Unnamed: 0
int64
0
15.9k
cleaned_code
stringlengths
67
124k
cleaned_prompt
stringlengths
168
30.3k
9,500
<ASSISTANT_TASK:> Python Code: # import statements to make numeric and plotting functions available %matplotlib inline from numpy import * from matplotlib.pyplot import * ## define your function in this cell def hill_activating(X, B, K, n): Xn = X**n return (B * Xn)/(K**n + Xn) ## generate a plot using your hill_activating function defined above # setup paramters for our simulation B = 5 K = 10 x = linspace(0,30,200) # generate 200 evenly spaced points between 0 and 30 y = hill_activating(x, B, K, 1) # hill fxn with n = 1 plot(x, y, label='n=1') xlabel('Concentration of X') ylabel('Promoter activity') legend(loc='best') ylim(0, 6) pass ## generate curves for different n here # setup paramters for our simulation B = 5 K = 10 x = linspace(0,30,200) # generate 200 evenly spaced points between 0 and 30 y1 = hill_activating(x, B, K, 1) # hill fxn with n = 1 y2 = hill_activating(x, B, K, 2) # hill fxn with n = 2 y4 = hill_activating(x, B, K, 4) # hill fxn with n = 4 y8 = hill_activating(x, B, K, 8) # hill fxn with n = 8 plot(x, y1, label='n=1') plot(x, y2, label='n=2') plot(x, y4, label='n=4') plot(x, y8, label='n=8') xlabel('Concentration of X') ylabel('Rate of production of Y') legend(loc='best') ylim(0, 6) pass ## define your repressive hill function in this cell def hill_repressing(X, B, K, n): return B/(1.0 + (X/K)**n) ## generate a plot using your hill_activating function defined above ## For X values range from 0 to 30 B = 5 K = 10 x = linspace(0,30,200) plot(x, hill_repressing(x, B, K, 1), label='n=1') plot(x, hill_repressing(x, B, K, 2), label='n=2') plot(x, hill_repressing(x, B, K, 4), label='n=4') plot(x, hill_repressing(x, B, K, 8), label='n=8') xlabel('Conc. of X') ylabel('Rate of production of Y') legend(loc='best') ylim(0, 6) pass ## write your logic approximation functions here def logic_activating(X, B, K): if X > K: theta = 1 else: theta = 0 return B*theta def logic_repressing(X, B, K): if X < K: theta = 1 else: theta = 0 return B*theta ## generate plots using your hill_activating and logic_activating functions defined above ## For X values range from 0 to 30 B = 5 K = 10 n = 4 x = linspace(0, 30, 200) plot(x, hill_activating(x, B, K, n), label='n=8') logicx = [logic_activating(i, B, K) for i in x] plot(x, logicx, label='logic approximation') xlabel('Concentration of X') ylabel('Promoter activity') ylim(-0.1, 5.5) legend(loc='best') pass ## write a function to represent the simple differential equation above def dYdt(B,a,Y): return B - a*Y # write your code here ## generate a plot using your dY function defined above ## Evaluated over 200 time units Y = [0] # initial value of Y B = 0.2 a = 0.05 nsteps = 200 for i in range(nsteps): deltay = dYdt(B, a, Y[-1]) ynew = Y[-1] + deltay Y.append(ynew) plot(Y) ylim(0, 4.5) xlabel('Time units') ylabel('Concentration of Y') pass # setup pulse of X # off (0) for first 50 steps, on for next 100 steps, off again for last 100 steps X = [0]*50 + [1]*100 + [0]*100 Y = [0] B = 0.2 K = 0.5 a = 0.05 nsteps = 250 for i in range(1, nsteps): xnow = X[i] growth = logic_activating(xnow, B, K) decay = a*Y[-1] deltay = growth - decay ynew = Y[-1] + deltay Y.append(ynew) plot(X, color='red', linestyle='dashed', label="X") plot(Y, color='blue', label="Y") ylim(0, 4.5) xlabel('Time units') ylabel('Concentration') legend(loc="best") pass <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: <h2> <font color="firebrick">In class exercise</font> </h2> Step2: Transcriptional repression Step3: <h2> <font color='firebrick'> Interactive exploration of the Hill function </font> </h2> Step4: Generate functions comparing the logic approximation to the Hill function, for the activating case Step5: Multi-dimensional Input Functions Step6: Toggling the activator X
9,501
<ASSISTANT_TASK:> Python Code: A = np.array([[2, -2], [1, 0]]) B = np.array([[1],[0]]) C = np.array([[0,1]]) D = np.array([[0]]) As = sy.Matrix(A) Bs = sy.Matrix(B) Cs = sy.Matrix(C) l1,l2 = sy.symbols("l1 l2") L = sy.Matrix([[l1, l2]]) Ac = A+B*L pc = Ac.eigenvals() pc l1l2 = sy.solve([l1/2+1+2, l1**2+4*l1+4*l2-4 + 4], (l1,l2)) L = np.array([float(l) for l in l1l2[0]]) L Ac2 = Ac.subs(l1,-6).subs(l2,-3) Ac2.eigenvals() tol = 1e-12 h = 0.1 hp = h term = np.identity(2)*h Psi = term k=1.0 while np.linalg.norm(term) > tol: k += 1.0 term = np.dot(A,term)*h/k Psi += term hp *= h print k Phi = np.identity(2) + np.dot(A,Psi) Gamma = np.dot(Psi, B) print Phi print Gamma z1 = np.exp((-2-1j)*h) z2 = np.exp((-2+1j)*h) print z1 print z2 p1 = -z1-z2 p2 = z1*z2 Wc = np.hstack((Gamma, np.dot(Phi,Gamma))) P = np.dot(Phi, Phi) + p1*Phi + p2*np.identity(2) WinvP = np.dot(np.linalg.inv(Wc), P) Ld = -np.real(WinvP[-1,:]) Ld.shape = (1,2) print Ld Phic = Phi + np.dot(Gamma, Ld) np.linalg.eig(Phic) sys_c = cm.ss(A,B,C,D) sys_d = cm.ss(Phi, Gamma, C, D, h) Lc = -cm.place(A, B, [-2+1j, -2-1j]) print (L-Lc) print L print Lc print np.linalg.eig(A+np.dot(B,Lc)) sys_d2 = cm.c2d(sys_c, h) print sys_d print sys_d2 Ld2 = -cm.place(Phi,Gamma,[z1,z2]) print (Ld-Ld2) print Ld print Ld2 print np.linalg.eig(Phi+np.dot(Gamma,Ld2)) print z1 Ac = A + np.dot(B,Lc) sys_cl = cm.ss(Ac, B, C, D) dcg = cm.dcgain(sys_cl) m = 1.0/dcg[0,0] sys_cl = sys_cl*m print cm.dcgain(sys_cl) sys_cl_d1 = cm.ss(Phi+np.dot(Gamma,Lc), Gamma*m, C, D, h ) sys_cl_d2 = cm.ss(Phi+np.dot(Gamma,Ld), Gamma, C, D, h ) dcg_d = np.dot(np.dot(C, np.linalg.inv(np.identity(2)-sys_cl_d2.A)), sys_cl_d2.B) md = 1.0/dcg_d[0,0] sys_cl_d2 = md * sys_cl_d2 Tc = np.linspace(0,10,100) Td = h*np.arange(100) (yc, tc) = cm.step(sys_cl, Tc) (yd1, td1) = cm.step(sys_cl_d1, Td) (yd2, td2) = cm.step(sys_cl_d2, Td) yy1 = np.ravel(yd1) yy2 = np.ravel(yd2) plt.plot(tc,yc) plt.plot(td1,np.ravel(yd1)/1) plt.plot(td2,np.ravel(yd2)/yy2[-1]) plt.xlim([0, 4]) plt.legend(["cont", "discrete w cont param", "discrete w discr param"], loc="lower right") Tc = np.linspace(0,10,100) Td = h*np.arange(100) (yc, tc) = cm.impulse(sys_cl, Tc) (yd1, td1) = cm.impulse(sys_cl_d1, Td) (yd2, td2) = cm.impulse(sys_cl_d2, Td) plt.plot(tc,yc) plt.plot(td1,np.ravel(yd1)) plt.plot(td2,np.ravel(yd2)) plt.legend(["cont", "discrete w cont param", "discrete w discr param"], loc="upper right") (yc, tc) = cm.step(sys_cl, Tc) plt.plot(tc,yc) for hh in [0.01, 0.1, 0.2, 0.4, 0.8, 1.6]: sys_d2 = cm.c2d(sys_c, hh) z1 = np.exp((-2-1j)*hh) z2 = np.exp((-2+1j)*hh) F = sys_d2.A G = sys_d2.B Ld2 = -cm.place(F,G,[z1,z2]) print Ld2 sys_cl_d = cm.ss(F+np.dot(G,Ld2), G, C, D, hh ) # Find dc gain of the discrete time system (See below) dcg_d = np.dot(np.dot(C, np.linalg.inv(np.identity(2)-sys_cl_d.A)), sys_cl_d.B) md = 1.0/dcg_d[0,0] sys_cl_d = md * sys_cl_d print md print cm.dcgain(sys_cl_d) Td = np.arange(1000)*hh (yd1, td1) = cm.step(sys_cl_d, Td) yy = np.ravel(yd1) #plt.plot(td1,yy/yy[-1]) plt.plot(td1,yy) plt.xlim([0, 10]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Preparations exercise 2 Step2: Preparation exercise 3 Step3: Find the control law $L$ for the discrete time case using Ackermans formula Step4: Computer experiments Step5: Computer exercise 2 Step6: Computer exercise 3 Simulation Step7: Discrete system with same feedback gain as continuous time system, and with correct feedback gain Step8: Simulate the three systems Step9: Effect of sampling interval
9,502
<ASSISTANT_TASK:> Python Code: import json import requests from requests.adapters import HTTPAdapter from requests.packages.urllib3.util.retry import Retry def requests_retry_session( retries=3, backoff_factor=0.3, status_forcelist=(500, 502, 504), session=None, ): session = session or requests.Session() retry = Retry( total=retries, read=retries, connect=retries, backoff_factor=backoff_factor, status_forcelist=status_forcelist, ) adapter = HTTPAdapter(max_retries=retry) session.mount('http://', adapter) session.mount('https://', adapter) return session api_url = "https://app.wikiwatershed.org/api/" def get_job_result(api_url, s, jobrequest): url_tmplt = api_url + "jobs/{job}/" get_url = url_tmplt.format result = '' while not result: get_req = requests_retry_session(session=s).get(get_url(job=jobrequest['job'])) result = json.loads(get_req.content)['result'] return result s = requests.Session() APIToken = 'Token 0501d9a98b8170a41d57df8ce82c000c477c621a' # HIDE THE API TOKEN s.headers.update({ 'Authorization': APIToken, 'Content-Type': 'application/json' }) from shapely.geometry import box, MultiPolygon width = 0.0004 # Looks like using a width smaller than 0.0002 causes a problem with the API? # GOOS: (-88.5552, 40.4374) elev 240.93. Agriculture Site—Goose Creek (Corn field) Site (GOOS) at IML CZO # SJER: (-119.7314, 37.1088) elev 403.86. San Joaquin Experimental Reserve Site (SJER) at South Sierra CZO lon, lat = -119.7314, 37.1088 bbox = box(lon-0.5*width, lat-0.5*width, lon+0.5*width, lat+0.5*width) payload = MultiPolygon([bbox]).__geo_interface__ json_payload = json.dumps(payload) payload # convenience function, to simplify the request calls, below def analyze_api_request(api_name, s, api_url, json_payload): post_url = "{}analyze/{}/".format(api_url, api_name) post_req = requests_retry_session(session=s).post(post_url, data=json_payload) jobrequest_json = json.loads(post_req.content) # Fetch and examine job result result = get_job_result(api_url, s, jobrequest_json) return result result = analyze_api_request('land', s, api_url, json_payload) type(result), result.keys() result['survey'].keys() categories = result['survey']['categories'] len(categories), categories[1] land_categories_nonzero = [d for d in categories if d['coverage'] > 0] land_categories_nonzero result = analyze_api_request('terrain', s, api_url, json_payload) categories = result['survey']['categories'] len(categories), categories [d for d in categories if d['type'] == 'average'] result = analyze_api_request('climate', s, api_url, json_payload) categories = result['survey']['categories'] len(categories), categories[:2] ppt = [d['ppt'] for d in categories] tmean = [d['tmean'] for d in categories] # ppt is in cm, right? sum(ppt) import calendar import numpy as np calendar.mdays # Annual tmean needs to be weighted by the number of days per month sum(np.asarray(tmean) * np.asarray(calendar.mdays[1:]))/365 <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: MMW production API endpoint base url. Step2: The job is not completed instantly and the results are not returned directly by the API request that initiated the job. The user must first issue an API request to confirm that the job is complete, then fetch the results. The demo presented here performs automated retries (checks) until the server confirms the job is completed, then requests the JSON results and converts (deserializes) them into a Python dictionary. Step3: 2. Construct AOI GeoJSON for job request Step4: 3. Issue job requests, fetch job results when done, then examine results. Repeat for each request type Step5: Issue job request Step6: Everything below is just exploration of the results. Examine the content of the results (as JSON, and Python dictionaries) Step7: result is a dictionary with one item, survey. This item in turn is a dictionary with 3 items Step8: Issue job request Step9: result is a dictionary with one item, survey. This item in turn is a dictionary with 3 items Step10: Issue job request Step11: result is a dictionary with one item, survey. This item in turn is a dictionary with 3 items
9,503
<ASSISTANT_TASK:> Python Code: import ROOT %jsroot on def writeHisto(outputFileName): outputFile = ROOT.TFile(outputFileName, "RECREATE") h = ROOT.TH1F("theHisto","My Test Histogram;X Title; Y Title",64, -4, 4) h.FillRandom("gaus") # now we write to the file h.Write() writeHisto("output.root") %%bash rootls -l output.root inputFile = ROOT.TFile("output.root") h = inputFile.theHisto c = ROOT.TCanvas() h.Draw() c.Draw() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We now define a function that will create a histogram, fill it and write it to a file. Later, we will read back the histogram from disk. Step2: All objects the class of which has a dictionary can be written on disk. By default, the most widely used ROOT classes are shipped with a dictionary Step3: Before reading the object, we can check from the commandline the content of the file with the rootls utility Step4: We see that the file contains one object of type TH1F, the name of which is theHisto and the title of which is My Test Histogram.
9,504
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import numpy as np # import barnaba import barnaba.enm as enm # define the input file fname = "../test/data/sample1.pdb" %time enm_obj=enm.Enm(fname,sparse=False) %time enm_AA=enm.Enm(fname,sele_atoms="AA",cutoff=0.7) e_val=enm_obj.get_eval() plt.plot(e_val) plt.plot(e_val[:10],marker='s') plt.ylabel(r'$\lambda_i$') plt.xlabel('$i$') plt.plot(1/e_val[6:26],marker='o') plt.ylabel(r'$1/\lambda_i$') plt.xlabel('$i$') msf=enm_obj.get_MSF() plt.figure(figsize=(12,3)) plt.plot(msf) plt.ylabel('MSF$_i$') plt.xlabel('$i$') plt.xlim(-1,enm_obj.n_beads) plt.grid() %time fluc_C2,reslist=enm_AA.c2_fluctuations() plt.plot(fluc_C2,c='r') plt.ylabel('C2-C2 fluctuations') plt.xlabel('Res index') plt.xlim(-0.5,69.5) %time enm_sparse=enm.Enm(fname,sparse=True,sele_atoms="AA",cutoff=0.7) plt.plot(1/enm_AA.get_eval()[6:26],label='Full',marker='x') plt.plot(1/enm_sparse.get_eval()[6:],marker='o',label='Sparse',ls='') plt.legend() plt.ylabel(r'$1/\lambda_i$') plt.xlabel('$i$') %time fluc_C2_sparse,reslist=enm_sparse.c2_fluctuations() plt.plot(fluc_C2,c='r',label='Full') plt.plot(fluc_C2_sparse,c='b',label='Sparse',ls='',marker='s') plt.ylabel('C2-C2 fluctuations') plt.xlabel('Res index') plt.legend() plt.xlim(-0.5,69.5) traj_mode=enm_AA.get_mode_traj(6,amp=5.0,nframes=50) import nglview view = nglview.show_mdtraj(traj_mode) view traj_mode.save_pdb('./enm_traj_mode_6.pdb') # default is beads_name="C2" %time fluc_mat,res_list=enm_sparse.get_dist_fluc_mat() plt.figure(figsize=(10,10)) plt.imshow(fluc_mat,) tt=plt.xticks(np.arange(len(res_list)),res_list,rotation=90,fontsize=7) tt=plt.yticks(np.arange(len(res_list)),res_list,fontsize=7) # one can calculate fluctuations of different atoms %time fluc_mat,res_list=enm_sparse.get_dist_fluc_mat(beads_name="C1\'") plt.figure(figsize=(10,10)) plt.imshow(fluc_mat,) tt=plt.xticks(np.arange(len(res_list)),res_list,rotation=90,fontsize=7) tt=plt.yticks(np.arange(len(res_list)),res_list,fontsize=7) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1 Step2: The input parameter Step3: We can see that this takes considerably more time compared to the 3-beads choice. Step4: We are usually not interested in the whole spectrum. In particular we can focus on the first (smallest) eigenvalues. Step5: After these, we have the eigenvalues representing the non-null normal modes of the system. Step6: 3 Step7: The MSF usually represent a decent approximation of the B-factors obtained from crystallography Step8: 5 Step9: This is now much faster (x10) than the full-matrix diagonalization. Step10: 5b Step11: As we can see the final result is extremely accurate, while the computational time is much reduced, already for a relatively small-sized molecule like the one used here (71 nucleotides). Step12: We can take a look at this trajectory using nglview Step13: We can also save it as a pdb (or any other format) to visualize it later on with a different visualization software Step14: References
9,505
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd import torch softmax_output = load_data() y = torch.argmin(softmax_output, dim=1).view(-1, 1) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
9,506
<ASSISTANT_TASK:> Python Code: import math import time import torch import torch.utils.cpp_extension %matplotlib inline from matplotlib import pyplot import matplotlib.transforms import ot # for comparison cuda_source = #include <torch/extension.h> #include <ATen/core/TensorAccessor.h> #include <ATen/cuda/CUDAContext.h> using at::RestrictPtrTraits; using at::PackedTensorAccessor; #if defined(__HIP_PLATFORM_HCC__) constexpr int WARP_SIZE = 64; #else constexpr int WARP_SIZE = 32; #endif // The maximum number of threads in a block #if defined(__HIP_PLATFORM_HCC__) constexpr int MAX_BLOCK_SIZE = 256; #else constexpr int MAX_BLOCK_SIZE = 512; #endif // Returns the index of the most significant 1 bit in `val`. __device__ __forceinline__ int getMSB(int val) { return 31 - __clz(val); } // Number of threads in a block given an input size up to MAX_BLOCK_SIZE static int getNumThreads(int nElem) { #if defined(__HIP_PLATFORM_HCC__) int threadSizes[5] = { 16, 32, 64, 128, MAX_BLOCK_SIZE }; #else int threadSizes[5] = { 32, 64, 128, 256, MAX_BLOCK_SIZE }; #endif for (int i = 0; i != 5; ++i) { if (nElem <= threadSizes[i]) { return threadSizes[i]; } } return MAX_BLOCK_SIZE; } template <typename T> __device__ __forceinline__ T WARP_SHFL_XOR(T value, int laneMask, int width = warpSize, unsigned int mask = 0xffffffff) { #if CUDA_VERSION >= 9000 return __shfl_xor_sync(mask, value, laneMask, width); #else return __shfl_xor(value, laneMask, width); #endif } // While this might be the most efficient sinkhorn step / logsumexp-matmul implementation I have seen, // this is awfully inefficient compared to matrix multiplication and e.g. NVidia cutlass may provide // many great ideas for improvement template <typename scalar_t, typename index_t> __global__ void sinkstep_kernel( // compute log v_bj = log nu_bj - logsumexp_i 1/lambda dist_ij - log u_bi // for this compute maxdiff_bj = max_i(1/lambda dist_ij - log u_bi) // i = reduction dim, using threadIdx.x PackedTensorAccessor<scalar_t, 2, RestrictPtrTraits, index_t> log_v, const PackedTensorAccessor<scalar_t, 2, RestrictPtrTraits, index_t> dist, const PackedTensorAccessor<scalar_t, 2, RestrictPtrTraits, index_t> log_nu, const PackedTensorAccessor<scalar_t, 2, RestrictPtrTraits, index_t> log_u, const scalar_t lambda) { using accscalar_t = scalar_t; __shared__ accscalar_t shared_mem[2 * WARP_SIZE]; index_t b = blockIdx.y; index_t j = blockIdx.x; int tid = threadIdx.x; if (b >= log_u.size(0) || j >= log_v.size(1)) { return; } // reduce within thread accscalar_t max = -std::numeric_limits<accscalar_t>::infinity(); accscalar_t sumexp = 0; if (log_nu[b][j] == -std::numeric_limits<accscalar_t>::infinity()) { if (tid == 0) { log_v[b][j] = -std::numeric_limits<accscalar_t>::infinity(); } return; } for (index_t i = threadIdx.x; i < log_u.size(1); i += blockDim.x) { accscalar_t oldmax = max; accscalar_t value = -dist[i][j]/lambda + log_u[b][i]; max = max > value ? max : value; if (oldmax == -std::numeric_limits<accscalar_t>::infinity()) { // sumexp used to be 0, so the new max is value and we can set 1 here, // because we will come back here again sumexp = 1; } else { sumexp *= exp(oldmax - max); sumexp += exp(value - max); // if oldmax was not -infinity, max is not either... } } // now we have one value per thread. we'll make it into one value per warp // first warpSum to get one value per thread to // one value per warp for (int i = 0; i < getMSB(WARP_SIZE); ++i) { accscalar_t o_max = WARP_SHFL_XOR(max, 1 << i, WARP_SIZE); accscalar_t o_sumexp = WARP_SHFL_XOR(sumexp, 1 << i, WARP_SIZE); if (o_max > max) { // we're less concerned about divergence here sumexp *= exp(max - o_max); sumexp += o_sumexp; max = o_max; } else if (max != -std::numeric_limits<accscalar_t>::infinity()) { sumexp += o_sumexp * exp(o_max - max); } } __syncthreads(); // this writes each warps accumulation into shared memory // there are at most WARP_SIZE items left because // there are at most WARP_SIZE**2 threads at the beginning if (tid % WARP_SIZE == 0) { shared_mem[tid / WARP_SIZE * 2] = max; shared_mem[tid / WARP_SIZE * 2 + 1] = sumexp; } __syncthreads(); if (tid < WARP_SIZE) { max = (tid < blockDim.x / WARP_SIZE ? shared_mem[2 * tid] : -std::numeric_limits<accscalar_t>::infinity()); sumexp = (tid < blockDim.x / WARP_SIZE ? shared_mem[2 * tid + 1] : 0); } for (int i = 0; i < getMSB(WARP_SIZE); ++i) { accscalar_t o_max = WARP_SHFL_XOR(max, 1 << i, WARP_SIZE); accscalar_t o_sumexp = WARP_SHFL_XOR(sumexp, 1 << i, WARP_SIZE); if (o_max > max) { // we're less concerned about divergence here sumexp *= exp(max - o_max); sumexp += o_sumexp; max = o_max; } else if (max != -std::numeric_limits<accscalar_t>::infinity()) { sumexp += o_sumexp * exp(o_max - max); } } if (tid == 0) { log_v[b][j] = (max > -std::numeric_limits<accscalar_t>::infinity() ? log_nu[b][j] - log(sumexp) - max : -std::numeric_limits<accscalar_t>::infinity()); } } template <typename scalar_t> torch::Tensor sinkstep_cuda_template(const torch::Tensor& dist, const torch::Tensor& log_nu, const torch::Tensor& log_u, const double lambda) { TORCH_CHECK(dist.is_cuda(), "need cuda tensors"); TORCH_CHECK(dist.device() == log_nu.device() && dist.device() == log_u.device(), "need tensors on same GPU"); TORCH_CHECK(dist.dim()==2 && log_nu.dim()==2 && log_u.dim()==2, "invalid sizes"); TORCH_CHECK(dist.size(0) == log_u.size(1) && dist.size(1) == log_nu.size(1) && log_u.size(0) == log_nu.size(0), "invalid sizes"); auto log_v = torch::empty_like(log_nu); using index_t = int32_t; auto log_v_a = log_v.packed_accessor<scalar_t, 2, RestrictPtrTraits, index_t>(); auto dist_a = dist.packed_accessor<scalar_t, 2, RestrictPtrTraits, index_t>(); auto log_nu_a = log_nu.packed_accessor<scalar_t, 2, RestrictPtrTraits, index_t>(); auto log_u_a = log_u.packed_accessor<scalar_t, 2, RestrictPtrTraits, index_t>(); auto stream = at::cuda::getCurrentCUDAStream(); int tf = getNumThreads(log_u.size(1)); dim3 blocks(log_v.size(1), log_u.size(0)); dim3 threads(tf); sinkstep_kernel<<<blocks, threads, 2*WARP_SIZE*sizeof(scalar_t), stream>>>( log_v_a, dist_a, log_nu_a, log_u_a, static_cast<scalar_t>(lambda) ); return log_v; } torch::Tensor sinkstep_cuda(const torch::Tensor& dist, const torch::Tensor& log_nu, const torch::Tensor& log_u, const double lambda) { return AT_DISPATCH_FLOATING_TYPES(log_u.scalar_type(), "sinkstep", [&] { return sinkstep_cuda_template<scalar_t>(dist, log_nu, log_u, lambda); }); } PYBIND11_MODULE(TORCH_EXTENSION_NAME, m) { m.def("sinkstep", &sinkstep_cuda, "sinkhorn step"); } wasserstein_ext = torch.utils.cpp_extension.load_inline("wasserstein", cpp_sources="", cuda_sources=cuda_source, extra_cuda_cflags=["--expt-relaxed-constexpr"] ) def sinkstep(dist, log_nu, log_u, lam: float): # dispatch to optimized GPU implementation for GPU tensors, slow fallback for CPU if dist.is_cuda: return wasserstein_ext.sinkstep(dist, log_nu, log_u, lam) assert dist.dim() == 2 and log_nu.dim() == 2 and log_u.dim() == 2 assert dist.size(0) == log_u.size(1) and dist.size(1) == log_nu.size(1) and log_u.size(0) == log_nu.size(0) log_v = log_nu.clone() for b in range(log_u.size(0)): log_v[b] -= torch.logsumexp(-dist/lam+log_u[b, :, None], 0) return log_v class SinkhornOT(torch.autograd.Function): @staticmethod def forward(ctx, mu, nu, dist, lam=1e-3, N=100): assert mu.dim() == 2 and nu.dim() == 2 and dist.dim() == 2 bs = mu.size(0) d1, d2 = dist.size() assert nu.size(0) == bs and mu.size(1) == d1 and nu.size(1) == d2 log_mu = mu.log() log_nu = nu.log() log_u = torch.full_like(mu, -math.log(d1)) log_v = torch.full_like(nu, -math.log(d2)) for i in range(N): log_v = sinkstep(dist, log_nu, log_u, lam) log_u = sinkstep(dist.t(), log_mu, log_v, lam) # this is slight abuse of the function. it computes (diag(exp(log_u))*Mt*exp(-Mt/lam)*diag(exp(log_v))).sum() # in an efficient (i.e. no bxnxm tensors) way in log space distances = (-sinkstep(-dist.log()+dist/lam, -log_v, log_u, 1.0)).logsumexp(1).exp() ctx.log_v = log_v ctx.log_u = log_u ctx.dist = dist ctx.lam = lam return distances @staticmethod def backward(ctx, grad_out): return grad_out[:, None] * ctx.log_u * ctx.lam, grad_out[:, None] * ctx.log_v * ctx.lam, None, None, None def get_coupling(mu, nu, dist, lam=1e-3, N=1000): assert mu.dim() == 2 and nu.dim() == 2 and dist.dim() == 2 bs = mu.size(0) d1, d2 = dist.size() assert nu.size(0) == bs and mu.size(1) == d1 and nu.size(1) == d2 log_mu = mu.log() log_nu = nu.log() log_u = torch.full_like(mu, -math.log(d1)) log_v = torch.full_like(nu, -math.log(d2)) for i in range(N): log_v = sinkstep(dist, log_nu, log_u, lam) log_u = sinkstep(dist.t(), log_mu, log_v, lam) return (log_v[:, None, :]-dist/lam+log_u[:, :, None]).exp() # some test distribution densities n = 100 lam = 1e-3 x = torch.linspace(0, 100, n) mu1 = torch.distributions.Normal(20., 10.).log_prob(x).exp() mu2 = torch.distributions.Normal(60., 30.).log_prob(x).exp() mu3 = torch.distributions.Normal(40., 20.).log_prob(x).exp() mu1 /= mu1.sum() mu2 /= mu2.sum() mu3 /= mu3.sum() mu123 = torch.stack([mu1, mu2, mu3], dim=0) mu231 = torch.stack([mu2, mu3, mu1], dim=0) cost = (x[None, :]-x[:, None])**2 cost /= cost.max() pyplot.plot(mu1, label="$\mu_1$") pyplot.plot(mu2, label="$\mu_2$") pyplot.plot(mu3, label="$\mu_3$") pyplot.legend(); t = time.time() device = "cuda" res = torch.autograd.gradcheck(lambda x: SinkhornOT.apply(x.softmax(1), mu231.to(device=device, dtype=torch.double), cost.to(device=device, dtype=torch.double), lam, 500), (mu123.log().to(device=device, dtype=torch.double).requires_grad_(),)) print("OK? {} took {:.0f} sec".format(res, time.time()-t)) res_cpu = sinkstep(cost.cpu(), mu123.log().cpu(), mu231.log().cpu(), lam) res_gpu = sinkstep(cost.to(device), mu123.log().to(device), mu231.log().to(device), lam).cpu() assert (res_cpu - res_gpu).abs().max() < 1e-5 coupling = get_coupling(mu123.cuda(), mu231.cuda(), cost.cuda()) pyplot.figure(figsize=(10,10)) pyplot.subplot(2, 2, 1) pyplot.plot(mu2.cpu()) pyplot.subplot(2, 2, 4) pyplot.plot(mu1.cpu(), transform=matplotlib.transforms.Affine2D().rotate_deg(270) + pyplot.gca().transData) pyplot.subplot(2, 2, 3) pyplot.imshow(coupling[0].cpu()); o_coupling12 = torch.tensor(ot.bregman.sinkhorn_stabilized(mu1.cpu(), mu2.cpu(), cost.cpu(), reg=1e-3)) o_coupling23 = torch.tensor(ot.bregman.sinkhorn_stabilized(mu2.cpu(), mu3.cpu(), cost.cpu(), reg=1e-3)) o_coupling31 = torch.tensor(ot.bregman.sinkhorn_stabilized(mu3.cpu(), mu1.cpu(), cost.cpu(), reg=1e-3)) pyplot.imshow(o_coupling12) o_coupling = torch.stack([o_coupling12, o_coupling23, o_coupling31], dim=0) (o_coupling.float() - coupling.cpu()).abs().max().item() # Copyright 2018 Daniel Dazac # MIT Licensed # License and source: https://github.com/dfdazac/wassdistance/ class SinkhornDistance(torch.nn.Module): r Given two empirical measures each with :math:`P_1` locations :math:`x\in\mathbb{R}^{D_1}` and :math:`P_2` locations :math:`y\in\mathbb{R}^{D_2}`, outputs an approximation of the regularized OT cost for point clouds. Args: eps (float): regularization coefficient max_iter (int): maximum number of Sinkhorn iterations reduction (string, optional): Specifies the reduction to apply to the output: 'none' | 'mean' | 'sum'. 'none': no reduction will be applied, 'mean': the sum of the output will be divided by the number of elements in the output, 'sum': the output will be summed. Default: 'none' Shape: - Input: :math:`(N, P_1, D_1)`, :math:`(N, P_2, D_2)` - Output: :math:`(N)` or :math:`()`, depending on `reduction` def __init__(self, eps, max_iter, reduction='none'): super(SinkhornDistance, self).__init__() self.eps = eps self.max_iter = max_iter self.reduction = reduction def forward(self, mu, nu, C): u = torch.zeros_like(mu) v = torch.zeros_like(nu) # To check if algorithm terminates because of threshold # or max iterations reached actual_nits = 0 # Stopping criterion thresh = 1e-1 # Sinkhorn iterations for i in range(self.max_iter): u1 = u # useful to check the update u = self.eps * (torch.log(mu+1e-8) - torch.logsumexp(self.M(C, u, v), dim=-1)) + u v = self.eps * (torch.log(nu+1e-8) - torch.logsumexp(self.M(C, u, v).transpose(-2, -1), dim=-1)) + v err = (u - u1).abs().sum(-1).mean() actual_nits += 1 if err.item() < thresh: break U, V = u, v # Transport plan pi = diag(a)*K*diag(b) pi = torch.exp(self.M(C, U, V)) # Sinkhorn distance cost = torch.sum(pi * C, dim=(-2, -1)) self.actual_nits = actual_nits if self.reduction == 'mean': cost = cost.mean() elif self.reduction == 'sum': cost = cost.sum() return cost, pi, C def M(self, C, u, v): "Modified cost for logarithmic updates" "$M_{ij} = (-c_{ij} + u_i + v_j) / \epsilon$" return (-C + u.unsqueeze(-1) + v.unsqueeze(-2)) / self.eps @staticmethod def ave(u, u1, tau): "Barycenter subroutine, used by kinetic acceleration through extrapolation." return tau * u + (1 - tau) * u1 n = 100 x = torch.linspace(0, 100, n) mu1 = torch.distributions.Normal(20., 10.).log_prob(x).exp() mu2 = torch.distributions.Normal(60., 30.).log_prob(x).exp() mu1 /= mu1.sum() mu2 /= mu2.sum() mu1, mu2, cost = mu1.cuda(), mu2.cuda(), cost.cuda() sinkhorn = SinkhornDistance(eps=1e-3, max_iter=200) def x(): mu1_ = mu1.detach().requires_grad_() dist, P, C = sinkhorn(mu1_, mu2, cost) gr, = torch.autograd.grad(dist, mu1_) torch.cuda.synchronize() dist, P, C = sinkhorn(mu1.cuda(), mu2.cuda(), cost.cuda()) torch.cuda.synchronize() x() %timeit x() pyplot.imshow(P.cpu()) sinkhorn.actual_nits def y(): mu1_ = mu1.detach().requires_grad_() l = SinkhornOT.apply(mu1_.unsqueeze(0), mu2.unsqueeze(0), cost, 1e-3, 200) gr, = torch.autograd.grad(l.sum(), mu1_) torch.cuda.synchronize() y() %timeit y() N = 50 a, b, c = torch.zeros(3, N, N, device="cuda") x = torch.linspace(-5, 5, N, device="cuda") a[N//5:-N//5, N//5:-N//5] = 1 b[(x[None]**2+x[:,None]**2 > 4) & (x[None]**2+x[:,None]**2 < 9)] = 1 c[((x[None]-2)**2+(x[:,None]-2)**2 < 4) | ((x[None]+2)**2+(x[:,None]+2)**2 < 4)] = 1 pyplot.imshow(c.cpu(), cmap=pyplot.cm.gray_r) coords = torch.stack([x[None, :].expand(N, N), x[:, None].expand(N, N)], 2).view(-1, 2) dist = ((coords[None]-coords[:, None])**2).sum(-1) dist /= dist.max() a = (a / a.sum()).view(1, -1) b = (c / b.sum()).view(1, -1) c = (c / c.sum()).view(1, -1) SinkhornOT.apply(a, b, dist, 1e-3, 200) def get_barycenter(mu, dist, weights, lam=1e-3, N=1000): assert mu.dim() == 2 and dist.dim() == 2 and weights.dim() == 1 bs = mu.size(0) d1, d2 = dist.size() assert mu.size(1) == d1 and d1 == d2 and weights.size(0) == bs log_mu = mu.log() log_u = torch.full_like(mu, -math.log(d1)) zeros = torch.zeros_like(log_u) for i in range(N): log_v = sinkstep(dist.t(), log_mu, log_u, lam) log_u = sinkstep(dist, zeros, log_v, lam) a = torch.sum(-weights[:, None] * log_u, dim=0, keepdim=True) log_u += a return (log_v[:, None, :]-dist/lam+log_u[:, :, None]).exp() res = [] for i in torch.linspace(0, 1, 10): res.append(get_barycenter(torch.cat([a, b, c], 0), dist, torch.tensor([i*0.9, (1-i)*0.9, 0], device="cuda"), N=100)) pyplot.figure(figsize=(15,5)) pyplot.imshow(torch.cat([r[0].sum(1).view(N, N).cpu() for r in res], 1), cmap=pyplot.cm.gray_r) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: The kernel Step3: Incorporating it in PyTorch Step4: We use this update step in a building block for the Sinkhorn iteration Step5: We also define a function to get the coupling itself Step6: We define some test distributions. These are similar to examples from Python Optimal Transport. Step7: We run a sanity check for the distance Step8: We might also check that sinkstep is the same on GPU and CPU (Kai Zhao pointed out that this was not the case for an earlier versions of this notebook, thank you, and indeed, there was a bug in the CPU implementation.) Step9: We can visiualize the coupling along with the marginals Step10: This looks a lot like the coupling form Python Optimal Transport and in fact all three match results computed with POT Step12: Performance comparison to existing implementations Step13: With this problem size and forward + backward, we achieve a speedup factor of approximately 6.5 when doing about 3 times as many iterations. Step14: It's fast enough to just use baricenters for interpolation
9,507
<ASSISTANT_TASK:> Python Code: from __future__ import print_function import tensorflow as tf import numpy as np from datetime import date date.today() author = "kyubyong. https://github.com/Kyubyong/tensorflow-exercises" tf.__version__ np.__version__ sess = tf.InteractiveSession() X = tf.constant( [[[0, 0, 1], [0, 1, 0], [0, 0, 0]], [[0, 0, 1], [0, 1, 0], [1, 0, 0]]]) _X = np.arange(1, 1*2*3*4 + 1).reshape((1, 2, 3, 4)) X = tf.convert_to_tensor(_X) _X = np.ones((1, 2, 3)) X = tf.convert_to_tensor(_X) _X = np.arange(1, 10).reshape((3, 3)) X = tf.convert_to_tensor(_X) _X = np.arange(1, 10).reshape((3, 3)) X = tf.convert_to_tensor(_X) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: NOTE on notation Step2: Q23. Given X below, reverse the last dimension. Step3: Q24. Given X below, permute its dimensions such that the new tensor has shape (3, 1, 2). Step4: Q25. Given X, below, get the first, and third rows. Step5: Q26. Given X below, get the elements 5 and 7.
9,508
<ASSISTANT_TASK:> Python Code: % matplotlib inline import numpy as np import math import nibabel as nib import scipy.stats as stats import matplotlib.pyplot as plt from nipy.labs.utils.simul_multisubject_fmri_dataset import surrogate_3d_dataset import palettable.colorbrewer as cb from nipype.interfaces import fsl import os import pandas as pd def peakdens3D(x,k): fd1 = 144*stats.norm.pdf(x)/(29*6**(0.5)-36) fd211 = k**2.*((1.-k**2.)**3. + 6.*(1.-k**2.)**2. + 12.*(1.-k**2.)+24.)*x**2. / (4.*(3.-k**2.)**2.) fd212 = (2.*(1.-k**2.)**3. + 3.*(1.-k**2.)**2.+6.*(1.-k**2.)) / (4.*(3.-k**2.)) fd213 = 3./2. fd21 = (fd211 + fd212 + fd213) fd22 = np.exp(-k**2.*x**2./(2.*(3.-k**2.))) / (2.*(3.-k**2.))**(0.5) fd23 = stats.norm.cdf(2.*k*x / ((3.-k**2.)*(5.-3.*k**2.))**(0.5)) fd2 = fd21*fd22*fd23 fd31 = (k**2.*(2.-k**2.))/4.*x**2. - k**2.*(1.-k**2.)/2. - 1. fd32 = np.exp(-k**2.*x**2./(2.*(2.-k**2.))) / (2.*(2.-k**2.))**(0.5) fd33 = stats.norm.cdf(k*x / ((2.-k**2.)*(5.-3.*k**2.))**(0.5)) fd3 = fd31 * fd32 * fd33 fd41 = (7.-k**2.) + (1-k**2)*(3.*(1.-k**2.)**2. + 12.*(1.-k**2.) + 28.)/(2.*(3.-k**2.)) fd42 = k*x / (4.*math.pi**(0.5)*(3.-k**2.)*(5.-3.*k**2)**0.5) fd43 = np.exp(-3.*k**2.*x**2/(2.*(5-3.*k**2.))) fd4 = fd41*fd42 * fd43 fd51 = math.pi**0.5*k**3./4.*x*(x**2.-3.) f521low = np.array([-10.,-10.]) f521up = np.array([0.,k*x/2.**(0.5)]) f521mu = np.array([0.,0.]) f521sigma = np.array([[3./2., -1.],[-1.,(3.-k**2.)/2.]]) fd521,i = stats.mvn.mvnun(f521low,f521up,f521mu,f521sigma) f522low = np.array([-10.,-10.]) f522up = np.array([0.,k*x/2.**(0.5)]) f522mu = np.array([0.,0.]) f522sigma = np.array([[3./2., -1./2.],[-1./2.,(2.-k**2.)/2.]]) fd522,i = stats.mvn.mvnun(f522low,f522up,f522mu,f522sigma) fd5 = fd51*(fd521+fd522) out = fd1*(fd2+fd3+fd4+fd5) return out xs = np.arange(-4,4,0.01).tolist() ys_3d_k01 = [] ys_3d_k05 = [] ys_3d_k1 = [] ys_2d_k01 = [] ys_2d_k05 = [] ys_2d_k1 = [] ys_1d_k01 = [] ys_1d_k05 = [] ys_1d_k1 = [] for x in xs: ys_1d_k01.append(peakdens1D(x,0.1)) ys_1d_k05.append(peakdens1D(x,0.5)) ys_1d_k1.append(peakdens1D(x,1)) ys_2d_k01.append(peakdens2D(x,0.1)) ys_2d_k05.append(peakdens2D(x,0.5)) ys_2d_k1.append(peakdens2D(x,1)) ys_3d_k01.append(peakdens3D(x,0.1)) ys_3d_k05.append(peakdens3D(x,0.5)) ys_3d_k1.append(peakdens3D(x,1)) plt.figure(figsize=(7,5)) plt.plot(xs,ys_1d_k01,color="black",ls=":",lw=2) plt.plot(xs,ys_1d_k05,color="black",ls="--",lw=2) plt.plot(xs,ys_1d_k1,color="black",ls="-",lw=2) plt.plot(xs,ys_2d_k01,color="blue",ls=":",lw=2) plt.plot(xs,ys_2d_k05,color="blue",ls="--",lw=2) plt.plot(xs,ys_2d_k1,color="blue",ls="-",lw=2) plt.plot(xs,ys_3d_k01,color="red",ls=":",lw=2) plt.plot(xs,ys_3d_k05,color="red",ls="--",lw=2) plt.plot(xs,ys_3d_k1,color="red",ls="-",lw=2) plt.ylim([-0.1,0.55]) plt.show() os.chdir("/Users/Joke/Documents/Onderzoek/Studie_7_newpower/WORKDIR/") sm=1 smooth_FWHM = 3 smooth_sd = smooth_FWHM/(2*math.sqrt(2*math.log(2))) data = surrogate_3d_dataset(n_subj=1,sk=smooth_sd,shape=(500,500,500),noise_level=1) minimum = data.min() newdata = data - minimum #little trick because fsl.model.Cluster ignores negative values img=nib.Nifti1Image(newdata,np.eye(4)) img.to_filename(os.path.join("RF_"+str(sm)+".nii.gz")) cl=fsl.model.Cluster() cl.inputs.threshold = 0 cl.inputs.in_file=os.path.join("RF_"+str(sm)+".nii.gz") cl.inputs.out_localmax_txt_file=os.path.join("locmax_"+str(sm)+".txt") cl.inputs.num_maxima=10000000 cl.inputs.connectivity=26 cl.inputs.terminal_output='none' cl.run() peaks = pd.read_csv("locmax_"+str(1)+".txt",sep="\t").drop('Unnamed: 5',1) peaks.Value = peaks.Value + minimum xn = np.arange(-10,10,0.01) yn = [] for x in xn: yn.append(peakdens3D(x,1)) plt.figure(figsize=(7,5)) plt.hist(peaks.Value,lw=0,facecolor=twocol[0],normed=True,bins=np.arange(-5,5,0.1),label="observed distribution") plt.xlim([-2,5]) plt.ylim([0,0.6]) plt.plot(xn,yn,color=twocol[1],lw=3,label="theoretical distribution") plt.title("histogram") plt.xlabel("peak height") plt.ylabel("density") plt.legend(loc="upper left",frameon=False) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Define formulae Step2: Apply formulae to a range of x-values Step3: Figure 1 from paper Step4: Apply the distribution to simulated data
9,509
<ASSISTANT_TASK:> Python Code: import numpy as py import tensorflow as tf import matplotlib as plt W = tf.Variable([.3], dtype=tf.float32) b = tf.Variable([-.3], dtype=tf.float32) x = tf.placeholder(tf.float32) linear_model = W * x + b a = tf.placeholder(tf.float32) b = tf.placeholder(tf.float32) adder_node = a + b # + provides a shortcut for tf.add(a, b) node1 = tf.constant(3.0, dtype=tf.float32) node2 = tf.constant(4.0) # also tf.float32 implicitly node3 = tf.add(node1, node2) node4 = a + b sess = tf.Session() print(sess.run([node1, node2])) print(sess.run(adder_node, {a: 3, b: 4.5})) print(sess.run(adder_node, {a: [1, 3], b: [2, 4]})) add_and_triple = adder_node * 3. print(sess.run(add_and_triple, {a: 3, b: 4.5})) init = tf.global_variables_initializer() sess.run(init) print(sess.run(linear_model, {x: [1, 2, 3, 4]})) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Variable Step2: Place Holder Step3: 除了variable和placeholder以外,还需要各种各样的node (常数,运算等) Step4: add Node Step5: 一切的grpth完成后,需要用session来执行graph以启动正式的运算 Step6: 对于定义的variable,需要进行初始化操作
9,510
<ASSISTANT_TASK:> Python Code: %matplotlib inline import pickle as pkl import matplotlib.pyplot as plt import numpy as np from scipy.io import loadmat import tensorflow as tf !mkdir data from urllib.request import urlretrieve from os.path import isfile, isdir from tqdm import tqdm data_dir = 'data/' if not isdir(data_dir): raise Exception("Data directory doesn't exist!") class DLProgress(tqdm): last_block = 0 def hook(self, block_num=1, block_size=1, total_size=None): self.total = total_size self.update((block_num - self.last_block) * block_size) self.last_block = block_num if not isfile(data_dir + "train_32x32.mat"): with DLProgress(unit='B', unit_scale=True, miniters=1, desc='SVHN Training Set') as pbar: urlretrieve( 'http://ufldl.stanford.edu/housenumbers/train_32x32.mat', data_dir + 'train_32x32.mat', pbar.hook) if not isfile(data_dir + "test_32x32.mat"): with DLProgress(unit='B', unit_scale=True, miniters=1, desc='SVHN Testing Set') as pbar: urlretrieve( 'http://ufldl.stanford.edu/housenumbers/test_32x32.mat', data_dir + 'test_32x32.mat', pbar.hook) trainset = loadmat(data_dir + 'train_32x32.mat') testset = loadmat(data_dir + 'test_32x32.mat') # Test: Know about trainset type(trainset) trainset.keys() trainset["X"].shape idx = np.random.randint(0, trainset['X'].shape[3], size=36) fig, axes = plt.subplots(6, 6, sharex=True, sharey=True, figsize=(5,5),) for ii, ax in zip(idx, axes.flatten()): ax.imshow(trainset['X'][:,:,:,ii], aspect='equal') ax.xaxis.set_visible(False) ax.yaxis.set_visible(False) plt.subplots_adjust(wspace=0, hspace=0) def scale(x, feature_range=(-1, 1)): # scale to (0, 1) x = ((x - x.min())/(255 - x.min())) # scale to feature_range min, max = feature_range x = x * (max - min) + min return x class Dataset: def __init__(self, train, test, val_frac=0.5, shuffle=False, scale_func=None): split_idx = int(len(test['y'])*(1 - val_frac)) self.test_x, self.valid_x = test['X'][:,:,:,:split_idx], test['X'][:,:,:,split_idx:] self.test_y, self.valid_y = test['y'][:split_idx], test['y'][split_idx:] self.train_x, self.train_y = train['X'], train['y'] self.train_x = np.rollaxis(self.train_x, 3) self.valid_x = np.rollaxis(self.valid_x, 3) self.test_x = np.rollaxis(self.test_x, 3) if scale_func is None: self.scaler = scale else: self.scaler = scale_func self.shuffle = shuffle def batches(self, batch_size): if self.shuffle: idx = np.arange(len(dataset.train_x)) np.random.shuffle(idx) self.train_x = self.train_x[idx] self.train_y = self.train_y[idx] n_batches = len(self.train_y)//batch_size for ii in range(0, len(self.train_y), batch_size): x = self.train_x[ii:ii+batch_size] y = self.train_y[ii:ii+batch_size] yield self.scaler(x), y def model_inputs(real_dim, z_dim): inputs_real = tf.placeholder(tf.float32, (None, *real_dim), name='input_real') inputs_z = tf.placeholder(tf.float32, (None, z_dim), name='input_z') return inputs_real, inputs_z def generator(z, output_dim, reuse=False, alpha=0.2, training=True): with tf.variable_scope('generator', reuse=reuse): # First fully connected layer x1 = tf.layers.dense(z, 4*4*512) # Reshape it to start the convolutional stack x1 = tf.reshape(x1, (-1, 4, 4, 512)) x1 = tf.layers.batch_normalization(x1, training=training) x1 = tf.maximum(alpha * x1, x1) # 4x4x512 now x2 = tf.layers.conv2d_transpose(x1, 256, 5, strides=2, padding='same') x2 = tf.layers.batch_normalization(x2, training=training) x2 = tf.maximum(alpha * x2, x2) # 8x8x256 now x3 = tf.layers.conv2d_transpose(x2, 128, 5, strides=2, padding='same') x3 = tf.layers.batch_normalization(x3, training=training) x3 = tf.maximum(alpha * x3, x3) # 16x16x128 now # Output layer logits = tf.layers.conv2d_transpose(x3, output_dim, 5, strides=2, padding='same') # 32x32x3 now out = tf.tanh(logits) return out def discriminator(x, reuse=False, alpha=0.2): with tf.variable_scope('discriminator', reuse=reuse): # Input layer is 32x32x3 x1 = tf.layers.conv2d(x, 64, 5, strides=2, padding='same') relu1 = tf.maximum(alpha * x1, x1) # 16x16x64 x2 = tf.layers.conv2d(relu1, 128, 5, strides=2, padding='same') bn2 = tf.layers.batch_normalization(x2, training=True) relu2 = tf.maximum(alpha * bn2, bn2) # 8x8x128 x3 = tf.layers.conv2d(relu2, 256, 5, strides=2, padding='same') bn3 = tf.layers.batch_normalization(x3, training=True) relu3 = tf.maximum(alpha * bn3, bn3) # 4x4x256 # Flatten it flat = tf.reshape(relu3, (-1, 4*4*256)) logits = tf.layers.dense(flat, 1) out = tf.sigmoid(logits) return out, logits def model_loss(input_real, input_z, output_dim, alpha=0.2): Get the loss for the discriminator and generator :param input_real: Images from the real dataset :param input_z: Z input :param out_channel_dim: The number of channels in the output image :return: A tuple of (discriminator loss, generator loss) g_model = generator(input_z, output_dim, alpha=alpha) d_model_real, d_logits_real = discriminator(input_real, alpha=alpha) d_model_fake, d_logits_fake = discriminator(g_model, reuse=True, alpha=alpha) d_loss_real = tf.reduce_mean( tf.nn.sigmoid_cross_entropy_with_logits(logits=d_logits_real, labels=tf.ones_like(d_model_real))) d_loss_fake = tf.reduce_mean( tf.nn.sigmoid_cross_entropy_with_logits(logits=d_logits_fake, labels=tf.zeros_like(d_model_fake))) g_loss = tf.reduce_mean( tf.nn.sigmoid_cross_entropy_with_logits(logits=d_logits_fake, labels=tf.ones_like(d_model_fake))) d_loss = d_loss_real + d_loss_fake return d_loss, g_loss def model_opt(d_loss, g_loss, learning_rate, beta1): Get optimization operations :param d_loss: Discriminator loss Tensor :param g_loss: Generator loss Tensor :param learning_rate: Learning Rate Placeholder :param beta1: The exponential decay rate for the 1st moment in the optimizer :return: A tuple of (discriminator training operation, generator training operation) # Get weights and bias to update t_vars = tf.trainable_variables() d_vars = [var for var in t_vars if var.name.startswith('discriminator')] g_vars = [var for var in t_vars if var.name.startswith('generator')] # Optimize with tf.control_dependencies(tf.get_collection(tf.GraphKeys.UPDATE_OPS)): d_train_opt = tf.train.AdamOptimizer(learning_rate, beta1=beta1).minimize(d_loss, var_list=d_vars) g_train_opt = tf.train.AdamOptimizer(learning_rate, beta1=beta1).minimize(g_loss, var_list=g_vars) return d_train_opt, g_train_opt class GAN: def __init__(self, real_size, z_size, learning_rate, alpha=0.2, beta1=0.5): tf.reset_default_graph() self.input_real, self.input_z = model_inputs(real_size, z_size) self.d_loss, self.g_loss = model_loss(self.input_real, self.input_z, real_size[2], alpha=0.2) self.d_opt, self.g_opt = model_opt(self.d_loss, self.g_loss, learning_rate, beta1) def view_samples(epoch, samples, nrows, ncols, figsize=(5,5)): fig, axes = plt.subplots(figsize=figsize, nrows=nrows, ncols=ncols, sharey=True, sharex=True) for ax, img in zip(axes.flatten(), samples[epoch]): ax.axis('off') img = ((img - img.min())*255 / (img.max() - img.min())).astype(np.uint8) ax.set_adjustable('box-forced') im = ax.imshow(img, aspect='equal') plt.subplots_adjust(wspace=0, hspace=0) return fig, axes def train(net, dataset, epochs, batch_size, print_every=10, show_every=100, figsize=(5,5)): saver = tf.train.Saver() sample_z = np.random.uniform(-1, 1, size=(72, z_size)) samples, losses = [], [] steps = 0 with tf.Session() as sess: sess.run(tf.global_variables_initializer()) for e in range(epochs): for x, y in dataset.batches(batch_size): steps += 1 # Sample random noise for G batch_z = np.random.uniform(-1, 1, size=(batch_size, z_size)) # Run optimizers _ = sess.run(net.d_opt, feed_dict={net.input_real: x, net.input_z: batch_z}) _ = sess.run(net.g_opt, feed_dict={net.input_z: batch_z, net.input_real: x}) if steps % print_every == 0: # At the end of each epoch, get the losses and print them out train_loss_d = net.d_loss.eval({net.input_z: batch_z, net.input_real: x}) train_loss_g = net.g_loss.eval({net.input_z: batch_z}) print("Epoch {}/{}...".format(e+1, epochs), "Discriminator Loss: {:.4f}...".format(train_loss_d), "Generator Loss: {:.4f}".format(train_loss_g)) # Save losses to view after training losses.append((train_loss_d, train_loss_g)) if steps % show_every == 0: gen_samples = sess.run( generator(net.input_z, 3, reuse=True, training=False), feed_dict={net.input_z: sample_z}) samples.append(gen_samples) _ = view_samples(-1, samples, 6, 12, figsize=figsize) plt.show() saver.save(sess, './checkpoints/generator.ckpt') with open('samples.pkl', 'wb') as f: pkl.dump(samples, f) return losses, samples real_size = (32,32,3) z_size = 100 learning_rate = 0.0002 batch_size = 128 epochs = 25 alpha = 0.2 beta1 = 0.5 # Create the network net = GAN(real_size, z_size, learning_rate, alpha=alpha, beta1=beta1) dataset = Dataset(trainset, testset) losses, samples = train(net, dataset, epochs, batch_size, figsize=(10,5)) fig, ax = plt.subplots() losses = np.array(losses) plt.plot(losses.T[0], label='Discriminator', alpha=0.5) plt.plot(losses.T[1], label='Generator', alpha=0.5) plt.title("Training Losses") plt.legend() fig, ax = plt.subplots() losses = np.array(losses) plt.plot(losses.T[0], label='Discriminator', alpha=0.5) plt.plot(losses.T[1], label='Generator', alpha=0.5) plt.title("Training Losses") plt.legend() _ = view_samples(-1, samples, 6, 12, figsize=(10,5)) _ = view_samples(-1, samples, 6, 12, figsize=(10,5)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Getting the data Step2: These SVHN files are .mat files typically used with Matlab. However, we can load them in with scipy.io.loadmat which we imported above. Step3: Here I'm showing a small sample of the images. Each of these is 32x32 with 3 color channels (RGB). These are the real images we'll pass to the discriminator and what the generator will eventually fake. Step4: Here we need to do a bit of preprocessing and getting the images into a form where we can pass batches to the network. First off, we need to rescale the images to a range of -1 to 1, since the output of our generator is also in that range. We also have a set of test and validation images which could be used if we're trying to identify the numbers in the images. Step5: Network Inputs Step6: Generator Step7: Discriminator Step9: Model Loss Step11: Optimizers Step12: Building the model Step13: Here is a function for displaying generated images. Step14: And another function we can use to train our network. Notice when we call generator to create the samples to display, we set training to False. That's so the batch normalization layers will use the population statistics rather than the batch statistics. Also notice that we set the net.input_real placeholder when we run the generator's optimizer. The generator doesn't actually use it, but we'd get an error without it because of the tf.control_dependencies block we created in model_opt. Step15: Hyperparameters
9,511
<ASSISTANT_TASK:> Python Code: import tensorflow as tf import numpy as np from tensorflow.examples.tutorials.mnist import input_data mnist = input_data.read_data_sets("MNIST_data/", one_hot=True, reshape=False) DO NOT MODIFY THIS CELL def fully_connected(prev_layer, num_units): Create a fully connectd layer with the given layer as input and the given number of neurons. :param prev_layer: Tensor The Tensor that acts as input into this layer :param num_units: int The size of the layer. That is, the number of units, nodes, or neurons. :returns Tensor A new fully connected layer layer = tf.layers.dense(prev_layer, num_units, activation=tf.nn.relu) return layer DO NOT MODIFY THIS CELL def conv_layer(prev_layer, layer_depth): Create a convolutional layer with the given layer as input. :param prev_layer: Tensor The Tensor that acts as input into this layer :param layer_depth: int We'll set the strides and number of feature maps based on the layer's depth in the network. This is *not* a good way to make a CNN, but it helps us create this example with very little code. :returns Tensor A new convolutional layer strides = 2 if layer_depth % 3 == 0 else 1 conv_layer = tf.layers.conv2d(prev_layer, layer_depth*4, 3, strides, 'same', activation=tf.nn.relu) return conv_layer DO NOT MODIFY THIS CELL def train(num_batches, batch_size, learning_rate): # Build placeholders for the input samples and labels inputs = tf.placeholder(tf.float32, [None, 28, 28, 1]) labels = tf.placeholder(tf.float32, [None, 10]) # Feed the inputs into a series of 20 convolutional layers layer = inputs for layer_i in range(1, 20): layer = conv_layer(layer, layer_i) # Flatten the output from the convolutional layers orig_shape = layer.get_shape().as_list() layer = tf.reshape(layer, shape=[-1, orig_shape[1] * orig_shape[2] * orig_shape[3]]) # Add one fully connected layer layer = fully_connected(layer, 100) # Create the output layer with 1 node for each logits = tf.layers.dense(layer, 10) # Define loss and training operations model_loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits(logits=logits, labels=labels)) train_opt = tf.train.AdamOptimizer(learning_rate).minimize(model_loss) # Create operations to test accuracy correct_prediction = tf.equal(tf.argmax(logits,1), tf.argmax(labels,1)) accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) # Train and test the network with tf.Session() as sess: sess.run(tf.global_variables_initializer()) for batch_i in range(num_batches): batch_xs, batch_ys = mnist.train.next_batch(batch_size) # train this batch sess.run(train_opt, {inputs: batch_xs, labels: batch_ys}) # Periodically check the validation or training loss and accuracy if batch_i % 100 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: mnist.validation.images, labels: mnist.validation.labels}) print('Batch: {:>2}: Validation loss: {:>3.5f}, Validation accuracy: {:>3.5f}'.format(batch_i, loss, acc)) elif batch_i % 25 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: batch_xs, labels: batch_ys}) print('Batch: {:>2}: Training loss: {:>3.5f}, Training accuracy: {:>3.5f}'.format(batch_i, loss, acc)) # At the end, score the final accuracy for both the validation and test sets acc = sess.run(accuracy, {inputs: mnist.validation.images, labels: mnist.validation.labels}) print('Final validation accuracy: {:>3.5f}'.format(acc)) acc = sess.run(accuracy, {inputs: mnist.test.images, labels: mnist.test.labels}) print('Final test accuracy: {:>3.5f}'.format(acc)) # Score the first 100 test images individually. This won't work if batch normalization isn't implemented correctly. correct = 0 for i in range(100): correct += sess.run(accuracy,feed_dict={inputs: [mnist.test.images[i]], labels: [mnist.test.labels[i]]}) print("Accuracy on 100 samples:", correct/100) num_batches = 800 batch_size = 64 learning_rate = 0.002 tf.reset_default_graph() with tf.Graph().as_default(): train(num_batches, batch_size, learning_rate) def fully_connected(prev_layer, num_units, is_training): Create a fully connectd layer with the given layer as input and the given number of neurons. :param prev_layer: Tensor The Tensor that acts as input into this layer :param num_units: int The size of the layer. That is, the number of units, nodes, or neurons. :returns Tensor A new fully connected layer layer = tf.layers.dense(prev_layer, num_units, use_bias=False, activation=None) layer = tf.layers.batch_normalization(layer, training=is_training) layer = tf.nn.relu(layer) return layer def conv_layer(prev_layer, layer_depth, is_training): Create a convolutional layer with the given layer as input. :param prev_layer: Tensor The Tensor that acts as input into this layer :param layer_depth: int We'll set the strides and number of feature maps based on the layer's depth in the network. This is *not* a good way to make a CNN, but it helps us create this example with very little code. :returns Tensor A new convolutional layer strides = 2 if layer_depth % 3 == 0 else 1 conv_layer = tf.layers.conv2d(prev_layer, layer_depth*4, 3, strides, 'same', activation=None, use_bias=False) conv_layer = tf.layers.batch_normalization(conv_layer, training=is_training) conv_layer = tf.nn.relu(conv_layer) return conv_layer def train(num_batches, batch_size, learning_rate): # Build placeholders for the input samples and labels inputs = tf.placeholder(tf.float32, [None, 28, 28, 1]) labels = tf.placeholder(tf.float32, [None, 10]) is_training = tf.placeholder(tf.bool, name='is_training') # Feed the inputs into a series of 20 convolutional layers layer = inputs for layer_i in range(1, 20): layer = conv_layer(layer, layer_i, is_training) # Flatten the output from the convolutional layers orig_shape = layer.get_shape().as_list() layer = tf.reshape(layer, shape=[-1, orig_shape[1] * orig_shape[2] * orig_shape[3]]) # Add one fully connected layer layer = fully_connected(layer, 100, is_training) # Create the output layer with 1 node for each logits = tf.layers.dense(layer, 10) # Define loss and training operations model_loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits(logits=logits, labels=labels)) with tf.control_dependencies(tf.get_collection(tf.GraphKeys.UPDATE_OPS)): train_opt = tf.train.AdamOptimizer(learning_rate).minimize(model_loss) # Create operations to test accuracy correct_prediction = tf.equal(tf.argmax(logits,1), tf.argmax(labels,1)) accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) # Train and test the network with tf.Session() as sess: sess.run(tf.global_variables_initializer()) for batch_i in range(num_batches): batch_xs, batch_ys = mnist.train.next_batch(batch_size) # train this batch sess.run(train_opt, {inputs: batch_xs, labels: batch_ys, is_training: True}) # Periodically check the validation or training loss and accuracy if batch_i % 100 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: mnist.validation.images, labels: mnist.validation.labels, is_training: False}) print('Batch: {:>2}: Validation loss: {:>3.5f}, Validation accuracy: {:>3.5f}'.format(batch_i, loss, acc)) elif batch_i % 25 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: batch_xs, labels: batch_ys, is_training: False}) print('Batch: {:>2}: Training loss: {:>3.5f}, Training accuracy: {:>3.5f}'.format(batch_i, loss, acc)) # At the end, score the final accuracy for both the validation and test sets acc = sess.run(accuracy, {inputs: mnist.validation.images, labels: mnist.validation.labels, is_training: False}) print('Final validation accuracy: {:>3.5f}'.format(acc)) acc = sess.run(accuracy, {inputs: mnist.test.images, labels: mnist.test.labels, is_training: False}) print('Final test accuracy: {:>3.5f}'.format(acc)) # Score the first 100 test images individually. This won't work if batch normalization isn't implemented correctly. correct = 0 for i in range(100): correct += sess.run(accuracy,feed_dict={inputs: [mnist.test.images[i]], labels: [mnist.test.labels[i]], is_training: False}) print("Accuracy on 100 samples:", correct/100) num_batches = 800 batch_size = 64 learning_rate = 0.002 tf.reset_default_graph() with tf.Graph().as_default(): train(num_batches, batch_size, learning_rate) def fully_connected(prev_layer, num_units, is_training): Create a fully connectd layer with the given layer as input and the given number of neurons. :param prev_layer: Tensor The Tensor that acts as input into this layer :param num_units: int The size of the layer. That is, the number of units, nodes, or neurons. :returns Tensor A new fully connected layer prev_shape = prev_layer.get_shape().as_list() weights = tf.Variable(tf.random_normal([int(prev_shape[-1]), num_units], stddev=0.05)) layer = tf.matmul(prev_layer, weights) beta = tf.Variable(tf.ones([num_units])) gamma = tf.Variable(tf.zeros([num_units])) pop_mean = tf.Variable(tf.zeros([num_units]), trainable=False) pop_variance = tf.Variable(tf.zeros([num_units]), trainable=False) epsilon = 1e-3 def batch_norm_training(): decay = 0.99 batch_mean, batch_variance = tf.nn.moments(layer, [0]) train_mean = tf.assign(pop_mean, pop_mean * decay + batch_mean * (1 - decay)) train_variance = tf.assign(pop_variance, pop_variance * decay + batch_variance * (1 - decay)) with tf.control_dependencies([train_mean, train_variance]): batch_norm_layer = (layer - batch_mean) / tf.sqrt(batch_variance + epsilon) return batch_norm_layer def batch_norm_inference(): batch_norm_layer = (layer - pop_mean) / tf.sqrt(pop_variance + epsilon) return batch_norm_layer layer = tf.cond(is_training, batch_norm_training, batch_norm_inference) layer = gamma * layer + beta layer = tf.nn.relu(layer) return layer def conv_layer(prev_layer, layer_depth, is_training): Create a convolutional layer with the given layer as input. :param prev_layer: Tensor The Tensor that acts as input into this layer :param layer_depth: int We'll set the strides and number of feature maps based on the layer's depth in the network. This is *not* a good way to make a CNN, but it helps us create this example with very little code. :returns Tensor A new convolutional layer strides = 2 if layer_depth % 3 == 0 else 1 in_channels = prev_layer.get_shape().as_list()[3] out_channels = layer_depth*4 weights = tf.Variable( tf.truncated_normal([3, 3, in_channels, out_channels], stddev=0.05)) beta = tf.Variable(tf.zeros([out_channels])) gamma = tf.Variable(tf.ones([out_channels])) pop_mean = tf.Variable(tf.zeros([out_channels]), trainable=False) pop_variance = tf.Variable(tf.zeros([out_channels]), trainable=False) #bias = tf.Variable(tf.zeros(out_channels)) conv_layer = tf.nn.conv2d(prev_layer, weights, strides=[1,strides, strides, 1], padding='SAME') epsilon = 1e-3 def batch_norm_training(): decay = 0.99 batch_mean, batch_variance = tf.nn.moments(conv_layer, [0,1,2], keep_dims=False) train_mean = tf.assign(pop_mean, batch_mean * decay + pop_mean * (1 - decay)) train_variance = tf.assign(pop_variance, batch_variance * decay + pop_variance * (1 - decay)) with tf.control_dependencies([train_mean, train_variance]): batch_norm_layer = (conv_layer - batch_mean) / tf.sqrt(batch_variance + epsilon) return batch_norm_layer def batch_norm_inferene(): batch_norm_layer = (conv_layer - pop_mean) / tf.sqrt(pop_variance + epsilon) return batch_norm_layer conv_layer = tf.cond(is_training, batch_norm_training, batch_norm_inferene) conv_layer = gamma * conv_layer + beta #conv_layer = tf.nn.bias_add(conv_layer, bias) conv_layer = tf.nn.relu(conv_layer) return conv_layer # Setting initial conditions layer = tf.placeholder(tf.float32, [None, 28, 28, 1]) print('Simulating parameter propagation over 5 steps:') for layer_i in range(1,5): strides = 2 if layer_i % 3 == 0 else 1 input_shape = layer.get_shape().as_list() in_channels = layer.get_shape().as_list()[3] out_channels = layer_i*4 weights = tf.truncated_normal([3, 3, in_channels, out_channels], stddev=0.05) layer = tf.nn.conv2d(layer, weights, strides=[1,strides, strides, 1], padding='SAME') print('-----------------------------------------------') print('strides:{0}'.format(strides)) print('Input layer shape:{0}'.format(input_shape)) print('in_channels:{0}'.format(in_channels)) print('out_channels:{0}'.format(out_channels)) print('Truncated normal output:{0}'.format(weights)) def train(num_batches, batch_size, learning_rate): # Build placeholders for the input samples and labels inputs = tf.placeholder(tf.float32, [None, 28, 28, 1]) labels = tf.placeholder(tf.float32, [None, 10]) is_training = tf.placeholder(tf.bool) # Feed the inputs into a series of 20 convolutional layers layer = inputs for layer_i in range(1, 20): layer = conv_layer(layer, layer_i, is_training) # Flatten the output from the convolutional layers orig_shape = layer.get_shape().as_list() layer = tf.reshape(layer, shape=[-1, orig_shape[1] * orig_shape[2] * orig_shape[3]]) # Add one fully connected layer layer = fully_connected(layer, 100, is_training) # Create the output layer with 1 node for each logits = tf.layers.dense(layer, 10) # Define loss and training operations model_loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits(logits=logits, labels=labels)) with tf.control_dependencies(tf.get_collection(tf.GraphKeys.UPDATE_OPS)): train_opt = tf.train.AdamOptimizer(learning_rate).minimize(model_loss) # Create operations to test accuracy correct_prediction = tf.equal(tf.argmax(logits,1), tf.argmax(labels,1)) accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) # Train and test the network with tf.Session() as sess: sess.run(tf.global_variables_initializer()) for batch_i in range(num_batches): batch_xs, batch_ys = mnist.train.next_batch(batch_size) # train this batch sess.run(train_opt, {inputs: batch_xs, labels: batch_ys, is_training:True}) # Periodically check the validation or training loss and accuracy if batch_i % 100 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: mnist.validation.images, labels: mnist.validation.labels, is_training: False}) print('Batch: {:>2}: Validation loss: {:>3.5f}, Validation accuracy: {:>3.5f}'.format(batch_i, loss, acc)) elif batch_i % 25 == 0: loss, acc = sess.run([model_loss, accuracy], {inputs: batch_xs, labels: batch_ys, is_training: False}) print('Batch: {:>2}: Training loss: {:>3.5f}, Training accuracy: {:>3.5f}'.format(batch_i, loss, acc)) # At the end, score the final accuracy for both the validation and test sets acc = sess.run(accuracy, {inputs: mnist.validation.images, labels: mnist.validation.labels, is_training: False}) print('Final validation accuracy: {:>3.5f}'.format(acc)) acc = sess.run(accuracy, {inputs: mnist.test.images, labels: mnist.test.labels, is_training: False}) print('Final test accuracy: {:>3.5f}'.format(acc)) # Score the first 100 test images individually. This won't work if batch normalization isn't implemented correctly. correct = 0 for i in range(100): correct += sess.run(accuracy,feed_dict={inputs: [mnist.test.images[i]], labels: [mnist.test.labels[i]], is_training: False}) print("Accuracy on 100 samples:", correct/100) num_batches = 800 batch_size = 64 learning_rate = 0.002 tf.reset_default_graph() with tf.Graph().as_default(): train(num_batches, batch_size, learning_rate) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step3: Batch Normalization using tf.layers.batch_normalization<a id="example_1"></a> Step6: We'll use the following function to create convolutional layers in our network. They are very basic Step8: Run the following cell, along with the earlier cells (to load the dataset and define the necessary functions). Step10: With this many layers, it's going to take a lot of iterations for this network to learn. By the time you're done training these 800 batches, your final test and validation accuracies probably won't be much better than 10%. (It will be different each time, but will most likely be less than 15%.) Step12: TODO Step13: TODO Step15: With batch normalization, you should now get an accuracy over 90%. Notice also the last line of the output Step17: TODO Step18: TODO
9,512
<ASSISTANT_TASK:> Python Code: from sklearn import grid_search from sklearn.cross_validation import StratifiedShuffleSplit from sklearn.cross_validation import train_test_split from sklearn.preprocessing import StandardScaler from sklearn.svm import SVC from time import time import numpy as np import pandas as pd import sys #Test each array of features in the training dataset if __name__ == '__main__': csv_file_features = [[0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13], [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13]] estimators_array = [] print('Order of results') print('Training score, Test score, Time, Features, SVM parameters\n') C_range = [0.01, 0.1, 1, 10, 100] gamma_range = [0.01, 0.1, 1, 10, 100] #Test for all the features sets for i in csv_file_features: stdsc = StandardScaler() df = pd.read_csv("../../Dataset/Train/EEG_Train_Sorted.csv") #Separate Class labels anda data X = df.ix[:, i] y = df['Class'] X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.3, random_state=0) #Standarize data X_train_std = stdsc.fit_transform(X_train) X_test_std = stdsc.transform(X_test) #Create SVM and define parameters svm = SVC() param_grid = [{'C': C_range, 'gamma': gamma_range, 'kernel': ['rbf'], 'decision_function_shape': ['ovr'], 'random_state': [0]}] #Set Grid Params init = time() gscv = grid_search.GridSearchCV(svm, param_grid, n_jobs=6, cv=StratifiedShuffleSplit(y=y_train, n_iter=5, test_size=0.4, random_state=0)) #Test classifier gscv.fit(X_train_std, y_train) sys.exit("Error message") #Save our estimator estimators_array.append(gscv) #Report testing results print('{:.5f}, {:.5f}, {:.5f}s, {}, {}'.format(gscv.best_score_, gscv.score(X_test_std, y_test), time() - init, i, gscv.best_params_)) #Get best estimator parameters print (estimators_array[0]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: SVM calibration Step2: Now we check the parameters of the best estimator
9,513
<ASSISTANT_TASK:> Python Code: # Import the print function that is compatible with Python 3 from __future__ import print_function # Import numpy - the fundamental package for scientific computing with Python import numpy as np # Import plotting Python plotting from matplotlib import matplotlib.pyplot as plt # Generate 1000 samples from a Gaussian pdf with mu=5 and sigma=2 mu = 5 sigma = 2 number_of_samples = 1000 test_samples = np.random.normal(mu, sigma, number_of_samples) # Plotting with matplotlib # First clear the figures plt.clf() # Segment the canvas into upper and lower subplots plt.subplot(211) # Plot the random numbers plt.plot(test_samples) plt.subplot(212) # Histogram the numbers plt.hist(test_samples, bins=100) # Display the canvas plt.show() # Function that generates N signal and N background samples (note that 'do_simple' is true by default) def generate_samples(N, do_superposition=False): # Case 1: Signal and background are each a single Gaussian if not do_superposition: # Signal Gaussian has mean 1 and standard deviation 1 mu1, sigma1 = 1, 1 signal = np.random.normal(mu1, sigma1, N) # Background Gaussian has mean 1 and standard deviation 1 mu1, sigma1 = -1, 1 background = np.random.normal(mu1, sigma1, N) # Case 2: Signal and background are superpositions of Gaussians else: mu1a, sigma1a = -1.1, 0.5 x1a = np.random.normal(mu1a, sigma1a, int(0.6*N)) mu1b, sigma1b = 1, 1 x1b = np.random.normal(mu1b, sigma1b, int(0.4*N)) mu2a, sigma2a = 2, 0.5 x2a = np.random.normal(mu2a, sigma2a, int(0.7*N)) mu2b, sigma2b = -1, 1 x2b = np.random.normal(mu2b, sigma2b, int(0.3*N)) signal = np.append(x1a,x1b) background = np.append(x2a,x2b) return signal, background # If 'do_superposition = True' we get multiple Gaussians do_superposition = True # Number of samples N = 10000000 # Number of bins in the histograms nbins = 500 # Generate signal and background signal, background = generate_samples(N, do_superposition) import h5py # create a new file h5_file = h5py.File("data1.h5", "w") h5_file.create_dataset('signal', data=signal) h5_file.create_dataset('background', data=background) h5_file.close() h5_file_readonly = h5py.File('data1.h5','r') signal = h5_file_readonly['signal'][:] background = h5_file_readonly['background'][:] h5_file_readonly.close() # Plot the histograms plt.clf() plt.hist(signal, 50, density=True, facecolor='blue', alpha=0.75, label='S') plt.hist(background, 50, density=True, facecolor='red', alpha=0.75, label='B') plt.xlabel('Input feature x') plt.ylabel('Probability density (arbitrary units)') plt.title(r'Signal and Background') plt.legend(loc='upper right') plt.axis([-5, 5, 0, 0.7]) plt.grid(True) plt.show() # Create the histograms, which we will use for calculating the log-likelihood ratio (LLR) below h_signal = np.histogram(signal, bins=500, range=(-5,5)) h_background = np.histogram(background, bins=500, range=(-5,5)) LL_dict = {} # used only for plotting LL_dict_bybin = {} # used for computing for i in range(len(h_signal[0])): # the if statements are there to account for "binning effects" if (h_background[0][i] > 0 and h_signal[0][i] > 0): LL_dict[h_background[1][i]] = np.log(1.*h_signal[0][i]/h_background[0][i]) elif (h_signal[0][i] > 0): # in case background bin = 0 LL_dict[h_background[1][i]] = np.log(100000.) #huge number elif (h_background[0][i] > 0): # in case signal bin = 0 LL_dict[h_background[1][i]] = np.log(1./100000.) #very small number else: LL_dict[h_background[1][i]] = np.log(1.) LL_dict_bybin[i] = LL_dict[h_background[1][i]] # array of 'x' values xvals = [d for d in LL_dict] # array of 'y' values yvals = [LL_dict[d] for d in LL_dict] xvals = np.array(xvals) yvals = np.array(yvals) # Return the indices that result from sorting the array (but do not modify the array itself) index_sorted = xvals.argsort() # Sort the arrays xvals = xvals[index_sorted[::-1]] yvals = yvals[index_sorted[::-1]] # Plot the LLR as a function of input feature x plt.clf() plt.plot(xvals,yvals) plt.xlabel('Input feature x') plt.ylabel('Log Likelihood Ratio') plt.title(r'LLR as a function of x') plt.axis([-6,6,-6,6]) plt.show() # Number of bins in the histgrams nbins = 50 # Create histograms h_signal_yvals = np.histogram([], bins=nbins, range=(-10,10)) h_background_yvals = np.histogram([], bins=nbins, range=(-10,10)) # Fill histograms for i in range(len(h_signal[0])): whichbin = np.digitize(LL_dict[h_signal[1][i]], h_signal_yvals[1]) if (whichbin > 49): whichbin = 49 h_signal_yvals[0][whichbin]+=h_signal[0][i] h_background_yvals[0][whichbin]+=h_background[0][i] # Plot the PDF of the LLR plt.clf() plt.xlabel('Log Likelihood Ratio') plt.ylabel('Probability Density (arbitrary units)') plt.title(r'Signal and Background') plt.bar(h_signal_yvals[1][:-1],h_signal_yvals[0], width=h_signal_yvals[1][1]-h_signal_yvals[1][0],facecolor='blue', alpha=0.75, label='S') plt.bar(h_background_yvals[1][:-1],h_background_yvals[0], width=h_background_yvals[1][1]-h_background_yvals[1][0],facecolor='red', alpha=0.75, label='B') plt.show() # Make the ROC curve ROCx = np.zeros(nbins) ROCy = np.zeros(nbins) intx = 0. inty = 0. for i in range(nbins): intx+=h_signal_yvals[0][i] inty+=h_background_yvals[0][i] for i in range(nbins): sum_signal = 0. sum_background = 0. for j in range(i,len(h_signal_yvals[1])-1): sum_signal+=h_signal_yvals[0][j] sum_background+=h_background_yvals[0][j] ROCx[i] = sum_signal/intx ROCy[i] = sum_background/inty # Plot the ROC curve plt.clf() plt.axes().set_aspect('equal') plt.plot(ROCx,ROCy,label="LLR") plt.plot([0,1],[0,1],linestyle='--',color="#C0C0C0",label="Random") plt.xlabel('Pr(label signal | signal)') plt.ylabel('Pr(label signal | background)') plt.title(r'ROC Curve') plt.axis([0, 1, 0, 1]) plt.legend(loc='upper left') plt.show() # Say we have two 1x3 arrays (e.g. A=signal, B=background) A = np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10], dtype=np.float32) B = np.array([11, 12, 13, 14, 15, 16, 17, 18, 19, 20], dtype=np.float32) # We want to have labels '1' associated with the signal (A) and labels '0' associated with the background (B) A_labels = np.ones(10) B_labels = np.zeros(10) print('\nA: {}'.format(A)) print('B: {}'.format(B)) print('\nA_labels: {}'.format(A_labels)) print('B_labels: {}\n'.format(B_labels)) # We can concatenate the A and B arrays, and the A_labels and B_labels array like this C = np.concatenate((A,B)) C_labels = np.concatenate((A_labels,B_labels)) print('\nC: {}'.format(C)) print('C_labels: {}'.format(C_labels)) # Before training on the a dataset one often want to split it up into a 'training set' and a 'test set' # There is a useful function in scikit-learn that does this for you # This function also scrambles the examples from sklearn.model_selection import train_test_split C_train, C_test, C_labels_train, C_labels_test, = train_test_split(C, C_labels, test_size=3, random_state=1) # If this seems confusing, taking a look at the print output below should hopefully make things clear print('\nC_train: {}'.format(C_train)) print('C_labels_train: {}'.format(C_labels_train)) print('\nC_test: {}'.format(C_test)) print('\nC_labels_test: {}'.format(C_labels_test)) A = np.array([1, 2, 3, 4], dtype=np.float32) print(A) AT = np.array(A)[np.newaxis].T print(AT) # total number of signal + background events n_signal = len(signal) n_background = len(background) n_total = len(signal) + len(background) # use 90% of the total number of events for training the network n_train = int(0.9*n_total) # use the remaning 10% for testing n_test = n_total-n_train # generate an array of ones as signal labels sig_labels = np.ones(n_signal) # generate an array of zeros as background labels bkg_labels = np.zeros(n_background) # concatenate the signal and background samples X = np.concatenate((signal,background)) y = np.concatenate((sig_labels,bkg_labels)) # Format the inputs for Keras X = np.array(X)[np.newaxis].T # split the dataset into a training and a validation set and scamble the inputs (as illustrated above) from sklearn.model_selection import train_test_split X_train, X_test, y_train, y_test, = train_test_split(X, y, test_size=n_test, random_state=1) from keras.models import Sequential model = Sequential() from keras.layers import Dense # Since our samples are only the X values (of either signal or background), the first layer just has one input dimension model.add(Dense(1, input_dim=1, kernel_initializer='normal', activation='relu')) # We then implement only one hidden layer with 8 neurons (you can experiment with changing this number) n_neurons_hidden = 8 model.add(Dense(n_neurons_hidden, kernel_initializer='normal', activation='relu')) # Finally we add one output layer model.add(Dense(1, kernel_initializer='normal', activation='sigmoid')) # Compile model model.compile(loss='binary_crossentropy', optimizer='adam', metrics=['accuracy']) # Print a summary of the model structure model.summary() history=model.fit(X_train, y_train, validation_data=(X_test,y_test), epochs=3, batch_size=2048) print(history.history) loss_history=history.history["loss"] plt.plot(range(len(loss_history)),loss_history) plt.show() # Here we make use of a function in scikit-learn to calculate the ROC curve from sklearn.metrics import roc_curve, auc fpr, tpr, _ = roc_curve(y_test, model.predict(X_test)) roc_auc = auc(fpr, tpr) # Plot the ROC curve from the NN and overlay the ROC curve from the 1D classifier plt.clf() plt.axes().set_aspect('equal') plt.plot(ROCx,ROCy,label="LLR") plt.plot(tpr,fpr,color='darkorange',label='ROC curve (area = %0.2f)' % roc_auc) plt.plot([0,1],[0,1],linestyle='--',color="#C0C0C0",label="Random") plt.xlabel('Pr(label signal | signal)') plt.ylabel('Pr(label signal | background)') plt.title(r'ROC Curve') plt.axis([0, 1, 0, 1]) plt.legend(loc='upper left') plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1D Optimal Classifier Step2: Let's generate some data. Below we have provided you with a function that gives you two cases Step3: Now, let's actually run the function and generate some data. Step4: Often when dealing with data you may want to either save something you generated or load data you got from somebody else. One of the most common formats is HDF5, a "data model, library, and file format for storing and managing data." It is also the most common storage format in data science. h5py provides a python API for HDF5. In most cases, you do not need to know very much about HDF5 or h5py, just how to read/write tensors into/from files, which you can easily pick up from the h5py (Quick Start)[http Step5: Here's how we can retreive the data back. Step6: Create histograms and plot the data. Step7: Next, let's compute the log-likelihood ratio (LLR). Step8: We can also plot the mapping between the input feature vector and the LLR. Step9: Don't worry about the 'bumps' towards the edges of the plot, that's just due to low statistics. Step10: Finally, we can scan a threshold cut on the LLR and make the ROC curve. Step11: That's it for the first part of this tutorial. Now let's do some Machine Learning! Step12: Another things is that Keras require the 'X' inputs to be formatted in a certain way. Here's a simple example of that. Step13: Now when we hopefully understand a little more about how to manipulate numpy arrays, let's prepare our actual data for training a Neural Network in Keras. Step14: Finally we get to the fun stuff, let's implement our first Neural Network in Keras. To learn more what all this does, you are strongly encouraged to go and read the Keras documentation. Step15: Now let's add some layers to our model with "Dense". Dense implements the operation Step16: Next, we compile our model and choose 'binary_crossentropy' as our loss function and 'ADAM' (adaptive moment estimation) as the optimizer (an extension of stochastic gradient descent). Step17: We then train our model in the training data. Keras automatically runs validation on the test data. Step18: This very simple model should converge very quickly (even after 1-3 epochs). Training more complicated networks can take a very long time (days, weeks, or even months). Step19: You can plot the loss versus epoch. Step20: Finally, let's plot the ROC curve and compare it to the result we got form the 1D optimal classifier above.
9,514
<ASSISTANT_TASK:> Python Code: observations = np.array([20, 6, 6, 6, 6, 6]) with pm.Model(): probs = pm.Dirichlet('probs', a=np.ones(6)) # flat prior rolls = pm.Multinomial('rolls', n=50, p=probs, observed=observations) trace = pm.sample(5000) pm.plot_posterior(trace); pm.traceplot(trace) # fair fwould be all the same, we want different # 1/4 = 0.25, so we want [10%, 20%, 30%, 40%] observations = np.array([50*.1, 50*.2, 50*.3 ,50*.4]) with pm.Model(): probs = pm.Dirichlet('probs', a=np.ones(4)) # flat prior rolls = pm.Multinomial('rolls', n=observations.sum(), p=probs, observed=observations) trace = pm.sample(5000) # pm.traceplot(trace) pm.plot_posterior(trace); # this is the number of 1,2,3,4 N_rolls = 50 observations = np.array([N_rolls*.1, N_rolls*.2, N_rolls*.3 ,N_rolls*.4]) # so the data for even and odd is, even = 1 obs_evenodd = [1]*observations[np.asarray([1, 3])].sum().astype(int) + [0]*observations[np.asarray([0, 2])].sum().astype(int) # make then obs_2_4 from even, 2=True obs_2_4 = [1]*observations[1].astype(int) + [0]*observations[3].astype(int) # make then obs_1_3 from even, 1=True obs_1_3 = [1]*observations[0].astype(int) + [0]*observations[2].astype(int) with pm.Model() as our_first_model: p_evenodd = pm.Beta('p_evenodd', alpha=1, beta=1) evenodd = pm.Bernoulli('evenodd', p=p_evenodd, observed=obs_evenodd) p_2_4 = pm.Beta('p_2_4', alpha=1, beta=1) b_2_4 = pm.Bernoulli('b_2_4', p=p_2_4, observed=obs_2_4) p_1_3 = pm.Beta('p_1_3', alpha=1, beta=1) b_1_3 = pm.Bernoulli('b_1_3', p=p_1_3, observed=obs_1_3) p1 = pm.Deterministic('p1', (1-p_evenodd)*p_1_3) p2 = pm.Deterministic('p2', (p_evenodd)*p_2_4) p3 = pm.Deterministic('p3', (1-p_evenodd)*(1-p_1_3)) p4 = pm.Deterministic('p4', (p_evenodd)*(1-p_1_3)) trace = pm.sample(5000,) pm.traceplot(trace, var_names=['p1', 'p2', 'p3', 'p4']) pm.plot_posterior(trace, var_names=['p1', 'p2', 'p3', 'p4']); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Now a 4-sided die and pull out hierarchial info Step2: Build the whole thing out the Bernoulli dists
9,515
<ASSISTANT_TASK:> Python Code: import numpy as np import itertools import warnings warnings.simplefilter(action='ignore') startbosshp = 104 bossdamage = 8 bossarmor = 1 startplayerhp = 100 playerdamage = 0 playerarmor = 0 from collections import namedtuple Item = namedtuple('item', ['name', 'cost', 'damage', 'armor']) weaponsnt = [ Item('Dagger', 8, 4, 0), Item('Shortsword', 10, 5, 0), Item('Warhammer', 25, 6, 0), Item('Longsword', 40, 7, 0), Item('Greataxe', 74, 8, 0), ] armornt = [ Item('Leather', 13, 0, 1), Item('Chainmail', 31, 0, 2), Item('Splintmail', 53, 0, 3), Item('Bandedmail', 75, 0, 4), Item('Platemail', 102, 0, 5), Item('Naked', 0, 0, 0), ] ringsnt = [ Item('Damage +1', 25, 1, 0), Item('Damage +2', 50, 2, 0), Item('Damage +3', 100, 3, 0), Item('Defense +1', 20, 0, 1), Item('Defense +2', 40, 0, 2), Item('Defense +3', 80, 0, 3), ] wn = 5 #weapons an = 6 #armor rn = 22 #rings comb = wn * an * rn #total number of possibilities #setup arrays player_spent = np.full((wn, an, rn), np.nan) player_damage = np.full((wn, an, rn), np.nan) #damage player_armor = np.full((wn, an, rn), np.nan) #cost #setup arrays #weapons = np.full((wn, 3), 0) armor = np.full((an, 3), 0) rings0 = np.full((6, 3), 0) rings = np.full((rn, 3), 0) weapons = np.array([[8, 4, 0], [10, 5, 0], [25, 6, 0], [40, 7, 0], [74, 8, 0]]) armor[:,:] = [[13, 0, 1], [31, 0, 2], [53, 0, 3], [75, 0, 4], [102, 0, 5], [0, 0, 0]] rings0[:,:] = [[25, 1, 0], [50, 2, 0], [100, 3, 0], [20, 0, 1], [40, 0, 2], [80, 0, 3]] ring_combs = (list(itertools.combinations(range(6), 2))) print(ring_combs) for i in range(0, len(ring_combs)): rings[i, 0] = int(rings0[ring_combs[i][0]][0] + rings0[ring_combs[i][1]][0]) #spent rings[i, 1] = int(rings0[ring_combs[i][0]][1] + rings0[ring_combs[i][1]][1]) #damage rings[i, 2] = int(rings0[ring_combs[i][0]][2] + rings0[ring_combs[i][1]][2]) #armor rings[15:-1, :] = rings0[:,:] print(rings) for w in range(0, wn): for a in range(0, an): for r in range(0, rn): player_spent[w, a, r] = weapons[w, 0] + armor[a, 0] + rings[r, 0] player_damage[w, a, r] = weapons[w, 1] + armor[a, 1] + rings[r, 1] player_armor[w, a, r] = weapons[w, 2] + armor[a, 2] + rings[r, 2] playerspent = player_spent[0,0,0] print('playerspent=',playerspent) playerdamage = player_damage[0,0,0] print('playerdamage=',playerdamage) playerarmor = player_armor[0,0,0] print('playerarmor=',playerarmor) bestspend = 999 wi = 0 ai = 0 ri = 0 worstspend = 0 wi2 = 0 ai2 = 0 ri2 = 0 win_no = 0 lose_no = 0 for w in range(0, wn): #length=5 for a in range(0, an): #length=6 for r in range(0, rn): #length=22 #get 1 of 660 playerspent = player_spent[w, a, r] playerdamage = player_damage[w, a, r] playerarmor = player_armor[w, a, r] bosshp = startbosshp playerhp = startplayerhp playeractdam = playerdamage - bossarmor if (playeractdam < 1): playeractdam = 1 # playactdam = max(playeractdam, 1) bossactdam = bossdamage - playerarmor if (bossactdam < 1): bossactdam = 1 while (bosshp > 0) and (playerhp > 0): #bosshp = bosshp - playeractdam bosshp -= playeractdam #playerhp = playerhp - bossactdam playerhp -= bossactdam if playerhp > bosshp: #if I win #win_no = win_no += 1 win_no += 1 if playerspent < bestspend: bestspend = playerspent wi = w ai = a ri = r if playerhp < bosshp: #if I lose #lose_no = lose_no + 1 lose_no += 1 if playerspent > worstspend: worstspend = playerspent wi2 = w ai2 = a ri2 = r print('lowest cost while still winning =',bestspend) print(weaponsnt[wi]) print(armornt[ai]) print('ringscombi',rings[ri]) print(wi) print(ai) print(ri) print('-') print('highest cost while still losing =',worstspend) print(weaponsnt[wi2]) print(armornt[ai2]) print('ringscombi',rings[ri2]) print(wi2) print(ai2) print(ri2) print('-') print('win_no=',win_no) print('lose_no=',lose_no) ww = 0 aa = 5 rr = 5 playerspend = player_spent[ww, aa, rr] playerdamage = player_damage[ww, aa, rr] playerarmor = player_armor[ww, aa, rr] bosshp = startbosshp playerhp = startplayerhp playeractdam = playerdamage - bossarmor if (playeractdam < 1): playeractdam = 1 bossactdam = bossdamage - playerarmor if (bossactdam < 1): bossactdam = 1 while (bosshp > 0) & (playerhp > 0): bosshp = bosshp - playeractdam playerhp = playerhp - bossactdam print('bosshp=',bosshp) print('playerhp=',playerhp) print('-') # class Boss: # def __init__(self, hp, damage, armor): # self.hp = hp # self.damage = damage # self.armor = armor # def calc_actdamage(self, playerarmor): # self.actdamage = self.damage - playerarmor # if (self.actdamage < 1): # self.actdamage = 1 # class Player: # def __init__(self, spent, hp, damage, armor): # self.spent = spent # self.hp = hp # self.damage = damage # self.armor = armor # def calc_actdamage(self, bossarmor): # self.actdamage = self.damage - bossarmor # if (self.actdamage < 1): # self.actdamage = 1 class RpgChara: def __init__(self, hp, damage, armor): self.hp = hp self.damage = damage self.armor = armor def calc_actdamage(self, enemyarmor): self.actdamage = self.damage - enemyarmor if (self.actdamage < 1): self.actdamage = 1 class Boss(RpgChara): pass class Player(RpgChara): def __init__(self, spent, hp, damage, armor): super().__init__(hp, damage, armor) self.spent = spent bestspend = 999 #too high in order to come down wi = 0 ai = 0 ri = 0 worstspend = 0 #too low in order to go up wi2 = 0 ai2 = 0 ri2 = 0 win_no = 0 lose_no = 0 for w in range(0, wn): #length5 for a in range(0, an): #length6 for r in range(0, rn): #length22 #get 1 of 660 instances per loop boss_i = Boss(startbosshp, bossdamage, bossarmor) player_i = Player(player_spent[w, a, r], startplayerhp, player_damage[w, a, r], \ player_armor[w, a, r]) #but what is their actual damage boss_i.calc_actdamage(player_i.armor) player_i.calc_actdamage(boss_i.armor) while (boss_i.hp > 0) & (player_i.hp > 0): boss_i.hp -= player_i.actdamage player_i.hp -= boss_i.actdamage if player_i.hp > boss_i.hp: #if I win win_no += 1 if player_i.spent < bestspend: bestspend = player_i.spent wi = w ai = a ri = r if player_i.hp < boss_i.hp: #if I lose lose_no += 1 if player_i.spent > worstspend: worstspend = player_i.spent wi2 = w ai2 = a ri2 = r print('lowest spend while still winning =',bestspend) print(weaponsnt[wi]) print(armornt[ai]) print('ringscombi',rings[ri]) print(ri) print('-') print('highest spend while still losing =',worstspend) print(weaponsnt[wi2]) print(armornt[ai2]) print('ringscombi',rings[ri2]) print(ri2) print('-') print('win_no=',win_no) print('lose_no=',lose_no) HTML(html) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Procedural code version Step2: Named tuples tuples but BETTER! Step3: Set up arrays Step4: Use itertool package to get 15 combinations of 2 rings Step5: The [Cost, Damage, Armor] of the 22 ring combinations Step6: Fill 3x 660-cell 3D arrays with the cost, damage and armor for each kit-combination Step7: E.g. [0,0,0] = rings Step8: 660 boss vs player battles Step9: Test a specific combination of weapons, armor and rings Step10: OOP code version Step11: ...Use inheritance Step12: another 660 fights, OOP style
9,516
<ASSISTANT_TASK:> Python Code: def is_possible(x , y ) : if(x < 2 and y != 0 ) : return false  y = y - x + 1 if(y % 2 == 0 and y >= 0 ) : return True  else : return False   if __name__== ' __main __' : x = 5 y = 2 if(is_possible(x , y ) ) : print("Yes ")  else : print("No ")   <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
9,517
<ASSISTANT_TASK:> Python Code: #|export def make_date(df, date_field): "Make sure `df[date_field]` is of the right date type." field_dtype = df[date_field].dtype if isinstance(field_dtype, pd.core.dtypes.dtypes.DatetimeTZDtype): field_dtype = np.datetime64 if not np.issubdtype(field_dtype, np.datetime64): df[date_field] = pd.to_datetime(df[date_field], infer_datetime_format=True) df = pd.DataFrame({'date': ['2019-12-04', '2019-11-29', '2019-11-15', '2019-10-24']}) make_date(df, 'date') test_eq(df['date'].dtype, np.dtype('datetime64[ns]')) #|export def add_datepart(df, field_name, prefix=None, drop=True, time=False): "Helper function that adds columns relevant to a date in the column `field_name` of `df`." make_date(df, field_name) field = df[field_name] prefix = ifnone(prefix, re.sub('[Dd]ate$', '', field_name)) attr = ['Year', 'Month', 'Week', 'Day', 'Dayofweek', 'Dayofyear', 'Is_month_end', 'Is_month_start', 'Is_quarter_end', 'Is_quarter_start', 'Is_year_end', 'Is_year_start'] if time: attr = attr + ['Hour', 'Minute', 'Second'] # Pandas removed `dt.week` in v1.1.10 week = field.dt.isocalendar().week.astype(field.dt.day.dtype) if hasattr(field.dt, 'isocalendar') else field.dt.week for n in attr: df[prefix + n] = getattr(field.dt, n.lower()) if n != 'Week' else week mask = ~field.isna() df[prefix + 'Elapsed'] = np.where(mask,field.values.astype(np.int64) // 10 ** 9,np.nan) if drop: df.drop(field_name, axis=1, inplace=True) return df df = pd.DataFrame({'date': ['2019-12-04', None, '2019-11-15', '2019-10-24']}) df = add_datepart(df, 'date') df.head() #|hide test_eq(df.columns, ['Year', 'Month', 'Week', 'Day', 'Dayofweek', 'Dayofyear', 'Is_month_end', 'Is_month_start', 'Is_quarter_end', 'Is_quarter_start', 'Is_year_end', 'Is_year_start', 'Elapsed']) test_eq(df[df.Elapsed.isna()].shape,(1, 13)) # Test that week dtype is consistent with other datepart fields test_eq(df['Year'].dtype, df['Week'].dtype) test_eq(pd.api.types.is_numeric_dtype(df['Elapsed']), True) #|hide df = pd.DataFrame({'f1': [1.],'f2': [2.],'f3': [3.],'f4': [4.],'date':['2019-12-04']}) df = add_datepart(df, 'date') df.head() #|hide # Test Order of columns when date isn't in first position test_eq(df.columns, ['f1', 'f2', 'f3', 'f4', 'Year', 'Month', 'Week', 'Day', 'Dayofweek', 'Dayofyear', 'Is_month_end', 'Is_month_start', 'Is_quarter_end', 'Is_quarter_start', 'Is_year_end', 'Is_year_start', 'Elapsed']) # Test that week dtype is consistent with other datepart fields test_eq(df['Year'].dtype, df['Week'].dtype) #|export def _get_elapsed(df,field_names, date_field, base_field, prefix): for f in field_names: day1 = np.timedelta64(1, 'D') last_date,last_base,res = np.datetime64(),None,[] for b,v,d in zip(df[base_field].values, df[f].values, df[date_field].values): if last_base is None or b != last_base: last_date,last_base = np.datetime64(),b if v: last_date = d res.append(((d-last_date).astype('timedelta64[D]') / day1)) df[prefix + f] = res return df #|export def add_elapsed_times(df, field_names, date_field, base_field): "Add in `df` for each event in `field_names` the elapsed time according to `date_field` grouped by `base_field`" field_names = list(L(field_names)) #Make sure date_field is a date and base_field a bool df[field_names] = df[field_names].astype('bool') make_date(df, date_field) work_df = df[field_names + [date_field, base_field]] work_df = work_df.sort_values([base_field, date_field]) work_df = _get_elapsed(work_df, field_names, date_field, base_field, 'After') work_df = work_df.sort_values([base_field, date_field], ascending=[True, False]) work_df = _get_elapsed(work_df, field_names, date_field, base_field, 'Before') for a in ['After' + f for f in field_names] + ['Before' + f for f in field_names]: work_df[a] = work_df[a].fillna(0).astype(int) for a,s in zip([True, False], ['_bw', '_fw']): work_df = work_df.set_index(date_field) tmp = (work_df[[base_field] + field_names].sort_index(ascending=a) .groupby(base_field).rolling(7, min_periods=1).sum()) if base_field in tmp: tmp.drop(base_field, axis=1,inplace=True) tmp.reset_index(inplace=True) work_df.reset_index(inplace=True) work_df = work_df.merge(tmp, 'left', [date_field, base_field], suffixes=['', s]) work_df.drop(field_names, axis=1, inplace=True) return df.merge(work_df, 'left', [date_field, base_field]) df = pd.DataFrame({'date': ['2019-12-04', '2019-11-29', '2019-11-15', '2019-10-24'], 'event': [False, True, False, True], 'base': [1,1,2,2]}) df = add_elapsed_times(df, ['event'], 'date', 'base') df.head() #|export def cont_cat_split(df, max_card=20, dep_var=None): "Helper function that returns column names of cont and cat variables from given `df`." cont_names, cat_names = [], [] for label in df: if label in L(dep_var): continue if ((pd.api.types.is_integer_dtype(df[label].dtype) and df[label].unique().shape[0] > max_card) or pd.api.types.is_float_dtype(df[label].dtype)): cont_names.append(label) else: cat_names.append(label) return cont_names, cat_names # Example with simple numpy types df = pd.DataFrame({'cat1': [1, 2, 3, 4], 'cont1': [1., 2., 3., 2.], 'cat2': ['a', 'b', 'b', 'a'], 'i8': pd.Series([1, 2, 3, 4], dtype='int8'), 'u8': pd.Series([1, 2, 3, 4], dtype='uint8'), 'f16': pd.Series([1, 2, 3, 4], dtype='float16'), 'y1': [1, 0, 1, 0], 'y2': [2, 1, 1, 0]}) cont_names, cat_names = cont_cat_split(df) #|hide_input print(f'cont_names: {cont_names}\ncat_names: {cat_names}`') #|hide # Test all columns cont, cat = cont_cat_split(df) test_eq((cont, cat), (['cont1', 'f16'], ['cat1', 'cat2', 'i8', 'u8', 'y1', 'y2'])) # Test exclusion of dependent variable cont, cat = cont_cat_split(df, dep_var='y1') test_eq((cont, cat), (['cont1', 'f16'], ['cat1', 'cat2', 'i8', 'u8', 'y2'])) # Test exclusion of multi-label dependent variables cont, cat = cont_cat_split(df, dep_var=['y1', 'y2']) test_eq((cont, cat), (['cont1', 'f16'], ['cat1', 'cat2', 'i8', 'u8'])) # Test maximal cardinality bound for int variable cont, cat = cont_cat_split(df, max_card=3) test_eq((cont, cat), (['cat1', 'cont1', 'i8', 'u8', 'f16'], ['cat2', 'y1', 'y2'])) cont, cat = cont_cat_split(df, max_card=2) test_eq((cont, cat), (['cat1', 'cont1', 'i8', 'u8', 'f16', 'y2'], ['cat2', 'y1'])) cont, cat = cont_cat_split(df, max_card=1) test_eq((cont, cat), (['cat1', 'cont1', 'i8', 'u8', 'f16', 'y1', 'y2'], ['cat2'])) # Example with pandas types and generated columns df = pd.DataFrame({'cat1': pd.Series(['l','xs','xl','s'], dtype='category'), 'ui32': pd.Series([1, 2, 3, 4], dtype='UInt32'), 'i64': pd.Series([1, 2, 3, 4], dtype='Int64'), 'f16': pd.Series([1, 2, 3, 4], dtype='Float64'), 'd1_date': ['2021-02-09', None, '2020-05-12', '2020-08-14'], }) df = add_datepart(df, 'd1_date', drop=False) df['cat1'].cat.set_categories(['xl','l','m','s','xs'], ordered=True, inplace=True) cont_names, cat_names = cont_cat_split(df, max_card=0) #|hide_input print(f'cont_names: {cont_names}\ncat_names: {cat_names}') #|hide cont, cat = cont_cat_split(df, max_card=0) test_eq((cont, cat), ( ['ui32', 'i64', 'f16', 'd1_Year', 'd1_Month', 'd1_Week', 'd1_Day', 'd1_Dayofweek', 'd1_Dayofyear', 'd1_Elapsed'], ['cat1', 'd1_date', 'd1_Is_month_end', 'd1_Is_month_start', 'd1_Is_quarter_end', 'd1_Is_quarter_start', 'd1_Is_year_end', 'd1_Is_year_start'] )) #|export def df_shrink_dtypes(df, skip=[], obj2cat=True, int2uint=False): "Return any possible smaller data types for DataFrame columns. Allows `object`->`category`, `int`->`uint`, and exclusion." # 1: Build column filter and typemap excl_types, skip = {'category','datetime64[ns]','bool'}, set(skip) typemap = {'int' : [(np.dtype(x), np.iinfo(x).min, np.iinfo(x).max) for x in (np.int8, np.int16, np.int32, np.int64)], 'uint' : [(np.dtype(x), np.iinfo(x).min, np.iinfo(x).max) for x in (np.uint8, np.uint16, np.uint32, np.uint64)], 'float' : [(np.dtype(x), np.finfo(x).min, np.finfo(x).max) for x in (np.float32, np.float64, np.longdouble)] } if obj2cat: typemap['object'] = 'category' # User wants to categorify dtype('Object'), which may not always save space else: excl_types.add('object') new_dtypes = {} exclude = lambda dt: dt[1].name not in excl_types and dt[0] not in skip for c, old_t in filter(exclude, df.dtypes.items()): t = next((v for k,v in typemap.items() if old_t.name.startswith(k)), None) if isinstance(t, list): # Find the smallest type that fits if int2uint and t==typemap['int'] and df[c].min() >= 0: t=typemap['uint'] new_t = next((r[0] for r in t if r[1]<=df[c].min() and r[2]>=df[c].max()), None) if new_t and new_t == old_t: new_t = None else: new_t = t if isinstance(t, str) else None if new_t: new_dtypes[c] = new_t return new_dtypes show_doc(df_shrink_dtypes, title_level=3) df = pd.DataFrame({'i': [-100, 0, 100], 'f': [-100.0, 0.0, 100.0], 'e': [True, False, True], 'date':['2019-12-04','2019-11-29','2019-11-15',]}) df.dtypes dt = df_shrink_dtypes(df) dt #|hide test_eq(df['i'].dtype, 'int64') test_eq(dt['i'], 'int8') test_eq(df['f'].dtype, 'float64') test_eq(dt['f'], 'float32') # Default ignore 'object' and 'boolean' columns test_eq(df['date'].dtype, 'object') test_eq(dt['date'], 'category') # Test categorifying 'object' type dt2 = df_shrink_dtypes(df, obj2cat=False) test_eq('date' not in dt2, True) #|export def df_shrink(df, skip=[], obj2cat=True, int2uint=False): "Reduce DataFrame memory usage, by casting to smaller types returned by `df_shrink_dtypes()`." dt = df_shrink_dtypes(df, skip, obj2cat=obj2cat, int2uint=int2uint) return df.astype(dt) show_doc(df_shrink, title_level=3) df = pd.DataFrame({'i': [-100, 0, 100], 'f': [-100.0, 0.0, 100.0], 'u':[0, 10,254], 'date':['2019-12-04','2019-11-29','2019-11-15']}) df2 = df_shrink(df, skip=['date']) df.dtypes df2.dtypes #|hide_input print(f'Initial Dataframe: {df.memory_usage().sum()} bytes') print(f'Reduced Dataframe: {df2.memory_usage().sum()} bytes') #|hide test_eq(df['i'].dtype=='int64' and df2['i'].dtype=='int8', True) test_eq(df['f'].dtype=='float64' and df2['f'].dtype=='float32', True) test_eq(df['u'].dtype=='int64' and df2['u'].dtype=='int16', True) test_eq(df2['date'].dtype, 'object') test_eq(df2.memory_usage().sum() < df.memory_usage().sum(), True) # Test int => uint (when col.min() >= 0) df3 = df_shrink(df, int2uint=True) test_eq(df3['u'].dtype, 'uint8') # int64 -> uint8 instead of int16 # Test excluding columns df4 = df_shrink(df, skip=['i','u']) test_eq(df['i'].dtype, df4['i'].dtype) test_eq(df4['u'].dtype, 'int64') path = untar_data(URLs.ADULT_SAMPLE) df = pd.read_csv(path/'adult.csv') new_df = df_shrink(df, int2uint=True) #|hide_input print(f'Initial Dataframe: {df.memory_usage().sum() / 1000000} megabytes') print(f'Reduced Dataframe: {new_df.memory_usage().sum() / 1000000} megabytes') #|export class _TabIloc: "Get/set rows by iloc and cols by name" def __init__(self,to): self.to = to def __getitem__(self, idxs): df = self.to.items if isinstance(idxs,tuple): rows,cols = idxs cols = df.columns.isin(cols) if is_listy(cols) else df.columns.get_loc(cols) else: rows,cols = idxs,slice(None) return self.to.new(df.iloc[rows, cols]) #|export class Tabular(CollBase, GetAttr, FilteredBase): "A `DataFrame` wrapper that knows which cols are cont/cat/y, and returns rows in `__getitem__`" _default,with_cont='procs',True def __init__(self, df, procs=None, cat_names=None, cont_names=None, y_names=None, y_block=None, splits=None, do_setup=True, device=None, inplace=False, reduce_memory=True): if inplace and splits is not None and pd.options.mode.chained_assignment is not None: warn("Using inplace with splits will trigger a pandas error. Set `pd.options.mode.chained_assignment=None` to avoid it.") if not inplace: df = df.copy() if reduce_memory: df = df_shrink(df) if splits is not None: df = df.iloc[sum(splits, [])] self.dataloaders = delegates(self._dl_type.__init__)(self.dataloaders) super().__init__(df) self.y_names,self.device = L(y_names),device if y_block is None and self.y_names: # Make ys categorical if they're not numeric ys = df[self.y_names] if len(ys.select_dtypes(include='number').columns)!=len(ys.columns): y_block = CategoryBlock() else: y_block = RegressionBlock() if y_block is not None and do_setup: if callable(y_block): y_block = y_block() procs = L(procs) + y_block.type_tfms self.cat_names,self.cont_names,self.procs = L(cat_names),L(cont_names),Pipeline(procs) self.split = len(df) if splits is None else len(splits[0]) if do_setup: self.setup() def new(self, df, inplace=False): return type(self)(df, do_setup=False, reduce_memory=False, y_block=TransformBlock(), inplace=inplace, **attrdict(self, 'procs','cat_names','cont_names','y_names', 'device')) def subset(self, i): return self.new(self.items[slice(0,self.split) if i==0 else slice(self.split,len(self))]) def copy(self): self.items = self.items.copy(); return self def decode(self): return self.procs.decode(self) def decode_row(self, row): return self.new(pd.DataFrame(row).T).decode().items.iloc[0] def show(self, max_n=10, **kwargs): display_df(self.new(self.all_cols[:max_n]).decode().items) def setup(self): self.procs.setup(self) def process(self): self.procs(self) def loc(self): return self.items.loc def iloc(self): return _TabIloc(self) def targ(self): return self.items[self.y_names] def x_names (self): return self.cat_names + self.cont_names def n_subsets(self): return 2 def y(self): return self[self.y_names[0]] def new_empty(self): return self.new(pd.DataFrame({}, columns=self.items.columns)) def to_device(self, d=None): self.device = d return self def all_col_names (self): ys = [n for n in self.y_names if n in self.items.columns] return self.x_names + self.y_names if len(ys) == len(self.y_names) else self.x_names properties(Tabular,'loc','iloc','targ','all_col_names','n_subsets','x_names','y') #|export class TabularPandas(Tabular): "A `Tabular` object with transforms" def transform(self, cols, f, all_col=True): if not all_col: cols = [c for c in cols if c in self.items.columns] if len(cols) > 0: self[cols] = self[cols].transform(f) #|export def _add_prop(cls, nm): @property def f(o): return o[list(getattr(o,nm+'_names'))] @f.setter def fset(o, v): o[getattr(o,nm+'_names')] = v setattr(cls, nm+'s', f) setattr(cls, nm+'s', fset) _add_prop(Tabular, 'cat') _add_prop(Tabular, 'cont') _add_prop(Tabular, 'y') _add_prop(Tabular, 'x') _add_prop(Tabular, 'all_col') #|hide df = pd.DataFrame({'a':[0,1,2,0,2], 'b':[0,0,0,0,1]}) to = TabularPandas(df, cat_names='a') t = pickle.loads(pickle.dumps(to)) test_eq(t.items,to.items) test_eq(to.all_cols,to[['a']]) #|hide import gc def _count_objs(o): "Counts number of instanes of class `o`" objs = gc.get_objects() return len([x for x in objs if isinstance(x, pd.DataFrame)]) df = pd.DataFrame({'a':[0,1,2,0,2], 'b':[0,0,0,0,1]}) df_b = pd.DataFrame({'a':[1,2,0,0,2], 'b':[1,0,3,0,1]}) to = TabularPandas(df, cat_names='a', inplace=True) _init_count = _count_objs(pd.DataFrame) to_new = to.new(df_b, inplace=True) test_eq(_init_count, _count_objs(pd.DataFrame)) #|export class TabularProc(InplaceTransform): "Base class to write a non-lazy tabular processor for dataframes" def setup(self, items=None, train_setup=False): #TODO: properly deal with train_setup super().setup(getattr(items,'train',items), train_setup=False) # Procs are called as soon as data is available return self(items.items if isinstance(items,Datasets) else items) @property def name(self): return f"{super().name} -- {getattr(self,'__stored_args__',{})}" #|export def _apply_cats (voc, add, c): if not is_categorical_dtype(c): return pd.Categorical(c, categories=voc[c.name][add:]).codes+add return c.cat.codes+add #if is_categorical_dtype(c) else c.map(voc[c.name].o2i) def _decode_cats(voc, c): return c.map(dict(enumerate(voc[c.name].items))) #|export class Categorify(TabularProc): "Transform the categorical variables to something similar to `pd.Categorical`" order = 1 def setups(self, to): store_attr(classes={n:CategoryMap(to.iloc[:,n].items, add_na=(n in to.cat_names)) for n in to.cat_names}, but='to') def encodes(self, to): to.transform(to.cat_names, partial(_apply_cats, self.classes, 1)) def decodes(self, to): to.transform(to.cat_names, partial(_decode_cats, self.classes)) def __getitem__(self,k): return self.classes[k] #|exporti @Categorize def setups(self, to:Tabular): if len(to.y_names) > 0: if self.vocab is None: self.vocab = CategoryMap(getattr(to, 'train', to).iloc[:,to.y_names[0]].items, strict=True) else: self.vocab = CategoryMap(self.vocab, sort=False, add_na=self.add_na) self.c = len(self.vocab) return self(to) @Categorize def encodes(self, to:Tabular): to.transform(to.y_names, partial(_apply_cats, {n: self.vocab for n in to.y_names}, 0), all_col=False) return to @Categorize def decodes(self, to:Tabular): to.transform(to.y_names, partial(_decode_cats, {n: self.vocab for n in to.y_names}), all_col=False) return to show_doc(Categorify, title_level=3) df = pd.DataFrame({'a':[0,1,2,0,2]}) to = TabularPandas(df, Categorify, 'a') to.show() cat = to.procs.categorify cat.classes #|hide def test_series(a,b): return test_eq(list(a), b) test_series(cat['a'], ['#na#',0,1,2]) test_series(to['a'], [1,2,3,1,3]) #|hide df1 = pd.DataFrame({'a':[1,0,3,-1,2]}) to1 = to.new(df1) to1.process() #Values that weren't in the training df are sent to 0 (na) test_series(to1['a'], [2,1,0,0,3]) to2 = cat.decode(to1) test_series(to2['a'], [1,0,'#na#','#na#',2]) #|hide #test with splits cat = Categorify() df = pd.DataFrame({'a':[0,1,2,3,2]}) to = TabularPandas(df, cat, 'a', splits=[[0,1,2],[3,4]]) test_series(cat['a'], ['#na#',0,1,2]) test_series(to['a'], [1,2,3,0,3]) #|hide df = pd.DataFrame({'a':pd.Categorical(['M','H','L','M'], categories=['H','M','L'], ordered=True)}) to = TabularPandas(df, Categorify, 'a') cat = to.procs.categorify test_series(cat['a'], ['#na#','H','M','L']) test_series(to.items.a, [2,1,3,2]) to2 = cat.decode(to) test_series(to2['a'], ['M','H','L','M']) #|hide #test with targets cat = Categorify() df = pd.DataFrame({'a':[0,1,2,3,2], 'b': ['a', 'b', 'a', 'b', 'b']}) to = TabularPandas(df, cat, 'a', splits=[[0,1,2],[3,4]], y_names='b') test_series(to.vocab, ['a', 'b']) test_series(to['b'], [0,1,0,1,1]) to2 = to.procs.decode(to) test_series(to2['b'], ['a', 'b', 'a', 'b', 'b']) #|hide cat = Categorify() df = pd.DataFrame({'a':[0,1,2,3,2], 'b': ['a', 'b', 'a', 'b', 'b']}) to = TabularPandas(df, cat, 'a', splits=[[0,1,2],[3,4]], y_names='b') test_series(to.vocab, ['a', 'b']) test_series(to['b'], [0,1,0,1,1]) to2 = to.procs.decode(to) test_series(to2['b'], ['a', 'b', 'a', 'b', 'b']) #|hide #test with targets and train cat = Categorify() df = pd.DataFrame({'a':[0,1,2,3,2], 'b': ['a', 'b', 'a', 'c', 'b']}) to = TabularPandas(df, cat, 'a', splits=[[0,1,2],[3,4]], y_names='b') test_series(to.vocab, ['a', 'b']) #|hide #test to ensure no copies of the dataframe are stored cat = Categorify() df = pd.DataFrame({'a':[0,1,2,3,4]}) to = TabularPandas(df, cat, cont_names='a', splits=[[0,1,2],[3,4]]) test_eq(hasattr(to.categorify, 'to'), False) #|exporti @Normalize def setups(self, to:Tabular): store_attr(but='to', means=dict(getattr(to, 'train', to).conts.mean()), stds=dict(getattr(to, 'train', to).conts.std(ddof=0)+1e-7)) return self(to) @Normalize def encodes(self, to:Tabular): to.conts = (to.conts-self.means) / self.stds return to @Normalize def decodes(self, to:Tabular): to.conts = (to.conts*self.stds ) + self.means return to #|hide norm = Normalize() df = pd.DataFrame({'a':[0,1,2,3,4]}) to = TabularPandas(df, norm, cont_names='a') x = np.array([0,1,2,3,4]) m,s = x.mean(),x.std() test_eq(norm.means['a'], m) test_close(norm.stds['a'], s) test_close(to['a'].values, (x-m)/s) #|hide df1 = pd.DataFrame({'a':[5,6,7]}) to1 = to.new(df1) to1.process() test_close(to1['a'].values, (np.array([5,6,7])-m)/s) to2 = norm.decode(to1) test_close(to2['a'].values, [5,6,7]) #|hide norm = Normalize() df = pd.DataFrame({'a':[0,1,2,3,4]}) to = TabularPandas(df, norm, cont_names='a', splits=[[0,1,2],[3,4]]) x = np.array([0,1,2]) m,s = x.mean(),x.std() test_eq(norm.means['a'], m) test_close(norm.stds['a'], s) test_close(to['a'].values, (np.array([0,1,2,3,4])-m)/s) #|hide norm = Normalize() df = pd.DataFrame({'a':[0,1,2,3,4]}) to = TabularPandas(df, norm, cont_names='a', splits=[[0,1,2],[3,4]]) test_eq(hasattr(to.procs.normalize, 'to'), False) #|export class FillStrategy: "Namespace containing the various filling strategies." def median (c,fill): return c.median() def constant(c,fill): return fill def mode (c,fill): return c.dropna().value_counts().idxmax() #|export class FillMissing(TabularProc): "Fill the missing values in continuous columns." def __init__(self, fill_strategy=FillStrategy.median, add_col=True, fill_vals=None): if fill_vals is None: fill_vals = defaultdict(int) store_attr() def setups(self, to): missing = pd.isnull(to.conts).any() store_attr(but='to', na_dict={n:self.fill_strategy(to[n], self.fill_vals[n]) for n in missing[missing].keys()}) self.fill_strategy = self.fill_strategy.__name__ def encodes(self, to): missing = pd.isnull(to.conts) for n in missing.any()[missing.any()].keys(): assert n in self.na_dict, f"nan values in `{n}` but not in setup training set" for n in self.na_dict.keys(): to[n].fillna(self.na_dict[n], inplace=True) if self.add_col: to.loc[:,n+'_na'] = missing[n] if n+'_na' not in to.cat_names: to.cat_names.append(n+'_na') show_doc(FillMissing, title_level=3) #|hide fill1,fill2,fill3 = (FillMissing(fill_strategy=s) for s in [FillStrategy.median, FillStrategy.constant, FillStrategy.mode]) df = pd.DataFrame({'a':[0,1,np.nan,1,2,3,4]}) df1 = df.copy(); df2 = df.copy() tos = (TabularPandas(df, fill1, cont_names='a'), TabularPandas(df1, fill2, cont_names='a'), TabularPandas(df2, fill3, cont_names='a')) test_eq(fill1.na_dict, {'a': 1.5}) test_eq(fill2.na_dict, {'a': 0}) test_eq(fill3.na_dict, {'a': 1.0}) for t in tos: test_eq(t.cat_names, ['a_na']) for to_,v in zip(tos, [1.5, 0., 1.]): test_eq(to_['a'].values, np.array([0, 1, v, 1, 2, 3, 4])) test_eq(to_['a_na'].values, np.array([0, 0, 1, 0, 0, 0, 0])) #|hide fill = FillMissing() df = pd.DataFrame({'a':[0,1,np.nan,1,2,3,4], 'b': [0,1,2,3,4,5,6]}) to = TabularPandas(df, fill, cont_names=['a', 'b']) test_eq(fill.na_dict, {'a': 1.5}) test_eq(to.cat_names, ['a_na']) test_eq(to['a'].values, np.array([0, 1, 1.5, 1, 2, 3, 4])) test_eq(to['a_na'].values, np.array([0, 0, 1, 0, 0, 0, 0])) test_eq(to['b'].values, np.array([0,1,2,3,4,5,6])) #|hide fill = FillMissing() df = pd.DataFrame({'a':[0,1,np.nan,1,2,3,4], 'b': [0,1,2,3,4,5,6]}) to = TabularPandas(df, fill, cont_names=['a', 'b']) test_eq(hasattr(to.procs.fill_missing, 'to'), False) #|hide procs = [Normalize, Categorify, FillMissing, noop] df = pd.DataFrame({'a':[0,1,2,1,1,2,0], 'b':[0,1,np.nan,1,2,3,4]}) to = TabularPandas(df, procs, cat_names='a', cont_names='b') #Test setup and apply on df_main test_series(to.cat_names, ['a', 'b_na']) test_series(to['a'], [1,2,3,2,2,3,1]) test_series(to['b_na'], [1,1,2,1,1,1,1]) x = np.array([0,1,1.5,1,2,3,4]) m,s = x.mean(),x.std() test_close(to['b'].values, (x-m)/s) test_eq(to.classes, {'a': ['#na#',0,1,2], 'b_na': ['#na#',False,True]}) #|hide #Test apply on y_names df = pd.DataFrame({'a':[0,1,2,1,1,2,0], 'b':[0,1,np.nan,1,2,3,4], 'c': ['b','a','b','a','a','b','a']}) to = TabularPandas(df, procs, 'a', 'b', y_names='c') test_series(to.cat_names, ['a', 'b_na']) test_series(to['a'], [1,2,3,2,2,3,1]) test_series(to['b_na'], [1,1,2,1,1,1,1]) test_series(to['c'], [1,0,1,0,0,1,0]) x = np.array([0,1,1.5,1,2,3,4]) m,s = x.mean(),x.std() test_close(to['b'].values, (x-m)/s) test_eq(to.classes, {'a': ['#na#',0,1,2], 'b_na': ['#na#',False,True]}) test_eq(to.vocab, ['a','b']) #|hide df = pd.DataFrame({'a':[0,1,2,1,1,2,0], 'b':[0,1,np.nan,1,2,3,4], 'c': ['b','a','b','a','a','b','a']}) to = TabularPandas(df, procs, 'a', 'b', y_names='c') test_series(to.cat_names, ['a', 'b_na']) test_series(to['a'], [1,2,3,2,2,3,1]) test_eq(df.a.dtype, np.int64 if sys.platform == "win32" else int) test_series(to['b_na'], [1,1,2,1,1,1,1]) test_series(to['c'], [1,0,1,0,0,1,0]) #|hide df = pd.DataFrame({'a':[0,1,2,1,1,2,0], 'b':[0,np.nan,1,1,2,3,4], 'c': ['b','a','b','a','a','b','a']}) to = TabularPandas(df, procs, cat_names='a', cont_names='b', y_names='c', splits=[[0,1,4,6], [2,3,5]]) test_series(to.cat_names, ['a', 'b_na']) test_series(to['a'], [1,2,2,1,0,2,0]) test_eq(df.a.dtype, np.int64 if sys.platform == "win32" else int) test_series(to['b_na'], [1,2,1,1,1,1,1]) test_series(to['c'], [1,0,0,0,1,0,1]) #|export def _maybe_expand(o): return o[:,None] if o.ndim==1 else o #|export class ReadTabBatch(ItemTransform): "Transform `TabularPandas` values into a `Tensor` with the ability to decode" def __init__(self, to): self.to = to.new_empty() def encodes(self, to): if not to.with_cont: res = (tensor(to.cats).long(),) else: res = (tensor(to.cats).long(),tensor(to.conts).float()) ys = [n for n in to.y_names if n in to.items.columns] if len(ys) == len(to.y_names): res = res + (tensor(to.targ),) if to.device is not None: res = to_device(res, to.device) return res def decodes(self, o): o = [_maybe_expand(o_) for o_ in to_np(o) if o_.size != 0] vals = np.concatenate(o, axis=1) try: df = pd.DataFrame(vals, columns=self.to.all_col_names) except: df = pd.DataFrame(vals, columns=self.to.x_names) to = self.to.new(df) return to #|export @typedispatch def show_batch(x: Tabular, y, its, max_n=10, ctxs=None): x.show() #|export @delegates() class TabDataLoader(TfmdDL): "A transformed `DataLoader` for Tabular data" def __init__(self, dataset, bs=16, shuffle=False, after_batch=None, num_workers=0, **kwargs): if after_batch is None: after_batch = L(TransformBlock().batch_tfms)+ReadTabBatch(dataset) super().__init__(dataset, bs=bs, shuffle=shuffle, after_batch=after_batch, num_workers=num_workers, **kwargs) def create_batch(self, b): return self.dataset.iloc[b] def do_item(self, s): return 0 if s is None else s TabularPandas._dl_type = TabDataLoader path = untar_data(URLs.ADULT_SAMPLE) df = pd.read_csv(path/'adult.csv') df_main,df_test = df.iloc[:10000].copy(),df.iloc[10000:].copy() df_test.drop('salary', axis=1, inplace=True) df_main.head() cat_names = ['workclass', 'education', 'marital-status', 'occupation', 'relationship', 'race'] cont_names = ['age', 'fnlwgt', 'education-num'] procs = [Categorify, FillMissing, Normalize] splits = RandomSplitter()(range_of(df_main)) to = TabularPandas(df_main, procs, cat_names, cont_names, y_names="salary", splits=splits) dls = to.dataloaders() dls.valid.show_batch() to.show() row = to.items.iloc[0] to.decode_row(row) to_tst = to.new(df_test) to_tst.process() to_tst.items.head() tst_dl = dls.valid.new(to_tst) tst_dl.show_batch() def _mock_multi_label(df): sal,sex,white = [],[],[] for row in df.itertuples(): sal.append(row.salary == '>=50k') sex.append(row.sex == ' Male') white.append(row.race == ' White') df['salary'] = np.array(sal) df['male'] = np.array(sex) df['white'] = np.array(white) return df path = untar_data(URLs.ADULT_SAMPLE) df = pd.read_csv(path/'adult.csv') df_main,df_test = df.iloc[:10000].copy(),df.iloc[10000:].copy() df_main = _mock_multi_label(df_main) df_main.head() #|exporti @EncodedMultiCategorize def setups(self, to:Tabular): self.c = len(self.vocab) return self(to) @EncodedMultiCategorize def encodes(self, to:Tabular): return to @EncodedMultiCategorize def decodes(self, to:Tabular): to.transform(to.y_names, lambda c: c==1) return to cat_names = ['workclass', 'education', 'marital-status', 'occupation', 'relationship', 'race'] cont_names = ['age', 'fnlwgt', 'education-num'] procs = [Categorify, FillMissing, Normalize] splits = RandomSplitter()(range_of(df_main)) y_names=["salary", "male", "white"] %time to = TabularPandas(df_main, procs, cat_names, cont_names, y_names=y_names, y_block=MultiCategoryBlock(encoded=True, vocab=y_names), splits=splits) dls = to.dataloaders() dls.valid.show_batch() def _mock_multi_label(df): targ = [] for row in df.itertuples(): labels = [] if row.salary == '>=50k': labels.append('>50k') if row.sex == ' Male': labels.append('male') if row.race == ' White': labels.append('white') targ.append(' '.join(labels)) df['target'] = np.array(targ) return df path = untar_data(URLs.ADULT_SAMPLE) df = pd.read_csv(path/'adult.csv') df_main,df_test = df.iloc[:10000].copy(),df.iloc[10000:].copy() df_main = _mock_multi_label(df_main) df_main.head() @MultiCategorize def encodes(self, to:Tabular): #to.transform(to.y_names, partial(_apply_cats, {n: self.vocab for n in to.y_names}, 0)) return to @MultiCategorize def decodes(self, to:Tabular): #to.transform(to.y_names, partial(_decode_cats, {n: self.vocab for n in to.y_names})) return to cat_names = ['workclass', 'education', 'marital-status', 'occupation', 'relationship', 'race'] cont_names = ['age', 'fnlwgt', 'education-num'] procs = [Categorify, FillMissing, Normalize] splits = RandomSplitter()(range_of(df_main)) %time to = TabularPandas(df_main, procs, cat_names, cont_names, y_names="target", y_block=MultiCategoryBlock(), splits=splits) to.procs[2].vocab #|exporti @RegressionSetup def setups(self, to:Tabular): if self.c is not None: return self.c = len(to.y_names) return to @RegressionSetup def encodes(self, to:Tabular): return to @RegressionSetup def decodes(self, to:Tabular): return to path = untar_data(URLs.ADULT_SAMPLE) df = pd.read_csv(path/'adult.csv') df_main,df_test = df.iloc[:10000].copy(),df.iloc[10000:].copy() df_main = _mock_multi_label(df_main) cat_names = ['workclass', 'education', 'marital-status', 'occupation', 'relationship', 'race'] cont_names = ['fnlwgt', 'education-num'] procs = [Categorify, FillMissing, Normalize] splits = RandomSplitter()(range_of(df_main)) %time to = TabularPandas(df_main, procs, cat_names, cont_names, y_names='age', splits=splits) to.procs[-1].means dls = to.dataloaders() dls.valid.show_batch() class TensorTabular(fastuple): def get_ctxs(self, max_n=10, **kwargs): n_samples = min(self[0].shape[0], max_n) df = pd.DataFrame(index = range(n_samples)) return [df.iloc[i] for i in range(n_samples)] def display(self, ctxs): display_df(pd.DataFrame(ctxs)) class TabularLine(pd.Series): "A line of a dataframe that knows how to show itself" def show(self, ctx=None, **kwargs): return self if ctx is None else ctx.append(self) class ReadTabLine(ItemTransform): def __init__(self, proc): self.proc = proc def encodes(self, row): cats,conts = (o.map(row.__getitem__) for o in (self.proc.cat_names,self.proc.cont_names)) return TensorTabular(tensor(cats).long(),tensor(conts).float()) def decodes(self, o): to = TabularPandas(o, self.proc.cat_names, self.proc.cont_names, self.proc.y_names) to = self.proc.decode(to) return TabularLine(pd.Series({c: v for v,c in zip(to.items[0]+to.items[1], self.proc.cat_names+self.proc.cont_names)})) class ReadTabTarget(ItemTransform): def __init__(self, proc): self.proc = proc def encodes(self, row): return row[self.proc.y_names].astype(np.int64) def decodes(self, o): return Category(self.proc.classes[self.proc.y_names][o]) # tds = TfmdDS(to.items, tfms=[[ReadTabLine(proc)], ReadTabTarget(proc)]) # enc = tds[1] # test_eq(enc[0][0], tensor([2,1])) # test_close(enc[0][1], tensor([-0.628828])) # test_eq(enc[1], 1) # dec = tds.decode(enc) # assert isinstance(dec[0], TabularLine) # test_close(dec[0], pd.Series({'a': 1, 'b_na': False, 'b': 1})) # test_eq(dec[1], 'a') # test_stdout(lambda: print(show_at(tds, 1)), a 1 # b_na False # b 1 # category a # dtype: object) #|hide from nbdev.export import notebook2script notebook2script() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: For example if we have a series of dates we can then generate features such as Year, Month, Day, Dayofweek, Is_month_start, etc as shown below Step2: This function works by determining if a column is continuous or categorical based on the cardinality of its values. If it is above the max_card parameter (or a float datatype) then it will be added to the cont_names else cat_names. An example is below Step3: For example we will make a sample DataFrame with int, float, bool, and object datatypes Step4: We can then call df_shrink_dtypes to find the smallest possible datatype that can support the data Step5: df_shrink(df) attempts to make a DataFrame uses less memory, by fit numeric columns into smallest datatypes. In addition Step6: Let's compare the two Step7: We can see that the datatypes changed, and even further we can look at their relative memory usages Step8: Here's another example using the ADULT_SAMPLE dataset Step9: We reduced the overall memory used by 79%! Step10: df Step11: These transforms are applied as soon as the data is available rather than as data is called from the DataLoader Step12: While visually in the DataFrame you will not see a change, the classes are stored in to.procs.categorify as we can see below on a dummy DataFrame Step13: Each column's unique values are stored in a dictionary of column Step14: Currently, filling with the median, a constant, and the mode are supported. Step15: TabularPandas Pipelines - Step16: Integration example Step17: We can decode any set of transformed data by calling to.decode_row with our raw data Step18: We can make new test datasets based on the training data with the to.new() Step19: We can then convert it to a DataLoader Step20: Other target types Step21: Not one-hot encoded Step22: Regression Step24: Not being used now - for multi-modal Step25: Export -
9,518
<ASSISTANT_TASK:> Python Code: #!pip install -I "phoebe>=2.3,<2.4" import phoebe from phoebe import u # units import numpy as np logger = phoebe.logger() b = phoebe.default_binary() help(phoebe.gaussian) dist = phoebe.gaussian(6000, 100) print(dist) _ = dist.plot(show=True) b.add_distribution('teff@primary', dist, distribution='mydist') b.get_value(qualifier='teff', component='primary', distribution='mydist') _ = b.get_value(qualifier='teff', component='primary', distribution='mydist').plot(show=True) _ = b.plot_distribution_collection(distribution='mydist') help(phoebe.gaussian) help(phoebe.gaussian_around) b = phoebe.default_binary() print(b.get_value(qualifier='teff', component='primary')) b.add_distribution('teff@primary', phoebe.gaussian(6000, 100), distribution='gaussian_dist') b.add_distribution('teff@primary', phoebe.gaussian_around(100), distribution='gaussian_around_dist') print(b.filter(context='distribution')) b.set_value('teff', component='primary', context='component', value=6123) print(b.filter(context='distribution')) help(phoebe.uniform) help(phoebe.uniform_around) help(phoebe.mvhistogram_from_data) help(phoebe.mvgaussian) import numpy as np b = phoebe.default_binary() dist = phoebe.mvgaussian([6500, 6200, 0.9], np.array([[ 2, 1, -1], [ 1, 2, 1], [-1, 1, 2]]), allow_singular=True, labels=['T1', 'T2', 'q']) _ = dist.plot(show=True) _ = dist.slice('T1').plot() dist.slice('T1') b.add_distribution({'teff@primary': dist.slice('T1'), 'teff@secondary': dist.slice('T2'), 'q': dist.slice('q')}, distribution='mydist') _ = b.plot_distribution_collection('mydist', show=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Top-level distl distribution creation functions Step2: Note that, when passing a distribution object to b.add_distribution, the values of unit, label, label_latex, and wrap_at will be handled by PHOEBE itself - based on the parameter to which the distribution is attached. Step3: Note that since we didn't provide label or unit, those will be missing when plotting the distribution object. Step4: However, b.add_distribution will populate unit and wrap_at (when applicable) Step5: And whenever plotting through b.plot_distribution_collection or b.plot, the latex representation of the respective parameters will be included. Step6: "Around" distributions Step7: When attached in PHOEBE, any "around" distribution will have its central value updated to always be that of the current parameter value to which its attached. This can be very convenient in some cases (for example, setting init_from to always be an N-dimensional Gaussian "ball" around the current values), but in other cases is not appropriate (for priors, where any attached distribution should be based on external knowledge or assumptions, and therefore should be fixed and not update with changing parameter values). Step8: Since the central value is currently 6000, these two distributions are currently identical (the value in the gaussian_around is the current value that will be adopted as loc whenever the distribution is actually used). Step9: However, if we change the parameter value, we can see that the "around" distribution updates its central value accordingly. Step10: Note that if we try to use any distribution-set with an "around" distribution as priors in a solver, a warning will be raised (as of PHOEBE 2.3.23). Step11: Multivariate distributions Step12: Once we create our single distl multivariate object, we then need to tell PHOEBE which "slices" of that multivariate distribution to attach to which parameters. Step13: By calling dist.slice, we get a distl object which retains the covariance matrix, but represents a single dimension, which can then be passed to PHOEBE. Step14: And we can see that the covariances (although stored three separate times) are maintained whenever sampling from the distributions within PHOEBE.
9,519
<ASSISTANT_TASK:> Python Code: 0.1 == 0.10000000000000000000001 0.1+0.1+0.1 == 0.3 (0.1).as_integer_ratio() (0.10000000000000001).as_integer_ratio() print(0.10000000000000001) a = .1 + .1 + .1 b = .3 print(a.as_integer_ratio()) print(b.as_integer_ratio()) print(a == b) round(a, 10) == round(b, 10) print(round(a, 17) == round(b, 17)) print(round(0.1, 1) == round(0.111, 1)) from decimal import Decimal a = Decimal(0.1) b = Decimal(0.1000000000000001) c = Decimal(0.10000000000000001) print(a) print(b) print(c) a == b == c from fractions import Fraction f1 = Fraction(1, 10) # 0.1 print(float(f1)) f3 = Fraction(3, 10) # 0.3 print(float(f3)) print(f1 + f1 + f1 == f3) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: IEEE 浮点数表示法 Step2: 也就是说 0.1 是通过 3602879701896397/36028797018963968 来近似表示的,很明显这样近似的表示会导致许多差距很小的数字公用相同的近似表示数,例如: Step3: 在 Python 中所有这些可以用相同的近似数表示的数字统一采用最短有效数字来表示: Step4: 浮点数运算 Step5: 为了解决运算中的问题,IEEE 标准还指定了一个舍入规则(round),即 Python 中内置的 round 方法,我们可以通过舍入的方式取得两个数的近似值,来判断其近似值是否相等: Step6: 当然这种舍入的方式并不一定是可靠的,依赖于舍入的选择的位数,位数太大,就失去了 round 的作用,太小,就会引入别的错误: Step7: Python 中使用更精确的浮点数可以通过 decimal 和 fractions 两个模块,从名字上也能猜到,decimal 表示完整的小数,而 fractions 通过分数的形式表示小数:
9,520
<ASSISTANT_TASK:> Python Code: import sys sys.path.append('/Users/spacecoffin/Development') import GravelKicker as gk import librosa import numpy as np import os import pandas as pd from datetime import datetime from supriya.tools import nonrealtimetools this_dir = '/Users/spacecoffin/Development/GravelKicker/__gen_files' pmtx = gk.generator.gendy1.gen_params(rows=100) df = gk.generator.gendy1.format_params(pmtx) df.to_pickle() pmtx %time for i, row in df.iterrows(): session = nonrealtimetools.Session() builder = gk.generator.gendy1.make_builder(row) out = gk.generator.gendy1.build_out(builder) synthdef = builder.build() with session.at(0): synth_a = session.add_synth(duration=10, synthdef=synthdef) gk.util.render_session(session, this_dir, row["hash"]) %timeit for i, row in df.iterrows(): y, sr = librosa.load(os.path.join(this_dir, "aif_files", row["hash"] + ".aiff")) _y_normed = librosa.util.normalize(y) _mfcc = librosa.feature.mfcc(y=_y_normed, sr=sr, n_mfcc=13) _cent = np.mean(librosa.feature.spectral_centroid(y=_y_normed, sr=sr)) _mfcc_mean = gk.feature_extraction.get_stats(_mfcc)["mean"] X_row = np.append(_mfcc_mean, _cent) if i==0: X_mtx = X_row else: X_mtx = np.vstack((X_mtx, X_row)) for i, row in df.iterrows(): session = nonrealtimetools.Session() builder = gk.generator.gendy1.make_builder(row) out = gk.generator.gendy1.build_out(builder) synthdef = builder.build() with session.at(0): synth_a = session.add_synth(duration=10, synthdef=synthdef) gk.util.render_session(session, this_dir, row["hash"]) y, sr = librosa.load(os.path.join(this_dir, "aif_files", row["hash"] + ".aiff")) _y_normed = librosa.util.normalize(y) _mfcc = librosa.feature.mfcc(y=_y_normed, sr=sr, n_mfcc=13) _cent = np.mean(librosa.feature.spectral_centroid(y=_y_normed, sr=sr)) _mfcc_mean = gk.feature_extraction.get_stats(_mfcc)["mean"] X_row = np.append(_mfcc_mean, _cent) if i==0: X_mtx = X_row else: X_mtx = np.vstack((X_mtx, X_row)) X_mtx.shape def col_rename_4_mfcc(c): if (c < 13): return "mfcc_mean_{}".format(c) else: return "spectral_centroid" pd.DataFrame(X_mtx).rename_axis(lambda c: col_rename_4_mfcc(c), axis=1) from sklearn import linear_model from sklearn import model_selection from sklearn import preprocessing import sklearn as sk import matplotlib.pyplot as plt %matplotlib inline pmtx.shape X_mtx.shape X_mtx[0] X_train, X_test, y_train, y_test = sk.model_selection.train_test_split( X_mtx, pmtx, test_size=0.4, random_state=1) # Create linear regression objectc regr = linear_model.LinearRegression() # Train the model using the training sets regr.fit(X_train, y_train) # The coefficients print('Coefficients: \n', regr.coef_) # The mean squared error print("Mean squared error: %.2f" % np.mean((regr.predict(X_test) - y_test) ** 2)) # Explained variance score: 1 is perfect prediction print('Variance score: %.2f' % regr.score(X_test, y_test)) # Scale data standard_scaler = sk.preprocessing.StandardScaler() X_scaled = standard_scaler.fit_transform(X_mtx) #Xte_s = standard_scaler.transform(X_test) robust_scaler = sk.preprocessing.RobustScaler() X_rscaled = robust_scaler.fit_transform(X_mtx) #Xte_r = robust_scaler.transform(X_test) X_scaled.mean(axis=0) X_scaled.mean(axis=0).mean() X_scaled.std(axis=0) X_train, X_test, y_train, y_test = sk.model_selection.train_test_split( X_scaled, pmtx, test_size=0.4, random_state=1) # Create linear regression objectc regr = linear_model.LinearRegression() # Train the model using the training sets regr.fit(X_train, y_train) # The coefficients print('Coefficients: \n', regr.coef_) # The mean squared error print("Mean squared error: %.2f" % np.mean((regr.predict(X_test) - y_test) ** 2)) # Explained variance score: 1 is perfect prediction print('Variance score: %.2f' % regr.score(X_test, y_test)) y_test[0] X_test[0] regr.predict(X_test[0]) y_test[0] <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Generation/rendering timing Step2: Feature extraction timing Step3: Thought Step4: Preprocessing
9,521
<ASSISTANT_TASK:> Python Code: import pyvinecopulib as pv pv.Bicop() pv.Bicop(family=pv.BicopFamily.gaussian) pv.Bicop(family=pv.BicopFamily.clayton, rotation=90, parameters=[3]) cop = pv.Bicop(family=pv.BicopFamily.student, rotation=0, parameters=[0.5, 4]) u = cop.simulate(n=10, seeds=[1, 2, 3]) fcts = [cop.pdf, cop.cdf, cop.hfunc1, cop.hfunc2, cop.hinv1, cop.hinv2, cop.loglik, cop.aic, cop.bic] [f(u) for f in fcts] u = cop.simulate(n=1000, seeds=[1, 2, 3]) # Create a new object an sets its parameters by fitting afterwards cop2 = pv.Bicop(pv.BicopFamily.student) cop2.fit(data=u) print(cop2) # Otherwise, define first an object to control the fits: # - pv.FitControlsBicop objects store the controls # - here, we only restrict the parametric family # - see help(pv.FitControlsBicop) for more details # Then, create a copula from the data controls = pv.FitControlsBicop(family_set=[pv.BicopFamily.student]) print(controls) cop2 = pv.Bicop(data=u, controls=controls) print(cop2) # Create a new object an selects both its family and parameters afterwards cop3 = pv.Bicop() cop3.select(data=u) print(cop3) # Or create directly from data cop3 = pv.Bicop(data=u) print(cop3) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create an independence bivariate copula Step2: Create a Gaussian copula Step3: Create a 90 degrees rotated Clayon copula with parameter = 3 Step4: Create a t copula with correlation of 0.5 and 4 degrees of freedom Step5: Different ways to fit a copula... Step6: Similarly, when the family is unkown,
9,522
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'cmcc', 'cmcc-cm2-sr5', 'land') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_atmosphere_flux_exchanges') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "water" # "energy" # "carbon" # "nitrogen" # "phospherous" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.atmospheric_coupling_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_cover') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "bare soil" # "urban" # "lake" # "land ice" # "lake ice" # "vegetated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_cover_change') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.energy') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.water') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.carbon') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.timestep_dependent_on_atmosphere') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.timestepping_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.horizontal.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.horizontal.matches_atmosphere_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.vertical.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.vertical.total_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_water_coupling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.number_of_soil layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.structure') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.texture') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.organic_matter') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.water_table') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.continuously_varying_soil_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.soil_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.prognostic') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.functions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation type" # "soil humidity" # "vegetation state" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.direct_diffuse') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "distinction between direct and diffuse albedo" # "no distinction between direct and diffuse albedo" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.number_of_wavelength_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.vertical_discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.number_of_ground_water_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.lateral_connectivity') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "perfect connectivity" # "Darcian flow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Bucket" # "Force-restore" # "Choisnel" # "Explicit diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.number_of_ground_ice_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.ice_storage_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.permafrost') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.drainage.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.drainage.types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Gravity drainage" # "Horton mechanism" # "topmodel-based" # "Dunne mechanism" # "Lateral subsurface flow" # "Baseflow from groundwater" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.vertical_discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.heat_storage') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Force-restore" # "Explicit diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "soil moisture freeze-thaw" # "coupling with snow temperature" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.number_of_snow_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.density') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.water_equivalent') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.heat_content') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.temperature') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.liquid_water_content') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_cover_fractions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "ground snow fraction" # "vegetation snow fraction" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "snow interception" # "snow melting" # "snow freezing" # "blowing snow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_albedo.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "prescribed" # "constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_albedo.functions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation type" # "snow age" # "snow density" # "snow grain type" # "aerosol deposition" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.dynamic_vegetation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation types" # "biome types" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "broadleaf tree" # "needleleaf tree" # "C3 grass" # "C4 grass" # "vegetated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biome_types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "evergreen needleleaf forest" # "evergreen broadleaf forest" # "deciduous needleleaf forest" # "deciduous broadleaf forest" # "mixed forest" # "woodland" # "wooded grassland" # "closed shrubland" # "opne shrubland" # "grassland" # "cropland" # "wetlands" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_time_variation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed (not varying)" # "prescribed (varying from files)" # "dynamical (varying from simulation)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_map') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.interception') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.phenology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic (vegetation map)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.phenology_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.leaf_area_index') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prescribed" # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.leaf_area_index_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biomass') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biomass_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biogeography') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biogeography_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.stomatal_resistance') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "light" # "temperature" # "water availability" # "CO2" # "O3" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.stomatal_resistance_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.number_of_surface_temperatures') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.evaporation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "alpha" # "beta" # "combined" # "Monteith potential evaporation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "transpiration" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.anthropogenic_carbon') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "grand slam protocol" # "residence time" # "decay time" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.forest_stand_dynamics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.photosynthesis.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.autotrophic_respiration.maintainance_respiration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.autotrophic_respiration.growth_respiration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.allocation_bins') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "leaves + stems + roots" # "leaves + stems + roots (leafy + woody)" # "leaves + fine roots + coarse roots + stems" # "whole plant (no distinction)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.allocation_fractions') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed" # "function of vegetation type" # "function of plant allometry" # "explicitly calculated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.phenology.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.mortality.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.is_permafrost_included') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.emitted_greenhouse_gases') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.impact_on_soil_properties') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.grid_inherited_from_land_surface') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.grid_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.number_of_reservoirs') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.water_re_evaporation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "flood plains" # "irrigation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.coupled_to_atmosphere') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.coupled_to_land') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.quantities_exchanged_with_atmosphere') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.basin_flow_direction_map') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "present day" # "adapted for other periods" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.flooding') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.oceanic_discharge.discharge_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "direct (large rivers)" # "diffuse" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.oceanic_discharge.quantities_transported') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.coupling_with_rivers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.quantities_exchanged_with_rivers') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.vertical_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.ice_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.dynamics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "No lake dynamics" # "vertical" # "horizontal" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.dynamic_lake_extent') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.endorheic_basins') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.wetlands.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Description Step7: 1.4. Land Atmosphere Flux Exchanges Step8: 1.5. Atmospheric Coupling Treatment Step9: 1.6. Land Cover Step10: 1.7. Land Cover Change Step11: 1.8. Tiling Step12: 2. Key Properties --&gt; Conservation Properties Step13: 2.2. Water Step14: 2.3. Carbon Step15: 3. Key Properties --&gt; Timestepping Framework Step16: 3.2. Time Step Step17: 3.3. Timestepping Method Step18: 4. Key Properties --&gt; Software Properties Step19: 4.2. Code Version Step20: 4.3. Code Languages Step21: 5. Grid Step22: 6. Grid --&gt; Horizontal Step23: 6.2. Matches Atmosphere Grid Step24: 7. Grid --&gt; Vertical Step25: 7.2. Total Depth Step26: 8. Soil Step27: 8.2. Heat Water Coupling Step28: 8.3. Number Of Soil layers Step29: 8.4. Prognostic Variables Step30: 9. Soil --&gt; Soil Map Step31: 9.2. Structure Step32: 9.3. Texture Step33: 9.4. Organic Matter Step34: 9.5. Albedo Step35: 9.6. Water Table Step36: 9.7. Continuously Varying Soil Depth Step37: 9.8. Soil Depth Step38: 10. Soil --&gt; Snow Free Albedo Step39: 10.2. Functions Step40: 10.3. Direct Diffuse Step41: 10.4. Number Of Wavelength Bands Step42: 11. Soil --&gt; Hydrology Step43: 11.2. Time Step Step44: 11.3. Tiling Step45: 11.4. Vertical Discretisation Step46: 11.5. Number Of Ground Water Layers Step47: 11.6. Lateral Connectivity Step48: 11.7. Method Step49: 12. Soil --&gt; Hydrology --&gt; Freezing Step50: 12.2. Ice Storage Method Step51: 12.3. Permafrost Step52: 13. Soil --&gt; Hydrology --&gt; Drainage Step53: 13.2. Types Step54: 14. Soil --&gt; Heat Treatment Step55: 14.2. Time Step Step56: 14.3. Tiling Step57: 14.4. Vertical Discretisation Step58: 14.5. Heat Storage Step59: 14.6. Processes Step60: 15. Snow Step61: 15.2. Tiling Step62: 15.3. Number Of Snow Layers Step63: 15.4. Density Step64: 15.5. Water Equivalent Step65: 15.6. Heat Content Step66: 15.7. Temperature Step67: 15.8. Liquid Water Content Step68: 15.9. Snow Cover Fractions Step69: 15.10. Processes Step70: 15.11. Prognostic Variables Step71: 16. Snow --&gt; Snow Albedo Step72: 16.2. Functions Step73: 17. Vegetation Step74: 17.2. Time Step Step75: 17.3. Dynamic Vegetation Step76: 17.4. Tiling Step77: 17.5. Vegetation Representation Step78: 17.6. Vegetation Types Step79: 17.7. Biome Types Step80: 17.8. Vegetation Time Variation Step81: 17.9. Vegetation Map Step82: 17.10. Interception Step83: 17.11. Phenology Step84: 17.12. Phenology Description Step85: 17.13. Leaf Area Index Step86: 17.14. Leaf Area Index Description Step87: 17.15. Biomass Step88: 17.16. Biomass Description Step89: 17.17. Biogeography Step90: 17.18. Biogeography Description Step91: 17.19. Stomatal Resistance Step92: 17.20. Stomatal Resistance Description Step93: 17.21. Prognostic Variables Step94: 18. Energy Balance Step95: 18.2. Tiling Step96: 18.3. Number Of Surface Temperatures Step97: 18.4. Evaporation Step98: 18.5. Processes Step99: 19. Carbon Cycle Step100: 19.2. Tiling Step101: 19.3. Time Step Step102: 19.4. Anthropogenic Carbon Step103: 19.5. Prognostic Variables Step104: 20. Carbon Cycle --&gt; Vegetation Step105: 20.2. Carbon Pools Step106: 20.3. Forest Stand Dynamics Step107: 21. Carbon Cycle --&gt; Vegetation --&gt; Photosynthesis Step108: 22. Carbon Cycle --&gt; Vegetation --&gt; Autotrophic Respiration Step109: 22.2. Growth Respiration Step110: 23. Carbon Cycle --&gt; Vegetation --&gt; Allocation Step111: 23.2. Allocation Bins Step112: 23.3. Allocation Fractions Step113: 24. Carbon Cycle --&gt; Vegetation --&gt; Phenology Step114: 25. Carbon Cycle --&gt; Vegetation --&gt; Mortality Step115: 26. Carbon Cycle --&gt; Litter Step116: 26.2. Carbon Pools Step117: 26.3. Decomposition Step118: 26.4. Method Step119: 27. Carbon Cycle --&gt; Soil Step120: 27.2. Carbon Pools Step121: 27.3. Decomposition Step122: 27.4. Method Step123: 28. Carbon Cycle --&gt; Permafrost Carbon Step124: 28.2. Emitted Greenhouse Gases Step125: 28.3. Decomposition Step126: 28.4. Impact On Soil Properties Step127: 29. Nitrogen Cycle Step128: 29.2. Tiling Step129: 29.3. Time Step Step130: 29.4. Prognostic Variables Step131: 30. River Routing Step132: 30.2. Tiling Step133: 30.3. Time Step Step134: 30.4. Grid Inherited From Land Surface Step135: 30.5. Grid Description Step136: 30.6. Number Of Reservoirs Step137: 30.7. Water Re Evaporation Step138: 30.8. Coupled To Atmosphere Step139: 30.9. Coupled To Land Step140: 30.10. Quantities Exchanged With Atmosphere Step141: 30.11. Basin Flow Direction Map Step142: 30.12. Flooding Step143: 30.13. Prognostic Variables Step144: 31. River Routing --&gt; Oceanic Discharge Step145: 31.2. Quantities Transported Step146: 32. Lakes Step147: 32.2. Coupling With Rivers Step148: 32.3. Time Step Step149: 32.4. Quantities Exchanged With Rivers Step150: 32.5. Vertical Grid Step151: 32.6. Prognostic Variables Step152: 33. Lakes --&gt; Method Step153: 33.2. Albedo Step154: 33.3. Dynamics Step155: 33.4. Dynamic Lake Extent Step156: 33.5. Endorheic Basins Step157: 34. Lakes --&gt; Wetlands
9,523
<ASSISTANT_TASK:> Python Code: from matplotlib import pyplot as plt import numpy as np from IPython.display import SVG from IPython.display import display from IPython.html.widgets import interactive, fixed s = <svg width="100" height="100"> <circle cx="50" cy="50" r="20" fill="aquamarine" /> </svg> SVG(s) def draw_circle(width=100, height=100, cx=25, cy=25, r=5, fill='red'): Draw an SVG circle. Parameters ---------- width : int The width of the svg drawing area in px. height : int The height of the svg drawing area in px. cx : int The x position of the center of the circle in px. cy : int The y position of the center of the circle in px. r : int The radius of the circle in px. fill : str The fill color of the circle. circ_image = <svg width="%d" height="%d"> <circle cx="%d" cy="%d" r="%d" fill="%s" /> </svg> %(width,height,cx,cy,r,fill) display(SVG(circ_image)) draw_circle(cx=10, cy=10, r=10, fill='blue') assert True # leave this to grade the draw_circle function w = interactive(draw_circle,width = fixed(300),height = fixed(300),cx = (0,300),cy = (0,300,10),r = (0,50), fill = "red") c = w.children assert c[0].min==0 and c[0].max==300 assert c[1].min==0 and c[1].max==300 assert c[2].min==0 and c[2].max==50 assert c[3].value=='red' display(w) assert True # leave this to grade the display of the widget <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Interact with SVG display Step5: Write a function named draw_circle that draws a circle using SVG. Your function should take the parameters of the circle as function arguments and have defaults as shown. You will have to write the raw SVG code as a Python string and then use the IPython.display.SVG object and IPython.display.display function. Step6: Use interactive to build a user interface for exploing the draw_circle function Step7: Use the display function to show the widgets created by interactive
9,524
<ASSISTANT_TASK:> Python Code: from mdp import * from notebook import psource, pseudocode, plot_pomdp_utility psource(MDP) # Transition Matrix as nested dict. State -> Actions in state -> List of (Probability, State) tuples t = { "A": { "X": [(0.3, "A"), (0.7, "B")], "Y": [(1.0, "A")] }, "B": { "X": {(0.8, "End"), (0.2, "B")}, "Y": {(1.0, "A")} }, "End": {} } init = "A" terminals = ["End"] rewards = { "A": 5, "B": -10, "End": 100 } class CustomMDP(MDP): def __init__(self, init, terminals, transition_matrix, reward = None, gamma=.9): # All possible actions. actlist = [] for state in transition_matrix.keys(): actlist.extend(transition_matrix[state]) actlist = list(set(actlist)) MDP.__init__(self, init, actlist, terminals, transition_matrix, reward, gamma=gamma) def T(self, state, action): if action is None: return [(0.0, state)] else: return self.t[state][action] our_mdp = CustomMDP(init, terminals, t, rewards, gamma=.9) psource(GridMDP) sequential_decision_environment psource(value_iteration) value_iteration(sequential_decision_environment) pseudocode("Value-Iteration") def value_iteration_instru(mdp, iterations=20): U_over_time = [] U1 = {s: 0 for s in mdp.states} R, T, gamma = mdp.R, mdp.T, mdp.gamma for _ in range(iterations): U = U1.copy() for s in mdp.states: U1[s] = R(s) + gamma * max([sum([p * U[s1] for (p, s1) in T(s, a)]) for a in mdp.actions(s)]) U_over_time.append(U) return U_over_time columns = 4 rows = 3 U_over_time = value_iteration_instru(sequential_decision_environment) %matplotlib inline from notebook import make_plot_grid_step_function plot_grid_step = make_plot_grid_step_function(columns, rows, U_over_time) import ipywidgets as widgets from IPython.display import display from notebook import make_visualize iteration_slider = widgets.IntSlider(min=1, max=15, step=1, value=0) w=widgets.interactive(plot_grid_step,iteration=iteration_slider) display(w) visualize_callback = make_visualize(iteration_slider) visualize_button = widgets.ToggleButton(description = "Visualize", value = False) time_select = widgets.ToggleButtons(description='Extra Delay:',options=['0', '0.1', '0.2', '0.5', '0.7', '1.0']) a = widgets.interactive(visualize_callback, Visualize = visualize_button, time_step=time_select) display(a) psource(expected_utility) psource(policy_iteration) psource(policy_evaluation) policy_iteration(sequential_decision_environment) pseudocode('Policy-Iteration') psource(GridMDP.T) psource(GridMDP.to_arrows) psource(GridMDP.to_grid) # Note that this environment is also initialized in mdp.py by default sequential_decision_environment = GridMDP([[-0.04, -0.04, -0.04, +1], [-0.04, None, -0.04, -1], [-0.04, -0.04, -0.04, -0.04]], terminals=[(3, 2), (3, 1)]) pi = best_policy(sequential_decision_environment, value_iteration(sequential_decision_environment, .001)) from utils import print_table print_table(sequential_decision_environment.to_arrows(pi)) sequential_decision_environment = GridMDP([[-0.4, -0.4, -0.4, +1], [-0.4, None, -0.4, -1], [-0.4, -0.4, -0.4, -0.4]], terminals=[(3, 2), (3, 1)]) pi = best_policy(sequential_decision_environment, value_iteration(sequential_decision_environment, .001)) from utils import print_table print_table(sequential_decision_environment.to_arrows(pi)) sequential_decision_environment = GridMDP([[-4, -4, -4, +1], [-4, None, -4, -1], [-4, -4, -4, -4]], terminals=[(3, 2), (3, 1)]) pi = best_policy(sequential_decision_environment, value_iteration(sequential_decision_environment, .001)) from utils import print_table print_table(sequential_decision_environment.to_arrows(pi)) sequential_decision_environment = GridMDP([[4, 4, 4, +1], [4, None, 4, -1], [4, 4, 4, 4]], terminals=[(3, 2), (3, 1)]) pi = best_policy(sequential_decision_environment, value_iteration(sequential_decision_environment, .001)) from utils import print_table print_table(sequential_decision_environment.to_arrows(pi)) psource(POMDP) # transition probability P(s'|s,a) t_prob = [[[0.9, 0.1], [0.1, 0.9]], [[0.1, 0.9], [0.9, 0.1]]] # evidence function P(e|s) e_prob = [[[0.6, 0.4], [0.4, 0.6]], [[0.6, 0.4], [0.4, 0.6]]] # reward function rewards = [[0.0, 0.0], [1.0, 1.0]] # discount factor gamma = 0.95 # actions actions = ('0', '1') # states states = ('0', '1') pomdp = POMDP(actions, t_prob, e_prob, rewards, states, gamma) pseudocode('POMDP-Value-Iteration') psource(pomdp_value_iteration) # transition function P(s'|s,a) t_prob = [[[0.65, 0.35], [0.65, 0.35]], [[0.65, 0.35], [0.65, 0.35]], [[1.0, 0.0], [0.0, 1.0]]] # evidence function P(e|s) e_prob = [[[0.5, 0.5], [0.5, 0.5]], [[0.5, 0.5], [0.5, 0.5]], [[0.8, 0.2], [0.3, 0.7]]] # reward function rewards = [[5, -10], [-20, 5], [-1, -1]] gamma = 0.95 actions = ('0', '1', '2') states = ('0', '1') pomdp = POMDP(actions, t_prob, e_prob, rewards, states, gamma) utility = pomdp_value_iteration(pomdp, epsilon=0.1) %matplotlib inline plot_pomdp_utility(utility) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: CONTENTS Step2: The _init _ method takes in the following parameters Step3: Finally we instantize the class with the parameters for our MDP in the picture. Step4: With this we have successfully represented our MDP. Later we will look at ways to solve this MDP. Step5: The _init _ method takes grid as an extra parameter compared to the MDP class. The grid is a nested list of rewards in states. Step6: VALUE ITERATION Step7: It takes as inputs two parameters, an MDP to solve and epsilon, the maximum error allowed in the utility of any state. It returns a dictionary containing utilities where the keys are the states and values represent utilities. <br> Value Iteration starts with arbitrary initial values for the utilities, calculates the right side of the Bellman equation and plugs it into the left hand side, thereby updating the utility of each state from the utilities of its neighbors. Step8: The pseudocode for the algorithm Step9: AIMA3e Step10: Next, we define a function to create the visualisation from the utilities returned by value_iteration_instru. The reader need not concern himself with the code that immediately follows as it is the usage of Matplotib with IPython Widgets. If you are interested in reading more about these visit ipywidgets.readthedocs.io Step11: Move the slider above to observe how the utility changes across iterations. It is also possible to move the slider using arrow keys or to jump to the value by directly editing the number with a double click. The Visualize Button will automatically animate the slider for you. The Extra Delay Box allows you to set time delay in seconds upto one second for each time step. There is also an interactive editor for grid-world problems grid_mdp.py in the gui folder for you to play around with. Step12: <br>Fortunately, it is not necessary to do exact policy evaluation. Step13: Let us now solve sequential_decision_environment using policy_iteration. Step14: AIMA3e Step15: To completely define our task environment, we need to specify the utility function for the agent. Step16: This method directly encodes the actions that the agent can take (described above) to characters representing arrows and shows it in a grid format for human visalization purposes. Step17: Now that we have all the tools required and a good understanding of the agent and the environment, we consider some cases and see how the agent should behave for each case. Step18: We will use the best_policy function to find the best policy for this environment. Step19: We can now use the to_arrows method to see how our agent should pick its actions in the environment. Step20: This is exactly the output we expected Step21: This is exactly the output we expected Step22: This is exactly the output we expected Step23: In this case, the output we expect is Step24: The POMDP class includes all variables of the MDP class and additionally also stores the sensor model in e_prob. Step25: We have defined our POMDP object. Step26: Let's have a look at the pomdp_value_iteration function. Step27: This function uses two aptly named helper methods from the POMDP class, remove_dominated_plans and max_difference. Step28: We have defined the POMDP object.
9,525
<ASSISTANT_TASK:> Python Code: name = "your-project-name" apikey = "your-api-key" # profile.materialsproject.org from mpcontribs.client import Client from mp_api.matproj import MPRester from refractivesqlite import dboperations as DB from pandas import DataFrame db = DB.Database("refractive.db") #db.create_database_from_url() db.search_pages("Au", exact=True) materials = db.search_custom( 'select * from pages where book="Au" and hasrefractive=1 and hasextinction=1' ) page_id = materials[0][0] mat = db.get_material(page_id) mpr = MPRester(apikey) def get_contrib(mat): info = mat.get_page_info() formula = info["book"] mpid = mpr.get_materials_ids(formula)[0] rmin, rmax = info['rangeMin']*1000, info['rangeMax']*1000 mid = (rmin + rmax) / 2 n = mat.get_refractiveindex(mid) k = mat.get_extinctioncoefficient(mid) x = "wavelength λ [μm]" refrac = DataFrame(mat.get_complete_refractive(), columns=[x, "n"]) refrac.set_index(x, inplace=True) extinct = DataFrame(mat.get_complete_extinction(), columns=[x, "k"]) extinct.set_index(x, inplace=True) df = refrac.join(extinct["k"]) df.attrs["title"] = f"Complex refractive index (n+ik) for {formula}" df.attrs["labels"] = { "value": "n, k", # y-axis label "variable": "Re/Im" # legend name (= df.columns.name) } df.plot(**df.attrs)#.show() df.attrs["name"] = "n,k(λ)" return { "project": name, "identifier": str(mpid), "data": { "n": float(n), "k": float(k), "range.min": f"{rmin} nm", "range.mid": f"{mid} nm", "range.max": f"{rmax} nm", "points": info["points"], "page": info["page"] }, "tables": [df] } contrib = get_contrib(mat) client = Client( host="workshop-contribs-api.materialsproject.org", apikey=apikey ) db.check_url_version() update = { 'unique_identifiers': False, 'references': [ {'label': 'website', 'url': 'https://refractiveindex.info'}, {'label': 'source', 'url': "https://refractiveindex.info/download/database/rii-database-2019-02-11.zip"} ], "other": { # describe the root fields here to automatically include tooltips on MP "n": "real part of complex refractive index", "k": "imaginary part of complex refractive index", "range": "wavelength range for n,k in nm", "points": "number of λ points in range", "page": "reference to data source/publication" } } # could also update authors, title, long_title, description client.projects.update_entry(pk=name, project=update).result() client.init_columns(name, { "n": "", # dimensionless "k": "", "range.min": "nm", "range.mid": "nm", "range.max": "nm", "points": "", "page": None # text }) client.submit_contributions([contrib]) contributions = [] for material in materials: page_id = material[0] mat = db.get_material(page_id) contrib = get_contrib(mat) contributions.append(contrib) contributions[10] client.delete_contributions(name) client.submit_contributions(contributions, ignore_dupes=True) client.make_public(name) all_ids = client.get_all_ids( {"project": name}, include=["tables"], data_id_fields={name: "page"}, fmt="map" ) tid = all_ids[name]["mp-81"]["Johnson"]["tables"]["n,k(λ)"]["id"] client.get_table(tid).display() query = { "project": name, "formula__contains": "Au", #"identifier__in": [] "data__n__value__lt": 200, "data__k__value__gte": 7, "_sort": "-data__range__mid__value", "_fields": [ "id", "identifier", "formula", "data.range.mid.value", "data.n.value", "data.k.value" ] } print(client.get_totals(query)) client.contributions.get_entries(**query).result() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Contribute data on Refractive Index Step2: Explore and extract refractive index data Step3: Prepare a single contribution for testing Step4: Retrieve and update project info Step5: Try searching for refractive in MPContribs browse page now Step6: Submit test contribution Step7: Your first contribution should now show up in your project on https Step8: Publish contributions Step9: Retrieve and query contributions Step10: Grab the table ID and retrieve it as Pandas DataFrame. Show a graph. Step11: Finally, let's build up a more complicated query to reduce the list of contributions to the ones we might be interested in.
9,526
<ASSISTANT_TASK:> Python Code: import numpy as np import scipy.misc def mosaic(f,N,s=1.0): f = np.asarray(f) d,h,w = f.shape N = int(N) nLines = int(np.ceil(float(d)/N)) nCells = int(nLines*N) # Add black slices to match the exact number of mosaic cells fullf = np.resize(f, (nCells,h,w)) fullf[d:nCells,:,:] = 0 Y,X = np.indices((nLines*h,N*w)) Pts = np.array([ (np.floor(Y/h)*N + np.floor(X/w)).ravel(), np.mod(Y,h).ravel(), np.mod(X,w).ravel() ]).astype(int).reshape((3,int(nLines*h),int(N*w))) g = fullf[Pts[0],Pts[1],Pts[2]] if (s != 1.0): #g = scipy.ndimage.interpolation.zoom(g,s,order=5) g = scipy.misc.imresize(g,s,interp='bilinear') return g testing = (__name__ == "__main__") if testing: ! jupyter nbconvert --to python mosaic.ipynb import sys import os import numpy as np ia898path = os.path.abspath('../../') if ia898path not in sys.path: sys.path.append(ia898path) import ia898.src as ia if testing: t = np.arange(60) t.shape = (5,3,4) print('Original 3D image:\n', t, '\n\n') for i in range(1,7): g = ia.mosaic(t,i) print('Mosaic with %d image column(s):\n' % i) print(g) print() for i in range(1,7): g = ia.mosaic(t,i,0.8) print('Mosaic with %d image column(s):\n' % i) print(g) print() if testing: d,r,c = np.indices((5,3,4)) t = ((r + c)%2) >0 for i in range(1,7): g = ia.mosaic(t,i,0.8) print('Mosaic with %d image column(s):\n' % i) print(g) print() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Examples Step2: Example 1 Step3: Example 2
9,527
<ASSISTANT_TASK:> Python Code: import numpy as np import sympy as sy sy.init_printing(use_latex='mathjax', order='lex') h,omega0 = sy.symbols('h,omega0', real=True, positive=True) z = sy.symbols('z') beta = sy.cos(omega0*h) Phi = sy.Matrix([[2*beta, 1],[-1, 0]]) Gamma = sy.Matrix([[1-beta],[1-beta]]) C = sy.Matrix([[1, 0]]) H = sy.simplify(C*(z*sy.eye(2)-Phi).inv()*Gamma) H omegaval = 0.5 hval = np.pi/6/omegaval Phi_np = np.array(Phi.subs({h:hval, omega0:omegaval})).astype(np.float64) Phi_np Gamma_np = np.array(Gamma.subs({h:hval, omega0:omegaval})).astype(np.float64) Gamma_np C_n = np.array(C).astype(np.float64) Wo_n = np.vstack((C_n, np.dot(C_n,Phi_np))) Wo_n np.linalg.det(Wo_n) k1,k2 = sy.symbols('k1,k2') K = sy.Matrix([[k1], [k2]]) Phi_o=Phi.subs({h:hval, omega0:omegaval}) - K*C Phi_o z = sy.symbols('z') zIminPhio = z*sy.eye(2) - Phi_o ch_poly = sy.Poly(zIminPhio.det(), z) ch_poly.as_expr() po = sy.symbols('p_o') K = sy.Matrix([[Phi[0,0]-2*po],[Phi[1,0]+po**2]]) K Phi_o = Phi - K*C Phi_o Phi_o.eigenvals() Wc = sy.BlockMatrix([[Gamma, Phi*Gamma]]).as_explicit() Wc Wc.det() Wc.det().subs({h:hval, omega0:omegaval}) l1,l2 = sy.symbols('l1,l2') L = sy.Matrix([[l1, l2]]) Phi_c=Phi.subs({h:hval, omega0:omegaval}) - Gamma.subs({h:hval, omega0:omegaval})*L Phi_c zIminPhic = z*sy.eye(2) - Phi_c zIminPhic ch_poly = sy.Poly(zIminPhic.det(), z) ch_poly.as_expr() p = sy.symbols('p') des_ch_poly = sy.Poly((z-p)**2, z) dioph_eqn = ch_poly - des_ch_poly sol = sy.solve(dioph_eqn.coeffs(), (l1,l2)) sol l0 = (1-p)**2/(2*(1-beta)) # We have assumed b=1 all along <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Choosing the sampling ratio $h$ Step2: Obervability Step3: Observer design Step4: The characteristic polynomial of the observer is given by Step5: Desired observer poles Step6: Reachability Step7: State feedback Step8: The characteristic polynomial of the closed-loop system is given by Step9: Desired closed-loop characteristic polynomial Step10: Determining $l_0$
9,528
<ASSISTANT_TASK:> Python Code: !nib-ls /data/ds102/sub-01/*/*.nii.gz %pylab inline from os.path import join as opj from nipype.interfaces.fsl import MCFLIRT, FLIRT from nipype.interfaces.afni import Resample from nipype.interfaces.spm import Smooth from nipype.interfaces.utility import IdentityInterface from nipype.interfaces.io import SelectFiles, DataSink from nipype.pipeline.engine import Workflow, Node experiment_dir = '/output' output_dir = 'datasink' working_dir = 'workingdir' # list of subject identifiers subject_list = ['sub-01', 'sub-02', 'sub-03', 'sub-04', 'sub-05'] # list of session identifiers session_list = ['run-1', 'run-2'] # Smoothing widths to apply fwhm = [4, 8] # MCFLIRT - motion correction mcflirt = Node(MCFLIRT(mean_vol=True, save_plots=True, output_type='NIFTI'), name="mcflirt") # Resample - resample anatomy to 3x3x3 voxel resolution resample = Node(Resample(voxel_size=(3, 3, 3), outputtype='NIFTI'), name="resample") # FLIRT - coregister functional images to anatomical images coreg_step1 = Node(FLIRT(output_type='NIFTI'), name="coreg_step1") coreg_step2 = Node(FLIRT(output_type='NIFTI', apply_xfm=True), name="coreg_step2") # Smooth - image smoothing smooth = Node(Smooth(), name="smooth") smooth.iterables = ("fwhm", fwhm) # Infosource - a function free node to iterate over the list of subject names infosource = Node(IdentityInterface(fields=['subject_id', 'session_id']), name="infosource") infosource.iterables = [('subject_id', subject_list), ('session_id', session_list)] # SelectFiles - to grab the data (alternativ to DataGrabber) anat_file = opj('{subject_id}', 'anat', '{subject_id}_T1w.nii.gz') func_file = opj('{subject_id}', 'func', '{subject_id}_task-flanker_{session_id}_bold.nii.gz') templates = {'anat': anat_file, 'func': func_file} selectfiles = Node(SelectFiles(templates, base_directory='/data/ds102'), name="selectfiles") # Datasink - creates output folder for important outputs datasink = Node(DataSink(base_directory=experiment_dir, container=output_dir), name="datasink") # Use the following DataSink output substitutions substitutions = [('_subject_id', ''), ('_session_id_', ''), ('_task-flanker', ''), ('_mcf.nii_mean_reg', '_mean'), ('.nii.par', '.par'), ] subjFolders = [('%s_%s/' % (sess, sub), '%s/%s' % (sub, sess)) for sess in session_list for sub in subject_list] subjFolders += [('%s_%s' % (sub, sess), '') for sess in session_list for sub in subject_list] subjFolders += [('%s%s_' % (sess, sub), '') for sess in session_list for sub in subject_list] substitutions.extend(subjFolders) datasink.inputs.substitutions = substitutions # Create a preprocessing workflow preproc = Workflow(name='preproc') preproc.base_dir = opj(experiment_dir, working_dir) # Connect all components of the preprocessing workflow preproc.connect([(infosource, selectfiles, [('subject_id', 'subject_id'), ('session_id', 'session_id')]), (selectfiles, mcflirt, [('func', 'in_file')]), (selectfiles, resample, [('anat', 'in_file')]), (mcflirt, coreg_step1, [('mean_img', 'in_file')]), (resample, coreg_step1, [('out_file', 'reference')]), (mcflirt, coreg_step2, [('out_file', 'in_file')]), (resample, coreg_step2, [('out_file', 'reference')]), (coreg_step1, coreg_step2, [('out_matrix_file', 'in_matrix_file')]), (coreg_step2, smooth, [('out_file', 'in_files')]), (mcflirt, datasink, [('par_file', 'preproc.@par')]), (resample, datasink, [('out_file', 'preproc.@resample')]), (coreg_step1, datasink, [('out_file', 'preproc.@coregmean')]), (smooth, datasink, [('smoothed_files', 'preproc.@smooth')]), ]) # Create preproc output graph preproc.write_graph(graph2use='colored', format='png', simple_form=True) # Visualize the graph from IPython.display import Image Image(filename=opj(preproc.base_dir, 'preproc', 'graph.dot.png')) # Visualize the detailed graph preproc.write_graph(graph2use='flat', format='png', simple_form=True) Image(filename=opj(preproc.base_dir, 'preproc', 'graph_detailed.dot.png')) preproc.run('MultiProc', plugin_args={'n_procs': 4}) !tree /output/datasink/preproc/sub-01/ preproc.run('MultiProc', plugin_args={'n_procs': 4}) from nilearn import image, plotting plotting.plot_epi( '/output/datasink/preproc/sub-01/run-1_bold_mean_flirt.nii', title="fwhm = 0mm", display_mode='ortho', annotate=False, draw_cross=False, cmap='gray') mean_img = image.mean_img('/output/datasink/preproc/sub-01/run-1_fwhm_4/s_bold_mcf_flirt.nii') plotting.plot_epi(mean_img, title="fwhm = 4mm", display_mode='ortho', annotate=False, draw_cross=False, cmap='gray') mean_img = image.mean_img('/output/datasink/preproc/sub-01/run-1_fwhm_8/s_bold_mcf_flirt.nii') plotting.plot_epi(mean_img, title="fwhm = 8mm", display_mode='ortho', annotate=False, draw_cross=False, cmap='gray') par = np.loadtxt('/output/datasink/preproc/sub-01/run-1_bold_mcf.par') fig, axes = plt.subplots(2, 1, figsize=(15, 5)) axes[0].set_ylabel('rotation (radians)') axes[0].plot(par[0:, :3]) axes[1].plot(par[0:, 3:]) axes[1].set_xlabel('time (TR)') axes[1].set_ylabel('translation (mm)') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: So, let's start! Step2: Experiment parameters Step3: Specify Nodes Step4: Specify input & output stream Step5: Specify Workflow Step6: Visualize the workflow Step7: Run the Workflow Step8: Inspect output Step9: Visualize results Step10: How do the motion parameters look like?
9,529
<ASSISTANT_TASK:> Python Code: # Primero tenemos que importar las librerias que usaremos para recopilar datos import base64 import json import requests # Si queremos imprimir los json de respuesta # de una forma mas agradable a la vista podemos usar def print_pretty(jsonstring, indent=4, sort_keys=False): print(json.dumps(jsonstring, indent=indent, sort_keys=sort_keys)) # Importamos nuestras credenciales with open("credentials") as f: credentials = tuple(f.read().splitlines()) # Constantes que usaremos OWNER = "IIC2233-2016-1" REPO = "syllabus" url = "https://api.github.com/repos/{}/{}/issues".format(OWNER, REPO) params = { "state": "closed", "sort": "created", "direction": "asc", "page": 1 } req = requests.get(url, params=params, auth=credentials) print(req.status_code) # Para obtener el json asociado: req.json() # Pero queremos imprimirlo de una manera mas legible for issue in req.json(): print(issue["number"], issue["title"]) # Si esta fuese la ultima pagina no existiria `rel="next"` print(dict(req.headers)["Link"]) print("¿Es la ultima pagina? {}".format("No" if 'rel="next"' in dict(req.headers)["Link"] else "Si")) class Issue: def __init__(self, number, title, labels): self.number = number self.title = title self.labels = labels def labels(labels_json): return [label_item["name"] for label_item in labels_json] ISSUES_LIST = list() url = "https://api.github.com/repos/{}/{}/issues".format(OWNER, REPO) params = { "state": "closed", "sort": "created", "direction": "asc", "page": 1 } # Primera pagina req = requests.get(url, params=params, auth=credentials) for issue in req.json(): ISSUES_LIST.append(Issue(issue["number"], issue["title"], labels(issue["labels"]))) # Paginas siguientes while 'rel="next"' in dict(req.headers)["Link"]: print("Page: {} ready".format(params["page"])) params["page"] += 1 req = requests.get(url, params=params, auth=credentials) for issue in req.json(): ISSUES_LIST.append(Issue(issue["number"], issue["title"], labels(issue["labels"]))) print("Tenemos {} issues en la lista".format(len(ISSUES_LIST))) LABELS = list(label for issue in ISSUES_LIST for label in issue.labels) print(set(LABELS)) %matplotlib inline # Cantidad de issues por label LABEL_ISSUES = {label: LABELS.count(label) for label in LABELS} # Imprimiendo de mayor a menor numero de issues... print("Top {}".format(min(5, len(LABEL_ISSUES)))) for v, k in sorted(((v,k) for k,v in LABEL_ISSUES.items()), reverse=True)[:min(5, len(LABEL_ISSUES))]: print("{}: {}".format(k, v)) # Todos los pares de labels from itertools import combinations LABEL_PAIRS = dict() PAIRS = list() for issue in ISSUES_LIST: combs = combinations(issue.labels, 2) for pair in combs: k = "{} + {}".format(*pair) if k not in LABEL_PAIRS: LABEL_PAIRS[k] = 0 PAIRS.append(pair) LABEL_PAIRS[k] += 1 # Imprimiendo de mayor a menor numero de issues print("Top {}".format(min(5, len(LABEL_PAIRS)))) for v, k in sorted(((v,k) for k,v in LABEL_PAIRS.items()), reverse=True)[:min(5, len(LABEL_PAIRS))]: print("{}: {}".format(k, v)) from pylab import rcParams rcParams['figure.figsize'] = 8, 8 import matplotlib.pylab as plt import networkx as nx # Crear grafo G = nx.Graph() # Max peso mp = LABEL_PAIRS[max(LABEL_PAIRS, key=LABEL_PAIRS.get)] # Crear nodos G.add_nodes_from(LABEL_ISSUES.keys()) # Crear arcos for o_pair in LABEL_PAIRS.keys(): pair = o_pair.split(' + ') G.add_edge(*pair, weight=mp-LABEL_PAIRS[o_pair], width=mp-LABEL_PAIRS[o_pair]) # Asignar color n_colors = list() for node in G.nodes(): color = 'white' if 'Tarea' in node: color = 'blue' elif node in ['Tengo un error', 'Setup']: color = 'purple' elif node in ['Actividades', 'Ayudantía', 'Ayudantia', 'Interrogación', 'Interrogacion', 'Materia', 'Material']: color = 'green' elif node in ['Código', 'Codigo', 'Git']: color = 'yellow' elif node in ['Duplicada', 'Invalida']: color = 'grey' elif node in ['IMPORTANTE']: color = 'red' n_colors.append(color) # Asignar tamaños de nodos sizes = list() for node in G.nodes(): sizes.append(20 * LABEL_ISSUES[node]) # Asignar grosores de aarcos average = round(sum(LABEL_PAIRS.values()) / (0.75 * len(LABEL_PAIRS))) styles = list() widths = list() for edge in G.edges(): k = "{} + {}".format(edge[0], edge[1]) if k not in LABEL_PAIRS: k = "{} + {}".format(edge[1], edge[0]) if LABEL_PAIRS[k] < average: styles.append('dashed') widths.append(LABEL_PAIRS[k] + average) else: styles.append('solid') widths.append(LABEL_PAIRS[k] + 1) # Colores de arcos e_colors = list(i + 10 for i in range(len(G.edges()))) # Desplegar graficos nx.draw(G, edge_color=e_colors, edge_cmap=plt.cm.Blues, node_color=n_colors, node_size=sizes, style=styles, width=widths, with_labels=True) nx.draw_circular(G, edge_color=e_colors, edge_cmap=plt.cm.Blues, node_color=n_colors, node_size=sizes, style=styles, width=widths, with_labels=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Antes que todo, debemos preguntarnos Step2: Como podemos notar, es posible que tengamos más de una página de issues, por lo que tendremos que acceder al header y obtener la url a la siguiente página, repitiendo la operación hasta llegar a la última. Para facilitar esto, podemos agregar el parametro page a la url indicando el número de la página que queremos. ¿Cómo sabremos cuándo detenernos? Cuando en el header, en Link, no exista una url a la siguiente página ("next") Step3: Guardemos la información que nos interesa en objetos de una clase Issue, extraeremos los nombres de las labels con la funcion labels y guardaremos a estos objetos en una lista llamada ISSUES_LIST Step4: Pediremos todas las issues e iremos guardando los objetos correspondientes Step5: Ya tenemos nuestra lista de issues. Ahora, veamos cuales son las labels que se han usado Step6: Empecemos con los gráficos. Para esto usaremos matplotlib Step7: Vamos a desplegar un grafo donde cada nodo es un label y cada arista representa las uniones de labels (cuando una issue tiene más de un label). El tamaño de los nodos dependerá de la cantidad de issues etiquetadas con aquel label y el grosor de las aristas dependerá de la cantidad de issues en la que ambos labels estuvieron. Si en alguna issue hubo mas de dos etiquetas, consideraremos los pares de labels y no un conjunto. Step8: Para la siguiente sección usaremos nextworkx para graficar la red de nodos
9,530
<ASSISTANT_TASK:> Python Code: # Inportant Packages import pandas as pd import matplotlib.pyplot as plt import sys import datetime as dt print('Python version is:', sys.version) print('Pandas version:', pd.__version__) print('Date:', dt.date.today()) path = 'C:\\Users\\emeka_000\\Desktop\\Bootcamp_Emeka.xlsx' odata = pd.read_excel(path, usecols = ['Series Name','2000 [YR2000]', '2001 [YR2001]', '2002 [YR2002]', '2003 [YR2003]', '2004 [YR2004]', '2005 [YR2005]', '2006 [YR2006]', '2007 [YR2007]', '2008 [YR2008]', '2009 [YR2009]', '2010 [YR2010]', '2011 [YR2011]', '2012 [YR2012]'] ) #retained only the necessary columns odata.columns = ['Metric', '2000', '2001', '2002', '2003', '2004', '2005', '2006', '2007', '2008', '2009', '2010', '2011', '2012'] #easier column names odata = odata.drop([20, 21, 22, 23, 24]) ##delete NaN values odata = odata.transpose() #transpose to make diagram easier odata #data with metrics description for the chart below data = pd.read_excel(path, usecols = ['2000 [YR2000]', '2001 [YR2001]', '2002 [YR2002]', '2003 [YR2003]', '2004 [YR2004]', '2005 [YR2005]', '2006 [YR2006]', '2007 [YR2007]', '2008 [YR2008]', '2009 [YR2009]', '2010 [YR2010]', '2011 [YR2011]', '2012 [YR2012]'] ) #same data but modified for pandas edits data.columns = ['2000', '2001', '2002', '2003', '2004', '2005', '2006', '2007', '2008', '2009', '2010', '2011', '2012'] #all columns are now string data = data.transpose() #data used for the rest of the project data[4].plot(kind = 'line', #line plot title = 'Brazil Yearly GDP (2000-2012) (current US$)', #title fontsize=15, color='Green', linewidth=4, #width of plot line figsize=(20,5),).title.set_size(20) #set figure size and title size plt.xlabel("Year").set_size(15) plt.ylabel("GDP (current US$) * 1e12").set_size(15) #set x and y axis, with their sizes data[6].plot(kind = 'line', title = 'Brazil Yearly GDP Per Capita (2000-2012) (current US$)', fontsize=15, color='blue', linewidth=4, figsize=(20,5)).title.set_size(20) plt.xlabel("Year").set_size(15) plt.ylabel("GDP per capita (current US$)").set_size(15) data[5].plot(kind = 'line', title = 'Brazil Yearly GDP Growth (2000-2012) (%)', fontsize=15, color='red', linewidth=4, figsize=(20,5)).title.set_size(20) plt.xlabel("Year").set_size(15) plt.ylabel("GDP Growth (%)").set_size(15) fig, ax1 = plt.subplots(figsize = (20,5)) y1 = data[8] y2 = data[4] ax2 = ax1.twinx() ax1.plot(y1, 'green') #household consumption ax2.plot(y2, 'blue') #GDP growth plt.title("Household Consumption (% of GDP) vs. GDP").set_size(20) fig, ax1 = plt.subplots(figsize = (20, 5)) y1 = data[11] y2 = data[4] ax2 = ax1.twinx() ax1.plot(y1, 'red') #Net official development assistance ax2.plot(y2, 'blue') #GDP growth plt.title("Foreign Aid vs. GDP").set_size(20) fig, ax1 = plt.subplots(figsize = (20, 5)) y1 = data[2] y2 = data[4] ax2 = ax1.twinx() ax1.plot(y1, 'yellow') #household consumption ax2.plot(y2, 'blue') #GDP growth plt.title("Foreign Direct Investment (Inflows) (% of GDP) vs. GDP").set_size(20) fig, ax1 = plt.subplots(figsize = (20, 5)) y1 = data[14] y2 = data[4] ax2 = ax1.twinx() ax1.plot(y1, 'purple') #household consumption ax2.plot(y2, 'blue') #GDP growth plt.title("Government Spending vs. GDP").set_size(20) data.plot.scatter(x = 5, y = 0, title = 'Population Growth vs. GDP Growth', figsize=(20,5)).title.set_size(20) plt.xlabel("GDP Growth Rate").set_size(15) plt.ylabel("Population Growth Rate").set_size(15) data.plot.scatter(x = 6, y = 0, title = 'Population Growth vs. GDP per Capita', figsize=(20,5)).title.set_size(20) plt.xlabel("GDP per Capita").set_size(15) plt.ylabel("Population Growth Rate").set_size(15) data[15].plot(kind = 'bar', title = 'Renewable energy consumption (% of total) (2000-2012)', fontsize=15, color='green', linewidth=4, figsize=(20,5)).title.set_size(20) data[12].plot(kind = 'bar', title = 'CO2 emissions from liquid fuel consumption (2000-2012)', fontsize=15, color='red', linewidth=4, figsize=(20,5)).title.set_size(20) data[13].plot(kind = 'bar', title = 'CO2 emissions from gaseous fuel consumption (2000-2012)', fontsize=15, color='blue', linewidth=4, figsize=(20,5)).title.set_size(20) data.plot.scatter(x = 7, y = 19, #scatter plot title = 'Health Expenditures vs. Life Expectancy', figsize=(20,5)).title.set_size(20) plt.xlabel("Health Expenditures").set_size(15) plt.ylabel("Life Expectancy").set_size(15) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Reading in and Cleaning up the Data Step2: GDP Growth and GDP Growth Rate in Brazil Step3: GDP Growth vs. GDP Growth Rate Step4: Actual Step5: Actual Step6: Actual Step7: Actual Step8: Actual Step9: Population Growth Step10: Actual
9,531
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np import Bio.Blast.NCBIXML from cStringIO import StringIO from __future__ import print_function # convert RDP-style lineage to Greengenes-style lineage def rdp_lineage_to_gg(lineage): d = {} linlist = lineage.split(';') for i in np.arange(0, len(linlist), 2): d[linlist[i+1]] = linlist[i] linstr = '' for level in ['domain', 'kingdom', 'phylum', 'class', 'order', 'family', 'genus']: try: linstr += level[0] + '__' + d[level].replace('"', '') + '; ' except: linstr += level[0] + '__' + '; ' linstr = linstr[:-2] return(linstr) # parse blast xml record def parse_record_alignments_taxonomy(record): df = pd.DataFrame(columns=('strain', 'lineage')) for alignment in record.alignments: strain, lineage = alignment.hit_def.split(' ') linstr = rdp_lineage_to_gg(lineage) df = df.append({'strain': strain, 'lineage': linstr}, ignore_index=True) df['species'] = [(x.split(' ')[0] + ' ' + x.split(' ')[1]).replace(';', '') for x in df.strain] num_hits = df.shape[0] vc_species = df.species.value_counts() vc_lineage = df.lineage.value_counts() return(num_hits, vc_species, vc_lineage) # main function def xml_to_taxonomy(path_xml, path_output): # read file as single string, generate handle, and parse xml handle to records generator with open(path_xml) as file: str_xml = file.read() handle_xml = StringIO(str_xml) records = Bio.Blast.NCBIXML.parse(handle_xml) # write top lineage and top 3 strains for each query with open(path_output, 'w') as target: # write header target.write('query\tlineage_count\tspecies_1st_count\tspecies_2nd_count\tspecies_3rd_count\n') # iterate over records generator for record in records: target.write('%s' % record.query) try: num_hits, vc_species, vc_lineage = parse_record_alignments_taxonomy(record) except: pass try: target.write('\t%s (%s/%s)' % (vc_lineage.index[0], vc_lineage[0], num_hits)) except: pass try: target.write('\t%s (%s/%s)' % (vc_species.index[0], vc_species[0], num_hits)) except: pass try: target.write('\t%s (%s/%s)' % (vc_species.index[1], vc_species[1], num_hits)) except: pass try: target.write('\t%s (%s/%s)' % (vc_species.index[2], vc_species[2], num_hits)) except: pass target.write('\n') path_xml = '../../data/sequence-lookup/rdp-taxonomy/otu_seqs_top_500_prev.emp_deblur_90bp.subset_2k.rare_5000.xml' path_output = 'otu_seqs_top_500_prev.emp_deblur_90bp.subset_2k.rare_5000.tsv' xml_to_taxonomy(path_xml, path_output) path_xml = '../../data/sequence-lookup/rdp-taxonomy/otu_seqs_top_500_prev.emp_deblur_100bp.subset_2k.rare_5000.xml' path_output = 'otu_seqs_top_500_prev.emp_deblur_100bp.subset_2k.rare_5000.tsv' xml_to_taxonomy(path_xml, path_output) path_xml = '../../data/sequence-lookup/rdp-taxonomy/otu_seqs_top_500_prev.emp_deblur_150bp.subset_2k.rare_5000.xml' path_output = 'otu_seqs_top_500_prev.emp_deblur_150bp.subset_2k.rare_5000.tsv' xml_to_taxonomy(path_xml, path_output) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Run for 90-bp sequences (top 500 by prevalence in 90-bp biom table) Step2: Run for 100-bp sequences (top 500 by prevalence in 100-bp biom table) Step3: Run for 150-bp sequences (top 500 by prevalence in 150-bp biom table)
9,532
<ASSISTANT_TASK:> Python Code: from sklearn.datasets import make_classification from sklearn.linear_model import LogisticRegression from sklearn.cross_validation import train_test_split X, y = make_classification(random_state=0) X_train, X_test, y_train, y_test = train_test_split(X, y, random_state=0) lr = LogisticRegression().fit(X_train, y_train) print("predictions: %s" % lr.predict(X_test)) print("accuracy: %.2f" % lr.score(X_test, y_test)) %matplotlib inline from plot_forest import plot_forest_interactive plot_forest_interactive() X = [{'age': 15.9, 'likes puppies': 'yes', 'location': 'Tokyo'}, {'age': 21.5, 'likes puppies': 'no', 'location': 'New York'}, {'age': 31.3, 'likes puppies': 'no', 'location': 'Paris'}, {'age': 25.1, 'likes puppies': 'yes', 'location': 'New York'}, {'age': 63.6, 'likes puppies': 'no', 'location': 'Tokyo'}, {'age': 14.4, 'likes puppies': 'yes', 'location': 'Tokyo'}] from sklearn.feature_extraction import DictVectorizer vect = DictVectorizer(sparse=False).fit(X) print(vect.transform(X)) print("feature names: %s" % vect.get_feature_names()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Grid-Search and Cross-Validation Step2: Processing Pipelines
9,533
<ASSISTANT_TASK:> Python Code: powers = (lambda x: pow(x, n) for n in range(-4,5)) phi = (1 + pow(5,0.5)) * 0.5 # golden proportion for n, f in enumerate(powers, start=-4): # iterates through lambda expressions print("phi ** {:2} == {:10.8f}".format(n, f(phi))) class Any: def __init__(self): self.__dict__ = {0:'scissors', 1:'paper', 2:'rock'} def __getitem__(self, n): # enough for iter() to go on if n == len(self.__dict__): raise StopIteration # tells for loop when to stop return self.__dict__[n] for thing in Any(): print(thing) import pprint def primes(): generate successive prime numbers (trial by division) candidate = 1 _primes_so_far = [2] # first prime, only even prime yield _primes_so_far[0] # share it! while True: candidate += 2 # check odds only from now on for prev in _primes_so_far: if prev**2 > candidate: yield candidate # new prime! _primes_so_far.append(candidate) break if not divmod(candidate, prev)[1]: # no remainder! break # done looping p = primes() # generator function based iterator pp = pprint.PrettyPrinter(width=40, compact=True) pp.pprint([next(p) for _ in range(50)]) # next 30 primes please! class Primes: def __init__(self): self.candidate = 1 self._primes_so_far = [2] # first prime, only even prime def __iter__(self): return self def __next__(self): while True: self.candidate += 2 # check odds only from now on for prev in self._primes_so_far: if prev**2 > self.candidate: self._primes_so_far.append(self.candidate) return self._primes_so_far[-2] if not divmod(self.candidate, prev)[1]: # no remainder! break pp = pprint.PrettyPrinter(width=40, compact=True) p = Primes() # class based iterator pp.pprint([next(p) for _ in range(30)]) # n from itertools import islice p = Primes() for n in islice(p, 0, 20): print(n, end=", ") # -*- coding: utf-8 -*- Created on Thu Oct 13 13:48:52 2016 @author: Kirby Urner David Beazley: https://youtu.be/Z_OAlIhXziw?t=23m42s Trial by division, but this time the primes coroutine acts more as a filter, passing qualified candidates through to print_me, which writes to a file. import pprint def coroutine(func): Advances decorated generator function to the first yield def start(*args, **kwargs): cr = func(*args, **kwargs) cr.send(None) # or next(cr) or cr.__next__() return cr return start @coroutine def print_me(file_name): with open(file_name, 'w') as file_obj: while True: to_print = (yield) file_obj.write(str(to_print)+"\n") @coroutine def primes(target): _primes_so_far = [2] target.send(2) while True: candidate = (yield) for prev in _primes_so_far: if not divmod(candidate, prev)[1]: break if prev**2 > candidate: _primes_so_far.append(candidate) target.send(candidate) break output = print_me("primes.txt") p = primes(output) for x in range(3, 200, 2): # test odds 3-199 p.send(x) with open("primes.txt", 'r') as file_obj: print(", ".join(file_obj.read().split("\n"))[:-2]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Any object expecting to be the target of a for loop, if not already an iterator, needs to either Step3: The generator function below shows what most Pythonistas consider the base case for the keyword yield Step4: Now lets take a look at pretty much the same iterator written a different way Step5: Feeding an open-ended iterator to a for loop runs the risk of a "forever loop". The itertools module is filled with tools designed to rein in the infinite loopers. Just use islice(obj, start, stop) to keep the for loop finite Step8: In the code below, we see (yield) turned around and used not to return objects, but to receive them. The parentheses are by convention and suggest a "mouth" bringing something in from outside.
9,534
<ASSISTANT_TASK:> Python Code: import numpy as np import tensorflow as tf with open('./reviews.txt', 'r') as f: reviews = f.read() with open('./labels.txt', 'r') as f: labels = f.read() reviews[:2000] from string import punctuation all_text = ''.join([c for c in reviews if c not in punctuation]) reviews = all_text.split('\n') all_text = ' '.join(reviews) words = all_text.split() all_text[:2000] words[:100] # Create your dictionary that maps vocab words to integers here vocab = set(words) vocab_to_int = {word: i for i, word in enumerate(vocab)} def text_to_ints(text): text_words = text.split() return [vocab_to_int[word] for word in text_words] # Convert the reviews to integers, same shape as reviews list, but with integers reviews_ints = [text_to_ints(review) for review in reviews] print(reviews_ints[0:3]) print(labels[0:20]) # Convert labels to 1s and 0s for 'positive' and 'negative' labels = labels.split("\n") labels = [1 if label == 'positive' else 0 for label in labels] print(labels[0:20]) from collections import Counter review_lens = Counter([len(x) for x in reviews_ints]) print("Zero-length reviews: {}".format(review_lens[0])) print("Maximum review length: {}".format(max(review_lens))) # Filter out that review with 0 length empty_indices = np.where(len(reviews_ints) == 0) empty_indices = set([i for i in range(len(reviews_ints)) if len(reviews_ints[i]) == 0]) print(empty_indices) reviews_ints = [review for index, review in enumerate(reviews_ints) if index not in empty_indices] labels = [label for index, label in enumerate(labels) if index not in empty_indices] print(len(reviews_ints)) print(len(labels)) seq_len = 200 def process_review(review): truncated = review[0:seq_len] length = len(truncated) padding = [0] * (seq_len - length) return padding + truncated features = np.array([process_review(review) for review in reviews_ints]) #print(features[0:3]) features[:10,:100] shuffled_indices = np.random.permutation(range(len(reviews_ints))) print(shuffled_indices[0:20]) split_frac = 0.8 labels = np.array(labels) max_training_index = int(split_frac * len(features)) shuffled_indices = np.random.permutation(range(len(features))) train_x, val_x = features[shuffled_indices[:max_training_index], :], features[shuffled_indices[max_training_index:], :] train_y, val_y = labels[shuffled_indices[:max_training_index]], labels[shuffled_indices[max_training_index:]] half_index = len(val_x) // 2 val_x, test_x = val_x[:half_index, :], val_x[half_index:, :] val_y, test_y = val_y[:half_index], val_y[half_index:] print("\t\t\tFeature Shapes:") print("Train set: \t\t{}".format(train_x.shape), "\nValidation set: \t{}".format(val_x.shape), "\nTest set: \t\t{}".format(test_x.shape)) lstm_size = 512 lstm_layers = 3 batch_size = 512 learning_rate = 0.001 n_words = len(vocab) # Create the graph object graph = tf.Graph() # Add nodes to the graph with graph.as_default(): inputs_ = tf.placeholder(tf.int32, shape=(None, seq_len)) labels_ = tf.placeholder(tf.int32, shape=(None, None)) keep_prob = tf.placeholder(tf.float32) # Size of the embedding vectors (number of units in the embedding layer) embed_size = 300 with graph.as_default(): embedding = tf.Variable(tf.truncated_normal([n_words, embed_size], -1.0, 1.0)) embed = tf.nn.embedding_lookup(embedding, inputs_) with graph.as_default(): # Your basic LSTM cell lstm = tf.contrib.rnn.BasicLSTMCell(lstm_size) # Add dropout to the cell drop = tf.contrib.rnn.DropoutWrapper(lstm, output_keep_prob=keep_prob) # Stack up multiple LSTM layers, for deep learning cell = tf.contrib.rnn.MultiRNNCell([drop] * lstm_layers) # Getting an initial state of all zeros initial_state = cell.zero_state(batch_size, tf.float32) with graph.as_default(): outputs, final_state = tf.nn.dynamic_rnn(cell, embed, initial_state=initial_state) with graph.as_default(): predictions = tf.contrib.layers.fully_connected(outputs[:, -1], 1, activation_fn=tf.sigmoid) cost = tf.losses.mean_squared_error(labels_, predictions) optimizer = tf.train.AdamOptimizer(learning_rate).minimize(cost) with graph.as_default(): correct_pred = tf.equal(tf.cast(tf.round(predictions), tf.int32), labels_) accuracy = tf.reduce_mean(tf.cast(correct_pred, tf.float32)) def get_batches(x, y, batch_size=100): n_batches = len(x)//batch_size x, y = x[:n_batches*batch_size], y[:n_batches*batch_size] for ii in range(0, len(x), batch_size): yield x[ii:ii+batch_size], y[ii:ii+batch_size] epochs = 20 with graph.as_default(): saver = tf.train.Saver() with tf.Session(graph=graph) as sess: sess.run(tf.global_variables_initializer()) iteration = 1 for e in range(epochs): state = sess.run(initial_state) for ii, (x, y) in enumerate(get_batches(train_x, train_y, batch_size), 1): feed = {inputs_: x, labels_: y[:, None], keep_prob: 0.5, initial_state: state} loss, state, _ = sess.run([cost, final_state, optimizer], feed_dict=feed) if iteration%5==0: print("Epoch: {}/{}".format(e, epochs), "Iteration: {}".format(iteration), "Train loss: {:.3f}".format(loss)) if iteration%25==0: val_acc = [] val_state = sess.run(cell.zero_state(batch_size, tf.float32)) for x, y in get_batches(val_x, val_y, batch_size): feed = {inputs_: x, labels_: y[:, None], keep_prob: 1, initial_state: val_state} batch_acc, val_state = sess.run([accuracy, final_state], feed_dict=feed) val_acc.append(batch_acc) print("Val acc: {:.3f}".format(np.mean(val_acc))) iteration +=1 saver.save(sess, "checkpoints/sentiment.ckpt") test_acc = [] with tf.Session(graph=graph) as sess: saver.restore(sess, tf.train.latest_checkpoint('checkpoints')) test_state = sess.run(cell.zero_state(batch_size, tf.float32)) for ii, (x, y) in enumerate(get_batches(test_x, test_y, batch_size), 1): feed = {inputs_: x, labels_: y[:, None], keep_prob: 1, initial_state: test_state} batch_acc, test_state = sess.run([accuracy, final_state], feed_dict=feed) test_acc.append(batch_acc) print("Test accuracy: {:.3f}".format(np.mean(test_acc))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Data preprocessing Step2: Encoding the words Step3: Encoding the labels Step4: If you built labels correctly, you should see the next output. Step5: Okay, a couple issues here. We seem to have one review with zero length. And, the maximum review length is way too many steps for our RNN. Let's truncate to 200 steps. For reviews shorter than 200, we'll pad with 0s. For reviews longer than 200, we can truncate them to the first 200 characters. Step6: Exercise Step7: If you build features correctly, it should look like that cell output below. Step8: Training, Validation, Test Step9: With train, validation, and text fractions of 0.8, 0.1, 0.1, the final shapes should look like Step10: For the network itself, we'll be passing in our 200 element long review vectors. Each batch will be batch_size vectors. We'll also be using dropout on the LSTM layer, so we'll make a placeholder for the keep probability. Step11: Embedding Step12: LSTM cell Step13: RNN forward pass Step14: Output Step15: Validation accuracy Step16: Batching Step17: Training Step18: Testing
9,535
<ASSISTANT_TASK:> Python Code: !pip install python_speech_features !pip install resampy !pip install scipy !pip install gdown !pip install tqdm -U PATH = '/content/drive/My Drive/DeepSpeechDistances' SAMPLE_PATH = '/content/drive/My Drive/DeepSpeechDistances/abstract_samples' NUM_SPLITS = 3 # number of data splits to comute std of DSD SAMPLES_PER_SPLIT = 500 # number of samples in a single DSD run. # We recommend at least 10k samples for evaluation to get reasonable estimates. AUDIO_LENGTH = 2 # length of individual sample, in seconds NUM_NOISE_LEVELS = 3 # number of different noise levels for samples to evaluate from google.colab import drive drive.mount('/content/drive/', force_remount=True) import sys, os sh = lambda path: "'" + path + "'" if not os.path.exists(PATH): !git clone https://github.com/mbinkowski/DeepSpeechDistances.git {sh(PATH)} else: print('Found DeepSpeechDistances directory, skipping git clone.') sys.path.append(PATH) if not os.path.exists(os.path.join(PATH, 'checkpoint', 'ds2_large')): CKPT = sh(PATH + '/ds2.tar.gz') !gdown https://drive.google.com/uc?id=1EDvL9wMCO2vVE-ynBvpwkFTultbzLNQX -O {CKPT} !tar -C {sh(PATH +'/checkpoint/')} -xvf {CKPT} !rm {CKPT} else: print('Found checkpoint directory, skipping download.') %tensorflow_version 1.x import tensorflow.compat.v1 as tf tf.disable_eager_execution() import audio_distance from sample_utils import subsample_audio subsample_audio(os.path.join(PATH, 'abstract.wav'), SAMPLE_PATH, num_samples=NUM_SPLITS * SAMPLES_PER_SPLIT, length=AUDIO_LENGTH, num_noise_levels=NUM_NOISE_LEVELS) reference_path = os.path.join(SAMPLE_PATH, 'ref', '*.wav') eval_paths = [os.path.join(SAMPLE_PATH, f'noisy_{i+1}', '*.wav') for i in range(NUM_NOISE_LEVELS)] evaluator = audio_distance.AudioDistance( load_path=os.path.join(PATH, 'checkpoint', 'ds2_large', 'model.ckpt-54800'), meta_path=os.path.join(PATH, 'checkpoint', 'collection-stripped-meta.meta'), required_sample_size=NUM_SPLITS * SAMPLES_PER_SPLIT, num_splits=NUM_SPLITS) evaluator.load_real_data(reference_path) dist_names = ['FDSD', 'KDSD', 'cFDSD', 'cKDSD'] def print_results(values): print('\n' + ', '.join(['%s = %.5f (%.5f)' % (n, v[0], v[1]) for n, v in zip(dist_names, values)])) with tf.Session(config=evaluator.sess_config) as sess: print('Computing reference DeepSpeech distances.') values = evaluator.get_distance(sess=sess) print_results(values) distances = [values] for eval_path in eval_paths: print('\nComputing DeepSpeech distances for files in the directory:\n' + os.path.dirname(eval_path)) values = evaluator.get_distance(sess=sess, files=eval_path) print_results(values) distances.append(values) all_paths = [reference_path] + eval_paths prefix_len = len(os.path.commonpath(all_paths)) sample_names = [path[prefix_len + 1:] for path in all_paths] if all([os.path.basename(p) == '*.wav' for p in all_paths]): sample_names = [name[:-6] for name in sample_names] import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 2, figsize=(12, 4)) x = range(NUM_NOISE_LEVELS + 1) for i, kind in enumerate(['Frechet', 'kernel']): ax[i].set_title(kind + ' distances') ax[i].set_xticks(x) ax[i].set_xticklabels(sample_names) for j in [0, 2]: k = i + j ax[i].plot(x, [d[k][0] for d in distances], color='cmyk'[k], label=dist_names[k]) ax[i].fill_between(x, [d[k][0] - d[k][1] for d in distances], [d[k][0] + d[k][1] for d in distances], color='cmyk'[k], alpha=.3) ax[i].legend() ax[i].grid() drive.flush_and_unmount() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set up evaluation parameters and paths within the mounted Google Drive. Clone repository and download checkpoint. Step2: Do other necessary imports. Step3: Create random 2-second samples from source audio file. Step4: Create evaluator object and load reference samples. Step5: Carry out distance estimation. Step6: Plot results.
9,536
<ASSISTANT_TASK:> Python Code: import keras import pandas as pd import numpy as np import matplotlib.pyplot as plt import os # Setting seed for reproducibility np.random.seed(1234) PYTHONHASHSEED = 0 from sklearn import preprocessing from sklearn.metrics import confusion_matrix, recall_score, precision_score from keras.models import Sequential,load_model from keras.layers import Dense, Dropout, LSTM # define path to save model model_path = 'binary_model.h5' # read training data - It is the aircraft engine run-to-failure data. train_df = pd.read_csv('PM_train.txt', sep=" ", header=None) train_df.drop(train_df.columns[[26, 27]], axis=1, inplace=True) train_df.columns = ['id', 'cycle', 'setting1', 'setting2', 'setting3', 's1', 's2', 's3', 's4', 's5', 's6', 's7', 's8', 's9', 's10', 's11', 's12', 's13', 's14', 's15', 's16', 's17', 's18', 's19', 's20', 's21'] train_df = train_df.sort_values(['id','cycle']) # read test data - It is the aircraft engine operating data without failure events recorded. test_df = pd.read_csv('PM_test.txt', sep=" ", header=None) test_df.drop(test_df.columns[[26, 27]], axis=1, inplace=True) test_df.columns = ['id', 'cycle', 'setting1', 'setting2', 'setting3', 's1', 's2', 's3', 's4', 's5', 's6', 's7', 's8', 's9', 's10', 's11', 's12', 's13', 's14', 's15', 's16', 's17', 's18', 's19', 's20', 's21'] # read ground truth data - It contains the information of true remaining cycles for each engine in the testing data. truth_df = pd.read_csv('PM_truth.txt', sep=" ", header=None) truth_df.drop(truth_df.columns[[1]], axis=1, inplace=True) ####### # TRAIN ####### # Data Labeling - generate column RUL(Remaining Usefull Life or Time to Failure) rul = pd.DataFrame(train_df.groupby('id')['cycle'].max()).reset_index() rul.columns = ['id', 'max'] train_df = train_df.merge(rul, on=['id'], how='left') train_df['RUL'] = train_df['max'] - train_df['cycle'] train_df.drop('max', axis=1, inplace=True) # generate label columns for training data # we will only make use of "label1" for binary classification, # while trying to answer the question: is a specific engine going to fail within w1 cycles? w1 = 30 w0 = 15 train_df['label1'] = np.where(train_df['RUL'] <= w1, 1, 0 ) train_df['label2'] = train_df['label1'] train_df.loc[train_df['RUL'] <= w0, 'label2'] = 2 # MinMax normalization (from 0 to 1) train_df['cycle_norm'] = train_df['cycle'] cols_normalize = train_df.columns.difference(['id','cycle','RUL','label1','label2']) min_max_scaler = preprocessing.MinMaxScaler() norm_train_df = pd.DataFrame(min_max_scaler.fit_transform(train_df[cols_normalize]), columns=cols_normalize, index=train_df.index) join_df = train_df[train_df.columns.difference(cols_normalize)].join(norm_train_df) train_df = join_df.reindex(columns = train_df.columns) ###### # TEST ###### # MinMax normalization (from 0 to 1) test_df['cycle_norm'] = test_df['cycle'] norm_test_df = pd.DataFrame(min_max_scaler.transform(test_df[cols_normalize]), columns=cols_normalize, index=test_df.index) test_join_df = test_df[test_df.columns.difference(cols_normalize)].join(norm_test_df) test_df = test_join_df.reindex(columns = test_df.columns) test_df = test_df.reset_index(drop=True) # We use the ground truth dataset to generate labels for the test data. # generate column max for test data rul = pd.DataFrame(test_df.groupby('id')['cycle'].max()).reset_index() rul.columns = ['id', 'max'] truth_df.columns = ['more'] truth_df['id'] = truth_df.index + 1 truth_df['max'] = rul['max'] + truth_df['more'] truth_df.drop('more', axis=1, inplace=True) # generate RUL for test data test_df = test_df.merge(truth_df, on=['id'], how='left') test_df['RUL'] = test_df['max'] - test_df['cycle'] test_df.drop('max', axis=1, inplace=True) # generate label columns w0 and w1 for test data test_df['label1'] = np.where(test_df['RUL'] <= w1, 1, 0 ) test_df['label2'] = test_df['label1'] test_df.loc[test_df['RUL'] <= w0, 'label2'] = 2 # pick a large window size of 50 cycles sequence_length = 50 # function to reshape features into (samples, time steps, features) def gen_sequence(id_df, seq_length, seq_cols): Only sequences that meet the window-length are considered, no padding is used. This means for testing we need to drop those which are below the window-length. An alternative would be to pad sequences so that we can use shorter ones # for one id I put all the rows in a single matrix data_matrix = id_df[seq_cols].values num_elements = data_matrix.shape[0] # Iterate over two lists in parallel. # For example id1 have 192 rows and sequence_length is equal to 50 # so zip iterate over two following list of numbers (0,112),(50,192) # 0 50 -> from row 0 to row 50 # 1 51 -> from row 1 to row 51 # 2 52 -> from row 2 to row 52 # ... # 111 191 -> from row 111 to 191 for start, stop in zip(range(0, num_elements-seq_length), range(seq_length, num_elements)): yield data_matrix[start:stop, :] # pick the feature columns sensor_cols = ['s' + str(i) for i in range(1,22)] sequence_cols = ['setting1', 'setting2', 'setting3', 'cycle_norm'] sequence_cols.extend(sensor_cols) # generator for the sequences seq_gen = (list(gen_sequence(train_df[train_df['id']==id], sequence_length, sequence_cols)) for id in train_df['id'].unique()) # generate sequences and convert to numpy array seq_array = np.concatenate(list(seq_gen)).astype(np.float32) seq_array.shape # function to generate labels def gen_labels(id_df, seq_length, label): # For one id I put all the labels in a single matrix. # For example: # [[1] # [4] # [1] # [5] # [9] # ... # [200]] data_matrix = id_df[label].values num_elements = data_matrix.shape[0] # I have to remove the first seq_length labels # because for one id the first sequence of seq_length size have as target # the last label (the previus ones are discarded). # All the next id's sequences will have associated step by step one label as target. return data_matrix[seq_length:num_elements, :] # generate labels label_gen = [gen_labels(train_df[train_df['id']==id], sequence_length, ['label1']) for id in train_df['id'].unique()] label_array = np.concatenate(label_gen).astype(np.float32) label_array.shape # Next, we build a deep network. # The first layer is an LSTM layer with 100 units followed by another LSTM layer with 50 units. # Dropout is also applied after each LSTM layer to control overfitting. # Final layer is a Dense output layer with single unit and sigmoid activation since this is a binary classification problem. # build the network nb_features = seq_array.shape[2] nb_out = label_array.shape[1] model = Sequential() model.add(LSTM( input_shape=(sequence_length, nb_features), units=100, return_sequences=True)) model.add(Dropout(0.2)) model.add(LSTM( units=50, return_sequences=False)) model.add(Dropout(0.2)) model.add(Dense(units=nb_out, activation='sigmoid')) model.compile(loss='binary_crossentropy', optimizer='adam', metrics=['accuracy']) print(model.summary()) # fit the network history = model.fit(seq_array, label_array, epochs=100, batch_size=200, validation_split=0.05, verbose=2, callbacks = [keras.callbacks.EarlyStopping(monitor='val_loss', min_delta=0, patience=10, verbose=0, mode='min'), keras.callbacks.ModelCheckpoint(model_path,monitor='val_loss', save_best_only=True, mode='min', verbose=0)] ) # list all data in history print(history.history.keys()) # summarize history for Accuracy fig_acc = plt.figure(figsize=(10, 10)) plt.plot(history.history['acc']) plt.plot(history.history['val_acc']) plt.title('model accuracy') plt.ylabel('accuracy') plt.xlabel('epoch') plt.legend(['train', 'test'], loc='upper left') plt.show() fig_acc.savefig("model_accuracy.png") # summarize history for Loss fig_acc = plt.figure(figsize=(10, 10)) plt.plot(history.history['loss']) plt.plot(history.history['val_loss']) plt.title('model loss') plt.ylabel('loss') plt.xlabel('epoch') plt.legend(['train', 'test'], loc='upper left') plt.show() fig_acc.savefig("model_loss.png") # training metrics scores = model.evaluate(seq_array, label_array, verbose=1, batch_size=200) print('Accurracy: {}'.format(scores[1])) # make predictions and compute confusion matrix y_pred = model.predict_classes(seq_array,verbose=1, batch_size=200) y_true = label_array test_set = pd.DataFrame(y_pred) test_set.to_csv('binary_submit_train.csv', index = None) print('Confusion matrix\n- x-axis is true labels.\n- y-axis is predicted labels') cm = confusion_matrix(y_true, y_pred) print(cm) # compute precision and recall precision = precision_score(y_true, y_pred) recall = recall_score(y_true, y_pred) print( 'precision = ', precision, '\n', 'recall = ', recall) # We pick the last sequence for each id in the test data seq_array_test_last = [test_df[test_df['id']==id][sequence_cols].values[-sequence_length:] for id in test_df['id'].unique() if len(test_df[test_df['id']==id]) >= sequence_length] seq_array_test_last = np.asarray(seq_array_test_last).astype(np.float32) #print("seq_array_test_last") #print(seq_array_test_last) #print(seq_array_test_last.shape) # Similarly, we pick the labels #print("y_mask") # serve per prendere solo le label delle sequenze che sono almeno lunghe 50 y_mask = [len(test_df[test_df['id']==id]) >= sequence_length for id in test_df['id'].unique()] #print("y_mask") #print(y_mask) label_array_test_last = test_df.groupby('id')['label1'].nth(-1)[y_mask].values label_array_test_last = label_array_test_last.reshape(label_array_test_last.shape[0],1).astype(np.float32) #print(label_array_test_last.shape) #print("label_array_test_last") #print(label_array_test_last) # if best iteration's model was saved then load and use it if os.path.isfile(model_path): estimator = load_model(model_path) # test metrics scores_test = estimator.evaluate(seq_array_test_last, label_array_test_last, verbose=2) print('Accurracy: {}'.format(scores_test[1])) # make predictions and compute confusion matrix y_pred_test = estimator.predict_classes(seq_array_test_last) y_true_test = label_array_test_last test_set = pd.DataFrame(y_pred_test) test_set.to_csv('binary_submit_test.csv', index = None) print('Confusion matrix\n- x-axis is true labels.\n- y-axis is predicted labels') cm = confusion_matrix(y_true_test, y_pred_test) print(cm) # compute precision and recall precision_test = precision_score(y_true_test, y_pred_test) recall_test = recall_score(y_true_test, y_pred_test) f1_test = 2 * (precision_test * recall_test) / (precision_test + recall_test) print( 'Precision: ', precision_test, '\n', 'Recall: ', recall_test,'\n', 'F1-score:', f1_test ) # Plot in blue color the predicted data and in green color the # actual data to verify visually the accuracy of the model. fig_verify = plt.figure(figsize=(10, 5)) plt.plot(y_pred_test, color="blue") plt.plot(y_true_test, color="green") plt.title('prediction') plt.ylabel('value') plt.xlabel('row') plt.legend(['predicted', 'actual data'], loc='upper left') plt.show() fig_verify.savefig("model_verify.png") import keras import keras.backend as K from keras.layers.core import Activation from keras.models import Sequential,load_model from keras.layers import Dense, Dropout, LSTM import pandas as pd import numpy as np import matplotlib.pyplot as plt import os from sklearn import preprocessing # Setting seed for reproducibility np.random.seed(1234) PYTHONHASHSEED = 0 # define path to save model model_path = 'regression_model.h5' # read training data - It is the aircraft engine run-to-failure data. train_df = pd.read_csv('PM_train.txt', sep=" ", header=None) train_df.drop(train_df.columns[[26, 27]], axis=1, inplace=True) train_df.columns = ['id', 'cycle', 'setting1', 'setting2', 'setting3', 's1', 's2', 's3', 's4', 's5', 's6', 's7', 's8', 's9', 's10', 's11', 's12', 's13', 's14', 's15', 's16', 's17', 's18', 's19', 's20', 's21'] train_df = train_df.sort_values(['id','cycle']) # read test data - It is the aircraft engine operating data without failure events recorded. test_df = pd.read_csv('PM_test.txt', sep=" ", header=None) test_df.drop(test_df.columns[[26, 27]], axis=1, inplace=True) test_df.columns = ['id', 'cycle', 'setting1', 'setting2', 'setting3', 's1', 's2', 's3', 's4', 's5', 's6', 's7', 's8', 's9', 's10', 's11', 's12', 's13', 's14', 's15', 's16', 's17', 's18', 's19', 's20', 's21'] # read ground truth data - It contains the information of true remaining cycles for each engine in the testing data. truth_df = pd.read_csv('PM_truth.txt', sep=" ", header=None) truth_df.drop(truth_df.columns[[1]], axis=1, inplace=True) ################################## # Data Preprocessing ################################## ####### # TRAIN ####### # Data Labeling - generate column RUL(Remaining Usefull Life or Time to Failure) rul = pd.DataFrame(train_df.groupby('id')['cycle'].max()).reset_index() rul.columns = ['id', 'max'] train_df = train_df.merge(rul, on=['id'], how='left') train_df['RUL'] = train_df['max'] - train_df['cycle'] train_df.drop('max', axis=1, inplace=True) # generate label columns for training data # we will only make use of "label1" for binary classification, # while trying to answer the question: is a specific engine going to fail within w1 cycles? w1 = 30 w0 = 15 train_df['label1'] = np.where(train_df['RUL'] <= w1, 1, 0 ) train_df['label2'] = train_df['label1'] train_df.loc[train_df['RUL'] <= w0, 'label2'] = 2 # MinMax normalization (from 0 to 1) train_df['cycle_norm'] = train_df['cycle'] cols_normalize = train_df.columns.difference(['id','cycle','RUL','label1','label2']) min_max_scaler = preprocessing.MinMaxScaler() norm_train_df = pd.DataFrame(min_max_scaler.fit_transform(train_df[cols_normalize]), columns=cols_normalize, index=train_df.index) join_df = train_df[train_df.columns.difference(cols_normalize)].join(norm_train_df) train_df = join_df.reindex(columns = train_df.columns) #train_df.to_csv('PredictiveManteinanceEngineTraining.csv', encoding='utf-8',index = None) ###### # TEST ###### # MinMax normalization (from 0 to 1) test_df['cycle_norm'] = test_df['cycle'] norm_test_df = pd.DataFrame(min_max_scaler.transform(test_df[cols_normalize]), columns=cols_normalize, index=test_df.index) test_join_df = test_df[test_df.columns.difference(cols_normalize)].join(norm_test_df) test_df = test_join_df.reindex(columns = test_df.columns) test_df = test_df.reset_index(drop=True) print(test_df.head()) # We use the ground truth dataset to generate labels for the test data. # generate column max for test data rul = pd.DataFrame(test_df.groupby('id')['cycle'].max()).reset_index() rul.columns = ['id', 'max'] truth_df.columns = ['more'] truth_df['id'] = truth_df.index + 1 truth_df['max'] = rul['max'] + truth_df['more'] truth_df.drop('more', axis=1, inplace=True) # generate RUL for test data test_df = test_df.merge(truth_df, on=['id'], how='left') test_df['RUL'] = test_df['max'] - test_df['cycle'] test_df.drop('max', axis=1, inplace=True) # generate label columns w0 and w1 for test data test_df['label1'] = np.where(test_df['RUL'] <= w1, 1, 0 ) test_df['label2'] = test_df['label1'] test_df.loc[test_df['RUL'] <= w0, 'label2'] = 2 #test_df.to_csv('PredictiveManteinanceEngineValidation.csv', encoding='utf-8',index = None) # pick a large window size of 50 cycles sequence_length = 50 # function to reshape features into (samples, time steps, features) def gen_sequence(id_df, seq_length, seq_cols): Only sequences that meet the window-length are considered, no padding is used. This means for testing we need to drop those which are below the window-length. An alternative would be to pad sequences so that we can use shorter ones # for one id I put all the rows in a single matrix data_matrix = id_df[seq_cols].values num_elements = data_matrix.shape[0] # Iterate over two lists in parallel. # For example id1 have 192 rows and sequence_length is equal to 50 # so zip iterate over two following list of numbers (0,112),(50,192) # 0 50 -> from row 0 to row 50 # 1 51 -> from row 1 to row 51 # 2 52 -> from row 2 to row 52 # ... # 111 191 -> from row 111 to 191 for start, stop in zip(range(0, num_elements-seq_length), range(seq_length, num_elements)): yield data_matrix[start:stop, :] # pick the feature columns sensor_cols = ['s' + str(i) for i in range(1,22)] sequence_cols = ['setting1', 'setting2', 'setting3', 'cycle_norm'] sequence_cols.extend(sensor_cols) # TODO for debug # val is a list of 192 - 50 = 142 bi-dimensional array (50 rows x 25 columns) val=list(gen_sequence(train_df[train_df['id']==1], sequence_length, sequence_cols)) print(len(val)) # generator for the sequences # transform each id of the train dataset in a sequence seq_gen = (list(gen_sequence(train_df[train_df['id']==id], sequence_length, sequence_cols)) for id in train_df['id'].unique()) # generate sequences and convert to numpy array seq_array = np.concatenate(list(seq_gen)).astype(np.float32) print(seq_array.shape) # function to generate labels def gen_labels(id_df, seq_length, label): Only sequences that meet the window-length are considered, no padding is used. This means for testing we need to drop those which are below the window-length. An alternative would be to pad sequences so that we can use shorter ones # For one id I put all the labels in a single matrix. # For example: # [[1] # [4] # [1] # [5] # [9] # ... # [200]] data_matrix = id_df[label].values num_elements = data_matrix.shape[0] # I have to remove the first seq_length labels # because for one id the first sequence of seq_length size have as target # the last label (the previus ones are discarded). # All the next id's sequences will have associated step by step one label as target. return data_matrix[seq_length:num_elements, :] # generate labels label_gen = [gen_labels(train_df[train_df['id']==id], sequence_length, ['RUL']) for id in train_df['id'].unique()] label_array = np.concatenate(label_gen).astype(np.float32) label_array.shape def r2_keras(y_true, y_pred): Coefficient of Determination SS_res = K.sum(K.square( y_true - y_pred )) SS_tot = K.sum(K.square( y_true - K.mean(y_true) ) ) return ( 1 - SS_res/(SS_tot + K.epsilon()) ) # Next, we build a deep network. # The first layer is an LSTM layer with 100 units followed by another LSTM layer with 50 units. # Dropout is also applied after each LSTM layer to control overfitting. # Final layer is a Dense output layer with single unit and linear activation since this is a regression problem. nb_features = seq_array.shape[2] nb_out = label_array.shape[1] model = Sequential() model.add(LSTM( input_shape=(sequence_length, nb_features), units=100, return_sequences=True)) model.add(Dropout(0.2)) model.add(LSTM( units=50, return_sequences=False)) model.add(Dropout(0.2)) model.add(Dense(units=nb_out)) model.add(Activation("linear")) model.compile(loss='mean_squared_error', optimizer='rmsprop',metrics=['mae',r2_keras]) print(model.summary()) # fit the network history = model.fit(seq_array, label_array, epochs=100, batch_size=200, validation_split=0.05, verbose=2, callbacks = [keras.callbacks.EarlyStopping(monitor='val_loss', min_delta=0, patience=10, verbose=0, mode='min'), keras.callbacks.ModelCheckpoint(model_path,monitor='val_loss', save_best_only=True, mode='min', verbose=0)] ) # list all data in history print(history.history.keys()) # summarize history for R^2 fig_acc = plt.figure(figsize=(10, 10)) plt.plot(history.history['r2_keras']) plt.plot(history.history['val_r2_keras']) plt.title('model r^2') plt.ylabel('R^2') plt.xlabel('epoch') plt.legend(['train', 'test'], loc='upper left') plt.show() fig_acc.savefig("model_r2.png") # summarize history for MAE fig_acc = plt.figure(figsize=(10, 10)) plt.plot(history.history['mean_absolute_error']) plt.plot(history.history['val_mean_absolute_error']) plt.title('model MAE') plt.ylabel('MAE') plt.xlabel('epoch') plt.legend(['train', 'test'], loc='upper left') plt.show() fig_acc.savefig("model_mae.png") # summarize history for Loss fig_acc = plt.figure(figsize=(10, 10)) plt.plot(history.history['loss']) plt.plot(history.history['val_loss']) plt.title('model loss') plt.ylabel('loss') plt.xlabel('epoch') plt.legend(['train', 'test'], loc='upper left') plt.show() fig_acc.savefig("model_regression_loss.png") # training metrics scores = model.evaluate(seq_array, label_array, verbose=1, batch_size=200) print('\nMAE: {}'.format(scores[1])) print('\nR^2: {}'.format(scores[2])) y_pred = model.predict(seq_array,verbose=1, batch_size=200) y_true = label_array test_set = pd.DataFrame(y_pred) test_set.to_csv('submit_train.csv', index = None) # We pick the last sequence for each id in the test data seq_array_test_last = [test_df[test_df['id']==id][sequence_cols].values[-sequence_length:] for id in test_df['id'].unique() if len(test_df[test_df['id']==id]) >= sequence_length] seq_array_test_last = np.asarray(seq_array_test_last).astype(np.float32) #print("seq_array_test_last") #print(seq_array_test_last) #print(seq_array_test_last.shape) # Similarly, we pick the labels #print("y_mask") y_mask = [len(test_df[test_df['id']==id]) >= sequence_length for id in test_df['id'].unique()] label_array_test_last = test_df.groupby('id')['RUL'].nth(-1)[y_mask].values label_array_test_last = label_array_test_last.reshape(label_array_test_last.shape[0],1).astype(np.float32) #print(label_array_test_last.shape) #print("label_array_test_last") #print(label_array_test_last) # if best iteration's model was saved then load and use it if os.path.isfile(model_path): estimator = load_model(model_path,custom_objects={'r2_keras': r2_keras}) # test metrics scores_test = estimator.evaluate(seq_array_test_last, label_array_test_last, verbose=2) print('\nMAE: {}'.format(scores_test[1])) print('\nR^2: {}'.format(scores_test[2])) y_pred_test = estimator.predict(seq_array_test_last) y_true_test = label_array_test_last test_set = pd.DataFrame(y_pred_test) test_set.to_csv('submit_test.csv', index = None) # Plot in blue color the predicted data and in green color the # actual data to verify visually the accuracy of the model. fig_verify = plt.figure(figsize=(10, 5)) plt.plot(y_pred_test, color="blue") plt.plot(y_true_test, color="green") plt.title('prediction') plt.ylabel('value') plt.xlabel('row') plt.legend(['predicted', 'actual data'], loc='upper left') plt.show() fig_verify.savefig("model_regression_verify.png") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Data Ingestion Step2: Data Preprocessing Step4: LSTM Step5: Model Evaluation on Test set Step6: Model Evaluation on Validation set Step7: Regression Step8: Data Ingestion Step11: Data Preprocessing Step13: LSTM Step14: Model Evaluation on Test set Step15: Evaluate on Validation set
9,537
<ASSISTANT_TASK:> Python Code: import os from pathlib import Path testfolder = Path().resolve().parent.parent / 'bifacial_radiance' / 'TEMP' / 'Tutorial_01' # Another option using relative address; for some operative systems you might need '/' instead of '\' # testfolder = os.path.abspath(r'..\..\bifacial_radiance\TEMP') print ("Your simulation will be stored in %s" % testfolder) if not os.path.exists(testfolder): os.makedirs(testfolder) try: from bifacial_radiance import * except ImportError: raise RuntimeError('bifacial_radiance is required. download distribution') import numpy as np # Create a RadianceObj 'object' named bifacial_example. no whitespace allowed demo = RadianceObj('tutorial_1',str(testfolder)) # Input albedo number or material name like 'concrete'. demo.setGround() # This prints available materials. albedo = 0.62 demo.setGround(albedo) # Pull in meteorological data using pyEPW for any global lat/lon epwfile = demo.getEPW(lat = 37.5, lon = -77.6) # This location corresponds to Richmond, VA. # Read in the weather data pulled in above. metdata = demo.readWeatherFile(epwfile, coerce_year=2001) fullYear = True if fullYear: demo.genCumSky() # entire year. else: timeindex = metdata.datetime.index(pd.to_datetime('2001-06-17 12:0:0 -7')) demo.gendaylit(timeindex) # Noon, June 17th (timepoint # 4020) module_type = 'test-module' module = demo.makeModule(name=module_type,x=1.695, y=0.984) print(module) availableModules = demo.printModules() sceneDict = {'tilt':10,'pitch':3,'clearance_height':0.2,'azimuth':180, 'nMods': 20, 'nRows': 7} scene = demo.makeScene(module,sceneDict) octfile = demo.makeOct(demo.getfilelist()) demo.getfilelist() analysis = AnalysisObj(octfile, demo.basename) frontscan, backscan = analysis.moduleAnalysis(scene) results = analysis.analysis(octfile, demo.basename, frontscan, backscan) load.read1Result('results\irr_tutorial_1.csv') bifacialityfactor = 0.9 print('Annual bifacial ratio: %0.2f ' %( np.mean(analysis.Wm2Back) * bifacialityfactor / np.mean(analysis.Wm2Front)) ) ## Comment the ! line below to run rvu from the Jupyter notebook instead of your terminal. ## Simulation will stop until you close the rvu window # !objview materials\ground.rad objects\test-module_C_0.20000_rtr_3.00000_tilt_10.00000_20modsx7rows_origin0,0.rad ## Comment the line below to run rvu from the Jupyter notebook instead of your terminal. ## Simulation will stop until you close the rvu window #!rvu -vf views\front.vp -e .01 tutorial_1.oct # Make a color render and falsecolor image of the scene. analysis.makeImage('side.vp') analysis.makeFalseColor('side.vp') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: This will load bifacial_radiance and other libraries from python that will be useful for this Jupyter Journal Step2: <a id='step2'></a> Step3: This will create all the folder structure of the bifacial_radiance Scene in the designated testfolder in your computer, and it should look like this Step4: If a number between 0 and 1 is passed, it assumes it's an albedo value. For this example, we want a high-reflectivity rooftop albedo surface, so we will set the albedo to 0.62 Step5: <a id='step4'></a> Step6: The downloaded EPW will be in the EPWs folder. Step7: <a id='step5'></a> Step8: The method gencumSky calculates the hourly radiance of the sky hemisphere by dividing it into 145 patches. Then it adds those hourly values to generate one single <b> cumulative sky</b>. Here is a visualization of this patched hemisphere for Richmond, VA, US. Can you deduce from the radiance values of each patch which way is North? Step9: In case you want to use a pre-defined module or a module you've created previously, they are stored in a JSON format in data/module.json, and the options available can be called with printModules Step10: <a id='step7'></a> Step11: To make the scene we have to create a Scene Object through the method makeScene. This method will create a .rad file in the objects folder, with the parameters specified in sceneDict and the module created above. You can alternatively pass a string with the name of the moduletype. Step12: <a id='step8'></a> Step13: To see what files got merged into the octfile, you can use the helper method getfilelist. This is useful for advanced simulations too, specially when you want to have different Scene objects in the same simulation, or if you want to add other custom elements to your scene (like a building, for example) Step14: <a id='step9'></a> Step15: Then let's specify the sensor location. If no parameters are passed to moduleAnalysis, it will scan the center module of the center row Step16: The frontscan and backscan include a linescan along a chord of the module, both on the front and back. Step17: The results are also automatically saved in the results folder. Some of our input/output functions can be used to read the results and work with them, for example Step18: As can be seen in the results for the Wm2Front and WM2Back, the irradiance values are quite high. This is because a cumulative sky simulation was performed on <b> step 5 </b>, so this is the total irradiance over all the hours of the year that the module at each sampling point will receive. Dividing the back irradiance average by the front irradiance average will give us the bifacial gain for the year Step19: <a id='step10'></a> Step20: This <b> objview </b> has 3 different light sources of its own, so the shading is not representative. Step21: The <b> rvu </b> manual can be found here
9,538
<ASSISTANT_TASK:> Python Code: %load_ext autoreload %autoreload 2 import numpy as np from stingray import Lightcurve, Powerspectrum, AveragedPowerspectrum import matplotlib.pyplot as plt import matplotlib.font_manager as font_manager %matplotlib inline font_prop = font_manager.FontProperties(size=16) dt = 0.03125 # seconds exposure = 8. # seconds times = np.arange(0, exposure, dt) # seconds signal = 300 * np.sin(2.*np.pi*times/0.5) + 1000 # counts/s noisy = np.random.poisson(signal*dt) # counts lc = Lightcurve(times, noisy, dt=dt, skip_checks=True) fig, ax = plt.subplots(1,1,figsize=(10,6)) ax.plot(lc.time, lc.counts, lw=2, color='blue') ax.set_xlabel("Time (s)", fontproperties=font_prop) ax.set_ylabel("Counts (cts)", fontproperties=font_prop) ax.tick_params(axis='x', labelsize=16) ax.tick_params(axis='y', labelsize=16) ax.tick_params(which='major', width=1.5, length=7) ax.tick_params(which='minor', width=1.5, length=4) plt.show() ps = Powerspectrum.from_lightcurve(lc, norm="leahy") print(ps) print("\nSize of positive Fourier frequencies:", len(ps.freq)) print("Number of data points per segment:", ps.n) print(ps.freq) print(ps.power) print(ps.df) print(ps.m) print(ps.n) print(ps.nphots1) fig, ax1 = plt.subplots(1,1,figsize=(9,6), sharex=True) ax1.plot(ps.freq, ps.power, lw=2, color='blue') ax1.set_ylabel("Frequency (Hz)", fontproperties=font_prop) ax1.set_ylabel("Power (raw)", fontproperties=font_prop) ax1.set_yscale('log') ax1.tick_params(axis='x', labelsize=16) ax1.tick_params(axis='y', labelsize=16) ax1.tick_params(which='major', width=1.5, length=7) ax1.tick_params(which='minor', width=1.5, length=4) for axis in ['top', 'bottom', 'left', 'right']: ax1.spines[axis].set_linewidth(1.5) plt.show() long_dt = 0.03125 # seconds long_exposure = 1600. # seconds long_times = np.arange(0, long_exposure, long_dt) # seconds # In count rate units here long_signal = 300 * np.sin(2.*np.pi*long_times/0.5) + 1000 # Multiply by dt to get count units, then add Poisson noise long_noisy = np.random.poisson(long_signal*dt) long_lc = Lightcurve(long_times, long_noisy, dt=long_dt, skip_checks=True) fig, ax = plt.subplots(1,1,figsize=(10,6)) ax.plot(long_lc.time, long_lc.counts, lw=2, color='blue') ax.set_xlim(0,20) ax.set_xlabel("Time (s)", fontproperties=font_prop) ax.set_ylabel("Counts (cts)", fontproperties=font_prop) ax.tick_params(axis='x', labelsize=16) ax.tick_params(axis='y', labelsize=16) ax.tick_params(which='major', width=1.5, length=7) ax.tick_params(which='minor', width=1.5, length=4) plt.show() avg_ps = AveragedPowerspectrum.from_lightcurve(long_lc, 8., norm="leahy") print("Number of segments: %d" % avg_ps.m) fig, ax1 = plt.subplots(1,1,figsize=(9,6)) ax1.plot(avg_ps.freq, avg_ps.power, lw=2, color='blue') ax1.set_xlabel("Frequency (Hz)", fontproperties=font_prop) ax1.set_ylabel("Power (raw)", fontproperties=font_prop) ax1.set_yscale('log') ax1.tick_params(axis='x', labelsize=16) ax1.tick_params(axis='y', labelsize=16) ax1.tick_params(which='major', width=1.5, length=7) ax1.tick_params(which='minor', width=1.5, length=4) for axis in ['top', 'bottom', 'left', 'right']: ax1.spines[axis].set_linewidth(1.5) plt.show() avg_ps_leahy = AveragedPowerspectrum.from_lightcurve(long_lc, 8, norm='leahy') avg_ps_frac = AveragedPowerspectrum.from_lightcurve(long_lc, 8., norm='frac') avg_ps_abs = AveragedPowerspectrum.from_lightcurve(long_lc, 8., norm='abs') fig, [ax1, ax2, ax3] = plt.subplots(3,1,figsize=(6,12)) ax1.plot(avg_ps_leahy.freq, avg_ps_leahy.power, lw=2, color='black') ax1.set_xlabel("Frequency (Hz)", fontproperties=font_prop) ax1.set_ylabel("Power (Leahy)", fontproperties=font_prop) ax1.set_yscale('log') ax1.tick_params(axis='x', labelsize=14) ax1.tick_params(axis='y', labelsize=14) ax1.tick_params(which='major', width=1.5, length=7) ax1.tick_params(which='minor', width=1.5, length=4) ax1.set_title("Leahy norm.", fontproperties=font_prop) ax2.plot(avg_ps_frac.freq, avg_ps_frac.power, lw=2, color='black') ax2.set_xlabel("Frequency (Hz)", fontproperties=font_prop) ax2.set_ylabel("Power (rms)", fontproperties=font_prop) ax2.tick_params(axis='x', labelsize=14) ax2.tick_params(axis='y', labelsize=14) ax2.set_yscale('log') ax2.tick_params(which='major', width=1.5, length=7) ax2.tick_params(which='minor', width=1.5, length=4) ax2.set_title("Fractional rms-squared norm.", fontproperties=font_prop) ax3.plot(avg_ps_abs.freq, avg_ps_abs.power, lw=2, color='black') ax3.set_xlabel("Frequency (Hz)", fontproperties=font_prop) ax3.set_ylabel("Power (abs)", fontproperties=font_prop) ax3.tick_params(axis='x', labelsize=14) ax3.tick_params(axis='y', labelsize=14) ax3.set_yscale('log') ax3.tick_params(which='major', width=1.5, length=7) ax3.tick_params(which='minor', width=1.5, length=4) ax3.set_title("Absolute rms-squared norm.", fontproperties=font_prop) for axis in ['top', 'bottom', 'left', 'right']: ax1.spines[axis].set_linewidth(1.5) ax2.spines[axis].set_linewidth(1.5) ax3.spines[axis].set_linewidth(1.5) plt.tight_layout() plt.show() print("DF before:", avg_ps.df) # Both of the following ways are allowed syntax: # lin_rb_ps = Powerspectrum.rebin(avg_ps, 0.25, method='mean') lin_rb_ps = avg_ps.rebin(0.25, method='mean') print("DF after:", lin_rb_ps.df) # Both of the following ways are allowed syntax: # log_rb_ps, log_rb_freq, binning = Powerspectrum.rebin_log(avg_ps, f=0.02) log_rb_ps = ps.rebin_log(f=0.02) print(type(lin_rb_ps)) long_norm = (long_noisy - long_noisy.mean()) / long_noisy.max() err = np.sqrt(long_noisy.mean()) / long_noisy.max() long_lc_gauss = Lightcurve(long_times, long_norm, err=np.zeros_like(long_norm) + err, dt=long_dt, skip_checks=True, err_dist='gauss') fig, ax = plt.subplots(1,1,figsize=(10, 6)) ax.plot(long_lc.time, long_lc.counts, lw=2, color='blue', label='Original light curve') ax.plot(long_lc_gauss.time, long_lc_gauss.counts, lw=2, color='red', label='Normalized light curve') ax.set_xlim(0,20) ax.set_xlabel("Time (s)", fontproperties=font_prop) ax.set_ylabel("Counts (cts)", fontproperties=font_prop) ax.tick_params(axis='x', labelsize=16) ax.tick_params(axis='y', labelsize=16) ax.tick_params(which='major', width=1.5, length=7) ax.tick_params(which='minor', width=1.5, length=4) plt.legend() plt.show() avg_ps_gauss_leahy = AveragedPowerspectrum.from_lightcurve(long_lc_gauss, 8, norm='leahy') avg_ps_gauss_frac = AveragedPowerspectrum.from_lightcurve(long_lc_gauss, 8., norm='frac') avg_ps_gauss_abs = AveragedPowerspectrum.from_lightcurve(long_lc_gauss, 8., norm='abs') fig, [ax1, ax2, ax3] = plt.subplots(3,1,figsize=(6,12)) ax1.plot(avg_ps_leahy.freq, avg_ps_leahy.power, lw=2, color='black') ax1.plot(avg_ps_gauss_leahy.freq, avg_ps_gauss_leahy.power, lw=2, color='red', zorder=10) ax1.set_xlabel("Frequency (Hz)", fontproperties=font_prop) ax1.set_ylabel("Power (Leahy)", fontproperties=font_prop) ax1.set_yscale('log') ax1.tick_params(axis='x', labelsize=14) ax1.tick_params(axis='y', labelsize=14) ax1.tick_params(which='major', width=1.5, length=7) ax1.tick_params(which='minor', width=1.5, length=4) ax1.set_title("Leahy norm.", fontproperties=font_prop) ax2.plot(avg_ps_frac.freq, avg_ps_frac.power, lw=2, color='black') ax2.plot(avg_ps_gauss_frac.freq, avg_ps_gauss_frac.power, lw=2, color='red') ax2.set_xlabel("Frequency (Hz)", fontproperties=font_prop) ax2.set_ylabel("Power (rms)", fontproperties=font_prop) ax2.tick_params(axis='x', labelsize=14) ax2.tick_params(axis='y', labelsize=14) ax2.set_yscale('log') ax2.tick_params(which='major', width=1.5, length=7) ax2.tick_params(which='minor', width=1.5, length=4) ax2.set_title("Fractional rms-squared norm.", fontproperties=font_prop) ax3.plot(avg_ps_abs.freq, avg_ps_abs.power, lw=2, color='black') ax3.plot(avg_ps_gauss_abs.freq, avg_ps_gauss_abs.power, lw=2, color='red') ax3.set_xlabel("Frequency (Hz)", fontproperties=font_prop) ax3.set_ylabel("Power (abs)", fontproperties=font_prop) ax3.tick_params(axis='x', labelsize=14) ax3.tick_params(axis='y', labelsize=14) ax3.set_yscale('log') ax3.tick_params(which='major', width=1.5, length=7) ax3.tick_params(which='minor', width=1.5, length=4) ax3.set_title("Absolute rms-squared norm.", fontproperties=font_prop) for axis in ['top', 'bottom', 'left', 'right']: ax1.spines[axis].set_linewidth(1.5) ax2.spines[axis].set_linewidth(1.5) ax3.spines[axis].set_linewidth(1.5) plt.tight_layout() plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1. Create a light curve Step2: Now let's turn noisy into a Lightcurve object. Step3: Here we plot it to see what it looks like. Step4: 2. Pass the light curve to the Powerspectrum class to create a Powerspectrum object. Step5: Note that, in principle, the Powerspectrum object could have been initialized directly as Step6: Properties Step7: We can plot the power as a function of Fourier frequency. Notice how there's a spike at our signal frequency of 2 Hz! Step8: You'll notice that the power spectrum is a bit noisy. This is because we're only using one segment of data. Let's try averaging together power spectra from multiple segments of data. Step9: 2. Pass the light curve to the AveragedPowerspectrum class with a specified segment_size. Step10: We can check how many segments were averaged together by printing the m attribute. Step11: AveragedPowerspectrum has the same properties as Powerspectrum, but with m $>$1. Step12: Now we'll show examples of all the things you can do with a Powerspectrum or AveragedPowerspectrum object using built-in stingray methods. Step13: Re-binning a power spectrum in frequency Step14: 2. And we can logarithmically/geometrically re-bin a power spectrum Step15: Like rebin, rebin_log returns a Powerspectrum or AveragedPowerspectrum object (depending on the input object) Step16: Power spectra of normal-distributed light curves
9,539
<ASSISTANT_TASK:> Python Code: import os import nibabel as nb import matplotlib.image as mpimg from m2g.utils.gen_utils import get_braindata, get_filename from m2g.utils.qa_utils import get_min_max, opaque_colorscale, pad_im from argparse import ArgumentParser from scipy import ndimage from matplotlib.colors import LinearSegmentedColormap from nilearn.plotting.edge_detect import _edge_map as edge_map import matplotlib.pyplot as plt %matplotlib inline def reg_mri_pngs( mri, atlas, outdir, loc=0, mean=False, minthr=2, maxthr=95, edge=False ): A function to create and save registered brain slice figures. Parameter --------- mri: nifti file the registered brain file generated in each registration step. atlas: nifti file the reference brain file used in each registration step. outdir: str directory where output png file is saved. loc: int which dimension of the 4d brain data to use mean: bool whether to calculate the mean of the 4d brain data If False, the loc=0 dimension of the data (mri_data[:, :, :, loc]) is used minthr: int lower percentile threshold maxthr: int upper percentile threshold atlas_data = nb.load(atlas).get_data() mri_data = nb.load(mri).get_data() if mri_data.ndim == 4: # 4d data, so we need to reduce a dimension if mean: mr_data = mri_data.mean(axis=3) else: mr_data = mri_data[:, :, :, loc] else: # dim=3 mr_data = mri_data cmap1 = LinearSegmentedColormap.from_list("mycmap1", ["white", "magenta"]) cmap2 = LinearSegmentedColormap.from_list("mycmap2", ["white", "green"]) fig = plot_overlays(atlas_data, mr_data, [cmap1, cmap2], minthr, maxthr, edge) # name and save the file fig.savefig(outdir + "/" + "{"+get_filename(mri) +"}"+ "2" +"{"+get_filename(atlas)+"}"+ ".png", format="png") #plt.close() def plot_overlays(atlas, b0, cmaps=None, minthr=2, maxthr=95, edge=False): A function to plot the overlay figures of registered and reference brain slices. Parameter --------- atlas: str, nifti image, numpy.ndarray an object to open the data for a registered brain. Can be a string (path to a brain file), nibabel.nifti1.nifti1image, or a numpy.ndarray. b0: str, nifti image, numpy.ndarray an object to open the data for a reference brain. Can be a string (path to a brain file), nibabel.nifti1.nifti1image, or a numpy.ndarray. cmap: Colormap objects based on lookup tables using linear segments. minthr: int lower percentile threshold maxthr: int upper percentile threshold edge: bool whether to use normalized luminance data If None, the respective min and max of the color array is used. Returns --------- foverlay: matplotlib.figure.Figure plt.rcParams.update({"axes.labelsize": "x-large", "axes.titlesize": "x-large"}) foverlay = plt.figure() atlas = get_braindata(atlas) b0 = get_braindata(b0) if atlas.shape != b0.shape: raise ValueError("Brains are not the same shape.") if cmaps is None: cmap1 = LinearSegmentedColormap.from_list("mycmap1", ["white", "magenta"]) cmap2 = LinearSegmentedColormap.from_list("mycmap2", ["white", "green"]) cmaps = [cmap1, cmap2] if b0.shape == (182, 218, 182): x = [78, 90, 100] y = [82, 107, 142] z = [88, 103, 107] else: brain_volume = b0.shape x = [int(brain_volume[0] * 0.35), int(brain_volume[0] * 0.51), int(brain_volume[0] * 0.65)] y = [int(brain_volume[1] * 0.35), int(brain_volume[1] * 0.51), int(brain_volume[1] * 0.65)] z = [int(brain_volume[2] * 0.35), int(brain_volume[2] * 0.51), int(brain_volume[2] * 0.65)] coords = (x, y, z) atlas = pad_im(atlas, max(brain_volume[0:3]), 0, False) b0 = pad_im(b0, max(brain_volume[0:3]), 0, False) x = [int(max(brain_volume[0:3]) * 0.35), int(max(brain_volume[0:3]) * 0.51), int(max(brain_volume[0:3]) * 0.65)] y = [int(max(brain_volume[0:3]) * 0.35), int(max(brain_volume[0:3]) * 0.51), int(max(brain_volume[0:3]) * 0.65)] z = [int(max(brain_volume[0:3]) * 0.35), int(max(brain_volume[0:3]) * 0.51), int(max(brain_volume[0:3]) * 0.65)] coords = (x, y, z) labs = [ "Sagittal Slice", "Coronal Slice", "Axial Slice", ] var = ["X", "Y", "Z"] # create subplot for first slice # and customize all labels idx = 0 if edge: min_val = 0 max_val = 1 else: min_val, max_val = get_min_max(b0, minthr, maxthr) for i, coord in enumerate(coords): for pos in coord: idx += 1 ax = foverlay.add_subplot(3, 3, idx) ax.set_title(var[i] + " = " + str(pos)) if i == 0: image = ndimage.rotate(b0[pos, :, :], 90) atl = ndimage.rotate(atlas[pos, :, :], 90) elif i == 1: image = ndimage.rotate(b0[:, pos, :], 90) atl = ndimage.rotate(atlas[:, pos, :], 90) else: image = b0[:, :, pos] atl = atlas[:, :, pos] if idx % 3 == 1: ax.set_ylabel(labs[i]) ax.yaxis.set_ticks([0, image.shape[0] / 2, image.shape[0] - 1]) ax.xaxis.set_ticks([0, image.shape[1] / 2, image.shape[1] - 1]) if edge: image = edge_map(image).data image[image > 0] = max_val image[image == 0] = min_val #Set the axis invisible plt.xticks([]) plt.yticks([]) #Set the frame invisible ax.spines['top'].set_visible(False) ax.spines['right'].set_visible(False) ax.spines['bottom'].set_visible(False) ax.spines['left'].set_visible(False) ax.imshow(atl, interpolation="none", cmap=cmaps[0], alpha=0.9) ax.imshow( opaque_colorscale( cmaps[1], image, alpha=0.9, vmin=min_val, vmax=max_val ) ) #set the legend if idx == 3: plt.plot(0,0,"-",c="pink",label='registered') plt.plot(0,0,"-",c="green",label='reference') plt.legend(loc='best',fontsize=12,bbox_to_anchor=(1.5,1.5)) #Set title for the whole picture a,b,c = brain_volume title = 'QA For Registration. Brain Volume:'+ str(a) +'*'+ str(b) + '*' + str(c)+'\n' foverlay.suptitle(title,fontsize=24) foverlay.set_size_inches(12.5, 10.5, forward=True) foverlay.tight_layout() return foverlay mri = r"/Users/xueminzhu/Desktop/test/t1w_aligned_mni.nii.gz" atlas = r"/Users/xueminzhu/Desktop/test/MNI152_T1_2mm_brain.nii.gz" output_dir = r"/Users/xueminzhu/Desktop/test" reg_mri_pngs(mri, atlas,output_dir) mri = r"/Users/xueminzhu/Desktop/test/desikan_space-MNI152NLin6_res-2x2x2_reor_RAS_nores_aligned_atlas.nii.gz" atlas = r"/Users/xueminzhu/Desktop/test/nodif_B0.nii.gz" output_dir = r"/Users/xueminzhu/Desktop/test" reg_mri_pngs(mri, atlas,output_dir) bad_example = r"/Users/xueminzhu/Desktop/test/example.png" display(Image.open(bad_example)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Saving figures Step4: Generating the qa overlay figures Step5: Input and Graphs Step6: This is a good example of well-registed images where pink and green are used to represent the registered output and reference image. The registration step of this image is first using function flirt and then fnirt in FSL. Step7: This is a final image of the registration step where pink and green are used to represent registered output and reference image.
9,540
<ASSISTANT_TASK:> Python Code: ! pip install --quiet -U pltvid # simple animation support by parrt import numpy as np import pandas as pd from sklearn.linear_model import LinearRegression, Ridge, Lasso, LogisticRegression from sklearn.tree import DecisionTreeClassifier, DecisionTreeRegressor from sklearn.ensemble import RandomForestClassifier, RandomForestRegressor from sklearn.datasets import load_boston, load_iris, load_wine, load_digits, \ load_breast_cancer, load_diabetes from sklearn.model_selection import train_test_split from sklearn.metrics import confusion_matrix, precision_score, recall_score import matplotlib.pyplot as plt from matplotlib.collections import PatchCollection %config InlineBackend.figure_format = 'svg' # Looks MUCH better than retina # %config InlineBackend.figure_format = 'retina' from rfpimp import * # pip install rfpimp from sklearn import tree import dtreeviz from dtreeviz import clfviz wine = load_wine() X = wine.data X = X[:,[12,6]] y = wine.target rf = RandomForestClassifier(n_estimators=50, min_samples_leaf=20, n_jobs=-1) rf.fit(X, y) import pltvid dpi = 300 camera = pltvid.Capture(dpi=dpi) max = 10 for depth in range(1,max+1): t = DecisionTreeClassifier(max_depth=depth) t.fit(X,y) fig,ax = plt.subplots(1,1, figsize=(4,3.5), dpi=dpi) clfviz(t, X, y, feature_names=['proline', 'flavanoid'], target_name="wine", ax=ax) plt.title(f"Wine tree depth {depth}") plt.tight_layout() if depth>=max: camera.snap(8) else: camera.snap() # plt.show() camera.save("wine-dtree-maxdepth.png", duration=500) # animated png def smiley(n = 1000): # mouth x1 = np.random.normal(1.0,.2,n).reshape(-1,1) x2 = np.random.normal(0.4,.05,n).reshape(-1,1) cl = np.full(shape=(n,1), fill_value=0, dtype=int) d = np.hstack([x1,x2,cl]) data = d # left eye x1 = np.random.normal(.7,.2,n).reshape(-1,1) x2 = x1 + .3 + np.random.normal(0,.1,n).reshape(-1,1) cl = np.full(shape=(n,1), fill_value=1, dtype=int) d = np.hstack([x1,x2,cl]) data = np.vstack([data, d]) # right eye x1 = np.random.normal(1.3,.2,n).reshape(-1,1) x2 = np.random.normal(0.8,.1,n).reshape(-1,1) x2 = x1 - .5 + .3 + np.random.normal(0,.1,n).reshape(-1,1) cl = np.full(shape=(n,1), fill_value=2, dtype=int) d = np.hstack([x1,x2,cl]) data = np.vstack([data, d]) # face outline noise = np.random.normal(0,.1,n).reshape(-1,1) x1 = np.linspace(0,2,n).reshape(-1,1) x2 = (x1-1)**2 + noise cl = np.full(shape=(n,1), fill_value=3, dtype=int) d = np.hstack([x1,x2,cl]) data = np.vstack([data, d]) df = pd.DataFrame(data, columns=['x1','x2','class']) return df import pltvid df = smiley(n=100) X = df[['x1','x2']] y = df['class'] rf = RandomForestClassifier(n_estimators=10, min_samples_leaf=1, n_jobs=-1) rf.fit(X, y) dpi = 300 camera = pltvid.Capture(dpi=dpi) max = 100 tree_sizes = [*range(1,10)]+[*range(10,max+1,5)] for nt in tree_sizes: np.random.seed(1) # use same bagging sets for animation rf = RandomForestClassifier(n_estimators=nt, min_samples_leaf=1, n_jobs=-1) rf.fit(X, y) fig,ax = plt.subplots(1,1, figsize=(5,3.5), dpi=dpi) clfviz(rf, X.values, y, feature_names=['x1', 'x2'], ntiles=70, dot_w=15, boundary_markersize=.4, ax=ax) plt.title(f"Synthetic dataset, {nt} trees") plt.tight_layout() if nt>=tree_sizes[-1]: camera.snap(5) else: camera.snap() # plt.show() camera.save("smiley-numtrees.png", duration=500) import pltvid df = smiley(n=100) # more stark changes with fewer X = df[['x1','x2']] y = df['class'] dpi = 300 camera = pltvid.Capture(dpi=dpi) max = 10 for depth in range(1,max+1): t = DecisionTreeClassifier(max_depth=depth) t.fit(X,y) fig,ax = plt.subplots(1,1, figsize=(5,3.5), dpi=dpi) clfviz(t, X, y, feature_names=['x1', 'x2'], target_name="class", colors={'scatter_edge': 'black', 'tesselation_alpha':.6}, ax=ax) plt.title(f"Synthetic dataset, tree depth {depth}") plt.tight_layout() if depth>=max: camera.snap(8) else: camera.snap() # plt.show() camera.save("smiley-dtree-maxdepth.png", duration=500) import pltvid df = smiley(n=100) X = df[['x1','x2']] y = df['class'] dpi = 300 camera = pltvid.Capture(dpi=dpi) max = 20 for leafsz in range(1,max+1): t = DecisionTreeClassifier(min_samples_leaf=leafsz) t.fit(X,y) fig,ax = plt.subplots(1,1, figsize=(5,3.5), dpi=dpi) clfviz(t, X, y, feature_names=['x1', 'x2'], target_name="class", colors={'scatter_edge': 'black', 'tesselation_alpha':.4}, ax=ax) plt.title(f"Synthetic dataset, {leafsz} samples/leaf") plt.tight_layout() if leafsz>=max: camera.snap(8) else: camera.snap() # plt.show() camera.save("smiley-dtree-minsamplesleaf.png", duration=500) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Wine data set Step2: Synthetic data set Step3: Animate num trees in RF Step4: Animate decision tree max depth Step5: Animate decision tree min samples per leaf
9,541
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'awi', 'awi-cm-1-0-mr', 'land') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_atmosphere_flux_exchanges') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "water" # "energy" # "carbon" # "nitrogen" # "phospherous" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.atmospheric_coupling_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_cover') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "bare soil" # "urban" # "lake" # "land ice" # "lake ice" # "vegetated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_cover_change') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.energy') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.water') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.carbon') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.timestep_dependent_on_atmosphere') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.timestepping_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.horizontal.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.horizontal.matches_atmosphere_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.vertical.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.vertical.total_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_water_coupling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.number_of_soil layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.structure') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.texture') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.organic_matter') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.water_table') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.continuously_varying_soil_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.soil_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.prognostic') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.functions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation type" # "soil humidity" # "vegetation state" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.direct_diffuse') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "distinction between direct and diffuse albedo" # "no distinction between direct and diffuse albedo" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.number_of_wavelength_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.vertical_discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.number_of_ground_water_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.lateral_connectivity') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "perfect connectivity" # "Darcian flow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Bucket" # "Force-restore" # "Choisnel" # "Explicit diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.number_of_ground_ice_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.ice_storage_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.permafrost') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.drainage.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.drainage.types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Gravity drainage" # "Horton mechanism" # "topmodel-based" # "Dunne mechanism" # "Lateral subsurface flow" # "Baseflow from groundwater" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.vertical_discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.heat_storage') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Force-restore" # "Explicit diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "soil moisture freeze-thaw" # "coupling with snow temperature" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.number_of_snow_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.density') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.water_equivalent') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.heat_content') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.temperature') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.liquid_water_content') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_cover_fractions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "ground snow fraction" # "vegetation snow fraction" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "snow interception" # "snow melting" # "snow freezing" # "blowing snow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_albedo.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "prescribed" # "constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_albedo.functions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation type" # "snow age" # "snow density" # "snow grain type" # "aerosol deposition" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.dynamic_vegetation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation types" # "biome types" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "broadleaf tree" # "needleleaf tree" # "C3 grass" # "C4 grass" # "vegetated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biome_types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "evergreen needleleaf forest" # "evergreen broadleaf forest" # "deciduous needleleaf forest" # "deciduous broadleaf forest" # "mixed forest" # "woodland" # "wooded grassland" # "closed shrubland" # "opne shrubland" # "grassland" # "cropland" # "wetlands" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_time_variation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed (not varying)" # "prescribed (varying from files)" # "dynamical (varying from simulation)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_map') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.interception') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.phenology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic (vegetation map)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.phenology_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.leaf_area_index') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prescribed" # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.leaf_area_index_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biomass') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biomass_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biogeography') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biogeography_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.stomatal_resistance') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "light" # "temperature" # "water availability" # "CO2" # "O3" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.stomatal_resistance_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.number_of_surface_temperatures') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.evaporation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "alpha" # "beta" # "combined" # "Monteith potential evaporation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "transpiration" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.anthropogenic_carbon') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "grand slam protocol" # "residence time" # "decay time" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.forest_stand_dynamics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.photosynthesis.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.autotrophic_respiration.maintainance_respiration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.autotrophic_respiration.growth_respiration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.allocation_bins') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "leaves + stems + roots" # "leaves + stems + roots (leafy + woody)" # "leaves + fine roots + coarse roots + stems" # "whole plant (no distinction)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.allocation_fractions') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed" # "function of vegetation type" # "function of plant allometry" # "explicitly calculated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.phenology.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.mortality.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.is_permafrost_included') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.emitted_greenhouse_gases') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.impact_on_soil_properties') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.grid_inherited_from_land_surface') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.grid_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.number_of_reservoirs') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.water_re_evaporation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "flood plains" # "irrigation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.coupled_to_atmosphere') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.coupled_to_land') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.quantities_exchanged_with_atmosphere') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.basin_flow_direction_map') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "present day" # "adapted for other periods" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.flooding') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.oceanic_discharge.discharge_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "direct (large rivers)" # "diffuse" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.oceanic_discharge.quantities_transported') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.coupling_with_rivers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.quantities_exchanged_with_rivers') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.vertical_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.ice_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.dynamics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "No lake dynamics" # "vertical" # "horizontal" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.dynamic_lake_extent') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.endorheic_basins') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.wetlands.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Description Step7: 1.4. Land Atmosphere Flux Exchanges Step8: 1.5. Atmospheric Coupling Treatment Step9: 1.6. Land Cover Step10: 1.7. Land Cover Change Step11: 1.8. Tiling Step12: 2. Key Properties --&gt; Conservation Properties Step13: 2.2. Water Step14: 2.3. Carbon Step15: 3. Key Properties --&gt; Timestepping Framework Step16: 3.2. Time Step Step17: 3.3. Timestepping Method Step18: 4. Key Properties --&gt; Software Properties Step19: 4.2. Code Version Step20: 4.3. Code Languages Step21: 5. Grid Step22: 6. Grid --&gt; Horizontal Step23: 6.2. Matches Atmosphere Grid Step24: 7. Grid --&gt; Vertical Step25: 7.2. Total Depth Step26: 8. Soil Step27: 8.2. Heat Water Coupling Step28: 8.3. Number Of Soil layers Step29: 8.4. Prognostic Variables Step30: 9. Soil --&gt; Soil Map Step31: 9.2. Structure Step32: 9.3. Texture Step33: 9.4. Organic Matter Step34: 9.5. Albedo Step35: 9.6. Water Table Step36: 9.7. Continuously Varying Soil Depth Step37: 9.8. Soil Depth Step38: 10. Soil --&gt; Snow Free Albedo Step39: 10.2. Functions Step40: 10.3. Direct Diffuse Step41: 10.4. Number Of Wavelength Bands Step42: 11. Soil --&gt; Hydrology Step43: 11.2. Time Step Step44: 11.3. Tiling Step45: 11.4. Vertical Discretisation Step46: 11.5. Number Of Ground Water Layers Step47: 11.6. Lateral Connectivity Step48: 11.7. Method Step49: 12. Soil --&gt; Hydrology --&gt; Freezing Step50: 12.2. Ice Storage Method Step51: 12.3. Permafrost Step52: 13. Soil --&gt; Hydrology --&gt; Drainage Step53: 13.2. Types Step54: 14. Soil --&gt; Heat Treatment Step55: 14.2. Time Step Step56: 14.3. Tiling Step57: 14.4. Vertical Discretisation Step58: 14.5. Heat Storage Step59: 14.6. Processes Step60: 15. Snow Step61: 15.2. Tiling Step62: 15.3. Number Of Snow Layers Step63: 15.4. Density Step64: 15.5. Water Equivalent Step65: 15.6. Heat Content Step66: 15.7. Temperature Step67: 15.8. Liquid Water Content Step68: 15.9. Snow Cover Fractions Step69: 15.10. Processes Step70: 15.11. Prognostic Variables Step71: 16. Snow --&gt; Snow Albedo Step72: 16.2. Functions Step73: 17. Vegetation Step74: 17.2. Time Step Step75: 17.3. Dynamic Vegetation Step76: 17.4. Tiling Step77: 17.5. Vegetation Representation Step78: 17.6. Vegetation Types Step79: 17.7. Biome Types Step80: 17.8. Vegetation Time Variation Step81: 17.9. Vegetation Map Step82: 17.10. Interception Step83: 17.11. Phenology Step84: 17.12. Phenology Description Step85: 17.13. Leaf Area Index Step86: 17.14. Leaf Area Index Description Step87: 17.15. Biomass Step88: 17.16. Biomass Description Step89: 17.17. Biogeography Step90: 17.18. Biogeography Description Step91: 17.19. Stomatal Resistance Step92: 17.20. Stomatal Resistance Description Step93: 17.21. Prognostic Variables Step94: 18. Energy Balance Step95: 18.2. Tiling Step96: 18.3. Number Of Surface Temperatures Step97: 18.4. Evaporation Step98: 18.5. Processes Step99: 19. Carbon Cycle Step100: 19.2. Tiling Step101: 19.3. Time Step Step102: 19.4. Anthropogenic Carbon Step103: 19.5. Prognostic Variables Step104: 20. Carbon Cycle --&gt; Vegetation Step105: 20.2. Carbon Pools Step106: 20.3. Forest Stand Dynamics Step107: 21. Carbon Cycle --&gt; Vegetation --&gt; Photosynthesis Step108: 22. Carbon Cycle --&gt; Vegetation --&gt; Autotrophic Respiration Step109: 22.2. Growth Respiration Step110: 23. Carbon Cycle --&gt; Vegetation --&gt; Allocation Step111: 23.2. Allocation Bins Step112: 23.3. Allocation Fractions Step113: 24. Carbon Cycle --&gt; Vegetation --&gt; Phenology Step114: 25. Carbon Cycle --&gt; Vegetation --&gt; Mortality Step115: 26. Carbon Cycle --&gt; Litter Step116: 26.2. Carbon Pools Step117: 26.3. Decomposition Step118: 26.4. Method Step119: 27. Carbon Cycle --&gt; Soil Step120: 27.2. Carbon Pools Step121: 27.3. Decomposition Step122: 27.4. Method Step123: 28. Carbon Cycle --&gt; Permafrost Carbon Step124: 28.2. Emitted Greenhouse Gases Step125: 28.3. Decomposition Step126: 28.4. Impact On Soil Properties Step127: 29. Nitrogen Cycle Step128: 29.2. Tiling Step129: 29.3. Time Step Step130: 29.4. Prognostic Variables Step131: 30. River Routing Step132: 30.2. Tiling Step133: 30.3. Time Step Step134: 30.4. Grid Inherited From Land Surface Step135: 30.5. Grid Description Step136: 30.6. Number Of Reservoirs Step137: 30.7. Water Re Evaporation Step138: 30.8. Coupled To Atmosphere Step139: 30.9. Coupled To Land Step140: 30.10. Quantities Exchanged With Atmosphere Step141: 30.11. Basin Flow Direction Map Step142: 30.12. Flooding Step143: 30.13. Prognostic Variables Step144: 31. River Routing --&gt; Oceanic Discharge Step145: 31.2. Quantities Transported Step146: 32. Lakes Step147: 32.2. Coupling With Rivers Step148: 32.3. Time Step Step149: 32.4. Quantities Exchanged With Rivers Step150: 32.5. Vertical Grid Step151: 32.6. Prognostic Variables Step152: 33. Lakes --&gt; Method Step153: 33.2. Albedo Step154: 33.3. Dynamics Step155: 33.4. Dynamic Lake Extent Step156: 33.5. Endorheic Basins Step157: 34. Lakes --&gt; Wetlands
9,542
<ASSISTANT_TASK:> Python Code: import os import zipfile import numpy as np import pandas as pd from sklearn import linear_model import matplotlib as mpl import matplotlib.pyplot as plt import seaborn as sns sns.set_style('darkgrid') %matplotlib inline # Put files in current direction into a list files_list = [f for f in os.listdir('.') if os.path.isfile(f)] # Filenames of unzipped files unzip_files = ['kc_house_data.csv','wk3_kc_house_set_1_data.csv', 'wk3_kc_house_set_2_data.csv', 'wk3_kc_house_set_3_data.csv', 'wk3_kc_house_set_4_data.csv', 'wk3_kc_house_test_data.csv', 'wk3_kc_house_train_data.csv', 'wk3_kc_house_valid_data.csv', 'wk3_kc_house_train_valid_shuffled.csv'] # If upzipped file not in files_list, unzip the file for filename in unzip_files: if filename not in files_list: zip_file = filename + '.zip' unzipping = zipfile.ZipFile(zip_file) unzipping.extractall() unzipping.close def polynomial_dataframe(feature, degree): # feature is pandas.Series type # assume that degree >= 1 # initialize the dataframe: poly_dataframe = pd.DataFrame() # and set poly_dataframe['power_1'] equal to the passed feature poly_dataframe['power_1'] = feature # first check if degree > 1 if degree > 1: # then loop over the remaining degrees: for power in range(2, degree+1): # first we'll give the column a name: name = 'power_' + str(power) # assign poly_dataframe[name] to be feature^power; use apply(*) poly_dataframe[name] = poly_dataframe['power_1'].apply(lambda x: x**power) return poly_dataframe # Dictionary with the correct dtypes for the DataFrame columns dtype_dict = {'bathrooms':float, 'waterfront':int, 'sqft_above':int, 'sqft_living15':float, 'grade':int, 'yr_renovated':int, 'price':float, 'bedrooms':float, 'zipcode':str, 'long':float, 'sqft_lot15':float, 'sqft_living':float, 'floors':str, 'condition':int, 'lat':float, 'date':str, 'sqft_basement':int, 'yr_built':int, 'id':str, 'sqft_lot':int, 'view':int} sales = pd.read_csv('kc_house_data.csv', dtype = dtype_dict) sales = sales.sort_values(['sqft_living', 'price']) sales[['sqft_living', 'price']].head() plt.figure(figsize=(8,6)) plt.plot(sales['sqft_living'], sales['price'],'.') plt.xlabel('Living Area (ft^2)', fontsize=16) plt.ylabel('House Price ($)', fontsize=16) plt.title('King County, Seattle House Price Data', fontsize=18) plt.axis([0.0, 14000.0, 0.0, 8000000.0]) plt.show() # Bulding dataframe with 15 polynomial features poly15_data = polynomial_dataframe(sales['sqft_living'], 15) l2_small_penalty = 1e-5 model = linear_model.Ridge(alpha=l2_small_penalty, normalize=True) model.fit(poly15_data, sales['price']) print 'Weight for power_1 feature is: %.2f' % (model.coef_[0]) set_1 = pd.read_csv('wk3_kc_house_set_1_data.csv', dtype=dtype_dict) set_2 = pd.read_csv('wk3_kc_house_set_2_data.csv', dtype=dtype_dict) set_3 = pd.read_csv('wk3_kc_house_set_3_data.csv', dtype=dtype_dict) set_4 = pd.read_csv('wk3_kc_house_set_4_data.csv', dtype=dtype_dict) # Putting data and keys in a list for looping data_list = [set_1, set_2, set_3, set_4] key_list = ['set_1', 'set_2', 'set_3', 'set_4'] # model_poly_deg is a dict which holds all the regression models for the ith polynomial fit poly_15_dframe_dict = {} models_poly_15_dict = {} # First, learn models with a really small L2 penalty l2_small_penalty = 1e-9 # Looping over polynomial features from 1-15 for key, dframe in zip(key_list, data_list): # Entering each dataframe returned from polynomial_dataframe function into a dict # Then, saving col_names into a list to do regression w/ these features. Then, adding price column to dataframe poly_15_dframe_dict[key] = polynomial_dataframe(dframe['sqft_living'], 15) # Adding regression models to dicts models_poly_15_dict[key] = linear_model.Ridge(alpha=l2_small_penalty, normalize=True) models_poly_15_dict[key].fit( poly_15_dframe_dict[key], dframe['price'] ) plt.figure(figsize=(8,6)) plt.plot(sales['sqft_living'], sales['price'],'.', label= 'House Price Data') plt.hold(True) # for i, key in enumerate(key_list): leg_label = 'Model ' + str(i+1) plt.plot( poly_15_dframe_dict[key]['power_1'], models_poly_15_dict[key].predict(poly_15_dframe_dict[key]), '-', label = leg_label ) # plt.hold(False) plt.legend(loc='upper left', fontsize=16) plt.xlabel('Living Area (ft^2)', fontsize=16) plt.ylabel('House Price ($)', fontsize=16) plt.title('4 Diff. 15th Deg. Polynomial Regr. Models, Small L2 Penalty', fontsize=16) plt.axis([0.0, 14000.0, 0.0, 8000000.0]) plt.show() power_l_coeff_list = [] for key in key_list: power_l_coeff_list.append( models_poly_15_dict[key].coef_[0] ) print 'Smallest power_1 weight with small L2 penalty is: %.2f' %( min(power_l_coeff_list)) print 'Largest power_1 weight with small L2 penalty is: %.2f' %( max(power_l_coeff_list)) # model_poly_deg is a dict which holds all the regression models for the ith polynomial fit poly_15_dframe_dict = {} models_poly_15_dict = {} # Re-learn models with a large L2 penalty l2_large_penalty=1.23e2 # Looping over polynomial features from 1-15 for key, dframe in zip(key_list, data_list): # Entering each dataframe returned from polynomial_dataframe function into a dict # Then, saving col_names into a list to do regression w/ these features. Then, adding price column to dataframe poly_15_dframe_dict[key] = polynomial_dataframe(dframe['sqft_living'], 15) # Adding regression models to dicts models_poly_15_dict[key] = linear_model.Ridge(alpha=l2_large_penalty, normalize=True) models_poly_15_dict[key].fit( poly_15_dframe_dict[key], dframe['price'] ) plt.figure(figsize=(8,6)) plt.plot(sales['sqft_living'], sales['price'],'.', label= 'House Price Data') plt.hold(True) # for i, key in enumerate(key_list): leg_label = 'Model ' + str(i+1) plt.plot( poly_15_dframe_dict[key]['power_1'], models_poly_15_dict[key].predict(poly_15_dframe_dict[key]), '-', label = leg_label ) # plt.hold(False) plt.legend(loc='upper left', fontsize=16) plt.xlabel('Living Area (ft^2)', fontsize=16) plt.ylabel('House Price ($)', fontsize=16) plt.title('4 Diff. 15th Deg. Polynomial Regr. Models, Large L2 Penalty', fontsize=16) plt.axis([0.0, 14000.0, 0.0, 8000000.0]) plt.show() power_l_coeff_list = [] for key in key_list: power_l_coeff_list.append( models_poly_15_dict[key].coef_[0] ) print 'Smallest power_1 weight with large L2 penalty is: %.2f' %( min(power_l_coeff_list)) print 'Largest power_1 weight with large L2 penalty is: %.2f' %( max(power_l_coeff_list)) train_valid_shuffled = pd.read_csv('wk3_kc_house_train_valid_shuffled.csv', dtype=dtype_dict) test = pd.read_csv('wk3_kc_house_test_data.csv', dtype=dtype_dict) n = len(train_valid_shuffled) k = 10 # 10-fold cross-validation for i in xrange(k): start = (n*i)/k end = (n*(i+1))/k-1 print i, (start, end) train_valid_shuffled[0:10] # rows 0 to 9 i = 3 start_ind = (n*3)/k end_ind = (n*(3+1))/k-1 validation4 = train_valid_shuffled[ start_ind : end_ind + 1] print int(round(validation4['price'].mean(), 0)) n = len(train_valid_shuffled) first_two = train_valid_shuffled[0:2] last_two = train_valid_shuffled[n-2:n] print first_two.append(last_two) i = 3 k = 10 n = len(train_valid_shuffled) start_ind = (n*3)/k end_ind = (n*(3+1))/k-1 train4 = train_valid_shuffled[0:start].append(train_valid_shuffled[end+1:n]) print int(round(train4['price'].mean(), 0)) def k_fold_cross_validation(k, l2_penalty, data, output_vals): # Defining n as the number of observations and an empty list to store the k cross_validation errors n = len(data) cv_error_list = [] # Looping to compute k slices. Computing the array index to get the kth_slice. for i in range(k): # Getting the starting and ending index of the kth slice start = (n*i)/k end = (n*(i+1))/k-1 # Using start and end to split data into cross-validation and training set cv_set = data[start: end + 1] training_set = data[0:start].append(data[end+1:n]) # Using the training data to create a linear regression model model_train_data = linear_model.Ridge(alpha=l2_penalty, normalize=True) model_train_data.fit( data, output_vals ) # Computing np.array with predictions from the model we learn predictions = model_train_data.predict(data) # Computing the error on the cross-validation set RSS_cv_set = sum( (predictions - output_vals)**2 ) cv_error_list.append(RSS_cv_set) # Return the average validation error return sum(cv_error_list)/float(len(cv_error_list)) l2_penalty_list = np.logspace(3, 9, num=26) poly_15_dframe = polynomial_dataframe(train_valid_shuffled['sqft_living'], 15) output_values = train_valid_shuffled['price'] l2_RSS_list = [] for l2_pen in l2_penalty_list: RSS_error = k_fold_cross_validation(10, l2_pen, poly_15_dframe, output_values) l2_RSS_list.append( (RSS_error, l2_pen) ) print 'Minimum value for RSS error is : %.2e' %min(l2_RSS_list)[0] print 'L2 penalty for this RSS error is: %.2e' %min(l2_RSS_list)[1] # Putting all L2 penalties and RSS errors for plotting L2_plot_list = [] RSS_plot_list = [] for entry in l2_RSS_list: L2_plot_list.append(entry[1]) RSS_plot_list.append(entry[0]) # Plot the l2_penalty values in the x axis and the cross-validation error in the y axis. # Using plt.xscale('log') will make your plot more intuitive. plt.figure(figsize=(8,6)) plt.plot(L2_plot_list, RSS_plot_list,'-') plt.xscale('log') # plt.xlabel('L2 penalty ' + r'$(\lambda)$', fontsize=16) plt.ylabel('Average Cross-Validation RSS', fontsize=16) plt.title('Cross-Validation RSS vs. L2 Penalty', fontsize=16) # plt.show() min_L2_pen = min(l2_RSS_list)[1] # Loading the training set data and defining the dataframe w/ 15 polynomial features train_data = pd.read_csv('wk3_kc_house_train_data.csv', dtype = dtype_dict) train_data = train_data.sort_values(['sqft_living', 'price']) poly_15_train_data = polynomial_dataframe(train_data['sqft_living'], 15) # Training a linear regression model with L2 penalty that gave the smallest RSS error model_train_data = linear_model.Ridge(alpha=min_L2_pen, normalize=True) model_train_data.fit( poly_15_train_data, train_data['price'] ) # Now, loading the test data and defining the dataframe w/ 15 polynomial features test_data = pd.read_csv('wk3_kc_house_test_data.csv', dtype = dtype_dict) poly_15_test_data = polynomial_dataframe(test_data['sqft_living'], 15) # Using the weights learning from the training data to calculate the predictions on the test data predictions = model_train_data.predict(poly_15_test_data) # Computing the RSS on the test data RSS_test_set = sum( (predictions - test_data['price'])**2 ) print 'RSS on test data with min_L2_pen: %.2e' %(RSS_test_set) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Unzipping files with house sales data Step2: Polynomial regression, revisited Step3: Let's use matplotlib to visualize what a polynomial regression looks like on the house data. Step4: As in Week 3, we will use the sqft_living variable. For plotting purposes (connecting the dots), you'll need to sort by the values of sqft_living. For houses with identical square footage, we break the tie by their prices. Step5: Plotting the data we are working with Step6: Let us revisit the 15th-order polynomial model using the 'sqft_living' input. Generate polynomial features up to degree 15 using polynomial_dataframe() and fit a model with these features. When fitting the model, use an L2 penalty of 1e-5 Step7: Note Step8: Observe overfitting Step9: Next, fit a 15th degree polynomial on set_1, set_2, set_3, and set_4, using 'sqft_living' to predict prices. Print the weights and make a plot of the resulting model. Step10: Plotting the data and the 4 different 15 degree polynomials we learned from the data. Step11: The four curves should differ from one another a lot, as should the coefficients you learned. Step12: Ridge regression comes to rescue Step13: These curves should vary a lot less, now that you applied a high degree of regularization. Step14: Selecting an L2 penalty via cross-validation Step15: Once the data is shuffled, we divide it into equal segments. Each segment should receive n/k elements, where n is the number of observations in the training set and k is the number of segments. Since the segment 0 starts at index 0 and contains n/k elements, it ends at index (n/k)-1. The segment 1 starts where the segment 0 left off, at index (n/k). With n/k elements, the segment 1 ends at index (n*2/k)-1. Continuing in this fashion, we deduce that the segment i starts at index (n*i/k) and ends at (n*(i+1)/k)-1. Step16: Let us familiarize ourselves with array slicing with DataFrames. To extract a continuous slice from a DataFrame, use colon in square brackets. For instance, the following cell extracts rows 0 to 9 of train_valid_shuffled. Notice that the first index (0) is included in the slice but the last index (10) is omitted. Step17: Now let us extract individual segments with array slicing. Consider the scenario where we group the houses in the train_valid_shuffled dataframe into k=10 segments of roughly equal size, with starting and ending indices computed as above. Step18: To verify that we have the right elements extracted, run the following cell, which computes the average price of the fourth segment. When rounded to nearest whole number, the average should be $536,234. Step19: After designating one of the k segments as the validation set, we train a model using the rest of the data. To choose the remainder, we slice (0 Step20: Extract the remainder of the data after excluding fourth segment (segment 3) and assign the subset to train4. Step21: To verify that we have the right elements extracted, run the following cell, which computes the average price of the data with fourth segment excluded. When rounded to nearest whole number, the average should be $539,450. Step22: Now we are ready to implement k-fold cross-validation. Write a function that computes k validation errors by designating each of the k segments as the validation set. It accepts as parameters (i) k, (ii) l2_penalty, (iii) dataframe, (iv) name of output column (e.g. price) and (v) list of feature names. The function returns the average validation error using k segments as validation sets. Step23: Once we have a function to compute the average validation error for a model, we can write a loop to find the model that minimizes the average validation error. Write a loop that does the following Step24: QUIZ QUESTIONS Step25: You may find it useful to plot the k-fold cross-validation errors you have obtained to better understand the behavior of the method. Step26: Once you found the best value for the L2 penalty using cross-validation, it is important to retrain a final model on all of the training data using this value of l2_penalty. This way, your final model will be trained on the entire dataset. Step27: QUIZ QUESTION
9,543
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np import tensorflow as tf from tensorflow import keras import tensorflow_hub as hub from tensorflow.keras import layers import tensorflow_decision_forests as tfdf import matplotlib.pyplot as plt # Turn .csv files into pandas DataFrame's df = pd.read_csv( "https://raw.githubusercontent.com/IMvision12/Tweets-Classification-NLP/main/train.csv" ) print(df.head()) print(f"Training dataset shape: {df.shape}") df_shuffled = df.sample(frac=1, random_state=42) # Dropping id, keyword and location columns as these columns consists of mostly nan values # we will be using only text and target columns df_shuffled.drop(["id", "keyword", "location"], axis=1, inplace=True) df_shuffled.reset_index(inplace=True, drop=True) print(df_shuffled.head()) print(df_shuffled.info()) print( "Total Number of disaster and non-disaster tweets: " f"{df_shuffled.target.value_counts()}" ) for index, example in df_shuffled[:5].iterrows(): print(f"Example #{index}") print(f"\tTarget : {example['target']}") print(f"\tText : {example['text']}") test_df = df_shuffled.sample(frac=0.1, random_state=42) train_df = df_shuffled.drop(test_df.index) print(f"Using {len(train_df)} samples for training and {len(test_df)} for validation") print(train_df["target"].value_counts()) print(test_df["target"].value_counts()) def create_dataset(dataframe): dataset = tf.data.Dataset.from_tensor_slices( (df["text"].to_numpy(), df["target"].to_numpy()) ) dataset = dataset.batch(100) dataset = dataset.prefetch(tf.data.AUTOTUNE) return dataset train_ds = create_dataset(train_df) test_ds = create_dataset(test_df) sentence_encoder_layer = hub.KerasLayer( "https://tfhub.dev/google/universal-sentence-encoder/4" ) inputs = layers.Input(shape=(), dtype=tf.string) outputs = sentence_encoder_layer(inputs) preprocessor = keras.Model(inputs=inputs, outputs=outputs) model_1 = tfdf.keras.GradientBoostedTreesModel(preprocessing=preprocessor) model_2 = tfdf.keras.GradientBoostedTreesModel() # Compiling model_1 model_1.compile(metrics=["Accuracy", "Recall", "Precision", "AUC"]) # Here we do not specify epochs as, TF-DF trains exactly one epoch of the dataset model_1.fit(train_ds) # Compiling model_2 model_2.compile(metrics=["Accuracy", "Recall", "Precision", "AUC"]) # Here we do not specify epochs as, TF-DF trains exactly one epoch of the dataset model_2.fit(train_ds) logs_1 = model_1.make_inspector().training_logs() print(logs_1) logs_2 = model_2.make_inspector().training_logs() print(logs_2) print("model_1 summary: ") print(model_1.summary()) print() print("model_2 summary: ") print(model_2.summary()) def plot_curve(logs): plt.figure(figsize=(12, 4)) plt.subplot(1, 2, 1) plt.plot([log.num_trees for log in logs], [log.evaluation.accuracy for log in logs]) plt.xlabel("Number of trees") plt.ylabel("Accuracy") plt.subplot(1, 2, 2) plt.plot([log.num_trees for log in logs], [log.evaluation.loss for log in logs]) plt.xlabel("Number of trees") plt.ylabel("Loss") plt.show() plot_curve(logs_1) plot_curve(logs_2) results = model_1.evaluate(test_ds, return_dict=True, verbose=0) print("model_1 Evaluation: \n") for name, value in results.items(): print(f"{name}: {value:.4f}") results = model_2.evaluate(test_ds, return_dict=True, verbose=0) print("model_2 Evaluation: \n") for name, value in results.items(): print(f"{name}: {value:.4f}") test_df.reset_index(inplace=True, drop=True) for index, row in test_df.iterrows(): text = tf.expand_dims(row["text"], axis=0) preds = model_1.predict_step(text) preds = tf.squeeze(tf.round(preds)) print(f"Text: {row['text']}") print(f"Prediction: {int(preds)}") print(f"Ground Truth : {row['target']}") if index == 10: break <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Get the data Step2: The dataset includes 7613 samples with 5 columns Step3: Shuffling and dropping unnecessary columns Step4: Printing information about the shuffled dataframe Step5: Total number of "disaster" and "non-disaster" tweets Step6: Let's preview a few samples Step7: Splitting dataset into training and test sets Step8: Total number of "disaster" and "non-disaster" tweets in the training data Step9: Total number of "disaster" and "non-disaster" tweets in the test data Step10: Convert data to a tf.data.Dataset Step11: Downloading pretrained embeddings Step12: Creating our models Step13: Building model_2 Step14: Train the models Step15: Prints training logs of model_1 Step16: Prints training logs of model_2 Step17: The model.summary() method prints a variety of information about your decision tree Step18: Plotting training an logs Step19: Evaluating on test data Step20: Predicting on validation data
9,544
<ASSISTANT_TASK:> Python Code: df = pd.read_csv("../data/coal_prod_cleaned.csv") df.head() df.shape df.columns qgrid_widget = qgrid.show_grid( df[["Year", "Mine_State", "Labor_Hours", "Production_short_tons"]], show_toolbar=True, ) qgrid_widget df2 = df.groupby('Mine_State').sum() df3 = df.groupby('Mine_State').sum() df2.loc['Wyoming', 'Production_short_tons'] = 5.181732e+08 # have to run the next line then restart your kernel # !cd ../insight; python setup.py develop %aimport insight.plotting insight.plotting.plot_prod_vs_hours(df2, color_index=1) insight.plotting.plot_prod_vs_hours(df3, color_index=0) def plot_prod_vs_hours( df, color_index=0, output_file="../img/production-vs-hours-worked.png" ): fig, ax = plt.subplots(figsize=(10, 8)) sns.regplot( df["Labor_Hours"], df["Production_short_tons"], ax=ax, color=sns.color_palette()[color_index], ) ax.set_xlabel("Labor Hours Worked") ax.set_ylabel("Total Amount Produced") x = ax.set_xlim(-9506023.213266129, 204993853.21326613) y = ax.set_ylim(-51476801.43653282, 746280580.4034251) fig.tight_layout() fig.savefig(output_file) plot_prod_vs_hours(df2, color_index=0) plot_prod_vs_hours(df3, color_index=1) # make a change via qgrid df3 = qgrid_widget.get_changed_df() qgrid_widget = qgrid.show_grid( df2[["Year", "Labor_Hours", "Production_short_tons"]], show_toolbar=True, ) qgrid_widget <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Github
9,545
<ASSISTANT_TASK:> Python Code: # Copyright 2019 The TensorFlow Hub Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== #@title MIT License # # Copyright (c) 2017 François Chollet # # Permission is hereby granted, free of charge, to any person obtaining a # copy of this software and associated documentation files (the "Software"), # to deal in the Software without restriction, including without limitation # the rights to use, copy, modify, merge, publish, distribute, sublicense, # and/or sell copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL # THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING # FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER # DEALINGS IN THE SOFTWARE. import numpy as np import tensorflow as tf import tensorflow_hub as hub import tensorflow_datasets as tfds import matplotlib.pyplot as plt print("Version: ", tf.__version__) print("Eager mode: ", tf.executing_eagerly()) print("Hub version: ", hub.__version__) print("GPU is", "available" if tf.config.list_physical_devices('GPU') else "NOT AVAILABLE") train_data, test_data = tfds.load(name="imdb_reviews", split=["train", "test"], batch_size=-1, as_supervised=True) train_examples, train_labels = tfds.as_numpy(train_data) test_examples, test_labels = tfds.as_numpy(test_data) print("Training entries: {}, test entries: {}".format(len(train_examples), len(test_examples))) train_examples[:10] train_labels[:10] model = "https://tfhub.dev/google/nnlm-en-dim50/2" hub_layer = hub.KerasLayer(model, input_shape=[], dtype=tf.string, trainable=True) hub_layer(train_examples[:3]) model = tf.keras.Sequential() model.add(hub_layer) model.add(tf.keras.layers.Dense(16, activation='relu')) model.add(tf.keras.layers.Dense(1)) model.summary() model.compile(optimizer='adam', loss=tf.losses.BinaryCrossentropy(from_logits=True), metrics=[tf.metrics.BinaryAccuracy(threshold=0.0, name='accuracy')]) x_val = train_examples[:10000] partial_x_train = train_examples[10000:] y_val = train_labels[:10000] partial_y_train = train_labels[10000:] history = model.fit(partial_x_train, partial_y_train, epochs=40, batch_size=512, validation_data=(x_val, y_val), verbose=1) results = model.evaluate(test_examples, test_labels) print(results) history_dict = history.history history_dict.keys() acc = history_dict['accuracy'] val_acc = history_dict['val_accuracy'] loss = history_dict['loss'] val_loss = history_dict['val_loss'] epochs = range(1, len(acc) + 1) # "bo" is for "blue dot" plt.plot(epochs, loss, 'bo', label='Training loss') # b is for "solid blue line" plt.plot(epochs, val_loss, 'b', label='Validation loss') plt.title('Training and validation loss') plt.xlabel('Epochs') plt.ylabel('Loss') plt.legend() plt.show() plt.clf() # clear figure plt.plot(epochs, acc, 'bo', label='Training acc') plt.plot(epochs, val_acc, 'b', label='Validation acc') plt.title('Training and validation accuracy') plt.xlabel('Epochs') plt.ylabel('Accuracy') plt.legend() plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 映画レビューを使ったテキスト分類 Step2: IMDB データセットをダウンロードする Step3: データの観察 Step4: 最初の 10 個のサンプルを出力しましょう。 Step5: 最初の 10 個のラベルも出力しましょう。 Step6: モデルを構築する Step7: 今度は、完全なモデルを構築しましょう。 Step8: これらのレイヤーは、分類器を構成するため一列に積み重ねられます。 Step9: 検証セットを作成する Step10: モデルのトレーニング Step11: モデルを評価する Step12: このかなり単純なアプローチで、約 87% の正解率が達成されます。より高度なアプローチを使えば、95% に近づくでしょう。 Step13: トレーニングと検証中に監視されている各メトリックに対して 1 つずつ、計 4 つのエントリがあります。このエントリを使用して、トレーニングと検証の損失とトレーニングと検証の精度を比較したグラフを作成することができます。
9,546
<ASSISTANT_TASK:> Python Code: DON'T MODIFY ANYTHING IN THIS CELL import helper data_dir = './data/simpsons/moes_tavern_lines.txt' text = helper.load_data(data_dir) # Ignore notice, since we don't use it for analysing the data text = text[81:] view_sentence_range = (0, 40) DON'T MODIFY ANYTHING IN THIS CELL import numpy as np print('Dataset Stats') print('Roughly the number of unique words: {}'.format(len({word: None for word in text.split()}))) scenes = text.split('\n\n') print('Number of scenes: {}'.format(len(scenes))) sentence_count_scene = [scene.count('\n') for scene in scenes] print('Average number of sentences in each scene: {}'.format(np.average(sentence_count_scene))) sentences = [sentence for scene in scenes for sentence in scene.split('\n')] print('Number of lines: {}'.format(len(sentences))) word_count_sentence = [len(sentence.split()) for sentence in sentences] print('Average number of words in each line: {}'.format(np.average(word_count_sentence))) print() print('The sentences {} to {}:'.format(*view_sentence_range)) print('\n'.join(text.split('\n')[view_sentence_range[0]:view_sentence_range[1]])) import numpy as np import problem_unittests as tests def create_lookup_tables(text): Create lookup tables for vocabulary :param text: The text of tv scripts split into words :return: A tuple of dicts (vocab_to_int, int_to_vocab) vocab = set(text) vocab_to_int = { word: i for (i, word) in enumerate(vocab) } int_to_vocab = { i: word for (i, word) in enumerate(vocab) } return (vocab_to_int, int_to_vocab) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_create_lookup_tables(create_lookup_tables) PUNCT = { 'Period': '.', 'Comma': ',', 'Quotation': '"', 'Semicolon': ';', 'Exclamation': '!', 'Question': '?', 'LeftParen': '(', 'RightParen': ')', 'Dash': '--', 'Return': '\n' } def token_lookup(): Generate a dict to turn punctuation into a token. :return: Tokenize dictionary where the key is the punctuation and the value is the token lookup = {} for (punc, token) in PUNCT.items(): symbol = ''.join(['||', punc, '||']) lookup[token] = symbol return lookup DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_tokenize(token_lookup) DON'T MODIFY ANYTHING IN THIS CELL # Preprocess Training, Validation, and Testing Data helper.preprocess_and_save_data(data_dir, token_lookup, create_lookup_tables) DON'T MODIFY ANYTHING IN THIS CELL import helper import numpy as np import problem_unittests as tests int_text, vocab_to_int, int_to_vocab, token_dict = helper.load_preprocess() DON'T MODIFY ANYTHING IN THIS CELL from distutils.version import LooseVersion import warnings import tensorflow as tf # Check TensorFlow Version assert LooseVersion(tf.__version__) >= LooseVersion('1.0'), 'Please use TensorFlow version 1.0 or newer' print('TensorFlow Version: {}'.format(tf.__version__)) # Check for a GPU if not tf.test.gpu_device_name(): warnings.warn('No GPU found. Please use a GPU to train your neural network.') else: print('Default GPU Device: {}'.format(tf.test.gpu_device_name())) def get_inputs(): Create TF Placeholders for input, targets, and learning rate. :return: Tuple (input, targets, learning rate) input = tf.placeholder(tf.int32, [None, None], name='input') targets = tf.placeholder(tf.int32, [None, None], name='targets') learning_rate = tf.placeholder(tf.float32, name='learning_rate') return (input, targets, learning_rate) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_inputs(get_inputs) def get_init_cell(batch_size, rnn_size): Create an RNN Cell and initialize it. :param batch_size: Size of batches :param rnn_size: Size of RNNs :return: Tuple (cell, initialize state) lstm_cell = tf.contrib.rnn.BasicLSTMCell(rnn_size) rnn_cell = tf.contrib.rnn.MultiRNNCell([lstm_cell]) zero_state = rnn_cell.zero_state(batch_size, tf.float32) initial_state = tf.identity(zero_state, name='initial_state') return (rnn_cell, initial_state) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_init_cell(get_init_cell) def get_embed(input_data, vocab_size, embed_dim): Create embedding for <input_data>. :param input_data: TF placeholder for text input. :param vocab_size: Number of words in vocabulary. :param embed_dim: Number of embedding dimensions :return: Embedded input. return tf.contrib.layers.embed_sequence( input_data, vocab_size=vocab_size, embed_dim=embed_dim ) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_embed(get_embed) def build_rnn(cell, inputs): Create a RNN using a RNN Cell :param cell: RNN Cell :param inputs: Input text data :return: Tuple (Outputs, Final State) outputs, final_state = tf.nn.dynamic_rnn(cell, inputs, dtype=tf.float32) final_state = tf.identity(final_state, name='final_state') return (outputs, final_state) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_build_rnn(build_rnn) def build_nn(cell, rnn_size, input_data, vocab_size, embed_dim): Build part of the neural network :param cell: RNN cell :param rnn_size: Size of rnns :param input_data: Input data :param vocab_size: Vocabulary size :param embed_dim: Number of embedding dimensions :return: Tuple (Logits, FinalState) embedding = get_embed(input_data, vocab_size, embed_dim) rnn_output, rnn_state = build_rnn(cell, embedding) logits = tf.contrib.layers.fully_connected( rnn_output, vocab_size, activation_fn=None ) return (logits, rnn_state) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_build_nn(build_nn) def get_batches(int_text, batch_size, seq_length): Return batches of input and target :param int_text: Text with the words replaced by their ids :param batch_size: The size of batch :param seq_length: The length of sequence :return: Batches as a Numpy array batches = [] num_ids_per_batch = batch_size * seq_length num_batches = len(int_text) // num_ids_per_batch # the offset to use to determine the next sequence start index seq_offset = num_batches * seq_length # create the batches for batch_index in range(num_batches): batch = [[], []] inputs = batch[0] targets = batch[1] seq_start = batch_index * seq_length # create the sequences for this batch for seq_index in range(batch_size): seq_end = seq_start + seq_length # create the next input sequence for this batch input_seq = int_text[seq_start:seq_end] inputs.append(input_seq) # create the next target sequence for this batch target_seq = int_text[seq_start + 1 : seq_end + 1] # set the last target to be the first input of the first batch if batch_index == num_batches - 1 and seq_index == batch_size - 1: target_seq[-1] = batches[0][0][0][0] targets.append(target_seq) seq_start += seq_offset batches.append(batch) return np.array(batches) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_batches(get_batches) # Number of Epochs num_epochs = 200 # Batch Size batch_size = 256 # RNN Size rnn_size = 512 # Embedding Dimension Size embed_dim = 256 # Sequence Length seq_length = 16 # Learning Rate learning_rate = 0.01 # Show stats for every n number of batches show_every_n_batches = 128 DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE save_dir = './save' DON'T MODIFY ANYTHING IN THIS CELL from tensorflow.contrib import seq2seq train_graph = tf.Graph() with train_graph.as_default(): vocab_size = len(int_to_vocab) input_text, targets, lr = get_inputs() input_data_shape = tf.shape(input_text) cell, initial_state = get_init_cell(input_data_shape[0], rnn_size) logits, final_state = build_nn(cell, rnn_size, input_text, vocab_size, embed_dim) # Probabilities for generating words probs = tf.nn.softmax(logits, name='probs') # Loss function cost = seq2seq.sequence_loss( logits, targets, tf.ones([input_data_shape[0], input_data_shape[1]])) # Optimizer optimizer = tf.train.AdamOptimizer(lr) # Gradient Clipping gradients = optimizer.compute_gradients(cost) capped_gradients = [(tf.clip_by_value(grad, -1., 1.), var) for grad, var in gradients if grad is not None] train_op = optimizer.apply_gradients(capped_gradients) DON'T MODIFY ANYTHING IN THIS CELL batches = get_batches(int_text, batch_size, seq_length) with tf.Session(graph=train_graph) as sess: sess.run(tf.global_variables_initializer()) for epoch_i in range(num_epochs): state = sess.run(initial_state, {input_text: batches[0][0]}) for batch_i, (x, y) in enumerate(batches): feed = { input_text: x, targets: y, initial_state: state, lr: learning_rate} train_loss, state, _ = sess.run([cost, final_state, train_op], feed) # Show every <show_every_n_batches> batches if (epoch_i * len(batches) + batch_i) % show_every_n_batches == 0: print('Epoch {:>3} Batch {:>4}/{} train_loss = {:.3f}'.format( epoch_i, batch_i, len(batches), train_loss)) # Save Model saver = tf.train.Saver() saver.save(sess, save_dir) print('Model Trained and Saved') DON'T MODIFY ANYTHING IN THIS CELL # Save parameters for checkpoint helper.save_params((seq_length, save_dir)) DON'T MODIFY ANYTHING IN THIS CELL import tensorflow as tf import numpy as np import helper import problem_unittests as tests _, vocab_to_int, int_to_vocab, token_dict = helper.load_preprocess() seq_length, load_dir = helper.load_params() def get_tensors(loaded_graph): Get input, initial state, final state, and probabilities tensor from <loaded_graph> :param loaded_graph: TensorFlow graph loaded from file :return: Tuple (InputTensor, InitialStateTensor, FinalStateTensor, ProbsTensor) input_tensor = loaded_graph.get_tensor_by_name('input:0') initial_state_tensor = loaded_graph.get_tensor_by_name('initial_state:0') final_state_tensor = loaded_graph.get_tensor_by_name('final_state:0') probs_tensor = loaded_graph.get_tensor_by_name('probs:0') return (input_tensor, initial_state_tensor, final_state_tensor, probs_tensor) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_get_tensors(get_tensors) def pick_word(probabilities, int_to_vocab): Pick the next word in the generated text :param probabilities: Probabilites of the next word :param int_to_vocab: Dictionary of word ids as the keys and words as the values :return: String of the predicted word max_prob = np.argmax(probabilities) next_word = int_to_vocab[max_prob] return next_word DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_pick_word(pick_word) gen_length = 200 # homer_simpson, moe_szyslak, or Barney_Gumble prime_word = 'moe_szyslak' DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE loaded_graph = tf.Graph() with tf.Session(graph=loaded_graph) as sess: # Load saved model loader = tf.train.import_meta_graph(load_dir + '.meta') loader.restore(sess, load_dir) # Get Tensors from loaded model input_text, initial_state, final_state, probs = get_tensors(loaded_graph) # Sentences generation setup gen_sentences = [prime_word + ':'] prev_state = sess.run(initial_state, {input_text: np.array([[1]])}) # Generate sentences for n in range(gen_length): # Dynamic Input dyn_input = [[vocab_to_int[word] for word in gen_sentences[-seq_length:]]] dyn_seq_length = len(dyn_input[0]) # Get Prediction probabilities, prev_state = sess.run( [probs, final_state], {input_text: dyn_input, initial_state: prev_state}) pred_word = pick_word(probabilities[dyn_seq_length-1], int_to_vocab) gen_sentences.append(pred_word) # Remove tokens tv_script = ' '.join(gen_sentences) for key, token in token_dict.items(): ending = ' ' if key in ['\n', '(', '"'] else '' tv_script = tv_script.replace(' ' + token.lower(), key) tv_script = tv_script.replace('\n ', '\n') tv_script = tv_script.replace('( ', '(') print(tv_script) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: TV Script Generation Step3: Explore the Data Step6: Implement Preprocessing Functions Step9: Tokenize Punctuation Step11: Preprocess all the data and save it Step13: Check Point Step15: Build the Neural Network Step18: Input Step21: Build RNN Cell and Initialize Step24: Word Embedding Step27: Build RNN Step30: Build the Neural Network Step33: Batches Step35: Neural Network Training Step37: Build the Graph Step39: Train Step41: Save Parameters Step43: Checkpoint Step46: Implement Generate Functions Step49: Choose Word Step51: Generate TV Script
9,547
<ASSISTANT_TASK:> Python Code: import numpy as np def histogram(f): return np.bincount(f.ravel()) def histogram_eq(f): from numpy import amax, zeros, arange, sum n = amax(f) + 1 h = zeros((n,),int) for i in arange(n): h[i] = sum(i == f) return h def histogram_eq1(f): import numpy as np n = f.size m = f.max() + 1 haux = np.zeros((m,n),int) fi = f.ravel() i = np.arange(n) haux[fi,i] = 1 h = np.add.reduce(haux,axis=1) return h testing = (__name__ == "__main__") if testing: ! jupyter nbconvert --to python histogram.ipynb import numpy as np import sys,os import matplotlib.image as mpimg ia898path = os.path.abspath('../../') if ia898path not in sys.path: sys.path.append(ia898path) import ia898.src as ia if testing: f = np.array([[0,1,2,3,4], [4,3,2,1,1]], 'uint8') h = ia.histogram(f) print(h.dtype) print(h) if testing: h1 = ia.histogram_eq(f) print(h1.dtype) print(h1) if testing: h1 = ia.histogram_eq1(f) print(h1.dtype) print(h1) if testing: %matplotlib inline import matplotlib.pyplot as plt import matplotlib.image as mpimg f = mpimg.imread('../data/woodlog.tif') plt.imshow(f,cmap='gray') if testing: h = ia.histogram(f) plt.plot(h) if testing: import numpy as np from numpy.random import rand, seed seed([10]) f = (255 * rand(1000,1000)).astype('uint8') %timeit h = ia.histogram(f) %timeit h1 = ia.histogram_eq(f) %timeit h2 = ia.histogram_eq1(f) if testing: print(ia.histogram(np.array([3,7,0,0,3,0,10,7,0,7])) == \ np.array([4, 0, 0, 2, 0, 0, 0, 3, 0, 0, 1])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Function Code for brute force implementation Step2: Function code for bidimensional matrix implementation Step3: Examples Step4: Numerical examples Step5: Example 1 Step6: Speed performance Step7: Equation
9,548
<ASSISTANT_TASK:> Python Code: from pearce.mocks import cat_dict import numpy as np from os import path from astropy.io import fits from astropy import constants as const, units as unit import george from george.kernels import ExpSquaredKernel import matplotlib #matplotlib.use('Agg') from matplotlib import pyplot as plt %matplotlib inline import seaborn as sns sns.set() fname = '/u/ki/jderose/public_html/bcc/measurement/y3/3x2pt/buzzard/flock/buzzard-2/tpt_Y3_v0.fits' hdulist = fits.open(fname) z_bins = np.array([0.15, 0.3, 0.45, 0.6, 0.75, 0.9]) zbin=1 a = 0.81120 z = 1.0/a - 1.0 print z cosmo_params = {'simname':'chinchilla', 'Lbox':400.0, 'scale_factors':[a]} cat = cat_dict[cosmo_params['simname']](**cosmo_params)#construct the specified catalog! cat.load_catalog(a) #cat.h = 1.0 #halo_masses = cat.halocat.halo_table['halo_mvir'] cat.load_model(a, 'redMagic') hdulist.info() nz_zspec = hdulist[8] #N = 0#np.zeros((5,)) N_total = np.sum([row[2+zbin] for row in nz_zspec.data]) dNdzs = [] zs = [] W = 0 for row in nz_zspec.data: N = row[2+zbin] dN = N*1.0/N_total #volIn, volOut = cat.cosmology.comoving_volume(row[0]), cat.cosmology.comoving_volume(row[2]) #fullsky_volume = volOut-volIn #survey_volume = fullsky_volume*area/full_sky #nd = dN/survey_volume dz = row[2] - row[0] #print row[2], row[0] dNdz = dN/dz H = cat.cosmology.H(row[1]) W+= dz*H*(dNdz)**2 dNdzs.append(dNdz) zs.append(row[1]) #for idx, n in enumerate(row[3:]): # N[idx]+=n W = 2*W/const.c print W N_z = [row[2+zbin] for row in nz_zspec.data] N_total = np.sum(N_z)#*0.01 plt.plot(zs,N_z/N_total) plt.xlim(0,1.0) len(dNdzs) plt.plot(zs, dNdzs) plt.vlines(z, 0,8) plt.xlim(0,1.0) plt.xlabel(r'$z$') plt.ylabel(r'$dN/dz$') len(nz_zspec.data) np.sum(dNdzs) np.sum(dNdzs)/len(nz_zspec.data) W.to(1/unit.Mpc) 4.51077317e-03 params = cat.model.param_dict.copy() #params['mean_occupation_centrals_assembias_param1'] = 0.0 #params['mean_occupation_satellites_assembias_param1'] = 0.0 params['logMmin'] = 13.4 params['sigma_logM'] = 0.1 params['f_c'] = 0.19 params['alpha'] = 1.0 params['logM1'] = 14.0 params['logM0'] = 12.0 print params cat.populate(params) nd_cat = cat.calc_analytic_nd() print nd_cat area = 5063 #sq degrees full_sky = 41253 #sq degrees volIn, volOut = cat.cosmology.comoving_volume(z_bins[zbin-1]), cat.cosmology.comoving_volume(z_bins[zbin]) fullsky_volume = volOut-volIn survey_volume = fullsky_volume*area/full_sky nd_mock = N_total/survey_volume print nd_mock nd_mock.value/nd_cat #compute the mean mass mf = cat.calc_mf() HOD = cat.calc_hod() mass_bin_range = (9,16) mass_bin_size = 0.01 mass_bins = np.logspace(mass_bin_range[0], mass_bin_range[1], int( (mass_bin_range[1]-mass_bin_range[0])/mass_bin_size )+1 ) mean_host_mass = np.sum([mass_bin_size*mf[i]*HOD[i]*(mass_bins[i]+mass_bins[i+1])/2 for i in xrange(len(mass_bins)-1)])/\ np.sum([mass_bin_size*mf[i]*HOD[i] for i in xrange(len(mass_bins)-1)]) print mean_host_mass 10**0.35 N_total theta_bins = np.logspace(np.log10(0.004), 0, 24)#/60 tpoints = (theta_bins[1:]+theta_bins[:-1])/2 r_bins = np.logspace(-0.5, 1.7, 16) rpoints = (r_bins[1:]+r_bins[:-1])/2 xi = cat.calc_xi(r_bins, do_jackknife=False) kernel = ExpSquaredKernel(0.05) gp = george.GP(kernel) gp.compute(np.log10(rpoints)) print xi xi[xi<=0] = 1e-2 #ack from scipy.stats import linregress m,b,_,_,_ = linregress(np.log10(rpoints), np.log10(xi)) plt.plot(rpoints, (2.22353827e+03)*(rpoints**(-1.88359))) #plt.plot(rpoints, b2*(rpoints**m2)) plt.scatter(rpoints, xi) plt.loglog(); plt.plot(np.log10(rpoints), b+(np.log10(rpoints)*m)) #plt.plot(np.log10(rpoints), b2+(np.log10(rpoints)*m2)) #plt.plot(np.log10(rpoints), 90+(np.log10(rpoints)*(-2))) plt.scatter(np.log10(rpoints), np.log10(xi) ) #plt.loglog(); print m,b rpoints_dense = np.logspace(-0.5, 2, 500) plt.scatter(rpoints, xi) plt.plot(rpoints_dense, np.power(10, gp.predict(np.log10(xi), np.log10(rpoints_dense))[0])) plt.loglog(); theta_bins_rm = np.logspace(np.log10(2.5), np.log10(250), 21)/60 #binning used in buzzard mocks tpoints_rm = (theta_bins_rm[1:]+theta_bins_rm[:-1])/2.0 rpoints_dense = np.logspace(-1.5, 2, 500) x = cat.cosmology.comoving_distance(z) plt.scatter(rpoints, xi) plt.plot(rpoints_dense, np.power(10, gp.predict(np.log10(xi), np.log10(rpoints_dense))[0])) plt.vlines((a*x*np.radians(tpoints_rm)).value, 1e-2, 1e4) plt.vlines((a*np.sqrt(x**2*np.radians(tpoints_rm)**2+unit.Mpc*unit.Mpc*10**(1.7*2))).value, 1e-2, 1e4, color = 'r') plt.loglog(); x = cat.cosmology.comoving_distance(z) print x - np.radians(tpoints_rm) #a subset of the data from above. I've verified it's correct, but we can look again. wt_redmagic = np.loadtxt('/u/ki/swmclau2/Git/pearce/bin/mcmc/buzzard2_wt_%d%d.npy'%(zbin,zbin)) tpoints_rm mathematica_calc = np.array([122.444, 94.8279, 73.4406, 56.8769, 44.049, 34.1143, 26.4202, \ 20.4614, 15.8466, 12.2726, 9.50465, 7.36099, 5.70081, 4.41506, \ 3.41929, 2.64811, 2.05086, 1.58831, 1.23009, 0.952656])#*W print W.value print W.to("1/Mpc").value print W.value from scipy.special import gamma def wt_analytic(m,b,t,x): return W.to("1/Mpc").value*b*np.sqrt(np.pi)*(t*x)**(1 + m)*(gamma(-(1./2) - m/2.)/(2*gamma(-(m/2.))) ) plt.plot(tpoints_rm, wt, label = 'My Calculation') plt.plot(tpoints_rm, wt_redmagic, label = 'Buzzard Mock') #plt.plot(tpoints_rm, W.to("1/Mpc").value*mathematica_calc, label = 'Mathematica Calc') #plt.plot(tpoints_rm, wt_analytic(m,10**b, np.radians(tpoints_rm), x),label = 'Mathematica Calc' ) plt.ylabel(r'$w(\theta)$') plt.xlabel(r'$\theta \mathrm{[degrees]}$') plt.loglog(); plt.legend(loc='best') wt_redmagic/(W.to("1/Mpc").value*mathematica_calc) import cPickle as pickle with open('/u/ki/jderose/ki23/bigbrother-addgals/bbout/buzzard-flock/buzzard-0/buzzard0_lb1050_xigg_ministry.pkl') as f: xi_rm = pickle.load(f) xi_rm.metrics[0].xi.shape xi_rm.metrics[0].mbins xi_rm.metrics[0].cbins #plt.plot(np.log10(rpoints), b2+(np.log10(rpoints)*m2)) #plt.plot(np.log10(rpoints), 90+(np.log10(rpoints)*(-2))) plt.scatter(rpoints, xi) for i in xrange(3): for j in xrange(3): plt.plot(xi_rm.metrics[0].rbins[:-1], xi_rm.metrics[0].xi[:,i,j,0]) plt.loglog(); plt.subplot(211) plt.plot(tpoints_rm, wt_redmagic/wt) plt.xscale('log') #plt.ylim([0,10]) plt.subplot(212) plt.plot(tpoints_rm, wt_redmagic/wt) plt.xscale('log') plt.ylim([2.0,4]) xi_rm.metrics[0].xi.shape xi_rm.metrics[0].rbins #Mpc/h x = cat.cosmology.comoving_distance(z)*a #ubins = np.linspace(10**-6, 10**2.0, 1001) ubins = np.logspace(-6, 2.0, 51) ubc = (ubins[1:]+ubins[:-1])/2.0 #NLL def liklihood(params, wt_redmagic,x, tpoints): #print _params #prior = np.array([ PRIORS[pname][0] < v < PRIORS[pname][1] for v,pname in zip(_params, param_names)]) #print param_names #print prior #if not np.all(prior): # return 1e9 #params = {p:v for p,v in zip(param_names, _params)} #cat.populate(params) #nd_cat = cat.calc_analytic_nd(parmas) #wt = np.zeros_like(tpoints_rm[:-5]) #xi = cat.calc_xi(r_bins, do_jackknife=False) #m,b,_,_,_ = linregress(np.log10(rpoints), np.log10(xi)) #if np.any(xi < 0): # return 1e9 #kernel = ExpSquaredKernel(0.05) #gp = george.GP(kernel) #gp.compute(np.log10(rpoints)) #for bin_no, t_med in enumerate(np.radians(tpoints_rm[:-5])): # int_xi = 0 # for ubin_no, _u in enumerate(ubc): # _du = ubins[ubin_no+1]-ubins[ubin_no] # u = _u*unit.Mpc*a # du = _du*unit.Mpc*a #print np.sqrt(u**2+(x*t_med)**2) # r = np.sqrt((u**2+(x*t_med)**2))#*cat.h#not sure about the h #if r > unit.Mpc*10**1.7: #ignore large scales. In the full implementation this will be a transition to a bias model. # int_xi+=du*0 #else: # the GP predicts in log, so i predict in log and re-exponate # int_xi+=du*(np.power(10, \ # gp.predict(np.log10(xi), np.log10(r.value), mean_only=True)[0])) # int_xi+=du*(10**b)*(r.to("Mpc").value**m) #print (((int_xi*W))/wt_redmagic[0]).to("m/m") #break # wt[bin_no] = int_xi*W.to("1/Mpc") wt = wt_analytic(params[0],params[1], tpoints, x.to("Mpc").value) chi2 = np.sum(((wt - wt_redmagic[:-5])**2)/(1e-3*wt_redmagic[:-5]) ) #chi2=0 #print nd_cat #print wt #chi2+= ((nd_cat-nd_mock.value)**2)/(1e-6) #mf = cat.calc_mf() #HOD = cat.calc_hod() #mass_bin_range = (9,16) #mass_bin_size = 0.01 #mass_bins = np.logspace(mass_bin_range[0], mass_bin_range[1], int( (mass_bin_range[1]-mass_bin_range[0])/mass_bin_size )+1 ) #mean_host_mass = np.sum([mass_bin_size*mf[i]*HOD[i]*(mass_bins[i]+mass_bins[i+1])/2 for i in xrange(len(mass_bins)-1)])/\ # np.sum([mass_bin_size*mf[i]*HOD[i] for i in xrange(len(mass_bins)-1)]) #chi2+=((13.35-np.log10(mean_host_mass))**2)/(0.2) print chi2 return chi2 #nll print nd_mock print wt_redmagic[:-5] import scipy.optimize as op results = op.minimize(liklihood, np.array([-2.2, 10**1.7]),(wt_redmagic,x, tpoints_rm[:-5])) results #plt.plot(tpoints_rm, wt, label = 'My Calculation') plt.plot(tpoints_rm, wt_redmagic, label = 'Buzzard Mock') plt.plot(tpoints_rm, wt_analytic(-1.88359, 2.22353827e+03,tpoints_rm, x.to("Mpc").value), label = 'Mathematica Calc') plt.ylabel(r'$w(\theta)$') plt.xlabel(r'$\theta \mathrm{[degrees]}$') plt.loglog(); plt.legend(loc='best') plt.plot(np.log10(rpoints), np.log10(2.22353827e+03)+(np.log10(rpoints)*(-1.88))) plt.scatter(np.log10(rpoints), np.log10(xi) ) np.array([v for v in params.values()]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load up the tptY3 buzzard mocks. Step2: Load up a snapshot at a redshift near the center of this bin. Step3: This code load a particular snapshot and and a particular HOD model. In this case, 'redMagic' is the Zheng07 HOD with the f_c variable added in. Step4: Take the zspec in our selected zbin to calculate the dN/dz distribution. The below cell calculate the redshift distribution prefactor Step5: If we happened to choose a model with assembly bias, set it to 0. Leave all parameters as their defaults, for now. Step6: Use my code's wrapper for halotools' xi calculator. Full source code can be found here. Step7: Interpolate with a Gaussian process. May want to do something else "at scale", but this is quick for now. Step8: This plot looks bad on large scales. I will need to implement a linear bias model for larger scales; however I believe this is not the cause of this issue. The overly large correlation function at large scales if anything should increase w(theta). Step9: Perform the below integral in each theta bin Step10: The below plot shows the problem. There appears to be a constant multiplicative offset between the redmagic calculation and the one we just performed. The plot below it shows their ratio. It is near-constant, but there is some small radial trend. Whether or not it is significant is tough to say. Step11: The below cell calculates the integrals jointly instead of separately. It doesn't change the results significantly, but is quite slow. I've disabled it for that reason.
9,549
<ASSISTANT_TASK:> Python Code: import veneer import numpy as np import pandas as pd import matplotlib.pyplot as plt %matplotlib inline %matplotlib inline plt.plot(range(10)) %matplotlib notebook plt.plot(range(10)) %matplotlib inline v = veneer.Veneer() # Equiavelent to # v = veneer.Veneer(host='localhost',port=9876) the_network = v.network() all_nodes = the_network['features'].find_by_feature_type('node') len(all_nodes) all_nodes._all_values('name') outlets = the_network.outlet_nodes() outlets the_network.upstream_links(outlets[0]) network_df = the_network.as_dataframe() network_df network_df[network_df.feature_type=='node'] network_df[network_df.icon=='/resources/StorageNodeModel'] model_functions = v.functions() model_functions model_variables = v.variables() model_variables model_variables.find_by_Name('$Runoff') model_variables.as_dataframe() runoff_ts = v.variable_time_series('$Runoff') runoff_ts.plot() mfr_piecewise = v.variable_piecewise('MFR_Piecewise') mfr_piecewise data_sources = v.data_sources() data_sources data_sources.as_dataframe() data_sources[0]['Items'] forcing = v.data_source('ForcingData_csv') forcing forcing_as_df = forcing['Items'].find_one_by_Name('Default Input Set')['Details'] forcing_as_df[0:30] # Look at the first 30 time steps rainfall = v.data_source_item('ForcingData_csv','Rainfall') rainfall[0:30] input_sets = v.input_sets() input_sets input_sets.find_one_by_Name('Default Input Set')['Configuration'] response,run_url = v.run_model() response,run_url run_url index = v.retrieve_run(run_url) index index['Results'].as_dataframe() help(v.retrieve_multiple_time_series) # Retrieve Downstream Flow Volume, anywhere it is recorded. # Name the columns for the network location ds_flow = v.retrieve_multiple_time_series(run_data=index,criteria={'RecordingVariable':'Downstream Flow Volume'}, name_fn=veneer.name_for_location) ds_flow[0:10] # Retrieve everything available from the Water User node # Name the columns for the variable water_user = v.retrieve_multiple_time_series(run_data=index,criteria={'NetworkElement':'Water User'}, name_fn=veneer.name_for_variable) water_user[0:10] v.drop_all_runs() v.configure_recording(enable=[{'RecordingVariable':'Storage Surface Area'}]) v.run_model() surface_area = v.retrieve_multiple_time_series(criteria={'RecordingVariable':'Storage Surface Area'}) surface_area.plot() v.drop_all_runs() default_input_set = v.input_sets()[0] default_input_set command_of_interest = default_input_set['Configuration'][0] command_of_interest default_input_set['Configuration'][0] = command_of_interest.replace('25 m','50 m') default_input_set v.update_input_set('Default Input Set',default_input_set) v.input_sets() v.apply_input_set('Default Input Set') v.model.link.routing.get_models() v.model.link.routing.get_models(by_name=True) from veneer.manage import start help(start) help(v.network) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: import Step2: Aside Step3: The rest of this tutorial uses v to refer to current Veneer client Step4: You can also perform some basic topological queries on the network, such as finding all network outlets, or finding upstream/downstream links for a given node Step5: If you have GeoPandas installed, you can convert network to a GeoDataFrame, which is useful for visualisation, reporting and advanced filtering. Step6: With a GeoDataFrame, you can filter against any column Step7: Querying Functions and Variables Step8: Both v.functions() and v.variables() return a searchable list Step9: Note Step10: v.variables() only returns summary information about the variable. If you want to get at the actual time series (or the piecewise linear function or similar), use v.variable_time_series(name) (or v.variable_piecewise(name)) Step11: Note Step12: Using .as_dataframe() can help to interpret the information Step13: This highlights that the Items column has nested information Step14: So, v.data_sources() returns information about all data sources. Specifically, it returns the list of data sources, and, for each one, information about the different time series. However, v.data_sources does not return the entire time series. (This is mainly for speed - on big models, this can be HUGE) Step15: You can see that the time series are included, but they are still nested within the returned data. Essentially, Veneer has returned the data for each input set, with each being a separate Pandas DataFrame. Step16: You can jump to a particular data source item (typically a column from an original file) with v.data_source_item(source,name) Step17: Input Sets Step18: Within a given input set, the individual commands are available in the Configuration property Step19: Input sets are a lot more interesting when you are changing them and applying them from Python... Step20: After a successful run, veneer-py returns the URL of the new run - this can be used to retrieve an index of all the available results and, from there, the actual time series results Step21: This index lists all of the time series (under ['Results']) and can be used to retrieve individual time series, or collections of time series Step22: The easiest way to retrieve time series results is with v.retrieve_multiple_time_series, which takes a set of run results, some search criteria by which it identifies wanted time series. There are also options for retrieve aggregated data and the ability to rename time series as they are retrieved. Step23: The following examples retrieve data from the latest run, using the index index we saved, earlier Step24: Other run related actions Step25: Note Step26: Manipulating model setup and the ‘Allow Scripts’ option Step27: At this point, you can check in the Source user interface (Edit|Scenario Input Sets) to see that the input set has been updated. Alternatively, you can query the input set again Step28: The Default Input Set would be applied when we next run, but if we want those parameters set on the model immediately, we can do so, with v.apply_input_set('Default Input Set') Step29: v.model and the Allow Scripts option Step30: This shows that, for the example model, there are three Straight Through Routing links and two Storage Routing links. Step31: PEST and Parallel processing Step32: Each copy of the Veneer command line is a copy of the Source engine with a Veneer server.
9,550
<ASSISTANT_TASK:> Python Code: import scipy.stats as stats from scipy.stats import binom from __future__ import division %pylab %matplotlib inline import seaborn as sns plt.plot([1,2,3], [2,3,5]) pylab.rcParams['figure.figsize'] = 12, 6 nCells = 1e6 nDays = 10 nDivisions = np.log2(nCells) time_per_division = nDays * 24 / nDivisions print "#Generations/Divisions: %d\n\nAverage generation time %.2f (hours)" %(round(nDivisions), time_per_division) colonies_per_spleen = dict() colonies_per_spleen["exp1"] = np.concatenate([np.repeat(0,24), np.repeat(1,6), np.array([2,6,19,21,23,36]) ]) colonies_per_spleen["exp2"] = np.concatenate([np.repeat(0,3), np.repeat(1,3), np.repeat(2,2), np.array([3,3, 20,20, 32]) ]) colonies_per_spleen["exp3"]= np.concatenate([np.repeat(0,12), np.repeat(1,8), np.repeat(2,5), np.repeat(3,2), np.array([4,5,5,7,8,8,11,13,20,23,29,46]) ]) fraction = 0.17 # the fraction of CFUs that actually go to the spleen #just divide each dict entry by 'fraction' tmpFunc = lambda x: np.ceil(x/fraction) # apply this function to each dictionary entry trueCFUs = {k: tmpFunc(v) for k,v in colonies_per_spleen.items()} print "#Colonies per spleen" print colonies_per_spleen["exp1"] print "Estimated #CFU per spleen" print trueCFUs["exp1"] #observations N = 100 k = 10 #inference tmpP = np.linspace(0,1,100) like_theta = binom.pmf(k,n=N,p=tmpP) prior_theta = 1 # simply constant posterior_theta = like_theta * prior_theta/ np.sum(like_theta * prior_theta) plot(tmpP,posterior_theta) xlabel('theta'), ylabel('Posterior(theta|k)'), xlim([0,0.4]) n = np.arange(300) data = unique(colonies_per_spleen["exp1"]) #just considering the first experiment posteriorArray = np.zeros((len(data), len(n))) for i,d in enumerate(data): likelihood_n = binom.pmf(d, n, fraction) prior_n = 1 #constant posterior_n = likelihood_n * prior_n / np.sum(likelihood_n*prior_n) posteriorArray[i,:] = posterior_n plot(n,posteriorArray.T) xlabel('N'), ylabel('Posterior(N|k,f)'), legend(data), ylim([0, 0.1]) #normal hists binning = np.arange(0,300,step=5) plt.figure() for exp,data in trueCFUs.iteritems(): plt.hist(data, bins=binning, histtype="stepfilled", alpha=.3) plt.legend(trueCFUs.keys()) xlabel('#CFU'), ylabel('Frequency') def ecdf(x): calculate the empirical distribution function of data x sortedX=np.sort( x ) yvals=np.arange(len(sortedX))/float(len(sortedX)) return sortedX, yvals # plot the CDF for each experiment individually for exp,data in trueCFUs.iteritems(): x,y = ecdf(data) plt.plot(x,y) xlabel('#CFUs'), ylabel('cumulative density') #put all three together trueCFUs_all = np.concatenate(trueCFUs.values()) x,y = ecdf(trueCFUs_all) plt.plot(x,y, linewidth=5) leg= trueCFUs.keys() leg.append('all') plt.legend(leg) plt.figure() # the figure as presented in the paper (scaled back to colonies) plt.plot(x*0.17,y*len(trueCFUs_all), linewidth=2) xlim([0,25]) ylim([0,120]) title('as in the paper') mu = np.mean(trueCFUs_all) sigma= np.std(trueCFUs_all) print "Mean: %f Fano factor %f" % (mu,sigma**2/mu) # put the poisson distribution as a comparision which has the same mean as the data x_ECDF,y_ECDF = ecdf(trueCFUs_all) x = np.arange(0,100) y =stats.poisson.cdf(x,mu) plt.subplot(1,2,1) plt.plot(x_ECDF, y_ECDF, linewidth=2) plt.plot(x,y, linewidth=2) plt.xlim([0,300]) plt.xlabel('#CFUs'), plt.ylabel('CDF'), plt.legend(['Data','Poisson fit']) # DO THE PDF as well, much easier to see #plt.figure() plt.subplot(1,2,2) sns.distplot(trueCFUs_all,norm_hist=True, kde=False) plt.plot(x,stats.poisson.pmf(x,mu), linewidth=2) plt.xlabel('#CFUs'), plt.ylabel('CDF'), plt.legend(['Poisson fit', 'Data']) plt.subplot(1,2,1) sns.distplot(trueCFUs_all, fit =stats.gamma, kde=False) xlim([0, 300]) plt.xlabel('#CFUs'), plt.ylabel('PDF'), plt.legend(['Gamma fit', 'Data']) # lets look at the CDF as well shape,loc,scale = stats.gamma.fit(trueCFUs_all) plt.title('Fitted Gamma(Shape=%.2f, scale=%.2f)' % (shape,scale)) x_Gamma = np.arange(0,200) y_Gamma = stats.gamma(shape,scale=scale).cdf(x_Gamma) plt.subplot(1,2,2) plt.plot(x_ECDF, y_ECDF, linewidth=2) plt.plot(x_Gamma, y_Gamma) plt.xlabel('#CFUs'), plt.ylabel('CDF'), plt.legend(['Data', 'Gamma fit']) def simulateTree(p0, nGens): simulates a single tree from the Till/McCulloch model inputs: - p0: probability that a single cell undergoes terminal differentiation (i.e. no more division) - nGens: number of generations to simulate returns: - a list (one element per generation) of single cells present at that generation. - a single element is just an array of cells present at that time (zeros for stem cells, 1s for differentiated cells). # cell state is either 0 (stem cell) or 1 (differentiated), # which is the only thing we keep track of here theGenerations = list() theGenerations.append(np.array(0)) for g in range(nGens): lastGen = theGenerations[-1] # for each of the last generation, roll a dice whether it terminally diffs newState = roll_the_dice(lastGen, p0) #all the zeros divide, the 1's just stay n0 = sum(newState==0) n1 = sum(newState==1) nextGen = np.concatenate([np.repeat(0, 2*n0), np.repeat(1,n1)]) theGenerations.append(nextGen) return theGenerations def roll_the_dice(cellstate_array, p0): decide if a cell goes from 0->1 (wit probability p0) does that for an entire vector of zeros and ones in paralell # helper function so that we can index into it via generation # makes sure that as soon as cell_state==1 it wont change anymore tmpP = np.array([p0, 1]) p = tmpP[cellstate_array] r = np.random.rand(cellstate_array.size) newGeneration = r<p return newGeneration.astype(int) def pretty_print_tree(tree): for gen in tree: print gen p0 = 0.4 nGens = 5 aTree = simulateTree(p0,nGens) bTree = simulateTree(p0,nGens) print 'First tree' pretty_print_tree(aTree) print 'Second tree' pretty_print_tree(bTree) #CFUs per generation print '\n#CFUs, first tree' print map(lambda x: sum(x==0), aTree) print '\n#CFUs, second tree' print map(lambda x: sum(x==0), bTree) nTrees = 1000 nGens = 20 p0 = 0.4 # assemble a matrix of tree vs #CFUs(t) (one row, one tree; one col one timepoint) cfus_over_time = np.zeros((nTrees, nGens+1)) for i in range(nTrees): tree = simulateTree(p0, nGens) nCFU = map(lambda x: np.sum(x==0), tree) cfus_over_time[i,:] = nCFU print cfus_over_time[0:5,:].astype(int) import seaborn as sns plt.plot(log10(cfus_over_time.T)) plt.xlabel('Generation') plt.ylabel("log10(#CFU)") # violin plot plt.figure() sns.violinplot((log10(cfus_over_time+1)), inner='points') plt.xlabel('Generation') plt.ylabel("log10(#CFU+1)") lastGen_nCFUs = cfus_over_time[:,-1] plt.subplot(1,2,1) plt.hist(lastGen_nCFUs, bins=50) xlabel('#CFUs') ylabel('Frequency in last generation') # CDF plt.subplot(1,2,2) x_ECDF_lastGen,y_ECDF_lastGen = ecdf(lastGen_nCFUs) plt.plot(x_ECDF_lastGen, y_ECDF_lastGen, linewidth=2) xlabel('#CFUs') ylabel('CDF') shape, loc, scale = stats.gamma.fit(lastGen_nCFUs) fittedGamma = stats.gamma(a=shape, loc=loc, scale=scale) print "Shape: %.3f, Location: %.3f, Scale: %.3f" %(shape, loc, scale) # histogram of the simulated data n,bins = np.histogram(lastGen_nCFUs, bins=arange(0, 300, step=5)) # pdf, cdf fittedPDF, fittedCDF = fittedGamma.pdf(bins[:-1]), fittedGamma.cdf(bins[:-1]) plt.subplot(1,2,1) plt.plot(x_ECDF, y_ECDF, linewidth=2) plt.plot(bins[:-1], fittedCDF) xlabel('#CFU'), ylabel('CDF'), legend(['synthetic Data','Gamma Fit']) ## the PDF derived from the cdf plt.subplot(1,2,2) plt.plot(bins[:-1],n/n.sum()) plt.plot(bins[:-1], diff(np.insert(fittedCDF, 0, 0))) #estimates, based on matching means an vars gamma_mean, gamma_var = fittedGamma.stats(moments='mv') sample_mean, sample_var = np.mean(lastGen_nCFUs), np.var(lastGen_nCFUs) myShape = sample_mean**2/sample_var myScale = sample_var/sample_mean print myShape,myScale #fittedGamma = stats.gamma(a=myShape, loc=0, scale=myScale) print "Sample Mean: %.2f Gamma Mean: %.2f" % (sample_mean,gamma_mean) print "Sample Var: %.2f Gamma Var: %.2f" % (sample_var,gamma_var) nGens = 20 p0 = 0.4 nTrees_fig8 = 71 fig8_cfu_20 = np.zeros((nTrees_fig8)) for i in range(nTrees_fig8): tree = simulateTree(p0, nGens) nCFU = map(lambda x: np.sum(x==0), tree) fig8_cfu_20[i] = nCFU[-1] xTmp, yTmp = ecdf(fig8_cfu_20) plot(xTmp, yTmp*nTrees_fig8) #fit by gamma shape, loc, scale = stats.gamma.fit(fig8_cfu_20) fittedGamma_synthData = stats.gamma(a=shape, loc=loc, scale=scale) fittedCDF = fittedGamma_synthData.cdf(xTmp[:-1]) plot(xTmp[:-1], fittedCDF*nTrees_fig8) "Simulate a bunch of trees and get the #CFUs over time" def sim_cfu_over_time(p0, nTrees, nGens): cfus_over_time = np.zeros((nTrees, nGens+1)) for i in range(nTrees): tree = simulateTree(p0, nGens) nCFU = map(lambda x: np.sum(x==0), tree) cfus_over_time[i,:] = nCFU return cfus_over_time "calculate a KS test between observed and simulated dists" def distance_function(obs, sim): K,pval = stats.ks_2samp(obs,sim) return K, pval #return np.abs(np.mean(obs)- np.mean(sim)) p0_grid = np.linspace(0, 1, 50) distances, pvals = np.zeros(p0_grid.shape), np.zeros(p0_grid.shape) observedData = trueCFUs_all # experimental data after 10 days/20divisions for i, p0 in enumerate(p0_grid): simData = sim_cfu_over_time(p0, nTrees = 100, nGens= 20) simData_lastGen = simData[:,-1] distances[i], pvals[i] = distance_function(obs= observedData, sim=simData_lastGen) def plot_fitted_stoch_model(p0_array, K_array, pval_array, observedData): bestP0 = p0_array[argmin(K_array)] plt.subplot(2,2,1) plt.plot(p0_array, K_array) plt.vlines(bestP0,0,1) xlabel('p0'), ylabel('KS distance') plt.subplot(2,2,2) plt.plot(p0_array, log10(pvals)) xlabel('p0'), ylabel('KS pval') bestpval = pval_array[argmin(K_array)] title(bestpval) plt.subplot(2,2,3) simData = sim_cfu_over_time(p0=0.4, nTrees = 100, nGens= 20) x,y =ecdf(observedData) plt.plot(x, y) x,y =ecdf(simData[:,-1]) plt.plot(x, y) xlabel('#CFU'), ylabel('CDF') legend(['observed','simulated']) binning = np.arange(0,300,step=5) plt.subplot(2,2,4) plt.hist(observedData, bins=binning, histtype="stepfilled", alpha=.5) plt.hist(simData[:,-1], bins=binning, histtype="stepfilled", alpha=.5) xlabel('#CFU'), ylabel('PDF') plot_fitted_stoch_model(p0_grid, distances, pvals, observedData) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Hematopoiesis Step2: Defining properties of stem cells Step3: Efficiency of the CFUs Step4: Converting to actual CFU numbers Step5: What's the catch here? Step6: Instead Step7: Conclusion Step9: Cumulative distribution function Step10: Figure 4 from the paper Step11: Comparison to a Possion distribution Step12: Comparison to a $\Gamma$-distribution Step15: Uncertainty revisited Step16: Create some trees/colonies, calculate number of CFUs within Step17: Distribution of #CFUs over time Step18: Last generation Step19: <img src="figures/ExperimentData.png" alt="Drawing" style="width Step20: Trying to reproduce Figure 8 Step21: Exercise
9,551
<ASSISTANT_TASK:> Python Code: import shutil import sys import os.path if not shutil.which("pyomo"): !pip install -q pyomo assert(shutil.which("pyomo")) if not (shutil.which("glpk") or os.path.isfile("glpk")): if "google.colab" in sys.modules: !apt-get install -y -qq glpk-utils else: try: !conda install -c conda-forge glpk except: pass from pyomo.environ import ConcreteModel, Var, Objective, Constraint, SolverFactory from pyomo.environ import RangeSet, ConstraintList, NonNegativeReals import numpy as np # Support function to normalize a numpy vector Normalize = lambda x: x/sum(x) # We define a data type for 2D-histograms as defined before class Measure2D(object): def __init__(self, N, M=32, seed=13): default c'tor: N random points # Fix the seed for debugging np.random.seed(seed) # N random weights self.W = Normalize(np.random.uniform(0, 1, size=N)) # N random support points x = set() while len(x) < N: x.add((np.random.randint(1, M), np.random.randint(1, M))) self.X = list(x) # Map point to weight self.D = {} for i in range(N): self.D[self.X[i]] = self.W[i] # Create two random measures GridSize = 32 Mu = Measure2D(300, GridSize, seed=13) Nu = Measure2D(200, GridSize, seed=14) from math import sqrt # Euclidean distance in the plane Cost = lambda x, y: sqrt((x[0] - y[0])**2 + (x[1] - y[1])**2) # Others useful libraries from time import time # Second, we write a function that implements the model, solves the LP, # and returns the KW distance along with an optimal transport plan. def BipartiteDistanceW1_L2(Mu, Nu): t0 = time() # Main Pyomo model model = ConcreteModel() # Parameters model.I = RangeSet(len(Mu.X)) model.J = RangeSet(len(Nu.X)) # Variables model.PI = Var(model.I, model.J, within=NonNegativeReals) # Objective Function model.obj = Objective( expr=sum(model.PI[i,j] * Cost(Mu.X[i-1], Nu.X[j-1]) for i,j in model.PI)) # Constraints on the marginals model.Mu = Constraint(model.I, rule = lambda m, i: sum(m.PI[i,j] for j in m.J) == Mu.W[i-1]) model.Nu = Constraint(model.J, rule = lambda m, j: sum(m.PI[i,j] for i in m.I) == Nu.W[j-1]) # Solve the model sol = SolverFactory('glpk').solve(model) # Get a JSON representation of the solution sol_json = sol.json_repn() # Check solution status if sol_json['Solver'][0]['Status'] != 'ok': return None if sol_json['Solver'][0]['Termination condition'] != 'optimal': return None return model.obj(), time()-t0 # Compute distance and runtime distA, runtimeA = BipartiteDistanceW1_L2(Mu, Nu) print("Optimal distance: {}, runtime: {}".format(distA, runtimeA)) # Given a value of the parameter L, build the corrisponding co-primes set def CoprimesSet(L): from numpy import gcd Cs = [] for v in range(-L, L+1): for w in range(-L, L+1): if (not (v == 0 and w == 0)) and gcd(v, w) == 1: Cs.append((v, w)) return Cs L = 3 Cs = CoprimesSet(L) print(Cs) # Import the graph library NetworkX import networkx as nx # Build a Network using a precomputed set of pair of coprimes numbers def BuildGridNetwork(N, Coprimes): def ID(x,y): return x*N+y G = nx.DiGraph() for i in range(N): for j in range(N): G.add_node(ID(i,j), pos=(i,j)) for i in range(N): for j in range(N): for (v, w) in Coprimes: if i + v >= 0 and i + v < N and j + w >= 0 and j + w < N: G.add_edge(ID(i,j), ID(i+v, j+w), weight=sqrt(pow(v, 2) + pow(w, 2))) return G # Plot a grid network (nodes must have coordinates position labels) def PlotGridNetwork(G, name=""): import matplotlib.pyplot as plt plt.figure(3,figsize=(8, 8)) plt.axis('equal') pos = nx.get_node_attributes(G, 'pos') nx.draw(G, pos, font_weight='bold', node_color='blue', arrows=True, arrowstyle='->', arrowsize=15, width=1, node_size=200) # If a name is specified, save the plot in a file if name: plt.savefig("grid_{}.png".format(name), format="PNG") L = 2 Cs = CoprimesSet(L) G1 = BuildGridNetwork(8, Cs) PlotGridNetwork(G1) L = 3 Cs = CoprimesSet(L) G1 = BuildGridNetwork(8, Cs) PlotGridNetwork(G1) def ApproximateDistanceW1_L2(Mu, Nu, G): t0 = time() # Number of egdes m = len(G.edges()) # Main Pyomo model model = ConcreteModel() # Parameters model.E = RangeSet(m) # Variables model.PI = Var(model.E, within=NonNegativeReals) # Map edges to cost C = np.zeros(m) M = {} for e, (i, j) in enumerate(G.edges()): C[e] = G.edges[i,j]['weight'] M[i,j] = e+1 # Objective Function model.obj = Objective(expr=sum(model.PI[e] * C[e-1] for e in model.PI)) # Flow balance constraints (using marginals balance at each location) model.Flow = ConstraintList() for v in G.nodes(): Fs = [M[w] for w in G.out_edges(v)] Bs = [M[w] for w in G.in_edges(v)] # Compute flow balance value at given node position x = G.nodes[v]['pos'] b = Mu.D.get(x, 0.0) - Nu.D.get(x, 0.0) # Flow balance constraint model.Flow.add(expr = sum(model.PI[e] for e in Fs) - sum(model.PI[e] for e in Bs) == b) # Solve the model sol = SolverFactory('glpk').solve(model) # Get a JSON representation of the solution sol_json = sol.json_repn() # Check solution status if sol_json['Solver'][0]['Status'] != 'ok': return None if sol_json['Solver'][0]['Termination condition'] != 'optimal': return None return model.obj(), (time()-t0) # We build a flow network of size 32x32, using L=3 L = 3 Cs = CoprimesSet(L) G = BuildGridNetwork(GridSize, Cs) # Compute distance and runtime with the approximate model distB, runtimeB = ApproximateDistanceW1_L2(Mu, Nu, G) # ... and to compare with previous solution print("LB Full = {:.5}, LB Apx = {:.5}".format(distA, distB)) print("Time Full = {:.5}, Time Apx = {:.5}".format(runtimeA, runtimeB)) # Create two random measures GridSize = 32 N = 900 Mu = Measure2D(N, GridSize, seed=13) Nu = Measure2D(N, GridSize, seed=14) # Compute distance and runtime distA, runtimeA = BipartiteDistanceW1_L2(Mu, Nu) # We build a flow network of size 32x32, using L=3 L = 3 Cs = CoprimesSet(L) G = BuildGridNetwork(GridSize, Cs) # Compute distance and runtime with the approximate model distB, runtimeB = ApproximateDistanceW1_L2(Mu, Nu, G) # ... and to compare with the previous solution optimal valur and runtime print("LB Full = {:.5}, LB Apx = {:.5}".format(distA, distB)) print("Time Full = {:.5}, Time Apx = {:.5}".format(runtimeA, runtimeB)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: From Pyomo, we use the following procedures for writing our LP models Step3: Creating random 2D discrete measures Step4: And to create two random measures over a grid of size $32 \times 32$, the first with 300 support points, and the second with 200 support points Step5: Later on, we need a cost function between a pair of support points defined in $\mathbb{R}^2$. Step6: Solving the Bipartite model Step7: In order to compute the distance between the two models, we have only to call our function with the two discrete meausures randomly defined before. Step8: In the following, we look at a different LP model which approximately solves an equivalent problem. Step9: For instance, if we want to build a small set of coprimes locations, we could use $L=3$. Step10: Using the set of coprimes pair, we can build our small flow network as follows. Step11: We add also a function to plot a network in the plane Step12: Let start we a couple of small example, to get an idea about the networks that are built. Step13: Note that the degree of every node is limited, and much smaller than the case where every node (location) is connected with every other possible locations, as in the bipartite graphs. Step14: Solving the Flow Problem Step15: At this point, we can compute the distance between the same pair of discrete measures $Mu$ and $Nu$ defined before, but using our new LP model. Step16: Note that in this case, the difference in running time is limited, and it is dominanted by the time for building the model (Pyomo is not very fast with this respect, despite its flexibility).
9,552
<ASSISTANT_TASK:> Python Code: ''' Trains a simple deep NN on the MNIST dataset. You can get to 98.40% test accuracy after 20 epochs. ''' from __future__ import print_function import tensorflow as tf import numpy as np tf.reset_default_graph() np.random.seed(1337) # for reproducibility from keras.datasets import mnist from keras.models import Sequential from keras.layers.core import Dense, Dropout, Activation from keras.optimizers import RMSprop from keras.utils import np_utils batch_size = 128 nb_classes = 10 nb_epoch = 10 # the data, shuffled and split between train and test sets (X_train, y_train), (X_test, y_test) = mnist.load_data() X_train = X_train.reshape(60000, 784) X_test = X_test.reshape(10000, 784) X_train = X_train.astype('float32') X_test = X_test.astype('float32') X_train /= 255 X_test /= 255 print(X_train.shape[0], 'train samples') print(X_test.shape[0], 'test samples') # convert class vectors to binary class matrices Y_train = np_utils.to_categorical(y_train, nb_classes) Y_test = np_utils.to_categorical(y_test, nb_classes) model = Sequential() model.add(Dense(512, input_shape=(784,))) model.add(Activation('relu')) model.add(Dropout(0.2)) model.add(Dense(512)) model.add(Activation('relu')) model.add(Dropout(0.2)) model.add(Dense(10)) model.add(Activation('softmax')) # print model characteristics model.summary() model.compile(loss='categorical_crossentropy', optimizer=RMSprop(), metrics=['accuracy']) history = model.fit(X_train, Y_train, batch_size=batch_size, nb_epoch=nb_epoch, verbose=1, validation_data=(X_test, Y_test)) score = model.evaluate(X_test, Y_test, verbose=0) print('\n') print('Test score:', score[0]) print('Test accuracy:', score[1]) from __future__ import print_function from keras.models import Sequential from keras.layers import Dense, Dropout, Activation from keras.layers import LSTM from keras.optimizers import RMSprop import numpy as np import random import sys import codecs f = codecs.open('data/NombresMujerBarcelona.txt', "r", "utf-8") #f = codecs.open('data/toponims.txt', "r", "utf-8") string = f.read() string.encode('utf-8') text = string.lower() # text = text.replace("\n", " ") print('corpus length:', len(text)) chars = sorted(list(set(text))) print('total chars:', len(chars)) char_indices = dict((c, i) for i, c in enumerate(chars)) indices_char = dict((i, c) for i, c in enumerate(chars)) # cut the text in semi-redundant sequences of maxlen characters maxlen = 20 step = 3 sentences = [] next_chars = [] for i in range(0, len(text) - maxlen, step): sentences.append(text[i: i + maxlen]) next_chars.append(text[i + maxlen]) print('nb sequences:', len(sentences)) print('Vectorization...') X = np.zeros((len(sentences), maxlen, len(chars)), dtype=np.bool) y = np.zeros((len(sentences), len(chars)), dtype=np.bool) for i, sentence in enumerate(sentences): for t, char in enumerate(sentence): X[i, t, char_indices[char]] = 1 y[i, char_indices[next_chars[i]]] = 1 # build the model print('Build model...') model = Sequential() model.add(LSTM(64, dropout=0.2, recurrent_dropout=0.2, input_shape=(maxlen, len(chars)))) #model.add(LSTM(64, # dropout_W=0.2, # dropout_U=0.2)) model.add(Dense(len(chars))) model.add(Activation('relu')) model.add(Dropout(0.2)) model.add(Activation('softmax')) optimizer = RMSprop(lr=0.01) model.compile(loss='categorical_crossentropy', optimizer=optimizer) def sample(preds, temperature=1.0): # helper function to sample an index from a probability array preds = np.asarray(preds).astype('float64') preds = np.log(preds) / temperature exp_preds = np.exp(preds) preds = exp_preds / np.sum(exp_preds) probas = np.random.multinomial(1, preds, 1) return np.argmax(probas) # train the model, output generated text after each iteration for iteration in range(1, 60): print() print('-' * 50) print('Iteration', iteration) model.fit(X, y, batch_size=256, epochs=1) start_index = random.randint(0, len(text) - maxlen - 1) generated = '' sentence = text[start_index: start_index + maxlen] generated += sentence print('----- Generating with seed: "' + sentence.replace("\n", " ") + '"') for diversity in [0.5, 1.0]: print() print('----- diversity:', diversity) for i in range(50): x = np.zeros((1, maxlen, len(chars))) for t, char in enumerate(sentence): x[0, t, char_indices[char]] = 1. preds = model.predict(x, verbose=0)[0] next_index = sample(preds, diversity) next_char = indices_char[next_index] generated += next_char sentence = sentence[1:] + next_char sys.stdout.write(next_char) sys.stdout.flush() print() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Name generation with LSTM Step2: Classical neural networks, including convolutional ones, suffer from two severe limitations Step3: The simplest way to use the Keras LSTM model to make predictions is to first start off with a seed sequence as input, generate the next character then update the seed sequence to add the generated character on the end and trim off the first character.
9,553
<ASSISTANT_TASK:> Python Code: import matplotlib.pyplot as plt import numpy as np %matplotlib inline # Calculates the core hot spot temperature of the transformer def core_hot_spot(ambient_temp, overload_ratio, t0=35, tc=30, N=1, N0=0.5, Nc=0.8, L=1): # ambient_temp is in Celsius # overload_ratio is in decimal form (e.g. 0.75 not 75%) # t0 is the temperature rise of oil over ambient # tc is the temperature rise of the windings over the oil # N = 1 (for simplification only) # N0 = 0.8 for self-cooled transformers, =0.5 for water-cooled # Nc = 1.0 for vertical windings, =0.8 for horizontal windings # L = 1 (for simplification only) T = t0*((N*overload_ratio**2+1)**0.8) + tc*L*overload_ratio**2 + ambient_temp return T # Plot the core hot spot as ambient temperature increases for R in [0.75, 0.9, 1.0, 1.1, 1.25]: # Use a listcomp to generate the core hot spots plt.plot([core_hot_spot(ii, R) for ii in range(100)]) # Plot labels plt.legend(['R=0.75', 'R=0.9', 'R=1.0', 'R=1.1', 'R=1.25']) plt.xlabel('Ambient Temperature (C)') plt.ylabel('Core Hot Spot Temperature (C)') plt.title('Core Hot Spot at Several Overload Ratios (R)'); def calculate_dp(core_hot_spot, time, dp_initial): # core_hot_spot is an output from the previous function # time is measured in hours # dp_initial is the initial degree of polymerization # A is a constant based on the type of paper insulation # k calculation is taken from [Emsley] A = 3.65*10**7 # See Emsley's paper for more discussion of this equation k = A*np.exp(-(117000/(8.314*(core_hot_spot+273.15)))) DPf=1/((k*24*7*time) + (1/dp_initial)) return DPf # Plot the DP ratio as a function of core hot spot for 1 day dp_ratio = [calculate_dp(chs, 24, 1000)/1000 for chs in range(50, 150)] plt.plot(range(50, 150), dp_ratio) plt.xlabel('Core Hot Spot Temperature (C)') plt.ylabel('DP Ratio') plt.title('DP Ratio After 24 Hours at Core Hot Spot Temperature'); def oil_contamination(dp): # dp is the degree of polymerization # CO and CO2 are the TOTAL accumulation # of each of those dissolved gases CO=(-0.0028*dp + 6.28) + 0.13*np.random.randn() CO2=(-0.0026*dp + 8.08) + 0.66*np.random.randn() return CO, CO2 # Plot the CO as a function of DP over time co_accumulation = [oil_contamination(dp)[0] for dp in range(150, 1000)] plt.plot(range(150, 1000), co_accumulation) plt.xlabel('Degree of Polymerization (DP)') plt.ylabel('CO Accumulation (ppm)') plt.title('CO Accumulation at Paper Insulation DPs'); # Transformer INSULation SIMulator # temps is an array of size 12x3, containing monthly low, average, and high temps # start_month is an integer, with January = 1, February = 2, etc. # num_transformers are the number of transformers to simulate (e.g. 20) # overload_ratio is R in the equation above (suggest between 0.75 and 1.1) def tinsul_sim(temps, start_month, num_transformers, overload_ratio = 1): trans_co = [] trans_co2 = [] # Iterate over the number of transformers: for ii in range(num_transformers): month_current = start_month failed = False dp_current = 1000 co_accumulation = [] co2_accumulation = [] # dp_failed determines the DP at which the paper insulation will # fail, drawn from a logistic distribution centered at 200 dp_failed = np.random.logistic(loc=200.0, scale=40.0) # Run the simulation until the transformer fails while not failed: # Remember- 6 hours at low, 12 hours at avg, and 6 hours at high temps # The first index is temp, the second index is hours at that temp ambient_low = [temps[int(month_current)-1][0], 6] ambient_avg = [temps[int(month_current)-1][1], 12] ambient_high = [temps[int(month_current)-1][2], 6] # Update DP based on the heat stresses from the core hot spot for ambient, time in [ambient_low, ambient_avg, ambient_high]: chs = core_hot_spot(ambient, overload_ratio) dp_current = calculate_dp(chs, time, dp_current) # Calculate the CO and CO2 accumulation based on DP co, co2 = oil_contamination(dp_current) co_accumulation.append(co) co2_accumulation.append(co2) # Check if the transformer has failed, using a "soft" distribution if dp_current<=dp_failed: failed = True # Add the value (Months/Weeks) to get proportion of month per week month_current += 0.230769 # Rollover to the next year, if necessary if month_current >= 13.0: month_current = 1 trans_co.append(co_accumulation) trans_co2.append(co2_accumulation) return trans_co, trans_co2 # Average temperature per month (Washington DC) # The array is ordered: [low, average, high] dc_temps = [[-2, 1, 6], # January [-1, 3, 8], # February [3, 7, 13], # March [8, 13, 19], # April [14, 18, 24], # May [19, 24, 29], # June [22, 28, 31], # July [21, 27, 30], # August [17, 22, 26], # September [10, 15, 20], # October [5, 10, 14], # November [0, 4, 8]] # December # Use the function above to simulate transformers transformers = tinsul_sim(dc_temps, 1, 20) # Plot the results from the first transformer plt.plot(transformers[0][0]) plt.xlabel('Time (weeks)') plt.ylabel('CO Accumulation (ppm)') plt.title('CO Accumulation Per Week, Transformer 1'); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The figure above demonstrates the core hot spot temperature from 0 to 100 degrees C, for five different overload ratios. Notice that the relationship between ambient temperature and core hot spot temperature (for all overload ratios) is linear. Examine Montsinger's equation (as well as the simplifying assumptions mentioned in the code above) to determine why this is the case. Step2: The figure above plots the ratio of initial DP (assumed to be starting at 1000) to final DP after 24 hours at a particular core hot spot temperature. Notice that below about 80 degrees C there is very little change, but after 110 degrees C the ratio drops off sharply. This behavior is the reason for derating; as the overload ratio of the transformer decreases, its core hot spot temperature will also decrease, which reduces the amount of degradation the paper insulation will experience. Step3: As expected, when the DP of the paper insulation is low (due to damage from heat stresses), the CO accumulation is high (due to byproducts from the degradation process).
9,554
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. try: %tensorflow_version 2.x except Exception: pass !pip install tensorflow-io # Install postgresql server !sudo apt-get -y -qq update !sudo apt-get -y -qq install postgresql !sudo service postgresql start # Setup a password `postgres` for username `postgres` !sudo -u postgres psql -U postgres -c "ALTER USER postgres PASSWORD 'postgres';" # Setup a database with name `tfio_demo` to be used !sudo -u postgres psql -U postgres -c 'DROP DATABASE IF EXISTS tfio_demo;' !sudo -u postgres psql -U postgres -c 'CREATE DATABASE tfio_demo;' %env TFIO_DEMO_DATABASE_NAME=tfio_demo %env TFIO_DEMO_DATABASE_HOST=localhost %env TFIO_DEMO_DATABASE_PORT=5432 %env TFIO_DEMO_DATABASE_USER=postgres %env TFIO_DEMO_DATABASE_PASS=postgres !curl -s -OL https://github.com/tensorflow/io/raw/master/docs/tutorials/postgresql/AirQualityUCI.sql !PGPASSWORD=$TFIO_DEMO_DATABASE_PASS psql -q -h $TFIO_DEMO_DATABASE_HOST -p $TFIO_DEMO_DATABASE_PORT -U $TFIO_DEMO_DATABASE_USER -d $TFIO_DEMO_DATABASE_NAME -f AirQualityUCI.sql import os import tensorflow_io as tfio endpoint="postgresql://{}:{}@{}?port={}&dbname={}".format( os.environ['TFIO_DEMO_DATABASE_USER'], os.environ['TFIO_DEMO_DATABASE_PASS'], os.environ['TFIO_DEMO_DATABASE_HOST'], os.environ['TFIO_DEMO_DATABASE_PORT'], os.environ['TFIO_DEMO_DATABASE_NAME'], ) dataset = tfio.experimental.IODataset.from_sql( query="SELECT co, pt08s1 FROM AirQualityUCI;", endpoint=endpoint) print(dataset.element_spec) dataset = tfio.experimental.IODataset.from_sql( query="SELECT nox, no2 FROM AirQualityUCI;", endpoint=endpoint) dataset = dataset.map(lambda e: (e['nox'] - e['no2'])) # check only the first 20 record dataset = dataset.take(20) print("NOx - NO2:") for difference in dataset: print(difference.numpy()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Reading PostgreSQL database from TensorFlow IO Step2: Install and setup PostgreSQL (optional) Step3: Setup necessary environmental variables Step4: Prepare data in PostgreSQL server Step5: Create Dataset from PostgreSQL server and use it in TensorFlow Step6: As you could see from the output of dataset.element_spec above, the element of the created Dataset is a python dict object with column names of the database table as keys.
9,555
<ASSISTANT_TASK:> Python Code: import os os.environ['TF_CPP_MIN_LOG_LEVEL']='2' import numpy as np np.set_printoptions(threshold=np.nan) import tensorflow as tf import time import pandas as pd import matplotlib.pyplot as plt import progressbar def calculate_contrast(window_orig, window_recon): ''' calculates the contrast metric for a given window of two images ''' k_2, L = 0.03, 255 c_2 = (L*k_2)**2 orig_data, recon_data = window_orig.flatten(), window_recon.flatten() var_x, var_y = np.var(recon_data), np.var(orig_data) num = 2*np.sqrt(var_x)*np.sqrt(var_y) + c_2 den = var_x + var_y + c_2 return num/den def calculate_structure(window_orig, window_recon): ''' calculates the structure metric for a given window of two images ''' k_2, L = 0.03, 255 c_2 = (L*k_2)**2 c_3 = c_2 / 2 orig_data, recon_data = window_orig.flatten(), window_recon.flatten() std_x, std_y = np.std(recon_data), np.std(orig_data) covar = np.cov(orig_data, recon_data)[0][1] num = covar + c_3 den = std_x * std_y + c_3 return num/den raw_image_dim, filter_dim = 96, 11 train_size, test_size = 500, 140 # data input data_path = 'https://raw.githubusercontent.com/michaelneuder/image_quality_analysis/master/data/sample_data/' # train data --- 500 images, 96x96 pixels orig_500_raw = pd.read_csv('{}orig_500.txt'.format(data_path), header=None, delim_whitespace = True) recon_500_raw = pd.read_csv('{}recon_500.txt'.format(data_path), header=None, delim_whitespace = True) # test data --- 140 images, 96x96 pixels orig_140_raw = pd.read_csv('{}orig_140.txt'.format(data_path), header=None, delim_whitespace = True) recon_140_raw = pd.read_csv('{}recon_140.txt'.format(data_path), header=None, delim_whitespace = True) # reshape orig_500 = np.reshape(orig_500_raw.values, (train_size, raw_image_dim, raw_image_dim)) recon_500 = np.reshape(recon_500_raw.values, (train_size, raw_image_dim, raw_image_dim)) orig_140 = np.reshape(orig_140_raw.values, (test_size, raw_image_dim, raw_image_dim)) recon_140 = np.reshape(recon_140_raw.values, (test_size, raw_image_dim, raw_image_dim)) # make sure pictures look right f, axarr = plt.subplots(nrows=3,ncols=4, figsize=(12,9)) for i in range(3): index = np.random.randint(140) axarr[i,0].imshow(orig_500[index,:,:], cmap='gray') axarr[i,1].imshow(recon_500[index,:,:], cmap='gray') axarr[i,2].imshow(orig_140[index,:,:], cmap='gray') axarr[i,3].imshow(recon_140[index,:,:], cmap='gray') axarr[0,0].set_title('original') axarr[0,1].set_title('reconstructed') axarr[0,2].set_title('original test') axarr[0,3].set_title('recon test') for ax_row in axarr: for ax in ax_row: ax.set_xticklabels([]) ax.set_yticklabels([]) f.suptitle('training & testing data sample', size=20) # plt.savefig('tt_data_sample.png') plt.show() def image_contrast(orig_im, recon_im): ''' gets the contrast for each patch of a set of images. ''' contrast_res = [] number_windows = orig_im.shape[0] - filter_dim + 1 for i in range(number_windows): for j in range(number_windows): orig_window = orig_im[i:i+11, j:j+11] recon_window = recon_im[i:i+11, j:j+11] temp = calculate_contrast(orig_window, recon_window) contrast_res.append(temp) return np.reshape(contrast_res, (number_windows, number_windows)) def image_structure(orig_im, recon_im): ''' gets the structure for each patch of a set of images. ''' structure_res = [] number_windows = orig_im.shape[0] - filter_dim + 1 for i in range(number_windows): for j in range(number_windows): orig_window = orig_im[i:i+11, j:j+11] recon_window = recon_im[i:i+11, j:j+11] temp = calculate_structure(orig_window, recon_window) structure_res.append(temp) return np.reshape(structure_res, (number_windows, number_windows)) contrast_res, structure_res = [], [] indeces = [] for ii in range(3): index = np.random.randint(140) indeces.append(index) temp_im_orig = orig_500[index,:,:] temp_im_recon = recon_500[index,:,:] contrast_res.append(image_contrast(temp_im_orig, temp_im_recon)) structure_res.append(image_structure(temp_im_orig, temp_im_recon)) contrast_res = np.asarray(contrast_res) structure_res = np.asarray(structure_res) f, axarr = plt.subplots(nrows=3,ncols=4, figsize=(12,9)) for i in range(3): axarr[i,0].imshow(orig_500[indeces[i],:,:], cmap='gray') axarr[i,1].imshow(recon_500[indeces[i],:,:], cmap='gray') axarr[i,2].imshow(contrast_res[i,:,:], cmap='viridis') axarr[i,3].imshow(structure_res[i,:,:], cmap='BuPu') axarr[0,0].set_title('original', size=15) axarr[0,1].set_title('reconstructed', size=15) axarr[0,2].set_title('contrast', size=15) axarr[0,3].set_title('structure', size=15) for ax_row in axarr: for ax in ax_row: ax.set_xticklabels([]) ax.set_yticklabels([]) f.suptitle('contrast & structure data sample', size=17) # plt.savefig('contrast_structure_data_sample.png') plt.show() def average_pool(window): return np.mean(window) def down_sample(orig_im, recon_im, pool_size): ''' down samples image by a factor of pool_size ''' reduce_im_orig, reduce_im_recon = [], [] number_pools = int(orig_im.shape[0] / pool_size) for i in range(number_pools): for j in range(number_pools): orig_pool = orig_im[i*pool_size:i*pool_size+pool_size, j*pool_size:j*pool_size+pool_size] recon_pool = recon_im[i*pool_size:i*pool_size+pool_size, j*pool_size:j*pool_size+pool_size] temp_orig, temp_recon = np.mean(orig_pool), np.mean(recon_pool) reduce_im_orig.append(temp_orig) reduce_im_recon.append(temp_recon) return np.reshape(reduce_im_orig, (number_pools,number_pools)), np.reshape(reduce_im_recon, (number_pools,number_pools)) down_sample_res = [] indeces = [] pool_size = 2 for ii in range(3): index = np.random.randint(140) indeces.append(index) temp_im_orig = orig_500[index,:,:] temp_im_recon = recon_500[index,:,:] down_sample_res.append(down_sample(temp_im_orig, temp_im_recon, pool_size)) down_sample_res = np.asarray(down_sample_res) down_sample_res.shape f, axarr = plt.subplots(nrows=3,ncols=4, figsize=(12,9)) for i in range(3): axarr[i,0].imshow(down_sample_res[i,0,:,:], cmap='gray') axarr[i,1].imshow(down_sample_res[i,1,:,:], cmap='gray') axarr[i,2].imshow(image_contrast(down_sample_res[i,0,:,:], down_sample_res[i,1,:,:]), cmap='viridis') axarr[i,3].imshow(image_structure(down_sample_res[i,0,:,:], down_sample_res[i,1,:,:]), cmap='BuPu') axarr[0,0].set_title('original', size=15) axarr[0,1].set_title('reconstructed', size=15) axarr[0,2].set_title('contrast', size=15) axarr[0,3].set_title('structure', size=15) for ax_row in axarr: for ax in ax_row: ax.set_xticklabels([]) ax.set_yticklabels([]) f.suptitle('contrast & structure data sample reduced image size', size=17) # plt.savefig('contrast_structure_data_sample_red1.png') plt.show() down_sample_res = [] indeces = [] pool_size = 2 for ii in range(3): index = np.random.randint(140) indeces.append(index) temp_im_orig = orig_500[index,:,:] temp_im_recon = recon_500[index,:,:] one_ds = down_sample(temp_im_orig, temp_im_recon, pool_size) two_ds = down_sample(one_ds[0], one_ds[1], pool_size) down_sample_res.append(two_ds) down_sample_res = np.asarray(down_sample_res) down_sample_res.shape f, axarr = plt.subplots(nrows=3,ncols=4, figsize=(12,9)) for i in range(3): axarr[i,0].imshow(down_sample_res[i,0,:,:], cmap='gray') axarr[i,1].imshow(down_sample_res[i,1,:,:], cmap='gray') axarr[i,2].imshow(image_contrast(down_sample_res[i,0,:,:], down_sample_res[i,1,:,:]), cmap='viridis') axarr[i,3].imshow(image_structure(down_sample_res[i,0,:,:], down_sample_res[i,1,:,:]), cmap='BuPu') axarr[0,0].set_title('original', size=15) axarr[0,1].set_title('reconstructed', size=15) axarr[0,2].set_title('contrast', size=15) axarr[0,3].set_title('structure', size=15) for ax_row in axarr: for ax in ax_row: ax.set_xticklabels([]) ax.set_yticklabels([]) f.suptitle('contrast & structure data sample reduced image size', size=17) # plt.savefig('contrast_structure_data_sample_red2.png') plt.show() def calculate_luminance(window_orig, window_recon): ''' calculates the contrast metric for a given window of two images ''' k_1, L = 0.01, 255 c_1 = (L*k_1)**2 orig_data, recon_data = window_orig.flatten(), window_recon.flatten() mean_x, mean_y = np.mean(recon_data), np.mean(orig_data) num = 2*mean_x*mean_y + c_1 den = np.square(mean_x)+ np.square(mean_y) + c_1 return num/den def image_luminance(orig_im, recon_im): ''' gets the contrast for each patch of a set of images. ''' luminance_res = [] number_windows = orig_im.shape[0] - filter_dim + 1 for i in range(number_windows): for j in range(number_windows): orig_window = orig_im[i:i+11, j:j+11] recon_window = recon_im[i:i+11, j:j+11] temp = calculate_luminance(orig_window, recon_window) luminance_res.append(temp) return np.reshape(luminance_res, (number_windows, number_windows)) luminance_res = [] indeces = [] for ii in range(3): index = np.random.randint(140) indeces.append(index) temp_im_orig = orig_500[index,:,:] temp_im_recon = recon_500[index,:,:] luminance_res.append(image_luminance(temp_im_orig, temp_im_recon)) luminance_res = np.asarray(luminance_res) f, axarr = plt.subplots(nrows=3,ncols=3, figsize=(9,9)) for i in range(3): axarr[i,0].imshow(orig_500[indeces[i],:,:], cmap='gray') axarr[i,1].imshow(recon_500[indeces[i],:,:], cmap='gray') axarr[i,2].imshow(luminance_res[i,:,:], cmap='copper') axarr[0,0].set_title('original', size=15) axarr[0,1].set_title('reconstructed', size=15) axarr[0,2].set_title('luminance', size=15) for ax_row in axarr: for ax in ax_row: ax.set_xticklabels([]) ax.set_yticklabels([]) f.suptitle('luminance data sample', size=17) # plt.savefig('luminance_data_sample.png') plt.show() f, axarr = plt.subplots(nrows=3,ncols=3, figsize=(9,9)) for i in range(3): axarr[i,0].imshow(down_sample_res[i,0,:,:], cmap='gray') axarr[i,1].imshow(down_sample_res[i,1,:,:], cmap='gray') axarr[i,2].imshow(image_luminance(down_sample_res[i,0,:,:], down_sample_res[i,1,:,:]), cmap='copper') axarr[0,0].set_title('original', size=15) axarr[0,1].set_title('reconstructed', size=15) axarr[0,2].set_title('luminance', size=15) for ax_row in axarr: for ax in ax_row: ax.set_xticklabels([]) ax.set_yticklabels([]) f.suptitle('luminance data sample reduced image size', size=17) # plt.savefig('luminance_data_sample_red2.png') plt.show() index = 269 sample_image_orig = orig_500[index,:,:]; sample_image_recon = recon_500[index,:,:]; sample_image_con = image_contrast(sample_image_orig,sample_image_recon) sample_image_str = image_contrast(sample_image_orig,sample_image_recon) sample_image_orig_ds1, sample_image_recon_ds1 = down_sample(sample_image_orig, sample_image_recon, 2) sample_image_con_ds1 = image_contrast(sample_image_orig_ds1,sample_image_recon_ds1) sample_image_str_ds1 = image_contrast(sample_image_orig_ds1,sample_image_recon_ds1) sample_image_orig_ds2, sample_image_recon_ds2 = down_sample(sample_image_orig_ds1, sample_image_recon_ds1, 2) sample_image_con_ds2 = image_contrast(sample_image_orig_ds2,sample_image_recon_ds2) sample_image_str_ds2 = image_contrast(sample_image_orig_ds2,sample_image_recon_ds2) import matplotlib.gridspec as gridspec plt.figure(figsize = (12,9)) gs1 = gridspec.GridSpec(3, 4) gs1.update(wspace=0.03, hspace=0.03) ax_dict = {} for ii in range(12): ax_dict[ii] = plt.subplot(gs1[ii]) ax_dict[ii].set_xticklabels([]) ax_dict[ii].set_yticklabels([]) ax_dict[ii].get_xaxis().set_visible(False) ax_dict[ii].get_yaxis().set_visible(False) ax_dict[0].set_title('original', size=20) ax_dict[1].set_title('reconstructed', size=20) ax_dict[2].set_title('contrast', size=20) ax_dict[3].set_title('structure', size=20) ax_dict[0].imshow(sample_image_orig, cmap='gray') ax_dict[1].imshow(sample_image_recon, cmap='gray') ax_dict[2].imshow(sample_image_con, cmap='viridis') ax_dict[3].imshow(sample_image_str, cmap='bone') ax_dict[4].imshow(sample_image_orig_ds1, cmap='gray') ax_dict[5].imshow(sample_image_recon_ds1, cmap='gray') ax_dict[6].imshow(sample_image_con_ds1, cmap='viridis') ax_dict[7].imshow(sample_image_str_ds1, cmap='bone') ax_dict[8].imshow(sample_image_orig_ds2, cmap='gray') ax_dict[9].imshow(sample_image_recon_ds2, cmap='gray') ax_dict[10].imshow(sample_image_con_ds2, cmap='viridis') ax_dict[11].imshow(sample_image_str_ds2, cmap='bone') plt.savefig('data_sample_msssim.png') plt.show() import matplotlib.gridspec as gridspec plt.figure(figsize = (12,12)) gs1 = gridspec.GridSpec(3, 3) gs1.update(wspace=0.03, hspace=0.03) ax_dict = {} for ii in range(9): ax_dict[ii] = plt.subplot(gs1[ii]) ax_dict[ii].set_xticklabels([]) ax_dict[ii].set_yticklabels([]) ax_dict[ii].get_xaxis().set_visible(False) ax_dict[ii].get_yaxis().set_visible(False) for ii in range(3): ax_dict[3*ii].imshow(down_sample_res[ii,0,:,:], cmap='gray') ax_dict[3*ii+1].imshow(down_sample_res[ii,1,:,:], cmap='gray') ax_dict[3*ii+2].imshow(image_luminance(down_sample_res[i,0,:,:], down_sample_res[ii,1,:,:]), cmap='copper') ax_dict[0].set_title('original', size=20) ax_dict[1].set_title('reconstructed', size=20) ax_dict[2].set_title('luminance', size=20) plt.savefig('lum.png') plt.show() # contrast_res, structure_res = [], [] # bar = progressbar.ProgressBar() # for ii in bar(range(140)): # temp_im_orig = orig_140[ii,:,:] # temp_im_recon = recon_140[ii,:,:] # contrast_res.append(image_contrast(temp_im_orig, temp_im_recon)) # structure_res.append(image_structure(temp_im_orig, temp_im_recon)) # contrast_res = np.asarray(contrast_res) # structure_res = np.asarray(structure_res) # luminance_res = [] # bar = progressbar.ProgressBar() # for ii in bar(range(140)): # temp_im_orig = orig_140[ii,:,:] # temp_im_recon = recon_140[ii,:,:] # luminance_res.append(image_luminance(temp_im_orig, temp_im_recon)) # luminance_res = np.asarray(luminance_res) # np.savetxt('luminance_140.csv', np.reshape(luminance_res, (140, 7396)), delimiter=',') # np.savetxt('contrast_500.csv', np.reshape(contrast_res, (140, 7396)), delimiter=',') # np.savetxt('structure_500.csv', np.reshape(structure_res, (140, 7396)), delimiter=',') # np.savetxt('cxs_500.csv', np.reshape(contrast_res*structure_res, (140, 7396)), delimiter=',') # down_sample_res = [] # pool_size = 2 # bar = progressbar.ProgressBar() # for ii in bar(range(140)): # temp_im_orig = orig_140[ii,:,:] # temp_im_recon = recon_140[ii,:,:] # one_ds = down_sample(temp_im_orig, temp_im_recon, pool_size) # two_ds = down_sample(one_ds[0], one_ds[1], pool_size) # down_sample_res.append(two_ds) # down_sample_res = np.asarray(down_sample_res) # down_sample_res.shape # luminance_res = [] # bar = progressbar.ProgressBar() # for ii in bar(range(140)): # temp_im_orig = down_sample_res[ii,0,:,:] # temp_im_recon = down_sample_res[ii,1,:,:] # luminance_res.append(image_luminance(temp_im_orig, temp_im_recon)) # luminance_res = np.asarray(luminance_res) # np.savetxt('luminance_140.csv', np.reshape(luminance_res, (140, 14*14)), delimiter=',') # ds2_orig = down_sample_res[:,0,:,:] # ds2_recon = down_sample_res[:,1,:,:] # np.savetxt('ds2_orig_140.csv', np.reshape(ds2_orig, (140, 24*24)), delimiter=',') # np.savetxt('ds2_recon_140.csv', np.reshape(ds2_recon, (140, 24*24)), delimiter=',') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Now that we have the metrics in place we can load the data an run them iteratively at each size of the images. Step2: data looks good. now we can get the contrast and structures for the full size images. Step3: Lets test these functions on a couple images and see how they look. Step4: This looks pretty good. Now lets do some down sampling and see how those look Step5: Now that we have the downsampled images, we can run the structure and contrast functions on them again. Step6: One more down sampling will be done when we do the ms ssim scores so lets just take a look at one more level. Step7: A lot of the information is lost when the images are so small, but so it goes. Now the last componenet of the ms ssim calculation is the luminance scale which is calclulated at the lowest resolution used (24x24) in this case. Step8: Lets check luminance on the larger images to make sure it is sensible. Step9: Not really what i expected, but it looks right. Now lets do it for the lowest resolution images. Step10: paper plot Step11: Now we have all the compnents of ms ssim. Now we can create the data sets we need in order to train the network. First lets create a full size image version of contrast times structure.
9,556
<ASSISTANT_TASK:> Python Code: # As usual, a bit of setup from __future__ import print_function import numpy as np import matplotlib.pyplot as plt from cs231n.classifiers.cnn import * from cs231n.data_utils import get_CIFAR10_data from cs231n.gradient_check import eval_numerical_gradient_array, eval_numerical_gradient from cs231n.layers import * from cs231n.fast_layers import * from cs231n.solver import Solver %matplotlib inline plt.rcParams['figure.figsize'] = (10.0, 8.0) # set default size of plots plt.rcParams['image.interpolation'] = 'nearest' plt.rcParams['image.cmap'] = 'gray' # for auto-reloading external modules # see http://stackoverflow.com/questions/1907993/autoreload-of-modules-in-ipython %load_ext autoreload %autoreload 2 def rel_error(x, y): returns relative error return np.max(np.abs(x - y) / (np.maximum(1e-8, np.abs(x) + np.abs(y)))) # Load the (preprocessed) CIFAR10 data. data = get_CIFAR10_data() for k, v in data.items(): print('%s: ' % k, v.shape) x_shape = (2, 3, 4, 4) w_shape = (3, 3, 4, 4) x = np.linspace(-0.1, 0.5, num=np.prod(x_shape)).reshape(x_shape) w = np.linspace(-0.2, 0.3, num=np.prod(w_shape)).reshape(w_shape) b = np.linspace(-0.1, 0.2, num=3) conv_param = {'stride': 2, 'pad': 1} out, _ = conv_forward_naive(x, w, b, conv_param) correct_out = np.array([[[[-0.08759809, -0.10987781], [-0.18387192, -0.2109216 ]], [[ 0.21027089, 0.21661097], [ 0.22847626, 0.23004637]], [[ 0.50813986, 0.54309974], [ 0.64082444, 0.67101435]]], [[[-0.98053589, -1.03143541], [-1.19128892, -1.24695841]], [[ 0.69108355, 0.66880383], [ 0.59480972, 0.56776003]], [[ 2.36270298, 2.36904306], [ 2.38090835, 2.38247847]]]]) # Compare your output to ours; difference should be around 2e-8 print('Testing conv_forward_naive') print('difference: ', rel_error(out, correct_out)) from scipy.misc import imread, imresize kitten, puppy = imread('kitten.jpg'), imread('puppy.jpg') # kitten is wide, and puppy is already square d = kitten.shape[1] - kitten.shape[0] kitten_cropped = kitten[:, d//2:-d//2, :] img_size = 200 # Make this smaller if it runs too slow x = np.zeros((2, 3, img_size, img_size)) x[0, :, :, :] = imresize(puppy, (img_size, img_size)).transpose((2, 0, 1)) x[1, :, :, :] = imresize(kitten_cropped, (img_size, img_size)).transpose((2, 0, 1)) # Set up a convolutional weights holding 2 filters, each 3x3 w = np.zeros((2, 3, 3, 3)) # The first filter converts the image to grayscale. # Set up the red, green, and blue channels of the filter. w[0, 0, :, :] = [[0, 0, 0], [0, 0.3, 0], [0, 0, 0]] w[0, 1, :, :] = [[0, 0, 0], [0, 0.6, 0], [0, 0, 0]] w[0, 2, :, :] = [[0, 0, 0], [0, 0.1, 0], [0, 0, 0]] # Second filter detects horizontal edges in the blue channel. w[1, 2, :, :] = [[1, 2, 1], [0, 0, 0], [-1, -2, -1]] # Vector of biases. We don't need any bias for the grayscale # filter, but for the edge detection filter we want to add 128 # to each output so that nothing is negative. b = np.array([0, 128]) # Compute the result of convolving each input in x with each filter in w, # offsetting by b, and storing the results in out. out, _ = conv_forward_naive(x, w, b, {'stride': 1, 'pad': 1}) def imshow_noax(img, normalize=True): Tiny helper to show images as uint8 and remove axis labels if normalize: img_max, img_min = np.max(img), np.min(img) img = 255.0 * (img - img_min) / (img_max - img_min) plt.imshow(img.astype('uint8')) plt.gca().axis('off') # Show the original images and the results of the conv operation plt.subplot(2, 3, 1) imshow_noax(puppy, normalize=False) plt.title('Original image') plt.subplot(2, 3, 2) imshow_noax(out[0, 0]) plt.title('Grayscale') plt.subplot(2, 3, 3) imshow_noax(out[0, 1]) plt.title('Edges') plt.subplot(2, 3, 4) imshow_noax(kitten_cropped, normalize=False) plt.subplot(2, 3, 5) imshow_noax(out[1, 0]) plt.subplot(2, 3, 6) imshow_noax(out[1, 1]) plt.show() np.random.seed(231) x = np.random.randn(4, 3, 5, 5) w = np.random.randn(2, 3, 3, 3) b = np.random.randn(2,) dout = np.random.randn(4, 2, 5, 5) conv_param = {'stride': 1, 'pad': 1} dx_num = eval_numerical_gradient_array(lambda x: conv_forward_naive(x, w, b, conv_param)[0], x, dout) dw_num = eval_numerical_gradient_array(lambda w: conv_forward_naive(x, w, b, conv_param)[0], w, dout) db_num = eval_numerical_gradient_array(lambda b: conv_forward_naive(x, w, b, conv_param)[0], b, dout) out, cache = conv_forward_naive(x, w, b, conv_param) dx, dw, db = conv_backward_naive(dout, cache) # Your errors should be around 1e-8' print('Testing conv_backward_naive function') print('dx error: ', rel_error(dx, dx_num)) print('dw error: ', rel_error(dw, dw_num)) print('db error: ', rel_error(db, db_num)) x_shape = (2, 3, 4, 4) x = np.linspace(-0.3, 0.4, num=np.prod(x_shape)).reshape(x_shape) pool_param = {'pool_width': 2, 'pool_height': 2, 'stride': 2} out, _ = max_pool_forward_naive(x, pool_param) correct_out = np.array([[[[-0.26315789, -0.24842105], [-0.20421053, -0.18947368]], [[-0.14526316, -0.13052632], [-0.08631579, -0.07157895]], [[-0.02736842, -0.01263158], [ 0.03157895, 0.04631579]]], [[[ 0.09052632, 0.10526316], [ 0.14947368, 0.16421053]], [[ 0.20842105, 0.22315789], [ 0.26736842, 0.28210526]], [[ 0.32631579, 0.34105263], [ 0.38526316, 0.4 ]]]]) # Compare your output with ours. Difference should be around 1e-8. print('Testing max_pool_forward_naive function:') print('difference: ', rel_error(out, correct_out)) np.random.seed(231) x = np.random.randn(3, 2, 8, 8) dout = np.random.randn(3, 2, 4, 4) pool_param = {'pool_height': 2, 'pool_width': 2, 'stride': 2} dx_num = eval_numerical_gradient_array(lambda x: max_pool_forward_naive(x, pool_param)[0], x, dout) out, cache = max_pool_forward_naive(x, pool_param) dx = max_pool_backward_naive(dout, cache) # Your error should be around 1e-12 print('Testing max_pool_backward_naive function:') print('dx error: ', rel_error(dx, dx_num)) from cs231n.fast_layers import conv_forward_fast, conv_backward_fast from time import time np.random.seed(231) x = np.random.randn(100, 3, 31, 31) w = np.random.randn(25, 3, 3, 3) b = np.random.randn(25,) dout = np.random.randn(100, 25, 16, 16) conv_param = {'stride': 2, 'pad': 1} t0 = time() out_naive, cache_naive = conv_forward_naive(x, w, b, conv_param) t1 = time() out_fast, cache_fast = conv_forward_fast(x, w, b, conv_param) t2 = time() print('Testing conv_forward_fast:') print('Naive: %fs' % (t1 - t0)) print('Fast: %fs' % (t2 - t1)) print('Speedup: %fx' % ((t1 - t0) / (t2 - t1))) print('Difference: ', rel_error(out_naive, out_fast)) t0 = time() dx_naive, dw_naive, db_naive = conv_backward_naive(dout, cache_naive) t1 = time() dx_fast, dw_fast, db_fast = conv_backward_fast(dout, cache_fast) t2 = time() print('\nTesting conv_backward_fast:') print('Naive: %fs' % (t1 - t0)) print('Fast: %fs' % (t2 - t1)) print('Speedup: %fx' % ((t1 - t0) / (t2 - t1))) print('dx difference: ', rel_error(dx_naive, dx_fast)) print('dw difference: ', rel_error(dw_naive, dw_fast)) print('db difference: ', rel_error(db_naive, db_fast)) from cs231n.fast_layers import max_pool_forward_fast, max_pool_backward_fast np.random.seed(231) x = np.random.randn(100, 3, 32, 32) dout = np.random.randn(100, 3, 16, 16) pool_param = {'pool_height': 2, 'pool_width': 2, 'stride': 2} t0 = time() out_naive, cache_naive = max_pool_forward_naive(x, pool_param) t1 = time() out_fast, cache_fast = max_pool_forward_fast(x, pool_param) t2 = time() print('Testing pool_forward_fast:') print('Naive: %fs' % (t1 - t0)) print('fast: %fs' % (t2 - t1)) print('speedup: %fx' % ((t1 - t0) / (t2 - t1))) print('difference: ', rel_error(out_naive, out_fast)) t0 = time() dx_naive = max_pool_backward_naive(dout, cache_naive) t1 = time() dx_fast = max_pool_backward_fast(dout, cache_fast) t2 = time() print('\nTesting pool_backward_fast:') print('Naive: %fs' % (t1 - t0)) print('speedup: %fx' % ((t1 - t0) / (t2 - t1))) print('dx difference: ', rel_error(dx_naive, dx_fast)) from cs231n.layer_utils import conv_relu_pool_forward, conv_relu_pool_backward np.random.seed(231) x = np.random.randn(2, 3, 16, 16) w = np.random.randn(3, 3, 3, 3) b = np.random.randn(3,) dout = np.random.randn(2, 3, 8, 8) conv_param = {'stride': 1, 'pad': 1} pool_param = {'pool_height': 2, 'pool_width': 2, 'stride': 2} out, cache = conv_relu_pool_forward(x, w, b, conv_param, pool_param) dx, dw, db = conv_relu_pool_backward(dout, cache) dx_num = eval_numerical_gradient_array(lambda x: conv_relu_pool_forward(x, w, b, conv_param, pool_param)[0], x, dout) dw_num = eval_numerical_gradient_array(lambda w: conv_relu_pool_forward(x, w, b, conv_param, pool_param)[0], w, dout) db_num = eval_numerical_gradient_array(lambda b: conv_relu_pool_forward(x, w, b, conv_param, pool_param)[0], b, dout) print('Testing conv_relu_pool') print('dx error: ', rel_error(dx_num, dx)) print('dw error: ', rel_error(dw_num, dw)) print('db error: ', rel_error(db_num, db)) from cs231n.layer_utils import conv_relu_forward, conv_relu_backward np.random.seed(231) x = np.random.randn(2, 3, 8, 8) w = np.random.randn(3, 3, 3, 3) b = np.random.randn(3,) dout = np.random.randn(2, 3, 8, 8) conv_param = {'stride': 1, 'pad': 1} out, cache = conv_relu_forward(x, w, b, conv_param) dx, dw, db = conv_relu_backward(dout, cache) dx_num = eval_numerical_gradient_array(lambda x: conv_relu_forward(x, w, b, conv_param)[0], x, dout) dw_num = eval_numerical_gradient_array(lambda w: conv_relu_forward(x, w, b, conv_param)[0], w, dout) db_num = eval_numerical_gradient_array(lambda b: conv_relu_forward(x, w, b, conv_param)[0], b, dout) print('Testing conv_relu:') print('dx error: ', rel_error(dx_num, dx)) print('dw error: ', rel_error(dw_num, dw)) print('db error: ', rel_error(db_num, db)) model = ThreeLayerConvNet() N = 50 X = np.random.randn(N, 3, 32, 32) y = np.random.randint(10, size=N) loss, grads = model.loss(X, y) print('Initial loss (no regularization): ', loss) model.reg = 0.5 loss, grads = model.loss(X, y) print('Initial loss (with regularization): ', loss) num_inputs = 2 input_dim = (3, 16, 16) reg = 0.0 num_classes = 10 np.random.seed(231) X = np.random.randn(num_inputs, *input_dim) y = np.random.randint(num_classes, size=num_inputs) model = ThreeLayerConvNet(num_filters=3, filter_size=3, input_dim=input_dim, hidden_dim=7, dtype=np.float64) loss, grads = model.loss(X, y) for param_name in sorted(grads): f = lambda _: model.loss(X, y)[0] param_grad_num = eval_numerical_gradient(f, model.params[param_name], verbose=False, h=1e-6) e = rel_error(param_grad_num, grads[param_name]) print('%s max relative error: %e' % (param_name, rel_error(param_grad_num, grads[param_name]))) np.random.seed(231) num_train = 100 small_data = { 'X_train': data['X_train'][:num_train], 'y_train': data['y_train'][:num_train], 'X_val': data['X_val'], 'y_val': data['y_val'], } model = ThreeLayerConvNet(weight_scale=1e-2) solver = Solver(model, small_data, num_epochs=15, batch_size=50, update_rule='adam', optim_config={ 'learning_rate': 1e-3, }, verbose=True, print_every=1) solver.train() plt.subplot(2, 1, 1) plt.plot(solver.loss_history, 'o') plt.xlabel('iteration') plt.ylabel('loss') plt.subplot(2, 1, 2) plt.plot(solver.train_acc_history, '-o') plt.plot(solver.val_acc_history, '-o') plt.legend(['train', 'val'], loc='upper left') plt.xlabel('epoch') plt.ylabel('accuracy') plt.show() model = ThreeLayerConvNet(weight_scale=0.001, hidden_dim=500, reg=0.001) solver = Solver(model, data, num_epochs=1, batch_size=50, update_rule='adam', optim_config={ 'learning_rate': 1e-3, }, verbose=True, print_every=20) solver.train() from cs231n.vis_utils import visualize_grid grid = visualize_grid(model.params['W1'].transpose(0, 2, 3, 1)) plt.imshow(grid.astype('uint8')) plt.axis('off') plt.gcf().set_size_inches(5, 5) plt.show() np.random.seed(231) # Check the training-time forward pass by checking means and variances # of features both before and after spatial batch normalization N, C, H, W = 2, 3, 4, 5 x = 4 * np.random.randn(N, C, H, W) + 10 print('Before spatial batch normalization:') print(' Shape: ', x.shape) print(' Means: ', x.mean(axis=(0, 2, 3))) print(' Stds: ', x.std(axis=(0, 2, 3))) # Means should be close to zero and stds close to one gamma, beta = np.ones(C), np.zeros(C) bn_param = {'mode': 'train'} out, _ = spatial_batchnorm_forward(x, gamma, beta, bn_param) print('After spatial batch normalization:') print(' Shape: ', out.shape) print(' Means: ', out.mean(axis=(0, 2, 3))) print(' Stds: ', out.std(axis=(0, 2, 3))) # Means should be close to beta and stds close to gamma gamma, beta = np.asarray([3, 4, 5]), np.asarray([6, 7, 8]) out, _ = spatial_batchnorm_forward(x, gamma, beta, bn_param) print('After spatial batch normalization (nontrivial gamma, beta):') print(' Shape: ', out.shape) print(' Means: ', out.mean(axis=(0, 2, 3))) print(' Stds: ', out.std(axis=(0, 2, 3))) np.random.seed(231) # Check the test-time forward pass by running the training-time # forward pass many times to warm up the running averages, and then # checking the means and variances of activations after a test-time # forward pass. N, C, H, W = 10, 4, 11, 12 bn_param = {'mode': 'train'} gamma = np.ones(C) beta = np.zeros(C) for t in range(50): x = 2.3 * np.random.randn(N, C, H, W) + 13 spatial_batchnorm_forward(x, gamma, beta, bn_param) bn_param['mode'] = 'test' x = 2.3 * np.random.randn(N, C, H, W) + 13 a_norm, _ = spatial_batchnorm_forward(x, gamma, beta, bn_param) # Means should be close to zero and stds close to one, but will be # noisier than training-time forward passes. print('After spatial batch normalization (test-time):') print(' means: ', a_norm.mean(axis=(0, 2, 3))) print(' stds: ', a_norm.std(axis=(0, 2, 3))) np.random.seed(231) N, C, H, W = 2, 3, 4, 5 x = 5 * np.random.randn(N, C, H, W) + 12 gamma = np.random.randn(C) beta = np.random.randn(C) dout = np.random.randn(N, C, H, W) bn_param = {'mode': 'train'} fx = lambda x: spatial_batchnorm_forward(x, gamma, beta, bn_param)[0] fg = lambda a: spatial_batchnorm_forward(x, gamma, beta, bn_param)[0] fb = lambda b: spatial_batchnorm_forward(x, gamma, beta, bn_param)[0] dx_num = eval_numerical_gradient_array(fx, x, dout) da_num = eval_numerical_gradient_array(fg, gamma, dout) db_num = eval_numerical_gradient_array(fb, beta, dout) _, cache = spatial_batchnorm_forward(x, gamma, beta, bn_param) dx, dgamma, dbeta = spatial_batchnorm_backward(dout, cache) print('dx error: ', rel_error(dx_num, dx)) print('dgamma error: ', rel_error(da_num, dgamma)) print('dbeta error: ', rel_error(db_num, dbeta)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Convolutional Networks Step2: Convolution Step4: Aside Step5: Convolution Step6: Max pooling Step7: Max pooling Step8: Fast layers Step9: Convolutional "sandwich" layers Step10: Three-layer ConvNet Step11: Gradient check Step12: Overfit small data Step13: Plotting the loss, training accuracy, and validation accuracy should show clear overfitting Step14: Train the net Step15: Visualize Filters Step16: Spatial Batch Normalization Step17: Spatial batch normalization
9,557
<ASSISTANT_TASK:> Python Code: # Authors: Pierre Ablin <pierreablin@gmail.com> # # License: BSD (3-clause) from time import time import mne from mne.preprocessing import ICA from mne.datasets import sample print(__doc__) data_path = sample.data_path() raw_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw.fif' raw = mne.io.read_raw_fif(raw_fname, preload=True) picks = mne.pick_types(raw.info, meg=True) reject = dict(mag=5e-12, grad=4000e-13) raw.filter(1, 30, fir_design='firwin') def run_ica(method, fit_params=None): ica = ICA(n_components=20, method=method, fit_params=fit_params, random_state=0) t0 = time() ica.fit(raw, picks=picks, reject=reject) fit_time = time() - t0 title = ('ICA decomposition using %s (took %.1fs)' % (method, fit_time)) ica.plot_components(title=title) run_ica('fastica') run_ica('picard') run_ica('infomax') run_ica('infomax', fit_params=dict(extended=True)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Read and preprocess the data. Preprocessing consists of Step2: Define a function that runs ICA on the raw MEG data and plots the components Step3: FastICA Step4: Picard Step5: Infomax Step6: Extended Infomax
9,558
<ASSISTANT_TASK:> Python Code: # Setup feedback system from learntools.core import binder binder.bind(globals()) from learntools.time_series.ex3 import * # Setup notebook from pathlib import Path from learntools.time_series.style import * # plot style settings from learntools.time_series.utils import plot_periodogram, seasonal_plot import pandas as pd import matplotlib.pyplot as plt import numpy as np import seaborn as sns from sklearn.linear_model import LinearRegression from statsmodels.tsa.deterministic import CalendarFourier, DeterministicProcess comp_dir = Path('../input/store-sales-time-series-forecasting') holidays_events = pd.read_csv( comp_dir / "holidays_events.csv", dtype={ 'type': 'category', 'locale': 'category', 'locale_name': 'category', 'description': 'category', 'transferred': 'bool', }, parse_dates=['date'], infer_datetime_format=True, ) holidays_events = holidays_events.set_index('date').to_period('D') store_sales = pd.read_csv( comp_dir / 'train.csv', usecols=['store_nbr', 'family', 'date', 'sales'], dtype={ 'store_nbr': 'category', 'family': 'category', 'sales': 'float32', }, parse_dates=['date'], infer_datetime_format=True, ) store_sales['date'] = store_sales.date.dt.to_period('D') store_sales = store_sales.set_index(['store_nbr', 'family', 'date']).sort_index() average_sales = ( store_sales .groupby('date').mean() .squeeze() .loc['2017'] ) X = average_sales.to_frame() X["week"] = X.index.week X["day"] = X.index.dayofweek seasonal_plot(X, y='sales', period='week', freq='day'); plot_periodogram(average_sales); # View the solution (Run this cell to receive credit!) q_1.check() y = average_sales.copy() # YOUR CODE HERE fourier = ____ dp = DeterministicProcess( index=y.index, constant=True, order=1, # YOUR CODE HERE # ____ drop=True, ) X = ____ # Check your answer q_2.check() # Lines below will give you a hint or solution code #_COMMENT_IF(PROD)_ q_2.hint() #_COMMENT_IF(PROD)_ q_2.solution() #%%RM_IF(PROD)%% y = average_sales.copy() fourier = CalendarFourier(freq='M', order=12) dp = DeterministicProcess( index=y.index, constant=True, order=1, seasonal=True, additional_terms=[fourier], drop=True, ) X = dp.in_sample() q_2.assert_check_failed() #%%RM_IF(PROD)%% y = average_sales.copy() fourier = CalendarFourier(freq='A', order=4) dp = DeterministicProcess( index=y.index, constant=True, order=1, seasonal=True, additional_terms=[fourier], drop=True, ) X = dp.in_sample() q_2.assert_check_failed() #%%RM_IF(PROD)%% y = average_sales.copy() fourier = CalendarFourier(freq='M', order=4) dp = DeterministicProcess( index=y.index[1:], constant=True, order=1, seasonal=True, additional_terms=[fourier], drop=True, ) X = dp.in_sample() q_2.assert_check_failed() #%%RM_IF(PROD)%% y = average_sales.copy() fourier = CalendarFourier(freq='M', order=4) dp = DeterministicProcess( index=y.index[1:], constant=True, order=1, seasonal=False, additional_terms=[fourier], drop=True, ) X = dp.in_sample() q_2.assert_check_failed() #%%RM_IF(PROD)%% y = average_sales.copy() fourier = CalendarFourier(freq='M', order=4) dp = DeterministicProcess( index=y.index, constant=True, order=1, seasonal=True, # additional_terms=[fourier], drop=True, ) X = dp.in_sample() q_2.assert_check_failed() #%%RM_IF(PROD)%% y = average_sales.copy() fourier = CalendarFourier(freq='M', order=4) dp = DeterministicProcess( index=y.index, constant=True, order=1, seasonal=True, additional_terms=[fourier], drop=True, ) X = dp.in_sample() q_2.assert_check_passed() model = LinearRegression().fit(X, y) y_pred = pd.Series( model.predict(X), index=X.index, name='Fitted', ) y_pred = pd.Series(model.predict(X), index=X.index) ax = y.plot(**plot_params, alpha=0.5, title="Average Sales", ylabel="items sold") ax = y_pred.plot(ax=ax, label="Seasonal") ax.legend(); y_deseason = y - y_pred fig, (ax1, ax2) = plt.subplots(2, 1, sharex=True, sharey=True, figsize=(10, 7)) ax1 = plot_periodogram(y, ax=ax1) ax1.set_title("Product Sales Frequency Components") ax2 = plot_periodogram(y_deseason, ax=ax2); ax2.set_title("Deseasonalized"); # View the solution (Run this cell to receive credit!) q_3.check() # National and regional holidays in the training set holidays = ( holidays_events .query("locale in ['National', 'Regional']") .loc['2017':'2017-08-15', ['description']] .assign(description=lambda x: x.description.cat.remove_unused_categories()) ) display(holidays) ax = y_deseason.plot(**plot_params) plt.plot_date(holidays.index, y_deseason[holidays.index], color='C3') ax.set_title('National and Regional Holidays'); # YOUR CODE HERE #_UNCOMMENT_IF(PROD)_ #X_holidays = ____ #_UNCOMMENT_IF(PROD)_ #X2 = X.join(X_holidays, on='date').fillna(0.0) # Check your answer q_4.check() # Lines below will give you a hint or solution code #_COMMENT_IF(PROD)_ q_4.hint() #_COMMENT_IF(PROD)_ q_4.hint(2) #_COMMENT_IF(PROD)_ q_4.solution() #%%RM_IF(PROD)%% # Scikit-learn solution from sklearn.preprocessing import OneHotEncoder ohe = OneHotEncoder(sparse=False) X_holidays = pd.DataFrame( ohe.fit_transform(holidays), index=holidays.index, columns=holidays.description.unique(), ) X2 = X.join(X_holidays, on='date').fillna(0.0) q_4.assert_check_passed() #%%RM_IF(PROD)%% # Pandas solution X_holidays = pd.get_dummies(holidays) X2 = X.join(X_holidays, on='date').fillna(0.0) q_4.assert_check_passed() model = LinearRegression().fit(X2, y) y_pred = pd.Series( model.predict(X2), index=X2.index, name='Fitted', ) y_pred = pd.Series(model.predict(X2), index=X2.index) ax = y.plot(**plot_params, alpha=0.5, title="Average Sales", ylabel="items sold") ax = y_pred.plot(ax=ax, label="Seasonal") ax.legend(); y = store_sales.unstack(['store_nbr', 'family']).loc["2017"] # Create training data fourier = CalendarFourier(freq='M', order=4) dp = DeterministicProcess( index=y.index, constant=True, order=1, seasonal=True, additional_terms=[fourier], drop=True, ) X = dp.in_sample() X['NewYear'] = (X.index.dayofyear == 1) model = LinearRegression(fit_intercept=False) model.fit(X, y) y_pred = pd.DataFrame(model.predict(X), index=X.index, columns=y.columns) STORE_NBR = '1' # 1 - 54 FAMILY = 'PRODUCE' # Uncomment to see a list of product families # display(store_sales.index.get_level_values('family').unique()) ax = y.loc(axis=1)['sales', STORE_NBR, FAMILY].plot(**plot_params) ax = y_pred.loc(axis=1)['sales', STORE_NBR, FAMILY].plot(ax=ax) ax.set_title(f'{FAMILY} Sales at Store {STORE_NBR}'); df_test = pd.read_csv( comp_dir / 'test.csv', dtype={ 'store_nbr': 'category', 'family': 'category', 'onpromotion': 'uint32', }, parse_dates=['date'], infer_datetime_format=True, ) df_test['date'] = df_test.date.dt.to_period('D') df_test = df_test.set_index(['store_nbr', 'family', 'date']).sort_index() # Create features for test set X_test = dp.out_of_sample(steps=16) X_test.index.name = 'date' X_test['NewYear'] = (X_test.index.dayofyear == 1) y_submit = pd.DataFrame(model.predict(X_test), index=X_test.index, columns=y.columns) y_submit = y_submit.stack(['store_nbr', 'family']) y_submit = y_submit.join(df_test.id).reindex(columns=['id', 'sales']) y_submit.to_csv('submission.csv', index=False) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Examine the following seasonal plot Step2: And also the periodogram Step3: 1) Determine seasonality Step4: 2) Create seasonal features Step5: Now run this cell to fit the seasonal model. Step6: Removing from a series its trend or seasons is called detrending or deseasonalizing the series. Step7: 3) Check for remaining seasonality Step8: The Store Sales dataset includes a table of Ecuadorian holidays. Step9: From a plot of the deseasonalized Average Sales, it appears these holidays could have some predictive power. Step10: 4) Create holiday features Step11: Use this cell to fit the seasonal model with holiday features added. Do the fitted values seem to have improved? Step12: (Optional) Submit to Store Sales competition Step13: You can use this cell to see some of its predictions. Step14: Finally, this cell loads the test data, creates a feature set for the forecast period, and then creates the submission file submission.csv.
9,559
<ASSISTANT_TASK:> Python Code: import os # Google Cloud Notebook if os.path.exists("/opt/deeplearning/metadata/env_version"): USER_FLAG = "--user" else: USER_FLAG = "" ! pip3 install --upgrade google-cloud-aiplatform $USER_FLAG ! pip3 install -U google-cloud-storage $USER_FLAG if os.getenv("IS_TESTING"): ! pip3 install --upgrade tensorflow $USER_FLAG import os if not os.getenv("IS_TESTING"): # Automatically restart kernel after installs import IPython app = IPython.Application.instance() app.kernel.do_shutdown(True) PROJECT_ID = "[your-project-id]" # @param {type:"string"} if PROJECT_ID == "" or PROJECT_ID is None or PROJECT_ID == "[your-project-id]": # Get your GCP project id from gcloud shell_output = ! gcloud config list --format 'value(core.project)' 2>/dev/null PROJECT_ID = shell_output[0] print("Project ID:", PROJECT_ID) ! gcloud config set project $PROJECT_ID REGION = "us-central1" # @param {type: "string"} from datetime import datetime TIMESTAMP = datetime.now().strftime("%Y%m%d%H%M%S") # If you are running this notebook in Colab, run this cell and follow the # instructions to authenticate your GCP account. This provides access to your # Cloud Storage bucket and lets you submit training jobs and prediction # requests. import os import sys # If on Google Cloud Notebook, then don't execute this code if not os.path.exists("/opt/deeplearning/metadata/env_version"): if "google.colab" in sys.modules: from google.colab import auth as google_auth google_auth.authenticate_user() # If you are running this notebook locally, replace the string below with the # path to your service account key and run this cell to authenticate your GCP # account. elif not os.getenv("IS_TESTING"): %env GOOGLE_APPLICATION_CREDENTIALS '' BUCKET_NAME = "gs://[your-bucket-name]" # @param {type:"string"} if BUCKET_NAME == "" or BUCKET_NAME is None or BUCKET_NAME == "gs://[your-bucket-name]": BUCKET_NAME = "gs://" + PROJECT_ID + "aip-" + TIMESTAMP ! gsutil mb -l $REGION $BUCKET_NAME ! gsutil ls -al $BUCKET_NAME import google.cloud.aiplatform as aip aip.init(project=PROJECT_ID, staging_bucket=BUCKET_NAME) if os.getenv("IS_TESTING_TRAIN_GPU"): TRAIN_GPU, TRAIN_NGPU = ( aip.gapic.AcceleratorType.NVIDIA_TESLA_K80, int(os.getenv("IS_TESTING_TRAIN_GPU")), ) else: TRAIN_GPU, TRAIN_NGPU = (None, None) if os.getenv("IS_TESTING_DEPLOY_GPU"): DEPLOY_GPU, DEPLOY_NGPU = ( aip.gapic.AcceleratorType.NVIDIA_TESLA_K80, int(os.getenv("IS_TESTING_DEPLOY_GPU")), ) else: DEPLOY_GPU, DEPLOY_NGPU = (None, None) if os.getenv("IS_TESTING_TF"): TF = os.getenv("IS_TESTING_TF") else: TF = "2-1" if TF[0] == "2": if TRAIN_GPU: TRAIN_VERSION = "tf-gpu.{}".format(TF) else: TRAIN_VERSION = "tf-cpu.{}".format(TF) if DEPLOY_GPU: DEPLOY_VERSION = "tf2-gpu.{}".format(TF) else: DEPLOY_VERSION = "tf2-cpu.{}".format(TF) else: if TRAIN_GPU: TRAIN_VERSION = "tf-gpu.{}".format(TF) else: TRAIN_VERSION = "tf-cpu.{}".format(TF) if DEPLOY_GPU: DEPLOY_VERSION = "tf-gpu.{}".format(TF) else: DEPLOY_VERSION = "tf-cpu.{}".format(TF) TRAIN_IMAGE = "gcr.io/cloud-aiplatform/training/{}:latest".format(TRAIN_VERSION) DEPLOY_IMAGE = "gcr.io/cloud-aiplatform/prediction/{}:latest".format(DEPLOY_VERSION) print("Training:", TRAIN_IMAGE, TRAIN_GPU, TRAIN_NGPU) print("Deployment:", DEPLOY_IMAGE, DEPLOY_GPU, DEPLOY_NGPU) if os.getenv("IS_TESTING_TRAIN_MACHINE"): MACHINE_TYPE = os.getenv("IS_TESTING_TRAIN_MACHINE") else: MACHINE_TYPE = "n1-standard" VCPU = "4" TRAIN_COMPUTE = MACHINE_TYPE + "-" + VCPU print("Train machine type", TRAIN_COMPUTE) if os.getenv("IS_TESTING_DEPLOY_MACHINE"): MACHINE_TYPE = os.getenv("IS_TESTING_DEPLOY_MACHINE") else: MACHINE_TYPE = "n1-standard" VCPU = "4" DEPLOY_COMPUTE = MACHINE_TYPE + "-" + VCPU print("Deploy machine type", DEPLOY_COMPUTE) # Make folder for Python training script ! rm -rf custom ! mkdir custom # Add package information ! touch custom/README.md setup_cfg = "[egg_info]\n\ntag_build =\n\ntag_date = 0" ! echo "$setup_cfg" > custom/setup.cfg setup_py = "import setuptools\n\nsetuptools.setup(\n\n install_requires=[\n\n 'tensorflow_datasets==1.3.0',\n\n ],\n\n packages=setuptools.find_packages())" ! echo "$setup_py" > custom/setup.py pkg_info = "Metadata-Version: 1.0\n\nName: Boston Housing tabular regression\n\nVersion: 0.0.0\n\nSummary: Demostration training script\n\nHome-page: www.google.com\n\nAuthor: Google\n\nAuthor-email: aferlitsch@google.com\n\nLicense: Public\n\nDescription: Demo\n\nPlatform: Vertex" ! echo "$pkg_info" > custom/PKG-INFO # Make the training subfolder ! mkdir custom/trainer ! touch custom/trainer/__init__.py %%writefile custom/trainer/task.py # Single, Mirror and Multi-Machine Distributed Training for Boston Housing import tensorflow_datasets as tfds import tensorflow as tf from tensorflow.python.client import device_lib import numpy as np import argparse import os import sys tfds.disable_progress_bar() parser = argparse.ArgumentParser() parser.add_argument('--model-dir', dest='model_dir', default=os.getenv('AIP_MODEL_DIR'), type=str, help='Model dir.') parser.add_argument('--lr', dest='lr', default=0.001, type=float, help='Learning rate.') parser.add_argument('--epochs', dest='epochs', default=20, type=int, help='Number of epochs.') parser.add_argument('--steps', dest='steps', default=100, type=int, help='Number of steps per epoch.') parser.add_argument('--distribute', dest='distribute', type=str, default='single', help='distributed training strategy') parser.add_argument('--param-file', dest='param_file', default='/tmp/param.txt', type=str, help='Output file for parameters') args = parser.parse_args() print('Python Version = {}'.format(sys.version)) print('TensorFlow Version = {}'.format(tf.__version__)) print('TF_CONFIG = {}'.format(os.environ.get('TF_CONFIG', 'Not found'))) # Single Machine, single compute device if args.distribute == 'single': if tf.test.is_gpu_available(): strategy = tf.distribute.OneDeviceStrategy(device="/gpu:0") else: strategy = tf.distribute.OneDeviceStrategy(device="/cpu:0") # Single Machine, multiple compute device elif args.distribute == 'mirror': strategy = tf.distribute.MirroredStrategy() # Multiple Machine, multiple compute device elif args.distribute == 'multi': strategy = tf.distribute.experimental.MultiWorkerMirroredStrategy() # Multi-worker configuration print('num_replicas_in_sync = {}'.format(strategy.num_replicas_in_sync)) def make_dataset(): # Scaling Boston Housing data features def scale(feature): max = np.max(feature) feature = (feature / max).astype(np.float) return feature, max (x_train, y_train), (x_test, y_test) = tf.keras.datasets.boston_housing.load_data( path="boston_housing.npz", test_split=0.2, seed=113 ) params = [] for _ in range(13): x_train[_], max = scale(x_train[_]) x_test[_], _ = scale(x_test[_]) params.append(max) # store the normalization (max) value for each feature with tf.io.gfile.GFile(args.param_file, 'w') as f: f.write(str(params)) return (x_train, y_train), (x_test, y_test) # Build the Keras model def build_and_compile_dnn_model(): model = tf.keras.Sequential([ tf.keras.layers.Dense(128, activation='relu', input_shape=(13,)), tf.keras.layers.Dense(128, activation='relu'), tf.keras.layers.Dense(1, activation='linear') ]) model.compile( loss='mse', optimizer=tf.keras.optimizers.RMSprop(learning_rate=args.lr)) return model NUM_WORKERS = strategy.num_replicas_in_sync # Here the batch size scales up by number of workers since # `tf.data.Dataset.batch` expects the global batch size. BATCH_SIZE = 16 GLOBAL_BATCH_SIZE = BATCH_SIZE * NUM_WORKERS with strategy.scope(): # Creation of dataset, and model building/compiling need to be within # `strategy.scope()`. model = build_and_compile_dnn_model() # Train the model (x_train, y_train), (x_test, y_test) = make_dataset() model.fit(x_train, y_train, epochs=args.epochs, batch_size=GLOBAL_BATCH_SIZE) model.save(args.model_dir) ! rm -f custom.tar custom.tar.gz ! tar cvf custom.tar custom ! gzip custom.tar ! gsutil cp custom.tar.gz $BUCKET_NAME/trainer_boston.tar.gz job = aip.CustomTrainingJob( display_name="boston_" + TIMESTAMP, script_path="custom/trainer/task.py", container_uri=TRAIN_IMAGE, requirements=["gcsfs==0.7.1", "tensorflow-datasets==4.4"], ) print(job) MODEL_DIR = "{}/{}".format(BUCKET_NAME, TIMESTAMP) EPOCHS = 20 STEPS = 100 DIRECT = True if DIRECT: CMDARGS = [ "--model-dir=" + MODEL_DIR, "--epochs=" + str(EPOCHS), "--steps=" + str(STEPS), ] else: CMDARGS = [ "--epochs=" + str(EPOCHS), "--steps=" + str(STEPS), ] if TRAIN_GPU: job.run( args=CMDARGS, replica_count=1, machine_type=TRAIN_COMPUTE, accelerator_type=TRAIN_GPU.name, accelerator_count=TRAIN_NGPU, base_output_dir=MODEL_DIR, sync=True, ) else: job.run( args=CMDARGS, replica_count=1, machine_type=TRAIN_COMPUTE, base_output_dir=MODEL_DIR, sync=True, ) model_path_to_deploy = MODEL_DIR import tensorflow as tf local_model = tf.keras.models.load_model(MODEL_DIR) import numpy as np from tensorflow.keras.datasets import boston_housing (_, _), (x_test, y_test) = boston_housing.load_data( path="boston_housing.npz", test_split=0.2, seed=113 ) def scale(feature): max = np.max(feature) feature = (feature / max).astype(np.float32) return feature # Let's save one data item that has not been scaled x_test_notscaled = x_test[0:1].copy() for _ in range(13): x_test[_] = scale(x_test[_]) x_test = x_test.astype(np.float32) print(x_test.shape, x_test.dtype, y_test.shape) print("scaled", x_test[0]) print("unscaled", x_test_notscaled) local_model.evaluate(x_test, y_test) loaded = tf.saved_model.load(model_path_to_deploy) serving_input = list( loaded.signatures["serving_default"].structured_input_signature[1].keys() )[0] print("Serving function input:", serving_input) serving_output = list(loaded.signatures["serving_default"].structured_outputs.keys())[0] print("Serving function output:", serving_output) input_name = local_model.input.name print("Model input name:", input_name) output_name = local_model.output.name print("Model output name:", output_name) XAI = "ig" # [ shapley, ig, xrai ] if XAI == "shapley": PARAMETERS = {"sampled_shapley_attribution": {"path_count": 10}} elif XAI == "ig": PARAMETERS = {"integrated_gradients_attribution": {"step_count": 50}} elif XAI == "xrai": PARAMETERS = {"xrai_attribution": {"step_count": 50}} parameters = aip.explain.ExplanationParameters(PARAMETERS) INPUT_METADATA = { "input_tensor_name": serving_input, "encoding": "BAG_OF_FEATURES", "modality": "numeric", "index_feature_mapping": [ "crim", "zn", "indus", "chas", "nox", "rm", "age", "dis", "rad", "tax", "ptratio", "b", "lstat", ], } OUTPUT_METADATA = {"output_tensor_name": serving_output} input_metadata = aip.explain.ExplanationMetadata.InputMetadata(INPUT_METADATA) output_metadata = aip.explain.ExplanationMetadata.OutputMetadata(OUTPUT_METADATA) metadata = aip.explain.ExplanationMetadata( inputs={"features": input_metadata}, outputs={"medv": output_metadata} ) model = aip.Model.upload( display_name="boston_" + TIMESTAMP, artifact_uri=MODEL_DIR, serving_container_image_uri=DEPLOY_IMAGE, explanation_parameters=parameters, explanation_metadata=metadata, sync=False, ) model.wait() ! gsutil cat $IMPORT_FILE | head -n 1 > tmp.csv ! gsutil cat $IMPORT_FILE | tail -n 10 >> tmp.csv ! cut -d, -f1-16 tmp.csv > batch.csv gcs_input_uri = BUCKET_NAME + "/test.csv" ! gsutil cp batch.csv $gcs_input_uri MIN_NODES = 1 MAX_NODES = 1 batch_predict_job = model.batch_predict( job_display_name="boston_" + TIMESTAMP, gcs_source=gcs_input_uri, gcs_destination_prefix=BUCKET_NAME, instances_format="csv", predictions_format="jsonl", machine_type=DEPLOY_COMPUTE, starting_replica_count=MIN_NODES, max_replica_count=MAX_NODES, generate_explanation=True, sync=False, ) print(batch_predict_job) if not os.getenv("IS_TESTING"): batch_predict_job.wait() if not os.getenv("IS_TESTING"): import tensorflow as tf bp_iter_outputs = batch_predict_job.iter_outputs() explanation_results = list() for blob in bp_iter_outputs: if blob.name.split("/")[-1].startswith("explanation"): explanation_results.append(blob.name) tags = list() for explanation_result in explanation_results: gfile_name = f"gs://{bp_iter_outputs.bucket.name}/{explanation_result}" with tf.io.gfile.GFile(name=gfile_name, mode="r") as gfile: for line in gfile.readlines(): print(line) delete_all = True if delete_all: # Delete the dataset using the Vertex dataset object try: if "dataset" in globals(): dataset.delete() except Exception as e: print(e) # Delete the model using the Vertex model object try: if "model" in globals(): model.delete() except Exception as e: print(e) # Delete the endpoint using the Vertex endpoint object try: if "endpoint" in globals(): endpoint.delete() except Exception as e: print(e) # Delete the AutoML or Pipeline trainig job try: if "dag" in globals(): dag.delete() except Exception as e: print(e) # Delete the custom trainig job try: if "job" in globals(): job.delete() except Exception as e: print(e) # Delete the batch prediction job using the Vertex batch prediction object try: if "batch_predict_job" in globals(): batch_predict_job.delete() except Exception as e: print(e) # Delete the hyperparameter tuning job using the Vertex hyperparameter tuning object try: if "hpt_job" in globals(): hpt_job.delete() except Exception as e: print(e) if "BUCKET_NAME" in globals(): ! gsutil rm -r $BUCKET_NAME <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Install the latest GA version of google-cloud-storage library as well. Step2: Restart the kernel Step3: Before you begin Step4: Region Step5: Timestamp Step6: Authenticate your Google Cloud account Step7: Create a Cloud Storage bucket Step8: Only if your bucket doesn't already exist Step9: Finally, validate access to your Cloud Storage bucket by examining its contents Step10: Set up variables Step11: Initialize Vertex SDK for Python Step12: Set hardware accelerators Step13: Set pre-built containers Step14: Set machine type Step15: Tutorial Step16: Task.py contents Step17: Store training script on your Cloud Storage bucket Step18: Create and run custom training job Step19: Prepare your command-line arguments Step20: Run the custom training job Step21: Load the saved model Step22: Evaluate the model Step23: Perform the model evaluation Step24: Get the serving function signature Step25: Explanation Specification Step26: Explanation Metadata Step27: Upload the model Step28: Send a batch prediction request Step29: Make the batch explanation request Step30: Wait for completion of batch prediction job Step31: Get the explanations Step32: Cleaning up
9,560
<ASSISTANT_TASK:> Python Code: from __future__ import division import numpy as np import matplotlib.pyplot as plt import pandas as pd from cs231n.classifiers.neural_net import TwoLayerNet %matplotlib inline plt.rcParams['figure.figsize'] = (10.0, 8.0) # set default size of plots plt.rcParams['image.interpolation'] = 'nearest' plt.rcParams['image.cmap'] = 'gray' np.set_printoptions(precision=4) pd.set_option('precision',1) # for auto-reloading external modules # see http://stackoverflow.com/questions/1907993/autoreload-of-modules-in-ipython %load_ext autoreload %autoreload 2 def rel_error(x, y): returns relative error return np.max(np.abs(x - y) / (np.maximum(1e-8, np.abs(x) + np.abs(y)))) # Create a small net and some toy data to check your implementations. # Note that we set the random seed for repeatable experiments. input_size = 4 hidden_size = 10 num_classes = 3 num_inputs = 5 def init_toy_model(): np.random.seed(0) return TwoLayerNet(input_size, hidden_size, num_classes, std=1e-1) def init_toy_data(): np.random.seed(1) X = 10 * np.random.randn(num_inputs, input_size) y = np.array([0, 1, 2, 2, 1]) return X, y net = init_toy_model() X, y = init_toy_data() scores = net.loss(X) print 'Your scores:' print scores print print 'correct scores:' correct_scores = np.asarray([ [-0.81233741, -1.27654624, -0.70335995], [-0.17129677, -1.18803311, -0.47310444], [-0.51590475, -1.01354314, -0.8504215 ], [-0.15419291, -0.48629638, -0.52901952], [-0.00618733, -0.12435261, -0.15226949]]) print correct_scores print # The difference should be very small. We get < 1e-7 print 'Difference between your scores and correct scores:' print np.sum(np.abs(scores - correct_scores)) loss, _ = net.loss(X, y, reg=0.1) correct_loss = 1.30378789133 # should be very small, we get < 1e-12 print 'Difference between your loss and correct loss:' print np.sum(np.abs(loss - correct_loss)) from cs231n.gradient_check import eval_numerical_gradient # Use numeric gradient checking to check your implementation of the backward pass. # If your implementation is correct, the difference between the numeric and # analytic gradients should be less than 1e-8 for each of W1, W2, b1, and b2. loss, grads = net.loss(X, y, reg=0.1) # these should all be less than 1e-8 or so for param_name in grads: f = lambda W: net.loss(X, y, reg=0.1)[0] param_grad_num = eval_numerical_gradient(f, net.params[param_name], verbose=False) print '%s max relative error: %e' % (param_name, rel_error(param_grad_num, grads[param_name])) net = init_toy_model() stats = net.train(X, y, X, y, learning_rate=1e-1, reg=1e-5, num_iters=100, verbose=True) print 'Final training loss: ', stats['loss_history'][-1] # plot the loss history plt.plot(stats['loss_history']) plt.xlabel('iteration') plt.ylabel('training loss') plt.title('Training Loss history') plt.show() from cs231n.data_utils import load_CIFAR10 def get_CIFAR10_data(num_training=49000, num_validation=1000, num_test=1000): Load the CIFAR-10 dataset from disk and perform preprocessing to prepare it for the two-layer neural net classifier. These are the same steps as we used for the SVM, but condensed to a single function. # Load the raw CIFAR-10 data cifar10_dir = 'cs231n/datasets/cifar-10-batches-py' X_train, y_train, X_test, y_test = load_CIFAR10(cifar10_dir) # Subsample the data mask = range(num_training, num_training + num_validation) X_val = X_train[mask] y_val = y_train[mask] mask = range(num_training) X_train = X_train[mask] y_train = y_train[mask] mask = range(num_test) X_test = X_test[mask] y_test = y_test[mask] # Normalize the data: subtract the mean image mean_image = np.mean(X_train, axis=0) X_train -= mean_image X_val -= mean_image X_test -= mean_image # Reshape data to rows X_train = X_train.reshape(num_training, -1) X_val = X_val.reshape(num_validation, -1) X_test = X_test.reshape(num_test, -1) return X_train, y_train, X_val, y_val, X_test, y_test # Invoke the above function to get our data. X_train, y_train, X_val, y_val, X_test, y_test = get_CIFAR10_data() print 'Train data shape: ', X_train.shape print 'Train labels shape: ', y_train.shape print 'Validation data shape: ', X_val.shape print 'Validation labels shape: ', y_val.shape print 'Test data shape: ', X_test.shape print 'Test labels shape: ', y_test.shape input_size = 32 * 32 * 3 hidden_size = 50 num_classes = 10 net = TwoLayerNet(input_size, hidden_size, num_classes) # Train the network stats = net.train(X_train, y_train, X_val, y_val, num_iters=1000, batch_size=200, learning_rate=1e-4, learning_rate_decay=0.95, reg=0.5, verbose=True) # Predict on the validation set val_acc = (net.predict(X_val) == y_val).mean() print 'Validation accuracy: ', val_acc # Plot the loss function and train / validation accuracies plt.subplot(2, 1, 1) plt.plot(stats['loss_history']) plt.title('Loss history') plt.xlabel('Iteration') plt.ylabel('Loss') plt.subplot(2, 1, 2) plt.plot(stats['train_acc_history'], label='train') plt.plot(stats['val_acc_history'], label='val') plt.title('Classification accuracy history') plt.xlabel('Epoch') plt.ylabel('Clasification accuracy') plt.legend(loc='best') plt.show() from cs231n.vis_utils import visualize_grid # Visualize the weights of the network def show_net_weights(net): W1 = net.params['W1'] W1 = W1.reshape(32, 32, 3, -1).transpose(3, 0, 1, 2) plt.imshow(visualize_grid(W1, padding=3).astype('uint8')) plt.gca().axis('off') plt.show() show_net_weights(net) X_train.shape best_net = None # store the best model into this ################################################################################# # TODO: Tune hyperparameters using the validation set. Store your best trained # # model in best_net. # # # # To help debug your network, it may help to use visualizations similar to the # # ones we used above; these visualizations will have significant qualitative # # differences from the ones we saw above for the poorly tuned network. # # # # Tweaking hyperparameters by hand can be fun, but you might find it useful to # # write code to sweep through possible combinations of hyperparameters # # automatically like we did on the previous exercises. # ################################################################################# input_size = 32 * 32 * 3 hidden_size = 50 num_classes = 10 best_val = -1 net = TwoLayerNet(input_size, hidden_size, num_classes) # hyperparameters learning_rates = [1e-3, 1e-4, 1e-5] regs = [0.4, 0.5, 0.6] learning_rate_decays = [0.5, 0.75, 0.95] # Train the network for lr in learning_rates: for rate in regs: for decay in learning_rate_decays: print print("learning rate: {}, epochs: {}, decay: {}".format(lr, rate, decay)) stats = net.train(X_train, y_train, X_val, y_val, num_iters=1000, batch_size=200, learning_rate=lr, learning_rate_decay=0.95, reg=rate, verbose=False) # Predict on the validation set val_acc = (net.predict(X_val) == y_val).mean() print 'Validation accuracy: ', val_acc if net.loss > best_val: best_net = net ################################################################################# # END OF YOUR CODE # ################################################################################# # visualize the weights of the best network show_net_weights(best_net) test_acc = (best_net.predict(X_test) == y_test).mean() print 'Test accuracy: ', test_acc <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Implementing a Neural Network Step2: We will use the class TwoLayerNet in the file cs231n/classifiers/neural_net.py to represent instances of our network. The network parameters are stored in the instance variable self.params where keys are string parameter names and values are numpy arrays. Below, we initialize toy data and a toy model that we will use to develop your implementation. Step3: Forward pass Step4: Forward pass Step5: Backward pass Step6: Train the network Step8: Load the data Step9: Train a network Step10: Debug the training Step11: Tune your hyperparameters Step12: Run on the test set
9,561
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd import pandas.io.data as web import plotly.plotly as py import cufflinks as cf py.sign_in('Python-Demo-Account', 'gwt101uhh0') symbols = ['AAPL', 'MSFT', 'YHOO'] data = pd.DataFrame() for sym in symbols: data[sym] = web.DataReader(sym, data_source='yahoo')['Adj Close'] data.tail() data.iplot(filename='financial', world_readable=True) data['AAPL'].iplot(filename='best_fit', bestfit=True, colors=['pink'], bestfit_colors=['blue'], world_readable=True) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Reading Financial Data Step2: Plotting the Data
9,562
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np import seaborn as sns import matplotlib.pyplot as plt train = pd.read_csv('https://gist.githubusercontent.com/ucals/' '2cf9d101992cb1b78c2cdd6e3bac6a4b/raw/' '43034c39052dcf97d4b894d2ec1bc3f90f3623d9/' 'osic_pulmonary_fibrosis.csv') train.head() def chart(patient_id, ax): data = train[train['Patient'] == patient_id] x = data['Weeks'] y = data['FVC'] ax.set_title(patient_id) ax = sns.regplot(x, y, ax=ax, ci=None, line_kws={'color':'red'}) f, axes = plt.subplots(1, 3, figsize=(15, 5)) chart('ID00007637202177411956430', axes[0]) chart('ID00009637202177434476278', axes[1]) chart('ID00010637202177584971671', axes[2]) import numpyro from numpyro.infer import MCMC, NUTS, Predictive import numpyro.distributions as dist from jax import random def model(PatientID, Weeks, FVC_obs=None): μ_α = numpyro.sample("μ_α", dist.Normal(0., 100.)) σ_α = numpyro.sample("σ_α", dist.HalfNormal(100.)) μ_β = numpyro.sample("μ_β", dist.Normal(0., 100.)) σ_β = numpyro.sample("σ_β", dist.HalfNormal(100.)) unique_patient_IDs = np.unique(PatientID) n_patients = len(unique_patient_IDs) with numpyro.plate("plate_i", n_patients): α = numpyro.sample("α", dist.Normal(μ_α, σ_α)) β = numpyro.sample("β", dist.Normal(μ_β, σ_β)) σ = numpyro.sample("σ", dist.HalfNormal(100.)) FVC_est = α[PatientID] + β[PatientID] * Weeks with numpyro.plate("data", len(PatientID)): numpyro.sample("obs", dist.Normal(FVC_est, σ), obs=FVC_obs) from sklearn.preprocessing import LabelEncoder le = LabelEncoder() train['PatientID'] = le.fit_transform(train['Patient'].values) FVC_obs = train['FVC'].values Weeks = train['Weeks'].values PatientID = train['PatientID'].values numpyro.set_host_device_count(4) nuts_kernel = NUTS(model) mcmc = MCMC(nuts_kernel, num_samples=2000, num_warmup=2000) rng_key = random.PRNGKey(0) mcmc.run(rng_key, PatientID, Weeks, FVC_obs=FVC_obs) posterior_samples = mcmc.get_samples() import arviz as az data = az.from_numpyro(mcmc) az.plot_trace(data, compact=True); pred_template = [] for i in range(train['Patient'].nunique()): df = pd.DataFrame(columns=['PatientID', 'Weeks']) df['Weeks'] = np.arange(-12, 134) df['PatientID'] = i pred_template.append(df) pred_template = pd.concat(pred_template, ignore_index=True) PatientID = pred_template['PatientID'].values Weeks = pred_template['Weeks'].values predictive = Predictive(model, posterior_samples, return_sites=['σ', 'obs']) samples_predictive = predictive(random.PRNGKey(0), PatientID, Weeks, None) df = pd.DataFrame(columns=['Patient', 'Weeks', 'FVC_pred', 'sigma']) df['Patient'] = le.inverse_transform(pred_template['PatientID']) df['Weeks'] = pred_template['Weeks'] df['FVC_pred'] = samples_predictive['obs'].T.mean(axis=1) df['sigma'] = samples_predictive['obs'].T.std(axis=1) df['FVC_inf'] = df['FVC_pred'] - df['sigma'] df['FVC_sup'] = df['FVC_pred'] + df['sigma'] df = pd.merge(df, train[['Patient', 'Weeks', 'FVC']], how='left', on=['Patient', 'Weeks']) df = df.rename(columns={'FVC': 'FVC_true'}) df.head() def chart(patient_id, ax): data = df[df['Patient'] == patient_id] x = data['Weeks'] ax.set_title(patient_id) ax.plot(x, data['FVC_true'], 'o') ax.plot(x, data['FVC_pred']) ax = sns.regplot(x, data['FVC_true'], ax=ax, ci=None, line_kws={'color':'red'}) ax.fill_between(x, data["FVC_inf"], data["FVC_sup"], alpha=0.5, color='#ffcd3c') ax.set_ylabel('FVC') f, axes = plt.subplots(1, 3, figsize=(15, 5)) chart('ID00007637202177411956430', axes[0]) chart('ID00009637202177434476278', axes[1]) chart('ID00011637202177653955184', axes[2]) y = df.dropna() rmse = ((y['FVC_pred'] - y['FVC_true']) ** 2).mean() ** (1/2) print(f'RMSE: {rmse:.1f} ml') sigma_c = y['sigma'].values sigma_c[sigma_c < 70] = 70 delta = (y['FVC_pred'] - y['FVC_true']).abs() delta[delta > 1000] = 1000 lll = - np.sqrt(2) * delta / sigma_c - np.log(np.sqrt(2) * sigma_c) print(f'Laplace Log Likelihood: {lll.mean():.4f}') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: In the dataset, we were provided with a baseline chest CT scan and associated clinical information for a set of patients. A patient has an image acquired at time Week = 0 and has numerous follow up visits over the course of approximately 1-2 years, at which time their FVC is measured. For this tutorial, I will use only the Patient ID, the weeks and the FVC measurements, discarding all the rest. Using only these columns enabled our team to achieve a competitive score, which shows the power of Bayesian hierarchical linear regression models especially when gauging uncertainty is an important part of the problem. Step2: On average, each of the 176 provided patients made 9 visits, when FVC was measured. The visits happened in specific weeks in the [-12, 133] interval. The decline in lung capacity is very clear. We see, though, they are very different from patient to patient. Step3: That's all for modelling! Step4: Now, calling NumPyro's inference engine Step5: 4. Checking the model Step6: Looks like our model learned personalized alphas and betas for each patient! Step7: Predicting the missing values in the FVC table and confidence (sigma) for each value becomes really easy Step8: Let's now put the predictions together with the true values, to visualize them Step9: Finally, let's see our predictions for 3 patients Step10: The results are exactly what we expected to see! Highlight observations
9,563
<ASSISTANT_TASK:> Python Code: # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import print_function import tensorflow as tf try: tf.contrib.eager.enable_eager_execution() print("TF imported with eager execution!") except ValueError: print("TF already imported with eager execution!") primes = tf.constant([2, 3, 5, 7, 11, 13], dtype=tf.int32) print("primes:", primes ) ones = tf.ones([6], dtype=tf.int32) print("ones:", ones) just_beyond_primes = tf.add(primes, ones) print("just_beyond_primes:", just_beyond_primes) twos = tf.constant([2, 2, 2, 2, 2, 2], dtype=tf.int32) primes_doubled = primes * twos print("primes_doubled:", primes_doubled) some_matrix = tf.constant([[1, 2, 3], [4, 5, 6]], dtype=tf.int32) print(some_matrix) print("\nvalue of some_matrix is:\n", some_matrix.numpy()) # A scalar (0-D tensor). scalar = tf.zeros([]) # A vector with 3 elements. vector = tf.zeros([3]) # A matrix with 2 rows and 3 columns. matrix = tf.zeros([2, 3]) print('scalar has shape', scalar.get_shape(), 'and value:\n', scalar.numpy()) print('vector has shape', vector.get_shape(), 'and value:\n', vector.numpy()) print('matrix has shape', matrix.get_shape(), 'and value:\n', matrix.numpy()) primes = tf.constant([2, 3, 5, 7, 11, 13], dtype=tf.int32) print("primes:", primes) one = tf.constant(1, dtype=tf.int32) print("one:", one) just_beyond_primes = tf.add(primes, one) print("just_beyond_primes:", just_beyond_primes) two = tf.constant(2, dtype=tf.int32) primes_doubled = primes * two print("primes_doubled:", primes_doubled) # Write your code for Task 1 here. # Task: Square each element in the primes vector, then subtract 1. def solution(primes): primes_squared = tf.multiply(primes, primes) neg_one = tf.constant(-1, dtype=tf.int32) just_under_primes_squared = tf.add(primes_squared, neg_one) return just_under_primes_squared def alternative_solution(primes): primes_squared = tf.pow(primes, 2) one = tf.constant(1, dtype=tf.int32) just_under_primes_squared = tf.subtract(primes_squared, one) return just_under_primes_squared primes = tf.constant([2, 3, 5, 7, 11, 13], dtype=tf.int32) just_under_primes_squared = solution(primes) print("just_under_primes_squared:", just_under_primes_squared) # A 3x4 matrix (2-d tensor). x = tf.constant([[5, 2, 4, 3], [5, 1, 6, -2], [-1, 3, -1, -2]], dtype=tf.int32) # A 4x2 matrix (2-d tensor). y = tf.constant([[2, 2], [3, 5], [4, 5], [1, 6]], dtype=tf.int32) # Multiply `x` by `y`; result is 3x2 matrix. matrix_multiply_result = tf.matmul(x, y) print(matrix_multiply_result) # Create an 8x2 matrix (2-D tensor). matrix = tf.constant( [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]], dtype=tf.int32) reshaped_2x8_matrix = tf.reshape(matrix, [2, 8]) reshaped_4x4_matrix = tf.reshape(matrix, [4, 4]) print("Original matrix (8x2):") print(matrix.numpy()) print("Reshaped matrix (2x8):") print(reshaped_2x8_matrix.numpy()) print("Reshaped matrix (4x4):") print(reshaped_4x4_matrix.numpy()) # Create an 8x2 matrix (2-D tensor). matrix = tf.constant( [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]], dtype=tf.int32) reshaped_2x2x4_tensor = tf.reshape(matrix, [2, 2, 4]) one_dimensional_vector = tf.reshape(matrix, [16]) print("Original matrix (8x2):") print(matrix.numpy()) print("Reshaped 3-D tensor (2x2x4):") print(reshaped_2x2x4_tensor.numpy()) print("1-D vector:") print(one_dimensional_vector.numpy()) # Write your code for Task 2 here. # Task: Reshape two tensors in order to multiply them a = tf.constant([5, 3, 2, 7, 1, 4]) b = tf.constant([4, 6, 3]) reshaped_a = tf.reshape(a, [2, 3]) reshaped_b = tf.reshape(b, [3, 1]) c = tf.matmul(reshaped_a, reshaped_b) print("reshaped_a (2x3):") print(reshaped_a.numpy()) print("reshaped_b (3x1):") print(reshaped_b.numpy()) print("reshaped_a x reshaped_b (2x1):") print(c.numpy()) # Create a scalar variable with the initial value 3. v = tf.contrib.eager.Variable([3]) # Create a vector variable of shape [1, 4], with random initial values, # sampled from a normal distribution with mean 1 and standard deviation 0.35. w = tf.contrib.eager.Variable(tf.random_normal([1, 4], mean=1.0, stddev=0.35)) print("v:", v.numpy()) print("w:", w.numpy()) v = tf.contrib.eager.Variable([3]) print(v.numpy()) tf.assign(v, [7]) print(v.numpy()) v.assign([5]) print(v.numpy()) v = tf.contrib.eager.Variable([[1, 2, 3], [4, 5, 6]]) print(v.numpy()) try: print("Assigning [7, 8, 9] to v") v.assign([7, 8, 9]) except ValueError as e: print("Exception:", e) # Write your code for Task 3 here. # Task: Simulate 10 throws of two dice. Store the results in a 10x3 matrix. die1 = tf.contrib.eager.Variable( tf.random_uniform([10, 1], minval=1, maxval=7, dtype=tf.int32)) die2 = tf.contrib.eager.Variable( tf.random_uniform([10, 1], minval=1, maxval=7, dtype=tf.int32)) dice_sum = tf.add(die1, die2) resulting_matrix = tf.concat(values=[die1, die2, dice_sum], axis=1) print(resulting_matrix.numpy()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 创建和操控张量 Step2: 矢量加法 Step3: 输出张量不仅会返回其值,还会返回其形状(将在下一部分中讨论)以及存储在张量中的值的类型。调用张量的 numpy 方法会返回该张量的值(以 NumPy 数组形式): Step4: 张量形状 Step5: 广播 Step6: 练习 1:矢量运算。 Step7: 解决方案 Step8: 矩阵乘法 Step9: 张量变形 Step10: 此外,您还可以使用 tf.reshape 更改张量的维数(“阶”)。 Step11: 练习 2:改变两个张量的形状,使其能够相乘。 Step12: 解决方案 Step13: 还有一个解决方案是,将 a 变形为 6x1 矩阵,并将 b 变形为 1x3 矩阵,从而在相乘后得到一个 6x3 矩阵。 Step14: 要更改变量的值,请使用 assign 操作: Step15: 向变量赋予新值时,其形状必须和之前的形状一致: Step16: 还有很多关于变量的内容我们并未在这里提及,例如加载和存储。要了解详情,请参阅 TensorFlow 文档。 Step17: 解决方案
9,564
<ASSISTANT_TASK:> Python Code: def stan_cache(model_code, model_name=None, **kwargs): Use just as you would `stan` code_hash = md5(model_code.encode('ascii')).hexdigest() if model_name is None: cache_fn = 'cached-model-{}.pkl'.format(code_hash) else: cache_fn = 'cached-{}-{}.pkl'.format(model_name, code_hash) try: sm = pickle.load(open(cache_fn, 'rb')) except: sm = pystan.StanModel(model_code=model_code) with open(cache_fn, 'wb') as f: pickle.dump(sm, f) else: print("Using cached StanModel") return sm.sampling(**kwargs) def toenglish(s): spanish = ['ene', 'abr', 'ago', 'dic', 'de mayo de'] english = ['jan', 'apr', 'aug', 'dec', 'may'] for (j, month) in enumerate(spanish): s = s.replace(month, english[j]) return s def getPercentage(s): if (s[0] not in ['0','1','2','3','4','5','6','7','8','9']): return 0 else: if (s.find('%') != -1): return float(s.split('%')[0].replace(',','.')) / 100.0 else: return float(s.split('\n')[0].replace(',','.')) / 100.0 def getSigma(s): left = s.find('(') right = s.find(')') if (s[left+1:right] in ['?', '-']): return 0.03 else: return 1.0 / np.sqrt(float(s[left+1:right])) def weeksDifference(d1, d2): monday1 = (d1 - datetime.timedelta(days=d1.weekday())) monday2 = (d2 - datetime.timedelta(days=d2.weekday())) return int((monday2 - monday1).days / 7) wb = openpyxl.load_workbook("data/sondeos.xlsx") ws = wb.active empresas = ['GAD3', 'Encuestamos', 'GESOP', 'Metroscopia', 'Celeste-Tel','Demoscopia Servicios', 'Simple Lógica', 'CIS', 'TNS Demoscopia', 'Invymark', 'NC Report', 'El Espanol', 'DYM', 'Sondaxe', 'Sigma Dos', 'Resultados de las elecciones'] empresaSondeoAll = [] sondeosAll = [] dateAll = [] sigmaAll = [] wbnew = openpyxl.Workbook() # grab the active worksheet wsnew = wbnew.active wsnew.append(['Encuestador','Fecha','Muestra','PP','PSOE','PODEMOS','Cs','IU']) otrosPartidos = ['F', 'G', 'H', 'I', 'J', 'K', 'L', 'M', 'N', 'O', 'R'] nSondeos = 302 loopSondeos = 0 for i in range(130): empresa = ws['A{0}'.format(i+2)].value for (loop, emp) in enumerate(empresas): if (empresa.find(emp) != -1): empresaSondeo = loop if (empresaSondeo == len(empresas)-1): sigma = 0.0001 else: sigma = getSigma(empresa) PP = getPercentage(ws['C{0}'.format(i+2)].value) PSOE = getPercentage(ws['D{0}'.format(i+2)].value) IU = getPercentage(ws['E{0}'.format(i+2)].value) PODEMOS = getPercentage(ws['P{0}'.format(i+2)].value) CS = getPercentage(ws['Q{0}'.format(i+2)].value) total = PP + PSOE + IU + PODEMOS + CS otros = 1.0 - total tmp = ws['B{0}'.format(i+2)].value if (isinstance(tmp, datetime.date)): date = tmp else: date = dateutil.parser.parse(toenglish(ws['B{0}'.format(i+2)].value.split('-')[-1].lower())) tmp = date.year + (date.month-1.0) / 12.0 sondeo = [PP, PSOE, IU+PODEMOS, CS, otros] if (0 not in sondeo): loopSondeos += 1 sondeosAll.append(sondeo) sigmaAll.append(sigma) dateAll.append(date) empresaSondeoAll.append(empresaSondeo+1) print ("{0} - {1} {7} - s={8:4.2f} : PP={2:4.2f} - PSOE={3:4.2f} - UP={4:4.2f} - CS={5:4.2f} - Resto={6:4.2f}".format(i, empresas[empresaSondeo], PP*100, PSOE*100, (IU+PODEMOS)*100, CS*100, otros*100, date, sigma*100)) wsnew.append([empresas[empresaSondeo],'{0}/{1}/{2}'.format(date.day,date.month,date.year-2000),1.0/sigma**2,PP*100,PSOE*100,(IU+PODEMOS)*100,CS*100,0.0]) wbnew.save('new.xlsx') sondeosAll = np.array(sondeosAll) nSondeos, nPartidos = sondeosAll.shape nEmpresas = len(empresas) print ("Número de sondeos incluidos : {0} de {1} posibles".format(loopSondeos,120)) # Compute week of every poll weekAll = [] for i in range(nSondeos): weekAll.append(weeksDifference(dateAll[nSondeos-1], dateAll[i]) + 1) nDates = max(weekAll) # Reverse all lists sondeosAll = sondeosAll[::-1] empresaSondeoAll.reverse() weekAll.reverse() sigmaAll.reverse() dictionary = {'NPartidos': nPartidos, 'NSondeos': nSondeos, 'NEmpresas': nEmpresas-1, 'NDates': nDates, 'empresa': empresaSondeoAll, 'sondeos': sondeosAll, 'date': weekAll, 'sigmaSondeo': sigmaAll, 'alpha': np.ones(nPartidos)*1.0} date.year-2000 f = open('model.stan', 'r') model = f.read() f.close() out = stan_cache(model, model_name='elecciones', data=dictionary, chains=1) thetaChain = out.extract('theta')['theta'] theta = np.percentile(thetaChain, [50.0, 50.0-68/2.0, 50.0+68/2], axis=0) houseChain = out.extract('house')['house'] house = np.percentile(houseChain, [50.0, 50.0-68/2.0, 50.0+68/2], axis=0) sigmaChain = out.extract('sigma')['sigma'] sigma = np.percentile(sigmaChain, [50.0, 50.0-68/2.0, 50.0+68/2], axis=0) colors = ["blue", "red", "violet", "orange", "yellow"] labelsPartidos = ['PP', 'PSOE', 'PODEMOS+IU', 'Cs', 'Otros'] labelsEmpresas = ['GAD3', 'Encuest', 'GESOP', 'Metroscopia', 'Celeste',' Demosc. S.', 'S. Lógica', 'CIS', 'TNS Demos.', 'Invymark', 'NC Rep.', 'Netquest'] f, ax = pl.subplots(figsize=(13,8)) for i in range(5): ax.plot(weekAll, sondeosAll[:,i], '.', color=sns.xkcd_rgb[colors[i]], linewidth=2) ax.plot(np.arange(max(weekAll))+1, theta[0,:,i], color=sns.xkcd_rgb[colors[i]], linewidth=2) ax.fill_between(np.arange(max(weekAll))+1, theta[1,:,i], theta[2,:,i], color=sns.xkcd_rgb[colors[i]], alpha=0.3) ax.set_xlabel('Semana') ax.set_ylabel('Fracción de votos') ax.axvline(49) pl.savefig("sondeos.png") f, ax = pl.subplots() sns.boxplot(data=thetaChain[:,-1,:], ax=ax) ax.set_xticks(np.arange(5)) ax.set_xticklabels(labelsPartidos, rotation=90) boxes = ax.artists for (i, box) in enumerate(boxes): box.set_facecolor(sns.xkcd_rgb[colors[i]]) pl.savefig("estimacionActual.png") labelsPartidos = ['PP', 'PSOE', 'PODEMOS+IU', 'Cs', 'Otros'] f, ax = pl.subplots(nrows=2, ncols=3, figsize=(10,8)) ax = ax.flatten() for i in range(5): ax[i].plot(weekAll, sondeosAll[:,i], '.', color=sns.xkcd_rgb[colors[i]], linewidth=2) ax[i].set_ylim([0,0.35]) ax[i].errorbar(weekAll, sondeosAll[:,i], fmt='none', yerr=sigmaAll, color=sns.xkcd_rgb[colors[i]], linewidth=2, ecolor=sns.xkcd_rgb[colors[i]]) ax[i].plot(np.arange(max(weekAll))+1, theta[0,:,i], color=sns.xkcd_rgb[colors[i]], linewidth=2) ax[i].fill_between(np.arange(max(weekAll))+1, theta[1,:,i], theta[2,:,i], color=sns.xkcd_rgb[colors[i]], alpha=0.3) ax[i].set_xlabel('Semana') ax[i].set_xlabel('Porcentaje de votos') ax[i].set_title(labelsPartidos[i]) pl.tight_layout() pl.savefig("porPartido.png") f, ax = pl.subplots(ncols=3, nrows=2, figsize=(12,10)) ax = ax.flatten() for i in range(5): sns.boxplot(data=houseChain[:,:,i], ax=ax[i]) ax[i].set_xticks(np.arange(12)) ax[i].set_xticklabels(labelsEmpresas, rotation=90) ax[i].set_title(labelsPartidos[i]) pl.tight_layout() pl.savefig("bias.png") f, ax = pl.subplots(figsize=(10,6)) sns.boxplot(data=sigmaChain, ax=ax) ax.set_xticks(np.arange(5)) ax.set_xticklabels(labelsPartidos, rotation=90) boxes = ax.artists for (i, box) in enumerate(boxes): box.set_facecolor(sns.xkcd_rgb[colors[i]]) pl.savefig("variabilidad.png", facecolor=f.get_facecolor(), edgecolor='none') f = open('elecciones2015/index.html','r') lines = f.readlines() f.close() fecha = datetime.datetime.now() lines[29] = <a id="welcome-to-github-pages" class="anchor" href="#welcome-to-github-pages" aria-hidden="true"><span aria-hidden="true" class="octicon octicon-link"></span></a>Resultado {0}/{1}/{2}</h3>\n.format(fecha.day,fecha.month,fecha.year) theta = np.percentile(thetaChain, [50.0, 50.0-95/2.0, 50.0+95/2], axis=0) lines[33] = <td style='height: 50px; background: #02B3F4; color: white; font-size: 25px; border-radius: 1px 10px 0px 0px;'>{0:4.1f}-{1:4.1f}-{2:4.1f}</td>\n.format(theta[1,-1,0]*100,theta[0,-1,0]*100,theta[2,-1,0]*100) lines[34] = <td style='height: 50px; background: #8E1744; color: white; font-size: 25px; border-radius: 1px 10px 0px 0px;'>{0:4.1f}-{1:4.1f}-{2:4.1f}</td>\n.format(theta[1,-1,2]*100,theta[0,-1,2]*100,theta[2,-1,2]*100) lines[35] = <td style='height: 50px; background: #FF0202; color: white; font-size: 25px; border-radius: 1px 10px 0px 0px;'>{0:4.1f}-{1:4.1f}-{2:4.1f}</td>\n.format(theta[1,-1,1]*100,theta[0,-1,1]*100,theta[2,-1,1]*100) lines[36] = <td style='height: 50px; background: #FF800E; color: white; font-size: 25px; border-radius: 1px 10px 0px 0px;'>{0:4.1f}-{1:4.1f}-{2:4.1f}</td>\n.format(theta[1,-1,3]*100,theta[0,-1,3]*100,theta[2,-1,3]*100) f = open('elecciones2015/index.html','w') f.writelines(lines) f.close() os.system('./update.sh') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Análisis de los sondeos electorales 2016 Step2: Leemos el fichero de datos obtenido de la Wikipedia y hacemos el parsing. Escogemos sólo aquellos sondeos en los que hay información para todos los partidos. Podríamos también escoger aquellos parciales porque el modelado Bayesiano los podría aceptar. Step3: Leemos el modelo que hemos definido y hacemos el sampling. Step4: Resultados Step5: Sondeos y variación subyacente Step6: Estimación de voto actual Step7: A continuación represento la evolución temporal del voto por cada partido político, incluyendo las incertidumbres estimadas para cada sondeo. Step8: Sesgos por casa encuestadora Step9: Variabilidad Step15: Push de la página web
9,565
<ASSISTANT_TASK:> Python Code: import plotly plotly.__version__ import numpy as np import plotly.graph_objs as go def rot_matrix(theta): return np.array([[np.cos(theta), -np.sin(theta)], [np.sin(theta), np.cos(theta)]]) def get_arrows(start, end, arrow_angle, plane=2, fract=0.1): this i function defines 3d vectors/quivers - start -numpy array of x, y, z-coordinates of the arrow starting points; shape (3, m) start[0,:] contains x-coordinates, etc - end - numpy array with the same shape as start; contains on rows the x, y and z-coords of ending points of the arrow - the arrowhead is an isosceles triangle with the equal sides forming an angle of 2*arrow_angle radians - plane=0 or 2 depending on the plane where the vectors are drawn (plane=0 i.e. x=0, plane=2, z=0) start = np.asarray(start) end = np.asarray(end) m = start[0,:].shape[0] arr_dir = start-end arr_dir_norm = np.linalg.norm(arr_dir, axis=0) arr_dir = fract*arr_dir/arr_dir_norm[None,:] # the arrowhead is a fraction fract from the unit vector if plane == 2: v = np.einsum('ji, im -> jm', rot_matrix(arrow_angle), arr_dir[:plane,:]) # Einstein summation # rotation to all vectors at a time w = np.einsum('ji, im -> jm', rot_matrix(-arrow_angle), arr_dir[:plane, :]) v = np.append(v, [[0]*m], axis=0) w = np.append(w, [[0]*m], axis=0) elif plane == 0: v = np.einsum('ji, im -> jm', rot_matrix(arrow_angle), arr_dir[1:,:]) w = np.einsum('ji, im -> jm', rot_matrix(-arrow_angle), arr_dir[1:, :]) v = np.append([[0]*m], v, axis=0) w = np.append([[0]*m], w, axis=0) else: raise ValueError('the key plane must be 0 or 2') p = end+v q = end+w suppx = np.stack((start[0,:], end[0,:], np.nan*np.ones(m ))) #supp is the line segment as support for arrow suppy = np.stack((start[1,:], end[1,:], np.nan*np.ones(m ))) suppz = np.stack((start[2,:], end[2,:], np.nan*np.ones(m ))) x = suppx.flatten('F')#Fortran type flattening y = suppy.flatten('F') z = suppz.flatten('F') x = list(map(lambda u: None if np.isnan(u) else u, x)) y = list(map(lambda u: None if np.isnan(u) else u, y)) z = list(map(lambda u: None if np.isnan(u) else u, z)) #headx, heady, headz are the x, y, z coordinates of the triangle vertices headx = np.stack((end[0,:], p[0,:], q[0,:], end[0,:], np.nan*np.ones(m))) heady = np.stack((end[1,:], p[1,:], q[1,:], end[1,:], np.nan*np.ones(m))) headz = np.stack((end[2,:], p[2,:], q[2,:], end[2,:], np.nan*np.ones(m))) xx = headx.flatten('F') yy = heady.flatten('F') zz = headz.flatten('F') xx = list(map(lambda u: None if np.isnan(u) else u, xx)) yy = list(map(lambda u: None if np.isnan(u) else u, yy)) zz = list(map(lambda u: None if np.isnan(u) else u, zz)) return x, y, z, xx, yy, zz a = 2 b = 5 xblue = [-a, a, a , -a, -a] yblue = [-b, -b, b, b, -b] zblue = [0]*5 xred = [0]*5+[None, 0, 0, 0] yred = [-b, -b, b, b, -b, None, -b, b] zred = [a, -a, -a, a, a, None, 0, 0] x_Oy = [0, 0] y_Oy = [-b, b] z_Oy = [0, 0] A = 1 # wave amplitude lambdA = 0.5 # wavelength omega = 1 # angular frequency t = np.arange(0., 10., 0.2)# interval of simulation Y = np.arange(-b, b, 0.2) # a grid of an interval on Oy, where the vector fields are evaluated X = np.zeros(Y.shape[0]) ZZe = np.zeros(Y.shape[0]) nr_frames = t.shape[0] theta = np.pi/13 # the characteristic angle of each arrow start = np.stack((X, Y, np.zeros(X.shape))) # the numpy array of starting points of the the two classes of vectors start.shape Ze = A*np.sin(Y/lambdA-omega*t[0]) end1 = np.stack((X, Y, Ze)) x1, y1, z1, xx1, yy1, zz1 = get_arrows(start, end1, theta, plane=0) XXe = A*np.sin(Y/lambdA-omega*t[0]) end2 = np.stack((XXe, Y, ZZe)) x2, y2, z2, xx2, yy2, zz2 = get_arrows(start, end2, theta, plane=2) tr0 = dict(type='scatter3d', # a rectangle in xOy x=xblue, y=yblue, z=zblue, mode='lines', line=dict(width=1.5, color='blue')) tr1 = dict(type='scatter3d',# a rectangle in yOz x=xred, y=yred, z=zred, mode='lines', line=dict(width=1.5, color='red')) tr2 = dict(type='scatter3d',#line of direction Oy x=x_Oy, y=y_Oy, z=z_Oy, mode='lines', line=dict(width=1.5, color='rgb(140,140,140)')) tr3 = dict( type='scatter3d', x=x1, y=y1, z=z1, mode='lines', line=dict(color='red', width=1.5), name='' ) tr4 = dict( type='scatter3d', x=xx1, y=yy1, z=zz1, mode='lines', line=dict(color='red', width=2), name='' ) tr5 = dict( type='scatter3d', x=x2, y=y2, z=z2, mode='lines', line=dict(color='blue', width=1.5), name='' ) tr6 = dict( type='scatter3d', x=xx2, y=yy2, z=zz2, mode='lines', line=dict(color='blue', width=2), name='' ) data = [tr0, tr1, tr2, tr3, tr4, tr5, tr6] frames=[] for k in range(nr_frames): Ze = A*np.sin(Y/lambdA-omega*t[k]) end1 = np.stack((X, Y, Ze)) x1, y1, z1, xx1, yy1, zz1 = get_arrows(start, end1, theta, plane=0) XXe = A*np.sin(Y/lambdA-omega*t[k]) end2 = np.stack((XXe, Y, ZZe)) x2, y2, z2, xx2, yy2, zz2 = get_arrows(start, end2, theta, plane=2) frames += [dict(data=[dict(type='scatter3d', x=x1, y=y1, z=z1), dict(type='scatter3d', x=xx1, y=yy1, z=zz1), dict(type='scatter3d', x=x2, y=y2, z=z2), dict(type='scatter3d', x=xx2, y=yy2, z=zz2)], traces=[3, 4, 5, 6] )] title='Electromagnetic wave propagating in the positive Oy direction<br>'+\ 'The electric field vectors (red) are included in the yz-plane,<br> and the magnetic field vectors (blue), in xy' layout = dict(title=title, font=dict(family='Balto'), autosize=False, width=700, height=700, showlegend=False, scene=dict(camera = dict(eye=dict(x=1.22, y=0.55, z=0.3)), aspectratio=dict(x=1, y=1, z=0.65), xaxis_visible=False, yaxis_visible=False, zaxis_visible=False, ), updatemenus=[dict(type='buttons', showactive=False, y=0.75, x=1.05, xanchor='left', yanchor='top', pad=dict(t=0, l=10), buttons=[dict(label='Play', method='animate', args=[None, dict(frame=dict(duration=80, redraw=True), transition=dict(duration=0), fromcurrent=True, mode='immediate' ) ] ) ] ) ] ) import chart_studio.plotly as py fig = go.Figure(data=data, layout=layout, frames=frames) py.iplot(fig, filename='anim-electromagwave') from IPython.core.display import HTML def css_styling(): styles = open("./custom.css", "r").read() return HTML(styles) css_styling() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Define a function that returns data to draw vectors of a vector field with values in the plane yOz or xOy (i.e. electric or magnetic field vectors, in our case). Step3: Define data for fixed traces in each frame (tr0, tr1, tr2, described below), representing the two orthogonal planes of the electric and magnetic field, and their common line Step4: Set the wave parameters and the interval of simulation Step5: Define data representing the vectors of the two vector fields Step6: The following four traces are the base traces updated by the animation frames Step7: Define data to be plotted in each animation frame Step8: Set the plot layout
9,566
<ASSISTANT_TASK:> Python Code: # Run the following to import necessary packages and import dataset. Do not use any additional plotting libraries. import pandas as pd import numpy as np import matplotlib import matplotlib.pyplot as plt matplotlib.style.use('ggplot') datafile = "dataset/icecream.csv" df = pd.read_csv(datafile) df # Here are the correlation coefficients between pairs of columns corr = df.corr() corr abs_corr = np.abs(df.corr()) indices = corr.index corr_pairs = [] for i, idx_i in enumerate(indices): for j, c in enumerate(abs_corr[idx_i]): if c > .9 and i < j: corr_pairs.append((idx_i, indices[j])) corr_pairs correlations = [] correlations.append(['ice_cream_sales', 'temperature']) # do not touch correlations.sort() print(correlations) # meaningful_correlation.append(['column_x', 'column_y']) correlations_clue = [] # do not touch correlations_clue.sort() print(correlations_clue) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The dataset above contains the ice cream sales, temperature, number of deaths by drowning and humidity level in a city during a timespan of 12 months. Step2: Identify strong (i.e., correleation coefficient > 0.9) and meaningful correlations among pairs of columns in this dataset. Step3: Clue
9,567
<ASSISTANT_TASK:> Python Code: import tensorflow as tf # Check that GPU is available: cf. https://colab.research.google.com/notebooks/gpu.ipynb assert(tf.test.is_gpu_available()) tf.keras.backend.clear_session() tf.config.optimizer.set_jit(False) # Start with XLA disabled. def load_data(): (x_train, y_train), (x_test, y_test) = tf.keras.datasets.cifar10.load_data() x_train = x_train.astype('float32') / 256 x_test = x_test.astype('float32') / 256 # Convert class vectors to binary class matrices. y_train = tf.keras.utils.to_categorical(y_train, num_classes=10) y_test = tf.keras.utils.to_categorical(y_test, num_classes=10) return ((x_train, y_train), (x_test, y_test)) (x_train, y_train), (x_test, y_test) = load_data() def generate_model(): return tf.keras.models.Sequential([ tf.keras.layers.Conv2D(32, (3, 3), padding='same', input_shape=x_train.shape[1:]), tf.keras.layers.Activation('relu'), tf.keras.layers.Conv2D(32, (3, 3)), tf.keras.layers.Activation('relu'), tf.keras.layers.MaxPooling2D(pool_size=(2, 2)), tf.keras.layers.Dropout(0.25), tf.keras.layers.Conv2D(64, (3, 3), padding='same'), tf.keras.layers.Activation('relu'), tf.keras.layers.Conv2D(64, (3, 3)), tf.keras.layers.Activation('relu'), tf.keras.layers.MaxPooling2D(pool_size=(2, 2)), tf.keras.layers.Dropout(0.25), tf.keras.layers.Flatten(), tf.keras.layers.Dense(512), tf.keras.layers.Activation('relu'), tf.keras.layers.Dropout(0.5), tf.keras.layers.Dense(10), tf.keras.layers.Activation('softmax') ]) model = generate_model() def compile_model(model): opt = tf.keras.optimizers.RMSprop(lr=0.0001, decay=1e-6) model.compile(loss='categorical_crossentropy', optimizer=opt, metrics=['accuracy']) return model model = compile_model(model) def train_model(model, x_train, y_train, x_test, y_test, epochs=25): model.fit(x_train, y_train, batch_size=256, epochs=epochs, validation_data=(x_test, y_test), shuffle=True) def warmup(model, x_train, y_train, x_test, y_test): # Warm up the JIT, we do not wish to measure the compilation time. initial_weights = model.get_weights() train_model(model, x_train, y_train, x_test, y_test, epochs=1) model.set_weights(initial_weights) warmup(model, x_train, y_train, x_test, y_test) train_model(model, x_train, y_train, x_test, y_test) scores = model.evaluate(x_test, y_test, verbose=1) print('Test loss:', scores[0]) print('Test accuracy:', scores[1]) # We need to clear the session to enable JIT in the middle of the program. tf.keras.backend.clear_session() tf.config.optimizer.set_jit(True) # Enable XLA. model = compile_model(generate_model()) (x_train, y_train), (x_test, y_test) = load_data() warmup(model, x_train, y_train, x_test, y_test) %time train_model(model, x_train, y_train, x_test, y_test) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We define the model, adapted from the Keras CIFAR-10 example Step2: We train the model using the Step3: Now let's train the model again, using the XLA compiler.
9,568
<ASSISTANT_TASK:> Python Code: %matplotlib inline import os import matplotlib.pyplot as plt # The two statements below are used mainly to set up a plotting # default style that's better than the default from matplotlib #import seaborn as sns plt.style.use('bmh') from shapely.geometry import Point #import pandas as pd import geopandas as gpd from geopandas import GeoSeries, GeoDataFrame file_pth = 'rgi_centralasia/13_rgi32_CentralAsia.shp' rgi_glac = gpd.read_file(file_pth) timeframe='[time between DEMs]' rgi_glac.head() # test data set-up gdf = rgi_glac gdf.plot() # test data set-up import random my_randoms = random.sample(xrange(-50,50), 15) gdf["spec"]= my_randoms gdf.to_file("rgi_test.shp") f, ax = plt.subplots(1, figsize=(6, 4)) rgi_glac.plot(column='[spec mb]', scheme='fisher_jenks', k=7, alpha=0.9, cmap=plt.cm.Blues, legend=True, ax=ax) plt.axis('equal') ax.set_title('Specific Mass Balance'+timeframe) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set file names and directories Step2: Plot the glacier outlines based on their specific mass balance
9,569
<ASSISTANT_TASK:> Python Code: # Python program to use AIM tools from asymptotic import * # symengine (symbolic) variables for lambda_0 and s_0 En, r = se.symbols("En, r") r0, m, λ, γ = se.symbols("r0, m, λ, γ") # lambda_0 and s_0 l0 = 2*r - 2*se.sqrt(λ)/r**(m+1) - (1 + m)/r s0 = se.expand(2 + m + 2*se.sqrt(λ)/r**m + ((2*γ+1-m)*(2*γ+1+m))/(4*r**2) - En) nr0 = o* 3 nλ = o* 1/10 nm = o* 1/2 nγ = o* 2 nα = 2* (nm + 1) print('nα =', nα) # parameters of lambda_0 (pl0) and s_0 (ps0) pl0 = {λ: nλ, m:nm} ps0 = {λ: nλ, m:nm, γ:nγ} %%time # pass lambda_0, s_0 and variable values to aim class singular = aim(l0, s0, pl0, ps0) singular.display_parameters() singular.display_l0s0(0) singular.parameters(En, r, nr0, nmax=51, nstep=10, dprec=1000, tol=1e-101) %%time # create coefficients for improved AIM singular.c0() singular.d0() singular.cndn() %%time singular.get_arb_roots(showRoots='+r', printFormat="{:25.20f}") nr0 = o* 3 nλ = o* 1/10 nm = o* 1 nγ = o* 0 nα = 2* (nm + 1) print('nα =', nα) # parameters of lambda_0 (pl0) and s_0 (ps0) pl0 = {λ: nλ, m:nm} ps0 = {λ: nλ, m:nm, γ:nγ} # pass lambda_0, s_0 and variable values to aim class singular = aim(l0, s0, pl0, ps0) singular.display_parameters() singular.display_l0s0(0) singular.parameters(En, r, nr0, nmax=51, nstep=10, dprec=500, tol=1e-101) # create coefficients for improved AIM singular.c0() singular.d0() singular.cndn() singular.get_arb_roots(showRoots='+r', printFormat="{:25.20f}") nm = o* 1 nα = 2* (nm + 1) print('nα =', nα) nr0 = o* 3 for nλ in [o* 1000/10**gi for gi in range(7)]: print('\033[91m\033[1m{linea} λ ={fnλ:>8s} {linea}\033[0m'.format(linea = '='*30, fnλ = str(nλ))) for nγ in [o* gi for gi in range(6)]: print('{linea} γ ={fnγ:>2s} {linea}'.format(linea = '-'*30, fnγ = str(nγ))) # parameters of lambda_0 (pl0) and s_0 (ps0) pl0 = {λ: nλ, m:nm} ps0 = {λ: nλ, m:nm, γ:nγ} # pass lambda_0, s_0 and variable values to aim class singular = aim(l0, s0, pl0, ps0) #singular.display_parameters() #singular.display_l0s0(0) singular.parameters(En, r, nr0, nmax=51, nstep=10, dprec=500, tol=1e-101) # create coefficients for improved AIM singular.c0() singular.d0() singular.cndn() singular.get_arb_roots(showRoots='+r', printFormat="{:25.20f}") # symengine (symbolic) variables for lambda_0 and s_0 En, r = se.symbols("En, r") r0, α, λ, γ = se.symbols("r0, α, λ, γ") # lambda_0 and s_0 l0 = 2*(r - (1 + γ)/r) s0 = 2*γ + 3 + λ/r**α - En nα = o* 1 nr0 = o* 5 for nλ in [o* 1000/10**gi for gi in range(10)]: print('\033[91m\033[1m{linea} λ ={fnλ:>11s} {linea}\033[0m'.format(linea = '='*30, fnλ = str(nλ))) for nγ in [o* gi for gi in range(1)]: print('{linea} γ ={fnγ:>2s} {linea}'.format(linea = '-'*30, fnγ = str(nγ))) # parameters of lambda_0 (pl0) and s_0 (ps0) pl0 = {λ: nλ, γ:nγ} ps0 = {λ: nλ, γ:nγ, α:nα} # pass lambda_0, s_0 and variable values to aim class singular = aim(l0, s0, pl0, ps0) #singular.display_parameters() #singular.display_l0s0(0) singular.parameters(En, r, nr0, nmax=51, nstep=10, dprec=500, tol=1e-101) # create coefficients for improved AIM singular.c0() singular.d0() singular.cndn() singular.get_arb_roots(showRoots='+r', printFormat="{:25.20f}") !pip3 install scipy from scipy.integrate import odeint # https://perso.crans.org/besson/publis/notebooks/Runge-Kutta_methods_for_ODE_integration_in_Python.html %matplotlib notebook import scipy.optimize as so import matplotlib.pyplot as plt from matplotlib import cm import numpy as np V = lambda r, α, β, γ, λ: r**β + γ*(γ+1)/r**2 + λ/r**α # potential parameters αβγλ = 4, 2, 5, 100 # Energy Eigenvalues Estop = 34 Espectrum = [15.54392598171621432978, 19.92653800987177727185, 24.26619272363845153429, 28.57312197406556227733, Estop] # Draw a line for each eigenvalue EigenLine = [] for Ei in Espectrum: Vr = lambda x: V(x, *αβγλ) - Ei rL, rR = so.newton(Vr, 1e-1), so.newton(Vr, 6) EigenLine += [[[rL, rR], [Ei, Ei]]] # create colors for the lines Eimin = .7 * Espectrum[0]/Espectrum[-1] Eimax = .7 cm_subsection = np.linspace(Eimin, Eimax, len(Espectrum)) colors = [ cm.hot_r(x) for x in cm_subsection ] Scale = 4.5 plt.figure(figsize=(Scale, Scale*1.618)) for i, Ei in enumerate(EigenLine[:-1]): plt.axhline(Espectrum[i], color=colors[i], linestyle=':') plt.plot(*Ei, color=colors[i]) for i, Ei in enumerate(Espectrum[0:-1]): def pend(y, t): return np.array([y[1], -(Ei - V(t, *αβγλ))*y[0]]) y0L = 1e-1, 1e-1 y0R = (-1)**i * 1e-1, (-1)**i * 1e-1 rL, rR = EigenLine[i][0] rM = (rL + rR)/2 tL = np.linspace(1e-1, rM, 101) tR = np.linspace(9, rM, 101) solL = odeint(pend, y0L, tL) solR = odeint(pend, y0R, tR) WL = solL[:, 0]/abs(solL[:, 0][-1]) WR = solR[:, 0]/abs(solR[:, 0][-1]) Wmax = max(max(abs(WL)), max(abs(WR))) plt.plot(tL, Ei + 1.6*WL/Wmax, color=colors[i]) plt.plot(tR, Ei + 1.6*WR/Wmax, color=colors[i]) rs = np.linspace(*EigenLine[-1][0], 500) plt.plot(rs, V(rs, *αβγλ), color='blue') plt.xlabel('r [arbitrary]', fontsize=14) plt.ylabel('$\psi(r)$, V(r), E [all arbitrary]', fontsize=14) #plt.grid(color='lightgray') plt.grid(axis='x', linestyle='--', color='lightgray') #plt.grid(linestyle='--', color='lightgray') plt.xlim(EigenLine[-1][0]) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Definitions Step2: $\lambda_0$ and $s_0$ Step3: Case Step4: Initialize AIM solver Step5: Calculation necessary coefficients Step6: The Solution Step7: Case Step8: Case Step9: Case Step10: Eigenvalues and Eigenfucntions for $\alpha = 4, \gamma = 5, \lambda = 100$
9,570
<ASSISTANT_TASK:> Python Code: ### START CODE HERE ### (≈ 1 line of code) test = "Hello World" ### END CODE HERE ### print ("test: " + test) # GRADED FUNCTION: basic_sigmoid import math import numpy as np def basic_sigmoid(x): Compute sigmoid of x. Arguments: x -- A scalar Return: s -- sigmoid(x) ### START CODE HERE ### (≈ 1 line of code) s = 1 / (1 + math.exp(-1 * x)) ### END CODE HERE ### return s basic_sigmoid(3) ### One reason why we use "numpy" instead of "math" in Deep Learning ### x = [1, 2, 3] basic_sigmoid(x) # you will see this give an error when you run it, because x is a vector. print(basic_sigmoid(x)) import numpy as np # example of np.exp x = np.array([1, 2, 3]) print(np.exp(x)) # result is (exp(1), exp(2), exp(3)) # example of vector operation x = np.array([1, 2, 3]) print (x + 3) # GRADED FUNCTION: sigmoid import numpy as np # this means you can access numpy functions by writing np.function() instead of numpy.function() def sigmoid(x): Compute the sigmoid of x Arguments: x -- A scalar or numpy array of any size Return: s -- sigmoid(x) ### START CODE HERE ### (≈ 1 line of code) #s = np.exp(np.multiply(-1, x)) #s = np.divide(1, np.add(1, s)) s = 1 / (1 + np.exp(-x)) ### END CODE HERE ### return s x = np.array([1, 2, 3]) sigmoid(x) # GRADED FUNCTION: sigmoid_derivative def sigmoid_derivative(x): Compute the gradient (also called the slope or derivative) of the sigmoid function with respect to its input x. You can store the output of the sigmoid function into variables and then use it to calculate the gradient. Arguments: x -- A scalar or numpy array Return: ds -- Your computed gradient. ### START CODE HERE ### (≈ 2 lines of code) s = sigmoid(x) ds = s * (1 - s) ### END CODE HERE ### return ds x = np.array([1, 2, 3]) print ("sigmoid_derivative(x) = " + str(sigmoid_derivative(x))) # GRADED FUNCTION: image2vector def image2vector(image): Argument: image -- a numpy array of shape (length, height, depth) Returns: v -- a vector of shape (length*height*depth, 1) ### START CODE HERE ### (≈ 1 line of code) v = image.copy() v = v.reshape(1, v.shape[0] * v.shape[1] * v.shape[2]) ### END CODE HERE ### return v # This is a 3 by 3 by 2 array, typically images will be (num_px_x, num_px_y,3) where 3 represents the RGB values image = np.array([[[ 0.67826139, 0.29380381], [ 0.90714982, 0.52835647], [ 0.4215251 , 0.45017551]], [[ 0.92814219, 0.96677647], [ 0.85304703, 0.52351845], [ 0.19981397, 0.27417313]], [[ 0.60659855, 0.00533165], [ 0.10820313, 0.49978937], [ 0.34144279, 0.94630077]]]) print ("image2vector(image) = " + str(image2vector(image))) # GRADED FUNCTION: normalizeRows def normalizeRows(x): Implement a function that normalizes each row of the matrix x (to have unit length). Argument: x -- A numpy matrix of shape (n, m) Returns: x -- The normalized (by row) numpy matrix. You are allowed to modify x. ### Here there are m examples and n features ### Number of rows is n ### Number of examples is m ### Each example is a column (and not a row) ### START CODE HERE ### (≈ 2 lines of code) # Compute x_norm as the norm 2 of x. Use np.linalg.norm(..., ord = 2, axis = ..., keepdims = True) #x_norm = None x_norm = np.linalg.norm(x, ord = 2, axis = 1, keepdims=True) # print ('===================================') # print (x.shape) # print (x_norm.shape) # Divide x by its norm. x = x / x_norm ### END CODE HERE ### return x x = np.array([ [0, 3, 4], [1, 6, 4]]) print("normalizeRows(x) = " + str(normalizeRows(x))) # GRADED FUNCTION: softmax def softmax(x): Calculates the softmax for each row of the input x. Your code should work for a row vector and also for matrices of shape (n, m). Argument: x -- A numpy matrix of shape (n,m) Returns: s -- A numpy matrix equal to the softmax of x, of shape (n,m) ### START CODE HERE ### (≈ 3 lines of code) # Apply exp() element-wise to x. Use np.exp(...). x_exp = np.exp(x) # Create a vector x_sum that sums each row of x_exp. Use np.sum(..., axis = 1, keepdims = True). x_sum = np.sum(x_exp, axis=1).reshape(2,1) # Compute softmax(x) by dividing x_exp by x_sum. It should automatically use numpy broadcasting. s = x_exp / x_sum ### END CODE HERE ### return s x = np.array([ [9, 2, 5, 0, 0], [7, 5, 0, 0 ,0]]) print("softmax(x) = " + str(softmax(x))) import time x1 = [9, 2, 5, 0, 0, 7, 5, 0, 0, 0, 9, 2, 5, 0, 0] x2 = [9, 2, 2, 9, 0, 9, 2, 5, 0, 0, 9, 2, 5, 0, 0] ### CLASSIC DOT PRODUCT OF VECTORS IMPLEMENTATION ### tic = time.process_time() dot = 0 for i in range(len(x1)): dot+= x1[i]*x2[i] toc = time.process_time() print ("dot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC OUTER PRODUCT IMPLEMENTATION ### tic = time.process_time() outer = np.zeros((len(x1),len(x2))) # we create a len(x1)*len(x2) matrix with only zeros for i in range(len(x1)): for j in range(len(x2)): outer[i,j] = x1[i]*x2[j] toc = time.process_time() print ("outer = " + str(outer) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC ELEMENTWISE IMPLEMENTATION ### tic = time.process_time() mul = np.zeros(len(x1)) for i in range(len(x1)): mul[i] = x1[i]*x2[i] toc = time.process_time() print ("elementwise multiplication = " + str(mul) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### CLASSIC GENERAL DOT PRODUCT IMPLEMENTATION ### W = np.random.rand(3,len(x1)) # Random 3*len(x1) numpy array tic = time.process_time() gdot = np.zeros(W.shape[0]) for i in range(W.shape[0]): for j in range(len(x1)): gdot[i] += W[i,j]*x1[j] toc = time.process_time() print ("gdot = " + str(gdot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") x1 = [9, 2, 5, 0, 0, 7, 5, 0, 0, 0, 9, 2, 5, 0, 0] x2 = [9, 2, 2, 9, 0, 9, 2, 5, 0, 0, 9, 2, 5, 0, 0] ### VECTORIZED DOT PRODUCT OF VECTORS ### tic = time.process_time() dot = np.dot(x1,x2) toc = time.process_time() print ("dot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED OUTER PRODUCT ### tic = time.process_time() outer = np.outer(x1,x2) toc = time.process_time() print ("outer = " + str(outer) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED ELEMENTWISE MULTIPLICATION ### tic = time.process_time() mul = np.multiply(x1,x2) toc = time.process_time() print ("elementwise multiplication = " + str(mul) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") ### VECTORIZED GENERAL DOT PRODUCT ### tic = time.process_time() dot = np.dot(W,x1) toc = time.process_time() print ("gdot = " + str(dot) + "\n ----- Computation time = " + str(1000*(toc - tic)) + "ms") # GRADED FUNCTION: L1 def L1(yhat, y): Arguments: yhat -- vector of size m (predicted labels) y -- vector of size m (true labels) Returns: loss -- the value of the L1 loss function defined above loss = 0 ### START CODE HERE ### (≈ 1 line of code) #y_minus_yhat = y - yhat #loss = np.linalg.norm(y_minus_yhat, ord=1) for i in range(y.shape[0]): loss += math.sqrt((y[i] - yhat[i]) ** 2) ### END CODE HERE ### return loss yhat = np.array([.9, 0.2, 0.1, .4, .9]) y = np.array([1, 0, 0, 1, 1]) print("L1 = " + str(L1(yhat,y))) # GRADED FUNCTION: L2 def L2(yhat, y): Arguments: yhat -- vector of size m (predicted labels) y -- vector of size m (true labels) Returns: loss -- the value of the L2 loss function defined above ### START CODE HERE ### (≈ 1 line of code) loss = (np.dot((y-yhat), (y-yhat))) ### END CODE HERE ### return loss yhat = np.array([.9, 0.2, 0.1, .4, .9]) y = np.array([1, 0, 0, 1, 1]) print("L2 = " + str(L2(yhat,y))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Expected output Step3: Expected Output Step4: In fact, if $ x = (x_1, x_2, ..., x_n)$ is a row vector then $np.exp(x)$ will apply the exponential function to every element of x. The output will thus be Step5: Furthermore, if x is a vector, then a Python operation such as $s = x + 3$ or $s = \frac{1}{x}$ will output s as a vector of the same size as x. Step7: Any time you need more info on a numpy function, we encourage you to look at the official documentation. Step9: Expected Output Step11: Expected Output Step13: Expected Output Step15: Expected Output Step16: Expected Output Step18: As you may have noticed, the vectorized implementation is much cleaner and more efficient. For bigger vectors/matrices, the differences in running time become even bigger. Step20: Expected Output
9,571
<ASSISTANT_TASK:> Python Code: # https://github.com/probml/pyprobml/blob/master/scripts/beta_binom_approx_post_pymc3.py # 1d approixmation to beta binomial model # https://github.com/aloctavodia/BAP # import superimport import pymc3 as pm import numpy as np import seaborn as sns import scipy.stats as stats import matplotlib.pyplot as plt import arviz as az import math # import pyprobml_utils as pml # data = np.repeat([0, 1], (10, 3)) data = np.repeat([0, 1], (10, 1)) h = data.sum() t = len(data) - h plt.figure() x = np.linspace(0, 1, 100) xs = x # grid dx_exact = xs[1] - xs[0] post_exact = stats.beta.pdf(xs, h + 1, t + 1) post_exact = post_exact / np.sum(post_exact) plt.plot(xs, post_exact) plt.yticks([]) plt.title("exact posterior") plt.savefig("bb_exact.pdf") # Grid def posterior_grid(heads, tails, grid_points=100): grid = np.linspace(0, 1, grid_points) prior = np.repeat(1 / grid_points, grid_points) # uniform prior likelihood = stats.binom.pmf(heads, heads + tails, grid) posterior = likelihood * prior posterior /= posterior.sum() # posterior = posterior * grid_points return grid, posterior n = 20 grid, posterior = posterior_grid(h, t, n) dx_grid = grid[1] - grid[0] sf = dx_grid / dx_exact # Jacobian scale factor plt.figure() # plt.stem(grid, posterior, use_line_collection=True) plt.bar(grid, posterior, width=1 / n, alpha=0.2) plt.plot(xs, post_exact * sf) plt.title("grid approximation") plt.yticks([]) plt.xlabel("θ") plt.savefig("bb_grid.pdf") # Laplace with pm.Model() as normal_aproximation: theta = pm.Beta("theta", 1.0, 1.0) y = pm.Binomial("y", n=1, p=theta, observed=data) # Bernoulli mean_q = pm.find_MAP() std_q = ((1 / pm.find_hessian(mean_q, vars=[theta])) ** 0.5)[0] mu = mean_q["theta"] print([mu, std_q]) plt.figure() plt.plot(xs, stats.norm.pdf(xs, mu, std_q), "--", label="Laplace") post_exact = stats.beta.pdf(xs, h + 1, t + 1) plt.plot(xs, post_exact, label="exact") plt.title("Quadratic approximation") plt.xlabel("θ", fontsize=14) plt.yticks([]) plt.legend() plt.savefig("bb_laplace.pdf"); # ADVI with pm.Model() as mf_model: theta = pm.Beta("theta", 1.0, 1.0) y = pm.Binomial("y", n=1, p=theta, observed=data) # Bernoulli mean_field = pm.fit(method="advi") trace_mf = mean_field.sample(1000) thetas = trace_mf["theta"] axes = az.plot_posterior(thetas, hdi_prob=0.95) plt.savefig("bb_mf.pdf") plt.show() # track mean and std with pm.Model() as mf_model: theta = pm.Beta("theta", 1.0, 1.0) y = pm.Binomial("y", n=1, p=theta, observed=data) # Bernoulli advi = pm.ADVI() tracker = pm.callbacks.Tracker( mean=advi.approx.mean.eval, std=advi.approx.std.eval # callable that returns mean # callable that returns std ) approx = advi.fit(callbacks=[tracker]) trace_approx = approx.sample(1000) thetas = trace_approx["theta"] axes = az.plot_posterior(thetas, hdi_prob=0.95) plt.savefig("bb_mf_kde_az.pdf") plt.figure() plt.plot(tracker["mean"]) plt.title("Mean") plt.savefig("bb_mf_mean.pdf") plt.figure() plt.plot(tracker["std"]) plt.title("Std ") plt.savefig("bb_mf_std.pdf") plt.figure() plt.plot(advi.hist) plt.title("Negative ELBO") plt.savefig("bb_mf_elbo.pdf") plt.figure() sns.kdeplot(thetas) plt.title("KDE of posterior samples") plt.savefig("bb_mf_kde.pdf") plt.show() # HMC with pm.Model() as hmc_model: theta = pm.Beta("theta", 1.0, 1.0) y = pm.Binomial("y", n=1, p=theta, observed=data) # Bernoulli trace = pm.sample(1000, random_seed=42, cores=1, chains=2) thetas = trace["theta"] axes = az.plot_posterior(thetas, hdi_prob=0.95) plt.savefig("bb_hmc.pdf") az.plot_trace(trace) plt.savefig("bb_hmc_trace.pdf", dpi=300) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Exact Step2: Grid Step3: Laplace Step4: ADVI Step5: HMC
9,572
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np #Lendo a base de dados df = pd.read_csv('../datasets/titanic/train.csv') print("Tabela Original") df.head() df = df.drop(['Name', 'Ticket', 'Cabin'], axis=1) df = df.dropna() df['Gender'] = df['Sex'].map({'female': 0, 'male':1}).astype(int) df['Port'] = df['Embarked'].map({'C':1, 'S':2, 'Q':3}).astype(int) df = df.drop(['Sex', 'Embarked'], axis=1) cols = df.columns.tolist() cols = [cols[1]] + cols[0:1] + cols[2:] df = df[cols] print("Tabela depois de processada") df.head() dataset = { 'data': df.values[0:,2:], 'target': df.values[0:,0] } X = dataset['data'] y = dataset['target'] <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Por fim, geramos nossa base de treino e teste no formato para o ScikitLearn
9,573
<ASSISTANT_TASK:> Python Code: import jax import jax.numpy as jnp from jax.config import config config.update("jax_enable_x64", True) @jax.jit def f(x, A, b): res = A @ x - b return res @ res gradf = jax.grad(f, argnums=0, has_aux=False) n = 1000 x = jax.random.normal(jax.random.PRNGKey(0), (n, )) A = jax.random.normal(jax.random.PRNGKey(0), (n, n)) b = jax.random.normal(jax.random.PRNGKey(0), (n, )) print("Check correctness", jnp.linalg.norm(gradf(x, A, b) - 2 * A.T @ (A @ x - b))) print("Compare speed") print("Analytical gradient") %timeit 2 * A.T @ (A @ x - b) print("Grad function") %timeit gradf(x, A, b).block_until_ready() jit_gradf = jax.jit(gradf) print("Jitted grad function") %timeit jit_gradf(x, A, b).block_until_ready() hess_func = jax.jit(jax.hessian(f)) print("Check correctness", jnp.linalg.norm(2 * A.T @ A - hess_func(x, A, b))) print("Time for hessian") %timeit hess_func(x, A, b).block_until_ready() print("Emulate hessian and check correctness", jnp.linalg.norm(jax.jit(hess_func)(x, A, b) - jax.jacfwd(jax.jacrev(f))(x, A, b))) print("Time of emulating hessian") hess_umul_func = jax.jit(jax.jacfwd(jax.jacrev(f))) %timeit hess_umul_func(x, A, b).block_until_ready() fmode_f = jax.jit(jax.jacfwd(f)) bmode_f = jax.jit(jax.jacrev(f)) print("Check correctness", jnp.linalg.norm(fmode_f(x, A, b) - bmode_f(x, A, b))) print("Forward mode") %timeit fmode_f(x, A, b).block_until_ready() print("Backward mode") %timeit bmode_f(x, A, b).block_until_ready() def fvec(x, A, b): y = A @ x + b return jnp.exp(y - jnp.max(y)) / jnp.sum(jnp.exp(y - jnp.max(y))) grad_fvec = jax.jit(jax.grad(fvec)) jac_fvec = jax.jacobian(fvec) fmode_fvec = jax.jit(jax.jacfwd(fvec)) bmode_fvec = jax.jit(jax.jacrev(fvec)) n = 1000 m = 1000 x = jax.random.normal(jax.random.PRNGKey(0), (n, )) A = jax.random.normal(jax.random.PRNGKey(0), (m, n)) b = jax.random.normal(jax.random.PRNGKey(0), (m, )) J = jac_fvec(x, A, b) print(J.shape) grad_fvec(x, A, b) print("Check correctness", jnp.linalg.norm(fmode_fvec(x, A, b) - bmode_fvec(x, A, b))) print("Check shape", fmode_fvec(x, A, b).shape, bmode_fvec(x, A, b).shape) print("Time forward mode") %timeit fmode_fvec(x, A, b).block_until_ready() print("Time backward mode") %timeit bmode_fvec(x, A, b).block_until_ready() n = 10 m = 1000 x = jax.random.normal(jax.random.PRNGKey(0), (n, )) A = jax.random.normal(jax.random.PRNGKey(0), (m, n)) b = jax.random.normal(jax.random.PRNGKey(0), (m, )) print("Check correctness", jnp.linalg.norm(fmode_fvec(x, A, b) - bmode_fvec(x, A, b))) print("Check shape", fmode_fvec(x, A, b).shape, bmode_fvec(x, A, b).shape) print("Time forward mode") %timeit fmode_fvec(x, A, b).block_until_ready() print("Time backward mode") %timeit bmode_fvec(x, A, b).block_until_ready() def hvp(f, x, z, *args): def g(x): return f(x, *args) return jax.jvp(jax.grad(g), (x,), (z,))[1] n = 3000 x = jax.random.normal(jax.random.PRNGKey(0), (n, )) A = jax.random.normal(jax.random.PRNGKey(0), (n, n)) b = jax.random.normal(jax.random.PRNGKey(0), (n, )) z = jax.random.normal(jax.random.PRNGKey(0), (n, )) print("Check correctness", jnp.linalg.norm(2 * A.T @ (A @ z) - hvp(f, x, z, A, b))) print("Time for hvp by hands") %timeit (2 * A.T @ (A @ z)).block_until_ready() print("Time for hvp via jvp, NO jit") %timeit hvp(f, x, z, A, b).block_until_ready() print("Time for hvp via jvp, WITH jit") %timeit jax.jit(hvp, static_argnums=0)(f, x, z, A, b).block_until_ready() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: By default, JAX exploits single-precision numbers float32 Step2: Random numbers in JAX Step3: Forward mode vs. backward mode Step4: Forward mode vs. backward mode Step5: Hessian-by-vector product
9,574
<ASSISTANT_TASK:> Python Code: %%bash pip freeze | grep tensor # Choose a version of TensorFlow that is supported on TPUs TFVERSION='1.13' import os os.environ['TFVERSION'] = TFVERSION %%bash pip install tensor2tensor==${TFVERSION} gutenberg # install from sou #git clone https://github.com/tensorflow/tensor2tensor.git #cd tensor2tensor #yes | pip install --user -e . %%bash pip freeze | grep tensor import os PROJECT = 'cloud-training-demos' # REPLACE WITH YOUR PROJECT ID BUCKET = 'cloud-training-demos-ml' # REPLACE WITH YOUR BUCKET NAME REGION = 'us-central1' # REPLACE WITH YOUR BUCKET REGION e.g. us-central1 # this is what this notebook is demonstrating PROBLEM= 'poetry_line_problem' # for bash os.environ['PROJECT'] = PROJECT os.environ['BUCKET'] = BUCKET os.environ['REGION'] = REGION os.environ['PROBLEM'] = PROBLEM #os.environ['PATH'] = os.environ['PATH'] + ':' + os.getcwd() + '/tensor2tensor/tensor2tensor/bin/' %%bash gcloud config set project $PROJECT gcloud config set compute/region $REGION %%bash rm -rf data/poetry mkdir -p data/poetry from gutenberg.acquire import load_etext from gutenberg.cleanup import strip_headers import re books = [ # bookid, skip N lines (26715, 1000, 'Victorian songs'), (30235, 580, 'Baldwin collection'), (35402, 710, 'Swinburne collection'), (574, 15, 'Blake'), (1304, 172, 'Bulchevys collection'), (19221, 223, 'Palgrave-Pearse collection'), (15553, 522, 'Knowles collection') ] with open('data/poetry/raw.txt', 'w') as ofp: lineno = 0 for (id_nr, toskip, title) in books: startline = lineno text = strip_headers(load_etext(id_nr)).strip() lines = text.split('\n')[toskip:] # any line that is all upper case is a title or author name # also don't want any lines with years (numbers) for line in lines: if (len(line) > 0 and line.upper() != line and not re.match('.*[0-9]+.*', line) and len(line) < 50 ): cleaned = re.sub('[^a-z\'\-]+', ' ', line.strip().lower()) ofp.write(cleaned) ofp.write('\n') lineno = lineno + 1 else: ofp.write('\n') print('Wrote lines {} to {} from {}'.format(startline, lineno, title)) !wc -l data/poetry/*.txt with open('data/poetry/raw.txt', 'r') as rawfp,\ open('data/poetry/input.txt', 'w') as infp,\ open('data/poetry/output.txt', 'w') as outfp: prev_line = '' for curr_line in rawfp: curr_line = curr_line.strip() # poems break at empty lines, so this ensures we train only # on lines of the same poem if len(prev_line) > 0 and len(curr_line) > 0: infp.write(prev_line + '\n') outfp.write(curr_line + '\n') prev_line = curr_line !head -5 data/poetry/*.txt %%bash rm -rf poetry mkdir -p poetry/trainer %%writefile poetry/trainer/problem.py import os import tensorflow as tf from tensor2tensor.utils import registry from tensor2tensor.models import transformer from tensor2tensor.data_generators import problem from tensor2tensor.data_generators import text_encoder from tensor2tensor.data_generators import text_problems from tensor2tensor.data_generators import generator_utils tf.summary.FileWriterCache.clear() # ensure filewriter cache is clear for TensorBoard events file @registry.register_problem class PoetryLineProblem(text_problems.Text2TextProblem): Predict next line of poetry from the last line. From Gutenberg texts. @property def approx_vocab_size(self): return 2**13 # ~8k @property def is_generate_per_split(self): # generate_data will NOT shard the data into TRAIN and EVAL for us. return False @property def dataset_splits(self): Splits of data to produce and number of output shards for each. # 10% evaluation data return [{ "split": problem.DatasetSplit.TRAIN, "shards": 90, }, { "split": problem.DatasetSplit.EVAL, "shards": 10, }] def generate_samples(self, data_dir, tmp_dir, dataset_split): with open('data/poetry/raw.txt', 'r') as rawfp: prev_line = '' for curr_line in rawfp: curr_line = curr_line.strip() # poems break at empty lines, so this ensures we train only # on lines of the same poem if len(prev_line) > 0 and len(curr_line) > 0: yield { "inputs": prev_line, "targets": curr_line } prev_line = curr_line # Smaller than the typical translate model, and with more regularization @registry.register_hparams def transformer_poetry(): hparams = transformer.transformer_base() hparams.num_hidden_layers = 2 hparams.hidden_size = 128 hparams.filter_size = 512 hparams.num_heads = 4 hparams.attention_dropout = 0.6 hparams.layer_prepostprocess_dropout = 0.6 hparams.learning_rate = 0.05 return hparams @registry.register_hparams def transformer_poetry_tpu(): hparams = transformer_poetry() transformer.update_hparams_for_tpu(hparams) return hparams # hyperparameter tuning ranges @registry.register_ranged_hparams def transformer_poetry_range(rhp): rhp.set_float("learning_rate", 0.05, 0.25, scale=rhp.LOG_SCALE) rhp.set_int("num_hidden_layers", 2, 4) rhp.set_discrete("hidden_size", [128, 256, 512]) rhp.set_float("attention_dropout", 0.4, 0.7) %%writefile poetry/trainer/__init__.py from . import problem %%writefile poetry/setup.py from setuptools import find_packages from setuptools import setup REQUIRED_PACKAGES = [ 'tensor2tensor' ] setup( name='poetry', version='0.1', author = 'Google', author_email = 'training-feedback@cloud.google.com', install_requires=REQUIRED_PACKAGES, packages=find_packages(), include_package_data=True, description='Poetry Line Problem', requires=[] ) !touch poetry/__init__.py !find poetry %%bash DATA_DIR=./t2t_data TMP_DIR=$DATA_DIR/tmp rm -rf $DATA_DIR $TMP_DIR mkdir -p $DATA_DIR $TMP_DIR # Generate data t2t-datagen \ --t2t_usr_dir=./poetry/trainer \ --problem=$PROBLEM \ --data_dir=$DATA_DIR \ --tmp_dir=$TMP_DIR !ls t2t_data | head %%bash DATA_DIR=./t2t_data gsutil -m rm -r gs://${BUCKET}/poetry/ gsutil -m cp ${DATA_DIR}/${PROBLEM}* ${DATA_DIR}/vocab* gs://${BUCKET}/poetry/data %%bash PROJECT_ID=$PROJECT AUTH_TOKEN=$(gcloud auth print-access-token) SVC_ACCOUNT=$(curl -X GET -H "Content-Type: application/json" \ -H "Authorization: Bearer $AUTH_TOKEN" \ https://ml.googleapis.com/v1/projects/${PROJECT_ID}:getConfig \ | python -c "import json; import sys; response = json.load(sys.stdin); \ print(response['serviceAccount'])") echo "Authorizing the Cloud ML Service account $SVC_ACCOUNT to access files in $BUCKET" gsutil -m defacl ch -u $SVC_ACCOUNT:R gs://$BUCKET gsutil -m acl ch -u $SVC_ACCOUNT:R -r gs://$BUCKET # error message (if bucket is empty) can be ignored gsutil -m acl ch -u $SVC_ACCOUNT:W gs://$BUCKET %%bash BASE=gs://${BUCKET}/poetry/data OUTDIR=gs://${BUCKET}/poetry/subset gsutil -m rm -r $OUTDIR gsutil -m cp \ ${BASE}/${PROBLEM}-train-0008* \ ${BASE}/${PROBLEM}-dev-00000* \ ${BASE}/vocab* \ $OUTDIR %%bash DATA_DIR=gs://${BUCKET}/poetry/subset OUTDIR=./trained_model rm -rf $OUTDIR t2t-trainer \ --data_dir=gs://${BUCKET}/poetry/subset \ --t2t_usr_dir=./poetry/trainer \ --problem=$PROBLEM \ --model=transformer \ --hparams_set=transformer_poetry \ --output_dir=$OUTDIR --job-dir=$OUTDIR --train_steps=10 %%bash LOCALGPU="--train_steps=7500 --worker_gpu=1 --hparams_set=transformer_poetry" DATA_DIR=gs://${BUCKET}/poetry/data OUTDIR=gs://${BUCKET}/poetry/model rm -rf $OUTDIR t2t-trainer \ --data_dir=gs://${BUCKET}/poetry/subset \ --t2t_usr_dir=./poetry/trainer \ --problem=$PROBLEM \ --model=transformer \ --hparams_set=transformer_poetry \ --output_dir=$OUTDIR ${LOCALGPU} %%bash GPU="--train_steps=7500 --cloud_mlengine --worker_gpu=1 --hparams_set=transformer_poetry" DATADIR=gs://${BUCKET}/poetry/data OUTDIR=gs://${BUCKET}/poetry/model JOBNAME=poetry_$(date -u +%y%m%d_%H%M%S) echo $OUTDIR $REGION $JOBNAME gsutil -m rm -rf $OUTDIR yes Y | t2t-trainer \ --data_dir=gs://${BUCKET}/poetry/subset \ --t2t_usr_dir=./poetry/trainer \ --problem=$PROBLEM \ --model=transformer \ --output_dir=$OUTDIR \ ${GPU} %%bash ## CHANGE the job name (based on output above: You will see a line such as Launched transformer_poetry_line_problem_t2t_20190322_233159) gcloud ml-engine jobs describe transformer_poetry_line_problem_t2t_20190323_003001 %%bash # use one of these TPU="--train_steps=7500 --use_tpu=True --cloud_tpu_name=laktpu --hparams_set=transformer_poetry_tpu" DATADIR=gs://${BUCKET}/poetry/data OUTDIR=gs://${BUCKET}/poetry/model_tpu JOBNAME=poetry_$(date -u +%y%m%d_%H%M%S) echo $OUTDIR $REGION $JOBNAME gsutil -m rm -rf $OUTDIR echo "'Y'" | t2t-trainer \ --data_dir=gs://${BUCKET}/poetry/subset \ --t2t_usr_dir=./poetry/trainer \ --problem=$PROBLEM \ --model=transformer \ --output_dir=$OUTDIR \ ${TPU} %%bash gsutil ls gs://${BUCKET}/poetry/model_tpu %%bash XXX This takes 3 hours on 4 GPUs. Remove this line if you are sure you want to do this. DATADIR=gs://${BUCKET}/poetry/data OUTDIR=gs://${BUCKET}/poetry/model_full2 JOBNAME=poetry_$(date -u +%y%m%d_%H%M%S) echo $OUTDIR $REGION $JOBNAME gsutil -m rm -rf $OUTDIR echo "'Y'" | t2t-trainer \ --data_dir=gs://${BUCKET}/poetry/subset \ --t2t_usr_dir=./poetry/trainer \ --problem=$PROBLEM \ --model=transformer \ --hparams_set=transformer_poetry \ --output_dir=$OUTDIR \ --train_steps=75000 --cloud_mlengine --worker_gpu=4 %%bash gsutil ls gs://${BUCKET}/poetry/model #_modeltpu %%writefile data/poetry/rumi.txt Where did the handsome beloved go? I wonder, where did that tall, shapely cypress tree go? He spread his light among us like a candle. Where did he go? So strange, where did he go without me? All day long my heart trembles like a leaf. All alone at midnight, where did that beloved go? Go to the road, and ask any passing traveler —  That soul-stirring companion, where did he go? Go to the garden, and ask the gardener —  That tall, shapely rose stem, where did he go? Go to the rooftop, and ask the watchman —  That unique sultan, where did he go? Like a madman, I search in the meadows! That deer in the meadows, where did he go? My tearful eyes overflow like a river —  That pearl in the vast sea, where did he go? All night long, I implore both moon and Venus —  That lovely face, like a moon, where did he go? If he is mine, why is he with others? Since he’s not here, to what “there” did he go? If his heart and soul are joined with God, And he left this realm of earth and water, where did he go? Tell me clearly, Shams of Tabriz, Of whom it is said, “The sun never dies” — where did he go? %%bash awk 'NR % 2 == 1' data/poetry/rumi.txt | tr '[:upper:]' '[:lower:]' | sed "s/[^a-z\'-\ ]//g" > data/poetry/rumi_leads.txt head -3 data/poetry/rumi_leads.txt %%bash # same as the above training job ... TOPDIR=gs://${BUCKET} OUTDIR=${TOPDIR}/poetry/model #_tpu # or ${TOPDIR}/poetry/model_full DATADIR=${TOPDIR}/poetry/data MODEL=transformer HPARAMS=transformer_poetry #_tpu # the file with the input lines DECODE_FILE=data/poetry/rumi_leads.txt BEAM_SIZE=4 ALPHA=0.6 t2t-decoder \ --data_dir=$DATADIR \ --problem=$PROBLEM \ --model=$MODEL \ --hparams_set=$HPARAMS \ --output_dir=$OUTDIR \ --t2t_usr_dir=./poetry/trainer \ --decode_hparams="beam_size=$BEAM_SIZE,alpha=$ALPHA" \ --decode_from_file=$DECODE_FILE %%bash DECODE_FILE=data/poetry/rumi_leads.txt cat ${DECODE_FILE}.*.decodes from google.datalab.ml import TensorBoard TensorBoard().start('gs://{}/poetry/model_full'.format(BUCKET)) for pid in TensorBoard.list()['pid']: TensorBoard().stop(pid) print('Stopped TensorBoard with pid {}'.format(pid)) %%bash XXX This takes about 15 hours and consumes about 420 ML units. Uncomment if you wish to proceed anyway DATADIR=gs://${BUCKET}/poetry/data OUTDIR=gs://${BUCKET}/poetry/model_hparam JOBNAME=poetry_$(date -u +%y%m%d_%H%M%S) echo $OUTDIR $REGION $JOBNAME gsutil -m rm -rf $OUTDIR echo "'Y'" | t2t-trainer \ --data_dir=gs://${BUCKET}/poetry/subset \ --t2t_usr_dir=./poetry/trainer \ --problem=$PROBLEM \ --model=transformer \ --hparams_set=transformer_poetry \ --output_dir=$OUTDIR \ --hparams_range=transformer_poetry_range \ --autotune_objective='metrics-poetry_line_problem/accuracy_per_sequence' \ --autotune_maximize \ --autotune_max_trials=4 \ --autotune_parallel_trials=4 \ --train_steps=7500 --cloud_mlengine --worker_gpu=4 %%bash # same as the above training job ... BEST_TRIAL=28 # CHANGE as needed. TOPDIR=gs://${BUCKET} OUTDIR=${TOPDIR}/poetry/model_hparam/$BEST_TRIAL DATADIR=${TOPDIR}/poetry/data MODEL=transformer HPARAMS=transformer_poetry # the file with the input lines DECODE_FILE=data/poetry/rumi_leads.txt BEAM_SIZE=4 ALPHA=0.6 t2t-decoder \ --data_dir=$DATADIR \ --problem=$PROBLEM \ --model=$MODEL \ --hparams_set=$HPARAMS \ --output_dir=$OUTDIR \ --t2t_usr_dir=./poetry/trainer \ --decode_hparams="beam_size=$BEAM_SIZE,alpha=$ALPHA" \ --decode_from_file=$DECODE_FILE \ --hparams="num_hidden_layers=4,hidden_size=512" %%bash DECODE_FILE=data/poetry/rumi_leads.txt cat ${DECODE_FILE}.*.decodes %%bash TOPDIR=gs://${BUCKET} OUTDIR=${TOPDIR}/poetry/model_full2 DATADIR=${TOPDIR}/poetry/data MODEL=transformer HPARAMS=transformer_poetry BEAM_SIZE=4 ALPHA=0.6 t2t-exporter \ --model=$MODEL \ --hparams_set=$HPARAMS \ --problem=$PROBLEM \ --t2t_usr_dir=./poetry/trainer \ --decode_hparams="beam_size=$BEAM_SIZE,alpha=$ALPHA" \ --data_dir=$DATADIR \ --output_dir=$OUTDIR %%bash MODEL_LOCATION=$(gsutil ls gs://${BUCKET}/poetry/model_full2/export/Servo | tail -1) echo $MODEL_LOCATION saved_model_cli show --dir $MODEL_LOCATION --tag_set serve --signature_def serving_default %%writefile mlengine.json description: Poetry service on ML Engine autoScaling: minNodes: 1 # We don't want this model to autoscale down to zero %%bash MODEL_NAME="poetry" MODEL_VERSION="v1" MODEL_LOCATION=$(gsutil ls gs://${BUCKET}/poetry/model_full2/export/Servo | tail -1) echo "Deleting and deploying $MODEL_NAME $MODEL_VERSION from $MODEL_LOCATION ... this will take a few minutes" gcloud ml-engine versions delete ${MODEL_VERSION} --model ${MODEL_NAME} #gcloud ml-engine models delete ${MODEL_NAME} #gcloud ml-engine models create ${MODEL_NAME} --regions $REGION gcloud alpha ml-engine versions create --machine-type=mls1-highcpu-4 ${MODEL_VERSION} \ --model ${MODEL_NAME} --origin ${MODEL_LOCATION} --runtime-version=1.5 --config=mlengine.json %%bash gcloud components update --quiet gcloud components install alpha --quiet %%bash MODEL_NAME="poetry" MODEL_VERSION="v1" MODEL_LOCATION=$(gsutil ls gs://${BUCKET}/poetry/model_full2/export/Servo | tail -1) gcloud alpha ml-engine versions create --machine-type=mls1-highcpu-4 ${MODEL_VERSION} \ --model ${MODEL_NAME} --origin ${MODEL_LOCATION} --runtime-version=1.5 --config=mlengine.json !cat application/app.yaml %%bash cd application #gcloud app create # if this is your first app #gcloud app deploy --quiet --stop-previous-version app.yaml <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: If the following cell does not reflect the version of tensorflow and tensor2tensor that you just installed, click "Reset Session" on the notebook so that the Python environment picks up the new packages. Step2: Download data Step3: Create training dataset Step6: We do not need to generate the data beforehand -- instead, we can have Tensor2Tensor create the training dataset for us. So, in the code below, I will use only data/poetry/raw.txt -- obviously, this allows us to productionize our model better. Simply keep collecting raw data and generate the training/test data at the time of training. Step7: Generate training data Step8: Let's check to see the files that were output. If you see a broken pipe error, please ignore. Step9: Provide Cloud ML Engine access to data Step10: Train model locally on subset of data Step11: Note Step12: Option 1 Step13: Option 2 Step14: The job took about <b>25 minutes</b> for me and ended with these evaluation metrics Step15: The job took about <b>10 minutes</b> for me and ended with these evaluation metrics Step16: This job took <b>12 hours</b> for me and ended with these metrics Step17: Batch-predict Step18: Let's write out the odd-numbered lines. We'll compare how close our model can get to the beauty of Rumi's second lines given his first. Step19: <b> Note </b> if you get an error about "AttributeError Step20: Some of these are still phrases and not complete sentences. This indicates that we might need to train longer or better somehow. We need to diagnose the model ... Step21: <table> Step22: When I ran the above job, it took about 15 hours and finished with these as the best parameters Step23: Take the first three line. I'm showing the first line of the couplet provided to the model, how the AI model that we trained complets it and how Rumi completes it Step24: Cloud ML Engine Step25: Kubeflow
9,575
<ASSISTANT_TASK:> Python Code: import matplotlib.pyplot as plt import pandas as pd import numpy as np import seaborn as sns import sklearn.metrics import sklearn.datasets import sklearn.manifold import sklearn.decomposition import sklearn.preprocessing import sklearn.cluster import sklearn.feature_selection import sklearn.ensemble import sklearn.svm import sklearn.model_selection # from sklearn import linear_model %matplotlib inline # sklearn.datasets.make_sparse_uncorrelated X, y = sklearn.datasets.make_blobs(n_samples=30, centers=3, n_features=7, random_state=0) print(X.shape) sns.heatmap(X, robust=True, square=False, yticklabels=True, xticklabels=True, cbar=True) plt.show() # D = pairwise_distances(X, metric='euclidean', n_jobs=-1) # sns.heatmap(D, robust=True, square=True, yticklabels=True, xticklabels=True, cbar=True) # plt.show() # plt.hist(np.hstack(D), 20, facecolor='orange', alpha=0.75) # plt.xlabel('Pairwise distances') # plt.ylabel('Frequency') # plt.grid(True) # plt.show() def scatterplot_2D(R, title, labels=None): Helper function to plot data points in 2D Requires (N, 2) numpy array shape assert(R.shape[1] == 2) # class labels are turned into colors if labels is None: c = 'black' else: color_scale = np.linspace(0, 1, len(set(labels))) c = [plt.cm.Set1(color_scale[i]) for i in labels] fig = plt.figure() ax = fig.add_subplot(111) ax.patch.set_facecolor('white') ax.scatter(R[...,0], R[...,1], color=c) ax.axis('square') ax.set_xlabel('R1') ax.set_ylabel('R2') fig.suptitle(title) plt.show() # examples of non-linear transformations: # NOTE THAT THERE IS NO transform(X) R_MDS = sklearn.manifold.MDS(n_components=2).fit_transform(X) scatterplot_2D(R_MDS, 'MDS', y) R_ISO = sklearn.manifold.Isomap(n_components=2).fit_transform(X) scatterplot_2D(R_ISO, 'Isomap', y) R_TSNE = sklearn.manifold.TSNE(n_components=2, perplexity=10.0).fit_transform(X) scatterplot_2D(R_TSNE, 'TSNE', y) # Examples of projection to 2D via decomposition # NOTE THAT THERE IS transform(X) # Principal Component Analysis R_PCA = sklearn.decomposition.PCA(n_components=2).fit_transform(X) scatterplot_2D(R_PCA, 'PCA', y) # Factor Analysus R = sklearn.decomposition.FactorAnalysis(n_components=2).fit_transform(X) scatterplot_2D(R, 'FA', y) # Nonnegative matrix factorization # NMF requires non-negative values X_nonnegative = sklearn.preprocessing.MinMaxScaler().fit_transform(X) R_NMF = sklearn.decomposition.NMF(n_components=2).fit_transform(X_nonnegative) scatterplot_2D(R_NMF, 'NMF', y) # from sklearn.metrics.cluster import v_measure_score, adjusted_rand_score # Original labels: scatterplot_2D(R_NMF, 'Original labels, 3 clusters', y) # Clustering the original 7D dataset with KMeans kmeans = sklearn.cluster.KMeans(n_clusters=3, random_state=0).fit(X) scatterplot_2D(R_NMF, 'Kmeans in 7D, 3 clusters', kmeans.labels_) print(y) print(kmeans.labels_) print("V measure", sklearn.metrics.cluster.v_measure_score(y, kmeans.labels_)) print("Adj. Rand score", sklearn.metrics.cluster.adjusted_rand_score(y, kmeans.labels_)) # Clustering 2D dataset kmeans = sklearn.cluster.KMeans(n_clusters=3, random_state=0).fit(R_NMF) scatterplot_2D(R_NMF, 'Kmeans in 2D, 3 clusters', kmeans.labels_) print(y) print(kmeans.labels_) print("V measure", sklearn.metrics.cluster.v_measure_score(y, kmeans.labels_)) print("Adj. Rand score", sklearn.metrics.cluster.adjusted_rand_score(y, kmeans.labels_)) # Original data points (can be unknown) X, y = sklearn.datasets.make_blobs(n_samples=4, centers=3, n_features=2, random_state=0) fig = plt.figure() ax = fig.add_subplot(111) ax.patch.set_facecolor('white') ax.scatter(X[...,0], X[...,1], c=("red", "green", "blue", "orange"), s=120, edgecolors='none') ax.set_autoscale_on(False) ax.axis('square') ax.set_xlabel('R1') ax.set_ylabel('R2') fig.suptitle("TRUE") plt.show() # Pairwise dissimilarities D = sklearn.metrics.pairwise_distances(X, metric = 'euclidean') #################################################################################### M = sklearn.manifold.MDS(n_components=2, n_init=1, max_iter=10000, metric=True, dissimilarity="precomputed") K = M.fit_transform(D) print("Stress", M.stress_) fig = plt.figure() ax = fig.add_subplot(111) ax.patch.set_facecolor('white') ax.scatter(K[...,0], K[...,1], c=("red", "green", "blue", "orange"), s=120, edgecolors='none') ax.set_autoscale_on(False) ax.axis('square') ax.set_xlabel('R1') ax.set_ylabel('R2') fig.suptitle("MDS on pairwise dissimilarities") plt.show() from pathlib import Path ICGC_API = 'https://dcc.icgc.org/api/v1/download?fn=/release_18/Projects/BRCA-US/' # clinical_fname = 'clinical.BRCA-US.tsv.gz' # if not Path(clinical_fname).is_file(): # urllib.request.urlretrieve(ICGC_API + 'clinical.BRCA-US.tsv.gz', clinical_fname); expression_fname = 'protein_expression.BRCA-US.tsv.gz' if not Path(expression_fname).is_file(): urllib.request.urlretrieve(ICGC_API + 'protein_expression.BRCA-US.tsv.gz', expression_fname); E = pd.read_csv(expression_fname, delimiter='\t') E.head(1) donors = set(E['icgc_donor_id']) genes = set(E['gene_name']) print("Donors (data points):", len(donors)) print("Genes (features): ", len(genes)) donor2id = {donor: i for i, donor in enumerate(donors)} id2donor = dict(zip(donor2id.values(), donor2id.keys())) gene2id = {gene: i for i, gene in enumerate(genes)} id2gene = dict(zip(gene2id.values(), gene2id.keys())) data = np.zeros((len(donors), len(genes))) for i in range(len(E)): data[donor2id[E.loc[i, 'icgc_donor_id']], gene2id[E.loc[i, 'gene_name']]] = float(E.loc[i, 'normalized_expression_level']) data = sklearn.preprocessing.MinMaxScaler().fit_transform(data) # NMF DECOMPOSITION rank = 10 nmf = sklearn.decomposition.NMF(n_components=rank).fit(data) V = data W = nmf.components_ H = nmf.transform(data) print("V ~ W dot H + error") print("Error = ", nmf.reconstruction_err_) print("V = ", V.shape) print("W = ", W.shape) print("H = ", H.shape) sns.heatmap(V, robust=True, square=False, yticklabels=False, xticklabels=False, cbar=False) plt.show() g, ax = plt.subplots(figsize=(6,6)) sns.heatmap(W, robust=True, square=True, yticklabels=False, xticklabels=False, cbar=False) plt.show() g, ax = plt.subplots(figsize=(15, 3)) sns.heatmap(H, robust=True, square=False, yticklabels=False, xticklabels=False, cbar=False) plt.show() # Clustering in reduced feature space sns.clustermap(H, xticklabels=True, yticklabels=False) plt.show() # Show top 5 genes in each gene group for gene_group in range(H.shape[1]): k = 5 topk = np.argsort(np.asarray(W[gene_group, :]).flatten())[-k:] # print("Indices of related genes", topk) val = W[gene_group, topk] # print("Gene weights", val) plt.barh(np.arange(k) + .5, val, align="center") labels = [id2gene[idx] for idx in topk] plt.yticks(np.arange(k) + .5, labels) plt.xlabel("Weight") plt.ylabel("Gene group {}".format(gene_group)); plt.show() X = np.array([[0, 0, 1], [0, 1, 0], [1, 0, 0], [0, 1, 1], [0, 1, 0], [0, 1, 1]]) print(X) sel = sklearn.feature_selection.VarianceThreshold(threshold=(.8 * (1 - .8))) X_selected = sel.fit_transform(X) print(X_selected) iris = sklearn.datasets.load_iris() X, y = iris.data, iris.target print(X.shape) print(y) X_new = sklearn.feature_selection.SelectKBest(sklearn.feature_selection.chi2, k=2).fit_transform(X, y) print(X_new.shape) # Load the digits dataset digits = sklearn.datasets.load_digits() X = digits.images.reshape((len(digits.images), -1)) y = digits.target # Create the RFE (Recursive feature elimination) object and rank each pixel clf = sklearn.linear_model.LogisticRegression(C=1.0, penalty='l1', tol=1e-6) rfe = sklearn.feature_selection.RFE(estimator=clf, n_features_to_select=1, step=1) rfe.fit(X, y) ranking = rfe.ranking_.reshape(digits.images[0].shape) # Plot pixel ranking plt.matshow(ranking) # cmap=plt.get_cmap('summer') plt.colorbar() plt.title("Ranking of pixels with RFE\n") plt.show() randomized_logistic = sklearn.linear_model.RandomizedLogisticRegression() randomized_logistic.fit(X, y) ranking = 1.0 - randomized_logistic.scores_.reshape(digits.images[0].shape) # Plot pixel ranking plt.matshow(ranking) plt.colorbar() plt.title("Ranking of pixels\n") plt.show() clf = sklearn.ensemble.RandomForestClassifier(n_estimators=100) clf.fit(X, y) ranking = clf.feature_importances_.reshape(digits.images[0].shape) # Plot pixel ranking plt.matshow(ranking) plt.colorbar() plt.title("Random Forest ranking\n") plt.show() # Build a classification task using 3 informative features X, y = sklearn.datasets.make_classification(n_samples=1000, n_features=30, n_informative=5, n_redundant=4, n_repeated=0, n_classes=4, n_clusters_per_class=1, random_state=0) # Create the RFE object and compute a cross-validated score. svc = sklearn.svm.SVC(kernel="linear", class_weight="balanced") rfecv = sklearn.feature_selection.RFECV(estimator=svc, step=1, cv=sklearn.model_selection.StratifiedKFold(2), scoring='accuracy') rfecv.fit(X, y) print("Number of features corresponding to max CV score : %d" % rfecv.n_features_) # Plot number of features VS. cross-validation scores plt.figure() plt.xlabel("Number of features selected") plt.ylabel("Cross validation score (# of correct classifications)") plt.plot(range(1, len(rfecv.grid_scores_) + 1), rfecv.grid_scores_) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Features and high-dimensional spaces Step3: 1.2 Non-linear transformations Step4: 1.3 Projection to 2D via decomposition Step5: 1.4 Clustering in transformed feature space Step6: 1.5 Transforming pairwise dissimilarities between objects into feature space Step7: 1.6. Example Step8: Features in the transformed space -- latent variables -- represent groups of genes with similar protein expression patterns in Breast Cancer. These could be, for instance, genes involved in the same pathway. Step9: 2. Feature Selection Step10: 2.2 Feature selection and model selection Step11: The disadvantage with L1 regularization is that if multiple features are correlated only one of them will have a high coefficient. Step12: Also important is to normalize the means and variances of the features before comparing the coefficients. Step13: 2.3 Feature selection with cross-validation
9,576
<ASSISTANT_TASK:> Python Code: # import libraries import torch import numpy as np from torchvision import datasets import torchvision.transforms as transforms # number of subprocesses to use for data loading num_workers = 0 # how many samples per batch to load batch_size = 20 # convert data to torch.FloatTensor transform = transforms.ToTensor() # choose the training and test datasets train_data = datasets.MNIST(root='data', train=True, download=True, transform=transform) test_data = datasets.MNIST(root='data', train=False, download=True, transform=transform) # prepare data loaders train_loader = torch.utils.data.DataLoader(dataset=train_data, batch_size=batch_size, num_workers=num_workers) test_loader = torch.utils.data.DataLoader(dataset=test_data, batch_size=batch_size, num_workers=num_workers) import matplotlib.pyplot as plt %matplotlib inline # obtain one batch of training images dataiter = iter(train_loader) images, labels = dataiter.next() images = images.numpy() # plot the images in the batch, along with the corresponding labels fig = plt.figure(figsize=(25, 4)) for idx in np.arange(20): ax = fig.add_subplot(2, 20/2, idx+1, xticks=[], yticks=[]) ax.imshow(np.squeeze(images[idx]), cmap='gray') # print out the correct label for each image # .item() gets the value contained in a Tensor ax.set_title(str(labels[idx].item())) img = np.squeeze(images[1]) fig = plt.figure(figsize = (12,12)) ax = fig.add_subplot(111) ax.imshow(img, cmap='gray') width, height = img.shape thresh = img.max()/2.5 for x in range(width): for y in range(height): val = round(img[x][y],2) if img[x][y] !=0 else 0 ax.annotate(str(val), xy=(y,x), horizontalalignment='center', verticalalignment='center', color='white' if img[x][y]<thresh else 'black') import torch.nn as nn import torch.nn.functional as F ## TODO: Define the NN architecture class Net(nn.Module): def __init__(self): super(Net, self).__init__() # Linear layer (784 -> 128 hidden nodes) self.fc1 = nn.Linear(in_features=(28 * 28), out_features=128) self.fc2 = nn.Linear(in_features=128, out_features=10) def forward(self, x): # flatten image input x = x.view(-1, 28 * 28) # add hidden layer, with relu activation function x = F.relu(self.fc1(x)) x = F.softmax(self.fc2(x), dim=1) return x # initialize the NN model = Net() print(model) ## TODO: Specify loss and optimization functions # specify loss function criterion = nn.CrossEntropyLoss() # specify optimizer optimizer = torch.optim.Adam(params=model.parameters(), lr=0.001) optimizer # Number of epochs to train the model n_epochs = 50 # suggest training between 20-50 epochs # Prep model for training model.train() for epoch in range(n_epochs): # Monitor training loss train_loss = 0.0 ################### # train the model # ################### for data, target in train_loader: # Clear the gradients of all optimized variables optimizer.zero_grad() # Forward pass: compute predicted outputs by passing inputs to the model output = model(data) # Calculate the loss loss = criterion(output, target) # Backward pass: compute gradient of the loss with respect to model parameters loss.backward() # Perform a single optimization step (parameter update) optimizer.step() # Update running training loss train_loss += loss.item() * data.size(0) # Print training statistics # Calculate average loss over an epoch train_loss = train_loss/len(train_loader.dataset) print('Epoch: {} \tTraining Loss: {:.6f}'.format(epoch+1, train_loss)) # initialize lists to monitor test loss and accuracy test_loss = 0.0 class_correct = list(0. for i in range(10)) class_total = list(0. for i in range(10)) # Prep model for *evaluation* model.eval() for data, target in test_loader: # forward pass: compute predicted outputs by passing inputs to the model output = model(data) # calculate the loss loss = criterion(output, target) # update test loss test_loss += loss.item()*data.size(0) # convert output probabilities to predicted class _, pred = torch.max(output, 1) # compare predictions to true label correct = np.squeeze(pred.eq(target.data.view_as(pred))) # calculate test accuracy for each object class for i in range(batch_size): label = target.data[i] class_correct[label] += correct[i].item() class_total[label] += 1 # calculate and print avg test loss test_loss = test_loss/len(test_loader.dataset) print('Test Loss: {:.6f}\n'.format(test_loss)) for i in range(10): if class_total[i] > 0: print('Test Accuracy of %5s: %2d%% (%2d/%2d)' % ( str(i), 100 * class_correct[i] / class_total[i], np.sum(class_correct[i]), np.sum(class_total[i]))) else: print('Test Accuracy of %5s: N/A (no training examples)' % (classes[i])) print('\nTest Accuracy (Overall): %2d%% (%2d/%2d)' % ( 100. * np.sum(class_correct) / np.sum(class_total), np.sum(class_correct), np.sum(class_total))) # obtain one batch of test images dataiter = iter(test_loader) images, labels = dataiter.next() # get sample outputs output = model(images) # convert output probabilities to predicted class _, preds = torch.max(output, 1) # prep images for display images = images.numpy() # plot the images in the batch, along with predicted and true labels fig = plt.figure(figsize=(25, 4)) for idx in np.arange(20): ax = fig.add_subplot(2, 20/2, idx+1, xticks=[], yticks=[]) ax.imshow(np.squeeze(images[idx]), cmap='gray') ax.set_title("{} ({})".format(str(preds[idx].item()), str(labels[idx].item())), color=("green" if preds[idx]==labels[idx] else "red")) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load and Visualize the Data Step2: Visualize a Batch of Training Data Step3: View an Image in More Detail Step4: Define the Network Architecture Step5: Specify Loss Function and Optimizer Step6: Train the Network Step7: Test the Trained Network Step8: Visualize Sample Test Results
9,577
<ASSISTANT_TASK:> Python Code: %load_ext sql %sql mysql://steinam:steinam@localhost/personal %%sql select MNr, MName, MVorname from Mitarbeiter order by MName desc limit 1; %%sql select Mitarbeiter.MNr, MName, Stunden, Projektname, Firma from Mitarbeiter inner join Projektbearbeitung on MItarbeiter.MNr = Projektbearbeitung.MNr inner join Projekte on Projektbearbeitung.ProjNr = Projekte.ProjektNr inner join Kunden on Kunden.KundenNr = Projekte.KundenCode %%sql select Abteilung.AbtName, sum(Monatsgehalt) from Abteilung inner join Mitarbeiter on Mitarbeiter.AbtNr = Abteilung.AbtNr inner join Gehalt on Mitarbeiter.MNr = Gehalt.MNr group by Abteilung.Abtname %%sql select avg((year(now()) - year(MGeburtsdatum))) from Mitarbeiter %%sql /* geht select count(MNr) from Mitarbeiter where Mitarbeiter.AbtNr = 3 */ /* gehjt auch, weil wir wegen dem where vor dem Groupen nur noch Datensätze haben, die die AbtNr 3 haben; dann kann das group by auch wegbleiben select Abteilung.AbtNr, Abteilung.AbtName, count(Mitarbeiter.MNr) from Abteilung inner join Mitarbeiter on Abteilung.AbtNr = Mitarbeiter.AbtNr where Abteilung.AbtNr = 3 */ %%sql select Mitarbeiter.MName, Monatsgehalt from Mitarbeiter inner join Gehalt on Mitarbeiter.MNr = Gehalt.MNr where Mitarbeiter.AbtNr = 4 and MOnatsgehalt > ( select max(Monatsgehalt) from Gehalt inner join Mitarbeiter on Mitarbeiter.MNr = Gehalt.MNr where Mitarbeiter.AbtNr = 5 ) %%sql select Mitarbeiter.MName, Monatsgehalt from Mitarbeiter inner join Gehalt on Mitarbeiter.MNr = Gehalt.MNr where Monatsgehalt < ( select avg(Monatsgehalt) from Gehalt ) %%sql select AbtNr, count(*) as Anzahl from Mitarbeiter M group by AbtNr having Anzahl > 4 %%sql select sum(Stundensatz * Stunden), ProjNr from Projektbearbeitung inner join Mitarbeiter on Projektbearbeitung.MNr = Mitarbeiter.MNr inner join Stundensatz on Mitarbeiter.StundensatzNr = Stundensatz.StundensatzNr where ProjNr = 'A1' <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Welcher Mitarbeiter steht in einer alphabetisch sortierten Liste an letzter Stelle? Es sollen die Mitarbeiternummer, der Nachname und der Vorname angezeigt werden. Step2: Welche Mitarbeiter haben an Step3: Die Unternehmensleitung möchte die Summe der Monatsgehälter für jede Abteilung wissen. Die Spalten Abteilungsnummer, Abteilungsname und Summe der Monatsgehälter sollen angezeigt werden. Step4: Es soll das durchschnittliche Alter aller Mitarbeiter, das Alter des ältesten Mitarbeiters und Alter des jüngsten Mitarbeiters ermittelt werden. Es genügt ein Näherungswert in Jahren Step5: Wie viele Mitarbeiter arbeiten in der Abteilung 3? Step6: Alle Mitarbeiter in der Abteilung 4, die mehr verdienen als der Mitarbeiter der Abteilung 5 mit dem Step7: Welche Mitarbeiter haben ein kleineres Monatsgehalt als das durchschnittliche Monatsgehalt aller Mitarbeiter? Nachname, Vorname und Monatsgehalt dieser Mitarbeiter sollen angezeigt werden. Step8: In welchen Abteilungen arbeiten mehr als vier Mitarbeiter? Step9: Sie wollen wissen, wieviel Kosten (Stunden * Stundensatz) bisher für das Projekt PKR aufgelaufen sind.
9,578
<ASSISTANT_TASK:> Python Code: import requests from bs4 import BeautifulSoup headers = { 'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,*/*;q=0.8', 'Accept-Encoding': 'gzip, deflate, sdch', 'Accept-Language': 'zh-CN,zh;q=0.8,en;q=0.6', 'Cache-Control': 'no-cache', 'Connection': 'keep-alive', 'Cookie': '_ntes_nnid=7eced19b27ffae35dad3f8f2bf5885cd,1476521011210; _ntes_nuid=7eced19b27ffae35dad3f8f2bf5885cd; usertrack=c+5+hlgB7TgnsAmACnXtAg==; Province=025; City=025; NTES_PASSPORT=6n9ihXhbWKPi8yAqG.i2kETSCRa.ug06Txh8EMrrRsliVQXFV_orx5HffqhQjuGHkNQrLOIRLLotGohL9s10wcYSPiQfI2wiPacKlJ3nYAXgM; P_INFO=hourui93@163.com|1476523293|1|study|11&12|jis&1476511733&mail163#jis&320100#10#0#0|151889&0|g37_client_check&mailsettings&mail163&study&blog|hourui93@163.com; NTES_SESS=Fa2uk.YZsGoj59AgD6tRjTXGaJ8_1_4YvGfXUkS7C1NwtMe.tG1Vzr255TXM6yj2mKqTZzqFtoEKQrgewi9ZK60ylIqq5puaG6QIaNQ7EK5MTcRgHLOhqttDHfaI_vsBzB4bibfamzx1.fhlpqZh_FcnXUYQFw5F5KIBUmGJg7xdasvGf_EgfICWV; S_INFO=1476597594|1|0&80##|hourui93; NETEASE_AUTH_SOURCE=space; NETEASE_AUTH_USERNAME=hourui93; _ga=GA1.2.1405085820.1476521280; JSESSIONID-WYYY=cbd082d2ce2cffbcd5c085d8bf565a95aee3173ddbbb00bfa270950f93f1d8bb4cb55a56a4049fa8c828373f630c78f4a43d6c3d252c4c44f44b098a9434a7d8fc110670a6e1e9af992c78092936b1e19351435ecff76a181993780035547fa5241a5afb96e8c665182d0d5b911663281967d675ff2658015887a94b3ee1575fa1956a5a%3A1476607977016; _iuqxldmzr_=25; __utma=94650624.1038096298.1476521011.1476595468.1476606177.8; __utmb=94650624.20.10.1476606177; __utmc=94650624; __utmz=94650624.1476521011.1.1.utmcsr=(direct)|utmccn=(direct)|utmcmd=(none)', 'DNT': '1', 'Host': 'music.163.com', 'Pragma': 'no-cache', 'Referer': 'http://music.163.com/', 'Upgrade-Insecure-Requests': '1', 'User-Agent': 'Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/53.0.2785.143 Safari/537.36' } group_id = 1001 initial = 67 params = {'id': group_id, 'initial': initial} r = requests.get('http://music.163.com/discover/artist/cat', params=params, headers=headers) # 网页解析 soup = BeautifulSoup(r.content.decode(), 'html.parser') body = soup.body hotartist_dic = {} hot_artists = body.find_all('a', attrs={'class': 'msk'}) for artist in hot_artists: artist_id = artist['href'].replace('/artist?id=', '').strip() artist_name = artist['title'].replace('的音乐', '') try: hotartist_dic[artist_id] = artist_name except Exception as e: # 打印错误日志 print(e) artist_dic = {} artists = body.find_all('a', attrs={'class': 'nm nm-icn f-thide s-fc0'}) for artist in artists: artist_id = artist['href'].replace('/artist?id=', '').strip() artist_name = artist['title'].replace('的音乐', '') try: artist_dic[artist_id] = artist_name except Exception as e: # 打印错误日志 print(e) artist_dic def save_artist(group_id, initial, hot_artist_dic, artisti_dic): params = {'id': group_id, 'initial': initial} r = requests.get('http://music.163.com/discover/artist/cat', params=params) # 网页解析 soup = BeautifulSoup(r.content.decode(), 'html.parser') body = soup.body hot_artists = body.find_all('a', attrs={'class': 'msk'}) artists = body.find_all('a', attrs={'class': 'nm nm-icn f-thide s-fc0'}) for artist in hot_artists: artist_id = artist['href'].replace('/artist?id=', '').strip() artist_name = artist['title'].replace('的音乐', '') try: hot_artist_dic[artist_id] = artist_name except Exception as e: # 打印错误日志 print(e) for artist in artists: artist_id = artist['href'].replace('/artist?id=', '').strip() artist_name = artist['title'].replace('的音乐', '') try: artist_dic[artist_id] = artist_name except Exception as e: # 打印错误日志 print(e) #return artist_dic, hot_artist_dic gg = 1001 initial = 67 artist_dic = {} hot_artist_dic = {} save_artist(gg, initial, hot_artist_dic, artist_dic ) artist_dic artist_dic = {} hot_artist_dic = {} for i in range(65, 91): print(i) save_artist(gg, i, hot_artist_dic, artist_dic ) len(hot_artist_dic) len(artist_dic) list(hot_artist_dic.keys())[0] headers = { 'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,*/*;q=0.8', 'Accept-Encoding': 'gzip, deflate, sdch', 'Accept-Language': 'zh-CN,zh;q=0.8,en;q=0.6', 'Cache-Control': 'no-cache', 'Connection': 'keep-alive', 'Cookie': '_ntes_nnid=7eced19b27ffae35dad3f8f2bf5885cd,1476521011210; _ntes_nuid=7eced19b27ffae35dad3f8f2bf5885cd; usertrack=c+5+hlgB7TgnsAmACnXtAg==; Province=025; City=025; _ga=GA1.2.1405085820.1476521280; NTES_PASSPORT=6n9ihXhbWKPi8yAqG.i2kETSCRa.ug06Txh8EMrrRsliVQXFV_orx5HffqhQjuGHkNQrLOIRLLotGohL9s10wcYSPiQfI2wiPacKlJ3nYAXgM; P_INFO=hourui93@163.com|1476523293|1|study|11&12|jis&1476511733&mail163#jis&320100#10#0#0|151889&0|g37_client_check&mailsettings&mail163&study&blog|hourui93@163.com; JSESSIONID-WYYY=189f31767098c3bd9d03d9b968c065daf43cbd4c1596732e4dcb471beafe2bf0605b85e969f92600064a977e0b64a24f0af7894ca898b696bd58ad5f39c8fce821ec2f81f826ea967215de4d10469e9bd672e75d25f116a9d309d360582a79620b250625859bc039161c78ab125a1e9bf5d291f6d4e4da30574ccd6bbab70b710e3f358f%3A1476594130342; _iuqxldmzr_=25; __utma=94650624.1038096298.1476521011.1476588849.1476592408.6; __utmb=94650624.11.10.1476592408; __utmc=94650624; __utmz=94650624.1476521011.1.1.utmcsr=(direct)|utmccn=(direct)|utmcmd=(none)', 'DNT': '1', 'Host': 'music.163.com', 'Pragma': 'no-cache', 'Referer': 'http://music.163.com/', 'Upgrade-Insecure-Requests': '1', 'User-Agent': 'Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/53.0.2785.143 Safari/537.36' } def save_albums(artist_id, albume_dic): params = {'id': artist_id, 'limit': '200'} # 获取歌手个人主页 r = requests.get('http://music.163.com/artist/album', headers=headers, params=params) # 网页解析 soup = BeautifulSoup(r.content.decode(), 'html.parser') body = soup.body albums = body.find_all('a', attrs={'class': 'tit s-fc0'}) # 获取所有专辑 for album in albums: albume_id = album['href'].replace('/album?id=', '') albume_dic[albume_id] = artist_id albume_dic = {} save_albums('2116', albume_dic) albume_dic def save_music(album_id, music_dic): params = {'id': album_id} # 获取专辑对应的页面 r = requests.get('http://music.163.com/album', headers=headers, params=params) # 网页解析 soup = BeautifulSoup(r.content.decode(), 'html.parser') body = soup.body musics = body.find('ul', attrs={'class': 'f-hide'}).find_all('li') # 获取专辑的所有音乐 for music in musics: music = music.find('a') music_id = music['href'].replace('/song?id=', '') music_name = music.getText() music_dic[music_id] = [music_name, album_id] list(albume_dic.keys())[0] music_dic = {} save_music('6423', music_dic) music_dic params = { 'csrf_token': '' } data = { 'params': '5L+s/X1qDy33tb2sjT6to2T4oxv89Fjg1aYRkjgzpNPR6hgCpp0YVjNoTLQAwWu9VYvKROPZQj6qTpBK+sUeJovyNHsnU9/StEfZwCOcKfECFFtAvoNIpulj1TDOtBir', 'encSecKey': '59079f3e07d6e240410018dc871bf9364f122b720c0735837d7916ac78d48a79ec06c6307e6a0e576605d6228bd0b377a96e1a7fc7c7ddc8f6a3dc6cc50746933352d4ec5cbe7bddd6dcb94de085a3b408d895ebfdf2f43a7c72fc783512b3c9efb860679a88ef21ccec5ff13592be450a1edebf981c0bf779b122ddbd825492' } print(url) offset = 0 music_id = '65337' url = 'http://music.163.com/api/v1/resource/comments/R_SO_4_'+ music_id + '?limit=20&offset=' + str(offset) response = requests.post(url, headers=headers, data=data) cj = response.json() cj.keys() cj['total'],len(cj['comments']), len(cj['hotComments']), len(cj['topComments']) cj['comments'][0] from Crypto.Cipher import AES import base64 import requests import json import time # headers headers = { 'Host': 'music.163.com', 'Connection': 'keep-alive', 'Content-Length': '484', 'Cache-Control': 'max-age=0', 'Origin': 'http://music.163.com', 'User-Agent': 'Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.84 Safari/537.36', 'Content-Type': 'application/x-www-form-urlencoded', 'Accept': '*/*', 'DNT': '1', 'Accept-Encoding': 'gzip, deflate', 'Accept-Language': 'zh-CN,zh;q=0.8,en;q=0.6,zh-TW;q=0.4', 'Cookie': 'JSESSIONID-WYYY=b66d89ed74ae9e94ead89b16e475556e763dd34f95e6ca357d06830a210abc7b685e82318b9d1d5b52ac4f4b9a55024c7a34024fddaee852404ed410933db994dcc0e398f61e670bfeea81105cbe098294e39ac566e1d5aa7232df741870ba1fe96e5cede8372ca587275d35c1a5d1b23a11e274a4c249afba03e20fa2dafb7a16eebdf6%3A1476373826753; _iuqxldmzr_=25; _ntes_nnid=7fa73e96706f26f3ada99abba6c4a6b2,1476372027128; _ntes_nuid=7fa73e96706f26f3ada99abba6c4a6b2; __utma=94650624.748605760.1476372027.1476372027.1476372027.1; __utmb=94650624.4.10.1476372027; __utmc=94650624; __utmz=94650624.1476372027.1.1.utmcsr=(direct)|utmccn=(direct)|utmcmd=(none)', } #获取params def get_params(first_param, forth_param): iv = "0102030405060708" first_key = forth_param second_key = 16 * 'F' h_encText = AES_encrypt(first_param, first_key.encode(), iv.encode()) h_encText = AES_encrypt(h_encText.decode(), second_key.encode(), iv.encode()) return h_encText.decode() # 获取encSecKey def get_encSecKey(): encSecKey = "257348aecb5e556c066de214e531faadd1c55d814f9be95fd06d6bff9f4c7a41f831f6394d5a3fd2e3881736d94a02ca919d952872e7d0a50ebfa1769a7a62d512f5f1ca21aec60bc3819a9c3ffca5eca9a0dba6d6f7249b06f5965ecfff3695b54e1c28f3f624750ed39e7de08fc8493242e26dbc4484a01c76f739e135637c" return encSecKey # 解AES秘 def AES_encrypt(text, key, iv): pad = 16 - len(text) % 16 text = text + pad * chr(pad) encryptor = AES.new(key, AES.MODE_CBC, iv) encrypt_text = encryptor.encrypt(text.encode()) encrypt_text = base64.b64encode(encrypt_text) return encrypt_text # 获取json数据 def get_json(url, data): response = requests.post(url, headers=headers, data=data) return response.content # 传入post数据 def crypt_api(id, offset): url = "http://music.163.com/weapi/v1/resource/comments/R_SO_4_%s/?csrf_token=" % id first_param = "{rid:\"\", offset:\"%s\", total:\"true\", limit:\"20\", csrf_token:\"\"}" % offset forth_param = "0CoJUm6Qyw8W8jud" params = get_params(first_param, forth_param) encSecKey = get_encSecKey() data = { "params": params, "encSecKey": encSecKey } return url, data offset = 0 id = '516997458' url, data = crypt_api(id, offset) json_text = get_json(url, data) json_dict = json.loads(json_text.decode("utf-8")) comments_sum = json_dict['total'] comments_sum len(json_dict['comments']) json_dict['comments'][0] json_dict['comments'][4] offset = 20 id = '516997458' url, data = crypt_api(id, offset) json_text = get_json(url, data) json_dict = json.loads(json_text.decode("utf-8")) comments_sum = json_dict['total'] json_dict['comments'][0] offset = 40 id = '516997458' url, data = crypt_api(id, offset) json_text = get_json(url, data) json_dict = json.loads(json_text.decode("utf-8")) comments_sum = json_dict['total'] json_dict['comments'][0] 800/1018*460 <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 爬取所有的专辑信息(album_by _artist.py) Step2: http Step3: 根据专辑信息爬取所有的歌曲信息(music_by _album.py) Step4: 根据歌曲信息爬取其评论条数(comments_by _music.py Step5: 翻页的实现
9,579
<ASSISTANT_TASK:> Python Code: %reload_ext autoreload %autoreload 2 %matplotlib inline from fastai.transforms import * from fastai.conv_learner import * from fastai.model import * from fastai.dataset import * from fastai.sgdr import * from fastai.plots import * import pandas as pd import numpy as np path = 'data/gloc/' model_path = path + 'results/' # to override the fastai vgg16 function from torchvision.models import vgg16 # Creates a ConvnetBuilder with all pretrained layers from vgg16 but the last fully connected layer class ConvnetBuilderVGG(): Class representing a convolutional network. Arguments: c (int): size of the last layer is_multi (bool): is multilabel classification is_reg (bool): is a regression ps (float): dropout parameter for last layer def __init__(self, c, is_multi, is_reg, ps=None): self.c, self.is_multi, self.is_reg = c, is_multi, is_reg self.ps = ps or 0.5 vgg = vgg16(True) # NOTE: okay so I need to study how PyTorch does this self.lr_cut = 30 layers = children(vgg.features) layers += [Flatten()] + children(vgg.classifier)[:5] #self.nf = 4096 # here top model is everything but the last layer self.top_model = nn.Sequential(*layers) # NOTE: I need to find out what the fn(*arg) syntax is fc_layers = self.create_fc_layer(4096, c, p=None) self.n_fc = len(fc_layers) self.fc_model = to_gpu(nn.Sequential(*fc_layers)) apply_init(self.fc_model, kaiming_normal) self.model = to_gpu(nn.Sequential(*(layers+fc_layers))) def create_fc_layer(self, ni, nf, p, actn=None): res=[] if p: res.append(nn.Dropout(p=p)) res.append(nn.Linear(in_features=ni, out_features=nf)) if actn: res.append(actn()) return res @property # NOTE: I also need to learn Python Static Method syntax --> https://stackoverflow.com/questions/400739/what-does-asterisk-mean-in-python def name(self): return "vgg16" def get_layer_groups(self, do_fc=False): if do_fc: m, idxs = self.fc_model, [] else: m, idxs = self.model, [self.lr_cut, -self.n_fc] lgs = list(split_by_idxs(children(m), idxs)) return lgs bs=32; sz=224 f_model = vgg16 n = 7637 val_idxs = get_cv_idxs(n, 0, val_pct=0.2) tfms = tfms_from_model(f_model, sz) # NOTE: how would it know, if this is a custom/PyTorch model? data = ImageClassifierData.from_csv(path, 'train', f'{path}train.csv', bs, tfms, val_idxs=val_idxs, continuous=True) # note precompute=False models = ConvnetBuilderVGG(data.c, data.is_multi, data.is_reg) models.model class ConvLearnerVGG(ConvLearner): # rewriting pretrained @classmethod def pretrained(cls, data, ps=None, **kwargs): models = ConvnetBuilderVGG(data.c, data.is_multi, data.is_reg, ps=ps) return cls(data, models, **kwargs) # redefining freeze to freeze everything but last layer def freeze(self): layers = children(self.model) n = len(layers) for λ in layers: λ.trainable=False for p in λ.parameters(): p.requires_grad=False λ = layers[n-1] λ.trainable=True for p in λ.parameters(): p.requires_grad=True def unfreeze_prev_layer(self): layers = children(self.model) λ = layers[35] λ.trainable=True for p in λ.parameters(): p.requires_grad=True bs = 32; sz = 224 f_model = vgg16 n = 7637 val_idxs = get_cv_idxs(n, 0, val_pct=0.2) tfms = tfms_from_model(f_model, sz) data = ImageClassifierData.from_csv(path, 'train', f'{path}train.csv', bs, tfms, val_idxs=val_idxs, continuous=True) learn = ConvLearnerVGG.pretrained(data, ps=0.0, precompute=False) m = learn.models.model trainable_params_(m) learn.unfreeze_prev_layer() trainable_params_(m) bs=32; sz=224 n = 7637 transforms_basic = [RandomRotateXY(10), RandomDihedralXY()] transforms_basic = [RandomRotateXY(10)] def get_model_i(i=0): val_idxs = get_cv_idxs(n, i, val_pct=0.1) tfms = tfms_from_model(f_model, sz, aug_tfms=transforms_basic, max_zoom=1.05) data = ImageClassifierData.from_csv(path, 'train', f'{path}train.csv', bs, tfms, val_idxs=val_idxs, suffix='.jpg', continuous=True) learn = ConvLearnerVGG.pretrained(data, ps=0.0, precompute=False) return learn def fit_and_predict(learn): learn.fit(1e-3, 3) learn.fit(1e-4, 4) print("unfreezing") learn.unfreeze_prev_layer() #learn.fit(1e-5, 3, cycle_len=1, cycle_mult=2) learn.fit(1e-5, 3) return learn.TTA() preds = [] for i in range(11): print("iteration ", i) learn = get_model_i(i) preds.append(fit_and_predict(learn)) def reshape_preds(preds): predictions = [preds[i][0] for i in range(11)] y = [preds[i][1] for i in range(11)] pp = np.vstack(predictions) yy = np.vstack(y) print(yy.shape) pp = np.maximum(pp, 0.0) err = np.abs(pp - yy).mean() print("err", err) reshape_preds(preds) df = pd.read_csv(path + 'train.csv') len(df['id']) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Custom ConvnetBuilder Step3: NOTE Step4: So, the numbers in the top layers are different from Yannet's, but the Conv layer pars are exactly the same. Pretty sure this is because when you finetune a model, the FC layer/s you stack ontop are randomly initialized, but the Conv layers coming from a pretrained network (PyTorch VGG 16), are necessarily exactly the same, given you got the same pretrained weights. Step5: Here's code to do cross-validation Step6: How to train is a W.I.P. --- great.. Step7: Predictions Step8: This'll actually take forever on an i5 CPU, but it does start training so, that's good. Step9: Alrighty, that gave me some idea of how a custom model is added to FastAI.
9,580
<ASSISTANT_TASK:> Python Code: star_wars = pd.read_csv('star_wars.csv', encoding="ISO-8859-1") star_wars.head() star_wars.columns star_wars = star_wars.dropna(subset=['RespondentID']) star_wars['Do you consider yourself to be a fan of the Star Wars film franchise?'].isnull().value_counts() star_wars['Have you seen any of the 6 films in the Star Wars franchise?'].value_counts() star_wars['Have you seen any of the 6 films in the Star Wars franchise?'] = star_wars['Have you seen any of the 6 films in the Star Wars franchise?'].map({'Yes': True, 'No': False}) star_wars['Do you consider yourself to be a fan of the Star Wars film franchise?'] = star_wars['Do you consider yourself to be a fan of the Star Wars film franchise?'].map({'Yes': True, 'No': False}) for col in star_wars.columns[3:9]: star_wars[col] = star_wars[col].apply(lambda x: False if pd.isnull(x) else True) star_wars.rename(columns={'Which of the following Star Wars films have you seen? Please select all that apply.': 'seen_1', \ 'Unnamed: 4': 'seen_2', \ 'Unnamed: 5': 'seen_3', \ 'Unnamed: 6': 'seen_4', \ 'Unnamed: 7': 'seen_5', \ 'Unnamed: 8': 'seen_6'}, inplace=True) star_wars[star_wars.columns[9:15]] = star_wars[star_wars.columns[9:15]].astype(float) star_wars.rename(columns={'Please rank the Star Wars films in order of preference with 1 being your favorite film in the franchise and 6 being your least favorite film.': 'ranking_1', \ 'Unnamed: 10': 'ranking_2', \ 'Unnamed: 11': 'ranking_3', \ 'Unnamed: 12': 'ranking_4', \ 'Unnamed: 13': 'ranking_5', \ 'Unnamed: 14': 'ranking_6'}, inplace=True) star_wars.rename(columns={'Please state whether you view the following characters favorably, unfavorably, or are unfamiliar with him/her.': 'Luck Skywalker', \ 'Unnamed: 16': 'Han Solo', \ 'Unnamed: 17': 'Princess Leia Oragana', \ 'Unnamed: 18': 'Obi Wan Kenobi', \ 'Unnamed: 19': 'Yoda', \ 'Unnamed: 20': 'R2-D2', \ 'Unnamed: 21': 'C-3P0', \ 'Unnamed: 22': 'Anakin Skywalker', \ 'Unnamed: 23': 'Darth Vader', \ 'Unnamed: 24': 'Lando Calrissian', \ 'Unnamed: 25': 'Padme Amidala', \ 'Unnamed: 26': 'Boba Fett', \ 'Unnamed: 27': 'Emperor Palpatine', \ 'Unnamed: 28': 'Jar Jar Binks'}, inplace=True) seen_sum = star_wars[['seen_1', 'seen_2', 'seen_3', 'seen_4', 'seen_5', 'seen_6']].sum() seen_sum seen_sum.idxmax() ax = seen_sum.plot(kind='bar') for p in ax.patches: ax.annotate(str(p.get_height()), (p.get_x() * 1.005, p.get_height() * 1.01)) plt.show() ranking_mean = star_wars[['ranking_1', 'ranking_2', 'ranking_3', 'ranking_4', 'ranking_5', 'ranking_6']].mean() ranking_mean ranking_mean.idxmin() ranking_mean.plot(kind='bar') plt.show() males = star_wars[star_wars['Gender'] == 'Male'] females = star_wars[star_wars['Gender'] == 'Female'] males[males.columns[3:9]].sum().plot(kind='bar', title='male seen') plt.show() males[females.columns[3:9]].sum().plot(kind='bar', title='female seen') plt.show() males[males.columns[9:15]].mean().plot(kind='bar', title='Male Ranking') plt.show() females[males.columns[9:15]].mean().plot(kind='bar', title='Female Ranking') plt.show() star_wars['Luck Skywalker'].value_counts() star_wars[star_wars.columns[15:29]].head() fav = star_wars[star_wars.columns[15:29]].dropna() fav.head() fav_df_list = [] for col in fav.columns.tolist(): row = fav[col].value_counts() d1 = pd.DataFrame(data={'favorably': row[0] + row[1], \ 'neutral': row[2], \ 'unfavorably': row[4] + row[5], \ 'Unfamiliar': row[3]}, \ index=[col], \ columns=['favorably', 'neutral', 'unfavorably', 'Unfamiliar']) fav_df_list.append(d1) fav_pivot = pd.concat(fav_df_list) fav_pivot fig = plt.figure() ax = plt.subplot(111) fav_pivot.plot(kind='barh', stacked=True, figsize=(10,10), ax=ax) # Shrink current axis's height by 10% on the bottom box = ax.get_position() ax.set_position([box.x0, box.y0 + box.height * 0.1, box.width, box.height * 0.9]) # Put a legend below current axis ax.legend(loc='upper center', bbox_to_anchor=(0.5, -0.05), fancybox=True, shadow=True, ncol=5) plt.show() shot_first = star_wars['Which character shot first?'].value_counts() shot_first shot_sum = shot_first.sum() shot_first = shot_first.apply(lambda x: x / shot_sum * 100) shot_first ax = shot_first.plot(kind='barh') for p in ax.patches: ax.annotate(str("{0:.2f}%".format(round(p.get_width(),2))), (p.get_width() * 1.005, p.get_y() + p.get_height() * 0.5)) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Data Cleaning Step2: Change the second and third columns. Step3: The values for the second and third columns which are Have you seen any of the 6 films in the Star Wars franchise? and Do you consider yourself to be a fan of the Star Wars film franchise? respectively are Yes, No, NaN. We want to change them to True or False. Step4: Cleaning the columns from index 3 to 9. Step5: Rename the columns from index 3 to 9 for better readibility. Step6: Cleaning the columns from index 9 to 15. Step7: Renaming columns names. Step8: Cleaning the cloumns from index 15 to 29. Step9: Data Analysis Step10: From the data above, we can find that the most seen movie is the episode V. Step11: Finding The Highest Ranked Movie. Step12: The highest ranked movie is ranking_5 which is the episode V. Step13: Let's break down data by Gender. Step14: The number of movies seen. Step15: The ranking of movies. Step16: From the charts above, we do not find significant difference among gender. Step17: Convert fav to pivot table. Step18: Who Shot First?
9,581
<ASSISTANT_TASK:> Python Code: !pip install -q flax from typing import Sequence import matplotlib.pyplot as plt import jax import jax.numpy as jnp import flax.linen as nn from flax.training import train_state import optax import functools import scipy as sp import math rng = jax.random.PRNGKey(0) @functools.partial(jax.jit, static_argnums=(1,)) def real_data(rng, batch_size): mog_mean = jnp.array( [ [1.50, 1.50], [1.50, 0.50], [1.50, -0.50], [1.50, -1.50], [0.50, 1.50], [0.50, 0.50], [0.50, -0.50], [0.50, -1.50], [-1.50, 1.50], [-1.50, 0.50], [-1.50, -0.50], [-1.50, -1.50], [-0.50, 1.50], [-0.50, 0.50], [-0.50, -0.50], [-0.50, -1.50], ] ) temp = jnp.tile(mog_mean, (batch_size // 16 + 1, 1)) mus = temp[0:batch_size, :] return mus + 0.02 * jax.random.normal(rng, shape=(batch_size, 2)) def plot_on_ax(ax, values, contours=None, bbox=None, xlabel="", ylabel="", title="", cmap="Blues"): kernel = sp.stats.gaussian_kde(values.T) ax.axis(bbox) ax.set_aspect(abs(bbox[1] - bbox[0]) / abs(bbox[3] - bbox[2])) ax.set_xlabel(xlabel) ax.set_ylabel(ylabel) ax.set_xticks([]) ax.set_yticks([]) xx, yy = jnp.mgrid[bbox[0] : bbox[1] : 300j, bbox[2] : bbox[3] : 300j] positions = jnp.vstack([xx.ravel(), yy.ravel()]) f = jnp.reshape(kernel(positions).T, xx.shape) cfset = ax.contourf(xx, yy, f, cmap=cmap) if contours is not None: x = jnp.arange(-2.0, 2.0, 0.1) y = jnp.arange(-2.0, 2.0, 0.1) cx, cy = jnp.meshgrid(x, y) new_set = ax.contour( cx, cy, contours.squeeze().reshape(cx.shape), levels=20, colors="k", linewidths=0.8, alpha=0.5 ) ax.set_title(title) class MLP(nn.Module): features: Sequence[int] @nn.compact def __call__(self, x): for feat in self.features[:-1]: x = jax.nn.relu(nn.Dense(features=feat)(x)) x = nn.Dense(features=self.features[-1])(x) return x @jax.jit def discriminator_step(disc_state, gen_state, latents, real_examples): def loss_fn(disc_params): fake_examples = gen_state.apply_fn(gen_state.params, latents) real_logits = disc_state.apply_fn(disc_params, real_examples) fake_logits = disc_state.apply_fn(disc_params, fake_examples) disc_real = -jax.nn.log_sigmoid(real_logits) # log(1 - sigmoid(x)) = log_sigmoid(-x) disc_fake = -jax.nn.log_sigmoid(-fake_logits) return jnp.mean(disc_real + disc_fake) disc_loss, disc_grad = jax.value_and_grad(loss_fn)(disc_state.params) disc_state = disc_state.apply_gradients(grads=disc_grad) return disc_state, disc_loss @jax.jit def generator_step(disc_state, gen_state, latents): def loss_fn(gen_params): fake_examples = gen_state.apply_fn(gen_params, latents) fake_logits = disc_state.apply_fn(disc_state.params, fake_examples) disc_fake = -jax.nn.log_sigmoid(fake_logits) return jnp.mean(disc_fake) gen_loss, gen_grad = jax.value_and_grad(loss_fn)(gen_state.params) gen_state = gen_state.apply_gradients(grads=gen_grad) return gen_state, gen_loss @jax.jit def train_step(disc_state, gen_state, latents, real_examples): disc_state, disc_loss = discriminator_step(disc_state, gen_state, latents, real_examples) gen_state, gen_loss = generator_step(disc_state, gen_state, latents) return disc_state, gen_state, disc_loss, gen_loss batch_size = 512 latent_size = 32 discriminator = MLP(features=[25, 25, 1]) generator = MLP(features=[25, 25, 2]) # Initialize parameters for the discriminator and the generator latents = jax.random.normal(rng, shape=(batch_size, latent_size)) real_examples = real_data(rng, batch_size) disc_params = discriminator.init(rng, real_examples) gen_params = generator.init(rng, latents) # Plot real examples bbox = [-2, 2, -2, 2] plot_on_ax(plt.gca(), real_examples, bbox=bbox, title="Data") plt.tight_layout() plt.savefig("gan_gmm_data.pdf") plt.show() # Create train states for the discriminator and the generator lr = 0.05 disc_state = train_state.TrainState.create( apply_fn=discriminator.apply, params=disc_params, tx=optax.sgd(learning_rate=lr) ) gen_state = train_state.TrainState.create(apply_fn=generator.apply, params=gen_params, tx=optax.sgd(learning_rate=lr)) # x and y grid for plotting discriminator contours x = jnp.arange(-2.0, 2.0, 0.1) y = jnp.arange(-2.0, 2.0, 0.1) X, Y = jnp.meshgrid(x, y) pairs = jnp.stack((X, Y), axis=-1) pairs = jnp.reshape(pairs, (-1, 2)) # Latents for testing generator test_latents = jax.random.normal(rng, shape=(batch_size * 10, latent_size)) num_iters = 20001 n_save = 2000 draw_contours = False history = [] for i in range(num_iters): rng_iter = jax.random.fold_in(rng, i) data_rng, latent_rng = jax.random.split(rng_iter) # Sample minibatch of examples real_examples = real_data(data_rng, batch_size) # Sample minibatch of latents latents = jax.random.normal(latent_rng, shape=(batch_size, latent_size)) # Update both the generator disc_state, gen_state, disc_loss, gen_loss = train_step(disc_state, gen_state, latents, real_examples) if i % n_save == 0: print(f"i = {i}, Discriminator Loss = {disc_loss}, " + f"Generator Loss = {gen_loss}") # Generate examples using the test latents fake_examples = gen_state.apply_fn(gen_state.params, test_latents) if draw_contours: real_logits = disc_state.apply_fn(disc_state.params, pairs) disc_contour = -real_logits + jax.nn.log_sigmoid(real_logits) else: disc_contour = None history.append((i, fake_examples, disc_contour, disc_loss, gen_loss)) # Plot generated examples from history for i, hist in enumerate(history): iter, fake_examples, contours, disc_loss, gen_loss = hist plot_on_ax( plt.gca(), fake_examples, contours=contours, bbox=bbox, xlabel=f"Disc Loss: {disc_loss:.3f} | Gen Loss: {gen_loss:.3f}", title=f"Samples at Iteration {iter}", ) plt.tight_layout() plt.savefig(f"gan_gmm_iter_{iter}.pdf") plt.show() cols = 3 rows = math.ceil((len(history) + 1) / cols) bbox = [-2, 2, -2, 2] fig, axs = plt.subplots(rows, cols, figsize=(cols * 3, rows * 3), dpi=200) axs = axs.flatten() # Plot real examples plot_on_ax(axs[0], real_examples, bbox=bbox, title="Data") # Plot generated examples from history for i, hist in enumerate(history): iter, fake_examples, contours, disc_loss, gen_loss = hist plot_on_ax( axs[i + 1], fake_examples, contours=contours, bbox=bbox, xlabel=f"Disc Loss: {disc_loss:.3f} | Gen Loss: {gen_loss:.3f}", title=f"Samples at Iteration {iter}", ) # Remove extra plots from the figure for i in range(len(history) + 1, len(axs)): axs[i].remove() plt.tight_layout() plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Data Generation Step2: Plotting Step3: Models and Training Step4: The loss function for the discriminator is Step5: The loss function for the generator is Step6: Perform a training step by first updating the discriminator parameters $\phi$ using the gradient $\nabla_\phi L_D (\phi, \theta)$ and then updating the generator parameters $\theta$ using the gradient $\nabla_\theta L_G (\phi, \theta)$. Step7: Plot Results
9,582
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd import matplotlib.pyplot as plt k = 30 start = '2014-01-01' end = '2015-01-01' pricing = get_pricing('PEP', fields='price', start_date=start, end_date=end) fundamentals = init_fundamentals() num_shares = get_fundamentals(query(fundamentals.earnings_report.basic_average_shares,) .filter(fundamentals.company_reference.primary_symbol == 'PEP',), end) x = np.log(pricing) v = x.diff() m = get_pricing('PEP', fields='volume', start_date=start, end_date=end)/num_shares.values[0,0] p0 = pd.rolling_sum(v, k) p1 = pd.rolling_sum(m*v, k) p2 = p1/pd.rolling_sum(m, k) p3 = pd.rolling_mean(v, k)/pd.rolling_std(v, k) f, (ax1, ax2) = plt.subplots(2,1) ax1.plot(p0) ax1.plot(p1) ax1.plot(p2) ax1.plot(p3) ax1.set_title('Momentum of PEP') ax1.legend(['p(0)', 'p(1)', 'p(2)', 'p(3)'], bbox_to_anchor=(1.1, 1)) ax2.plot(p0) ax2.plot(p1) ax2.plot(p2) ax2.plot(p3) ax2.axis([0, 300, -0.005, 0.005]) ax2.set_xlabel('Time'); def get_p(prices, m, d, k): Returns the dth-degree rolling momentum of data using lookback window length k x = np.log(prices) v = x.diff() m = np.array(m) if d == 0: return pd.rolling_sum(v, k) elif d == 1: return pd.rolling_sum(m*v, k) elif d == 2: return pd.rolling_sum(m*v, k)/pd.rolling_sum(m, k) elif d == 3: return pd.rolling_mean(v, k)/pd.rolling_std(v, k) # Load the assets we want to trade start = '2010-01-01' end = '2015-01-01' assets = sorted(['STX', 'WDC', 'CBI', 'JEC', 'VMC', 'PG', 'AAPL', 'PEP', 'AON', 'DAL']) data = get_pricing(assets, start_date='2010-01-01', end_date='2015-01-01').loc['price', :, :] # Get turnover rate for the assets fundamentals = init_fundamentals() num_shares = get_fundamentals(query(fundamentals.earnings_report.basic_average_shares,) .filter(fundamentals.company_reference.primary_symbol.in_(assets),), end) turnover = get_pricing(assets, fields='volume', start_date=start, end_date=end)/num_shares.values[0] # Plot the prices just for fun data.plot(figsize=(10,7), colors=['r', 'g', 'b', 'k', 'c', 'm', 'orange', 'chartreuse', 'slateblue', 'silver']) plt.legend(bbox_to_anchor=(1.05, 1), loc=2, borderaxespad=0.) plt.ylabel('Price') plt.xlabel('Time'); # Calculate all the rolling momenta for the data and compute daily ranking of assets by momentum lookback = 30 ps = np.array([np.array(get_p(data, turnover, j, lookback).T) for j in range(4)]) orders = [[ps[j].T[i].argsort() for i in range(len(ps[0,0]))] for j in range(4)] ranks = [[orders[j][i].argsort() for i in range(len(orders[1]))] for j in range(4)] # Cast data to numpy array for easier manipulation data_array = np.array(data) # Simulate going long on high-momentum stocks and short low-momentum stocks # Our first 2*lookback - 2 values will be NaN since we used 2 lookback windows, so start on day 2*lookback tots = [[0]*4 for j in range(len(data) - 2*lookback)] for t in range(2*lookback, len(ranks[0]) - 2*lookback): tots[t] = list(tots[t-1]) # Only update portfolio every 2*lookback days if t%(2*lookback): continue # Go long top quintile of stocks and short bottom quintile shorts = np.array([[int(x < 2)for x in ranks[j][t]] for j in range(4)]) longs = np.array([[int(x > 7) for x in ranks[j][t]] for j in range(4)]) # How many shares of each stock are in $1000 shares_in_1k = 1000/data_array[t] # Go long and short $1000 each in the specified stocks, then clear holdings in 2*lookback days returns = (data_array[t+2*lookback]*shares_in_1k - [1000]*len(assets))*(longs - shorts) tots[t] += np.sum(returns, 1) # Adjust so that tots[t] is actually money on day t tots = [[0,0,0,0]]*2*lookback + tots # Plot total money earned using the 3 different momentum definitions plt.plot(tots) plt.title('Cash in portfolio') plt.legend(['p(0)', 'p(1)', 'p(2)', 'p(3)'], loc=4) plt.xlabel('Time') plt.ylabel('$'); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: In order to use this in a strategy, we should wrap our momentum calculator in a function Step3: Now we implement the strategy described in the paper
9,583
<ASSISTANT_TASK:> Python Code: # Import packages here: import math as m import numpy as np from IPython.display import Image import matplotlib.pyplot as plt # Properties of Materials (engineeringtoolbox.com, Cengel, Tian) # Conductivity Kair = 0.026 # w/mk Kptfe = 0.25 # w/mk Kcf = 0.8 # transverse conductivity 0.5 -0.8 w/mk # Fluid Properties rhoLox = 1141 # kg/m^3 TLox = -183 # *C # Latent Heat of Evaporation heOxy = 214000 # j/kg # Layer Dimensions: r1 = 0.0381 # meters (1.5") r2 = 0.0396 # m r3 = 0.0399 # m r4 = 0.0446 # m r5 = 0.0449 # m L = 0.13081 # meters (5.15") # Environmental Properties: Ts = 38 # *C T1 = -183 #*C Rptfe = m.log(r2/r1)/(2*m.pi*L*Kptfe) Rcf1 = m.log(r3/r2)/(2*m.pi*L*Kcf) Rair = m.log(r4/r3)/(2*m.pi*L*Kair) Rcf2 = m.log(r5/r4)/(2*m.pi*L*Kcf) Rtot = Rptfe + Rcf1 + Rair + Rcf2 print('Total Thermal Resistance equals: ', "%.2f" % Rtot, 'K/W') #Heat transfer rate: Qrate = (Ts - T1)/Rtot print('Calculated Heat Transfer rate equals: ',"%.2f" % Qrate, 'W') EvapRate = Qrate/heOxy print ('The rate of evaporation is', "%.6f" % EvapRate, 'kg/s') VLox = m.pi*(r1)**2*L mLox = rhoLox*VLox print('The mass of the liquid oxygen in tank is: ', "%.2f" % mLox, 'kg') Tboiloff = mLox/EvapRate/60 print('%.2f' % Tboiloff, 'minutes' ) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Heat Transfer Rate Step2: Evaporation Rate Step3: Time for total Evaporation Step4: Finally, the amount of time that it takes for all 0.68kg of LOX to boil off is
9,584
<ASSISTANT_TASK:> Python Code: loc_data = pd.read_csv('location_data_hw9.csv') loc_data.head() fig, axes = plt.subplots(2,2, figsize=[6, 4]) ylabels = [['red_pos_X', 'red_pos_Y'], ['blue_pos_X', 'blue_pos_Y']] for i in range(2): for j in range(2): axes[i,j].plot(loc_data['t'], loc_data[ylabels[i][j]]) axes[i,j].set_xlabel('t') axes[i,j].set_ylabel(ylabels[i][j]) plt.tight_layout() from scipy import stats slopes, intercepts = {}, {} columns = ['red_pos_X', 'red_pos_Y', 'blue_pos_X', 'blue_pos_Y'] for var in columns: a, b, _, _, _ = stats.linregress(loc_data['t'], loc_data[var]) slopes[var] = a intercepts[var] = b print(slopes) print(intercepts) import pymc3 as pm import theano.tensor as tt with pm.Model() as model_red: t = loc_data['t'] xname, yname = 'red_pos_X', 'red_pos_Y' obs_x, obs_y = loc_data[xname], loc_data[yname] # vx --> a, x0 --> b # we choose the range of vx and x0 to be around the values obtained from linear regression vx = pm.Uniform('vx', slopes[xname]/5, slopes[xname]*5) x0 = pm.Uniform('x0', intercepts[xname]-1, intercepts[xname]+1) # vy --> a, y0 --> b # note that vy is negative vy = pm.Uniform('vy', slopes[yname]*5, slopes[yname]/5) y0 = pm.Uniform('y0', intercepts[yname]-1, intercepts[yname]+1) # speed v = pm.Deterministic('v', tt.sqrt(vx**2 + vy**2)) sigma_x = pm.Uniform('sigma_x', 0, 1) sigma_y = pm.Uniform('sigma_y', 0, 1) mu_x = pm.Deterministic('mu_x', vx*t+x0) mu_y = pm.Deterministic('mu_y', vy*t+y0) with model_red: mc_x = pm.Normal("mc_x", mu_x, sigma_x, observed=obs_x) mc_y = pm.Normal("mc_y", mu_y, sigma_y, observed=obs_y) start = pm.find_MAP() step = pm.Metropolis() trace = pm.sample(100000, step=step, start=start) red_burned_trace = trace[50000::5] pm.plots.plot_posterior(trace=red_burned_trace["v"], round_to=6, alpha_level=0.05) with pm.Model() as model_blue: t = loc_data['t'] xname, yname = 'blue_pos_X', 'blue_pos_Y' obs_x, obs_y = loc_data[xname], loc_data[yname] # vx --> a, x0 --> b vx = pm.Uniform('vx', slopes[xname]/5, slopes[xname]*5) x0 = pm.Uniform('x0', intercepts[xname]-1, intercepts[xname]+1) # vy --> a, y0 --> b # note that vy is negative # we choose the range of vx and x0 to be around the values obtained from linear regression vy = pm.Uniform('vy', slopes[yname]/5, slopes[yname]*5) y0 = pm.Uniform('y0', intercepts[yname]-1, intercepts[yname]+1) # speed v = pm.Deterministic('v', tt.sqrt(vx**2 + vy**2)) sigma_x = pm.Uniform('sigma_x', 0, 1) sigma_y = pm.Uniform('sigma_y', 0, 1) mu_x = pm.Deterministic('mu_x', vx*t+x0) mu_y = pm.Deterministic('mu_y', vy*t+y0) with model_blue: mc_x = pm.Normal("mc_x", mu_x, sigma_x, observed=obs_x) mc_y = pm.Normal("mc_y", mu_y, sigma_y, observed=obs_y) start = pm.find_MAP() step = pm.Metropolis() trace = pm.sample(100000, step=step, start=start) blue_burned_trace = trace[50000::5] pm.plots.plot_posterior(trace=blue_burned_trace["v"],round_to=6, alpha_level=0.05) import numpy as np t_red = -red_burned_trace["y0"]/red_burned_trace["vy"] t_blue = -blue_burned_trace["y0"]/blue_burned_trace["vy"] tau = np.max(np.array([t_red, t_blue]), axis=0) pm.plots.plot_posterior(trace=tau, alpha_level=0.05, round_to=2) with pm.Model() as model_coupled: t = loc_data['t'] xname_blue, yname_blue = 'blue_pos_X', 'blue_pos_Y' xname_red, yname_red = 'red_pos_X', 'red_pos_Y' obs_x_blue, obs_y_blue = loc_data[xname_blue], loc_data[yname_blue] obs_x_red, obs_y_red = loc_data[xname_red], loc_data[yname_red] # vx --> a, x0 --> b vx_blue = pm.Uniform('vx_blue', slopes[xname_blue]/5, slopes[xname_blue]*5) x0_blue = pm.Uniform('x0_blue', intercepts[xname_blue]-1, intercepts[xname_blue]+1) vx_red = pm.Uniform('vx_red', slopes[xname_red]/5, slopes[xname_red]*5) x0_red = pm.Uniform('x0_red', intercepts[xname_red]-1, intercepts[xname_red]+1) # vy --> a, y0 --> b # we choose the range of vx and x0 to be around the values obtained from linear regression vy_blue = pm.Uniform('vy_blue', slopes[yname_blue]/5, slopes[yname_blue]*5) y0_blue = pm.Uniform('y0_blue', intercepts[yname_blue]-1, intercepts[yname_red]+1) y0_red = pm.Uniform('y0_red', intercepts[yname_red]-1, intercepts[yname_red]+1) # speed v = pm.Deterministic('v', tt.sqrt(vx_blue**2 + vy_blue**2)) # vy_red is not independent anymore !!! # vy_red is negative vy_red = pm.Deterministic('vy_red', -tt.sqrt(v**2 - vx_red**2)) sigma_x_blue = pm.Uniform('sigma_x_blue', 0, 1) sigma_y_blue = pm.Uniform('sigma_y_blue', 0, 1) sigma_x_red = pm.Uniform('sigma_x_red', 0, 1) sigma_y_red = pm.Uniform('sigma_y_red', 0, 1) mu_x_blue = pm.Deterministic('mu_x_blue', vx_blue * t + x0_blue) mu_y_blue = pm.Deterministic('mu_y_blue', vy_blue * t + y0_blue) mu_x_red = pm.Deterministic('mu_x_red', vx_red * t + x0_red) mu_y_red = pm.Deterministic('mu_y_red', vy_red * t + y0_red) with model_coupled: mc_x_blue = pm.Normal("mc_x_blue", mu_x_blue, sigma_x_blue, observed=obs_x_blue) mc_y_blue = pm.Normal("mc_y_blue", mu_y_blue, sigma_y_blue, observed=obs_y_blue) mc_x_red = pm.Normal("mc_x_red", mu_x_red, sigma_x_red, observed=obs_x_red) mc_y_red = pm.Normal("mc_y_red", mu_y_red, sigma_y_red, observed=obs_y_red) start = pm.find_MAP() step = pm.Metropolis() trace = pm.sample(100000, step=step, start=start) coupled_burned_trace = trace[50000::5] pm.plots.plot_posterior(trace=coupled_burned_trace["v"], round_to=6, alpha_level=0.05) t_red = -coupled_burned_trace["y0_red"]/coupled_burned_trace["vy_red"] t_blue = -coupled_burned_trace["y0_blue"]/coupled_burned_trace["vy_blue"] tau = np.max(np.array([t_red, t_blue]), axis=0) pm.plots.plot_posterior(trace=tau, alpha_level=0.05, round_to=2) # We only use the first 100 data point N = 100 from scipy import stats slopes, intercepts = {}, {} columns = ['red_pos_X', 'red_pos_Y', 'blue_pos_X', 'blue_pos_Y'] for var in columns: a, b, _, _, _ = stats.linregress(loc_data['t'][:N], loc_data[var][:N]) slopes[var] = a intercepts[var] = b print(slopes) print(intercepts) with pm.Model() as model_decoupled_small: t = loc_data['t'][:N] xname_blue, yname_blue = 'blue_pos_X', 'blue_pos_Y' xname_red, yname_red = 'red_pos_X', 'red_pos_Y' obs_x_blue, obs_y_blue = loc_data[xname_blue][:N], loc_data[yname_blue][:N] obs_x_red, obs_y_red = loc_data[xname_red][:N], loc_data[yname_red][:N] # vx --> a, x0 --> b vx_blue = pm.Uniform('vx_blue', slopes[xname_blue]/5, slopes[xname_blue]*5) x0_blue = pm.Uniform('x0_blue', intercepts[xname_blue]-1, intercepts[xname_blue]+1) vx_red = pm.Uniform('vx_red', slopes[xname_red]/5, slopes[xname_red]*5) x0_red = pm.Uniform('x0_red', intercepts[xname_red]-1, intercepts[xname_red]+1) # vy --> a, y0 --> b # we choose the range of vx and x0 to be around the values obtained from linear regression vy_blue = pm.Uniform('vy_blue', slopes[yname_blue]/5, slopes[yname_blue]*5) y0_blue = pm.Uniform('y0_blue', intercepts[yname_blue]-1, intercepts[yname_blue]+1) # notice that vy_red is negative vy_red = pm.Uniform('vy_red', slopes[yname_red]*5, slopes[yname_red]/5) y0_red = pm.Uniform('y0_red', intercepts[yname_red]-1, intercepts[yname_red]+1) # speed v_blue = pm.Deterministic('v_blue', tt.sqrt(vx_blue**2 + vy_blue**2)) v_red = pm.Deterministic('v_red', tt.sqrt(vx_red**2 + vy_red**2)) sigma_x_blue = pm.Uniform('sigma_x_blue', 0, 1) sigma_y_blue = pm.Uniform('sigma_y_blue', 0, 1) sigma_x_red = pm.Uniform('sigma_x_red', 0, 1) sigma_y_red = pm.Uniform('sigma_y_red', 0, 1) mu_x_blue = pm.Deterministic('mu_x_blue', vx_blue * t + x0_blue) mu_y_blue = pm.Deterministic('mu_y_blue', vy_blue * t + y0_blue) mu_x_red = pm.Deterministic('mu_x_red', vx_red * t + x0_red) mu_y_red = pm.Deterministic('mu_y_red', vy_red * t + y0_red) with model_decoupled_small: mc_x_blue = pm.Normal("mc_x_blue", mu_x_blue, sigma_x_blue, observed=obs_x_blue) mc_y_blue = pm.Normal("mc_y_blue", mu_y_blue, sigma_y_blue, observed=obs_y_blue) mc_x_red = pm.Normal("mc_x_red", mu_x_red, sigma_x_red, observed=obs_x_red) mc_y_red = pm.Normal("mc_y_red", mu_y_red, sigma_y_red, observed=obs_y_red) start = pm.find_MAP() step = pm.Metropolis() trace = pm.sample(100000, step=step, start=start) decoupled_small_burned_trace = trace[50000::5] pm.plots.plot_posterior(trace=decoupled_small_burned_trace["v_blue"], round_to=6, alpha_level=0.05) pm.plots.plot_posterior(trace=decoupled_small_burned_trace["v_red"], round_to=6, alpha_level=0.05) t_red = -decoupled_small_burned_trace["y0_red"]/decoupled_small_burned_trace["vy_red"] t_blue = -decoupled_small_burned_trace["y0_blue"]/decoupled_small_burned_trace["vy_blue"] tau = np.max(np.array([t_red, t_blue]), axis=0) pm.plots.plot_posterior(trace=tau, alpha_level=0.05, round_to=2) with pm.Model() as model_coupled_small: t = loc_data['t'][:N] xname_blue, yname_blue = 'blue_pos_X', 'blue_pos_Y' xname_red, yname_red = 'red_pos_X', 'red_pos_Y' obs_x_blue, obs_y_blue = loc_data[xname_blue][:N], loc_data[yname_blue][:N] obs_x_red, obs_y_red = loc_data[xname_red][:N], loc_data[yname_red][:N] # vx --> a, x0 --> b vx_blue = pm.Uniform('vx_blue', slopes[xname_blue]/5, slopes[xname_blue]*5) x0_blue = pm.Uniform('x0_blue', intercepts[xname_blue]-1, intercepts[xname_blue]+1) vx_red = pm.Uniform('vx_red', slopes[xname_red]/5, slopes[xname_red]*5) x0_red = pm.Uniform('x0_red', intercepts[xname_red]-1, intercepts[xname_red]+1) # vy --> a, y0 --> b # we choose the range of vx and x0 to be around the values obtained from linear regression vy_blue = pm.Uniform('vy_blue', slopes[yname_blue]/5, slopes[yname_blue]*5) y0_blue = pm.Uniform('y0_blue', intercepts[yname_blue]-1, intercepts[yname_red]+1) y0_red = pm.Uniform('y0_red', intercepts[yname_red]-1, intercepts[yname_red]+1) # speed v = pm.Deterministic('v', tt.sqrt(vx_blue**2 + vy_blue**2)) # vy_red is not independent anymore !!! # vy_red is negative vy_red = pm.Deterministic('vy_red', -tt.sqrt(v**2 - vx_red**2)) sigma_x_blue = pm.Uniform('sigma_x_blue', 0, 1) sigma_y_blue = pm.Uniform('sigma_y_blue', 0, 1) sigma_x_red = pm.Uniform('sigma_x_red', 0, 1) sigma_y_red = pm.Uniform('sigma_y_red', 0, 1) mu_x_blue = pm.Deterministic('mu_x_blue', vx_blue * t + x0_blue) mu_y_blue = pm.Deterministic('mu_y_blue', vy_blue * t + y0_blue) mu_x_red = pm.Deterministic('mu_x_red', vx_red * t + x0_red) mu_y_red = pm.Deterministic('mu_y_red', vy_red * t + y0_red) with model_coupled_small: mc_x_blue = pm.Normal("mc_x_blue", mu_x_blue, sigma_x_blue, observed=obs_x_blue) mc_y_blue = pm.Normal("mc_y_blue", mu_y_blue, sigma_y_blue, observed=obs_y_blue) mc_x_red = pm.Normal("mc_x_red", mu_x_red, sigma_x_red, observed=obs_x_red) mc_y_red = pm.Normal("mc_y_red", mu_y_red, sigma_y_red, observed=obs_y_red) start = pm.find_MAP() step = pm.Metropolis() trace = pm.sample(100000, step=step, start=start) coupled_small_burned_trace = trace[50000::5] pm.plots.plot_posterior(trace=coupled_small_burned_trace["v"], round_to=6, alpha_level=0.05) t_red = -coupled_small_burned_trace["y0_red"]/coupled_small_burned_trace["vy_red"] t_blue = -coupled_small_burned_trace["y0_blue"]/coupled_small_burned_trace["vy_blue"] tau = np.max(np.array([t_red, t_blue]), axis=0) pm.plots.plot_posterior(trace=tau, alpha_level=0.05, round_to=2) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Visualize data Step2: value of slope and intercept from linear regression Step3: model Step4: a) Step5: posterior of red speed Step6: Blue / A Step7: posterior of blue speed Step8: b) Step9: C) Step10: shared Speed Step11: Transition time Step12: d) Step13: blue speed Step14: red speed Step15: transition time Step16: coupled case with first 100 data points Step17: shared speed
9,585
<ASSISTANT_TASK:> Python Code:: dataFrame = dataFrame.drop(row) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
9,586
<ASSISTANT_TASK:> Python Code: class MPCORB: class for accessing MRCORB database records def __init__(self, file='MRCORB.DAT'): self.file = file class MPOrbit: parse and process MPCORB entries http://www.minorplanetcenter.org/iau/info/MPOrbitFormat.html def __init__(self, line): parse line and fill self.data dictionary with fields according to header line in MPCORB.DAT file. Fix MPCORB format issues: - adds header for uncertainty parameter U headerline = "Des'n H G Epoch M Peri. Node Incl. e n a "\ "Reference #Obs #Opp Arc rms Perts Computer" self.headers = headerline.split() # fill missing Uncertainty header self.headers.insert(11, 'U') data = line.split() # join space separated Perts argument data[17:19] = [data[17]+' '+data[18]] for i, h in enumerate(self.headers): self.data = OrderedDict() self.data[h] = data[i] # dict-type access methods: mporbit['h'] def __getitem__(self, name): return self.data.__getitem__(name) def __setitem__(self, name, value): return self.data.__setitem__(name, value) def find_semiminor(major, e): Given semimajor and eccentricity, return semiminor return float(major)*math.sqrt(1-float(e)**2) def find_diameter(absmag, albedo=0.15): Return asteroid diameter in km http://www.physics.sfasu.edu/astro/asteroids/sizemagnitude.html return (10**(-0.2*float(absmag)))*1329/math.sqrt(albedo) def norm_radius(minr, maxr, minv, maxv, v): Given minimal/maximum radius, min/max value and value, return radius. return table = [] headers = [] for idx, line in enumerate(open('MPCORB.DAT', 'r')): if idx == 38: headers = line.split() headers.insert(11, 'U') # fill missing Uncertainty header #print(len(headers)) if 40 < idx < 42+100: data = line.split() data[17:19] = [data[17]+' '+data[18]] entry = MPOrbit(line) #entry = dict() for i, h in enumerate(headers): if h == 'a': h = 'semimajor' if h == 'Des\'n': h = 'id' entry[h] = data[i] entry['semiminor'] = find_semiminor(entry['semimajor'], entry['e']) entry['size'] = find_diameter(entry['H']) table.append(entry) minv = min(e['semimajor'] for e in table) maxv = max(e['semimajor'] for e in table) asteroids = [] aheaders = 'id', 'size' print('// id size distance platinum fuel terraforming orbit') tojson = [] seed(3.14) for e in table: a = OrderedDict() a['id'] = e['id'] a['size'] = e['size'] a['distance'] = float(e['semimajor']) a['period'] = 365/float(e['n']) # n = Mean daily motion (degrees per day) a['---'] = '' a['platinum'] = random() a['fuel'] = random() a['terraforming'] = random() a['orbit'] = random() tojson.append(a) import json print('') #e[radius] = norm_radius() #print('{id} {size} {distance}'.format(**a)) print(json.dumps(tojson, indent=4)) with open('dataset.js', 'w') as fw: fw.write('var dataset = ') fw.write(json.dumps(tojson, indent=4)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step6: Snatching asteroids. A hijacking guide to the galaxy! Step7: Output format
9,587
<ASSISTANT_TASK:> Python Code: 2 + 3 2*3 2**3 sin(pi) from math import sin, pi sin(pi) a = 10 a # YOUR CODE HERE raise NotImplementedError() # YOUR CODE HERE raise NotImplementedError() from nose.tools import assert_equal assert_equal(_, c) print("Sin errores") A = [2, 4, 8, 10] A A*2 f = lambda x: x**2 + 1 f(2) def g(x): y = x**2 + 1 return y g(2) def cel_a_faren(grados_cel): # YOUR CODE HERE raise NotImplementedError() return grados_faren cel_a_faren(-1) from nose.tools import assert_equal assert_equal(cel_a_faren(10), 50) assert_equal(cel_a_faren(50), 122) print("Sin errores") for dato in A: print(dato*2) B = [] for dato in A: B.append(dato*2) B # YOUR CODE HERE raise NotImplementedError() C # YOUR CODE HERE raise NotImplementedError() D from numpy.testing import assert_array_equal print("Sin errores") from numpy import matrix A = matrix([[1, 2], [3, 4]]) A v1 = matrix([[1], [2]]) v1 # Dependiendo de la version de python que exista en tu computadora, # esta operacion pudiera no funcionar, en dado caso solo hay que # cambiar @ por * A@v1 # La siguiente linea no va a funcionar, porque? v1@A from numpy import sin, cos, pi τ = 2*pi # YOUR CODE HERE raise NotImplementedError() vec_rot from numpy.testing import assert_array_equal assert_array_equal(vec_rot, matrix([[2*(cos(τ/12)-sin(τ/12))], [2*(cos(τ/12)+sin(τ/12))]])) print("Sin errores") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Sin embargo no existen funciones trigonométricas cargadas por default. Para esto tenemos que importarlas de la libreria math Step2: Variables Step3: Ejercicio Step4: Ejecuta la prueba de abajo para saber si has creado el codigo correcto Step5: Listas Step6: Pero si intentamos multiplicar estos datos por un numero, no tendrá el comportamiento esperado. Step7: Funciones Step8: Esta linea de codigo es equivalente a definir una función matemática de la siguiente manera Step9: Esta notación que introducimos es muy util para funciones matemáticas, pero esto nos obliga a pensar en las definiciones de una manera funcional, lo cual no siempre es la solución (sobre todo en un lenguaje con un paradigma de programación orientado a objetos). Step10: Con los mismos resultados Step11: Ejercicio Step12: Y para probar trata de convertir algunos datos Step13: Ciclos de control Step14: ó agregarlo en una lista nueva Step15: Ejercicio Step16: Ejecuta las pruebas de abajo Step17: Matrices Step18: Ejercicio
9,588
<ASSISTANT_TASK:> Python Code: DON'T MODIFY ANYTHING IN THIS CELL import helper import problem_unittests as tests source_path = 'data/small_vocab_en' target_path = 'data/small_vocab_fr' source_text = helper.load_data(source_path) target_text = helper.load_data(target_path) view_sentence_range = (0, 10) DON'T MODIFY ANYTHING IN THIS CELL import numpy as np # source_text.split() with empty string to get all words without the '\n' # source_text.split('\n') to get all sentences print('Dataset Stats') print('Roughly the number of unique words: {}'.format(len({word: None for word in source_text.split()}))) sentences = source_text.split('\n') word_counts = [len(sentence.split()) for sentence in sentences] print('Number of sentences: {}'.format(len(sentences))) print('Average number of words in a sentence: {}'.format(np.average(word_counts))) print() print('English sentences {} to {}:'.format(*view_sentence_range)) print('\n'.join(source_text.split('\n')[view_sentence_range[0]:view_sentence_range[1]])) print() print('French sentences {} to {}:'.format(*view_sentence_range)) print('\n'.join(target_text.split('\n')[view_sentence_range[0]:view_sentence_range[1]])) def text_to_ids_helper(text, vocab_to_int, appendEOS=False): sentences = [sentence if not appendEOS else sentence + ' <EOS>' for sentence in text.split('\n')] ids = [[vocab_to_int[word] for word in sentence.split()] for sentence in sentences] return ids def text_to_ids(source_text, target_text, source_vocab_to_int, target_vocab_to_int): Convert source and target text to proper word ids :param source_text: String that contains all the source text. :param target_text: String that contains all the target text. :param source_vocab_to_int: Dictionary to go from the source words to an id :param target_vocab_to_int: Dictionary to go from the target words to an id :return: A tuple of lists (source_id_text, target_id_text) # TODO: Implement Function source_id_text = text_to_ids_helper(source_text, source_vocab_to_int) target_id_text = text_to_ids_helper(target_text, target_vocab_to_int, True) return (source_id_text, target_id_text) DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_text_to_ids(text_to_ids) DON'T MODIFY ANYTHING IN THIS CELL helper.preprocess_and_save_data(source_path, target_path, text_to_ids) DON'T MODIFY ANYTHING IN THIS CELL import numpy as np import helper (source_int_text, target_int_text), (source_vocab_to_int, target_vocab_to_int), _ = helper.load_preprocess() DON'T MODIFY ANYTHING IN THIS CELL from distutils.version import LooseVersion import warnings import tensorflow as tf # Check TensorFlow Version assert LooseVersion(tf.__version__) in [LooseVersion('1.0.0'), LooseVersion('1.0.1')], 'This project requires TensorFlow version 1.0 You are using {}'.format(tf.__version__) print('TensorFlow Version: {}'.format(tf.__version__)) # Check for a GPU if not tf.test.gpu_device_name(): warnings.warn('No GPU found. Please use a GPU to train your neural network.') else: print('Default GPU Device: {}'.format(tf.test.gpu_device_name())) def model_inputs(): Create TF Placeholders for input, targets, and learning rate. :return: Tuple (input, targets, learning rate, keep probability) # TODO: Implement Function input = tf.placeholder(tf.int32, [None, None], name='input') targets = tf.placeholder(tf.int32, [None, None], name='targets') learning_rate = tf.placeholder(tf.float32, name='learning_rate') keep_prob = tf.placeholder(tf.float32, name='keep_prob') return input, targets, learning_rate, keep_prob DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_model_inputs(model_inputs) def process_decoding_input(target_data, target_vocab_to_int, batch_size): Preprocess target data for dencoding :param target_data: Target Placehoder :param target_vocab_to_int: Dictionary to go from the target words to an id :param batch_size: Batch Size :return: Preprocessed target data # TODO: Implement Function ending = tf.strided_slice(target_data, [0, 0], [batch_size, -1], [1, 1]) id_GO = target_vocab_to_int['<GO>'] decoder_input = tf.concat([tf.fill([batch_size, 1], id_GO), ending], 1) return decoder_input DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_process_decoding_input(process_decoding_input) def encoding_layer(rnn_inputs, rnn_size, num_layers, keep_prob): Create encoding layer :param rnn_inputs: Inputs for the RNN :param rnn_size: RNN Size :param num_layers: Number of layers :param keep_prob: Dropout keep probability :return: RNN state # TODO: Implement Function lstm = tf.contrib.rnn.BasicLSTMCell(rnn_size) drop = tf.contrib.rnn.DropoutWrapper(lstm, output_keep_prob=keep_prob) cell = tf.contrib.rnn.MultiRNNCell([drop] * num_layers) _, encoder_state = tf.nn.dynamic_rnn(cell, rnn_inputs, dtype=tf.float32) return encoder_state DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_encoding_layer(encoding_layer) def decoding_layer_train(encoder_state, dec_cell, dec_embed_input, sequence_length, decoding_scope, output_fn, keep_prob): Create a decoding layer for training :param encoder_state: Encoder State :param dec_cell: Decoder RNN Cell :param dec_embed_input: Decoder embedded input :param sequence_length: Sequence Length :param decoding_scope: TenorFlow Variable Scope for decoding :param output_fn: Function to apply the output layer :param keep_prob: Dropout keep probability :return: Train Logits # TODO: Implement Function # Per discussion on Slack, dropout could be applied to encoder and train decoder. # https://nd101.slack.com/archives/C3SEUBC5C/p1492633046150410 drop = tf.contrib.rnn.DropoutWrapper(dec_cell, output_keep_prob=keep_prob) train_decoder_fn = tf.contrib.seq2seq.simple_decoder_fn_train(encoder_state) train_pred, _, _ = tf.contrib.seq2seq.dynamic_rnn_decoder(cell=drop, decoder_fn=train_decoder_fn, inputs=dec_embed_input, sequence_length=sequence_length, scope=decoding_scope) train_logits = output_fn(train_pred) return train_logits DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_decoding_layer_train(decoding_layer_train) def decoding_layer_infer(encoder_state, dec_cell, dec_embeddings, start_of_sequence_id, end_of_sequence_id, maximum_length, vocab_size, decoding_scope, output_fn, keep_prob): Create a decoding layer for inference :param encoder_state: Encoder state :param dec_cell: Decoder RNN Cell :param dec_embeddings: Decoder embeddings :param start_of_sequence_id: GO ID :param end_of_sequence_id: EOS Id :param maximum_length: The maximum allowed time steps to decode :param vocab_size: Size of vocabulary :param decoding_scope: TensorFlow Variable Scope for decoding :param output_fn: Function to apply the output layer :param keep_prob: Dropout keep probability :return: Inference Logits # TODO: Implement Function infer_decoder_fn = \ tf.contrib.seq2seq.simple_decoder_fn_inference(output_fn=output_fn, encoder_state=encoder_state, embeddings=dec_embeddings, start_of_sequence_id=start_of_sequence_id, end_of_sequence_id=end_of_sequence_id, maximum_length=maximum_length-1, num_decoder_symbols=vocab_size) infer_logits, _, _ = tf.contrib.seq2seq.dynamic_rnn_decoder(cell=dec_cell, decoder_fn=infer_decoder_fn, scope=decoding_scope) return infer_logits DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_decoding_layer_infer(decoding_layer_infer) tf.reset_default_graph() def decoding_layer(dec_embed_input, dec_embeddings, encoder_state, vocab_size, sequence_length, rnn_size, num_layers, target_vocab_to_int, keep_prob): Create decoding layer :param dec_embed_input: Decoder embedded input :param dec_embeddings: Decoder embeddings :param encoder_state: The encoded state :param vocab_size: Size of vocabulary :param sequence_length: Sequence Length :param rnn_size: RNN Size :param num_layers: Number of layers :param target_vocab_to_int: Dictionary to go from the target words to an id :param keep_prob: Dropout keep probability :return: Tuple of (Training Logits, Inference Logits) # TODO: Implement Function start_of_sequence_id = target_vocab_to_int['<GO>'] end_of_sequence_id = target_vocab_to_int['<EOS>'] with tf.variable_scope('decoding') as decoding_scope: lstm = tf.contrib.rnn.BasicLSTMCell(rnn_size) dec_cell = tf.contrib.rnn.MultiRNNCell([lstm] * num_layers) output_fn = lambda x: tf.contrib.layers.fully_connected(inputs=x, num_outputs=vocab_size, activation_fn=None, scope=decoding_scope) train_logits = \ decoding_layer_train(encoder_state, dec_cell, dec_embed_input, sequence_length, decoding_scope, output_fn, keep_prob) with tf.variable_scope('decoding', reuse=True) as decoding_scope: infer_logits = \ decoding_layer_infer(encoder_state, dec_cell, dec_embeddings, start_of_sequence_id, end_of_sequence_id, sequence_length, vocab_size, decoding_scope, output_fn, keep_prob) return train_logits, infer_logits DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_decoding_layer(decoding_layer) def seq2seq_model(input_data, target_data, keep_prob, batch_size, sequence_length, source_vocab_size, target_vocab_size, enc_embedding_size, dec_embedding_size, rnn_size, num_layers, target_vocab_to_int): Build the Sequence-to-Sequence part of the neural network :param input_data: Input placeholder :param target_data: Target placeholder :param keep_prob: Dropout keep probability placeholder :param batch_size: Batch Size :param sequence_length: Sequence Length :param source_vocab_size: Source vocabulary size :param target_vocab_size: Target vocabulary size :param enc_embedding_size: Decoder embedding size :param dec_embedding_size: Encoder embedding size :param rnn_size: RNN Size :param num_layers: Number of layers :param target_vocab_to_int: Dictionary to go from the target words to an id :return: Tuple of (Training Logits, Inference Logits) # TODO: Implement Function enc_embed_input = tf.contrib.layers.embed_sequence(input_data, source_vocab_size, enc_embedding_size) encoder_state = encoding_layer(enc_embed_input, rnn_size, num_layers, keep_prob) decoder_input = process_decoding_input(target_data, target_vocab_to_int, batch_size) dec_embeddings = tf.Variable(tf.random_uniform([target_vocab_size, dec_embedding_size])) dec_embed_input = tf.nn.embedding_lookup(dec_embeddings, decoder_input) train_logits, infer_logits = \ decoding_layer(dec_embed_input, dec_embeddings, encoder_state, target_vocab_size, sequence_length, rnn_size, num_layers, target_vocab_to_int, keep_prob) return train_logits, infer_logits DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_seq2seq_model(seq2seq_model) # Number of Epochs epochs = 5 # Batch Size batch_size = 512 # RNN Size rnn_size = 512 # Number of Layers num_layers = 1 # Embedding Size: according to unique words (Is this assumption valid?) encoding_embedding_size = 300 decoding_embedding_size = 300 # Learning Rate learning_rate = 0.001 # Dropout Keep Probability keep_probability = 0.70 DON'T MODIFY ANYTHING IN THIS CELL save_path = 'checkpoints/dev' (source_int_text, target_int_text), (source_vocab_to_int, target_vocab_to_int), _ = helper.load_preprocess() max_source_sentence_length = max([len(sentence) for sentence in source_int_text]) train_graph = tf.Graph() with train_graph.as_default(): input_data, targets, lr, keep_prob = model_inputs() sequence_length = tf.placeholder_with_default(max_source_sentence_length, None, name='sequence_length') input_shape = tf.shape(input_data) train_logits, inference_logits = seq2seq_model( tf.reverse(input_data, [-1]), targets, keep_prob, batch_size, sequence_length, len(source_vocab_to_int), len(target_vocab_to_int), encoding_embedding_size, decoding_embedding_size, rnn_size, num_layers, target_vocab_to_int) tf.identity(inference_logits, 'logits') with tf.name_scope("optimization"): # Loss function cost = tf.contrib.seq2seq.sequence_loss( train_logits, targets, tf.ones([input_shape[0], sequence_length])) # Optimizer optimizer = tf.train.AdamOptimizer(lr) # Gradient Clipping gradients = optimizer.compute_gradients(cost) capped_gradients = [(tf.clip_by_value(grad, -1., 1.), var) for grad, var in gradients if grad is not None] train_op = optimizer.apply_gradients(capped_gradients) DON'T MODIFY ANYTHING IN THIS CELL import time def get_accuracy(target, logits): Calculate accuracy max_seq = max(target.shape[1], logits.shape[1]) if max_seq - target.shape[1]: target = np.pad( target, [(0,0),(0,max_seq - target.shape[1])], 'constant') if max_seq - logits.shape[1]: logits = np.pad( logits, [(0,0),(0,max_seq - logits.shape[1]), (0,0)], 'constant') return np.mean(np.equal(target, np.argmax(logits, 2))) train_source = source_int_text[batch_size:] train_target = target_int_text[batch_size:] valid_source = helper.pad_sentence_batch(source_int_text[:batch_size]) valid_target = helper.pad_sentence_batch(target_int_text[:batch_size]) with tf.Session(graph=train_graph) as sess: sess.run(tf.global_variables_initializer()) for epoch_i in range(epochs): for batch_i, (source_batch, target_batch) in enumerate( helper.batch_data(train_source, train_target, batch_size)): start_time = time.time() _, loss = sess.run( [train_op, cost], {input_data: source_batch, targets: target_batch, lr: learning_rate, sequence_length: target_batch.shape[1], keep_prob: keep_probability}) batch_train_logits = sess.run( inference_logits, {input_data: source_batch, keep_prob: 1.0}) batch_valid_logits = sess.run( inference_logits, {input_data: valid_source, keep_prob: 1.0}) train_acc = get_accuracy(target_batch, batch_train_logits) valid_acc = get_accuracy(np.array(valid_target), batch_valid_logits) end_time = time.time() print('Epoch {:>3} Batch {:>4}/{} - Train Accuracy: {:>6.3f}, Validation Accuracy: {:>6.3f}, Loss: {:>6.3f}' .format(epoch_i, batch_i, len(source_int_text) // batch_size, train_acc, valid_acc, loss)) # Save Model saver = tf.train.Saver() saver.save(sess, save_path) print('Model Trained and Saved') DON'T MODIFY ANYTHING IN THIS CELL # Save parameters for checkpoint helper.save_params(save_path) DON'T MODIFY ANYTHING IN THIS CELL import tensorflow as tf import numpy as np import helper import problem_unittests as tests _, (source_vocab_to_int, target_vocab_to_int), (source_int_to_vocab, target_int_to_vocab) = helper.load_preprocess() load_path = helper.load_params() def sentence_to_seq(sentence, vocab_to_int): Convert a sentence to a sequence of ids :param sentence: String :param vocab_to_int: Dictionary to go from the words to an id :return: List of word ids # TODO: Implement Function id_UNK = vocab_to_int['<UNK>'] ids = [vocab_to_int.get(word, id_UNK) for word in sentence.lower().split()] return ids DON'T MODIFY ANYTHING IN THIS CELL THAT IS BELOW THIS LINE tests.test_sentence_to_seq(sentence_to_seq) translate_sentence = 'he saw a old yellow truck .' DON'T MODIFY ANYTHING IN THIS CELL translate_sentence = sentence_to_seq(translate_sentence, source_vocab_to_int) loaded_graph = tf.Graph() with tf.Session(graph=loaded_graph) as sess: # Load saved model loader = tf.train.import_meta_graph(load_path + '.meta') loader.restore(sess, load_path) input_data = loaded_graph.get_tensor_by_name('input:0') logits = loaded_graph.get_tensor_by_name('logits:0') keep_prob = loaded_graph.get_tensor_by_name('keep_prob:0') translate_logits = sess.run(logits, {input_data: [translate_sentence], keep_prob: 1.0})[0] print('Input') print(' Word Ids: {}'.format([i for i in translate_sentence])) print(' English Words: {}'.format([source_int_to_vocab[i] for i in translate_sentence])) print('\nPrediction') print(' Word Ids: {}'.format([i for i in np.argmax(translate_logits, 1)])) print(' French Words: {}'.format([target_int_to_vocab[i] for i in np.argmax(translate_logits, 1)])) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Language Translation Step3: Explore the Data Step6: Implement Preprocessing Function Step8: Preprocess all the data and save it Step10: Check Point Step12: Check the Version of TensorFlow and Access to GPU Step15: Build the Neural Network Step18: Process Decoding Input Step21: Encoding Step24: Decoding - Training Step27: Decoding - Inference Step30: Build the Decoding Layer Step33: Build the Neural Network Step34: Neural Network Training Step36: Build the Graph Step39: Train Step41: Save Parameters Step43: Checkpoint Step46: Sentence to Sequence Step48: Translate
9,589
<ASSISTANT_TASK:> Python Code: # Download data, unzip, etc. import pandas as pd import urllib import tempfile import shutil import zipfile temp_dir = tempfile.mkdtemp() data_source = 'http://archive.ics.uci.edu/ml/machine-learning-databases/00275/Bike-Sharing-Dataset.zip' zipname = temp_dir + '/Bike-Sharing-Dataset.zip' urllib.urlretrieve(data_source, zipname) zip_ref = zipfile.ZipFile(zipname, 'r') zip_ref.extractall(temp_dir) zip_ref.close() daily_path = temp_dir + '/day.csv' daily_data = pd.read_csv(daily_path) daily_data['dteday'] = pd.to_datetime(daily_data['dteday']) drop_list = ['instant', 'season', 'yr', 'mnth', 'holiday', 'workingday', 'weathersit', 'atemp', 'hum'] daily_data.drop(drop_list, inplace = True, axis = 1) shutil.rmtree(temp_dir) daily_data.head() from __future__ import division, print_function from matplotlib import pyplot as plt import pandas as pd import numpy as np # In a notebook environment, display the plots inline %matplotlib inline # Set some parameters to apply to all plots. These can be overridden in each plot if desired import matplotlib # Plot size to 14" x 7" matplotlib.rc('figure', figsize = (14, 7)) # Font size to 14 matplotlib.rc('font', size = 14) # Do not display top and right frame lines matplotlib.rc('axes.spines', top = False, right = False) # Remove grid lines matplotlib.rc('axes', grid = False) # Set backgound color to white matplotlib.rc('axes', facecolor = 'white') # Define a function to create the scatterplot. This makes it easy to reuse code within and across notebooks def scatterplot(x_data, y_data, x_label, y_label, title): # Create the plot object _, ax = plt.subplots() # Plot the data, set the size (s), color and transparency (alpha) of the points ax.scatter(x_data, y_data, s = 30, color = '#539caf', alpha = 0.75) # Label the axes and provide a title ax.set_title(title) ax.set_xlabel(x_label) ax.set_ylabel(y_label) # Call the function to create plot scatterplot(x_data = daily_data['temp'] , y_data = daily_data['cnt'] , x_label = 'Normalized temperature (C)' , y_label = 'Check outs' , title = 'Number of Check Outs vs Temperature') # Perform linear regression import statsmodels.api as sm from statsmodels.stats.outliers_influence import summary_table x = sm.add_constant(daily_data['temp']) y = daily_data['cnt'] regr = sm.OLS(y, x) res = regr.fit() # Get fitted values from model to plot st, data, ss2 = summary_table(res, alpha=0.05) fitted_values = data[:,2] # Define a function for the line plot def lineplot(x_data, y_data, x_label, y_label, title): # Create the plot object _, ax = plt.subplots() # Plot the best fit line, set the linewidth (lw), color and transparency (alpha) of the line ax.plot(x_data, y_data, lw = 2, color = '#539caf', alpha = 1) # Label the axes and provide a title ax.set_title(title) ax.set_xlabel(x_label) ax.set_ylabel(y_label) # Call the function to create plot lineplot(x_data = daily_data['temp'] , y_data = fitted_values , x_label = 'Normalized temperature (C)' , y_label = 'Check outs' , title = 'Line of Best Fit for Number of Check Outs vs Temperature') # Get the confidence intervals of the model predict_mean_ci_low, predict_mean_ci_upp = data[:,4:6].T # Data for regions where we want to shade to indicate the intervals has to be sorted by the x axis to display correctly CI_df = pd.DataFrame(columns = ['x_data', 'low_CI', 'upper_CI']) CI_df['x_data'] = daily_data['temp'] CI_df['low_CI'] = predict_mean_ci_low CI_df['upper_CI'] = predict_mean_ci_upp CI_df.sort_values('x_data', inplace = True) # Define a function for the line plot with intervals def lineplotCI(x_data, y_data, sorted_x, low_CI, upper_CI, x_label, y_label, title): # Create the plot object _, ax = plt.subplots() # Plot the data, set the linewidth, color and transparency of the line, provide a label for the legend ax.plot(x_data, y_data, lw = 1, color = '#539caf', alpha = 1, label = 'Fit') # Shade the confidence interval ax.fill_between(sorted_x, low_CI, upper_CI, color = '#539caf', alpha = 0.4, label = '95% CI') # Label the axes and provide a title ax.set_title(title) ax.set_xlabel(x_label) ax.set_ylabel(y_label) # Display legend ax.legend(loc = 'best') # Call the function to create plot lineplotCI(x_data = daily_data['temp'] , y_data = fitted_values , sorted_x = CI_df['x_data'] , low_CI = CI_df['low_CI'] , upper_CI = CI_df['upper_CI'] , x_label = 'Normalized temperature (C)' , y_label = 'Check outs' , title = 'Line of Best Fit for Number of Check Outs vs Temperature') # Define a function for a plot with two y axes def lineplot2y(x_data, x_label, y1_data, y1_color, y1_label, y2_data, y2_color, y2_label, title): # Each variable will actually have its own plot object but they will be displayed in just one plot # Create the first plot object and draw the line _, ax1 = plt.subplots() ax1.plot(x_data, y1_data, color = y1_color) # Label axes ax1.set_ylabel(y1_label, color = y1_color) ax1.set_xlabel(x_label) ax1.set_title(title) # Create the second plot object, telling matplotlib that the two objects have the same x-axis ax2 = ax1.twinx() ax2.plot(x_data, y2_data, color = y2_color) ax2.set_ylabel(y2_label, color = y2_color) # Show right frame line ax2.spines['right'].set_visible(True) # Call the function to create plot lineplot2y(x_data = daily_data['dteday'] , x_label = 'Day' , y1_data = daily_data['cnt'] , y1_color = '#539caf' , y1_label = 'Check outs' , y2_data = daily_data['windspeed'] , y2_color = '#7663b0' , y2_label = 'Normalized windspeed' , title = 'Check Outs and Windspeed Over Time') # Define a function for a histogram def histogram(data, x_label, y_label, title): _, ax = plt.subplots() ax.hist(data, color = '#539caf') ax.set_ylabel(y_label) ax.set_xlabel(x_label) ax.set_title(title) # Call the function to create plot histogram(data = daily_data['registered'] , x_label = 'Check outs' , y_label = 'Frequency' , title = 'Distribution of Registered Check Outs') # Define a function for an overlaid histogram def overlaid_histogram(data1, data1_name, data1_color, data2, data2_name, data2_color, x_label, y_label, title): # Set the bounds for the bins so that the two distributions are fairly compared max_nbins = 10 data_range = [min(min(data1), min(data2)), max(max(data1), max(data2))] binwidth = (data_range[1] - data_range[0]) / max_nbins bins = np.arange(data_range[0], data_range[1] + binwidth, binwidth) # Create the plot _, ax = plt.subplots() ax.hist(data1, bins = bins, color = data1_color, alpha = 1, label = data1_name) ax.hist(data2, bins = bins, color = data2_color, alpha = 0.75, label = data2_name) ax.set_ylabel(y_label) ax.set_xlabel(x_label) ax.set_title(title) ax.legend(loc = 'best') # Call the function to create plot overlaid_histogram(data1 = daily_data['registered'] , data1_name = 'Registered' , data1_color = '#539caf' , data2 = daily_data['casual'] , data2_name = 'Casual' , data2_color = '#7663b0' , x_label = 'Check outs' , y_label = 'Frequency' , title = 'Distribution of Check Outs By Type') # We must first create a density estimate from our data from scipy.stats import gaussian_kde data = daily_data['registered'] density_est = gaussian_kde(data) density_est.covariance_factor = lambda : .25 # This controls the 'smoothness' of the estimate. Higher values give smoother estimates. density_est._compute_covariance() x_data = np.arange(min(data), max(data), 200) # Define a function for a density plot def densityplot(x_data, density_est, x_label, y_label, title): _, ax = plt.subplots() ax.plot(x_data, density_est(x_data), color = '#539caf', lw = 2) ax.set_ylabel(y_label) ax.set_xlabel(x_label) ax.set_title(title) # Call the function to create plot densityplot(x_data = x_data , density_est = density_est , x_label = 'Check outs' , y_label = 'Frequency' , title = 'Distribution of Registered Check Outs') # Calculate the mean and standard deviation for number of check outs each day mean_total_co_day = daily_data[['weekday', 'cnt']].groupby('weekday').agg([np.mean, np.std]) mean_total_co_day.columns = mean_total_co_day.columns.droplevel() # Define a function for a bar plot def barplot(x_data, y_data, error_data, x_label, y_label, title): _, ax = plt.subplots() # Draw bars, position them in the center of the tick mark on the x-axis ax.bar(x_data, y_data, color = '#539caf', align = 'center') # Draw error bars to show standard deviation, set ls to 'none' to remove line between points ax.errorbar(x_data, y_data, yerr = error_data, color = '#297083', ls = 'none', lw = 2, capthick = 2) ax.set_ylabel(y_label) ax.set_xlabel(x_label) ax.set_title(title) # Call the function to create plot barplot(x_data = mean_total_co_day.index.values , y_data = mean_total_co_day['mean'] , error_data = mean_total_co_day['std'] , x_label = 'Day of week' , y_label = 'Check outs' , title = 'Total Check Outs By Day of Week (0 = Sunday)') mean_by_reg_co_day = daily_data[['weekday', 'registered', 'casual']].groupby('weekday').mean() mean_by_reg_co_day # Calculate the mean number of check outs for each day by registration status mean_by_reg_co_day = daily_data[['weekday', 'registered', 'casual']].groupby('weekday').mean() # Calculate proportion of each category of user for each day mean_by_reg_co_day['total'] = mean_by_reg_co_day['registered'] + mean_by_reg_co_day['casual'] mean_by_reg_co_day['reg_prop'] = mean_by_reg_co_day['registered'] / mean_by_reg_co_day['total'] mean_by_reg_co_day['casual_prop'] = mean_by_reg_co_day['casual'] / mean_by_reg_co_day['total'] # Define a function for a stacked bar plot def stackedbarplot(x_data, y_data_list, y_data_names, colors, x_label, y_label, title): _, ax = plt.subplots() # Draw bars, one category at a time for i in range(0, len(y_data_list)): if i == 0: ax.bar(x_data, y_data_list[i], color = colors[i], align = 'center', label = y_data_names[i]) else: # For each category after the first, the bottom of the bar will be the top of the last category ax.bar(x_data, y_data_list[i], color = colors[i], bottom = y_data_list[i - 1], align = 'center', label = y_data_names[i]) ax.set_ylabel(y_label) ax.set_xlabel(x_label) ax.set_title(title) ax.legend(loc = 'upper right') # Call the function to create plot stackedbarplot(x_data = mean_by_reg_co_day.index.values , y_data_list = [mean_by_reg_co_day['reg_prop'], mean_by_reg_co_day['casual_prop']] , y_data_names = ['Registered', 'Casual'] , colors = ['#539caf', '#7663b0'] , x_label = 'Day of week' , y_label = 'Proportion of check outs' , title = 'Check Outs By Registration Status and Day of Week (0 = Sunday)') # Define a function for a grouped bar plot def groupedbarplot(x_data, y_data_list, y_data_names, colors, x_label, y_label, title): _, ax = plt.subplots() # Total width for all bars at one x location total_width = 0.8 # Width of each individual bar ind_width = total_width / len(y_data_list) # This centers each cluster of bars about the x tick mark alteration = np.arange(-(total_width/2), total_width/2, ind_width) # Draw bars, one category at a time for i in range(0, len(y_data_list)): # Move the bar to the right on the x-axis so it doesn't overlap with previously drawn ones ax.bar(x_data + alteration[i], y_data_list[i], color = colors[i], label = y_data_names[i], width = ind_width) ax.set_ylabel(y_label) ax.set_xlabel(x_label) ax.set_title(title) ax.legend(loc = 'upper right') # Call the function to create plot groupedbarplot(x_data = mean_by_reg_co_day.index.values , y_data_list = [mean_by_reg_co_day['registered'], mean_by_reg_co_day['casual']] , y_data_names = ['Registered', 'Casual'] , colors = ['#539caf', '#7663b0'] , x_label = 'Day of week' , y_label = 'Check outs' , title = 'Check Outs By Registration Status and Day of Week (0 = Sunday)') # Unlike with bar plots, there is no need to aggregate the data before plotting # However the data for each group (day) needs to be defined days = np.unique(daily_data['weekday']) bp_data = [] for day in days: bp_data.append(daily_data[daily_data['weekday'] == day]['cnt'].values) # Define a function to create a boxplot: def boxplot(x_data, y_data, base_color, median_color, x_label, y_label, title): _, ax = plt.subplots() # Draw boxplots, specifying desired style ax.boxplot(y_data # patch_artist must be True to control box fill , patch_artist = True # Properties of median line , medianprops = {'color': median_color} # Properties of box , boxprops = {'color': base_color, 'facecolor': base_color} # Properties of whiskers , whiskerprops = {'color': base_color} # Properties of whiker caps , capprops = {'color': base_color}) # By default, the tick label starts at 1 and increments by 1 for each box drawn. This sets the labels to the ones we want ax.set_xticklabels(x_data) ax.set_ylabel(y_label) ax.set_xlabel(x_label) ax.set_title(title) # Call the function to create plot boxplot(x_data = days , y_data = bp_data , base_color = '#539caf' , median_color = '#297083' , x_label = 'Day of week' , y_label = 'Check outs' , title = 'Total Check Outs By Day of Week (0 = Sunday)') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Import matplotlib (and other useful libraries) Step2: Exploring relationships between quantitative variables Step3: Line plot Step4: Line plot with confidence intervals Step5: Line plot with two y axes Step6: Examining distributions Step7: Overlaid histogram Step8: Density plot Step9: Between group comparisons Step10: There are several options when there is more than one level to how we are grouping our data. To expand on the example above, we can divide check outs into those by registered and casual users. So we now have two grouping levels Step11: Grouped bar plot Step12: Box plot
9,590
<ASSISTANT_TASK:> Python Code: message = "Hello Python world!" print(message) ###highlight=[5,6] message = "Hello Python world!" print(message) message = "Python is my favorite language!" print(message) message = "Thank you for sharing Python with the world, Guido!" print(mesage) ###highlight=[3] message = "Thank you for sharing Python with the world, Guido!" print(message) my_string = "This is a double-quoted string." my_string = 'This is a single-quoted string.' quote = "Linus Torvalds once said, 'Any program is only as good as it is useful.'" first_name = 'eric' print(first_name) print(first_name.title()) ###highlight=[6,8,9] first_name = 'eric' print(first_name) print(first_name.title()) print(first_name.upper()) first_name = 'Eric' print(first_name.lower()) first_name = 'ada' last_name = 'lovelace' full_name = first_name + ' ' + last_name print(full_name.title()) ###highlight=[6,7,8] first_name = 'ada' last_name = 'lovelace' full_name = first_name + ' ' + last_name message = full_name.title() + ' ' + "was considered the world's first computer programmer." print(message) print("Hello everyone!") print("\tHello everyone!") print("Hello \teveryone!") print("Hello everyone!") print("\nHello everyone!") print("Hello \neveryone!") print("\n\n\nHello everyone!") name = ' eric ' print(name.lstrip()) print(name.rstrip()) print(name.strip()) name = ' eric ' print('-' + name.lstrip() + '-') print('-' + name.rstrip() + '-') print('-' + name.strip() + '-') print(3+2) print(3-2) print(3*2) print(3/2) print(3**2) standard_order = 2+3*4 print(standard_order) my_order = (2+3)*4 print(my_order) print(0.1+0.1) print(0.1+0.2) print(3*0.1) # Python 2.7 print 4/2 # Python 2.7 print 3/2 # Python 3.3 print(4/2) # Python 3.3 print(3/2) # This line is a comment. print("This line is not a comment, it is code.") import this # I learned how to strip whitespace from strings. name = '\t\teric' print("I can strip tabs from my name: " + name.strip()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: A variable holds a value. You can change the value of a variable at any point. Step2: Naming rules Step3: Let's look through this error message. First, we see it is a NameError. Then we see the file that caused the error, and a green arrow shows us what line in that file caused the error. Then we get some more specific feedback, that "name 'mesage' is not defined". Step4: In case you didn't know Guido van Rossum created the Python language over 20 years ago, and he is considered Python's Benevolent Dictator for Life. Guido still signs off on all major changes to the core Python language. Step5: This lets us make strings that contain quotations. Step6: Changing case Step7: It is often good to store data in lower case, and then change the case as you want to for presentation. This catches some TYpos. It also makes sure that 'eric', 'Eric', and 'ERIC' are not considered three different people. Step8: You will see this syntax quite often, where a variable name is followed by a dot and then the name of an action, followed by a set of parentheses. The parentheses may be empty, or they may contain some values. Step9: The plus sign combines two strings into one, which is called "concatenation". You can use as many plus signs as you want in composing messages. In fact, many web pages are written as giant strings which are put together through a long series of string concatenations. Step10: If you don't know who Ada Lovelace is, you might want to go read what Wikipedia or the Computer History Museum have to say about her. Her life and her work are also the inspiration for the Ada Initiative, which supports women who are involved in technical fields. Step11: The combination "\n" makes a newline appear in a string. You can use newlines anywhere you like in a string. Step12: Stripping whitespace Step13: It's hard to see exactly what is happening, so maybe the following will make it a little more clear Step14: <a id="Exercises-strings"></a> Step15: You can use parenthesis to modify the standard order of operations. Step16: Floating-Point numbers Step17: However, sometimes you will get an answer with an unexpectly long decimal part Step18: This happens because of the way computers represent numbers internally; this has nothing to do with Python itself. Basically, we are used to working in powers of ten, where one tenth plus two tenths is just three tenths. But computers work in powers of two. So your computer has to represent 0.1 in a power of two, and then 0.2 as a power of two, and express their sum as a power of two. There is no exact representation for 0.3 in powers of two, and we see that in the answer to 0.1+0.2. Step19: Integers in Python 2.7 Step20: Division in Python 3.3 Step21: If you are getting numerical results that you don't expect, or that don't make sense, check if the version of Python you are using is treating integers differently than you expect. Step22: What makes a good comment? Step23: There is a lot here. Let's just take a few lines, and see what they mean for you as a new programmer.
9,591
<ASSISTANT_TASK:> Python Code: import sqlite3 conn = sqlite3.connect('example.db') c = conn.cursor() c.execute( CREATE TABLE employees ( id int unsigned NOT NULL, first_name string NOT NULL, last_name string NOT NULL, department_id int unsigned, PRIMARY KEY (id) )) c.execute( CREATE TABLE departments ( id int unsigned NOT NULL, title string NOT NULL, PRIMARY KEY (id) )) conn.commit() c.execute( INSERT INTO `employees` (`id`, `first_name`, `last_name`, `department_id`) VALUES ('1', 'Darth', 'Vader', 1), ('2', 'Darth', 'Maul', 1), ('3', 'Kylo', 'Ren', 1), ('4', 'Magister', 'Yoda', 2), ('5', 'Leia', 'Organa', 2), ('6', 'Luke', 'Skywalker', 2), ('7', 'Jar Jar', 'Binks', NULL) ) c.execute( INSERT INTO `departments` (`id`, `title`) VALUES ('1', 'Dark Side Inc.'), ('2', 'Light Side Ltd.'), ('3', 'Rebels'), ('4', 'Wookie') ) conn.commit() c.execute("SELECT emp.last_name AS Surname, d.title AS Department FROM departments d LEFT JOIN employees emp ON (d.id = emp.department_id)") print(c.fetchall()) # hello/models.py from django.db import models class Question(models.Model): question_text = models.CharField(max_length=200) pub_date = models.DateTimeField('date published') class Choice(models.Model): question = models.ForeignKey(Question, on_delete=models.CASCADE) choice_text = models.CharField(max_length=200) votes = models.IntegerField(default=0) INSTALLED_APPS = [ 'hello', # <---- вот сюда, например 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', ] import django django.setup() from django.utils import timezone # поддержка временных зон from hello.models import Question, Choice Question.objects.all() # вернуть все объекты из базы q = Question(question_text="Чёкак?", pub_date=timezone.now()) # создать объект q.save() # сохранить объект в базу q.question_text = "Чёкаво?" q.save() str(q.query) # заглянуть внутрь Question.objects.filter(question_text__startswith='Чё') # фильтруем по строчкам current_year = timezone.now().year Question.objects.get(pub_date__year=current_year) # фильтруем по году Question.objects.get(id=2) q.choice_set.all() # все варианты ответа для данного вопроса c = q.choice_set.create(choice_text='Кто бы знал', votes=0) # создаем связанный объект c.delete() # удаляем объект # hello/admin.py from django.contrib import admin from .models import Question admin.site.register(Question) import asyncio import aiohttp from aioes import Elasticsearch from datetime import datetime es = Elasticsearch(['localhost:9200']) URL = "https://ghibliapi.herokuapp.com/species/603428ba-8a86-4b0b-a9f1-65df6abef3d3" async def create_db(): async with aiohttp.ClientSession() as session: async with session.get(URL) as resp: films_urls = (await resp.json())["films"] for i, film_url in enumerate(films_urls): async with session.get(film_url) as resp: res = await es.index( index="coding-index", doc_type='film', id=i, body=await resp.json() ) print(res['created']) loop = asyncio.get_event_loop() loop.run_until_complete(create_db()) # https://www.elastic.co/guide/en/elasticsearch/reference/current/query-dsl-match-query.html async def get_by_id(key): return await es.get(index='coding-index', doc_type='film', id=key) async def search_by_director(director): return await es.search(index='coding-index', body={"query": {"match": {'director': director}}}) async def search_in_description(sentence): return await es.search(index='coding-index', body={"query": {"match": {'description': sentence}}}) # loop.run_until_complete(get_by_id(0)) # loop.run_until_complete(search_by_director("Hayao Miyazaki")) loop.run_until_complete(search_in_description("cat")) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step4: Вопросы Step5: ORM - Object-Relational Mapping Step6: Нужно добавить наше приложение в INSTALLED_APPS в settings.py Step7: Создадим миграцию для наших новых моделей Step8: Админка Step9: python manage.py runserver
9,592
<ASSISTANT_TASK:> Python Code: from IPython.display import Image Image(filename="YoungTwoSlitExperiment.JPG") from IPython.display import Image Image(filename="ExperimentoYoung.jpg") from matplotlib.pyplot import * from numpy import * %matplotlib inline style.use('fivethirtyeight') ################################################################################### # PARÁMETROS. SE PUEDEN MODIFICAR SUS VALORES ################################################################################### Lambda =400e-9 # en metros, longitud de onda de la radiación D = 4.5 # en metros, distancia entre el plano que contiene las fuentes y la pantalla de observación a = 0.003 # en metros, separación entre fuentes ################################################################################### interfranja=Lambda*D/a # cálculo de la interfranja k = 2.0*pi/Lambda x = linspace(-5*interfranja,5*interfranja,500) I1 = 1 # Consideramos irradiancias normalizadas a un cierto valor. I2 = 0.01 X,Y = meshgrid(x,x) delta = k*a*X/D Itotal = I1 + I2 + 2.0*sqrt(I1*I2)*cos(delta) figure(figsize=(14,5)) subplot(121) pcolormesh(x*1e3,x*1e3,Itotal,cmap = 'gray',vmin=0,vmax=4) xlabel("x (mm)"); ylabel("y (mm)") subplot(122) plot(x*1e3,Itotal[x.shape[0]/2,:]) xlabel("x (mm)"); ylabel("Irradiancia total normalizada") interfranja=Lambda*D/a # cálculo de la interfranja C = (Itotal.max() - Itotal.min())/(Itotal.max() + Itotal.min()) # cálculo del contraste print "a=",a*1e3,"mm ","D=",D,"m ","Longitud de onda=",Lambda*1e9,"nm" # valores de los parámetros print "Interfranja=",interfranja*1e3,"mm" # muestra el valor de la interfranja en mm print 'Contraste=',C # muestra el valor del contraste from IPython.display import Image Image(filename="FranjasYoungWhiteLight.jpg") from IPython.display import YouTubeVideo YouTubeVideo("B34bAGtQL9A") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: ''The experiments I am about to relate ... may be repeated with great ease, Step2: Según la figura, $\Delta = r_2 - r_1$ lo podemos escribir como $\Delta = a sen(\theta)$, siendo $a$ la separación entre las rendijas. Si éste ángulo es pequeño (lo que significa que la distancia entre las fuentes y la pantalla de observación sea grande comparada con la separación entre las fuentes), esta expresión la podemos simplificar, Step3: Como podemos ver, los máximos están equiespaciados (lo mismo sucede con los míminos), siendo la distancia entre dos máximos consecutivos Step4: Cuestiones. Preguntas Step5: Como se puede observar, en el caso de luz blanca, cada una de las longitudes de onda que la componen forma un sistema de franjas con los máximos situados en posiciones distintas y con una interfranja diferente. Esto dificulta enormemente la visualización de la interferencia y nos llevará a definir el concepto de luz coherente e incoherente.
9,593
<ASSISTANT_TASK:> Python Code: def write_answer_to_file(answer, filename): with open(filename, 'w') as f_out: f_out.write(str(round(answer, 3))) import pandas as pd adver_data = pd.read_csv('advertising.csv') adver_data.head(5) adver_data.describe() import numpy as np X = np.array(adver_data.values[:,0:3]) y = np.array(adver_data.values[:,3]) means, stds = np.mean(X,axis=0), np.std(X, axis=0) X = (X-means)/stds n = np.shape(X)[0] ones = np.reshape(np.ones(n),(n,1)) X = np.hstack((X,ones)) def mserror(y, y_pred): return np.mean((y-y_pred)**2) y_med = np.median(y) answer1 = mserror(y,y_med) print(answer1) write_answer_to_file(answer1, '1.txt') def normal_equation(X, y): return np.linalg.solve(np.dot(X.transpose(),X),np.dot(X.transpose(),y)) norm_eq_weights = normal_equation(X, y) print(norm_eq_weights) answer2 = np.sum([0., 0., 0., 1.]*norm_eq_weights) print(answer2) write_answer_to_file(answer2, '2.txt') def linear_prediction(X, w): return np.dot(X,w) lin_pred = linear_prediction(X,norm_eq_weights) answer3 = mserror(y,lin_pred) print(answer3) write_answer_to_file(answer3, '3.txt') def stochastic_gradient_step(X, y, w, train_ind, eta=0.01): return w + 2 * eta/X.shape[0] * X[train_ind] * (y[train_ind] - linear_prediction(X[train_ind], w)) def stochastic_gradient_descent(X, y, w_init, eta=1e-2, max_iter=1e4, min_weight_dist=1e-8, seed=42, verbose=False): # Инициализируем расстояние между векторами весов на соседних # итерациях большим числом. weight_dist = np.inf # Инициализируем вектор весов w = w_init # Сюда будем записывать ошибки на каждой итерации errors = [] # Счетчик итераций iter_num = 0 # Будем порождать псевдослучайные числа # (номер объекта, который будет менять веса), а для воспроизводимости # этой последовательности псевдослучайных чисел используем seed. np.random.seed(seed) # Основной цикл while weight_dist > min_weight_dist and iter_num < max_iter: # порождаем псевдослучайный # индекс объекта обучающей выборки random_ind = np.random.randint(X.shape[0]) w_new = stochastic_gradient_step(X, y, w, random_ind, eta) weight_dist = np.linalg.norm(w-w_new) w = w_new errors.append(mserror(y, linear_prediction(X, w))) iter_num += 1 return w, errors %%time stoch_grad_desc_weights, stoch_errors_by_iter = stochastic_gradient_descent(X, y, np.zeros(X.shape[1]),max_iter=1e5) %pylab inline plot(range(50), stoch_errors_by_iter[:50]) xlabel('Iteration number') ylabel('MSE') %pylab inline plot(range(len(stoch_errors_by_iter)), stoch_errors_by_iter) xlabel('Iteration number') ylabel('MSE') stoch_grad_desc_weights stoch_errors_by_iter[-1] answer4 = mserror(y, linear_prediction(X, stoch_grad_desc_weights)) print(answer4) write_answer_to_file(answer4, '4.txt') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 1. Загрузите данные из файла advertising.csv в объект pandas DataFrame. Источник данных. Step2: Посмотрите на первые 5 записей и на статистику признаков в этом наборе данных. Step3: Создайте массивы NumPy X из столбцов TV, Radio и Newspaper и y - из столбца Sales. Используйте атрибут values объекта pandas DataFrame. Step4: Отмасштабируйте столбцы матрицы X, вычтя из каждого значения среднее по соответствующему столбцу и поделив результат на стандартное отклонение. Для определенности, используйте методы mean и std векторов NumPy (реализация std в Pandas может отличаться). Обратите внимание, что в numpy вызов функции .mean() без параметров возвращает среднее по всем элементам массива, а не по столбцам, как в pandas. Чтобы произвести вычисление по столбцам, необходимо указать параметр axis. Step5: Добавьте к матрице X столбец из единиц, используя методы hstack, ones и reshape библиотеки NumPy. Вектор из единиц нужен для того, чтобы не обрабатывать отдельно коэффициент $w_0$ линейной регрессии. Step6: 2. Реализуйте функцию mserror - среднеквадратичную ошибку прогноза. Она принимает два аргумента - объекты Series y (значения целевого признака) и y_pred (предсказанные значения). Не используйте в этой функции циклы - тогда она будет вычислительно неэффективной. Step7: Какова среднеквадратичная ошибка прогноза значений Sales, если всегда предсказывать медианное значение Sales по исходной выборке? Запишите ответ в файл '1.txt'. Step8: 3. Реализуйте функцию normal_equation, которая по заданным матрицам (массивам NumPy) X и y вычисляет вектор весов $w$ согласно нормальному уравнению линейной регрессии. Step9: Какие продажи предсказываются линейной моделью с весами, найденными с помощью нормального уравнения, в случае средних инвестиций в рекламу по ТВ, радио и в газетах? (то есть при нулевых значениях масштабированных признаков TV, Radio и Newspaper). Запишите ответ в файл '2.txt'. Step10: 4. Напишите функцию linear_prediction, которая принимает на вход матрицу X и вектор весов линейной модели w, а возвращает вектор прогнозов в виде линейной комбинации столбцов матрицы X с весами w. Step11: Какова среднеквадратичная ошибка прогноза значений Sales в виде линейной модели с весами, найденными с помощью нормального уравнения? Запишите ответ в файл '3.txt'. Step12: 5. Напишите функцию stochastic_gradient_step, реализующую шаг стохастического градиентного спуска для линейной регрессии. Функция должна принимать матрицу X, вектора y и w, число train_ind - индекс объекта обучающей выборки (строки матрицы X), по которому считается изменение весов, а также число $\eta$ (eta) - шаг градиентного спуска (по умолчанию eta=0.01). Результатом будет вектор обновленных весов. Наша реализация функции будет явно написана для данных с 3 признаками, но несложно модифицировать для любого числа признаков, можете это сделать. Step13: 6. Напишите функцию stochastic_gradient_descent, реализующую стохастический градиентный спуск для линейной регрессии. Функция принимает на вход следующие аргументы Step14: Запустите $10^5$ итераций стохастического градиентного спуска. Укажите вектор начальных весов w_init, состоящий из нулей. Оставьте параметры eta и seed равными их значениям по умолчанию (eta=0.01, seed=42 - это важно для проверки ответов). Step15: Посмотрим, чему равна ошибка на первых 50 итерациях стохастического градиентного спуска. Видим, что ошибка не обязательно уменьшается на каждой итерации. Step16: Теперь посмотрим на зависимость ошибки от номера итерации для $10^5$ итераций стохастического градиентного спуска. Видим, что алгоритм сходится. Step17: Посмотрим на вектор весов, к которому сошелся метод. Step18: Посмотрим на среднеквадратичную ошибку на последней итерации. Step19: Какова среднеквадратичная ошибка прогноза значений Sales в виде линейной модели с весами, найденными с помощью градиентного спуска? Запишите ответ в файл '4.txt'.
9,594
<ASSISTANT_TASK:> Python Code: import itertools from pprint import pprint from operator import getitem import matplotlib.pyplot as plt from matplotlib.colors import LogNorm import numpy as np import spacepy.plot as spp import pymc as mc import tqdm from MCA_file_viewer_v001 import GetMCAfile def plot_box(x, y, c='r', lw=0.6, ax=None): if ax is None: plt.plot((xind[0], xind[0]), (yind[0], yind[1]), lw=lw, c=c) plt.plot((xind[1], xind[1]), (yind[0], yind[1]), lw=lw, c=c) plt.plot((xind[0], xind[1]), (yind[0], yind[0]), lw=lw, c=c) plt.plot((xind[0], xind[1]), (yind[1], yind[1]), lw=lw, c=c) else: ax.plot((xind[0], xind[0]), (yind[0], yind[1]), lw=lw, c=c) ax.plot((xind[1], xind[1]), (yind[0], yind[1]), lw=lw, c=c) ax.plot((xind[0], xind[1]), (yind[0], yind[0]), lw=lw, c=c) ax.plot((xind[0], xind[1]), (yind[1], yind[1]), lw=lw, c=c) ZZ, XX, YY = GetMCAfile('16090203.mca') # It is believed as of 2016-09-19 that the MCA records 2 counts for each count. # This means all data are even and all the data can be divided by 2 to give the # right number of counts. Per emails Larsen-Fernandes 2016-09-17 # These data are integres and care muct be taken to assure that /2 does not # lead to number that are not representable in float ZZ = ZZ.astype(float) ZZ /= 2 XX = XX.astype(np.uint16) # as they all should be integers anyway xind = (986, 1003) yind = (492, 506) fig = plt.figure(figsize=(20,8)) ax1 = fig.add_subplot(131) ax2 = fig.add_subplot(132) ax3 = fig.add_subplot(133) pc = ax1.pcolormesh(XX, YY, ZZ, norm=LogNorm()) plt.colorbar(pc, ax=ax1) plot_box(xind, yind, ax=ax1) ax2.hist(ZZ.flatten(), 20) ax2.set_yscale('log') ax3.hist(ZZ.flatten(), 20, normed=True) ax3.set_yscale('log') total_cnts = ZZ.sum() print('Total counts:{0} -- Phil got {1} -- remember /2'.format(total_cnts, 4570/2)) # remember we did a /2 # Is the whitness hole at x=1000, y=500? XX.shape, YY.shape, ZZ.shape print(ZZ[yind[0]:yind[1], xind[0]:xind[1]]) plt.figure() plt.pcolormesh(XX[xind[0]:xind[1]], YY[yind[0]:yind[1]], ZZ[yind[0]:yind[1], xind[0]:xind[1]] , norm=LogNorm()) plt.colorbar() witness_counts = ZZ[yind[0]:yind[1], xind[0]:xind[1]].sum() print('Witness counts: {0}, Phil got {1}/2={2}'.format(witness_counts, 658, 658/2)) wit_pixels = 46 print('There {0} pixels in the witness peak'.format(wit_pixels)) total_counts = ZZ.sum() print("There are a total of {0} counts".format(total_counts)) def neighbor_inds(x, y, xlim=(0,1023), ylim=(0,1023), center=False, mask=False): given an x and y index return the 8 neighbor indices if center also return the center index if mask return a boolean mask over the whole 2d array xi = np.clip([x + v for v in [-1, 0, 1]], xlim[0], xlim[1]) yi = np.clip([y + v for v in [-1, 0, 1]], ylim[0], ylim[1]) ans = [(i, j) for i, j in itertools.product(xi, yi)] if not center: ans.remove((x,y)) if mask: out = np.zeros((np.diff(xlim)+1, np.diff(ylim)+1), dtype=np.bool) for c in ans: out[c] = True else: out = ans return np.asarray(out) print(neighbor_inds(2,2)) print(neighbor_inds(2,2, mask=True)) print(ZZ[neighbor_inds(500, 992, mask=True)]) def get_alone_pixels(dat): loop over all the data and store the value of all lone pixels ans = [] for index, x in tqdm.tqdm_notebook(np.ndenumerate(dat)): if (np.sum([ZZ[i, j] for i, j in neighbor_inds(index[0], index[1])]) == 0) and x != 0: ans.append((index, x)) return ans # print((neighbor_inds(5, 4))) alone = get_alone_pixels(ZZ) pprint(alone) # ZZ[neighbor_inds(5, 4)[0]].shape # print((neighbor_inds(5, 4))[0]) # print(ZZ[(neighbor_inds(5, 4))[0]].shape) # ZZ[4,3] ZZ[(965, 485)] print(neighbor_inds(4,3)[0]) print(ZZ[neighbor_inds(4,3)[0]]) print(ZZ[3,2]) ni = neighbor_inds(4,3)[0] print(ZZ[ni[0], ni[1]]) (ZZ % 2).any() # not all even any longer n_noise = np.sum([v[1] for v in alone]) n_pixels = 1024*1024 noise_pixel = n_noise/n_pixels print("There were a total of {0} random counts over {1} pixels, {2} cts/pixel".format(n_noise, n_pixels, noise_pixel)) minx_tmp = ZZ.sum(axis=0) minx_tmp.shape print(minx_tmp) miny_tmp = ZZ.sum(axis=1) miny_tmp.shape print(miny_tmp) Aw = np.pi*(0.2/2)**2 # mm**2 Af = 182.75 # mm**2 this is the area of the foil W_F_ratio = Aw/Af print(Aw, Af, W_F_ratio) C = wit_pixels/n_pixels D = (n_pixels-wit_pixels)/n_pixels print('C', C, 'D', D) nbkg = mc.Uniform('nbkg', 1, n_noise*5) # just 1 to some large number obsnbkg = mc.Poisson('obsnbkg', nbkg, observed=True, value=n_noise) witc = mc.Uniform('witc', 0, witness_counts*5) # just 0 to some large number obswit = mc.Poisson('obswit', nbkg*C + witc, observed=True, value=witness_counts) realc = mc.Uniform('realc', 0, total_counts*5) # just 0 to some large number obsopen = mc.Poisson('obsopen', nbkg*D + realc, observed=True, value=total_counts-witness_counts) @mc.deterministic(plot=True) def open_area(realc=realc, witc=witc): return realc*Aw/witc/Af model = mc.MCMC([nbkg, obsnbkg, witc, obswit, realc, obsopen, open_area]) model.sample(200000, burn=100, thin=30, burn_till_tuned=True) mc.Matplot.plot(model) # 1000, burn=100, thin=30 0.000985 +/- 0.000058 # 10000, burn=100, thin=30 0.000982 +/- 0.000061 # 100000, burn=100, thin=30 0.000984 +/- 0.000059 # 200000, burn=100, thin=30 0.000986 +/- 0.000059 # 1000000, burn=100, thin=30 0.000985 +/- 0.000059 print("Foil 1 \n") witc_mean = np.mean(witc.trace()[...]) witc_std = np.std(witc.trace()[...]) print("Found witness counts of {0} turn into {1} +/- {2} ({3:.2f}%)\n".format(witness_counts, witc_mean, witc_std, witc_std/witc_mean*100)) realc_mean = np.mean(realc.trace()[...]) realc_std = np.std(realc.trace()[...]) print("Found non-witness counts of {0} turn into {1} +/- {2} ({3:.2f}%)\n".format(total_counts-witness_counts, realc_mean, realc_std, realc_std/realc_mean*100)) nbkg_mean = np.mean(nbkg.trace()[...]) nbkg_std = np.std(nbkg.trace()[...]) print("Found noise counts of {0} turn into {1} +/- {2} ({3:.2f}%)\n".format(0, nbkg_mean, nbkg_std, nbkg_std/nbkg_mean*100)) OA_median = np.median(open_area.trace()[...]) OA_mean = np.mean(open_area.trace()[...]) OA_std = np.std(open_area.trace()[...]) print("The open area fraction is {0:.6f} +/- {1:.6f} ({2:.2f}%) at the 1 stddev level from 1 measurement\n".format(OA_mean, OA_std,OA_std/OA_mean*100 )) print("Phil got {0} for 1 measurement\n".format(0.00139)) print("The ratio Brian/Phil is: {0:.6f} or {1:.6f}".format(OA_mean/0.00139, 0.00139/OA_mean)) _Aw = np.pi*(0.2/2)**2 # mm**2 _Af = 182.75 # mm**2 this is the area of the foil Aw = mc.Normal('Aw', _Aw, (_Aw*0.2)**-2) # 20% Af = mc.Normal('Af', _Af, (_Af*0.1)**-2) # 10% print(_Aw, _Af) C = wit_pixels/n_pixels D = (n_pixels-wit_pixels)/n_pixels print('C', C, 'D', D) nbkg = mc.Uniform('nbkg', 1, n_noise*5) # just 1 to some large number obsnbkg = mc.Poisson('obsnbkg', nbkg, observed=True, value=n_noise) witc = mc.Uniform('witc', 0, witness_counts*5) # just 0 to some large number obswit = mc.Poisson('obswit', nbkg*C + witc, observed=True, value=witness_counts) realc = mc.Uniform('realc', 0, total_counts*5) # just 0 to some large number obsopen = mc.Poisson('obsopen', nbkg*D + realc, observed=True, value=total_counts-witness_counts) @mc.deterministic(plot=True) def open_area(realc=realc, witc=witc, Aw=Aw, Af=Af): return realc*Aw/witc/Af model = mc.MCMC([nbkg, obsnbkg, witc, obswit, realc, obsopen, open_area, Af, Aw]) model.sample(200000, burn=100, thin=30, burn_till_tuned=True) mc.Matplot.plot(nbkg) mc.Matplot.plot(witc) mc.Matplot.plot(realc) # mc.Matplot.plot(open_area) mc.Matplot.plot(Aw) _ = spp.plt.hist(open_area.trace(), 20) print("Foil 1 \n") witc_mean = np.mean(witc.trace()[...]) witc_std = np.std(witc.trace()[...]) print("Found witness counts of {0} turn into {1} +/- {2} ({3:.2f}%)\n".format(witness_counts, witc_mean, witc_std, witc_std/witc_mean*100)) realc_mean = np.mean(realc.trace()[...]) realc_std = np.std(realc.trace()[...]) print("Found non-witness counts of {0} turn into {1} +/- {2} ({3:.2f}%)\n".format(total_counts-witness_counts, realc_mean, realc_std, realc_std/realc_mean*100)) nbkg_mean = np.mean(nbkg.trace()[...]) nbkg_std = np.std(nbkg.trace()[...]) print("Found noise counts of {0} turn into {1} +/- {2} ({3:.2f}%)\n".format(0, nbkg_mean, nbkg_std, nbkg_std/nbkg_mean*100)) OA_median = np.median(open_area.trace()[...]) OA_mean = np.mean(open_area.trace()[...]) OA_std = np.std(open_area.trace()[...]) print("The open area fraction is {0:.6f} +/- {1:.6f} ({2:.2f}%) at the 1 stddev level from 1 measurement\n".format(OA_mean, OA_std,OA_std/OA_mean*100 )) print("Phil got {0} for 1 measurement\n".format(0.00139)) print("The ratio Brian/Phil is: {0:.6f} or {1:.6f}".format(OA_mean/0.00139, 0.00139/OA_mean)) mc.Matplot.plot(Aw) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Do some calculations to try and match Phil's analysis Step4: Can we get a noise estimate? Step5: Noise estimates Step6: Maybe we should consider just part of the MCP, lets get the min,max X and min,max Y where there are counts and just use that area. This will increase the cts/pixel. Step7: Looks to go all the way to all sides in X-Y. Step8: Run again allowing some uncertainity on witness and foil areas
9,595
<ASSISTANT_TASK:> Python Code: # Basic imports import os import pandas as pd import matplotlib.pyplot as plt import numpy as np import datetime as dt import scipy.optimize as spo import sys from time import time from sklearn.metrics import r2_score, median_absolute_error %matplotlib inline %pylab inline pylab.rcParams['figure.figsize'] = (20.0, 10.0) %load_ext autoreload %autoreload 2 sys.path.append('../../') import utils.misc as misc res_df = pd.read_pickle('../../data/results_ahead1_linear_df.pkl') res_df.head() RELEVANT_COLUMNS = ['base_days', 'train_days', 'r2', 'mre', 'ahead_days', 'train_val_time', 'step_days', 'GOOD_DATA_RATIO', 'SAMPLES_GOOD_DATA_RATIO', 'x_filename', 'y_filename'] best_params_df = res_df[RELEVANT_COLUMNS].loc[np.argmin(res_df['mre']),:] best_params_df['model'] = 'linear' best_params_df test_df = pd.DataFrame() test_df.append(best_params_df, ignore_index=True) RELEVANT_COLUMNS = ['base_days', 'train_days', 'r2', 'mre', 'ahead_days', 'train_val_time', 'step_days', 'GOOD_DATA_RATIO', 'SAMPLES_GOOD_DATA_RATIO', 'x_filename', 'y_filename'] ahead_days_list = [1, 7, 14, 28, 56] models_list = ['linear', 'random_forest'] results_df = pd.DataFrame() for ahead_days in ahead_days_list: for model in models_list: res_df = pd.read_pickle('../../data/results_ahead{}_{}_df.pkl'.format(ahead_days, model)) best_params_df = res_df[RELEVANT_COLUMNS].loc[np.argmax(res_df['r2']),:] best_params_df['ahead_days'] = ahead_days best_params_df['model'] = model results_df = results_df.append(best_params_df, ignore_index=True) results_df results_df.to_pickle('../../data/best_dataset_params_raw_df.pkl') def keep_max_r2(record): return record.loc[np.argmax(record['r2']),:] best_r2_df = results_df.groupby('ahead_days').apply(keep_max_r2) best_r2_df best_r2_df[['mre', 'r2']].plot() initial_performance_df = results_df[results_df['model']=='random_forest'] initial_performance_df.set_index('ahead_days', inplace=True) initial_performance_df initial_performance_df.loc[14, 'base_days'] n_estimators = [10, 50, 100, 200] max_depth = [None, 5, 10, 15] hyper_df = pd.DataFrame([(x, y) for x in n_estimators for y in max_depth], columns=['n_estimators', 'max_depth']) hyper_df['n_jobs'] = -1 hyper_df params_df = initial_performance_df.loc[1] params_df AHEAD_DAYS = 1 # Get the normal parameters set params_df = initial_performance_df.loc[AHEAD_DAYS].copy() params_df['ahead_days'] = AHEAD_DAYS tic = time() from predictor.random_forest_predictor import RandomForestPredictor PREDICTOR_NAME = 'random_forest' # Global variables eval_predictor_class = RandomForestPredictor step_eval_days = 60 # The step to move between training/validation pairs # Build the params list params = {'params_df': params_df, 'step_eval_days': step_eval_days, 'eval_predictor_class': eval_predictor_class} results_df = misc.parallelize_dataframe(hyper_df, misc.search_mean_score_eval, params) # Some postprocessing... ----------------------------------------------------------- results_df['r2'] = results_df.apply(lambda x: x['scores'][0], axis=1) results_df['mre'] = results_df.apply(lambda x: x['scores'][1], axis=1) # Pickle that! results_df.to_pickle('../../data/hyper_ahead{}_{}_df.pkl'.format(AHEAD_DAYS, PREDICTOR_NAME)) results_df['r2'].plot() print('Minimum MRE param set: \n {}'.format(results_df.iloc[np.argmin(results_df['mre'])])) print('Maximum R^2 param set: \n {}'.format(results_df.iloc[np.argmax(results_df['r2'])])) # ----------------------------------------------------------------------------------- toc = time() print('Elapsed time: {} seconds.'.format((toc-tic))) AHEAD_DAYS = 7 # Get the normal parameters set params_df = initial_performance_df.loc[AHEAD_DAYS].copy() params_df['ahead_days'] = AHEAD_DAYS tic = time() from predictor.random_forest_predictor import RandomForestPredictor PREDICTOR_NAME = 'random_forest' # Global variables eval_predictor_class = RandomForestPredictor step_eval_days = 60 # The step to move between training/validation pairs # Build the params list params = {'params_df': params_df, 'step_eval_days': step_eval_days, 'eval_predictor_class': eval_predictor_class} results_df = misc.parallelize_dataframe(hyper_df, misc.search_mean_score_eval, params) # Some postprocessing... ----------------------------------------------------------- results_df['r2'] = results_df.apply(lambda x: x['scores'][0], axis=1) results_df['mre'] = results_df.apply(lambda x: x['scores'][1], axis=1) # Pickle that! results_df.to_pickle('../../data/hyper_ahead{}_{}_df.pkl'.format(AHEAD_DAYS, PREDICTOR_NAME)) results_df['r2'].plot() print('Minimum MRE param set: \n {}'.format(results_df.iloc[np.argmin(results_df['mre'])])) print('Maximum R^2 param set: \n {}'.format(results_df.iloc[np.argmax(results_df['r2'])])) # ----------------------------------------------------------------------------------- toc = time() print('Elapsed time: {} seconds.'.format((toc-tic))) AHEAD_DAYS = 14 # Get the normal parameters set params_df = initial_performance_df.loc[AHEAD_DAYS].copy() params_df['ahead_days'] = AHEAD_DAYS tic = time() from predictor.random_forest_predictor import RandomForestPredictor PREDICTOR_NAME = 'random_forest' # Global variables eval_predictor_class = RandomForestPredictor step_eval_days = 60 # The step to move between training/validation pairs # Build the params list params = {'params_df': params_df, 'step_eval_days': step_eval_days, 'eval_predictor_class': eval_predictor_class} results_df = misc.parallelize_dataframe(hyper_df, misc.search_mean_score_eval, params) # Some postprocessing... ----------------------------------------------------------- results_df['r2'] = results_df.apply(lambda x: x['scores'][0], axis=1) results_df['mre'] = results_df.apply(lambda x: x['scores'][1], axis=1) # Pickle that! results_df.to_pickle('../../data/hyper_ahead{}_{}_df.pkl'.format(AHEAD_DAYS, PREDICTOR_NAME)) results_df['r2'].plot() print('Minimum MRE param set: \n {}'.format(results_df.iloc[np.argmin(results_df['mre'])])) print('Maximum R^2 param set: \n {}'.format(results_df.iloc[np.argmax(results_df['r2'])])) # ----------------------------------------------------------------------------------- toc = time() print('Elapsed time: {} seconds.'.format((toc-tic))) AHEAD_DAYS = 28 # Get the normal parameters set params_df = initial_performance_df.loc[AHEAD_DAYS].copy() params_df['ahead_days'] = AHEAD_DAYS tic = time() from predictor.random_forest_predictor import RandomForestPredictor PREDICTOR_NAME = 'random_forest' # Global variables eval_predictor_class = RandomForestPredictor step_eval_days = 60 # The step to move between training/validation pairs # Build the params list params = {'params_df': params_df, 'step_eval_days': step_eval_days, 'eval_predictor_class': eval_predictor_class} results_df = misc.parallelize_dataframe(hyper_df, misc.search_mean_score_eval, params) # Some postprocessing... ----------------------------------------------------------- results_df['r2'] = results_df.apply(lambda x: x['scores'][0], axis=1) results_df['mre'] = results_df.apply(lambda x: x['scores'][1], axis=1) # Pickle that! results_df.to_pickle('../../data/hyper_ahead{}_{}_df.pkl'.format(AHEAD_DAYS, PREDICTOR_NAME)) results_df['r2'].plot() print('Minimum MRE param set: \n {}'.format(results_df.iloc[np.argmin(results_df['mre'])])) print('Maximum R^2 param set: \n {}'.format(results_df.iloc[np.argmax(results_df['r2'])])) # ----------------------------------------------------------------------------------- toc = time() print('Elapsed time: {} seconds.'.format((toc-tic))) AHEAD_DAYS = 56 # Get the normal parameters set params_df = initial_performance_df.loc[AHEAD_DAYS].copy() params_df['ahead_days'] = AHEAD_DAYS tic = time() from predictor.random_forest_predictor import RandomForestPredictor PREDICTOR_NAME = 'random_forest' # Global variables eval_predictor_class = RandomForestPredictor step_eval_days = 60 # The step to move between training/validation pairs # Build the params list params = {'params_df': params_df, 'step_eval_days': step_eval_days, 'eval_predictor_class': eval_predictor_class} results_df = misc.parallelize_dataframe(hyper_df, misc.search_mean_score_eval, params) # Some postprocessing... ----------------------------------------------------------- results_df['r2'] = results_df.apply(lambda x: x['scores'][0], axis=1) results_df['mre'] = results_df.apply(lambda x: x['scores'][1], axis=1) # Pickle that! results_df.to_pickle('../../data/hyper_ahead{}_{}_df.pkl'.format(AHEAD_DAYS, PREDICTOR_NAME)) results_df['r2'].plot() print('Minimum MRE param set: \n {}'.format(results_df.iloc[np.argmin(results_df['mre'])])) print('Maximum R^2 param set: \n {}'.format(results_df.iloc[np.argmax(results_df['r2'])])) # ----------------------------------------------------------------------------------- toc = time() print('Elapsed time: {} seconds.'.format((toc-tic))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Let's first organize the results from the previous notebooks Step2: Which is the best model before hyperparameter tuning? Step3: Before hyperparameter tuning, it seems like the linear regression is doing better in all the predictions. Clearly, as the days ahead are more, the r2 value drops, and the mre goes up. Step4: Build the hyperparameters DataFrame Step5: Ahead days = 1 Step6: Ahead days = 7 Step7: Ahead days = 14 Step8: Ahead days = 28 Step9: Ahead days = 56
9,596
<ASSISTANT_TASK:> Python Code: def AofT(time,T, ai, taui): return ai*np.exp(-time/taui)/(1.+np.exp(-T/(2*taui))) from SimPEG import * import sys sys.path.append("./DoubleLog/") from plotting import mapDat class LinearSurvey(Survey.BaseSurvey): nD = None def __init__(self, time, **kwargs): self.time = time self.nD = time.size def projectFields(self, u): return u class LinearProblem(Problem.BaseProblem): surveyPair = LinearSurvey def __init__(self, mesh, G, **kwargs): Problem.BaseProblem.__init__(self, mesh, **kwargs) self.G = G def fields(self, m, u=None): return self.G.dot(m) def Jvec(self, m, v, u=None): return self.G.dot(v) def Jtvec(self, m, v, u=None): return self.G.T.dot(v) # time = np.cumsum(np.r_[0., 1e-5*np.ones(10), 5e-5*np.ones(10), 1e-4*np.ones(10), 5e-4*np.ones(10), 1e-3*np.ones(10)]) time = np.cumsum(np.r_[0., 1e-5*np.ones(10), 5e-5*np.ones(10),1e-4*np.ones(10), 5e-4*np.ones(10)]) M = 41 tau = np.logspace(-5.1, -1, M) N = time.size A = np.zeros((N, M)) for j in range(M): A[:,j] = np.exp(-time/tau[j])//tau[j] mtrue = np.zeros(M) np.random.seed(1) inds = np.random.random_integers(0, 41, size=5) mtrue[inds] = np.r_[-3, 2, 1, 4, 5] out = np.dot(A,mtrue) fig = plt.figure(figsize=(6,4.5)) ax = plt.subplot(111) for i, ind in enumerate(inds): temp, dum, dum = mapDat(mtrue[inds][i]*np.exp(-time/tau[ind])/tau[j], 1e-1, stretch=2) plt.semilogx(time, temp, 'k', alpha = 0.5) outmap, ticks, tickLabels = mapDat(out, 1e-1, stretch=2) ax.semilogx(time, outmap, 'k', lw=2) ax.set_yticks(ticks) ax.set_yticklabels(tickLabels) # ax.set_ylim(ticks.min(), ticks.max()) ax.set_ylim(ticks.min(), ticks.max()) ax.set_xlim(time.min(), time.max()) ax.grid(True) # from pymatsolver import MumpsSolver abs(survey.dobs).min() mesh = Mesh.TensorMesh([M]) prob = LinearProblem(mesh, A) survey = LinearSurvey(time) survey.pair(prob) survey.makeSyntheticData(mtrue, std=0.01) # survey.dobs = out reg = Regularization.BaseRegularization(mesh) dmis = DataMisfit.l2_DataMisfit(survey) dmis.Wd = 1./(0.05*abs(survey.dobs)+0.05*100.) opt = Optimization.ProjectedGNCG(maxIter=20) # opt = Optimization.InexactGaussNewton(maxIter=20) opt.lower = -1e-10 invProb = InvProblem.BaseInvProblem(dmis, reg, opt) invProb.beta = 1e-4 beta = Directives.BetaSchedule() beta.coolingFactor = 2 target = Directives.TargetMisfit() inv = Inversion.BaseInversion(invProb, directiveList=[beta, target]) m0 = np.zeros_like(survey.mtrue) mrec = inv.run(m0) plt.semilogx(tau, mtrue, '.') plt.semilogx(tau, mrec, '.') fig = plt.figure(figsize=(6,4.5)) ax = plt.subplot(111) obsmap, ticks, tickLabels = mapDat(survey.dobs, 1e0, stretch=2) predmap, dum, dum = mapDat(invProb.dpred, 1e0, stretch=2) ax.loglog(time, survey.dobs, 'k', lw=2) ax.loglog(time, invProb.dpred, 'k.', lw=2) # ax.set_yticks(ticks) # ax.set_yticklabels(tickLabels) # ax.set_ylim(ticks.min(), ticks.max()) # ax.set_ylim(ticks.min(), ticks.max()) ax.set_xlim(time.min(), time.max()) ax.grid(True) time = np.cumsum(np.r_[0., 1e-5*np.ones(10), 5e-5*np.ones(10), 1e-4*np.ones(10), 5e-4*np.ones(10), 1e-3*np.ones(10)]) N = time.size A = np.zeros((N, M)) for j in range(M): A[:,j] = np.exp(-time/tau[j]) /tau[j] mfund = mtrue.copy() mfund[mfund<0.] = 0. obs = np.dot(A, mtrue) fund = np.dot(A, mfund) pred = np.dot(A, mrec) ip = obs-fund ipobs = obs-pred plt.loglog(time, obs, 'k.-', lw=2) plt.loglog(time, -obs, 'k--', lw=2) plt.loglog(time, fund, 'b.', lw=2) plt.loglog(time, pred, 'b-', lw=2) plt.loglog(time, -ip, 'r--', lw=2) plt.loglog(time, abs(ipobs), 'r.', lw=2) plt.ylim(abs(obs).min(), abs(obs).max()) plt.xlim(time.min(), time.max()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Simple exponential basis
9,597
<ASSISTANT_TASK:> Python Code: attend = sns.load_dataset("attention").query("subject <= 12") g = sns.FacetGrid(attend, col="subject", col_wrap=4, size=2, ylim=(0, 10)) g.map(sns.pointplot, "solutions", "score", color=".3", ci=None); tips = sns.load_dataset("tips") with sns.axes_style("white"): g = sns.FacetGrid(tips, row="sex", col="smoker", margin_titles=True, size=2.5) g.map(plt.scatter, "total_bill", "tip", alpha=0.5); g.set_axis_labels("Total bill (US Dollars)", "Tip"); g.set(xticks=[10, 30, 50], yticks=[2, 6, 10]); g.fig.subplots_adjust(wspace=.02, hspace=.02); g = sns.FacetGrid(tips, col="day", size=4, aspect=.5) g.map(sns.barplot, "sex", "total_bill"); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: A slide with just text Step2: Here we show some code
9,598
<ASSISTANT_TASK:> Python Code: from IPython.display import Image Image('images/02_network_flowchart.png') %matplotlib inline import matplotlib.pyplot as plt import tensorflow as tf import numpy as np from sklearn.metrics import confusion_matrix import time from datetime import timedelta import math import os # Use PrettyTensor to simplify Neural Network construction. import prettytensor as pt tf.__version__ pt.__version__ from tensorflow.examples.tutorials.mnist import input_data data = input_data.read_data_sets('data/MNIST/', one_hot=True) print("Size of:") print("- Training-set:\t\t{}".format(len(data.train.labels))) print("- Test-set:\t\t{}".format(len(data.test.labels))) print("- Validation-set:\t{}".format(len(data.validation.labels))) data.test.cls = np.argmax(data.test.labels, axis=1) data.validation.cls = np.argmax(data.validation.labels, axis=1) combined_images = np.concatenate([data.train.images, data.validation.images], axis=0) combined_labels = np.concatenate([data.train.labels, data.validation.labels], axis=0) print(combined_images.shape) print(combined_labels.shape) combined_size = len(combined_images) combined_size train_size = int(0.8 * combined_size) train_size validation_size = combined_size - train_size validation_size def random_training_set(): # Create a randomized index into the full / combined training-set. idx = np.random.permutation(combined_size) # Split the random index into training- and validation-sets. idx_train = idx[0:train_size] idx_validation = idx[train_size:] # Select the images and labels for the new training-set. x_train = combined_images[idx_train, :] y_train = combined_labels[idx_train, :] # Select the images and labels for the new validation-set. x_validation = combined_images[idx_validation, :] y_validation = combined_labels[idx_validation, :] # Return the new training- and validation-sets. return x_train, y_train, x_validation, y_validation # We know that MNIST images are 28 pixels in each dimension. img_size = 28 # Images are stored in one-dimensional arrays of this length. img_size_flat = img_size * img_size # Tuple with height and width of images used to reshape arrays. img_shape = (img_size, img_size) # Number of colour channels for the images: 1 channel for gray-scale. num_channels = 1 # Number of classes, one class for each of 10 digits. num_classes = 10 def plot_images(images, # Images to plot, 2-d array. cls_true, # True class-no for images. ensemble_cls_pred=None, # Ensemble predicted class-no. best_cls_pred=None): # Best-net predicted class-no. assert len(images) == len(cls_true) # Create figure with 3x3 sub-plots. fig, axes = plt.subplots(3, 3) # Adjust vertical spacing if we need to print ensemble and best-net. if ensemble_cls_pred is None: hspace = 0.3 else: hspace = 1.0 fig.subplots_adjust(hspace=hspace, wspace=0.3) # For each of the sub-plots. for i, ax in enumerate(axes.flat): # There may not be enough images for all sub-plots. if i < len(images): # Plot image. ax.imshow(images[i].reshape(img_shape), cmap='binary') # Show true and predicted classes. if ensemble_cls_pred is None: xlabel = "True: {0}".format(cls_true[i]) else: msg = "True: {0}\nEnsemble: {1}\nBest Net: {2}" xlabel = msg.format(cls_true[i], ensemble_cls_pred[i], best_cls_pred[i]) # Show the classes as the label on the x-axis. ax.set_xlabel(xlabel) # Remove ticks from the plot. ax.set_xticks([]) ax.set_yticks([]) # Ensure the plot is shown correctly with multiple plots # in a single Notebook cell. plt.show() # Get the first images from the test-set. images = data.test.images[0:9] # Get the true classes for those images. cls_true = data.test.cls[0:9] # Plot the images and labels using our helper-function above. plot_images(images=images, cls_true=cls_true) x = tf.placeholder(tf.float32, shape=[None, img_size_flat], name='x') x_image = tf.reshape(x, [-1, img_size, img_size, num_channels]) y_true = tf.placeholder(tf.float32, shape=[None, 10], name='y_true') y_true_cls = tf.argmax(y_true, dimension=1) x_pretty = pt.wrap(x_image) with pt.defaults_scope(activation_fn=tf.nn.relu): y_pred, loss = x_pretty.\ conv2d(kernel=5, depth=16, name='layer_conv1').\ max_pool(kernel=2, stride=2).\ conv2d(kernel=5, depth=36, name='layer_conv2').\ max_pool(kernel=2, stride=2).\ flatten().\ fully_connected(size=128, name='layer_fc1').\ softmax_classifier(num_classes=num_classes, labels=y_true) optimizer = tf.train.AdamOptimizer(learning_rate=1e-4).minimize(loss) y_pred_cls = tf.argmax(y_pred, dimension=1) correct_prediction = tf.equal(y_pred_cls, y_true_cls) accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) saver = tf.train.Saver(max_to_keep=100) save_dir = 'checkpoints/' if not os.path.exists(save_dir): os.makedirs(save_dir) def get_save_path(net_number): return save_dir + 'network' + str(net_number) session = tf.Session() def init_variables(): session.run(tf.initialize_all_variables()) train_batch_size = 64 def random_batch(x_train, y_train): # Total number of images in the training-set. num_images = len(x_train) # Create a random index into the training-set. idx = np.random.choice(num_images, size=train_batch_size, replace=False) # Use the random index to select random images and labels. x_batch = x_train[idx, :] # Images. y_batch = y_train[idx, :] # Labels. # Return the batch. return x_batch, y_batch def optimize(num_iterations, x_train, y_train): # Start-time used for printing time-usage below. start_time = time.time() for i in range(num_iterations): # Get a batch of training examples. # x_batch now holds a batch of images and # y_true_batch are the true labels for those images. x_batch, y_true_batch = random_batch(x_train, y_train) # Put the batch into a dict with the proper names # for placeholder variables in the TensorFlow graph. feed_dict_train = {x: x_batch, y_true: y_true_batch} # Run the optimizer using this batch of training data. # TensorFlow assigns the variables in feed_dict_train # to the placeholder variables and then runs the optimizer. session.run(optimizer, feed_dict=feed_dict_train) # Print status every 100 iterations and after last iteration. if i % 100 == 0: # Calculate the accuracy on the training-batch. acc = session.run(accuracy, feed_dict=feed_dict_train) # Status-message for printing. msg = "Optimization Iteration: {0:>6}, Training Batch Accuracy: {1:>6.1%}" # Print it. print(msg.format(i + 1, acc)) # Ending time. end_time = time.time() # Difference between start and end-times. time_dif = end_time - start_time # Print the time-usage. print("Time usage: " + str(timedelta(seconds=int(round(time_dif))))) num_networks = 5 num_iterations = 10000 if True: # For each of the neural networks. for i in range(num_networks): print("Neural network: {0}".format(i)) # Create a random training-set. Ignore the validation-set. x_train, y_train, _, _ = random_training_set() # Initialize the variables of the TensorFlow graph. session.run(tf.global_variables_initializer()) # Optimize the variables using this training-set. optimize(num_iterations=num_iterations, x_train=x_train, y_train=y_train) # Save the optimized variables to disk. saver.save(sess=session, save_path=get_save_path(i)) # Print newline. print() # Split the data-set in batches of this size to limit RAM usage. batch_size = 256 def predict_labels(images): # Number of images. num_images = len(images) # Allocate an array for the predicted labels which # will be calculated in batches and filled into this array. pred_labels = np.zeros(shape=(num_images, num_classes), dtype=np.float) # Now calculate the predicted labels for the batches. # We will just iterate through all the batches. # There might be a more clever and Pythonic way of doing this. # The starting index for the next batch is denoted i. i = 0 while i < num_images: # The ending index for the next batch is denoted j. j = min(i + batch_size, num_images) # Create a feed-dict with the images between index i and j. feed_dict = {x: images[i:j, :]} # Calculate the predicted labels using TensorFlow. pred_labels[i:j] = session.run(y_pred, feed_dict=feed_dict) # Set the start-index for the next batch to the # end-index of the current batch. i = j return pred_labels def correct_prediction(images, labels, cls_true): # Calculate the predicted labels. pred_labels = predict_labels(images=images) # Calculate the predicted class-number for each image. cls_pred = np.argmax(pred_labels, axis=1) # Create a boolean array whether each image is correctly classified. correct = (cls_true == cls_pred) return correct def test_correct(): return correct_prediction(images = data.test.images, labels = data.test.labels, cls_true = data.test.cls) def validation_correct(): return correct_prediction(images = data.validation.images, labels = data.validation.labels, cls_true = data.validation.cls) def classification_accuracy(correct): # When averaging a boolean array, False means 0 and True means 1. # So we are calculating: number of True / len(correct) which is # the same as the classification accuracy. return correct.mean() def test_accuracy(): # Get the array of booleans whether the classifications are correct # for the test-set. correct = test_correct() # Calculate the classification accuracy and return it. return classification_accuracy(correct) def validation_accuracy(): # Get the array of booleans whether the classifications are correct # for the validation-set. correct = validation_correct() # Calculate the classification accuracy and return it. return classification_accuracy(correct) def ensemble_predictions(): # Empty list of predicted labels for each of the neural networks. pred_labels = [] # Classification accuracy on the test-set for each network. test_accuracies = [] # Classification accuracy on the validation-set for each network. val_accuracies = [] # For each neural network in the ensemble. for i in range(num_networks): # Reload the variables into the TensorFlow graph. saver.restore(sess=session, save_path=get_save_path(i)) # Calculate the classification accuracy on the test-set. test_acc = test_accuracy() # Append the classification accuracy to the list. test_accuracies.append(test_acc) # Calculate the classification accuracy on the validation-set. val_acc = validation_accuracy() # Append the classification accuracy to the list. val_accuracies.append(val_acc) # Print status message. msg = "Network: {0}, Accuracy on Validation-Set: {1:.4f}, Test-Set: {2:.4f}" print(msg.format(i, val_acc, test_acc)) # Calculate the predicted labels for the images in the test-set. # This is already calculated in test_accuracy() above but # it is re-calculated here to keep the code a bit simpler. pred = predict_labels(images=data.test.images) # Append the predicted labels to the list. pred_labels.append(pred) return np.array(pred_labels), \ np.array(test_accuracies), \ np.array(val_accuracies) pred_labels, test_accuracies, val_accuracies = ensemble_predictions() print("Mean test-set accuracy: {0:.4f}".format(np.mean(test_accuracies))) print("Min test-set accuracy: {0:.4f}".format(np.min(test_accuracies))) print("Max test-set accuracy: {0:.4f}".format(np.max(test_accuracies))) pred_labels.shape ensemble_pred_labels = np.mean(pred_labels, axis=0) ensemble_pred_labels.shape ensemble_cls_pred = np.argmax(ensemble_pred_labels, axis=1) ensemble_cls_pred.shape ensemble_correct = (ensemble_cls_pred == data.test.cls) ensemble_incorrect = np.logical_not(ensemble_correct) test_accuracies best_net = np.argmax(test_accuracies) best_net test_accuracies[best_net] best_net_pred_labels = pred_labels[best_net, :, :] best_net_cls_pred = np.argmax(best_net_pred_labels, axis=1) best_net_correct = (best_net_cls_pred == data.test.cls) best_net_incorrect = np.logical_not(best_net_correct) np.sum(ensemble_correct) np.sum(best_net_correct) ensemble_better = np.logical_and(best_net_incorrect, ensemble_correct) ensemble_better.sum() best_net_better = np.logical_and(best_net_correct, ensemble_incorrect) best_net_better.sum() def plot_images_comparison(idx): plot_images(images=data.test.images[idx, :], cls_true=data.test.cls[idx], ensemble_cls_pred=ensemble_cls_pred[idx], best_cls_pred=best_net_cls_pred[idx]) def print_labels(labels, idx, num=1): # Select the relevant labels based on idx. labels = labels[idx, :] # Select the first num labels. labels = labels[0:num, :] # Round numbers to 2 decimal points so they are easier to read. labels_rounded = np.round(labels, 2) # Print the rounded labels. print(labels_rounded) def print_labels_ensemble(idx, **kwargs): print_labels(labels=ensemble_pred_labels, idx=idx, **kwargs) def print_labels_best_net(idx, **kwargs): print_labels(labels=best_net_pred_labels, idx=idx, **kwargs) def print_labels_all_nets(idx): for i in range(num_networks): print_labels(labels=pred_labels[i, :, :], idx=idx, num=1) plot_images_comparison(idx=ensemble_better) print_labels_ensemble(idx=ensemble_better, num=1) print_labels_best_net(idx=ensemble_better, num=1) print_labels_all_nets(idx=ensemble_better) plot_images_comparison(idx=best_net_better) print_labels_ensemble(idx=best_net_better, num=1) print_labels_best_net(idx=best_net_better, num=1) print_labels_all_nets(idx=best_net_better) # This has been commented out in case you want to modify and experiment # with the Notebook without having to restart it. # session.close() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Imports Step2: This was developed using Python 3.5.2 (Anaconda) and TensorFlow version Step3: PrettyTensor version Step4: Load Data Step5: The MNIST data-set has now been loaded and consists of 70,000 images and associated labels (i.e. classifications of the images). The data-set is split into 3 mutually exclusive sub-sets, but we will make random training-sets further below. Step6: Class numbers Step7: Helper-function for creating random training-sets Step8: Check that the shape of the combined arrays is correct. Step9: Size of the combined data-set. Step10: Define the size of the training-set used for each neural network. You can try and change this. Step11: We do not use a validation-set during training, but this would be the size. Step12: Helper-function for splitting the combined data-set into a random training- and validation-set. Step13: Data Dimensions Step14: Helper-function for plotting images Step15: Plot a few images to see if data is correct Step16: TensorFlow Graph Step17: The convolutional layers expect x to be encoded as a 4-dim tensor so we have to reshape it so its shape is instead [num_images, img_height, img_width, num_channels]. Note that img_height == img_width == img_size and num_images can be inferred automatically by using -1 for the size of the first dimension. So the reshape operation is Step18: Next we have the placeholder variable for the true labels associated with the images that were input in the placeholder variable x. The shape of this placeholder variable is [None, num_classes] which means it may hold an arbitrary number of labels and each label is a vector of length num_classes which is 10 in this case. Step19: We could also have a placeholder variable for the class-number, but we will instead calculate it using argmax. Note that this is a TensorFlow operator so nothing is calculated at this point. Step20: Neural Network Step21: Now that we have wrapped the input image in a Pretty Tensor object, we can add the convolutional and fully-connected layers in just a few lines of source-code. Step22: Optimization Method Step23: Performance Measures Step24: Then we create a vector of booleans telling us whether the predicted class equals the true class of each image. Step25: The classification accuracy is calculated by first type-casting the vector of booleans to floats, so that False becomes 0 and True becomes 1, and then taking the average of these numbers. Step26: Saver Step27: This is the directory used for saving and retrieving the data. Step28: Create the directory if it does not exist. Step29: This function returns the save-path for the data-file with the given network number. Step30: TensorFlow Run Step31: Initialize variables Step32: Helper-function to create a random training batch. Step33: Function for selecting a random training-batch of the given size. Step34: Helper-function to perform optimization iterations Step35: Create ensemble of neural networks Step36: Number of optimization iterations for each neural network. Step37: Create the ensemble of neural networks. All networks use the same TensorFlow graph that was defined above. For each neural network the TensorFlow weights and variables are initialized to random values and then optimized. The variables are then saved to disk so they can be reloaded later. Step38: Helper-functions for calculating and predicting classifications Step39: Calculate a boolean array whether the predicted classes for the images are correct. Step40: Calculate a boolean array whether the images in the test-set are classified correctly. Step41: Calculate a boolean array whether the images in the validation-set are classified correctly. Step42: Helper-functions for calculating the classification accuracy Step43: Calculate the classification accuracy on the test-set. Step44: Calculate the classification accuracy on the original validation-set. Step45: Results and analysis Step46: Summarize the classification accuracies on the test-set for the neural networks in the ensemble. Step47: The predicted labels of the ensemble is a 3-dim array, the first dim is the network-number, the second dim is the image-number, the third dim is the classification vector. Step48: Ensemble predictions Step49: The ensemble's predicted class number is then the index of the highest number in the label, which is calculated using argmax as usual. Step50: Boolean array whether each of the images in the test-set was correctly classified by the ensemble of neural networks. Step51: Negate the boolean array so we can use it to lookup incorrectly classified images. Step52: Best neural network Step53: The index of the neural network with the highest classification accuracy. Step54: The best neural network's classification accuracy on the test-set. Step55: Predicted labels of the best neural network. Step56: The predicted class-number. Step57: Boolean array whether the best neural network classified each image in the test-set correctly. Step58: Boolean array whether each image is incorrectly classified. Step59: Comparison of ensemble vs. the best single network Step60: The number of images in the test-set that were correctly classified by the best neural network. Step61: Boolean array whether each image in the test-set was correctly classified by the ensemble and incorrectly classified by the best neural network. Step62: Number of images in the test-set where the ensemble was better than the best single network Step63: Boolean array whether each image in the test-set was correctly classified by the best single network and incorrectly classified by the ensemble. Step64: Number of images in the test-set where the best single network was better than the ensemble. Step65: Helper-functions for plotting and printing comparisons Step66: Function for printing the predicted labels. Step67: Function for printing the predicted labels for the ensemble of neural networks. Step68: Function for printing the predicted labels for the best single network. Step69: Function for printing the predicted labels of all the neural networks in the ensemble. This only prints the labels for the first image. Step70: Examples Step71: The ensemble's predicted labels for the first of these images (top left image) Step72: The best network's predicted labels for the first of these images Step73: The predicted labels of all the networks in the ensemble, for the first of these images Step74: Examples Step75: The ensemble's predicted labels for the first of these images (top left image) Step76: The best single network's predicted labels for the first of these images Step77: The predicted labels of all the networks in the ensemble, for the first of these images Step78: Close TensorFlow Session
9,599
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np df = pd.DataFrame(np.random.randn(8, 4), columns=['A', 'B', 'C', 'D']) df["A"] #indexing df.A #attribute type(df.A) df.A[0] df[["A","B"]] type(df[["A","B"]]) s = df["A"] s[:5] s[::2] s[::-1] df[:3] # for convenience as it is a common use df["A"] df.loc[:,"B":] df.loc[4:,"C":] = 0 df df.loc[:,"A"]>0 df.loc[df.loc[:,"A"]>0] df.iloc[0,0] df.iloc[3:,2:] df.iloc[[0,1,3],[1,3]] df.loc[:,lambda df: df.columns == "A"] df["X"] = range(0, df.shape[0]) df df[df["X"].isin([0,2])] df.where(df["A"]>0) df.where(df["A"]>0,100) s * 2 s.max() np.max(s) s.apply(np.max) def multiply_by_2(x): return x*2 s.apply(multiply_by_2) s.apply(lambda x: x*2) s.map(lambda x: x*2) mydict={2:"a"} df["X"].map(mydict) df.apply(np.max,axis=0) df.apply(np.max,axis=1) df.applymap(lambda x: x*2) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Slicing ranges Step2: Watchout... this is a rather incoherent use of the indexinf method over rows. That's why it is said that loc provides a more coherent use. Step3: The .loc attribute is the primary access method. The following are valid inputs Step4: Boolean accessing Step5: Accessing by position by .iloc Step6: Selection by callable Step7: Selection by isin Step8: The where() Method Step9: Applying Functions Step10: Over dataframes