Datasets:
Tasks:
Table Question Answering
Modalities:
Text
Formats:
json
Languages:
English
Size:
10K - 100K
License:
instruction stringclasses 1
value | input stringlengths 4 139 | output stringlengths 165 168 |
|---|---|---|
Based on the given SMILES string, predict the monomer's relevant properties. | CC(O)c1cc(Br)ccc1Br | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=Cc1cc(Br)cc(Br)c1O | The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Oc1c(S)cc(Br)cc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 272.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NNc1cc(Br)cc(Br)c1O | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CCCc1c(Br)cncc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NNc1c(Br)cncc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 232.93 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1cc(Br)c(C2CO2)s1 | The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | SCc1sc(Br)cc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 256.98 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Sc1sc(Br)cc1Br | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.8 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | N=C(N)c1sc(Br)cc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 259.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1ccc(Br)c(C2CO2)c1 | The compound has a boiling point of 215.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1cncc(Br)c1C1CO1 | The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | N#CCCc1c(Br)cncc1Br | The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 220.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(C#N)c1c(Br)cncc1Br | The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 0, and a molar mass of 246.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NOCc1c(Br)cncc1Br | The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.94 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(C)(O)c1cc(Br)c(Br)o1 | The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 244.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=CCc1ccc(Br)cc1Br | The compound has a boiling point of 315.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CCc1c(Br)cncc1Br | The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 221.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NOCc1ccc(Br)cc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C=Nc1c(Br)cncc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 244.87 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CC(C)c1c(Br)cncc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 234.95 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1cc(C2CO2)oc1Br | The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.86 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | OCCc1sc(Br)cc1Br | The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.98 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC1(c2cc(Br)c(Br)o2)CO1 | The compound has a boiling point of 220.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(O)c1cc(Br)c(Br)o1 | The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=Cc1sc(Br)cc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Oc1cc(Br)c(Br)o1 | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.81 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Oc1sc(Br)cc1Br | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.87 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | OCc1sc(Br)cc1Br | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.94 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | ONCc1ccc(Br)cc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 251.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(C#N)c1ccc(Br)cc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.94 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=Cc1cc(Br)ccc1Br | The compound has a boiling point of 315.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1ccc(C2CO2)c(Br)c1 | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CCc1ccc(Br)cc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CCc1cc(Br)ccc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | SCc1cc(Br)cnc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.04 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CC(C)c1cc(Br)ccc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 234.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | N=C(N)c1ccc(Br)cc1Br | The compound has a boiling point of 305.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.85 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NOCc1cc(Br)ccc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 251.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=Cc1ccc(Br)cc1Br | The compound has a boiling point of 326.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.89 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NNc1cc(Br)c(O)c(Br)c1 | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=CC=Cc1ccc(Br)cc1Br | The compound has a boiling point of 315.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#Cc1ccc(Br)cc1Br | The compound has a boiling point of 326.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.86 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(O)c1c(Br)cncc1Br | The compound has a boiling point of 260.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(O)c1ccc(Br)c(Br)c1 | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=CC(=O)c1ccc(Br)c(Br)c1 | The compound has a boiling point of 305.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CCc1cc(Br)c(O)c(Br)c1 | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 243.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#Cc1cc(Br)c(OC)c(Br)c1 | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 244.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=Cc1cc(Br)c(O)c(Br)c1 | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 243.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C=Nc1ccc(Br)c(Br)c1 | The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 244.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#Cc1cc(Br)cnc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 207.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(C#N)c1ncc(Br)cc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 0, and a molar mass of 243.94 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(O)c1cc(Br)cnc1Br | The compound has a boiling point of 280.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1cnc(C2CO2)c(Br)c1 | The compound has a boiling point of 230.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.87 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=Cc1cc(Br)cnc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 221.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1cccc(Br)c1C1CO1 | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Brc1ccc(C2CO2)cc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.87 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=CC=Cc1c(Br)cccc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CCCc1c(Br)cccc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(O)c1c(Br)cccc1Br | The compound has a boiling point of 260.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 215.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | N=C(N)c1c(Br)cccc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CCc1c(Br)cccc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#CC(C)c1c(Br)cccc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 243.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=Cc1c(Br)cccc1Br | The compound has a boiling point of 285.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | ONCc1c(Br)cccc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 246.92 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C#Cc1c(Br)cccc1Br | The compound has a boiling point of 326.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NNc1cc(Br)cnc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 229.93 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=CCc1cc(Br)cnc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 0, solubility rating of 1, and a molar mass of 246.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | NOCc1c(Br)cccc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 259.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=CC(=O)c1c(Br)cccc1Br | The compound has a boiling point of 320.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 251.91 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | SCc1c(Br)cccc1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 246.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | COCOc1c(Br)cc(F)cc1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CCCCNC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 287.05 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Nc1ccncc1)c1cc(Br)ccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 319.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CCCCCCNC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.07 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(O)c1cnn(Cc2ccccc2Br)c1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 344.1 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | COC(CNC(=O)c1cc(Br)ccc1Br)OC | The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 335.05 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | COC(=O)C(C)NC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 312.04 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Cc1ccc(Br)cc1)Nc1ncccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 312.1 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Nc1ccc(Cl)cc1)c1cc(Br)ccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Nc1ccccc1Cl)c1cc(Br)ccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.04 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Cc1ccccc1NC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 327.1 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | C=C(C)COc1c(Br)cc(C=O)cc1Br | The compound has a boiling point of 280.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Cc1cc(Br)c(S(=O)(=O)NC(C)(C)C)cc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 355.1 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(c1ccc(Br)nc1)c1ccc(Br)nc1 | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.04 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Nc1ccccc1NC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 360.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 317.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=S(=O)(Cl)Cc1cccc(Br)c1Br | The compound has a boiling point of 280.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 306.94 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Cc1c(Br)csc1Br | The compound has a boiling point of 279.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 215.94 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(O)Cc1cc(Br)sc1Br | The compound has a boiling point of 320.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 282.9 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(=O)SCc1cccc(Br)c1Br | The compound has a boiling point of 310.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 272.05 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Nc1ncccc1Br)c1ccccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 311.1 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Nc1ncccc1Br)c1ccc(Br)cc1 | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 320.1 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | Cc1ccc(Br)c(NC(=O)c2cccc(Br)c2)c1 | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.1 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Nc1cccc(Cl)c1)c1cc(Br)ccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.44 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CCOC(=O)CNC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 322.05 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | O=C(Nc1ccccc1F)c1cc(Br)ccc1Br | The compound has a boiling point of 350.0 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 344.0 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(=O)NCCNC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 1, and a molar mass of 312.05 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CCCCCNC(=O)c1cc(Br)ccc1Br | The compound has a boiling point of 320.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 313.06 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CCOC(=O)C(N)Cc1cc(Br)cc(Br)c1 | The compound has a boiling point of 320.5 °C, flammability rating of 0, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 313.04 g/mol. |
Based on the given SMILES string, predict the monomer's relevant properties. | CC(C)=CCOc1c(Br)cc(Br)cc1C=O | The compound has a boiling point of 280.5 °C, flammability rating of 1, toxicity level of 1, odor rating of 1, solubility rating of 0, and a molar mass of 282.0 g/mol. |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 9