nO}.") from thinc.api import chain, glorot_uniform_init n_hidden = 128 X = numpy.zeros((128, 16), dtype="f") Y = numpy.zeros((128, 10), dtype="f") model = chain(Linear(n_hidden, init_W=glorot_uniform_init), Linear(init_W=zero_init),) model.initialize(X=X, Y=Y) nI = model.get_dim("nI") nO = model.get_dim("nO") nO_hidden = model.layers[0].get_dim("nO") print(f"Initialized model with input dimension nI={nI} and output dimension nO={nO}.") print(f"The size of the hidden layer is {nO_hidden}.") from thinc.api import concatenate model = concatenate(Linear(n_hidden), Linear(n_hidden)) model.initialize(X=X) nO = model.get_dim("nO") print(f"Initialized model with output dimension nO={nO}.") from thinc.api import clone model = clone(Linear(), 5) model.layers[0].set_dim("nO", n_hidden) model.initialize(X=X, Y=Y) nI = model.get_dim("nI") nO = model.get_dim("nO") print(f"Initialized model with input dimension nI={nI} and output dimension nO={nO}.") from thinc.api import Relu, Dropout def Hidden(dropout=0.2): return chain(Linear(), Relu(), Dropout(dropout)) model = clone(Hidden(0.2), 5) from thinc.api import with_array model = with_array(Linear(4, 2)) Xs = [model.ops.alloc2f(10, 2, dtype="f")] model.initialize(X=Xs) Ys = model.predict(Xs) print(f"Prediction shape: {Ys[0].shape}.") from thinc.api import add, chain, concatenate, clone from thinc.api import with_array, reduce_max, reduce_mean, residual from thinc.api import Model, Embed, Maxout, Softmax nH = 5 with Model.define_operators({">>": chain, "|": concatenate, "+": add, "**": clone}): model = ( with_array( (Embed(128, column=0) + Embed(64, column=1)) >> Maxout(nH, normalize=True, dropout=0.2) ) >> (reduce_max() | reduce_mean()) >> residual(Relu() >> Dropout(0.2)) ** 2 >> Softmax() ) from thinc.api import Linear, Adam import numpy X = numpy.zeros((128, 10), dtype="f") dY = numpy.zeros((128, 10), dtype="f") model = Linear(10, 10) model.initialize(X=X, Y=dY) Y = model.predict(X) Y Y, backprop = model.begin_update(X) Y, backprop dX = backprop(dY) dX optimizer = Adam() model.finish_update(optimizer) dim = model.get_dim("nO") W = model.get_param("W") model.attrs["hello"] = "world" model.attrs.get("foo", "bar") dW = model.get_grad("W") model.inc_grad("W", dW * 0.1) model_bytes = model.to_bytes() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Thinc provides a variety of layers, functions that create Model instances. Thinc tries to avoid inheritance, preferring function composition. The Linear function gives you a model that computes Y = X @ W.T + b (the function is defined in thinc.layers.linear.forward). Step2: Models support dimension inference from data. You can defer some or all of the dimensions. Step3: The chain function wires two model instances together, with a feed-forward relationship. Dimension inference is especially helpful here. Step4: We call functions like chain combinators. Combinators take one or more models as arguments, and return another model instance, without introducing any new weight parameters. Another useful combinator is concatenate Step5: The concatenate function produces a layer that runs the child layers separately, and then concatenates their outputs together. This is often useful for combining features from different sources. For instance, we use this all the time to build spaCy's embedding layers. Step6: We can apply clone to model instances that have child layers, making it easy to define more complex architectures. For instance, we often want to attach an activation function and dropout to a linear layer, and then repeat that substructure a number of times. Of course, you can make whatever intermediate functions you find helpful. Step7: Some combinators are unary functions Step8: The combinator system makes it easy to wire together complex models very concisely. A concise notation is a huge advantage, because it lets you read and review your model with less clutter – making it easy to spot mistakes, and easy to make changes. For the ultimate in concise notation, you can also take advantage of Thinc's operator overloading, which lets you use an infix notation. Operator overloading can lead to unexpected results, so you have to enable the overloading explicitly in a contextmanager. This also lets you control how the operators are bound, making it easy to use the feature with your own combinators. For instance, here is a definition for a text classification network Step9: The network above will expect a list of arrays as input, where each array should have two columns with different numeric identifier features. The two features will be embedded using separate embedding tables, and the two vectors added and passed through a Maxout layer with layer normalization and dropout. The sequences then pass through two pooling functions, and the concatenated results are passed through 2 Relu layers with dropout and residual connections. Finally, the sequence vectors are passed through an output layer, which has a Softmax activation. Step10: Initialize the model with a sample of the data Step11: Run the model over some data Step12: Get a callback to backpropagate Step13: Run the callback to calculate the gradient with respect to the inputs. If the model has trainable parameters, gradients for the parameters are accumulated internally, as a side-effect. Step14: The backprop() callback only increments the parameter gradients, it doesn't actually change the weights. To increment the weights, call model.finish_update(), passing it an optimizer Step15: You can get and set dimensions, parameters and attributes by name Step16: You can also retrieve parameter gradients, and increment them explicitly Step17: Finally, you can serialize models using the model.to_bytes and model.to_disk methods, and load them back with from_bytes and from_disk.
8,047
<ASSISTANT_TASK:> Python Code: df = spark.read.format("csv") \ .option("inferSchema", "true").option("header", "true") \ .load("s3a://datapalooza/airbnb/airbnb.csv.bz2") df.registerTempTable("df") print(df.head()) print(df.count()) df_filtered = df.filter("price >= 50 AND price <= 750 AND bathrooms > 0.0 AND bedrooms is not null") df_filtered.registerTempTable("df_filtered") df_final = spark.sql( select id, city, case when state in('NY', 'CA', 'London', 'Berlin', 'TX' ,'IL', 'OR', 'DC', 'WA') then state else 'Other' end as state, space, cast(price as double) as price, cast(bathrooms as double) as bathrooms, cast(bedrooms as double) as bedrooms, room_type, host_is_super_host, cancellation_policy, cast(case when security_deposit is null then 0.0 else security_deposit end as double) as security_deposit, price_per_bedroom, cast(case when number_of_reviews is null then 0.0 else number_of_reviews end as double) as number_of_reviews, cast(case when extra_people is null then 0.0 else extra_people end as double) as extra_people, instant_bookable, cast(case when cleaning_fee is null then 0.0 else cleaning_fee end as double) as cleaning_fee, cast(case when review_scores_rating is null then 80.0 else review_scores_rating end as double) as review_scores_rating, cast(case when square_feet is not null and square_feet > 100 then square_feet when (square_feet is null or square_feet <=100) and (bedrooms is null or bedrooms = 0) then 350.0 else 380 * bedrooms end as double) as square_feet from df_filtered ).persist() df_final.registerTempTable("df_final") df_final.select("square_feet", "price", "bedrooms", "bathrooms", "cleaning_fee").describe().show() print(df_final.count()) print(df_final.schema) # Most popular cities spark.sql( select state, count(*) as ct, avg(price) as avg_price, max(price) as max_price from df_final group by state order by count(*) desc ).show() # Most expensive popular cities spark.sql( select city, count(*) as ct, avg(price) as avg_price, max(price) as max_price from df_final group by city order by avg(price) desc ).filter("ct > 25").show() continuous_features = ["bathrooms", \ "bedrooms", \ "security_deposit", \ "cleaning_fee", \ "extra_people", \ "number_of_reviews", \ "square_feet", \ "review_scores_rating"] categorical_features = ["room_type", \ "host_is_super_host", \ "cancellation_policy", \ "instant_bookable", \ "state"] [training_dataset, validation_dataset] = df_final.randomSplit([0.8, 0.2]) continuous_feature_assembler = VectorAssembler(inputCols=continuous_features, outputCol="unscaled_continuous_features") continuous_feature_scaler = StandardScaler(inputCol="unscaled_continuous_features", outputCol="scaled_continuous_features", \ withStd=True, withMean=False) categorical_feature_indexers = [StringIndexer(inputCol=x, \ outputCol="{}_index".format(x)) \ for x in categorical_features] categorical_feature_one_hot_encoders = [OneHotEncoder(inputCol=x.getOutputCol(), \ outputCol="oh_encoder_{}".format(x.getOutputCol() )) \ for x in categorical_feature_indexers] feature_cols_lr = [x.getOutputCol() \ for x in categorical_feature_one_hot_encoders] feature_cols_lr.append("scaled_continuous_features") feature_assembler_lr = VectorAssembler(inputCols=feature_cols_lr, \ outputCol="features_lr") linear_regression = LinearRegression(featuresCol="features_lr", \ labelCol="price", \ predictionCol="price_prediction", \ maxIter=10, \ regParam=0.3, \ elasticNetParam=0.8) estimators_lr = \ [continuous_feature_assembler, continuous_feature_scaler] \ + categorical_feature_indexers + categorical_feature_one_hot_encoders \ + [feature_assembler_lr] + [linear_regression] pipeline = Pipeline(stages=estimators_lr) pipeline_model = pipeline.fit(training_dataset) print(pipeline_model) from jpmml import toPMMLBytes pmmlBytes = toPMMLBytes(spark, training_dataset, pipeline_model) print(pmmlBytes.decode("utf-8")) import urllib.request update_url = 'http://prediction-pmml-aws.demo.pipeline.io/update-pmml/pmml_airbnb' update_headers = {} update_headers['Content-type'] = 'application/xml' req = urllib.request.Request(update_url, \ headers=update_headers, \ data=pmmlBytes) resp = urllib.request.urlopen(req) print(resp.status) # Should return Http Status 200 import urllib.request update_url = 'http://prediction-pmml-gcp.demo.pipeline.io/update-pmml/pmml_airbnb' update_headers = {} update_headers['Content-type'] = 'application/xml' req = urllib.request.Request(update_url, \ headers=update_headers, \ data=pmmlBytes) resp = urllib.request.urlopen(req) print(resp.status) # Should return Http Status 200 import urllib.parse import json evaluate_url = 'http://prediction-pmml-aws.demo.pipeline.io/evaluate-pmml/pmml_airbnb' evaluate_headers = {} evaluate_headers['Content-type'] = 'application/json' input_params = '{"bathrooms":2.0, \ "bedrooms":2.0, \ "security_deposit":175.00, \ "cleaning_fee":25.0, \ "extra_people":1.0, \ "number_of_reviews": 2.0, \ "square_feet": 250.0, \ "review_scores_rating": 2.0, \ "room_type": "Entire home/apt", \ "host_is_super_host": "0.0", \ "cancellation_policy": "flexible", \ "instant_bookable": "1.0", \ "state": "CA"}' encoded_input_params = input_params.encode('utf-8') req = urllib.request.Request(evaluate_url, \ headers=evaluate_headers, \ data=encoded_input_params) resp = urllib.request.urlopen(req) print(resp.read()) import urllib.parse import json evaluate_url = 'http://prediction-pmml-gcp.demo.pipeline.io/evaluate-pmml/pmml_airbnb' evaluate_headers = {} evaluate_headers['Content-type'] = 'application/json' input_params = '{"bathrooms":2.0, \ "bedrooms":2.0, \ "security_deposit":175.00, \ "cleaning_fee":25.0, \ "extra_people":1.0, \ "number_of_reviews": 2.0, \ "square_feet": 250.0, \ "review_scores_rating": 2.0, \ "room_type": "Entire home/apt", \ "host_is_super_host": "0.0", \ "cancellation_policy": "flexible", \ "instant_bookable": "1.0", \ "state": "CA"}' encoded_input_params = input_params.encode('utf-8') req = urllib.request.Request(evaluate_url, \ headers=evaluate_headers, \ data=encoded_input_params) resp = urllib.request.urlopen(req) print(resp.read()) with open('/root/pipeline/prediction.ml/pmml/data/pmml_airbnb/pmml_airbnb.pmml', 'wb') as f: f.write(pmmlBytes) !cat /root/pipeline/prediction.ml/pmml/data/pmml_airbnb/pmml_airbnb.pmml !git !git status <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step4: Step 1 Step5: Step 2 Step6: Step 3 Step7: Step 4 Step8: Step 5 Step9: Step 6 Step10: Step 7 Step11: TODO Step12: Deployment Option 1 Step13: Deployment Option 2
8,048
<ASSISTANT_TASK:> Python Code: %matplotlib inline import numpy as np import tensorflow as tf import matplotlib.pyplot as plt from tensorflow.examples.tutorials.mnist import input_data mnist = input_data.read_data_sets('MNIST_data', validation_size=0) img = mnist.train.images[200] plt.imshow(img.reshape((28, 28)), cmap='Greys_r') len(mnist.train.images) type(mnist.train.images[0]) inputs_ = [[image.flatten()] for image in mnist.train.images] inputs_[1] # Size of the encoding layer (the hidden layer) encoding_dim = 32 # feel free to change this value image_size = 784 inputs_ = tf.placeholder(tf.float32, (None, image_size), name='inputs') targets_ = tf.placeholder(tf.float32, (None, image_size), name='targets') # Output of hidden layer encoded = tf.contrib.layers.fully_connected(inputs_, encoding_dim, activation_fn = tf.nn.relu) # Output layer logits logits = tf.contrib.layers.fully_connected(encoded, image_size, activation_fn = None) # Sigmoid output from logits decoded = tf.nn.sigmoid(logits) # Sigmoid cross-entropy loss loss = tf.nn.sigmoid_cross_entropy_with_logits(labels=targets_,logits = logits) # Mean of the loss cost = tf.reduce_mean(loss) # Adam optimizer opt = tf.train.AdamOptimizer().minimize(cost) # Create the session sess = tf.Session() epochs = 20 batch_size = 200 sess.run(tf.global_variables_initializer()) for e in range(epochs): for ii in range(mnist.train.num_examples//batch_size): batch = mnist.train.next_batch(batch_size) feed = {inputs_: batch[0], targets_: batch[0]} batch_cost, _ = sess.run([cost, opt], feed_dict=feed) print("Epoch: {}/{}...".format(e+1, epochs), "Training loss: {:.4f}".format(batch_cost)) fig, axes = plt.subplots(nrows=2, ncols=10, sharex=True, sharey=True, figsize=(20,4)) in_imgs = mnist.test.images[:10] reconstructed, compressed = sess.run([decoded, encoded], feed_dict={inputs_: in_imgs}) for images, row in zip([in_imgs, reconstructed], axes): for img, ax in zip(images, row): ax.imshow(img.reshape((28, 28)), cmap='Greys_r') ax.get_xaxis().set_visible(False) ax.get_yaxis().set_visible(False) fig.tight_layout(pad=0.1) sess.close() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Below I'm plotting an example image from the MNIST dataset. These are 28x28 grayscale images of handwritten digits. Step2: We'll train an autoencoder with these images by flattening them into 784 length vectors. The images from this dataset are already normalized such that the values are between 0 and 1. Let's start by building basically the simplest autoencoder with a single ReLU hidden layer. This layer will be used as the compressed representation. Then, the encoder is the input layer and the hidden layer. The decoder is the hidden layer and the output layer. Since the images are normalized between 0 and 1, we need to use a sigmoid activation on the output layer to get values matching the input. Step3: Training Step4: Here I'll write a bit of code to train the network. I'm not too interested in validation here, so I'll just monitor the training loss. Step5: Checking out the results
8,049
<ASSISTANT_TASK:> Python Code: # Authors: Denis Engemann <denis.engemann@gmail.com> # Eric Larson <larson.eric.d@gmail.com> # Alexandre Gramfort <alexandre.gramfort@telecom-paristech.fr> # # License: BSD (3-clause) import numpy as np import matplotlib.pyplot as plt import mne from mne.time_frequency import tfr_morlet from mne.stats import f_threshold_mway_rm, f_mway_rm, fdr_correction from mne.datasets import sample print(__doc__) data_path = sample.data_path() raw_fname = data_path + '/MEG/sample/sample_audvis_raw.fif' event_fname = data_path + '/MEG/sample/sample_audvis_raw-eve.fif' tmin, tmax = -0.2, 0.5 # Setup for reading the raw data raw = mne.io.read_raw_fif(raw_fname) events = mne.read_events(event_fname) include = [] raw.info['bads'] += ['MEG 2443'] # bads # picks MEG gradiometers picks = mne.pick_types(raw.info, meg='grad', eeg=False, eog=True, stim=False, include=include, exclude='bads') ch_name = 'MEG 1332' # Load conditions reject = dict(grad=4000e-13, eog=150e-6) event_id = dict(aud_l=1, aud_r=2, vis_l=3, vis_r=4) epochs = mne.Epochs(raw, events, event_id, tmin, tmax, picks=picks, baseline=(None, 0), preload=True, reject=reject) epochs.pick_channels([ch_name]) # restrict example to one channel epochs.equalize_event_counts(event_id) # Factor to down-sample the temporal dimension of the TFR computed by # tfr_morlet. decim = 2 freqs = np.arange(7, 30, 3) # define frequencies of interest n_cycles = freqs / freqs[0] zero_mean = False # don't correct morlet wavelet to be of mean zero # To have a true wavelet zero_mean should be True but here for illustration # purposes it helps to spot the evoked response. epochs_power = list() for condition in [epochs[k] for k in event_id]: this_tfr = tfr_morlet(condition, freqs, n_cycles=n_cycles, decim=decim, average=False, zero_mean=zero_mean, return_itc=False) this_tfr.apply_baseline(mode='ratio', baseline=(None, 0)) this_power = this_tfr.data[:, 0, :, :] # we only have one channel. epochs_power.append(this_power) n_conditions = len(epochs.event_id) n_replications = epochs.events.shape[0] // n_conditions factor_levels = [2, 2] # number of levels in each factor effects = 'A*B' # this is the default signature for computing all effects # Other possible options are 'A' or 'B' for the corresponding main effects # or 'A:B' for the interaction effect only (this notation is borrowed from the # R formula language) n_freqs = len(freqs) times = 1e3 * epochs.times[::decim] n_times = len(times) data = np.swapaxes(np.asarray(epochs_power), 1, 0) # reshape last two dimensions in one mass-univariate observation-vector data = data.reshape(n_replications, n_conditions, n_freqs * n_times) # so we have replications * conditions * observations: print(data.shape) fvals, pvals = f_mway_rm(data, factor_levels, effects=effects) effect_labels = ['modality', 'location', 'modality by location'] # let's visualize our effects by computing f-images for effect, sig, effect_label in zip(fvals, pvals, effect_labels): plt.figure() # show naive F-values in gray plt.imshow(effect.reshape(8, 211), cmap=plt.cm.gray, extent=[times[0], times[-1], freqs[0], freqs[-1]], aspect='auto', origin='lower') # create mask for significant Time-frequency locations effect = np.ma.masked_array(effect, [sig > .05]) plt.imshow(effect.reshape(8, 211), cmap='RdBu_r', extent=[times[0], times[-1], freqs[0], freqs[-1]], aspect='auto', origin='lower') plt.colorbar() plt.xlabel('Time (ms)') plt.ylabel('Frequency (Hz)') plt.title(r"Time-locked response for '%s' (%s)" % (effect_label, ch_name)) plt.show() effects = 'A:B' def stat_fun(*args): return f_mway_rm(np.swapaxes(args, 1, 0), factor_levels=factor_levels, effects=effects, return_pvals=False)[0] # The ANOVA returns a tuple f-values and p-values, we will pick the former. pthresh = 0.00001 # set threshold rather high to save some time f_thresh = f_threshold_mway_rm(n_replications, factor_levels, effects, pthresh) tail = 1 # f-test, so tail > 0 n_permutations = 256 # Save some time (the test won't be too sensitive ...) T_obs, clusters, cluster_p_values, h0 = mne.stats.permutation_cluster_test( epochs_power, stat_fun=stat_fun, threshold=f_thresh, tail=tail, n_jobs=1, n_permutations=n_permutations, buffer_size=None) good_clusers = np.where(cluster_p_values < .05)[0] T_obs_plot = np.ma.masked_array(T_obs, np.invert(clusters[np.squeeze(good_clusers)])) plt.figure() for f_image, cmap in zip([T_obs, T_obs_plot], [plt.cm.gray, 'RdBu_r']): plt.imshow(f_image, cmap=cmap, extent=[times[0], times[-1], freqs[0], freqs[-1]], aspect='auto', origin='lower') plt.xlabel('Time (ms)') plt.ylabel('Frequency (Hz)') plt.title("Time-locked response for 'modality by location' (%s)\n" " cluster-level corrected (p <= 0.05)" % ch_name) plt.show() mask, _ = fdr_correction(pvals[2]) T_obs_plot2 = np.ma.masked_array(T_obs, np.invert(mask)) plt.figure() for f_image, cmap in zip([T_obs, T_obs_plot2], [plt.cm.gray, 'RdBu_r']): plt.imshow(f_image, cmap=cmap, extent=[times[0], times[-1], freqs[0], freqs[-1]], aspect='auto', origin='lower') plt.xlabel('Time (ms)') plt.ylabel('Frequency (Hz)') plt.title("Time-locked response for 'modality by location' (%s)\n" " FDR corrected (p <= 0.05)" % ch_name) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set parameters Step2: We have to make sure all conditions have the same counts, as the ANOVA Step3: Create TFR representations for all conditions Step4: Setup repeated measures ANOVA Step5: Now we'll assemble the data matrix and swap axes so the trial replications Step6: While the iteration scheme used above for assembling the data matrix Step7: Account for multiple comparisons using FDR versus permutation clustering test Step8: A stat_fun must deal with a variable number of input arguments. Step9: Create new stats image with only significant clusters Step10: Now using FDR
8,050
<ASSISTANT_TASK:> Python Code: import math, re, os import numpy as np import tensorflow as tf print("Tensorflow version " + tf.__version__) # Detect TPU, return appropriate distribution strategy try: tpu = tf.distribute.cluster_resolver.TPUClusterResolver() print('Running on TPU ', tpu.master()) except ValueError: tpu = None if tpu: tf.config.experimental_connect_to_cluster(tpu) tf.tpu.experimental.initialize_tpu_system(tpu) strategy = tf.distribute.experimental.TPUStrategy(tpu) else: strategy = tf.distribute.get_strategy() print("REPLICAS: ", strategy.num_replicas_in_sync) from kaggle_datasets import KaggleDatasets GCS_DS_PATH = KaggleDatasets().get_gcs_path('tpu-getting-started') print(GCS_DS_PATH) # what do gcs paths look like? #$HIDE_INPUT$ IMAGE_SIZE = [512, 512] GCS_PATH = GCS_DS_PATH + '/tfrecords-jpeg-512x512' AUTO = tf.data.experimental.AUTOTUNE TRAINING_FILENAMES = tf.io.gfile.glob(GCS_PATH + '/train/*.tfrec') VALIDATION_FILENAMES = tf.io.gfile.glob(GCS_PATH + '/val/*.tfrec') TEST_FILENAMES = tf.io.gfile.glob(GCS_PATH + '/test/*.tfrec') CLASSES = ['pink primrose', 'hard-leaved pocket orchid', 'canterbury bells', 'sweet pea', 'wild geranium', 'tiger lily', 'moon orchid', 'bird of paradise', 'monkshood', 'globe thistle', # 00 - 09 'snapdragon', "colt's foot", 'king protea', 'spear thistle', 'yellow iris', 'globe-flower', 'purple coneflower', 'peruvian lily', 'balloon flower', 'giant white arum lily', # 10 - 19 'fire lily', 'pincushion flower', 'fritillary', 'red ginger', 'grape hyacinth', 'corn poppy', 'prince of wales feathers', 'stemless gentian', 'artichoke', 'sweet william', # 20 - 29 'carnation', 'garden phlox', 'love in the mist', 'cosmos', 'alpine sea holly', 'ruby-lipped cattleya', 'cape flower', 'great masterwort', 'siam tulip', 'lenten rose', # 30 - 39 'barberton daisy', 'daffodil', 'sword lily', 'poinsettia', 'bolero deep blue', 'wallflower', 'marigold', 'buttercup', 'daisy', 'common dandelion', # 40 - 49 'petunia', 'wild pansy', 'primula', 'sunflower', 'lilac hibiscus', 'bishop of llandaff', 'gaura', 'geranium', 'orange dahlia', 'pink-yellow dahlia', # 50 - 59 'cautleya spicata', 'japanese anemone', 'black-eyed susan', 'silverbush', 'californian poppy', 'osteospermum', 'spring crocus', 'iris', 'windflower', 'tree poppy', # 60 - 69 'gazania', 'azalea', 'water lily', 'rose', 'thorn apple', 'morning glory', 'passion flower', 'lotus', 'toad lily', 'anthurium', # 70 - 79 'frangipani', 'clematis', 'hibiscus', 'columbine', 'desert-rose', 'tree mallow', 'magnolia', 'cyclamen ', 'watercress', 'canna lily', # 80 - 89 'hippeastrum ', 'bee balm', 'pink quill', 'foxglove', 'bougainvillea', 'camellia', 'mallow', 'mexican petunia', 'bromelia', 'blanket flower', # 90 - 99 'trumpet creeper', 'blackberry lily', 'common tulip', 'wild rose'] # 100 - 102 def decode_image(image_data): image = tf.image.decode_jpeg(image_data, channels=3) image = tf.cast(image, tf.float32) / 255.0 # convert image to floats in [0, 1] range image = tf.reshape(image, [*IMAGE_SIZE, 3]) # explicit size needed for TPU return image def read_labeled_tfrecord(example): LABELED_TFREC_FORMAT = { "image": tf.io.FixedLenFeature([], tf.string), # tf.string means bytestring "class": tf.io.FixedLenFeature([], tf.int64), # shape [] means single element } example = tf.io.parse_single_example(example, LABELED_TFREC_FORMAT) image = decode_image(example['image']) label = tf.cast(example['class'], tf.int32) return image, label # returns a dataset of (image, label) pairs def read_unlabeled_tfrecord(example): UNLABELED_TFREC_FORMAT = { "image": tf.io.FixedLenFeature([], tf.string), # tf.string means bytestring "id": tf.io.FixedLenFeature([], tf.string), # shape [] means single element # class is missing, this competitions's challenge is to predict flower classes for the test dataset } example = tf.io.parse_single_example(example, UNLABELED_TFREC_FORMAT) image = decode_image(example['image']) idnum = example['id'] return image, idnum # returns a dataset of image(s) def load_dataset(filenames, labeled=True, ordered=False): # Read from TFRecords. For optimal performance, reading from multiple files at once and # disregarding data order. Order does not matter since we will be shuffling the data anyway. ignore_order = tf.data.Options() if not ordered: ignore_order.experimental_deterministic = False # disable order, increase speed dataset = tf.data.TFRecordDataset(filenames, num_parallel_reads=AUTO) # automatically interleaves reads from multiple files dataset = dataset.with_options(ignore_order) # uses data as soon as it streams in, rather than in its original order dataset = dataset.map(read_labeled_tfrecord if labeled else read_unlabeled_tfrecord, num_parallel_calls=AUTO) # returns a dataset of (image, label) pairs if labeled=True or (image, id) pairs if labeled=False return dataset #$HIDE_INPUT$ def data_augment(image, label): # Thanks to the dataset.prefetch(AUTO) # statement in the next function (below), this happens essentially # for free on TPU. Data pipeline code is executed on the "CPU" # part of the TPU while the TPU itself is computing gradients. image = tf.image.random_flip_left_right(image) #image = tf.image.random_saturation(image, 0, 2) return image, label def get_training_dataset(): dataset = load_dataset(TRAINING_FILENAMES, labeled=True) dataset = dataset.map(data_augment, num_parallel_calls=AUTO) dataset = dataset.repeat() # the training dataset must repeat for several epochs dataset = dataset.shuffle(2048) dataset = dataset.batch(BATCH_SIZE) dataset = dataset.prefetch(AUTO) # prefetch next batch while training (autotune prefetch buffer size) return dataset def get_validation_dataset(ordered=False): dataset = load_dataset(VALIDATION_FILENAMES, labeled=True, ordered=ordered) dataset = dataset.batch(BATCH_SIZE) dataset = dataset.cache() dataset = dataset.prefetch(AUTO) return dataset def get_test_dataset(ordered=False): dataset = load_dataset(TEST_FILENAMES, labeled=False, ordered=ordered) dataset = dataset.batch(BATCH_SIZE) dataset = dataset.prefetch(AUTO) return dataset def count_data_items(filenames): # the number of data items is written in the name of the .tfrec # files, i.e. flowers00-230.tfrec = 230 data items n = [int(re.compile(r"-([0-9]*)\.").search(filename).group(1)) for filename in filenames] return np.sum(n) NUM_TRAINING_IMAGES = count_data_items(TRAINING_FILENAMES) NUM_VALIDATION_IMAGES = count_data_items(VALIDATION_FILENAMES) NUM_TEST_IMAGES = count_data_items(TEST_FILENAMES) print('Dataset: {} training images, {} validation images, {} unlabeled test images'.format(NUM_TRAINING_IMAGES, NUM_VALIDATION_IMAGES, NUM_TEST_IMAGES)) # Define the batch size. This will be 16 with TPU off and 128 (=16*8) with TPU on BATCH_SIZE = 16 * strategy.num_replicas_in_sync ds_train = get_training_dataset() ds_valid = get_validation_dataset() ds_test = get_test_dataset() print("Training:", ds_train) print ("Validation:", ds_valid) print("Test:", ds_test) np.set_printoptions(threshold=15, linewidth=80) print("Training data shapes:") for image, label in ds_train.take(3): print(image.numpy().shape, label.numpy().shape) print("Training data label examples:", label.numpy()) print("Test data shapes:") for image, idnum in ds_test.take(3): print(image.numpy().shape, idnum.numpy().shape) print("Test data IDs:", idnum.numpy().astype('U')) # U=unicode string #$HIDE_INPUT$ from matplotlib import pyplot as plt def batch_to_numpy_images_and_labels(data): images, labels = data numpy_images = images.numpy() numpy_labels = labels.numpy() if numpy_labels.dtype == object: # binary string in this case, # these are image ID strings numpy_labels = [None for _ in enumerate(numpy_images)] # If no labels, only image IDs, return None for labels (this is # the case for test data) return numpy_images, numpy_labels def title_from_label_and_target(label, correct_label): if correct_label is None: return CLASSES[label], True correct = (label == correct_label) return "{} [{}{}{}]".format(CLASSES[label], 'OK' if correct else 'NO', u"\u2192" if not correct else '', CLASSES[correct_label] if not correct else ''), correct def display_one_flower(image, title, subplot, red=False, titlesize=16): plt.subplot(*subplot) plt.axis('off') plt.imshow(image) if len(title) > 0: plt.title(title, fontsize=int(titlesize) if not red else int(titlesize/1.2), color='red' if red else 'black', fontdict={'verticalalignment':'center'}, pad=int(titlesize/1.5)) return (subplot[0], subplot[1], subplot[2]+1) def display_batch_of_images(databatch, predictions=None): This will work with: display_batch_of_images(images) display_batch_of_images(images, predictions) display_batch_of_images((images, labels)) display_batch_of_images((images, labels), predictions) # data images, labels = batch_to_numpy_images_and_labels(databatch) if labels is None: labels = [None for _ in enumerate(images)] # auto-squaring: this will drop data that does not fit into square # or square-ish rectangle rows = int(math.sqrt(len(images))) cols = len(images)//rows # size and spacing FIGSIZE = 13.0 SPACING = 0.1 subplot=(rows,cols,1) if rows < cols: plt.figure(figsize=(FIGSIZE,FIGSIZE/cols*rows)) else: plt.figure(figsize=(FIGSIZE/rows*cols,FIGSIZE)) # display for i, (image, label) in enumerate(zip(images[:rows*cols], labels[:rows*cols])): title = '' if label is None else CLASSES[label] correct = True if predictions is not None: title, correct = title_from_label_and_target(predictions[i], label) dynamic_titlesize = FIGSIZE*SPACING/max(rows,cols)*40+3 # magic formula tested to work from 1x1 to 10x10 images subplot = display_one_flower(image, title, subplot, not correct, titlesize=dynamic_titlesize) #layout plt.tight_layout() if label is None and predictions is None: plt.subplots_adjust(wspace=0, hspace=0) else: plt.subplots_adjust(wspace=SPACING, hspace=SPACING) plt.show() def display_training_curves(training, validation, title, subplot): if subplot%10==1: # set up the subplots on the first call plt.subplots(figsize=(10,10), facecolor='#F0F0F0') plt.tight_layout() ax = plt.subplot(subplot) ax.set_facecolor('#F8F8F8') ax.plot(training) ax.plot(validation) ax.set_title('model '+ title) ax.set_ylabel(title) #ax.set_ylim(0.28,1.05) ax.set_xlabel('epoch') ax.legend(['train', 'valid.']) ds_iter = iter(ds_train.unbatch().batch(20)) one_batch = next(ds_iter) display_batch_of_images(one_batch) EPOCHS = 12 with strategy.scope(): pretrained_model = tf.keras.applications.VGG16( weights='imagenet', include_top=False , input_shape=[*IMAGE_SIZE, 3] ) pretrained_model.trainable = False model = tf.keras.Sequential([ # To a base pretrained on ImageNet to extract features from images... pretrained_model, # ... attach a new head to act as a classifier. tf.keras.layers.GlobalAveragePooling2D(), tf.keras.layers.Dense(len(CLASSES), activation='softmax') ]) model.compile( optimizer='adam', loss = 'sparse_categorical_crossentropy', metrics=['sparse_categorical_accuracy'], ) model.summary() #$HIDE_INPUT$ # Learning Rate Schedule for Fine Tuning # def exponential_lr(epoch, start_lr = 0.00001, min_lr = 0.00001, max_lr = 0.00005, rampup_epochs = 5, sustain_epochs = 0, exp_decay = 0.8): def lr(epoch, start_lr, min_lr, max_lr, rampup_epochs, sustain_epochs, exp_decay): # linear increase from start to rampup_epochs if epoch < rampup_epochs: lr = ((max_lr - start_lr) / rampup_epochs * epoch + start_lr) # constant max_lr during sustain_epochs elif epoch < rampup_epochs + sustain_epochs: lr = max_lr # exponential decay towards min_lr else: lr = ((max_lr - min_lr) * exp_decay**(epoch - rampup_epochs - sustain_epochs) + min_lr) return lr return lr(epoch, start_lr, min_lr, max_lr, rampup_epochs, sustain_epochs, exp_decay) lr_callback = tf.keras.callbacks.LearningRateScheduler(exponential_lr, verbose=True) rng = [i for i in range(EPOCHS)] y = [exponential_lr(x) for x in rng] plt.plot(rng, y) print("Learning rate schedule: {:.3g} to {:.3g} to {:.3g}".format(y[0], max(y), y[-1])) # Define training epochs EPOCHS = 12 STEPS_PER_EPOCH = NUM_TRAINING_IMAGES // BATCH_SIZE history = model.fit( ds_train, validation_data=ds_valid, epochs=EPOCHS, steps_per_epoch=STEPS_PER_EPOCH, callbacks=[lr_callback], ) display_training_curves( history.history['loss'], history.history['val_loss'], 'loss', 211, ) display_training_curves( history.history['sparse_categorical_accuracy'], history.history['val_sparse_categorical_accuracy'], 'accuracy', 212, ) #$HIDE_INPUT$ import matplotlib.pyplot as plt from sklearn.metrics import f1_score, precision_score, recall_score, confusion_matrix def display_confusion_matrix(cmat, score, precision, recall): plt.figure(figsize=(15,15)) ax = plt.gca() ax.matshow(cmat, cmap='Reds') ax.set_xticks(range(len(CLASSES))) ax.set_xticklabels(CLASSES, fontdict={'fontsize': 7}) plt.setp(ax.get_xticklabels(), rotation=45, ha="left", rotation_mode="anchor") ax.set_yticks(range(len(CLASSES))) ax.set_yticklabels(CLASSES, fontdict={'fontsize': 7}) plt.setp(ax.get_yticklabels(), rotation=45, ha="right", rotation_mode="anchor") titlestring = "" if score is not None: titlestring += 'f1 = {:.3f} '.format(score) if precision is not None: titlestring += '\nprecision = {:.3f} '.format(precision) if recall is not None: titlestring += '\nrecall = {:.3f} '.format(recall) if len(titlestring) > 0: ax.text(101, 1, titlestring, fontdict={'fontsize': 18, 'horizontalalignment':'right', 'verticalalignment':'top', 'color':'#804040'}) plt.show() def display_training_curves(training, validation, title, subplot): if subplot%10==1: # set up the subplots on the first call plt.subplots(figsize=(10,10), facecolor='#F0F0F0') plt.tight_layout() ax = plt.subplot(subplot) ax.set_facecolor('#F8F8F8') ax.plot(training) ax.plot(validation) ax.set_title('model '+ title) ax.set_ylabel(title) #ax.set_ylim(0.28,1.05) ax.set_xlabel('epoch') ax.legend(['train', 'valid.']) cmdataset = get_validation_dataset(ordered=True) images_ds = cmdataset.map(lambda image, label: image) labels_ds = cmdataset.map(lambda image, label: label).unbatch() cm_correct_labels = next(iter(labels_ds.batch(NUM_VALIDATION_IMAGES))).numpy() cm_probabilities = model.predict(images_ds) cm_predictions = np.argmax(cm_probabilities, axis=-1) labels = range(len(CLASSES)) cmat = confusion_matrix( cm_correct_labels, cm_predictions, labels=labels, ) cmat = (cmat.T / cmat.sum(axis=1)).T # normalize score = f1_score( cm_correct_labels, cm_predictions, labels=labels, average='macro', ) precision = precision_score( cm_correct_labels, cm_predictions, labels=labels, average='macro', ) recall = recall_score( cm_correct_labels, cm_predictions, labels=labels, average='macro', ) display_confusion_matrix(cmat, score, precision, recall) dataset = get_validation_dataset() dataset = dataset.unbatch().batch(20) batch = iter(dataset) images, labels = next(batch) probabilities = model.predict(images) predictions = np.argmax(probabilities, axis=-1) display_batch_of_images((images, labels), predictions) test_ds = get_test_dataset(ordered=True) print('Computing predictions...') test_images_ds = test_ds.map(lambda image, idnum: image) probabilities = model.predict(test_images_ds) predictions = np.argmax(probabilities, axis=-1) print(predictions) print('Generating submission.csv file...') # Get image ids from test set and convert to unicode test_ids_ds = test_ds.map(lambda image, idnum: idnum).unbatch() test_ids = next(iter(test_ids_ds.batch(NUM_TEST_IMAGES))).numpy().astype('U') # Write the submission file np.savetxt( 'submission.csv', np.rec.fromarrays([test_ids, predictions]), fmt=['%s', '%d'], delimiter=',', header='id,label', comments='', ) # Look at the first few predictions !head submission.csv <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Step 2 Step2: We'll use the distribution strategy when we create our neural network model. Then, TensorFlow will distribute the training among the eight TPU cores by creating eight different replicas of the model, one for each core. Step 3 Step3: You can use data from any public dataset here on Kaggle in just the same way. If you'd like to use data from one of your private datasets, see here. Step4: Create Data Pipelines Step5: This next cell will create the datasets that we'll use with Keras during training and inference. Notice how we scale the size of the batches to the number of TPU cores. Step6: These datasets are tf.data.Dataset objects. You can think about a dataset in TensorFlow as a stream of data records. The training and validation sets are streams of (image, label) pairs. Step7: The test set is a stream of (image, idnum) pairs; idnum here is the unique identifier given to the image that we'll use later when we make our submission as a csv file. Step9: Step 4 Step10: You can display a single batch of images from a dataset with another of our helper functions. The next cell will turn the dataset into an iterator of batches of 20 images. Step11: Use the Python next function to pop out the next batch in the stream and display it with the helper function. Step12: By defining ds_iter and one_batch in separate cells, you only need to rerun the cell above to see a new batch of images. Step 5 Step13: The 'sparse_categorical' versions of the loss and metrics are appropriate for a classification task with more than two labels, like this one. Step14: Step 6 Step15: Fit Model Step16: This next cell shows how the loss and metrics progressed during training. Thankfully, it converges! Step17: Step 7 Step18: Confusion Matrix Step19: You might be familiar with metrics like F1-score or precision and recall. This cell will compute these metrics and display them with a plot of the confusion matrix. (These metrics are defined in the Scikit-learn module sklearn.metrics; we've imported them in the helper script for you.) Step20: Visual Validation Step21: And here is a set of flowers with their predicted species. Run the cell again to see another set. Step22: Step 8 Step23: We'll generate a file submission.csv. This file is what you'll submit to get your score on the leaderboard.
8,051
<ASSISTANT_TASK:> Python Code: %matplotlib inline import numpy import matplotlib.pyplot as plt import allantools from allantools import noise def plotallan_phase(plt,y,rate,taus, style): (t2, ad, ade,adn) = allantools.mdev(y,rate=rate,taus=taus) plt.loglog(t2, ad, style) # plot a line with the slope alpha def plotline(plt, alpha, taus,style): y = [ pow(tt,alpha) for tt in taus] plt.loglog(taus,y,style) t = numpy.logspace( 0 ,4,50) # tau values from 1 to 1000 N=10000 rate = 1.0 # white phase noise => 1/tau ADEV d = numpy.random.randn(4*N) phaseA = d[0:N] # numpy.random.randn(N) #pink(N) phaseA = [1*x for x in phaseA] phaseB = d[N:2*N] #numpy.random.randn(N) #noise.pink(N) phaseB = [5*x for x in phaseB] phaseC = d[2*N:3*N] #numpy.random.randn(N) #noise.pink(N) phaseC = [5*x for x in phaseC] phaseAB = [a-b for (a,b) in zip(phaseA,phaseB)] phaseBC = [b-c for (b,c) in zip(phaseB,phaseC)] phaseCA = [c-a for (c,a) in zip(phaseC,phaseA)] (taus,devA,err_a,ns_ab) = allantools.three_cornered_hat_phase(phaseAB,phaseBC,phaseCA,rate,t, allantools.mdev) plt.subplot(111, xscale="log", yscale="log") plotallan_phase(plt, phaseA, 1, t, 'ro') plotallan_phase(plt, phaseB, 1, t, 'go') plotallan_phase(plt, phaseC, 1, t, 'bo') plotallan_phase(plt, phaseAB, 1, t, 'r.') plotallan_phase(plt, phaseBC, 1, t, 'g.') plotallan_phase(plt, phaseCA, 1, t, 'b.') plt.loglog(taus, devA, 'rv') plt.grid() plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Generate some example data Step2: Now, run three-cornered hat phase calculation Step3: Plot results
8,052
<ASSISTANT_TASK:> Python Code: from pybaseball import statcast pitch_data = statcast(start_dt='2017-04-01', end_dt='2017-04-30') pitch_data.shape pitch_data.pitch_type.value_counts() pitch_type = pitch_data.pop('pitch_type') from sklearn.model_selection import train_test_split X_train, X_test, y_train, y_test = train_test_split( pitch_data, pitch_type, test_size=0.33, random_state=42) prediction_cols = ['p_throws', 'release_spin_rate', 'effective_speed', 'release_extension', 'vx0', 'vy0', 'vz0', 'ax', 'ay', 'az'] from sklearn.preprocessing import LabelEncoder encoder = LabelEncoder().fit(y_train) y_train_encoded = encoder.transform(y_train) import xgboost as xgb dtrain = xgb.DMatrix(X_train[prediction_cols], label=y_train_encoded) dtest = xgb.DMatrix(X_test[prediction_cols]) xgb_params = { 'max_depth': 12, 'eta': 0.2, 'nthread': 4, # Use 4 cores for multiprocessing 'num_class': 6, # pitch types 'objective': 'multi:softmax' # use softmax multi-class classification } boosted_classifier = xgb.train(xgb_params, dtrain, num_boost_round=30) from sklearn.metrics import accuracy_score predictions = boosted_classifier.predict(dtrain) accuracy_score(y_train_encoded, predictions) param_grid = [(max_depth, min_child_weight, eta) for max_depth in (6, 8, 10, 12) for min_child_weight in (7, 9, 11, 13) for eta in (0.15, 0.2, 0.25)] min_merror = np.inf best_params = None for max_depth, min_child_weight, eta in param_grid: print("CV with max_depth={}, min_child_weight={}, eta={}".format( max_depth, min_child_weight, eta)) # Update our parameters xgb_params['max_depth'] = max_depth xgb_params['min_child_weight'] = min_child_weight xgb_params['eta'] = eta # Run CV cv_results = xgb.cv( xgb_params, dtrain, num_boost_round=50, nfold=5, metrics={'merror'}, early_stopping_rounds=3 ) # Update best score mean_merror = cv_results['test-merror-mean'].min() boost_rounds = cv_results['test-merror-mean'].idxmin() print("\tmerror {} for {} rounds".format(mean_merror, boost_rounds)) if mean_merror < min_merror: min_merror = mean_merror best_params = (max_depth, min_child_weight, eta) print("Best params: {}, {}, {}, merror: {}".format(best_params[0], best_params[1], best_params[2], min_merror)) xgb_params = { 'max_depth': 10, 'eta': 0.2, 'min_child_weight': 9, # minimum sum of instance weight needed in a child 'nthread': 4, # use 4 cores for multiprocessing 'num_class': 6, # pitch types 'objective': 'multi:softmax' # use softmax multi-class classification } boosted_classifier = xgb.train(xgb_params, dtrain, num_boost_round=30) from sklearn.metrics import accuracy_score predictions = boosted_classifier.predict(dtrain) accuracy_score(y_train_encoded, predictions) xgb.plot_importance(boosted_classifier) test_predictions = boosted_classifier.predict(dtest) test_predictions predicted_pitches = pd.Series(encoder.inverse_transform(test_predictions.astype(int)), index=X_test.index) predicted_pitches.name = 'pitch_type' predicted_pitches.index.name = 'pitchid' predicted_pitches.to_csv('predicted_pitches_fonnesbeck.csv', header=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Extract columns to be used for prediction. Pitcher and year are probably not predictive, so I am leaving them out. Step2: Relabel pitch types using the scikit-learn label encoder (XGboost requires sequential labels). Step3: XGBoost runs faster using its own binary data structures Step4: We can specify the hyperparameters of the model, to use as a starting point for the analysis. Step5: Using arbitrarily-chosen hyperparemeters, the model achieves nearly perfect accuracy on the training set. Step6: However, this model may be overfit to the training dataset, so I am going to use 5-fold cross-validation to select hyperparameters that result in the best fit. Step7: I can select the best parameters from the cross-validation procedure to use to predict on the test data (I could do a more refined search of the hyperparameter space, but the multiclass errors appear to be broadly similar across the range of values that I used, so I will stick with these). Step8: The accuracy score for the training data is nominally lower than the original model, but not much; moreover this model should perform better in out-of-sample prediction. Step9: Below is a plot of feature importances, using the F-score. This quantifies how many times a particular variable is used as a splitting variable across all the trees. This ranking makes intiutive sense, with movement and velocity being the most relevant factors. Step10: Generate predictions on the test set using fitted classifier. Step11: Back-transform label encoding, and export to predicted_pitches_fonnesbeck.csv.
8,053
<ASSISTANT_TASK:> Python Code: # Load pickled data import pickle import csv import cv2 import numpy as np import math import matplotlib.pyplot as plt signnames = [] with open("signnames.csv", 'r') as f: next(f) reader = csv.reader(f) signnames = list(reader) n_classes = len(signnames) training_file = "./train.p" testing_file = "./test.p" with open(training_file, mode='rb') as f: train = pickle.load(f) with open(testing_file, mode='rb') as f: test = pickle.load(f) from sklearn import cross_validation X_train, X_test = [], [] y_train, y_test = [], test['labels'] for i, img in enumerate(train['features']): img = cv2.resize(img,(48, 48), interpolation = cv2.INTER_CUBIC) X_train.append(img) y_train.append(train['labels'][i]) # Adaptive Histogram (CLAHE) imgLab = cv2.cvtColor(img, cv2.COLOR_RGB2Lab) clahe = cv2.createCLAHE(clipLimit=2.0, tileGridSize=(8,8)) l, a, b = cv2.split(imgLab) l = clahe.apply(l) imgLab = cv2.merge((l, a, b)) imgLab = cv2.cvtColor(imgLab, cv2.COLOR_Lab2RGB) X_train.append(imgLab) y_train.append(train['labels'][i]) # Rotate -15 M = cv2.getRotationMatrix2D((24, 24), -15.0, 1) imgL = cv2.warpAffine(img, M, (48, 48)) X_train.append(imgL) y_train.append(train['labels'][i]) # Rotate 15 M = cv2.getRotationMatrix2D((24, 24), 15.0, 1) imgR = cv2.warpAffine(img, M, (48, 48)) X_train.append(imgR) y_train.append(train['labels'][i]) for img in test['features']: X_test.append(cv2.resize(img,(48, 48), interpolation = cv2.INTER_CUBIC)) X_train, X_validation, y_train, y_validation = cross_validation.train_test_split(X_train, y_train, test_size=0.2, random_state=7) from sklearn.utils import shuffle X_train, y_train = shuffle(X_train, y_train) n_train = len(X_train) n_test = len(X_test) image_shape = X_train[0].shape print("Number of training examples =", n_train) print("Number of testing examples =", n_test) print("Image data shape =", image_shape) print("Number of classes =", n_classes) print("Number of X_train = ", len(X_train)) print("Number of X_validation = ", len(X_validation)) print("Number of y_train = ", len(y_train)) print("Number of y_validation = ", len(y_validation)) import random # Visualizations will be shown in the notebook. %matplotlib inline index = random.randint(0, len(X_train)) image = X_train[index].squeeze() plt.figure(figsize=(1,1)) plt.imshow(image) print(y_train[index], signnames[y_train[index]][1]) import tensorflow as tf from tensorflow.contrib.layers import flatten EPOCHS = 10 BATCH_SIZE = 128 def ConvNet(x): mu = 0 sigma = 0.1 # Layer 1: Convolutional. Input = 48x48x3. Output = 42x42x100. c1_W = tf.Variable(tf.truncated_normal([7, 7, 3, 100], mean=mu, stddev=sigma)) c1_b = tf.Variable(tf.zeros(100)) c1 = tf.nn.conv2d(x, c1_W, strides=[1, 1, 1, 1], padding='VALID') c1 = tf.nn.bias_add(c1, c1_b) c1 = tf.nn.relu(c1) # Layer 2: Max Pooling. Input = 42x42x100. Output = 21x21x100. s2 = tf.nn.max_pool(c1, ksize=[1, 2, 2, 1], strides=[1, 2, 2, 1], padding='SAME') # Layer 3: Convolutional. Input = 21x21x100. Output = 18x18x150. c3_W = tf.Variable(tf.truncated_normal([4, 4, 100, 150], mean=mu, stddev=sigma)) c3_b = tf.Variable(tf.zeros(150)) c3 = tf.nn.conv2d(s2, c3_W, strides=[1, 1, 1, 1], padding='VALID') c3 = tf.nn.bias_add(c3, c3_b) c3 = tf.nn.relu(c3) # Layer 4: Max Pooling. Input = 18x18x150. Output = 9x9x150 s4 = tf.nn.max_pool(c3, ksize=[1, 2, 2, 1], strides=[1, 2, 2, 1], padding='SAME') # Layer 5: Convolutional. Input = 9x9x150. Output = 6x6x250. c5_W = tf.Variable(tf.truncated_normal([4, 4, 150, 250], mean=mu, stddev=sigma)) c5_b = tf.Variable(tf.zeros(250)) c5 = tf.nn.conv2d(s4, c5_W, strides=[1, 1, 1, 1], padding='VALID') c5 = tf.nn.bias_add(c5, c5_b) c5 = tf.nn.relu(c5) # Layer 6: Max Pooling. Input = 6x6x250. Output = 3x3x250. s6 = tf.nn.max_pool(c5, ksize=[1, 2, 2, 1], strides=[1, 2, 2, 1], padding='SAME') # Layer 6: Flatten. Input = 3x3x250. Output = 2250 s6 = flatten(s6) # Layer 7: Fully Connected. Input = 2250. Output = 300. fc7_W = tf.Variable(tf.truncated_normal([2250, 300], mean=mu, stddev=sigma)) fc7_b = tf.Variable(tf.zeros(300)) fc7 = tf.add(tf.matmul(s6, fc7_W), fc7_b) fc7 = tf.nn.relu(fc7) # Layer 8: Fully Connected. Input = 300. Output = 43. fc8_W = tf.Variable(tf.truncated_normal([300, 43], mean=mu, stddev=sigma)) fc8_b = tf.Variable(tf.zeros(43)) fc8 = tf.add(tf.matmul(fc7, fc8_W), fc8_b) return fc8 x = tf.placeholder(tf.float32, (None, 48, 48, 3)) y = tf.placeholder(tf.int32, (None)) one_hot_y = tf.one_hot(y, n_classes) rate = 0.001 logits = ConvNet(x) cross_entropy = tf.nn.softmax_cross_entropy_with_logits(logits, one_hot_y) loss_operation = tf.reduce_mean(cross_entropy) optimizer = tf.train.AdamOptimizer(learning_rate = rate) training_operation = optimizer.minimize(loss_operation) correct_prediction = tf.equal(tf.argmax(logits, 1), tf.argmax(one_hot_y, 1)) accuracy_operation = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) def evaluate(X_data, y_data): num_examples = len(X_data) total_accuracy = 0 sess = tf.get_default_session() for offset in range(0, num_examples, BATCH_SIZE): batch_x, batch_y = X_data[offset:offset+BATCH_SIZE], y_data[offset:offset+BATCH_SIZE] accuracy = sess.run(accuracy_operation, feed_dict={x: batch_x, y: batch_y}) total_accuracy += (accuracy * len(batch_x)) return total_accuracy / num_examples with tf.Session() as sess: sess.run(tf.global_variables_initializer()) num_examples = len(X_train) print("Training...") print() for i in range(EPOCHS): X_train, y_train = shuffle(X_train, y_train) for offset in range(0, num_examples, BATCH_SIZE): end = offset + BATCH_SIZE batch_x, batch_y = X_train[offset:end], y_train[offset:end] sess.run(training_operation, feed_dict={x: batch_x, y: batch_y}) validation_accuracy = evaluate(X_validation, y_validation) print("EPOCH {} ...".format(i+1)) print("Validation Accuracy = {:.3f}".format(validation_accuracy)) print() try: saver except NameError: saver = tf.train.Saver() saver.save(sess, 'convnet') print("Model saved") with tf.Session() as sess: loader = tf.train.import_meta_graph("convnet.meta") loader.restore(sess, tf.train.latest_checkpoint('./')) test_accuracy = evaluate(X_test, y_test) print("Test Accuracy = {:.3f}".format(test_accuracy)) from PIL import Image # Visualizations will be shown in the notebook. %matplotlib inline new_images = [] new_labels = np.array([4, 17, 26, 28, 14]) fig = plt.figure() for i in range(1, 6): subplot = fig.add_subplot(2,3,i) img = cv2.imread("./dataset/{}.png".format(i)) img = cv2.cvtColor(img, cv2.COLOR_RGB2BGR) img = cv2.resize(img,(48, 48), interpolation = cv2.INTER_CUBIC) subplot.set_title(signnames[new_labels[i-1]][1],fontsize=8) subplot.imshow(img) new_images.append(img) with tf.Session() as sess: loader = tf.train.import_meta_graph("convnet.meta") loader.restore(sess, tf.train.latest_checkpoint('./')) new_pics_classes = sess.run(logits, feed_dict={x: new_images}) test_accuracy = evaluate(new_images, new_labels) print("Test Accuracy = {:.3f}".format(test_accuracy)) top3 = sess.run(tf.nn.top_k(new_pics_classes, k=3, sorted=True)) for i in range(len(top3[0])): labels = list(map(lambda x: signnames[x][1], top3[1][i])) print("Image {} predicted labels: {} with probabilities: {}".format(i+1, labels, top3[0][i])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Preprocess Data Step2: Step 1 Step3: Visualize the German Traffic Signs Dataset using the pickled file(s). This is open ended, suggestions include Step4: Step 2 Step5: Features and Labels Step6: Training Pipeline Step7: Model Evaluation Step8: Model Training Step9: Model Evaluation Step10: Question 1 Step11: Question 6
8,054
<ASSISTANT_TASK:> Python Code: repo_uoa = 'explore-matrix-size-gemm-libs-dvdt-prof-firefly-rk3399-001' import os import sys import json import re import IPython as ip import pandas as pd import numpy as np import seaborn as sns import matplotlib as mp print ('IPython version: %s' % ip.__version__) print ('Pandas version: %s' % pd.__version__) print ('NumPy version: %s' % np.__version__) print ('Seaborn version: %s' % sns.__version__) # apt install python-tk print ('Matplotlib version: %s' % mp.__version__) import matplotlib.pyplot as plt from matplotlib import cm %matplotlib inline from IPython.display import Image, display def display_in_full(df): pd.options.display.max_columns = len(df.columns) pd.options.display.max_rows = len(df.index) display(df) import ck.kernel as ck print ('CK version: %s' % ck.__version__) # client: 'acl-sgemm-opencl-example' or 'clblast-tune' def get_mnk(characteristics, client): # dim: 'm', 'n', 'k' def get_dim_int(characteristics, client, dim): if client == 'clblast-tune': dim_str = characteristics['run'][dim][0] dim_int = np.int64(dim_str) else: dim_str = characteristics['run'][dim] dim_int = np.int64(dim_str) return dim_int m = get_dim_int(characteristics, client, 'm') n = get_dim_int(characteristics, client, 'n') k = get_dim_int(characteristics, client, 'k') return ('(%d, %d, %d)' % (m, n, k)) def get_GFLOPS(characteristics, client): if client == 'acl-sgemm-opencl-example': GFLOPS_str = characteristics['run']['GFLOPS_1'] else: GFLOPS_str = characteristics['run']['GFLOPS_1'][0] GFLOPS = np.float(GFLOPS_str) return GFLOPS def get_TimeMS(characteristics,client): time_execution =characteristics['run'].get('ms_1') return time_execution print profiling start = datetime.strptime(profiling['timestamp']['start'], '%Y-%m-%dT%H:%M:%S.%f') end = datetime.strptime(profiling['timestamp']['end'], '%Y-%m-%dT%H:%M:%S.%f') print (start.timestamp() * 1000) print (end.timestamp() * 1000) elapsed = (end.timestamp() * 1000) - (start.timestamp() * 1000) return elapsed default_colormap = cm.autumn default_figsize = [20, 12] default_dpi = 200 default_fontsize = 20 default_legend_fontsize = 'medium' if mp.__version__[0]=='2': mp.style.use('classic') mp.rcParams['figure.figsize'] = default_figsize mp.rcParams['figure.dpi'] = default_dpi mp.rcParams['font.size'] = default_fontsize mp.rcParams['legend.fontsize'] = default_legend_fontsize def plot(df_mean, df_std, rot=90, patch_fontsize=default_fontsize): ax = df_mean.plot(yerr=df_std, kind='bar', ylim=[0, 20], rot=rot, width=0.9, grid=True, legend=True, figsize=default_figsize, colormap=default_colormap, fontsize=default_fontsize) ax.set_title('ARM Compute Library vs CLBlast (dv/dt)', fontsize=default_fontsize) ax.set_ylabel('SGEMM GFLOPS', fontsize=default_fontsize) ax.legend(loc='upper right') for patch in ax.patches: text = '{0:2.1f}'.format(patch.get_height()) ax.annotate(text, (patch.get_x()*1.00, patch.get_height()*1.01), fontsize=patch_fontsize) def get_experimental_results(repo_uoa='explore-matrix-size-gemm-libs-dvdt-prof-firefly-rk3399', tags='explore-matrix-size-libs-sgemm, acl-sgemm-opencl-example'): module_uoa = 'experiment' r = ck.access({'action':'search', 'repo_uoa':repo_uoa, 'module_uoa':module_uoa, 'tags':tags}) if r['return']>0: print ("Error: %s" % r['error']) exit(1) experiments = r['lst'] dfs = [] for experiment in experiments: data_uoa = experiment['data_uoa'] r = ck.access({'action':'list_points', 'repo_uoa':repo_uoa, 'module_uoa':module_uoa, 'data_uoa':data_uoa}) if r['return']>0: print ("Error: %s" % r['error']) exit(1) for point in r['points']: with open(os.path.join(r['path'], 'ckp-%s.0001.json' % point)) as point_file: point_data_raw = json.load(point_file) characteristics_list = point_data_raw['characteristics_list'] num_repetitions = len(characteristics_list) client = data_uoa[len('explore-matrix-size-gemm-libs-'):] # Obtain column data. data = [ { 'client': client, '(m, n, k)': get_mnk(characteristics, client), 'GFLOPS': get_GFLOPS(characteristics, client), 'dvdt_prof_info': characteristics['run'].get('dvdt_prof',[]), 'time (ms)' : get_TimeMS(characteristics,client), 'repetition_id': repetition_id } for (characteristics, repetition_id) in zip(characteristics_list, range(num_repetitions)) ] #Construct a DataFrame. df = pd.DataFrame(data) # Set columns and index names. df.columns.name = 'characteristics' df.index.name = 'index' df = df.set_index(['client', '(m, n, k)', 'repetition_id','GFLOPS','time (ms)']) # Append to the list of similarly constructed DataFrames. dfs.append(df) # Concatenate all constructed DataFrames (i.e. stack on top of each other). result = pd.concat(dfs).unstack('client').swaplevel(axis=1) return result.sort_index(level=result.index.names) df = get_experimental_results(repo_uoa=repo_uoa) display_in_full(df) df_min = df \ .ix[df.groupby(level=df.index.names[:-1])['time (ms)'].idxmin()] \ .reset_index('repetition_id', drop=True) df_min batch_size = 1 df_model_lib = df_min[['dvdt_prof_info']] \ .reset_index('platform', drop=True) \ .reorder_levels([ 'batch_size', 'model', 'lib']) \ .loc[batch_size] \ .sortlevel() df_model_lib models = df_model_lib.index.levels[0] libs = df_model_lib.index.levels[1] def concat(model, lib): return '%s:%s' % (model, lib) def analyse_model_lib(df_model_lib, model, lib, min_pc=1.0): trace = pw.index_calls(df_model_lib.loc[model].loc[lib]['dvdt_prof_info']) # All kernel enqueues. df_kernel_enqueues = pw.df_kernel_enqueues(pw.filter_calls(trace, ['clEnqueueNDRangeKernel']), unit='ms') # Kernel enqueues that take at least 'min_pc' % of the execution time. df_kernel_enqueues_cum_time_num = pw.df_kernel_enqueues_cumulative_time_num(df_kernel_enqueues, unit) df_kernel_enqueues_cum_time_num.columns.name = concat(model, lib) return df_kernel_enqueues_cum_time_num[df_kernel_enqueues_cum_time_num['** Execution time (%) **'] > min_pc] def analyse_xgemm_kernel(df_model_lib, model, lib, kernel): # Get trace for lib and model. trace = pw.index_calls(df_model_lib.loc[model].loc[lib]['dvdt_prof_info']) # All calls to set kernel args. set_args = pw.filter_calls(trace, ['clSetKernelArg']) # All kernel enqueues. nqs = pw.filter_calls(trace, ['clEnqueueNDRangeKernel']) # Construct a DataFrame with info about kernel enqueues. df = pw.df_kernel_enqueues(nqs, unit='ms').swaplevel().ix[kernel] df = df[['p3 - p2 (ms)', 'gws2']] # As gws2 is always 1, we can use it to count the number of enqueues. df.columns = [ '** Execution time (ms) **', '** Number of enqueues **' ] df.columns.name = kernel # Augment the DataFrame with columns for the (M, N, K) triples. df['kSizeM'] = 'M'; df['bSizeM'] = 'MM' df['kSizeN'] = 'N'; df['bSizeN'] = 'NN' df['kSizeK'] = 'K'; df['bSizeK'] = 'KK' # Initialise buckets. buckets = init_buckets() # Augment the DataFrame with the actual (M, N, K) triples. mnk_triples = []; mmnnkk_triples = [] for nq in nqs: if nq['name'] == kernel: prof = nq['profiling'] (M, N, K) = ('M', 'N', 'K'); (MM, NN, KK) = ('MM', 'NN', 'KK') for set_arg in set_args: if (set_arg['call_index'] > nq['call_index']): break if (set_arg['kernel'] != nq['kernel']): continue arg_value = pc.hex_str_as_int(set_arg['arg_value']) if (set_arg['arg_index'] == 0): M = arg_value; MM = arg_value if (set_arg['arg_index'] == 1): N = arg_value; NN = arg_value if (set_arg['arg_index'] == 2): K = arg_value; KK = arg_value mnk_triples.append((M, N, K)) mmnnkk_triples.append(get_nearest_bucket(buckets, (M, N, K))) df[['kSizeM', 'kSizeN', 'kSizeK']] = mnk_triples df[['bSizeM', 'bSizeN', 'bSizeK']] = mmnnkk_triples # Calculate Gflops and GFLOPS (Gflops/s). df['** Gflops **'] = 2*df['kSizeM']*df['kSizeN']*df['kSizeK']*1e-9 df['** GFLOPS **'] = df['** Gflops **'] / (df['** Execution time (ms) **']*1e-3) return df model_lib_kernel_analysis = {} for model in models: for lib in libs: title = concat(model, lib) print('== %s ==' % title) try: analysis = model_lib_analysis[title] except: print(' ... missing ...'); print(''); continue for kernel in analysis.index: if kernel.lower().find('xgemm') == -1: continue analysis_xgemm = analyse_xgemm_kernel(df_model_lib, model, lib, kernel) pd.options.display.max_columns = analysis_xgemm.columns.size pd.options.display.max_rows = analysis_xgemm.index.size display(analysis_xgemm) analysis_xgemm_stats = analysis_xgemm.describe() pd.options.display.max_columns = analysis_xgemm_stats.columns.size pd.options.display.max_rows = analysis_xgemm_stats.index.size display(analysis_xgemm_stats) model_lib_kernel_analysis[concat(title, kernel)] = analysis_xgemm print('') print('') df = get_experimental_results(repo_uoa=repo_uoa) display_in_full(df) df_mean = df.groupby(level=df.index.names[:-1]).mean() df_std = df.groupby(level=df.index.names[:-1]).std() plot(df_mean, df_std) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: NB Step2: Scientific Step3: Collective Knowledge Step4: Define helper functions Step5: Plot experimental data Step6: Access experimental data Step7: Print Step8: <a id="table"></a> Step9: <a id="plot"></a>
8,055
<ASSISTANT_TASK:> Python Code: !mkdir -p ~/agave %cd ~/agave !pip3 install --upgrade setvar import re import os import sys from setvar import * from time import sleep # This cell enables inline plotting in the notebook %matplotlib inline import matplotlib import numpy as np import matplotlib.pyplot as plt writefile("input.txt", !INPUT FILE FOR FUNWAVE_TVD ! NOTE: all input parameter are capital sensitive ! --------------------TITLE------------------------------------- ! title only for log file TITLE = VESSEL ! -------------------HOT START--------------------------------- HOT_START = F FileNumber_HOTSTART = 1 ! -------------------PARALLEL INFO----------------------------- ! ! PX,PY - processor numbers in X and Y ! NOTE: make sure consistency with mpirun -np n (px*py) ! PX = 2 PY = 1 ! --------------------DEPTH------------------------------------- ! Depth types, DEPTH_TYPE=DATA: from depth file ! DEPTH_TYPE=FLAT: idealized flat, need depth_flat ! DEPTH_TYPE=SLOPE: idealized slope, ! need slope,SLP starting point, Xslp ! and depth_flat DEPTH_TYPE = FLAT DEPTH_FLAT = 10.0 ! -------------------PRINT--------------------------------- ! PRINT*, ! result folder RESULT_FOLDER = output/ ! ------------------DIMENSION----------------------------- ! global grid dimension Mglob = 500 Nglob = 100 ! ----------------- TIME---------------------------------- ! time: total computational time/ plot time / screen interval ! all in seconds TOTAL_TIME = 3.0 PLOT_INTV = 1.0 PLOT_INTV_STATION = 50000.0 SCREEN_INTV = 1.0 HOTSTART_INTV = 360000000000.0 WAVEMAKER = INI_GAU AMP = 3.0 Xc = 250.0 Yc = 50.0 WID = 20.0 ! -----------------GRID---------------------------------- ! if use spherical grid, in decimal degrees ! cartesian grid sizes DX = 1.0 DY = 1.0 ! ----------------SHIP WAKES ---------------------------- VESSEL_FOLDER = ./ NumVessel = 2 ! -----------------OUTPUT----------------------------- ETA = T U = T V = T ) writefile("run.sh", #!/bin/bash export LD_LIBRARY_PATH=/usr/local/lib mkdir -p rundir cd ./rundir cp ../input.txt . mpirun -np 2 ~/FUNWAVE-TVD/src/funwave_vessel ) if os.environ.get('USE_TUNNEL') == 'True': # fetch the hostname and port of the reverse tunnel running in the sandbox # so Agave can connect to our local sandbox !echo $(ssh -q -o StrictHostKeyChecking=no -o UserKnownHostsFile=/dev/null sandbox 'curl -s http://localhost:4040/api/tunnels | jq -r '.tunnels[0].public_url'') > ngrok_url.txt !cat ngrok_url.txt | sed 's|^tcp://||' !cat ngrok_url.txt | sed 's|^tcp://||' | sed -r 's#(.*):(.*)#\1#' > ngrok_host.txt !cat ngrok_url.txt | sed 's|^tcp://||' | sed -r 's#(.*):(.*)#\2#' > ngrok_port.txt # set the environment variables otherwise set when running in a training cluster os.environ['VM_PORT'] = readfile('ngrok_port.txt').strip() os.environ['VM_MACHINE'] = readfile('ngrok_host.txt').strip() os.environ['AGAVE_SYSTEM_HOST'] = readfile('ngrok_host.txt').strip() os.environ['AGAVE_SYSTEM_PORT'] = readfile('ngrok_port.txt').strip() !echo "VM_PORT=$VM_PORT" !echo "VM_MACHINE=$VM_MACHINE" setvar("VM_IPADDRESS=$(getent hosts ${VM_MACHINE}|cut -d' ' -f1)") !scp -o "StrictHostKeyChecking=no" -P $VM_PORT input.txt run.sh $VM_IPADDRESS:. !ssh -p $VM_PORT $VM_IPADDRESS bash run.sh !ssh -p $VM_PORT $VM_IPADDRESS tar -C rundir -czf output.tgz output !rm -fr output.tgz output !scp -q -r -P $VM_PORT $VM_IPADDRESS:output.tgz . !tar xzf output.tgz !ls output data = np.genfromtxt("output/v_00003") fig = plt.figure(figsize=(12,12)) pltres = plt.imshow(data[::-1,:]) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: The parameter file for Funwave-TVD is called "input.txt". Here we create it using writefile. You don't need to understand the details of how this file for this tutorial. Step4: Here is a simple bash script to run the code.... Step5: FOLLOWING ALONG AT HOME Step6: Here's how the average developer might run the code when doing their research. Step7: Here's how they might retrieve the data. Step8: Now let's use Python to graph the output
8,056
<ASSISTANT_TASK:> Python Code: #$HIDE$ import pandas as pd pd.plotting.register_matplotlib_converters() import matplotlib.pyplot as plt %matplotlib inline import seaborn as sns print("Setup Complete") # Path of the file to read spotify_filepath = "../input/spotify.csv" # Read the file into a variable spotify_data spotify_data = pd.read_csv(spotify_filepath, index_col="Date", parse_dates=True) # Print the first 5 rows of the data spotify_data.head() # Print the last five rows of the data spotify_data.tail() # Line chart showing daily global streams of each song sns.lineplot(data=spotify_data) # Set the width and height of the figure plt.figure(figsize=(14,6)) # Add title plt.title("Daily Global Streams of Popular Songs in 2017-2018") # Line chart showing daily global streams of each song sns.lineplot(data=spotify_data) list(spotify_data.columns) # Set the width and height of the figure plt.figure(figsize=(14,6)) # Add title plt.title("Daily Global Streams of Popular Songs in 2017-2018") # Line chart showing daily global streams of 'Shape of You' sns.lineplot(data=spotify_data['Shape of You'], label="Shape of You") # Line chart showing daily global streams of 'Despacito' sns.lineplot(data=spotify_data['Despacito'], label="Despacito") # Add label for horizontal axis plt.xlabel("Date") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Select a dataset Step2: The end result of running both lines of code above is that we can now access the dataset by using spotify_data. Step3: Check now that the first five rows agree with the image of the dataset (from when we saw what it would look like in Excel) above. Step4: Thankfully, everything looks about right, with millions of daily global streams for each song, and we can proceed to plotting the data! Step5: As you can see above, the line of code is relatively short and has two main components Step6: The first line of code sets the size of the figure to 14 inches (in width) by 6 inches (in height). To set the size of any figure, you need only copy the same line of code as it appears. Then, if you'd like to use a custom size, change the provided values of 14 and 6 to the desired width and height. Step7: In the next code cell, we plot the lines corresponding to the first two columns in the dataset.
8,057
<ASSISTANT_TASK:> Python Code: import pandas as pd import requests import json import numpy as np TOKEN = '198f959a5f39a1c441c7c863423264' base_url = "https://gatewayapi.prodam.sp.gov.br:443/financas/orcamento/sof/v2.1.0" headers={'Authorization' : str('Bearer ' + TOKEN)} url_orcado = '{base_url}/consultarDespesas?anoDotacao=2017&mesDotacao=08&codOrgao=84'.format(base_url=base_url) request_orcado = requests.get(url_orcado, headers=headers, verify=True).json() df_orcado = pd.DataFrame(request_orcado['lstDespesas']) df_resumo_orcado = df_orcado[['valOrcadoInicial', 'valOrcadoAtualizado', 'valCongelado', 'valDisponivel', 'valEmpenhadoLiquido', 'valLiquidado']] df_resumo_orcado url_empenho = '{base_url}/consultaEmpenhos?anoEmpenho=2017&mesEmpenho=08&codOrgao=84'.format(base_url=base_url) pagination = '&numPagina={PAGE}' request_empenhos = requests.get(url_empenho, headers=headers, verify=True).json() number_of_pages = request_empenhos['metadados']['qtdPaginas'] todos_empenhos = [] todos_empenhos = todos_empenhos + request_empenhos['lstEmpenhos'] if number_of_pages>1: for p in range(2, number_of_pages+1): request_empenhos = requests.get(url_empenho + pagination.format(PAGE=p), headers=headers, verify=True).json() todos_empenhos = todos_empenhos + request_empenhos['lstEmpenhos'] df_empenhos = pd.DataFrame(todos_empenhos) df_empenhos.tail() modalidades = df_empenhos.groupby('txtModalidadeAplicacao')['valTotalEmpenhado', 'valLiquidado'].sum() modalidades # Outra maneira de fazer a mesma operação: #pd.pivot_table(df_empenhos, values='valTotalEmpenhado', index=['txtModalidadeAplicacao'], aggfunc=np.sum) despesas = pd.pivot_table(df_empenhos, values=['valLiquidado', 'valPagoExercicio'], index=['numCpfCnpj', 'txtRazaoSocial', 'txtDescricaoPrograma'], aggfunc=np.sum).sort_values('valPagoExercicio', axis=0, ascending=False, inplace=False, kind='quicksort', na_position='last') despesas.head(15) fonte = pd.pivot_table(df_empenhos, values=['valLiquidado', 'valPagoExercicio'], index=['txtDescricaoFonteRecurso'], aggfunc=np.sum).sort_values('valPagoExercicio', axis=0, ascending=False, inplace=False, kind='quicksort', na_position='last') fonte df_empenhos.to_csv('empenhos.csv') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Orçamento Step2: Empenhos Step3: A API fornece apenas uma página na consulta. O script abaixo checa a quantidade de páginas nos metadados da consulta e itera o número de vezes necessário para obter todas as páginas Step4: Com os passos acima, fizemos a requisição de todas as páginas e convertemos o arquivo formato json em um DataFrame. Agora podemos trabalhar com a análise desses dado no Pandas. Para checar quantos registros existentes, vamos ver o final da lista Step5: Modalidades de Aplicação Step6: Maiores despesas de 2017 Step7: Fontes de recursos Step8: Passo 4. Quer salvar um csv?
8,058
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np import matplotlib.pyplot as plt import sklearn.feature_selection as FS data = pd.read_csv("./wine_dataset.csv", delimiter=";") data.head() data["Type"] = pd.Categorical.from_array(data["Type"]).codes data["Type"].replace("A",0) data["Type"].replace("B",1) data["Type"].replace("C",2) data.head() data.describe() data_y = data["Type"] data_X = data.drop("Type", 1) data_X.head() mi = FS.mutual_info_classif(data_X, data_y) print(mi) data_X.head(0) names=data_X.axes[1] names indice=np.argsort(mi)[::-1] print(indice) print(names[indice]) plt.figure(figsize=(8,6)) plt.subplot(121) plt.scatter(data[data.Type==1].Flavanoids,data[data.Type==1].Color_Intensity, color='red') plt.scatter(data[data.Type==2].Flavanoids,data[data.Type==2].Color_Intensity, color='blue') plt.scatter(data[data.Type==0].Flavanoids,data[data.Type==0].Color_Intensity, color='green') plt.title('Good Predictor Variables \n Flavanoids vs Color_Intensity') plt.xlabel('Flavanoids') plt.ylabel('Color_Intensity') plt.legend(['A','B','C']) plt.subplot(122) plt.scatter(data[data.Type==1].Ash,data[data.Type==1].Nonflavanoid_Phenols, color='red') plt.scatter(data[data.Type==2].Ash,data[data.Type==2].Nonflavanoid_Phenols, color='blue') plt.scatter(data[data.Type==0].Ash,data[data.Type==0].Nonflavanoid_Phenols, color='green') plt.title('Ash vs Nonflavanoid_Phenols') plt.xlabel('Ash') plt.ylabel('Nonflavanoid_Phenols') plt.legend(['A','B','C']) plt.show() chi = FS.chi2(X = data_X, y = data["Type"])[0] print(chi) indice_chi=np.argsort(chi)[::-1] print(indice_chi) print(names[indice_chi]) plt.figure() plt.scatter(data[data.Type==1].Proline,data[data.Type==1].Color_Intensity, color='red') plt.scatter(data[data.Type==2].Proline,data[data.Type==2].Color_Intensity, color='blue') plt.scatter(data[data.Type==0].Proline,data[data.Type==0].Color_Intensity, color='green') plt.title('Good Predictor Variables Chi-Square \n Proline vs Color_Intensity') plt.xlabel('Proline') plt.ylabel('Color_Intensity') plt.legend(['A','B','C']) plt.show() from sklearn.decomposition.pca import PCA pca = PCA() pca.fit(data_X) plt.plot(pca.explained_variance_) plt.ylabel("eigenvalues") plt.xlabel("position") plt.show() print ("Eigenvalues\n",pca.explained_variance_) # Percentage of variance explained for each components print('\nExplained variance ratio (first two components):\n %s' % str(pca.explained_variance_ratio_)) pca = PCA(n_components=2) X_pca = pd.DataFrame(pca.fit_transform(data_X)) pca_A = X_pca[data_y == 0] pca_B = X_pca[data_y == 1] pca_C = X_pca[data_y == 2] #plot plt.scatter(x = pca_A[0], y = pca_A[1], c="blue") plt.scatter(x = pca_B[0], y = pca_B[1], c="turquoise") plt.scatter(x = pca_C[0], y = pca_C[1], c="darkorange") plt.xlabel("First Component") plt.ylabel("Second Component") plt.legend(["A","B","C"]) plt.show() from sklearn import preprocessing X_scaled = preprocessing.scale(data_X) pca = PCA() pca.fit(X_scaled) plt.plot(pca.explained_variance_) plt.ylabel("eigenvalues") plt.xlabel("position") plt.show() print ("Eigenvalues\n",pca.explained_variance_) # Percentage of variance explained for each components print('\nExplained variance ratio (first two components):\n %s' % str(pca.explained_variance_ratio_)) pca = PCA(n_components=2) X_pca = pd.DataFrame(pca.fit_transform(X_scaled)) pca_A = X_pca[data_y == 'A'] pca_B = X_pca[data_y == 'B'] pca_C = X_pca[data_y == 'C'] #plot plt.scatter(x = pca_A[0], y = pca_A[1], c="blue") plt.scatter(x = pca_B[0], y = pca_B[1], c="turquoise") plt.scatter(x = pca_C[0], y = pca_C[1], c="darkorange") plt.xlabel("First Component") plt.ylabel("Second Component") plt.legend(["A","B","C"]) plt.show() from sklearn.discriminant_analysis import LinearDiscriminantAnalysis as LDA lda = LDA() lda.fit(data_X,data_y) print("Porcentaje explicado:", lda.explained_variance_ratio_) X_lda = pd.DataFrame(lda.fit_transform(data_X, data_y)) # Dividimos en los 3 tipos para ponerles diferentes colores lda_A = X_lda[data_y == 0] lda_B = X_lda[data_y == 1] lda_C = X_lda[data_y == 2] #plot plt.scatter(x = lda_A[0], y = lda_A[1], c="blue") plt.scatter(x = lda_B[0], y = lda_B[1], c="turquoise") plt.scatter(x = lda_C[0], y = lda_C[1], c="darkorange") plt.title("LDA without normalization") plt.xlabel("First LDA Component") plt.ylabel("Second LDA Component") plt.legend((["A","B","C"]), loc="lower right") plt.show() lda = LDA(n_components=2) lda.fit(X_scaled,data_y) print("Porcentaje explicado:", lda.explained_variance_ratio_) X_lda = pd.DataFrame(lda.fit_transform(data_X, data_y)) # Dividimos en los 3 tipos para ponerles diferentes colores lda_A = X_lda[data_y == 0] lda_B = X_lda[data_y == 1] lda_C = X_lda[data_y == 2] #plot plt.scatter(x = lda_A[0], y = lda_A[1], c="blue") plt.scatter(x = lda_B[0], y = lda_B[1], c="turquoise") plt.scatter(x = lda_C[0], y = lda_C[1], c="darkorange") plt.xlabel("First LDA Component") plt.ylabel("Second LDA Component") plt.legend(["A","B","C"],loc="lower right") plt.title("LDA with normalization") plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Se sustituye la columna Type por un valor categórico Step2: Separamos la columna target del resto de variables predictoras Step3: Mutual Information Step4: Chi-Square Step5: Principal Component Analysis (PCA) Step6: PCA without normalization Step7: Dibujamos la proyección en las dos primeras componentes principales Step8: PCA with Normalization Step9: Linear Discriminant Analysis (LDA) Step10: LDA without normalization Step11: LDA with normalization
8,059
<ASSISTANT_TASK:> Python Code: test = "Hello World" print ("test: " + test) # #The function zeros creates an array full of zeros # function ones creates an array full of ones #function empty creates an array whose initial content is random and depends on the state of the memory # To create sequences of numbers, NumPy provides a function analogous to range that returns arrays instead of lists. <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: NumPy Step2: shape Step3: np.ones Step4: np.empty Step5: np.arange
8,060
<ASSISTANT_TASK:> Python Code: ROMAN = [ (1000, "M"), ( 900, "CM"), ( 500, "D"), ( 400, "CD"), ( 100, "C"), ( 90, "XC"), ( 50, "L"), ( 40, "XL"), ( 10, "X"), ( 9, "IX"), ( 5, "V"), ( 4, "IV"), ( 1, "I"), ] def to_roman(number: int): result = "" for (arabic, roman) in ROMAN: (factor, number) = divmod(number, arabic) result += roman * factor return result print(to_roman(2021)) print(to_roman(8)) import snoop @snoop def to_roman2(number: int): result = "" for (arabic, roman) in ROMAN: (factor, number) = divmod(number, arabic) result += roman * factor return result print(to_roman2(2021)) from statistics import stdev numbers = [1, 2, 3, 4, 5, 6, 7, 8, 9, 10] print(f"numbers={numbers}: stdev={stdev(numbers)}") def mystddev(max: int) -> float: my_numbers = list(range(max)) with snoop(depth=2): return stdev(my_numbers) print(mystddev(5)) from statistics import median print(median(numbers) + 2 * stdev(numbers)) from snoop import pp pp(pp(median(numbers)) + pp(2 * pp(stdev(numbers)))) # print(median(numbers) + 2 * stdev(numbers)) pp.deep(lambda: median(numbers) + 2 * stdev(numbers)) users = { 'user1': { 'is_admin': True, 'email': 'one@exmple.com'}, 'user2': { 'is_admin': True, 'phone': '281-555-5555' }, 'user3': { 'is_admin': False, 'email': 'three@example.com' }, } def email_user(*user_names) -> None: global users for user in user_names: print("Emailing %s at %s", (user, users[user]['email'])) email_user('user1', 'user2') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Snooping on execution Step2: Snooping on referenced functions Step3: pp - pretty print Step4: Shortcut Step5: How to use in Jupyter
8,061
<ASSISTANT_TASK:> Python Code: # These are all the modules we'll be using later. Make sure you can import them # before proceeding further. from __future__ import print_function import matplotlib.pyplot as plt import numpy as np import os import sys import tarfile from IPython.display import display, Image from scipy import ndimage from sklearn.linear_model import LogisticRegression from six.moves.urllib.request import urlretrieve from six.moves import cPickle as pickle # Config the matplotlib backend as plotting inline in IPython %matplotlib inline url = 'http://commondatastorage.googleapis.com/books1000/' last_percent_reported = None def download_progress_hook(count, blockSize, totalSize): A hook to report the progress of a download. This is mostly intended for users with slow internet connections. Reports every 1% change in download progress. global last_percent_reported percent = int(count * blockSize * 100 / totalSize) if last_percent_reported != percent: if percent % 5 == 0: sys.stdout.write("%s%%" % percent) sys.stdout.flush() else: sys.stdout.write(".") sys.stdout.flush() last_percent_reported = percent def maybe_download(filename, expected_bytes, force=False): Download a file if not present, and make sure it's the right size. if force or not os.path.exists(filename): print('Attempting to download:', filename) filename, _ = urlretrieve(url + filename, filename, reporthook=download_progress_hook) print('\nDownload Complete!') statinfo = os.stat(filename) if statinfo.st_size == expected_bytes: print('Found and verified', filename) else: raise Exception( 'Failed to verify ' + filename + '. Can you get to it with a browser?') return filename train_filename = maybe_download('notMNIST_large.tar.gz', 247336696) test_filename = maybe_download('notMNIST_small.tar.gz', 8458043) num_classes = 10 np.random.seed(133) def maybe_extract(filename, force=False): root = os.path.splitext(os.path.splitext(filename)[0])[0] # remove .tar.gz if os.path.isdir(root) and not force: # You may override by setting force=True. print('%s already present - Skipping extraction of %s.' % (root, filename)) else: print('Extracting data for %s. This may take a while. Please wait.' % root) tar = tarfile.open(filename) sys.stdout.flush() tar.extractall() tar.close() data_folders = [ os.path.join(root, d) for d in sorted(os.listdir(root)) if os.path.isdir(os.path.join(root, d))] if len(data_folders) != num_classes: raise Exception( 'Expected %d folders, one per class. Found %d instead.' % ( num_classes, len(data_folders))) print(data_folders) return data_folders train_folders = maybe_extract(train_filename) test_folders = maybe_extract(test_filename) image_size = 28 # Pixel width and height. pixel_depth = 255.0 # Number of levels per pixel. def load_letter(folder, min_num_images): Load the data for a single letter label. image_files = os.listdir(folder) dataset = np.ndarray(shape=(len(image_files), image_size, image_size), dtype=np.float32) print(folder) num_images = 0 for image in image_files: image_file = os.path.join(folder, image) try: image_data = (ndimage.imread(image_file).astype(float) - pixel_depth / 2) / pixel_depth if image_data.shape != (image_size, image_size): raise Exception('Unexpected image shape: %s' % str(image_data.shape)) dataset[num_images, :, :] = image_data num_images = num_images + 1 except IOError as e: print('Could not read:', image_file, ':', e, '- it\'s ok, skipping.') dataset = dataset[0:num_images, :, :] if num_images < min_num_images: raise Exception('Many fewer images than expected: %d < %d' % (num_images, min_num_images)) print('Full dataset tensor:', dataset.shape) print('Mean:', np.mean(dataset)) print('Standard deviation:', np.std(dataset)) return dataset def maybe_pickle(data_folders, min_num_images_per_class, force=False): dataset_names = [] for folder in data_folders: set_filename = folder + '.pickle' dataset_names.append(set_filename) if os.path.exists(set_filename) and not force: # You may override by setting force=True. print('%s already present - Skipping pickling.' % set_filename) else: print('Pickling %s.' % set_filename) dataset = load_letter(folder, min_num_images_per_class) try: with open(set_filename, 'wb') as f: pickle.dump(dataset, f, pickle.HIGHEST_PROTOCOL) except Exception as e: print('Unable to save data to', set_filename, ':', e) return dataset_names train_datasets = maybe_pickle(train_folders, 45000) test_datasets = maybe_pickle(test_folders, 1800) def make_arrays(nb_rows, img_size): if nb_rows: dataset = np.ndarray((nb_rows, img_size, img_size), dtype=np.float32) labels = np.ndarray(nb_rows, dtype=np.int32) else: dataset, labels = None, None return dataset, labels def merge_datasets(pickle_files, train_size, valid_size=0): num_classes = len(pickle_files) valid_dataset, valid_labels = make_arrays(valid_size, image_size) train_dataset, train_labels = make_arrays(train_size, image_size) vsize_per_class = valid_size // num_classes tsize_per_class = train_size // num_classes start_v, start_t = 0, 0 end_v, end_t = vsize_per_class, tsize_per_class end_l = vsize_per_class+tsize_per_class for label, pickle_file in enumerate(pickle_files): try: with open(pickle_file, 'rb') as f: letter_set = pickle.load(f) # let's shuffle the letters to have random validation and training set np.random.shuffle(letter_set) if valid_dataset is not None: valid_letter = letter_set[:vsize_per_class, :, :] valid_dataset[start_v:end_v, :, :] = valid_letter valid_labels[start_v:end_v] = label start_v += vsize_per_class end_v += vsize_per_class train_letter = letter_set[vsize_per_class:end_l, :, :] train_dataset[start_t:end_t, :, :] = train_letter train_labels[start_t:end_t] = label start_t += tsize_per_class end_t += tsize_per_class except Exception as e: print('Unable to process data from', pickle_file, ':', e) raise return valid_dataset, valid_labels, train_dataset, train_labels train_size = 200000 valid_size = 10000 test_size = 10000 valid_dataset, valid_labels, train_dataset, train_labels = merge_datasets( train_datasets, train_size, valid_size) _, _, test_dataset, test_labels = merge_datasets(test_datasets, test_size) print('Training:', train_dataset.shape, train_labels.shape) print('Validation:', valid_dataset.shape, valid_labels.shape) print('Testing:', test_dataset.shape, test_labels.shape) def randomize(dataset, labels): permutation = np.random.permutation(labels.shape[0]) shuffled_dataset = dataset[permutation,:,:] shuffled_labels = labels[permutation] return shuffled_dataset, shuffled_labels train_dataset, train_labels = randomize(train_dataset, train_labels) test_dataset, test_labels = randomize(test_dataset, test_labels) valid_dataset, valid_labels = randomize(valid_dataset, valid_labels) pickle_file = 'notMNIST.pickle' try: f = open(pickle_file, 'wb') save = { 'train_dataset': train_dataset, 'train_labels': train_labels, 'valid_dataset': valid_dataset, 'valid_labels': valid_labels, 'test_dataset': test_dataset, 'test_labels': test_labels, } pickle.dump(save, f, pickle.HIGHEST_PROTOCOL) f.close() except Exception as e: print('Unable to save data to', pickle_file, ':', e) raise statinfo = os.stat(pickle_file) print('Compressed pickle size:', statinfo.st_size) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step3: First, we'll download the dataset to our local machine. The data consists of characters rendered in a variety of fonts on a 28x28 image. The labels are limited to 'A' through 'J' (10 classes). The training set has about 500k and the testset 19000 labelled examples. Given these sizes, it should be possible to train models quickly on any machine. Step4: Extract the dataset from the compressed .tar.gz file. Step6: Problem 1 Step7: Problem 2 Step8: Next, we'll randomize the data. It's important to have the labels well shuffled for the training and test distributions to match. Step9: Problem 4
8,062
<ASSISTANT_TASK:> Python Code: import ROOT h = ROOT.TH1F("my_histo", "Example histogram", 100, -4, 4) ROOT.gInterpreter.ProcessLine( double add(double a, double b) { return a + b; } ) ROOT.add(3.14, 100) ROOT.gInterpreter.ProcessLine("void print_integer(int i) { std::cout << i << std::endl; }") ROOT.print_integer(7) ROOT.print_integer([]) # fails with TypeError ROOT.gInterpreter.ProcessLine( void print_vector(const std::vector<std::string> &v) { for (auto &s : v) { std::cout << s << std::endl; } } ) ROOT.print_vector(['Two', 'Words']) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The ROOT Python module is the entry point for all the ROOT C++ functionality. Step3: Calling user-defined C++ code via PyROOT Step4: and use it right away from Python Step5: What about code in C++ libraries? Step6: Of course not every conversion is allowed! Step8: An example of a useful allowed conversion is Python list to std
8,063
<ASSISTANT_TASK:> Python Code: from sklearn.feature_extraction import stop_words from nltk.corpus import stopwords import math from textblob import TextBlob as tb with open("scripts/script.txt", "r") as f: data = f.read() #with open("scripts/script.txt", "r") as f: # data2 = f.readlines() #for line in data: # words = data.split() with open("scripts/transcript_1.txt", "r") as t1: t1 = t1.read() with open("scripts/transcript_2.txt", "r") as t2: t2 = t2.read() with open("scripts/transcript_3.txt", "r") as t3: t3 = t3.read() from spacy.en import English import nltk from sklearn.feature_extraction.stop_words import ENGLISH_STOP_WORDS parser = English() parsedData = parser(data) # All you have to do is iterate through the parsedData # Each token is an object with lots of different properties # A property with an underscore at the end returns the string representation # while a property without the underscore returns an index (int) into spaCy's vocabulary # The probability estimate is based on counts from a 3 billion word # corpus, smoothed using the Simple Good-Turing method. for i, token in enumerate(parsedData[0:2]): print("original:", token.orth, token.orth_) print("lowercased:", token.lower, token.lower_) print("lemma:", token.lemma, token.lemma_) print("shape:", token.shape, token.shape_) print("prefix:", token.prefix, token.prefix_) print("suffix:", token.suffix, token.suffix_) print("log probability:", token.prob) print("Brown cluster id:", token.cluster) print("----------------------------------------") from sklearn.metrics import accuracy_score from sklearn.feature_extraction.text import TfidfVectorizer, CountVectorizer def tf(word, blob): return blob.words.count(word) / len(blob.words) def n_containing(word, bloblist): return sum(1 for blob in bloblist if word in blob.words) def idf(word, bloblist): return math.log(len(bloblist) / (1 + n_containing(word, bloblist))) def tfidf(word, blob, bloblist): return tf(word, blob) * idf(word, bloblist) bloblist = [] [bloblist.append(tb(doc)) for doc in [data, t1, t2, t3]] for i, blob in enumerate(bloblist): print("Top words in document {}".format(i + 1)) scores = {word: tfidf(word, blob, bloblist) for word in blob.words} sorted_words = sorted(scores.items(), key=lambda x: x[1], reverse=True) for word, score in sorted_words[:3]: print("Word: {}, TF-IDF: {}".format(word, round(score, 5))) CountVectorizer(data) tf = TfidfVectorizer(analyzer='word', ngram_range=(1,3), min_df = 0, stop_words = 'english') tfidf_matrix = tf.fit_transform(data2) feature_names = tf.get_feature_names() tfidf_matrix.shape, len(feature_names) dense = tfidf_matrix.todense() episode = dense[0].tolist()[0] phrase_scores = [pair for pair in zip(range(0, len(episode)), episode) if pair[1] > 0] sorted_phrase_scores = sorted(phrase_scores, key=lambda t: t[1] * -1) for phrase, score in [(feature_names[word_id], score) for (word_id, score) in sorted_phrase_scores][:20]: print('{0: <20} {1}'.format(phrase, score)) def freq(word, tokens): return tokens.count(word) #Compute the frequency for each term. vocabulary = [] docs = {} all_tips = [] for tip in (venue.tips()): tokens = tokenizer.tokenize(tip.text) bi_tokens = bigrams(tokens) tri_tokens = trigrams(tokens) tokens = [token.lower() for token in tokens if len(token) > 2] tokens = [token for token in tokens if token not in stopwords] bi_tokens = [' '.join(token).lower() for token in bi_tokens] bi_tokens = [token for token in bi_tokens if token not in stopwords] tri_tokens = [' '.join(token).lower() for token in tri_tokens] tri_tokens = [token for token in tri_tokens if token not in stopwords] final_tokens = [] final_tokens.extend(tokens) final_tokens.extend(bi_tokens) final_tokens.extend(tri_tokens) docs[tip.text] = {'freq': {}} for token in final_tokens: docs[tip.text]['freq'][token] = freq(token, final_tokens) print docs from rake_nltk import Rake r = Rake() # Uses stopwords for english from NLTK, and all puntuation characters. # If you want to provide your own set of stop words and punctuations to # r = Rake(<list of stopwords>, <string of puntuations to ignore> r.extract_keywords_from_text(data) r.get_ranked_phrases_with_scores() # To get keyword phrases ranked highest to lowest. <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: PRE-PROCESSING! Step2: TF-IDF Step3: RAKE
8,064
<ASSISTANT_TASK:> Python Code: import graphlab loans = graphlab.SFrame('lending-club-data.gl/') loans['safe_loans'] = loans['bad_loans'].apply(lambda x : +1 if x==0 else -1) loans = loans.remove_column('bad_loans') features = ['grade', # grade of the loan 'term', # the term of the loan 'home_ownership', # home_ownership status: own, mortgage or rent 'emp_length', # number of years of employment ] target = 'safe_loans' loans = loans[features + [target]] loans safe_loans_raw = loans[loans[target] == 1] risky_loans_raw = loans[loans[target] == -1] # Since there are less risky loans than safe loans, find the ratio of the sizes # and use that percentage to undersample the safe loans. percentage = len(risky_loans_raw)/float(len(safe_loans_raw)) safe_loans = safe_loans_raw.sample(percentage, seed = 1) risky_loans = risky_loans_raw loans_data = risky_loans.append(safe_loans) print "Percentage of safe loans :", len(safe_loans) / float(len(loans_data)) print "Percentage of risky loans :", len(risky_loans) / float(len(loans_data)) print "Total number of loans in our new dataset :", len(loans_data) loans_data = risky_loans.append(safe_loans) for feature in features: loans_data_one_hot_encoded = loans_data[feature].apply(lambda x: {x: 1}) loans_data_unpacked = loans_data_one_hot_encoded.unpack(column_name_prefix=feature) # Change None's to 0's for column in loans_data_unpacked.column_names(): loans_data_unpacked[column] = loans_data_unpacked[column].fillna(0) loans_data.remove_column(feature) loans_data.add_columns(loans_data_unpacked) features = loans_data.column_names() features.remove('safe_loans') # Remove the response variable features print "Number of features (after binarizing categorical variables) = %s" % len(features) loans_data['grade.A'] print "Total number of grade.A loans : %s" % loans_data['grade.A'].sum() print "Expexted answer : 6422" train_data, test_data = loans_data.random_split(.8, seed=1) def intermediate_node_num_mistakes(labels_in_node): # Corner case: If labels_in_node is empty, return 0 if len(labels_in_node) == 0: return 0 # Count the number of 1's (safe loans) ## YOUR CODE HERE nr_of_safe_loans = 0 for e in labels_in_node: if e == 1: nr_of_safe_loans += 1 # Count the number of -1's (risky loans) ## YOUR CODE HERE nr_of_risky_loans = 0 for e in labels_in_node: if e == -1: nr_of_risky_loans += 1 # Return the number of mistakes that the majority classifier makes. ## YOUR CODE HERE if nr_of_safe_loans > nr_of_risky_loans: return nr_of_risky_loans return nr_of_safe_loans # Test case 1 example_labels = graphlab.SArray([-1, -1, 1, 1, 1]) if intermediate_node_num_mistakes(example_labels) == 2: print 'Test passed!' else: print 'Test 1 failed... try again!' # Test case 2 example_labels = graphlab.SArray([-1, -1, 1, 1, 1, 1, 1]) if intermediate_node_num_mistakes(example_labels) == 2: print 'Test passed!' else: print 'Test 2 failed... try again!' # Test case 3 example_labels = graphlab.SArray([-1, -1, -1, -1, -1, 1, 1]) if intermediate_node_num_mistakes(example_labels) == 2: print 'Test passed!' else: print 'Test 3 failed... try again!' def best_splitting_feature(data, features, target): best_feature = None # Keep track of the best feature best_error = 10 # Keep track of the best error so far # Note: Since error is always <= 1, we should intialize it with something larger than 1. # Convert to float to make sure error gets computed correctly. num_data_points = float(len(data)) # Loop through each feature to consider splitting on that feature for feature in features: # The left split will have all data points where the feature value is 0 left_split = data[data[feature] == 0] # The right split will have all data points where the feature value is 1 ## YOUR CODE HERE right_split = data[data[feature] == 1] # Calculate the number of misclassified examples in the left split. # Remember that we implemented a function for this! (It was called intermediate_node_num_mistakes) # YOUR CODE HERE left_mistakes = intermediate_node_num_mistakes(left_split[target]) # Calculate the number of misclassified examples in the right split. ## YOUR CODE HERE right_mistakes = intermediate_node_num_mistakes(right_split[target]) # Compute the classification error of this split. # Error = (# of mistakes (left) + # of mistakes (right)) / (# of data points) ## YOUR CODE HERE error = (left_mistakes + right_mistakes) / num_data_points # If this is the best error we have found so far, store the feature as best_feature and the error as best_error ## YOUR CODE HERE if error < best_error: best_error = error best_feature = feature return best_feature # Return the best feature we found if best_splitting_feature(train_data, features, 'safe_loans') == 'term. 36 months': print 'Test passed!' else: print 'Test failed... try again!' def create_leaf(target_values): # Create a leaf node leaf = {'splitting_feature' : None, 'left' : None, 'right' : None, 'is_leaf': True} ## YOUR CODE HERE # Count the number of data points that are +1 and -1 in this node. num_ones = len(target_values[target_values == +1]) num_minus_ones = len(target_values[target_values == -1]) # For the leaf node, set the prediction to be the majority class. # Store the predicted class (1 or -1) in leaf['prediction'] if num_ones > num_minus_ones: leaf['prediction'] = 1 ## YOUR CODE HERE else: leaf['prediction'] = -1 ## YOUR CODE HERE # Return the leaf node return leaf def decision_tree_create(data, features, target, current_depth = 0, max_depth = 10): remaining_features = features[:] # Make a copy of the features. target_values = data[target] print "--------------------------------------------------------------------" print "Subtree, depth = %s (%s data points)." % (current_depth, len(target_values)) # Stopping condition 1 # (Check if there are mistakes at current node. # Recall you wrote a function intermediate_node_num_mistakes to compute this.) if intermediate_node_num_mistakes(target_values) == 0: ## YOUR CODE HERE print "Stopping condition 1 reached." # If not mistakes at current node, make current node a leaf node return create_leaf(target_values) # Stopping condition 2 (check if there are remaining features to consider splitting on) if not remaining_features: ## YOUR CODE HERE print "Stopping condition 2 reached." # If there are no remaining features to consider, make current node a leaf node return create_leaf(target_values) # Additional stopping condition (limit tree depth) if current_depth >= max_depth: ## YOUR CODE HERE print "Reached maximum depth. Stopping for now." # If the max tree depth has been reached, make current node a leaf node return create_leaf(target_values) # Find the best splitting feature (recall the function best_splitting_feature implemented above) ## YOUR CODE HERE splitting_feature = best_splitting_feature(data, remaining_features, target) # Split on the best feature that we found. left_split = data[data[splitting_feature] == 0] right_split = data[data[splitting_feature] == 1] ## YOUR CODE HERE remaining_features.remove(splitting_feature) print "Split on feature %s. (%s, %s)" % (\ splitting_feature, len(left_split), len(right_split)) # Create a leaf node if the split is "perfect" if len(left_split) == len(data): print "Creating leaf node." return create_leaf(left_split[target]) if len(right_split) == len(data): print "Creating leaf node." ## YOUR CODE HERE return create_leaf(right_split[target]) # Repeat (recurse) on left and right subtrees left_tree = decision_tree_create(left_split, remaining_features, target, current_depth + 1, max_depth) ## YOUR CODE HERE right_tree = decision_tree_create(right_split, remaining_features, target, current_depth + 1, max_depth) return {'is_leaf' : False, 'prediction' : None, 'splitting_feature': splitting_feature, 'left' : left_tree, 'right' : right_tree} def count_nodes(tree): if tree['is_leaf']: return 1 return 1 + count_nodes(tree['left']) + count_nodes(tree['right']) small_data_decision_tree = decision_tree_create(train_data, features, 'safe_loans', max_depth = 3) if count_nodes(small_data_decision_tree) == 13: print 'Test passed!' else: print 'Test failed... try again!' print 'Number of nodes found :', count_nodes(small_data_decision_tree) print 'Number of nodes that should be there : 13' # Make sure to cap the depth at 6 by using max_depth = 6 my_decision_tree = decision_tree_create(train_data, features, 'safe_loans', max_depth = 6) def classify(tree, x, annotate = False): # if the node is a leaf node. if tree['is_leaf']: if annotate: print "At leaf, predicting %s" % tree['prediction'] return tree['prediction'] else: # split on feature. split_feature_value = x[tree['splitting_feature']] if annotate: print "Split on %s = %s" % (tree['splitting_feature'], split_feature_value) if split_feature_value == 0: return classify(tree['left'], x, annotate) else: return classify(tree['right'], x, annotate) ### YOUR CODE HERE test_data[0] print 'Predicted class: %s ' % classify(my_decision_tree, test_data[0]) classify(my_decision_tree, test_data[0], annotate=True) def evaluate_classification_error(tree, data): # Apply the classify(tree, x) to each row in your data prediction = data.apply(lambda x: classify(tree, x)) # Once you've made the predictions, calculate the classification error and return it ## YOUR CODE HERE nr_of_mistakes = data[data[target] != prediction] print len(nr_of_mistakes) / float(len(data)) evaluate_classification_error(my_decision_tree, test_data) def print_stump(tree, name = 'root'): split_name = tree['splitting_feature'] # split_name is something like 'term. 36 months' if split_name is None: print "(leaf, label: %s)" % tree['prediction'] return None split_feature, split_value = split_name.split('.') print ' %s' % name print ' |---------------|----------------|' print ' | |' print ' | |' print ' | |' print ' [{0} == 0] [{0} == 1] '.format(split_name) print ' | |' print ' | |' print ' | |' print ' (%s) (%s)' \ % (('leaf, label: ' + str(tree['left']['prediction']) if tree['left']['is_leaf'] else 'subtree'), ('leaf, label: ' + str(tree['right']['prediction']) if tree['right']['is_leaf'] else 'subtree')) print_stump(my_decision_tree) print_stump(my_decision_tree['left'], my_decision_tree['splitting_feature']) print_stump(my_decision_tree['left']['left']['left'], my_decision_tree['left']['left']['splitting_feature']) print_stump(my_decision_tree['left']['left']['left'], my_decision_tree['left']['splitting_feature']) print_stump(my_decision_tree['right'], my_decision_tree['right']['splitting_feature']) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load the lending club dataset Step2: Like the previous assignment, we reassign the labels to have +1 for a safe loan, and -1 for a risky (bad) loan. Step3: Unlike the previous assignment where we used several features, in this assignment, we will just be using 4 categorical Step4: Let's explore what the dataset looks like. Step5: Subsample dataset to make sure classes are balanced Step6: Note Step7: Let's see what the feature columns look like now Step8: Let's explore what one of these columns looks like Step9: This column is set to 1 if the loan grade is A and 0 otherwise. Step10: Train-test split Step11: Decision tree implementation Step12: Because there are several steps in this assignment, we have introduced some stopping points where you can check your code and make sure it is correct before proceeding. To test your intermediate_node_num_mistakes function, run the following code until you get a Test passed!, then you should proceed. Otherwise, you should spend some time figuring out where things went wrong. Step13: Function to pick best feature to split on Step14: To test your best_splitting_feature function, run the following code Step15: Building the tree Step16: We have provided a function that learns the decision tree recursively and implements 3 stopping conditions Step17: Here is a recursive function to count the nodes in your tree Step18: Run the following test code to check your implementation. Make sure you get 'Test passed' before proceeding. Step19: Build the tree! Step20: Making predictions with a decision tree Step21: Now, let's consider the first example of the test set and see what my_decision_tree model predicts for this data point. Step22: Let's add some annotations to our prediction to see what the prediction path was that lead to this predicted class Step23: Quiz question Step24: Now, let's use this function to evaluate the classification error on the test set. Step25: Quiz Question Step26: Quiz Question Step27: Exploring the left subtree of the left subtree Step28: Quiz question
8,065
<ASSISTANT_TASK:> Python Code: import numpy as np np.lookfor('weighted average') a1d = np.array([3, 4, 5, 6]) a1d a2d = np.array([[10., 20, 30], [9, 8, 7]]) a2d print( type( a1d[0] ) ) print( type( a2d[0,0] ) ) type(a1d) try: a = np.array(1,2,3,4) # WRONG, only 2 non-keyword arguments accepted except ValueError as err: print(err) a = np.array([1,2,3,4]) # RIGHT np.ndarray([1,2,3,4]) # ndarray is is a low level method. Use np.array() instead np.arange(1, 9, 2) # for integers, np.arange is same as range but returns an array insted of a list np.array( range(1,9,2) ) np.linspace(0, 1, 10) # start, end, num-points np.zeros((2, 3)) np.zeros((2,2),dtype=int) np.ones((2, 3)) np.random.rand(4) # uniform in [0, 1] np.random.normal(0,1,4) # Gaussian (mean,std dev, num samples) np.random.gamma(1,1,(2,2)) # Gamma (shape, scale , num samples) x = np.linspace(-5, 5, 3) y = np.linspace(10, 40, 4) x2d, y2d = np.meshgrid(x, y) print(x2d) print(y2d) print(np.transpose(y2d)) # or equivalentely print(y2d.transpose()) # using the method of y2d print(y2d.T) # using the property of y2d a2d a2d.ndim a2d.shape a2d.size len(a2d) print('array a1d :',a1d) print('Minimum and maximum :', a1d.min(), a1d.max()) print('Sum and product of all elements :', a1d.sum(), a1d.prod()) print('Mean and standard deviation :', a1d.mean(), a1d.std()) print(a2d) print('sum :',a2d.sum()) print('sum :',a2d.sum(axis=0)) print('sum :',a2d.sum(axis=1)) np.exp(a/100.)/a # Non-vectorised r=np.zeros(a.shape) # create empy array for results for i in range(len(a)): r[i] = np.exp(a[i]/100.)/a[i] r a = np.arange(10, 100, 10) a a[2:9:3] # [start:end:step] a[:3] # last is not included a[-2] # negative index counts from the end x = np.random.rand(6) x xs = np.sort(x) xs xs[1:] - xs[:-1] # [[2, 3.2, 5.5, -6.4, -2.2, 2.4], # [1, 22, 4, 0.1, 5.3, -9], # [3, 1, 2.1, 21, 1.1, -2]] # a[:, 3] # a[1:4, 0:4] # a[1:, 2] a = np.random.randint(1, 100, 6) # array of 6 random integers between 1 and 100 a mask = ( a % 3 == 0 ) # Where divisible by 3 (% is the modulus operator). mask a[mask] a = np.arange(-100, 0, 5).reshape(4, 5) a result = np.zeros(a.shape, dtype=a.dtype) for i in range(a.shape[0]): for j in range(a.shape[1]): if a[i, j] > -90 and a[i, j] < -40: result[i, j] = a[i, j]**2 else: result[i, j] = 1 result condition = (a > -90) & (a < -40) condition result[condition] = a[condition]**2 result[~condition] = 1 print(result) result = np.where(condition, a**2, 1) print(result) a = np.ma.masked_array(data=[1, 2, 3], mask=[True, True, False], fill_value=-999) a a = np.linspace(1, 15, 15) masked_a = np.ma.masked_greater_equal(a, 11) masked_a # Your code: # arr = # Your code: # condition = # masked_arr = np.ma.masked_where(condition, arr) # print(masked_arr) a = np.array([[1, 2, 3], [4, 5, 6]]) print('{} <-- array'.format(a)) print('{} <-- its shape'.format(a.shape)) a.flatten() a.repeat(4) a.reshape((3, 2)) print('Old shape: {}'.format(a.shape)) print('New shape: {}'.format(a.reshape((3, 2)).shape)) a[..., np.newaxis].shape e4 = np.arange(0.,2.5,.1) e4 e4.reshape([5,5]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Vectorised Step2: Creating an array from a list Step3: The core class of NumPy is the ndarray (homogeneous n-dimensional array). Step4: Functions for creating arrays Step5: linspace(start, stop, num=50, endpoint=True, retstep=False, dtype=None) Step6: Filled with zeros Step7: By default, the dtype of the created array is float64 but other dtypes can be used Step8: Filled with ones Step9: Create array with random numbers Step10: Grid generation Step11: Transpose arrays Step12: Array attributes Step13: ndarray.ndim Step14: ndarray.shape Step15: This is a tuple of integers indicating the size of the array in each dimension. For a matrix with n rows and m columns, shape will be (n,m). The length of the shape tuple is therefore the rank, or number of dimensions, ndim. Step16: Note that size is not equal to len(). The latter returns the length of the first dimension. Step17: Statistical methods of arrays Step18: Operations over a given axis Step19: Vectorisation Step20: Vectorization is generally faster than a for loop. Step21: Using indexes Step22: Exercise 1 Step23: Can you guess what the following slices are equal to? Print them to check your understanding. Step24: Fancy indexing Step25: Exercise 2 Step26: Suppose you want to return an array result, which has the squared value when an element in array a is greater than -90 and less than -40, and is 1 otherwise. Step27: But a more less verbose and quicker approach would be Step28: A one-liner using np.where Step29: Masked arrays - how to handle (propagating) missing values Step30: Often, a task is to mask array depending on a criterion. Step31: Exercise 3 Step32: Shape manipulation Step33: Add a dimension Step34: Exercise 4
8,066
<ASSISTANT_TASK:> Python Code: import pandas as pd df = pd.DataFrame({'codes':[[71020], [77085], [36415], [99213, 99287], [99233, 99233, 99233]]}) def g(df): return df.codes.apply(pd.Series).add_prefix('code_') result = g(df.copy()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
8,067
<ASSISTANT_TASK:> Python Code: titles.tail() len(titles) titles.sort(columns='year', ascending=True).head()[:2] titles[titles['title'].str.contains('Hamlet')].sort('year') len(titles[titles.title == 'North by Northwest']) titles[titles['title'] 'Hamlet'].sort('year')[:1] titles[titles.title == 'Treasure Island'].sort('year') len(titles[titles.year == 1950]) movies_of_1960 = titles[titles.year == 1960] len(movies_of_1960) moviesOf1950And1959 = titles[(titles.year >= 1950) & (titles.year <= 1950)] len(moviesOf1950And1959) titles.year.value_counts().sort_index().plot() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: What are the earliest two films listed in the titles dataframe? Step2: How many movies have the title "Hamlet"? Step3: How many movies are titled "North by Northwest"? Step4: When was the first movie titled "Hamlet" made? Step5: List all of the "Treasure Island" movies from earliest to most recent. Step6: How many movies were made in the year 1950? Step7: How many movies were made in the year 1960? Step8: How many movies were made from 1950 through 1959? Step9: In what years has a movie titled "Batman" been released?
8,068
<ASSISTANT_TASK:> Python Code: ### # There is now a 'SparkContext' instance available as the named variable 'sc' # and there is a HiveContext instance (for SQL-like queries) available as 'sqlCtx' # ## Check that this simple code runs without error: sc.parallelize([1,2,3,4,5]).take(2) ### # Inspect the SparkContext [sc] or the HiveContext [sqlCtx] #help(sc) help(sqlCtx) from random import random from operator import add def monte_carlo(_): 4 * area (1 quadrant of a unit circle) pi x = random() y = random() return 4.0 if pow(x, 2) + pow(y, 2) < 1 else 0 N = 1000 parts = 2 sc.parallelize(xrange(N), parts).map(monte_carlo).reduce(add) / N ### ------------------------------------------------- AMAZON ----- ### # ⇒ These files identify columns that will be common to the job # board data and the BLS datasets. # # To use S3 buckets add `--copy-aws-credentials` to the ec2 launch command. # # Create a Resilient Distributed Dataset with the # list of occupations in the BLS dataset: # https://s3.amazonaws.com/tts-wwmm/occupations.txt from pyspark.sql import Row # Load the occupations lookups and convert each line to a Row. lines = sc.textFile('s3n://tts-wwmm/occupations.txt') Occupation = Row('OCC_CODE', 'OCC_TITLE') occ = lines.map(lambda l: Occupation( *l.split('\t') )) # Do the same for the areas lookups. lines = sc.textFile('s3n://tts-wwmm/areas.txt') Area = Row('AREA', 'AREA_NAME') area = lines.map(lambda l: Area( *l.split('\t') )) area_df = sqlCtx.createDataFrame(area) area_df.registerTempTable('area') # Just to show how sqlCtx.sql works states = sqlCtx.sql("SELECT AREA_NAME, AREA FROM area WHERE AREA RLIKE '^S.*'") print states.take(2) # Same as above, but result is another Resilient Distributed Dataset states = area.filter(lambda a: a.AREA.startswith('S')) # Create every combination of occupation, state occ_by_states = occ.cartesian(states) # Broadcast makes a static copy of the variable available to all nodes #broadcast_state_names = sc.broadcast(broadcast_state_names) # #print broadcast_state_names.take(2) ### ----------------------------------------- JOBS_AGGREGATOR ----- ### # # Make `jobs_aggregator_scraper.py` available on all nodes # and iteratively get the top 5 jobs from each poster in each state for # each occupation via JobsAggregator.com sc.addPyFile('s3n://tts-wwmm/jobsaggregator_scraper.py') def scrape_occupation(occ_state): from jobsaggregator_scraper import scrape occ_row, state_entry = occ_state return [Row(**job) for job in scrape(state=state_entry[1], occupation=occ_row.OCC_TITLE)] jobs = occ_by_states.flatMap(scrape_occupation).distinct() jobs_df = sqlCtx.inferSchema(jobs) jobs_df.registerTempTable('jobs') jobs_df.toJSON().saveAsTextFile('wwmm/jobsaggregator_json') jobs.saveAsTextFile('wwmm/jobsaggregator_df') jobs.take(2) ### -------------------------------------------- BLS OES DATA ----- ### # # The OES data were loaded to a mongolabs database. Read the URI # (which has a user name and password) from an environment variable # and create a connection. The pymongo API is very simple. # # Datasets are stored one entry per Occupation ID (OCC_ID) # per area (00-0000) from pymongo import MongoClient MONGO_URI = os.getenv('MONGO_URI') client = MongoClient(MONGO_URI) # connection oe = client.oe # database # Confirm we can get data from each collection oo = oe['nat'].find(filter={'OCC_CODE':'00-0000'}, projection={'_id':False, 'OCC_CODE':True, 'OCC_TITLE':True, 'ANNUAL':{'$slice':-5}, 'OVERALL':{'$slice':-2}}) for o in oo: print o # Which OCC contains software-type people? occ_df = sqlCtx.createDataFrame(occ) occ_df.registerTempTable('occ') computer_jobs = sqlCtx.sql(( "SELECT OCC_CODE, OCC_TITLE " "FROM occ " "WHERE OCC_TITLE RLIKE 'omputer'" )).collect() for row in computer_jobs: print "{OCC_CODE}: {OCC_TITLE}".format(**row.asDict()) # Want Chicago's area code chicago = sqlCtx.sql(( "SELECT AREA, AREA_NAME " "FROM area " "WHERE AREA_NAME RLIKE 'icago' or AREA_NAME RLIKE 'llinois'" )).collect() print "\n".join("{}: {}".format(c.AREA, c.AREA_NAME) for c in chicago) # Now get the data: ## -------------------------------------- National desired_data = {'_id':False, 'ANNUAL':{'$slice':-5}, 'OVERALL':{'$slice':-2}} nat = oe['nat'].find(filter={'OCC_CODE':'15-1131'}, projection=desired_data) nat = [n for n in nat] len(nat) ## -------------------------------------- State il = oe['st'].find(filter={'OCC_CODE':'15-1131', 'AREA':'17'}, projection=desired_data) il = [i for i in il] len(il) ## -------------------------------------- Municipal Areas ## The lookup for chicago didn't work... ## ... so I am looking through all of the municipal areas... chi = oe['ma'].find(filter={'OCC_CODE':'15-1131'}, projection=desired_data) chi = [c for c in chi if 'IL' in c['AREA_NAME']] len(chi) # Get the mean import tablib nat_annual = tablib.Dataset() nat_annual.dict = nat[0]['ANNUAL'] il_annual = tablib.Dataset() il_annual.dict = il[0]['ANNUAL'] chi_annual = tablib.Dataset() chi_annual.dict = chi[1]['ANNUAL'] from lightning import Lightning lgn = Lightning(host="https://tts-lightning.herokuapp.com", ipython=True, auth=("tanya@tickel.net", "password")) # Median salaries lgn.line(series=[nat_annual['pct50'], il_annual['pct50'], chi_annual['pct50']], index=nat_annual['YEAR'], color=[[0,0,0],[255,0,0],[0,155,0]], size=[5,2,2], xaxis="Year", yaxis="Median annual salary") # How about regionally? all_states = oe['st'].find(filter={'OCC_CODE':'15-1131'}, projection={'$_id': False, 'OVERALL':{'$slice':-2}}) all_states = [a for a in all_states] len(all_states) state_abbrs = [a['ST'] for a in all_states] mean_salaries = [a['OVERALL'][0]['A_MEAN'] for a in all_states] num_employed = [a['OVERALL'][0]['TOT_EMP'] for a in all_states] # Mean salaries print "max average salary:", max(mean_salaries) print "Illinois:", mean_salaries[state_abbrs.index('IL')] lgn.map(regions=state_abbrs, values=mean_salaries) # Employees print "Most programmers:", max(num_employed) print "Illinois:", num_employed[state_abbrs.index('IL')] lgn.map(regions=state_abbrs, values=num_employed) salaries = tablib.Dataset(*zip(state_abbrs, mean_salaries), headers=('State', 'Salary')) employees= tablib.Dataset(*zip(state_abbrs, num_employed), headers=('State', 'Employees')) salaries = salaries.sort("Salary", reverse=True) print "\n".join("{s[0]}: {s[1]:0,.0f}".format(s=s) for s in salaries[:5]) employees = employees.sort("Employees", reverse=True) print "\n".join("{e[0]}: {e[1]:0,.0f}".format(e=e) for e in employees[:5]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: De Pie Step3: The data Step4: Scrape JobsAggregator Step5: Load OES Data Step6: Lightning-viz plots for inline D3.js in IPython
8,069
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd import torch softmax_output = load_data() def solve(softmax_output): # def solve(softmax_output): ### BEGIN SOLUTION y = torch.argmin(softmax_output, dim=1).detach() ### END SOLUTION # return y # y = solve(softmax_output) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
8,070
<ASSISTANT_TASK:> Python Code: def funcc(x,xo,g): pr=[] pi=[] pr=gen(x) for i in range(x): pi.append(xo+g*math.tan(math.pi*(pr[i]-(1/2)))) return pi fcc=funcc(x,0,1) for i in range(len(fcc)): print "{0:.2f}".format(fcc[i]) lambda_=1 def funexp(l,x): lmda=[] for i in range(x): lmda.append(l*math.exp(-l*i)) return lmda fprobe=funexp(lambda_,x) def funcexp(x,l): p=[] pi=[] p=gen(x) for i in range(x): pi.append(-math.log10(1-p[i])/l) return pi fcue=funcuanexp(x,lambda_) for i in range(len(fcue)): print "{0:.2f}".format(fcue[i]) %matplotlib inline import matplotlib.pyplot as plt from scipy.integrate import quad import math import numpy as np import scipy as sp x=10 s1=17 s2=27 def gen(x): x0=x*10 x0=((75*x0))%((2**16)+1) Ux=float(x0)/((2**16)+1) return Ux def gena(N): Ux=[] x=0 x0=7 while x<N: x0=((5*x0)+3)%607 x=x+1 Ux.append(float(x0)/607) return Ux p=gen(s1) #funcion de probabilidad binomial def funpb(x,p): y=[] for i in range(x): y.append((math.factorial(x)/(math.factorial(i)*math.factorial(x-i)))*(p**i)*(1-p)**(x-i)) return y fpb=funpb(x,p) #funcion acumulada binomial def funab(): y=[] y.append(fpb[0]) for i in range(x-1): y.append(fpb[i+1]+y[i]) return y fab=funab() plt.plot(fab) #funcion inversa binomial def fib(x): p=[] p=gena(x) pi=[] for i in range(x): for j in range(len(fab)): if p[i]<fab[j]: pi.append(j) break return pi finb=fib(x) print finb p=gen(s2) def funpg(x,p): y=[] for i in range(x+1): y.append(p*(1-p)**(i)) return y fpg=funpg(x,p) def funag(): y=[] y.append(fpg[0]) for i in range(x-1): y.append(fpg[i+1]+y[i]) return y fag=funag() plt.plot(fag) #funcion inversa binomial def fig(x): p=[] p=gena(x) pi=[] for i in range(x): for j in range(len(fag)): if p[i]<fag[j]: pi.append(j) break return pi fing=fig(x) print fing #Funcion de probabilidad Uniforme Discreta def funpun(x): fpu=[] for i in range(x): fpu.append(1/float(x)) return fpu fpu=funpun(x) def funaun(x): facu=[] facu.append(fpu[0]) for i in range(x-1): facu.append(fpu[i+1]+facu[i]) return facu facu=funaun(x) plt.plot(facu) #funcion inversa Uniforme def fiun(x): p=[] p=gena(x) pi=[] for i in range(x): for j in range(len(facu)): if p[i]<facu[j]: pi.append(j) break return pi fing=fiun(x) print fing <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Distribucion Exponencial Step2: Distribuciones Discretas Step3: Distribucion Geometrica Step4: Distribucion Uniforme Discreta
8,071
<ASSISTANT_TASK:> Python Code: from bedrock.client.client import BedrockAPI import requests import pandas import pprint SERVER = "http://localhost:81/" api = BedrockAPI(SERVER) resp = api.ingest("opals.spreadsheet.Spreadsheet.Spreadsheet") if resp.json(): print("Spreadsheet Opal Installed!") else: print("Spreadsheet Opal Not Installed!") resp = api.analytic('opals.stan.Stan.Stan_GLM') if resp.json(): print("Stan_GLM Opal Installed!") else: print("Stan_GLM Opal Not Installed!") resp = api.analytic('opals.select-from-dataframe.SelectByCondition.SelectByCondition') if resp.json(): print("Select-from-dataframe Opal Installed!") else: print("Select-from-dataframe Opal Not Installed!") resp = api.analytic('opals.summarize.Summarize.Summarize') if resp.json(): print("Summarize Opal Installed!") else: print("Summarize Opal Not Installed!") filepath = 'Rand2011PNAS_cooperation_data.csv' datafile = pandas.read_csv('Rand2011PNAS_cooperation_data.csv') datafile.head(10) ingest_id = 'opals.spreadsheet.Spreadsheet.Spreadsheet' resp = api.put_source('Rand2011', ingest_id, 'default', {'file': open(filepath, "rb")}) if resp.status_code == 201: source_id = resp.json()['src_id'] print('Source {0} successfully uploaded'.format(filepath)) else: try: print("Error in Upload: {}".format(resp.json()['msg'])) except Exception: pass try: source_id = resp.json()['src_id'] print("Using existing source. If this is not the desired behavior, upload with a different name.") except Exception: print("No existing source id provided") available_sources = api.list("dataloader", "sources").json() s = next(filter(lambda source: source['src_id'] == source_id, available_sources),'None') if s != 'None': pp = pprint.PrettyPrinter() pp.pprint(s) else: print("Could not find source") resp = api.create_matrix(source_id, 'rand_mtx') mtx = resp[0] matrix_id = mtx['id'] print(mtx) resp analytic_id = "opals.summarize.Summarize.Summarize" inputData = { 'matrix.csv': mtx, 'features.txt': mtx } paramsData = [] summary_mtx = api.run_analytic(analytic_id, mtx, 'rand_mtx_summary', input_data=inputData, parameter_data=paramsData) output = api.download_results_matrix(matrix_id, summary_mtx['id'], 'matrix.csv') output analytic_id = "opals.select-from-dataframe.SelectByCondition.SelectByCondition" inputData = { 'matrix.csv': mtx, 'features.txt': mtx } paramsData = [ {"attrname":"colname","value":"condition"}, {"attrname":"comparator","value":"=="}, {"attrname":"value","value":"Static"} ] filtered_mtx = api.run_analytic(analytic_id, mtx, 'rand_static_only', input_data=inputData, parameter_data=paramsData) filtered_mtx output = api.download_results_matrix('rand_mtx', 'rand_static_only', 'matrix.csv', remote_header_file='features.txt') output analytic_id = "opals.stan.Stan.Stan_GLM" inputData = { 'matrix.csv': filtered_mtx, 'features.txt': filtered_mtx } paramsData = [ {"attrname":"formula","value":"decision0d1c ~ round_num"}, {"attrname":"family","value":'logit'}, {"attrname":"chains","value":"3"}, {"attrname":"iter","value":"3000"} ] result_mtx = api.run_analytic(analytic_id, mtx, 'rand_bayesian1', input_data=inputData, parameter_data=paramsData) result_mtx summary_table = api.download_results_matrix('rand_mtx', 'rand_bayesian1', 'matrix.csv') summary_table prior_summary = api.download_results_matrix('rand_mtx', 'rand_bayesian1', 'prior_summary.txt') print(prior_summary) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Test Connection to Bedrock Server Step2: Check for Spreadsheet Opal Step3: Check for STAN GLM Opal Step4: Check for select-from-dataframe Opal Step5: Check for summarize Opal Step6: Step 2 Step7: Now Upload the source file to the Bedrock Server Step8: Check available data sources for the CSV file Step9: Create a Bedrock Matrix from the CSV Source Step10: Look at basic statistics on the source data Step11: Step 3 Step12: Check that Matrix is filtered Step13: Step 4 Step14: Visualize the output of the analysis
8,072
<ASSISTANT_TASK:> Python Code: import numpy as np from keras.models import Sequential from keras.layers.embeddings import Embedding from keras.layers import Flatten, Activation, Merge from keras.preprocessing.text import Tokenizer from keras.preprocessing.sequence import skipgrams, make_sampling_table from glob import glob text_files = glob('../data/sotu/*.txt') def text_generator(): for path in text_files: with open(path, 'r') as f: yield f.read() len(text_files) # our corpus is small enough where we # don't need to worry about this, but good practice max_vocab_size = 50000 # `filters` specify what characters to get rid of tokenizer = Tokenizer(nb_words=max_vocab_size, filters='!"#$%&()*+,-./:;<=>?@[\\]^_{|}~\t\n\'`“”–') # fit the tokenizer tokenizer.fit_on_texts(text_generator()) # we also want to keep track of the actual vocab size # we'll need this later # note: we add one because `0` is a reserved index in keras' tokenizer vocab_size = len(tokenizer.word_index) + 1 embedding_dim = 256 pivot_model = Sequential() pivot_model.add(Embedding(vocab_size, embedding_dim, input_length=1)) context_model = Sequential() context_model.add(Embedding(vocab_size, embedding_dim, input_length=1)) # merge the pivot and context models model = Sequential() model.add(Merge([pivot_model, context_model], mode='dot', dot_axes=2)) model.add(Flatten()) # the task as we've framed it here is # just binary classification, # so we want the output to be in [0,1], # and we can use binary crossentropy as our loss model.add(Activation('sigmoid')) model.compile(optimizer='adam', loss='binary_crossentropy') n_epochs = 60 # used to sample words (indices) sampling_table = make_sampling_table(vocab_size) for i in range(n_epochs): loss = 0 for seq in tokenizer.texts_to_sequences_generator(text_generator()): # generate skip-gram training examples # - `couples` consists of the pivots (i.e. target words) and surrounding contexts # - `labels` represent if the context is true or not # - `window_size` determines how far to look between words # - `negative_samples` specifies the ratio of negative couples # (i.e. couples where the context is false) # to generate with respect to the positive couples; # i.e. `negative_samples=4` means "generate 4 times as many negative samples" couples, labels = skipgrams(seq, vocab_size, window_size=5, negative_samples=4, sampling_table=sampling_table) if couples: pivot, context = zip(*couples) pivot = np.array(pivot, dtype='int32') context = np.array(context, dtype='int32') labels = np.array(labels, dtype='int32') loss += model.train_on_batch([pivot, context], labels) print('epoch %d, %0.02f'%(i, loss)) embeddings = model.get_weights()[0] word_index = tokenizer.word_index reverse_word_index = {v: k for k, v in word_index.items()} def get_embedding(word): idx = word_index[word] # make it 2d return embeddings[idx][:,np.newaxis].T from scipy.spatial.distance import cdist ignore_n_most_common = 50 def get_closest(word): embedding = get_embedding(word) # get the distance from the embedding # to every other embedding distances = cdist(embedding, embeddings)[0] # pair each embedding index and its distance distances = list(enumerate(distances)) # sort from closest to furthest distances = sorted(distances, key=lambda d: d[1]) # skip the first one; it's the target word for idx, dist in distances[1:]: # ignore the n most common words; # they can get in the way. # because the tokenizer organized indices # from most common to least, we can just do this if idx > ignore_n_most_common: return reverse_word_index[idx] print(get_closest('freedom')) print(get_closest('justice')) print(get_closest('america')) print(get_closest('citizens')) print(get_closest('citizen')) from gensim.models.doc2vec import Word2Vec with open('embeddings.dat', 'w') as f: f.write('{} {}'.format(vocab_size, embedding_dim)) for word, idx in word_index.items(): embedding = ' '.join(str(d) for d in embeddings[idx]) f.write('\n{} {}'.format(word, embedding)) w2v = Word2Vec.load_word2vec_format('embeddings.dat', binary=False) print(w2v.most_similar(positive=['freedom'])) from sklearn.manifold import TSNE # `n_components` is the number of dimensions to reduce to tsne = TSNE(n_components=2) # apply the dimensionality reduction # to our embeddings to get our 2d points points = tsne.fit_transform(embeddings) print(points) import matplotlib matplotlib.use('Agg') # for pngs import matplotlib.pyplot as plt # plot our results # make it quite big so we can see everything fig, ax = plt.subplots(figsize=(40, 20)) # extract x and y values separately xs = points[:,0] ys = points[:,1] # plot the points # we don't actually care about the point markers, # just want to automatically set the bounds of the plot ax.scatter(xs, ys, alpha=0) # annotate each point with its word for i, point in enumerate(points): ax.annotate(reverse_word_index.get(i), (xs[i], ys[i]), fontsize=8) plt.savefig('tsne.png') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Then load in our data. We're actually going to define a generator to load our data in on-demand; this way we'll avoid having all our data sitting around in memory when we don't need it. Step2: Before we go any further, we need to map the words in our corpus to numbers, so that we have a consistent way of referring to them. First we'll fit a tokenizer to the corpus Step3: Now the tokenizer knows what tokens (words) are in our corpus and has mapped them to numbers. The keras tokenizer also indexes them in order of frequency (most common first, i.e. index 1 is usually a word like "the"), which will come in handy later. Step4: Now let's define the model. When I described the skip-gram task, I mentioned two inputs Step5: Finally, we can train the model. Step6: With any luck, the model should finish training without a hitch. Step7: We also want to set aside the tokenizer's word index for later use (so we can get indices for words) and also create a reverse word index (so we can get words from indices) Step8: That's it for learning the embeddings. Now we can try using them. Step9: Then we can define a function to get a most similar word for an input word Step10: Now let's give it a try (you may get different results) Step11: For the most part, we seem to be getting related words! Step12: t-SNE Step13: And now let's plot it out
8,073
<ASSISTANT_TASK:> Python Code: from urllib.request import urlretrieve from os.path import isfile, isdir from tqdm import tqdm vgg_dir = 'tensorflow_vgg/' # Make sure vgg exists if not isdir(vgg_dir): raise Exception("VGG directory doesn't exist!") class DLProgress(tqdm): last_block = 0 def hook(self, block_num=1, block_size=1, total_size=None): self.total = total_size self.update((block_num - self.last_block) * block_size) self.last_block = block_num if not isfile(vgg_dir + "vgg16.npy"): with DLProgress(unit='B', unit_scale=True, miniters=1, desc='VGG16 Parameters') as pbar: urlretrieve( 'https://s3.amazonaws.com/content.udacity-data.com/nd101/vgg16.npy', vgg_dir + 'vgg16.npy', pbar.hook) else: print("Parameter file already exists!") import tarfile dataset_folder_path = 'flower_photos' class DLProgress(tqdm): last_block = 0 def hook(self, block_num=1, block_size=1, total_size=None): self.total = total_size self.update((block_num - self.last_block) * block_size) self.last_block = block_num if not isfile('flower_photos.tar.gz'): with DLProgress(unit='B', unit_scale=True, miniters=1, desc='Flowers Dataset') as pbar: urlretrieve( 'http://download.tensorflow.org/example_images/flower_photos.tgz', 'flower_photos.tar.gz', pbar.hook) if not isdir(dataset_folder_path): with tarfile.open('flower_photos.tar.gz') as tar: tar.extractall() tar.close() import os import numpy as np import tensorflow as tf from tensorflow_vgg import vgg16 from tensorflow_vgg import utils data_dir = 'flower_photos/' contents = os.listdir(data_dir) classes = [each for each in contents if os.path.isdir(data_dir + each)] classes classes t = [[1,1], [2,2], [3,3], [4,4]] np.concatenate(t) next(enumerate(os.listdir(data_dir+'roses')), 1) # Set the batch size higher if you can fit in in your GPU memory batch_size = 16 codes_list = [] labels = [] batch = [] codes = None with tf.Session() as sess: # TODO: Build the vgg network here vgg = vgg16.Vgg16() input_ = tf.placeholder(tf.float32, [None, 224, 224, 3]) with tf.name_scope("content_vgg"): vgg.build(input_) for each in classes: print("Starting {} images".format(each)) class_path = data_dir + each files = os.listdir(class_path) for ii, file in enumerate(files, 1): # Add images to the current batch # utils.load_image crops the input images for us, from the center img = utils.load_image(os.path.join(class_path, file)) batch.append(img.reshape((1, 224, 224, 3))) labels.append(each) # Running the batch through the network to get the codes if ii % batch_size == 0 or ii == len(files): # Image batch to pass to VGG network images = np.concatenate(batch) # TODO: Get the values from the relu6 layer of the VGG network feed_dict = {input_: images} codes_batch = sess.run(vgg.relu6, feed_dict=feed_dict) # Here I'm building an array of the codes if codes is None: codes = codes_batch else: codes = np.concatenate((codes, codes_batch)) # Reset to start building the next batch batch = [] print('{} images processed'.format(ii)) # write codes to file with open('codes', 'w') as f: codes.tofile(f) # write labels to file import csv with open('labels', 'w') as f: writer = csv.writer(f, delimiter='\n') writer.writerow(labels) # read codes and labels from file import csv with open('labels') as f: reader = csv.reader(f, delimiter='\n') labels = np.array([each for each in reader if len(each) > 0]).squeeze() with open('codes') as f: codes = np.fromfile(f, dtype=np.float32) codes = codes.reshape((len(labels), -1)) codes[:5] from sklearn import preprocessing as pp lb = pp.LabelBinarizer() lb.fit(labels) labels_vecs = lb.transform(labels) # Your one-hot encoded labels array here from sklearn.model_selection import StratifiedShuffleSplit ss = StratifiedShuffleSplit(n_splits=1, test_size=0.2) splitter = ss.split(codes, labels_vecs) train_index, test_index = next(splitter) print(len(train_index), len(test_index)) train_x, train_y = codes[train_index], labels_vecs[train_index] other_x, other_y = codes[test_index], labels_vecs[test_index] mid_other = len(other_x) // 2 val_x, val_y = other_x[:mid_other], other_y[:mid_other] test_x, test_y = other_x[mid_other:], other_y[mid_other:] print("Train shapes (x, y):", train_x.shape, train_y.shape) print("Validation shapes (x, y):", val_x.shape, val_y.shape) print("Test shapes (x, y):", test_x.shape, test_y.shape) inputs_ = tf.placeholder(tf.float32, shape=[None, codes.shape[1]]) labels_ = tf.placeholder(tf.int64, shape=[None, labels_vecs.shape[1]]) # TODO: Classifier layers and operations fc = tf.contrib.layers.fully_connected(inputs_, 256) logits = tf.contrib.layers.fully_connected(fc, labels_vecs.shape[1], activation_fn=None) cost = tf.reduce_mean(tf.nn.softmax_cross_entropy_with_logits(logits=logits, labels=labels_)) optimizer = tf.train.AdamOptimizer().minimize(cost) # Operations for validation/test accuracy predicted = tf.nn.softmax(logits) correct_pred = tf.equal(tf.argmax(predicted, 1), tf.argmax(labels_, 1)) accuracy = tf.reduce_mean(tf.cast(correct_pred, tf.float32)) def get_batches(x, y, n_batches=10): Return a generator that yields batches from arrays x and y. batch_size = len(x)//n_batches for ii in range(0, n_batches*batch_size, batch_size): # If we're not on the last batch, grab data with size batch_size if ii != (n_batches-1)*batch_size: X, Y = x[ii: ii+batch_size], y[ii: ii+batch_size] # On the last batch, grab the rest of the data else: X, Y = x[ii:], y[ii:] # I love generators yield X, Y for x,y in get_batches(codes, labels_vecs, n_batches=2935): print(x[0]) print(y[0]) # Hyperparameters epochs = 20 iteration = 0 number_of_batches = 10 saver = tf.train.Saver() with tf.Session() as sess: # TODO: Your training code here sess.run(tf.global_variables_initializer()) for epoch in range(epochs): # Loop over all batches for batch_x, batch_y in get_batches(train_x, train_y, n_batches=number_of_batches): feed = {inputs_: batch_x, labels_: batch_y} _, cost = sess.run([optimizer, cost], feed_dict = feed) iteration += 1 print("Epoch: {}/{}".format(epoch+1, epochs), "Iteration: {}".format(iteration), "Training loss: {:.5f}".format(cost)) if iteration % 5 == 0: feed = {inputs_: val_x, labels_: val_y} val_acc = sess.run(accuracy, feed_dict=feed) print("Epoch: {}/{}".format(epoch+1, epochs), "Iteration: {}".format(iteration), "Validation Acc: {:.4f}".format(val_acc)) # Save Model saver.save(sess, "checkpoints/flowers.ckpt") with tf.Session() as sess: saver.restore(sess, tf.train.latest_checkpoint('checkpoints')) feed = {inputs_: test_x, labels_: test_y} test_acc = sess.run(accuracy, feed_dict=feed) print("Test accuracy: {:.4f}".format(test_acc)) %matplotlib inline import matplotlib.pyplot as plt from scipy.ndimage import imread test_img_path = 'flower_photos/roses/10894627425_ec76bbc757_n.jpg' test_img = imread(test_img_path) plt.imshow(test_img) # Run this cell if you don't have a vgg graph built if 'vgg' in globals(): print('"vgg" object already exists. Will not create again.') else: #create vgg with tf.Session() as sess: input_ = tf.placeholder(tf.float32, [None, 224, 224, 3]) vgg = vgg16.Vgg16() vgg.build(input_) with tf.Session() as sess: img = utils.load_image(test_img_path) img = img.reshape((1, 224, 224, 3)) feed_dict = {input_: img} code = sess.run(vgg.relu6, feed_dict=feed_dict) saver = tf.train.Saver() with tf.Session() as sess: saver.restore(sess, tf.train.latest_checkpoint('checkpoints')) feed = {inputs_: code} prediction = sess.run(predicted, feed_dict=feed).squeeze() plt.imshow(test_img) plt.barh(np.arange(5), prediction) _ = plt.yticks(np.arange(5), lb.classes_) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Flower power Step2: ConvNet Codes Step3: Below I'm running images through the VGG network in batches. Step4: Building the Classifier Step5: Data prep Step6: Now you'll want to create your training, validation, and test sets. An important thing to note here is that our labels and data aren't randomized yet. We'll want to shuffle our data so the validation and test sets contain data from all classes. Otherwise, you could end up with testing sets that are all one class. Typically, you'll also want to make sure that each smaller set has the same the distribution of classes as it is for the whole data set. The easiest way to accomplish both these goals is to use StratifiedShuffleSplit from scikit-learn. Step7: If you did it right, you should see these sizes for the training sets Step9: Batches! Step10: Training Step11: Testing Step12: Below, feel free to choose images and see how the trained classifier predicts the flowers in them.
8,074
<ASSISTANT_TASK:> Python Code: # Copyright 2019 The TensorFlow Hub Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== %%capture #@title Setup Environment # Install the latest Tensorflow version. !pip install -q tensorflow_text !pip install -q simpleneighbors[annoy] !pip install -q nltk !pip install -q tqdm #@title Setup common imports and functions import json import nltk import os import pprint import random import simpleneighbors import urllib from IPython.display import HTML, display from tqdm.notebook import tqdm import tensorflow.compat.v2 as tf import tensorflow_hub as hub from tensorflow_text import SentencepieceTokenizer nltk.download('punkt') def download_squad(url): return json.load(urllib.request.urlopen(url)) def extract_sentences_from_squad_json(squad): all_sentences = [] for data in squad['data']: for paragraph in data['paragraphs']: sentences = nltk.tokenize.sent_tokenize(paragraph['context']) all_sentences.extend(zip(sentences, [paragraph['context']] * len(sentences))) return list(set(all_sentences)) # remove duplicates def extract_questions_from_squad_json(squad): questions = [] for data in squad['data']: for paragraph in data['paragraphs']: for qas in paragraph['qas']: if qas['answers']: questions.append((qas['question'], qas['answers'][0]['text'])) return list(set(questions)) def output_with_highlight(text, highlight): output = "<li> " i = text.find(highlight) while True: if i == -1: output += text break output += text[0:i] output += '<b>'+text[i:i+len(highlight)]+'</b>' text = text[i+len(highlight):] i = text.find(highlight) return output + "</li>\n" def display_nearest_neighbors(query_text, answer_text=None): query_embedding = model.signatures['question_encoder'](tf.constant([query_text]))['outputs'][0] search_results = index.nearest(query_embedding, n=num_results) if answer_text: result_md = ''' <p>Random Question from SQuAD:</p> <p>&nbsp;&nbsp;<b>%s</b></p> <p>Answer:</p> <p>&nbsp;&nbsp;<b>%s</b></p> ''' % (query_text , answer_text) else: result_md = ''' <p>Question:</p> <p>&nbsp;&nbsp;<b>%s</b></p> ''' % query_text result_md += ''' <p>Retrieved sentences : <ol> ''' if answer_text: for s in search_results: result_md += output_with_highlight(s, answer_text) else: for s in search_results: result_md += '<li>' + s + '</li>\n' result_md += "</ol>" display(HTML(result_md)) #@title Download and extract SQuAD data squad_url = 'https://rajpurkar.github.io/SQuAD-explorer/dataset/dev-v1.1.json' #@param ["https://rajpurkar.github.io/SQuAD-explorer/dataset/train-v2.0.json", "https://rajpurkar.github.io/SQuAD-explorer/dataset/dev-v2.0.json", "https://rajpurkar.github.io/SQuAD-explorer/dataset/train-v1.1.json", "https://rajpurkar.github.io/SQuAD-explorer/dataset/dev-v1.1.json"] squad_json = download_squad(squad_url) sentences = extract_sentences_from_squad_json(squad_json) questions = extract_questions_from_squad_json(squad_json) print("%s sentences, %s questions extracted from SQuAD %s" % (len(sentences), len(questions), squad_url)) print("\nExample sentence and context:\n") sentence = random.choice(sentences) print("sentence:\n") pprint.pprint(sentence[0]) print("\ncontext:\n") pprint.pprint(sentence[1]) print() #@title Load model from tensorflow hub module_url = "https://tfhub.dev/google/universal-sentence-encoder-multilingual-qa/3" #@param ["https://tfhub.dev/google/universal-sentence-encoder-multilingual-qa/3", "https://tfhub.dev/google/universal-sentence-encoder-qa/3"] model = hub.load(module_url) #@title Compute embeddings and build simpleneighbors index batch_size = 100 encodings = model.signatures['response_encoder']( input=tf.constant([sentences[0][0]]), context=tf.constant([sentences[0][1]])) index = simpleneighbors.SimpleNeighbors( len(encodings['outputs'][0]), metric='angular') print('Computing embeddings for %s sentences' % len(sentences)) slices = zip(*(iter(sentences),) * batch_size) num_batches = int(len(sentences) / batch_size) for s in tqdm(slices, total=num_batches): response_batch = list([r for r, c in s]) context_batch = list([c for r, c in s]) encodings = model.signatures['response_encoder']( input=tf.constant(response_batch), context=tf.constant(context_batch) ) for batch_index, batch in enumerate(response_batch): index.add_one(batch, encodings['outputs'][batch_index]) index.build() print('simpleneighbors index for %s sentences built.' % len(sentences)) #@title Retrieve nearest neighbors for a random question from SQuAD num_results = 25 #@param {type:"slider", min:5, max:40, step:1} query = random.choice(questions) display_nearest_neighbors(query[0], query[1]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 多言語ユニバーサルセンテンスエンコーダーの Q&amp;A と取得 Step2: 次のコードブロックを実行して、SQuAD データセットを次のように抽出します。 Step3: 次のコードブロックは、Univeral Encoder Multilingual Q&amp;A モデルの question_encoder と response_encoder シグネチャを使用して、TensorFlow グラフ g と session をセットアップします。 Step4: 次のコードブロックは、response_encoder を使用して、すべてのテキストの埋め込みを計算し、タプルのコンテキストを形成し、simpleneighbors インデックスに格納します。 Step5: 取得時、質問は question_encoder でエンコードされ、質問の埋め込みを使って simpleneighbors インデックスがクエリされます。
8,075
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'mri', 'sandbox-1', 'atmoschem') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.chemistry_scheme_scope') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "troposhere" # "stratosphere" # "mesosphere" # "mesosphere" # "whole atmosphere" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.basic_approximations') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.prognostic_variables_form') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "3D mass/mixing ratio for gas" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.number_of_tracers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.family_approach') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.coupling_with_chemical_reactivity') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Operator splitting" # "Integrated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_advection_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_physical_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_chemistry_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_alternate_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.integrated_timestep') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.integrated_scheme_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Implicit" # "Semi-implicit" # "Semi-analytic" # "Impact solver" # "Back Euler" # "Newton Raphson" # "Rosenbrock" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.turbulence') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.convection') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.precipitation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.emissions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.gas_phase_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.tropospheric_heterogeneous_phase_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.stratospheric_heterogeneous_phase_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.photo_chemistry') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.timestep_framework.split_operator_order.aerosols') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.global_mean_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.regional_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.key_properties.tuning_applied.trend_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.matches_atmosphere_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.grid.resolution.is_adaptive_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.transport.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.transport.use_atmospheric_transport') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.transport.transport_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.sources') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Vegetation" # "Soil" # "Sea surface" # "Anthropogenic" # "Biomass burning" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Climatology" # "Spatially uniform mixing ratio" # "Spatially uniform concentration" # "Interactive" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.prescribed_climatology_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.prescribed_spatially_uniform_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.interactive_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.surface_emissions.other_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.sources') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Aircraft" # "Biomass burning" # "Lightning" # "Volcanos" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Climatology" # "Spatially uniform mixing ratio" # "Spatially uniform concentration" # "Interactive" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.prescribed_climatology_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.prescribed_spatially_uniform_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.interactive_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.atmospheric_emissions.other_emitted_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.concentrations.prescribed_lower_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.emissions_concentrations.concentrations.prescribed_upper_boundary') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "HOx" # "NOy" # "Ox" # "Cly" # "HSOx" # "Bry" # "VOCs" # "isoprene" # "H2O" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_bimolecular_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_termolecular_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_tropospheric_heterogenous_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_stratospheric_heterogenous_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_advected_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.number_of_steady_state_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.interactive_dry_deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.wet_deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.gas_phase_chemistry.wet_oxidation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.gas_phase_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Cly" # "Bry" # "NOy" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.aerosol_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sulphate" # "Polar stratospheric ice" # "NAT (Nitric acid trihydrate)" # "NAD (Nitric acid dihydrate)" # "STS (supercooled ternary solution aerosol particule))" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.number_of_steady_state_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.sedimentation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.stratospheric_heterogeneous_chemistry.coagulation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.gas_phase_species') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.aerosol_species') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sulphate" # "Nitrate" # "Sea salt" # "Dust" # "Ice" # "Organic" # "Black carbon/soot" # "Polar stratospheric ice" # "Secondary organic aerosols" # "Particulate organic matter" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.number_of_steady_state_species') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.interactive_dry_deposition') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.tropospheric_heterogeneous_chemistry.coagulation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.number_of_reactions') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.photolysis.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Offline (clear sky)" # "Offline (with clouds)" # "Online" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmoschem.photo_chemistry.photolysis.environmental_conditions') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Chemistry Scheme Scope Step7: 1.4. Basic Approximations Step8: 1.5. Prognostic Variables Form Step9: 1.6. Number Of Tracers Step10: 1.7. Family Approach Step11: 1.8. Coupling With Chemical Reactivity Step12: 2. Key Properties --&gt; Software Properties Step13: 2.2. Code Version Step14: 2.3. Code Languages Step15: 3. Key Properties --&gt; Timestep Framework Step16: 3.2. Split Operator Advection Timestep Step17: 3.3. Split Operator Physical Timestep Step18: 3.4. Split Operator Chemistry Timestep Step19: 3.5. Split Operator Alternate Order Step20: 3.6. Integrated Timestep Step21: 3.7. Integrated Scheme Type Step22: 4. Key Properties --&gt; Timestep Framework --&gt; Split Operator Order Step23: 4.2. Convection Step24: 4.3. Precipitation Step25: 4.4. Emissions Step26: 4.5. Deposition Step27: 4.6. Gas Phase Chemistry Step28: 4.7. Tropospheric Heterogeneous Phase Chemistry Step29: 4.8. Stratospheric Heterogeneous Phase Chemistry Step30: 4.9. Photo Chemistry Step31: 4.10. Aerosols Step32: 5. Key Properties --&gt; Tuning Applied Step33: 5.2. Global Mean Metrics Used Step34: 5.3. Regional Metrics Used Step35: 5.4. Trend Metrics Used Step36: 6. Grid Step37: 6.2. Matches Atmosphere Grid Step38: 7. Grid --&gt; Resolution Step39: 7.2. Canonical Horizontal Resolution Step40: 7.3. Number Of Horizontal Gridpoints Step41: 7.4. Number Of Vertical Levels Step42: 7.5. Is Adaptive Grid Step43: 8. Transport Step44: 8.2. Use Atmospheric Transport Step45: 8.3. Transport Details Step46: 9. Emissions Concentrations Step47: 10. Emissions Concentrations --&gt; Surface Emissions Step48: 10.2. Method Step49: 10.3. Prescribed Climatology Emitted Species Step50: 10.4. Prescribed Spatially Uniform Emitted Species Step51: 10.5. Interactive Emitted Species Step52: 10.6. Other Emitted Species Step53: 11. Emissions Concentrations --&gt; Atmospheric Emissions Step54: 11.2. Method Step55: 11.3. Prescribed Climatology Emitted Species Step56: 11.4. Prescribed Spatially Uniform Emitted Species Step57: 11.5. Interactive Emitted Species Step58: 11.6. Other Emitted Species Step59: 12. Emissions Concentrations --&gt; Concentrations Step60: 12.2. Prescribed Upper Boundary Step61: 13. Gas Phase Chemistry Step62: 13.2. Species Step63: 13.3. Number Of Bimolecular Reactions Step64: 13.4. Number Of Termolecular Reactions Step65: 13.5. Number Of Tropospheric Heterogenous Reactions Step66: 13.6. Number Of Stratospheric Heterogenous Reactions Step67: 13.7. Number Of Advected Species Step68: 13.8. Number Of Steady State Species Step69: 13.9. Interactive Dry Deposition Step70: 13.10. Wet Deposition Step71: 13.11. Wet Oxidation Step72: 14. Stratospheric Heterogeneous Chemistry Step73: 14.2. Gas Phase Species Step74: 14.3. Aerosol Species Step75: 14.4. Number Of Steady State Species Step76: 14.5. Sedimentation Step77: 14.6. Coagulation Step78: 15. Tropospheric Heterogeneous Chemistry Step79: 15.2. Gas Phase Species Step80: 15.3. Aerosol Species Step81: 15.4. Number Of Steady State Species Step82: 15.5. Interactive Dry Deposition Step83: 15.6. Coagulation Step84: 16. Photo Chemistry Step85: 16.2. Number Of Reactions Step86: 17. Photo Chemistry --&gt; Photolysis Step87: 17.2. Environmental Conditions
8,076
<ASSISTANT_TASK:> Python Code: #|export class MCDropoutCallback(Callback): def before_validate(self): for m in [m for m in flatten_model(self.model) if 'dropout' in m.__class__.__name__.lower()]: m.train() def after_validate(self): for m in [m for m in flatten_model(self.model) if 'dropout' in m.__class__.__name__.lower()]: m.eval() learn = synth_learner() # Call get_preds 10 times, then stack the predictions, yielding a tensor with shape [# of samples, batch_size, ...] dist_preds = [] for i in range(10): preds, targs = learn.get_preds(cbs=[MCDropoutCallback()]) dist_preds += [preds] torch.stack(dist_preds).shape #|hide from nbdev.export import notebook2script notebook2script() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Export -
8,077
<ASSISTANT_TASK:> Python Code: import numpy as np from matplotlib.pyplot import figure, plot, show, title, xlabel, ylabel from landlab import RasterModelGrid from landlab.components import FlowDirectorSteepest, TransportLengthHillslopeDiffuser from landlab.plot import imshow_grid # to plot figures in the notebook: %matplotlib inline mg = RasterModelGrid( (20, 20), xy_spacing=50.0) # raster grid with 20 rows, 20 columns and dx=50m z = np.random.rand(mg.size('node')) # random noise for initial topography mg.add_field("topographic__elevation", z, at="node") mg.set_closed_boundaries_at_grid_edges( False, True, False, True) # N and S boundaries are closed, E and W are open total_t = 2000000.0 # total run time (yr) dt = 1000.0 # time step (yr) nt = int(total_t // dt) # number of time steps uplift_rate = 0.0001 # uplift rate (m/yr) kappa = 0.001 # erodibility (m/yr) Sc = 0.6 # critical slope fdir = FlowDirectorSteepest(mg) tl_diff = TransportLengthHillslopeDiffuser(mg, erodibility=kappa, slope_crit=Sc) for t in range(nt): fdir.run_one_step() tl_diff.run_one_step(dt) z[mg.core_nodes] += uplift_rate * dt # add the uplift # add some output to let us see we aren't hanging: if t % 100 == 0: print(t * dt) # plot east-west cross-section of topography: x_plot = range(0, 1000, 50) z_plot = z[100:120] figure("cross-section") plot(x_plot, z_plot) figure("cross-section") title("East-West cross section") xlabel("x (m)") ylabel("z (m)") figure("final topography") im = imshow_grid(mg, "topographic__elevation", grid_units=["m", "m"], var_name="Elevation (m)") # Create grid and topographic elevation field: mg2 = RasterModelGrid((20, 20), xy_spacing=50.0) z = np.zeros(mg2.number_of_nodes) z[mg2.node_x > 500] = mg2.node_x[mg2.node_x > 500] / 10 mg2.add_field("topographic__elevation", z, at="node") # Set boundary conditions: mg2.set_closed_boundaries_at_grid_edges(False, True, False, True) # Show initial topography: im = imshow_grid(mg2, "topographic__elevation", grid_units=["m", "m"], var_name="Elevation (m)") # Plot an east-west cross-section of the initial topography: z_plot = z[100:120] x_plot = range(0, 1000, 50) figure(2) plot(x_plot, z_plot) title("East-West cross section") xlabel("x (m)") ylabel("z (m)") total_t = 1000000.0 # total run time (yr) dt = 1000.0 # time step (yr) nt = int(total_t // dt) # number of time steps fdir = FlowDirectorSteepest(mg2) tl_diff = TransportLengthHillslopeDiffuser(mg2, erodibility=0.001, slope_crit=0.6) for t in range(nt): fdir.run_one_step() tl_diff.run_one_step(dt) # add some output to let us see we aren't hanging: if t % 100 == 0: print(t * dt) z_plot = z[100:120] figure(2) plot(x_plot, z_plot) # Import Linear diffuser: from landlab.components import LinearDiffuser # Create grid and topographic elevation field: mg3 = RasterModelGrid((20, 20), xy_spacing=50.0) z = np.ones(mg3.number_of_nodes) z[mg.node_x > 500] = mg.node_x[mg.node_x > 500] / 10 mg3.add_field("topographic__elevation", z, at="node") # Set boundary conditions: mg3.set_closed_boundaries_at_grid_edges(False, True, False, True) # Instantiate components: fdir = FlowDirectorSteepest(mg3) diff = LinearDiffuser(mg3, linear_diffusivity=0.1) # Set run conditions: total_t = 1000000.0 dt = 1000.0 nt = int(total_t // dt) # Run for 1 Myr, plotting east-west cross-section regularly: for t in range(nt): fdir.run_one_step() diff.run_one_step(dt) # add some output to let us see we aren't hanging: if t % 100 == 0: print(t * dt) z_plot = z[100:120] figure(2) plot(x_plot, z_plot) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Make a grid and set boundary conditions Step2: Set the initial and run conditions Step3: Instantiate the components Step4: Run the components for 2 Myr and trace an East-West cross-section of the topography every 100 kyr Step5: And plot final topography Step6: This behaviour corresponds to the evolution observed using a classical non-linear diffusion model. Step7: Set the run conditions Step8: Instantiate the components Step9: Run for 1 Myr, plotting the cross-section regularly Step10: The material is diffused from the top and along the slope and it accumulates at the bottom, where the topography flattens.
8,078
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np import statsmodels.api as sm import matplotlib.pyplot as plt %matplotlib inline df_adv = pd.read_csv('http://www-bcf.usc.edu/~gareth/ISL/Advertising.csv', index_col=0) X = df_adv[['TV', 'Radio']] y = df_adv['Sales'] df_adv.head() X = df_adv[['TV', 'Radio']] y = df_adv['Sales'] ## fit a OLS model with intercept on TV and Radio X = sm.add_constant(X) est = sm.OLS(y, X).fit() est.summary() # import formula api as alias smf import statsmodels.formula.api as smf # formula: response ~ predictor + predictor est = smf.ols(formula='Sales ~ TV + Radio', data=df_adv).fit() import pandas as pd df = pd.read_csv('http://statweb.stanford.edu/~tibs/ElemStatLearn/datasets/SAheart.data', index_col=0) # copy data and separate predictors and response X = df.copy() y = X.pop('chd') df.head() # compute percentage of chronic heart disease for famhist y.groupby(X.famhist).mean() import statsmodels.formula.api as smf # encode df.famhist as a numeric via pd.Factor df['famhist_ord'] = pd.Categorical(df.famhist).labels est = smf.ols(formula="chd ~ famhist_ord", data=df).fit() df = pd.read_csv('https://raw.githubusercontent.com/statsmodels/statsmodels/master/statsmodels/datasets/randhie/src/randhie.csv') df["logincome"] = np.log1p(df.income) df[['mdvis', 'logincome', 'hlthp']].tail() plt.scatter(df.logincome, df.mdvis, alpha=0.3) plt.xlabel('Log income') plt.ylabel('Number of visits') income_linspace = np.linspace(df.logincome.min(), df.logincome.max(), 100) est = smf.ols(formula='mdvis ~ logincome + hlthp', data=df).fit() plt.plot(income_linspace, est.params[0] + est.params[1] * income_linspace + est.params[2] * 0, 'r') plt.plot(income_linspace, est.params[0] + est.params[1] * income_linspace + est.params[2] * 1, 'g') short_summary(est) plt.scatter(df.logincome, df.mdvis, alpha=0.3) plt.xlabel('Log income') plt.ylabel('Number of visits') est = smf.ols(formula='mdvis ~ hlthp * logincome', data=df).fit() plt.plot(income_linspace, est.params[0] + est.params[1] * 0 + est.params[2] * income_linspace + est.params[3] * 0 * income_linspace, 'r') plt.plot(income_linspace, est.params[0] + est.params[1] * 1 + est.params[2] * income_linspace + est.params[3] * 1 * income_linspace, 'g') short_summary(est) # load the boston housing dataset - median house values in the Boston area df = pd.read_csv('http://vincentarelbundock.github.io/Rdatasets/csv/MASS/Boston.csv') # plot lstat (% lower status of the population) against median value plt.figure(figsize=(6 * 1.618, 6)) plt.scatter(df.lstat, df.medv, s=10, alpha=0.3) plt.xlabel('lstat') plt.ylabel('medv') # points linearlyd space on lstats x = pd.DataFrame({'lstat': np.linspace(df.lstat.min(), df.lstat.max(), 100)}) # 1-st order polynomial poly_1 = smf.ols(formula='medv ~ 1 + lstat', data=df).fit() plt.plot(x.lstat, poly_1.predict(x), 'b-', label='Poly n=1 $R^2$=%.2f' % poly_1.rsquared, alpha=0.9) # 2-nd order polynomial poly_2 = smf.ols(formula='medv ~ 1 + lstat + I(lstat ** 2.0)', data=df).fit() plt.plot(x.lstat, poly_2.predict(x), 'g-', label='Poly n=2 $R^2$=%.2f' % poly_2.rsquared, alpha=0.9) # 3-rd order polynomial poly_3 = smf.ols(formula='medv ~ 1 + lstat + I(lstat ** 2.0) + I(lstat ** 3.0)', data=df).fit() plt.plot(x.lstat, poly_3.predict(x), 'r-', alpha=0.9, label='Poly n=3 $R^2$=%.2f' % poly_3.rsquared) plt.legend() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The multiple regression model describes the response as a weighted sum of the predictors Step2: You can also use the formulaic interface of statsmodels to compute regression with multiple predictors. You just need append the predictors to the formula via a '+' symbol. Step3: Handling Categorical Variables Step4: The variable famhist holds if the patient has a family history of coronary artery disease. The percentage of the response chd (chronic heart disease ) for patients with absent/present family history of coronary artery disease is Step5: These two levels (absent/present) have a natural ordering to them, so we can perform linear regression on them, after we convert them to numeric. This can be done using pd.Categorical. Step6: There are several possible approaches to encode categorical values, and statsmodels has built-in support for many of them. In general these work by splitting a categorical variable into many different binary variables. The simplest way to encode categoricals is "dummy-encoding" which encodes a k-level categorical variable into k-1 binary variables. In statsmodels this is done easily using the C() function. Step7: Because hlthp is a binary variable we can visualize the linear regression model by plotting two lines Step8: Notice that the two lines are parallel. This is because the categorical variable affects only the intercept and not the slope (which is a function of logincome). Step9: The * in the formula means that we want the interaction term in addition each term separately (called main-effects). If you want to include just an interaction, use
8,079
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import numpy as np iso_120_gas07 = np.genfromtxt('data/dmestar_00120.0myr_z+0.00_a+0.00_marcs.iso') iso_600_gas07 = np.genfromtxt('data/isochrone_600.0myr_z+0.15_a+0.00_marcs.iso') iso_120_mixed = np.genfromtxt('data/dmestar_00120.0myr_z+0.00_a+0.00_mixed.iso') iso_emp_k14 = np.genfromtxt('data/Kamai_Pleiades_emp.iso') pleiades_s07 = np.genfromtxt('data/Stauffer_Pleiades_litPhot.txt', usecols=(2, 3, 5, 6, 8, 9, 13, 14, 15)) pleiades_k14 = np.genfromtxt('data/Kamai_Pleiades_cmd.dat', usecols=(0, 1, 2, 3, 4, 5)) praesepe_u79 = np.genfromtxt('data/Upgren_Praesepe.txt', usecols=(3, 4)) praesepe_w81 = np.genfromtxt('data/Weis_Praesepe.txt', usecols=(3, 4)) praesepe_s82 = np.genfromtxt('data/Stauffer1982_Praesepe.txt', usecols=(3, 4)) praesepe_m90 = np.genfromtxt('data/Mermilliod_Praesepe.txt', usecols=(2, 3)) praesepe_j11 = np.genfromtxt('data/Joner_Praesepe.txt', usecols=(2, 4, 6, 8, 10)) pl_dis = 5.61 pl_ebv = 0.034 pl_evi = 1.25*pl_ebv pl_evk = 2.78*pl_ebv pl_ejk = 0.50*pl_ebv pl_av = 3.12*pl_ebv pl_ak = 0.34*pl_ebv pr_dis = 6.26 pr_ebv = 0.027 pr_evi = 1.25*pr_ebv pr_evk = 2.78*pr_ebv pr_ejk = 0.50*pr_ebv pr_av = 3.12*pr_ebv pr_ak = 0.34*pr_ebv fig, ax = plt.subplots(1, 2, figsize=(12., 8.), sharex=True, sharey=True) for axis in ax: axis.grid(True) axis.tick_params(which='major', axis='both', length=15., labelsize=16.) axis.set_ylim(12., 3.) axis.set_xlim(0.0, 2.0) axis.set_xlabel('$(B-V)$', fontsize=20.) # PLEIADES ax[0].set_title('Pleiades', fontsize=20., family='serif') ax[0].set_ylabel('$M_V$', fontsize=20.) ax[0].plot(pleiades_k14[:, 2] - pl_ebv, pleiades_k14[:, 0] - pl_av - pl_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[0].plot(pleiades_s07[:, 6] - pleiades_s07[:, 7] - pl_ebv, pleiades_s07[:, 7] - pl_av - pl_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[0].plot(iso_emp_k14[:, 1] - pl_ebv, iso_emp_k14[:, 0] - pl_av - pl_dis, dashes=(20., 5.), lw=3, c='#B22222', alpha=0.8) ax[0].plot(iso_120_gas07[:, 7] - iso_120_gas07[:, 8], iso_120_gas07[:, 8], lw=3, c='#0094b2') ax[0].plot(iso_120_mixed[:, 6] - iso_120_mixed[:, 7], iso_120_mixed[:, 7], lw=3, c='#555555') # PRAESEPE ax[1].set_title('Praesepe', fontsize=20., family='serif') ax[1].plot(praesepe_u79[:, 1] - pr_ebv, praesepe_u79[:, 0] - pr_av - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(praesepe_w81[:, 1] - pr_ebv, praesepe_w81[:, 0] - pr_av - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(praesepe_s82[:, 1] - pr_ebv, praesepe_s82[:, 0] - pr_av - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(praesepe_m90[:, 1] - pr_ebv, praesepe_m90[:, 0] - pr_av - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(praesepe_j11[:, 1] - pr_ebv, praesepe_j11[:, 0] - pr_av - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(iso_emp_k14[:, 1] - pl_ebv, iso_emp_k14[:, 0] - pl_av - pl_dis, dashes=( 20., 5.), lw=3, c='#B22222', alpha=0.8) ax[1].plot(iso_600_gas07[:, 7] - iso_600_gas07[:, 8], iso_600_gas07[:, 8], lw=3, c='#0094b2') praesepe_a02 = np.genfromtxt('data/Adams_Praesepe.txt', usecols=(3, 4, 5, 6, 7, 8)) # 2MASS NIR photometry praesepe_h99 = np.genfromtxt('data/Hodgkin_Praesepe.txt') # JHK (UKIRT?) photometry praesepe_t08 = np.genfromtxt('data/Taylor_Praesepe.txt') # VRI (Cousins) photometry fig, ax = plt.subplots(1, 2, figsize=(12., 8.), sharex=True, sharey=True) for axis in ax: axis.grid(True) axis.tick_params(which='major', axis='both', length=15., labelsize=16.) axis.set_ylim(10., 1.) axis.set_xlim(0.0, 1.5) axis.set_xlabel('$(J - K)$', fontsize=20.) # PLEIADES ax[0].set_title('Pleiades', fontsize=20., family='serif') ax[0].set_ylabel('$M_K$', fontsize=20.) ax[0].plot(pleiades_s07[:, 0] - pleiades_s07[:, 4] - pl_ejk, pleiades_s07[:, 4] - pl_ak - pl_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[0].plot(iso_120_gas07[:, 11] - iso_120_gas07[:, 13], iso_120_gas07[:, 13], lw=3, c='#0094b2') # PRAESEPE ax[1].set_title('Praesepe', fontsize=20., family='serif') ax[1].plot(praesepe_a02[:, 0] - praesepe_a02[:, 4] - pr_ejk, praesepe_a02[:, 4] - pr_ak - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(praesepe_h99[:, 7] - pr_ejk, praesepe_h99[:, 4] - pr_ak - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(iso_600_gas07[:, 11] - iso_600_gas07[:, 13], iso_600_gas07[:, 13], lw=3, c='#0094b2') fig, ax = plt.subplots(1, 2, figsize=(12., 8.), sharex=True, sharey=True) for axis in ax: axis.grid(True) axis.tick_params(which='major', axis='both', length=15., labelsize=16.) axis.set_ylim(10., 1.) axis.set_xlim(0.0, 2.5) axis.set_xlabel('$(V - I_C)$', fontsize=20.) # PLEIADES ax[0].set_title('Pleiades', fontsize=20., family='serif') ax[0].set_ylabel('$M_V$', fontsize=20.) ax[0].plot(pleiades_s07[:, 7] - pleiades_s07[:, 8] - pl_evi, pleiades_s07[:, 7] - pl_av - pl_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[0].plot(pleiades_k14[:, 4] - pl_evi, pleiades_k14[:, 0] - pl_av - pl_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[0].plot(iso_emp_k14[:, 2] - pl_ebv, iso_emp_k14[:, 0] - pl_av - pl_dis, dashes=(20., 5.), lw=3, c='#B22222', alpha=0.8) ax[0].plot(iso_120_gas07[:, 8] - iso_120_gas07[:, 10], iso_120_gas07[:, 8], lw=3, c='#0094b2') ax[0].plot(iso_120_mixed[:, 7] - iso_120_mixed[:, 9], iso_120_mixed[:, 7], lw=3, c='#555555') # PRAESEPE ax[1].set_title('Praesepe', fontsize=20., family='serif') ax[1].plot(praesepe_t08[:, 5] + praesepe_t08[:, 7] - pr_evi, praesepe_t08[:, 3] - pr_av - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(praesepe_j11[:, -1] - pr_evi, praesepe_j11[:, 0] - pr_av - pr_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[1].plot(iso_600_gas07[:, 8] - iso_600_gas07[:, 10], iso_600_gas07[:, 8], lw=3, c='#0094b2') fig, ax = plt.subplots(1, 2, figsize=(12., 8.), sharex=True, sharey=True) for axis in ax: axis.grid(True) axis.tick_params(which='major', axis='both', length=15., labelsize=16.) axis.set_ylim(10., 1.) axis.set_xlim(0.0, 5.0) axis.set_xlabel('$(V - K)$', fontsize=20.) # PLEIADES ax[0].set_title('Pleiades', fontsize=20., family='serif') ax[0].set_ylabel('$M_V$', fontsize=20.) ax[0].plot(pleiades_s07[:, 7] - pleiades_s07[:, 4] - pl_evk, pleiades_s07[:, 7] - pl_av - pl_dis, 'o', c='#555555', markersize=4.0, alpha=0.2) ax[0].plot(iso_emp_k14[:, 3] - pl_evk, iso_emp_k14[:, 0] - pl_av - pl_dis, dashes=(20., 5.), lw=3, c='#B22222', alpha=0.8) ax[0].plot(iso_120_gas07[:, 8] - iso_120_gas07[:, 13], iso_120_gas07[:, 8], lw=3, c='#0094b2') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Now we'll import isochrones for each cluster adopting nominal ages (Pleiades Step2: Load data for Pleiades and Praesepe stars to demonstrate that models fit data. Step3: Define cluster distance modulii and reddening. Pleiades reddening is adoted from Tayler (2008, AJ, 136, 3) while for Praesepe we adopt the value from Taylor (2006, AJ, 132, 6). Step4: Start with just plotting $(B-V)$ CMD for both clusters. Step5: Already we see a hint that Pleiades stars are as blue as one might expect (on average) given the properties of the cluster. Similarly, the stars in Praesepe are just as red as expected. However, issues arise once one begins to directly compare K-dwarf stars in the two clusters. The empirical isochrone from Kamai et al. (2014) reproduces well the Pleiades locus and is barely visible under the model isochrone, lending credence to the quality of the model color predictions above $M_V \sim 8$. However, if we compare the Kamai empirical isochrone to stars in Praesepe, the Kamai isochrone is noticeably bluer between $6 < M_V < 8$, or the magnitude range covered largely by K-dwarf stars. Yet, in both cases the model isochrones reproduce the morpohology of the CMDs, differing only by their ages (insignificant) and their metallicity. Step6: Unfortunately, for Praesepe, there is not enough NIR data G and K dwarfs beyond the MgH bump. We can see from the Pleiades cluster that there are some issues with the observed K band magnitudes in the small region between the MgH bump and the formation of strong water absorption. Step7: Now for a (V - K) diagram for the Pleiades only.
8,080
<ASSISTANT_TASK:> Python Code: iris = load_iris() X = iris.data[:,:2] #Choosing only the first two input-features Y = iris.target number_of_samples = len(Y) #Splitting into training and test sets random_indices = np.random.permutation(number_of_samples) #Training set num_training_samples = int(number_of_samples*0.75) x_train = X[random_indices[:num_training_samples]] y_train = Y[random_indices[:num_training_samples]] #Test set x_test = X[random_indices[num_training_samples:]] y_test = Y[random_indices[num_training_samples:]] #Visualizing the training data X_class0 = np.asmatrix([x_train[i] for i in range(len(x_train)) if y_train[i]==0]) #Picking only the first two classes Y_class0 = np.zeros((X_class0.shape[0]),dtype=np.int) X_class1 = np.asmatrix([x_train[i] for i in range(len(x_train)) if y_train[i]==1]) Y_class1 = np.ones((X_class1.shape[0]),dtype=np.int) X_class2 = np.asmatrix([x_train[i] for i in range(len(x_train)) if y_train[i]==2]) Y_class2 = np.full((X_class2.shape[0]),fill_value=2,dtype=np.int) plt.scatter(X_class0[:,0], X_class0[:,1],color='red') plt.scatter(X_class1[:,0], X_class1[:,1],color='blue') plt.scatter(X_class2[:,0], X_class2[:,1],color='green') plt.xlabel('sepal length') plt.ylabel('sepal width') plt.legend(['class 0','class 1','class 2']) plt.title('Fig 3: Visualization of training data') plt.show() model = neighbors.KNeighborsClassifier(n_neighbors = 5) # K = 5 model.fit(x_train, y_train) query_point = np.array([5.9,2.9]) true_class_of_query_point = 1 predicted_class_for_query_point = model.predict([query_point]) print("Query point: {}".format(query_point)) print("True class of query point: {}".format(true_class_of_query_point)) query_point.shape neighbors_object = neighbors.NearestNeighbors(n_neighbors=5) neighbors_object.fit(x_train) distances_of_nearest_neighbors, indices_of_nearest_neighbors_of_query_point = neighbors_object.kneighbors([query_point]) nearest_neighbors_of_query_point = x_train[indices_of_nearest_neighbors_of_query_point[0]] print("The query point is: {}\n".format(query_point)) print("The nearest neighbors of the query point are:\n {}\n".format(nearest_neighbors_of_query_point)) print("The classes of the nearest neighbors are: {}\n".format(y_train[indices_of_nearest_neighbors_of_query_point[0]])) print("Predicted class for query point: {}".format(predicted_class_for_query_point[0])) plt.scatter(X_class0[:,0], X_class0[:,1],color='red') plt.scatter(X_class1[:,0], X_class1[:,1],color='blue') plt.scatter(X_class2[:,0], X_class2[:,1],color='green') plt.scatter(query_point[0], query_point[1],marker='^',s=75,color='black') plt.scatter(nearest_neighbors_of_query_point[:,0], nearest_neighbors_of_query_point[:,1],marker='s',s=150,color='yellow',alpha=0.30) plt.xlabel('sepal length') plt.ylabel('sepal width') plt.legend(['class 0','class 1','class 2']) plt.title('Fig 3: Working of the K-NN classification algorithm') plt.show() def evaluate_performance(model, x_test, y_test): test_set_predictions = [model.predict(x_test[i].reshape((1,len(x_test[i]))))[0] for i in range(x_test.shape[0])] test_misclassification_percentage = 0 for i in range(len(test_set_predictions)): if test_set_predictions[i]!=y_test[i]: test_misclassification_percentage+=1 test_misclassification_percentage *= 100/len(y_test) return test_misclassification_percentage #Evaluate the performances on the validation and test sets print("Evaluating K-NN classifier:") test_err = evaluate_performance(model, x_test, y_test) print('test misclassification percentage = {}%'.format(test_err)) faces_data = fetch_olivetti_faces() n_samples, height, width = faces_data.images.shape X = faces_data.data n_features = X.shape[1] y = faces_data.target n_classes = int(max(y)+1) print("Number of samples: {}, \nHeight of each image: {}, \nWidth of each image: {}, \nNumber of input features: {},\nNumber of output classes: {}\n".format(n_samples,height, width,n_features,n_classes)) # Split into a training set (75%) and a test set (25%) X_train, X_test, y_train, y_test = train_test_split( X, y, test_size=0.25, random_state=42) mean_image = np.mean(X_train,axis=0) plt.figure plt.imshow(mean_image.reshape((64,64)), cmap=plt.cm.gray) plt.xticks(()) plt.yticks(()) plt.show() def plot_gallery(images, h, w, titles=None, n_row=3, n_col=4): Helper function to plot a gallery of portraits Taken from: http://scikit-learn.org/stable/auto_examples/applications/face_recognition.html plt.figure(figsize=(1.8 * n_col, 2.4 * n_row)) plt.subplots_adjust(bottom=0, left=.01, right=.99, top=.90, hspace=.35) for i in range(n_row * n_col): plt.subplot(n_row, n_col, i + 1) plt.imshow(images[i].reshape((h, w)), cmap=plt.cm.gray) if titles != None: plt.title(titles[i], size=12) plt.xticks(()) plt.yticks(()) chosen_images = X_train[:12] chosen_labels = y_train[:12] titles = ['Person #'+str(i) for i in chosen_labels] plot_gallery(chosen_images, height, width, titles) #Reduce the dimensionality of the feature space n_components = 150 #Finding the top n_components principal components in the data pca = RandomizedPCA(n_components=n_components, whiten=True).fit(X_train) #Find the eigen-vectors of the feature space eigenfaces = pca.components_.reshape((n_components, height, width)) titles = ['eigen-face #'+str(i) for i in range(12)] plot_gallery(eigenfaces, height, width, titles) #Projecting the data onto the eigenspace X_train_pca = pca.transform(X_train) X_test_pca = pca.transform(X_test) print("Current shape of input data matrix: ", X_train_pca.shape) knn_classifier = KNeighborsClassifier(n_neighbors = 5) knn_classifier.fit(X_train_pca, y_train) #Detect faces in the test set y_pred_test = knn_classifier.predict(X_test_pca) correct_count = 0.0 for i in range(len(y_test)): if y_pred_test[i] == y_test[i]: correct_count += 1.0 accuracy = correct_count/float(len(y_test)) print("Accuracy:", accuracy) print(classification_report(y_test, y_pred_test)) print(confusion_matrix(y_test, y_pred_test, labels=range(n_classes))) def title(y_pred, y_test, target_names, i): pred_name = target_names[y_pred[i]].rsplit(' ', 1)[-1] true_name = target_names[y_test[i]].rsplit(' ', 1)[-1] return 'predicted: %s\ntrue: %s' % (pred_name, true_name) target_names = [str(element) for element in np.arange(40)+1] prediction_titles = [title(y_pred_test, y_test, target_names, i) for i in range(y_pred_test.shape[0])] plot_gallery(X_test, height, width, prediction_titles, n_row=2, n_col=6) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Note that the first class is linearly separable from the other two classes but the second and third classes are not linearly separable from each other. Step2: Visualize the working of the algorithm Step3: Let's visualize the point and its K=5 nearest neighbors. Step4: 2. Principal Components Analysis Step5: Shuffle the data randomly and make train and test splits Step7: Make a function for visualization of the images as an album Step8: Visualize some faces from the training set Step9: Calculate a set of eigen-faces Step10: Visualize the eigen faces Step11: Transform the data to the vector space spanned by the eigen faces Step12: Use a KNN-Classifier in this transformed space to identify the faces
8,081
<ASSISTANT_TASK:> Python Code: %matplotlib inline import numpy as np import matplotlib.pyplot as plt # Discretization c1=30 # Number of grid points per dominant wavelength c2=0.2 # CFL-Number nx=300 # Number of grid points in X ny=300 # Number of grid points in Y T=1 # Total propagation time # Source Signal f0= 5 # Center frequency Ricker-wavelet q0= 100 # Maximum amplitude Ricker-Wavelet xscr = 150 # Source position (in grid points) in X yscr = 150 # Source position (in grid points) in Y # Receiver xrec1=150; yrec1=120; # Position Reciever 1 (in grid points) xrec2=150; yrec2=150; # Position Reciever 2 (in grid points) xrec3=150; yrec3=180;# Position Reciever 3 (in grid points) # Velocity and density modell_v = 3000*np.ones((ny,nx)) rho=2.2*np.ones((ny,nx)) # Init wavefields vx=np.zeros(shape = (ny,nx)) vy=np.zeros(shape = (ny,nx)) p=np.zeros(shape = (ny,nx)) vx_x=np.zeros(shape = (ny,nx)) vy_y=np.zeros(shape = (ny,nx)) p_x=np.zeros(shape = (ny,nx)) p_y=np.zeros(shape = (ny,nx)) # Calculate first Lame-Paramter l=rho * modell_v * modell_v cmin=min(modell_v.flatten()) # Lowest P-wave velocity cmax=max(modell_v.flatten()) # Highest P-wave velocity fmax=2*f0 # Maximum frequency dx=cmin/(fmax*c1) # Spatial discretization (in m) dy=dx # Spatial discretization (in m) dt=dx/(cmax)*c2 # Temporal discretization (in s) lampda_min=cmin/fmax # Smallest wavelength # Output model parameter: print("Model size: x:",dx*nx,"in m, y:",dy*ny,"in m") print("Temporal discretization: ",dt," s") print("Spatial discretization: ",dx," m") print("Number of gridpoints per minimum wavelength: ",lampda_min/dx) x=np.arange(0,dx*nx,dx) # Space vector in X y=np.arange(0,dy*ny,dy) # Space vector in Y t=np.arange(0,T,dt) # Time vector nt=np.size(t) # Number of time steps # Plotting model fig, (ax1, ax2) = plt.subplots(1, 2) fig.subplots_adjust(wspace=0.4,right=1.6) ax1.plot(x,modell_v) ax1.set_ylabel('VP in m/s') ax1.set_xlabel('Depth in m') ax1.set_title('P-wave velocity') ax2.plot(x,rho) ax2.set_ylabel('Density in g/cm^3') ax2.set_xlabel('Depth in m') ax2.set_title('Density'); tau=np.pi*f0*(t-1.5/f0) q=q0*(1.0-2.0*tau**2.0)*np.exp(-tau**2) # Plotting source signal plt.figure(3) plt.plot(t,q) plt.title('Source signal Ricker-Wavelet') plt.ylabel('Amplitude') plt.xlabel('Time in s') plt.draw() # Init Seismograms Seismogramm=np.zeros((3,nt)); # Three seismograms # Calculation of some coefficients i_dx=1.0/(dx) i_dy=1.0/(dy) c1=9.0/(8.0*dx) c2=1.0/(24.0*dx) c3=9.0/(8.0*dy) c4=1.0/(24.0*dy) c5=1.0/np.power(dx,3) c6=1.0/np.power(dy,3) c7=1.0/np.power(dx,2) c8=1.0/np.power(dy,2) c9=np.power(dt,3)/24.0 # Prepare slicing parameter: kxM2=slice(5-2,nx-4-2) kxM1=slice(5-1,nx-4-1) kx=slice(5,nx-4) kxP1=slice(5+1,nx-4+1) kxP2=slice(5+2,nx-4+2) kyM2=slice(5-2,ny-4-2) kyM1=slice(5-1,ny-4-1) ky=slice(5,ny-4) kyP1=slice(5+1,ny-4+1) kyP2=slice(5+2,ny-4+2) ## Time stepping print("Starting time stepping...") for n in range(2,nt): # Inject source wavelet p[yscr,xscr]=p[yscr,xscr]+q[n] # Update velocity p_x[ky,kx]=c1*(p[ky,kxP1]-p[ky,kx])-c2*(p[ky,kxP2]-p[ky,kxM1]) p_y[ky,kx]=c3*(p[kyP1,kx]-p[ky,kx])-c4*(p[kyP2,kx]-p[kyM1,kx]) vx=vx-dt/rho*p_x vy=vy-dt/rho*p_y # Update pressure vx_x[ky,kx]=c1*(vx[ky,kx]-vx[ky,kxM1])-c2*(vx[ky,kxP1]-vx[ky,kxM2]) vy_y[ky,kx]=c3*(vy[ky,kx]-vy[kyM1,kx])-c4*(vy[kyP1,kx]-vy[kyM2,kx]) p=p-l*dt*(vx_x+vy_y) # Save seismograms Seismogramm[0,n]=p[yrec1,xrec1] Seismogramm[1,n]=p[yrec2,xrec2] Seismogramm[2,n]=p[yrec3,xrec3] print("Finished time stepping!") ## Save seismograms np.save("Seismograms/FD_2D_DX4_DT2_fast",Seismogramm) ## Image plot fig, ax = plt.subplots(1,1) img = ax.imshow(p); ax.set_title('P-Wavefield') ax.set_xticks(range(0,nx+1,int(nx/5))) ax.set_yticks(range(0,ny+1,int(ny/5))) ax.set_xlabel('Grid-points in X') ax.set_ylabel('Grid-points in Y') fig.colorbar(img) ## Plot seismograms fig, (ax1, ax2, ax3) = plt.subplots(3, 1) fig.subplots_adjust(hspace=0.4,right=1.6, top = 2 ) ax1.plot(t,Seismogramm[0,:]) ax1.set_title('Seismogram 1') ax1.set_ylabel('Amplitude') ax1.set_xlabel('Time in s') ax1.set_xlim(0, T) ax2.plot(t,Seismogramm[1,:]) ax2.set_title('Seismogram 2') ax2.set_ylabel('Amplitude') ax2.set_xlabel('Time in s') ax2.set_xlim(0, T) ax3.plot(t,Seismogramm[2,:]) ax3.set_title('Seismogram 3') ax3.set_ylabel('Amplitude') ax3.set_xlabel('Time in s') ax3.set_xlim(0, T); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Input Parameter Step2: Preparation Step3: Create space and time vector Step4: Source signal - Ricker-wavelet Step5: Time stepping Step6: Save seismograms Step7: Plotting
8,082
<ASSISTANT_TASK:> Python Code: import os PATH=%env PATH %env PATH={PATH}:/home/jupyter/.local/bin %%bash LOCAL_BIN="/home/jupyter/.local/bin" SKAFFOLD_URI="https://storage.googleapis.com/skaffold/releases/latest/skaffold-linux-amd64" test -d $LOCAL_BIN || mkdir -p $LOCAL_BIN which skaffold || ( curl -Lo skaffold $SKAFFOLD_URI && chmod +x skaffold && mv skaffold $LOCAL_BIN ) !which skaffold shell_output=!gcloud config list --format 'value(core.project)' 2>/dev/null GOOGLE_CLOUD_PROJECT=shell_output[0] %env GOOGLE_CLOUD_PROJECT={GOOGLE_CLOUD_PROJECT} ENDPOINT = # Enter your ENDPOINT here. # Docker image name for the pipeline image. CUSTOM_TFX_IMAGE = 'gcr.io/' + GOOGLE_CLOUD_PROJECT + '/tfx-pipeline' CUSTOM_TFX_IMAGE PIPELINE_NAME = "guided_project_1" PROJECT_DIR = os.path.join(os.path.expanduser("."), PIPELINE_NAME) PROJECT_DIR !tfx template copy \ --pipeline-name={PIPELINE_NAME} \ --destination-path={PROJECT_DIR} \ --model=taxi %cd {PROJECT_DIR} !python -m models.features_test !python -m models.keras.model_test !tail -26 models/features_test.py GCS_BUCKET_NAME = GOOGLE_CLOUD_PROJECT + '-kubeflowpipelines-default' GCS_BUCKET_NAME !gsutil mb gs://{GCS_BUCKET_NAME} !gsutil cp data/data.csv gs://{GCS_BUCKET_NAME}/tfx-template/data/data.csv !tfx pipeline create \ --pipeline-path=kubeflow_dag_runner.py \ --endpoint={ENDPOINT} \ --build-target-image={CUSTOM_TFX_IMAGE} !tfx run create --pipeline-name={PIPELINE_NAME} --endpoint={ENDPOINT} # Update the pipeline !tfx pipeline update \ --pipeline-path=kubeflow_dag_runner.py \ --endpoint={ENDPOINT} # You can run the pipeline the same way. !tfx run create --pipeline-name {PIPELINE_NAME} --endpoint={ENDPOINT} print('https://' + ENDPOINT) !tfx pipeline update \ --pipeline-path=kubeflow_dag_runner.py \ --endpoint={ENDPOINT} print("https://" + ENDPOINT) !tfx run create --pipeline-name {PIPELINE_NAME} --endpoint={ENDPOINT} !tfx pipeline update \ --pipeline-path=kubeflow_dag_runner.py \ --endpoint={ENDPOINT} !tfx run create --pipeline-name {PIPELINE_NAME} --endpoint={ENDPOINT} !tfx pipeline update \ --pipeline-path=kubeflow_dag_runner.py \ --endpoint={ENDPOINT} !tfx run create --pipeline-name {PIPELINE_NAME} --endpoint={ENDPOINT} !tfx pipeline update \ --pipeline-path=kubeflow_dag_runner.py \ --endpoint={ENDPOINT} !tfx run create --pipeline-name {PIPELINE_NAME} --endpoint={ENDPOINT} <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Step 1. Environment setup Step2: Modify the PATH environment variable so that skaffold is available Step3: Environment variable setup Step4: We also need to access your KFP cluster. You can access it in your Google Cloud Console under "AI Platform > Pipeline" menu. Step5: Set the image name as tfx-pipeline under the current GCP project Step6: Step 2. Copy the predefined template to your project directory. Step7: TFX includes the taxi template with the TFX python package. Step8: Step 3. Browse your copied source files Step9: Let's quickly go over the structure of a test file to test Tensorflow code Step10: First of all, notice that you start by importing the code you want to test by importing the corresponding module. Here we want to test the code in features.py so we import the module features Step11: Let's upload our sample data to GCS bucket so that we can use it in our pipeline later. Step12: Let's create a TFX pipeline using the tfx pipeline create command. Step13: While creating a pipeline, Dockerfile and build.yaml will be generated to build a Docker image. Step14: Or, you can also run the pipeline in the KFP Dashboard. The new execution run will be listed Step 5. Add components for data validation. Step15: Check pipeline outputs Step16: Step 6. Add components for training Step17: When this execution run finishes successfully, you have now created and run your first TFX pipeline in AI Platform Pipelines! Step 7. Try BigQueryExampleGen Step18: Step 8. Try Dataflow with KFP Step19: You can find your Dataflow jobs in Dataflow in Cloud Console. Step 9. Try Cloud AI Platform Training and Prediction with KFP
8,083
<ASSISTANT_TASK:> Python Code: mtcars = spark.read.csv(path='../../data/mtcars.csv', sep=',', encoding='UTF-8', comment=None, header=True, inferSchema=True) mtcars.show(n=5) # adjust first column name colnames = mtcars.columns colnames[0] = 'model' mtcars = mtcars.rdd.toDF(colnames) mtcars.show(5) from pyspark.sql import Row mtcars_rdd = mtcars.rdd.map(lambda x: Row(model=x[0], values=x[1:])) mtcars_rdd.take(5) mtcars_df = spark.createDataFrame(mtcars_rdd) mtcars_df.show(5, truncate=False) mtcars_rdd_2 = mtcars_df.rdd.map(lambda x: Row(model=x[0], x1=x[1][:5], x2=x[1][5:])) # convert RDD back to DataFrame mtcars_df_2 = spark.createDataFrame(mtcars_rdd_2) mtcars_df_2.show(5, truncate=False) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Merge multiple columns Step2: Then we create a new DataFrame from the obtained RDD. Step3: Split one column
8,084
<ASSISTANT_TASK:> Python Code: import math #given an array of Y values at consecutive integral x abscissas, #return array of corresponding derivatives to make a natural cubic spline def naturalSpline(ys): vs = [0.0] * len(ys) if (len(ys) < 2): return vs DECAY = math.sqrt(3)-2; endi = len(ys)-1 # make convolutional spline S = 0.0;E = 0.0 for i in range(len(Y)): vs[i]+=S;vs[endi-i]+=E; S=(S+3.0*ys[i])*DECAY; E=(E-3.0*ys[endi-i])*DECAY; #Natural Boundaries S2 = 6.0*(ys[1]-ys[0]) - 4.0*vs[0] - 2.0*vs[1] E2 = 6.0*(ys[endi-1]-ys[endi]) + 4.0*vs[endi] + 2.0*vs[endi-1] # A = dE2/dE = -dS2/dS, B = dE2/dS = -dS2/dS A = 4.0+2.0*DECAY B = (4.0*DECAY+2.0)*(DECAY**(len(ys)-2)) DEN = A*A - B*B S = (A*S2 + B*E2) / DEN E = (-A*E2 - B*S2) / DEN for i in range(len(ys)): vs[i]+=S;vs[endi-i]+=E S*=DECAY;E*=DECAY return vs # #Plot a different natural spline, along with its 1st and 2nd derivatives, each time you run this # %run plothelp.py %matplotlib inline import random import numpy Y = [random.random()*10.0+2 for _ in range(5)] V = naturalSpline(Y) xs = numpy.linspace(0,len(Y)-1, 1000) plt.figure(0, figsize=(12.0,4.0)) plt.plot(xs,[hermite_interp(Y,V,x) for x in xs]) plt.plot(range(0,len(Y)),[Y[x] for x in range(0,len(Y))], "bo") plt.figure(1, figsize=(12.0,4.0));plt.grid(True) plt.plot(xs,[hermite_interp1(Y,V,x) for x in xs]) plt.plot(xs,[hermite_interp2(Y,V,x) for x in xs]) # # Plot the kernel # DECAY = math.sqrt(3)-2; vs = [3*(DECAY**x) for x in range(1,7)] ys = [0]*len(vs) + [1] + [0]*len(vs) vs = [-v for v in vs[::-1]] + [0.0] + vs xs = numpy.linspace(0,len(ys)-1, 1000) plt.figure(0, figsize=(12.0,4.0));plt.grid(True);plt.ylim([-0.2,1.1]);plt.xticks(range(-5,6)) plt.plot([x-6.0 for x in xs],[hermite_interp(ys,vs,x) for x in xs]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The Kernel
8,085
<ASSISTANT_TASK:> Python Code: def cube(x): return x*x*x map(cube,range(1,11)) seq = range(8) def add(x,y): return x+y map(add, seq,seq) result = map(add, seq,seq) reduce(add, result) # adding each element of the result together import re import pandas as pd import numpy as np aliceFile = open('data/canterbury/alice29.txt','r') map1=[] WORD_RE = re.compile(r"[\w']+") # Create the map of words with prelminary counts for line in aliceFile: for w in WORD_RE.findall(line): map1.append([w,1]) #sort the map map2 = sorted(map1) #Separate the map into groups by the key values df = pd.DataFrame(map2) uniquewords = df[0].unique() DataFrameDict = {elem : pd.DataFrame for elem in uniquewords} for key in DataFrameDict.keys(): DataFrameDict[key] = df[:][df[0] == key] def wordcount(x,y): x[1] = x[1] + y[1] return x #Add up the counts using reduce for uw in uniquewords: uarray = np.array(DataFrameDict[uw]) print reduce(wordcount,uarray) ! pip install mrjob # %load code/MRWordFrequencyCount.py # Do not run this cell it is just displaying the content of the code from mrjob.job import MRJob class MRWordFrequencyCount(MRJob): def mapper(self, _ , line): yield "chars", len(line) yield "words", len(line.split()) yield "lines", 1 def reducer(self, key, values): yield key, sum(values) if __name__ == '__main__': MRWordFrequencyCount.run() %run -G code/MRWordFrequencyCount.py ./.mrjob.conf data/canterbury/alice29.txt # %load code\MRWordFreqCount.py # Do not run this block of code just a display of the stored program from mrjob.job import MRJob import re WORD_RE = re.compile(r"[\w']+") class MRWordFreqCount(MRJob): def mapper(self, _, line): for word in WORD_RE.findall(line): yield word.lower(), 1 def combiner(self, word, counts): yield word, sum(counts) def reducer(self, word, counts): yield word, sum(counts) if __name__ == '__main__': MRWordFreqCount.run() %run code/MRWordFreqCount.py data/canterbury/alice29.txt !pip install pyspark # %load code\pysparkcount.py # # Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # #https://github.com/apache/spark/blob/master/examples/src/main/python/wordcount.py from __future__ import print_function import sys from operator import add from pyspark import SparkContext if __name__ == "__main__": if len(sys.argv) != 2: print("Usage: wordcount <file>", file=sys.stderr) exit(-1) sc = SparkContext(appName="PythonWordCount") lines = sc.textFile(sys.argv[1], 1) counts = lines.flatMap(lambda x: x.split(' ')) \ .map(lambda x: (x, 1)) \ .reduceByKey(add) output = counts.collect() for (word, count) in output: print("%s: %i" % (word, count)) sc.stop() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: If there are more parameters then each could be an array, and they are applied together one element at a time Step2: Python Reduce Function Step3: If there is only one value in a sequence then that element is returned; if the sequence is empty, an exception is raised. Step4: MapReduce using MRJOB Step5: MRJOB Word count function Step6: Another way to implement this is to use SPARK on your local box
8,086
<ASSISTANT_TASK:> Python Code: # read in exported table for genus fig4a_genus = pd.read_csv('../../../data/07-entropy-and-covariation/genus-level-distribution.csv', header=0) # read in exported table for otu fig4a_otu = pd.read_csv('../../../data/07-entropy-and-covariation/otu-level-distribution-400.csv', header=0) # read in exported table fig4b = pd.read_csv('../../../data/07-entropy-and-covariation/entropy_by_phylogeny_c20.csv', header=0) # read in exported table fig4c = pd.read_csv('../../../data/07-entropy-and-covariation/entropy_by_taxonomy_c20.csv', header=0) # read in exported table fig4bc = pd.read_csv('../../../data/07-entropy-and-covariation/entropy_per_tag_sequence_s10.csv', header=0) fig4 = pd.ExcelWriter('Figure4_data.xlsx') fig4a_genus.to_excel(fig4,'Fig-4a_genus') fig4a_otu.to_excel(fig4,'Fig-4a_sequence') fig4b.to_excel(fig4,'Fig-4b') fig4c.to_excel(fig4,'Fig-4c') fig4bc.to_excel(fig4,'Fig-4bc_violin') fig4.save() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Figure 4b Step2: Figure 4c Step3: Figure 4bc
8,087
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import tensorflow as tf # Creates some virtual devices (cpu:0, cpu:1, etc.) for using distribution strategy physical_devices = tf.config.list_physical_devices("CPU") tf.config.experimental.set_virtual_device_configuration( physical_devices[0], [ tf.config.experimental.VirtualDeviceConfiguration(), tf.config.experimental.VirtualDeviceConfiguration(), tf.config.experimental.VirtualDeviceConfiguration() ]) g1 = tf.random.Generator.from_seed(1) print(g1.normal(shape=[2, 3])) g2 = tf.random.get_global_generator() print(g2.normal(shape=[2, 3])) g1 = tf.random.Generator.from_seed(1, alg='philox') print(g1.normal(shape=[2, 3])) g = tf.random.Generator.from_non_deterministic_state() print(g.normal(shape=[2, 3])) g = tf.random.Generator.from_seed(1) print(g.normal([])) print(g.normal([])) g.reset_from_seed(1) print(g.normal([])) g = tf.random.Generator.from_seed(1) print(g.normal([])) new_gs = g.split(3) for new_g in new_gs: print(new_g.normal([])) print(g.normal([])) with tf.device("cpu"): # change "cpu" to the device you want g = tf.random.get_global_generator().split(1)[0] print(g.normal([])) # use of g won't cause cross-device copy, unlike the global generator g = tf.random.Generator.from_seed(1) @tf.function def foo(): return g.normal([]) print(foo()) g = None @tf.function def foo(): global g if g is None: g = tf.random.Generator.from_seed(1) return g.normal([]) print(foo()) print(foo()) num_traces = 0 @tf.function def foo(g): global num_traces num_traces += 1 return g.normal([]) foo(tf.random.Generator.from_seed(1)) foo(tf.random.Generator.from_seed(2)) print(num_traces) num_traces = 0 @tf.function def foo(v): global num_traces num_traces += 1 return v.read_value() foo(tf.Variable(1)) foo(tf.Variable(2)) print(num_traces) g = tf.random.Generator.from_seed(1) strat = tf.distribute.MirroredStrategy(devices=["cpu:0", "cpu:1"]) with strat.scope(): def f(): print(g.normal([])) results = strat.run(f) strat = tf.distribute.MirroredStrategy(devices=["cpu:0", "cpu:1"]) with strat.scope(): g = tf.random.Generator.from_seed(1) print(strat.run(lambda: g.normal([]))) print(strat.run(lambda: g.normal([]))) strat = tf.distribute.MirroredStrategy(devices=["cpu:0", "cpu:1"]) with strat.scope(): def f(): g = tf.random.Generator.from_seed(1) a = g.normal([]) b = g.normal([]) return tf.stack([a, b]) print(strat.run(f)) print(strat.run(f)) filename = "./checkpoint" g = tf.random.Generator.from_seed(1) cp = tf.train.Checkpoint(generator=g) print(g.normal([])) cp.write(filename) print("RNG stream from saving point:") print(g.normal([])) print(g.normal([])) cp.restore(filename) print("RNG stream from restoring point:") print(g.normal([])) print(g.normal([])) filename = "./checkpoint" strat = tf.distribute.MirroredStrategy(devices=["cpu:0", "cpu:1"]) with strat.scope(): g = tf.random.Generator.from_seed(1) cp = tf.train.Checkpoint(my_generator=g) print(strat.run(lambda: g.normal([]))) with strat.scope(): cp.write(filename) print("RNG stream from saving point:") print(strat.run(lambda: g.normal([]))) print(strat.run(lambda: g.normal([]))) with strat.scope(): cp.restore(filename) print("RNG stream from restoring point:") print(strat.run(lambda: g.normal([]))) print(strat.run(lambda: g.normal([]))) filename = "./checkpoint" strat1 = tf.distribute.MirroredStrategy(devices=["cpu:0", "cpu:1"]) with strat1.scope(): g1 = tf.random.Generator.from_seed(1) cp1 = tf.train.Checkpoint(my_generator=g1) print(strat1.run(lambda: g1.normal([]))) with strat1.scope(): cp1.write(filename) print("RNG stream from saving point:") print(strat1.run(lambda: g1.normal([]))) print(strat1.run(lambda: g1.normal([]))) strat2 = tf.distribute.MirroredStrategy(devices=["cpu:0", "cpu:1", "cpu:2"]) with strat2.scope(): g2 = tf.random.Generator.from_seed(1) cp2 = tf.train.Checkpoint(my_generator=g2) cp2.restore(filename) print("RNG stream from restoring point:") print(strat2.run(lambda: g2.normal([]))) print(strat2.run(lambda: g2.normal([]))) filename = "./saved_model" class MyModule(tf.Module): def __init__(self): super(MyModule, self).__init__() self.g = tf.random.Generator.from_seed(0) @tf.function def __call__(self): return self.g.normal([]) @tf.function def state(self): return self.g.state strat = tf.distribute.MirroredStrategy(devices=["cpu:0", "cpu:1"]) with strat.scope(): m = MyModule() print(strat.run(m)) print("state:", m.state()) with strat.scope(): tf.saved_model.save(m, filename) print("RNG stream from saving point:") print(strat.run(m)) print("state:", m.state()) print(strat.run(m)) print("state:", m.state()) imported = tf.saved_model.load(filename) print("RNG stream from loading point:") print("state:", imported.state()) print(imported()) print("state:", imported.state()) print(imported()) print("state:", imported.state()) print(tf.random.stateless_normal(shape=[2, 3], seed=[1, 2])) print(tf.random.stateless_normal(shape=[2, 3], seed=[1, 2])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 乱数の生成 Step2: tf.random.Generator クラス Step3: ジェネレータオブジェクトには、さまざまな作成方法があります。最も簡単なのは、上記に示した Generator.from_seed で、シードからジェネレータを作成します。シードは、負でない整数値です。from_seed にはオプションの引数 alg があり、このジェネレータが使用する RNG アルゴリズムを指定します。 Step4: この詳細については、以下の「アルゴリズム」のセクションをご覧ください。 Step5: ジェネレータの作成方法はほかにもありますが、このガイドでは説明されていません。 Step6: 独立乱数ストリームを作成する Step7: split は、normal などの RNG メソッドと同様に、それを呼び出したジェネレータ(上記の例の g)の状態を変更します。互いに独立しているほかに、新しいジェネレータ(new_gs)は、古いジェネレータ(g)からの独立も保証されます。 Step8: 注意 Step9: ユーザーは、関数が呼び出されたときにジェネレータオブジェクトがアライブである(ガベージコレクトされていない)ことを確認する必要があります。 Step10: ジェネレータを引数として tf.function に渡す Step11: この再トレースの動作は tf.Variable と同じです。 Step12: 分散ストラテジーとのインタラクション Step13: この使用方法では、ジェネレータのデバイスがレプリカとは異なるため、パフォーマンスの問題が発生する可能性があります。 Step14: 注意 Step15: tf.random.Generator を Strategy.run の引数として渡すことは推奨されなくなりました。Strategy.run が一般的にジェネレータではなくテンソルの引数を期待するためです。 Step16: また、分散ストラテジー内でも保存と復元を実行することができます。 Step17: 保存する前に、レプリカが RNG 呼び出し履歴で分岐しないことを確認する必要があります(1 つのレプリカが 1 つの RNG 呼び出しを行い、もう 1 つが 2 つの RNG 呼び出しを行うなど)。そうでない場合、RNG の内部状態が分岐してしまい、最初のレプリカの状態のみを保存する tf.train.Checkpoint が、すべてのレプリカを適切に復元できなくなります。 Step18: g1 と cp1 は g2 と cp2 からの別々のオブジェクトですが、共通の filename というチェックポイントファイルと my_generator というオブジェクト名を介してリンクされています。ストラテジー間で重複するレプリカ(上の cpu Step19: tf.random.Generator を含む SavedModel を分散ストラテジーに読み込むのは、レプリカがすべて同じ乱数ストリームを生成するため、推奨されません。これは、レプリカの ID が SavedModel のグラフで凍結しているために起こります。
8,088
<ASSISTANT_TASK:> Python Code: !pip install -q numpyro@git+https://github.com/pyro-ppl/numpyro import os from IPython.display import set_matplotlib_formats import arviz as az import matplotlib.pyplot as plt import numpy as np import pandas as pd from scipy.interpolate import BSpline import seaborn as sns import jax import jax.numpy as jnp import numpyro import numpyro.distributions as dist plt.style.use("seaborn") if "NUMPYRO_SPHINXBUILD" in os.environ: set_matplotlib_formats("svg") numpyro.set_host_device_count(4) assert numpyro.__version__.startswith("0.9.2") %matplotlib inline wells = pd.read_csv( "http://stat.columbia.edu/~gelman/arm/examples/arsenic/wells.dat", sep=" " ) wells.head() fig, ax = plt.subplots(2, 2, figsize=(12, 6)) fig.suptitle("Target variable plotted against various predictors") sns.scatterplot(data=wells, x="arsenic", y="switch", ax=ax[0][0]) sns.scatterplot(data=wells, x="dist", y="switch", ax=ax[0][1]) sns.barplot( data=wells.groupby("assoc")["switch"].mean().reset_index(), x="assoc", y="switch", ax=ax[1][0], ) ax[1][0].set_ylabel("Proportion switch") sns.barplot( data=wells.groupby("educ")["switch"].mean().reset_index(), x="educ", y="switch", ax=ax[1][1], ) ax[1][1].set_ylabel("Proportion switch"); np.random.seed(1) train_id = wells.sample(n=200).index test_id = wells.loc[~wells.index.isin(train_id)].sample(n=1500).index y_train = wells.loc[train_id, "switch"].to_numpy() y_test = wells.loc[test_id, "switch"].to_numpy() wells["edu0"] = wells["educ"].isin(np.arange(0, 1)).astype(int) wells["edu1"] = wells["educ"].isin(np.arange(1, 6)).astype(int) wells["edu2"] = wells["educ"].isin(np.arange(6, 12)).astype(int) wells["edu3"] = wells["educ"].isin(np.arange(12, 18)).astype(int) wells["logarsenic"] = np.log(wells["arsenic"]) wells["assoc_half"] = wells["assoc"] / 2.0 wells["as_square"] = wells["logarsenic"] ** 2 wells["as_third"] = wells["logarsenic"] ** 3 wells["dist100"] = wells["dist"] / 100.0 wells["intercept"] = 1 def bs(x, knots, degree): Generate the B-spline basis matrix for a polynomial spline. Parameters ---------- x predictor variable. knots locations of internal breakpoints (not padded). degree degree of the piecewise polynomial. Returns ------- pd.DataFrame Spline basis matrix. Notes ----- This mirrors ``bs`` from splines package in R. padded_knots = np.hstack( [[x.min()] * (degree + 1), knots, [x.max()] * (degree + 1)] ) return pd.DataFrame( BSpline(padded_knots, np.eye(len(padded_knots) - degree - 1), degree)(x)[:, 1:], index=x.index, ) knots = np.quantile(wells.loc[train_id, "logarsenic"], np.linspace(0.1, 0.9, num=10)) spline_arsenic = bs(wells["logarsenic"], knots=knots, degree=3) knots = np.quantile(wells.loc[train_id, "dist100"], np.linspace(0.1, 0.9, num=10)) spline_dist = bs(wells["dist100"], knots=knots, degree=3) features_0 = ["intercept", "dist100", "arsenic", "assoc", "edu1", "edu2", "edu3"] features_1 = ["intercept", "dist100", "logarsenic", "assoc", "edu1", "edu2", "edu3"] features_2 = [ "intercept", "dist100", "arsenic", "as_third", "as_square", "assoc", "edu1", "edu2", "edu3", ] features_3 = ["intercept", "dist100", "assoc", "edu1", "edu2", "edu3"] features_4 = ["intercept", "logarsenic", "assoc", "edu1", "edu2", "edu3"] features_5 = ["intercept", "dist100", "logarsenic", "assoc", "educ"] X0 = wells.loc[train_id, features_0].to_numpy() X1 = wells.loc[train_id, features_1].to_numpy() X2 = wells.loc[train_id, features_2].to_numpy() X3 = ( pd.concat([wells.loc[:, features_3], spline_arsenic], axis=1) .loc[train_id] .to_numpy() ) X4 = pd.concat([wells.loc[:, features_4], spline_dist], axis=1).loc[train_id].to_numpy() X5 = wells.loc[train_id, features_5].to_numpy() X0_test = wells.loc[test_id, features_0].to_numpy() X1_test = wells.loc[test_id, features_1].to_numpy() X2_test = wells.loc[test_id, features_2].to_numpy() X3_test = ( pd.concat([wells.loc[:, features_3], spline_arsenic], axis=1) .loc[test_id] .to_numpy() ) X4_test = ( pd.concat([wells.loc[:, features_4], spline_dist], axis=1).loc[test_id].to_numpy() ) X5_test = wells.loc[test_id, features_5].to_numpy() train_x_list = [X0, X1, X2, X3, X4, X5] test_x_list = [X0_test, X1_test, X2_test, X3_test, X4_test, X5_test] K = len(train_x_list) def logistic(x, y=None): beta = numpyro.sample("beta", dist.Normal(0, 3).expand([x.shape[1]])) logits = numpyro.deterministic("logits", jnp.matmul(x, beta)) numpyro.sample( "obs", dist.Bernoulli(logits=logits), obs=y, ) fit_list = [] for k in range(K): sampler = numpyro.infer.NUTS(logistic) mcmc = numpyro.infer.MCMC( sampler, num_chains=4, num_samples=1000, num_warmup=1000, progress_bar=False ) rng_key = jax.random.fold_in(jax.random.PRNGKey(13), k) mcmc.run(rng_key, x=train_x_list[k], y=y_train) fit_list.append(mcmc) def find_point_wise_loo_score(fit): return az.loo(az.from_numpyro(fit), pointwise=True, scale="log").loo_i.values lpd_point = np.vstack([find_point_wise_loo_score(fit) for fit in fit_list]).T exp_lpd_point = np.exp(lpd_point) dist100_median = wells.loc[wells.index[train_id], "dist100"].median() logarsenic_median = wells.loc[wells.index[train_id], "logarsenic"].median() wells["dist100_l"] = (wells["dist100"] - dist100_median).clip(upper=0) wells["dist100_r"] = (wells["dist100"] - dist100_median).clip(lower=0) wells["logarsenic_l"] = (wells["logarsenic"] - logarsenic_median).clip(upper=0) wells["logarsenic_r"] = (wells["logarsenic"] - logarsenic_median).clip(lower=0) stacking_features = [ "edu0", "edu1", "edu2", "edu3", "assoc_half", "dist100_l", "dist100_r", "logarsenic_l", "logarsenic_r", ] X_stacking_train = wells.loc[train_id, stacking_features].to_numpy() X_stacking_test = wells.loc[test_id, stacking_features].to_numpy() def stacking( X, d_discrete, X_test, exp_lpd_point, tau_mu, tau_sigma, *, test, ): Get weights with which to stack candidate models' predictions. Parameters ---------- X Training stacking matrix: features on which stacking weights should depend, for the training set. d_discrete Number of discrete features in `X` and `X_test`. The first `d_discrete` features from these matrices should be the discrete ones, with the continuous ones coming after them. X_test Test stacking matrix: features on which stacking weights should depend, for the testing set. exp_lpd_point LOO score evaluated at each point in the training set, for each candidate model. tau_mu Hyperprior for mean of `beta`, for discrete features. tau_sigma Hyperprior for standard deviation of `beta`, for continuous features. test Whether to calculate stacking weights for test set. Notes ----- Naming of variables mirrors what's used in the original paper. N = X.shape[0] d = X.shape[1] N_test = X_test.shape[0] K = lpd_point.shape[1] # number of candidate models with numpyro.plate("Candidate models", K - 1, dim=-2): # mean effect of discrete features on stacking weights mu = numpyro.sample("mu", dist.Normal(0, tau_mu)) # standard deviation effect of discrete features on stacking weights sigma = numpyro.sample("sigma", dist.HalfNormal(scale=tau_sigma)) with numpyro.plate("Discrete features", d_discrete, dim=-1): # effect of discrete features on stacking weights tau = numpyro.sample("tau", dist.Normal(0, 1)) with numpyro.plate("Continuous features", d - d_discrete, dim=-1): # effect of continuous features on stacking weights beta_con = numpyro.sample("beta_con", dist.Normal(0, 1)) # effects of features on stacking weights beta = numpyro.deterministic( "beta", jnp.hstack([(sigma.squeeze() * tau.T + mu.squeeze()).T, beta_con]) ) assert beta.shape == (K - 1, d) # stacking weights (in unconstrained space) f = jnp.hstack([X @ beta.T, jnp.zeros((N, 1))]) assert f.shape == (N, K) # log probability of LOO training scores weighted by stacking weights. log_w = jax.nn.log_softmax(f, axis=1) # stacking weights (constrained to sum to 1) numpyro.deterministic("w", jnp.exp(log_w)) logp = jax.nn.logsumexp(lpd_point + log_w, axis=1) numpyro.factor("logp", jnp.sum(logp)) if test: # test set stacking weights (in unconstrained space) f_test = jnp.hstack([X_test @ beta.T, jnp.zeros((N_test, 1))]) # test set stacking weights (constrained to sum to 1) w_test = numpyro.deterministic("w_test", jax.nn.softmax(f_test, axis=1)) sampler = numpyro.infer.NUTS(stacking) mcmc = numpyro.infer.MCMC( sampler, num_chains=4, num_samples=1000, num_warmup=1000, progress_bar=False ) mcmc.run( jax.random.PRNGKey(17), X=X_stacking_train, d_discrete=4, X_test=X_stacking_test, exp_lpd_point=exp_lpd_point, tau_mu=1.0, tau_sigma=0.5, test=True, ) trace = mcmc.get_samples() fig, ax = plt.subplots(nrows=1, ncols=2, figsize=(16, 6), sharey=True) training_stacking_weights = trace["w"].mean(axis=0) sns.scatterplot(data=pd.DataFrame(training_stacking_weights), ax=ax[0]) fixed_weights = ( az.compare({idx: fit for idx, fit in enumerate(fit_list)}, method="stacking") .sort_index()["weight"] .to_numpy() ) fixed_weights_df = pd.DataFrame( np.repeat( fixed_weights[jnp.newaxis, :], len(X_stacking_train), axis=0, ) ) sns.scatterplot(data=fixed_weights_df, ax=ax[1]) ax[0].set_title("Training weights from Bayesian Hierarchical stacking") ax[1].set_title("Fixed weights stacking") ax[0].set_xlabel("Index") ax[1].set_xlabel("Index") fig.suptitle( "Bayesian Hierarchical Stacking weights can vary according to the input", fontsize=18, ) fig.tight_layout(); # for each candidate model, extract the posterior predictive logits train_preds = [] for k in range(K): predictive = numpyro.infer.Predictive(logistic, fit_list[k].get_samples()) rng_key = jax.random.fold_in(jax.random.PRNGKey(19), k) train_pred = predictive(rng_key, x=train_x_list[k])["logits"] train_preds.append(train_pred.mean(axis=0)) # reshape, so we have (N, K) train_preds = np.vstack(train_preds).T # same as previous cell, but for test set test_preds = [] for k in range(K): predictive = numpyro.infer.Predictive(logistic, fit_list[k].get_samples()) rng_key = jax.random.fold_in(jax.random.PRNGKey(20), k) test_pred = predictive(rng_key, x=test_x_list[k])["logits"] test_preds.append(test_pred.mean(axis=0)) test_preds = np.vstack(test_preds).T # get the stacking weights for the test set test_stacking_weights = trace["w_test"].mean(axis=0) # get predictions using the stacking weights bhs_predictions = (test_stacking_weights * test_preds).sum(axis=1) # get predictions using only the model with the best LOO score model_selection_preds = test_preds[:, lpd_point.sum(axis=0).argmax()] # get predictions using fixed stacking weights, dependent on the LOO score fixed_weights_preds = (fixed_weights * test_preds).sum(axis=1) fig, ax = plt.subplots(figsize=(12, 6)) neg_log_pred_densities = np.vstack( [ -dist.Bernoulli(logits=bhs_predictions).log_prob(y_test), -dist.Bernoulli(logits=model_selection_preds).log_prob(y_test), -dist.Bernoulli(logits=fixed_weights_preds).log_prob(y_test), ] ).T neg_log_pred_density = pd.DataFrame( neg_log_pred_densities, columns=[ "Bayesian Hierarchical Stacking", "Model selection", "Fixed stacking weights", ], ) sns.barplot( data=neg_log_pred_density.reindex( columns=neg_log_pred_density.mean(axis=0).sort_values(ascending=False).index ), orient="h", ax=ax, ) ax.set_title( "Bayesian Hierarchical Stacking performs best here", fontdict={"fontsize": 18} ) ax.set_xlabel("Negative mean log predictive density (lower is better)"); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1. Exploratory Data Analysis <a class="anchor" id="1"></a> Step2: Next, we'll choose 200 observations to be part of our train set, and 1500 to be part of our test set. Step4: 2. Prepare 6 different candidate models <a class="anchor" id="2"></a> Step5: 2.2 Training <a class="anchor" id="2.2"></a> Step6: 2.3 Estimate leave-one-out cross-validated score for each training point <a class="anchor" id="2.3"></a> Step7: 3. Bayesian Hierarchical Stacking <a class="anchor" id="3"></a> Step9: 3.2 Define stacking model <a class="anchor" id="3.2"></a> Step10: We can now extract the weights with which to weight the different models from the posterior, and then visualise how they vary across the training set. Step11: 4. Evaluate on test set <a class="anchor" id="4"></a> Step12: 4.2 Compare methods <a class="anchor" id="4.2"></a>
8,089
<ASSISTANT_TASK:> Python Code: import ipywidgets as widgets from traitlets import Unicode class HelloWidget(widgets.DOMWidget): _view_name = Unicode('HelloView').tag(sync=True) _view_module = Unicode('hello').tag(sync=True) %%javascript require.undef('hello'); define('hello', ["@jupyter-widgets/base"], function(widgets) { var HelloView = widgets.DOMWidgetView.extend({ // Render the view. render: function() { this.$el.text('Hello World!'); }, }); return { HelloView: HelloView }; }); HelloWidget() class HelloWidget(widgets.DOMWidget): _view_name = Unicode('HelloView').tag(sync=True) _view_module = Unicode('hello').tag(sync=True) value = Unicode('Hello World!').tag(sync=True) %%javascript require.undef('hello'); define('hello', ["@jupyter-widgets/base"], function(widgets) { var HelloView = widgets.DOMWidgetView.extend({ render: function() { this.$el.text(this.model.get('value')); }, }); return { HelloView : HelloView }; }); %%javascript require.undef('hello'); define('hello', ["@jupyter-widgets/base"], function(widgets) { var HelloView = widgets.DOMWidgetView.extend({ render: function() { this.value_changed(); this.model.on('change:value', this.value_changed, this); }, value_changed: function() { this.$el.text(this.model.get('value')); }, }); return { HelloView : HelloView }; }); w = HelloWidget() w w.value = 'test' from traitlets import CInt class SpinnerWidget(widgets.DOMWidget): _view_name = Unicode('SpinnerView').tag(sync=True) _view_module = Unicode('spinner').tag(sync=True) value = CInt().tag(sync=True) %%javascript requirejs.undef('spinner'); define('spinner', ["@jupyter-widgets/base"], function(widgets) { var SpinnerView = widgets.DOMWidgetView.extend({ render: function() { var that = this; this.$input = $('<input />'); this.$el.append(this.$input); this.$spinner = this.$input.spinner({ change: function( event, ui ) { that.handle_spin(that.$spinner.spinner('value')); }, spin: function( event, ui ) { //ui.value is the new value of the spinner that.handle_spin(ui.value); } }); this.value_changed(); this.model.on('change:value', this.value_changed, this); }, value_changed: function() { this.$spinner.spinner('value', this.model.get('value')); }, handle_spin: function(value) { this.model.set('value', value); this.touch(); }, }); return { SpinnerView: SpinnerView }; }); w = SpinnerWidget(value=5) w w.value = 7 from IPython.display import display w1 = SpinnerWidget(value=0) w2 = widgets.IntSlider() display(w1,w2) from traitlets import link mylink = link((w1, 'value'), (w2, 'value')) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Front end (JavaScript) Step2: Test Step3: Making the widget stateful Step4: Dynamic updates Step5: An example including bidirectional communication Step6: Test of the spinner widget Step7: Wiring the spinner with another widget
8,090
<ASSISTANT_TASK:> Python Code: import numpy as np import os import six.moves.urllib as urllib import sys import tarfile import tensorflow as tf import zipfile from collections import defaultdict from io import StringIO from matplotlib import pyplot as plt from PIL import Image # This is needed to display the images. %matplotlib inline # This is needed since the notebook is stored in the object_detection folder. sys.path.append("..") from utils import label_map_util from utils import visualization_utils as vis_util # What model to download. MODEL_NAME = 'ssd_mobilenet_v1_coco_11_06_2017' MODEL_FILE = MODEL_NAME + '.tar.gz' DOWNLOAD_BASE = 'http://download.tensorflow.org/models/object_detection/' # Path to frozen detection graph. This is the actual model that is used for the object detection. PATH_TO_CKPT = MODEL_NAME + '/frozen_inference_graph.pb' # List of the strings that is used to add correct label for each box. PATH_TO_LABELS = os.path.join('data', 'mscoco_label_map.pbtxt') NUM_CLASSES = 90 opener = urllib.request.URLopener() opener.retrieve(DOWNLOAD_BASE + MODEL_FILE, MODEL_FILE) tar_file = tarfile.open(MODEL_FILE) for file in tar_file.getmembers(): file_name = os.path.basename(file.name) if 'frozen_inference_graph.pb' in file_name: tar_file.extract(file, os.getcwd()) detection_graph = tf.Graph() with detection_graph.as_default(): od_graph_def = tf.GraphDef() with tf.gfile.GFile(PATH_TO_CKPT, 'rb') as fid: serialized_graph = fid.read() od_graph_def.ParseFromString(serialized_graph) tf.import_graph_def(od_graph_def, name='') label_map = label_map_util.load_labelmap(PATH_TO_LABELS) categories = label_map_util.convert_label_map_to_categories(label_map, max_num_classes=NUM_CLASSES, use_display_name=True) category_index = label_map_util.create_category_index(categories) def load_image_into_numpy_array(image): (im_width, im_height) = image.size return np.array(image.getdata()).reshape( (im_height, im_width, 3)).astype(np.uint8) # For the sake of simplicity we will use only 2 images: # image1.jpg # image2.jpg # If you want to test the code with your images, just add path to the images to the TEST_IMAGE_PATHS. PATH_TO_TEST_IMAGES_DIR = 'test_images' TEST_IMAGE_PATHS = [ os.path.join(PATH_TO_TEST_IMAGES_DIR, 'image{}.jpg'.format(i)) for i in range(1, 3) ] # Size, in inches, of the output images. IMAGE_SIZE = (12, 8) with detection_graph.as_default(): with tf.Session(graph=detection_graph) as sess: # Definite input and output Tensors for detection_graph image_tensor = detection_graph.get_tensor_by_name('image_tensor:0') # Each box represents a part of the image where a particular object was detected. detection_boxes = detection_graph.get_tensor_by_name('detection_boxes:0') # Each score represent how level of confidence for each of the objects. # Score is shown on the result image, together with the class label. detection_scores = detection_graph.get_tensor_by_name('detection_scores:0') detection_classes = detection_graph.get_tensor_by_name('detection_classes:0') num_detections = detection_graph.get_tensor_by_name('num_detections:0') for image_path in TEST_IMAGE_PATHS: image = Image.open(image_path) # the array based representation of the image will be used later in order to prepare the # result image with boxes and labels on it. image_np = load_image_into_numpy_array(image) # Expand dimensions since the model expects images to have shape: [1, None, None, 3] image_np_expanded = np.expand_dims(image_np, axis=0) # Actual detection. (boxes, scores, classes, num) = sess.run( [detection_boxes, detection_scores, detection_classes, num_detections], feed_dict={image_tensor: image_np_expanded}) # Visualization of the results of a detection. vis_util.visualize_boxes_and_labels_on_image_array( image_np, np.squeeze(boxes), np.squeeze(classes).astype(np.int32), np.squeeze(scores), category_index, use_normalized_coordinates=True, line_thickness=8) plt.figure(figsize=IMAGE_SIZE) plt.imshow(image_np) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Env setup Step2: Object detection imports Step3: Model preparation Step4: Download Model Step5: Load a (frozen) Tensorflow model into memory. Step6: Loading label map Step7: Helper code Step8: Detection
8,091
<ASSISTANT_TASK:> Python Code: movie_reviews.categories() documents = [(list(word for word in movie_reviews.words(fileid) if word not in stop_words), category) for category in movie_reviews.categories() for fileid in movie_reviews.fileids(category) ] random.shuffle(documents) all_words = [] for w in movie_reviews.words(): all_words.append(w.lower()) all_words = nltk.FreqDist(all_words) all_words.most_common(20) all_words["hate"] ## counting the occurences of a single word feature_words = list(all_words.keys())[:5000] def find_features(document): words = set(document) feature = {} for w in feature_words: feature[w] = (w in words) return feature feature_sets = [(find_features(rev), category) for (rev, category) in documents] feature_sets[:1] training_set = feature_sets[:1900] testing_set = feature_sets[1900:] ## TO-DO: To build own naive bais algorithm # classifier = nltk.NaiveBayesClassifier.train(training_set) ## saving the classifier # save_classifier = open("naive_bayes.pickle", "wb") # pickle.dump(classifier, save_classifier) # save_classifier.close() ## Now that the picke is saved we will use that. ## Using the pickle file now pickle_classifier = open("naive_bayes.pickle", "rb") classifier = pickle.load(pickle_classifier) pickle_classifier.close() ## Testing it's accuracy print("Naive bayes classifier accuracy percentage : ", (nltk.classify.accuracy(classifier, testing_set))*100) classifier.show_most_informative_features(20) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Now I need to store it as Step2: Getting the list of all words to store the most frequently occuring ones Step3: Making a frequency distribution of the words Step4: will train only for the first 5000 top words in the list Step5: Finding these feature words in documents, making our function would ease it out! Step6: What the below one does is, before hand we had only words and its category. But not we have the feature set (along with a boolean value of whether it is one of the most frequently used words or not)of the same word and then the category. Step7: Training the classifier Step8: We won't be telling the machine the category i.e. whether the document is a postive one or a negative one. We ask it to tell that to us. Then we compare it to the known category that we have and calculate how accurate it is.
8,092
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import tensorflow as tf from tensorflow.keras.preprocessing.text import Tokenizer from tensorflow.keras.preprocessing.sequence import pad_sequences # Other imports for processing data import string import numpy as np import pandas as pd !wget --no-check-certificate \ https://drive.google.com/uc?id=1LiJFZd41ofrWoBtW-pMYsfz1w8Ny0Bj8 \ -O /tmp/songdata.csv def tokenize_corpus(corpus, num_words=-1): # Fit a Tokenizer on the corpus if num_words > -1: tokenizer = Tokenizer(num_words=num_words) else: tokenizer = Tokenizer() tokenizer.fit_on_texts(corpus) return tokenizer def create_lyrics_corpus(dataset, field): # Remove all other punctuation dataset[field] = dataset[field].str.replace('[{}]'.format(string.punctuation), '') # Make it lowercase dataset[field] = dataset[field].str.lower() # Make it one long string to split by line lyrics = dataset[field].str.cat() corpus = lyrics.split('\n') # Remove any trailing whitespace for l in range(len(corpus)): corpus[l] = corpus[l].rstrip() # Remove any empty lines corpus = [l for l in corpus if l != ''] return corpus def tokenize_corpus(corpus, num_words=-1): # Fit a Tokenizer on the corpus if num_words > -1: tokenizer = Tokenizer(num_words=num_words) else: tokenizer = Tokenizer() tokenizer.fit_on_texts(corpus) return tokenizer # Read the dataset from csv - this time with 250 songs dataset = pd.read_csv('/tmp/songdata.csv', dtype=str)[:250] # Create the corpus using the 'text' column containing lyrics corpus = create_lyrics_corpus(dataset, 'text') # Tokenize the corpus tokenizer = tokenize_corpus(corpus, num_words=2000) total_words = tokenizer.num_words # There should be a lot more words now print(total_words) sequences = [] for line in corpus: token_list = tokenizer.texts_to_sequences([line])[0] for i in range(1, len(token_list)): n_gram_sequence = token_list[:i+1] sequences.append(n_gram_sequence) # Pad sequences for equal input length max_sequence_len = max([len(seq) for seq in sequences]) sequences = np.array(pad_sequences(sequences, maxlen=max_sequence_len, padding='pre')) # Split sequences between the "input" sequence and "output" predicted word input_sequences, labels = sequences[:,:-1], sequences[:,-1] # One-hot encode the labels one_hot_labels = tf.keras.utils.to_categorical(labels, num_classes=total_words) from tensorflow.keras.models import Sequential from tensorflow.keras.layers import Embedding, LSTM, Dense, Bidirectional model = Sequential() model.add(Embedding(total_words, 64, input_length=max_sequence_len-1)) model.add(Bidirectional(LSTM(20))) model.add(Dense(total_words, activation='softmax')) model.compile(loss='categorical_crossentropy', optimizer='adam', metrics=['accuracy']) history = model.fit(input_sequences, one_hot_labels, epochs=100, verbose=1) import matplotlib.pyplot as plt def plot_graphs(history, string): plt.plot(history.history[string]) plt.xlabel("Epochs") plt.ylabel(string) plt.show() plot_graphs(history, 'accuracy') seed_text = "im feeling chills" next_words = 100 for _ in range(next_words): token_list = tokenizer.texts_to_sequences([seed_text])[0] token_list = pad_sequences([token_list], maxlen=max_sequence_len-1, padding='pre') predicted = np.argmax(model.predict(token_list), axis=-1) output_word = "" for word, index in tokenizer.word_index.items(): if index == predicted: output_word = word break seed_text += " " + output_word print(seed_text) # Test the method with just the first word after the seed text seed_text = "im feeling chills" next_words = 100 token_list = tokenizer.texts_to_sequences([seed_text])[0] token_list = pad_sequences([token_list], maxlen=max_sequence_len-1, padding='pre') predicted_probs = model.predict(token_list)[0] predicted = np.random.choice([x for x in range(len(predicted_probs))], p=predicted_probs) # Running this cell multiple times should get you some variance in output print(predicted) # Use this process for the full output generation seed_text = "im feeling chills" next_words = 100 for _ in range(next_words): token_list = tokenizer.texts_to_sequences([seed_text])[0] token_list = pad_sequences([token_list], maxlen=max_sequence_len-1, padding='pre') predicted_probs = model.predict(token_list)[0] predicted = np.random.choice([x for x in range(len(predicted_probs))], p=predicted_probs) output_word = "" for word, index in tokenizer.word_index.items(): if index == predicted: output_word = word break seed_text += " " + output_word print(seed_text) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Optimizing the Text Generation Model Step2: Get the Dataset Step3: 250 Songs Step4: Create Sequences and Labels Step5: Train a (Better) Text Generation Model Step6: View the Training Graph Step7: Generate better lyrics! Step8: Varying the Possible Outputs
8,093
<ASSISTANT_TASK:> Python Code: import pandas as pd # Importing necessary data package import matplotlib.pyplot as plt # pyplot module import numpy as np Zillow = pd.ExcelFile("Properties_philly_Kraggle_v2.xlsx") zz = Zillow.parse('Properties_philly_Kraggle_v2') zz print('Dimensions: ', zz.shape) # looking at the categories I can work with print('Column labels: ', zz.columns) #Listing out the Column headings print('Row labels: ', zz.index) z = zz.dropna() #Dropped empty rows that does have any data print('Dimensions: ', z.shape) plt.scatter(z['Postal Code'], z[' Violent Crime Rate ']) plt.show() plt.scatter(z['Postal Code'], z[' Avg Walk&Transit score ']) plt.show() plt.scatter(z['Postal Code'], z[' School Score ']) plt.show() plt.scatter(z['Postal Code'], z['Sale Price/bid price']) plt.show() z1 = pd.DataFrame(z, columns = ['Address', 'Zillow Address', 'Sale Date', 'Opening Bid', 'Sale Price/bid price', 'Book/Writ', 'OPA', 'Postal Code', 'Attorney', 'Ward', 'Seller', 'Buyer', 'Sheriff Cost', 'Advertising', 'Other', 'Record Deed', 'Water', 'PGW', ' Avg Walk&Transit score ', ' Violent Crime Rate ', ' School Score ', 'Zillow Estimate', 'Rent Estimate', 'taxAssessment', 'yearBuilt', 'finished \n(SqFt)', ' bathrooms ', ' bedrooms ', 'PropType', 'Average comps']) z1['Avg. Price'] = z1[['Zillow Estimate', 'taxAssessment', 'Average comps']].mean(axis=1) list(z1) z1['Avg. Price'].head() z1['Avg. price per sq. ft'] = z1['Avg. Price']/z1['finished \n(SqFt)'] z1['Avg. price per sq. ft'].head() z1[' Violent Crime Rate '].median() z1[' Violent Crime Rate '].min() z1[' Violent Crime Rate '].max() crimerank = [] for row in z1[' Violent Crime Rate ']: if row<0.344: crimerank.append(1) elif row>=0.344 and row<0.688: crimerank.append(2) elif row>=0.688 and row<1.032: crimerank.append(3) elif row>=1.032 and row<1.376: crimerank.append(4) else: crimerank.append(5) z1['Crime Rank'] = crimerank z1['Crime Rank'].head() zcrime = z1.groupby(['Crime Rank'])['Avg. Price'].mean() zcrime plt.figure(figsize = (16,7)) # plotting our data plt.plot(zcrime, color = 'red', marker= '*') plt.suptitle('Average price by crime', fontsize=18) plt.xlabel('Crime Rank', fontsize=12) plt.ylabel('Average price of houses', fontsize=12) plt.show() Walkrank = [] for row in z1[' Avg Walk&Transit score ']: if row>88: Walkrank.append(1) elif row>77 and row<=88: Walkrank.append(2) elif row>66 and row<=77: Walkrank.append(3) elif row>55 and row<=66: Walkrank.append(4) else: Walkrank.append(5) z1['Walk Rank'] = Walkrank z1['Walk Rank'].head() zwalk = z1.groupby(['Walk Rank'])['Avg. Price'].mean() zwalk plt.figure(figsize = (16,7)) # plotting our data plt.plot(zwalk, color = 'blue', marker= '*') plt.suptitle('Average price by walkrank', fontsize=18) plt.xlabel('Walk Rank', fontsize=12) plt.ylabel('Average price of houses', fontsize=12) plt.show() Schoolrank = [] for row in z1[' School Score ']: if row>57.308: Schoolrank.append(1) elif row>43.816 and row<=57.308: Schoolrank.append(2) elif row>30.324 and row<=43.816: Schoolrank.append(3) elif row>16.832 and row<=30.324: Schoolrank.append(4) else: Schoolrank.append(5) z1['School Rank'] = Schoolrank zschool = z1.groupby(['School Rank'])['Avg. Price'].mean() zschool plt.figure(figsize = (16,7)) # plotting our data plt.plot(zschool, color = 'blue', marker= '*') plt.suptitle('Average price by schoolrank', fontsize=18) plt.xlabel('School Rank', fontsize=12) plt.ylabel('Average price of houses', fontsize=12) plt.show() z1.head() z1['Closing Cost'] = z1['Avg. Price']*.085 z1['Rehab Cost'] = z1['finished \n(SqFt)']*25 z1['Estimated Max Bid Price']= z1['Avg. Price']-z1['Rehab Cost'] z1.head() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Data Soure Step2: Crime rate, Walks and School score in each postal code Step3: House sales price by zipcode Step4: Calculating Average price of the property Step5: Average Price per sq. ft Step6: Calculating rank based on Crime rate Step7: Impact of Crime over sales price Step8: Calculating rank based on Walk score Step9: Impact of Walkscore over sales price Step10: Calculating rank based on School rating Step11: Impact of School score over sales price Step12: z1['Avg. price per sq. ft'] = z1['Avg. Price']/z1['finished \n(SqFt)']
8,094
<ASSISTANT_TASK:> Python Code: %run ../python-libs/inpututils.py %run ../python-libs/graycodes.py %run ../python-libs/bits.py python_code(graycode_unrank) print('\n'.join(list(binary_reflected_graycodes(3, justified=True)))) from itertools import count example_graycodes = binary_reflected_graycodes(length=3) for c, (o, s, p, r) in zip(count(), binary_reflected_graycodes_reduce(example_graycodes)): print('{:>5}\t{:>5}\t{}'.format(bin(c), bin(o), p)) python_code(graycodes_direct) for i, (code, changingbit_position) in zip(count(), graycodes_direct(3)): print('{:>5}\t{:>5}\t{}'.format(bin(i),bin(code), changingbit_position)) python_code(rightmost_zeroes_in_binary_counting, graycodes_by_transition_sequence) list(rightmost_zeroes_in_binary_counting(3)) graycodes_with_positions = graycodes_by_transition_sequence(rightmost_zeroes_in_binary_counting(3)) for b, (code, p) in zip(count(), graycodes_with_positions): print('{:>5}\t{:>5}\t{}'.format(bin(b), bin(code), p)) python_code(turn_on_last_zero) for i in range(2**3-1): I, z = turn_on_last_zero(i) print(I, z) python_code(graycode_rank) python_code(is_on, set_all) python_code(graycodes_combinations) for c, i, j in graycodes_combinations(6,3): print("{:>8}\t{}\t{}".format(bin(c), i, j)) python_code(graycodes_combinations_homogeneous) for c, i, j in graycodes_combinations_homogeneous(8,4): print('{}\t{}\t{:>8}'.format(i, j, bin(c),)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Combinatorial Generation Step2: The following is an iterable of Gray codes we saw in the example above, namely all of them of length 3, pretty-printed Step3: Moreover, we have implemented an operator which allows us to process an iterable of codes pairwise, possibly plugging-in custom behavior via lambda expressions. Previous table with the position of the changing-bit can be rebuilt as follows Step4: Direct generation Step5: and can be used to build the same example table; observe that the changing-bit positions sequence is shifted forward by one Step6: Counting without cycles Step7: Simply via bitmasking Step8: and can be used directly with binary counting Step9: Ranking Gray codes Step10: where auxiliary functions are defined as follows Step11: Gray codes for combinations Step12: it can be used as follows, showing changing-bits positions too Step13: Using homogeneous transposition relation
8,095
<ASSISTANT_TASK:> Python Code: id # id(obj: Any) -> int int # int(obj: SupportsInt) -> int list.append # list.append(self: List[T], obj: T) -> None from typing import TypeVar # PEP 484 T = TypeVar('T') def add(self: T, other: T) -> T: # PEP 3107 return self + other from typing import List, Tuple t0: int = add(1, 2) t1: List[int] = add([1], [2]) t2: Tuple = add((1,), (2,)) from typing import List l: List[int] = [1,2,3] def indexer(i): return l[i] from typing import overload, Iterable @overload def indexer(i: int) -> int: pass @overload def indexer(i: slice) -> Iterable[int]: pass def indexer(i): return l[i] def bar(x): return str(x) def foo(x): return bar if int(x) else None from typing import Optional, SupportsInt, Any, Callable def bar(x: Any) -> str: return str(x) def foo(x: SupportsInt) -> Optional[Callable[[Any], str]]: return bar if int(x) else None from typing import Iterable, Tuple, List x: Iterable[int] = range(3) y: Iterable[int] = reversed(range(3)) l0: Iterable[Tuple[int, int]] = zip(x, y) l1: Tuple[Iterable[int], Iterable[int]] = zip(*l0) from random import randint n = randint(1, 4) t0: List[Tuple[int]] = [(1, )] * n l2: Tuple[(int,) * n] = zip(*t0) l: Any = eval("1 + 2") %%file pyconfr2017/ko.py a: int = 1 ko = __import__("pyconfr2017.ko") def isiterable0(x): # nominal return isinstance(x, (set, tuple, list, dict, str)) def isiterable1(x): # structurel return hasattr(x, '__iter__') def isiterable2(x): # duck type v0 try: x.__iter__() return True except: return False def isiterable3(x): # duck type v1 try: iter(x) return True except: return False from collections.abc import Iterable def isiterable(x): return isinstance(x, Iterable) def check_iterable(l): return isiterable0(l), isiterable1(l), isiterable2(l), isiterable3(l), isiterable(l) l = [1, 2, 3, 5] check_iterable(l) class EmptySequence(object): def __iter__(self): yield def __len__(self): return 0 es = EmptySequence() check_iterable(es) class Infinity(object): def __getitem__(self, _): return 0 infnty = Infinity() check_iterable(infnty) class Hole(object): def __iter__(self, _): pass h = Hole() check_iterable(h) import abc # PEP 3119 class Appendable(abc.ABC): @classmethod def __subclasshook__(cls, C): return any('append' in B.__dict__ for B in C.mro()) class DevNull(object): def append(self, value): pass def __len__(self): return 0 issubclass(DevNull, Appendable) class TraitsFactory(object): def __getitem__(self, method_names): if not isinstance(method_names, tuple): method_names = method_names, class SlotCheck(abc.ABC): @classmethod def __subclasshook__(cls, C): return all(any(method_name in B.__dict__ for B in C.mro()) for method_name in method_names) return SlotCheck Members = TraitsFactory() issubclass(DevNull, Members['append', '__len__']) issubclass(DevNull, Members['append', 'clear']) class Twice(list): def append(self, value, times): for _ in range(times): super(Twice, self).append(value) tw = Twice() tw.append("ore", 2) len(tw) isinstance(tw, Members['append', '__len__']) tw.append("aison") # gentlemna contract again import inspect inspect.signature(Twice.append).parameters inspect.signature(list.append) from typing import Callable isinstance(list.append, Callable) from typing import List, TypeVar; T = TypeVar('T') isinstance(list.append, Callable[[List[T], T], None]) from typeguard import typechecked def aff(x: int) -> int: return x * 2 + 1 aff(2) aff("2") taff = typechecked(aff) taff(2) taff("2") taff(2.) from numbers import Number # PEP 3141 @typechecked def taff(x: Number) -> Number: return x * 2 + 1 taff(1), taff(1.), taff(1j) print("** without type checking **") %timeit aff(2) print("** with type checking **") %timeit taff(2) @typechecked def index(x: Members["__getitem__"]) -> None: x[1] index([1,2]) @typechecked def pouce(x: Members['__getitem__']) -> None: return x[0] pouce([0]) from typing import List, TypeVar; T = TypeVar('T') @typechecked def majeur(x: List[T]) -> T: return x[2] majeur([1,2,3]) majeur([1, "1", 1]) @typechecked def step(x : List[T]) -> List[T]: return x + [x[-2] + x[-1]] step([1, 2]) from functools import reduce reduce(lambda x, _: step(x), range(10), [0, 1]) from typing import Tuple @typechecked def step(x : Tuple) -> Tuple: return x + (x[-2] + x[-1],) step((1,2)) @typechecked def step(x : Tuple) -> Tuple: return x + (x[-2] + x[-1],) step((1,2)) from mypy.api import run as mypy_runner def mypy(*args): print( mypy_runner(args)[0]) %%file pyconfr2017/mypy0.py from typing import Tuple def step(x : Tuple) -> Tuple: return x + (x[-2] + x[-1],) step([1, 2]) mypy("pyconfr2017/mypy0.py") %%file pyconfr2017/mypy1.py from typing import Tuple def step(x : Tuple) -> Tuple: return x + (x[-2] + x[-1],) step((1, 2)) mypy("pyconfr2017/mypy1.py") %%file pyconfr2017/mypy2.py from typing import Tuple, Any def step(x : Tuple[int, ...]) -> Tuple[int, ...]: return x + (x[-2] + x[-1],) step((1, 2)) mypy("pyconfr2017/mypy2.py") float_mode = True scalar = float if float_mode else int @typechecked def div(n: scalar): return 2 / n div(scalar(3)) %%file pyconfr2017/mypy3.py float_mode = True scalar_type = float if float_mode else int def div(n: scalar_type): return 2 / n div(scalar_type(3)) mypy("pyconfr2017/mypy3.py") import numpy help(numpy.sum) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Round 1 Step2: Round 2 Step3: Round 3 Step4: K.O. Step5: Pour avoir l'air savant Step6: Quizz Step7: Peut-on se mocker ? Step8: Test de robustesse n°0 Step9: Test de robustesse n°1 Step10: __subclasshook__ Step11: NB ça ne teste que les noms de membre, pas leur type... Step12: Le gadget de l'inspecteur Step13: Un bon moyen pour tester l'arité ? Step14: import typeguard Step15: Un peu plus loin Step16: MyPy Step17: Python n'est il pas Dynamique? Step18: Le coup fatal
8,096
<ASSISTANT_TASK:> Python Code: import fiona from shapely.geometry import shape import nhrc2 import matplotlib.pyplot as plt from mpl_toolkits.basemap import Basemap from collections import defaultdict import numpy as np from matplotlib.patches import Polygon from shapely.geometry import Point %matplotlib inline #the project root directory: nhrc2dir = ('/').join(nhrc2.__file__.split('/')[:-1])+'/' c = fiona.open(nhrc2dir+'data/nh_neighborhoods/nh_neighborhoods.shp') pol = c.next() geom = shape(pol['geometry']) c.crs for i in c.items(): print(i[1]) len(c) for i in c: pol = i geom = shape(pol['geometry']) geom geom #Based on code from Kelly Jordhal: #http://nbviewer.ipython.org/github/mqlaql/geospatial-data/blob/master/Geospatial-Data-with-Python.ipynb def plot_polygon(ax, poly): a = np.asarray(poly.exterior) ax.add_patch(Polygon(a, facecolor='#46959E', alpha=0.3)) ax.plot(a[:, 0], a[:, 1], color='black') def plot_multipolygon(ax, geom): Can safely call with either Polygon or Multipolygon geometry if geom.type == 'Polygon': plot_polygon(ax, geom) elif geom.type == 'MultiPolygon': for poly in geom.geoms: plot_polygon(ax, poly) nhv_geom = defaultdict() #colors = ['red', 'green', 'orange', 'brown', 'purple'] fig, ax = plt.subplots(figsize=(12,12)) for rec in c: #print(rec['geometry']['type']) hood = rec['properties']['name'] nhv_geom[hood] = shape(rec['geometry']) plot_multipolygon(ax, nhv_geom[hood]) labels = ax.get_xticklabels() for label in labels: label.set_rotation(90) ax.set_xlabel('Longitude') ax.set_ylabel('Latitude') ax.plot(scf_df.loc[0, 'lng'], scf_df.loc[0, 'lat'], 'o') import nhrc2.backend.read_seeclickfix_api_to_csv as rscf scf_cats = rscf.read_categories(readfile=True) scf_df = rscf.read_issues(scf_cats, readfile=True) len(scf_cats) scf_df.head(3) len(scf_df) scf_df = scf_df[((scf_df['lat'] < 41.36) & (scf_df['lat'] > 41.24) & (scf_df['lng']>=-73.00) & (scf_df['lng'] <= -72.86))] print(len(scf_df)) scf_df.loc[0, 'lat'] grid_point = Point(scf_df.loc[0, 'lng'], scf_df.loc[0, 'lat']) for idx in range(5): grid_point = Point(scf_df.loc[idx, 'lng'], scf_df.loc[idx, 'lat']) print('Point {} at {}'.format(idx, scf_df.loc[idx, 'address'])) print('Downtown: {}'.format(grid_point.within(nhv_geom['Downtown']))) print('East Rock: {}'.format(grid_point.within(nhv_geom['East Rock']))) print('Fair Haven Heights: {}'.format(grid_point.within(nhv_geom['Fair Haven Heights']))) print('Number of neighborhoods: {}'.format(len(nhv_geom.keys()))) for hood in nhv_geom.keys(): print(hood) def get_neighborhoods(scf_df, neighborhoods): hoods = [] for idx in scf_df.index: grid_point = Point(scf_df.loc[idx, 'lng'], scf_df.loc[idx, 'lat']) for hoodnum, hood in enumerate(nhv_geom.keys()): if grid_point.within(nhv_geom[hood]): hoods.append(hood) break if hoodnum == 19: #There are 20 neighborhoods. If you are the 20th (element 19 in #zero-based indexing) and have not continued out of the iteration #set the neighborhood name to "Other": hoods.append('Other') return hoods %time nbrhoods = get_neighborhoods(scf_df, nhv_geom) print(len(scf_df)) print(len(nbrhoods)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Read in neighborhood shapefiles Step3: Now plot the shapefiles Step4: Read in issues and determine the region Step5: Remove issues that do not have correct coordinates
8,097
<ASSISTANT_TASK:> Python Code: from __future__ import division from numpy.random import randn import numpy as np import os import sys import matplotlib.pyplot as plt np.random.seed(12345) plt.rc('figure', figsize=(10, 6)) from pandas import Series, DataFrame import pandas as pd np.set_printoptions(precision=4) %pwd !cat ch06/ex1.csv df = pd.read_csv('ch06/ex1.csv') df !cat ch06/test.csv dfx = pd.read_csv('ch06/test.csv') dfx pd.read_table('ch06/ex1.csv', sep=',') !cat ch06/ex2.csv pd.read_csv('ch06/ex2.csv', names=['a', 'b', 'c', 'd', 'message']) pd.read_csv('ch06/ex2.csv', header=None) names = ['a', 'b', 'c', 'd', 'message'] pd.read_csv('ch06/ex2.csv', names=names, index_col='message') !cat ch06/csv_mindex.csv parsed = pd.read_csv('ch06/csv_mindex.csv', index_col=['key1', 'key2']) parsed list(open('ch06/ex3.txt')) result = pd.read_table('ch06/ex3.txt', sep='\s+') result !cat ch06/ex4.csv pd.read_csv('ch06/ex4.csv', skiprows=[0, 2, 3]) !cat ch06/ex5.csv result = pd.read_csv('ch06/ex5.csv') result pd.isnull(result) result = pd.read_csv('ch06/ex5.csv', na_values=['NULL']) result sentinels = {'message': ['foo', 'NA'], 'something': ['two']} pd.read_csv('ch06/ex5.csv', na_values=sentinels) result = pd.read_csv('ch06/ex6.csv') result pd.read_csv('ch06/ex6.csv', nrows=5) chunker = pd.read_csv('ch06/ex6.csv', chunksize=1000) chunker chunker = pd.read_csv('ch06/ex6.csv', chunksize=1000) tot = Series([]) for piece in chunker: tot = tot.add(piece['key'].value_counts(), fill_value=0) tot = tot.sort_values(ascending=False) tot[:10] data = pd.read_csv('ch06/ex5.csv') data data.to_csv('ch06/out.csv') !cat ch06/out.csv data.to_csv(sys.stdout, sep='|') data.to_csv(sys.stdout, na_rep='HELLO') data.to_csv(sys.stdout, index=False, header=False) data.to_csv(sys.stdout, index=False, columns=['a', 'b', 'c']) dates = pd.date_range('1/1/2000', periods=7) ts = Series(np.arange(7), index=dates) ts.to_csv('ch06/tseries.csv') !cat ch06/tseries.csv Series.from_csv('ch06/tseries.csv', parse_dates=True) !cat ch06/ex7.csv import csv f = open('ch06/ex7.csv') reader = csv.reader(f) for line in reader: print(line) lines = list(csv.reader(open('ch06/ex7.csv'))) header, values = lines[0], lines[1:] data_dict = {h: v for h, v in zip(header, zip(*values))} data_dict class my_dialect(csv.Dialect): lineterminator = '\n' delimiter = ';' quotechar = '"' quoting = csv.QUOTE_MINIMAL with open('mydata.csv', 'w') as f: writer = csv.writer(f, dialect=my_dialect) writer.writerow(('one', 'two', 'three')) writer.writerow(('1', '2', '3')) writer.writerow(('4', '5', '6')) writer.writerow(('7', '8', '9')) %cat mydata.csv obj = {"name": "Wes", "places_lived": ["United States", "Spain", "Germany"], "pet": null, "siblings": [{"name": "Scott", "age": 25, "pet": "Zuko"}, {"name": "Katie", "age": 33, "pet": "Cisco"}] } import json result = json.loads(obj) result asjson = json.dumps(result) siblings = DataFrame(result['siblings'], columns=['name', 'age']) siblings from lxml.html import parse from urllib2 import urlopen parsed = parse(urlopen('http://finance.yahoo.com/q/op?s=AAPL+Options')) doc = parsed.getroot() links = doc.findall('.//a') links[15:20] lnk = links[28] lnk lnk.get('href') lnk.text_content() urls = [lnk.get('href') for lnk in doc.findall('.//a')] urls[-10:] tables = doc.findall('.//table') calls = tables[9] puts = tables[13] rows = calls.findall('.//tr') def _unpack(row, kind='td'): elts = row.findall('.//%s' % kind) return [val.text_content() for val in elts] _unpack(rows[0], kind='th') _unpack(rows[1], kind='td') from pandas.io.parsers import TextParser def parse_options_data(table): rows = table.findall('.//tr') header = _unpack(rows[0], kind='th') data = [_unpack(r) for r in rows[1:]] return TextParser(data, names=header).get_chunk() call_data = parse_options_data(calls) put_data = parse_options_data(puts) call_data[:10] %cd ch06/mta_perf/Performance_XML_Data !head -21 Performance_MNR.xml from lxml import objectify path = 'Performance_MNR.xml' parsed = objectify.parse(open(path)) root = parsed.getroot() data = [] skip_fields = ['PARENT_SEQ', 'INDICATOR_SEQ', 'DESIRED_CHANGE', 'DECIMAL_PLACES'] for elt in root.INDICATOR: el_data = {} for child in elt.getchildren(): if child.tag in skip_fields: continue el_data[child.tag] = child.pyval data.append(el_data) perf = DataFrame(data) perf root root.get('href') root.text cd ../.. frame = pd.read_csv('ch06/ex1.csv') frame frame.to_pickle('ch06/frame_pickle') pd.read_pickle('ch06/frame_pickle') store = pd.HDFStore('mydata.h5') store['obj1'] = frame store['obj1_col'] = frame['a'] store store['obj1'] store.close() os.remove('mydata.h5') import requests url = 'https://api.github.com/repos/pydata/pandas/milestones/28/labels' resp = requests.get(url) resp data[:5] issue_labels = DataFrame(data) issue_labels import sqlite3 query = CREATE TABLE test (a VARCHAR(20), b VARCHAR(20), c REAL, d INTEGER ); con = sqlite3.connect(':memory:') con.execute(query) con.commit() data = [('Atlanta', 'Georgia', 1.25, 6), ('Tallahassee', 'Florida', 2.6, 3), ('Sacramento', 'California', 1.7, 5)] stmt = "INSERT INTO test VALUES(?, ?, ?, ?)" con.executemany(stmt, data) con.commit() cursor = con.execute('select * from test') rows = cursor.fetchall() rows cursor.description DataFrame(rows, columns=zip(*cursor.description)[0]) import pandas.io.sql as sql sql.read_sql('select * from test', con) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Reading and Writing Data in Text Format Step2: A file will not always have a header row. Consider this file Step3: To read this in, you have a couple of options. You can allow pandas to assign default column names, or you can specify names yourself Step4: Suppose you wanted the message column to be the index of the returned DataFrame. You can either indicate you want the column at index 4 or named 'message' using the index_col argument Step5: In the event that you want to form a hierarchical index from multiple columns, just pass a list of column numbers or names Step6: In some cases, a table might not have a fixed delimiter, using whitespace or some other pattern to separate fields. In these cases, you can pass a regular expression as a delimiter for read_table. Consider a text file that looks like this Step7: Because there was one fewer column name than the number of data rows, read_table infers that the first column should be the DataFrame’s index in this special case. Step8: Handling missing values is an important and frequently nuanced part of the file parsing process. Missing data is usually either not present (empty string) or marked by some sentinel value. By default, pandas uses a set of commonly occurring sentinels, such as NA, -1.#IND, and NULL Step9: The na_values option can take either a list or set of strings to consider missing values Step10: Different NA sentinels can be specified for each column in a dict Step11: Reading text files in pieces Step12: If you want to only read out a small number of rows (avoiding reading the entire file), specify that with nrows Step13: To read out a file in pieces, specify a chunksize as a number of rows Step14: The TextParser object returned by read_csv allows you to iterate over the parts of the file according to the chunksize. For example, we can iterate over ex6.csv, aggregating the value counts in the 'key' column like so Step15: Writing data out to text format Step16: Using DataFrame’s to_csv method, we can write the data out to a comma-separated file Step17: Other delimiters can be used, of course (writing to sys.stdout so it just prints the text result; make sure to import sys) Step18: Missing values appear as empty strings in the output. You might want to denote them by some other sentinel value Step19: With no other options specified, both the row and column labels are written. Both of these can be disabled Step20: You can also write only a subset of the columns, and in an order of your choosing Step21: Series also has a to_csv method Step22: With a bit of wrangling (no header, first column as index), you can read a CSV version of a Series with read_csv, but there is also a from_csv convenience method that makes it a bit simpler Step23: Manually working with delimited formats Step25: JSON data Step26: XML and HTML, Web scraping Step27: Parsing XML with lxml.objectify Step28: Binary data formats Step29: Using HDF5 format Step30: Interacting with HTML and Web APIs Step32: Interacting with databases
8,098
<ASSISTANT_TASK:> Python Code: # Import libraries necessary for this project import numpy as np import pandas as pd from time import time from IPython.display import display # Allows the use of display() for DataFrames # Import supplementary visualization code visuals.py import visuals as vs # Pretty display for notebooks %matplotlib inline # Load the Census dataset data = pd.read_csv("census.csv") # Success - Display the first record display(data.head(n=1)) # TODO: Total number of records n_records = data['age'].count() # TODO: Number of records where individual's income is more than $50,000 n_greater_50k = data[data.income==">50K"].income.count() #df[df.a > 1].sum() #data[data['income']==">50K"].count() # TODO: Number of records where individual's income is at most $50,000 n_at_most_50k = data[data.income=="<=50K"].income.count() #data[data['income']=="<=50K"].count() # TODO: Percentage of individuals whose income is more than $50,000 greater_percent = float(n_greater_50k)*100/n_records # Print the results print "Total number of records: {}".format(n_records) print "Individuals making more than $50,000: {}".format(n_greater_50k) print "Individuals making at most $50,000: {}".format(n_at_most_50k) print "Percentage of individuals making more than $50,000: {:.2f}%".format(greater_percent) # Split the data into features and target label income_raw = data['income'] features_raw = data.drop('income', axis = 1) # Visualize skewed continuous features of original data vs.distribution(data) # Log-transform the skewed features skewed = ['capital-gain', 'capital-loss'] features_raw[skewed] = data[skewed].apply(lambda x: np.log(x + 1)) # Visualize the new log distributions vs.distribution(features_raw, transformed = True) # Import sklearn.preprocessing.StandardScaler from sklearn.preprocessing import MinMaxScaler # Initialize a scaler, then apply it to the features scaler = MinMaxScaler() numerical = ['age', 'education-num', 'capital-gain', 'capital-loss', 'hours-per-week'] features_raw[numerical] = scaler.fit_transform(data[numerical]) # Show an example of a record with scaling applied display(features_raw.head(n = 1)) # TODO: One-hot encode the 'features_raw' data using pandas.get_dummies() features = pd.get_dummies(features_raw) # TODO: Encode the 'income_raw' data to numerical values income = income_raw.apply(lambda x: 1 if x == ">50K" else 0) # Print the number of features after one-hot encoding encoded = list(features.columns) print "{} total features after one-hot encoding.".format(len(encoded)) # Uncomment the following line to see the encoded feature names #print encoded # Import train_test_split from sklearn.cross_validation import train_test_split # Split the 'features' and 'income' data into training and testing sets X_train, X_test, y_train, y_test = train_test_split(features, income, test_size = 0.2, random_state = 0) # Show the results of the split print "Training set has {} samples.".format(X_train.shape[0]) print "Testing set has {} samples.".format(X_test.shape[0]) # TODO: Calculate accuracy from sklearn.metrics import accuracy_score from sklearn.metrics import recall_score from sklearn.metrics import fbeta_score income_pred=income.apply(lambda x:1) TP=sum(map(lambda x,y: 1 if x==1 and y==1 else 0, income,income_pred)) #True Pos FP=sum(map(lambda x,y: 1 if x==0 and y==1 else 0, income,income_pred)) #False Pos FN=sum(map(lambda x,y: 1 if x==1 and y==0 else 0, income,income_pred)) #False Neg # accuracy = TP/(TP+FP) accuracy = float(TP)/(TP+FP) # The commented code below was used to confirm the precision calculation was correct #accuracy1 = accuracy_score(income,income_pred) #print 'accuracy comparison',accuracy,accuracy1 # recall = TP/(TP+FN) recall=float(TP)/(TP+FN) # The commented code below was used to confirm the recall calculation was correct #recal1=recall_score(income,income_pred) #print 'recall comparison',recal1,recall1 # TODO: Calculate F-score using the formula above for beta = 0.5 beta=0.5 fscore = (1+beta**2)*(accuracy*recall)/(beta**2*accuracy+recall) #fscore1=fbeta_score(income,income_pred, beta=0.5) #print 'fscore comparison',fscore,fscore1 # Print the results print "Naive Predictor: [Accuracy score: {:.4f}, F-score: {:.4f}]".format(accuracy, fscore) # TODO: Import two metrics from sklearn - fbeta_score and accuracy_score from sklearn.metrics import fbeta_score, accuracy_score def train_predict(learner, sample_size, X_train, y_train, X_test, y_test): ''' inputs: - learner: the learning algorithm to be trained and predicted on - sample_size: the size of samples (number) to be drawn from training set - X_train: features training set - y_train: income training set - X_test: features testing set - y_test: income testing set ''' results = {} # TODO: Fit the learner to the training data using slicing with 'sample_size' start = time() # Get start time learner.fit(X_train[:sample_size],y_train[:sample_size]) end = time() # Get end time # TODO: Calculate the training time results['train_time'] = end-start # TODO: Get the predictions on the test set, # then get predictions on the first 300 training samples start = time() # Get start time predictions_test = learner.predict(X_test) predictions_train = learner.predict(X_train[:300]) end = time() # Get end time # TODO: Calculate the total prediction time results['pred_time'] = end-start # TODO: Compute accuracy on the first 300 training samples results['acc_train'] = accuracy_score(y_train[:300],predictions_train) # TODO: Compute accuracy on test set results['acc_test'] = accuracy_score(y_test,predictions_test) # TODO: Compute F-score on the the first 300 training samples results['f_train'] = fbeta_score(y_train[:300],predictions_train,beta=0.5) # TODO: Compute F-score on the test set results['f_test'] = fbeta_score(y_test,predictions_test,beta=0.5) # Success print "{} trained on {} samples.".format(learner.__class__.__name__, sample_size) # Return the results return results # TODO: Import the three supervised learning models from sklearn from sklearn.naive_bayes import GaussianNB from sklearn.svm import SVC from sklearn.ensemble import AdaBoostClassifier # TODO: Initialize the three models clf_A = GaussianNB() clf_B = SVC(random_state=0) clf_C = AdaBoostClassifier(random_state=0) # TODO: Calculate the number of samples for 1%, 10%, and 100% of the training data samples_1 = len(X_train)/100 samples_10 = len(X_train)/10 samples_100 = len(X_train) # Collect results on the learners results = {} for clf in [clf_A, clf_B, clf_C]: clf_name = clf.__class__.__name__ results[clf_name] = {} for i, samples in enumerate([samples_1, samples_10, samples_100]): results[clf_name][i] = \ train_predict(clf, samples, X_train, y_train, X_test, y_test) # Run metrics visualization for the three supervised learning models chosen vs.evaluate(results, accuracy, fscore) # TODO: Import 'GridSearchCV', 'make_scorer', and any other necessary libraries from sklearn.grid_search import GridSearchCV from sklearn.metrics import fbeta_score, make_scorer from sklearn.ensemble import AdaBoostClassifier from sklearn.tree import DecisionTreeClassifier from sklearn.ensemble import RandomForestClassifier from sklearn.naive_bayes import MultinomialNB # TODO: Initialize the classifier clf = AdaBoostClassifier(random_state=0) # TODO: Create the parameters list you wish to tune #parameters = {'n_estimators':[75,100,200]} parameters = {'n_estimators':[75,200,500],'learning_rate':[1.0,1.5,2.0]} # TODO: Make an fbeta_score scoring object scorer = make_scorer(fbeta_score, beta=0.5) # TODO: Perform grid search on the classifier using 'scorer' as the scoring method grid_obj = GridSearchCV(clf, parameters,scoring=scorer) # TODO: Fit the grid search object to the training data and find the optimal parameters grid_fit = grid_obj.fit(X_train, y_train) # Get the estimator best_clf = grid_fit.best_estimator_ # Make predictions using the unoptimized and model predictions = (clf.fit(X_train, y_train)).predict(X_test) best_predictions = best_clf.predict(X_test) # Report the before-and-afterscores print "Unoptimized model\n------" print "Accuracy score on testing data: {:.4f}".format(accuracy_score(y_test, predictions)) print "F-score on testing data: {:.4f}".format(fbeta_score(y_test, predictions, beta = 0.5)) print "\nOptimized Model\n------" print "Final accuracy score on the testing data: {:.4f}".format(accuracy_score(y_test, best_predictions)) print "Final F-score on the testing data: {:.4f}".format(fbeta_score(y_test, best_predictions, beta = 0.5)) # TODO: Import a supervised learning model that has 'feature_importances_' # TODO: Train the supervised model on the training set #AdaBoostClassifier(random_state=0) model = AdaBoostClassifier(random_state=0,n_estimators=500).fit(X_train, y_train) # TODO: Extract the feature importances importances = model.feature_importances_ # Plot vs.feature_plot(importances, X_train, y_train) # Import functionality for cloning a model from sklearn.base import clone # Reduce the feature space X_train_reduced = X_train[X_train.columns.values[(np.argsort(importances)[::-1])[:5]]] X_test_reduced = X_test[X_test.columns.values[(np.argsort(importances)[::-1])[:5]]] # Train on the "best" model found from grid search earlier clf = (clone(best_clf)).fit(X_train_reduced, y_train) # Make new predictions reduced_predictions = clf.predict(X_test_reduced) # Report scores from the final model using both versions of data print "Final Model trained on full data\n------" print "Accuracy on testing data: {:.4f}".format(accuracy_score(y_test, best_predictions)) print "F-score on testing data: {:.4f}".format(fbeta_score(y_test, best_predictions, beta = 0.5)) print "\nFinal Model trained on reduced data\n------" print "Accuracy on testing data: {:.4f}".format(accuracy_score(y_test, reduced_predictions)) print "F-score on testing data: {:.4f}".format(fbeta_score(y_test, reduced_predictions, beta = 0.5)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Implementation Step2: Preparing the Data Step3: For highly-skewed feature distributions such as 'capital-gain' and 'capital-loss', it is common practice to apply a <a href="https Step4: Normalizing Numerical Features Step5: Implementation Step6: Shuffle and Split Data Step7: Evaluating Model Performance Step8: Supervised Learning Models Step9: Implementation Step10: Question 3 - Choosing the Best Model Step11: Question 5 - Final Model Evaluation Step12: Question 7 - Extracting Feature Importance
8,099
<ASSISTANT_TASK:> Python Code: %matplotlib inline import os, sys import numpy as np import matplotlib import pandas as pd import requests import StringIO # set matplotlib style matplotlib.style.use('ggplot') sitename = 'alligatorriver' roiname = 'DB_0001' infile = "{}_{}_1day.csv".format(sitename, roiname) print infile %%bash head -30 alligatorriver_DB_0001_1day.csv with open(infile,'r') as fd: df = pd.read_csv(fd, comment='#', parse_dates=[0]) df.head() df.plot('date', ['gcc_90'], figsize=(16,4), grid=True, style=['g'] ) url = "https://phenocam.sr.unh.edu/data/archive/{}/ROI/{}_{}_1day.csv" url = url.format(sitename, sitename, roiname) print url response = requests.get(url) fd = StringIO.StringIO(response.text) df = pd.read_csv(fd, comment='#', parse_dates=[0]) fd.close df[0:5] df[df['gcc_90'] == -9999.].gcc_90 = np.nan df.plot('date', ['gcc_90'], figsize=(16,4), grid=True, style=['g'] ) df.plot('date','image_count', figsize=(16,4), style='b') df10 = df[df['image_count'] >= 10] df10.plot('date', ['gcc_90'], figsize=(16,4), grid=True, style=['g'] ) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: While the data can be read directly from a URL we'll start by doing the simple thing of reading the CSV file directly from our local disk. Step2: That was pretty simple. Now try to read directly from a URL to see if we get the same result. This has the advantage that you always get the latest version of the file which is updated nightly. Step3: Use the requests package to read the CSV file from the URL. Step4: If necessary we'll need to convert nodata values. Step5: We can look at other columns and also filter the data in a variety of ways. Recently we had a site where the number of images varied a lot over time. Let's look at how consistent the number of images for the alligator river site. The image_count reflects our brightness threshold which will eliminate images in the winter time when the days are shorter. But there are a number of other ways the image count can be reduced. The ability reliably extract a 90^th precentile value is dependent on the number of images available for a particular summary period. Step6: One possibility would be to filter the data for summary periods which had at least 10 images.