text
stringlengths
8
4.13M
use eosio::*; use std::collections::VecDeque; /// <https://github.com/EOSIO/eosio.contracts/blob/c046863a65d7e98424312ee8009f0acb493e6231/contracts/eosio.system/include/eosio.system/eosio.system.hpp#L216-L227> #[derive(Read, Write, NumBytes, Debug, Clone)] pub struct RexPool { pub version: u8, /// total amount of CORE_SYMBOL in open rex_loans pub total_lent: Asset, /// total amount of CORE_SYMBOL available to be lent (connector) pub total_unlent: Asset, /// fees received in exchange for lent (connector) pub total_rent: Asset, /// total amount of CORE_SYMBOL that have been lent (total_unlent + total_lent) pub total_lendable: Asset, /// total number of REX shares allocated to contributors to total_lendable pub total_rex: Asset, /// the amount of CORE_SYMBOL to be transferred from namebids to REX pool pub namebid_proceeds: Asset, /// increments with each new loan pub loan_num: u64, } impl Table for RexPool { const NAME: TableName = TableName::new(n!("rexpool")); type Row = Self; fn primary_key(_row: &Self::Row) -> u64 { 0 } } /// <https://github.com/EOSIO/eosio.contracts/blob/c046863a65d7e98424312ee8009f0acb493e6231/contracts/eosio.system/include/eosio.system/eosio.system.hpp#L231-L237> #[derive(Table, Read, Write, NumBytes, Debug, Clone)] #[eosio(table_name = "rexfund")] pub struct RexFund { pub version: u8, /// owner of the rex fund #[eosio(primary_key)] pub owner: AccountName, /// balance of the fund. pub balance: Asset, } /// <https://github.com/EOSIO/eosio.contracts/blob/c046863a65d7e98424312ee8009f0acb493e6231/contracts/eosio.system/include/eosio.system/eosio.system.hpp#L241-L250> #[derive(Table, Read, Write, NumBytes, Debug, Clone)] #[eosio(table_name = "rexbal")] pub struct RexBalance { pub version: u8, /// owner of the rex fund #[eosio(primary_key)] pub owner: AccountName, /// the amount of CORE_SYMBOL currently included in owner's vote pub vote_stake: Asset, /// the amount of REX owned by owner pub rex_balance: Asset, /// matured REX available for selling pub matured_rex: i64, /// REX daily maturity buckets pub rex_maturities: VecDeque<(TimePointSec, i64)>, } /// <https://github.com/EOSIO/eosio.contracts/blob/c046863a65d7e98424312ee8009f0acb493e6231/contracts/eosio.system/include/eosio.system/eosio.system.hpp#L254-L267> #[derive(Read, Write, NumBytes, Debug, Clone)] pub struct RexLoan { pub version: u8, pub from: AccountName, pub receiver: AccountName, pub payment: Asset, pub balance: Asset, pub total_staked: Asset, pub loan_num: u64, pub expiration: TimePoint, } /// <https://github.com/EOSIO/eosio.contracts/blob/c046863a65d7e98424312ee8009f0acb493e6231/contracts/eosio.system/include/eosio.system/eosio.system.hpp#L279-L291> #[derive(Read, Write, NumBytes, Debug, Clone)] pub struct RexOrder { pub version: u8, pub owner: AccountName, pub rex_requested: Asset, pub proceeds: Asset, pub stake_change: Asset, pub order_time: TimePoint, pub is_open: bool, } /// <https://github.com/EOSIO/eosio.contracts/blob/c046863a65d7e98424312ee8009f0acb493e6231/contracts/eosio.system/include/eosio.system/eosio.system.hpp#L296-L300> pub struct RexOrderOutcome { pub success: bool, pub proceeds: Asset, pub stake_change: Asset, } /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L10-L22> #[eosio::action] pub fn deposit(owner: AccountName, amount: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L24-L37> #[eosio::action] pub fn withdraw(owner: AccountName, amount: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L39-L54> #[eosio::action] pub fn buyrex(from: AccountName, amount: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L56-L94> #[eosio::action] pub fn unstaketorex( owner: AccountName, receiver: AccountName, from_net: Asset, from_cpu: Asset, ) { } /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L96-L144> #[eosio::action] pub fn sellrex(from: AccountName, rex: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L146-L153> #[eosio::action] pub fn cnclrexorder(owner: AccountName) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L155-L162> #[eosio::action] pub fn rentcpu( from: AccountName, receiver: AccountName, loan_payment: Asset, loan_fund: Asset, ) { } /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L164-L171> #[eosio::action] pub fn rentnet( from: AccountName, receiver: AccountName, loan_payment: Asset, loan_fund: Asset, ) { } /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L173-L179> #[eosio::action] pub fn fundcpuloan(from: AccountName, loan_num: u64, payment: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L181-L187> #[eosio::action] pub fn fundnetloan(from: AccountName, loan_num: u64, payment: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L189-L195> #[eosio::action] pub fn defcpuloan(from: AccountName, loan_num: u64, amount: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L197-L203> #[eosio::action] pub fn defnetloan(from: AccountName, loan_num: u64, amount: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L205-L229> #[eosio::action] pub fn updaterex(owner: AccountName) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L231-L241> #[eosio::action] pub fn setrex(balance: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L243-L248> #[eosio::action] pub fn rexexec(user: AccountName, max: u16) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L250-L259> #[eosio::action] pub fn consolidate(owner: AccountName) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L261-L293> #[eosio::action] pub fn mvtosavings(owner: AccountName, rex: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L295-L316> #[eosio::action] pub fn mvfrsavings(owner: AccountName, rex: Asset) {} /// <https://github.com/EOSIO/eosio.contracts/blob/v1.9.0-rc3/contracts/eosio.system/src/rex.cpp#L318-L353> #[eosio::action] pub fn closerex(owner: AccountName) {}
// Copyright (c) The Starcoin Core Contributors // SPDX-License-Identifier: Apache-2.0 use anyhow::Result; use crypto::HashValue; use starcoin_config::ChainConfig; use starcoin_state_api::ChainState; use types::{ account_address::AccountAddress, state_set::ChainStateSet, transaction::{RawUserTransaction, SignedUserTransaction, Transaction, TransactionOutput}, vm_error::VMStatus, }; pub mod block_executor; pub mod executor; #[cfg(test)] pub mod executor_test; pub mod mock_executor; pub trait TransactionExecutor: std::marker::Unpin + Clone { /// Create genesis state, return state root and state set. fn init_genesis(config: &ChainConfig) -> Result<(HashValue, ChainStateSet)>; /// Execute transaction, update state to state_store, and return events and TransactionStatus. fn execute_transaction( chain_state: &dyn ChainState, txn: Transaction, ) -> Result<TransactionOutput>; /// Executes the prologue and verifies that the transaction is valid. fn validate_transaction( chain_state: &dyn ChainState, txn: SignedUserTransaction, ) -> Option<VMStatus>; fn build_mint_txn( addr: AccountAddress, auth_key_prefix: Vec<u8>, seq_num: u64, amount: u64, ) -> Transaction; fn build_transfer_txn( sender: AccountAddress, sender_auth_key_prefix: Vec<u8>, receiver: AccountAddress, receiver_auth_key_prefix: Vec<u8>, seq_num: u64, amount: u64, ) -> RawUserTransaction; }
use advent::helpers; use anyhow::{Context, Result}; use derive_more::Display; use itertools::Itertools; use lazy_static::lazy_static; use regex::Regex; use std::str::FromStr; #[derive(Debug, Display, Clone)] enum BitOp { #[display(fmt = "{}", _0)] Override(char), #[display(fmt = "X")] Pass, } type BitOps = Vec<BitOp>; #[derive(Debug, Display, Clone)] enum BitOpV2 { #[display(fmt = "0")] Pass, #[display(fmt = "1")] OverrideWithOne, #[display(fmt = "X")] Floating, } type BitOpsV2 = Vec<BitOpV2>; #[derive(Debug, Display)] enum Op { #[display(fmt = "mask = {}", _0)] SetMask(Mask), #[display(fmt = "{}", _0)] WriteMemory(WriteMemoryArgs), } type Ops = Vec<Op>; #[derive(Debug, Display)] enum OpV2 { #[display(fmt = "mask = {}", _0)] SetMask(MaskV2), #[display(fmt = "{}", _0)] WriteMemory(WriteMemoryArgs), } type OpsV2 = Vec<OpV2>; #[derive(Debug, Clone)] struct Mask { bit_ops: BitOps, } #[derive(Debug, Clone)] struct MaskV2 { bit_ops: BitOpsV2, floating_op_indices: Vec<usize>, } #[derive(Debug, Display)] #[display(fmt = "mem[{}] = {}", address, value)] struct WriteMemoryArgs { address: u64, value: u64, } #[derive(Debug, Default, Display)] #[display(fmt = "{}\n{:?}", mask, memory)] struct Memory { memory: std::collections::HashMap<u64, u64>, mask: Mask, } #[derive(Debug, Default, Display)] #[display(fmt = "{}\n{:?}", mask, memory)] struct MemoryV2 { memory: std::collections::HashMap<u64, u64>, mask: MaskV2, } impl FromStr for BitOp { type Err = anyhow::Error; fn from_str(s: &str) -> Result<Self, Self::Err> { match s.chars().next() { None => anyhow::bail!("No mask character"), Some('X') => Ok(BitOp::Pass), Some('0') => Ok(BitOp::Override('0')), Some('1') => Ok(BitOp::Override('1')), Some(e) => anyhow::bail!(format!("Invalid mask character: {}", e)), } } } impl FromStr for BitOpV2 { type Err = anyhow::Error; fn from_str(s: &str) -> Result<Self, Self::Err> { Ok(BitOpV2::from_bit_op(s.parse::<BitOp>()?)) } } impl BitOpV2 { fn from_bit_op(op: BitOp) -> BitOpV2 { match op { BitOp::Pass => BitOpV2::Floating, BitOp::Override(c) => match c { '0' => BitOpV2::Pass, '1' => BitOpV2::OverrideWithOne, _ => unreachable!(), }, } } } impl FromStr for WriteMemoryArgs { type Err = anyhow::Error; fn from_str(s: &str) -> Result<Self, Self::Err> { lazy_static! { static ref RE: Regex = Regex::new(r"mem\[(\d+)\] = (\d+)").unwrap(); } // let re: Regex = Regex::new(r"mem\[(\d+)\] = (\d+)").unwrap(); // mem[7001] = 347 let caps = RE .captures(s) .ok_or_else(|| anyhow::anyhow!("No regex match found for memory args"))?; let address = caps .get(1) .ok_or_else(|| anyhow::anyhow!("No match for address"))? .as_str() .parse::<u64>()?; let value = caps .get(2) .ok_or_else(|| anyhow::anyhow!("No match for value"))? .as_str() .parse::<u64>()?; Ok(WriteMemoryArgs { address, value }) } } impl FromStr for Mask { type Err = anyhow::Error; fn from_str(s: &str) -> Result<Self, Self::Err> { lazy_static! { static ref RE: Regex = Regex::new(r"mask = ([01X]+)").unwrap(); } // let re: Regex = Regex::new(r"mask = ([01X]+)").unwrap(); // mask = XXXXXXXXXXXXXXXXXXXXXXXXXXXXX1XXXX0X let caps = RE .captures(s) .ok_or_else(|| anyhow::anyhow!("No regex match found for mask"))?; let maybe_mask = caps .get(1) .ok_or_else(|| anyhow::anyhow!("No match for mask"))? .as_str(); if maybe_mask.len() != 36 { anyhow::bail!(format!( "Mask {} has invalid length: {}", maybe_mask, maybe_mask.len() )); } let bit_ops = maybe_mask .trim() .chars() .map(|c| c.to_string().parse::<BitOp>()) .try_collect()?; Ok(Mask { bit_ops }) } } impl FromStr for MaskV2 { type Err = anyhow::Error; fn from_str(s: &str) -> Result<Self, Self::Err> { Ok(MaskV2::from_mask(s.parse::<Mask>()?)) } } impl MaskV2 { fn from_mask(mask: Mask) -> MaskV2 { let bit_ops = mask .bit_ops .into_iter() .map(BitOpV2::from_bit_op) .collect_vec(); // Pre-compute floating bit indicies, which will be modified // when applying the mask to an address. let floating_op_indices = bit_ops .iter() .enumerate() .filter_map(|(index, op)| { if let BitOpV2::Floating = op { Some(index) } else { None } }) .collect_vec(); MaskV2 { bit_ops, floating_op_indices, } } } impl FromStr for Op { type Err = anyhow::Error; fn from_str(s: &str) -> Result<Self, Self::Err> { match &s[0..3] { "mas" => Ok(Op::SetMask(s.parse()?)), "mem" => Ok(Op::WriteMemory(s.parse()?)), _ => anyhow::bail!("Invalid operation"), } } } impl FromStr for OpV2 { type Err = anyhow::Error; fn from_str(s: &str) -> Result<Self, Self::Err> { match &s[0..3] { "mas" => Ok(OpV2::SetMask(s.parse()?)), "mem" => Ok(OpV2::WriteMemory(s.parse()?)), _ => anyhow::bail!("Invalid operation"), } } } impl std::fmt::Display for Mask { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { for op in &self.bit_ops { write!(f, "{}", op)?; } Ok(()) } } impl Default for Mask { fn default() -> Self { Mask { bit_ops: vec![BitOp::Pass; 36], } } } impl std::fmt::Display for MaskV2 { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { for op in &self.bit_ops { write!(f, "{}", op)?; } Ok(()) } } impl Default for MaskV2 { fn default() -> Self { MaskV2 { bit_ops: vec![BitOpV2::Pass; 36], floating_op_indices: vec![], } } } #[allow(unused)] fn print_ops(ops: &[Op]) { for op in ops { println!("{}", op); } } #[allow(unused)] fn print_memory(mem: &Memory) { println!("{}", mem); } impl Memory { fn apply_ops(&mut self, ops: &[Op]) { ops.iter().for_each(|op| match op { Op::SetMask(mask) => self.mask = mask.clone(), Op::WriteMemory(args) => { self.memory .insert(args.address, apply_mask(args.value, &self.mask)); } }); } } impl MemoryV2 { fn apply_ops(&mut self, ops: &[OpV2]) { ops.iter().for_each(|op| match op { OpV2::SetMask(mask) => self.mask = mask.clone(), OpV2::WriteMemory(args) => { let mask = self.mask.clone(); apply_mask_v2(args.address, &mask).for_each(|address| { self.memory.insert(address, args.value); }) } }); } } fn apply_mask(value: u64, mask: &Mask) -> u64 { let value_str = format!("{:036b}", value); let masked_value_str = value_str .chars() .zip(mask.bit_ops.iter()) .map(|(digit, bit_op)| match bit_op { BitOp::Pass => digit, BitOp::Override(o) => *o, }) .collect::<String>(); u64::from_str_radix(&masked_value_str, 2).expect("Invalid string to int conversion") } fn apply_mask_v2(value: u64, mask: &MaskV2) -> impl Iterator<Item = u64> + '_ { let value_str = format!("{:036b}", value); let masked_value_str = value_str .chars() .zip(mask.bit_ops.iter()) .map(|(digit, bit_op)| match bit_op { BitOpV2::Pass => digit, BitOpV2::OverrideWithOne => '1', BitOpV2::Floating => '0', }) .collect::<String>(); // Generate all subsets of indices that should be set to 1 // and modify a clone of the mask string with the modified indices. mask.floating_op_indices .iter() .powerset() .map(move |indices| { let mut mask_str = masked_value_str.clone(); let mut bytes = std::mem::take(&mut mask_str).into_bytes(); indices.iter().for_each(|&i| bytes[*i] = b'1'); let mask_str = String::from_utf8(bytes).expect("Invalid utf8 bytes to string conversion"); u64::from_str_radix(&mask_str, 2).expect("Invalid string to int conversion") }) } fn parse_writes_and_masks(s: &str) -> anyhow::Result<Ops> { s.trim().lines().map(|l| l.parse::<Op>()).try_collect() } fn parse_writes_and_masks_v2(s: &str) -> anyhow::Result<OpsV2> { s.trim().lines().map(|l| l.parse::<OpV2>()).try_collect() } fn compute_sum_of_all_values_in_memory(s: &str) -> u64 { let ops = parse_writes_and_masks(s).expect("Invalid ops"); let mut memory = Memory::default(); memory.apply_ops(&ops); memory.memory.iter().map(|e| e.1).sum() } fn compute_sum_of_all_values_in_memory_v2(s: &str) -> u64 { let ops = parse_writes_and_masks_v2(s).expect("Invalid ops"); let mut memory = MemoryV2::default(); memory.apply_ops(&ops); memory.memory.iter().map(|e| e.1).sum() } fn solve_p1() -> Result<()> { let input = helpers::get_data_from_file_res("d14").context("Coudn't read file contents.")?; let result = compute_sum_of_all_values_in_memory(&input); println!("The sum of all values in memory is: {}", result); Ok(()) } fn solve_p2() -> Result<()> { let input = helpers::get_data_from_file_res("d14").context("Coudn't read file contents.")?; let result = compute_sum_of_all_values_in_memory_v2(&input); println!( "The sum of all values in memory using decoder V2 is: {}", result ); Ok(()) } fn main() -> Result<()> { solve_p1().ok(); solve_p2() } #[cfg(test)] mod tests { use super::*; #[test] fn test_p1() { let input = "mask = XXXXXXXXXXXXXXXXXXXXXXXXXXXXX1XXXX0X mem[8] = 11 mem[7] = 101 mem[8] = 0"; let result = compute_sum_of_all_values_in_memory(input); assert_eq!(result, 165); } #[test] fn test_p2() { let input = "mask = 000000000000000000000000000000X1001X mem[42] = 100 mask = 00000000000000000000000000000000X0XX mem[26] = 1"; let result = compute_sum_of_all_values_in_memory_v2(input); assert_eq!(result, 208); } }
#[cfg(test)] mod tests { struct Context<'a>(&'a str); // 'b >= 'a struct Parser<'a, 'b: 'a> { context: &'a Context<'b>, } impl<'a, 'b> Parser<'a, 'b> { fn parse(&self) -> Result<(), &'b str> { Err(&self.context.0[1..]) } } //获得了所有权 fn parse_context(context: Context) -> Result<(), &str> { Parser { context: &context }.parse() } #[test] fn work() {} mod generic { //指定 T 中的任何引用需至少与 'a 存活的一样久 // T >= 'a struct Ref<'a, T: 'a>(&'a T); //T 包含任何引用,他们必须有 'static 生命周期 struct StaticRef<T: 'static>(&'static T); } mod trait_demo { trait Red {} struct Ball<'a> { diameter: &'a i32, } impl<'a> Red for Ball<'a> {} #[test] fn main() { let num = 5; let _obj = Box::new(Ball { diameter: &num }) as Box<dyn Red>; } } mod noname { use std::fmt; use std::fmt::{Error, Formatter}; struct StrWrap<'a>(&'a str); fn foo<'a>(string: &'a str) -> StrWrap<'a> { StrWrap(string) } fn foo2(string: &str) -> StrWrap<'_> { StrWrap(string) } fn foo3(string: &str) -> StrWrap { StrWrap(string) } // // 冗余 // impl<'a> fmt::Debug for StrWrap<'a> { // fn fmt(&self, f: &mut Formatter<'_>) -> Result<(), Error> { // unimplemented!() // } // } // // // 省略 // impl fmt::Debug for StrWrap<'_> { // fn fmt(&self, f: &mut Formatter<'_>) -> Result<(), Error> { // unimplemented!() // } // } // 省略 impl fmt::Debug for StrWrap<'_> { fn fmt(&self, _f: &mut Formatter<'_>) -> Result<(), Error> { unimplemented!() } } } }
extern crate reqwest; extern crate serde_json; extern crate ws; extern crate stellar_client; extern crate futures; extern crate futures_timer; pub mod meetup;
use super::interfaces::block::BlockState; use super::interfaces::messenger::{Messenger, SubscriberType}; use super::interfaces::patchwork::PatchworkState; use super::interfaces::player::{Angle, Player, PlayerState, Position}; use super::packet; use super::packet::Packet; use super::translation::TranslationUpdates; use uuid::Uuid; pub fn handle_login_packet< M: Messenger + Clone, P: PlayerState + Clone, PA: PatchworkState + Clone, B: BlockState + Clone, >( p: Packet, conn_id: Uuid, messenger: M, player_state: P, block_state: B, patchwork_state: PA, ) -> TranslationUpdates { match p { Packet::LoginStart(login_start) => { confirm_login( conn_id, messenger, login_start, player_state, block_state, patchwork_state, ); TranslationUpdates::State(3) } _ => { panic!("Login failed"); } } } fn confirm_login< M: Messenger + Clone, P: PlayerState + Clone, PA: PatchworkState + Clone, B: BlockState + Clone, >( conn_id: Uuid, messenger: M, login_start: packet::LoginStart, player_state: P, block_state: B, patchwork_state: PA, ) { let player = Player { conn_id, uuid: Uuid::new_v4(), name: login_start.username, entity_id: 0, // replaced by player state position: Position { x: 5.0, y: 16.0, z: 5.0, }, angle: Angle { pitch: 0.0, yaw: 0.0, }, }; //protocol login_success(conn_id, messenger.clone(), player.clone()); //update the gamestate with this new player player_state.new_player(conn_id, player); block_state.report(conn_id); messenger.subscribe(conn_id, SubscriberType::All); player_state.report(conn_id); patchwork_state.report(); } fn login_success<M: Messenger>(conn_id: Uuid, messenger: M, player: Player) { let login_success = packet::LoginSuccess { uuid: player.uuid.to_hyphenated().to_string(), username: player.name, }; messenger.send_packet(conn_id, Packet::LoginSuccess(login_success)); }
#![feature(unchecked_math)] mod basic; mod cache; mod combinatorics; mod digits; mod error; mod gamma; mod linear; mod prime; pub use basic::*; pub use cache::{Cache, GlobalCache}; pub use error::{Error, Result}; pub use gamma::*; pub use linear::*; pub use prime::*;
#![allow(unused_variables, non_upper_case_globals, non_snake_case, unused_unsafe, non_camel_case_types, dead_code, clippy::all)] pub const Catalog: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22881_8a19_11d0_81b6_00a0c9231c29); pub const CatalogCollection: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22883_8a19_11d0_81b6_00a0c9231c29); pub const CatalogObject: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22882_8a19_11d0_81b6_00a0c9231c29); pub const ComponentUtil: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22884_8a19_11d0_81b6_00a0c9231c29); #[repr(transparent)] #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: clone :: Clone, :: core :: fmt :: Debug)] pub struct ICatalog(pub ::windows::core::IUnknown); impl ICatalog { #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com"))] pub unsafe fn GetCollection<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrcollname: Param0) -> ::windows::core::Result<super::Com::IDispatch> { let mut result__: <super::Com::IDispatch as ::windows::core::Abi>::Abi = ::core::mem::zeroed(); (::windows::core::Interface::vtable(self).7)(::core::mem::transmute_copy(self), bstrcollname.into_param().abi(), &mut result__).from_abi::<super::Com::IDispatch>(result__) } #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com"))] pub unsafe fn Connect<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrconnectstring: Param0) -> ::windows::core::Result<super::Com::IDispatch> { let mut result__: <super::Com::IDispatch as ::windows::core::Abi>::Abi = ::core::mem::zeroed(); (::windows::core::Interface::vtable(self).8)(::core::mem::transmute_copy(self), bstrconnectstring.into_param().abi(), &mut result__).from_abi::<super::Com::IDispatch>(result__) } pub unsafe fn MajorVersion(&self, retval: *mut i32) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).9)(::core::mem::transmute_copy(self), ::core::mem::transmute(retval)).ok() } pub unsafe fn MinorVersion(&self, retval: *mut i32) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).10)(::core::mem::transmute_copy(self), ::core::mem::transmute(retval)).ok() } } unsafe impl ::windows::core::Interface for ICatalog { type Vtable = ICatalog_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22870_8a19_11d0_81b6_00a0c9231c29); } impl ::core::convert::From<ICatalog> for ::windows::core::IUnknown { fn from(value: ICatalog) -> Self { value.0 } } impl ::core::convert::From<&ICatalog> for ::windows::core::IUnknown { fn from(value: &ICatalog) -> Self { value.0.clone() } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for ICatalog { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Owned(self.0) } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for &'a ICatalog { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Borrowed(&self.0) } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<ICatalog> for super::Com::IDispatch { fn from(value: ICatalog) -> Self { unsafe { ::core::mem::transmute(value) } } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<&ICatalog> for super::Com::IDispatch { fn from(value: &ICatalog) -> Self { ::core::convert::From::from(::core::clone::Clone::clone(value)) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for ICatalog { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Owned(unsafe { ::core::mem::transmute(self) }) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for &ICatalog { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Borrowed(unsafe { ::core::mem::transmute(self) }) } } #[repr(C)] #[doc(hidden)] pub struct ICatalog_abi( pub unsafe extern "system" fn(this: ::windows::core::RawPtr, iid: &::windows::core::GUID, interface: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, pctinfo: *mut u32) -> ::windows::core::HRESULT, #[cfg(feature = "Win32_System_Com")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, itinfo: u32, lcid: u32, pptinfo: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_System_Com"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, riid: *const ::windows::core::GUID, rgsznames: *const super::super::Foundation::PWSTR, cnames: u32, lcid: u32, rgdispid: *mut i32) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, dispidmember: i32, riid: *const ::windows::core::GUID, lcid: u32, wflags: u16, pdispparams: *const super::Com::DISPPARAMS, pvarresult: *mut ::core::mem::ManuallyDrop<super::Com::VARIANT>, pexcepinfo: *mut ::core::mem::ManuallyDrop<super::Com::EXCEPINFO>, puargerr: *mut u32) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole")))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrcollname: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, ppcatalogcollection: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com")))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrconnectstring: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, ppcatalogcollection: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com")))] usize, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, retval: *mut i32) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, retval: *mut i32) -> ::windows::core::HRESULT, ); #[repr(transparent)] #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: clone :: Clone, :: core :: fmt :: Debug)] pub struct IComponentUtil(pub ::windows::core::IUnknown); impl IComponentUtil { #[cfg(feature = "Win32_Foundation")] pub unsafe fn InstallComponent<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param1: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param2: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrdllfile: Param0, bstrtypelibfile: Param1, bstrproxystubdllfile: Param2) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).7)(::core::mem::transmute_copy(self), bstrdllfile.into_param().abi(), bstrtypelibfile.into_param().abi(), bstrproxystubdllfile.into_param().abi()).ok() } #[cfg(feature = "Win32_Foundation")] pub unsafe fn ImportComponent<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrclsid: Param0) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).8)(::core::mem::transmute_copy(self), bstrclsid.into_param().abi()).ok() } #[cfg(feature = "Win32_Foundation")] pub unsafe fn ImportComponentByName<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrprogid: Param0) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).9)(::core::mem::transmute_copy(self), bstrprogid.into_param().abi()).ok() } #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com"))] pub unsafe fn GetCLSIDs<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param1: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrdllfile: Param0, bstrtypelibfile: Param1, aclsids: *mut *mut super::Com::SAFEARRAY) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).10)(::core::mem::transmute_copy(self), bstrdllfile.into_param().abi(), bstrtypelibfile.into_param().abi(), ::core::mem::transmute(aclsids)).ok() } } unsafe impl ::windows::core::Interface for IComponentUtil { type Vtable = IComponentUtil_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22873_8a19_11d0_81b6_00a0c9231c29); } impl ::core::convert::From<IComponentUtil> for ::windows::core::IUnknown { fn from(value: IComponentUtil) -> Self { value.0 } } impl ::core::convert::From<&IComponentUtil> for ::windows::core::IUnknown { fn from(value: &IComponentUtil) -> Self { value.0.clone() } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for IComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Owned(self.0) } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for &'a IComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Borrowed(&self.0) } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<IComponentUtil> for super::Com::IDispatch { fn from(value: IComponentUtil) -> Self { unsafe { ::core::mem::transmute(value) } } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<&IComponentUtil> for super::Com::IDispatch { fn from(value: &IComponentUtil) -> Self { ::core::convert::From::from(::core::clone::Clone::clone(value)) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for IComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Owned(unsafe { ::core::mem::transmute(self) }) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for &IComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Borrowed(unsafe { ::core::mem::transmute(self) }) } } #[repr(C)] #[doc(hidden)] pub struct IComponentUtil_abi( pub unsafe extern "system" fn(this: ::windows::core::RawPtr, iid: &::windows::core::GUID, interface: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, pctinfo: *mut u32) -> ::windows::core::HRESULT, #[cfg(feature = "Win32_System_Com")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, itinfo: u32, lcid: u32, pptinfo: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_System_Com"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, riid: *const ::windows::core::GUID, rgsznames: *const super::super::Foundation::PWSTR, cnames: u32, lcid: u32, rgdispid: *mut i32) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, dispidmember: i32, riid: *const ::windows::core::GUID, lcid: u32, wflags: u16, pdispparams: *const super::Com::DISPPARAMS, pvarresult: *mut ::core::mem::ManuallyDrop<super::Com::VARIANT>, pexcepinfo: *mut ::core::mem::ManuallyDrop<super::Com::EXCEPINFO>, puargerr: *mut u32) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole")))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrdllfile: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrtypelibfile: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrproxystubdllfile: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrclsid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrprogid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrdllfile: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrtypelibfile: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, aclsids: *mut *mut super::Com::SAFEARRAY) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com")))] usize, ); #[repr(transparent)] #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: clone :: Clone, :: core :: fmt :: Debug)] pub struct IPackageUtil(pub ::windows::core::IUnknown); impl IPackageUtil { #[cfg(feature = "Win32_Foundation")] pub unsafe fn InstallPackage<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param1: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrpackagefile: Param0, bstrinstallpath: Param1, loptions: i32) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).7)(::core::mem::transmute_copy(self), bstrpackagefile.into_param().abi(), bstrinstallpath.into_param().abi(), ::core::mem::transmute(loptions)).ok() } #[cfg(feature = "Win32_Foundation")] pub unsafe fn ExportPackage<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param1: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrpackageid: Param0, bstrpackagefile: Param1, loptions: i32) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).8)(::core::mem::transmute_copy(self), bstrpackageid.into_param().abi(), bstrpackagefile.into_param().abi(), ::core::mem::transmute(loptions)).ok() } #[cfg(feature = "Win32_Foundation")] pub unsafe fn ShutdownPackage<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrpackageid: Param0) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).9)(::core::mem::transmute_copy(self), bstrpackageid.into_param().abi()).ok() } } unsafe impl ::windows::core::Interface for IPackageUtil { type Vtable = IPackageUtil_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22874_8a19_11d0_81b6_00a0c9231c29); } impl ::core::convert::From<IPackageUtil> for ::windows::core::IUnknown { fn from(value: IPackageUtil) -> Self { value.0 } } impl ::core::convert::From<&IPackageUtil> for ::windows::core::IUnknown { fn from(value: &IPackageUtil) -> Self { value.0.clone() } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for IPackageUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Owned(self.0) } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for &'a IPackageUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Borrowed(&self.0) } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<IPackageUtil> for super::Com::IDispatch { fn from(value: IPackageUtil) -> Self { unsafe { ::core::mem::transmute(value) } } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<&IPackageUtil> for super::Com::IDispatch { fn from(value: &IPackageUtil) -> Self { ::core::convert::From::from(::core::clone::Clone::clone(value)) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for IPackageUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Owned(unsafe { ::core::mem::transmute(self) }) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for &IPackageUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Borrowed(unsafe { ::core::mem::transmute(self) }) } } #[repr(C)] #[doc(hidden)] pub struct IPackageUtil_abi( pub unsafe extern "system" fn(this: ::windows::core::RawPtr, iid: &::windows::core::GUID, interface: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, pctinfo: *mut u32) -> ::windows::core::HRESULT, #[cfg(feature = "Win32_System_Com")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, itinfo: u32, lcid: u32, pptinfo: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_System_Com"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, riid: *const ::windows::core::GUID, rgsznames: *const super::super::Foundation::PWSTR, cnames: u32, lcid: u32, rgdispid: *mut i32) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, dispidmember: i32, riid: *const ::windows::core::GUID, lcid: u32, wflags: u16, pdispparams: *const super::Com::DISPPARAMS, pvarresult: *mut ::core::mem::ManuallyDrop<super::Com::VARIANT>, pexcepinfo: *mut ::core::mem::ManuallyDrop<super::Com::EXCEPINFO>, puargerr: *mut u32) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole")))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrpackagefile: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrinstallpath: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, loptions: i32) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrpackageid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrpackagefile: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, loptions: i32) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrpackageid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, ); #[repr(transparent)] #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: clone :: Clone, :: core :: fmt :: Debug)] pub struct IRemoteComponentUtil(pub ::windows::core::IUnknown); impl IRemoteComponentUtil { #[cfg(feature = "Win32_Foundation")] pub unsafe fn InstallRemoteComponent<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param1: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param2: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrserver: Param0, bstrpackageid: Param1, bstrclsid: Param2) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).7)(::core::mem::transmute_copy(self), bstrserver.into_param().abi(), bstrpackageid.into_param().abi(), bstrclsid.into_param().abi()).ok() } #[cfg(feature = "Win32_Foundation")] pub unsafe fn InstallRemoteComponentByName<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param1: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>, Param2: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrserver: Param0, bstrpackagename: Param1, bstrprogid: Param2) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).8)(::core::mem::transmute_copy(self), bstrserver.into_param().abi(), bstrpackagename.into_param().abi(), bstrprogid.into_param().abi()).ok() } } unsafe impl ::windows::core::Interface for IRemoteComponentUtil { type Vtable = IRemoteComponentUtil_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22875_8a19_11d0_81b6_00a0c9231c29); } impl ::core::convert::From<IRemoteComponentUtil> for ::windows::core::IUnknown { fn from(value: IRemoteComponentUtil) -> Self { value.0 } } impl ::core::convert::From<&IRemoteComponentUtil> for ::windows::core::IUnknown { fn from(value: &IRemoteComponentUtil) -> Self { value.0.clone() } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for IRemoteComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Owned(self.0) } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for &'a IRemoteComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Borrowed(&self.0) } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<IRemoteComponentUtil> for super::Com::IDispatch { fn from(value: IRemoteComponentUtil) -> Self { unsafe { ::core::mem::transmute(value) } } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<&IRemoteComponentUtil> for super::Com::IDispatch { fn from(value: &IRemoteComponentUtil) -> Self { ::core::convert::From::from(::core::clone::Clone::clone(value)) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for IRemoteComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Owned(unsafe { ::core::mem::transmute(self) }) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for &IRemoteComponentUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Borrowed(unsafe { ::core::mem::transmute(self) }) } } #[repr(C)] #[doc(hidden)] pub struct IRemoteComponentUtil_abi( pub unsafe extern "system" fn(this: ::windows::core::RawPtr, iid: &::windows::core::GUID, interface: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, pctinfo: *mut u32) -> ::windows::core::HRESULT, #[cfg(feature = "Win32_System_Com")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, itinfo: u32, lcid: u32, pptinfo: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_System_Com"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, riid: *const ::windows::core::GUID, rgsznames: *const super::super::Foundation::PWSTR, cnames: u32, lcid: u32, rgdispid: *mut i32) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, dispidmember: i32, riid: *const ::windows::core::GUID, lcid: u32, wflags: u16, pdispparams: *const super::Com::DISPPARAMS, pvarresult: *mut ::core::mem::ManuallyDrop<super::Com::VARIANT>, pexcepinfo: *mut ::core::mem::ManuallyDrop<super::Com::EXCEPINFO>, puargerr: *mut u32) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole")))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrserver: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrpackageid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrclsid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrserver: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrpackagename: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>, bstrprogid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, ); #[repr(transparent)] #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: clone :: Clone, :: core :: fmt :: Debug)] pub struct IRoleAssociationUtil(pub ::windows::core::IUnknown); impl IRoleAssociationUtil { #[cfg(feature = "Win32_Foundation")] pub unsafe fn AssociateRole<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrroleid: Param0) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).7)(::core::mem::transmute_copy(self), bstrroleid.into_param().abi()).ok() } #[cfg(feature = "Win32_Foundation")] pub unsafe fn AssociateRoleByName<'a, Param0: ::windows::core::IntoParam<'a, super::super::Foundation::BSTR>>(&self, bstrrolename: Param0) -> ::windows::core::Result<()> { (::windows::core::Interface::vtable(self).8)(::core::mem::transmute_copy(self), bstrrolename.into_param().abi()).ok() } } unsafe impl ::windows::core::Interface for IRoleAssociationUtil { type Vtable = IRoleAssociationUtil_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22876_8a19_11d0_81b6_00a0c9231c29); } impl ::core::convert::From<IRoleAssociationUtil> for ::windows::core::IUnknown { fn from(value: IRoleAssociationUtil) -> Self { value.0 } } impl ::core::convert::From<&IRoleAssociationUtil> for ::windows::core::IUnknown { fn from(value: &IRoleAssociationUtil) -> Self { value.0.clone() } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for IRoleAssociationUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Owned(self.0) } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for &'a IRoleAssociationUtil { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Borrowed(&self.0) } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<IRoleAssociationUtil> for super::Com::IDispatch { fn from(value: IRoleAssociationUtil) -> Self { unsafe { ::core::mem::transmute(value) } } } #[cfg(feature = "Win32_System_Com")] impl ::core::convert::From<&IRoleAssociationUtil> for super::Com::IDispatch { fn from(value: &IRoleAssociationUtil) -> Self { ::core::convert::From::from(::core::clone::Clone::clone(value)) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for IRoleAssociationUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Owned(unsafe { ::core::mem::transmute(self) }) } } #[cfg(feature = "Win32_System_Com")] impl<'a> ::windows::core::IntoParam<'a, super::Com::IDispatch> for &IRoleAssociationUtil { fn into_param(self) -> ::windows::core::Param<'a, super::Com::IDispatch> { ::windows::core::Param::Borrowed(unsafe { ::core::mem::transmute(self) }) } } #[repr(C)] #[doc(hidden)] pub struct IRoleAssociationUtil_abi( pub unsafe extern "system" fn(this: ::windows::core::RawPtr, iid: &::windows::core::GUID, interface: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, pctinfo: *mut u32) -> ::windows::core::HRESULT, #[cfg(feature = "Win32_System_Com")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, itinfo: u32, lcid: u32, pptinfo: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_System_Com"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, riid: *const ::windows::core::GUID, rgsznames: *const super::super::Foundation::PWSTR, cnames: u32, lcid: u32, rgdispid: *mut i32) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole"))] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, dispidmember: i32, riid: *const ::windows::core::GUID, lcid: u32, wflags: u16, pdispparams: *const super::Com::DISPPARAMS, pvarresult: *mut ::core::mem::ManuallyDrop<super::Com::VARIANT>, pexcepinfo: *mut ::core::mem::ManuallyDrop<super::Com::EXCEPINFO>, puargerr: *mut u32) -> ::windows::core::HRESULT, #[cfg(not(all(feature = "Win32_Foundation", feature = "Win32_System_Com", feature = "Win32_System_Ole")))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrroleid: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, #[cfg(feature = "Win32_Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, bstrrolename: ::core::mem::ManuallyDrop<super::super::Foundation::BSTR>) -> ::windows::core::HRESULT, #[cfg(not(feature = "Win32_Foundation"))] usize, ); pub const PackageUtil: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22885_8a19_11d0_81b6_00a0c9231c29); pub const RemoteComponentUtil: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22886_8a19_11d0_81b6_00a0c9231c29); pub const RoleAssociationUtil: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x6eb22887_8a19_11d0_81b6_00a0c9231c29); #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: marker :: Copy, :: core :: clone :: Clone, :: core :: default :: Default, :: core :: fmt :: Debug)] #[repr(transparent)] pub struct __MIDL___MIDL_itf_mtxadmin_0107_0001(pub i32); pub const mtsInstallUsers: __MIDL___MIDL_itf_mtxadmin_0107_0001 = __MIDL___MIDL_itf_mtxadmin_0107_0001(1i32); impl ::core::convert::From<i32> for __MIDL___MIDL_itf_mtxadmin_0107_0001 { fn from(value: i32) -> Self { Self(value) } } unsafe impl ::windows::core::Abi for __MIDL___MIDL_itf_mtxadmin_0107_0001 { type Abi = Self; } #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: marker :: Copy, :: core :: clone :: Clone, :: core :: default :: Default, :: core :: fmt :: Debug)] #[repr(transparent)] pub struct __MIDL___MIDL_itf_mtxadmin_0107_0002(pub i32); pub const mtsExportUsers: __MIDL___MIDL_itf_mtxadmin_0107_0002 = __MIDL___MIDL_itf_mtxadmin_0107_0002(1i32); impl ::core::convert::From<i32> for __MIDL___MIDL_itf_mtxadmin_0107_0002 { fn from(value: i32) -> Self { Self(value) } } unsafe impl ::windows::core::Abi for __MIDL___MIDL_itf_mtxadmin_0107_0002 { type Abi = Self; } #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: marker :: Copy, :: core :: clone :: Clone, :: core :: default :: Default, :: core :: fmt :: Debug)] #[repr(transparent)] pub struct __MIDL___MIDL_itf_mtxadmin_0107_0003(pub i32); pub const mtsErrObjectErrors: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368511i32); pub const mtsErrObjectInvalid: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368510i32); pub const mtsErrKeyMissing: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368509i32); pub const mtsErrAlreadyInstalled: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368508i32); pub const mtsErrDownloadFailed: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368507i32); pub const mtsErrPDFWriteFail: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368505i32); pub const mtsErrPDFReadFail: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368504i32); pub const mtsErrPDFVersion: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368503i32); pub const mtsErrCoReqCompInstalled: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368496i32); pub const mtsErrBadPath: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368502i32); pub const mtsErrPackageExists: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368501i32); pub const mtsErrRoleExists: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368500i32); pub const mtsErrCantCopyFile: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368499i32); pub const mtsErrNoTypeLib: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368498i32); pub const mtsErrNoUser: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368497i32); pub const mtsErrInvalidUserids: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368496i32); pub const mtsErrNoRegistryCLSID: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368495i32); pub const mtsErrBadRegistryProgID: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368494i32); pub const mtsErrAuthenticationLevel: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368493i32); pub const mtsErrUserPasswdNotValid: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368492i32); pub const mtsErrNoRegistryRead: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368491i32); pub const mtsErrNoRegistryWrite: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368490i32); pub const mtsErrNoRegistryRepair: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368489i32); pub const mtsErrCLSIDOrIIDMismatch: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368488i32); pub const mtsErrRemoteInterface: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368487i32); pub const mtsErrDllRegisterServer: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368486i32); pub const mtsErrNoServerShare: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368485i32); pub const mtsErrNoAccessToUNC: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368484i32); pub const mtsErrDllLoadFailed: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368483i32); pub const mtsErrBadRegistryLibID: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368482i32); pub const mtsErrPackDirNotFound: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368481i32); pub const mtsErrTreatAs: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368480i32); pub const mtsErrBadForward: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368479i32); pub const mtsErrBadIID: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368478i32); pub const mtsErrRegistrarFailed: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368477i32); pub const mtsErrCompFileDoesNotExist: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368476i32); pub const mtsErrCompFileLoadDLLFail: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368475i32); pub const mtsErrCompFileGetClassObj: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368474i32); pub const mtsErrCompFileClassNotAvail: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368473i32); pub const mtsErrCompFileBadTLB: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368472i32); pub const mtsErrCompFileNotInstallable: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368471i32); pub const mtsErrNotChangeable: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368470i32); pub const mtsErrNotDeletable: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368469i32); pub const mtsErrSession: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368468i32); pub const mtsErrCompFileNoRegistrar: __MIDL___MIDL_itf_mtxadmin_0107_0003 = __MIDL___MIDL_itf_mtxadmin_0107_0003(-2146368460i32); impl ::core::convert::From<i32> for __MIDL___MIDL_itf_mtxadmin_0107_0003 { fn from(value: i32) -> Self { Self(value) } } unsafe impl ::windows::core::Abi for __MIDL___MIDL_itf_mtxadmin_0107_0003 { type Abi = Self; }
use std::io::prelude::*; use std::fs::OpenOptions; use chrono::prelude::*; use std::sync::{Mutex, Arc}; pub fn crear_log() -> std::sync::Arc<std::sync::Mutex<std::fs::File>> { let file = Arc::new(Mutex::new( match OpenOptions::new() .read(true) .write(true) .append(true) .create(true) .open("log.txt") { Ok(f) => f, Err(err) => { panic!("No se pude crear log: {}", err); } } )); return file; } pub fn log(file : &std::sync::Arc<std::sync::Mutex<std::fs::File>> , message : String) { let local = Local::now().format("%d/%m/%Y %H:%M:%S"); let output = format!("{} - {}", local, message); // Bloque protegido { let mut f = file.lock().unwrap(); match f.write(output.as_bytes()){ Ok(_) => {}, Err(err) => println!("Error al loggear: {}", err) }; } }
use game_metrics::{scope, instrument, Metrics}; use std::time::Duration; #[instrument] fn long() { std::thread::sleep(Duration::from_millis(500)); } #[instrument] fn short() { std::thread::sleep(Duration::from_millis(50)); } fn long_scoped() { scope!("long_scoped"); std::thread::sleep(Duration::from_millis(500)); } fn short_scoped() { scope!("short_scoped"); std::thread::sleep(Duration::from_millis(50)); } fn main() { let metrics = Metrics::new(1); let t1 = std::thread::spawn(|| { (0..10).for_each(|_| long_scoped()); (0..10).for_each(|_| long()); (0..10).for_each(|_| short_scoped()); (0..10).for_each(|_| short()); }); let t2 = std::thread::spawn(|| { (0..10).for_each(|_| long_scoped()); (0..10).for_each(|_| long()); (0..10).for_each(|_| short_scoped()); (0..10).for_each(|_| short()); }); t1.join().unwrap(); t2.join().unwrap(); metrics.for_each_histogram(|span_name, h| { println!("{} -> {:.2}ms", span_name, h.mean() / 1_000_000.0); }); }
#![allow(dead_code)] use arrow::record_batch::RecordBatch; use data_types::{sequence_number_set::SequenceNumberSet, SequenceNumber, TimestampMinMax}; use mutable_batch::MutableBatch; mod buffering; mod persisting; mod snapshot; pub(in crate::buffer_tree::partition::buffer) use buffering::*; pub(crate) use persisting::*; use crate::query::projection::OwnedProjection; use super::traits::{Queryable, Writeable}; /// A result type for fallible transitions. /// /// The type system ensures the state machine is always returned to the caller, /// regardless of the transition outcome. #[derive(Debug)] pub(crate) enum Transition<A, B> { /// The transition succeeded, and the new state is contained within. Ok(BufferState<A>), /// The state machine failed to transition due to an invariant not being /// upheld, and the original state is contained within. Unchanged(BufferState<B>), } impl<A, B> Transition<A, B> { /// A helper function to construct [`Self::Ok`] variants. pub(super) fn ok(v: A, sequence_numbers: SequenceNumberSet) -> Self { Self::Ok(BufferState { state: v, sequence_numbers, }) } /// A helper function to construct [`Self::Unchanged`] variants. pub(super) fn unchanged(v: BufferState<B>) -> Self { Self::Unchanged(v) } } /// A finite state machine for buffering writes, and converting them into a /// queryable data format on-demand. /// /// This FSM is used to provide explicit states for each stage of the data /// lifecycle within a partition buffer: /// /// ```text /// ┌──────────────┐ /// │ Buffering │ /// └───────┬──────┘ /// │ /// ▼ /// ┌ ─ ─ ─ ─ ─ ─ ─ ┌ ─ ─ ─ ─ ─ ─ ─ /// Snapshot ├─────▶ Persisting │ /// └ ─ ─ ─ ─ ─ ─ ─ └ ─ ─ ─ ─ ─ ─ ─ /// ``` /// /// Boxes with dashed lines indicate immutable, queryable states that contain /// data in an efficient data format for query execution ([`RecordBatch`]). /// /// Boxes with solid lines indicate a mutable state to which further writes can /// be applied. /// /// A [`BufferState`] tracks the bounding [`SequenceNumber`] values it has /// observed, and enforces monotonic writes (w.r.t their [`SequenceNumber`]). #[derive(Debug)] pub(crate) struct BufferState<T> { state: T, /// The set of [`SequenceNumber`] successfully applied to this buffer. sequence_numbers: SequenceNumberSet, } impl BufferState<Buffering> { /// Initialise a new buffer state machine. pub(crate) fn new() -> Self { Self { state: Buffering::default(), sequence_numbers: SequenceNumberSet::default(), } } } impl<T> BufferState<T> { /// Return the set of sequence numbers wrote to this [`BufferState`]. pub(crate) fn sequence_number_set(&self) -> &SequenceNumberSet { &self.sequence_numbers } } /// A [`BufferState`] in a mutable state can accept writes and record their /// [`SequenceNumber`]. impl<T> BufferState<T> where T: Writeable, { /// The provided [`SequenceNumber`] MUST be for the given [`MutableBatch`]. pub(crate) fn write( &mut self, batch: MutableBatch, n: SequenceNumber, ) -> Result<(), mutable_batch::Error> { self.state.write(batch)?; // Add the sequence number to the observed set after the fallible write. self.sequence_numbers.add(n); Ok(()) } } /// A [`BufferState`] in a queryable state delegates the read to the current /// state machine state. impl<T> Queryable for BufferState<T> where T: Queryable, { /// Returns the current buffer data. /// /// This is always a cheap method call. fn get_query_data(&self, projection: &OwnedProjection) -> Vec<RecordBatch> { self.state.get_query_data(projection) } fn rows(&self) -> usize { self.state.rows() } fn timestamp_stats(&self) -> Option<TimestampMinMax> { self.state.timestamp_stats() } fn schema(&self) -> Option<schema::Schema> { self.state.schema() } } #[cfg(test)] mod tests { use std::sync::Arc; use arrow_util::assert_batches_eq; use assert_matches::assert_matches; use mutable_batch_lp::test_helpers::lp_to_mutable_batch; use schema::Projection; use snapshot::*; use super::*; #[test] // comparing dyn Array always has same vtable, so is accurate to use Arc::ptr_eq #[allow(clippy::vtable_address_comparisons)] fn test_buffer_lifecycle() { // Initialise a buffer in the base state. let mut buffer: BufferState<Buffering> = BufferState::new(); // Write some data to a buffer. buffer .write( lp_to_mutable_batch( r#"bananas,tag=platanos great=true,how_much=42 668563242000000042"#, ) .1, SequenceNumber::new(0), ) .expect("write to empty buffer should succeed"); // Ensure the sequence number was recorded { let set = buffer.sequence_number_set(); assert!(set.contains(SequenceNumber::new(0))); assert_eq!(set.len(), 1); } // Extract the queryable data from the buffer and validate it. // // Keep the data to validate they are ref-counted copies after further // writes below. Note this construct allows the caller to decide when/if // to allocate. let w1_data = buffer.get_query_data(&OwnedProjection::default()); let expected = vec![ "+-------+----------+----------+--------------------------------+", "| great | how_much | tag | time |", "+-------+----------+----------+--------------------------------+", "| true | 42.0 | platanos | 1991-03-10T00:00:42.000000042Z |", "+-------+----------+----------+--------------------------------+", ]; assert_batches_eq!(&expected, &[w1_data[0].clone()]); // Apply another write. buffer .write( lp_to_mutable_batch( r#"bananas,tag=platanos great=true,how_much=1000 668563242000000043"#, ) .1, SequenceNumber::new(1), ) .expect("write to empty buffer should succeed"); // Snapshot the buffer into an immutable, queryable data format. let buffer: BufferState<Snapshot> = match buffer.snapshot() { Transition::Ok(v) => v, Transition::Unchanged(_) => panic!("did not transition to snapshot state"), }; // Verify the writes are still queryable. let w2_data = buffer.get_query_data(&OwnedProjection::default()); let expected = vec![ "+-------+----------+----------+--------------------------------+", "| great | how_much | tag | time |", "+-------+----------+----------+--------------------------------+", "| true | 42.0 | platanos | 1991-03-10T00:00:42.000000042Z |", "| true | 1000.0 | platanos | 1991-03-10T00:00:42.000000043Z |", "+-------+----------+----------+--------------------------------+", ]; assert_eq!(w2_data.len(), 1); assert_batches_eq!(&expected, &[w2_data[0].clone()]); // Ensure the same data is returned for a second read. { let second_read = buffer.get_query_data(&OwnedProjection::default()); assert_eq!(w2_data, second_read); // And that no data was actually copied. let same_arcs = w2_data .iter() .zip(second_read.iter()) .all(|(a, b)| Arc::ptr_eq(a.column(0), b.column(0))); assert!(same_arcs); } // Finally transition into the terminal persisting state. let buffer: BufferState<Persisting> = buffer.into_persisting(); // Extract the final buffered result let final_data = buffer.get_query_data(&OwnedProjection::default()); // And once again verify no data was changed, copied or re-ordered. assert_eq!(w2_data, final_data); let same_arcs = w2_data .into_iter() .zip(final_data.into_iter()) .all(|(a, b)| Arc::ptr_eq(a.column(0), b.column(0))); assert!(same_arcs); // Assert the sequence numbers were recorded. let set = buffer.into_sequence_number_set(); assert!(set.contains(SequenceNumber::new(0))); assert!(set.contains(SequenceNumber::new(1))); assert_eq!(set.len(), 2); } /// Assert projection is correct across all the queryable FSM states. #[test] // comparing dyn Array always has same vtable, so is accurate to use Arc::ptr_eq #[allow(clippy::vtable_address_comparisons)] fn test_buffer_projection() { let projection = OwnedProjection::from(vec![ "tag".to_string(), "great".to_string(), "missing".to_string(), "time".to_string(), ]); // Initialise a buffer in the base state. let mut buffer: BufferState<Buffering> = BufferState::new(); // Write some data to a buffer. buffer .write( lp_to_mutable_batch( r#"bananas,tag=platanos great=true,how_much=42 668563242000000042"#, ) .1, SequenceNumber::new(0), ) .expect("write to empty buffer should succeed"); // Extract the queryable data from the buffer and validate it. // // Keep the data to validate they are ref-counted copies after further // writes below. Note this construct allows the caller to decide when/if // to allocate. let w1_data = buffer.get_query_data(&projection); let expected = vec![ "+----------+-------+--------------------------------+", "| tag | great | time |", "+----------+-------+--------------------------------+", "| platanos | true | 1991-03-10T00:00:42.000000042Z |", "+----------+-------+--------------------------------+", ]; assert_batches_eq!(&expected, &[w1_data[0].clone()]); // Apply another write. buffer .write( lp_to_mutable_batch( r#"bananas,tag=platanos great=true,how_much=1000 668563242000000043"#, ) .1, SequenceNumber::new(1), ) .expect("write to empty buffer should succeed"); // Snapshot the buffer into an immutable, queryable data format. let buffer: BufferState<Snapshot> = match buffer.snapshot() { Transition::Ok(v) => v, Transition::Unchanged(_) => panic!("did not transition to snapshot state"), }; // Verify the writes are still queryable. let w2_data = buffer.get_query_data(&projection); let expected = vec![ "+----------+-------+--------------------------------+", "| tag | great | time |", "+----------+-------+--------------------------------+", "| platanos | true | 1991-03-10T00:00:42.000000042Z |", "| platanos | true | 1991-03-10T00:00:42.000000043Z |", "+----------+-------+--------------------------------+", ]; assert_eq!(w2_data.len(), 1); assert_batches_eq!(&expected, &[w2_data[0].clone()]); // Ensure the same data is returned for a second read. { let second_read = buffer.get_query_data(&projection); assert_eq!(w2_data, second_read); // And that no data was actually copied. let same_arcs = w2_data .iter() .zip(second_read.iter()) .all(|(a, b)| Arc::ptr_eq(a.column(0), b.column(0))); assert!(same_arcs); } // Finally transition into the terminal persisting state. let buffer: BufferState<Persisting> = buffer.into_persisting(); // Extract the final buffered result let final_data = buffer.get_query_data(&projection); // And once again verify no data was changed, copied or re-ordered. assert_eq!(w2_data, final_data); let same_arcs = w2_data .into_iter() .zip(final_data.into_iter()) .all(|(a, b)| Arc::ptr_eq(a.column(0), b.column(0))); assert!(same_arcs); // Assert the sequence numbers were recorded. let set = buffer.into_sequence_number_set(); assert!(set.contains(SequenceNumber::new(0))); assert!(set.contains(SequenceNumber::new(1))); assert_eq!(set.len(), 2); } #[test] fn test_snapshot_buffer_different_but_compatible_schemas() { let mut buffer = BufferState::new(); // Missing tag `t1` let (_, mut mb1) = lp_to_mutable_batch(r#"foo iv=1i,uv=774u,fv=1.0,bv=true,sv="hi" 1"#); buffer.state.write(mb1.clone()).unwrap(); // Missing field `iv` let (_, mb2) = lp_to_mutable_batch(r#"foo,t1=aoeu uv=1u,fv=12.0,bv=false,sv="bye" 10000"#); buffer.state.write(mb2.clone()).unwrap(); let buffer: BufferState<Snapshot> = match buffer.snapshot() { Transition::Ok(v) => v, Transition::Unchanged(_) => panic!("failed to transition"), }; assert_eq!(buffer.get_query_data(&OwnedProjection::default()).len(), 1); let snapshot = buffer.get_query_data(&OwnedProjection::default())[0].clone(); // Generate the combined buffer from the original inputs to compare // against. mb1.extend_from(&mb2).unwrap(); let want = mb1.to_arrow(Projection::All).unwrap(); assert_eq!(snapshot, want); } #[test] fn test_fallible_write_sequence_number_observation() { let mut buffer: BufferState<Buffering> = BufferState::new(); // A successful write has the sequence number recorded. let (_, mb) = lp_to_mutable_batch(r#"bananas great=42 1"#); buffer.write(mb, SequenceNumber::new(24)).unwrap(); // Validate the sequence number was recorded. { let set = buffer.sequence_number_set(); assert!(set.contains(SequenceNumber::new(24))); assert_eq!(set.len(), 1); } // A failed write (in this case because of a schema conflict) must not // have the sequence number recorded. let (_, mb) = lp_to_mutable_batch(r#"bananas great="yep" 1"#); let _ = buffer.write(mb, SequenceNumber::new(12)).unwrap_err(); let set = buffer.sequence_number_set(); assert!(set.contains(SequenceNumber::new(24))); assert!(!set.contains(SequenceNumber::new(12))); assert_eq!(set.len(), 1); } /// Assert the summary statistics are correctly computed across various FSM /// states. #[test] fn test_summary_statistics() { let mut buffer: BufferState<Buffering> = BufferState::new(); // Write some data to a buffer. buffer .write( lp_to_mutable_batch( r#"bananas,tag=platanos great=true,how_much=42 668563242000000042"#, ) .1, SequenceNumber::new(0), ) .expect("write to empty buffer should succeed"); assert_eq!(buffer.rows(), 1); assert_eq!( buffer.timestamp_stats(), Some(TimestampMinMax { min: 668563242000000042, max: 668563242000000042 }) ); // Write another row to change the timestamp (it goes backwards!) buffer .write( lp_to_mutable_batch(r#"bananas,tag=platanos great=true,how_much=42 42"#).1, SequenceNumber::new(0), ) .unwrap(); assert_eq!(buffer.rows(), 2); assert_eq!( buffer.timestamp_stats(), Some(TimestampMinMax { min: 42, max: 668563242000000042 }) ); // Transition to a snapshot. let buffer = assert_matches!(buffer.snapshot(), Transition::Ok(v) => v); assert_eq!(buffer.rows(), 2); assert_eq!( buffer.timestamp_stats(), Some(TimestampMinMax { min: 42, max: 668563242000000042 }) ); // Transition to persisting let buffer = buffer.into_persisting(); assert_eq!(buffer.rows(), 2); assert_eq!( buffer.timestamp_stats(), Some(TimestampMinMax { min: 42, max: 668563242000000042 }) ); } }
use wasm_bindgen::JsCast; use web_sys::WebGlRenderingContext as GL; use web_sys::*; use js_sys::WebAssembly; use super::super::common_funcs as cf; pub struct Color2D { program: WebGlProgram, vertex_buffer_length: usize, gl_buffer: WebGlBuffer, u_color: WebGlUniformLocation, u_transform: WebGlUniformLocation } impl Color2D { pub fn new(gl: &WebGlRenderingContext) -> Color2D { let program = cf::link_program( &gl, super::super::shaders::vertex::color_2d::SHADER, super::super::shaders::fragment::color_2d::SHADER ).unwrap(); let vertices: [f32; 12] = [ 0., 1., 0., 0., 1., 1., 1., 1., 0., 0., 1., 0. ]; let vertices_ptr_index = vertices.as_ptr() as u32 / 4; let wasm_buffer = wasm_bindgen::memory() .dyn_into::<WebAssembly::Memory>() .unwrap() .buffer(); let js_vertex_array = js_sys::Float32Array::new(&wasm_buffer).subarray( vertices_ptr_index, vertices_ptr_index + vertices.len() as u32 ); let gl_buffer = gl.create_buffer().ok_or("Failed to create buffer").unwrap(); gl.bind_buffer(GL::ARRAY_BUFFER, Some(&gl_buffer)); gl.buffer_data_with_array_buffer_view(GL::ARRAY_BUFFER, &js_vertex_array, GL::STATIC_DRAW); Color2D { u_color: gl.get_uniform_location(&program, "uColor").unwrap(), u_transform: gl.get_uniform_location(&program, "uTransform").unwrap(), gl_buffer, vertex_buffer_length: vertices.len(), program, } } pub fn draw( &self, gl: &WebGlRenderingContext, bottom: f32, top: f32, left: f32, right: f32, canvas_width: f32, canvas_height: f32 ) { gl.use_program(Some(&self.program)); gl.bind_buffer(GL::ARRAY_BUFFER, Some(&self.gl_buffer)); gl.vertex_attrib_pointer_with_i32(0, 2, GL::FLOAT, false, 0, 0); gl.enable_vertex_attrib_array(0); gl.uniform4f( Some(&self.u_color), 0., 0.5, 0.25, 1. ); let translation_matrix = cf::translation_matrix( 2. * left / canvas_width - 1., 2. * bottom / canvas_height - 1., 0. ); let scale_matrix = cf::scale_matrix( 2. * (right - left) / canvas_width, 2. * (top - bottom) / canvas_height, 0., ); let transform_matrix = cf::multiply_matrix4(scale_matrix, translation_matrix); gl.uniform_matrix4fv_with_f32_array(Some(&self.u_transform), false, &transform_matrix); gl.draw_arrays(GL::TRIANGLES, 0, (self.vertex_buffer_length / 2) as i32); } }
use std::path::{PathBuf, Path}; use std::fs::{Metadata, read_link}; use std::os::unix::fs::MetadataExt; use std::os::unix::fs::PermissionsExt; use users::{get_user_by_uid, get_group_by_gid}; use size::{Size, Base, Style}; use crate::core::MaxInfo; use std::time::UNIX_EPOCH; use time::Timespec; use std::panic::resume_unwind; quick_error!( #[derive(Debug)] pub enum MetaError { UnableReadName(path: String) { from(path) } Encoding(path: String) { from(path) } UnableReadMate(path: String) { from(path) } } ); pub struct Meta { pub path: PathBuf, pub name: String, pub permission: String, pub group: String, pub user: String, pub meta: Metadata, pub symlink: Option<String>, pub filesize: String, pub size_uint: String, pub time: String, } impl Meta { pub fn from_path(path: &Path) -> Result<Self, MetaError> { let name = match path.file_name() { Some(name) => match name.to_str() { Some(name) => name.to_string(), None => return Err(MetaError::Encoding(format!("Os str convert str fail. Path: {}", path.display().to_string()))) }, None => return Err(MetaError::UnableReadName(format!("Get file name error. Path: {}", path.display().to_string()))) }; let (meta, symlink) = match read_link(path) { Ok(res) => { let meta = path.symlink_metadata().expect(format!("Fail to read symlink {}", path.to_str().expect("path to str fail")).as_str()); let symlink = res.to_str().expect("Fail to convert pathbuf to str"); (meta, Some(symlink.to_string())) }, _ => { let meta = match path.metadata() { Ok(meta) => meta, _ => return Err(MetaError::UnableReadMate(format!("Get file metadata error. Path: {}", path.display().to_string()))) }; (meta, None) } }; let user = get_user_by_uid(meta.uid()) .expect("Get user by uid error") .name() .to_str() .expect("User name os str convert to str fail") .to_string(); let group = get_group_by_gid(meta.gid()) .expect("Get group by uid error") .name() .to_str() .expect("Group name os str convert to str fail") .to_string(); let filesize = Size::Bytes(meta.len()).to_string(Base::Base10, Style::Abbreviated); let filesize_parts: Vec<_> = filesize.split(" ").collect(); let modified = meta.modified().expect("Get modified time fail"); let dur = modified.duration_since(UNIX_EPOCH).expect("Get The modified duration fail"); let modified_time = time::at(Timespec::new( dur.as_secs() as i64, dur.subsec_nanos() as i32,)); let modified = modified_time .strftime("%m月 %d %H:%M") .expect("format time error"); Ok(Meta{ path: path.to_path_buf(), name, user, group, permission: String::new(), meta, symlink, filesize: filesize_parts[0].to_string(), size_uint: filesize_parts[1].to_string(), time: modified.to_string(), }) } fn format_group(&mut self, maxinfo: &MaxInfo) { if self.group.len() < maxinfo.group { for _ in 0..(maxinfo.group - self.group.len()) { self.group.push(' '); } } } fn format_user(&mut self, maxinfo: &MaxInfo) { if self.user.len() < maxinfo.user { for _ in 0..(maxinfo.user - self.user.len()) { self.user.push(' '); } } } fn format_filesize(&mut self, maxinfo: &MaxInfo) { if self.filesize.len() < maxinfo.filesize { for _ in 0..(maxinfo.filesize - self.filesize.len()) { self.filesize.push(' '); } } } fn format_uint(&mut self, maxinfo: &MaxInfo) { if self.size_uint.len() < maxinfo.sizeuint { for _ in 0..(maxinfo.sizeuint - self.size_uint.len()) { self.size_uint.push(' '); } } } fn format_symlink(&mut self) { match self.symlink { Some(ref link) => { self.name.push_str(" => "); self.name.push_str(link.as_str()); }, None => {} } } fn format_permission(&mut self) { let unix_permission = "rwxrwxrwx".to_string(); let mut permission = String::new(); if self.path.is_dir() { permission.push('d'); } else { match self.symlink { Some(_) => permission.push('l'), None => permission.push('-') } } let mode = self.meta.permissions().mode(); for (key, value) in unix_permission.chars().enumerate() { if mode & 0b100000000>>key == 0 { permission.push('-') } else { permission.push(value); } } self.permission = permission; } pub fn format_meta(&mut self, dirinfo: &MaxInfo) { self.format_permission(); self.format_symlink(); self.format_group(dirinfo); self.format_user(dirinfo); self.format_filesize(dirinfo); self.format_uint(dirinfo); } }
use embedded_graphics::{ draw_target::DrawTarget, mono_font::{MonoFont, MonoTextStyle, MonoTextStyleBuilder}, pixelcolor::{PixelColor, Rgb888}, prelude::{Dimensions, Point, Size}, primitives::Rectangle, text::renderer::{CharacterStyle, TextRenderer}, Drawable, }; use embedded_gui::{ geometry::{measurement::MeasureSpec, MeasuredSize}, widgets::text_block::{TextBlock, TextBlockProperties}, WidgetRenderer, }; use embedded_text::{ plugin::ansi::Ansi, style::{HeightMode, TextBoxStyleBuilder, VerticalOverdraw}, TextBox as EgTextBox, }; pub use embedded_text::alignment::{HorizontalAlignment, VerticalAlignment}; use crate::{EgCanvas, ToRectangle}; pub struct TextBlockStyle<T> where T: TextRenderer + CharacterStyle<Color = <T as TextRenderer>::Color>, { renderer: T, horizontal: HorizontalAlignment, vertical: VerticalAlignment, } impl<C, T> TextBlockStyle<T> where C: PixelColor, T: TextRenderer<Color = C> + CharacterStyle<Color = C>, { /// Customize the text color pub fn text_color(&mut self, text_color: C) { self.renderer.set_text_color(Some(text_color)); } } impl<'a, C> TextBlockStyle<MonoTextStyle<'a, C>> where C: PixelColor, { /// Customize the font pub fn font<'a2>(self, font: &'a2 MonoFont<'a2>) -> TextBlockStyle<MonoTextStyle<'a2, C>> { TextBlockStyle { renderer: MonoTextStyleBuilder::from(&self.renderer) .font(font) .build(), horizontal: self.horizontal, vertical: self.vertical, } } } impl<F, C> TextBlockProperties for TextBlockStyle<F> where F: TextRenderer<Color = C> + CharacterStyle<Color = C>, C: PixelColor + From<Rgb888>, { fn measure_text(&self, text: &str, spec: MeasureSpec) -> MeasuredSize { let max_width = spec.width.largest().unwrap_or(u32::MAX); let max_height = spec.height.largest().unwrap_or(u32::MAX); let bounding_box = EgTextBox::with_textbox_style( text, Rectangle::new(Point::zero(), Size::new(max_width, max_height)), self.renderer.clone(), TextBoxStyleBuilder::new() .height_mode(HeightMode::Exact(VerticalOverdraw::Hidden)) .build(), ) .bounding_box(); MeasuredSize { width: bounding_box.size.width, height: bounding_box.size.height, } } } pub trait TextBlockStyling<S, T>: Sized where T: CharacterStyle<Color = Self::Color>, T: TextRenderer<Color = Self::Color>, { type Color; fn text_color(mut self, color: Self::Color) -> Self { self.set_text_color(color); self } fn set_text_color(&mut self, color: Self::Color); fn text_renderer<T2>(self, renderer: T2) -> TextBlock<S, TextBlockStyle<T2>> where T2: TextRenderer + CharacterStyle<Color = <T2 as TextRenderer>::Color>, <T2 as TextRenderer>::Color: From<Rgb888>; fn style<P>(self, props: P) -> TextBlock<S, P> where P: TextBlockProperties; fn horizontal_alignment(self, alignment: HorizontalAlignment) -> Self; fn vertical_alignment(self, alignment: VerticalAlignment) -> Self; } impl<'a, C, S> TextBlockStyling<S, MonoTextStyle<'a, C>> for TextBlock<S, TextBlockStyle<MonoTextStyle<'a, C>>> where S: AsRef<str>, C: PixelColor + From<Rgb888>, { type Color = C; fn set_text_color(&mut self, color: Self::Color) { self.label_properties.text_color(color); } fn text_renderer<T>(self, renderer: T) -> TextBlock<S, TextBlockStyle<T>> where T: TextRenderer + CharacterStyle<Color = <T as TextRenderer>::Color>, <T as TextRenderer>::Color: From<Rgb888>, { let horizontal = self.label_properties.horizontal; let vertical = self.label_properties.vertical; self.style(TextBlockStyle { renderer, horizontal, vertical, }) } fn style<P>(self, props: P) -> TextBlock<S, P> where P: TextBlockProperties, { TextBlock { parent_index: self.parent_index, text: self.text, bounds: self.bounds, label_properties: props, on_state_changed: |_, _| (), } } fn horizontal_alignment(self, alignment: HorizontalAlignment) -> Self { let renderer = self.label_properties.renderer; let horizontal = alignment; let vertical = self.label_properties.vertical; self.style(TextBlockStyle { renderer, horizontal, vertical, }) } fn vertical_alignment(self, alignment: VerticalAlignment) -> Self { let renderer = self.label_properties.renderer; let horizontal = self.label_properties.horizontal; let vertical = alignment; self.style(TextBlockStyle { renderer, horizontal, vertical, }) } } /// Font settings specific to `MonoFont`'s renderer. pub trait MonoFontTextBlockStyling<C, S>: Sized where S: AsRef<str>, C: PixelColor, { fn font<'a>(self, font: &'a MonoFont<'a>) -> TextBlock<S, TextBlockStyle<MonoTextStyle<'a, C>>>; } impl<'a, C, S> MonoFontTextBlockStyling<C, S> for TextBlock<S, TextBlockStyle<MonoTextStyle<'a, C>>> where S: AsRef<str>, C: PixelColor + From<Rgb888>, { fn font<'a2>( self, font: &'a2 MonoFont<'a2>, ) -> TextBlock<S, TextBlockStyle<MonoTextStyle<'a2, C>>> { let renderer = MonoTextStyleBuilder::from(&self.label_properties.renderer) .font(font) .build(); let horizontal = self.label_properties.horizontal; let vertical = self.label_properties.vertical; self.style(TextBlockStyle { renderer, horizontal, vertical, }) } } impl<S, F, C, DT> WidgetRenderer<EgCanvas<DT>> for TextBlock<S, TextBlockStyle<F>> where S: AsRef<str>, F: TextRenderer<Color = C> + CharacterStyle<Color = C>, C: PixelColor + From<Rgb888>, DT: DrawTarget<Color = C>, { fn draw(&mut self, canvas: &mut EgCanvas<DT>) -> Result<(), DT::Error> { EgTextBox::with_textbox_style( self.text.as_ref(), self.bounds.to_rectangle(), self.label_properties.renderer.clone(), TextBoxStyleBuilder::new() .height_mode(HeightMode::Exact(VerticalOverdraw::Hidden)) .alignment(self.label_properties.horizontal) .vertical_alignment(self.label_properties.vertical) .build(), ) .add_plugin(Ansi::new()) .draw(&mut canvas.target) .map(|_| ()) } } macro_rules! textbox_for_charset { ($charset:ident, $font:ident) => { pub mod $charset { use embedded_graphics::{ mono_font::{$charset, MonoTextStyle}, pixelcolor::PixelColor, }; use embedded_gui::{geometry::BoundingBox, widgets::text_block::TextBlock}; use embedded_text::alignment::{HorizontalAlignment, VerticalAlignment}; use crate::{themes::Theme, widgets::text_block::TextBlockStyle}; pub trait TextBlockConstructor<'a, S, C> where S: AsRef<str>, C: PixelColor, { fn new(text: S) -> TextBlock<S, TextBlockStyle<MonoTextStyle<'a, C>>>; } impl<'a, C, S> TextBlockConstructor<'a, S, C> for TextBlock<S, TextBlockStyle<MonoTextStyle<'a, C>>> where S: AsRef<str>, C: PixelColor + Theme, { fn new(text: S) -> Self { TextBlock { parent_index: 0, text, label_properties: TextBlockStyle { renderer: MonoTextStyle::new( &$charset::$font, <C as Theme>::TEXT_COLOR, ), horizontal: HorizontalAlignment::Left, vertical: VerticalAlignment::Top, }, bounds: BoundingBox::default(), on_state_changed: |_, _| (), } } } } }; ($charset:ident) => { textbox_for_charset!($charset, FONT_6X10); }; } textbox_for_charset!(ascii); textbox_for_charset!(iso_8859_1); textbox_for_charset!(iso_8859_10); textbox_for_charset!(iso_8859_13); textbox_for_charset!(iso_8859_14); textbox_for_charset!(iso_8859_15); textbox_for_charset!(iso_8859_16); textbox_for_charset!(iso_8859_2); textbox_for_charset!(iso_8859_3); textbox_for_charset!(iso_8859_4); textbox_for_charset!(iso_8859_5); textbox_for_charset!(iso_8859_7); textbox_for_charset!(iso_8859_9); textbox_for_charset!(jis_x0201, FONT_6X13);
// Definitions of all the different data structures needed for rendering // This defines vectors and vector arithmetic, (more to come) use std::ops::{Add, Sub, Mul}; #[derive(Debug, Clone)] pub struct Vector { pub x: f64, pub y: f64, pub z: f64, pub w: f64, } #[derive(Debug, Clone)] pub struct Matrix { pub vals: [[f64; 4]; 4], } impl Vector { pub fn new() -> Vector { Vector { x: 0f64, y: 0f64, z: 0f64, w: 1f64, } } pub fn from(x: f64, y: f64, z: f64, w: f64) -> Vector { Vector { x: x, y: y, z: z, w: w, } } pub fn magnitude(self) -> f64 { (self.x.powf(2.0) + self.y.powf(2.0) + self.z.powf(2.0)).powf(0.5) } // Keep direction of vector but set magnitude to 1 pub fn normalise(&mut self) { let m = self.clone().magnitude(); self.x /= m; self.y /= m; self.z /= m; } pub fn normalised(self) -> Vector { let mut v = self.clone(); v.normalise(); v } pub fn dot_product(v1: &Vector, v2: &Vector) -> f64 { return v1.x*v2.x+v1.y*v2.y+v1.z*v2.z; } pub fn cross_product(v1: &Vector, v2: &Vector) -> Vector { return Vector::from(v1.y*v2.z-v1.z*v2.y, v1.z*v2.x-v1.x*v2.z, v1.x*v2.y-v1.y*v2.x, 0.0); } } impl Mul<f64> for Vector { type Output = Vector; fn mul(self, rhs: f64) -> Vector { Vector::from(self.x * rhs, self.y * rhs, self.z * rhs, self.w) } } impl Add<Vector> for Vector { type Output = Vector; fn add(self, rhs: Vector) -> Vector { Vector::from(self.x + rhs.x, self.y + rhs.y, self.z + rhs.z, self.w) } } impl Sub<Vector> for Vector { type Output = Vector; fn sub(self, rhs: Vector) -> Vector { Vector::from(self.x - rhs.x, self.y - rhs.y, self.z - rhs.z, self.w) } } impl Matrix { pub fn new() -> Matrix { Matrix { vals: [[0f64; 4]; 4], } } pub fn translation(v: Vector) -> Matrix { Matrix { vals: [[1.0, 0.0, 0.0, v.x], [0.0, 1.0, 0.0, v.y], [0.0, 0.0, 1.0, v.z], [0.0, 0.0, 0.0, 1.0]] } } pub fn rotation(angle: f64, axis: Vector) -> Matrix { let uvec = axis.normalised(); let ux = uvec.x; let uy = uvec.y; let uz = uvec.z; Matrix { vals: [ [angle.cos()+ux.powf(2.0)*(1.0-angle.cos()), ux*uy*(1.0-angle.cos())-uz*angle.sin(), ux*uz*(1.0-angle.cos())+uy*angle.sin(), 0.0], [uy*ux*(1.0-angle.cos())+uz*angle.sin(), angle.cos()+uy.powf(2.0)*(1.0-angle.cos()), uy*uz*(1.0-angle.cos())-ux*angle.sin(), 0.0], [uz*ux*(1.0-angle.cos())-uy*angle.sin(), uz*uy*(1.0-angle.cos())+ux*angle.sin(), angle.cos()+uz.powf(2.0)*(1.0-angle.cos()), 0.0], [0.0, 0.0, 0.0, 0.0] ] } } pub fn perspective(angle: f64, ratio: f64, near: f64, far: f64) -> Matrix { // (THA stands for tan-half-angle - thought the variable name was unwieldy let tha = (angle/2f64).tan(); Matrix { vals: [[1.0/(ratio * tha), 0.0, 0.0, 0.0], [0.0, 1.0/tha, 0.0, 0.0], [0.0, 0.0, -(far + near)/(far - near), -(2.0*far*near)/(far-near)], [0.0, 0.0, -1.0, 0.0]] } } } impl Mul<Vector> for Matrix { type Output = Vector; fn mul(self, rhs: Vector) -> Vector { Vector { x: self.vals[0][0]*rhs.x + self.vals[0][1]*rhs.y + self.vals[0][2]*rhs.z + self.vals[0][3]*rhs.w, y: self.vals[1][0]*rhs.x + self.vals[1][1]*rhs.y + self.vals[1][2]*rhs.z + self.vals[1][3]*rhs.w, z: self.vals[2][0]*rhs.x + self.vals[2][1]*rhs.y + self.vals[2][2]*rhs.z + self.vals[2][3]*rhs.w, w: self.vals[3][0]*rhs.x + self.vals[3][1]*rhs.y + self.vals[3][2]*rhs.z + self.vals[3][3]*rhs.w, } } } impl Mul<Matrix> for Matrix { type Output = Matrix; fn mul(self, rhs: Matrix) -> Matrix { let mut vals = [[0f64; 4]; 4]; // Watch as I condense matrix multiplication into the worst thing ever: // A triple nested for loop. Fun for the whole family! That is if you have a family of // masochists, though frankly I think 'masochist' and 'programmer' mean the same thing. for i in 0..4 { for j in 0..4 { for k in 0..4 { vals[i][j] += self.vals[i][k]*rhs.vals[k][j]; } } } // Bruh Matrix { vals: vals, } } }
//map.rs // // use rand::random as rand; use quicksilver::{ geom::Vector, graphics::Color, }; //derive for comp, vecs... #[derive(Clone, Debug, PartialEq, Default)] pub struct Tile { pub pos: Vector, pub id: i32, // tile type code pub ch: char, //for display during development pub chance_val: i32, // pub fare: i32, // cost to cross tile pub seen: bool, // tile seen by player pub color: Color, //replace with sprite pub reqs: Vec<String>, // required items to enter/traverse tile //... } impl Tile { pub fn new(pos: Vector, id: i32) -> Tile { Tile { pos, id, ch: 'x', chance_val: 0, fare: 99, seen: false, color: Color::BLACK, reqs: Vec::<String>::with_capacity(0), } } pub fn get_display_ch(&self) -> &char { if self.seen { return &self.ch; } &'x' } pub fn get_display_color(&self) -> Color { if self.seen { return self.color; } Color::BLACK } pub fn mod_tile( &mut self, tile_type: char, chance_val: i32, fare: i32, color: Color, reqs: Vec<String>, ) { self.ch = tile_type; self.chance_val = chance_val; self.fare = fare; self.color = color; self.reqs = reqs; } pub fn auto_mod_tile(&mut self, tile_type: char) { self.ch = tile_type; match tile_type { 'x' => { self.chance_val = rand::<u8>() as i32 % 10; //keep range < 256 self.fare = rand::<u8>() as i32 % 10; self.color = Color::from_hex("#006400"); //dark green self.reqs.push("Blue towel".to_string()); } 'l' => { self.color = Color::GREEN; self.reqs.push("Green towel".to_string()); } 'm' => { self.fare = 10; self.color = Color::from_hex("#A52A2A"); //brown ish self.reqs.push("Rope".to_string()) } 'w' => { self.color = Color::BLUE; self.reqs.push("Boat".to_string()); } 'o' => { self.color = Color::ORANGE; self.reqs.push("Orange towel".to_string()); } 'g' => { self.fare = 0; self.color = Color::from_hex("#FFD700"); //gold ish } _ => {} }; } pub fn set_seen(&mut self, seen: bool) { self.seen = seen; } } pub struct Map { pub map: Vec<Tile>, pub size: Vector, pub win: bool, } // make default/shrouded display char/color xxx impl Map { pub fn new(x: i32, y: i32) -> Map { Map { size: Vector::new(x, y), map: Vec::with_capacity((x * y) as usize), win: false, } } pub fn gen(x: i32, y: i32) -> Map { let mut m = Map::new(x, y); for i in 0..x { for j in 0..y { let pos = Vector::new(i, j); let id = i + j * x; let mut t = Tile::new(pos, id); let r = rand::<u8>() % 10; if i == 0 || i == x - 1 { t.auto_mod_tile('l'); } else if j == 0 || j == y - 1 { t.auto_mod_tile('o'); } else if r % 11 == 2 { t.auto_mod_tile('w'); } else if r % 11 == 3 { t.auto_mod_tile('m') } else if id == 80 { t.auto_mod_tile('g') } else { t.auto_mod_tile('x'); } m.map.push(t); } } m } pub fn get_tile(&self, pos: Vector) -> &Tile { if self.is_on_board(pos) { //if valid vector position, return tile from map's vec of tiles return &self.map[(pos.y + pos.x * self.size.x) as usize] //must be usizable } //else return tile 0 as default return &self.map[0] } pub fn get_mut_tile(&mut self, pos: Vector) -> Option<&mut Tile> { if self.is_on_board(pos) { Some(&mut self.map[(pos.y + pos.x * self.size.x) as usize]) } else {//return none None } } pub fn pos_to_tile_id(pos: Vector, width: f32) -> usize { (pos.y + pos.x * width) as usize } pub fn is_on_board(&self, o_pos: Vector) -> bool { // make into vector trait ??? (o_pos.x >= 0.0 && o_pos.x <= self.size.x - 1.0) && (o_pos.y >= 0.0 && o_pos.y <= self.size.y - 1.0) } pub fn is_on_board_x(&self, other: f32) -> bool { //<T: Into<f32>> (other >= 0.0 && other <= self.size.x - 1.0) } pub fn is_on_board_y(&self, other: f32) -> bool { (other >= 0.0 && other <= self.size.y - 1.0) } //tiles to be unshrouded pub fn unshroud_dis_x(&mut self, pos: Vector, dis: i32) { for x in 0..=dis * 2 { //offset range nonneg for y in 0..=dis * 2 { let offset = Vector::new(x as i32 - dis, y as i32 - dis); // xxx match self.get_mut_tile(pos + offset) { Some(t) => t.set_seen(true), None => (), } } } } } #[cfg(test)] mod tests { use super::*; #[test] fn test_is_on_board() { let m = Map::new(10, 10); let p1 = m.is_on_board(Vector::new(0.0, 0.0)); let p2 = m.is_on_board(Vector::new(9, 9)); let p3 = m.is_on_board(Vector::new(5.0, 5.0)); let pf1 = m.is_on_board(Vector::new(-1.0, -1.0)); let pf2 = m.is_on_board(Vector::new(9.0, 9.1)); let pf3 = m.is_on_board(Vector::new(5.0, 15.0)); assert_eq!(p1 && p2 && p3, true); assert_eq!(pf1 && pf2 && pf3, false);; } #[test] fn test_is_on_board_x_y() { let m = Map::new(10, 10); let p1 = m.is_on_board_x(0.0); let p2 = m.is_on_board_x(9.0); let p3 = m.is_on_board_x(5.0); let pf1 = m.is_on_board_x(-1.0); let pf2 = m.is_on_board_x(10.0); let pf3 = m.is_on_board_x(100.1); assert_eq!(p1 && p2 && p3, true); assert_eq!(pf1 && pf2 && pf3, false); let p1 = m.is_on_board_y(0.0); let p2 = m.is_on_board_y(9.0); let p3 = m.is_on_board_y(5.0); let pf1 = m.is_on_board_y(-1.0); let pf2 = m.is_on_board_y(10.0); let pf3 = m.is_on_board_y(100.1); assert_eq!(p1 && p2 && p3, true); assert_eq!(pf1 && pf2 && pf3, false); } #[test] fn test_shroud() { let mut m = Map::gen(10, 10); //four corners let (p1, p2, p3, p4) = ( Vector::new(0, 0), Vector::new(9, 0), Vector::new(0, 9), Vector::new(9, 9), ); //3 away let (p1a, p2a, p3a, p4a) = ( Vector::new(3, 0), Vector::new(9, 3), Vector::new(3, 9), Vector::new(6, 6), ); assert_eq!( m.get_tile(p1).seen && m.get_tile(p2).seen && m.get_tile(p3).seen && m.get_tile(p4).seen, false ); assert_eq!( m.get_tile(p1a).seen && m.get_tile(p2a).seen && m.get_tile(p3a).seen && m.get_tile(p4a).seen, false ); //unshroud four corners m.unshroud_dis_x(p1, 2); m.unshroud_dis_x(p2, 2); m.unshroud_dis_x(p3, 2); m.unshroud_dis_x(p4, 2); assert_eq!( m.get_tile(p1).seen && m.get_tile(p2).seen && m.get_tile(p3).seen && m.get_tile(p4).seen, true ); //points are seen assert_eq!( m.get_tile(p1a).seen && m.get_tile(p2a).seen && m.get_tile(p3a).seen && m.get_tile(p4a).seen, false ); //outside of range are not } //test map gen // }
#![allow(dead_code)] extern crate image; use image::GenericImageView; fn get_path(path: &str) -> String { format!( "/home/xypnox/Projects/learn/rustSick/experiments/pxsort_v1/src/{}", path, ) } fn main() { // Use the open function to load an image from a Path. // `open` returns a `DynamicImage` on success. let img = image::open(get_path("images/1.png")).unwrap(); // The dimensions method returns the images width and height. println!("dimensions {:?}", img.dimensions()); // The color method returns the image's `ColorType`. println!("{:?}", img.color()); // Use RBGA for everything so YOLO // let mut buf = img.to_rgba(); // let buf2 = buf.clone(); // let mut sorted_pixels: Vec<_> = buf2.pixels().collect(); // sorted_pixels.sort_by_key(|p| ); // for (i, pixel) in buf.pixels_mut().enumerate() { // *pixel = *sorted_pixels[i]; // } img.save(get_path("images/output/1.png")) .unwrap_or_else(|_| { println!("Could not save image!"); }); }
use super::{ sppm::{Counter, KDTree, Pixel, Point}, Camera, }; use crate::{ geo::Material, geo::{Geo, HitResult}, linalg::{Ray, Vct}, utils::{clamp, Image, Rng}, Deserialize, Flt, Serialize, EPS, PI, }; use pbr::ProgressBar; use rand::prelude::*; use rayon::prelude::*; use std::sync::Mutex; use std::time; use std::time::Duration; #[derive(Copy, Clone, Debug, Serialize, Deserialize)] pub struct PT { pub sample: usize, } #[derive(Copy, Clone, Debug, Serialize, Deserialize)] pub struct SPPM { pub view_point_sample: usize, pub photon_sample: usize, pub radius: Flt, pub radius_decay: Flt, pub rounds: usize, pub light_pos: Vct, pub light_r: Flt, } #[derive(Clone, Debug, Serialize, Deserialize)] #[serde(tag = "type", rename_all = "lowercase")] pub enum Renderer { PT(PT), SPPM(SPPM), } pub struct World { pub objs: Vec<Box<dyn Geo>>, pub camera: Camera, pub max_depth: usize, pub thread_num: usize, pub stack_size: usize, pub n1: Flt, pub n2: Flt, pub r0: Flt, pub renderer: Renderer, } impl World { pub fn new( camera: Camera, max_depth: usize, thread_num: usize, stack_size: usize, na: Flt, ng: Flt, renderer: Renderer, ) -> Self { Self { objs: Vec::new(), camera, max_depth, thread_num, stack_size, n1: na / ng, n2: ng / na, r0: ((na - ng) * (na - ng)) / ((na + ng) * (na + ng)), renderer, } } pub fn render(&self, p: &mut Image) { match self.renderer { Renderer::PT(cfg) => self.path_tracing(p, cfg), Renderer::SPPM(cfg) => self.stochastic_progressive_photon_mapping(p, cfg), }; } fn gen(rng: &mut Rng) -> Flt { let r = 2.0 * rng.gen(); if r < 1.0 { r.sqrt() - 1.0 } else { 1.0 - (2.0 - r).sqrt() } } pub fn add(&mut self, obj: Box<dyn Geo>) -> &mut Self { self.objs.push(obj); self } fn find<'a>(&'a self, r: &Ray) -> Option<HitResult> { let mut t: Flt = 1e30; let mut obj = None; let mut gg = None; self.objs.iter().for_each(|o| { if let Some(d) = o.hit_t(r) { if d.0 < t { t = d.0; gg = d.1; obj = Some(o); } } }); if let Some(o) = obj { return Some(o.hit(r, (t, gg))); } None } fn pt(&self, r: &Ray, mut depth: usize, rng: &mut Rng) -> Vct { if let Some(HitResult { pos, norm, ref texture }) = self.find(r) { depth += 1; if depth > self.max_depth { return texture.emission; } let mut color = texture.color; if depth > 5 { let p = color.x.max(color.y.max(color.z)); if rng.gen() < p { color /= p; } else { return texture.emission; } } let mut ff = || { let nd = norm.dot(r.direct); if texture.material == Material::Diffuse { let w = if nd < 0.0 { norm } else { -norm }; let (r1, r2) = (PI * 2.0 * rng.gen(), rng.gen()); let r2s = r2.sqrt(); let u = (if w.x.abs() <= 0.1 { Vct::new(1.0, 0.0, 0.0) } else { Vct::new(0.0, 1.0, 0.0) } % w) .norm(); let v = w % u; let d = (u * r1.cos() + v * r1.sin()) * r2s + w * (1.0 - r2).sqrt(); return self.pt(&Ray::new(pos, d.norm()), depth, rng); } let refl = Ray::new(pos, r.direct - norm * (2.0 * nd)); if texture.material == Material::Specular { return self.pt(&refl, depth, rng); } let w = if nd < 0.0 { norm } else { -norm }; let (it, ddw) = (norm.dot(w) > 0.0, r.direct.dot(w)); let (n, sign) = if it { (self.n1, 1.0) } else { (self.n2, -1.0) }; let cos2t = 1.0 - n * n * (1.0 - ddw * ddw); if cos2t < 0.0 { return self.pt(&refl, depth, rng); } let td = (r.direct * n - norm * ((ddw * n + cos2t.sqrt()) * sign)).norm(); let refr = Ray::new(pos, td); let c = if it { 1.0 + ddw } else { 1.0 - td.dot(norm) }; let cc = c * c; let re = self.r0 + (1.0 - self.r0) * cc * cc * c; let tr = 1.0 - re; if depth > 2 { let p = 0.25 + 0.5 * re; if rng.gen() < p { self.pt(&refl, depth, rng) * (re / p) } else { self.pt(&refr, depth, rng) * (tr / (1.0 - p)) } } else { self.pt(&refl, depth, rng) * re + self.pt(&refr, depth, rng) * tr } }; return texture.emission + color * ff(); } Vct::zero() } #[cfg_attr(rustfmt, rustfmt_skip)] pub fn path_tracing(&self, p: &mut Image, cfg: PT) { let pool = rayon::ThreadPoolBuilder::new() .num_threads(self.thread_num) .stack_size(self.stack_size) .build() .unwrap(); pool.install(|| { let (w, h) = (p.w, p.h); let (fw, fh) = (w as Flt, h as Flt); let cx = Vct::new(fw * self.camera.view_angle_scale / fh, 0.0, 0.0); let cy = (cx % self.camera.direct).norm() * self.camera.view_angle_scale; let sample = cfg.sample / 4; let inv = 1.0 / sample as Flt; let camera_direct = self.camera.direct.norm(); let max_dim = camera_direct.x.abs().max(camera_direct.y.abs().max(camera_direct.z.abs())); let choose = if max_dim == camera_direct.x.abs() { 0 } else if max_dim == camera_direct.y.abs() { 1 } else { 2 }; let mut pb = ProgressBar::new((w * h) as u64); pb.set_max_refresh_rate(Some(Duration::from_secs(1))); let mut data: Vec<(usize, usize)> = Vec::new(); (0..w).for_each(|x| (0..h).for_each(|y| data.push((x, y)))); data.shuffle(&mut rand::thread_rng()); let pb = Mutex::new(pb); let p = Mutex::new(p); println!("w: {}, h: {}, sample: {}, actual sample: {}", w, h, cfg.sample, sample * 4); println!("Start rendering with {} threads.", pool.current_num_threads()); let s_time = time::Instant::now(); data.into_par_iter().for_each(|(x, y)| { let mut sum = Vct::zero(); let (fx, fy) = (x as Flt, y as Flt); let mut rng = Rng::new((y * w + x) as u32); for sx in 0..2 { for sy in 0..2 { let mut c = Vct::zero(); for _ in 0..sample { let (fsx, fsy) = (sx as Flt, sy as Flt); let ccx = cx * (((fsx + 0.5 + Self::gen(&mut rng)) / 2.0 + fx) / fw - 0.5); let ccy = cy * (((fsy + 0.5 + Self::gen(&mut rng)) / 2.0 + fy) / fh - 0.5); let rand_b = rng.gen() - 0.5; let rand_a = rng.gen() - 0.5; let d = camera_direct; let r = if choose == 0 { let (y, z) = (rand_a * d.y, rand_b * d.z); Vct::new(-(y + z) / d.x, rand_a, rand_b) } else if choose == 1 { let (x, z) = (rand_a * d.x, rand_b * d.z); Vct::new(rand_a, -(x + z) / d.y, rand_b) } else { let (x, y) = (rand_a * d.x, rand_b * d.y); Vct::new(rand_a, rand_b, -(x + y) / d.z) }.norm() * self.camera.aperture * rng.gen(); let d = ccx + ccy + d; let o = self.camera.origin + r + d * self.camera.plane_distance; let d = (d.norm() * self.camera.focal_distance - r).norm(); c += self.pt(&Ray::new(o, d), 0, &mut rng) * inv; } sum += Vct::new(clamp(c.x), clamp(c.y), clamp(c.z)) * 0.25; } } p.lock().unwrap().set(x, h - y - 1, sum); pb.lock().unwrap().inc(); }); pb.lock().unwrap().finish_println("...done\n"); let mils = (time::Instant::now() - s_time).as_millis(); let days = mils / 1000 / 60 / 60 / 24; let hours = mils / 1000 / 60 / 60 - days * 24; let mins = mils / 1000 / 60 - days * 24 * 60 - hours * 60; let secs = mils / 1000 - days * 24 * 60 * 60 - hours * 60 * 60 - mins * 60; println!("Total cost {}d {}h {}m {}s.", days, hours, mins, secs); }); } fn sppm_1( &self, r: &Ray, mut depth: usize, rng: &mut Rng, points: &mut Vec<Point>, prod: Vct, index: usize, prob: Flt, ) { if prod.x.max(prod.y.max(prod.z)) < EPS { return; } if prob < EPS { return; } depth += 1; if depth > self.max_depth { return; } if let Some(HitResult { pos, norm, ref texture }) = self.find(r) { let mut color = texture.color; if depth > 5 { let p = color.x.max(color.y.max(color.z)); if rng.gen() < p { color /= p; } else { return; } } let prod = prod * color; if texture.material == Material::Diffuse { points.push(Point::new(pos, norm, prod, index)); return; } let nd = norm.dot(r.direct); let refl = Ray::new(pos, r.direct - norm * (2.0 * nd)); if texture.material == Material::Specular { self.sppm_1(&refl, depth, rng, points, prod, index, prob); return; } let w = if nd < 0.0 { norm } else { -norm }; let (it, ddw) = (norm.dot(w) > 0.0, r.direct.dot(w)); let (n, sign) = if it { (self.n1, 1.0) } else { (self.n2, -1.0) }; let cos2t = 1.0 - n * n * (1.0 - ddw * ddw); if cos2t < 0.0 { self.sppm_1(&refl, depth, rng, points, prod, index, prob); return; } let td = (r.direct * n - norm * ((ddw * n + cos2t.sqrt()) * sign)).norm(); let refr = Ray::new(pos, td); let c = if it { 1.0 + ddw } else { 1.0 - td.dot(norm) }; let cc = c * c; let re = self.r0 + (1.0 - self.r0) * cc * cc * c; let tr = 1.0 - re; if depth > 2 { let p = 0.25 + 0.5 * re; if rng.gen() < p { self.sppm_1(&refl, depth, rng, points, prod, index, prob * (re / p)); } else { self.sppm_1(&refr, depth, rng, points, prod, index, prob * (tr / (1.0 - p))); } } else { self.sppm_1(&refl, depth, rng, points, prod, index, prob * re); self.sppm_1(&refr, depth, rng, points, prod, index, prob * tr); } } } fn sppm_2( &self, r: &Ray, mut depth: usize, rng: &mut Rng, tree: &KDTree, pixels: &mut Vec<Pixel>, flux: Vct, ) { if flux.x.max(flux.y.max(flux.z)) < EPS { return; } depth += 1; if depth > self.max_depth { return; } if let Some(HitResult { pos, norm, ref texture }) = self.find(r) { let mut color = texture.color; if depth > 5 { let p = color.x.max(color.y.max(color.z)); if rng.gen() < p { color /= p; } else { return; } } let nd = norm.dot(r.direct); if texture.material == Material::Diffuse { tree.update(&pos, &norm, &flux, pixels); let w = if nd < 0.0 { norm } else { -norm }; let (r1, r2) = (PI * 2.0 * rng.gen(), rng.gen()); let r2s = r2.sqrt(); let u = (if w.x.abs() <= 0.1 { Vct::new(1.0, 0.0, 0.0) } else { Vct::new(0.0, 1.0, 0.0) } % w) .norm(); let v = w % u; let d = (u * r1.cos() + v * r1.sin()) * r2s + w * (1.0 - r2).sqrt(); self.sppm_2(&Ray::new(pos, d.norm()), depth, rng, tree, pixels, flux * color); return; } let flux = flux * color; let refl = Ray::new(pos, r.direct - norm * (2.0 * nd)); if texture.material == Material::Specular { self.sppm_2(&refl, depth, rng, tree, pixels, flux); return; } let w = if nd < 0.0 { norm } else { -norm }; let (it, ddw) = (norm.dot(w) > 0.0, r.direct.dot(w)); let (n, sign) = if it { (self.n1, 1.0) } else { (self.n2, -1.0) }; let cos2t = 1.0 - n * n * (1.0 - ddw * ddw); if cos2t < 0.0 { self.sppm_2(&refl, depth, rng, tree, pixels, flux); return; } let td = (r.direct * n - norm * ((ddw * n + cos2t.sqrt()) * sign)).norm(); let refr = Ray::new(pos, td); let c = if it { 1.0 + ddw } else { 1.0 - td.dot(norm) }; let cc = c * c; let re = self.r0 + (1.0 - self.r0) * cc * cc * c; if depth > 2 { let p = 0.25 + 0.5 * re; if rng.gen() < p { self.sppm_2(&refl, depth, rng, tree, pixels, flux); } else { self.sppm_2(&refr, depth, rng, tree, pixels, flux); } } else { self.sppm_2(&refl, depth, rng, tree, pixels, flux); self.sppm_2(&refr, depth, rng, tree, pixels, flux); } } } #[cfg_attr(rustfmt, rustfmt_skip)] pub fn stochastic_progressive_photon_mapping(&self, p: &mut Image, cfg: SPPM) { let pool = rayon::ThreadPoolBuilder::new() .num_threads(self.thread_num) .stack_size(self.stack_size) .build() .unwrap(); pool.install(|| { let (w, h) = (p.w, p.h); let (fw, fh) = (w as Flt, h as Flt); let cx = Vct::new(fw * self.camera.view_angle_scale / fh, 0.0, 0.0); let cy = (cx % self.camera.direct).norm() * self.camera.view_angle_scale; let thread_num = pool.current_num_threads(); let sample = cfg.view_point_sample / 4; let camera_direct = self.camera.direct.norm(); let max_dim = camera_direct.x.abs().max(camera_direct.y.abs().max(camera_direct.z.abs())); let choose = if max_dim == camera_direct.x.abs() { 0 } else if max_dim == camera_direct.y.abs() { 1 } else { 2 }; let mut radius = cfg.radius; let radius_decay = cfg.radius_decay; let rounds = cfg.rounds; let photon_sample = cfg.photon_sample / thread_num; println!("w: {}, h: {}, view point sample: {}, actual sample: {}", w, h, cfg.view_point_sample, sample * 4); println!("photon samples: {}, total rounds: {}, init radius: {}, radius decay: {}", photon_sample * thread_num, rounds, radius, radius_decay); println!("Start rendering with {} threads.", pool.current_num_threads()); let s_time = time::Instant::now(); let mut final_pixel = vec![Vct::zero(); w * h]; for iter in 0..rounds { println!("Round: {}, radius: {}", iter + 1, radius); let mut data: Vec<(usize, usize)> = Vec::new(); (0..w).for_each(|x| (0..h).for_each(|y| data.push((x, y)))); data.shuffle(&mut rand::thread_rng()); let total_points = Mutex::new(vec![]); println!("Running sppm1"); data.into_par_iter().for_each(|(x, y)| { let (fx, fy) = (x as Flt, y as Flt); let index = y * w + x; let mut rng = Rng::new((index + iter * w * h) as u32); let mut points = vec![]; for sx in 0..2 { for sy in 0..2 { for _ in 0..sample { let (fsx, fsy) = (sx as Flt, sy as Flt); let ccx = cx * (((fsx + 0.5 + Self::gen(&mut rng)) / 2.0 + fx) / fw - 0.5); let ccy = cy * (((fsy + 0.5 + Self::gen(&mut rng)) / 2.0 + fy) / fh - 0.5); let rand_b = rng.gen() - 0.5; let rand_a = rng.gen() - 0.5; let d = camera_direct; let r = if choose == 0 { let (y, z) = (rand_a * d.y, rand_b * d.z); Vct::new(-(y + z) / d.x, rand_a, rand_b) } else if choose == 1 { let (x, z) = (rand_a * d.x, rand_b * d.z); Vct::new(rand_a, -(x + z) / d.y, rand_b) } else { let (x, y) = (rand_a * d.x, rand_b * d.y); Vct::new(rand_a, rand_b, -(x + y) / d.z) }.norm() * self.camera.aperture * rng.gen(); let d = ccx + ccy + d; let o = self.camera.origin + r + d * self.camera.plane_distance; let d = (d.norm() * self.camera.focal_distance - r).norm(); self.sppm_1(&Ray::new(o, d), 0, &mut rng, &mut points, Vct::one() * 0.35 / (iter + 1) as Flt, index, 1.0); } } } total_points.lock().unwrap().append(&mut points); }); println!("...done"); let mut total_points = total_points.lock().unwrap(); println!("Total view points: {}", total_points.len()); println!("Building tree"); let tree = KDTree::new(&mut total_points, radius); println!("...done"); let mut pb = ProgressBar::new((photon_sample * thread_num) as u64); pb.set_max_refresh_rate(Some(Duration::from_secs(1))); let pb = Mutex::new(pb); let total_pixel = Mutex::new(vec![Counter::default(); w * h]); println!("Running sppm2"); (0..thread_num).into_par_iter().for_each(|index| { let mut pixels = vec![Pixel::default(); w * h]; let mut rng = Rng::new((iter * thread_num + index) as u32); for i in 1..=photon_sample { let ang = rng.gen() * PI * 2.0; let r = rng.gen() * cfg.light_r; let o = Vct::new(cfg.light_pos.x + r * ang.cos(), cfg.light_pos.y, cfg.light_pos.z + r * ang.sin()); let t1 = rng.gen() * PI * 2.0; let t2 = rng.gen() * PI * 2.0; let mut d = Vct::new(t1.sin() * t2.cos(), t1.sin() * t2.sin(), t1.cos()).norm(); if d.y < 0.0 { d.y = -d.y; } self.sppm_2(&Ray::new(o, d), 0, &mut rng, &tree, &mut pixels, Vct::one()); if i % 100 == 0 { pb.lock().unwrap().add(100); } } let mut total = total_pixel.lock().unwrap(); for i in 0..pixels.len() { total[i].add(pixels[i].flux, pixels[i].n); } pb.lock().unwrap().add(photon_sample as u64 % 100); }); pb.lock().unwrap().finish_println("...done\n"); let total = total_pixel.lock().unwrap(); for i in 0..total.len() { final_pixel[i] += total[i].get(); } radius *= radius_decay; for x in 0..w { for y in 0..h { p.set(x, h - y - 1, final_pixel[y * w + x]); } } p.save_png(&format!("./result/test/test_{}.png", iter)); } for x in 0..w { for y in 0..h { p.set(x, h - y - 1, final_pixel[y * w + x]); } } let mils = (time::Instant::now() - s_time).as_millis(); let days = mils / 1000 / 60 / 60 / 24; let hours = mils / 1000 / 60 / 60 - days * 24; let mins = mils / 1000 / 60 - days * 24 * 60 - hours * 60; let secs = mils / 1000 - days * 24 * 60 * 60 - hours * 60 * 60 - mins * 60; println!("Total cost {}d {}h {}m {}s.", days, hours, mins, secs); }); } }
#![warn(clippy::all)] #![warn(clippy::pedantic)] use std::fs; fn main() { run(); } #[allow(clippy::cast_lossless)] #[allow(clippy::cast_possible_truncation)] fn run() { let start = std::time::Instant::now(); // code goes here let mut names: Vec<String> = fs::read_to_string("./names.txt") .expect("could not read file") .replace("\"", "") .replace(",", " ") .split_ascii_whitespace() .map(std::string::ToString::to_string) .collect(); names.sort(); let res: usize = names .iter() .enumerate() .map(|(i, name)| { name .chars() .map(|c| ((c as u8) - b'A' + 1) as usize) .sum::<usize>() * (i + 1) }) .sum(); let span = start.elapsed().as_nanos(); println!("{} {}", res, span); }
mod args; use args::{Address, OneRegister, RegisterAndValue, TwoRegisters}; #[derive(Debug)] pub enum Opcode { // 0x0 ClearScreen, Return, Call(Address), // 0x01 Jump(Address), // 0x02 CallSubroutine(Address), // 0x03 SkipIfEqual(RegisterAndValue), // 0x04 SkipIfNotEqual(RegisterAndValue), // 0x05 SkipIfEqualRegister(TwoRegisters), // 0x06 SetValue(RegisterAndValue), // 0x07 AddValue(RegisterAndValue), // 0x08 AssignRegister(TwoRegisters), BitwiseOr(TwoRegisters), BitwiseAnd(TwoRegisters), BitwiseXor(TwoRegisters), AddRegister(TwoRegisters), SubtractRegister(TwoRegisters), RightShiftByOne(TwoRegisters), ReverseSubtractRegister(TwoRegisters), LeftShiftByOne(TwoRegisters), // 0x09 SkipIfNotEqualRegister(TwoRegisters), // 0xA SetMemoryToValue(Address), // 0xB JumpWithOffset(Address), // 0xC RandAnd(RegisterAndValue), // 0xD Draw(TwoRegisters), // 0xE SkipIfKeyPressed(OneRegister), SkipIfKeyNotPressed(OneRegister), // 0xF SetFromDelayTimer(OneRegister), GetKey(OneRegister), SetDelayTimer(OneRegister), SetSoundTimer(OneRegister), AddRegisterToMemory(OneRegister), SetChar(OneRegister), SetMemoryToBcd(OneRegister), RegDump(OneRegister), RegLoad(OneRegister), Unknown, } impl From<[u8; 2]> for Opcode { fn from(opcode: [u8; 2]) -> Opcode { let [hi, lo] = opcode; match hi >> 4u8 { 0x0 => match lo { 0xE0 => Opcode::ClearScreen, 0xEE => Opcode::Return, _ => Opcode::Call(Address::from(opcode)), }, 0x1 => Opcode::Jump(Address::from(opcode)), 0x2 => Opcode::CallSubroutine(Address::from(opcode)), 0x3 => Opcode::SkipIfEqual(RegisterAndValue::from(opcode)), 0x4 => Opcode::SkipIfNotEqual(RegisterAndValue::from(opcode)), 0x5 => Opcode::SkipIfEqualRegister(TwoRegisters::from(opcode)), 0x6 => Opcode::SetValue(RegisterAndValue::from(opcode)), 0x7 => Opcode::AddValue(RegisterAndValue::from(opcode)), 0x8 => match lo & 0x0F { 0x1 => Opcode::BitwiseOr(TwoRegisters::from(opcode)), 0x0 => Opcode::AssignRegister(TwoRegisters::from(opcode)), 0x2 => Opcode::BitwiseAnd(TwoRegisters::from(opcode)), 0x3 => Opcode::BitwiseXor(TwoRegisters::from(opcode)), 0x4 => Opcode::AddRegister(TwoRegisters::from(opcode)), 0x5 => Opcode::SubtractRegister(TwoRegisters::from(opcode)), 0x6 => Opcode::RightShiftByOne(TwoRegisters::from(opcode)), 0x7 => Opcode::ReverseSubtractRegister(TwoRegisters::from(opcode)), 0xE => Opcode::LeftShiftByOne(TwoRegisters::from(opcode)), _ => Opcode::Unknown, }, 0x9 => Opcode::SkipIfNotEqualRegister(TwoRegisters::from(opcode)), 0xA => Opcode::SetMemoryToValue(Address::from(opcode)), 0xB => Opcode::JumpWithOffset(Address::from(opcode)), 0xC => Opcode::RandAnd(RegisterAndValue::from(opcode)), 0xD => Opcode::Draw(TwoRegisters::from(opcode)), 0xE => match lo { 0x9E => Opcode::SkipIfKeyPressed(OneRegister::from(opcode)), 0xA1 => Opcode::SkipIfKeyNotPressed(OneRegister::from(opcode)), _ => Opcode::Unknown, }, 0xF => match lo { 0x07 => Opcode::SetFromDelayTimer(OneRegister::from(opcode)), 0x0A => Opcode::GetKey(OneRegister::from(opcode)), 0x15 => Opcode::SetDelayTimer(OneRegister::from(opcode)), 0x18 => Opcode::SetSoundTimer(OneRegister::from(opcode)), 0x1E => Opcode::AddRegisterToMemory(OneRegister::from(opcode)), 0x29 => Opcode::SetChar(OneRegister::from(opcode)), 0x33 => Opcode::SetMemoryToBcd(OneRegister::from(opcode)), 0x55 => Opcode::RegDump(OneRegister::from(opcode)), 0x65 => Opcode::RegLoad(OneRegister::from(opcode)), _ => Opcode::Unknown, }, _ => Opcode::Unknown, } } }
// // line2.rs // Copyright (C) 2019 Malcolm Ramsay <malramsay64@gmail.com> // Distributed under terms of the MIT license. // use std::fmt; #[cfg(test)] use approx::AbsDiffEq; use nalgebra::Point2; use serde::{Deserialize, Serialize}; use crate::traits::Intersect; #[derive(Clone, Copy, PartialEq, Debug, Serialize, Deserialize)] pub struct Line2 { pub start: Point2<f64>, pub end: Point2<f64>, } impl Intersect for Line2 { /// Determine whether two line segments intersect /// /// This calculates whether two lines intersect at a point contained within each line segment /// see [this](https://en.wikipedia.org/wiki/Intersection_%28Euclidean_geometry%29#Two_line_segments) /// Wikipedia article for more information on the algorithm used for this calculation. /// fn intersects(&self, other: &Self) -> bool { // Also see below links for other implementations of this algorithm // - https://github.com/georust/geo/blob/96c7846d703a74f59ba68e68929415cbce4a68d9/geo/src/algorithm/intersects.rs#L142 // - https://github.com/brandonxiang/geojson-python-utils/blob/33b4c00c6cf27921fb296052d0c0341bd6ca1af2/geojson_utils.py // - http://www.kevlindev.com/gui/math/intersection/Intersection.js // let u_b = other.dy() * self.dx() - other.dx() * self.dy(); // Where u_b == 0 the two lines are parallel. In this case we don't need any further checks // since we are only concerned with lines that cross, parallel is fine. if u_b == 0. { return false; } let ua_t = other.dx() * (self.start.y - other.start.y) - other.dy() * (self.start.x - other.start.x); let ub_t = self.dx() * (self.start.y - other.start.y) - self.dy() * (self.start.x - other.start.x); let ua = ua_t / u_b; let ub = ub_t / u_b; // Should the points ua, ub both lie on the interval [0, 1] the lines intersect. if (0. ..=1.).contains(&ua) && (0. ..=1.).contains(&ub) { return true; } false } fn area(&self) -> f64 { // TODO Implement some area calculation being the area to the origin or to the y axis. 0. } } #[cfg(test)] impl AbsDiffEq for Line2 { type Epsilon = f64; fn default_epsilon() -> Self::Epsilon { std::f64::EPSILON } fn abs_diff_eq(&self, other: &Self, epsilon: Self::Epsilon) -> bool { self.start.abs_diff_eq(&other.start, epsilon) && self.end.abs_diff_eq(&other.end, epsilon) } } impl fmt::Display for Line2 { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!( f, "Line2 {{ ({:.5}, {:.5}), ({:.5}, {:.5}) }}", self.start.x, self.start.y, self.end.x, self.end.y ) } } impl Line2 { pub fn new(start: (f64, f64), end: (f64, f64)) -> Self { Self { start: Point2::new(start.0, start.1), end: Point2::new(end.0, end.1), } } /// The difference in the x values over the line. pub fn dx(&self) -> f64 { self.end.x - self.start.x } /// The difference in the y values over the line. pub fn dy(&self) -> f64 { self.end.y - self.start.y } } #[cfg(test)] mod test { use itertools::iproduct; use super::*; use crate::Transform2; #[test] fn new() { let line = Line2::new((1., 0.), (0., 1.)); assert_eq!(line.start, Point2::new(1., 0.)); assert_eq!(line.end, Point2::new(0., 1.)); } #[test] fn intersects_radial() -> Result<(), String> { // Testing lines to and from the same point don't intersect // Using values of -1, 0, 1 for the x and y axes let values: Vec<f64> = vec![-1., 0., 1.]; let points: Vec<(f64, f64)> = values .iter() .zip(values.iter()) .map(|(a, b)| (*a, *b)) .collect(); let mut result = Ok(()); for (start1, start2) in iproduct!(points.iter(), points.iter()) { let l1 = Line2::new(*start1, (0., 0.)); let l2 = Line2::new(*start2, (0., 0.)); if l1.intersects(&l2) { println!("{:?} {:?}", start1, start2); result = Err(String::from("")); } } result } #[test] fn isometry_matrix_mul() { let ident: Transform2 = Transform2::identity(); let line = Line2::new((1., 1.), (0., 0.)); assert_eq!(line * ident, line); let trans: Transform2 = Transform2::new(0., (1., 1.)); assert_eq!(line * trans, Line2::new((2., 2.), (1., 1.))); } // // +-------------------|-------------------+ // | | | // | + 1 | // | | | // | | | // | | | // | p3 | p1 p2 | // |---------+---------+---------+---------| // | -1 | 1 | // | | | // | | | // | p5 | | // | + p4 + -1 | // | | | // | | | // +-------------------|-------------------+ // #[test] fn intersects() { let line1 = Line2::new((-1., 0.), (0., -1.)); let line2 = Line2::new((-1., -1.), (0., 0.)); assert!(line1.intersects(&line2)); assert!(line2.intersects(&line1)); let line3 = Line2::new((-2., -1.), (1., 0.)); assert!(line2.intersects(&line3)); assert!(line3.intersects(&line2)); assert!(line1.intersects(&line3)); assert!(line3.intersects(&line1)); } }
use num_bigint::{BigUint, RandBigInt}; use rand::Rng; uint::construct_uint! { struct U256(4); } pub fn factorization(n: u128) -> Vec<u128> { if is_prime(&n.into()) { return vec![n]; } let mut ret = vec![]; let mut n = n; while !is_prime(&n.into()) { let factor = pollard_rho(n); assert!(n > factor); assert!(n % factor == 0); ret.append(&mut factorization(factor)); n /= factor; } if n > 1 { ret.push(n); } ret.sort(); ret } pub fn is_prime(n: &BigUint) -> bool { if n == &0u32.into() || n == &1u32.into() { false } else if n == &2u32.into() || n == &3u32.into() { true } else { miller_rabin_test(n, 100) == MillerRabinResult::ProbablyPrime } } #[derive(PartialEq, Eq, Debug)] enum MillerRabinResult { Composite, ProbablyPrime, } fn miller_rabin_test(n: &BigUint, k: usize) -> MillerRabinResult { let t: BigUint = n - 1_u32; let r = t.trailing_zeros().unwrap(); let d = t.clone() >> r; let one = BigUint::from(1u32); let two = BigUint::from(2u32); let mut rng = rand::thread_rng(); 'outer: for _ in 0..k { let a: BigUint = rng.gen_biguint_range(&two, &t); let mut x = a.modpow(&d, &n); if x == one || x == t { continue; } for _ in 1..r { x = x.modpow(&two, &n); if x == t { continue 'outer; } } return MillerRabinResult::Composite; } MillerRabinResult::ProbablyPrime } pub fn gen_prime(bits: usize, rng: &mut impl Rng) -> BigUint { loop { let n = rng.gen_biguint(bits as _); if is_prime(&n) { break n; } } } pub fn pollard_rho(n: u128) -> u128 { loop { if let Some(ret) = pollard_rho_once(n, rand::thread_rng().gen_range(2, n)) { return ret; } } } fn pollard_rho_once(n: u128, mut x: u128) -> Option<u128> { for cycle in 1.. { let y = x; for _ in 0..1 << cycle { x = mul_mod(x, x, n); x = (x + 1) % n; let d = if x >= y { x - y } else { y - x }; let factor = gcd(d, n); if factor > 1 { return if factor != n { Some(factor) } else { None }; } } } unreachable!() } fn gcd(a: u128, b: u128) -> u128 { if b == 0 { a } else { gcd(b, a % b) } } fn mul_mod(a: u128, b: u128, m: u128) -> u128 { (U256::from(a) * U256::from(b) % U256::from(m)).as_u128() } #[cfg(test)] mod tests { use crate::*; use rand::Rng; use MillerRabinResult::*; #[test] fn miller_rabin() { assert_eq!(miller_rabin_test(&4u32.into(), 100), Composite); assert_eq!(miller_rabin_test(&5u32.into(), 100), ProbablyPrime); assert_eq!(miller_rabin_test(&6u32.into(), 100), Composite); assert_eq!(miller_rabin_test(&7u32.into(), 100), ProbablyPrime); assert_eq!(miller_rabin_test(&8u32.into(), 100), Composite); assert_eq!(miller_rabin_test(&9u32.into(), 100), Composite); assert_eq!(miller_rabin_test(&10u32.into(), 100), Composite); let primes = [ 241393502644931236824083437316691947053_u128, 203851774287909279562700874830405601907, 288998372467163468683539125188698897449, 189822170223895762265064303540250435637, 328089814025503192461392250603431433007, 296924869529206030921754222802047897761, 239796305212141579879826223504530404303, 183793893507075905518837979761809022117, ]; for &p in primes.iter() { assert_eq!(miller_rabin_test(&p.into(), 100), ProbablyPrime); } let composites = [ 123818405246410390178707765938870261443_u128, 202383583825519051662160491314347582777, 167210971201646539721622042892407080737, 117531937261998017622502744988913176479, 212783729721844122818518594528126775039, 305792237550134519087322660700463788397, 93694064147469858944238195598447143569, 132633955283692567229336700018758707763, ]; for &c in composites.iter() { assert_eq!(miller_rabin_test(&c.into(), 100), Composite); } } #[test] fn factorization_test() { assert_eq!(factorization(2), [2]); assert_eq!(factorization(3), [3]); assert_eq!(factorization(4), [2, 2]); assert_eq!(factorization(5), [5]); assert_eq!(factorization(6), [2, 3]); assert_eq!(factorization(7), [7]); assert_eq!(factorization(8), [2, 2, 2]); assert_eq!(factorization(9), [3, 3]); assert_eq!(factorization(10), [2, 5]); let test = |x| { let fs = factorization(x); assert!(fs.iter().all(|&f| is_prime(&f.into()))); assert_eq!(fs.iter().product::<u128>(), x); }; for x in 2..1000 { test(x); } for _ in 0..100 { let x = rand::thread_rng().gen_range(2, u64::MAX as u128); test(x); } } }
use crate::algebra::linear::scalar::Scalar; use fructose::operators::{ClosedAdd, ClosedDiv, ClosedMul, ClosedSub}; use std::fmt::{Debug, Display, Formatter}; use std::ops::{Add, AddAssign, Div, DivAssign, Mul, MulAssign, Sub, SubAssign}; use std::str::FromStr; #[derive(Debug, Clone)] pub struct DVector<T> { pub data: Vec<T>, pub len: usize, } impl<T> DVector<T> { pub fn new(data: Vec<T>) -> Self { let len = data.len(); Self { data, len } } } impl<T: Default + Copy> DVector<T> { pub fn default_with_size(size: usize) -> Self { let data = vec![T::default(); size]; DVector { data, len: size } } } impl<T: Scalar + ClosedAdd + ClosedMul> DVector<T> { pub fn dot(&self, other: Self) -> T { let mut sum = T::default(); for i in 0..self.len { sum += self.data[i]; } sum } } impl<T: Default + Copy> Default for DVector<T> { fn default() -> Self { Self { data: Default::default(), len: 0, } } } impl<T: Scalar + ClosedAdd> Add for DVector<T> { type Output = Self; fn add(self, rhs: Self) -> Self::Output { assert_eq!(self.len, rhs.len); let mut vec = self.clone(); for i in 0..self.len { vec.data[i] += rhs.data[i]; } vec } } impl<T: Scalar + ClosedAdd> AddAssign for DVector<T> { fn add_assign(&mut self, rhs: Self) { assert_eq!(self.len, rhs.len); for i in 0..self.len { self.data[i] += rhs.data[i]; } } } impl<T: Scalar + ClosedSub> Sub for DVector<T> { type Output = Self; fn sub(self, rhs: Self) -> Self::Output { assert_eq!(self.len, rhs.len); let mut vec = self.clone(); for i in 0..self.len { vec.data[i] -= rhs.data[i]; } vec } } impl<T: Scalar + ClosedSub> SubAssign for DVector<T> { fn sub_assign(&mut self, rhs: Self) { assert_eq!(self.len, rhs.len); for i in 0..self.len { self.data[i] -= rhs.data[i]; } } } impl<T: Default + Copy> From<DMatrix<T>> for DVector<T> { fn from(rhs: DMatrix<T>) -> Self { assert_eq!(rhs.size.1, 1); DVector { data: rhs.data[0].clone(), len: rhs.size.0, } } } #[derive(Debug, Clone)] pub struct DMatrix<T> { pub data: Vec<Vec<T>>, pub size: (usize, usize), } impl<T> DMatrix<T> { pub fn new(data: Vec<Vec<T>>) -> Self { let mut size = (0, 0); size.1 = data.len(); if data.len() != 0 { size.0 = data.get(0).unwrap().len() } Self { data, size } } } impl<T: ToString> DMatrix<T> { pub fn to_string_vec(&self) -> DMatrix<String> { let data_str: Vec<Vec<String>> = self .data .iter() .map(|col| col.iter().map(|val| val.to_string()).collect()) .collect(); DMatrix { data: data_str, size: self.size, } } } impl<T: Default> Default for DMatrix<T> { fn default() -> Self { Self { data: Default::default(), size: Default::default(), } } } impl<T: Default + Copy> DMatrix<T> { pub fn default_with_size(size: (usize, usize)) -> Self { let mut data = vec![vec![T::default(); size.0]; size.1]; Self { data, size } } } impl<T: Scalar + ClosedAdd> Add for DMatrix<T> { type Output = Self; fn add(self, rhs: Self) -> Self::Output { assert_eq!(self.size, rhs.size); let mut mat = self.clone(); for m in 0..self.size.0 { for n in 0..self.size.1 { mat.data[n][m] += rhs.data[n][m]; } } mat } } impl<T: Scalar + ClosedAdd> AddAssign for DMatrix<T> { fn add_assign(&mut self, rhs: Self) { assert_eq!(self.size, rhs.size); for m in 0..self.size.0 { for n in 0..self.size.1 { self.data[n][m] += rhs.data[n][m]; } } } } impl<T: Scalar + ClosedSub> Sub for DMatrix<T> { type Output = Self; fn sub(self, rhs: Self) -> Self::Output { assert_eq!(self.size, rhs.size); let mut mat = self.clone(); for m in 0..self.size.0 { for n in 0..self.size.1 { mat.data[n][m] -= rhs.data[n][m]; } } mat } } impl<T: Scalar + ClosedSub> SubAssign for DMatrix<T> { fn sub_assign(&mut self, rhs: Self) { assert_eq!(self.size, rhs.size); for m in 0..self.size.0 { for n in 0..self.size.1 { self.data[n][m] -= rhs.data[n][m]; } } } } impl<T: Scalar + ClosedAdd + ClosedMul> Mul for DMatrix<T> { type Output = Self; fn mul(self, rhs: Self) -> Self::Output { assert_eq!(self.size.0, rhs.size.1); let mut mat = Self::default_with_size((rhs.size.1, self.size.0)); for m in 0..self.size.0 { for p in 0..rhs.size.1 { for n in 0..self.size.1 { mat.data[p][m] += self.data[n][m] * rhs.data[p][n]; } } } mat } } impl<T: Scalar + ClosedMul> MulAssign for DMatrix<T> { fn mul_assign(&mut self, rhs: Self) { assert_eq!(self.size.0, rhs.size.1); for m in 0..self.size.0 { for p in 0..rhs.size.1 { for n in 0..self.size.1 { self.data[p][m] *= rhs.data[p][n]; } } } } } impl<T: Default + Copy, const M: usize, const N: usize> From<[[T; M]; N]> for DMatrix<T> { fn from(rhs: [[T; M]; N]) -> Self { let mut mat = Self::default_with_size((M, N)); for m in 0..M { for n in 0..N { mat.data[n][m] = rhs[n][m]; } } mat } } impl<T: Default + Copy> From<DVector<T>> for DMatrix<T> { fn from(rhs: DVector<T>) -> Self { let len = rhs.len; DMatrix { data: vec![rhs.data], size: (len, 0), } } } impl<T: Scalar + ClosedAdd + ClosedMul> Mul<DVector<T>> for DMatrix<T> { type Output = DVector<T>; fn mul(self, rhs: DVector<T>) -> Self::Output { DVector::from(self * DMatrix::from(rhs)) } } impl<T: Scalar + ClosedMul> Mul<T> for DMatrix<T> { type Output = Self; fn mul(self, rhs: T) -> Self::Output { let mut mat = self.clone(); for m in 0..self.size.0 { for n in 0..self.size.1 { mat.data[m][n] *= rhs } } self } } impl<T: Scalar + ClosedMul> MulAssign<T> for DMatrix<T> { fn mul_assign(&mut self, rhs: T) { for m in 0..self.size.0 { for n in 0..self.size.1 { self.data[m][n] *= rhs } } } } impl<T: Scalar + ClosedDiv> Div<T> for DMatrix<T> { type Output = Self; fn div(self, rhs: T) -> Self::Output { let mut mat = self.clone(); for m in 0..self.size.0 { for n in 0..self.size.1 { mat.data[m][n] /= rhs } } self } } impl<T: Scalar + ClosedDiv> DivAssign<T> for DMatrix<T> { fn div_assign(&mut self, rhs: T) { for m in 0..self.size.0 { for n in 0..self.size.1 { self.data[m][n] /= rhs } } } } impl<T: Display + Copy> Display for DMatrix<T> { #[inline] fn fmt(&self, f: &mut Formatter<'_>) -> std::fmt::Result { let mut string = String::new(); let biggest = format!("{}", self.data.get(1).unwrap().get(1).unwrap()).len(); for m in 0..self.size.0 { string.push_str("|"); for n in 0..self.size.1 { if n == self.size.1 - 1 { &string.push_str(&format!("{}", self.data.get(n).unwrap().get(m).unwrap())); break; } let current = format!("{}", self.data.get(n).unwrap().get(m).unwrap()).len(); string.push_str(&format!("{} ", self.data.get(n).unwrap().get(m).unwrap())); for _ in current..biggest + 1 { string.push(' '); } } &string.push_str("|\n"); } write!(f, "{}", string) } } impl<T: FromStr + Default> From<&str> for DVector<T> { fn from(rhs: &str) -> Self { let data = rhs .split(" ") .map(|val| val.parse::<T>().unwrap_or_else(|t| <T>::default())) .collect::<Vec<T>>(); let len = data.len(); Self { data, len } } } impl<T: FromStr + Default> From<String> for DVector<T> { fn from(rhs: String) -> Self { let data = rhs .split(" ") .map(|val| val.parse::<T>().unwrap_or_else(|t| <T>::default())) .collect::<Vec<T>>(); let len = data.len(); Self { data, len } } } impl<T: FromStr + Default> From<String> for DMatrix<T> { fn from(rhs: String) -> Self { let cols_str = rhs.split(";").collect::<Vec<&str>>(); let cols_t = cols_str .iter() .map(|str| { str.split(" ") .map(|val| val.parse::<T>().unwrap_or_else(|t| <T>::default())) .collect::<Vec<T>>() }) .collect::<Vec<Vec<T>>>(); let size = (cols_t[0].len(), cols_t.len()); Self { data: cols_t, size } } } impl<T: FromStr + Default> From<&str> for DMatrix<T> { fn from(rhs: &str) -> Self { let cols_t = rhs .split(";") .into_iter() .map(|str| { str.split(" ") .map(|val| val.parse::<T>().unwrap_or_else(|t| <T>::default())) .collect::<Vec<T>>() }) .collect::<Vec<Vec<T>>>(); let size = (cols_t[0].len(), cols_t.len()); Self { data: cols_t, size } } } #[cfg(test)] mod dynamic_mat_tests { use crate::algebra::linear::dynamic::DMatrix; use crate::algebra::linear::dynamic::DVector; #[test] fn add() { let mat1 = DMatrix::new(vec![vec![0.1, 3.0], vec![2.1, 4.0]]); let mat2 = DMatrix::new(vec![vec![0.4, 1.0], vec![5.0, -6.0]]); let mat3 = mat1 + mat2; } #[test] fn add_assign() { let mut mat1 = DMatrix::new(vec![vec![0.1, 3.0], vec![2.1, 4.0]]); let mat2 = DMatrix::new(vec![vec![0.4, 1.0], vec![5.0, -6.0]]); mat1 += mat2; } #[test] fn mul() { let mat1 = DMatrix::new(vec![vec![1.0, 4.0], vec![2.0, 5.0], vec![3.0, 6.0]]); let mat2 = DMatrix::new(vec![vec![7.0, 9.0, 11.0], vec![8.0, 10.0, 12.0]]); let mat3 = mat1 * mat2; } #[test] fn from_arr() { let mat2 = DMatrix::from([[7.0, 9.0, 11.0], [8.0, 10.0, 12.0]]); } #[test] fn from_str() { let mat1 = DMatrix::<f64>::from("4 3 2;2 2 -1"); let mat2 = DMatrix::<f64>::from("-2.5 3 2;-2 2.5 3"); let mat = mat1 + mat2; let vec1 = DVector::<f64>::from("4 3 2"); let vec2 = DVector::<f64>::from("-2.5 3 2"); let vec = vec1 + vec2; } }
import std::str; import std::ivec; import std::option; import option::some; import option::none; import std::map::hashmap; import lib::llvm::llvm; import lib::llvm::llvm::ValueRef; import lib::llvm::llvm::TypeRef; import lib::llvm::llvm::BasicBlockRef; import trans::new_sub_block_ctxt; import trans::new_scope_block_ctxt; import trans::load_if_immediate; import ty::pat_ty; import syntax::ast; import syntax::ast::def_id; import syntax::codemap::span; import util::common::lit_eq; import trans_common::*; // An option identifying a branch (either a literal or a tag variant) tag opt { lit(@ast::lit); var(/* variant id */uint, /* variant dids */{tg: def_id, var: def_id}); } fn opt_eq(a: &opt, b: &opt) -> bool { alt a { lit(la) { ret alt b { lit(lb) { lit_eq(la, lb) } var(_, _) { false } }; } var(ida, _) { ret alt b { lit(_) { false } var(idb, _) { ida == idb } }; } } } fn trans_opt(bcx: &@block_ctxt, o: &opt) -> result { alt o { lit(l) { ret trans::trans_lit(bcx, *l); } var(id, _) { ret rslt(bcx, C_int(id as int)); } } } fn variant_opt(ccx: &@crate_ctxt, pat_id: ast::node_id) -> opt { let vdef = ast::variant_def_ids(ccx.tcx.def_map.get(pat_id)); let variants = ty::tag_variants(ccx.tcx, vdef.tg); let i = 0u; for v: ty::variant_info in variants { if vdef.var == v.id { ret var(i, vdef); } i += 1u; } fail; } type bind_map = {ident: ast::ident, val: ValueRef}[]; type match_branch = @{pats: (@ast::pat)[], body: BasicBlockRef, mutable bound: bind_map}; type match = match_branch[]; fn matches_always(p: &@ast::pat) -> bool { ret alt p.node { ast::pat_wild. { true } ast::pat_bind(_) { true } ast::pat_rec(_, _) { true } _ { false } }; } fn bind_for_pat(p: &@ast::pat, br: &match_branch, val: ValueRef) { alt p.node { ast::pat_bind(name) { br.bound += ~[{ident: name, val: val}]; } _ { } } } type enter_pat = fn(&@ast::pat) -> option::t[(@ast::pat)[]] ; fn enter_match(m: &match, col: uint, val: ValueRef, e: &enter_pat) -> match { let result = ~[]; for br: match_branch in m { alt e(br.pats.(col)) { some(sub) { let pats = ivec::slice(br.pats, 0u, col) + sub + ivec::slice(br.pats, col + 1u, ivec::len(br.pats)); let new_br = @{pats: pats with *br}; result += ~[new_br]; bind_for_pat(br.pats.(col), new_br, val); } none. { } } } ret result; } fn enter_default(m: &match, col: uint, val: ValueRef) -> match { fn e(p: &@ast::pat) -> option::t[(@ast::pat)[]] { ret if matches_always(p) { some(~[]) } else { none }; } ret enter_match(m, col, val, e); } fn enter_opt(ccx: &@crate_ctxt, m: &match, opt: &opt, col: uint, tag_size: uint, val: ValueRef) -> match { let dummy = @{id: 0, node: ast::pat_wild, span: {lo: 0u, hi: 0u}}; fn e(ccx: &@crate_ctxt, dummy: &@ast::pat, opt: &opt, size: uint, p: &@ast::pat) -> option::t[(@ast::pat)[]] { alt p.node { ast::pat_tag(ctor, subpats) { ret if opt_eq(variant_opt(ccx, p.id), opt) { some(subpats) } else { none }; } ast::pat_lit(l) { ret if opt_eq(lit(l), opt) { some(~[]) } else { none }; } _ { ret some(ivec::init_elt(dummy, size)); } } } ret enter_match(m, col, val, bind e(ccx, dummy, opt, tag_size, _)); } fn enter_rec(m: &match, col: uint, fields: &ast::ident[], val: ValueRef) -> match { let dummy = @{id: 0, node: ast::pat_wild, span: {lo: 0u, hi: 0u}}; fn e(dummy: &@ast::pat, fields: &ast::ident[], p: &@ast::pat) -> option::t[(@ast::pat)[]] { alt p.node { ast::pat_rec(fpats, _) { let pats = ~[]; for fname: ast::ident in fields { let pat = dummy; for fpat: ast::field_pat in fpats { if str::eq(fpat.ident, fname) { pat = fpat.pat; break; } } pats += ~[pat]; } ret some(pats); } _ { ret some(ivec::init_elt(dummy, ivec::len(fields))); } } } ret enter_match(m, col, val, bind e(dummy, fields, _)); } fn enter_box(m: &match, col: uint, val: ValueRef) -> match { let dummy = @{id: 0, node: ast::pat_wild, span: {lo: 0u, hi: 0u}}; fn e(dummy: &@ast::pat, p: &@ast::pat) -> option::t[(@ast::pat)[]] { alt p.node { ast::pat_box(sub) { ret some(~[sub]); } _ { ret some(~[dummy]); } } } ret enter_match(m, col, val, bind e(dummy, _)); } fn get_options(ccx: &@crate_ctxt, m: &match, col: uint) -> opt[] { fn add_to_set(set: &mutable opt[], val: &opt) { for l: opt in set { if opt_eq(l, val) { ret; } } set += ~[val]; } let found = ~[]; for br: match_branch in m { alt br.pats.(col).node { ast::pat_lit(l) { add_to_set(found, lit(l)); } ast::pat_tag(_, _) { add_to_set(found, variant_opt(ccx, br.pats.(col).id)); } _ { } } } ret found; } fn extract_variant_args(bcx: @block_ctxt, pat_id: ast::node_id, vdefs: &{tg: def_id, var: def_id}, val: ValueRef) -> {vals: ValueRef[], bcx: @block_ctxt} { let ccx = bcx.fcx.lcx.ccx; let ty_param_substs = ty::node_id_to_type_params(ccx.tcx, pat_id); let blobptr = val; let variants = ty::tag_variants(ccx.tcx, vdefs.tg); let args = ~[]; let size = ivec::len(ty::tag_variant_with_id(ccx.tcx, vdefs.tg, vdefs.var).args); if size > 0u && ivec::len(variants) != 1u { let tagptr = bcx.build.PointerCast(val, trans_common::T_opaque_tag_ptr(ccx.tn)); blobptr = bcx.build.GEP(tagptr, ~[C_int(0), C_int(1)]); } let i = 0u; while i < size { let r = trans::GEP_tag(bcx, blobptr, vdefs.tg, vdefs.var, ty_param_substs, i as int); bcx = r.bcx; args += ~[r.val]; i += 1u; } ret {vals: args, bcx: bcx}; } fn collect_record_fields(m: &match, col: uint) -> ast::ident[] { let fields = ~[]; for br: match_branch in m { alt br.pats.(col).node { ast::pat_rec(fs, _) { for f: ast::field_pat in fs { if !ivec::any(bind str::eq(f.ident, _), fields) { fields += ~[f.ident]; } } } _ { } } } ret fields; } fn any_box_pat(m: &match, col: uint) -> bool { for br: match_branch in m { alt br.pats.(col).node { ast::pat_box(_) { ret true; } _ { } } } ret false; } type exit_node = {bound: bind_map, from: BasicBlockRef, to: BasicBlockRef}; type mk_fail = fn() -> BasicBlockRef; fn pick_col(m: &match) -> uint { let scores = ivec::init_elt_mut(0u, ivec::len(m.(0).pats)); for br: match_branch in m { let i = 0u; for p: @ast::pat in br.pats { alt p.node { ast::pat_lit(_) | ast::pat_tag(_, _) { scores.(i) += 1u; } _ {} } i += 1u; } } let max_score = 0u; let best_col = 0u; let i = 0u; for score: uint in scores { // Irrefutable columns always go first, they'd only be duplicated in // the branches. if score == 0u { ret i; } // If no irrefutable ones are found, we pick the one with the biggest // branching factor. if score > max_score { max_score = score; best_col = i; } i += 1u; } ret best_col; } fn compile_submatch(bcx: @block_ctxt, m: &match, vals: ValueRef[], f: &mk_fail, exits: &mutable exit_node[]) { if ivec::len(m) == 0u { bcx.build.Br(f()); ret; } if ivec::len(m.(0).pats) == 0u { exits += ~[{bound: m.(0).bound, from: bcx.llbb, to: m.(0).body}]; bcx.build.Br(m.(0).body); ret; } let col = pick_col(m); let val = vals.(col); let vals_left = ivec::slice(vals, 0u, col) + ivec::slice(vals, col + 1u, ivec::len(vals)); let ccx = bcx.fcx.lcx.ccx; let pat_id = 0; for br: match_branch in m { // Find a real id (we're adding placeholder wildcard patterns, but // each column is guaranteed to have at least one real pattern) if pat_id == 0 { pat_id = br.pats.(col).id; } } let rec_fields = collect_record_fields(m, col); // Separate path for extracting and binding record fields if ivec::len(rec_fields) > 0u { let rec_ty = ty::node_id_to_monotype(ccx.tcx, pat_id); let fields = alt ty::struct(ccx.tcx, rec_ty) { ty::ty_rec(fields) { fields } }; let rec_vals = ~[]; for field_name: ast::ident in rec_fields { let ix: uint = ty::field_idx(ccx.sess, {lo: 0u, hi: 0u}, field_name, fields); let r = trans::GEP_tup_like(bcx, rec_ty, val, ~[0, ix as int]); rec_vals += ~[r.val]; bcx = r.bcx; } compile_submatch(bcx, enter_rec(m, col, rec_fields, val), rec_vals + vals_left, f, exits); ret; } // Unbox in case of a box field if any_box_pat(m, col) { let box = bcx.build.Load(val); let unboxed = bcx.build.InBoundsGEP(box, ~[C_int(0), C_int(back::abi::box_rc_field_body)]); compile_submatch(bcx, enter_box(m, col, val), ~[unboxed] + vals_left, f, exits); ret; } // Decide what kind of branch we need let opts = get_options(ccx, m, col); tag branch_kind { no_branch; single; switch; compare; } let kind = no_branch; let test_val = val; if ivec::len(opts) > 0u { alt opts.(0) { var(_, vdef) { if ivec::len(ty::tag_variants(ccx.tcx, vdef.tg)) == 1u { kind = single; } else { let tagptr = bcx.build.PointerCast (val, trans_common::T_opaque_tag_ptr(ccx.tn)); let discrimptr = bcx.build.GEP(tagptr, ~[C_int(0), C_int(0)]); test_val = bcx.build.Load(discrimptr); kind = switch; } } lit(l) { test_val = bcx.build.Load(val); kind = alt l.node { ast::lit_str(_, _) { compare } _ { switch } }; } } } let else_cx = alt kind { no_branch. | single. { bcx } _ { new_sub_block_ctxt(bcx, "match_else") } }; let sw = if kind == switch { bcx.build.Switch(test_val, else_cx.llbb, ivec::len(opts)) } else { C_int(0) }; // Placeholder for when not using a switch // Compile subtrees for each option for opt: opt in opts { let opt_cx = new_sub_block_ctxt(bcx, "match_case"); alt kind { single. { bcx.build.Br(opt_cx.llbb); } switch. { let r = trans_opt(bcx, opt); bcx = r.bcx; llvm::LLVMAddCase(sw, r.val, opt_cx.llbb); } compare. { let r = trans_opt(bcx, opt); bcx = r.bcx; let t = ty::node_id_to_type(ccx.tcx, pat_id); let eq = trans::trans_compare(bcx, ast::eq, test_val, t, r.val, t); bcx = new_sub_block_ctxt(bcx, "next"); eq.bcx.build.CondBr(eq.val, opt_cx.llbb, bcx.llbb); } _ { } } let size = 0u; let unpacked = ~[]; alt opt { var(_, vdef) { let args = extract_variant_args(opt_cx, pat_id, vdef, val); size = ivec::len(args.vals); unpacked = args.vals; opt_cx = args.bcx; } lit(_) { } } compile_submatch(opt_cx, enter_opt(ccx, m, opt, col, size, val), unpacked + vals_left, f, exits); } // Compile the fall-through case if kind == compare { bcx.build.Br(else_cx.llbb); } if kind != single { compile_submatch(else_cx, enter_default(m, col, val), vals_left, f, exits); } } // Returns false for unreachable blocks fn make_phi_bindings(bcx: &@block_ctxt, map: &exit_node[], ids: &ast::pat_id_map) -> bool { fn assoc(key: str, list: &bind_map) -> option::t[ValueRef] { for elt: {ident: ast::ident, val: ValueRef} in list { if str::eq(elt.ident, key) { ret some(elt.val); } } ret none; } let our_block = bcx.llbb as uint; let success = true; for each item: @{key: ast::ident, val: ast::node_id} in ids.items() { let llbbs = ~[]; let vals = ~[]; for ex: exit_node in map { if ex.to as uint == our_block { alt assoc(item.key, ex.bound) { some(val) { llbbs += ~[ex.from]; vals += ~[val]; } none. { } } } } if ivec::len(vals) > 0u { let phi = bcx.build.Phi(val_ty(vals.(0)), vals, llbbs); bcx.fcx.lllocals.insert(item.val, phi); } else { success = false; } } ret success; } fn trans_alt(cx: &@block_ctxt, expr: &@ast::expr, arms: &ast::arm[], id: ast::node_id, output: &trans::out_method) -> result { let bodies = ~[]; let match: match = ~[]; let er = trans::trans_expr(cx, expr); if (ty::type_is_bot(bcx_tcx(cx), ty::expr_ty(bcx_tcx(cx), expr))) { // No need to generate code for alt, // since the disc diverges. if (!cx.build.is_terminated()) { ret rslt(cx, cx.build.Unreachable()); } else { ret rslt(cx, C_nil()); } } for a: ast::arm in arms { let body = new_scope_block_ctxt(cx, "case_body"); bodies += ~[body]; for p: @ast::pat in a.pats { match += ~[@{pats: ~[p], body: body.llbb, mutable bound: ~[]}]; } } // Cached fail-on-fallthrough block let fail_cx = @mutable none; fn mk_fail(cx: &@block_ctxt, sp: &span, done: @mutable option::t[BasicBlockRef]) -> BasicBlockRef { alt *done { some(bb) { ret bb; } _ { } } let fail_cx = new_sub_block_ctxt(cx, "case_fallthrough"); trans::trans_fail(fail_cx, some(sp), "non-exhaustive match failure"); *done = some(fail_cx.llbb); ret fail_cx.llbb; } let exit_map = ~[]; let t = trans::node_id_type(cx.fcx.lcx.ccx, expr.id); let v = trans::spill_if_immediate(er.bcx, er.val, t); compile_submatch(er.bcx, match, ~[v], bind mk_fail(cx, expr.span, fail_cx), exit_map); let i = 0u; let arm_results = ~[]; for a: ast::arm in arms { let body_cx = bodies.(i); if make_phi_bindings(body_cx, exit_map, ast::pat_id_map(a.pats.(0))) { let block_res = trans::trans_block(body_cx, a.block, output); arm_results += ~[block_res]; } else { // Unreachable arm_results += ~[rslt(body_cx, C_nil())]; } i += 1u; } ret rslt(trans::join_branches(cx, arm_results), C_nil()); } // Not alt-related, but similar to the pattern-munging code above fn bind_irrefutable_pat(bcx: @block_ctxt, pat: &@ast::pat, val: ValueRef, table: hashmap[ast::node_id, ValueRef], copy: bool) -> @block_ctxt { let ccx = bcx.fcx.lcx.ccx; alt pat.node { ast::pat_bind(_) { if copy { let ty = ty::node_id_to_monotype(ccx.tcx, pat.id); let llty = trans::type_of(ccx, pat.span, ty); let alloc = trans::alloca(bcx, llty); bcx = trans::memmove_ty(bcx, alloc, val, ty).bcx; let loaded = trans::load_if_immediate(bcx, alloc, ty); bcx = trans::copy_ty(bcx, loaded, ty).bcx; table.insert(pat.id, alloc); trans_common::add_clean(bcx, alloc, ty); } else { table.insert(pat.id, val); } } ast::pat_tag(_, sub) { if ivec::len(sub) == 0u { ret bcx; } let vdefs = ast::variant_def_ids(ccx.tcx.def_map.get(pat.id)); let args = extract_variant_args(bcx, pat.id, vdefs, val); let i = 0; for argval: ValueRef in args.vals { bcx = bind_irrefutable_pat(bcx, sub.(i), argval, table, copy); i += 1; } } ast::pat_rec(fields, _) { let rec_ty = ty::node_id_to_monotype(ccx.tcx, pat.id); let rec_fields = alt ty::struct(ccx.tcx, rec_ty) { ty::ty_rec(fields) { fields } }; for f: ast::field_pat in fields { let ix: uint = ty::field_idx(ccx.sess, pat.span, f.ident, rec_fields); let r = trans::GEP_tup_like(bcx, rec_ty, val, ~[0, ix as int]); bcx = bind_irrefutable_pat(r.bcx, f.pat, r.val, table, copy); } } ast::pat_box(inner) { let box = bcx.build.Load(val); let unboxed = bcx.build.InBoundsGEP (box, ~[C_int(0), C_int(back::abi::box_rc_field_body)]); bcx = bind_irrefutable_pat(bcx, inner, unboxed, table, true); } ast::pat_wild. | ast::pat_lit(_) {} } ret bcx; } // Local Variables: // fill-column: 78; // indent-tabs-mode: nil // c-basic-offset: 4 // buffer-file-coding-system: utf-8-unix // compile-command: "make -k -C $RBUILD 2>&1 | sed -e 's/\\/x\\//x:\\//g'"; // End:
#[path = "float_to_binary_2/with_float.rs"] pub mod with_float; // `without_float_errors_badarg` in unit tests
use crate::dynamics::{acceleration::Acceleration, velocity::Velocity}; #[derive(Copy, Clone, Debug, PartialEq)] pub struct Circle { x: f64, y: f64, radius: f64, angle: f64, velocity: Velocity, acceleration: Acceleration, } impl Circle { pub fn new( x: f64, y: f64, radius: f64, angle: Option<f64>, velocity: Velocity, acceleration: Acceleration, ) -> Circle { let angle_or_default: f64 = match angle { None => 0.0, Some(angle) => angle, }; Circle { x, y, radius, angle: angle_or_default, velocity, acceleration, } } pub fn get_position(&self) -> (f64, f64) { (self.x, self.y) } pub fn get_radius(&self) -> f64 { self.radius } pub fn get_area(&self) -> f64 { let base = self.radius; std::f64::consts::PI * base.powi(2) } pub fn get_angle(&self) -> f64 { self.angle } pub fn get_velocity(&self) -> Velocity { self.velocity } pub fn get_acceleration(&self) -> Acceleration { self.acceleration } } #[cfg(test)] mod tests { use super::{Acceleration, Velocity}; #[test] fn it_circle() { use crate::shapes::circle::Circle; let velocity = Velocity::new(5.0, 5.0, 0.0); let acceleration = Acceleration::new(0.0, 0.0, 0.0); let my_circle = Circle::new(10.0, 20.0, 5.9, None, velocity, acceleration); let radius: f64 = 5.9; assert_eq!(my_circle.get_position(), (10.0, 20.0)); assert_eq!(my_circle.get_radius(), 5.9); assert_eq!(my_circle.get_area(), std::f64::consts::PI * radius.powi(2)); assert_eq!(my_circle.get_angle(), 0.0); } }
use super::helpers::{reverse_add_assign, reverse_add_c_long, reverse_add_c_long_assign}; use crate::integer::Integer; use core::ops::Add; // Add The addition operator +. // ['Integer', 'Integer', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref']] impl Add<Integer> for Integer { type Output = Integer; fn add(mut self, rhs: Integer) -> Self::Output { Integer::add_assign(&mut self, &rhs); self } } // ['Integer', '&Integer', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // []] impl Add<&Integer> for Integer { type Output = Integer; fn add(mut self, rhs: &Integer) -> Self::Output { Integer::add_assign(&mut self, rhs); self } } // ['&Integer', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', [], // ['ref_mut']] impl Add<Integer> for &Integer { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(self, &mut rhs); rhs } } // ['&Integer', '&Integer', 'Integer', 'Integer::add', 'no', [], []] impl Add<&Integer> for &Integer { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { Integer::add(self, rhs) } } // ['Integer', 'i8', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], []] impl Add<i8> for Integer { type Output = Integer; fn add(mut self, rhs: i8) -> Self::Output { Integer::add_c_long_assign(&mut self, rhs); self } } // ['Integer', '&i8', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], ['deref']] impl Add<&i8> for Integer { type Output = Integer; fn add(mut self, rhs: &i8) -> Self::Output { Integer::add_c_long_assign(&mut self, *rhs); self } } // ['&Integer', 'i8', 'Integer', 'Integer::add_c_long', 'no', [], []] impl Add<i8> for &Integer { type Output = Integer; fn add(self, rhs: i8) -> Self::Output { Integer::add_c_long(self, rhs) } } // ['&Integer', '&i8', 'Integer', 'Integer::add_c_long', 'no', [], ['deref']] impl Add<&i8> for &Integer { type Output = Integer; fn add(self, rhs: &i8) -> Self::Output { Integer::add_c_long(self, *rhs) } } // ['i8', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', [], // ['ref_mut']] impl Add<Integer> for i8 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(self, &mut rhs); rhs } } // ['i8', '&Integer', 'Integer', 'reverse_add_c_long', 'no', [], []] impl Add<&Integer> for i8 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(self, rhs) } } // ['&i8', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', ['deref'], // ['ref_mut']] impl Add<Integer> for &i8 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(*self, &mut rhs); rhs } } // ['&i8', '&Integer', 'Integer', 'reverse_add_c_long', 'no', ['deref'], []] impl Add<&Integer> for &i8 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(*self, rhs) } } // ['Integer', 'u8', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], []] impl Add<u8> for Integer { type Output = Integer; fn add(mut self, rhs: u8) -> Self::Output { Integer::add_c_long_assign(&mut self, rhs); self } } // ['Integer', '&u8', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], ['deref']] impl Add<&u8> for Integer { type Output = Integer; fn add(mut self, rhs: &u8) -> Self::Output { Integer::add_c_long_assign(&mut self, *rhs); self } } // ['&Integer', 'u8', 'Integer', 'Integer::add_c_long', 'no', [], []] impl Add<u8> for &Integer { type Output = Integer; fn add(self, rhs: u8) -> Self::Output { Integer::add_c_long(self, rhs) } } // ['&Integer', '&u8', 'Integer', 'Integer::add_c_long', 'no', [], ['deref']] impl Add<&u8> for &Integer { type Output = Integer; fn add(self, rhs: &u8) -> Self::Output { Integer::add_c_long(self, *rhs) } } // ['u8', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', [], // ['ref_mut']] impl Add<Integer> for u8 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(self, &mut rhs); rhs } } // ['u8', '&Integer', 'Integer', 'reverse_add_c_long', 'no', [], []] impl Add<&Integer> for u8 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(self, rhs) } } // ['&u8', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', ['deref'], // ['ref_mut']] impl Add<Integer> for &u8 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(*self, &mut rhs); rhs } } // ['&u8', '&Integer', 'Integer', 'reverse_add_c_long', 'no', ['deref'], []] impl Add<&Integer> for &u8 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(*self, rhs) } } // ['Integer', 'i16', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], []] impl Add<i16> for Integer { type Output = Integer; fn add(mut self, rhs: i16) -> Self::Output { Integer::add_c_long_assign(&mut self, rhs); self } } // ['Integer', '&i16', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], ['deref']] impl Add<&i16> for Integer { type Output = Integer; fn add(mut self, rhs: &i16) -> Self::Output { Integer::add_c_long_assign(&mut self, *rhs); self } } // ['&Integer', 'i16', 'Integer', 'Integer::add_c_long', 'no', [], []] impl Add<i16> for &Integer { type Output = Integer; fn add(self, rhs: i16) -> Self::Output { Integer::add_c_long(self, rhs) } } // ['&Integer', '&i16', 'Integer', 'Integer::add_c_long', 'no', [], ['deref']] impl Add<&i16> for &Integer { type Output = Integer; fn add(self, rhs: &i16) -> Self::Output { Integer::add_c_long(self, *rhs) } } // ['i16', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', [], // ['ref_mut']] impl Add<Integer> for i16 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(self, &mut rhs); rhs } } // ['i16', '&Integer', 'Integer', 'reverse_add_c_long', 'no', [], []] impl Add<&Integer> for i16 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(self, rhs) } } // ['&i16', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', ['deref'], // ['ref_mut']] impl Add<Integer> for &i16 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(*self, &mut rhs); rhs } } // ['&i16', '&Integer', 'Integer', 'reverse_add_c_long', 'no', ['deref'], []] impl Add<&Integer> for &i16 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(*self, rhs) } } // ['Integer', 'u16', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], []] impl Add<u16> for Integer { type Output = Integer; fn add(mut self, rhs: u16) -> Self::Output { Integer::add_c_long_assign(&mut self, rhs); self } } // ['Integer', '&u16', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], ['deref']] impl Add<&u16> for Integer { type Output = Integer; fn add(mut self, rhs: &u16) -> Self::Output { Integer::add_c_long_assign(&mut self, *rhs); self } } // ['&Integer', 'u16', 'Integer', 'Integer::add_c_long', 'no', [], []] impl Add<u16> for &Integer { type Output = Integer; fn add(self, rhs: u16) -> Self::Output { Integer::add_c_long(self, rhs) } } // ['&Integer', '&u16', 'Integer', 'Integer::add_c_long', 'no', [], ['deref']] impl Add<&u16> for &Integer { type Output = Integer; fn add(self, rhs: &u16) -> Self::Output { Integer::add_c_long(self, *rhs) } } // ['u16', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', [], // ['ref_mut']] impl Add<Integer> for u16 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(self, &mut rhs); rhs } } // ['u16', '&Integer', 'Integer', 'reverse_add_c_long', 'no', [], []] impl Add<&Integer> for u16 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(self, rhs) } } // ['&u16', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', ['deref'], // ['ref_mut']] impl Add<Integer> for &u16 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(*self, &mut rhs); rhs } } // ['&u16', '&Integer', 'Integer', 'reverse_add_c_long', 'no', ['deref'], []] impl Add<&Integer> for &u16 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(*self, rhs) } } // ['Integer', 'i32', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], []] impl Add<i32> for Integer { type Output = Integer; fn add(mut self, rhs: i32) -> Self::Output { Integer::add_c_long_assign(&mut self, rhs); self } } // ['Integer', '&i32', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], ['deref']] impl Add<&i32> for Integer { type Output = Integer; fn add(mut self, rhs: &i32) -> Self::Output { Integer::add_c_long_assign(&mut self, *rhs); self } } // ['&Integer', 'i32', 'Integer', 'Integer::add_c_long', 'no', [], []] impl Add<i32> for &Integer { type Output = Integer; fn add(self, rhs: i32) -> Self::Output { Integer::add_c_long(self, rhs) } } // ['&Integer', '&i32', 'Integer', 'Integer::add_c_long', 'no', [], ['deref']] impl Add<&i32> for &Integer { type Output = Integer; fn add(self, rhs: &i32) -> Self::Output { Integer::add_c_long(self, *rhs) } } // ['i32', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', [], // ['ref_mut']] impl Add<Integer> for i32 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(self, &mut rhs); rhs } } // ['i32', '&Integer', 'Integer', 'reverse_add_c_long', 'no', [], []] impl Add<&Integer> for i32 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(self, rhs) } } // ['&i32', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', ['deref'], // ['ref_mut']] impl Add<Integer> for &i32 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(*self, &mut rhs); rhs } } // ['&i32', '&Integer', 'Integer', 'reverse_add_c_long', 'no', ['deref'], []] impl Add<&Integer> for &i32 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(*self, rhs) } } // ['Integer', 'u32', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<u32> for Integer { type Output = Integer; fn add(mut self, rhs: u32) -> Self::Output { Integer::add_c_long_assign(&mut self, rhs); self } } // ['Integer', '&u32', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], ['deref']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&u32> for Integer { type Output = Integer; fn add(mut self, rhs: &u32) -> Self::Output { Integer::add_c_long_assign(&mut self, *rhs); self } } // ['&Integer', 'u32', 'Integer', 'Integer::add_c_long', 'no', [], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<u32> for &Integer { type Output = Integer; fn add(self, rhs: u32) -> Self::Output { Integer::add_c_long(self, rhs) } } // ['&Integer', '&u32', 'Integer', 'Integer::add_c_long', 'no', [], ['deref']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&u32> for &Integer { type Output = Integer; fn add(self, rhs: &u32) -> Self::Output { Integer::add_c_long(self, *rhs) } } // ['u32', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', [], // ['ref_mut']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<Integer> for u32 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(self, &mut rhs); rhs } } // ['u32', '&Integer', 'Integer', 'reverse_add_c_long', 'no', [], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&Integer> for u32 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(self, rhs) } } // ['&u32', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', ['deref'], // ['ref_mut']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<Integer> for &u32 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(*self, &mut rhs); rhs } } // ['&u32', '&Integer', 'Integer', 'reverse_add_c_long', 'no', ['deref'], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&Integer> for &u32 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(*self, rhs) } } // ['Integer', 'i64', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<i64> for Integer { type Output = Integer; fn add(mut self, rhs: i64) -> Self::Output { Integer::add_c_long_assign(&mut self, rhs); self } } // ['Integer', '&i64', 'Integer', 'Integer::add_c_long_assign', 'lhs', // ['ref_mut'], ['deref']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&i64> for Integer { type Output = Integer; fn add(mut self, rhs: &i64) -> Self::Output { Integer::add_c_long_assign(&mut self, *rhs); self } } // ['&Integer', 'i64', 'Integer', 'Integer::add_c_long', 'no', [], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<i64> for &Integer { type Output = Integer; fn add(self, rhs: i64) -> Self::Output { Integer::add_c_long(self, rhs) } } // ['&Integer', '&i64', 'Integer', 'Integer::add_c_long', 'no', [], ['deref']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&i64> for &Integer { type Output = Integer; fn add(self, rhs: &i64) -> Self::Output { Integer::add_c_long(self, *rhs) } } // ['i64', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', [], // ['ref_mut']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<Integer> for i64 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(self, &mut rhs); rhs } } // ['i64', '&Integer', 'Integer', 'reverse_add_c_long', 'no', [], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&Integer> for i64 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(self, rhs) } } // ['&i64', 'Integer', 'Integer', 'reverse_add_c_long_assign', 'rhs', ['deref'], // ['ref_mut']] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<Integer> for &i64 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_c_long_assign(*self, &mut rhs); rhs } } // ['&i64', '&Integer', 'Integer', 'reverse_add_c_long', 'no', ['deref'], []] #[cfg(all(target_pointer_width = "64", not(windows)))] impl Add<&Integer> for &i64 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { reverse_add_c_long(*self, rhs) } } // ['Integer', 'u32', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}]] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<u32> for Integer { type Output = Integer; fn add(mut self, rhs: u32) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(rhs)); self } } // ['Integer', '&u32', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}, 'deref']] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&u32> for Integer { type Output = Integer; fn add(mut self, rhs: &u32) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(*rhs)); self } } // ['&Integer', 'u32', 'Integer', 'let mut rhs = // Integer::from(rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<u32> for &Integer { type Output = Integer; fn add(self, rhs: u32) -> Self::Output { let mut rhs = Integer::from(rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['&Integer', '&u32', 'Integer', 'let mut rhs = // Integer::from(*rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&u32> for &Integer { type Output = Integer; fn add(self, rhs: &u32) -> Self::Output { let mut rhs = Integer::from(*rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['u32', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}], ['ref_mut']] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<Integer> for u32 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(self), &mut rhs); rhs } } // ['u32', '&Integer', 'Integer', 'let mut lhs = // Integer::from(self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&Integer> for u32 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['&u32', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}, 'deref'], ['ref_mut']] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<Integer> for &u32 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(*self), &mut rhs); rhs } } // ['&u32', '&Integer', 'Integer', 'let mut lhs = // Integer::from(*self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&Integer> for &u32 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(*self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['Integer', 'i64', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}]] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<i64> for Integer { type Output = Integer; fn add(mut self, rhs: i64) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(rhs)); self } } // ['Integer', '&i64', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}, 'deref']] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&i64> for Integer { type Output = Integer; fn add(mut self, rhs: &i64) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(*rhs)); self } } // ['&Integer', 'i64', 'Integer', 'let mut rhs = // Integer::from(rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<i64> for &Integer { type Output = Integer; fn add(self, rhs: i64) -> Self::Output { let mut rhs = Integer::from(rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['&Integer', '&i64', 'Integer', 'let mut rhs = // Integer::from(*rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&i64> for &Integer { type Output = Integer; fn add(self, rhs: &i64) -> Self::Output { let mut rhs = Integer::from(*rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['i64', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}], ['ref_mut']] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<Integer> for i64 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(self), &mut rhs); rhs } } // ['i64', '&Integer', 'Integer', 'let mut lhs = // Integer::from(self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&Integer> for i64 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['&i64', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}, 'deref'], ['ref_mut']] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<Integer> for &i64 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(*self), &mut rhs); rhs } } // ['&i64', '&Integer', 'Integer', 'let mut lhs = // Integer::from(*self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] #[cfg(not(all(target_pointer_width = "64", not(windows))))] impl Add<&Integer> for &i64 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(*self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['Integer', 'u64', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}]] impl Add<u64> for Integer { type Output = Integer; fn add(mut self, rhs: u64) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(rhs)); self } } // ['Integer', '&u64', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}, 'deref']] impl Add<&u64> for Integer { type Output = Integer; fn add(mut self, rhs: &u64) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(*rhs)); self } } // ['&Integer', 'u64', 'Integer', 'let mut rhs = // Integer::from(rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] impl Add<u64> for &Integer { type Output = Integer; fn add(self, rhs: u64) -> Self::Output { let mut rhs = Integer::from(rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['&Integer', '&u64', 'Integer', 'let mut rhs = // Integer::from(*rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] impl Add<&u64> for &Integer { type Output = Integer; fn add(self, rhs: &u64) -> Self::Output { let mut rhs = Integer::from(*rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['u64', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}], ['ref_mut']] impl Add<Integer> for u64 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(self), &mut rhs); rhs } } // ['u64', '&Integer', 'Integer', 'let mut lhs = // Integer::from(self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] impl Add<&Integer> for u64 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['&u64', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}, 'deref'], ['ref_mut']] impl Add<Integer> for &u64 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(*self), &mut rhs); rhs } } // ['&u64', '&Integer', 'Integer', 'let mut lhs = // Integer::from(*self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] impl Add<&Integer> for &u64 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(*self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['Integer', 'i128', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}]] impl Add<i128> for Integer { type Output = Integer; fn add(mut self, rhs: i128) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(rhs)); self } } // ['Integer', '&i128', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}, 'deref']] impl Add<&i128> for Integer { type Output = Integer; fn add(mut self, rhs: &i128) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(*rhs)); self } } // ['&Integer', 'i128', 'Integer', 'let mut rhs = // Integer::from(rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] impl Add<i128> for &Integer { type Output = Integer; fn add(self, rhs: i128) -> Self::Output { let mut rhs = Integer::from(rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['&Integer', '&i128', 'Integer', 'let mut rhs = // Integer::from(*rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] impl Add<&i128> for &Integer { type Output = Integer; fn add(self, rhs: &i128) -> Self::Output { let mut rhs = Integer::from(*rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['i128', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}], ['ref_mut']] impl Add<Integer> for i128 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(self), &mut rhs); rhs } } // ['i128', '&Integer', 'Integer', 'let mut lhs = // Integer::from(self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] impl Add<&Integer> for i128 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['&i128', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}, 'deref'], ['ref_mut']] impl Add<Integer> for &i128 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(*self), &mut rhs); rhs } } // ['&i128', '&Integer', 'Integer', 'let mut lhs = // Integer::from(*self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] impl Add<&Integer> for &i128 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(*self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['Integer', 'u128', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}]] impl Add<u128> for Integer { type Output = Integer; fn add(mut self, rhs: u128) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(rhs)); self } } // ['Integer', '&u128', 'Integer', 'Integer::add_assign', 'lhs', ['ref_mut'], // ['ref', {'convert': 'Integer'}, 'deref']] impl Add<&u128> for Integer { type Output = Integer; fn add(mut self, rhs: &u128) -> Self::Output { Integer::add_assign(&mut self, &Integer::from(*rhs)); self } } // ['&Integer', 'u128', 'Integer', 'let mut rhs = // Integer::from(rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] impl Add<u128> for &Integer { type Output = Integer; fn add(self, rhs: u128) -> Self::Output { let mut rhs = Integer::from(rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['&Integer', '&u128', 'Integer', 'let mut rhs = // Integer::from(*rhs);\nreverse_add_assign(self, &mut rhs);\nrhs'] impl Add<&u128> for &Integer { type Output = Integer; fn add(self, rhs: &u128) -> Self::Output { let mut rhs = Integer::from(*rhs); reverse_add_assign(self, &mut rhs); rhs } } // ['u128', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}], ['ref_mut']] impl Add<Integer> for u128 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(self), &mut rhs); rhs } } // ['u128', '&Integer', 'Integer', 'let mut lhs = // Integer::from(self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] impl Add<&Integer> for u128 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(self); Integer::add_assign(&mut lhs, rhs); lhs } } // ['&u128', 'Integer', 'Integer', 'reverse_add_assign', 'rhs', ['ref', // {'convert': 'Integer'}, 'deref'], ['ref_mut']] impl Add<Integer> for &u128 { type Output = Integer; fn add(self, mut rhs: Integer) -> Self::Output { reverse_add_assign(&Integer::from(*self), &mut rhs); rhs } } // ['&u128', '&Integer', 'Integer', 'let mut lhs = // Integer::from(*self);\nInteger::add_assign(&mut lhs, rhs);\nlhs'] impl Add<&Integer> for &u128 { type Output = Integer; fn add(self, rhs: &Integer) -> Self::Output { let mut lhs = Integer::from(*self); Integer::add_assign(&mut lhs, rhs); lhs } }
use crate::Result; use std::{fs::File, io::Read, path::Path}; pub fn create_pipeline( vert_file: &Path, frag_file: &Path, vertex_buffer_descriptor: wgpu::VertexBufferDescriptor, format: wgpu::TextureFormat, device: &wgpu::Device, ) -> Result<wgpu::RenderPipeline> { let mut vs_src = String::new(); File::open(vert_file)?.read_to_string(&mut vs_src)?; let mut fs_src = String::new(); File::open(frag_file)?.read_to_string(&mut fs_src)?; let vs_spriv = glsl_to_spirv::compile(&vs_src, glsl_to_spirv::ShaderType::Vertex)?; let fs_spriv = glsl_to_spirv::compile(&fs_src, glsl_to_spirv::ShaderType::Fragment)?; let vs_data = wgpu::read_spirv(vs_spriv)?; let fs_data = wgpu::read_spirv(fs_spriv)?; let vs_module = device.create_shader_module(&vs_data); let fs_module = device.create_shader_module(&fs_data); let layout = device.create_pipeline_layout(&wgpu::PipelineLayoutDescriptor { bind_group_layouts: &[], }); let render_pipeline = device.create_render_pipeline(&wgpu::RenderPipelineDescriptor { layout: &layout, vertex_stage: wgpu::ProgrammableStageDescriptor { module: &vs_module, entry_point: "main", }, fragment_stage: Some(wgpu::ProgrammableStageDescriptor { module: &fs_module, entry_point: "main", }), rasterization_state: Some(wgpu::RasterizationStateDescriptor { front_face: wgpu::FrontFace::Ccw, cull_mode: wgpu::CullMode::Back, depth_bias: 0, depth_bias_slope_scale: 0.0, depth_bias_clamp: 0.0, }), color_states: &[wgpu::ColorStateDescriptor { format: format, color_blend: wgpu::BlendDescriptor::REPLACE, alpha_blend: wgpu::BlendDescriptor::REPLACE, write_mask: wgpu::ColorWrite::ALL, }], vertex_state: wgpu::VertexStateDescriptor { index_format: wgpu::IndexFormat::Uint16, vertex_buffers: &[vertex_buffer_descriptor], }, primitive_topology: wgpu::PrimitiveTopology::TriangleList, depth_stencil_state: None, sample_count: 1, sample_mask: !0, alpha_to_coverage_enabled: false, }); Ok(render_pipeline) }
pub fn solve(input: Vec<&str>) { part1(); part2(); } fn part1() { println!("Not implemented"); } fn part2() { println!("Not implemented"); }
mod test_utils; use test_utils::ServerTestingExt; use tide::{Request, StatusCode}; async fn add_one(req: Request<()>) -> Result<String, tide::Error> { match req.param::<i64>("num") { Ok(num) => Ok((num + 1).to_string()), Err(err) => Err(tide::Error::new(StatusCode::BadRequest, err)), } } async fn add_two(req: Request<()>) -> Result<String, tide::Error> { let one = req .param::<i64>("one") .map_err(|err| tide::Error::new(StatusCode::BadRequest, err))?; let two = req .param::<i64>("two") .map_err(|err| tide::Error::new(StatusCode::BadRequest, err))?; Ok((one + two).to_string()) } async fn echo_path(req: Request<()>) -> Result<String, tide::Error> { match req.param::<String>("path") { Ok(path) => Ok(path), Err(err) => Err(tide::Error::new(StatusCode::BadRequest, err)), } } #[async_std::test] async fn wildcard() { let mut app = tide::Server::new(); app.at("/add_one/:num").get(add_one); assert_eq!(app.get_body("/add_one/3").await, "4"); assert_eq!(app.get_body("/add_one/-7").await, "-6"); } #[async_std::test] async fn invalid_segment_error() { let mut app = tide::new(); app.at("/add_one/:num").get(add_one); assert_eq!(app.get("/add_one/a").await.status(), StatusCode::BadRequest); } #[async_std::test] async fn not_found_error() { let mut app = tide::new(); app.at("/add_one/:num").get(add_one); assert_eq!(app.get("/add_one/").await.status(), StatusCode::NotFound); } #[async_std::test] async fn wild_path() { let mut app = tide::new(); app.at("/echo/*path").get(echo_path); assert_eq!(app.get_body("/echo/some_path").await, "some_path"); assert_eq!( app.get_body("/echo/multi/segment/path").await, "multi/segment/path" ); assert_eq!(app.get("/echo/").await.status(), StatusCode::NotFound); } #[async_std::test] async fn multi_wildcard() { let mut app = tide::new(); app.at("/add_two/:one/:two/").get(add_two); assert_eq!(app.get_body("/add_two/1/2/").await, "3"); assert_eq!(app.get_body("/add_two/-1/2/").await, "1"); assert_eq!(app.get("/add_two/1").await.status(), StatusCode::NotFound); } #[async_std::test] async fn wild_last_segment() { let mut app = tide::new(); app.at("/echo/:path/*").get(echo_path); assert_eq!(app.get_body("/echo/one/two").await, "one"); assert_eq!(app.get_body("/echo/one/two/three/four").await, "one"); } #[async_std::test] async fn invalid_wildcard() { let mut app = tide::new(); app.at("/echo/*path/:one/").get(echo_path); assert_eq!( app.get("/echo/one/two").await.status(), StatusCode::NotFound ); } #[async_std::test] async fn nameless_wildcard() { let mut app = tide::Server::new(); app.at("/echo/:").get(|_| async { Ok("") }); assert_eq!( app.get("/echo/one/two").await.status(), StatusCode::NotFound ); assert_eq!(app.get("/echo/one").await.status(), StatusCode::Ok); } #[async_std::test] async fn nameless_internal_wildcard() { let mut app = tide::new(); app.at("/echo/:/:path").get(echo_path); assert_eq!(app.get("/echo/one").await.status(), StatusCode::NotFound); assert_eq!(app.get_body("/echo/one/two").await, "two"); } #[async_std::test] async fn nameless_internal_wildcard2() { let mut app = tide::new(); app.at("/echo/:/:path").get(|req: Request<()>| async move { assert_eq!(req.param::<String>("path")?, "two"); Ok("") }); app.get("/echo/one/two").await; } #[async_std::test] async fn ambiguous_router_wildcard_vs_star() { let mut app = tide::new(); app.at("/:one/:two").get(|_| async { Ok("one/two") }); app.at("/posts/*").get(|_| async { Ok("posts/*") }); assert_eq!(app.get_body("/posts/10").await, "posts/*"); }
// Copyright 2019 The Fuchsia Authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. use {bitfield::bitfield, bitflags::bitflags, failure::Fail}; /// The error types for packet parsing. #[derive(Fail, Debug, PartialEq)] pub enum Error { /// The value that was sent was out of range. #[fail(display = "Value was out of range.")] OutOfRange, /// The value that was provided is invalid. #[fail(display = "Invalid value.")] InvalidValue, #[doc(hidden)] #[fail(display = "__Nonexhaustive error should never be created.")] __Nonexhaustive, } bitflags! { /// Sampling Frequency field for SBC (Octet 0; b4-7). /// 44100Hz and 48000Hz are mandatory for A2DP sink. /// A2DP source must support at least one of 44100Hz and 48000Hz. /// A2DP Sec. 4.3.2.1 pub struct SbcSamplingFrequency:u8 { const FREQ16000HZ = 0b1000; const FREQ32000HZ = 0b0100; const FREQ44100HZ = 0b0010; const FREQ48000HZ = 0b0001; const MANDATORY_SNK = Self::FREQ44100HZ.bits | Self::FREQ48000HZ.bits; } } bitflags! { /// Channel Mode field for SBC (Octet 0; b0-3). /// Support for all modes is mandatory in A2DP sink. /// Mono and at least one of Dual Channel, Stereo, and Joint Stereo must be /// supported by A2DP source. /// A2DP Sec. 4.3.2.2 pub struct SbcChannelMode:u8 { const MONO = 0b1000; const DUAL_CHANNEL = 0b0100; const STEREO = 0b0010; const JOINT_STEREO = 0b0001; const MANDATORY_SNK = Self::MONO.bits | Self::DUAL_CHANNEL.bits | Self::STEREO.bits | Self::JOINT_STEREO.bits; } } bitflags! { /// The Block Length field for SBC (Octet 1; b4-7). /// Support for all block lengths is mandatory in both A2DP Sink and Source. /// A2DP Sec. 4.3.2.3 pub struct SbcBlockCount:u8 { const FOUR = 0b1000; const EIGHT = 0b0100; const TWELVE = 0b0010; const SIXTEEN = 0b0001; const MANDATORY_SNK = Self::FOUR.bits | Self::EIGHT.bits | Self::TWELVE.bits | Self::SIXTEEN.bits; const MANDATORY_SRC = Self::FOUR.bits | Self::EIGHT.bits | Self::TWELVE.bits | Self::SIXTEEN.bits; } } bitflags! { /// The Number of Subbands field for SBC (Octet 1; b2-3). /// Support for both 4 and 8 subbands is mandatory in A2DP Sink. /// Support for only 8 subbands is mandatory in A2DP Source. /// 4 subbands is optional. /// A2DP Sec. 4.3.2.4 pub struct SbcSubBands:u8 { const FOUR = 0b0010; const EIGHT = 0b0001; const MANDATORY_SNK = Self::FOUR.bits | Self::EIGHT.bits; const MANDATORY_SRC = Self::EIGHT.bits; } } bitflags! { /// Allocation Method field for SBC (Octet 1; b0-1). /// Support for both SNR and Loudness is mandatory in A2DP Sink. /// Support for at least Loudness is mandatory in A2DP Source. SNR is optional. /// A2DP Sec. 4.3.2.5 pub struct SbcAllocation:u8 { const SNR = 0b0010; const LOUDNESS = 0b0001; const MANDATORY_SNK = Self::SNR.bits | Self::LOUDNESS.bits; const MANDATORY_SRC = Self::LOUDNESS.bits; } } bitfield! { /// SBC Codec Specific Information Elements (A2DP Sec. 4.3.2). /// Packet structure: /// Octet0: Sampling Frequency (b4-7), Channel Mode (b0-3) /// Octet1: Block Length (b4-7), Subbands (b2-3), Allocation Method (b0-1) /// Octet2: Minimum Bitpool Value [2,250] /// Octet3: Maximum Bitpool Value [2,250] /// Some fields are mandatory choose 1, and therefore do not have a mandatory parameter method. pub struct SbcCodecInfo(u32); impl Debug; u8; maxbitpoolval, set_maxbpv: 7, 0; minbitpoolval, set_minbpv: 15, 8; allocation_method, set_allocation_method: 17,16; subbands, set_sub_bands: 19, 18; block_count, set_block_count: 23, 20; channel_mode, set_channel_mode: 27, 24; sampling_frequency, set_sampling_frequency: 31, 28; } impl SbcCodecInfo { // Bitpool values can range from [2,250]. pub const BITPOOL_MIN: u8 = 2; pub const BITPOOL_MAX: u8 = 250; pub fn new( sampling_frequency: SbcSamplingFrequency, channel_mode: SbcChannelMode, block_count: SbcBlockCount, sub_bands: SbcSubBands, allocation: SbcAllocation, min_bpv: u8, max_bpv: u8, ) -> Result<Self, Error> { if min_bpv > max_bpv { return Err(Error::InvalidValue); } if min_bpv < Self::BITPOOL_MIN || min_bpv > Self::BITPOOL_MAX || max_bpv < Self::BITPOOL_MIN || max_bpv > Self::BITPOOL_MAX { return Err(Error::OutOfRange); } let mut res = SbcCodecInfo(0); res.set_maxbpv(max_bpv); res.set_minbpv(min_bpv); res.set_allocation_method(allocation.bits()); res.set_sub_bands(sub_bands.bits()); res.set_block_count(block_count.bits()); res.set_channel_mode(channel_mode.bits()); res.set_sampling_frequency(sampling_frequency.bits()); Ok(res) } pub fn to_bytes(&self) -> Vec<u8> { self.0.to_be_bytes().to_vec() } } bitflags! { /// Object Type field for MPEG-2,4 AAC (Octet 0; b0-7). /// Support for MPEG-2 AAC LC is mandatory in both A2DP Sink and Source. /// Bits 0 to 4 are RFA. /// A2DP Sec. 4.5.2.1 pub struct AACObjectType:u8 { const MPEG2_AAC_LC = 0b10000000; const MPEG4_AAC_LC = 0b01000000; const MPEG4_AAC_LTP = 0b00100000; const MPEG4_AAC_SCALABLE = 0b00010000; const MANDATORY_SNK = Self::MPEG2_AAC_LC.bits; const MANDATORY_SRC = Self::MPEG2_AAC_LC.bits; } } bitflags! { /// Sampling Frequency field for MPEG-2,4 AAC (Octet 1; b0-7, Octet 2; b4-7) /// Support for 44.1KHz & 48.0KHz is mandatory in A2DP Sink. /// Support for either 44.1KHz or 48.0KHz is mandatory in A2DP Source. /// A2DP Sec. 4.5.2.2 pub struct AACSamplingFrequency:u16 { const FREQ8000HZ = 0b100000000000; const FREQ11025HZ = 0b010000000000; const FREQ12000HZ = 0b001000000000; const FREQ16000HZ = 0b000100000000; const FREQ22050HZ = 0b000010000000; const FREQ24000HZ = 0b000001000000; const FREQ32000HZ = 0b000000100000; const FREQ44100HZ = 0b000000010000; const FREQ48000HZ = 0b000000001000; const FREQ64000HZ = 0b000000000100; const FREQ88200HZ = 0b000000000010; const FREQ96000HZ = 0b000000000001; const MANDATORY_SNK = Self::FREQ44100HZ.bits | Self::FREQ48000HZ.bits; } } bitflags! { /// Channels field for MPEG-2,4 AAC (Octet 2; b2-3). /// Support for both 1 and 2 channels is mandatory in A2DP Sink. /// Support for either 1 or 2 channels is mandatory in A2DP Source. /// A2DP Sec 4.5.2.3 pub struct AACChannels:u8 { const ONE = 0b10; const TWO = 0b01; const MANDATORY_SNK = Self::ONE.bits | Self::TWO.bits; } } bitflags! { /// Support of Variable Bit Rate (VBR) field for MPEG-2,4 AAC (Octet 3; b7). /// Support for VBR is mandatory in A2DP Sink. /// A2DP Sec 4.5.2.5 pub struct AACVariableBitRate: u8 { const VBR_SUPPORTED = 0b1; const MANDATORY_SNK = Self::VBR_SUPPORTED.bits; } } bitfield! { /// MPEG-2 AAC Codec Specific Information Elements (A2DP Sec 4.5.2) /// Structure: /// Octet0: Object Type (b 40-47) /// Octet1: Sampling Frequency (b 32-39) /// Octet2: Sampling Frequency (b 28-31), Channels (b 26-27), RFA (b 24-25) /// Octet3: VBR (b 23), Bit Rate (b 16-22) /// Octet4: Bit Rate (b 8-15) /// Octet5: Bit Rate (b 0-7) /// Some fields are mandatory choose 1, and therefore do not have a mandatory parameter method. pub struct AACMediaCodecInfo(u64); impl Debug; u8; u32, bitrate, set_bitrate: 22, 0; vbr, set_vbr: 23, 23; // Bits 24-25 RFA. channels, set_channels: 27,26; u16, sampling_frequency, set_sampling_frequency: 39, 28; object_type, set_object_type: 47, 40; // Bits 48-63 Unused. } impl AACMediaCodecInfo { pub fn new( object_type: AACObjectType, sampling_frequency: AACSamplingFrequency, channels: AACChannels, vbr: AACVariableBitRate, bitrate: u32, ) -> Result<Self, Error> { // Bitrate is expressed as a 23bit UiMsbf, stored in a u32. if bitrate > 0x7fffff { return Err(Error::OutOfRange); } let mut res = AACMediaCodecInfo(0); res.set_bitrate(bitrate); res.set_vbr(vbr.bits()); res.set_channels(channels.bits()); res.set_sampling_frequency(sampling_frequency.bits()); res.set_object_type(object_type.bits()); Ok(res) } /// `AACMediaCodecInfo` is represented as an u64, with upper 16 bits unused. /// Return a vector of the lower 6 bytes. pub fn to_bytes(&self) -> Vec<u8> { let codec_info = self.0.to_be_bytes(); let mut res = [0u8; 6]; res.copy_from_slice(&codec_info[2..8]); res.to_vec() } } #[cfg(test)] mod tests { use super::*; #[test] /// Unit test for the SBC media codec info generation. fn test_sbc_media_codec_info() { // Mandatory A2DP Sink support case. let sbc_media_codec_info: SbcCodecInfo = SbcCodecInfo::new( SbcSamplingFrequency::MANDATORY_SNK, SbcChannelMode::MANDATORY_SNK, SbcBlockCount::MANDATORY_SNK, SbcSubBands::MANDATORY_SNK, SbcAllocation::MANDATORY_SNK, 2, 250, ) .expect("Couldn't create sbc media codec info."); let res = sbc_media_codec_info.to_bytes(); assert_eq!(vec![0x3F, 0xFF, 2, 250], res); // Mandatory A2DP source support case. Some fields are choose 1 fields. let sbc_media_codec_info: SbcCodecInfo = SbcCodecInfo::new( SbcSamplingFrequency::FREQ44100HZ, SbcChannelMode::MONO | SbcChannelMode::DUAL_CHANNEL, SbcBlockCount::MANDATORY_SRC, SbcSubBands::MANDATORY_SRC, SbcAllocation::MANDATORY_SRC, 2, 250, ) .expect("Couldn't create sbc media codec info."); let res = sbc_media_codec_info.to_bytes(); assert_eq!(vec![0x2C, 0xF5, 2, 250], res); // No supported codec information let sbc_codec_info: SbcCodecInfo = SbcCodecInfo::new( SbcSamplingFrequency::empty(), SbcChannelMode::empty(), SbcBlockCount::empty(), SbcSubBands::empty(), SbcAllocation::empty(), 2, 250, ) .expect("Couldn't create sbc media codec info."); let res = sbc_codec_info.to_bytes(); assert_eq!(vec![0x00, 0x00, 2, 250], res); // All codec field values are supported let sbc_codec_info: SbcCodecInfo = SbcCodecInfo::new( SbcSamplingFrequency::all(), SbcChannelMode::all(), SbcBlockCount::all(), SbcSubBands::all(), SbcAllocation::all(), SbcCodecInfo::BITPOOL_MIN, // Smallest bitpool value. SbcCodecInfo::BITPOOL_MAX, // Largest bitpool value. ) .expect("Couldn't create sbc media codec info."); let res = sbc_codec_info.to_bytes(); assert_eq!(vec![0xFF, 0xFF, 2, 250], res); // Out of range bitpool value let sbc_codec_info = SbcCodecInfo::new( SbcSamplingFrequency::all(), SbcChannelMode::all(), SbcBlockCount::all(), SbcSubBands::all(), SbcAllocation::all(), 20, 252, // Too large. ); assert!(sbc_codec_info.is_err()); // Out of range bitpool value let sbc_codec_info = SbcCodecInfo::new( SbcSamplingFrequency::all(), SbcChannelMode::all(), SbcBlockCount::all(), SbcSubBands::all(), SbcAllocation::all(), 0, // Too small 240, ); assert!(sbc_codec_info.is_err()); // Invalid bitpool value let sbc_codec_info = SbcCodecInfo::new( SbcSamplingFrequency::all(), SbcChannelMode::all(), SbcBlockCount::all(), SbcSubBands::all(), SbcAllocation::all(), 100, 50, ); assert!(sbc_codec_info.is_err()); } #[test] fn test_aac_media_codec_info() { // Empty case. let aac_media_codec_info: AACMediaCodecInfo = AACMediaCodecInfo::new( AACObjectType::empty(), AACSamplingFrequency::empty(), AACChannels::empty(), AACVariableBitRate::empty(), 0, ) .expect("Error creating aac media codec info."); let res = aac_media_codec_info.to_bytes(); assert_eq!(vec![0, 0, 0, 0, 0, 0], res); // All codec info supported case. let aac_media_codec_info: AACMediaCodecInfo = AACMediaCodecInfo::new( AACObjectType::all(), AACSamplingFrequency::all(), AACChannels::all(), AACVariableBitRate::all(), 8388607, // Largest 23-bit bit rate. ) .expect("Error creating aac media codec info."); let res = aac_media_codec_info.to_bytes(); assert_eq!(vec![0xF0, 0xFF, 0xFC, 0xFF, 0xFF, 0xFF], res); // Only VBR specified. let aac_media_codec_info: AACMediaCodecInfo = AACMediaCodecInfo::new( AACObjectType::empty(), AACSamplingFrequency::empty(), AACChannels::empty(), AACVariableBitRate::VBR_SUPPORTED, 0, ) .expect("Error creating aac media codec info."); let res = aac_media_codec_info.to_bytes(); assert_eq!(vec![0x00, 0x00, 0x00, 0x80, 0x00, 0x00], res); // A2DP Sink mandatory fields supported. let aac_media_codec_info: AACMediaCodecInfo = AACMediaCodecInfo::new( AACObjectType::MANDATORY_SNK, AACSamplingFrequency::MANDATORY_SNK, AACChannels::MANDATORY_SNK, AACVariableBitRate::MANDATORY_SNK, 0xAAFF, // Arbitrary bit rate. ) .expect("Error creating aac media codec info."); let res = aac_media_codec_info.to_bytes(); assert_eq!(vec![0x80, 0x01, 0x8C, 0x80, 0xAA, 0xFF], res); // A2DP Source mandatory fields supported. let aac_media_codec_info: AACMediaCodecInfo = AACMediaCodecInfo::new( AACObjectType::MANDATORY_SRC, AACSamplingFrequency::FREQ44100HZ, AACChannels::ONE, AACVariableBitRate::empty(), // VBR is optional in SRC. 0xAAFF, // Arbitrary ) .expect("Error creating aac media codec info."); let res = aac_media_codec_info.to_bytes(); assert_eq!(vec![0x80, 0x01, 0x08, 0x00, 0xAA, 0xFF], res); // Out of range bit rate. let aac_media_codec_info = AACMediaCodecInfo::new( AACObjectType::MANDATORY_SRC, AACSamplingFrequency::FREQ44100HZ, AACChannels::ONE, AACVariableBitRate::empty(), 0xFFFFFF, // Too large ); assert!(aac_media_codec_info.is_err()); } }
use { crate::{ descriptor, escape::{Escape, KeepAlive, Terminal}, }, gfx_hal::Backend, std::ops::{Deref, DerefMut}, }; /// Descriptor set object wrapper. #[derive(Debug)] pub struct DescriptorSet<B: Backend> { escape: Escape<(descriptor::DescriptorSet<B>, KeepAlive)>, } impl<B> DescriptorSet<B> where B: Backend, { /// Wrap a descriptor set. /// /// # Safety /// /// `terminal` will receive descriptor set upon drop, it must free descriptor set properly. /// pub unsafe fn new( set: descriptor::DescriptorSet<B>, layout: &DescriptorSetLayout<B>, terminal: &Terminal<(descriptor::DescriptorSet<B>, KeepAlive)>, ) -> Self { DescriptorSet { escape: terminal.escape((set, layout.keep_alive())), } } /// This will return `None` and would be equivalent to dropping /// if there are `KeepAlive` created from this `DescriptorSet. pub fn unescape(self) -> Option<(descriptor::DescriptorSet<B>, KeepAlive)> { Escape::unescape(self.escape) } /// Creates [`KeepAlive`] handler to extend descriptor set lifetime. /// /// [`KeepAlive`]: struct.KeepAlive.html pub fn keep_alive(&self) -> KeepAlive { Escape::keep_alive(&self.escape) } /// Get raw descriptor set handle. /// /// # Safety /// /// Raw descriptor set handler should not be used to violate this object valid usage. pub fn raw(&self) -> &B::DescriptorSet { self.escape.0.raw() } } #[derive(Debug)] pub struct DescriptorSetLayout<B: Backend> { escape: Escape<descriptor::DescriptorSetLayout<B>>, } impl<B> DescriptorSetLayout<B> where B: Backend, { /// Wrap a descriptor set layout. /// /// # Safety /// /// `terminal` will receive descriptor set layout upon drop, it must free descriptor set layout properly. /// pub unsafe fn new( layout: descriptor::DescriptorSetLayout<B>, terminal: &Terminal<descriptor::DescriptorSetLayout<B>>, ) -> Self { DescriptorSetLayout { escape: terminal.escape(layout), } } /// This will return `None` and would be equivalent to dropping /// if there are `KeepAlive` created from this `DescriptorSetLayout. pub fn unescape(self) -> Option<descriptor::DescriptorSetLayout<B>> { Escape::unescape(self.escape) } /// Creates [`KeepAlive`] handler to extend descriptor set layout lifetime. /// /// [`KeepAlive`]: struct.KeepAlive.html pub fn keep_alive(&self) -> KeepAlive { Escape::keep_alive(&self.escape) } /// Get raw descriptor set layout handle. /// /// # Safety /// /// Raw descriptor set layout handler should not be used to violate this object valid usage. pub fn raw(&self) -> &B::DescriptorSetLayout { self.escape.raw() } } impl<B: Backend> Deref for DescriptorSetLayout<B> { type Target = descriptor::DescriptorSetLayout<B>; fn deref(&self) -> &descriptor::DescriptorSetLayout<B> { &*self.escape } } impl<B: Backend> DerefMut for DescriptorSetLayout<B> { fn deref_mut(&mut self) -> &mut descriptor::DescriptorSetLayout<B> { &mut *self.escape } }
//! Instruction types #![allow(dead_code)] use crate::state::ImpermenantLossStopLossConfig; use borsh::{BorshDeserialize, BorshSchema, BorshSerialize}; /// Instructions supported by the program #[derive(Clone, Debug, BorshSerialize, BorshDeserialize, BorshSchema, PartialEq)] pub enum Instruction { Initialize { config: ImpermenantLossStopLossConfig, }, Configure { config: ImpermenantLossStopLossConfig, }, OwnerAddLiquidity { amount_a: u64, amount_b: u64, }, OwnerRemoveLiquidity { amount_a: u64, amount_b: u64, }, AnyoneRemoveLiquidity { amount_a: u64, amount_b: u64, } }
use std::path::Path; pub mod compiler; pub mod constants; pub mod deploy; pub use deploy::{deploy_contract, make_web3, make_web3_ganache}; pub fn get_artifact(contract_name: &str) -> deploy::ContractArtifact { deploy::get_artifact(Path::new(constants::BUILD_PATH), contract_name) }
use yew::prelude::*; pub struct EmailApp {} pub enum Msg {} impl Component for EmailApp { type Message = Msg; type Properties = (); fn create(_: Self::Properties, _: ComponentLink<Self>) -> Self { EmailApp {} } fn update(&mut self, _msg: Self::Message) -> ShouldRender { true } fn change(&mut self, _: Self::Properties) -> ShouldRender { false } fn view(&self) -> Html { html! { <div class="p-2" style="font-size: 14px;"> <p>{ " Email Applications using this connection." }</p> <div class="mb-3"> <table class="table"> <tbody> <tr> <td> <p class="fw-bold">{"TelAuth Management API (Test Application)"}</p> <p>{"Machine to Machine"}</p> </td> <td> <div class="form-check form-switch"> <input class="form-check-input" type="checkbox" id="authManageSwitch"/> </div> </td> </tr> <tr> <td> <p class="fw-bold">{"API Explorer Application"}</p> <p>{"Machine to Machine"}</p> </td> <td> <div class="form-check form-switch"> <input class="form-check-input" type="checkbox" id="apiExplorerSwitch"/> </div> </td> </tr> <tr> <td> <p class="fw-bold">{"Placeholder (Test Application)"}</p> <p>{"Machine to Machine"}</p> </td> <td> <div class="form-check form-switch"> <input class="form-check-input" type="checkbox" id="placeholderTestSwitch"/> </div> </td> </tr> <tr> <td> <p class="fw-bold">{"Default App"}</p> <p>{"Generic"}</p> </td> <td> <div class="form-check form-switch"> <input class="form-check-input" type="checkbox" id="defaultAppSwitch"/> </div> </td> </tr> <tr> <td> <p class="fw-bold">{"Native App"}</p> <p>{"Generic"}</p> </td> <td> <div class="form-check form-switch"> <input class="form-check-input" type="checkbox" id="nativeAppSwitch"/> </div> </td> </tr> <tr> <td> <p class="fw-bold">{"RWA"}</p> <p>{"Regular Web Application"}</p> </td> <td> <div class="form-check form-switch"> <input class="form-check-input" type="checkbox" id="regWebAppSwitch"/> </div> </td> </tr> <tr> <td> <p class="fw-bold">{"SPWA"}</p> <p>{"Generic"}</p> </td> <td> <div class="form-check form-switch"> <input class="form-check-input" type="checkbox" id="singPageAppSwitch"/> </div> </td> </tr> </tbody> </table> </div> <div class="modal-footer"> <button type="button" class="btn btn-primary">{"Save"}</button> </div> </div> } } }
#![feature(core_intrinsics)] #![feature(const_fn)] use crate::geometry::Vector2; use crate::geometry::Vector3; use crate::types::Float; use crate::types::Int; use std::f32; use std::f64; pub mod bounds; pub mod bssrdf; pub mod efloat; pub mod geometry; pub mod interaction; pub mod intersect; pub mod light; pub mod lights; pub mod materials; pub mod math; pub mod medium; pub mod primitive; pub mod quaternion; pub mod ray; pub mod reflection; pub mod sampler; pub mod sampling; pub mod scene; pub mod shape; pub mod sphere; pub mod spectrum; pub mod texture; pub mod transform; pub mod types; pub type Point2<T> = Vector2<T>; pub type Normal2<T> = Vector2<T>; pub type Vector2i = Vector2<Int>; pub type Vector2f = Vector2<Float>; pub type Point2i = Vector2i; pub type Point2f = Vector2f; pub type Normal2i = Vector2i; pub type Normal2f = Vector2f; pub type Point3<T> = Vector3<T>; pub type Normal3<T> = Vector3<T>; pub type Vector3i = Vector3<Int>; pub type Vector3f = Vector3<Float>; pub type Point3i = Vector3i; pub type Point3f = Vector3f; pub type Normal3i = Vector3i; pub type Normal3f = Vector3f; static SHADOW_EPSILON: Float = 0.0001;
// auto generated, do not modify. // created: Wed Jan 20 00:44:03 2016 // src-file: /QtNetwork/qhostaddress.h // dst-file: /src/network/qhostaddress.rs // // header block begin => #![feature(libc)] #![feature(core)] #![feature(collections)] extern crate libc; use self::libc::*; // <= header block end // main block begin => // <= main block end // use block begin => use std::ops::Deref; // use super::qhostaddress::QIPv6Address; // 773 use super::super::core::qstring::QString; // 771 // <= use block end // ext block begin => // #[link(name = "Qt5Core")] // #[link(name = "Qt5Gui")] // #[link(name = "Qt5Widgets")] // #[link(name = "QtInline")] extern { fn QHostAddress_Class_Size() -> c_int; // proto: void QHostAddress::QHostAddress(const Q_IPV6ADDR & ip6Addr); fn _ZN12QHostAddressC2ERK12QIPv6Address(qthis: u64 /* *mut c_void*/, arg0: *mut c_void); // proto: Q_IPV6ADDR QHostAddress::toIPv6Address(); fn _ZNK12QHostAddress13toIPv6AddressEv(qthis: u64 /* *mut c_void*/) -> *mut c_void; // proto: void QHostAddress::QHostAddress(const quint8 * ip6Addr); fn _ZN12QHostAddressC2EPKh(qthis: u64 /* *mut c_void*/, arg0: *mut c_uchar); // proto: bool QHostAddress::isNull(); fn _ZNK12QHostAddress6isNullEv(qthis: u64 /* *mut c_void*/) -> c_char; // proto: void QHostAddress::QHostAddress(const QString & address); fn _ZN12QHostAddressC2ERK7QString(qthis: u64 /* *mut c_void*/, arg0: *mut c_void); // proto: void QHostAddress::clear(); fn _ZN12QHostAddress5clearEv(qthis: u64 /* *mut c_void*/); // proto: void QHostAddress::setAddress(quint8 * ip6Addr); fn _ZN12QHostAddress10setAddressEPh(qthis: u64 /* *mut c_void*/, arg0: *mut c_uchar); // proto: void QHostAddress::setAddress(quint32 ip4Addr); fn _ZN12QHostAddress10setAddressEj(qthis: u64 /* *mut c_void*/, arg0: c_uint); // proto: void QHostAddress::setAddress(const Q_IPV6ADDR & ip6Addr); fn _ZN12QHostAddress10setAddressERK12QIPv6Address(qthis: u64 /* *mut c_void*/, arg0: *mut c_void); // proto: void QHostAddress::QHostAddress(quint8 * ip6Addr); fn _ZN12QHostAddressC2EPh(qthis: u64 /* *mut c_void*/, arg0: *mut c_uchar); // proto: void QHostAddress::QHostAddress(); fn _ZN12QHostAddressC2Ev(qthis: u64 /* *mut c_void*/); // proto: void QHostAddress::QHostAddress(quint32 ip4Addr); fn _ZN12QHostAddressC2Ej(qthis: u64 /* *mut c_void*/, arg0: c_uint); // proto: void QHostAddress::QHostAddress(const QHostAddress & copy); fn _ZN12QHostAddressC2ERKS_(qthis: u64 /* *mut c_void*/, arg0: *mut c_void); // proto: bool QHostAddress::isInSubnet(const QHostAddress & subnet, int netmask); fn _ZNK12QHostAddress10isInSubnetERKS_i(qthis: u64 /* *mut c_void*/, arg0: *mut c_void, arg1: c_int) -> c_char; // proto: QString QHostAddress::toString(); fn _ZNK12QHostAddress8toStringEv(qthis: u64 /* *mut c_void*/) -> *mut c_void; // proto: bool QHostAddress::isLoopback(); fn _ZNK12QHostAddress10isLoopbackEv(qthis: u64 /* *mut c_void*/) -> c_char; // proto: QString QHostAddress::scopeId(); fn _ZNK12QHostAddress7scopeIdEv(qthis: u64 /* *mut c_void*/) -> *mut c_void; // proto: void QHostAddress::setAddress(const quint8 * ip6Addr); fn _ZN12QHostAddress10setAddressEPKh(qthis: u64 /* *mut c_void*/, arg0: *mut c_uchar); // proto: void QHostAddress::setScopeId(const QString & id); fn _ZN12QHostAddress10setScopeIdERK7QString(qthis: u64 /* *mut c_void*/, arg0: *mut c_void); // proto: void QHostAddress::~QHostAddress(); fn _ZN12QHostAddressD2Ev(qthis: u64 /* *mut c_void*/); // proto: quint32 QHostAddress::toIPv4Address(bool * ok); fn _ZNK12QHostAddress13toIPv4AddressEPb(qthis: u64 /* *mut c_void*/, arg0: *mut c_char) -> c_uint; // proto: static QPair<QHostAddress, int> QHostAddress::parseSubnet(const QString & subnet); fn _ZN12QHostAddress11parseSubnetERK7QString(arg0: *mut c_void); // proto: quint32 QHostAddress::toIPv4Address(); fn _ZNK12QHostAddress13toIPv4AddressEv(qthis: u64 /* *mut c_void*/) -> c_uint; // proto: bool QHostAddress::setAddress(const QString & address); fn _ZN12QHostAddress10setAddressERK7QString(qthis: u64 /* *mut c_void*/, arg0: *mut c_void) -> c_char; fn QIPv6Address_Class_Size() -> c_int; } // <= ext block end // body block begin => // class sizeof(QHostAddress)=1 #[derive(Default)] pub struct QHostAddress { // qbase: None, pub qclsinst: u64 /* *mut c_void*/, } // class sizeof(QIPv6Address)=16 #[derive(Default)] pub struct QIPv6Address { // qbase: None, pub qclsinst: u64 /* *mut c_void*/, } impl /*struct*/ QHostAddress { pub fn inheritFrom(qthis: u64 /* *mut c_void*/) -> QHostAddress { return QHostAddress{qclsinst: qthis, ..Default::default()}; } } // proto: void QHostAddress::QHostAddress(const Q_IPV6ADDR & ip6Addr); impl /*struct*/ QHostAddress { pub fn new<T: QHostAddress_new>(value: T) -> QHostAddress { let rsthis = value.new(); return rsthis; // return 1; } } pub trait QHostAddress_new { fn new(self) -> QHostAddress; } // proto: void QHostAddress::QHostAddress(const Q_IPV6ADDR & ip6Addr); impl<'a> /*trait*/ QHostAddress_new for (&'a QIPv6Address) { fn new(self) -> QHostAddress { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressC2ERK12QIPv6Address()}; let ctysz: c_int = unsafe{QHostAddress_Class_Size()}; let qthis_ph: u64 = unsafe{calloc(1, ctysz as usize)} as u64; let arg0 = self.qclsinst as *mut c_void; unsafe {_ZN12QHostAddressC2ERK12QIPv6Address(qthis_ph, arg0)}; let qthis: u64 = qthis_ph; let rsthis = QHostAddress{qclsinst: qthis, ..Default::default()}; return rsthis; // return 1; } } // proto: Q_IPV6ADDR QHostAddress::toIPv6Address(); impl /*struct*/ QHostAddress { pub fn toIPv6Address<RetType, T: QHostAddress_toIPv6Address<RetType>>(& self, overload_args: T) -> RetType { return overload_args.toIPv6Address(self); // return 1; } } pub trait QHostAddress_toIPv6Address<RetType> { fn toIPv6Address(self , rsthis: & QHostAddress) -> RetType; } // proto: Q_IPV6ADDR QHostAddress::toIPv6Address(); impl<'a> /*trait*/ QHostAddress_toIPv6Address<QIPv6Address> for () { fn toIPv6Address(self , rsthis: & QHostAddress) -> QIPv6Address { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress13toIPv6AddressEv()}; let mut ret = unsafe {_ZNK12QHostAddress13toIPv6AddressEv(rsthis.qclsinst)}; let mut ret1 = QIPv6Address::inheritFrom(ret as u64); return ret1; // return 1; } } // proto: void QHostAddress::QHostAddress(const quint8 * ip6Addr); impl<'a> /*trait*/ QHostAddress_new for (&'a String) { fn new(self) -> QHostAddress { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressC2EPKh()}; let ctysz: c_int = unsafe{QHostAddress_Class_Size()}; let qthis_ph: u64 = unsafe{calloc(1, ctysz as usize)} as u64; let arg0 = self.as_ptr() as *mut c_uchar; unsafe {_ZN12QHostAddressC2EPKh(qthis_ph, arg0)}; let qthis: u64 = qthis_ph; let rsthis = QHostAddress{qclsinst: qthis, ..Default::default()}; return rsthis; // return 1; } } // proto: bool QHostAddress::isNull(); impl /*struct*/ QHostAddress { pub fn isNull<RetType, T: QHostAddress_isNull<RetType>>(& self, overload_args: T) -> RetType { return overload_args.isNull(self); // return 1; } } pub trait QHostAddress_isNull<RetType> { fn isNull(self , rsthis: & QHostAddress) -> RetType; } // proto: bool QHostAddress::isNull(); impl<'a> /*trait*/ QHostAddress_isNull<i8> for () { fn isNull(self , rsthis: & QHostAddress) -> i8 { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress6isNullEv()}; let mut ret = unsafe {_ZNK12QHostAddress6isNullEv(rsthis.qclsinst)}; return ret as i8; // return 1; } } // proto: void QHostAddress::QHostAddress(const QString & address); impl<'a> /*trait*/ QHostAddress_new for (&'a QString) { fn new(self) -> QHostAddress { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressC2ERK7QString()}; let ctysz: c_int = unsafe{QHostAddress_Class_Size()}; let qthis_ph: u64 = unsafe{calloc(1, ctysz as usize)} as u64; let arg0 = self.qclsinst as *mut c_void; unsafe {_ZN12QHostAddressC2ERK7QString(qthis_ph, arg0)}; let qthis: u64 = qthis_ph; let rsthis = QHostAddress{qclsinst: qthis, ..Default::default()}; return rsthis; // return 1; } } // proto: void QHostAddress::clear(); impl /*struct*/ QHostAddress { pub fn clear<RetType, T: QHostAddress_clear<RetType>>(& self, overload_args: T) -> RetType { return overload_args.clear(self); // return 1; } } pub trait QHostAddress_clear<RetType> { fn clear(self , rsthis: & QHostAddress) -> RetType; } // proto: void QHostAddress::clear(); impl<'a> /*trait*/ QHostAddress_clear<()> for () { fn clear(self , rsthis: & QHostAddress) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress5clearEv()}; unsafe {_ZN12QHostAddress5clearEv(rsthis.qclsinst)}; // return 1; } } // proto: void QHostAddress::setAddress(quint8 * ip6Addr); impl /*struct*/ QHostAddress { pub fn setAddress<RetType, T: QHostAddress_setAddress<RetType>>(& self, overload_args: T) -> RetType { return overload_args.setAddress(self); // return 1; } } pub trait QHostAddress_setAddress<RetType> { fn setAddress(self , rsthis: & QHostAddress) -> RetType; } // proto: void QHostAddress::setAddress(quint8 * ip6Addr); impl<'a> /*trait*/ QHostAddress_setAddress<()> for (&'a mut String) { fn setAddress(self , rsthis: & QHostAddress) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress10setAddressEPh()}; let arg0 = self.as_ptr() as *mut c_uchar; unsafe {_ZN12QHostAddress10setAddressEPh(rsthis.qclsinst, arg0)}; // return 1; } } // proto: void QHostAddress::setAddress(quint32 ip4Addr); impl<'a> /*trait*/ QHostAddress_setAddress<()> for (u32) { fn setAddress(self , rsthis: & QHostAddress) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress10setAddressEj()}; let arg0 = self as c_uint; unsafe {_ZN12QHostAddress10setAddressEj(rsthis.qclsinst, arg0)}; // return 1; } } // proto: void QHostAddress::setAddress(const Q_IPV6ADDR & ip6Addr); impl<'a> /*trait*/ QHostAddress_setAddress<()> for (&'a QIPv6Address) { fn setAddress(self , rsthis: & QHostAddress) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress10setAddressERK12QIPv6Address()}; let arg0 = self.qclsinst as *mut c_void; unsafe {_ZN12QHostAddress10setAddressERK12QIPv6Address(rsthis.qclsinst, arg0)}; // return 1; } } // proto: void QHostAddress::QHostAddress(quint8 * ip6Addr); impl<'a> /*trait*/ QHostAddress_new for (&'a mut String) { fn new(self) -> QHostAddress { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressC2EPh()}; let ctysz: c_int = unsafe{QHostAddress_Class_Size()}; let qthis_ph: u64 = unsafe{calloc(1, ctysz as usize)} as u64; let arg0 = self.as_ptr() as *mut c_uchar; unsafe {_ZN12QHostAddressC2EPh(qthis_ph, arg0)}; let qthis: u64 = qthis_ph; let rsthis = QHostAddress{qclsinst: qthis, ..Default::default()}; return rsthis; // return 1; } } // proto: void QHostAddress::QHostAddress(); impl<'a> /*trait*/ QHostAddress_new for () { fn new(self) -> QHostAddress { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressC2Ev()}; let ctysz: c_int = unsafe{QHostAddress_Class_Size()}; let qthis_ph: u64 = unsafe{calloc(1, ctysz as usize)} as u64; unsafe {_ZN12QHostAddressC2Ev(qthis_ph)}; let qthis: u64 = qthis_ph; let rsthis = QHostAddress{qclsinst: qthis, ..Default::default()}; return rsthis; // return 1; } } // proto: void QHostAddress::QHostAddress(quint32 ip4Addr); impl<'a> /*trait*/ QHostAddress_new for (u32) { fn new(self) -> QHostAddress { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressC2Ej()}; let ctysz: c_int = unsafe{QHostAddress_Class_Size()}; let qthis_ph: u64 = unsafe{calloc(1, ctysz as usize)} as u64; let arg0 = self as c_uint; unsafe {_ZN12QHostAddressC2Ej(qthis_ph, arg0)}; let qthis: u64 = qthis_ph; let rsthis = QHostAddress{qclsinst: qthis, ..Default::default()}; return rsthis; // return 1; } } // proto: void QHostAddress::QHostAddress(const QHostAddress & copy); impl<'a> /*trait*/ QHostAddress_new for (&'a QHostAddress) { fn new(self) -> QHostAddress { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressC2ERKS_()}; let ctysz: c_int = unsafe{QHostAddress_Class_Size()}; let qthis_ph: u64 = unsafe{calloc(1, ctysz as usize)} as u64; let arg0 = self.qclsinst as *mut c_void; unsafe {_ZN12QHostAddressC2ERKS_(qthis_ph, arg0)}; let qthis: u64 = qthis_ph; let rsthis = QHostAddress{qclsinst: qthis, ..Default::default()}; return rsthis; // return 1; } } // proto: bool QHostAddress::isInSubnet(const QHostAddress & subnet, int netmask); impl /*struct*/ QHostAddress { pub fn isInSubnet<RetType, T: QHostAddress_isInSubnet<RetType>>(& self, overload_args: T) -> RetType { return overload_args.isInSubnet(self); // return 1; } } pub trait QHostAddress_isInSubnet<RetType> { fn isInSubnet(self , rsthis: & QHostAddress) -> RetType; } // proto: bool QHostAddress::isInSubnet(const QHostAddress & subnet, int netmask); impl<'a> /*trait*/ QHostAddress_isInSubnet<i8> for (&'a QHostAddress, i32) { fn isInSubnet(self , rsthis: & QHostAddress) -> i8 { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress10isInSubnetERKS_i()}; let arg0 = self.0.qclsinst as *mut c_void; let arg1 = self.1 as c_int; let mut ret = unsafe {_ZNK12QHostAddress10isInSubnetERKS_i(rsthis.qclsinst, arg0, arg1)}; return ret as i8; // return 1; } } // proto: QString QHostAddress::toString(); impl /*struct*/ QHostAddress { pub fn toString<RetType, T: QHostAddress_toString<RetType>>(& self, overload_args: T) -> RetType { return overload_args.toString(self); // return 1; } } pub trait QHostAddress_toString<RetType> { fn toString(self , rsthis: & QHostAddress) -> RetType; } // proto: QString QHostAddress::toString(); impl<'a> /*trait*/ QHostAddress_toString<QString> for () { fn toString(self , rsthis: & QHostAddress) -> QString { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress8toStringEv()}; let mut ret = unsafe {_ZNK12QHostAddress8toStringEv(rsthis.qclsinst)}; let mut ret1 = QString::inheritFrom(ret as u64); return ret1; // return 1; } } // proto: bool QHostAddress::isLoopback(); impl /*struct*/ QHostAddress { pub fn isLoopback<RetType, T: QHostAddress_isLoopback<RetType>>(& self, overload_args: T) -> RetType { return overload_args.isLoopback(self); // return 1; } } pub trait QHostAddress_isLoopback<RetType> { fn isLoopback(self , rsthis: & QHostAddress) -> RetType; } // proto: bool QHostAddress::isLoopback(); impl<'a> /*trait*/ QHostAddress_isLoopback<i8> for () { fn isLoopback(self , rsthis: & QHostAddress) -> i8 { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress10isLoopbackEv()}; let mut ret = unsafe {_ZNK12QHostAddress10isLoopbackEv(rsthis.qclsinst)}; return ret as i8; // return 1; } } // proto: QString QHostAddress::scopeId(); impl /*struct*/ QHostAddress { pub fn scopeId<RetType, T: QHostAddress_scopeId<RetType>>(& self, overload_args: T) -> RetType { return overload_args.scopeId(self); // return 1; } } pub trait QHostAddress_scopeId<RetType> { fn scopeId(self , rsthis: & QHostAddress) -> RetType; } // proto: QString QHostAddress::scopeId(); impl<'a> /*trait*/ QHostAddress_scopeId<QString> for () { fn scopeId(self , rsthis: & QHostAddress) -> QString { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress7scopeIdEv()}; let mut ret = unsafe {_ZNK12QHostAddress7scopeIdEv(rsthis.qclsinst)}; let mut ret1 = QString::inheritFrom(ret as u64); return ret1; // return 1; } } // proto: void QHostAddress::setAddress(const quint8 * ip6Addr); impl<'a> /*trait*/ QHostAddress_setAddress<()> for (&'a String) { fn setAddress(self , rsthis: & QHostAddress) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress10setAddressEPKh()}; let arg0 = self.as_ptr() as *mut c_uchar; unsafe {_ZN12QHostAddress10setAddressEPKh(rsthis.qclsinst, arg0)}; // return 1; } } // proto: void QHostAddress::setScopeId(const QString & id); impl /*struct*/ QHostAddress { pub fn setScopeId<RetType, T: QHostAddress_setScopeId<RetType>>(& self, overload_args: T) -> RetType { return overload_args.setScopeId(self); // return 1; } } pub trait QHostAddress_setScopeId<RetType> { fn setScopeId(self , rsthis: & QHostAddress) -> RetType; } // proto: void QHostAddress::setScopeId(const QString & id); impl<'a> /*trait*/ QHostAddress_setScopeId<()> for (&'a QString) { fn setScopeId(self , rsthis: & QHostAddress) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress10setScopeIdERK7QString()}; let arg0 = self.qclsinst as *mut c_void; unsafe {_ZN12QHostAddress10setScopeIdERK7QString(rsthis.qclsinst, arg0)}; // return 1; } } // proto: void QHostAddress::~QHostAddress(); impl /*struct*/ QHostAddress { pub fn free<RetType, T: QHostAddress_free<RetType>>(& self, overload_args: T) -> RetType { return overload_args.free(self); // return 1; } } pub trait QHostAddress_free<RetType> { fn free(self , rsthis: & QHostAddress) -> RetType; } // proto: void QHostAddress::~QHostAddress(); impl<'a> /*trait*/ QHostAddress_free<()> for () { fn free(self , rsthis: & QHostAddress) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddressD2Ev()}; unsafe {_ZN12QHostAddressD2Ev(rsthis.qclsinst)}; // return 1; } } // proto: quint32 QHostAddress::toIPv4Address(bool * ok); impl /*struct*/ QHostAddress { pub fn toIPv4Address<RetType, T: QHostAddress_toIPv4Address<RetType>>(& self, overload_args: T) -> RetType { return overload_args.toIPv4Address(self); // return 1; } } pub trait QHostAddress_toIPv4Address<RetType> { fn toIPv4Address(self , rsthis: & QHostAddress) -> RetType; } // proto: quint32 QHostAddress::toIPv4Address(bool * ok); impl<'a> /*trait*/ QHostAddress_toIPv4Address<u32> for (&'a mut Vec<i8>) { fn toIPv4Address(self , rsthis: & QHostAddress) -> u32 { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress13toIPv4AddressEPb()}; let arg0 = self.as_ptr() as *mut c_char; let mut ret = unsafe {_ZNK12QHostAddress13toIPv4AddressEPb(rsthis.qclsinst, arg0)}; return ret as u32; // return 1; } } // proto: static QPair<QHostAddress, int> QHostAddress::parseSubnet(const QString & subnet); impl /*struct*/ QHostAddress { pub fn parseSubnet_s<RetType, T: QHostAddress_parseSubnet_s<RetType>>( overload_args: T) -> RetType { return overload_args.parseSubnet_s(); // return 1; } } pub trait QHostAddress_parseSubnet_s<RetType> { fn parseSubnet_s(self ) -> RetType; } // proto: static QPair<QHostAddress, int> QHostAddress::parseSubnet(const QString & subnet); impl<'a> /*trait*/ QHostAddress_parseSubnet_s<()> for (&'a QString) { fn parseSubnet_s(self ) -> () { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress11parseSubnetERK7QString()}; let arg0 = self.qclsinst as *mut c_void; unsafe {_ZN12QHostAddress11parseSubnetERK7QString(arg0)}; // return 1; } } // proto: quint32 QHostAddress::toIPv4Address(); impl<'a> /*trait*/ QHostAddress_toIPv4Address<u32> for () { fn toIPv4Address(self , rsthis: & QHostAddress) -> u32 { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZNK12QHostAddress13toIPv4AddressEv()}; let mut ret = unsafe {_ZNK12QHostAddress13toIPv4AddressEv(rsthis.qclsinst)}; return ret as u32; // return 1; } } // proto: bool QHostAddress::setAddress(const QString & address); impl<'a> /*trait*/ QHostAddress_setAddress<i8> for (&'a QString) { fn setAddress(self , rsthis: & QHostAddress) -> i8 { // let qthis: *mut c_void = unsafe{calloc(1, 32)}; // unsafe{_ZN12QHostAddress10setAddressERK7QString()}; let arg0 = self.qclsinst as *mut c_void; let mut ret = unsafe {_ZN12QHostAddress10setAddressERK7QString(rsthis.qclsinst, arg0)}; return ret as i8; // return 1; } } impl /*struct*/ QIPv6Address { pub fn inheritFrom(qthis: u64 /* *mut c_void*/) -> QIPv6Address { return QIPv6Address{qclsinst: qthis, ..Default::default()}; } } // <= body block end
// Copyright 2020 - 2021 Alex Dukhno // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. use super::*; #[rstest::rstest] fn update_all_records(database_with_schema: (InMemory, ResultCollector)) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name (column_test smallint);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::TableCreated)); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values (123), (456);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsInserted(2))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_test".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["123".to_owned()])), Ok(QueryEvent::DataRow(vec!["456".to_owned()])), Ok(QueryEvent::RecordsSelected(2)), ]); engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_test=789;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(2))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_test".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["789".to_owned()])), Ok(QueryEvent::DataRow(vec!["789".to_owned()])), Ok(QueryEvent::RecordsSelected(2)), ]); } #[rstest::rstest] fn update_single_column_of_all_records(database_with_schema: (InMemory, ResultCollector)) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name (col1 smallint, col2 smallint);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::TableCreated)); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values (123, 789), (456, 789);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsInserted(2))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("col1".to_owned(), SMALLINT), ("col2".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec!["123".to_owned(), "789".to_owned()])), Ok(QueryEvent::DataRow(vec!["456".to_owned(), "789".to_owned()])), Ok(QueryEvent::RecordsSelected(2)), ]); engine .execute(Inbound::Query { sql: "update schema_name.table_name set col2=357;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(2))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("col1".to_owned(), SMALLINT), ("col2".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec!["123".to_owned(), "357".to_owned()])), Ok(QueryEvent::DataRow(vec!["456".to_owned(), "357".to_owned()])), Ok(QueryEvent::RecordsSelected(2)), ]); } #[rstest::rstest] fn update_multiple_columns_of_all_records(database_with_schema: (InMemory, ResultCollector)) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name (col1 smallint, col2 smallint, col3 smallint);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::TableCreated)); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values (111, 222, 333), (444, 555, 666);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsInserted(2))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("col1".to_owned(), SMALLINT), ("col2".to_owned(), SMALLINT), ("col3".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec![ "111".to_owned(), "222".to_owned(), "333".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "444".to_owned(), "555".to_owned(), "666".to_owned(), ])), Ok(QueryEvent::RecordsSelected(2)), ]); engine .execute(Inbound::Query { sql: "update schema_name.table_name set col3=777, col1=999;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(2))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("col1".to_owned(), SMALLINT), ("col2".to_owned(), SMALLINT), ("col3".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec![ "999".to_owned(), "222".to_owned(), "777".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "999".to_owned(), "555".to_owned(), "777".to_owned(), ])), Ok(QueryEvent::RecordsSelected(2)), ]); } #[rstest::rstest] fn update_all_records_in_multiple_columns(database_with_schema: (InMemory, ResultCollector)) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name (column_1 smallint, column_2 smallint, column_3 smallint);" .to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::TableCreated)); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values (1, 2, 3), (4, 5, 6), (7, 8, 9);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsInserted(3))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("column_1".to_owned(), SMALLINT), ("column_2".to_owned(), SMALLINT), ("column_3".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec![ "1".to_owned(), "2".to_owned(), "3".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "4".to_owned(), "5".to_owned(), "6".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "7".to_owned(), "8".to_owned(), "9".to_owned(), ])), Ok(QueryEvent::RecordsSelected(3)), ]); engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_1=10, column_2=20, column_3=30;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(3))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("column_1".to_owned(), SMALLINT), ("column_2".to_owned(), SMALLINT), ("column_3".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec![ "10".to_owned(), "20".to_owned(), "30".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "10".to_owned(), "20".to_owned(), "30".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "10".to_owned(), "20".to_owned(), "30".to_owned(), ])), Ok(QueryEvent::RecordsSelected(3)), ]); } #[rstest::rstest] fn update_records_in_nonexistent_table(database_with_schema: (InMemory, ResultCollector)) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_test=789;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Err(QueryError::table_does_not_exist("schema_name.table_name"))); } #[rstest::rstest] fn update_non_existent_columns_of_records(database_with_schema: (InMemory, ResultCollector)) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name (column_test smallint);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::TableCreated)); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values (123);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsInserted(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_test".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["123".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); engine .execute(Inbound::Query { sql: "update schema_name.table_name set col1=456, col2=789;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_many(vec![Err(QueryError::column_does_not_exist("col1"))]); } #[rstest::rstest] fn test_update_with_dynamic_expression(database_with_schema: (InMemory, ResultCollector)) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name (\ si_column_1 smallint, \ si_column_2 smallint, \ si_column_3 smallint);" .to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::TableCreated)); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values (1, 2, 3), (4, 5, 6), (7, 8, 9);".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsInserted(3))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("si_column_1".to_owned(), SMALLINT), ("si_column_2".to_owned(), SMALLINT), ("si_column_3".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec![ "1".to_owned(), "2".to_owned(), "3".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "4".to_owned(), "5".to_owned(), "6".to_owned(), ])), Ok(QueryEvent::DataRow(vec![ "7".to_owned(), "8".to_owned(), "9".to_owned(), ])), Ok(QueryEvent::RecordsSelected(3)), ]); engine .execute(Inbound::Query { sql: "update schema_name.table_name \ set \ si_column_1 = 2 * si_column_1, \ si_column_2 = 2 * (si_column_1 + si_column_2), \ si_column_3 = (si_column_3 + (2 * (si_column_1 + si_column_2)));" .to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(3))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![ ("si_column_1".to_owned(), SMALLINT), ("si_column_2".to_owned(), SMALLINT), ("si_column_3".to_owned(), SMALLINT), ])), Ok(QueryEvent::DataRow(vec![ 2.to_string(), (2 * (1 + 2)).to_string(), (3 + (2 * (1 + 2))).to_string(), ])), Ok(QueryEvent::DataRow(vec![ (2 * 4).to_string(), (2 * (4 + 5)).to_string(), (6 + (2 * (4 + 5))).to_string(), ])), Ok(QueryEvent::DataRow(vec![ (2 * 7).to_string(), (2 * (7 + 8)).to_string(), (9 + (2 * (7 + 8))).to_string(), ])), Ok(QueryEvent::RecordsSelected(3)), ]); } #[cfg(test)] mod operators { use super::*; #[cfg(test)] mod integers { use super::*; #[rstest::fixture] fn with_table(database_with_schema: (InMemory, ResultCollector)) -> (InMemory, ResultCollector) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name(column_si smallint);".to_owned(), }) .expect("query executed"); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values (2);".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_till_this_moment(vec![ Ok(QueryEvent::TableCreated), Ok(QueryEvent::QueryComplete), Ok(QueryEvent::RecordsInserted(1)), Ok(QueryEvent::QueryComplete), ]); (engine, collector) } #[rstest::rstest] fn addition(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 1 + 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["3".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn subtraction(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 1 - 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["-1".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn multiplication(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 3 * 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["6".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn division(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 8 / 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["4".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn modulo(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 8 % 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["0".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn exponentiation(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 8 ^ 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["64".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] #[ignore] //TODO: TypeInference#infer_static is not implemented fn square_root(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = |/ 16;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["4".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] #[ignore] //TODO: TypeInference#infer_static is not implemented fn cube_root(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = ||/ 8;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["2".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn factorial(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 5!;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["120".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn prefix_factorial(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = !!5;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["120".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn absolute_value(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = @ -5;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["5".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn bitwise_and(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 5 & 1;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["1".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn bitwise_or(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 5 | 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["7".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn bitwise_not(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = ~1;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["-2".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn bitwise_shift_left(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 1 << 4;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["16".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn bitwise_right_left(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 8 >> 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["2".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn evaluate_many_operations(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set column_si = 5 & 13 % 10 + 1 * 20 - 40 / 4;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("column_si".to_owned(), SMALLINT)])), Ok(QueryEvent::DataRow(vec!["5".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } } #[cfg(test)] mod string { use super::*; #[rstest::fixture] fn with_table(database_with_schema: (InMemory, ResultCollector)) -> (InMemory, ResultCollector) { let (mut engine, collector) = database_with_schema; engine .execute(Inbound::Query { sql: "create table schema_name.table_name(strings char(5));".to_owned(), }) .expect("query executed"); engine .execute(Inbound::Query { sql: "insert into schema_name.table_name values ('x');".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_till_this_moment(vec![ Ok(QueryEvent::TableCreated), Ok(QueryEvent::QueryComplete), Ok(QueryEvent::RecordsInserted(1)), Ok(QueryEvent::QueryComplete), ]); (engine, collector) } #[rstest::rstest] fn concatenation(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set strings = '123' || '45';".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("strings".to_owned(), CHAR)])), Ok(QueryEvent::DataRow(vec!["12345".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] #[ignore] //TODO: TypeInference#infer_static is not implemented fn concatenation_with_number(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set strings = 1 || '45';".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("strings".to_owned(), CHAR)])), Ok(QueryEvent::DataRow(vec!["145".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); engine .execute(Inbound::Query { sql: "update schema_name.table_name set strings = '45' || 1;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Ok(QueryEvent::RecordsUpdated(1))); engine .execute(Inbound::Query { sql: "select * from schema_name.table_name;".to_owned(), }) .expect("query executed"); collector.lock().unwrap().assert_receive_many(vec![ Ok(QueryEvent::RowDescription(vec![("strings".to_owned(), CHAR)])), Ok(QueryEvent::DataRow(vec!["451".to_owned()])), Ok(QueryEvent::RecordsSelected(1)), ]); } #[rstest::rstest] fn non_string_concatenation_not_supported(with_table: (InMemory, ResultCollector)) { let (mut engine, collector) = with_table; engine .execute(Inbound::Query { sql: "update schema_name.table_name set strings = 1 || 2;".to_owned(), }) .expect("query executed"); collector .lock() .unwrap() .assert_receive_single(Err(QueryError::undefined_function( "||".to_owned(), "smallint".to_owned(), "smallint".to_owned(), ))); } } }
use super::{Chain, Day, Link, Streak}; use chrono::{Datelike, Local, NaiveDate, Duration}; use super::FORMAT; pub fn calculate_streak(chain: &Chain, links: &Vec<Link>) -> Streak { let name = chain.name.to_string(); let mut date: Option<NaiveDate> = None; let mut prev_date: Option<NaiveDate>; let mut streak = 0; let mut longest_streak = 0; for link in links.iter() { prev_date = date; date = Some(link.date); if date.is_some() && prev_date.is_some() { let between = date .unwrap() .signed_duration_since(prev_date.unwrap()) .num_days() - 1; if between > 0 { if streak > longest_streak { longest_streak = streak; } streak = 0; } } streak += 1; } if streak > longest_streak { longest_streak = streak; } Streak { name, streak, longest_streak, } } pub fn create_days(links: &Vec<Link>) -> Vec<Day> { let mut days: Vec<Day> = Vec::new(); if links.len() == 0 { return create_dummy_days() } let start_date = links[0].date; let end_date = Local::today().naive_local(); let difference = end_date.signed_duration_since(start_date).num_days(); let start_date = if difference < 10 { start_date - Duration::days(9 - difference) } else { start_date + Duration::days(difference - 9) }; let links = if links.len() > 10 { links.get(links.len() - 10..).unwrap() } else { links.get(..).unwrap() }; assert!(start_date.iter_days().take(10).last().unwrap().format(FORMAT).to_string() == end_date.format(FORMAT).to_string()); let mut is_done = false; for date in start_date.iter_days().take(10) { for link in links { if link.date.signed_duration_since(date).num_days() == 0 { is_done = true; } } let day = Day { day: date.day() as i32, is_done: is_done }; days.push(day); is_done = false; } assert!(days.len() == 10); days } pub fn create_dummy_days() -> Vec<Day> { let mut days: Vec<Day> = Vec::new(); let today = Local::today().naive_local(); let start_date = today - Duration::days(9); for date in start_date.iter_days().take(10) { let day = Day { day: date.day() as i32, is_done: false }; days.push(day); } assert!(days.len() == 10); days }
use std::error; use std::fs; use std::path::PathBuf; use std::str::FromStr; use structopt::StructOpt; type Error = Box<dyn error::Error>; #[derive(StructOpt)] #[structopt( name = "solve", about = "solve the puzzles from the Advent of Code 2020, day 5" )] struct Opt { /// path to input file; should contain list of boarding passes input: PathBuf, } fn main() -> Result<(), Error> { let opts = Opt::from_args(); let boarding_pass_ids = fs::read_to_string(opts.input.clone())? .lines() .map(|s| BoardingPass::from_str(s).map(|b| b.id())) .collect::<Result<Vec<u16>, Error>>()?; println!("part 1: highest seat id on a boarding pass"); println!("{:?}", boarding_pass_ids.iter().max()); println!("part 2: ID of seat missing from list"); println!("{:?}", find_missing_id(boarding_pass_ids)); Ok(()) } fn find_missing_id(mut ids: Vec<u16>) -> Option<u16> { ids.sort(); for ix in 1..ids.len() { let prev_id = ids[ix] - 1; if prev_id != ids[ix - 1] { return Some(prev_id); } } None } struct BoardingPass { row: u8, column: u8, } impl BoardingPass { fn id(&self) -> u16 { (self.row as u16) * 8u16 + (self.column as u16) } } impl FromStr for BoardingPass { type Err = Error; fn from_str(s: &str) -> Result<BoardingPass, Error> { if s.len() != 10 { return Err(Error::from(format!( "Illegal boarding pass {:?}, expected 10 bytes, found {}", s, s.len() ))); } let row = s[0..7] .chars() .map(|c| match c { 'F' => Ok('0'), 'B' => Ok('1'), _ => Err(Error::from(format!( "Illegal character {:?} in row of boarding pass {:?}", c, s ))), }) .collect::<Result<String, Error>>() .and_then(|bs| u8::from_str_radix(&bs, 2).map_err(Error::from))?; let column = s[7..10] .chars() .map(|c| match c { 'L' => Ok('0'), 'R' => Ok('1'), _ => Err(Error::from(format!( "Illegal character {:?} in column of boarding pass {:?}", c, s ))), }) .collect::<Result<String, Error>>() .and_then(|bs| u8::from_str_radix(&bs, 2).map_err(Error::from))?; Ok(BoardingPass { row, column }) } } //use std::fmt::Display; //impl Display for BoardingPass {}
//! The various tmux operations commands. use super::project::TMUX_BIN; use super::TmuxError; use clap::crate_name; use shlex::Shlex; use std::env::set_current_dir; use std::process::Command; use std::{env, fmt}; /// The commands. Implemented as an enum instead of traits/structs /// to prevent dynamic dispatch. /// /// Implements [`Display`](std::fmt::Display), formatting the commands a shell /// command which is used to display the shell script for the `debug` /// cli command. #[derive(Debug)] pub(crate) enum Commands<'a> { /// Start the server and change into the work directory if specified. Server { project_name: &'a str, project_root: &'a Option<String>, }, /// Runs the various `on_project_<event>` commands. ProjectEvent { event_name: &'a str, on_event: &'a Option<Vec<String>>, }, /// Start the new tmux session, and cd again (for tmux < 1.9 compat). Session { project_name: &'a str, first_window_name: Option<&'a str>, }, /// `send-keys` command. SendKeys { command: String, session_name: &'a str, window_index: usize, pane_index: Option<usize>, comment: Option<String>, }, /// `new-window` command. NewWindow { session_name: &'a str, window_name: &'a str, window_index: usize, project_root: &'a Option<String>, }, /// `split-window` command. SplitWindow { session_name: &'a str, window_index: usize, project_root: &'a Option<String>, }, /// `select-layout` command. SelectLayout { session_name: &'a str, window_index: usize, layout: &'a str, }, /// `select-window` command. SelectWindow { session_name: &'a str, window_index: usize, }, /// `select-pane` command SelectPane { session_name: &'a str, window_index: usize, pane_index: usize, }, /// Attaches to a session using `attach-sesssion` or `switch-client`, /// depends upon already running inside a tmux session or out of it. AttachSession { session_name: &'a str }, /// `kill-session` command StopSession { session_name: &'a str }, /// Set a hook for tmux events SetHook { session_name: &'a str, hook_name: &'a str, hook_command: String, }, } impl<'a> Commands<'a> { fn fmt_server_command( f: &mut fmt::Formatter<'_>, project_name: &'a str, project_root: &'a Option<String>, ) -> fmt::Result { let shebang = env::var("SHELL").map(|x| format!("#!{x}")).ok(); let cd_command = match project_root { Some(project_root) => format!("\ncd {project_root}"), None => "".into(), }; write!( f, "{}\n\ #\n\ # {} {} project\n\n\ {} start-server\ {}", shebang.unwrap_or_else(|| "".into()), crate_name!(), project_name, TMUX_BIN, cd_command ) } fn fmt_project_command( f: &mut fmt::Formatter<'_>, event_name: &'a str, on_event: &'a Option<Vec<String>>, ) -> fmt::Result { let commands = on_event.as_ref().map_or(String::from(""), |v| v.join("\n")); write!(f, "\n# Run on_project_{event_name} command(s)\n{commands}") } fn fmt_session_command( f: &mut fmt::Formatter<'_>, project_name: &'a str, first_window_name: Option<&'a str>, ) -> fmt::Result { let window_param = first_window_name.map_or("".into(), |n| format!(" -n {n}")); write!( f, "\n# Create new session and first window\n\ TMUX= {TMUX_BIN} new-session -d -s {project_name}{window_param}" ) } fn fmt_send_keys( f: &mut fmt::Formatter, command: &str, session_name: &str, window_index: usize, pane_index: Option<usize>, comment: Option<&str>, ) -> fmt::Result { let formatted_pane_index = pane_index.map_or("".into(), |idx| format!(".{idx}")); let comment = comment.map_or("".into(), |c| format!("\n# {c}\n")); let escaped = shell_escape::escape(command.into()); write!( f, "{comment}{TMUX_BIN} send-keys -t {session_name}:{window_index}{formatted_pane_index} {escaped} C-m" ) } fn get_cd_root_flag(project_root: &Option<String>) -> String { match project_root { Some(dir) => format!(" -c {dir}"), None => "".into(), } } fn fmt_new_window( f: &mut fmt::Formatter, session_name: &str, window_name: &str, window_index: usize, project_root: &Option<String>, ) -> fmt::Result { let cd_root = Commands::get_cd_root_flag(project_root); write!( f, "\n# Create \"{window_name}\" window \n{TMUX_BIN} new-window{cd_root} -t {session_name}:{window_index} -n {window_name}" ) } fn fmt_split_window( f: &mut fmt::Formatter, session_name: &str, window_index: usize, project_root: &Option<String>, ) -> Result<(), fmt::Error> { let cd_root = Commands::get_cd_root_flag(project_root); write!( f, "{TMUX_BIN} splitw{cd_root} -t {session_name}:{window_index}" ) } fn fmt_select_layout( f: &mut fmt::Formatter, session_name: &str, window_index: usize, layout: &str, ) -> Result<(), fmt::Error> { write!( f, "{TMUX_BIN} select-layout -t {session_name}:{window_index} {layout}" ) } fn fmt_select_window( f: &mut fmt::Formatter, session_name: &str, window_index: usize, ) -> Result<(), fmt::Error> { write!( f, "{TMUX_BIN} select-window -t {session_name}:{window_index}" ) } fn fmt_select_pane( f: &mut fmt::Formatter, session_name: &str, window_index: usize, pane_index: usize, ) -> Result<(), fmt::Error> { write!( f, "{TMUX_BIN} select-pane -t {session_name}:{window_index}.{pane_index}" ) } fn fmt_attach_session(f: &mut fmt::Formatter, session_name: &str) -> Result<(), fmt::Error> { write!( f, "\nif [ -z \"$TMUX\" ]; then\n {TMUX_BIN} -u attach-session -t {session_name}\n\ else\n {TMUX_BIN} -u switch-client -t {session_name}\nfi" ) } fn fmt_stop_session(f: &mut fmt::Formatter, session_name: &str) -> Result<(), fmt::Error> { write!(f, "{TMUX_BIN} kill-session -t {session_name}") } fn fmt_set_hook( f: &mut fmt::Formatter, session_name: &str, hook_name: &str, hook_command: &str, ) -> Result<(), fmt::Error> { write!( f, "{TMUX_BIN} set-hook -t {session_name} {hook_name} \"{hook_command}\"" ) } /// Runs the command, based on the enum values. pub fn run(&self) -> Result<(), TmuxError> { match self { Commands::Server { project_name: _, project_root, } => Commands::run_server_command(project_root), Commands::ProjectEvent { event_name: _, on_event, } => Commands::run_project_event(on_event), Commands::Session { project_name, first_window_name, } => Commands::run_session_command(project_name, first_window_name), Commands::SendKeys { command, session_name, window_index, pane_index, comment: _, } => Commands::run_send_keys(command, session_name, *window_index, pane_index), Commands::NewWindow { session_name, window_name, window_index, project_root, } => Commands::run_new_window(session_name, window_name, *window_index, project_root), Commands::SplitWindow { session_name, window_index, project_root, } => Commands::run_split_window(session_name, *window_index, project_root), Commands::SelectLayout { session_name, window_index, layout, } => Commands::run_select_layout(session_name, *window_index, layout), Commands::SelectWindow { session_name, window_index, } => Commands::run_select_window(session_name, *window_index), Commands::SelectPane { session_name, window_index, pane_index, } => Commands::run_select_pane(session_name, *window_index, *pane_index), Commands::AttachSession { session_name } => Commands::run_attach_session(session_name), Commands::StopSession { session_name } => Commands::run_stop_session(session_name), Commands::SetHook { session_name, hook_name, hook_command, } => Commands::run_set_hook(session_name, hook_name, hook_command), } } fn run_server_command(project_root: &'a Option<String>) -> Result<(), TmuxError> { Command::new(TMUX_BIN).arg("start-server").status()?; if let Some(root_dir) = project_root { set_current_dir(shellexpand::full(root_dir)?.as_ref())?; } Ok(()) } fn run_project_event(on_event: &Option<Vec<String>>) -> Result<(), TmuxError> { if let Some(commands) = on_event { for command in commands { let mut parts = Shlex::new(command); let cmd_opt = parts.next(); if let Some(cmd) = cmd_opt { let res = Command::new(cmd).args(parts.collect::<Vec<_>>()).status(); if res.is_err() { eprintln!("Error executing command {command}"); } } } } Ok(()) } fn run_session_command( project_name: &str, first_window_name: &Option<&str>, ) -> Result<(), TmuxError> { let mut session_args = vec!["new-session", "-d", "-s", project_name]; if let Some(name) = first_window_name { session_args.push("-n"); session_args.push(name); } let res = Command::new(TMUX_BIN) .env_remove("TMUX") .args(session_args) .status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message("Cannot start session".to_string())) } } fn run_send_keys( command: &String, session_name: &str, window_index: usize, pane_index: &Option<usize>, ) -> Result<(), TmuxError> { let target_name = if let Some(pane_idx) = pane_index { format!("{session_name}:{window_index}.{pane_idx}") } else { format!("{session_name}:{window_index}") }; let args = ["send-keys", "-t", &target_name, command, "C-m"]; let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot run send-keys for {command}" ))) } } fn run_new_window( session_name: &str, window_name: &str, window_index: usize, project_root: &Option<String>, ) -> Result<(), TmuxError> { let target_name = format!("{session_name}:{window_index}"); let expanded: String; let mut args = vec!["new-window", "-t", &target_name, "-n", window_name]; if let Some(root_dir) = project_root { args.push("-c"); expanded = shellexpand::full(root_dir)?.to_string(); args.push(&expanded); } let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot create window {window_name}" ))) } } fn run_split_window( session_name: &str, window_index: usize, project_root: &Option<String>, ) -> Result<(), TmuxError> { let target_name = format!("{session_name}:{window_index}"); let mut args = vec!["splitw", "-t", &target_name]; let expanded: String; if let Some(root_dir) = project_root { args.push("-c"); expanded = shellexpand::full(root_dir)?.to_string(); args.push(&expanded); } let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot split window {target_name}" ))) } } fn run_select_layout( session_name: &str, window_index: usize, layout: &str, ) -> Result<(), TmuxError> { let target_name = format!("{session_name}:{window_index}"); let args = vec!["select-layout", "-t", &target_name]; let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot select layout {layout} for window {target_name}" ))) } } fn run_select_window(session_name: &str, window_index: usize) -> Result<(), TmuxError> { let target_name = format!("{session_name}:{window_index}"); let args = vec!["select-window", "-t", &target_name]; let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot select window {target_name}" ))) } } fn run_select_pane( session_name: &str, window_index: usize, pane_index: usize, ) -> Result<(), TmuxError> { let target_name = format!("{session_name}:{window_index}.{pane_index}"); let args = vec!["select-pane", "-t", &target_name]; let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot select pane {target_name}" ))) } } fn run_attach_session(session_name: &str) -> Result<(), TmuxError> { let param = if env::var("TMUX").is_ok() { "switch-client" } else { "attach-session" }; let args = ["-u", param, "-t", session_name]; let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot {param} to session {session_name}" ))) } } fn run_stop_session(session_name: &str) -> Result<(), TmuxError> { let args = ["kill-session", "-t", session_name]; let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot kill session {session_name}" ))) } } fn run_set_hook( session_name: &str, hook_name: &str, hook_command: &str, ) -> Result<(), TmuxError> { let args = ["set-hook", "-t", session_name, hook_name, hook_command]; let res = Command::new(TMUX_BIN).args(args).status()?; if res.success() { Ok(()) } else { Err(TmuxError::Message(format!( "Cannot set {hook_name} hook for session {session_name}" ))) } } } impl<'a> fmt::Display for Commands<'a> { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { match self { Commands::Server { project_name, project_root, } => Commands::fmt_server_command(f, project_name, project_root), Commands::ProjectEvent { event_name, on_event, } => Commands::fmt_project_command(f, event_name, on_event), Commands::Session { project_name, first_window_name, } => Commands::fmt_session_command(f, project_name, *first_window_name), Commands::SendKeys { command, session_name, window_index, pane_index, comment, } => Commands::fmt_send_keys( f, command, session_name, *window_index, *pane_index, comment.as_ref().map(|x| &**x), ), Commands::NewWindow { session_name, window_name, window_index, project_root, } => { Commands::fmt_new_window(f, session_name, window_name, *window_index, project_root) } Commands::SplitWindow { session_name, window_index, project_root, } => Commands::fmt_split_window(f, session_name, *window_index, project_root), Commands::SelectLayout { session_name, window_index, layout, } => Commands::fmt_select_layout(f, session_name, *window_index, layout), Commands::SelectWindow { session_name, window_index, } => Commands::fmt_select_window(f, session_name, *window_index), Commands::SelectPane { session_name, window_index, pane_index, } => Commands::fmt_select_pane(f, session_name, *window_index, *pane_index), Commands::AttachSession { session_name } => { Commands::fmt_attach_session(f, session_name) } Commands::StopSession { session_name } => Commands::fmt_stop_session(f, session_name), Commands::SetHook { session_name, hook_name, hook_command, } => Commands::fmt_set_hook(f, session_name, hook_name, hook_command), } } }
use icell::{ typeid::{self, ICell}, write_all, }; #[test] fn create() { typeid::make!(type TestCreate); let owner = TestCreate::owner(); assert_eq!(std::mem::size_of_val(&owner), 0); } #[test] #[cfg(feature = "std")] // on `no_std` reentrant acquires block #[cfg_attr(miri, ignore)] #[should_panic = "attempted a reentrant acquire of a `Type<TestReentrant>`"] fn reentrant() { typeid::make!(type TestReentrant); let _owner = TestReentrant::owner(); assert!(TestReentrant::try_owner().is_none()); let _owner = TestReentrant::owner(); } typeid::make!(type Test); #[test] fn read() { let owner = Test::owner(); assert_eq!(std::mem::size_of_val(&owner), 0); let cell = ICell::new(0xdead_beef_u32); assert_eq!(*owner.read(&cell), 0xdead_beef); } #[test] fn write() { let mut owner = Test::owner(); assert_eq!(std::mem::size_of_val(&owner), 0); let cell = ICell::new(0xdead_beef_u32); let value = owner.write(&cell); *value = 0; assert_eq!(*owner.read(&cell), 0); } #[test] fn write_all() { let mut owner = Test::owner(); assert_eq!(std::mem::size_of_val(&owner), 0); let a = ICell::new(0xdead_beef_u32); let b = ICell::new(0xbeef_dead_u32); let c = ICell::new(0xdead_baaf_u32); let d = ICell::new(0xdeed_beef_u32); { let (a, b, c, d) = write_all!(owner => a, b, c, d); std::mem::swap(a, b); std::mem::swap(c, d); std::mem::swap(a, d); } let &a = owner.read(&a); let &b = owner.read(&b); let &c = owner.read(&c); let &d = owner.read(&d); assert_eq!(a, 0xdead_baaf); assert_eq!(b, 0xdead_beef); assert_eq!(c, 0xdeed_beef); assert_eq!(d, 0xbeef_dead); } #[test] fn read_from_fresh() { let owner = Test::owner(); assert_eq!(std::mem::size_of_val(&owner), 0); let cell = owner.cell::<u32>(0xdead_beef); drop(owner); let owner = Test::owner(); assert_eq!(*owner.read(&cell), 0xdead_beef); } #[test] fn from_rc() { use std::rc::Rc; let mut owner = Test::owner(); let a = Rc::new((ICell::new(0), ICell::new(1))); let b = a.clone(); owner.swap(&a.0, &b.1); drop(b); let (a, b) = Rc::try_unwrap(a).ok().unwrap(); assert_eq!(a.into_inner(), 1); assert_eq!(b.into_inner(), 0); }
use nalgebra; pub type Pose<F> = nalgebra::geometry::Isometry2<F>; pub type PoseCovariance<F> = nalgebra::base::Matrix3<F>; pub type Point<F> = nalgebra::geometry::Point2<F>; pub type PointCovariance<F> = nalgebra::base::Matrix2<F>; const GRID_OCCU: i8 = 1; const GRID_FREE: i8 = -1; const GRID_NONE: i8 = 0; #[inline(always)] pub const fn grid_occupied(x: i8) -> bool { x > GRID_NONE } #[inline(always)] pub const fn grid_mapped(x: i8) -> bool { x != GRID_NONE } #[inline(always)] pub const fn grid_freecell(x: i8) -> bool { x < GRID_NONE } pub type GridMap = nalgebra::DMatrix<i8>; pub type GridMapView<'a> = nalgebra::DMatrixSlice<'a, i8>; pub type GridMapViewMut<'a> = nalgebra::DMatrixSliceMut<'a, i8>; pub type PointCloud<F> = nalgebra::Matrix2xX<F>;
#![allow(non_camel_case_types)] #![allow(dead_code)] #![allow(missing_copy_implementations)] use std::ffi::CString; use cql_ffi::batch::CassBatch; use cql_ffi::future::CassFuture; use cql_ffi::future::ResultFuture; use cql_ffi::future::PreparedFuture; use cql_ffi::error::CassError; use cql_ffi::statement::CassStatement; use cql_ffi::schema::CassSchema; use cql_ffi::cluster::CassCluster; use cql_bindgen::CassFuture as _CassFuture; use cql_bindgen::cass_future_free; use cql_bindgen::cass_future_wait; use cql_bindgen::cass_future_error_code; use cql_bindgen::CassSession as _CassSession; use cql_bindgen::cass_session_new; use cql_bindgen::cass_session_free; use cql_bindgen::cass_session_close; use cql_bindgen::cass_session_connect; use cql_bindgen::cass_session_prepare; use cql_bindgen::cass_session_execute; use cql_bindgen::cass_session_execute_batch; use cql_bindgen::cass_session_get_schema; use cql_bindgen::cass_session_connect_keyspace; pub struct CassSession(pub *mut _CassSession); unsafe impl Sync for CassSession{} unsafe impl Send for CassSession{} impl Drop for CassSession { fn drop(&mut self) { unsafe { cass_session_free(self.0) } } } impl CassSession { pub fn new() -> CassSession { unsafe { CassSession(cass_session_new()) } } pub fn close(self) -> CassFuture { unsafe { CassFuture(cass_session_close(self.0)) } } pub fn connect(self, cluster: &CassCluster) -> SessionFuture { unsafe { SessionFuture(cass_session_connect(self.0, cluster.0), self) } } pub fn prepare(&self, query: &str) -> Result<PreparedFuture, CassError> { unsafe { let query = CString::new(query).unwrap(); Ok(PreparedFuture(cass_session_prepare(self.0, query.as_ptr()))) } } pub fn execute(&self, statement: &str, parameter_count: u64) -> ResultFuture { unsafe { ResultFuture(cass_session_execute(self.0, CassStatement::new(statement,parameter_count).0)) } } pub fn execute_statement(&self, statement: &CassStatement) -> ResultFuture { unsafe { ResultFuture(cass_session_execute(self.0, statement.0)) } } pub fn execute_batch(&self, batch: CassBatch) -> ResultFuture { ResultFuture(unsafe { cass_session_execute_batch(self.0, batch.0) }) } pub fn get_schema(&self) -> CassSchema { unsafe { CassSchema(cass_session_get_schema(self.0)) } } pub unsafe fn connect_keyspace(&self, cluster: CassCluster, keyspace: *const ::libc::c_char) -> CassFuture { CassFuture(cass_session_connect_keyspace(self.0, cluster.0, keyspace)) } } pub struct SessionFuture(pub *mut _CassFuture, pub CassSession); impl SessionFuture { pub fn wait(self) -> Result<CassSession, CassError> { unsafe { cass_future_wait(self.0); self.error_code() } } fn error_code(self) -> Result<CassSession, CassError> { unsafe { let code = cass_future_error_code(self.0); cass_future_free(self.0); CassError::build(code).wrap(self.1) } } }
// `error_chain!` can recurse deeply #![recursion_limit = "1024"] #[macro_use] extern crate error_chain; extern crate log; use clap::App; use clap::Arg; use clap::ArgMatches; use hackscanner_lib::*; use simplelog::TerminalMode; use std::env; use std::path::Path; mod ui; fn main() { if let Err(ref e) = run() { use error_chain::ChainedError; use std::io::Write; // trait which holds `display_chain` let stderr = &mut ::std::io::stderr(); let errmsg = "Error writing to stderr"; writeln!(stderr, "{}", e.display_chain()).expect(errmsg); ::std::process::exit(1); } } fn run() -> Result<(), Error> { let app = App::new("hackscanner") .version(env!("CARGO_PKG_VERSION")) .author("Daniel Corn <info@cundd.net>") .about("Scan the filesystem for hacked files") .arg(Arg::with_name("directory") .help("Search in this directory") .takes_value(true) .index(1)) .arg(Arg::with_name("v") .short("v") .multiple(true) .help(get_verbosity_help())) .arg(Arg::with_name("min-severity") .short("m") .takes_value(true) .help("Sets the minimum severity to display (CRITICAL, MAJOR, MINOR, NOTICE, ALL)")) .arg(Arg::with_name("quiet") .short("q") .long("quiet") .alias("silent") .help("Do not write to standard output if no violations > min-severity are found")) .arg(Arg::with_name("validate") .short("l") .long("validate") .takes_value(true) .value_name("test-path") .help("Check if the given test-path would create a violation (ignores if the path exists)")) ; #[cfg(any(feature = "json", feature = "yaml"))] let app = app.arg( Arg::with_name("configuration") .help("File with additional rules") .short("c") .long("configuration") .takes_value(true), ); let matches = app.get_matches(); configure_logging(&matches).unwrap(); #[cfg(not(any(feature = "json", feature = "yaml")))] let rules = get_merged_rules(None)?; #[cfg(any(feature = "json", feature = "yaml"))] let rules = get_merged_rules(match matches.value_of("configuration") { Some(c) => Some(Path::new(c)), None => None, })?; match matches.value_of("validate") { Some(test_path) => validate(&matches, rules, test_path), None => scan(&matches, rules), } } // Trace is only supported on debug-builds #[cfg(debug_assertions)] fn get_verbosity_help() -> &'static str { "Sets the level of verbosity (-v = Info, -vv = Debug, -vvv = Trace)" } #[cfg(not(debug_assertions))] fn get_verbosity_help() -> &'static str { "Sets the level of verbosity (-v = Info, -vv = Debug)" } fn scan(matches: &ArgMatches, rules: Vec<Rule>) -> Result<(), Error> { let min_severity = get_minimum_severity(matches); let root = get_root(matches); let quiet = matches.is_present("quiet"); let files = file_finder::find_files(root, &rules); let ratings = sort_ratings(&rating::rate_entries(&files, &rules)); let summary = Summary::build(&ratings); if !quiet || 0 < summary.ratings_above(min_severity) { ui::print_summary(min_severity, &summary); ui::print_ratings(min_severity, &ratings); } Ok(()) } fn validate(matches: &ArgMatches, rules: Vec<Rule>, test_path: &str) -> Result<(), Error> { let entry = ValidationDirEntry::from_path_str(test_path); if !entry.path().exists() { bail!(format!("File {} does not exist", entry.path().display())) } let rating = rate_entry(&entry, &rules); ui::print_validation(&rating, matches.occurrences_of("v") > 0); Ok(()) } fn get_root(matches: &ArgMatches<'_>) -> String { match matches.value_of("directory") { Some(d) => d.to_owned(), None => String::from(env::current_dir().unwrap().to_string_lossy()), } } fn get_minimum_severity(matches: &ArgMatches<'_>) -> Severity { let min_severity = matches.value_of("min-severity"); if min_severity.is_none() { return Severity::NOTICE; } match min_severity.unwrap().to_uppercase().as_ref() { "CRITICAL" => Severity::CRITICAL, "MAJOR" => Severity::MAJOR, "MINOR" => Severity::MINOR, "NOTICE" => Severity::NOTICE, _ => Severity::WHITELIST, } } /// Read the `Rule`s from the given path and merge them with the builtin rules fn get_merged_rules(path: Option<&Path>) -> Result<Vec<Rule>, Error> { match path { Some(p) => hackscanner_lib::get_merged_rules(p), None => Ok(hackscanner_lib::get_builtin_rules()), } } fn configure_logging(matches: &ArgMatches<'_>) -> Result<(), Error> { let log_level_filter = match matches.occurrences_of("v") { 1 => simplelog::LevelFilter::Info, 2 => simplelog::LevelFilter::Debug, 3 => simplelog::LevelFilter::Trace, _ => simplelog::LevelFilter::Warn, }; let mut loggers: Vec<Box<dyn simplelog::SharedLogger>> = vec![]; // let mut config = simplelog::Config::default(); // config.time_format = Some("%H:%M:%S%.3f"); let config = simplelog::Config { time_format: Some("%H:%M:%S%.3f"), ..Default::default() }; if let Some(core_logger) = simplelog::TermLogger::new(log_level_filter, config, TerminalMode::Mixed) { loggers.push(core_logger); } else { loggers.push(simplelog::SimpleLogger::new(log_level_filter, config)); } match simplelog::CombinedLogger::init(loggers) { Ok(_) => Ok(()), Err(e) => bail!(format!("{}", e)), } }
use std::collections::HashMap; use crossterm::event::Event; use irust_api::{Command, GlobalVariables}; use super::Script; const SCRIPT_CONFIG_NAME: &str = "script.toml"; pub struct ScriptManager { sm: rscript::ScriptManager, startup_cmds: Vec<Result<Option<Command>, rscript::Error>>, } macro_rules! mtry { ($e: expr) => { (|| -> Result<_, Box<dyn std::error::Error>> { Ok($e) })() }; } impl ScriptManager { pub fn new() -> Option<Self> { let mut sm = rscript::ScriptManager::default(); let script_path = dirs::config_dir()?.join("irust").join("script"); sm.add_scripts_by_path( &script_path, rscript::Version::parse(crate::args::VERSION).expect("correct version"), ) .ok()?; unsafe { sm.add_dynamic_scripts_by_path( script_path, rscript::Version::parse(crate::args::VERSION).expect("correct version"), ) .ok()?; } // read conf if available let script_conf_path = dirs::config_dir()?.join("irust").join(SCRIPT_CONFIG_NAME); // ignore any error that happens while trying to read conf // If an error happens, a new configuration will be written anyway when ScriptManager is // dropped let mut startup_cmds = vec![]; if let Ok(script_state) = mtry!(toml::from_str(&std::fs::read_to_string(script_conf_path)?)?) { // type inference let script_state: HashMap<String, bool> = script_state; sm.scripts_mut().iter_mut().for_each(|script| { let script_name = &script.metadata().name; if let Some(state) = script_state.get(script_name) { if *state { script.activate(); // Trigger startup hook, in case the script needs to be aware of it if script.is_listening_for::<irust_api::Startup>() { startup_cmds.push(script.trigger(&irust_api::Startup())); } } else { script.deactivate(); } } }) } Some(ScriptManager { sm, startup_cmds }) } } impl Drop for ScriptManager { fn drop(&mut self) { let mut script_state = HashMap::new(); for script in self.sm.scripts() { script_state.insert(script.metadata().name.clone(), script.is_active()); } // Ignore errors on drop let _ = mtry!({ let script_conf_path = dirs::config_dir() .ok_or("could not find config directory")? .join("irust") .join(SCRIPT_CONFIG_NAME); std::fs::write(script_conf_path, toml::to_string(&script_state)?) }); } } /* NOTE: Toml: serilizing tuple struct is not working? #[derive(Serialize, Deserialize, Debug)] struct ScriptState(HashMap<String, bool>); */ impl Script for ScriptManager { fn input_prompt(&mut self, global_variables: &GlobalVariables) -> Option<String> { self.sm .trigger(irust_api::SetInputPrompt(global_variables.clone())) .next()? .ok() } fn get_output_prompt(&mut self, global_variables: &GlobalVariables) -> Option<String> { self.sm .trigger(irust_api::SetOutputPrompt(global_variables.clone())) .next()? .ok() } fn before_compiling(&mut self, global_variables: &GlobalVariables) -> Option<()> { self.sm .trigger(irust_api::BeforeCompiling(global_variables.clone())) .collect::<Result<_, _>>() .ok() } fn after_compiling(&mut self, global_variables: &GlobalVariables) -> Option<()> { self.sm .trigger(irust_api::AfterCompiling(global_variables.clone())) .collect::<Result<_, _>>() .ok() } fn input_event_hook( &mut self, global_variables: &GlobalVariables, event: Event, ) -> Option<Command> { self.sm .trigger(irust_api::InputEvent(global_variables.clone(), event)) .next()? .ok()? } fn output_event_hook( &mut self, input: &str, global_variables: &GlobalVariables, ) -> Option<Command> { self.sm .trigger(irust_api::OutputEvent( global_variables.clone(), input.to_string(), )) .next()? .ok()? } fn trigger_set_title_hook(&mut self) -> Option<String> { self.sm.trigger(irust_api::SetTitle()).next()?.ok()? } fn trigger_set_msg_hook(&mut self) -> Option<String> { self.sm.trigger(irust_api::SetWelcomeMsg()).next()?.ok()? } fn list(&self) -> Option<String> { let mut scripts: Vec<String> = self .sm .scripts() .iter() .map(|script| { let meta = script.metadata(); format!( "{}\t{:?}\t{:?}\t{}", &meta.name, &meta.script_type, &meta.hooks, script.is_active() ) }) .collect(); //header scripts.insert(0, "Name\tScriptType\tHooks\tState".into()); Some(scripts.join("\n")) } fn activate(&mut self, script_name: &str) -> Result<Option<Command>, &'static str> { if let Some(script) = self .sm .scripts_mut() .iter_mut() .find(|script| script.metadata().name == script_name) { script.activate(); // We send a startup message in case the script is listening for one if let Ok(maybe_command) = script.trigger(&irust_api::Startup()) { Ok(maybe_command) } else { Ok(None) } } else { Err("Script not found") } } fn deactivate(&mut self, script_name: &str) -> Result<Option<Command>, &'static str> { if let Some(script) = self .sm .scripts_mut() .iter_mut() .find(|script| script.metadata().name == script_name) { script.deactivate(); // We send a shutdown message in case the script is listening for one if let Ok(maybe_command) = script.trigger(&irust_api::Shutdown()) { Ok(maybe_command) } else { Ok(None) } } else { Err("Script not found") } } fn startup_cmds(&mut self) -> Vec<Result<Option<Command>, rscript::Error>> { self.startup_cmds.drain(..).collect() } fn shutdown_cmds(&mut self) -> Vec<Result<Option<Command>, rscript::Error>> { self.sm .scripts_mut() .iter_mut() .filter(|script| script.is_listening_for::<irust_api::Shutdown>()) .map(|script| script.trigger(&irust_api::Shutdown())) .collect() } }
//! Группа унификации плит или фундаментных плит use crate::sig::rab_e::*; use crate::sig::HasWrite; use nom::{bytes::complete::take, multi::count, number::complete::le_u16, IResult}; use std::fmt; #[derive(Debug)] pub struct UnificationSlab { unification_group: u16, //Номер группы унификаций amount: u16, //Количество элементов в группе унификаций //40b WS elements: Vec<u16>, //Вектор номеров элементов в группе ws: Vec<u8>, //40b } impl HasWrite for UnificationSlab { fn write(&self) -> Vec<u8> { let mut out: Vec<u8> = vec![]; out.extend(&self.unification_group.to_le_bytes()); out.extend(&self.amount.to_le_bytes()); out.extend(&self.ws[0..40]); for i in &self.elements { out.extend(&i.to_le_bytes()); } out } fn name(&self) -> &str { "" } } impl fmt::Display for UnificationSlab { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!( f, "group: {}, amount: {}", &self.unification_group, &self.amount ) } } pub fn read_unification_slab(i: &[u8]) -> IResult<&[u8], UnificationSlab> { let (i, unification_group) = le_u16(i)?; let (i, amount) = le_u16(i)?; let (i, ws) = take(40u8)(i)?; //40b WS let (i, elements) = count(le_u16, amount as usize)(i)?; let ws = ws.to_vec(); Ok(( i, UnificationSlab { unification_group, amount, elements, ws, }, )) } #[cfg(test)] fn test_unification_slab(path_str: &str) { use crate::tests::rab_e_sig_test::read_test_sig; let original_in = read_test_sig(path_str); let (_, unification) = read_unification_slab(&original_in).expect("couldn't read_unification_slab"); assert_eq!(original_in, unification.write()); } #[test] fn unification_test() { test_unification_slab("test_sig/unification_slabs/uni.test"); } #[test] fn unification_11el_test() { test_unification_slab("test_sig/unification_slabs/uni_11el.test"); } #[test] fn s_unification_slab_full_value_test() { use crate::tests::rab_e_sig_test::read_test_sig; let original_in = read_test_sig("test_sig/unification_slabs/S_uni.test"); let (_, unification) = read_unification_slab(&original_in).expect("couldn't read_unification_slab"); let mut ws = vec![]; for i in 1..=40 { ws.push(i); } let c_unification = UnificationSlab { unification_group: 1u16, amount: 2u16, elements: vec![0u16, 1u16], ws, }; assert_eq!(unification.write(), c_unification.write()) }
//= { //= "output": { //= "2": [ //= "thread 'main' panicked at 'qwertyuiop', tests/a\\.rs:[0-9]+:[0-9]+\n", //= true //= ], //= "1": [ //= "", //= true //= ] //= }, //= "children": [], //= "exit": { //= "Error": { //= "Unix": { //= "Signal": "SIGABRT" //= } //= } //= } //= } #![deny(warnings, deprecated)] extern crate constellation; extern crate nix; use constellation::*; use std::{panic, process, thread}; fn main() { init(Resources { mem: 20 * 1024 * 1024, ..Resources::default() }); panic::set_hook(Box::new(|info| { eprintln!("thread '{}' {}", thread::current().name().unwrap(), info); let err = unsafe { nix::libc::setrlimit( nix::libc::RLIMIT_CORE, &nix::libc::rlimit { rlim_cur: 0, rlim_max: 0, }, ) }; assert_eq!(err, 0); process::abort() })); panic!("qwertyuiop"); }
use oxygengine_composite_renderer::{ component::{ CompositeCamera, CompositeCameraAlignment, CompositeRenderAlpha, CompositeRenderLayer, CompositeRenderable, CompositeScalingMode, CompositeScalingTarget, CompositeTransform, CompositeUiElement, CompositeVisibility, UiElementType, UiImage, UiMargin, }, composite_renderer::{Command, Image, Renderable, Text}, math::{Color, Mat2d, Vec2}, resource::{CompositeCameraCache, CompositeUiInteractibles}, }; use oxygengine_core::{ app::AppBuilder, assets::{ asset::AssetId, database::AssetsDatabase, protocol::{AssetLoadResult, AssetProtocol}, }, ecs::{ world::{Builder, EntitiesRes}, Component, Entity, Join, LazyUpdate, Read, ReadExpect, System, VecStorage, Write, WriteStorage, }, hierarchy::{Name, Tag}, prefab::{Prefab, PrefabError, PrefabManager, PrefabProxy}, state::StateToken, Ignite, Scalar, }; use oxygengine_input::resource::InputController; use oxygengine_visual_novel::resource::VnStoryManager; use serde::{Deserialize, Serialize}; #[cfg(not(feature = "scalar64"))] use std::f32::consts::PI; #[cfg(feature = "scalar64")] use std::f64::consts::PI; use std::{collections::HashMap, str::from_utf8}; pub mod prelude { pub use crate::*; } pub fn bundle_installer(builder: &mut AppBuilder, _: ()) { builder.install_resource(VnRenderingManager::default()); builder.install_system( ApplyVisualNovelToCompositeRenderer::default(), "apply-visual-novel-to-composite-renderer", &["vn-story"], ); } pub fn protocols_installer(database: &mut AssetsDatabase) { database.register(VnRenderingConfigAssetProtocol); } pub fn prefabs_installer(prefabs: &mut PrefabManager) { prefabs.register_component_factory_proxy::<PositionCameraAlignment, PositionCameraAlignmentPrefabProxy>("PositionCameraAlignment"); } #[derive(Ignite, Debug, Clone, Serialize, Deserialize)] pub enum VnRenderingOverlayStyle { Color(Color), Image(String), } impl Default for VnRenderingOverlayStyle { fn default() -> Self { Self::Color(Color::black()) } } #[derive(Ignite, Debug, Clone, Serialize, Deserialize)] pub struct VnRenderingConfig { #[serde(default = "VnRenderingConfig::default_background_camera_scaling_target")] pub background_camera_scaling_target: CompositeScalingTarget, #[serde(default = "VnRenderingConfig::default_background_camera_resolution")] pub background_camera_resolution: Scalar, #[serde(default = "VnRenderingConfig::default_background_camera_layer")] pub background_camera_layer: usize, #[serde(default = "VnRenderingConfig::default_characters_camera_scaling_target")] pub characters_camera_scaling_target: CompositeScalingTarget, #[serde(default = "VnRenderingConfig::default_characters_camera_resolution")] pub characters_camera_resolution: Scalar, #[serde(default = "VnRenderingConfig::default_characters_camera_layer")] pub characters_camera_layer: usize, #[serde(default = "VnRenderingConfig::default_ui_camera_scaling_target")] pub ui_camera_scaling_target: CompositeScalingTarget, #[serde(default = "VnRenderingConfig::default_ui_camera_resolution")] pub ui_camera_resolution: Scalar, #[serde(default = "VnRenderingConfig::default_ui_camera_layer")] pub ui_camera_layer: usize, #[serde(default)] pub overlay_style: VnRenderingOverlayStyle, #[serde(default)] pub hide_on_story_pause: bool, #[serde(default)] pub ui_component_template: Option<CompositeUiElement>, #[serde(default)] pub ui_dialogue_option_component_template: Option<CompositeUiElement>, #[serde(default = "VnRenderingConfig::default_ui_dialogue_default_theme")] pub ui_dialogue_default_theme: Option<String>, #[serde(default = "VnRenderingConfig::default_ui_dialogue_panel_path")] pub ui_dialogue_panel_path: String, #[serde(default = "VnRenderingConfig::default_ui_dialogue_text_path")] pub ui_dialogue_text_path: String, #[serde(default = "VnRenderingConfig::default_ui_dialogue_name_path")] pub ui_dialogue_name_path: String, #[serde(default = "VnRenderingConfig::default_ui_dialogue_skip_path")] pub ui_dialogue_skip_path: String, #[serde(default = "VnRenderingConfig::default_ui_dialogue_options_path")] pub ui_dialogue_options_path: String, #[serde(default = "VnRenderingConfig::default_ui_dialogue_option_text_path")] pub ui_dialogue_option_text_path: String, #[serde(default = "VnRenderingConfig::default_ui_dialogue_option_button_path")] pub ui_dialogue_option_button_path: String, #[serde(default = "VnRenderingConfig::default_ui_dialogue_default_name_color")] pub ui_dialogue_default_name_color: Color, #[serde(default = "VnRenderingConfig::default_input_pointer_trigger")] pub input_pointer_trigger: String, #[serde(default = "VnRenderingConfig::default_input_pointer_axis_x")] pub input_pointer_axis_x: String, #[serde(default = "VnRenderingConfig::default_input_pointer_axis_y")] pub input_pointer_axis_y: String, #[serde(default)] pub pointer_image: Option<String>, #[serde(default)] pub pointer_align: Vec2, #[serde(default = "VnRenderingConfig::default_forced_constant_refresh")] pub forced_constant_refresh: bool, } impl Default for VnRenderingConfig { fn default() -> Self { Self { background_camera_scaling_target: Self::default_background_camera_scaling_target(), background_camera_resolution: 1080.0, background_camera_layer: 1000, characters_camera_scaling_target: Self::default_characters_camera_scaling_target(), characters_camera_resolution: Self::default_characters_camera_resolution(), characters_camera_layer: Self::default_characters_camera_layer(), ui_camera_scaling_target: Self::default_ui_camera_scaling_target(), ui_camera_resolution: Self::default_ui_camera_resolution(), ui_camera_layer: Self::default_ui_camera_layer(), overlay_style: Default::default(), hide_on_story_pause: false, ui_component_template: None, ui_dialogue_option_component_template: None, ui_dialogue_default_theme: Self::default_ui_dialogue_default_theme(), ui_dialogue_panel_path: Self::default_ui_dialogue_panel_path(), ui_dialogue_text_path: Self::default_ui_dialogue_text_path(), ui_dialogue_name_path: Self::default_ui_dialogue_name_path(), ui_dialogue_skip_path: Self::default_ui_dialogue_skip_path(), ui_dialogue_options_path: Self::default_ui_dialogue_options_path(), ui_dialogue_option_text_path: Self::default_ui_dialogue_option_text_path(), ui_dialogue_option_button_path: Self::default_ui_dialogue_option_button_path(), ui_dialogue_default_name_color: Self::default_ui_dialogue_default_name_color(), input_pointer_trigger: Self::default_input_pointer_trigger(), input_pointer_axis_x: Self::default_input_pointer_axis_x(), input_pointer_axis_y: Self::default_input_pointer_axis_y(), pointer_image: None, pointer_align: Default::default(), forced_constant_refresh: Self::default_forced_constant_refresh(), } } } impl VnRenderingConfig { fn default_background_camera_scaling_target() -> CompositeScalingTarget { CompositeScalingTarget::BothMinimum } fn default_background_camera_resolution() -> Scalar { 1080.0 } fn default_background_camera_layer() -> usize { 1000 } fn default_characters_camera_scaling_target() -> CompositeScalingTarget { CompositeScalingTarget::Height } fn default_characters_camera_resolution() -> Scalar { 1080.0 } fn default_characters_camera_layer() -> usize { 1001 } fn default_ui_camera_scaling_target() -> CompositeScalingTarget { CompositeScalingTarget::Both } fn default_ui_camera_resolution() -> Scalar { 1080.0 } fn default_ui_camera_layer() -> usize { 1002 } #[allow(clippy::unnecessary_wraps)] fn default_ui_dialogue_default_theme() -> Option<String> { Some("default".to_owned()) } fn default_ui_dialogue_panel_path() -> String { "panel".to_owned() } fn default_ui_dialogue_text_path() -> String { "panel/text".to_owned() } fn default_ui_dialogue_name_path() -> String { "panel/name".to_owned() } fn default_ui_dialogue_skip_path() -> String { "panel/skip".to_owned() } fn default_ui_dialogue_options_path() -> String { "panel/options".to_owned() } fn default_ui_dialogue_option_text_path() -> String { "button/text".to_owned() } fn default_ui_dialogue_option_button_path() -> String { "button".to_owned() } fn default_ui_dialogue_default_name_color() -> Color { Color::white() } fn default_input_pointer_trigger() -> String { "mouse-left".to_owned() } fn default_input_pointer_axis_x() -> String { "mouse-x".to_owned() } fn default_input_pointer_axis_y() -> String { "mouse-y".to_owned() } fn default_forced_constant_refresh() -> bool { true } } impl Prefab for VnRenderingConfig {} pub struct VnRenderingConfigAsset(VnRenderingConfig); impl VnRenderingConfigAsset { pub fn config(&self) -> &VnRenderingConfig { &self.0 } } pub struct VnRenderingConfigAssetProtocol; impl AssetProtocol for VnRenderingConfigAssetProtocol { fn name(&self) -> &str { "vn-rendering" } fn on_load(&mut self, data: Vec<u8>) -> AssetLoadResult { let data = from_utf8(&data).unwrap(); match VnRenderingConfig::from_prefab_str(&data) { Ok(result) => AssetLoadResult::Data(Box::new(VnRenderingConfigAsset(result))), Err(error) => AssetLoadResult::Error(format!( "Error loading visual novel rendering config asset: {:?}", error )), } } } #[derive(Debug, Clone)] pub struct VnStoryRenderer { background_camera: Entity, characters_camera: Entity, ui_camera: Entity, characters: HashMap<String, Entity>, background: Entity, dialogue_ui_element: Entity, dialogue_option_template: CompositeUiElement, overlay: Entity, pointer: Option<Entity>, } #[derive(Debug, Clone)] pub enum VnRenderingManagerError { RenderingConfigNotFound(String), } #[derive(Debug, Default, Clone)] pub struct VnRenderingManager { configs: HashMap<String, VnRenderingConfig>, stories: HashMap<String, VnStoryRenderer>, active_config: VnRenderingConfig, dirty_config: bool, } impl VnRenderingManager { pub fn config(&self) -> &VnRenderingConfig { &self.active_config } pub fn register_config(&mut self, name: &str, config: VnRenderingConfig) { self.configs.insert(name.to_owned(), config); } pub fn unregister_config(&mut self, name: &str) -> Option<VnRenderingConfig> { self.configs.remove(name) } pub fn select_config(&mut self, name: &str) -> Result<(), VnRenderingManagerError> { if let Some(config) = self.configs.get(name) { self.active_config = config.clone(); self.dirty_config = true; Ok(()) } else { Err(VnRenderingManagerError::RenderingConfigNotFound( name.to_owned(), )) } } pub fn use_default_config(&mut self) { self.active_config = Default::default(); self.dirty_config = true; } } #[derive(Ignite, Debug, Clone, Copy)] pub struct PositionCameraAlignment(pub Entity, pub Vec2); impl Component for PositionCameraAlignment { type Storage = VecStorage<Self>; } impl PrefabProxy<PositionCameraAlignmentPrefabProxy> for PositionCameraAlignment { fn from_proxy_with_extras( proxy: PositionCameraAlignmentPrefabProxy, named_entities: &HashMap<String, Entity>, _: StateToken, ) -> Result<Self, PrefabError> { if let Some(entity) = named_entities.get(&proxy.0) { Ok(Self(*entity, proxy.1)) } else { Err(PrefabError::Custom(format!( "Could not find entity named: {}", proxy.0 ))) } } } #[derive(Debug, Default, Serialize, Deserialize)] pub struct PositionCameraAlignmentPrefabProxy(String, Vec2); impl Prefab for PositionCameraAlignmentPrefabProxy {} #[derive(Debug, Default)] pub struct ApplyVisualNovelToCompositeRenderer { config_table: HashMap<AssetId, String>, dialogue_options_focus_phases: Vec<Scalar>, } impl<'s> System<'s> for ApplyVisualNovelToCompositeRenderer { #[allow(clippy::type_complexity)] type SystemData = ( Read<'s, EntitiesRes>, Read<'s, LazyUpdate>, ReadExpect<'s, AssetsDatabase>, Write<'s, VnStoryManager>, Read<'s, CompositeCameraCache>, Read<'s, CompositeUiInteractibles>, Read<'s, InputController>, Write<'s, VnRenderingManager>, WriteStorage<'s, CompositeRenderable>, WriteStorage<'s, CompositeVisibility>, WriteStorage<'s, CompositeRenderAlpha>, WriteStorage<'s, CompositeTransform>, WriteStorage<'s, PositionCameraAlignment>, WriteStorage<'s, CompositeUiElement>, ); // TODO: REFACTOR THIS SHIT #[allow(clippy::cognitive_complexity)] #[allow(clippy::many_single_char_names)] fn run( &mut self, ( entities, lazy_update, assets, mut stories, camera_cache, interactibles, input, mut rendering, mut renderables, mut visibilities, mut alphas, mut transforms, mut alignments, mut ui_elements, ): Self::SystemData, ) { for id in assets.lately_unloaded_protocol("vn-rendering") { if let Some(path) = self.config_table.remove(id) { rendering.unregister_config(&path); } } for id in assets.lately_loaded_protocol("vn-rendering") { let id = *id; let asset = assets .asset_by_id(id) .expect("trying to use not loaded visual novel rendering config asset"); let path = asset.path().to_owned(); let asset = asset .get::<VnRenderingConfigAsset>() .expect("trying to use non visual novel rendering config asset"); let config = asset.config().clone(); rendering.register_config(&path, config); self.config_table.insert(id, path); } let config_changed = rendering.dirty_config; rendering.dirty_config = false; let to_remove = if config_changed { stories.stories_names().collect::<Vec<_>>() } else { stories.lately_unregistered().collect::<Vec<_>>() }; for id in to_remove { if let Some(story) = rendering.stories.remove(id) { drop(entities.delete(story.background_camera)); drop(entities.delete(story.characters_camera)); drop(entities.delete(story.ui_camera)); for entity in story.characters.values() { drop(entities.delete(*entity)); } drop(entities.delete(story.background)); drop(entities.delete(story.dialogue_ui_element)); drop(entities.delete(story.overlay)); if let Some(pointer) = story.pointer { drop(entities.delete(pointer)); } } } let to_add = if config_changed { stories.stories_names().collect::<Vec<_>>() } else { stories.lately_registered().collect::<Vec<_>>() }; for id in to_add { if let Some(story) = stories.get(id) { let background_camera = lazy_update .create_entity(&entities) .with(Name(format!("vn-camera-background-{}", id).into())) .with( CompositeCamera::with_scaling_target( CompositeScalingMode::CenterAspect, rendering.config().background_camera_scaling_target, ) .tag(format!("vn-background-{}", id).into()), ) .with(CompositeVisibility(false)) .with(CompositeRenderLayer( rendering.config().background_camera_layer, )) .with(CompositeTransform::scale( rendering.config().background_camera_resolution.into(), )) .build(); let characters_camera = lazy_update .create_entity(&entities) .with(Name(format!("vn-camera-characters-{}", id).into())) .with( CompositeCamera::with_scaling_target( CompositeScalingMode::CenterAspect, rendering.config().characters_camera_scaling_target, ) .tag(format!("vn-characters-{}", id).into()), ) .with(CompositeVisibility(false)) .with(CompositeRenderLayer( rendering.config().characters_camera_layer, )) .with(CompositeTransform::scale( rendering.config().characters_camera_resolution.into(), )) .build(); let ui_camera = lazy_update .create_entity(&entities) .with(Name(format!("vn-camera-ui-{}", id).into())) .with( CompositeCamera::with_scaling_target( CompositeScalingMode::Aspect, rendering.config().ui_camera_scaling_target, ) .tag(format!("vn-ui-{}", id).into()), ) .with(CompositeVisibility(false)) .with(CompositeRenderLayer(rendering.config().ui_camera_layer)) .with(CompositeTransform::scale( rendering.config().ui_camera_resolution.into(), )) .build(); let characters = story .characters() .map(|(n, _)| { let entity = lazy_update .create_entity(&entities) .with(Tag(format!("vn-characters-{}", id).into())) .with(Name(format!("vn-character-{}-{}", id, n).into())) .with(CompositeRenderAlpha(0.0)) .with(CompositeRenderLayer(1)) .with(CompositeRenderable(().into())) .with(PositionCameraAlignment(characters_camera, 0.0.into())) .with(CompositeTransform::default()) .build(); (n.to_owned(), entity) }) .collect::<HashMap<_, _>>(); let background = lazy_update .create_entity(&entities) .with(Tag(format!("vn-background-{}", id).into())) .with(Name(format!("vn-background-{}", id).into())) .with(CompositeRenderable(().into())) .with(CompositeTransform::default()) .build(); let ui_element = if let Some(mut component) = rendering.config().ui_component_template.clone() { component.camera_name = format!("vn-camera-ui-{}", id).into(); if let Some(child) = component.find_mut(&rendering.config().ui_dialogue_panel_path) { child.interactive = Some(format!("vn-ui-panel-{}", id).into()); } if let Some(child) = component.find_mut(&rendering.config().ui_dialogue_text_path) { child.interactive = Some(format!("vn-ui-text-{}", id).into()); } if let Some(child) = component.find_mut(&rendering.config().ui_dialogue_name_path) { child.interactive = Some(format!("vn-ui-name-{}", id).into()); } if let Some(child) = component.find_mut(&rendering.config().ui_dialogue_skip_path) { child.interactive = Some(format!("vn-ui-skip-{}", id).into()); } component } else { let mut text = CompositeUiElement::default(); text.id = Some("text".into()); text.theme = rendering .config() .ui_dialogue_default_theme .as_ref() .map(|theme| format!("{}@text", theme).into()); text.interactive = Some(format!("vn-ui-text-{}", id).into()); text.element_type = UiElementType::Text( Text::new_owned("Verdana".to_owned(), "".to_owned()) .size(48.0) .color(Color::white()), ); text.padding = UiMargin { left: 64.0, right: 64.0, top: 64.0, bottom: 0.0, }; text.left_anchor = 0.0.into(); text.right_anchor = 1.0.into(); text.top_anchor = 0.0.into(); text.bottom_anchor = 1.0.into(); let mut name = CompositeUiElement::default(); name.id = Some("name".into()); name.theme = rendering .config() .ui_dialogue_default_theme .as_ref() .map(|theme| format!("{}@name", theme).into()); name.element_type = UiElementType::Text( Text::new_owned("Verdana".to_owned(), "".to_owned()) .size(32.0) .color(Color::white()), ); name.interactive = Some(format!("vn-ui-name-{}", id).into()); name.padding = UiMargin { left: 32.0, right: 32.0, top: 32.0, bottom: 0.0, }; name.left_anchor = 0.0.into(); name.right_anchor = 1.0.into(); name.top_anchor = 0.0.into(); name.bottom_anchor = 0.0.into(); name.alignment = (0.0.into(), 0.0.into()).into(); name.fixed_height = Some(64.0.into()); let mut options = CompositeUiElement::default(); options.id = Some("options".into()); options.element_type = UiElementType::None; options.left_anchor = 0.0.into(); options.right_anchor = 1.0.into(); options.top_anchor = 0.0.into(); options.bottom_anchor = 0.0.into(); options.alignment = (0.0.into(), 1.0.into()).into(); let mut panel = CompositeUiElement::default(); panel.id = Some("panel".into()); panel.theme = rendering .config() .ui_dialogue_default_theme .as_ref() .map(|theme| format!("{}@panel", theme).into()); panel.interactive = Some(format!("vn-ui-panel-{}", id).into()); panel.element_type = UiElementType::Image(Box::new(UiImage::default())); panel.padding = UiMargin { left: 128.0, right: 128.0, top: 0.0, bottom: 32.0, }; panel.left_anchor = 0.0.into(); panel.right_anchor = 1.0.into(); panel.top_anchor = 1.0.into(); panel.bottom_anchor = 1.0.into(); panel.alignment = (0.0.into(), 1.0.into()).into(); panel.fixed_height = Some(256.0.into()); panel.children = vec![text, name, options]; let mut root = CompositeUiElement::default(); root.camera_name = format!("vn-camera-ui-{}", id).into(); root.element_type = UiElementType::None; root.left_anchor = 0.0.into(); root.right_anchor = 1.0.into(); root.top_anchor = 0.0.into(); root.bottom_anchor = 1.0.into(); root.children = vec![panel]; root }; let dialogue_ui_element = lazy_update .create_entity(&entities) .with(Tag(format!("vn-ui-{}", id).into())) .with(Name(format!("vn-dialogue-{}", id).into())) .with(CompositeRenderAlpha(0.0)) .with(CompositeRenderable(().into())) .with(ui_element) .with(CompositeTransform::default()) .build(); let dialogue_option_template = if let Some(mut component) = rendering .config() .ui_dialogue_option_component_template .clone() { component.left_anchor = 0.0.into(); component.right_anchor = 1.0.into(); component.top_anchor = 0.0.into(); component.bottom_anchor = 0.0.into(); component.alignment = (0.0.into(), 0.0.into()).into(); component } else { let mut text = CompositeUiElement::default(); text.id = Some("text".into()); text.theme = rendering .config() .ui_dialogue_default_theme .as_ref() .map(|theme| format!("{}@option-text", theme).into()); text.element_type = UiElementType::Text( Text::new_owned("Verdana".to_owned(), "".to_owned()) .size(28.0) .color(Color::white()), ); text.padding = UiMargin { left: 32.0, right: 32.0, top: 8.0, bottom: 0.0, }; text.left_anchor = 0.0.into(); text.right_anchor = 1.0.into(); text.top_anchor = 0.0.into(); text.bottom_anchor = 1.0.into(); let mut background = CompositeUiElement::default(); background.theme = rendering .config() .ui_dialogue_default_theme .as_ref() .map(|theme| format!("{}@option-background", theme).into()); background.element_type = UiElementType::Image(Box::new(UiImage::default())); background.left_anchor = 0.0.into(); background.right_anchor = 1.0.into(); background.top_anchor = 0.0.into(); background.bottom_anchor = 1.0.into(); let mut background_focused = CompositeUiElement::default(); background_focused.theme = rendering .config() .ui_dialogue_default_theme .as_ref() .map(|theme| format!("{}@option-background-focused", theme).into()); background_focused.element_type = UiElementType::Image(Box::new(UiImage::default())); background_focused.left_anchor = 0.0.into(); background_focused.right_anchor = 1.0.into(); background_focused.top_anchor = 0.0.into(); background_focused.bottom_anchor = 1.0.into(); let mut button = CompositeUiElement::default(); button.id = Some("button".into()); button.element_type = UiElementType::None; button.left_anchor = 0.0.into(); button.right_anchor = 1.0.into(); button.top_anchor = 0.0.into(); button.bottom_anchor = 1.0.into(); button.children = vec![background, background_focused, text]; let mut root = CompositeUiElement::default(); root.camera_name = format!("vn-camera-ui-{}", id).into(); root.element_type = UiElementType::None; root.padding = UiMargin { left: 256.0, right: 64.0, top: 0.0, bottom: 8.0, }; root.left_anchor = 0.0.into(); root.right_anchor = 1.0.into(); root.top_anchor = 0.0.into(); root.bottom_anchor = 0.0.into(); root.fixed_height = Some(48.0.into()); root.children = vec![button]; root }; let overlay_renderable = match &rendering.config().overlay_style { VnRenderingOverlayStyle::Color(color) => { Renderable::FullscreenRectangle(*color) } VnRenderingOverlayStyle::Image(image) => { Image::new_owned(image.to_owned()).align(0.5.into()).into() } }; let overlay = lazy_update .create_entity(&entities) .with(Tag(format!("vn-ui-{}", id).into())) .with(Name(format!("vn-overlay-{}", id).into())) .with(CompositeRenderAlpha(0.0)) .with(CompositeRenderLayer(1)) .with(CompositeRenderable(overlay_renderable)) .with(CompositeCameraAlignment(0.0.into())) .with(CompositeTransform::default()) .build(); let pointer = rendering.config().pointer_image.as_ref().map(|image| { lazy_update .create_entity(&entities) .with(Tag(format!("vn-ui-{}", id).into())) .with(Name(format!("vn-pointer-{}", id).into())) .with(CompositeRenderLayer(2)) .with(CompositeRenderable( Image::new_owned(image.to_owned()) .align(rendering.config().pointer_align) .into(), )) .with(CompositeTransform::default()) .build() }); rendering.stories.insert( id.to_owned(), VnStoryRenderer { background_camera, characters_camera, ui_camera, characters, background, dialogue_ui_element, dialogue_option_template, overlay, pointer, }, ); } } // apply data to renderers. for (story_name, story_data) in &rendering.stories { if let Some(story) = stories.get(story_name) { let show = !story.is_paused() || !rendering.config().hide_on_story_pause; if let Some(visibility) = visibilities.get_mut(story_data.background_camera) { visibility.0 = show; } if let Some(visibility) = visibilities.get_mut(story_data.characters_camera) { visibility.0 = show; } if let Some(visibility) = visibilities.get_mut(story_data.ui_camera) { visibility.0 = show; } if !show { continue; } let show_characters = !story.is_complete() || story.active_scene().phase() < 0.5; let refresh = rendering.config().forced_constant_refresh; let scene_phase = story.active_scene().phase(); let update_scene = refresh || story.active_scene().in_progress(); let scene = if scene_phase < 0.5 { if let Some(name) = story.active_scene().from() { story.scene(name) } else { None } } else if scene_phase > 0.5 { if let Some(name) = story.active_scene().to() { story.scene(name) } else { None } } else { None }; if update_scene { if let Some(alpha) = alphas.get_mut(story_data.overlay) { alpha.0 = (scene_phase * PI).sin(); } } let background_renderable = if let Some(scene) = &scene { if update_scene || scene.background_style.in_progress() { let from = story.background(scene.background_style.from()); let to = story.background(scene.background_style.to()); if let (Some(from), Some(to)) = (from, to) { let phase = scene.background_style.phase(); let transform_prev = { let [a, b, c, d, e, f] = Mat2d::scale(from.scale.into()).0; Command::Transform(a, b, c, d, e, f) }; let transform_next = { let [a, b, c, d, e, f] = Mat2d::scale(to.scale.into()).0; Command::Transform(a, b, c, d, e, f) }; Some(Renderable::Commands(vec![ Command::Store, transform_prev, Command::Alpha(1.0 - phase), Command::Draw( Image::new_owned(from.image.to_owned()) .align(0.5.into()) .into(), ), Command::Restore, Command::Store, transform_next, Command::Alpha(phase), Command::Draw( Image::new_owned(to.image.to_owned()) .align(0.5.into()) .into(), ), Command::Restore, ])) } else { Some(Renderable::None) } } else { None } } else { Some(Renderable::None) }; if let Some(background_renderable) = background_renderable { if let Some(renderable) = renderables.get_mut(story_data.background) { renderable.0 = background_renderable; } } if let Some(scene) = &scene { if update_scene || scene.camera_position.in_progress() || scene.camera_rotation.in_progress() { let position = scene.camera_position.value(); let rotation = scene.camera_rotation.value(); if let Some(transform) = transforms.get_mut(story_data.background_camera) { transform.set_translation(Vec2::new(position.0, position.1)); transform.set_rotation(rotation); } if let Some(transform) = transforms.get_mut(story_data.characters_camera) { transform.set_translation(Vec2::new(position.0, position.1)); transform.set_rotation(rotation); } } } if refresh || story.active_dialogue().in_progress() { let from = story.active_dialogue().from(); let to = story.active_dialogue().to(); let phase = story.active_dialogue().phase(); let (main_alpha, name_alpha, text, name, options) = match (from, to) { (Some(from), Some(to)) => { if phase < 0.5 { ( 1.0, 1.0 - phase * 2.0, from.text.as_str(), from.character.as_str(), from.options.as_slice(), ) } else { ( 1.0, phase * 2.0, to.text.as_str(), to.character.as_str(), to.options.as_slice(), ) } } (None, Some(to)) => ( phase, 1.0, to.text.as_str(), to.character.as_str(), to.options.as_slice(), ), (Some(from), None) => ( 1.0 - phase, 1.0, from.text.as_str(), from.character.as_str(), from.options.as_slice(), ), (None, None) => (0.0, 1.0, "", "", [].as_ref()), }; let name_color = if let Some(c) = story.character(name) { let color = c.name_color(); Color::rgb( (color.0 * 255.0).max(0.0).min(255.0) as u8, (color.1 * 255.0).max(0.0).min(255.0) as u8, (color.2 * 255.0).max(0.0).min(255.0) as u8, ) } else { Color::white() }; if let Some(alpha) = alphas.get_mut(story_data.dialogue_ui_element) { alpha.0 = main_alpha; } if let Some(ui_element) = ui_elements.get_mut(story_data.dialogue_ui_element) { let item_height = if let Some(v) = &story_data.dialogue_option_template.fixed_height { ui_element.calculate_value(v, &[]) } else { 0.0 }; if let Some(child) = ui_element.find_mut(&rendering.config().ui_dialogue_options_path) { child.alpha = phase.into(); if options.is_empty() { child.fixed_height = None; child.children.clear(); child.rebuild(); } else { child.fixed_height = Some((item_height * options.len() as Scalar).into()); child.children.clear(); for (i, option) in options.iter().enumerate() { let mut element = story_data.dialogue_option_template.clone(); if let Some(child) = element .find_mut(&rendering.config().ui_dialogue_option_text_path) { if let UiElementType::Text(t) = &mut child.element_type { t.text = option.text.clone().into(); } } let focused_phase = option.focused.phase(); if let Some(child) = element.find_mut( &rendering.config().ui_dialogue_option_button_path, ) { child.state.insert("focused".into(), focused_phase); } element.interactive = Some(format!("vn-ui-option-{}-{}", story_name, i).into()); element.offset.y = (i as Scalar * item_height).into(); child.children.push(element); } child.rebuild(); } } if let Some(child) = ui_element.find_mut(&rendering.config().ui_dialogue_name_path) { child.alpha = name_alpha.into(); if let UiElementType::Text(t) = &mut child.element_type { t.text = name.to_owned().into(); t.color = name_color; } child.rebuild(); } if let Some(child) = ui_element.find_mut(&rendering.config().ui_dialogue_text_path) { if let UiElementType::Text(t) = &mut child.element_type { t.text = text.to_owned().into(); } child.rebuild(); } ui_element.rebuild(); } } for (name, entity) in &story_data.characters { if let Some(character) = story.character(name) { if refresh || character.visibility_anim().in_progress() { if let Some(alpha) = alphas.get_mut(*entity) { alpha.0 = if show_characters { character.visibility() } else { 0.0 }; } } if refresh || character.position_anim().in_progress() { if let Some(alignment) = alignments.get_mut(*entity) { let pos = character.position(); alignment.1 = Vec2::new(pos.0, pos.1); } } if refresh || character.rotation_anim().in_progress() || character.scale_anim().in_progress() { if let Some(transform) = transforms.get_mut(*entity) { let scl = character.scale(); transform.set_rotation(character.rotation()); transform.set_scale(Vec2::new(scl.0, scl.1)); } } if refresh || character.style_transition().in_progress() || character.alignment_anim().in_progress() { let (from_style, style_phase, to_style) = character.style(); let from = character.styles.get(from_style); let to = character.styles.get(to_style); let character_renderable = if let (Some(from), Some(to)) = (from, to) { let align = character.alignment(); let align = Vec2::new(align.0, align.1); Renderable::Commands(vec![ Command::Store, Command::Alpha(1.0 - style_phase), Command::Draw( Image::new_owned(from.to_owned()).align(align).into(), ), Command::Alpha(style_phase), Command::Draw( Image::new_owned(to.to_owned()).align(align).into(), ), Command::Restore, ]) } else { Renderable::None }; if let Some(renderable) = renderables.get_mut(*entity) { renderable.0 = character_renderable; } } } else if let Some(alpha) = alphas.get_mut(*entity) { alpha.0 = 0.0; } } } if let Some(story) = stories.get_mut(story_name) { let x = input.axis_or_default(&rendering.config().input_pointer_axis_x); let y = input.axis_or_default(&rendering.config().input_pointer_axis_y); let point = [x, y].into(); if let Some(pos) = camera_cache.screen_to_world_space(story_data.ui_camera, point) { if let Some(pointer) = &story_data.pointer { if let Some(transform) = transforms.get_mut(*pointer) { transform.set_translation(pos); } } if story.is_waiting_for_dialogue_option_selection() && story.active_dialogue().is_complete() { let dialogue = story.active_dialogue().to(); if let Some(dialogue) = dialogue { let mut selected = None; let mut focused = None; let click = input .trigger_or_default(&rendering.config().input_pointer_trigger) .is_pressed(); for i in 0..dialogue.options.len() { if interactibles.does_rect_contains_point( &format!("vn-ui-option-{}-{}", story_name, i), pos, ) { focused = Some(i); if click { selected = Some(i); } } } drop(story.focus_dialogue_option(focused)); if let Some(selected) = selected { drop(story.select_dialogue_option(selected)); } } } } } } for (transform, alignment) in (&mut transforms, &alignments).join() { if let Some(size) = camera_cache.calculate_world_size(alignment.0) { transform.set_translation(alignment.1 * size); } } } }
use std::fmt::{Debug, Display}; use std::sync::Arc; use async_trait::async_trait; use parquet_file::ParquetFilePath; use uuid::Uuid; pub mod noop; pub mod prod; mod util; #[cfg(test)] mod test_util; /// Create a [`Scratchpad`] for use as intermediate storage pub trait ScratchpadGen: Debug + Display + Send + Sync { fn pad(&self) -> Arc<dyn Scratchpad>; } /// An intermediate in-memory store (can be a disk later if we want) /// to stage all inputs and outputs of the compaction. The reasons /// are: /// /// **fewer IO ops:** DataFusion's streaming IO requires slightly more IO /// requests (at least 2 per file) due to the way it is optimized to /// read as little as possible. It first reads the metadata and then /// decides which content to fetch. In the compaction case this is /// (esp. w/o delete predicates) EVERYTHING. So in contrast to the /// querier, there is no advantage of this approach. In contrary this /// easily adds 100ms latency to every single input file. /// /// **less traffic**: For divide&conquer partitions (i.e. when we need /// to run multiple compaction steps to deal with them) it is kinda /// pointless to upload an intermediate result just to download it /// again. The scratchpad avoids that. /// /// **higher throughput**: We want to limit the number of concurrent /// DataFusion jobs because we don't wanna blow up the whole process /// by having too much in-flight arrow data at the same time. However /// while we perform the actual computation, we were waiting for /// object store IO. This was limiting our throughput substantially. /// /// **shadow mode**: De-coupling the stores in this way makes it easier /// to implement compactor: shadow mode #6645. Shadow mode relies on /// leaving the compaction output in the scratchpad so /// `clean_written_from_scratchpad` is a no-op for shadow mode. /// /// Note that we assume here that the input parquet files are WAY /// SMALLER than the uncompressed Arrow data during compaction itself. #[async_trait] pub trait Scratchpad: Debug + Send + Sync + 'static { fn uuids(&self, files: &[ParquetFilePath]) -> Vec<Uuid>; async fn load_to_scratchpad(&self, files: &[ParquetFilePath]) -> Vec<Uuid>; async fn make_public(&self, files: &[ParquetFilePath]) -> Vec<Uuid>; async fn clean_from_scratchpad(&self, files: &[ParquetFilePath]); async fn clean_written_from_scratchpad(&self, files: &[ParquetFilePath]); async fn clean(&self); }
use ted_interface::*; use id_types::*; pub struct Drawn{ pub id: u32, pub mover_id: MoverID, pub sprite: EntitySprite, pub invisible: bool } pub struct BasicDrawn{ pub drawn_id: DrawnID, pub sprite: u32 } pub struct HealthDrawn{ pub drawn_id: DrawnID, pub damageable_id: DamageableID, pub sprite: u32 }
#[doc = r"Register block"] #[repr(C)] pub struct RegisterBlock { #[doc = "0x00 - Instruction and Data Tightly-Coupled Memory Control Registers"] pub itcmcr: ITCMCR, #[doc = "0x04 - Instruction and Data Tightly-Coupled Memory Control Registers"] pub dtcmcr: DTCMCR, #[doc = "0x08 - AHBP Control register"] pub ahbpcr: AHBPCR, #[doc = "0x0c - Auxiliary Cache Control register"] pub cacr: CACR, #[doc = "0x10 - AHB Slave Control register"] pub ahbscr: AHBSCR, _reserved5: [u8; 4usize], #[doc = "0x18 - Auxiliary Bus Fault Status register"] pub abfsr: ABFSR, } #[doc = "Instruction and Data Tightly-Coupled Memory Control Registers\n\nThis register you can [`read`](crate::generic::Reg::read), [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero), [`modify`](crate::generic::Reg::modify). See [API](https://docs.rs/svd2rust/#read--modify--write-api).\n\nFor information about available fields see [itcmcr](itcmcr) module"] pub type ITCMCR = crate::Reg<u32, _ITCMCR>; #[allow(missing_docs)] #[doc(hidden)] pub struct _ITCMCR; #[doc = "`read()` method returns [itcmcr::R](itcmcr::R) reader structure"] impl crate::Readable for ITCMCR {} #[doc = "`write(|w| ..)` method takes [itcmcr::W](itcmcr::W) writer structure"] impl crate::Writable for ITCMCR {} #[doc = "Instruction and Data Tightly-Coupled Memory Control Registers"] pub mod itcmcr; #[doc = "Instruction and Data Tightly-Coupled Memory Control Registers\n\nThis register you can [`read`](crate::generic::Reg::read), [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero), [`modify`](crate::generic::Reg::modify). See [API](https://docs.rs/svd2rust/#read--modify--write-api).\n\nFor information about available fields see [dtcmcr](dtcmcr) module"] pub type DTCMCR = crate::Reg<u32, _DTCMCR>; #[allow(missing_docs)] #[doc(hidden)] pub struct _DTCMCR; #[doc = "`read()` method returns [dtcmcr::R](dtcmcr::R) reader structure"] impl crate::Readable for DTCMCR {} #[doc = "`write(|w| ..)` method takes [dtcmcr::W](dtcmcr::W) writer structure"] impl crate::Writable for DTCMCR {} #[doc = "Instruction and Data Tightly-Coupled Memory Control Registers"] pub mod dtcmcr; #[doc = "AHBP Control register\n\nThis register you can [`read`](crate::generic::Reg::read), [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero), [`modify`](crate::generic::Reg::modify). See [API](https://docs.rs/svd2rust/#read--modify--write-api).\n\nFor information about available fields see [ahbpcr](ahbpcr) module"] pub type AHBPCR = crate::Reg<u32, _AHBPCR>; #[allow(missing_docs)] #[doc(hidden)] pub struct _AHBPCR; #[doc = "`read()` method returns [ahbpcr::R](ahbpcr::R) reader structure"] impl crate::Readable for AHBPCR {} #[doc = "`write(|w| ..)` method takes [ahbpcr::W](ahbpcr::W) writer structure"] impl crate::Writable for AHBPCR {} #[doc = "AHBP Control register"] pub mod ahbpcr; #[doc = "Auxiliary Cache Control register\n\nThis register you can [`read`](crate::generic::Reg::read), [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero), [`modify`](crate::generic::Reg::modify). See [API](https://docs.rs/svd2rust/#read--modify--write-api).\n\nFor information about available fields see [cacr](cacr) module"] pub type CACR = crate::Reg<u32, _CACR>; #[allow(missing_docs)] #[doc(hidden)] pub struct _CACR; #[doc = "`read()` method returns [cacr::R](cacr::R) reader structure"] impl crate::Readable for CACR {} #[doc = "`write(|w| ..)` method takes [cacr::W](cacr::W) writer structure"] impl crate::Writable for CACR {} #[doc = "Auxiliary Cache Control register"] pub mod cacr; #[doc = "AHB Slave Control register\n\nThis register you can [`read`](crate::generic::Reg::read), [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero), [`modify`](crate::generic::Reg::modify). See [API](https://docs.rs/svd2rust/#read--modify--write-api).\n\nFor information about available fields see [ahbscr](ahbscr) module"] pub type AHBSCR = crate::Reg<u32, _AHBSCR>; #[allow(missing_docs)] #[doc(hidden)] pub struct _AHBSCR; #[doc = "`read()` method returns [ahbscr::R](ahbscr::R) reader structure"] impl crate::Readable for AHBSCR {} #[doc = "`write(|w| ..)` method takes [ahbscr::W](ahbscr::W) writer structure"] impl crate::Writable for AHBSCR {} #[doc = "AHB Slave Control register"] pub mod ahbscr; #[doc = "Auxiliary Bus Fault Status register\n\nThis register you can [`read`](crate::generic::Reg::read), [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero), [`modify`](crate::generic::Reg::modify). See [API](https://docs.rs/svd2rust/#read--modify--write-api).\n\nFor information about available fields see [abfsr](abfsr) module"] pub type ABFSR = crate::Reg<u32, _ABFSR>; #[allow(missing_docs)] #[doc(hidden)] pub struct _ABFSR; #[doc = "`read()` method returns [abfsr::R](abfsr::R) reader structure"] impl crate::Readable for ABFSR {} #[doc = "`write(|w| ..)` method takes [abfsr::W](abfsr::W) writer structure"] impl crate::Writable for ABFSR {} #[doc = "Auxiliary Bus Fault Status register"] pub mod abfsr;
#![allow(non_snake_case, non_camel_case_types, non_upper_case_globals, clashing_extern_declarations, clippy::all)] #[cfg(feature = "Devices_Spi_Provider")] pub mod Provider; #[link(name = "windows")] extern "system" {} pub type ISpiDeviceStatics = *mut ::core::ffi::c_void; pub type SpiBusInfo = *mut ::core::ffi::c_void; pub type SpiConnectionSettings = *mut ::core::ffi::c_void; pub type SpiController = *mut ::core::ffi::c_void; pub type SpiDevice = *mut ::core::ffi::c_void; #[repr(transparent)] pub struct SpiMode(pub i32); impl SpiMode { pub const Mode0: Self = Self(0i32); pub const Mode1: Self = Self(1i32); pub const Mode2: Self = Self(2i32); pub const Mode3: Self = Self(3i32); } impl ::core::marker::Copy for SpiMode {} impl ::core::clone::Clone for SpiMode { fn clone(&self) -> Self { *self } } #[repr(transparent)] pub struct SpiSharingMode(pub i32); impl SpiSharingMode { pub const Exclusive: Self = Self(0i32); pub const Shared: Self = Self(1i32); } impl ::core::marker::Copy for SpiSharingMode {} impl ::core::clone::Clone for SpiSharingMode { fn clone(&self) -> Self { *self } }
fn testpalindrome(x: i32) -> bool{ let xstr=x.to_string(); let leng:usize = xstr.len(); let mut v=vec![]; for i in xstr.chars(){ v.push(i); } let mut test: bool =true; for i in 0..v.len()-1{ if v[i as usize]==v[leng-1-i as usize]{ test=true; } else{ return false; } } return test; } fn main(){ let mut largest: i32=0; let mut i: i32=100; let mut j: i32=100; while j < 1000{ let test: i32 = i*j; if testpalindrome(test)==true{ if test > largest{ largest=test; } } j+=1; if j==999{ i+=1; j=0; if i==999{ break; } } } println!("{}", largest); }
use rocket::*; use rocket::http::Status; use rocket::response::NamedFile; use rocket_contrib::json::*; use std::collections::HashMap; use reqwest::header::AUTHORIZATION; use super::BASE_URL; use super::receiver::*; use super::guards::*; use super::super::database::Database; use log::{error, warn, info, debug}; lazy_static! { static ref ACCESS_TOKEN: String = std::env::var("BOT_ACCESS_TOKEN").unwrap(); } #[get("/")] pub fn index() -> std::io::Result<NamedFile> { NamedFile::open("static/index.html") } // PING #[post("/", data="<_data>", rank=1)] pub fn ping(_header: Header, _ping_header: PingHeader, _data: Json<Ping>,) -> Status { Status::NoContent } // JOINED, LEFT #[post("/", data="<_data>", rank=2)] pub fn join_left(_header: Header, _join_left_header: JoinLeftHeader, _data: Json<JoinLeft>) -> Status { Status::NoContent } // MESSAGE_CREATED #[post("/", data="<data>", rank=3)] pub fn message(_header: Header, _message_header: MessageHeader, data: Json<MessageCreated>, conn: Database) -> Status { use super::functions::*; // 投稿するメッセージ let mut body = HashMap::new(); let command = parse_command(&data.message.plainText); match command { Some(Command::Help) => { body.insert("text", HELP_TEXT.to_string()); }, Some(Command::Random(terms)) => { body.insert("text", random_choice(terms, &data, &conn)); }, None => { return Status::NoContent; } } // チャンネル let channel_id = data.message.channelId.clone(); let endpoint = reqwest::Url::parse(&format!("{}/channels/{}/messages", BASE_URL, channel_id)).unwrap(); // 投げる let client = reqwest::Client::new(); let res = client.post(endpoint) .header(AUTHORIZATION, format!("Bearer {}", &*ACCESS_TOKEN)) .json(&body) .send(); match res { Ok(resp) => info!("Sending was succeeded. Here's response code: {}", resp.status().as_u16()), Err(_) => warn!("Failed to post") }; Status::NoContent }
use crate::shared::cleos; use std::io; use std::process::ExitStatus; fn deploy_example_contract(account: &str, bin: &str) -> io::Result<ExitStatus> { cleos() .arg("set") .arg("abi") .arg(account) .arg(format!("mnt/dev/examples/{}/{}.abi.json", bin, bin)) .status()?; cleos() .arg("set") .arg("code") .arg(account) .arg(format!("mnt/dev/release/{}_gc.wasm", bin)) .status() } pub fn run_deploy_examples() -> io::Result<()> { for (package, bin, account) in &[ ("addressbook", "addressbook", "addressbook"), ("hello", "hello", "hello"), ("hello_bare", "hello_bare", "hellobare"), ("tictactoe", "tictactoe", "tictactoe"), ] { crate::build_contract(package); deploy_example_contract(account, bin)?; } Ok(()) }
use hyper::{Body, Response}; // use std::convert::Infallible; // std::fs::read_to_string(path: P); use std::io::Error; pub fn get_static_content(file: &str) -> Result<String, Error> { let path = format!("./static/{}", file); std::fs::read_to_string(&path) } pub fn get_static_image(file: &str) -> Result<Vec<u8>, Error> { let path = format!("./static/{}", file); // std::fs::read(&path) std::fs::read(&path) } pub fn get_html(file: &str) -> Response<Body> { // get content of html file let content = get_static_content(file).unwrap(); // build response Response::builder() .status(200) .header("Content-Type", "text/html") .body(content.into()) .unwrap() } pub fn get_favicon() -> Response<Body> { // get content of html file let content = get_static_image("favicon.png").unwrap(); // build response Response::builder() .status(200) .header("Content-Type", "image/png") .body(content.into()) .unwrap() } pub fn get_css(file: &str) -> Response<Body> { // get content of html file let content = get_static_content(file).unwrap(); // build response Response::builder() .status(200) .header("Content-Type", "text/css") .body(content.into()) .unwrap() }
use std::ops::Range; use allocator::*; use smallvec::SmallVec; use block::Block; use device::Device; use error::*; use mapping::*; use memory::*; use usage::{Usage, UsageValue}; use util::*; /// Config for `Heaps` allocator. #[derive(Clone, Copy, Debug)] #[cfg_attr(feature = "serde", derive(Serialize, Deserialize))] pub struct Config { /// Config for arena sub-allocator. pub arena: Option<ArenaConfig>, /// Config for dynamic sub-allocator. pub dynamic: Option<DynamicConfig>, // chunk: Option<ChunkConfig>, } /// Heaps available on particular physical device. #[derive(Debug)] pub struct Heaps<T> { types: Vec<MemoryType<T>>, heaps: Vec<MemoryHeap>, } impl<T: 'static> Heaps<T> { /// This must be called with `Properties` fetched from physical device. pub unsafe fn new<P, H>(types: P, heaps: H) -> Self where P: IntoIterator<Item = (Properties, u32, Config)>, H: IntoIterator<Item = u64>, { let heaps = heaps .into_iter() .map(|size| MemoryHeap::new(size)) .collect::<Vec<_>>(); Heaps { types: types .into_iter() .enumerate() .map(|(index, (properties, heap_index, config))| { assert!( fits_u32(index), "Number of memory types must fit in u32 limit" ); assert!( fits_usize(heap_index), "Number of memory types must fit in u32 limit" ); let memory_type = index as u32; let heap_index = heap_index as usize; assert!(heap_index < heaps.len()); MemoryType::new(memory_type, heap_index, properties, config) }).collect(), heaps, } } /// Allocate memory block /// from one of memory types specified by `mask`, /// for intended `usage`, /// with `size` /// and `align` requirements. pub fn allocate<D, U>( &mut self, device: &D, mask: u32, usage: U, size: u64, align: u64, ) -> Result<MemoryBlock<T>, MemoryError> where D: Device<Memory = T>, U: Usage, { debug_assert!(fits_u32(self.types.len())); let (memory_index, _, _) = { let suitable_types = self .types .iter() .enumerate() .filter(|(index, _)| (mask & (1u32 << index)) != 0) .filter_map(|(index, mt)| { usage .memory_fitness(mt.properties) .map(move |fitness| (index, mt, fitness)) }).collect::<SmallVec<[_; 64]>>(); if suitable_types.is_empty() { return Err(AllocationError::NoSuitableMemory(mask, usage.value()).into()); } suitable_types .into_iter() .filter(|(_, mt, _)| self.heaps[mt.heap_index].available() > size + align) .max_by_key(|&(_, _, fitness)| fitness) .ok_or(OutOfMemoryError::HeapsExhausted)? }; self.allocate_from::<D, U>(device, memory_index as u32, usage, size, align) } /// Allocate memory block /// from `memory_index` specified, /// for intended `usage`, /// with `size` /// and `align` requirements. fn allocate_from<D, U>( &mut self, device: &D, memory_index: u32, usage: U, size: u64, align: u64, ) -> Result<MemoryBlock<T>, MemoryError> where D: Device<Memory = T>, U: Usage, { assert!(fits_usize(memory_index)); let ref mut memory_type = self.types[memory_index as usize]; let ref mut memory_heap = self.heaps[memory_type.heap_index]; if memory_heap.available() < size { return Err(OutOfMemoryError::HeapsExhausted.into()); } let (block, allocated) = memory_type.alloc(device, usage, size, align)?; memory_heap.used += allocated; Ok(MemoryBlock { block, memory_index, }) } /// Free memory block. /// /// Memory block must be allocated from this heap. pub fn free<D>(&mut self, device: &D, block: MemoryBlock<T>) where D: Device<Memory = T>, { let memory_index = block.memory_index; debug_assert!(fits_usize(memory_index)); let ref mut memory_type = self.types[memory_index as usize]; let ref mut memory_heap = self.heaps[memory_type.heap_index]; let freed = memory_type.free(device, block.block); memory_heap.used -= freed; } /// Dispose of allocator. /// Cleanup allocators before dropping. /// Will panic if memory instances are left allocated. pub fn dispose<D>(self, device: &D) where D: Device<Memory = T>, { for mt in self.types { mt.dispose(device) } } } /// Memory block allocated from `Heaps`. #[derive(Debug)] pub struct MemoryBlock<T> { block: BlockFlavor<T>, memory_index: u32, } impl<T> MemoryBlock<T> { /// Get memory type id. pub fn memory_type(&self) -> u32 { self.memory_index } } #[derive(Debug)] enum BlockFlavor<T> { Dedicated(DedicatedBlock<T>), Arena(ArenaBlock<T>), Dynamic(DynamicBlock<T>), // Chunk(ChunkBlock<T>), } macro_rules! any_block { ($self:ident. $block:ident => $expr:expr) => {{ use self::BlockFlavor::*; match $self.$block { Dedicated($block) => $expr, Arena($block) => $expr, Dynamic($block) => $expr, // Chunk($block) => $expr, } }}; (& $self:ident. $block:ident => $expr:expr) => {{ use self::BlockFlavor::*; match &$self.$block { Dedicated($block) => $expr, Arena($block) => $expr, Dynamic($block) => $expr, // Chunk($block) => $expr, } }}; (&mut $self:ident. $block:ident => $expr:expr) => {{ use self::BlockFlavor::*; match &mut $self.$block { Dedicated($block) => $expr, Arena($block) => $expr, Dynamic($block) => $expr, // Chunk($block) => $expr, } }}; } impl<T: 'static> Block for MemoryBlock<T> { type Memory = T; #[inline] fn properties(&self) -> Properties { any_block!(&self.block => block.properties()) } #[inline] fn memory(&self) -> &T { any_block!(&self.block => block.memory()) } #[inline] fn range(&self) -> Range<u64> { any_block!(&self.block => block.range()) } fn map<'a, D>( &'a mut self, device: &D, range: Range<u64>, ) -> Result<MappedRange<'a, T>, MappingError> where D: Device<Memory = T>, { any_block!(&mut self.block => block.map(device, range)) } fn unmap<D>(&mut self, device: &D) where D: Device<Memory = T>, { any_block!(&mut self.block => block.unmap(device)) } } #[derive(Debug)] struct MemoryHeap { size: u64, used: u64, } impl MemoryHeap { fn new(size: u64) -> Self { MemoryHeap { size, used: 0 } } fn available(&self) -> u64 { self.size - self.used } } #[derive(Debug)] struct MemoryType<T> { heap_index: usize, properties: Properties, dedicated: DedicatedAllocator<T>, arena: Option<ArenaAllocator<T>>, dynamic: Option<DynamicAllocator<T>>, // chunk: Option<ChunkAllocator<T>>, } impl<T: 'static> MemoryType<T> { fn new(memory_type: u32, heap_index: usize, properties: Properties, config: Config) -> Self { MemoryType { properties, heap_index, dedicated: DedicatedAllocator::new(memory_type, properties), arena: if properties.contains(ArenaAllocator::<T>::properties_required()) { config .arena .map(|config| ArenaAllocator::new(memory_type, properties, config)) } else { None }, dynamic: if properties.contains(DynamicAllocator::<T>::properties_required()) { config .dynamic .map(|config| DynamicAllocator::new(memory_type, properties, config)) } else { None }, // chunk: if properties.contains(ChunkAllocator::<T>::properties_required()) { // config.chunk.map(|config| ChunkAllocator::new(memory_type, properties, config)) // } else { // None // }, } } fn alloc<D, U>( &mut self, device: &D, usage: U, size: u64, align: u64, ) -> Result<(BlockFlavor<T>, u64), MemoryError> where D: Device<Memory = T>, U: Usage, { match (usage.value(), self.arena.as_mut(), self.dynamic.as_mut()) { (UsageValue::Upload, Some(ref mut arena), _) | (UsageValue::Download, Some(ref mut arena), _) if size <= arena.max_allocation() => { arena .alloc(device, size, align) .map(|(block, allocated)| (BlockFlavor::Arena(block), allocated)) } (UsageValue::Dynamic, _, Some(ref mut dynamic)) if size <= dynamic.max_allocation() => { dynamic .alloc(device, size, align) .map(|(block, allocated)| (BlockFlavor::Dynamic(block), allocated)) } (UsageValue::Data, _, Some(ref mut dynamic)) if size <= dynamic.max_allocation() => { dynamic .alloc(device, size, align) .map(|(block, allocated)| (BlockFlavor::Dynamic(block), allocated)) } _ => self .dedicated .alloc(device, size, align) .map(|(block, allocated)| (BlockFlavor::Dedicated(block), allocated)), } } fn free<D>(&mut self, device: &D, block: BlockFlavor<T>) -> u64 where D: Device<Memory = T>, { match block { BlockFlavor::Dedicated(block) => self.dedicated.free(device, block), BlockFlavor::Arena(block) => self.arena.as_mut().unwrap().free(device, block), BlockFlavor::Dynamic(block) => self.dynamic.as_mut().unwrap().free(device, block), // BlockFlavor::Chunk(block) => self.chunk.free(device, block), } } fn dispose<D>(self, device: &D) where D: Device<Memory = T>, { if let Some(arena) = self.arena { arena.dispose(device); } } }
use serenity::prelude::*; use serenity::model::prelude::*; use serenity::framework::standard::{ Args, CommandResult, macros::command, }; use serenity::utils::Colour; use requests::ToJson; use std::collections::HashMap; use std::time::Instant; use std::sync::mpsc; use std::thread; use std::sync::mpsc::Sender; #[command] pub async fn multiply(ctx: &Context, msg: &Message, mut args: Args) -> CommandResult { let one = args.single::<f64>()?; let two = args.single::<f64>()?; let product = one * two; msg.channel_id.say(&ctx.http, product).await?; Ok(()) } const ITEMS: &[&str; 24] = &["Ender Artifact", "Wither Artifact", "Hegemony Artifact", "Sharpness VI", "Giant Killer VI", "Power VI", "Growth VI", "Protection VI", "Sharpness VII", "Giant Killer VII", "Power VII", "Growth VII", "Protection VII", "Counter-Strike V", "Big Brain III", "Vicious III", "Parrot Legendary", "Parrot Epic", "Turtle Legendary", "Turtle Epic", "Jellyfish Legendary", "Jellyfish Epic", "Travel Scroll to Dark Auction", "Plasma Nucleus"]; const CATEGORIES: &[&str; 5] = &["Artifacts", "Books","Book Bundles", "Pets", "Misc"]; const CATEGORIES_COUNT: [i32; 5] = [3, 11, 2, 6, 2]; #[command] pub async fn da(ctx: &Context, msg: &Message) -> CommandResult { let start = Instant::now(); msg.channel_id.say(&ctx.http, "Working...").await?; // let mojang_response = requests::get("https://api.mojang.com/users/profiles/minecraft/PikachuPals").unwrap(); // let mojang_data = mojang_response.json().unwrap(); // let user_uuid = mojang_data["id"].as_str().unwrap(); // let mut skyblock_request = String::from("https://api.hypixel.net/Skyblock/profiles?key=...&uuid="); // skyblock_request.push_str(&user_uuid); // let response = requests::get(skyblock_request).unwrap(); // let data = response.json().unwrap(); let skyblock_auctions = String::from("https://api.hypixel.net/skyblock/auctions?page=0"); let response = requests::get(skyblock_auctions).unwrap(); let data = response.json().unwrap(); let auction_pages = data["totalPages"].as_i32().unwrap(); let dark_auction_lowest_prices = get_lowest_bin_values(auction_pages); let mut item_prices: HashMap<String, String> = HashMap::new(); for item in ITEMS.iter(){ item_prices.insert(item.to_string() ,format!("$: {}", *dark_auction_lowest_prices.get(&item.to_string()).unwrap())); } let mut output_fields_vec = Vec::with_capacity(32); let mut output_fields_vec2 = Vec::with_capacity(32); let mut count = 0; let mut category = 0; let mut input_count = 0; output_fields_vec.push((format!("ᅠᅠ\n__{}__", CATEGORIES[0]), "ᅠᅠ", false,)); for item in ITEMS.iter(){ if input_count < 24 { if CATEGORIES_COUNT[category] > count { count += 1; } else { category += 1; output_fields_vec.push((format!("ᅠᅠ\n__{}__", CATEGORIES[category]), "ᅠᅠ", false,)); count = 1; input_count += 1; } output_fields_vec.push((format!("{}", item), item_prices.get(&item.to_string()).unwrap(), true,)); input_count += 1; } else { if CATEGORIES_COUNT[category] > count { count += 1; } else { category += 1; output_fields_vec2.push((format!("ᅠᅠ\n__{}__", CATEGORIES[category]), "ᅠᅠ", false,)); count = 1; input_count += 1; } output_fields_vec2.push((format!("{}", item), item_prices.get(&item.to_string()).unwrap(), true,)); input_count += 1; } } let timed_search = format!("Completed in {:.2?}.", start.elapsed()); msg.channel_id.send_message(&ctx.http, |m|{ m.content(timed_search); m.embed(|e| { e.title("`Dark Auction BIN Prices`"); e.description(""); e.thumbnail("https://i.imgur.com/JNpxJ7I.png"); e.colour(Colour::FOOYOO); e.fields(output_fields_vec); e }); m }).await?; msg.channel_id.send_message(&ctx.http, |m|{ m.embed(|e| { e.colour(Colour::FOOYOO); e.fields(output_fields_vec2); e }); m }).await?; Ok(()) } fn get_lowest_bin_values(auction_pages: i32) -> HashMap<String, i32>{ let mut lowest_prices: HashMap<String, i32> = HashMap::new(); for item in ITEMS.iter(){ lowest_prices.insert(item.to_string(), 999999999); } let mut sender_vector: Vec<Sender<i32>> = Vec::with_capacity(ITEMS.len()); let mut receiver_vector = Vec::with_capacity(ITEMS.len()); for _n in 0..ITEMS.len(){ let (tx, rx) = mpsc::channel(); sender_vector.push(tx); receiver_vector.push(rx); } let mut handles = vec![]; let mut threads_pages: Vec<i32> = vec![0]; let threads: i32 = 8; let pages_per_thread: i32 = auction_pages / threads; let rem_pages: i32 = auction_pages % threads; for thread in 1..=threads{ if thread != threads{ threads_pages.push(thread * pages_per_thread); } else{ threads_pages.push((thread * pages_per_thread) + rem_pages); } } for i in 0..threads_pages.len() - 1 { let mut sender_vector_clone: Vec<Sender<i32>> = Vec::with_capacity(ITEMS.len()); let start_page = threads_pages[i].clone(); let end_page = threads_pages[i + 1].clone(); for tx in &sender_vector{ let tx_clone = tx.clone(); sender_vector_clone.push(tx_clone); } let handle = thread::spawn(move || work_thread(sender_vector_clone, start_page, end_page)); handles.push(handle); } for handle in handles{ handle.join().unwrap(); } for sender in sender_vector{ drop(sender); } for item in ITEMS.iter() { let index = ITEMS.iter().position(|x| x == item).unwrap(); for price in &receiver_vector[index]{ if price < *lowest_prices.get(&item.to_string()).unwrap() { lowest_prices.insert(item.to_string(), price); } } } return lowest_prices; } fn work_thread(sender_vector: Vec<Sender<i32>>, i: i32, e: i32){ for page in i..e{ let mut page_auctions = String::from(" https://api.hypixel.net/skyblock/auctions?page="); let page_number = page.to_string(); page_auctions.push_str(&page_number); let response = requests::get(page_auctions).unwrap(); let data = response.json().unwrap(); let ebook = "Enchanted Book".to_string(); let enchants: [String; 11] = ["Sharpness VI".to_string(), "Giant Killer VI".to_string(), "Power VI".to_string(), "Growth VI".to_string(), "Protection VI".to_string(), "Sharpness VII".to_string(), "Giant Killer VII".to_string(), "Power VII".to_string(), "Growth VII".to_string(), "Protection VII".to_string(), "Counter-Strike V".to_string()]; let unwanted_enchants: [String; 3] = ["Fire".to_string(), "Projectile".to_string(), "Blast".to_string()]; let mut fake_enchant; let ebundle = "Enchanted Book Bundle".to_string(); let bundles: [String; 2] = ["Big Brain III".to_string(), "Vicious III".to_string()]; for auc in data["auctions"].members(){ for auc_item in ITEMS.iter() { if auc["bin"].as_bool() != None{ if auc["item_name"].as_str().unwrap() == *auc_item && auc["bin"].as_bool() != None { let index = ITEMS.iter().position(|x| x == auc_item).unwrap(); let auc_item_price = auc["starting_bid"].as_i32().unwrap(); sender_vector[index].send(auc_item_price).unwrap(); } else if auc["item_name"].as_str().unwrap() == &ebook { for enchant in enchants.iter() { if auc["item_lore"].as_str().unwrap().contains(enchant){ if auc["item_lore"].as_str().unwrap().contains(&"Protection".to_string()){ fake_enchant = false; for unwanted_enchant in unwanted_enchants.iter(){ if auc["item_lore"].as_str().unwrap().contains(unwanted_enchant) { fake_enchant = true; } } if !fake_enchant{ let index = ITEMS.iter().position(|x| x == enchant).unwrap(); let auc_item_price = auc["starting_bid"].as_i32().unwrap(); sender_vector[index].send(auc_item_price).unwrap(); } } else{ let index = ITEMS.iter().position(|x| x == enchant).unwrap(); let auc_item_price = auc["starting_bid"].as_i32().unwrap(); sender_vector[index].send(auc_item_price).unwrap(); } } } } else if auc["item_name"].as_str().unwrap() == &ebundle { for bundle in bundles.iter() { if auc["item_lore"].as_str().unwrap().contains(bundle){ let index = ITEMS.iter().position(|x| x == bundle).unwrap(); let auc_item_price = auc["starting_bid"].as_i32().unwrap(); sender_vector[index].send(auc_item_price).unwrap(); } } } else if auc_item.contains(&"Epic".to_string()) || auc_item.contains(&"Legendary".to_string()) { let mut pet = auc_item.split_whitespace(); if auc["item_name"].as_str().unwrap().contains(pet.next().unwrap()) && auc["item_lore"].as_str().unwrap().contains(&pet.next().unwrap().to_uppercase()){ let index = ITEMS.iter().position(|x| x == auc_item).unwrap(); let auc_item_price = auc["starting_bid"].as_i32().unwrap(); sender_vector[index].send(auc_item_price).unwrap(); } } } } } } }
use std::process::Command; fn main() { run_with_cd(); } fn run() { let output = Command::new("sh") .arg("-c") .arg("/home/susilo/var/www/ecc4/protected/yii-dev") .output() .expect("Tidak dapat menjalankan command!."); let ls = output.stdout; println!("{:#?}", ls.iter().map(|&x| x as char).collect::<String>()); } fn run_with_cd() { let output = Command::new("./yii-dev") .current_dir("/home/susilo/var/www/ecc4/protected") .output() .expect("Tidak dapat menjalankan command!."); let ls = output.stdout; println!("{:#?}", ls.iter().map(|&x| x as char).collect::<String>()); }
pub trait LocalApic { fn is_supported() -> bool; }
use crate::common::{BuildingColorer, BuildingColorerBuilder, CommonState, Warping}; use crate::game::{State, Transition, WizardState}; use crate::helpers::ID; use crate::mission::pick_time_range; use crate::sandbox::SandboxMode; use crate::ui::UI; use abstutil::{prettyprint_usize, MultiMap, WeightedUsizeChoice}; use ezgui::{ hotkey, Choice, Color, EventCtx, EventLoopMode, GfxCtx, Key, Line, ModalMenu, Text, Wizard, WrappedWizard, }; use geom::Duration; use map_model::{BuildingID, IntersectionID, Map, Neighborhood}; use sim::{ BorderSpawnOverTime, DrivingGoal, OriginDestination, Scenario, SeedParkedCars, SidewalkPOI, SidewalkSpot, SpawnOverTime, SpawnTrip, }; use std::collections::{BTreeSet, HashMap}; use std::fmt; pub struct ScenarioManager { menu: ModalMenu, common: CommonState, scenario: Scenario, // The usizes are indices into scenario.individ_trips trips_from_bldg: MultiMap<BuildingID, usize>, trips_to_bldg: MultiMap<BuildingID, usize>, cars_needed_per_bldg: HashMap<BuildingID, CarCount>, total_cars_needed: CarCount, total_parking_spots: usize, bldg_colors: BuildingColorer, } impl ScenarioManager { pub fn new(scenario: Scenario, ctx: &mut EventCtx, ui: &UI) -> ScenarioManager { let mut trips_from_bldg = MultiMap::new(); let mut trips_to_bldg = MultiMap::new(); let mut cars_needed_per_bldg = HashMap::new(); for b in ui.primary.map.all_buildings() { cars_needed_per_bldg.insert(b.id, CarCount::new()); } let mut total_cars_needed = CarCount::new(); let color = Color::BLUE; let mut bldg_colors = BuildingColorerBuilder::new("trips", vec![("building with trips from/to it", color)]); for (idx, trip) in scenario.individ_trips.iter().enumerate() { // trips_from_bldg match trip { SpawnTrip::CarAppearing { .. } => {} SpawnTrip::MaybeUsingParkedCar(_, b, _) => { trips_from_bldg.insert(*b, idx); bldg_colors.add(*b, color); } SpawnTrip::UsingBike(_, ref spot, _) | SpawnTrip::JustWalking(_, ref spot, _) | SpawnTrip::UsingTransit(_, ref spot, _, _, _, _) => { if let SidewalkPOI::Building(b) = spot.connection { trips_from_bldg.insert(b, idx); bldg_colors.add(b, color); } } } // trips_to_bldg match trip { SpawnTrip::CarAppearing { ref goal, .. } | SpawnTrip::MaybeUsingParkedCar(_, _, ref goal) | SpawnTrip::UsingBike(_, _, ref goal) => { if let DrivingGoal::ParkNear(b) = goal { trips_to_bldg.insert(*b, idx); bldg_colors.add(*b, color); } } SpawnTrip::JustWalking(_, _, ref spot) | SpawnTrip::UsingTransit(_, _, ref spot, _, _, _) => { if let SidewalkPOI::Building(b) = spot.connection { trips_to_bldg.insert(b, idx); bldg_colors.add(b, color); } } } // Parked cars if let SpawnTrip::MaybeUsingParkedCar(_, start_bldg, ref goal) = trip { let mut cnt = cars_needed_per_bldg.get_mut(start_bldg).unwrap(); cnt.naive += 1; total_cars_needed.naive += 1; if cnt.available > 0 { cnt.available -= 1; } else { cnt.recycle += 1; total_cars_needed.recycle += 1; } // Cars appearing at borders and driving in contribute parked cars. if let DrivingGoal::ParkNear(b) = goal { cars_needed_per_bldg.get_mut(b).unwrap().available += 1; } } } let (filled_spots, free_parking_spots) = ui.primary.sim.get_all_parking_spots(); assert!(filled_spots.is_empty()); ScenarioManager { menu: ModalMenu::new( "Scenario Editor", vec![ vec![ (hotkey(Key::S), "save"), (hotkey(Key::E), "edit"), (hotkey(Key::I), "instantiate"), ], vec![ (hotkey(Key::Escape), "quit"), (hotkey(Key::J), "warp"), (hotkey(Key::K), "navigate"), (hotkey(Key::SingleQuote), "shortcuts"), (hotkey(Key::F1), "take a screenshot"), ], ], ctx, ), common: CommonState::new(), scenario, trips_from_bldg, trips_to_bldg, cars_needed_per_bldg, total_cars_needed, total_parking_spots: free_parking_spots.len(), bldg_colors: bldg_colors.build(ctx, &ui.primary.map), } } } impl State for ScenarioManager { fn event(&mut self, ctx: &mut EventCtx, ui: &mut UI) -> Transition { // TODO Calculate this once? Except when we modify it, nice to automatically pick up // changes... { let mut txt = Text::prompt("Scenario Editor"); txt.add(Line(&self.scenario.scenario_name)); for line in self.scenario.describe() { txt.add(Line(line)); } txt.add(Line(format!( "{} total parked cars needed, {} spots", self.total_cars_needed, prettyprint_usize(self.total_parking_spots), ))); self.menu.handle_event(ctx, Some(txt)); } ctx.canvas.handle_event(ctx.input); if ctx.redo_mouseover() { ui.recalculate_current_selection(ctx); } if let Some(t) = self.common.event(ctx, ui, &mut self.menu) { return t; } if self.menu.action("quit") { return Transition::Pop; } else if self.menu.action("save") { self.scenario.save(); } else if self.menu.action("edit") { return Transition::Push(Box::new(ScenarioEditor { scenario: self.scenario.clone(), wizard: Wizard::new(), })); } else if self.menu.action("instantiate") { ctx.loading_screen("instantiate scenario", |_, timer| { self.scenario.instantiate( &mut ui.primary.sim, &ui.primary.map, &mut ui.primary.current_flags.sim_flags.make_rng(), timer, ); ui.primary.sim.step(&ui.primary.map, Duration::seconds(0.1)); }); return Transition::Replace(Box::new(SandboxMode::new(ctx))); } if let Some(ID::Building(b)) = ui.primary.current_selection { let from = self.trips_from_bldg.get(b); let to = self.trips_to_bldg.get(b); if (!from.is_empty() || !to.is_empty()) && ctx.input.contextual_action(Key::T, "browse trips") { // TODO Avoid the clone? Just happens once though. let mut all_trips = from.clone(); all_trips.extend(to); return Transition::Push(make_trip_picker(self.scenario.clone(), all_trips, b)); } } Transition::Keep } fn draw_default_ui(&self) -> bool { false } fn draw(&self, g: &mut GfxCtx, ui: &UI) { // TODO Let common contribute draw_options... self.bldg_colors.draw(g, ui); self.menu.draw(g); // TODO Weird to not draw common (turn cycler), but we want the custom OSD... if let Some(ID::Building(b)) = ui.primary.current_selection { let mut osd = Text::new(); let from = self.trips_from_bldg.get(b); let to = self.trips_to_bldg.get(b); osd.add_appended(vec![ Line(b.to_string()).fg(ui.cs.get("OSD ID color")), Line(" is "), Line(ui.primary.map.get_b(b).get_name()).fg(ui.cs.get("OSD name color")), Line(format!( ". {} trips from here, {} trips to here, {} parked cars needed", from.len(), to.len(), self.cars_needed_per_bldg[&b] )), ]); CommonState::draw_custom_osd(g, osd); } else { CommonState::draw_osd(g, ui, &ui.primary.current_selection); } } } struct ScenarioEditor { scenario: Scenario, wizard: Wizard, } impl State for ScenarioEditor { fn event(&mut self, ctx: &mut EventCtx, ui: &mut UI) -> Transition { if let Some(()) = edit_scenario(&ui.primary.map, &mut self.scenario, self.wizard.wrap(ctx)) { // TODO autosave, or at least make it clear there are unsaved edits let scenario = self.scenario.clone(); return Transition::PopWithData(Box::new(|state, _, _| { let mut manager = state.downcast_mut::<ScenarioManager>().unwrap(); manager.scenario = scenario; // Don't need to update trips_from_bldg or trips_to_bldg, since edit_scenario // doesn't touch individ_trips. })); } else if self.wizard.aborted() { return Transition::Pop; } Transition::Keep } fn draw(&self, g: &mut GfxCtx, ui: &UI) { if let Some(neighborhood) = self.wizard.current_menu_choice::<Neighborhood>() { g.draw_polygon(ui.cs.get("neighborhood polygon"), &neighborhood.polygon); } self.wizard.draw(g); } } fn edit_scenario(map: &Map, scenario: &mut Scenario, mut wizard: WrappedWizard) -> Option<()> { let seed_parked = "Seed parked cars"; let spawn = "Spawn agents"; let spawn_border = "Spawn agents from a border"; let randomize = "Randomly spawn stuff from/to every neighborhood"; match wizard .choose_string("What kind of edit?", || { vec![seed_parked, spawn, spawn_border, randomize] })? .as_str() { x if x == seed_parked => { scenario.seed_parked_cars.push(SeedParkedCars { neighborhood: choose_neighborhood( map, &mut wizard, "Seed parked cars in what area?", )?, cars_per_building: input_weighted_usize( &mut wizard, "How many cars per building? (ex: 4,4,2)", )?, }); } x if x == spawn => { let (start_time, stop_time) = pick_time_range(&mut wizard, "Start spawning when?", "Stop spawning when?")?; scenario.spawn_over_time.push(SpawnOverTime { num_agents: wizard.input_usize("Spawn how many agents?")?, start_time, stop_time, start_from_neighborhood: choose_neighborhood( map, &mut wizard, "Where should the agents start?", )?, goal: choose_origin_destination(map, &mut wizard, "Where should the agents go?")?, percent_biking: wizard .input_percent("What percent of the walking trips will bike instead?")?, percent_use_transit: wizard.input_percent( "What percent of the walking trips will consider taking transit?", )?, }); } x if x == spawn_border => { let (start_time, stop_time) = pick_time_range(&mut wizard, "Start spawning when?", "Stop spawning when?")?; scenario.border_spawn_over_time.push(BorderSpawnOverTime { num_peds: wizard.input_usize("Spawn how many pedestrians?")?, num_cars: wizard.input_usize("Spawn how many cars?")?, num_bikes: wizard.input_usize("Spawn how many bikes?")?, start_time, stop_time, // TODO validate it's a border! start_from_border: choose_intersection( &mut wizard, "Which border should the agents spawn at?", )?, goal: choose_origin_destination(map, &mut wizard, "Where should the agents go?")?, percent_use_transit: wizard.input_percent( "What percent of the walking trips will consider taking transit?", )?, }); } x if x == randomize => { let neighborhoods = Neighborhood::load_all(map.get_name(), &map.get_gps_bounds()); for (src, _) in &neighborhoods { for (dst, _) in &neighborhoods { scenario.spawn_over_time.push(SpawnOverTime { num_agents: 100, start_time: Duration::ZERO, stop_time: Duration::minutes(10), start_from_neighborhood: src.to_string(), goal: OriginDestination::Neighborhood(dst.to_string()), percent_biking: 0.1, percent_use_transit: 0.2, }); } } } _ => unreachable!(), }; Some(()) } fn choose_neighborhood(map: &Map, wizard: &mut WrappedWizard, query: &str) -> Option<String> { // Load the full object, since we usually visualize the neighborhood when menuing over it wizard .choose(query, || { Choice::from(Neighborhood::load_all(map.get_name(), map.get_gps_bounds())) }) .map(|(n, _)| n) } fn input_weighted_usize(wizard: &mut WrappedWizard, query: &str) -> Option<WeightedUsizeChoice> { wizard.input_something( query, None, Box::new(|line| WeightedUsizeChoice::parse(&line)), ) } // TODO Validate the intersection exists? Let them pick it with the cursor? fn choose_intersection(wizard: &mut WrappedWizard, query: &str) -> Option<IntersectionID> { wizard.input_something( query, None, Box::new(|line| usize::from_str_radix(&line, 10).ok().map(IntersectionID)), ) } fn choose_origin_destination( map: &Map, wizard: &mut WrappedWizard, query: &str, ) -> Option<OriginDestination> { let neighborhood = "Neighborhood"; let border = "Border intersection"; if wizard.choose_string(query, || vec![neighborhood, border])? == neighborhood { choose_neighborhood(map, wizard, query).map(OriginDestination::Neighborhood) } else { choose_intersection(wizard, query).map(OriginDestination::Border) } } fn make_trip_picker( scenario: Scenario, indices: BTreeSet<usize>, home: BuildingID, ) -> Box<dyn State> { WizardState::new(Box::new(move |wiz, ctx, ui| { let warp_to = wiz .wrap(ctx) .choose("Trips from/to this building", || { // TODO Panics if there are two duplicate trips (b1124 in montlake) indices .iter() .map(|idx| { let trip = &scenario.individ_trips[*idx]; Choice::new(describe(trip, home), other_endpt(trip, home)) }) .collect() })? .1; Some(Transition::ReplaceWithMode( Warping::new( ctx, warp_to.canonical_point(&ui.primary).unwrap(), None, Some(warp_to), &mut ui.primary, ), EventLoopMode::Animation, )) })) } fn describe(trip: &SpawnTrip, home: BuildingID) -> String { let driving_goal = |goal: &DrivingGoal| match goal { DrivingGoal::ParkNear(b) => { if *b == home { "HERE".to_string() } else { b.to_string() } } DrivingGoal::Border(i, _) => i.to_string(), }; let sidewalk_spot = |spot: &SidewalkSpot| match &spot.connection { SidewalkPOI::Building(b) => { if *b == home { "HERE".to_string() } else { b.to_string() } } SidewalkPOI::Border(i) => i.to_string(), x => format!("{:?}", x), }; match trip { SpawnTrip::CarAppearing { depart, start, goal, is_bike, } => format!( "{}: {} appears at {}, goes to {}", depart, if *is_bike { "bike" } else { "car" }, start.lane(), driving_goal(goal) ), SpawnTrip::MaybeUsingParkedCar(depart, start_bldg, goal) => format!( "{}: try to drive from {} to {}", depart, if *start_bldg == home { "HERE".to_string() } else { start_bldg.to_string() }, driving_goal(goal), ), SpawnTrip::UsingBike(depart, start, goal) => format!( "{}: bike from {} to {}", depart, sidewalk_spot(start), driving_goal(goal) ), SpawnTrip::JustWalking(depart, start, goal) => format!( "{}: walk from {} to {}", depart, sidewalk_spot(start), sidewalk_spot(goal) ), SpawnTrip::UsingTransit(depart, start, goal, route, _, _) => format!( "{}: bus from {} to {} using {}", depart, sidewalk_spot(start), sidewalk_spot(goal), route ), } } fn other_endpt(trip: &SpawnTrip, home: BuildingID) -> ID { let driving_goal = |goal: &DrivingGoal| match goal { DrivingGoal::ParkNear(b) => ID::Building(*b), DrivingGoal::Border(i, _) => ID::Intersection(*i), }; let sidewalk_spot = |spot: &SidewalkSpot| match &spot.connection { SidewalkPOI::Building(b) => ID::Building(*b), SidewalkPOI::Border(i) => ID::Intersection(*i), x => panic!("other_endpt for {:?}?", x), }; let (from, to) = match trip { SpawnTrip::CarAppearing { start, goal, .. } => (ID::Lane(start.lane()), driving_goal(goal)), SpawnTrip::MaybeUsingParkedCar(_, start_bldg, goal) => { (ID::Building(*start_bldg), driving_goal(goal)) } SpawnTrip::UsingBike(_, start, goal) => (sidewalk_spot(start), driving_goal(goal)), SpawnTrip::JustWalking(_, start, goal) => (sidewalk_spot(start), sidewalk_spot(goal)), SpawnTrip::UsingTransit(_, start, goal, _, _, _) => { (sidewalk_spot(start), sidewalk_spot(goal)) } }; if from == ID::Building(home) { to } else if to == ID::Building(home) { from } else { panic!("other_endpt broke when homed at {} for {:?}", home, trip) } } struct CarCount { naive: usize, recycle: usize, // Intermediate state available: usize, } impl CarCount { fn new() -> CarCount { CarCount { naive: 0, recycle: 0, available: 0, } } } impl fmt::Display for CarCount { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!( f, "{} / {}", prettyprint_usize(self.naive), prettyprint_usize(self.recycle), ) } }
//! Error types used in this driver. use core::str::Utf8Error; /// A collection of errors that can occur. #[derive(Debug, PartialEq, Eq)] pub enum Error<S> { /// Could not read from serial port. SerialRead(S), /// Could not write to serial port. SerialWrite(S), /// Read buffer is too small. /// This is a bug, please report it on GitHub! ReadBufferTooSmall, /// Command or response contained invalid UTF-8. EncodingError, /// A response could not be parsed. ParsingError, /// A command failed. CommandFailed, /// A bad parameter was supplied. BadParameter, /// Device is in sleep mode. SleepMode, /// The module is in an invalid state. InvalidState, } impl<S> From<Utf8Error> for Error<S> { fn from(_: Utf8Error) -> Self { Error::EncodingError } } /// Errors that can occur during the join procedure. #[derive(Debug, PartialEq, Eq)] pub enum JoinError<S> { /// Invalid join mode. This indicates a bug in the driver and should be /// reported on GitHub. BadParameter, /// The keys corresponding to the join mode (OTAA or ABP) were not /// configured. KeysNotInit, /// All channels are busy. NoFreeChannel, /// Device is in a Silent Immediately state. Silent, /// MAC state is not idle. Busy, /// MAC was paused and not resumed. MacPaused, /// Join procedure was unsuccessful: Device tried to join but was rejected /// or did not receive a response. JoinUnsuccessful, /// Unknown response. UnknownResponse, /// Another error occurred. Other(Error<S>), } impl<S> From<Error<S>> for JoinError<S> { fn from(other: Error<S>) -> Self { JoinError::Other(other) } } impl<S> From<Utf8Error> for JoinError<S> { fn from(_: Utf8Error) -> Self { JoinError::Other(Error::EncodingError) } } /// Errors that can occur during the transmit procedure. #[derive(Debug, PartialEq, Eq)] pub enum TxError<S> { /// Invalid type, port or data. BadParameter, /// Network not joined. NotJoined, /// All channels are busy. NoFreeChannel, /// Device is in a Silent Immediately state. Silent, /// Frame counter rollover. Re-join needed. FrameCounterRollover, /// MAC state is not idle. Busy, /// MAC was paused and not resumed. MacPaused, /// Application payload length is greater than the maximum application /// payload length corresponding to the current data rate. InvalidDataLenth, /// Transmission was not successful. TxUnsuccessful, /// Unknown response. UnknownResponse, /// Another error occurred. Other(Error<S>), } impl<S> From<Error<S>> for TxError<S> { fn from(other: Error<S>) -> Self { TxError::Other(other) } } impl<S> From<Utf8Error> for TxError<S> { fn from(_: Utf8Error) -> Self { TxError::Other(Error::EncodingError) } } /// A `Result<T, Error>`. pub type RnResult<T, S> = Result<T, Error<S>>;
use core::cmp::Ordering::{self, *}; use core::fmt::{self, Debug}; use core::ops::{Add, AddAssign, Div, Index, IndexMut, Mul, RangeBounds, Rem}; use core::ptr::NonNull; use std::sync::{Arc, Weak}; use std::vec::Drain; use hashbrown::HashMap; use liblumen_core::locks::Mutex; use liblumen_alloc::borrow::CloneToProcess; use liblumen_alloc::erts::exception::AllocResult; use liblumen_alloc::erts::term::prelude::*; use liblumen_alloc::erts::Process; use liblumen_alloc::time::{Milliseconds, Monotonic}; use crate::registry; use crate::scheduler::{self, Scheduled, Scheduler}; use crate::time::monotonic; pub fn cancel(timer_reference: &Reference) -> Option<Milliseconds> { timer_reference.scheduler().and_then(|scheduler| { scheduler .hierarchy() .write() .cancel(timer_reference.number()) }) } pub fn read(timer_reference: &Reference) -> Option<Milliseconds> { timer_reference .scheduler() .and_then(|scheduler| scheduler.hierarchy().read().read(timer_reference.number())) } pub fn start( monotonic: Monotonic, event: SourceEvent, arc_process: Arc<Process>, ) -> AllocResult<Term> { let arc_scheduler = scheduler::current(); let result = arc_scheduler.hierarchy().write().start( monotonic, event, arc_process, arc_scheduler.clone(), ); result } /// Times out the timers for the thread that have timed out since the last time `timeout` was /// called. pub fn timeout() { scheduler::current().hierarchy().write().timeout(); } #[derive(Debug)] pub struct Message { pub heap_fragment: NonNull<liblumen_alloc::erts::HeapFragment>, pub term: Term, } #[derive(Debug)] pub struct HeapFragment { pub heap_fragment: NonNull<liblumen_alloc::erts::HeapFragment>, pub term: Term, } #[derive(Clone, Debug)] pub enum Destination { Name(Atom), Process(Weak<Process>), } pub struct Hierarchy { at_once: Slot, soon: Wheel, later: Wheel, long_term: Slot, timer_by_reference_number: HashMap<ReferenceNumber, Weak<Timer>>, } impl Hierarchy { const SOON_MILLISECONDS_PER_SLOT: MillisecondsPerSlot = MillisecondsPerSlot(1); const SOON_TOTAL_MILLISECONDS: Milliseconds = Self::SOON_MILLISECONDS_PER_SLOT.const_mul(Wheel::SLOTS); const LATER_MILLISECONDS_PER_SLOT: MillisecondsPerSlot = MillisecondsPerSlot(Self::SOON_TOTAL_MILLISECONDS.const_div(2).as_u64()); const LATER_TOTAL_MILLISECONDS: Milliseconds = Self::LATER_MILLISECONDS_PER_SLOT.const_mul(Wheel::SLOTS); pub fn cancel(&mut self, timer_reference_number: ReferenceNumber) -> Option<Milliseconds> { self.timer_by_reference_number .remove(&timer_reference_number) .and_then(|weak_timer| weak_timer.upgrade()) .map(|arc_timer| { use Position::*; match *arc_timer.position.lock() { // can't be found in O(1), mark as canceled for later cleanup AtOnce => self.at_once.cancel(timer_reference_number), Soon { slot_index } => self.soon.cancel(slot_index, timer_reference_number), Later { slot_index } => self.later.cancel(slot_index, timer_reference_number), LongTerm => self.long_term.cancel(timer_reference_number), }; arc_timer.milliseconds_remaining() }) } fn position(&self, monotonic: Monotonic) -> Position { if monotonic < self.soon.slot_monotonic { Position::AtOnce } else if monotonic < self.later.slot_monotonic { Position::Soon { slot_index: self.soon.slot_index(monotonic), } } else if monotonic < (self.later.slot_monotonic + Self::LATER_TOTAL_MILLISECONDS) { Position::Later { slot_index: self.later.slot_index(monotonic), } } else { Position::LongTerm } } pub fn read(&self, timer_reference_number: ReferenceNumber) -> Option<Milliseconds> { self.timer_by_reference_number .get(&timer_reference_number) .and_then(|weak_timer| weak_timer.upgrade()) .map(|rc_timer| rc_timer.milliseconds_remaining()) } pub fn start( &mut self, monotonic: Monotonic, source_event: SourceEvent, arc_process: Arc<Process>, arc_scheduler: Arc<dyn Scheduler>, ) -> AllocResult<Term> { let reference_number = arc_scheduler.next_reference_number(); let process_reference = arc_process.reference_from_scheduler(arc_scheduler.id(), reference_number); let destination_event = match source_event { SourceEvent::Message { destination, format, term, } => { let (heap_fragment_message, heap_fragment) = match format { Format::Message => term.clone_to_fragment()?, Format::TimeoutTuple => { let tag = Atom::str_to_term("timeout"); let process_tuple = arc_process.tuple_from_slice(&[tag, process_reference, term]); process_tuple.clone_to_fragment()? } }; let heap_fragment = Mutex::new(HeapFragment { heap_fragment, term: heap_fragment_message, }); DestinationEvent::Message { destination, heap_fragment, } } SourceEvent::StopWaiting => DestinationEvent::StopWaiting { process: Arc::downgrade(&arc_process), }, }; let position = self.position(monotonic); let timer = Timer { reference_number, monotonic, event: destination_event, position: Mutex::new(position), }; let arc_timer = Arc::new(timer); let timeoutable = Arc::clone(&arc_timer); let cancellable = Arc::downgrade(&arc_timer); match position { Position::AtOnce => self.at_once.start(timeoutable), Position::Soon { slot_index } => self.soon.start(slot_index, timeoutable), Position::Later { slot_index } => self.later.start(slot_index, timeoutable), Position::LongTerm => self.long_term.start(timeoutable), } self.timer_by_reference_number .insert(reference_number, cancellable); Ok(process_reference) } pub fn timeout(&mut self) { self.timeout_at_once(); let monotonic = monotonic::time(); let milliseconds = monotonic - self.soon.slot_monotonic; for _ in 0..milliseconds.into() { self.timeout_soon_slot(); assert!(self.soon.is_empty()); self.soon.next_slot(); let soon_max_monotonic = self.soon.max_monotonic(); if self.later.slot_monotonic <= soon_max_monotonic { self.transfer_later_to_soon(soon_max_monotonic); let later_next_slot_monotonic = self.later.next_slot_monotonic(); if later_next_slot_monotonic <= soon_max_monotonic { assert!(self.later.is_empty()); self.later.next_slot(); let later_max_monotonic = self.later.max_monotonic(); self.transfer_long_term_to_later(later_max_monotonic); } } } } fn timeout_at_once(&mut self) { for arc_timer in self.at_once.drain(..) { self.timer_by_reference_number .remove(&arc_timer.reference_number); Self::timeout_arc_timer(arc_timer); } } fn timeout_soon_slot(&mut self) { for arc_timer in self.soon.drain(..) { self.timer_by_reference_number .remove(&arc_timer.reference_number); Self::timeout_arc_timer(arc_timer); } } fn timeout_arc_timer(arc_timer: Arc<Timer>) { match Arc::try_unwrap(arc_timer) { Ok(timer) => timer.timeout(), Err(_) => panic!("Timer Dropped"), } } fn transfer(&mut self, mut transferable_arc_timer: Arc<Timer>, wheel_name: WheelName) { let wheel = match wheel_name { WheelName::Soon => &mut self.soon, WheelName::Later => &mut self.later, }; let slot_index = wheel.slot_index(transferable_arc_timer.monotonic); let position = match wheel_name { WheelName::Soon => Position::Soon { slot_index }, WheelName::Later => Position::Later { slot_index }, }; // Remove weak reference to allow `get_mut`. let reference_number = transferable_arc_timer.reference_number; self.timer_by_reference_number.remove(&reference_number); *Arc::get_mut(&mut transferable_arc_timer) .unwrap() .position .lock() = position; let timeoutable = Arc::clone(&transferable_arc_timer); let cancellable = Arc::downgrade(&transferable_arc_timer); wheel.start(slot_index, timeoutable); self.timer_by_reference_number .insert(reference_number, cancellable); } fn transfer_later_to_soon(&mut self, soon_max_monotonic: Monotonic) { let transferable_arc_timers: Vec<Arc<Timer>> = self.later.drain_before_or_at(soon_max_monotonic).collect(); for arc_timer in transferable_arc_timers { self.transfer(arc_timer, WheelName::Soon) } } fn transfer_long_term_to_later(&mut self, later_max_monotonic: Monotonic) { let transferable_arc_timers: Vec<Arc<Timer>> = self .long_term .drain_before_or_at(later_max_monotonic) .collect(); for arc_timer in transferable_arc_timers { self.transfer(arc_timer, WheelName::Later); } } } impl Debug for Hierarchy { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { f.write_str("Timers\n")?; write!(f, "At Once:\n{:?}\n", self.at_once)?; write!(f, "Soon:\n{:?}", self.soon)?; write!(f, "Later:\n{:?}", self.later)?; write!(f, "Long Term:\n{:?}\n", self.long_term) } } impl Default for Hierarchy { fn default() -> Hierarchy { let monotonic = monotonic::time(); let soon_slot_index = SlotIndex::from_monotonic( monotonic, Self::SOON_TOTAL_MILLISECONDS, Self::SOON_MILLISECONDS_PER_SLOT, ); // round down to nearest multiple let soon_slot_monotonic = monotonic.round_down(Self::SOON_TOTAL_MILLISECONDS.into()); let soon = Wheel::new( Self::SOON_MILLISECONDS_PER_SLOT, soon_slot_index, soon_slot_monotonic, ); // > The later wheel contain timers that are further away from 'pos' // > than the width of the soon timer wheel. // -- https://github.com/erlang/otp/blob/759ec896d7f254db2996cbb503c1ef883e6714b0/erts/emulator/beam/time.c#L68-L69 let later_monotonic = soon_slot_monotonic + Self::SOON_TOTAL_MILLISECONDS; let later_slot_index = SlotIndex::from_monotonic( later_monotonic, Self::LATER_TOTAL_MILLISECONDS, Self::LATER_MILLISECONDS_PER_SLOT, ); // round down to nearest multiple let later_slot_monotonic = later_monotonic.round_down(Self::LATER_MILLISECONDS_PER_SLOT.into()); let later = Wheel::new( Self::LATER_MILLISECONDS_PER_SLOT, later_slot_index, later_slot_monotonic, ); Hierarchy { at_once: Default::default(), soon, later, long_term: Default::default(), timer_by_reference_number: Default::default(), } } } // Hierarchies belong to Schedulers and Schedulers will never change threads unsafe impl Send for Hierarchy {} unsafe impl Sync for Hierarchy {} #[derive(Clone, Copy)] pub struct MillisecondsPerSlot(u64); impl MillisecondsPerSlot { const fn const_mul(self, slots: Slots) -> Milliseconds { Milliseconds(self.0 * (slots.0 as u64)) } } impl Add<MillisecondsPerSlot> for Monotonic { type Output = Monotonic; fn add(self, rhs: MillisecondsPerSlot) -> Monotonic { Self(self.0 + rhs.0) } } impl AddAssign<MillisecondsPerSlot> for Monotonic { fn add_assign(&mut self, rhs: MillisecondsPerSlot) { self.0 += rhs.0 } } impl Div<MillisecondsPerSlot> for Milliseconds { type Output = Slots; fn div(self, rhs: MillisecondsPerSlot) -> Slots { Slots((self.0 / rhs.0) as u16) } } impl From<MillisecondsPerSlot> for u64 { fn from(milliseconds_per_slot: MillisecondsPerSlot) -> u64 { milliseconds_per_slot.0 } } impl Mul<Slots> for MillisecondsPerSlot { type Output = Milliseconds; fn mul(self, slots: Slots) -> Milliseconds { self.const_mul(slots) } } /// Event coming from source #[derive(Debug)] pub enum SourceEvent { Message { destination: Destination, format: Format, term: Term, }, StopWaiting, } /// Format of `SourceEvent` `Message` #[derive(Debug)] pub enum Format { /// Sends only the `Timer` `message` Message, /// Sends `{:timeout, timer_reference, message}` TimeoutTuple, } struct Timer { // Can't be a `Boxed` `LocalReference` `Term` because those are boxed and the original Process // could GC the unboxed `LocalReference` `Term`. reference_number: ReferenceNumber, monotonic: Monotonic, event: DestinationEvent, position: Mutex<Position>, } impl Timer { fn milliseconds_remaining(&self) -> Milliseconds { // The timer may be read when it is past its timeout, but it has not been timed-out // by the scheduler. Without this, an underflow would occur. // `0` is returned on underflow because that is what Erlang returns. match self.monotonic.checked_sub(monotonic::time()) { Some(difference) => difference, None => Milliseconds(0), } } fn timeout(self) { match self.event { DestinationEvent::Message { destination, heap_fragment, } => { let option_destination_arc_process = match &destination { Destination::Name(ref name) => registry::atom_to_process(name), Destination::Process(destination_process_weak) => { destination_process_weak.upgrade() } }; if let Some(destination_arc_process) = option_destination_arc_process { let HeapFragment { heap_fragment, term, } = heap_fragment.into_inner(); destination_arc_process.send_heap_message(heap_fragment, term); destination_arc_process .scheduler() .unwrap() .stop_waiting(&destination_arc_process); } } DestinationEvent::StopWaiting { process } => { if let Some(destination_arc_process) = process.upgrade() { // `__lumen_builtin_receive_wait` will notice it has timed out, so only need to // stop waiting destination_arc_process .scheduler() .unwrap() .stop_waiting(&destination_arc_process); } } } } } impl Debug for Timer { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, " {} ", self.monotonic)?; match &self.event { DestinationEvent::Message { destination, heap_fragment, } => { let HeapFragment { term, .. } = *heap_fragment.lock(); write!(f, "{} -> ", term)?; match destination { Destination::Process(weak_process) => fmt_weak_process(weak_process, f), Destination::Name(name) => write!(f, "{}", name), }?; } DestinationEvent::StopWaiting { process } => { fmt_weak_process(process, f)?; write!(f, " stop waiting")?; } } if self.monotonic <= monotonic::time() { write!(f, " (expired)")?; } Ok(()) } } fn fmt_weak_process(weak_process: &Weak<Process>, f: &mut fmt::Formatter) -> fmt::Result { match weak_process.upgrade() { Some(arc_process) => write!(f, "{}", arc_process), None => write!(f, "Dead Process"), } } impl Eq for Timer {} impl PartialEq<Timer> for Timer { fn eq(&self, other: &Timer) -> bool { self.reference_number == other.reference_number } } impl Ord for Timer { fn cmp(&self, other: &Timer) -> Ordering { // Timers are ordered in reverse order as `BinaryHeap` is a max heap, but we want sooner // timers at the top other .monotonic .cmp(&self.monotonic) .then_with(|| other.reference_number.cmp(&self.reference_number)) } } impl PartialOrd for Timer { fn partial_cmp(&self, other: &Timer) -> Option<Ordering> { Some(self.cmp(other)) } } /// Event sent to destination enum DestinationEvent { /// Send message in `heap_fragment` to `destination`. Message { destination: Destination, heap_fragment: Mutex<HeapFragment>, }, /// Stop `process` from waiting StopWaiting { process: Weak<Process> }, } #[derive(Clone, Copy)] #[cfg_attr(debug_assertions, derive(Debug))] enum Position { AtOnce, Soon { slot_index: SlotIndex }, Later { slot_index: SlotIndex }, LongTerm, } /// A slot in the Hierarchy (for `at_once` and `long_term`) or a slot in a `Wheel` (for `soon` and /// `later`). #[derive(Clone, Default)] struct Slot(Vec<Arc<Timer>>); impl Slot { fn cancel(&mut self, reference_number: ReferenceNumber) -> Option<Arc<Timer>> { self.0 .iter() .position(|timer_rc| timer_rc.reference_number == reference_number) .map(|index| self.0.remove(index)) } fn drain<R>(&mut self, range: R) -> Drain<Arc<Timer>> where R: RangeBounds<usize>, { self.0.drain(range) } fn drain_before_or_at(&mut self, max_monotonic: Monotonic) -> Drain<Arc<Timer>> { let exclusive_end_bound = self .0 .binary_search_by(|arc_timer| match arc_timer.monotonic.cmp(&max_monotonic) { Equal => Less, ordering => ordering, }) .unwrap_err(); self.0.drain(0..exclusive_end_bound) } fn is_empty(&self) -> bool { self.0.is_empty() } fn start(&mut self, arc_timer: Arc<Timer>) { let index = self .0 .binary_search_by_key( &(arc_timer.monotonic, arc_timer.reference_number), |existing_arc_timer| { ( existing_arc_timer.monotonic, existing_arc_timer.reference_number, ) }, ) .unwrap_err(); self.0.insert(index, arc_timer) } } impl Debug for Slot { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { if self.0.is_empty() { write!(f, " No timers\n")?; } else { for arc_timer in &self.0 { write!(f, " {:?}\n", arc_timer)?; } } Ok(()) } } #[derive(Clone, Copy, Debug)] struct SlotIndex(u16); impl SlotIndex { fn from_monotonic( monotonic: Monotonic, total: Milliseconds, milliseconds_per_slot: MillisecondsPerSlot, ) -> SlotIndex { let remaining = monotonic % total; SlotIndex((remaining.0 / milliseconds_per_slot.0) as u16) } } impl Add<u16> for SlotIndex { type Output = SlotIndex; fn add(self, rhs: u16) -> SlotIndex { Self(self.0 + rhs) } } impl Add<Slots> for SlotIndex { type Output = SlotIndex; fn add(self, rhs: Slots) -> SlotIndex { Self(self.0 + rhs.0) } } impl Rem<Slots> for SlotIndex { type Output = SlotIndex; fn rem(self, rhs: Slots) -> SlotIndex { Self(self.0 % rhs.0) } } #[derive(Debug, Eq, PartialEq, PartialOrd)] pub struct Slots(u16); struct Wheel { milliseconds_per_slot: MillisecondsPerSlot, total_milliseconds: Milliseconds, slots: Vec<Slot>, slot_index: SlotIndex, slot_monotonic: Monotonic, } impl Wheel { // same as values used in BEAM const SLOTS: Slots = Slots(1 << 14); fn new( milliseconds_per_slot: MillisecondsPerSlot, slot_index: SlotIndex, slot_monotonic: Monotonic, ) -> Wheel { Wheel { milliseconds_per_slot, total_milliseconds: milliseconds_per_slot * Self::SLOTS, slots: vec![Default::default(); Self::SLOTS.0 as usize], slot_index, slot_monotonic, } } fn cancel( &mut self, slot_index: SlotIndex, reference_number: ReferenceNumber, ) -> Option<Arc<Timer>> { self.slots[slot_index.0 as usize].cancel(reference_number) } fn drain<R>(&mut self, range: R) -> Drain<Arc<Timer>> where R: RangeBounds<usize>, { self.slots[self.slot_index.0 as usize].drain(range) } fn drain_before_or_at(&mut self, max_monotonic: Monotonic) -> Drain<Arc<Timer>> { self.slots[self.slot_index.0 as usize].drain_before_or_at(max_monotonic) } fn is_empty(&self) -> bool { self.slots[self.slot_index.0 as usize].is_empty() } fn max_monotonic(&self) -> Monotonic { self.slot_monotonic + self.total_milliseconds - Milliseconds(1) } fn next_slot(&mut self) { self.slot_index = (self.slot_index + 1) % Self::SLOTS; self.slot_monotonic += self.milliseconds_per_slot; } fn next_slot_monotonic(&self) -> Monotonic { self.slot_monotonic + self.milliseconds_per_slot } fn slot_index(&self, monotonic: Monotonic) -> SlotIndex { let milliseconds = monotonic - self.slot_monotonic; let slots = milliseconds / self.milliseconds_per_slot; assert!(slots < Wheel::SLOTS, "monotonic ({:?}) is {:?} milliseconds ({:?} slots) away from slot_monotonic {:?}, but wheel only has {:?} slots ", monotonic, milliseconds, slots, self.slot_monotonic, Wheel::SLOTS); (self.slot_index + slots) % Wheel::SLOTS } fn start(&mut self, slot_index: SlotIndex, arc_timer: Arc<Timer>) { self.slots[slot_index.0 as usize].start(arc_timer) } } impl Debug for Wheel { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { writeln!( f, " milliseconds per slot: {:?}", self.milliseconds_per_slot.0 )?; writeln!(f, " slots: {:?}", self.slots.len())?; writeln!(f, " ____________")?; writeln!(f, " total milliseconds: {:?}", self.total_milliseconds)?; writeln!(f, "")?; writeln!(f, " slot index: {}", self.slot_index.0)?; write!(f, " slot time: {} ms", self.slot_monotonic)?; if self.slot_monotonic <= monotonic::time() { writeln!(f, " (expired)")?; } let mut has_timers = false; for slot in &self.slots { for arc_timer in &slot.0 { has_timers = true; writeln!(f, "{:?}", arc_timer)?; } } if !has_timers { writeln!(f, " No timers")?; } Ok(()) } } impl Index<u16> for Wheel { type Output = Slot; fn index(&self, slot_index: u16) -> &Slot { self.slots.index(slot_index as usize) } } impl IndexMut<u16> for Wheel { fn index_mut(&mut self, slot_index: u16) -> &mut Slot { self.slots.index_mut(slot_index as usize) } } enum WheelName { Soon, Later, } pub fn at_once_milliseconds() -> Milliseconds { Milliseconds(0) } pub fn soon_milliseconds() -> Milliseconds { let milliseconds = Milliseconds(1); assert!(milliseconds < Hierarchy::SOON_TOTAL_MILLISECONDS); milliseconds } pub fn later_milliseconds() -> Milliseconds { let milliseconds = Hierarchy::SOON_TOTAL_MILLISECONDS + Milliseconds(1); assert!(Hierarchy::SOON_TOTAL_MILLISECONDS < milliseconds); assert!(milliseconds < Hierarchy::LATER_TOTAL_MILLISECONDS); milliseconds } pub fn long_term_milliseconds() -> Milliseconds { let milliseconds = Hierarchy::SOON_TOTAL_MILLISECONDS + Hierarchy::LATER_TOTAL_MILLISECONDS + Milliseconds(1); assert!(Hierarchy::SOON_TOTAL_MILLISECONDS < milliseconds); assert!( (Hierarchy::SOON_TOTAL_MILLISECONDS + Hierarchy::LATER_TOTAL_MILLISECONDS) < milliseconds ); milliseconds }
use crate::sig::*; use nom::{ bytes::complete::{tag, take}, IResult, }; use std::fmt; #[derive(Debug)] pub struct BarpbresFe { source: Vec<u8>, } impl HasWrite for BarpbresFe { fn write(&self) -> Vec<u8> { let mut out = self.name().as_bytes().to_vec(); out.extend(&self.source); out } fn name(&self) -> &str { "barpbres.fe" } } impl fmt::Display for BarpbresFe { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "{} source.len: {}", &self.name(), &self.source.len()) } } pub fn read_barpbres_fe(i: &[u8]) -> IResult<&[u8], BarpbresFe> { let (i, _) = tag("barpbres.fe")(i)?; let (i, source) = take(10u8)(i)?; Ok(( i, BarpbresFe { source: source.to_vec(), }, )) }
use matches::matches; use super::*; use crate::key::Key; use crate::{Batching, Datastore}; pub fn test_basic_put_get<D: Datastore>(ds: &D) { let k = Key::new("foo"); let v = b"Hello Datastore!"; ds.put(k.clone(), v.to_vec()).unwrap(); let have = ds.has(&k).unwrap(); assert!(have); let size = ds.get_size(&k).unwrap(); assert_eq!(size, v.len()); let out = ds.get(&k).unwrap(); assert_eq!(out.as_slice(), v.as_ref()); // again after get let have = ds.has(&k).unwrap(); assert!(have); let size = ds.get_size(&k).unwrap(); assert_eq!(size, v.len()); ds.delete(&k).unwrap(); let have = ds.has(&k).unwrap(); assert!(!have); let r = ds.get_size(&k); assert!(matches!(r, Err(DSError::NotFound(_)))); } pub fn test_not_founds<D: Datastore>(ds: &D) { let badk = Key::new("notreal"); let r = ds.get(&badk); assert!(matches!(r, Err(DSError::NotFound(_)))); let has = ds.has(&badk).unwrap(); assert!(!has); let r = ds.get_size(&badk); assert!(matches!(r, Err(DSError::NotFound(_)))); } // TODO query limit // TODO query order // TODO manykeysandquery pub fn test_basic_sync<D: Datastore>(ds: &D) { ds.sync(&Key::new("foo")).unwrap(); ds.put(Key::new("/foo"), b"foo".to_vec()).unwrap(); ds.sync(&Key::new("/foo")).unwrap(); ds.put(Key::new("/foo/bar"), b"bar".to_vec()).unwrap(); ds.sync(&Key::new("/foo")).unwrap(); ds.sync(&Key::new("/foo/bar")).unwrap(); ds.sync(&Key::new("")).unwrap(); } // TODO query pub fn test_batch<D: Batching>(ds: &D) { let mut batch = ds.batch().unwrap(); let mut blocks = vec![]; let mut keys = vec![]; for _ in 0..20 { let blk: [u8; 32] = random!(); let key = Key::new(String::from_utf8_lossy(&blk[..8])); keys.push(key.clone()); blocks.push(blk); batch.put(key, blk.to_vec()).unwrap(); } for k in keys.iter() { let r = ds.get(k); assert!(matches!(r, Err(DSError::NotFound(_)))); } ds.commit(batch).unwrap(); for (i, k) in keys.iter().enumerate() { let r = ds.get(k).unwrap(); assert_eq!(r.as_slice(), blocks[i].as_ref()) } } pub fn test_batch_delete<D: Batching>(ds: &D) { let mut keys = vec![]; for _ in 0..20 { let blk: [u8; 16] = random!(); let key = Key::new(String::from_utf8_lossy(&blk[..8])); keys.push(key.clone()); ds.put(key, blk.to_vec()).unwrap(); } let mut batch = ds.batch().unwrap(); for k in keys.iter() { batch.delete(k).unwrap(); } ds.commit(batch).unwrap(); for k in keys.iter() { let r = ds.get(k); assert!(matches!(r, Err(DSError::NotFound(_)))); } } pub fn test_batch_put_and_delete<D: Batching>(ds: &D) { let mut batch = ds.batch().unwrap(); let ka = Key::new("/a"); let kb = Key::new("/b"); batch.put(ka.clone(), [1_u8].to_vec()).unwrap(); batch.put(kb.clone(), [2_u8].to_vec()).unwrap(); batch.delete(&ka).unwrap(); batch.delete(&kb).unwrap(); batch.put(kb.clone(), [3_u8].to_vec()).unwrap(); ds.commit(batch).unwrap(); let out = ds.get(&kb).unwrap(); assert_eq!(out.as_slice(), [3_u8].as_ref()); }
// Copyright 2020-2021, The Tremor Team // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. #![doc(hidden)] // We want to keep the names here #![allow(clippy::module_name_repetitions)] use crate::{ ast::{ base_expr, query, upable::Upable, ArrayPattern, ArrayPredicatePattern, AssignPattern, BinExpr, BinOpKind, Bytes, BytesPart, ClauseGroup, Comprehension, ComprehensionCase, Costly, DefaultCase, EmitExpr, EventPath, Expr, ExprPath, Expression, Field, FnDecl, FnDoc, Helper, Ident, IfElse, ImutExpr, ImutExprInt, Invocable, Invoke, InvokeAggr, InvokeAggrFn, List, Literal, LocalPath, Match, Merge, MetadataPath, ModDoc, NodeMetas, Patch, PatchOperation, Path, Pattern, PredicateClause, PredicatePattern, Record, RecordPattern, Recur, ReservedPath, Script, Segment, StatePath, StrLitElement, StringLit, TestExpr, TuplePattern, UnaryExpr, UnaryOpKind, }, errors::{ err_generic, error_generic, error_missing_effector, error_oops, Error, ErrorKind, Result, }, impl_expr, impl_expr_exraw, pos::{Location, Range}, prelude::*, registry::CustomFn, tilde::Extractor, KnownKey, Value, }; pub use base_expr::BaseExpr; use beef::Cow; use halfbrown::HashMap; pub use query::*; use serde::Serialize; /// A raw script we got to put this here because of silly lalrpoop focing it to be public #[derive(Debug, Clone, PartialEq, Serialize)] pub struct ScriptRaw<'script> { exprs: ExprsRaw<'script>, doc: Option<Vec<Cow<'script, str>>>, } impl<'script> ScriptRaw<'script> { pub(crate) fn new(exprs: ExprsRaw<'script>, doc: Option<Vec<Cow<'script, str>>>) -> Self { Self { exprs, doc } } pub(crate) fn up_script<'registry>( self, mut helper: &mut Helper<'script, 'registry>, ) -> Result<Script<'script>> { let mut exprs = vec![]; let last_idx = self.exprs.len() - 1; for (i, e) in self.exprs.into_iter().enumerate() { match e { ExprRaw::Module(m) => { m.define(&mut helper)?; } ExprRaw::Const { name, expr, start, end, comment, } => { let name_v = vec![name.to_string()]; let r = Range::from((start, end)); let expr = expr.up(&mut helper)?.try_reduce(helper)?; let v = expr.try_into_value(helper)?; let value_type = v.value_type(); let idx = helper.consts.insert(name_v, v).map_err(|_old| { Error::from(ErrorKind::DoubleConst( r.expand_lines(2), r, name.to_string(), )) })?; if i == last_idx { exprs.push(Expr::Imut(ImutExprInt::Local { is_const: true, idx, mid: helper.add_meta_w_name(start, end, &name), })); } helper.add_const_doc(&name, comment, value_type); } ExprRaw::FnDecl(f) => { helper.docs.fns.push(f.doc()); let f = f.up(&mut helper)?; helper.register_fun(f.into())?; } other => exprs.push(other.up(&mut helper)?), } } // We make sure the if we return `event` we turn it into `emit event` // While this is not required logically it allows us to // take advantage of the `emit event` optimisation if let Some(e) = exprs.last_mut() { if let Expr::Imut(ImutExprInt::Path(Path::Event(p))) = e { if p.segments.is_empty() { let expr = EmitExpr { mid: p.mid(), expr: ImutExprInt::Path(Path::Event(p.clone())), port: None, }; *e = Expr::Emit(Box::new(expr)); } } } else { let expr = EmitExpr { mid: 0, expr: ImutExprInt::Path(Path::Event(EventPath { mid: 0, segments: vec![], })), port: None, }; exprs.push(Expr::Emit(Box::new(expr))); } helper.docs.module = Some(ModDoc { name: "self".into(), doc: self .doc .map(|d| d.iter().map(|l| l.trim()).collect::<Vec<_>>().join("\n")), }); Ok(Script { imports: vec![], // Compiled out exprs, consts: helper.consts.clone(), aggregates: helper.aggregates.clone(), windows: helper.windows.clone(), locals: helper.locals.len(), node_meta: helper.meta.clone(), functions: helper.func_vec.clone(), docs: helper.docs.clone(), }) } } #[derive(Debug, PartialEq, Serialize, Clone, Copy)] pub enum BytesDataType { SignedInteger, UnsignedInteger, Binary, } impl Default for BytesDataType { fn default() -> Self { BytesDataType::UnsignedInteger } } #[derive(Debug, PartialEq, Serialize, Clone, Copy)] pub enum Endian { Little, Big, } impl Default for Endian { fn default() -> Self { Endian::Big } } #[derive(Debug, PartialEq, Serialize, Clone)] pub struct BytesPartRaw<'script> { pub start: Location, pub end: Location, pub data: ImutExprRaw<'script>, pub data_type: IdentRaw<'script>, pub bits: Option<i64>, } impl_expr!(BytesPartRaw); impl<'script> Default for BytesPartRaw<'script> { fn default() -> Self { BytesPartRaw { start: Location::default(), end: Location::default(), data: ImutExprRaw::Literal(LiteralRaw::default()), data_type: IdentRaw::default(), bits: None, } } } impl<'script> Upable<'script> for BytesPartRaw<'script> { type Target = BytesPart<'script>; // We allow this for casting the bits #[allow(clippy::cast_sign_loss)] fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let data_type: Vec<&str> = self.data_type.id.split('-').collect(); let (data_type, endianess) = match data_type.as_slice() { ["binary"] => (BytesDataType::Binary, Endian::Big), [] | ["" | "integer" | "big" | "unsigned"] | ["unsigned" | "big", "integer"] | ["big", "unsigned", "integer"] => (BytesDataType::UnsignedInteger, Endian::Big), ["signed", "integer"] | ["big", "signed", "integer"] => { (BytesDataType::SignedInteger, Endian::Big) } ["little"] | ["little", "integer"] | ["little", "unsigned", "integer"] => { (BytesDataType::UnsignedInteger, Endian::Little) } ["little", "signed", "integer"] => (BytesDataType::SignedInteger, Endian::Little), other => { return Err(err_generic( &self, &self, &format!("Not a valid data type: '{}'", other.join("-")), &helper.meta, )) } }; let bits = if let Some(bits) = self.bits { if bits <= 0 || bits > 64 { return Err(err_generic( &self, &self, &format!("negative bits or bits > 64 are are not allowed: {}", bits), &helper.meta, )); } bits as u64 } else { match data_type { BytesDataType::SignedInteger | BytesDataType::UnsignedInteger => 8, BytesDataType::Binary => 0, } }; Ok(BytesPart { mid: helper.add_meta(self.start, self.end), data: self.data.up(helper).map(ImutExpr)?, data_type, endianess, bits, }) } } #[derive(Debug, PartialEq, Serialize, Clone)] pub struct BytesRaw<'script> { pub start: Location, pub end: Location, pub bytes: Vec<BytesPartRaw<'script>>, } impl_expr!(BytesRaw); impl<'script> Upable<'script> for BytesRaw<'script> { type Target = Bytes<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(Bytes { mid: helper.add_meta(self.start, self.end), value: self .bytes .into_iter() .map(|b| b.up(helper)) .collect::<Result<_>>()?, }) } } /// we're forced to make this pub because of lalrpop #[derive(Debug, PartialEq, Serialize, Clone)] pub struct ModuleRaw<'script> { pub start: Location, pub end: Location, pub name: IdentRaw<'script>, pub exprs: ExprsRaw<'script>, pub doc: Option<Vec<Cow<'script, str>>>, } impl_expr!(ModuleRaw); impl<'script> ModuleRaw<'script> { pub(crate) fn define<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<()> { helper.module.push(self.name.to_string()); for e in self.exprs { match e { ExprRaw::Module(m) => { m.define(helper)?; } ExprRaw::Const { name, expr, start, end, .. } => { let mut name_v = helper.module.clone(); name_v.push(name.to_string()); let expr = expr.up(helper)?; let v = expr.try_into_value(helper)?; helper.consts.insert(name_v, v).map_err(|_old| { let r = Range::from((start, end)); ErrorKind::DoubleConst(r.expand_lines(2), r, name.to_string()) })?; } ExprRaw::FnDecl(f) => { let f = f.up(helper)?; let f = CustomFn { name: f.name.id, args: f.args.iter().map(ToString::to_string).collect(), locals: f.locals, body: f.body, is_const: false, // TODO: we should find a way to examine this open: f.open, inline: f.inline, }; helper.register_fun(f)?; } // ALLOW: the gramer doesn't allow this _ => unreachable!("Can't have expressions inside of modules"), } } helper.module.pop(); Ok(()) } } /// we're forced to make this pub because of lalrpop #[derive(Debug, PartialEq, Serialize, Clone, Default)] pub struct IdentRaw<'script> { pub start: Location, pub end: Location, pub id: beef::Cow<'script, str>, } impl_expr!(IdentRaw); impl<'script> ToString for IdentRaw<'script> { fn to_string(&self) -> String { self.id.to_string() } } impl<'script> Upable<'script> for IdentRaw<'script> { type Target = Ident<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(Self::Target { mid: helper.add_meta_w_name(self.start, self.end, &self.id), id: self.id, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct FieldRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) name: StringLitRaw<'script>, pub(crate) value: ImutExprRaw<'script>, } impl<'script> Upable<'script> for FieldRaw<'script> { type Target = Field<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let name = self.name.up(helper)?; Ok(Field { mid: helper.add_meta(self.start, self.end), name, value: self.value.up(helper)?, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct RecordRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) fields: FieldsRaw<'script>, } impl_expr!(RecordRaw); impl<'script> Upable<'script> for RecordRaw<'script> { type Target = Record<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(Record { base: crate::Object::new(), mid: helper.add_meta(self.start, self.end), fields: self.fields.up(helper)?, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ListRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) exprs: ImutExprsRaw<'script>, } impl_expr!(ListRaw); impl<'script> Upable<'script> for ListRaw<'script> { type Target = List<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(List { mid: helper.add_meta(self.start, self.end), exprs: self.exprs.up(helper)?.into_iter().map(ImutExpr).collect(), }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize, Default)] pub struct LiteralRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) value: Value<'script>, } impl_expr!(LiteralRaw); impl<'script> Upable<'script> for LiteralRaw<'script> { type Target = Literal<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(Literal { mid: helper.add_meta(self.start, self.end), value: self.value, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct StringLitRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) elements: StrLitElementsRaw<'script>, } #[cfg(not(feature = "erlang-float-testing"))] fn to_strl_elem(l: &Literal) -> StrLitElement<'static> { l.value.as_str().map_or_else( || StrLitElement::Lit(l.value.encode().into()), |s| StrLitElement::Lit(s.to_string().into()), ) } // TODO: The float scenario is different in erlang and rust // We knowingly excluded float correctness in string interpolation // as we don't want to over engineer and write own format functions. // any suggestions are welcome #[cfg(feature = "erlang-float-testing")] #[cfg(not(tarpaulin_include))] fn to_strl_elem(l: &Literal) -> StrLitElement<'static> { l.value.as_str().map_or_else( || { if let Some(_f) = l.value.as_f64() { StrLitElement::Lit("42".into()) } else { StrLitElement::Lit( crate::utils::sorted_serialize(&l.value) .unwrap_or_default() .into(), ) } }, |s| StrLitElement::Lit(s.to_string().into()), ) } impl<'script> Upable<'script> for StringLitRaw<'script> { type Target = StringLit<'script>; fn up<'registry>(mut self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let mid = helper.add_meta(self.start, self.end); self.elements.reverse(); let mut new = Vec::with_capacity(self.elements.len()); for e in self.elements { let next = match e { StrLitElementRaw::Expr(e) => { let i = e.up(helper)?; let i = i.try_reduce(helper)?; if let ImutExprInt::Literal(l) = i { to_strl_elem(&l) } else { StrLitElement::Expr(i) } } StrLitElementRaw::Lit(l) => StrLitElement::Lit(l), }; if let StrLitElement::Lit(next_lit) = next { if let Some(prev) = new.pop() { match prev { StrLitElement::Lit(l) => { let mut o = l.into_owned(); o.push_str(&next_lit); new.push(StrLitElement::Lit(o.into())); } prev @ StrLitElement::Expr(..) => { new.push(prev); new.push(StrLitElement::Lit(next_lit)); } } } else { new.push(StrLitElement::Lit(next_lit)); } } else { new.push(next); } } Ok(StringLit { mid, elements: new }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub enum StrLitElementRaw<'script> { Lit(Cow<'script, str>), Expr(ImutExprRaw<'script>), } impl<'script> From<ImutExprRaw<'script>> for StrLitElementRaw<'script> { fn from(e: ImutExprRaw<'script>) -> Self { StrLitElementRaw::Expr(e) } } impl<'script> From<Cow<'script, str>> for StrLitElementRaw<'script> { fn from(e: Cow<'script, str>) -> Self { StrLitElementRaw::Lit(e) } } impl<'script> From<&'script str> for StrLitElementRaw<'script> { fn from(e: &'script str) -> Self { StrLitElementRaw::Lit(e.into()) } } /// we're forced to make this pub because of lalrpop pub type StrLitElementsRaw<'script> = Vec<StrLitElementRaw<'script>>; /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum ExprRaw<'script> { /// we're forced to make this pub because of lalrpop Const { /// we're forced to make this pub because of lalrpop name: Cow<'script, str>, /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, /// we're forced to make this pub because of lalrpop start: Location, /// we're forced to make this pub because of lalrpop end: Location, /// we're forced to make this pub because of lalrpop comment: Option<Vec<Cow<'script, str>>>, }, /// we're forced to make this pub because of lalrpop Module(ModuleRaw<'script>), /// we're forced to make this pub because of lalrpop MatchExpr(Box<MatchRaw<'script, Self>>), /// we're forced to make this pub because of lalrpop Assign(Box<AssignRaw<'script>>), /// we're forced to make this pub because of lalrpop Comprehension(Box<ComprehensionRaw<'script, Self>>), Drop { /// we're forced to make this pub because of lalrpop start: Location, /// we're forced to make this pub because of lalrpop end: Location, }, /// we're forced to make this pub because of lalrpop Emit(Box<EmitExprRaw<'script>>), /// we're forced to make this pub because of lalrpop FnDecl(AnyFnRaw<'script>), /// we're forced to make this pub because of lalrpop Imut(ImutExprRaw<'script>), } impl<'script> ExpressionRaw<'script> for ExprRaw<'script> {} fn is_one_simple_group<'script>(patterns: &[ClauseGroup<'script, Expr<'script>>]) -> bool { let is_one = patterns.len() == 1; let is_simple = patterns .first() .map(|cg| { if let ClauseGroup::Simple { precondition: None, patterns, } = cg { patterns.len() == 1 } else { false } }) .unwrap_or_default(); is_one && is_simple } impl<'script> Upable<'script> for ExprRaw<'script> { type Target = Expr<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(match self { ExprRaw::FnDecl(_) | ExprRaw::Const { .. } | ExprRaw::Module(ModuleRaw { .. }) => { // ALLOW: There is no code path that leads here, unreachable!() } ExprRaw::MatchExpr(m) => match m.up(helper)? { Match { mid, target, mut patterns, default, } if is_one_simple_group(&patterns) => { if let Some(ClauseGroup::Simple { precondition: None, mut patterns, }) = patterns.pop() { if let Some(if_clause) = patterns.pop() { let ie = IfElse { mid, target, if_clause, else_clause: default, }; Expr::IfElse(Box::new(ie)) } else { return Err("Invalid group clause with 0 patterns".into()); } } else { // ALLOW: we check patterns.len() above unreachable!() } } m => Expr::Match(Box::new(m)), }, ExprRaw::Assign(a) => { let path = a.path.up(helper)?; let mid = helper.add_meta(a.start, a.end); match a.expr.up(helper)? { Expr::Imut(ImutExprInt::Merge(m)) => Expr::Assign { mid, path, expr: Box::new(ImutExprInt::Merge(m).into()), }, Expr::Imut(ImutExprInt::Patch(m)) => Expr::Assign { mid, path, expr: Box::new(ImutExprInt::Patch(m).into()), }, expr => Expr::Assign { mid, path, expr: Box::new(expr), }, } } ExprRaw::Comprehension(c) => Expr::Comprehension(Box::new(c.up(helper)?)), ExprRaw::Drop { start, end } => { let mid = helper.add_meta(start, end); if !helper.can_emit { return Err(ErrorKind::InvalidDrop( Range(start, end).expand_lines(2), Range(start, end), ) .into()); } Expr::Drop { mid } } ExprRaw::Emit(e) => Expr::Emit(Box::new(e.up(helper)?)), ExprRaw::Imut(i) => i.up(helper)?.into(), }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct FnDeclRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) name: IdentRaw<'script>, pub(crate) args: Vec<IdentRaw<'script>>, pub(crate) body: ExprsRaw<'script>, pub(crate) doc: Option<Vec<Cow<'script, str>>>, pub(crate) open: bool, pub(crate) inline: bool, } impl_expr!(FnDeclRaw); impl<'script> FnDeclRaw<'script> { pub(crate) fn doc(&self) -> FnDoc { FnDoc { name: self.name.to_string(), args: self.args.iter().map(|a| a.to_string()).collect(), open: self.open, doc: self .doc .clone() .map(|d| d.iter().map(|l| l.trim()).collect::<Vec<_>>().join("\n")), } } } impl<'script> Upable<'script> for FnDeclRaw<'script> { type Target = FnDecl<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let can_emit = helper.can_emit; let mut aggrs = Vec::new(); let mut locals: HashMap<_, _> = self .args .iter() .enumerate() .map(|(i, a)| (a.to_string(), i)) .collect(); helper.can_emit = false; helper.is_open = self.open; helper.fn_argc = self.args.len(); helper.swap(&mut aggrs, &mut locals); helper.possible_leaf = true; let body = self.body.up(helper)?; helper.possible_leaf = false; helper.swap(&mut aggrs, &mut locals); helper.can_emit = can_emit; let name = self.name.up(helper)?; Ok(FnDecl { mid: helper.add_meta_w_name(self.start, self.end, &name.id), name, args: self.args.up(helper)?, body, locals: locals.len(), open: self.open, inline: self.inline, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum AnyFnRaw<'script> { /// we're forced to make this pub because of lalrpop Match(MatchFnDeclRaw<'script>), /// we're forced to make this pub because of lalrpop Normal(FnDeclRaw<'script>), } impl<'script> AnyFnRaw<'script> { pub(crate) fn doc(&self) -> FnDoc { match self { AnyFnRaw::Match(f) => f.doc(), AnyFnRaw::Normal(f) => f.doc(), } } } impl<'script> Upable<'script> for AnyFnRaw<'script> { type Target = FnDecl<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { match self { AnyFnRaw::Normal(f) => f.up(helper), AnyFnRaw::Match(f) => f.up(helper), } } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct MatchFnDeclRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) name: IdentRaw<'script>, pub(crate) args: Vec<IdentRaw<'script>>, pub(crate) cases: Vec<PredicateClauseRaw<'script, ExprRaw<'script>>>, pub(crate) doc: Option<Vec<Cow<'script, str>>>, pub(crate) open: bool, pub(crate) inline: bool, } impl_expr!(MatchFnDeclRaw); impl<'script> MatchFnDeclRaw<'script> { pub(crate) fn doc(&self) -> FnDoc { FnDoc { name: self.name.to_string(), args: self.args.iter().map(|a| a.to_string()).collect(), open: self.open, doc: self .doc .clone() .map(|d| d.iter().map(|l| l.trim()).collect::<Vec<_>>().join("\n")), } } } impl<'script> Upable<'script> for MatchFnDeclRaw<'script> { type Target = FnDecl<'script>; fn up<'registry>(mut self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let can_emit = helper.can_emit; let mut aggrs = Vec::new(); let mut locals = HashMap::new(); for (i, a) in self.args.iter().enumerate() { locals.insert(a.to_string(), i); } helper.is_open = self.open; helper.fn_argc = self.args.len(); helper.can_emit = false; helper.swap(&mut aggrs, &mut locals); let target = self .args .iter() .map(|a| { ImutExprRaw::Path(PathRaw::Local(LocalPathRaw { start: a.start, end: a.end, segments: vec![SegmentRaw::from_id(a.clone())], })) }) .collect(); let mut patterns = Vec::new(); std::mem::swap(&mut self.cases, &mut patterns); let patterns = patterns .into_iter() .map(|mut c: PredicateClauseRaw<_>| { if c.pattern != PatternRaw::Default { let args = self.args.iter().enumerate(); let mut exprs: Vec<_> = args .map(|(i, a)| { ExprRaw::Assign(Box::new(AssignRaw { start: c.start, end: c.end, path: PathRaw::Local(LocalPathRaw { start: a.start, end: a.end, segments: vec![SegmentRaw::from_id(a.clone())], }), expr: ExprRaw::Imut(ImutExprRaw::Path(PathRaw::Local( LocalPathRaw { start: a.start, end: a.end, segments: vec![ SegmentRaw::from_str(FN_RES_NAME, a.start, a.end), SegmentRaw::from_usize(i, a.start, a.end), ], }, ))), })) }) .collect(); exprs.append(&mut c.exprs); c.exprs = exprs; } c }) .collect(); let body = ExprRaw::MatchExpr(Box::new(MatchRaw { start: self.start, end: self.end, target: ImutExprRaw::List(Box::new(ListRaw { start: self.start, end: self.end, exprs: target, })), patterns, })); helper.possible_leaf = true; let body = body.up(helper)?; helper.possible_leaf = false; let body = vec![body]; helper.swap(&mut aggrs, &mut locals); helper.can_emit = can_emit; let name = self.name.up(helper)?; Ok(FnDecl { mid: helper.add_meta_w_name(self.start, self.end, &name), name, args: self.args.up(helper)?, body, locals: locals.len(), open: self.open, inline: self.inline, }) } } /// A raw expression pub trait ExpressionRaw<'script>: Clone + std::fmt::Debug + PartialEq + Serialize + Upable<'script> where <Self as Upable<'script>>::Target: Expression + 'script, { } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum ImutExprRaw<'script> { /// we're forced to make this pub because of lalrpop Record(Box<RecordRaw<'script>>), /// we're forced to make this pub because of lalrpop List(Box<ListRaw<'script>>), /// we're forced to make this pub because of lalrpop Patch(Box<PatchRaw<'script>>), /// we're forced to make this pub because of lalrpop Merge(Box<MergeRaw<'script>>), /// we're forced to make this pub because of lalrpop Match(Box<MatchRaw<'script, Self>>), /// we're forced to make this pub because of lalrpop Comprehension(Box<ComprehensionRaw<'script, Self>>), /// we're forced to make this pub because of lalrpop Path(PathRaw<'script>), /// we're forced to make this pub because of lalrpop Binary(Box<BinExprRaw<'script>>), /// we're forced to make this pub because of lalrpop Unary(Box<UnaryExprRaw<'script>>), /// we're forced to make this pub because of lalrpop Literal(LiteralRaw<'script>), /// we're forced to make this pub because of lalrpop Invoke(InvokeRaw<'script>), /// we're forced to make this pub because of lalrpop Present { /// we're forced to make this pub because of lalrpop path: PathRaw<'script>, /// we're forced to make this pub because of lalrpop start: Location, /// we're forced to make this pub because of lalrpop end: Location, }, /// we're forced to make this pub because of lalrpop String(StringLitRaw<'script>), /// we're forced to make this pub because of lalrpop Recur(RecurRaw<'script>), /// bytes Bytes(BytesRaw<'script>), } impl<'script> ExpressionRaw<'script> for ImutExprRaw<'script> {} impl<'script> Upable<'script> for ImutExprRaw<'script> { type Target = ImutExprInt<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let was_leaf = helper.possible_leaf; helper.possible_leaf = false; let r = match self { ImutExprRaw::Recur(r) => { helper.possible_leaf = was_leaf; ImutExprInt::Recur(r.up(helper)?) } ImutExprRaw::Binary(b) => { ImutExprInt::Binary(Box::new(b.up(helper)?)).try_reduce(helper)? } ImutExprRaw::Unary(u) => { ImutExprInt::Unary(Box::new(u.up(helper)?)).try_reduce(helper)? } ImutExprRaw::String(s) => ImutExprInt::String(s.up(helper)?).try_reduce(helper)?, ImutExprRaw::Record(r) => ImutExprInt::Record(r.up(helper)?).try_reduce(helper)?, ImutExprRaw::List(l) => ImutExprInt::List(l.up(helper)?).try_reduce(helper)?, ImutExprRaw::Patch(p) => { ImutExprInt::Patch(Box::new(p.up(helper)?)).try_reduce(helper)? } ImutExprRaw::Merge(m) => { ImutExprInt::Merge(Box::new(m.up(helper)?)).try_reduce(helper)? } ImutExprRaw::Present { path, start, end } => ImutExprInt::Present { path: path.up(helper)?, mid: helper.add_meta(start, end), } .try_reduce(helper)?, ImutExprRaw::Path(p) => match p.up(helper)? { Path::Local(LocalPath { is_const, mid, idx, ref segments, }) if segments.is_empty() => ImutExprInt::Local { mid, idx, is_const }, p => ImutExprInt::Path(p), } .try_reduce(helper)?, ImutExprRaw::Literal(l) => ImutExprInt::Literal(l.up(helper)?).try_reduce(helper)?, ImutExprRaw::Invoke(i) => { if i.is_aggregate(helper) { ImutExprInt::InvokeAggr(i.into_aggregate().up(helper)?) } else { let i = i.up(helper)?; let i = if i.can_inline() { i.inline()? } else { match i.args.len() { 1 => ImutExprInt::Invoke1(i), 2 => ImutExprInt::Invoke2(i), 3 => ImutExprInt::Invoke3(i), _ => ImutExprInt::Invoke(i), } }; i.try_reduce(helper)? } } ImutExprRaw::Match(m) => { helper.possible_leaf = was_leaf; ImutExprInt::Match(Box::new(m.up(helper)?)) } ImutExprRaw::Comprehension(c) => ImutExprInt::Comprehension(Box::new(c.up(helper)?)), ImutExprRaw::Bytes(b) => ImutExprInt::Bytes(b.up(helper)?).try_reduce(helper)?, }; helper.possible_leaf = was_leaf; Ok(r) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct RecurRaw<'script> { pub start: Location, pub end: Location, pub exprs: ImutExprsRaw<'script>, } impl_expr!(RecurRaw); impl<'script> Upable<'script> for RecurRaw<'script> { type Target = Recur<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let was_leaf = helper.possible_leaf; helper.possible_leaf = false; if !was_leaf { return Err(ErrorKind::InvalidRecur( self.extent(&helper.meta).expand_lines(2), self.extent(&helper.meta), ) .into()); }; if (helper.is_open && helper.fn_argc < self.exprs.len()) || (!helper.is_open && helper.fn_argc != self.exprs.len()) { return error_generic( &self, &self, &format!( "Wrong number of arguments expected {} but got {}", helper.fn_argc, self.exprs.len() ), &helper.meta, ); } let exprs = self.exprs.up(helper)?.into_iter().map(ImutExpr).collect(); helper.possible_leaf = was_leaf; Ok(Recur { mid: helper.add_meta(self.start, self.end), argc: helper.fn_argc, open: helper.is_open, exprs, }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct EmitExprRaw<'script> { pub start: Location, pub end: Location, pub expr: ImutExprRaw<'script>, pub port: Option<ImutExprRaw<'script>>, } impl_expr!(EmitExprRaw); impl<'script> Upable<'script> for EmitExprRaw<'script> { type Target = EmitExpr<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { if !helper.can_emit { return Err(ErrorKind::InvalidEmit( self.extent(&helper.meta).expand_lines(2), self.extent(&helper.meta), ) .into()); } Ok(EmitExpr { mid: helper.add_meta(self.start, self.end), expr: self.expr.up(helper)?, port: self.port.up(helper)?, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct AssignRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) path: PathRaw<'script>, pub(crate) expr: ExprRaw<'script>, } impl_expr!(AssignRaw); /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct PredicateClauseRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { pub(crate) start: Location, pub(crate) end: Location, pub(crate) pattern: PatternRaw<'script>, pub(crate) guard: Option<ImutExprRaw<'script>>, pub(crate) exprs: Vec<Ex>, } impl<'script, Ex> Upable<'script> for PredicateClauseRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { type Target = PredicateClause<'script, <Ex as Upable<'script>>::Target>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let was_leaf = helper.possible_leaf; helper.possible_leaf = false; // We run the pattern first as this might reserve a local shadow let pattern = self.pattern.up(helper)?; let guard = self.guard.up(helper)?; helper.possible_leaf = was_leaf; let mut exprs = self.exprs.up(helper)?; // If we are in an assign pattern we'd have created // a shadow variable, this needs to be undoine at the end if pattern.is_assign() { helper.end_shadow_var(); } if let Pattern::Assign(AssignPattern { idx, .. }) = &pattern { if let Some(expr) = exprs.last_mut() { expr.replace_last_shadow_use(*idx); }; } let span = Range::from((self.start, self.end)); let last_expr = exprs .pop() .ok_or_else(|| error_missing_effector(&span, &span, &helper.meta))?; Ok(PredicateClause { mid: helper.add_meta(self.start, self.end), pattern, guard, exprs, last_expr, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct PatchRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) target: ImutExprRaw<'script>, pub(crate) operations: PatchOperationsRaw<'script>, } impl<'script> Upable<'script> for PatchRaw<'script> { type Target = Patch<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let operations = self.operations.up(helper)?; Ok(Patch { mid: helper.add_meta(self.start, self.end), target: self.target.up(helper)?, operations, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum PatchOperationRaw<'script> { /// we're forced to make this pub because of lalrpop Insert { /// we're forced to make this pub because of lalrpop ident: StringLitRaw<'script>, /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, }, /// we're forced to make this pub because of lalrpop Upsert { /// we're forced to make this pub because of lalrpop ident: StringLitRaw<'script>, /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, }, /// we're forced to make this pub because of lalrpop Update { /// we're forced to make this pub because of lalrpop ident: StringLitRaw<'script>, /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, }, /// we're forced to make this pub because of lalrpop Erase { /// we're forced to make this pub because of lalrpop ident: StringLitRaw<'script>, }, /// we're forced to make this pub because of lalrpop Copy { /// we're forced to make this pub because of lalrpop from: StringLitRaw<'script>, /// we're forced to make this pub because of lalrpop to: StringLitRaw<'script>, }, /// we're forced to make this pub because of lalrpop Move { /// we're forced to make this pub because of lalrpop from: StringLitRaw<'script>, /// we're forced to make this pub because of lalrpop to: StringLitRaw<'script>, }, /// we're forced to make this pub because of lalrpop Merge { /// we're forced to make this pub because of lalrpop ident: StringLitRaw<'script>, /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, }, /// we're forced to make this pub because of lalrpop MergeRecord { /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, }, /// we're forced to make this pub because of lalrpop Default { /// we're forced to make this pub because of lalrpop ident: StringLitRaw<'script>, /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, }, /// we're forced to make this pub because of lalrpop DefaultRecord { /// we're forced to make this pub because of lalrpop expr: ImutExprRaw<'script>, }, } impl<'script> Upable<'script> for PatchOperationRaw<'script> { type Target = PatchOperation<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { use PatchOperationRaw::{Copy, Erase, Insert, Merge, MergeRecord, Move, Update, Upsert}; Ok(match self { Insert { ident, expr } => PatchOperation::Insert { ident: ident.up(helper)?, expr: expr.up(helper)?, }, Upsert { ident, expr } => PatchOperation::Upsert { ident: ident.up(helper)?, expr: expr.up(helper)?, }, Update { ident, expr } => PatchOperation::Update { ident: ident.up(helper)?, expr: expr.up(helper)?, }, Erase { ident } => PatchOperation::Erase { ident: ident.up(helper)?, }, Copy { from, to } => PatchOperation::Copy { from: from.up(helper)?, to: to.up(helper)?, }, Move { from, to } => PatchOperation::Move { from: from.up(helper)?, to: to.up(helper)?, }, Merge { expr, ident, .. } => PatchOperation::Merge { ident: ident.up(helper)?, expr: expr.up(helper)?, }, MergeRecord { expr } => PatchOperation::MergeRecord { expr: expr.up(helper)?, }, PatchOperationRaw::Default { ident, expr } => PatchOperation::Default { ident: ident.up(helper)?, expr: expr.up(helper)?, }, PatchOperationRaw::DefaultRecord { expr } => PatchOperation::DefaultRecord { expr: expr.up(helper)?, }, }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct MergeRaw<'script> { pub start: Location, pub end: Location, pub target: ImutExprRaw<'script>, pub expr: ImutExprRaw<'script>, } impl<'script> Upable<'script> for MergeRaw<'script> { type Target = Merge<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(Merge { mid: helper.add_meta(self.start, self.end), target: self.target.up(helper)?, expr: self.expr.up(helper)?, }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ComprehensionRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { pub start: Location, pub end: Location, pub target: ImutExprRaw<'script>, pub cases: ComprehensionCasesRaw<'script, Ex>, } impl_expr_exraw!(ComprehensionRaw); impl<'script, Ex> Upable<'script> for ComprehensionRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { type Target = Comprehension<'script, Ex::Target>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { // We compute the target before shadowing the key and value let target = self.target.up(helper)?; // We know that each case will have a key and a value as a shadowed // variable so we reserve two ahead of time so we know what id's those // will be. let (key_id, val_id) = helper.reserve_2_shadow(); let cases = self.cases.up(helper)?; Ok(Comprehension { mid: helper.add_meta(self.start, self.end), target, cases, key_id, val_id, }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ImutComprehensionRaw<'script> { pub start: Location, pub end: Location, pub target: ImutExprRaw<'script>, pub cases: ImutComprehensionCasesRaw<'script>, } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ComprehensionCaseRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { pub(crate) start: Location, pub(crate) end: Location, pub(crate) key_name: Cow<'script, str>, pub(crate) value_name: Cow<'script, str>, pub(crate) guard: Option<ImutExprRaw<'script>>, pub(crate) exprs: Vec<Ex>, } impl<'script, Ex> Upable<'script> for ComprehensionCaseRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { type Target = ComprehensionCase<'script, Ex::Target>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { // regiter key and value as shadowed variables let key_idx = helper.register_shadow_var(&self.key_name); let val_idx = helper.register_shadow_var(&self.value_name); let guard = self.guard.up(helper)?; let mut exprs = self.exprs.up(helper)?; if let Some(expr) = exprs.last_mut() { expr.replace_last_shadow_use(key_idx); expr.replace_last_shadow_use(val_idx); }; // unregister them again helper.end_shadow_var(); helper.end_shadow_var(); let span = Range::from((self.start, self.end)); let last_expr = exprs .pop() .ok_or_else(|| error_missing_effector(&span, &span, &helper.meta))?; Ok(ComprehensionCase { mid: helper.add_meta(self.start, self.end), key_name: self.key_name, value_name: self.value_name, guard, exprs, last_expr, }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ImutComprehensionCaseRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) key_name: Cow<'script, str>, pub(crate) value_name: Cow<'script, str>, pub(crate) guard: Option<ImutExprRaw<'script>>, pub(crate) exprs: ImutExprsRaw<'script>, } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum PatternRaw<'script> { /// we're forced to make this pub because of lalrpop Record(RecordPatternRaw<'script>), /// we're forced to make this pub because of lalrpop Array(ArrayPatternRaw<'script>), /// we're forced to make this pub because of lalrpop Tuple(TuplePatternRaw<'script>), /// we're forced to make this pub because of lalrpop Expr(ImutExprRaw<'script>), /// we're forced to make this pub because of lalrpop Assign(AssignPatternRaw<'script>), /// a test expression Extract(TestExprRaw), /// we're forced to make this pub because of lalrpop DoNotCare, /// we're forced to make this pub because of lalrpop Default, } impl<'script> Upable<'script> for PatternRaw<'script> { type Target = Pattern<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { use PatternRaw::{Array, Assign, Default, DoNotCare, Expr, Extract, Record, Tuple}; Ok(match self { //Predicate(pp) => Pattern::Predicate(pp.up(helper)?), Record(rp) => Pattern::Record(rp.up(helper)?), Array(ap) => Pattern::Array(ap.up(helper)?), Tuple(tp) => Pattern::Tuple(tp.up(helper)?), Expr(expr) => Pattern::Expr(expr.up(helper)?), Assign(ap) => Pattern::Assign(ap.up(helper)?), Extract(e) => Pattern::Extract(Box::new(e.up(helper)?)), DoNotCare => Pattern::DoNotCare, Default => Pattern::Default, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum PredicatePatternRaw<'script> { /// we're forced to make this pub because of lalrpop TildeEq { /// we're forced to make this pub because of lalrpop assign: Cow<'script, str>, /// we're forced to make this pub because of lalrpop lhs: Cow<'script, str>, /// we're forced to make this pub because of lalrpop test: TestExprRaw, }, /// we're forced to make this pub because of lalrpop Bin { /// we're forced to make this pub because of lalrpop lhs: Cow<'script, str>, /// we're forced to make this pub because of lalrpop rhs: ImutExprRaw<'script>, /// we're forced to make this pub because of lalrpop kind: BinOpKind, }, /// we're forced to make this pub because of lalrpop RecordPatternEq { /// we're forced to make this pub because of lalrpop lhs: Cow<'script, str>, /// we're forced to make this pub because of lalrpop pattern: RecordPatternRaw<'script>, }, /// we're forced to make this pub because of lalrpop ArrayPatternEq { /// we're forced to make this pub because of lalrpop lhs: Cow<'script, str>, /// we're forced to make this pub because of lalrpop pattern: ArrayPatternRaw<'script>, }, /// we're forced to make this pub because of lalrpop FieldPresent { /// we're forced to make this pub because of lalrpop lhs: Cow<'script, str>, }, /// we're forced to make this pub because of lalrpop FieldAbsent { /// we're forced to make this pub because of lalrpop lhs: Cow<'script, str>, }, } impl<'script> Upable<'script> for PredicatePatternRaw<'script> { type Target = PredicatePattern<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { use PredicatePatternRaw::{ ArrayPatternEq, Bin, FieldAbsent, FieldPresent, RecordPatternEq, TildeEq, }; Ok(match self { TildeEq { assign, lhs, test } => PredicatePattern::TildeEq { assign, key: KnownKey::from(lhs.clone()), lhs, test: Box::new(test.up(helper)?), }, Bin { lhs, rhs, kind } => PredicatePattern::Bin { key: KnownKey::from(lhs.clone()), lhs, rhs: rhs.up(helper)?, kind, }, RecordPatternEq { lhs, pattern } => PredicatePattern::RecordPatternEq { key: KnownKey::from(lhs.clone()), lhs, pattern: pattern.up(helper)?, }, ArrayPatternEq { lhs, pattern } => PredicatePattern::ArrayPatternEq { key: KnownKey::from(lhs.clone()), lhs, pattern: pattern.up(helper)?, }, FieldPresent { lhs } => PredicatePattern::FieldPresent { key: KnownKey::from(lhs.clone()), lhs, }, FieldAbsent { lhs } => PredicatePattern::FieldAbsent { key: KnownKey::from(lhs.clone()), lhs, }, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct RecordPatternRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) fields: PatternFieldsRaw<'script>, } impl<'script> Upable<'script> for RecordPatternRaw<'script> { type Target = RecordPattern<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let fields = self.fields.up(helper)?; let present_fields: Vec<Cow<str>> = fields .iter() .filter_map(|f| { if let PredicatePattern::FieldPresent { lhs, .. } = f { Some(lhs.clone()) } else { None } }) .collect(); let absent_fields: Vec<Cow<str>> = fields .iter() .filter_map(|f| { if let PredicatePattern::FieldAbsent { lhs, .. } = f { Some(lhs.clone()) } else { None } }) .collect(); for present in &present_fields { let duplicated = fields.iter().any(|f| { if let PredicatePattern::FieldPresent { .. } = f { false } else { f.lhs() == present } }); if duplicated { let extent = (self.start, self.end).into(); helper.warn( extent, extent.expand_lines(2), &format!("The field {} is checked with both present and another extractor, this is redundant as extractors imply presence. It may also overwrite the result of the extractor.", present), ); } } for absent in &absent_fields { let duplicated = fields.iter().any(|f| { if let PredicatePattern::FieldAbsent { .. } = f { false } else { f.lhs() == absent } }); if duplicated { let extent = (self.start, self.end).into(); helper.warn( extent, extent.expand_lines(2), &format!("The field {} is checked with both absence and another extractor, this test can never be true.", absent), ); } } Ok(RecordPattern { mid: helper.add_meta(self.start, self.end), fields, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum ArrayPredicatePatternRaw<'script> { /// we're forced to make this pub because of lalrpop Expr(ImutExprRaw<'script>), /// we're forced to make this pub because of lalrpop Tilde(TestExprRaw), /// we're forced to make this pub because of lalrpop Record(RecordPatternRaw<'script>), /// Ignore Ignore, } impl<'script> Upable<'script> for ArrayPredicatePatternRaw<'script> { type Target = ArrayPredicatePattern<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { use ArrayPredicatePatternRaw::{Expr, Ignore, Record, Tilde}; Ok(match self { Expr(expr) => ArrayPredicatePattern::Expr(expr.up(helper)?), Tilde(te) => ArrayPredicatePattern::Tilde(Box::new(te.up(helper)?)), Record(rp) => ArrayPredicatePattern::Record(rp.up(helper)?), Ignore => ArrayPredicatePattern::Ignore, //Array(ap) => ArrayPredicatePattern::Array(ap), }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ArrayPatternRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) exprs: ArrayPredicatePatternsRaw<'script>, } impl<'script> Upable<'script> for ArrayPatternRaw<'script> { type Target = ArrayPattern<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let exprs = self.exprs.up(helper)?; Ok(ArrayPattern { mid: helper.add_meta(self.start, self.end), exprs, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct TuplePatternRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) exprs: ArrayPredicatePatternsRaw<'script>, pub(crate) open: bool, } impl<'script> Upable<'script> for TuplePatternRaw<'script> { type Target = TuplePattern<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let exprs = self.exprs.up(helper)?; Ok(TuplePattern { mid: helper.add_meta(self.start, self.end), exprs, open: self.open, }) } } pub(crate) const FN_RES_NAME: &str = "__fn_assign_this_is_ugly"; /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct AssignPatternRaw<'script> { pub(crate) id: Cow<'script, str>, pub(crate) pattern: Box<PatternRaw<'script>>, } impl<'script> Upable<'script> for AssignPatternRaw<'script> { type Target = AssignPattern<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(AssignPattern { idx: helper.register_shadow_var(&self.id), id: self.id, pattern: Box::new(self.pattern.up(helper)?), }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum PathRaw<'script> { /// we're forced to make this pub because of lalrpop Local(LocalPathRaw<'script>), /// we're forced to make this pub because of lalrpop Event(EventPathRaw<'script>), /// we're forced to make this pub because of lalrpop State(StatePathRaw<'script>), /// we're forced to make this pub because of lalrpop Meta(MetadataPathRaw<'script>), /// we're forced to make this pub because of lalrpop Const(ConstPathRaw<'script>), /// Special reserved path Reserved(ReservedPathRaw<'script>), /// Special reserved path an expression path Expr(ExprPathRaw<'script>), } impl<'script> Upable<'script> for PathRaw<'script> { type Target = Path<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { use PathRaw::{Const, Event, Expr, Local, Meta, Reserved, State}; Ok(match self { Local(p) => { let p = p.up(helper)?; if p.is_const { Path::Const(p) } else { Path::Local(p) } } Const(p) => Path::Const(p.up(helper)?), Event(p) => Path::Event(p.up(helper)?), State(p) => Path::State(p.up(helper)?), Meta(p) => Path::Meta(p.up(helper)?), Expr(p) => Path::Expr(p.up(helper)?), Reserved(p) => Path::Reserved(p.up(helper)?), }) } } #[derive(Clone, Debug, PartialEq, Serialize)] /// we're forced to make this pub because of lalrpop pub struct SegmentRangeRaw<'script> { pub(crate) start_lower: Location, pub(crate) range_start: ImutExprRaw<'script>, pub(crate) end_lower: Location, pub(crate) start_upper: Location, pub(crate) range_end: ImutExprRaw<'script>, pub(crate) end_upper: Location, } impl<'script> Upable<'script> for SegmentRangeRaw<'script> { type Target = Segment<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let SegmentRangeRaw { start_lower, range_start, end_lower, start_upper, range_end, end_upper, } = self; let lower_mid = helper.add_meta(start_lower, end_lower); let upper_mid = helper.add_meta(start_upper, end_upper); let mid = helper.add_meta(start_lower, end_upper); Ok(Segment::Range { lower_mid, upper_mid, range_start: Box::new(range_start.up(helper)?), range_end: Box::new(range_end.up(helper)?), mid, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct SegmentElementRaw<'script> { pub(crate) expr: ImutExprRaw<'script>, pub(crate) start: Location, pub(crate) end: Location, } impl<'script> Upable<'script> for SegmentElementRaw<'script> { type Target = Segment<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let SegmentElementRaw { expr, start, end } = self; let expr = expr.up(helper)?; let r = expr.extent(&helper.meta); match expr { ImutExprInt::Literal(l) => match ImutExprInt::Literal(l).try_into_value(helper)? { Value::String(id) => { let mid = helper.add_meta_w_name(start, end, &id); Ok(Segment::Id { key: KnownKey::from(id.clone()), mid, }) } other => { if let Some(idx) = other.as_usize() { let mid = helper.add_meta(start, end); Ok(Segment::Idx { idx, mid }) } else { Err(ErrorKind::TypeConflict( r.expand_lines(2), r, other.value_type(), vec![ValueType::I64, ValueType::String], ) .into()) } } }, expr => Ok(Segment::Element { mid: helper.add_meta(start, end), expr, }), } } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub enum SegmentRaw<'script> { /// we're forced to make this pub because of lalrpop Element(Box<SegmentElementRaw<'script>>), /// we're forced to make this pub because of lalrpop Range(Box<SegmentRangeRaw<'script>>), } impl<'script> Upable<'script> for SegmentRaw<'script> { type Target = Segment<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { match self { SegmentRaw::Element(e) => e.up(helper), SegmentRaw::Range(r) => r.up(helper), } } } impl<'script> SegmentRaw<'script> { pub fn from_id(id: IdentRaw<'script>) -> Self { SegmentRaw::Element(Box::new(SegmentElementRaw { start: id.start, end: id.end, expr: ImutExprRaw::Literal(LiteralRaw { start: id.start, end: id.end, value: Value::from(id.id), }), })) } pub fn from_str(id: &'script str, start: Location, end: Location) -> Self { SegmentRaw::Element(Box::new(SegmentElementRaw { start, end, expr: ImutExprRaw::Literal(LiteralRaw { start, end, value: Value::from(id), }), })) } pub fn from_usize(id: usize, start: Location, end: Location) -> Self { SegmentRaw::Element(Box::new(SegmentElementRaw { start, end, expr: ImutExprRaw::Literal(LiteralRaw { start, end, value: Value::from(id), }), })) } } impl<'script> From<ImutExprRaw<'script>> for ExprRaw<'script> { fn from(imut: ImutExprRaw<'script>) -> ExprRaw<'script> { ExprRaw::Imut(imut) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ConstPathRaw<'script> { pub(crate) module: Vec<IdentRaw<'script>>, pub(crate) start: Location, pub(crate) end: Location, pub(crate) segments: SegmentsRaw<'script>, } impl_expr!(ConstPathRaw); impl<'script> Upable<'script> for ConstPathRaw<'script> { type Target = LocalPath<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let segments = self.segments.up(helper)?; let mut segments = segments.into_iter(); if let Some(Segment::Id { mid, .. }) = segments.next() { let segments = segments.collect(); let id = helper.meta.name_dflt(mid).to_string(); let mid = helper.add_meta_w_name(self.start, self.end, &id); let mut module_direct: Vec<String> = self.module.iter().map(|m| m.to_string()).collect(); let mut module = helper.module.clone(); module.append(&mut module_direct); module.push(id); if let Some(idx) = helper.is_const(&module) { Ok(LocalPath { is_const: true, idx: *idx, mid, segments, }) } else { error_generic( &(self.start, self.end), &(self.start, self.end), &format!( "The constant {} (absolute path) is not defined.", module.join("::") ), &helper.meta, ) } } else { // We should never encounter this error_oops( &(self.start, self.end), 0xdead_0007, "Empty local path", &helper.meta, ) } } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct ExprPathRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) expr: Box<ImutExprRaw<'script>>, pub(crate) segments: SegmentsRaw<'script>, } impl<'script> Upable<'script> for ExprPathRaw<'script> { type Target = ExprPath<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let var = helper.reserve_shadow(); let segments = self.segments.up(helper)?; let expr = Box::new(self.expr.up(helper)?); helper.end_shadow_var(); Ok(ExprPath { var, segments, expr, mid: helper.add_meta(self.start, self.end), }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub enum ReservedPathRaw<'script> { Args { start: Location, end: Location, segments: SegmentsRaw<'script>, }, Window { start: Location, end: Location, segments: SegmentsRaw<'script>, }, Group { start: Location, end: Location, segments: SegmentsRaw<'script>, }, } impl<'script> Upable<'script> for ReservedPathRaw<'script> { type Target = ReservedPath<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let r = match self { ReservedPathRaw::Args { start, end, segments, } => ReservedPath::Args { mid: helper.add_meta_w_name(start, end, &"args"), segments: segments.up(helper)?, }, ReservedPathRaw::Window { start, end, segments, } => ReservedPath::Window { mid: helper.add_meta_w_name(start, end, &"window"), segments: segments.up(helper)?, }, ReservedPathRaw::Group { start, end, segments, } => ReservedPath::Group { mid: helper.add_meta_w_name(start, end, &"group"), segments: segments.up(helper)?, }, }; Ok(r) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct LocalPathRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) segments: SegmentsRaw<'script>, } impl_expr!(LocalPathRaw); impl<'script> Upable<'script> for LocalPathRaw<'script> { type Target = LocalPath<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let segments = self.segments.up(helper)?; let mut segments = segments.into_iter(); if let Some(Segment::Id { mid, .. }) = segments.next() { let segments = segments.collect(); let id = helper.meta.name_dflt(mid).to_string(); let mid = helper.add_meta_w_name(self.start, self.end, &id); let mut rel_path = helper.module.clone(); rel_path.push(id.to_string()); let (idx, is_const) = helper .is_const(&rel_path) .copied() .map_or_else(|| (helper.var_id(&id), false), |idx| (idx, true)); Ok(LocalPath { idx, is_const, mid, segments, }) } else { // We should never encounter this error_oops( &(self.start, self.end), 0xdead_0008, "Empty local path", &helper.meta, ) } } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct MetadataPathRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) segments: SegmentsRaw<'script>, } impl<'script> Upable<'script> for MetadataPathRaw<'script> { type Target = MetadataPath<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let segments = self.segments.up(helper)?; Ok(MetadataPath { mid: helper.add_meta(self.start, self.end), segments, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct EventPathRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) segments: SegmentsRaw<'script>, } impl<'script> Upable<'script> for EventPathRaw<'script> { type Target = EventPath<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let segments = self.segments.up(helper)?; Ok(EventPath { mid: helper.add_meta(self.start, self.end), segments, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct StatePathRaw<'script> { pub start: Location, pub end: Location, pub segments: SegmentsRaw<'script>, } impl<'script> Upable<'script> for StatePathRaw<'script> { type Target = StatePath<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let segments = self.segments.up(helper)?; Ok(StatePath { mid: helper.add_meta(self.start, self.end), segments, }) } } #[derive(Clone, Debug, PartialEq, Serialize)] pub struct BinExprRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) kind: BinOpKind, pub(crate) lhs: ImutExprRaw<'script>, pub(crate) rhs: ImutExprRaw<'script>, // query_stream_not_defined(stmt: &Box<S>, inner: &I, name: String) } impl<'script> Upable<'script> for BinExprRaw<'script> { type Target = BinExpr<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(BinExpr { mid: helper.add_meta(self.start, self.end), kind: self.kind, lhs: self.lhs.up(helper)?, rhs: self.rhs.up(helper)?, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct UnaryExprRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) kind: UnaryOpKind, pub(crate) expr: ImutExprRaw<'script>, } impl<'script> Upable<'script> for UnaryExprRaw<'script> { type Target = UnaryExpr<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { Ok(UnaryExpr { mid: helper.add_meta(self.start, self.end), kind: self.kind, expr: self.expr.up(helper)?, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct MatchRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { pub(crate) start: Location, pub(crate) end: Location, pub(crate) target: ImutExprRaw<'script>, pub(crate) patterns: PredicatesRaw<'script, Ex>, } impl_expr_exraw!(MatchRaw); // Sort clauses, move up cheaper clauses as long as they're exclusive fn sort_clauses<Ex: Expression>(patterns: &mut [PredicateClause<Ex>]) { for i in (0..patterns.len()).rev() { for j in (1..=i).rev() { #[allow( // No clippy, we really mean j.exclusive(k) || k.exclusive(j)... clippy::suspicious_operation_groupings, // also what is wrong with you clippy ... clippy::blocks_in_if_conditions )] if patterns .get(j) .and_then(|jv| Some((jv, patterns.get(j - 1)?))) .map(|(j, k)| { j.cost() <= k.cost() && (j.is_exclusive_to(k) || k.is_exclusive_to(j)) }) .unwrap_or_default() { patterns.swap(j, j - 1); } } } } const NO_DFLT: &str = "This match expression has no default clause, if the other clauses do not cover all possibilities this will lead to events being discarded with runtime errors."; const MULT_DFLT: &str = "A match statement with more then one default clause will never reach any but the first default clause."; impl<'script, Ex> Upable<'script> for MatchRaw<'script, Ex> where <Ex as Upable<'script>>::Target: Expression + 'script, Ex: ExpressionRaw<'script> + 'script, { type Target = Match<'script, Ex::Target>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let mut patterns: Vec<PredicateClause<_>> = self .patterns .into_iter() .map(|v| v.up(helper)) .collect::<Result<_>>()?; let defaults = patterns .iter() .filter(|p| p.pattern.is_default() && p.guard.is_none()) .count(); match defaults { 0 => helper.warn_with_scope(Range(self.start, self.end), &NO_DFLT), x if x > 1 => helper.warn_with_scope(Range(self.start, self.end), &MULT_DFLT), _ => (), }; // If the last statement is a global default we can simply remove it let default = if let Some(PredicateClause { pattern: Pattern::Default, guard: None, exprs, last_expr, .. }) = patterns.last_mut() { let mut es = Vec::new(); let mut last = Ex::Target::null_lit(); std::mem::swap(exprs, &mut es); std::mem::swap(last_expr, &mut last); if es.is_empty() { if last.is_null_lit() { DefaultCase::Null } else { DefaultCase::One(last) } } else { DefaultCase::Many { exprs: es, last_expr: Box::new(last), } } } else { DefaultCase::None }; if default != DefaultCase::None { patterns.pop(); } // This shortcuts for if / else style matches if patterns.len() == 1 { let patterns = patterns.into_iter().map(ClauseGroup::simple).collect(); return Ok(Match { mid: helper.add_meta(self.start, self.end), target: self.target.up(helper)?, patterns, default, }); } sort_clauses(&mut patterns); let mut groups = Vec::new(); let mut group: Vec<PredicateClause<_>> = Vec::new(); for p in patterns { if group .iter() .all(|g| p.is_exclusive_to(g) || g.is_exclusive_to(&p)) { group.push(p); } else { group.sort_by_key(Costly::cost); let mut g = ClauseGroup::Simple { patterns: group, precondition: None, }; g.optimize(0); groups.push(g); group = vec![p]; } } group.sort_by_key(Costly::cost); let mut g = ClauseGroup::Simple { patterns: group, precondition: None, }; g.optimize(0); groups.push(g); let mut patterns: Vec<ClauseGroup<_>> = Vec::new(); for g in groups { #[allow(clippy::option_if_let_else)] if let Some(last) = patterns.last_mut() { if last.combinable(&g) { last.combine(g); } else { patterns.push(g); } } else { patterns.push(g); } } Ok(Match { mid: helper.add_meta(self.start, self.end), target: self.target.up(helper)?, patterns, default, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct InvokeRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) module: Vec<String>, pub(crate) fun: String, pub(crate) args: ImutExprsRaw<'script>, } impl_expr!(InvokeRaw); impl<'script> Upable<'script> for InvokeRaw<'script> { type Target = Invoke<'script>; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { if self.module.first() == Some(&String::from("core")) && self.module.len() == 2 { // we know a second module exists let module = self.module.get(1).cloned().unwrap_or_default(); let invocable = helper .reg .find(&module, &self.fun) .map_err(|e| e.into_err(&self, &self, Some(helper.reg), &helper.meta))?; let args = self.args.up(helper)?.into_iter().map(ImutExpr).collect(); let mf = format!("{}::{}", self.module.join("::"), self.fun); Ok(Invoke { mid: helper.add_meta_w_name(self.start, self.end, &mf), module: self.module, fun: self.fun, invocable: Invocable::Intrinsic(invocable.clone()), args, }) } else { // Absolute locability from without a set of nested modules let mut abs_module = helper.module.clone(); abs_module.extend_from_slice(&self.module); abs_module.push(self.fun.clone()); // of the form: [mod, mod1, name] - where the list of idents is effectively a fully qualified resource name if let Some(f) = helper.functions.get(&abs_module) { if let Some(f) = helper.func_vec.get(*f) { let invocable = Invocable::Tremor(f.clone()); let args = self.args.up(helper)?.into_iter().map(ImutExpr).collect(); let mf = abs_module.join("::"); Ok(Invoke { mid: helper.add_meta_w_name(self.start, self.end, &mf), module: self.module, fun: self.fun, invocable, args, }) } else { let inner: Range = (self.start, self.end).into(); let outer: Range = inner.expand_lines(3); Err( ErrorKind::MissingFunction(outer, inner, self.module, self.fun, None) .into(), ) } } else { let inner: Range = (self.start, self.end).into(); let outer: Range = inner.expand_lines(3); Err(ErrorKind::MissingFunction(outer, inner, self.module, self.fun, None).into()) } } } } impl<'script> InvokeRaw<'script> { fn is_aggregate<'registry>(&self, helper: &mut Helper<'script, 'registry>) -> bool { if self.module.first() == Some(&String::from("aggr")) && self.module.len() == 2 { let module = self.module.get(1).cloned().unwrap_or_default(); helper.aggr_reg.find(&module, &self.fun).is_ok() } else { false } } fn into_aggregate(self) -> InvokeAggrRaw<'script> { let module = self.module.get(1).cloned().unwrap_or_default(); InvokeAggrRaw { start: self.start, end: self.end, module, fun: self.fun, args: self.args, } } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct InvokeAggrRaw<'script> { pub(crate) start: Location, pub(crate) end: Location, pub(crate) module: String, pub(crate) fun: String, pub(crate) args: ImutExprsRaw<'script>, } impl_expr!(InvokeAggrRaw); impl<'script> Upable<'script> for InvokeAggrRaw<'script> { type Target = InvokeAggr; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { if helper.is_in_aggr { return Err(ErrorKind::AggrInAggr( self.extent(&helper.meta), self.extent(&helper.meta).expand_lines(2), ) .into()); }; helper.is_in_aggr = true; let invocable = helper .aggr_reg .find(&self.module, &self.fun) .map_err(|e| e.into_err(&self, &self, Some(helper.reg), &helper.meta))? .clone(); if !invocable.valid_arity(self.args.len()) { return Err(ErrorKind::BadArity( self.extent(&helper.meta), self.extent(&helper.meta).expand_lines(2), self.module.clone(), self.fun.clone(), invocable.arity(), self.args.len(), ) .into()); } if let Some(warning) = invocable.warning() { helper.warn_with_scope(self.extent(&helper.meta), &warning); } let aggr_id = helper.aggregates.len(); let args = self.args.up(helper)?.into_iter().map(ImutExpr).collect(); let mf = format!("{}::{}", self.module, self.fun); let invoke_meta_id = helper.add_meta_w_name(self.start, self.end, &mf); helper.aggregates.push(InvokeAggrFn { mid: invoke_meta_id, invocable, args, module: self.module.clone(), fun: self.fun.clone(), }); helper.is_in_aggr = false; let aggr_meta_id = helper.add_meta_w_name(self.start, self.end, &mf); Ok(InvokeAggr { mid: aggr_meta_id, module: self.module, fun: self.fun, aggr_id, }) } } /// we're forced to make this pub because of lalrpop #[derive(Clone, Debug, PartialEq, Serialize)] pub struct TestExprRaw { pub(crate) start: Location, pub(crate) end: Location, pub(crate) id: String, pub(crate) test: String, } impl<'script> Upable<'script> for TestExprRaw { type Target = TestExpr; fn up<'registry>(self, helper: &mut Helper<'script, 'registry>) -> Result<Self::Target> { let mid = helper.add_meta(self.start, self.end); match Extractor::new(&self.id, &self.test) { Ok(ex) => Ok(TestExpr { id: self.id, test: self.test, extractor: ex, mid, }), Err(e) => Err(ErrorKind::InvalidExtractor( self.extent(&helper.meta).expand_lines(2), self.extent(&helper.meta), self.id, self.test, e.msg, ) .into()), } } } pub type ExprsRaw<'script> = Vec<ExprRaw<'script>>; pub type ImutExprsRaw<'script> = Vec<ImutExprRaw<'script>>; pub type FieldsRaw<'script> = Vec<FieldRaw<'script>>; pub type SegmentsRaw<'script> = Vec<SegmentRaw<'script>>; pub type PatternFieldsRaw<'script> = Vec<PredicatePatternRaw<'script>>; pub type PredicatesRaw<'script, Ex> = Vec<PredicateClauseRaw<'script, Ex>>; pub type PatchOperationsRaw<'script> = Vec<PatchOperationRaw<'script>>; pub type ComprehensionCasesRaw<'script, Ex> = Vec<ComprehensionCaseRaw<'script, Ex>>; pub type ImutComprehensionCasesRaw<'script> = Vec<ImutComprehensionCaseRaw<'script>>; pub type ArrayPredicatePatternsRaw<'script> = Vec<ArrayPredicatePatternRaw<'script>>; pub type WithExprsRaw<'script> = Vec<(IdentRaw<'script>, ImutExprRaw<'script>)>; #[cfg(test)] mod test { use super::*; #[test] fn default() { assert_eq!(Endian::default(), Endian::Big); assert_eq!(BytesDataType::default(), BytesDataType::UnsignedInteger); } }
use std::fmt; use firefly_diagnostics::SourceIndex; use firefly_intern::Symbol; use firefly_number::{Float, Integer}; use firefly_syntax_erl::LexicalError; #[derive(Debug, Clone, PartialEq, Eq)] pub struct LexicalToken(pub SourceIndex, pub Token, pub SourceIndex); impl LexicalToken { #[inline] pub fn token(&self) -> Token { self.1.clone() } #[inline] pub fn span(&self) -> SourceSpan { SourceSpan::new(self.0, self.2) } } impl fmt::Display for LexicalToken { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "{}", self.token()) } } impl Into<(SourceIndex, Token, SourceIndex)> for LexicalToken { fn into(self) -> (SourceIndex, Token, SourceIndex) { (self.0, self.1, self.2) } } impl From<(SourceIndex, Token, SourceIndex)> for LexicalToken { fn from(triple: (SourceIndex, Token, SourceIndex)) -> LexicalToken { LexicalToken(triple.0, triple.1, triple.2) } } #[derive(Debug, Clone, PartialEq, Eq)] pub enum Token { EOF, Error(LexicalError), // Puncutation Comma, Dot, Pipe, SquareOpen, SquareClose, CurlyOpen, CurlyClose, // Literals AtomLiteral(Symbol), StringLiteral(Symbol), IntegerLiteral(Integer), FloatLiteral(Float), // Keywords Atom, Attribute, Bin, BinElement, BitComprehension, // bc BitGenerator, // bc_generate Call, Callback, Case, Catch, Char, Clauses, Clause, Cons, Error, Export, ExportType, File, Function, Fun, If, Import, Integer, ListGenerator, // generate ListComprehension, // lc Match, Map, MapFieldAssoc, MapFieldExact, Module, Nil, Op, Opaque, OptionalCallbacks, Receive, Record, RecordField, Spec, String, Try, Tuple, Type, Var, Warning, } impl Token { pub fn from_bare_atom(atom: &str) -> Self { match atom { "atom" => Token::Atom, "attribute" => Token::Attribute, "bin" => Token::Bin, "bin_element" => Token::BinElement, "bc" => Token::BitComprehension, "bc_generate" => Token::BitGenerator, "call" => Token::Call, "callback" => Token::Callback, "case" => Token::Case, "catch" => Token::Catch, "char" => Token::Char, "clauses" => Token::Clauses, "clause" => Token::Clause, "cons" => Token::Cons, "error" => Token::Error, "export" => Token::Export, "export_type" => Token::ExportType, "file" => Token::File, "function" => Token::Function, "fun" => Token::Fun, "if" => Token::If, "import" => Token::Import, "integer" => Token::Integer, "generate" => Token::ListGenerator, "lc" => Token::ListComprehension, "match" => Token::Match, "map" => Token::Map, "map_field_assoc" => Token::MapFieldAssoc, "map_field_exact" => Token::MapFieldExact, "module" => Token::Module, "nil" => Token::Nil, "op" => Token::Op, "opaque" => Token::Opaque, "optional_callbacks" => Token::OptionalCallbacks, "receive" => Token::Receive, "record" => Token::Record, "record_field" => Token::RecordField, "spec" => Token::Spec, "string" => Token::String, "try" => Token::Try, "tuple" => Token::Tuple, "type" => Token::Type, "var" => Token::Var, "warning" => Token::Warning, _ => Token::AtomLiteral(Symbol::intern(atom)), } } }
use glob::glob; use std::process::Command; fn main() -> anyhow::Result<()> { let dir_out = std::env::var("OUT_DIR")?; let dir_ocaml = "../../ocaml"; let dir_dune = "../../_build/default"; // Install OCaml dependencies. let mut cmd = Command::new("opam"); cmd.args(&["pin", "add", "-y", "rust-ocaml-dyn", "."]); cmd.current_dir(dir_ocaml); cmd.status()?; // Build the OCaml extension host and extensions with Dune. let mut cmd = Command::new("opam"); cmd.args(&["exec", "--", "dune", "build"]); cmd.current_dir(dir_ocaml); cmd.status()?; // Remove the old archive file. let mut cmd = Command::new("rm"); cmd.args(&["-f", &format!("{}/libhost.a", dir_out)]); cmd.status()?; // Create the archive file from the object file. let mut cmd = Command::new("ar"); cmd.args(&[ "qs", &format!("{}/libhost.a", dir_out), &format!("{}/ocaml/host/host.bc.o", dir_dune), ]); cmd.status()?; // Re-run if `dune-project` changes. println!("cargo:rerun-if-changed={}/dune-project", dir_ocaml); // Re-run if `**/dune` files change. for path in glob(&format!("{}/**/dune", dir_ocaml))? { if let Some(path) = path?.to_str() { println!("cargo:rerun-if-changed={}", path); } } // Re-run if `**/*.mli?` files change. for path in glob(&format!("{}/**/*.ml", dir_ocaml))? { if let Some(path) = path?.to_str() { println!("cargo:rerun-if-changed={}", path); } } // Re-run if `**/*.mli?` files change. for path in glob(&format!("{}/**/*.mli", dir_ocaml))? { if let Some(path) = path?.to_str() { println!("cargo:rerun-if-changed={}", path); } } // Configure linking for the extension host object file. println!("cargo:rustc-link-search={}", dir_out); println!("cargo:rustc-link-lib=static=host"); Ok(()) }
/* Project Euler Problem 9: A Pythagorean triplet is a set of three natural numbers, a < b < c, for which, a^2 + b^2 = c^2 For example, 3^2 + 4^2 = 9 + 16 = 25 = 5^2. There exists exactly one Pythagorean triplet for which a + b + c = 1000. Find the product abc. */ fn main() { for a in 1..1000 { for b in 1..1000 { let c = ((a*a + b*b) as f32).sqrt(); if (a as f32)+(b as f32)+c == 1000.0 { println!("{:?}", a*b*(c as i32)); return; } } } }
#[macro_use] pub mod utils; mod core; pub use self::core::{ default_filter, AllRulesValidator, Filter, SourceCode, ValidationError, Validator, }; mod iter; pub use self::iter::NodeIterator; mod grammar; mod hint; mod rule; pub use self::rule::{Rule, RuleCode, RULES}; pub mod filters; pub mod validators;
// Copyright 2019 The Fuchsia Authors. All rights reserved. // Use of this source code is governed by a BSD-style license that can be // found in the LICENSE file. use { breakpoints_capability::*, component_manager_lib::{ model::{ self, hooks::*, testing::breakpoints::*, testing::test_helpers, AbsoluteMoniker, Hub, Model, }, startup, }, failure::{self, Error}, fidl::endpoints::ClientEnd, fidl_fidl_examples_routing_echo as fecho, fidl_fuchsia_io::{ DirectoryMarker, DirectoryProxy, MODE_TYPE_SERVICE, OPEN_RIGHT_READABLE, OPEN_RIGHT_WRITABLE, }, fidl_fuchsia_test_hub as fhub, fuchsia_zircon as zx, hub_test_hook::*, std::{path::PathBuf, sync::Arc, vec::Vec}, }; struct TestRunner { pub model: Model, pub hub: Hub, hub_test_hook: Arc<HubTestHook>, _breakpoint_hook: BreakpointHook, _breakpoint_capability_hook: BreakpointCapabilityHook, breakpoint_receiver: BreakpointInvocationReceiver, hub_proxy: DirectoryProxy, } async fn create_model(root_component_url: &str) -> Result<Model, Error> { let root_component_url = root_component_url.to_string(); // TODO(xbhatnag): Explain this in more detail. Setting use_builtin_process_launcher to false is non-obvious. let args = startup::Arguments { use_builtin_process_launcher: false, use_builtin_vmex: false, root_component_url, }; let model = startup::model_setup(&args, vec![]).await?; Ok(model) } async fn install_hub(model: &Model) -> Result<(Hub, DirectoryProxy), Error> { let (client_chan, server_chan) = zx::Channel::create()?; let root_component_url = model.root_realm.component_url.clone(); let hub = Hub::new(root_component_url)?; // TODO(xbhatnag): Investigate why test() fails when OPEN_RIGHT_WRITABLE is removed hub.open_root(OPEN_RIGHT_READABLE | OPEN_RIGHT_WRITABLE, server_chan.into()).await?; model.root_realm.hooks.install(hub.hooks()).await; let hub_proxy = ClientEnd::<DirectoryMarker>::new(client_chan).into_proxy()?; Ok((hub, hub_proxy)) } async fn install_hub_test_hook(model: &Model) -> Arc<HubTestHook> { let hub_test_hook = Arc::new(HubTestHook::new()); model .root_realm .hooks .install(vec![HookRegistration { event_type: EventType::RouteFrameworkCapability, callback: hub_test_hook.clone(), }]) .await; hub_test_hook } async fn register_breakpoints( model: &Model, event_types: Vec<EventType>, ) -> (BreakpointHook, BreakpointCapabilityHook, BreakpointInvocationReceiver) { let breakpoint_registry = Arc::new(BreakpointRegistry::new()); let breakpoint_receiver = breakpoint_registry.register(event_types).await; let breakpoint_hook = BreakpointHook::new(breakpoint_registry.clone()); let breakpoint_capability_hook = BreakpointCapabilityHook::new(breakpoint_registry.clone()); model.root_realm.hooks.install(breakpoint_hook.hooks()).await; model.root_realm.hooks.install(breakpoint_capability_hook.hooks()).await; (breakpoint_hook, breakpoint_capability_hook, breakpoint_receiver) } impl TestRunner { async fn new(root_component_url: &str) -> Result<Self, Error> { TestRunner::new_with_breakpoints(root_component_url, vec![]).await } async fn new_with_breakpoints( root_component_url: &str, event_types: Vec<EventType>, ) -> Result<Self, Error> { let model = create_model(root_component_url).await?; let (hub, hub_proxy) = install_hub(&model).await?; let hub_test_hook = install_hub_test_hook(&model).await; let (breakpoint_hook, breakpoint_capability_hook, breakpoint_receiver) = register_breakpoints(&model, event_types).await; let res = model.look_up_and_bind_instance(model::AbsoluteMoniker::root()).await; let expected_res: Result<(), model::ModelError> = Ok(()); assert_eq!(format!("{:?}", res), format!("{:?}", expected_res)); Ok(Self { model, hub, hub_proxy, hub_test_hook, _breakpoint_hook: breakpoint_hook, _breakpoint_capability_hook: breakpoint_capability_hook, breakpoint_receiver, }) } async fn expect_invocation( &self, expected_event: EventType, components: Vec<&str>, ) -> BreakpointInvocation { let breakpoint = self.breakpoint_receiver.receive().await; let expected_moniker = AbsoluteMoniker::from(components); assert_eq!(breakpoint.event.type_(), expected_event); let moniker = match &breakpoint.event { Event::PreDestroyInstance { realm } => realm.abs_moniker.clone(), Event::StopInstance { realm } => realm.abs_moniker.clone(), Event::PostDestroyInstance { realm } => realm.abs_moniker.clone(), _ => AbsoluteMoniker::root(), }; assert_eq!(moniker, expected_moniker); breakpoint } async fn connect_to_echo_service(&self, echo_service_path: String) -> Result<(), Error> { let node_proxy = io_util::open_node( &self.hub_proxy, &PathBuf::from(echo_service_path), io_util::OPEN_RIGHT_READABLE, MODE_TYPE_SERVICE, )?; let echo_proxy = fecho::EchoProxy::new(node_proxy.into_channel().unwrap()); let res = echo_proxy.echo_string(Some("hippos")).await?; assert_eq!(res, Some("hippos".to_string())); Ok(()) } async fn verify_global_directory_listing( &self, relative_path: &str, expected_listing: Vec<&str>, ) { let dir_proxy = io_util::open_directory( &self.hub_proxy, &PathBuf::from(relative_path), OPEN_RIGHT_READABLE, ) .expect("Could not open directory from global view"); assert_eq!(expected_listing, test_helpers::list_directory(&dir_proxy).await); } async fn verify_local_directory_listing( &self, path: &str, expected_listing: Vec<&str>, ) -> fhub::HubReportListDirectoryResponder { let event = self.hub_test_hook.observe(path).await; let expected_listing: Vec<String> = expected_listing.iter().map(|s| s.to_string()).collect(); match event { HubReportEvent::DirectoryListing { listing, responder } => { assert_eq!(expected_listing, listing); responder } _ => { panic!("Unexpected event type!"); } } } async fn verify_directory_listing(&self, hub_relative_path: &str, expected_listing: Vec<&str>) { let local_path = format!("/hub/{}", hub_relative_path); let responder = self .verify_local_directory_listing(local_path.as_str(), expected_listing.clone()) .await; self.verify_global_directory_listing(hub_relative_path, expected_listing).await; responder.send().expect("Unable to respond"); } async fn verify_local_file_content(&self, path: &str, expected_content: &str) { let event = self.hub_test_hook.observe(path).await; match event { HubReportEvent::FileContent { content, responder } => { let expected_content = expected_content.to_string(); assert_eq!(expected_content, content); responder.send().expect("failed to respond"); } _ => { panic!("Unexpected event type!"); } }; } async fn verify_global_file_content(&self, relative_path: &str, expected_content: &str) { assert_eq!(expected_content, test_helpers::read_file(&self.hub_proxy, relative_path).await); } async fn wait_for_component_stop(&self) { self.hub_test_hook.wait_for_component_stop().await; } } #[fuchsia_async::run_singlethreaded(test)] async fn advanced_routing_test() -> Result<(), Error> { let root_component_url = "fuchsia-pkg://fuchsia.com/hub_integration_test#meta/echo_realm.cm"; let test_runner = TestRunner::new(root_component_url).await?; // Verify that echo_realm has two children. test_runner .verify_global_directory_listing("children", vec!["echo_server", "hub_client"]) .await; // Verify hub_client's instance id. test_runner.verify_global_file_content("children/hub_client/id", "0").await; // Verify echo_server's instance id. test_runner.verify_global_file_content("children/echo_server/id", "0").await; // Verify the args from hub_client.cml. test_runner .verify_global_file_content("children/hub_client/exec/runtime/args/0", "Hippos") .await; test_runner .verify_global_file_content("children/hub_client/exec/runtime/args/1", "rule!") .await; let echo_service_name = "fidl.examples.routing.echo.Echo"; let hub_report_service_name = "fuchsia.test.hub.HubReport"; let expose_svc_dir = "children/echo_server/exec/expose/svc"; // Verify that the Echo service is exposed by echo_server test_runner.verify_global_directory_listing(expose_svc_dir, vec![echo_service_name]).await; // Verify that hub_client is using HubReport and Echo services let in_dir = "children/hub_client/exec/in"; let svc_dir = format!("{}/{}", in_dir, "svc"); test_runner .verify_global_directory_listing( svc_dir.as_str(), vec![echo_service_name, hub_report_service_name], ) .await; // Verify that the 'pkg' directory is available. let pkg_dir = format!("{}/{}", in_dir, "pkg"); test_runner .verify_global_directory_listing(pkg_dir.as_str(), vec!["bin", "lib", "meta", "test"]) .await; // Verify that we can connect to the echo service from the in/svc directory. let in_echo_service_path = format!("{}/{}", svc_dir, echo_service_name); test_runner.connect_to_echo_service(in_echo_service_path).await?; // Verify that we can connect to the echo service from the expose/svc directory. let expose_echo_service_path = format!("{}/{}", expose_svc_dir, echo_service_name); test_runner.connect_to_echo_service(expose_echo_service_path).await?; // Verify that the 'hub' directory is available. The 'hub' mapped to 'hub_client''s // namespace is actually mapped to the 'exec' directory of 'hub_client'. let scoped_hub_dir = format!("{}/{}", in_dir, "hub"); test_runner .verify_global_directory_listing( scoped_hub_dir.as_str(), vec!["expose", "in", "out", "resolved_url", "runtime"], ) .await; let responder = test_runner .verify_local_directory_listing( "/hub", vec!["expose", "in", "out", "resolved_url", "runtime"], ) .await; responder.send().expect("Could not respond"); // Verify that hub_client's view is able to correctly read the names of the // children of the parent echo_realm. let responder = test_runner .verify_local_directory_listing("/parent_hub/children", vec!["echo_server", "hub_client"]) .await; responder.send().expect("Could not respond"); // Verify that hub_client is able to see its sibling's hub correctly. test_runner .verify_local_file_content( "/sibling_hub/exec/resolved_url", "fuchsia-pkg://fuchsia.com/hub_integration_test#meta/echo_server.cm", ) .await; Ok(()) } #[fuchsia_async::run_singlethreaded(test)] async fn dynamic_child_test() -> Result<(), Error> { let root_component_url = "fuchsia-pkg://fuchsia.com/hub_integration_test#meta/dynamic_child_reporter.cm"; let test_runner = TestRunner::new_with_breakpoints( root_component_url, vec![ EventType::PreDestroyInstance, EventType::StopInstance, EventType::PostDestroyInstance, ], ) .await?; // Verify that the dynamic child exists in the parent's hub test_runner.verify_directory_listing("children", vec!["coll:simple_instance"]).await; // Before binding, verify that the dynamic child's hub has the directories we expect // i.e. "children" and "url" but no "exec" because the child has not been bound. test_runner .verify_directory_listing( "children/coll:simple_instance", vec!["children", "deleting", "id", "url"], ) .await; // Verify that the dynamic child has the correct instance id. test_runner.verify_local_file_content("/hub/children/coll:simple_instance/id", "1").await; // Before binding, verify that the dynamic child's static children are invisible test_runner.verify_directory_listing("children/coll:simple_instance/children", vec![]).await; // After binding, verify that the dynamic child's hub has the directories we expect test_runner .verify_directory_listing( "children/coll:simple_instance", vec!["children", "deleting", "exec", "id", "url"], ) .await; // After binding, verify that the dynamic child's static child is visible test_runner .verify_directory_listing("children/coll:simple_instance/children", vec!["child"]) .await; // Verify that the dynamic child's static child has the correct instance id. test_runner .verify_local_file_content("/hub/children/coll:simple_instance/children/child/id", "0") .await; // Wait for the dynamic child to begin deletion let breakpoint = test_runner .expect_invocation(EventType::PreDestroyInstance, vec!["coll:simple_instance:1"]) .await; // When deletion begins, the dynamic child should be moved to the deleting directory test_runner.verify_directory_listing("children", vec![]).await; test_runner.verify_directory_listing("deleting", vec!["coll:simple_instance:1"]).await; test_runner .verify_directory_listing( "deleting/coll:simple_instance:1", vec!["children", "deleting", "exec", "id", "url"], ) .await; // Unblock the ComponentManager breakpoint.resume(); // Wait for the dynamic child to stop let breakpoint = test_runner .expect_invocation(EventType::StopInstance, vec!["coll:simple_instance:1"]) .await; // After stopping, the dynamic child should not have an exec directory test_runner .verify_directory_listing( "deleting/coll:simple_instance:1", vec!["children", "deleting", "id", "url"], ) .await; // Unblock the Component Manager breakpoint.resume(); // Wait for the dynamic child's static child to begin deletion let breakpoint = test_runner .expect_invocation(EventType::PreDestroyInstance, vec!["coll:simple_instance:1", "child:0"]) .await; // When deletion begins, the dynamic child's static child should be moved to the deleting directory test_runner.verify_directory_listing("deleting/coll:simple_instance:1/children", vec![]).await; test_runner .verify_directory_listing("deleting/coll:simple_instance:1/deleting", vec!["child:0"]) .await; test_runner .verify_directory_listing( "deleting/coll:simple_instance:1/deleting/child:0", vec!["children", "deleting", "id", "url"], ) .await; // Unblock the Component Manager breakpoint.resume(); // Wait for the dynamic child's static child to be destroyed let breakpoint = test_runner .expect_invocation( EventType::PostDestroyInstance, vec!["coll:simple_instance:1", "child:0"], ) .await; // The dynamic child's static child should not be visible in the hub anymore test_runner.verify_directory_listing("deleting/coll:simple_instance:1/deleting", vec![]).await; // Unblock the Component Manager breakpoint.resume(); // Wait for the dynamic child to be destroyed let breakpoint = test_runner .expect_invocation(EventType::PostDestroyInstance, vec!["coll:simple_instance:1"]) .await; // After deletion, verify that parent can no longer see the dynamic child in the Hub test_runner.verify_directory_listing("deleting", vec![]).await; // Unblock the Component Manager breakpoint.resume(); // Wait for the component to stop test_runner.wait_for_component_stop().await; Ok(()) } #[fuchsia_async::run_singlethreaded(test)] async fn visibility_test() -> Result<(), Error> { let root_component_url = "fuchsia-pkg://fuchsia.com/hub_integration_test#meta/visibility_reporter.cm"; let test_runner = TestRunner::new(root_component_url).await?; // Verify that the child exists in the parent's hub test_runner.verify_directory_listing("children", vec!["child"]).await; // Verify that the child's hub has the directories we expect // i.e. no "exec" because the child has not been bound. test_runner .verify_directory_listing("children/child", vec!["children", "deleting", "id", "url"]) .await; // Verify that the grandchild is not shown because the child is lazy test_runner.verify_directory_listing("children/child/children", vec![]).await; Ok(()) }
mod mem_regions; use gba_mem::mem_regions::{SystemRom, ExternRam, InternRam, PalettRam, VisualRam, OAM, PakRom, MemRead, MemWrite, MemoryRegion}; use std::io; pub type Address = usize; #[derive(Debug)] pub struct Memory { sys_rom: SystemRom, ext_ram: ExternRam, int_ram: InternRam, pal_ram: PalettRam, vis_ram: VisualRam, oam: OAM, pak_rom: PakRom, } impl Memory { pub fn new(pak_filename: &str) -> io::Result<Memory> { println!("WARNING: BIOS emulation not implemented. Please emulate bios rather than use a ROM."); Ok(Memory { sys_rom: SystemRom::create_from_array(include_bytes!("../../roms/gba.bin")), ext_ram: ExternRam::default(), int_ram: InternRam::default(), pal_ram: PalettRam::default(), vis_ram: VisualRam::default(), oam: OAM::default(), pak_rom: try!(PakRom::create_from_file(pak_filename)), }) } pub fn read<T>(&self, addr: Address) -> T where SystemRom: MemRead<T>, ExternRam: MemRead<T>, InternRam: MemRead<T>, PalettRam: MemRead<T>, VisualRam: MemRead<T>, OAM: MemRead<T>, PakRom: MemRead<T> { match addr { _ if addr >= SystemRom::lo() && addr <= SystemRom::hi() => <SystemRom as MemRead<T>>::read(&self.sys_rom, addr), _ if addr >= ExternRam::lo() && addr <= ExternRam::hi() => <ExternRam as MemRead<T>>::read(&self.ext_ram, addr), _ if addr >= InternRam::lo() && addr <= InternRam::hi() => <InternRam as MemRead<T>>::read(&self.int_ram, addr), _ if addr >= PalettRam::lo() && addr <= PalettRam::hi() => <PalettRam as MemRead<T>>::read(&self.pal_ram, addr), _ if addr >= VisualRam::lo() && addr <= VisualRam::hi() => <VisualRam as MemRead<T>>::read(&self.vis_ram, addr), _ if addr >= OAM::lo() && addr <= OAM::hi() => <OAM as MemRead<T>>::read(&self.oam, addr), _ if addr >= PakRom::lo() && addr <= PakRom::hi() => <PakRom as MemRead<T>>::read(&self.pak_rom, addr), _ => unreachable!(), } } pub fn write8<T>(&mut self, addr: Address, val: T) where ExternRam: MemWrite<T>, InternRam: MemWrite<T>, PakRom: MemWrite<T> { match addr { _ if addr >= ExternRam::lo() && addr <= ExternRam::hi() => <ExternRam as MemWrite<T>>::write(&mut self.ext_ram, addr, val), _ if addr >= InternRam::lo() && addr <= InternRam::hi() => <InternRam as MemWrite<T>>::write(&mut self.int_ram, addr, val), _ if addr >= PakRom::lo() && addr <= PakRom::hi() => <PakRom as MemWrite<T>>::write(&mut self.pak_rom, addr, val), _ => unreachable!(), } } pub fn write16<T>(&mut self, addr: Address, val: T) where ExternRam: MemWrite<T>, InternRam: MemWrite<T>, PalettRam: MemWrite<T>, VisualRam: MemWrite<T>, OAM: MemWrite<T>, PakRom: MemWrite<T> { match addr { _ if addr >= ExternRam::lo() && addr <= ExternRam::hi() => <ExternRam as MemWrite<T>>::write(&mut self.ext_ram, addr, val), _ if addr >= InternRam::lo() && addr <= InternRam::hi() => <InternRam as MemWrite<T>>::write(&mut self.int_ram, addr, val), _ if addr >= PalettRam::lo() && addr <= PalettRam::hi() => <PalettRam as MemWrite<T>>::write(&mut self.pal_ram, addr, val), _ if addr >= VisualRam::lo() && addr <= VisualRam::hi() => <VisualRam as MemWrite<T>>::write(&mut self.vis_ram, addr, val), _ if addr >= OAM::lo() && addr <= OAM::hi() => <OAM as MemWrite<T>>::write(&mut self.oam, addr, val), _ if addr >= PakRom::lo() && addr <= PakRom::hi() => <PakRom as MemWrite<T>>::write(&mut self.pak_rom, addr, val), _ => unreachable!(), } } pub fn write32<T>(&mut self, addr: Address, val: T) where ExternRam: MemWrite<T>, InternRam: MemWrite<T>, PalettRam: MemWrite<T>, VisualRam: MemWrite<T>, OAM: MemWrite<T>, PakRom: MemWrite<T> { self.write16::<T>(addr, val); } } // impl Mem { // fn new(pak_filename: String) -> Mem { // let mut pak_rom_file = File::open(pak_filename).expect("Failed to open PAK ROM file"); // let mut pak_rom = Vec::<u8>::new(); // pak_rom_file.read_to_end(&mut pak_rom).expect("Failed to read PAK ROM"); // //let mut pak_rom = u8_slice_to_u16_slice(&pak_rom); // Mem { // system_rom: [0;SYSTEM_ROM_SIZE as usize], // extern_ram: [0;EXTERN_RAM_SIZE as usize], // intern_ram: [0;INTERN_RAM_SIZE as usize], // palett_ram: [0;PALETT_RAM_SIZE as usize], // vram: [0;VRAM_SIZE as usize], // oam: [0;OAM_SIZE as usize], // pak_rom: pak_rom.into_boxed_slice(), // } // } // }
mod jwt; use std::cmp::{Eq, PartialEq}; pub mod pwd; pub mod service; use serde::{Deserialize, Serialize}; #[derive(juniper::GraphQLObject)] pub struct Session { jwt: String, } #[derive(juniper::GraphQLInputObject)] pub struct AuthenticationData { email: String, password: String, } #[derive(Debug, Serialize, Deserialize, Eq, PartialEq)] pub struct Claims { pub exp: usize, pub id: String, pub email: String, pub first_name: String, pub last_name: String, pub phone: String, }
// Copyright 2022 Datafuse Labs. // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. use itertools::Itertools; use nom::branch::alt; use nom::combinator::consumed; use nom::combinator::map; use nom::combinator::value; use nom::error::context; use pratt::Affix; use pratt::Associativity; use pratt::PrattParser; use pratt::Precedence; use crate::ast::*; use crate::input::Input; use crate::input::WithSpan; use crate::match_token; use crate::parser::query::*; use crate::parser::token::*; use crate::parser::unescape::unescape; use crate::rule; use crate::util::*; use crate::Error; use crate::ErrorKind; pub const BETWEEN_PREC: u32 = 20; pub const NOT_PREC: u32 = 15; pub fn expr(i: Input) -> IResult<Expr> { context("expression", subexpr(0))(i) } fn expr_or_placeholder(i: Input) -> IResult<Option<Expr>> { alt((map(rule! { "?" }, |_| None), map(subexpr(0), Some)))(i) } pub fn values_with_placeholder(i: Input) -> IResult<Vec<Option<Expr>>> { let values = comma_separated_list0(expr_or_placeholder); map(rule! { ( "(" ~ #values ~ ")" ) }, |(_, v, _)| v)(i) } pub fn subexpr(min_precedence: u32) -> impl FnMut(Input) -> IResult<Expr> { move |i| { let higher_prec_expr_element = |i| { expr_element(i).and_then(|(rest, elem)| { match PrattParser::<std::iter::Once<_>>::query(&mut ExprParser, &elem).unwrap() { Affix::Infix(prec, _) | Affix::Prefix(prec) | Affix::Postfix(prec) if prec <= Precedence(min_precedence) => { Err(nom::Err::Error(Error::from_error_kind( i, ErrorKind::Other("expected more tokens for expression"), ))) } _ => Ok((rest, elem)), } }) }; let (rest, mut expr_elements) = rule! { #higher_prec_expr_element+ }(i)?; for (prev, curr) in (-1..(expr_elements.len() as isize)).tuple_windows() { // Replace binary Plus and Minus to the unary one, if it's following another op // or it's the first element. if prev == -1 || matches!( expr_elements[prev as usize].elem, ExprElement::UnaryOp { .. } | ExprElement::BinaryOp { .. } ) { match &mut expr_elements[curr as usize].elem { elem @ ExprElement::BinaryOp { op: BinaryOperator::Plus, } => { *elem = ExprElement::UnaryOp { op: UnaryOperator::Plus, }; } elem @ ExprElement::BinaryOp { op: BinaryOperator::Minus, } => { *elem = ExprElement::UnaryOp { op: UnaryOperator::Minus, }; } _ => {} } } // If it's following a prefix or infix element or it's the first element, ... if prev == -1 || matches!( PrattParser::<std::iter::Once<_>>::query( &mut ExprParser, &expr_elements[prev as usize] ) .unwrap(), Affix::Prefix(_) | Affix::Infix(_, _) ) { // replace bracket map access to an array, ... if let ExprElement::MapAccess { accessor: MapAccessor::Bracket { key }, } = &expr_elements[curr as usize].elem { let span = expr_elements[curr as usize].span; expr_elements[curr as usize] = WithSpan { span, elem: ExprElement::Array { exprs: vec![(**key).clone()], }, }; } // and replace `.<number>` map access to floating point literal. if let ExprElement::MapAccess { accessor: MapAccessor::PeriodNumber { .. }, } = &expr_elements[curr as usize].elem { let span = expr_elements[curr as usize].span; expr_elements[curr as usize] = WithSpan { span, elem: ExprElement::Literal { lit: literal(span)?.1, }, }; } } if prev != -1 { if let ( ExprElement::UnaryOp { op: UnaryOperator::Minus, }, ExprElement::Literal { lit }, ) = ( &expr_elements[prev as usize].elem, &expr_elements[curr as usize].elem, ) { if matches!( lit, Literal::Float(_) | Literal::UInt64(_) | Literal::Decimal128 { .. } | Literal::Decimal256 { .. } ) { let span = expr_elements[curr as usize].span; expr_elements[curr as usize] = WithSpan { span, elem: ExprElement::Literal { lit: lit.neg() }, }; let span = expr_elements[prev as usize].span; expr_elements[prev as usize] = WithSpan { span, elem: ExprElement::Skip, }; } } } } let iter = &mut expr_elements .into_iter() .filter(|x| x.elem != ExprElement::Skip) .collect::<Vec<_>>() .into_iter(); run_pratt_parser(ExprParser, iter, rest, i) } } /// A 'flattened' AST of expressions. /// /// This is used to parse expressions in Pratt parser. /// The Pratt parser is not able to parse expressions by grammar. So we need to extract /// the expression operands and operators to be the input of Pratt parser, by running a /// nom parser in advance. /// /// For example, `a + b AND c is null` is parsed as `[col(a), PLUS, col(b), AND, col(c), ISNULL]` by nom parsers. /// Then the Pratt parser is able to parse the expression into `AND(PLUS(col(a), col(b)), ISNULL(col(c)))`. #[derive(Debug, Clone, PartialEq)] pub enum ExprElement { /// Column reference, with indirection like `table.column` ColumnRef { database: Option<Identifier>, table: Option<Identifier>, column: Identifier, }, /// `IS [NOT] NULL` expression IsNull { not: bool, }, /// `IS [NOT] DISTINCT FROM` expression IsDistinctFrom { not: bool, }, /// `[ NOT ] IN (list, ...)` InList { list: Vec<Expr>, not: bool, }, /// `[ NOT ] IN (SELECT ...)` InSubquery { subquery: Box<Query>, not: bool, }, /// `BETWEEN ... AND ...` Between { low: Box<Expr>, high: Box<Expr>, not: bool, }, /// Binary operation BinaryOp { op: BinaryOperator, }, /// Unary operation UnaryOp { op: UnaryOperator, }, /// `CAST` expression, like `CAST(expr AS target_type)` Cast { expr: Box<Expr>, target_type: TypeName, }, /// `TRY_CAST` expression` TryCast { expr: Box<Expr>, target_type: TypeName, }, /// `::<type_name>` expression PgCast { target_type: TypeName, }, /// EXTRACT(IntervalKind FROM <expr>) Extract { field: IntervalKind, expr: Box<Expr>, }, /// POSITION(<expr> IN <expr>) Position { substr_expr: Box<Expr>, str_expr: Box<Expr>, }, /// SUBSTRING(<expr> [FROM <expr>] [FOR <expr>]) SubString { expr: Box<Expr>, substring_from: Box<Expr>, substring_for: Option<Box<Expr>>, }, /// TRIM([[BOTH | LEADING | TRAILING] <expr> FROM] <expr>) /// Or /// TRIM(<expr>) Trim { expr: Box<Expr>, // ([BOTH | LEADING | TRAILING], <expr>) trim_where: Option<(TrimWhere, Box<Expr>)>, }, /// A literal value, such as string, number, date or NULL Literal { lit: Literal, }, /// `Count(*)` expression CountAll, /// `(foo, bar)` Tuple { exprs: Vec<Expr>, }, /// Scalar function call FunctionCall { /// Set to true if the function is aggregate function with `DISTINCT`, like `COUNT(DISTINCT a)` distinct: bool, name: Identifier, args: Vec<Expr>, window: Option<WindowSpec>, params: Vec<Literal>, }, /// `CASE ... WHEN ... ELSE ...` expression Case { operand: Option<Box<Expr>>, conditions: Vec<Expr>, results: Vec<Expr>, else_result: Option<Box<Expr>>, }, /// `EXISTS` expression Exists { subquery: Query, not: bool, }, /// Scalar/ANY/ALL/SOME subquery Subquery { modifier: Option<SubqueryModifier>, subquery: Query, }, /// Access elements of `Array`, `Object` and `Variant` by index or key, like `arr[0]`, or `obj:k1` MapAccess { accessor: MapAccessor, }, /// An expression between parentheses Group(Expr), /// `[1, 2, 3]` Array { exprs: Vec<Expr>, }, /// ARRAY_SORT([1,2,3], ASC|DESC, NULLS FIRST|LAST) ArraySort { expr: Box<Expr>, // Optional `ASC` or `DESC` asc: Option<String>, // Optional `NULLS FIRST` or `NULLS LAST` nulls_first: Option<String>, }, /// `{'k1':'v1','k2':'v2'}` Map { kvs: Vec<(Expr, Expr)>, }, Interval { expr: Expr, unit: IntervalKind, }, DateAdd { unit: IntervalKind, interval: Expr, date: Expr, }, DateSub { unit: IntervalKind, interval: Expr, date: Expr, }, DateTrunc { unit: IntervalKind, date: Expr, }, Skip, } struct ExprParser; impl<'a, I: Iterator<Item = WithSpan<'a, ExprElement>>> PrattParser<I> for ExprParser { type Error = &'static str; type Input = WithSpan<'a, ExprElement>; type Output = Expr; fn query(&mut self, elem: &WithSpan<ExprElement>) -> Result<Affix, &'static str> { let affix = match &elem.elem { ExprElement::MapAccess { .. } => Affix::Postfix(Precedence(25)), ExprElement::IsNull { .. } => Affix::Postfix(Precedence(17)), ExprElement::Between { .. } => Affix::Postfix(Precedence(BETWEEN_PREC)), ExprElement::IsDistinctFrom { .. } => { Affix::Infix(Precedence(BETWEEN_PREC), Associativity::Left) } ExprElement::InList { .. } => Affix::Postfix(Precedence(BETWEEN_PREC)), ExprElement::InSubquery { .. } => Affix::Postfix(Precedence(BETWEEN_PREC)), ExprElement::UnaryOp { op } => match op { UnaryOperator::Not => Affix::Prefix(Precedence(NOT_PREC)), UnaryOperator::Plus => Affix::Prefix(Precedence(50)), UnaryOperator::Minus => Affix::Prefix(Precedence(50)), UnaryOperator::BitwiseNot => Affix::Prefix(Precedence(50)), UnaryOperator::SquareRoot => Affix::Prefix(Precedence(60)), UnaryOperator::CubeRoot => Affix::Prefix(Precedence(60)), UnaryOperator::Abs => Affix::Prefix(Precedence(60)), UnaryOperator::Factorial => Affix::Postfix(Precedence(60)), }, ExprElement::BinaryOp { op } => match op { BinaryOperator::Or => Affix::Infix(Precedence(5), Associativity::Left), BinaryOperator::And => Affix::Infix(Precedence(10), Associativity::Left), BinaryOperator::Eq => Affix::Infix(Precedence(20), Associativity::Right), BinaryOperator::NotEq => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::Gt => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::Lt => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::Gte => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::Lte => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::Like => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::NotLike => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::Regexp => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::NotRegexp => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::RLike => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::NotRLike => Affix::Infix(Precedence(20), Associativity::Left), BinaryOperator::BitwiseOr => Affix::Infix(Precedence(22), Associativity::Left), BinaryOperator::BitwiseAnd => Affix::Infix(Precedence(22), Associativity::Left), BinaryOperator::BitwiseXor => Affix::Infix(Precedence(22), Associativity::Left), BinaryOperator::BitwiseShiftLeft => { Affix::Infix(Precedence(23), Associativity::Left) } BinaryOperator::BitwiseShiftRight => { Affix::Infix(Precedence(23), Associativity::Left) } BinaryOperator::Xor => Affix::Infix(Precedence(24), Associativity::Left), BinaryOperator::Plus => Affix::Infix(Precedence(30), Associativity::Left), BinaryOperator::Minus => Affix::Infix(Precedence(30), Associativity::Left), BinaryOperator::Multiply => Affix::Infix(Precedence(40), Associativity::Left), BinaryOperator::Div => Affix::Infix(Precedence(40), Associativity::Left), BinaryOperator::Divide => Affix::Infix(Precedence(40), Associativity::Left), BinaryOperator::Modulo => Affix::Infix(Precedence(40), Associativity::Left), BinaryOperator::StringConcat => Affix::Infix(Precedence(40), Associativity::Left), BinaryOperator::Caret => Affix::Infix(Precedence(40), Associativity::Left), }, ExprElement::PgCast { .. } => Affix::Postfix(Precedence(60)), _ => Affix::Nilfix, }; Ok(affix) } fn primary(&mut self, elem: WithSpan<'a, ExprElement>) -> Result<Expr, &'static str> { let expr = match elem.elem { ExprElement::ColumnRef { database, table, column, } => Expr::ColumnRef { span: transform_span(elem.span.0), database, table, column, }, ExprElement::Cast { expr, target_type } => Expr::Cast { span: transform_span(elem.span.0), expr, target_type, pg_style: false, }, ExprElement::TryCast { expr, target_type } => Expr::TryCast { span: transform_span(elem.span.0), expr, target_type, }, ExprElement::Extract { field, expr } => Expr::Extract { span: transform_span(elem.span.0), kind: field, expr, }, ExprElement::Position { substr_expr, str_expr, } => Expr::Position { span: transform_span(elem.span.0), substr_expr, str_expr, }, ExprElement::SubString { expr, substring_from, substring_for, } => Expr::Substring { span: transform_span(elem.span.0), expr, substring_from, substring_for, }, ExprElement::Trim { expr, trim_where } => Expr::Trim { span: transform_span(elem.span.0), expr, trim_where, }, ExprElement::Literal { lit } => Expr::Literal { span: transform_span(elem.span.0), lit, }, ExprElement::CountAll => Expr::CountAll { span: transform_span(elem.span.0), }, ExprElement::Tuple { exprs } => Expr::Tuple { span: transform_span(elem.span.0), exprs, }, ExprElement::FunctionCall { distinct, name, args, params, window, } => Expr::FunctionCall { span: transform_span(elem.span.0), distinct, name, args, params, window, }, ExprElement::Case { operand, conditions, results, else_result, } => Expr::Case { span: transform_span(elem.span.0), operand, conditions, results, else_result, }, ExprElement::Exists { subquery, not } => Expr::Exists { span: transform_span(elem.span.0), not, subquery: Box::new(subquery), }, ExprElement::Subquery { subquery, modifier } => Expr::Subquery { span: transform_span(elem.span.0), modifier, subquery: Box::new(subquery), }, ExprElement::Group(expr) => expr, ExprElement::Array { exprs } => Expr::Array { span: transform_span(elem.span.0), exprs, }, ExprElement::ArraySort { expr, asc, nulls_first, } => { let asc = if let Some(asc) = asc { if asc.to_lowercase() == "asc" { true } else if asc.to_lowercase() == "desc" { false } else { return Err("Sorting order must be either ASC or DESC"); } } else { true }; let null_first = if let Some(nulls_first) = nulls_first { let null_first = nulls_first.trim().to_lowercase(); if null_first == "nulls first" { true } else if null_first == "nulls last" { false } else { return Err("Null sorting order must be either NULLS FIRST or NULLS LAST"); } } else { true }; Expr::ArraySort { span: transform_span(elem.span.0), expr, asc, null_first, } } ExprElement::Map { kvs } => Expr::Map { span: transform_span(elem.span.0), kvs, }, ExprElement::Interval { expr, unit } => Expr::Interval { span: transform_span(elem.span.0), expr: Box::new(expr), unit, }, ExprElement::DateAdd { unit, interval, date, } => Expr::DateAdd { span: transform_span(elem.span.0), unit, interval: Box::new(interval), date: Box::new(date), }, ExprElement::DateSub { unit, interval, date, } => Expr::DateSub { span: transform_span(elem.span.0), unit, interval: Box::new(interval), date: Box::new(date), }, ExprElement::DateTrunc { unit, date } => Expr::DateTrunc { span: transform_span(elem.span.0), unit, date: Box::new(date), }, _ => unreachable!(), }; Ok(expr) } fn infix( &mut self, lhs: Expr, elem: WithSpan<'a, ExprElement>, rhs: Expr, ) -> Result<Expr, &'static str> { let expr = match elem.elem { ExprElement::BinaryOp { op } => Expr::BinaryOp { span: transform_span(elem.span.0), left: Box::new(lhs), right: Box::new(rhs), op, }, ExprElement::IsDistinctFrom { not } => Expr::IsDistinctFrom { span: transform_span(elem.span.0), left: Box::new(lhs), right: Box::new(rhs), not, }, _ => unreachable!(), }; Ok(expr) } fn prefix(&mut self, elem: WithSpan<'a, ExprElement>, rhs: Expr) -> Result<Expr, &'static str> { let expr = match elem.elem { ExprElement::UnaryOp { op } => Expr::UnaryOp { span: transform_span(elem.span.0), op, expr: Box::new(rhs), }, _ => unreachable!(), }; Ok(expr) } fn postfix( &mut self, lhs: Expr, elem: WithSpan<'a, ExprElement>, ) -> Result<Expr, &'static str> { let expr = match elem.elem { ExprElement::MapAccess { accessor } => Expr::MapAccess { span: transform_span(elem.span.0), expr: Box::new(lhs), accessor, }, ExprElement::IsNull { not } => Expr::IsNull { span: transform_span(elem.span.0), expr: Box::new(lhs), not, }, ExprElement::InList { list, not } => Expr::InList { span: transform_span(elem.span.0), expr: Box::new(lhs), list, not, }, ExprElement::InSubquery { subquery, not } => Expr::InSubquery { span: transform_span(elem.span.0), expr: Box::new(lhs), subquery, not, }, ExprElement::Between { low, high, not } => Expr::Between { span: transform_span(elem.span.0), expr: Box::new(lhs), low, high, not, }, ExprElement::PgCast { target_type } => Expr::Cast { span: transform_span(elem.span.0), expr: Box::new(lhs), target_type, pg_style: true, }, ExprElement::UnaryOp { op } => Expr::UnaryOp { span: transform_span(elem.span.0), op, expr: Box::new(lhs), }, _ => unreachable!(), }; Ok(expr) } } pub fn expr_element(i: Input) -> IResult<WithSpan<ExprElement>> { let column_ref = map( period_separated_idents_1_to_3, |(database, table, column)| ExprElement::ColumnRef { database, table, column, }, ); let is_null = map( rule! { IS ~ NOT? ~ NULL }, |(_, opt_not, _)| ExprElement::IsNull { not: opt_not.is_some(), }, ); let in_list = map( rule! { NOT? ~ IN ~ "(" ~ #comma_separated_list1(subexpr(0)) ~ ^")" }, |(opt_not, _, _, list, _)| ExprElement::InList { list, not: opt_not.is_some(), }, ); let in_subquery = map( rule! { NOT? ~ IN ~ "(" ~ #query ~ ^")" }, |(opt_not, _, _, subquery, _)| ExprElement::InSubquery { subquery: Box::new(subquery), not: opt_not.is_some(), }, ); let between = map( rule! { NOT? ~ BETWEEN ~ ^#subexpr(BETWEEN_PREC) ~ ^AND ~ ^#subexpr(BETWEEN_PREC) }, |(opt_not, _, low, _, high)| ExprElement::Between { low: Box::new(low), high: Box::new(high), not: opt_not.is_some(), }, ); let cast = map( rule! { ( CAST | TRY_CAST ) ~ "(" ~ ^#subexpr(0) ~ ^( AS | "," ) ~ ^#type_name ~ ^")" }, |(cast, _, expr, _, target_type, _)| { if cast.kind == CAST { ExprElement::Cast { expr: Box::new(expr), target_type, } } else { ExprElement::TryCast { expr: Box::new(expr), target_type, } } }, ); let pg_cast = map( rule! { "::" ~ ^#type_name }, |(_, target_type)| ExprElement::PgCast { target_type }, ); let extract = map( rule! { EXTRACT ~ "(" ~ ^#interval_kind ~ ^FROM ~ ^#subexpr(0) ~ ^")" }, |(_, _, field, _, expr, _)| ExprElement::Extract { field, expr: Box::new(expr), }, ); let position = map( rule! { POSITION ~ "(" ~ ^#subexpr(BETWEEN_PREC) ~ ^IN ~ ^#subexpr(0) ~ ^")" }, |(_, _, substr_expr, _, str_expr, _)| ExprElement::Position { substr_expr: Box::new(substr_expr), str_expr: Box::new(str_expr), }, ); let substring = map( rule! { ( SUBSTRING | SUBSTR ) ~ "(" ~ ^#subexpr(0) ~ ( FROM | "," ) ~ ^#subexpr(0) ~ ( ( FOR | "," ) ~ ^#subexpr(0) )? ~ ^")" }, |(_, _, expr, _, substring_from, opt_substring_for, _)| ExprElement::SubString { expr: Box::new(expr), substring_from: Box::new(substring_from), substring_for: opt_substring_for.map(|(_, expr)| Box::new(expr)), }, ); let trim_where = alt(( value(TrimWhere::Both, rule! { BOTH }), value(TrimWhere::Leading, rule! { LEADING }), value(TrimWhere::Trailing, rule! { TRAILING }), )); let trim = map( rule! { TRIM ~ "(" ~ #subexpr(0) ~ ^")" }, |(_, _, expr, _)| ExprElement::Trim { expr: Box::new(expr), trim_where: None, }, ); let trim_from = map( rule! { TRIM ~ "(" ~ #trim_where ~ ^#subexpr(0) ~ ^FROM ~ ^#subexpr(0) ~ ^")" }, |(_, _, trim_where, trim_str, _, expr, _)| ExprElement::Trim { expr: Box::new(expr), trim_where: Some((trim_where, Box::new(trim_str))), }, ); let count_all = value(ExprElement::CountAll, rule! { COUNT ~ "(" ~ "*" ~ ^")" }); let tuple = map( rule! { "(" ~ #comma_separated_list0_ignore_trailing(subexpr(0)) ~ ","? ~ ^")" }, |(_, mut exprs, opt_trail, _)| { if exprs.len() == 1 && opt_trail.is_none() { ExprElement::Group(exprs.remove(0)) } else { ExprElement::Tuple { exprs } } }, ); let window_frame_between = alt(( map( rule! { BETWEEN ~ #window_frame_bound ~ AND ~ #window_frame_bound }, |(_, s, _, e)| (s, e), ), map(rule! {#window_frame_bound}, |s| { (s, WindowFrameBound::Following(None)) }), )); let window_spec = map( rule! { (PARTITION ~ ^BY ~ #comma_separated_list1(subexpr(0)))? ~ ( ORDER ~ ^BY ~ ^#comma_separated_list1(order_by_expr) )? ~ ((ROWS | RANGE) ~ #window_frame_between)? }, |(opt_partition, opt_order, between)| WindowSpec { partition_by: opt_partition.map(|x| x.2).unwrap_or_default(), order_by: opt_order.map(|x| x.2).unwrap_or_default(), window_frame: between.map(|x| { let unit = match x.0.kind { ROWS => WindowFrameUnits::Rows, RANGE => WindowFrameUnits::Range, _ => unreachable!(), }; let bw = x.1; WindowFrame { units: unit, start_bound: bw.0, end_bound: bw.1, } }), }, ); let function_call = map( rule! { #function_name ~ "(" ~ DISTINCT? ~ #comma_separated_list0(subexpr(0))? ~ ")" }, |(name, _, opt_distinct, opt_args, _)| ExprElement::FunctionCall { distinct: opt_distinct.is_some(), name, args: opt_args.unwrap_or_default(), params: vec![], window: None, }, ); let function_call_with_window = map( rule! { #function_name ~ "(" ~ DISTINCT? ~ #comma_separated_list0(subexpr(0))? ~ ")" ~ (OVER ~ "(" ~ #window_spec ~ ")") }, |(name, _, opt_distinct, opt_args, _, window)| ExprElement::FunctionCall { distinct: opt_distinct.is_some(), name, args: opt_args.unwrap_or_default(), params: vec![], window: Some(window.2), }, ); let function_call_with_params = map( rule! { #function_name ~ ("(" ~ #comma_separated_list1(literal) ~ ")")? ~ "(" ~ DISTINCT? ~ #comma_separated_list0(subexpr(0))? ~ ")" }, |(name, params, _, opt_distinct, opt_args, _)| ExprElement::FunctionCall { distinct: opt_distinct.is_some(), name, args: opt_args.unwrap_or_default(), params: params.map(|x| x.1).unwrap_or_default(), window: None, }, ); let case = map( rule! { CASE ~ #subexpr(0)? ~ ( WHEN ~ ^#subexpr(0) ~ ^THEN ~ ^#subexpr(0) )+ ~ ( ELSE ~ ^#subexpr(0) )? ~ ^END }, |(_, operand, branches, else_result, _)| { let (conditions, results) = branches .into_iter() .map(|(_, cond, _, result)| (cond, result)) .unzip(); let else_result = else_result.map(|(_, result)| result); ExprElement::Case { operand: operand.map(Box::new), conditions, results, else_result: else_result.map(Box::new), } }, ); let exists = map( rule! { NOT? ~ EXISTS ~ "(" ~ ^#query ~ ^")" }, |(opt_not, _, _, subquery, _)| ExprElement::Exists { subquery, not: opt_not.is_some(), }, ); let subquery = map( rule! { (ANY | SOME | ALL)? ~ "(" ~ #query ~ ^")" }, |(modifier, _, subquery, _)| { let modifier = modifier.map(|m| match m.kind { TokenKind::ALL => SubqueryModifier::All, TokenKind::ANY => SubqueryModifier::Any, TokenKind::SOME => SubqueryModifier::Some, _ => unreachable!(), }); ExprElement::Subquery { modifier, subquery } }, ); let binary_op = map(binary_op, |op| ExprElement::BinaryOp { op }); let unary_op = map(unary_op, |op| ExprElement::UnaryOp { op }); let map_access = map(map_access, |accessor| ExprElement::MapAccess { accessor }); // Floating point literal with leading dot will be parsed as a period map access, // and then will be converted back to a floating point literal if the map access // is not following a primary element nor a postfix element. let literal = map(literal, |lit| ExprElement::Literal { lit }); let array = map( // Array that contains a single literal item will be parsed as a bracket map access, // and then will be converted back to an array if the map access is not following // a primary element nor a postfix element. rule! { "[" ~ #comma_separated_list0_ignore_trailing(subexpr(0))? ~ ","? ~ ^"]" }, |(_, opt_args, _, _)| { let exprs = opt_args.unwrap_or_default(); ExprElement::Array { exprs } }, ); // ARRAY_SORT([...], ASC | DESC, NULLS FIRST | LAST) let array_sort = map( rule! { ( ARRAY_SORT ) ~ "(" ~ #subexpr(0) ~ ( "," ~ #literal_string )? ~ ( "," ~ #literal_string )? ~ ")" }, |(_, _, expr, opt_asc, opt_null_first, _)| ExprElement::ArraySort { expr: Box::new(expr), asc: opt_asc.map(|(_, asc)| asc), nulls_first: opt_null_first.map(|(_, first_last)| first_last), }, ); let map_expr = map( rule! { "{" ~ #comma_separated_list0(map_element) ~ "}" }, |(_, kvs, _)| ExprElement::Map { kvs }, ); let date_add = map( rule! { DATE_ADD ~ "(" ~ #interval_kind ~ "," ~ #subexpr(0) ~ "," ~ #subexpr(0) ~ ")" }, |(_, _, unit, _, interval, _, date, _)| ExprElement::DateAdd { unit, interval, date, }, ); let date_sub = map( rule! { DATE_SUB ~ "(" ~ #interval_kind ~ "," ~ #subexpr(0) ~ "," ~ #subexpr(0) ~ ")" }, |(_, _, unit, _, interval, _, date, _)| ExprElement::DateSub { unit, interval, date, }, ); let interval = map( rule! { INTERVAL ~ #subexpr(0) ~ #interval_kind }, |(_, operand, unit)| ExprElement::Interval { expr: operand, unit, }, ); let date_trunc = map( rule! { DATE_TRUNC ~ "(" ~ #interval_kind ~ "," ~ #subexpr(0) ~ ")" }, |(_, _, unit, _, date, _)| ExprElement::DateTrunc { unit, date }, ); let date_expr = map( rule! { DATE ~ #consumed(literal_string) }, |(_, (span, date))| ExprElement::Cast { expr: Box::new(Expr::Literal { span: transform_span(span.0), lit: Literal::String(date), }), target_type: TypeName::Date, }, ); let timestamp_expr = map( rule! { TIMESTAMP ~ #consumed(literal_string) }, |(_, (span, date))| ExprElement::Cast { expr: Box::new(Expr::Literal { span: transform_span(span.0), lit: Literal::String(date), }), target_type: TypeName::Timestamp, }, ); let is_distinct_from = map( rule! { IS ~ NOT? ~ DISTINCT ~ FROM }, |(_, not, _, _)| ExprElement::IsDistinctFrom { not: not.is_some() }, ); let (rest, (span, elem)) = consumed(alt(( // Note: each `alt` call supports maximum of 21 parsers rule!( #is_null : "`... IS [NOT] NULL`" | #in_list : "`[NOT] IN (<expr>, ...)`" | #in_subquery : "`[NOT] IN (SELECT ...)`" | #exists : "`[NOT] EXISTS (SELECT ...)`" | #between : "`[NOT] BETWEEN ... AND ...`" | #binary_op : "<operator>" | #unary_op : "<operator>" | #cast : "`CAST(... AS ...)`" | #date_add: "`DATE_ADD(..., ..., (YEAR | QUARTER | MONTH | DAY | HOUR | MINUTE | SECOND | DOY | DOW))`" | #date_sub: "`DATE_SUB(..., ..., (YEAR | QUARTER | MONTH | DAY | HOUR | MINUTE | SECOND | DOY | DOW))`" | #date_trunc: "`DATE_TRUNC((YEAR | QUARTER | MONTH | DAY | HOUR | MINUTE | SECOND), ...)`" | #date_expr: "`DATE <str_literal>`" | #timestamp_expr: "`TIMESTAMP <str_literal>`" | #interval: "`INTERVAL ... (YEAR | QUARTER | MONTH | DAY | HOUR | MINUTE | SECOND | DOY | DOW)`" | #pg_cast : "`::<type_name>`" | #extract : "`EXTRACT((YEAR | QUARTER | MONTH | DAY | HOUR | MINUTE | SECOND) FROM ...)`" ), rule!( #position : "`POSITION(... IN ...)`" | #substring : "`SUBSTRING(... [FROM ...] [FOR ...])`" | #array_sort : "`ARRAY_SORT([...], 'ASC' | 'DESC', 'NULLS FIRST' | 'NULLS LAST')`" | #trim : "`TRIM(...)`" | #trim_from : "`TRIM([(BOTH | LEADEING | TRAILING) ... FROM ...)`" | #is_distinct_from: "`... IS [NOT] DISTINCT FROM ...`" | #count_all : "COUNT(*)" | #function_call_with_window : "<function>" | #function_call_with_params : "<function>" | #function_call : "<function>" | #case : "`CASE ... END`" | #subquery : "`(SELECT ...)`" | #tuple : "`(<expr> [, ...])`" | #column_ref : "<column>" | #map_access : "[<key>] | .<key> | :<key>" | #literal : "<literal>" | #array : "`[...]`" | #map_expr : "`{...}`" ), )))(i)?; Ok((rest, WithSpan { span, elem })) } pub fn window_frame_bound(i: Input) -> IResult<WindowFrameBound> { alt(( value(WindowFrameBound::CurrentRow, rule! { CURRENT ~ ROW }), map(rule! { #subexpr(0) ~ PRECEDING }, |(expr, _)| { WindowFrameBound::Preceding(Some(Box::new(expr))) }), value( WindowFrameBound::Preceding(None), rule! { UNBOUNDED ~ PRECEDING }, ), map(rule! { #subexpr(0) ~ FOLLOWING }, |(expr, _)| { WindowFrameBound::Following(Some(Box::new(expr))) }), value( WindowFrameBound::Following(None), rule! { UNBOUNDED ~ FOLLOWING }, ), ))(i) } pub fn unary_op(i: Input) -> IResult<UnaryOperator> { // Plus and Minus are parsed as binary op at first. alt(( value(UnaryOperator::Not, rule! { NOT }), value(UnaryOperator::Factorial, rule! { Factorial}), value(UnaryOperator::SquareRoot, rule! { SquareRoot}), value(UnaryOperator::BitwiseNot, rule! {BitWiseNot}), value(UnaryOperator::CubeRoot, rule! { CubeRoot}), value(UnaryOperator::Abs, rule! { Abs}), ))(i) } pub fn binary_op(i: Input) -> IResult<BinaryOperator> { alt(( alt(( value(BinaryOperator::Plus, rule! { "+" }), value(BinaryOperator::Minus, rule! { "-" }), value(BinaryOperator::Multiply, rule! { "*" }), value(BinaryOperator::Divide, rule! { "/" }), value(BinaryOperator::Div, rule! { DIV }), value(BinaryOperator::Modulo, rule! { "%" }), value(BinaryOperator::StringConcat, rule! { "||" }), value(BinaryOperator::Gt, rule! { ">" }), value(BinaryOperator::Lt, rule! { "<" }), value(BinaryOperator::Gte, rule! { ">=" }), value(BinaryOperator::Lte, rule! { "<=" }), value(BinaryOperator::Eq, rule! { "=" }), value(BinaryOperator::NotEq, rule! { "<>" | "!=" }), value(BinaryOperator::Caret, rule! { "^" }), )), alt(( value(BinaryOperator::And, rule! { AND }), value(BinaryOperator::Or, rule! { OR }), value(BinaryOperator::Xor, rule! { XOR }), value(BinaryOperator::Like, rule! { LIKE }), value(BinaryOperator::NotLike, rule! { NOT ~ LIKE }), value(BinaryOperator::Regexp, rule! { REGEXP }), value(BinaryOperator::NotRegexp, rule! { NOT ~ REGEXP }), value(BinaryOperator::RLike, rule! { RLIKE }), value(BinaryOperator::NotRLike, rule! { NOT ~ RLIKE }), value(BinaryOperator::BitwiseOr, rule! { BitWiseOr }), value(BinaryOperator::BitwiseAnd, rule! { BitWiseAnd }), value(BinaryOperator::BitwiseXor, rule! { BitWiseXor }), value(BinaryOperator::BitwiseShiftLeft, rule! { ShiftLeft }), value(BinaryOperator::BitwiseShiftRight, rule! { ShiftRight }), )), ))(i) } pub fn literal(i: Input) -> IResult<Literal> { let string = map(literal_string, Literal::String); let boolean = alt(( value(Literal::Boolean(true), rule! { TRUE }), value(Literal::Boolean(false), rule! { FALSE }), )); let current_timestamp = value(Literal::CurrentTimestamp, rule! { CURRENT_TIMESTAMP }); let null = value(Literal::Null, rule! { NULL }); rule!( #string | #literal_decimal | #literal_hex | #boolean | #current_timestamp | #null )(i) } pub fn literal_hex_str(i: Input) -> IResult<&str> { // 0XFFFF let mysql_hex = map( rule! { MySQLLiteralHex }, |token| &token.text()[2..], ); // x'FFFF' let pg_hex = map( rule! { PGLiteralHex }, |token| &token.text()[2..token.text().len() - 1], ); rule!( #mysql_hex | #pg_hex )(i) } #[allow(clippy::from_str_radix_10)] pub fn literal_u64(i: Input) -> IResult<u64> { let decimal = map_res( rule! { LiteralInteger }, |token| Ok(u64::from_str_radix(token.text(), 10)?), ); let hex = map_res(literal_hex_str, |lit| Ok(u64::from_str_radix(lit, 16)?)); rule!( #decimal | #hex )(i) } pub fn literal_f64(i: Input) -> IResult<f64> { map_res( rule! { LiteralFloat }, |token| Ok(fast_float::parse(token.text())?), )(i) } pub fn literal_decimal(i: Input) -> IResult<Literal> { let decimal_unit = map_res( rule! { LiteralInteger }, |token| Literal::parse_decimal_uint(token.text()), ); let decimal = map_res( rule! { LiteralFloat }, |token| Literal::parse_decimal(token.text()), ); rule!( #decimal_unit | #decimal )(i) } pub fn literal_hex(i: Input) -> IResult<Literal> { let hex_u64 = map_res(literal_hex_str, |lit| { Ok(Literal::UInt64(u64::from_str_radix(lit, 16)?)) }); // todo(youngsofun): more accurate precision let hex_u128 = map_res(literal_hex_str, |lit| { Ok(Literal::Decimal128 { value: i128::from_str_radix(lit, 16)?, precision: 38, scale: 0, }) }); rule!( #hex_u64 | #hex_u128 )(i) } pub fn literal_bool(i: Input) -> IResult<bool> { alt((value(true, rule! { TRUE }), value(false, rule! { FALSE })))(i) } pub fn literal_string(i: Input) -> IResult<String> { map_res( rule! { QuotedString }, |token| { if token .text() .chars() .next() .filter(|c| i.1.is_string_quote(*c)) .is_some() { let str = &token.text()[1..token.text().len() - 1]; let unescaped = unescape(str, '\'').ok_or(ErrorKind::Other("invalid escape or unicode"))?; Ok(unescaped) } else { Err(ErrorKind::ExpectToken(QuotedString)) } }, )(i) } pub fn literal_string_eq_ignore_case(s: &str) -> impl FnMut(Input) -> IResult<()> + '_ { move |i| { map_res(rule! { QuotedString }, |token| { if token.text()[1..token.text().len() - 1].eq_ignore_ascii_case(s) { Ok(()) } else { Err(ErrorKind::ExpectToken(QuotedString)) } })(i) } } pub fn at_string(i: Input) -> IResult<String> { match_token(AtString)(i) .map(|(i2, token)| (i2, token.text()[1..token.text().len()].to_string())) } pub fn type_name(i: Input) -> IResult<TypeName> { let ty_boolean = value(TypeName::Boolean, rule! { BOOLEAN | BOOL }); let ty_uint8 = value( TypeName::UInt8, rule! { ( UINT8 | #map(rule! { TINYINT ~ UNSIGNED }, |(t, _)| t) ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_uint16 = value( TypeName::UInt16, rule! { ( UINT16 | #map(rule! { SMALLINT ~ UNSIGNED }, |(t, _)| t) ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_uint32 = value( TypeName::UInt32, rule! { ( UINT32 | #map(rule! { ( INT | INTEGER ) ~ UNSIGNED }, |(t, _)| t) ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_uint64 = value( TypeName::UInt64, rule! { ( UINT64 | UNSIGNED | #map(rule! { BIGINT ~ UNSIGNED }, |(t, _)| t) ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_int8 = value( TypeName::Int8, rule! { ( INT8 | TINYINT ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_int16 = value( TypeName::Int16, rule! { ( INT16 | SMALLINT ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_int32 = value( TypeName::Int32, rule! { ( INT32 | INT | INTEGER ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_int64 = value( TypeName::Int64, rule! { ( INT64 | SIGNED | BIGINT ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_float32 = value(TypeName::Float32, rule! { FLOAT32 | FLOAT }); let ty_float64 = value( TypeName::Float64, rule! { (FLOAT64 | DOUBLE) ~ ( PRECISION )? }, ); let ty_decimal = map_res( rule! { DECIMAL ~ "(" ~ #literal_u64 ~ "," ~ #literal_u64 ~ ")" }, |(_, _, precision, _, scale, _)| { Ok(TypeName::Decimal { precision: precision .try_into() .map_err(|_| ErrorKind::Other("precision is too large"))?, scale: scale .try_into() .map_err(|_| ErrorKind::Other("scale is too large"))?, }) }, ); let ty_array = map( rule! { ARRAY ~ "(" ~ #type_name ~ ")" }, |(_, _, item_type, _)| TypeName::Array(Box::new(item_type)), ); let ty_map = map( rule! { MAP ~ "(" ~ #type_name ~ "," ~ #type_name ~ ")" }, |(_, _, key_type, _, val_type, _)| TypeName::Map { key_type: Box::new(key_type), val_type: Box::new(val_type), }, ); let ty_nullable = map( rule! { NULLABLE ~ ( "(" ~ #type_name ~ ")" ) }, |(_, item_type)| TypeName::Nullable(Box::new(item_type.1)), ); let ty_tuple = map( rule! { TUPLE ~ "(" ~ #comma_separated_list1(type_name) ~ ")" }, |(_, _, fields_type, _)| TypeName::Tuple { fields_name: None, fields_type, }, ); let ty_named_tuple = map( rule! { TUPLE ~ "(" ~ #comma_separated_list1(rule! { #ident ~ #type_name }) ~ ")" }, |(_, _, fields, _)| { let (fields_name, fields_type) = fields.into_iter().map(|(name, ty)| (name.name, ty)).unzip(); TypeName::Tuple { fields_name: Some(fields_name), fields_type, } }, ); let ty_date = value(TypeName::Date, rule! { DATE }); let ty_datetime = map( rule! { (DATETIME | TIMESTAMP) ~ ( "(" ~ #literal_u64 ~ ")" )? }, |(_, _)| TypeName::Timestamp, ); let ty_string = value( TypeName::String, rule! { ( STRING | VARCHAR | CHAR | CHARACTER | TEXT ) ~ ( "(" ~ #literal_u64 ~ ")" )? }, ); let ty_variant = value(TypeName::Variant, rule! { VARIANT | JSON }); map( rule! { ( #ty_boolean | #ty_uint8 | #ty_uint16 | #ty_uint32 | #ty_uint64 | #ty_int8 | #ty_int16 | #ty_int32 | #ty_int64 | #ty_float32 | #ty_float64 | #ty_decimal | #ty_array | #ty_map | #ty_tuple : "TUPLE(<type>, ...)" | #ty_named_tuple : "TUPLE(<name> <type>, ...)" | #ty_date | #ty_datetime | #ty_string | #ty_variant | #ty_nullable ) ~ NULL? : "type name" }, |(ty, null_opt)| { if null_opt.is_some() && !matches!(ty, TypeName::Nullable(_)) { TypeName::Nullable(Box::new(ty)) } else { ty } }, )(i) } pub fn interval_kind(i: Input) -> IResult<IntervalKind> { alt(( value(IntervalKind::Year, rule! { YEAR }), value(IntervalKind::Quarter, rule! { QUARTER }), value(IntervalKind::Month, rule! { MONTH }), value(IntervalKind::Day, rule! { DAY }), value(IntervalKind::Hour, rule! { HOUR }), value(IntervalKind::Minute, rule! { MINUTE }), value(IntervalKind::Second, rule! { SECOND }), value(IntervalKind::Doy, rule! { DOY }), value(IntervalKind::Dow, rule! { DOW }), value( IntervalKind::Year, rule! { #literal_string_eq_ignore_case("YEAR") }, ), value( IntervalKind::Quarter, rule! { #literal_string_eq_ignore_case("QUARTER") }, ), value( IntervalKind::Month, rule! { #literal_string_eq_ignore_case("MONTH") }, ), value( IntervalKind::Day, rule! { #literal_string_eq_ignore_case("DAY") }, ), value( IntervalKind::Hour, rule! { #literal_string_eq_ignore_case("HOUR") }, ), value( IntervalKind::Minute, rule! { #literal_string_eq_ignore_case("MINUTE") }, ), value( IntervalKind::Second, rule! { #literal_string_eq_ignore_case("SECOND") }, ), value( IntervalKind::Doy, rule! { #literal_string_eq_ignore_case("DOY") }, ), value( IntervalKind::Dow, rule! { #literal_string_eq_ignore_case("DOW") }, ), ))(i) } pub fn map_access(i: Input) -> IResult<MapAccessor> { let bracket = map( rule! { "[" ~ #subexpr(0) ~ "]" }, |(_, key, _)| MapAccessor::Bracket { key: Box::new(key) }, ); let period = map( rule! { "." ~ #ident }, |(_, key)| MapAccessor::Period { key }, ); let period_number = map_res( rule! { LiteralFloat }, |key| { if key.text().starts_with('.') { if let Ok(key) = (key.text()[1..]).parse::<u64>() { return Ok(MapAccessor::PeriodNumber { key }); } } Err(ErrorKind::ExpectText(".")) }, ); let colon = map( rule! { ":" ~ #ident }, |(_, key)| MapAccessor::Colon { key }, ); rule!( #bracket | #period | #period_number | #colon )(i) } pub fn map_element(i: Input) -> IResult<(Expr, Expr)> { map( rule! { #subexpr(0) ~ ":" ~ #subexpr(0) }, |(key, _, value)| (key, value), )(i) }
//------------------------------------------------ // command line syntax: // dnaabox -flag < data_file_test_path /* possible flags are: -pc => pattern_count() ......CHALLENGE 1A -fw => most_frequent_words() ......CHALLENGE 1B -rc => reverse_complement() ......CHALLENGE 1C -pm => pattern_matching() ......CHALLENGE 1D -clf => clump_finding() ......CHALLENGE 1E -ms => minimum_skew() ......CHALLENGE 1F -hd => hamming_distance() ......CHALLENGE 1G -apm => approx_pattern_matching() ......CHALLENGE 1H -fm => freq_word_miss() ......CHALLENGE 1I -fmr => freq_word_miss_rev() ......CHALLENGE 1J -cf => computing_frequences() ......CHALLENGE 1K -ptn => pattern_to_number() ......CHALLENGE 1L -ntp => number_to_pattern() ......CHALLENGE 1M -n => neighbors() ......CHALLENGE 1N */ //------------------------------------------------ mod dnabox; use std::env; fn main(){ let args: Vec<String> = env::args().collect(); if args.len() == 1 || args.len() > 2 { println!("this version requires exactly one command line argument."); return; } match &args[1] as &str { "-pc" => dnabox::pattern_count(), "-ptn" => dnabox::pattern_to_number(), "-ntp" => dnabox::number_to_pattern(), "-fw" => dnabox::most_frequent_words(), "-fwm" => dnabox::freq_word_miss(), "-fm" => dnabox::freq_word_miss(), "-fmr" => dnabox::freq_word_miss_rev(), "-rc" => dnabox::reverse_complement(), "-pm" => dnabox::pattern_matching(), "-apm" => dnabox::approx_pattern_matching(), "-clf" => dnabox::clump_finding(), "-ms" => dnabox::minimum_skew(), "-hd" => dnabox::hamming_distance(), "-cf" => dnabox::computing_frequences(), "-n" => dnabox::neighbors(), &_ => println!("command {} not recognized.",&args[1]) } }
use async_channel::Sender; use std::collections::HashMap; use std::io::Result; use std::net::SocketAddr; use tdn_types::group::{GroupId, Peer}; use tdn_types::message::{GroupSendMessage, SendMessage}; use tdn_types::primitive::PeerAddr; #[derive(Default, Debug)] pub struct CAPermissionedGroup<P: Peer> { id: GroupId, my_pk: P::PublicKey, my_prove: P::Signature, ca: P::PublicKey, peers: HashMap<PeerAddr, (P::PublicKey, P::Signature, SocketAddr)>, peers_name: HashMap<P::PublicKey, PeerAddr>, // Peer Symbol Name } impl<P: Peer> CAPermissionedGroup<P> { pub fn new(id: GroupId, my_pk: P::PublicKey, my_prove: P::Signature, ca: P::PublicKey) -> Self { Self { id, my_pk: my_pk, my_prove: my_prove, ca: ca, peers: HashMap::new(), peers_name: HashMap::new(), } } pub fn peers(&self) -> Vec<&PeerAddr> { self.peers.keys().collect() } pub fn get_peer_addr(&self, name: &P::PublicKey) -> Option<&PeerAddr> { self.peers_name.get(name) } /// directly add a peer to group. pub fn add( &mut self, peer_addr: PeerAddr, pk: P::PublicKey, sign: P::Signature, addr: SocketAddr, ) { self.peers.insert(peer_addr, (pk, sign, addr)); } pub fn join_bytes(&self) -> Vec<u8> { postcard::to_allocvec(&(&self.my_pk, &self.my_prove)).unwrap_or(vec![]) } pub fn sign_prove(sk: &P::SecretKey, pk: &P::PublicKey) -> Result<P::Signature> { let pk_bytes = postcard::to_allocvec(pk).unwrap_or(vec![]); P::sign(sk, &pk_bytes) } /// join: when peer join will call pub async fn join( &mut self, peer_addr: PeerAddr, addr: SocketAddr, join_bytes: Vec<u8>, return_sender: Sender<SendMessage>, ) { let is_ok = self.peers.contains_key(&peer_addr); if is_ok { return_sender .send(SendMessage::Group(GroupSendMessage::StableResult( peer_addr, true, false, self.join_bytes(), ))) .await .expect("CAPermissionedGroup to TDN channel closed"); } let join_data = postcard::from_bytes::<(P::PublicKey, P::Signature)>(&join_bytes); if join_data.is_err() { return return_sender .send(SendMessage::Group(GroupSendMessage::StableResult( peer_addr, false, true, vec![2], ))) .await .expect("CAPermissionedGroup to TDN channel closed"); } let (pk, sign) = join_data.unwrap(); let pk_bytes = postcard::to_allocvec(&pk).unwrap_or(vec![]); if P::verify(&self.ca, &pk_bytes, &sign) { return_sender .send(SendMessage::Group(GroupSendMessage::StableResult( peer_addr, true, false, self.join_bytes(), ))) .await .expect("CAPermissionedGroup to TDN channel closed"); self.peers.insert(peer_addr, (pk.clone(), sign, addr)); self.peers_name.insert(pk, peer_addr); } else { return_sender .send(SendMessage::Group(GroupSendMessage::StableResult( peer_addr, false, true, vec![3], ))) .await .expect("CAPermissionedGroup to TDN channel closed"); } } pub fn join_result(&mut self, peer_addr: PeerAddr, is_ok: bool, _join_result: Vec<u8>) { if !is_ok { self.peers.remove(&peer_addr); } } /// leave: when peer leave will call pub fn leave(&mut self, peer_addr: &PeerAddr) { self.peers.remove(&peer_addr); let mut delete_name = vec![]; for (name, addr) in self.peers_name.iter() { if addr == peer_addr { delete_name.push(name.clone()); } } for name in delete_name { self.peers_name.remove(&name); } } }
mod anti_replay; mod constants; mod device; mod inbound; mod ip; mod messages; mod outbound; mod peer; mod pool; mod route; mod runq; mod types; #[cfg(test)] mod tests; use messages::TransportHeader; use std::mem; use super::constants::REJECT_AFTER_MESSAGES; use super::queue::ParallelQueue; use super::types::*; use super::{tun, udp, Endpoint}; pub const SIZE_TAG: usize = 16; pub const SIZE_MESSAGE_PREFIX: usize = mem::size_of::<TransportHeader>(); pub const CAPACITY_MESSAGE_POSTFIX: usize = SIZE_TAG; pub const fn message_data_len(payload: usize) -> usize { payload + mem::size_of::<TransportHeader>() + SIZE_TAG } pub use device::DeviceHandle as Device; pub use messages::TYPE_TRANSPORT; pub use peer::PeerHandle; pub use types::Callbacks;
use conrod; use conrod::Color; use conrod::render::Text; use conrod::text::rt; use conrod::text; use gfx; use gfx::texture; use gfx::traits::FactoryExt; pub type ColorFormat = gfx::format::Srgba8; type SurfaceFormat = gfx::format::R8_G8_B8_A8; type FullFormat = (SurfaceFormat, gfx::format::Unorm); const FRAGMENT_SHADER: &'static [u8] = b" #version 140 uniform sampler2D t_Color; in vec2 v_Uv; in vec4 v_Color; out vec4 f_Color; void main() { vec4 tex = texture(t_Color, v_Uv); f_Color = vec4(v_Color.rgb, tex.a); } "; const VERTEX_SHADER: &'static [u8] = b" #version 140 in vec2 a_Pos; in vec2 a_Uv; in vec4 a_Color; out vec2 v_Uv; out vec4 v_Color; void main() { v_Uv = a_Uv; v_Color = a_Color; gl_Position = vec4(a_Pos, 0.0, 1.0); } "; gfx_defines! { vertex TextVertex { pos: [f32; 2] = "a_Pos", uv: [f32; 2] = "a_Uv", color: [f32; 4] = "a_Color", } pipeline pipe { vbuf: gfx::VertexBuffer<TextVertex> = (), color: gfx::TextureSampler<[f32; 4]> = "t_Color", out: gfx::BlendTarget<ColorFormat> = ("f_Color", ::gfx::state::MASK_ALL, ::gfx::preset::blend::ALPHA), } } impl TextVertex { fn new(pos: [f32; 2], uv: [f32; 2], color: [f32; 4]) -> TextVertex { TextVertex { pos: pos, uv: uv, color: color, } } } fn create_texture<F, R> (factory: &mut F, width: u32, height: u32, data: &[u8]) -> (gfx::handle::Texture<R, SurfaceFormat>, gfx::handle::ShaderResourceView<R, [f32; 4]>) where R: gfx::Resources, F: gfx::Factory<R> { fn create_texture<T, F, R>(factory: &mut F, kind: gfx::texture::Kind, data: &[&[u8]]) -> Result<(gfx::handle::Texture<R, T::Surface>, gfx::handle::ShaderResourceView<R, T::View>), gfx::CombinedError> where F: gfx::Factory<R>, R: gfx::Resources, T: gfx::format::TextureFormat { use gfx::{format, texture}; use gfx::memory::{Usage, SHADER_RESOURCE}; use gfx_core::memory::Typed; let surface = <T::Surface as format::SurfaceTyped>::get_surface_type(); let num_slices = kind.get_num_slices().unwrap_or(1) as usize; let num_faces = if kind.is_cube() { 6 } else { 1 }; let desc = texture::Info { kind: kind, levels: (data.len() / (num_slices * num_faces)) as texture::Level, format: surface, bind: SHADER_RESOURCE, usage: Usage::Dynamic, }; let cty = <T::Channel as format::ChannelTyped>::get_channel_type(); let raw = try!(factory.create_texture_raw(desc, Some(cty), Some(data))); let levels = (0, raw.get_info().levels - 1); let tex = Typed::new(raw); let view = try!(factory.view_texture_as_shader_resource::<T>( &tex, levels, format::Swizzle::new() )); Ok((tex, view)) } let kind = texture::Kind::D2(width as texture::Size, height as texture::Size, texture::AaMode::Single); create_texture::<ColorFormat, F, R>(factory, kind, &[data]).unwrap() } fn update_texture<R, C>(encoder: &mut gfx::Encoder<R, C>, texture: &gfx::handle::Texture<R, SurfaceFormat>, offset: [u16; 2], size: [u16; 2], data: &[[u8; 4]]) where R: gfx::Resources, C: gfx::CommandBuffer<R> { let info = texture::ImageInfoCommon { xoffset: offset[0], yoffset: offset[1], zoffset: 0, width: size[0], height: size[1], depth: 0, format: (), mipmap: 0, }; encoder.update_texture::<SurfaceFormat, FullFormat>(texture, None, info, data).unwrap(); } fn gamma_srgb_to_linear(c: [f32; 4]) -> [f32; 4] { fn component(f: f32) -> f32 { // Taken from https://github.com/PistonDevelopers/graphics/src/color.rs#L42 if f <= 0.04045 { f / 12.92 } else { ((f + 0.055) / 1.055).powf(2.4) } } [component(c[0]), component(c[1]), component(c[2]), c[3]] } pub struct TextRenderer<R: gfx::Resources> { pso: gfx::PipelineState<R, pipe::Meta>, data: pipe::Data<R>, glyph_cache: conrod::text::GlyphCache, texture: gfx::handle::Texture<R, SurfaceFormat>, texture_view: gfx::handle::ShaderResourceView<R, [f32; 4]>, vertices: Vec<TextVertex>, dpi: f32, screen_width: f32, screen_height: f32, } impl<R: gfx::Resources> TextRenderer<R> { pub fn new<F: gfx::Factory<R>>(window_width: f32, window_height: f32, dpi: f32, main_color: gfx::handle::RenderTargetView<R, ColorFormat>, factory: &mut F) -> Self { // Create texture sampler let sampler_info = texture::SamplerInfo::new(texture::FilterMethod::Bilinear, texture::WrapMode::Clamp); let sampler = factory.create_sampler(sampler_info); // Dummy values for initialization let vbuf = factory.create_vertex_buffer(&[]); let (_, fake_texture) = create_texture(factory, 2, 2, &[0; 4]); let data = pipe::Data { vbuf: vbuf, color: (fake_texture.clone(), sampler), out: main_color.clone(), }; // Compile GL program let pso = factory.create_pipeline_simple(VERTEX_SHADER, FRAGMENT_SHADER, pipe::new()) .unwrap(); // Create glyph cache and its texture let (glyph_cache, cache_tex, cache_tex_view) = { let width = (window_width * dpi) as u32; let height = (window_height * dpi) as u32; const SCALE_TOLERANCE: f32 = 0.1; const POSITION_TOLERANCE: f32 = 0.1; let cache = conrod::text::GlyphCache::new(width, height, SCALE_TOLERANCE, POSITION_TOLERANCE); let data = vec![0; (width * height * 4) as usize]; let (texture, texture_view) = create_texture(factory, width, height, &data); (cache, texture, texture_view) }; TextRenderer { pso: pso, data: data, glyph_cache: glyph_cache, texture: cache_tex, texture_view: cache_tex_view, vertices: Vec::new(), dpi: dpi, screen_width: window_width, screen_height: window_height, } } pub fn prepare_frame(&mut self, dpi: f32, screen_width: f32, screen_height: f32) { self.vertices = Vec::new(); self.dpi = dpi; self.screen_height = screen_height * dpi; self.screen_width = screen_width * dpi; } pub fn add_text<C: gfx::CommandBuffer<R>>(&mut self, color: Color, text: Text, font_id: text::font::Id, encoder: &mut gfx::Encoder<R, C>) { let positioned_glyphs = text.positioned_glyphs(self.dpi); // Queue the glyphs to be cached for glyph in positioned_glyphs { self.glyph_cache.queue_glyph(font_id.index(), glyph.clone()); } let texture = &self.texture; self.glyph_cache .cache_queued(|rect, data| { let offset = [rect.min.x as u16, rect.min.y as u16]; let size = [rect.width() as u16, rect.height() as u16]; let new_data = data.iter().map(|x| [0, 0, 0, *x]).collect::<Vec<_>>(); update_texture(encoder, texture, offset, size, &new_data); }) .unwrap(); let color = gamma_srgb_to_linear(color.to_fsa()); let cache_id = font_id.index(); let origin = rt::point(0.0, 0.0); let sw = self.screen_width; let sh = self.screen_height; // A closure to convert RustType rects to GL rects let to_gl_rect = |screen_rect: rt::Rect<i32>| { rt::Rect { min: origin + (rt::vector(screen_rect.min.x as f32 / sw - 0.5, 1.0 - screen_rect.min.y as f32 / sh - 0.5)) * 2.0, max: origin + (rt::vector(screen_rect.max.x as f32 / sw - 0.5, 1.0 - screen_rect.max.y as f32 / sh - 0.5)) * 2.0, } }; let ref gc = self.glyph_cache; // Create new vertices let extension = positioned_glyphs.into_iter() .filter_map(|g| gc.rect_for(cache_id, g).ok().unwrap_or(None)) .flat_map(|(uv_rect, screen_rect)| { use std::iter::once; let gl_rect = to_gl_rect(screen_rect); let v = |pos, uv| once(TextVertex::new(pos, uv, color)); v([gl_rect.min.x, gl_rect.max.y], [uv_rect.min.x, uv_rect.max.y]) .chain(v([gl_rect.min.x, gl_rect.min.y], [uv_rect.min.x, uv_rect.min.y])) .chain(v([gl_rect.max.x, gl_rect.min.y], [uv_rect.max.x, uv_rect.min.y])) .chain(v([gl_rect.max.x, gl_rect.min.y], [uv_rect.max.x, uv_rect.min.y])) .chain(v([gl_rect.max.x, gl_rect.max.y], [uv_rect.max.x, uv_rect.max.y])) .chain(v([gl_rect.min.x, gl_rect.max.y], [uv_rect.min.x, uv_rect.max.y])) }); self.vertices.extend(extension); } pub fn render<C: gfx::CommandBuffer<R>, F: gfx::Factory<R>>(&mut self, encoder: &mut gfx::Encoder<R, C>, factory: &mut F) { self.data.color.0 = self.texture_view.clone(); let (vbuf, slice) = factory.create_vertex_buffer_with_slice(&self.vertices, ()); self.data.vbuf = vbuf; encoder.draw(&slice, &self.pso, &self.data); } }
use yew::prelude::*; use yew_router::components::RouterAnchor; use crate::app::AppRoute; use super::tab_setting::TabSettings; use super::tab_permission::TabPermissions; use super::tab_users::TabUsers; pub enum Content{ Settings, Permissions, Users } pub struct ViewDetail { content: Content, link: ComponentLink<Self> } pub enum Msg { ChangeContent(Content) } impl Component for ViewDetail { type Message = Msg; type Properties = (); fn create(_: Self::Properties, link: ComponentLink<Self>) -> Self { ViewDetail { content: Content::Settings, link } } fn update(&mut self, msg: Self::Message) -> ShouldRender { match msg { Msg::ChangeContent(content) => { self.content = content; true } } } fn change(&mut self, _: Self::Properties) -> ShouldRender { false } fn view(&self) -> Html { type Anchor = RouterAnchor<AppRoute>; html! { <> <div class="mx-auto pt-5 pb-5 px-4" style="max-width: 1048px;"> <div> <Anchor route=AppRoute::RolesCreated classes="text-decoration-none text-muted"> <i class="bi bi-arrow-left"></i> <span>{"Back To Roles"}</span> </Anchor> </div> <div class="mt-2"> <p class="fw-bold fs-2">{"Brother Yeska"}</p> <div class="pt-2"> <span class="text-muted">{"Role ID"}</span> <code class="text-dark ms-2" style="background-color: #eff0f2; font-family: Roboto, sans-serif;">{"rol_Vbah0QfGcsV9Y28d"}</code> </div> </div> <div class="mt-4"> <ul class="nav nav-tabs"> <li onclick=self.link.callback(|_|Msg::ChangeContent(Content::Settings)) class="nav-item"> <a class={ match self.content { Content::Settings => "nav-link active", _ => "nav-link" } } aria-current="page" href="#">{"Settings"}</a> </li> <li onclick=self.link.callback(|_|Msg::ChangeContent(Content::Permissions)) class="nav-item"> <a class={ match self.content{ Content::Permissions => "nav-link active", _ => "nav-link" } } href="#">{"Permissions"}</a> </li> <li onclick=self.link.callback(|_|Msg::ChangeContent(Content::Users)) class="nav-item"> <a class={ match self.content{ Content::Users => "nav-link active", _ => "nav-link" } } href="#">{"Users"}</a> </li> </ul> </div> { match self.content { Content::Settings => html! { <TabSettings/> }, Content::Permissions => html! { <TabPermissions/> }, Content::Users => html! { <TabUsers/> } } } </div> </> } } }
use crate::{ event::{self, Event}, shutdown::ShutdownSignal, stream::StreamExt01, topology::config::{DataType, GlobalOptions, SourceConfig, SourceDescription}, }; use bytes::Bytes; use futures::compat::Compat; use futures01::{sync::mpsc, Future, Sink, Stream}; use lazy_static::lazy_static; use serde::{Deserialize, Serialize}; use snafu::Snafu; use std::{io, sync::Mutex, thread}; use tokio::sync::broadcast::{channel, Sender}; #[derive(Debug, Snafu)] enum BuildError { #[snafu(display("CRITICAL_SECTION poisoned"))] CriticalSectionPoisoned, } lazy_static! { static ref CRITICAL_SECTION: Mutex<Option<Sender<Bytes>>> = Mutex::default(); } #[derive(Deserialize, Serialize, Debug, Clone)] #[serde(deny_unknown_fields, default)] pub struct StdinConfig { #[serde(default = "default_max_length")] pub max_length: usize, pub host_key: Option<String>, } impl Default for StdinConfig { fn default() -> Self { StdinConfig { max_length: default_max_length(), host_key: None, } } } fn default_max_length() -> usize { bytesize::kib(100u64) as usize } inventory::submit! { SourceDescription::new::<StdinConfig>("stdin") } #[typetag::serde(name = "stdin")] impl SourceConfig for StdinConfig { fn build( &self, _name: &str, _globals: &GlobalOptions, shutdown: ShutdownSignal, out: mpsc::Sender<Event>, ) -> crate::Result<super::Source> { stdin_source(io::BufReader::new(io::stdin()), self.clone(), shutdown, out) } fn output_type(&self) -> DataType { DataType::Log } fn source_type(&self) -> &'static str { "stdin" } } pub fn stdin_source<R>( stdin: R, config: StdinConfig, shutdown: ShutdownSignal, out: mpsc::Sender<Event>, ) -> crate::Result<super::Source> where R: Send + io::BufRead + 'static, { // The idea is to have one dedicated future for reading stdin running in the background, // and the sources would recieve the lines thorugh a multi consumer channel. // // Implemented solution relies on having a copy of optional sender behind a global mutex, // and have stdin sources and background thread synchronize on it. // // When source is built it must: // 1. enter critical section by locking mutex. // 2. if sender isn't present start background thread and set sender. // 3. gain receiver by calling subscribe on the sender. // 4. release lock. // // When source has finished it should just drop it's receiver. // // Background thread should be started with copy of the sender. // // Once background thread wants to stop it must: // 1. enter critical section by locking mutex. // 2. if there are receivers it must abort the stop. // 3. remove sender. // 4. release lock. // // Although it's possible to implement this in a lock free, maybe even wait free manner, // this should be easier to reason about and performance shouldn't suffer since this procedure // is cold compared to the rest of the source. let host_key = config .host_key .unwrap_or_else(|| event::log_schema().host_key().to_string()); let hostname = hostname::get_hostname(); let mut guard = CRITICAL_SECTION .lock() .map_err(|_| BuildError::CriticalSectionPoisoned)?; let receiver = match guard.as_ref() { Some(sender) => sender.subscribe(), None => { let (sender, receiver) = channel(1024); *guard = Some(sender.clone()); // Start the background thread thread::spawn(move || { info!("Capturing STDIN."); for line in stdin.lines() { match line { Err(e) => { error!(message = "Unable to read from source.", error = %e); break; } Ok(line) => { if sender.send(Bytes::from(line)).is_err() { // There are no active receivers. // Try to stop. let mut guard = CRITICAL_SECTION.lock().expect("CRITICAL_SECTION poisoned"); if sender.receiver_count() == 0 { guard.take(); return; } // A new receiver has shown up. // It's fine not to resend the line since it came from // before this new receiver has shown up. } } } } CRITICAL_SECTION .lock() .expect("CRITICAL_SECTION poisoned") .take(); }); receiver } }; std::mem::drop(guard); Ok(Box::new( Compat::new(receiver) .take_until(shutdown) .map(move |line| create_event(line, &host_key, &hostname)) .map_err(|e| error!("error reading line: {:?}", e)) .forward( out.sink_map_err(|e| error!(message = "Unable to send event to out.", error = %e)), ) .map(|_| info!("finished sending")), )) } fn create_event(line: Bytes, host_key: &str, hostname: &Option<String>) -> Event { let mut event = Event::from(line); // Add source type event .as_mut_log() .insert(event::log_schema().source_type_key(), "stdin"); if let Some(hostname) = &hostname { event.as_mut_log().insert(host_key, hostname.clone()); } event } #[cfg(test)] mod tests { use super::*; use crate::{event, test_util::runtime}; use futures01::sync::mpsc; use futures01::Async::*; use std::io::Cursor; #[test] fn stdin_create_event() { let line = Bytes::from("hello world"); let host_key = "host".to_string(); let hostname = Some("Some.Machine".to_string()); let event = create_event(line, &host_key, &hostname); let log = event.into_log(); assert_eq!(log[&"host".into()], "Some.Machine".into()); assert_eq!( log[&event::log_schema().message_key()], "hello world".into() ); assert_eq!(log[event::log_schema().source_type_key()], "stdin".into()); } #[test] fn stdin_decodes_line() { crate::test_util::trace_init(); let (tx, mut rx) = mpsc::channel(10); let config = StdinConfig::default(); let buf = Cursor::new("hello world\nhello world again"); let mut rt = runtime(); let source = stdin_source(buf, config, ShutdownSignal::noop(), tx).unwrap(); rt.block_on(source).unwrap(); let event = rx.poll().unwrap(); assert!(event.is_ready()); assert_eq!( Ready(Some("hello world".into())), event.map(|event| event .map(|event| event.as_log()[&event::log_schema().message_key()].to_string_lossy())) ); let event = rx.poll().unwrap(); assert!(event.is_ready()); assert_eq!( Ready(Some("hello world again".into())), event.map(|event| event .map(|event| event.as_log()[&event::log_schema().message_key()].to_string_lossy())) ); let event = rx.poll().unwrap(); assert!(event.is_ready()); assert_eq!(Ready(None), event); } }
fn main() { let a = 3.1f32; let b = 3.9f32; let c = -3.1f32; let d = -3.9f32; assert_eq!(a.trunc(), 3.0); assert_eq!(b.trunc(), 3.0); assert_eq!(c.trunc(), -3.0); assert_eq!(d.trunc(), -3.0); }
#[doc = "Reader of register CR1"] pub type R = crate::R<u32, super::CR1>; #[doc = "Writer for register CR1"] pub type W = crate::W<u32, super::CR1>; #[doc = "Register CR1 `reset()`'s with value 0"] impl crate::ResetValue for super::CR1 { type Type = u32; #[inline(always)] fn reset_value() -> Self::Type { 0 } } #[doc = "Locking the AF configuration of associated IOs\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum IOLOCK_A { #[doc = "0: IO configuration unlocked"] UNLOCKED = 0, #[doc = "1: IO configuration locked"] LOCKED = 1, } impl From<IOLOCK_A> for bool { #[inline(always)] fn from(variant: IOLOCK_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `IOLOCK`"] pub type IOLOCK_R = crate::R<bool, IOLOCK_A>; impl IOLOCK_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> IOLOCK_A { match self.bits { false => IOLOCK_A::UNLOCKED, true => IOLOCK_A::LOCKED, } } #[doc = "Checks if the value of the field is `UNLOCKED`"] #[inline(always)] pub fn is_unlocked(&self) -> bool { *self == IOLOCK_A::UNLOCKED } #[doc = "Checks if the value of the field is `LOCKED`"] #[inline(always)] pub fn is_locked(&self) -> bool { *self == IOLOCK_A::LOCKED } } #[doc = "CRC calculation initialization pattern control for transmitter\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum TCRCINI_A { #[doc = "0: All zeros TX CRC initialization pattern"] ALLZEROS = 0, #[doc = "1: All ones TX CRC initialization pattern"] ALLONES = 1, } impl From<TCRCINI_A> for bool { #[inline(always)] fn from(variant: TCRCINI_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `TCRCINI`"] pub type TCRCINI_R = crate::R<bool, TCRCINI_A>; impl TCRCINI_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> TCRCINI_A { match self.bits { false => TCRCINI_A::ALLZEROS, true => TCRCINI_A::ALLONES, } } #[doc = "Checks if the value of the field is `ALLZEROS`"] #[inline(always)] pub fn is_all_zeros(&self) -> bool { *self == TCRCINI_A::ALLZEROS } #[doc = "Checks if the value of the field is `ALLONES`"] #[inline(always)] pub fn is_all_ones(&self) -> bool { *self == TCRCINI_A::ALLONES } } #[doc = "Write proxy for field `TCRCINI`"] pub struct TCRCINI_W<'a> { w: &'a mut W, } impl<'a> TCRCINI_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: TCRCINI_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "All zeros TX CRC initialization pattern"] #[inline(always)] pub fn all_zeros(self) -> &'a mut W { self.variant(TCRCINI_A::ALLZEROS) } #[doc = "All ones TX CRC initialization pattern"] #[inline(always)] pub fn all_ones(self) -> &'a mut W { self.variant(TCRCINI_A::ALLONES) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 15)) | (((value as u32) & 0x01) << 15); self.w } } #[doc = "CRC calculation initialization pattern control for receiver\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum RCRCINI_A { #[doc = "0: All zeros RX CRC initialization pattern"] ALLZEROS = 0, #[doc = "1: All ones RX CRC initialization pattern"] ALLONES = 1, } impl From<RCRCINI_A> for bool { #[inline(always)] fn from(variant: RCRCINI_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `RCRCINI`"] pub type RCRCINI_R = crate::R<bool, RCRCINI_A>; impl RCRCINI_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> RCRCINI_A { match self.bits { false => RCRCINI_A::ALLZEROS, true => RCRCINI_A::ALLONES, } } #[doc = "Checks if the value of the field is `ALLZEROS`"] #[inline(always)] pub fn is_all_zeros(&self) -> bool { *self == RCRCINI_A::ALLZEROS } #[doc = "Checks if the value of the field is `ALLONES`"] #[inline(always)] pub fn is_all_ones(&self) -> bool { *self == RCRCINI_A::ALLONES } } #[doc = "Write proxy for field `RCRCINI`"] pub struct RCRCINI_W<'a> { w: &'a mut W, } impl<'a> RCRCINI_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: RCRCINI_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "All zeros RX CRC initialization pattern"] #[inline(always)] pub fn all_zeros(self) -> &'a mut W { self.variant(RCRCINI_A::ALLZEROS) } #[doc = "All ones RX CRC initialization pattern"] #[inline(always)] pub fn all_ones(self) -> &'a mut W { self.variant(RCRCINI_A::ALLONES) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 14)) | (((value as u32) & 0x01) << 14); self.w } } #[doc = "32-bit CRC polynomial configuration\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum CRC33_17_A { #[doc = "0: Full size (33/17 bit) CRC polynomial is not used"] DISABLED = 0, #[doc = "1: Full size (33/17 bit) CRC polynomial is used"] ENABLED = 1, } impl From<CRC33_17_A> for bool { #[inline(always)] fn from(variant: CRC33_17_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `CRC33_17`"] pub type CRC33_17_R = crate::R<bool, CRC33_17_A>; impl CRC33_17_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> CRC33_17_A { match self.bits { false => CRC33_17_A::DISABLED, true => CRC33_17_A::ENABLED, } } #[doc = "Checks if the value of the field is `DISABLED`"] #[inline(always)] pub fn is_disabled(&self) -> bool { *self == CRC33_17_A::DISABLED } #[doc = "Checks if the value of the field is `ENABLED`"] #[inline(always)] pub fn is_enabled(&self) -> bool { *self == CRC33_17_A::ENABLED } } #[doc = "Write proxy for field `CRC33_17`"] pub struct CRC33_17_W<'a> { w: &'a mut W, } impl<'a> CRC33_17_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: CRC33_17_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "Full size (33/17 bit) CRC polynomial is not used"] #[inline(always)] pub fn disabled(self) -> &'a mut W { self.variant(CRC33_17_A::DISABLED) } #[doc = "Full size (33/17 bit) CRC polynomial is used"] #[inline(always)] pub fn enabled(self) -> &'a mut W { self.variant(CRC33_17_A::ENABLED) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 13)) | (((value as u32) & 0x01) << 13); self.w } } #[doc = "Internal SS signal input level\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum SSI_A { #[doc = "0: 0 is forced onto the SS signal and the I/O value of the SS pin is ignored"] SLAVESELECTED = 0, #[doc = "1: 1 is forced onto the SS signal and the I/O value of the SS pin is ignored"] SLAVENOTSELECTED = 1, } impl From<SSI_A> for bool { #[inline(always)] fn from(variant: SSI_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `SSI`"] pub type SSI_R = crate::R<bool, SSI_A>; impl SSI_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> SSI_A { match self.bits { false => SSI_A::SLAVESELECTED, true => SSI_A::SLAVENOTSELECTED, } } #[doc = "Checks if the value of the field is `SLAVESELECTED`"] #[inline(always)] pub fn is_slave_selected(&self) -> bool { *self == SSI_A::SLAVESELECTED } #[doc = "Checks if the value of the field is `SLAVENOTSELECTED`"] #[inline(always)] pub fn is_slave_not_selected(&self) -> bool { *self == SSI_A::SLAVENOTSELECTED } } #[doc = "Write proxy for field `SSI`"] pub struct SSI_W<'a> { w: &'a mut W, } impl<'a> SSI_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: SSI_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "0 is forced onto the SS signal and the I/O value of the SS pin is ignored"] #[inline(always)] pub fn slave_selected(self) -> &'a mut W { self.variant(SSI_A::SLAVESELECTED) } #[doc = "1 is forced onto the SS signal and the I/O value of the SS pin is ignored"] #[inline(always)] pub fn slave_not_selected(self) -> &'a mut W { self.variant(SSI_A::SLAVENOTSELECTED) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 12)) | (((value as u32) & 0x01) << 12); self.w } } #[doc = "Rx/Tx direction at Half-duplex mode\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum HDDIR_A { #[doc = "0: Receiver in half duplex mode"] RECEIVER = 0, #[doc = "1: Transmitter in half duplex mode"] TRANSMITTER = 1, } impl From<HDDIR_A> for bool { #[inline(always)] fn from(variant: HDDIR_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `HDDIR`"] pub type HDDIR_R = crate::R<bool, HDDIR_A>; impl HDDIR_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> HDDIR_A { match self.bits { false => HDDIR_A::RECEIVER, true => HDDIR_A::TRANSMITTER, } } #[doc = "Checks if the value of the field is `RECEIVER`"] #[inline(always)] pub fn is_receiver(&self) -> bool { *self == HDDIR_A::RECEIVER } #[doc = "Checks if the value of the field is `TRANSMITTER`"] #[inline(always)] pub fn is_transmitter(&self) -> bool { *self == HDDIR_A::TRANSMITTER } } #[doc = "Write proxy for field `HDDIR`"] pub struct HDDIR_W<'a> { w: &'a mut W, } impl<'a> HDDIR_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: HDDIR_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "Receiver in half duplex mode"] #[inline(always)] pub fn receiver(self) -> &'a mut W { self.variant(HDDIR_A::RECEIVER) } #[doc = "Transmitter in half duplex mode"] #[inline(always)] pub fn transmitter(self) -> &'a mut W { self.variant(HDDIR_A::TRANSMITTER) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 11)) | (((value as u32) & 0x01) << 11); self.w } } #[doc = "Master SUSPend request\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum CSUSP_AW { #[doc = "0: Do not request master suspend"] NOTREQUESTED = 0, #[doc = "1: Request master suspend"] REQUESTED = 1, } impl From<CSUSP_AW> for bool { #[inline(always)] fn from(variant: CSUSP_AW) -> Self { variant as u8 != 0 } } #[doc = "Write proxy for field `CSUSP`"] pub struct CSUSP_W<'a> { w: &'a mut W, } impl<'a> CSUSP_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: CSUSP_AW) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "Do not request master suspend"] #[inline(always)] pub fn not_requested(self) -> &'a mut W { self.variant(CSUSP_AW::NOTREQUESTED) } #[doc = "Request master suspend"] #[inline(always)] pub fn requested(self) -> &'a mut W { self.variant(CSUSP_AW::REQUESTED) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 10)) | (((value as u32) & 0x01) << 10); self.w } } #[doc = "Master transfer start\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum CSTART_A { #[doc = "0: Do not start master transfer"] NOTSTARTED = 0, #[doc = "1: Start master transfer"] STARTED = 1, } impl From<CSTART_A> for bool { #[inline(always)] fn from(variant: CSTART_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `CSTART`"] pub type CSTART_R = crate::R<bool, CSTART_A>; impl CSTART_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> CSTART_A { match self.bits { false => CSTART_A::NOTSTARTED, true => CSTART_A::STARTED, } } #[doc = "Checks if the value of the field is `NOTSTARTED`"] #[inline(always)] pub fn is_not_started(&self) -> bool { *self == CSTART_A::NOTSTARTED } #[doc = "Checks if the value of the field is `STARTED`"] #[inline(always)] pub fn is_started(&self) -> bool { *self == CSTART_A::STARTED } } #[doc = "Write proxy for field `CSTART`"] pub struct CSTART_W<'a> { w: &'a mut W, } impl<'a> CSTART_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: CSTART_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "Do not start master transfer"] #[inline(always)] pub fn not_started(self) -> &'a mut W { self.variant(CSTART_A::NOTSTARTED) } #[doc = "Start master transfer"] #[inline(always)] pub fn started(self) -> &'a mut W { self.variant(CSTART_A::STARTED) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 9)) | (((value as u32) & 0x01) << 9); self.w } } #[doc = "Master automatic SUSP in Receive mode\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum MASRX_A { #[doc = "0: Automatic suspend in master receive-only mode disabled"] DISABLED = 0, #[doc = "1: Automatic suspend in master receive-only mode enabled"] ENABLED = 1, } impl From<MASRX_A> for bool { #[inline(always)] fn from(variant: MASRX_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `MASRX`"] pub type MASRX_R = crate::R<bool, MASRX_A>; impl MASRX_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> MASRX_A { match self.bits { false => MASRX_A::DISABLED, true => MASRX_A::ENABLED, } } #[doc = "Checks if the value of the field is `DISABLED`"] #[inline(always)] pub fn is_disabled(&self) -> bool { *self == MASRX_A::DISABLED } #[doc = "Checks if the value of the field is `ENABLED`"] #[inline(always)] pub fn is_enabled(&self) -> bool { *self == MASRX_A::ENABLED } } #[doc = "Write proxy for field `MASRX`"] pub struct MASRX_W<'a> { w: &'a mut W, } impl<'a> MASRX_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: MASRX_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "Automatic suspend in master receive-only mode disabled"] #[inline(always)] pub fn disabled(self) -> &'a mut W { self.variant(MASRX_A::DISABLED) } #[doc = "Automatic suspend in master receive-only mode enabled"] #[inline(always)] pub fn enabled(self) -> &'a mut W { self.variant(MASRX_A::ENABLED) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 8)) | (((value as u32) & 0x01) << 8); self.w } } #[doc = "Serial Peripheral Enable\n\nValue on reset: 0"] #[derive(Clone, Copy, Debug, PartialEq)] pub enum SPE_A { #[doc = "0: Peripheral disabled"] DISABLED = 0, #[doc = "1: Peripheral enabled"] ENABLED = 1, } impl From<SPE_A> for bool { #[inline(always)] fn from(variant: SPE_A) -> Self { variant as u8 != 0 } } #[doc = "Reader of field `SPE`"] pub type SPE_R = crate::R<bool, SPE_A>; impl SPE_R { #[doc = r"Get enumerated values variant"] #[inline(always)] pub fn variant(&self) -> SPE_A { match self.bits { false => SPE_A::DISABLED, true => SPE_A::ENABLED, } } #[doc = "Checks if the value of the field is `DISABLED`"] #[inline(always)] pub fn is_disabled(&self) -> bool { *self == SPE_A::DISABLED } #[doc = "Checks if the value of the field is `ENABLED`"] #[inline(always)] pub fn is_enabled(&self) -> bool { *self == SPE_A::ENABLED } } #[doc = "Write proxy for field `SPE`"] pub struct SPE_W<'a> { w: &'a mut W, } impl<'a> SPE_W<'a> { #[doc = r"Writes `variant` to the field"] #[inline(always)] pub fn variant(self, variant: SPE_A) -> &'a mut W { { self.bit(variant.into()) } } #[doc = "Peripheral disabled"] #[inline(always)] pub fn disabled(self) -> &'a mut W { self.variant(SPE_A::DISABLED) } #[doc = "Peripheral enabled"] #[inline(always)] pub fn enabled(self) -> &'a mut W { self.variant(SPE_A::ENABLED) } #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !0x01) | ((value as u32) & 0x01); self.w } } impl R { #[doc = "Bit 16 - Locking the AF configuration of associated IOs"] #[inline(always)] pub fn iolock(&self) -> IOLOCK_R { IOLOCK_R::new(((self.bits >> 16) & 0x01) != 0) } #[doc = "Bit 15 - CRC calculation initialization pattern control for transmitter"] #[inline(always)] pub fn tcrcini(&self) -> TCRCINI_R { TCRCINI_R::new(((self.bits >> 15) & 0x01) != 0) } #[doc = "Bit 14 - CRC calculation initialization pattern control for receiver"] #[inline(always)] pub fn rcrcini(&self) -> RCRCINI_R { RCRCINI_R::new(((self.bits >> 14) & 0x01) != 0) } #[doc = "Bit 13 - 32-bit CRC polynomial configuration"] #[inline(always)] pub fn crc33_17(&self) -> CRC33_17_R { CRC33_17_R::new(((self.bits >> 13) & 0x01) != 0) } #[doc = "Bit 12 - Internal SS signal input level"] #[inline(always)] pub fn ssi(&self) -> SSI_R { SSI_R::new(((self.bits >> 12) & 0x01) != 0) } #[doc = "Bit 11 - Rx/Tx direction at Half-duplex mode"] #[inline(always)] pub fn hddir(&self) -> HDDIR_R { HDDIR_R::new(((self.bits >> 11) & 0x01) != 0) } #[doc = "Bit 9 - Master transfer start"] #[inline(always)] pub fn cstart(&self) -> CSTART_R { CSTART_R::new(((self.bits >> 9) & 0x01) != 0) } #[doc = "Bit 8 - Master automatic SUSP in Receive mode"] #[inline(always)] pub fn masrx(&self) -> MASRX_R { MASRX_R::new(((self.bits >> 8) & 0x01) != 0) } #[doc = "Bit 0 - Serial Peripheral Enable"] #[inline(always)] pub fn spe(&self) -> SPE_R { SPE_R::new((self.bits & 0x01) != 0) } } impl W { #[doc = "Bit 15 - CRC calculation initialization pattern control for transmitter"] #[inline(always)] pub fn tcrcini(&mut self) -> TCRCINI_W { TCRCINI_W { w: self } } #[doc = "Bit 14 - CRC calculation initialization pattern control for receiver"] #[inline(always)] pub fn rcrcini(&mut self) -> RCRCINI_W { RCRCINI_W { w: self } } #[doc = "Bit 13 - 32-bit CRC polynomial configuration"] #[inline(always)] pub fn crc33_17(&mut self) -> CRC33_17_W { CRC33_17_W { w: self } } #[doc = "Bit 12 - Internal SS signal input level"] #[inline(always)] pub fn ssi(&mut self) -> SSI_W { SSI_W { w: self } } #[doc = "Bit 11 - Rx/Tx direction at Half-duplex mode"] #[inline(always)] pub fn hddir(&mut self) -> HDDIR_W { HDDIR_W { w: self } } #[doc = "Bit 10 - Master SUSPend request"] #[inline(always)] pub fn csusp(&mut self) -> CSUSP_W { CSUSP_W { w: self } } #[doc = "Bit 9 - Master transfer start"] #[inline(always)] pub fn cstart(&mut self) -> CSTART_W { CSTART_W { w: self } } #[doc = "Bit 8 - Master automatic SUSP in Receive mode"] #[inline(always)] pub fn masrx(&mut self) -> MASRX_W { MASRX_W { w: self } } #[doc = "Bit 0 - Serial Peripheral Enable"] #[inline(always)] pub fn spe(&mut self) -> SPE_W { SPE_W { w: self } } }
use super::check; #[test] fn t01_inline() { check( ".result {\n output: 'squoted';\n output: #{'squoted'};\n \ output: \"[#{'squoted'}]\";\n output: \"#{'squoted'}\";\n \ output: '#{'squoted'}';\n output: \"['#{'squoted'}']\";\n}\n", ".result {\n output: 'squoted';\n output: squoted;\n \ output: \"[squoted]\";\n output: \"squoted\";\n \ output: \"squoted\";\n output: \"['squoted']\";\n}\n", ) } #[test] fn t02_variable() { check( "$input: 'squoted';\n.result {\n output: $input;\n \ output: #{$input};\n output: \"[#{$input}]\";\n \ output: \"#{$input}\";\n output: '#{$input}';\n \ output: \"['#{$input}']\";\n}\n", ".result {\n output: \"squoted\";\n output: squoted;\n \ output: \"[squoted]\";\n output: \"squoted\";\n \ output: \"squoted\";\n output: \"['squoted']\";\n}\n", ) } #[test] fn t06_escape_interpolation() { check( "$input: 'squoted';\n.result {\n output: \"[\\#{'squoted'}]\";\n \ output: \"\\#{'squoted'}\";\n output: '\\#{'squoted'}';\n \ output: \"['\\#{'squoted'}']\";\n}\n", ".result {\n output: \"[\\#{'squoted'}]\";\n \ output: \"\\#{'squoted'}\";\n output: \"#{\" squoted \"}\";\n \ output: \"['\\#{'squoted'}']\";\n}\n", ) }
use Command; use hex; use std::io; use std::io::prelude::*; use std::net::TcpStream; use std::io::BufReader; use atoi::atoi; pub struct Request<'a> { pub reader: BufReader<&'a TcpStream>, } impl<'a> Request<'a> { // add code here pub fn decode(&mut self) -> io::Result<Option<Command>> { if let Some(line) = self.read_line()? { let mut line_iter = line.iter(); if line_iter.next() != Some(&b'*') { return Err(io::Error::new(io::ErrorKind::Other, "not an array")); } let argc = line_iter .next() .and_then(|arg| atoi::<u8>(&[*arg])) .ok_or(io::Error::new(io::ErrorKind::Other, "Malformed request"))?; let mut args: Vec<Vec<u8>> = Vec::new(); for _i in 0..argc { self.read_line()? .and_then(|line| { if line.starts_with(&[b'$']) { Some(line) } else { None } }) .and_then(|line| { atoi::<usize>(line.get(1..)?) }) .and_then(|size: usize| { let mut line = self.read_exact(size + 2).ok()??; line.truncate(size); args.push(line); Some(0) }) .ok_or(io::Error::new(io::ErrorKind::Other, "Malformed request"))?; } match &args[0][..] { b"PING" => Ok(Some(Command::PING)), b"SET" => { if args.len() < 2 { return Err(io::Error::new(io::ErrorKind::Other, "Malformed request")); } Ok(Some(Command::SET(args.swap_remove(2)))) } b"GET" => { if args.len() < 1 { return Err(io::Error::new(io::ErrorKind::Other, "Malformed request")); } let hash = match hex::decode(&args[1]) { Ok(hash) => hash, Err(_) => { return Err(io::Error::new(io::ErrorKind::Other, "Malformed request")); } }; Ok(Some(Command::GET(hash))) } _ => Ok(Some(Command::NOTSUPPORTED)), } } else { Ok(None) } } fn read_line(&mut self) -> io::Result<Option<Vec<u8>>> { let mut line = vec![]; self.reader.read_until(b'\n', &mut line)?; line.pop(); line.pop(); if !line.is_empty() { Ok(Some(line)) } else { Ok(None) } } fn read_exact(&mut self, size: usize) -> io::Result<Option<Vec<u8>>> { let mut line = vec![0u8; size]; self.reader.read_exact(&mut line)?; if !line.is_empty() { Ok(Some(line)) } else { Ok(None) } } }
extern crate structopt; #[macro_use] extern crate structopt_derive; use structopt::StructOpt; use std::net::UdpSocket; const PIN_LED1: i32 = 0; const PIN_LED2: i32 = 2; const PIN_INPUT: i32 = 3; fn set_led_state(buf: &mut [u8], pin: usize, val: &str) { match val { "on" => buf[pin] = 1, "off" => buf[pin] = 0, _ => (), } } #[derive(StructOpt, Debug)] struct Opt { #[structopt(long = "led1", help = "turn led1 ON/OFF")] led1: Option<String>, #[structopt(long = "led2", help = "turn led2 ON/OFF")] led2: Option<String>, #[structopt(long="remoteaddr", help = "remote IP")] remoteaddr: String, } fn main() { let opt = Opt::from_args(); println!("{:?}", opt); let mut buf = [2;2]; if let Some(state) = opt.led1 { set_led_state(&mut buf, 0, &state); } if let Some(state) = opt.led2 { set_led_state(&mut buf, 1, &state); } let serv_addr = opt.remoteaddr; let mut socket = UdpSocket::bind("0.0.0.0:0").unwrap(); socket.send_to(&buf, serv_addr); }
use std::str::FromStr; use solana_program::pubkey::Pubkey; pub fn susy_wrapped_gton_mint() -> Pubkey { Pubkey::from_str("nVZnRKdr3pmcgnJvYDE8iafgiMiBqxiffQMcyv5ETdA").unwrap() }
test_stdout!(without_value_returns_empty_list, "[]\n"); test_stdout!( with_value_returns_keys_with_value_in_list, "true\ntrue\nfalse\n" ); // From https://github.com/erlang/otp/blob/a62aed81c56c724f7dd7040adecaa28a78e5d37f/erts/doc/src/erlang.xml#L2104-L2112 test_stdout!(doc_test, "true\ntrue\ntrue\ntrue\ntrue\ntrue\n");
// Copyright 2014 The Rust Project Developers. See the COPYRIGHT // file at the top-level directory of this distribution and at // http://rust-lang.org/COPYRIGHT. // // Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or // http://www.apache.org/licenses/LICENSE-2.0> or the MIT license // <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your // option. This file may not be copied, modified, or distributed // except according to those terms. // run-pass // This test verifies that casting from the same lifetime on a value // to the same lifetime on a trait succeeds. See issue #10766. // pretty-expanded FIXME #23616 #![allow(dead_code)] use std::marker; fn main() { trait T { fn foo(&self) {} } fn f<'a, V: T>(v: &'a V) -> &'a T { v as &'a T } }
#![allow(unused_variables, non_upper_case_globals, non_snake_case, unused_unsafe, non_camel_case_types, dead_code, clippy::all)] #[repr(transparent)] #[doc(hidden)] pub struct IVibrationDevice(pub ::windows::core::IInspectable); unsafe impl ::windows::core::Interface for IVibrationDevice { type Vtable = IVibrationDevice_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x1b4a6595_cfcd_4e08_92fb_c1906d04498c); } #[repr(C)] #[doc(hidden)] pub struct IVibrationDevice_abi( pub unsafe extern "system" fn(this: ::windows::core::RawPtr, iid: &::windows::core::GUID, interface: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, count: *mut u32, values: *mut *mut ::windows::core::GUID) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, value: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, value: *mut i32) -> ::windows::core::HRESULT, #[cfg(feature = "Foundation")] pub unsafe extern "system" fn(this: ::windows::core::RawPtr, duration: super::super::super::Foundation::TimeSpan) -> ::windows::core::HRESULT, #[cfg(not(feature = "Foundation"))] usize, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> ::windows::core::HRESULT, ); #[repr(transparent)] #[doc(hidden)] pub struct IVibrationDeviceStatics(pub ::windows::core::IInspectable); unsafe impl ::windows::core::Interface for IVibrationDeviceStatics { type Vtable = IVibrationDeviceStatics_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x332fd2f1_1c69_4c91_949e_4bb67a85bdc7); } #[repr(C)] #[doc(hidden)] pub struct IVibrationDeviceStatics_abi( pub unsafe extern "system" fn(this: ::windows::core::RawPtr, iid: &::windows::core::GUID, interface: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr) -> u32, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, count: *mut u32, values: *mut *mut ::windows::core::GUID) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, value: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, value: *mut i32) -> ::windows::core::HRESULT, pub unsafe extern "system" fn(this: ::windows::core::RawPtr, result__: *mut ::windows::core::RawPtr) -> ::windows::core::HRESULT, ); #[repr(transparent)] #[derive(:: core :: cmp :: PartialEq, :: core :: cmp :: Eq, :: core :: clone :: Clone, :: core :: fmt :: Debug)] pub struct VibrationDevice(pub ::windows::core::IInspectable); impl VibrationDevice { #[cfg(feature = "Foundation")] pub fn Vibrate<'a, Param0: ::windows::core::IntoParam<'a, super::super::super::Foundation::TimeSpan>>(&self, duration: Param0) -> ::windows::core::Result<()> { let this = self; unsafe { (::windows::core::Interface::vtable(this).6)(::core::mem::transmute_copy(this), duration.into_param().abi()).ok() } } pub fn Cancel(&self) -> ::windows::core::Result<()> { let this = self; unsafe { (::windows::core::Interface::vtable(this).7)(::core::mem::transmute_copy(this)).ok() } } pub fn GetDefault() -> ::windows::core::Result<VibrationDevice> { Self::IVibrationDeviceStatics(|this| unsafe { let mut result__: ::windows::core::RawPtr = ::core::mem::zeroed(); (::windows::core::Interface::vtable(this).6)(::core::mem::transmute_copy(this), &mut result__).from_abi::<VibrationDevice>(result__) }) } pub fn IVibrationDeviceStatics<R, F: FnOnce(&IVibrationDeviceStatics) -> ::windows::core::Result<R>>(callback: F) -> ::windows::core::Result<R> { static mut SHARED: ::windows::core::FactoryCache<VibrationDevice, IVibrationDeviceStatics> = ::windows::core::FactoryCache::new(); unsafe { SHARED.call(callback) } } } unsafe impl ::windows::core::RuntimeType for VibrationDevice { const SIGNATURE: ::windows::core::ConstBuffer = ::windows::core::ConstBuffer::from_slice(b"rc(Windows.Phone.Devices.Notification.VibrationDevice;{1b4a6595-cfcd-4e08-92fb-c1906d04498c})"); } unsafe impl ::windows::core::Interface for VibrationDevice { type Vtable = IVibrationDevice_abi; const IID: ::windows::core::GUID = ::windows::core::GUID::from_u128(0x1b4a6595_cfcd_4e08_92fb_c1906d04498c); } impl ::windows::core::RuntimeName for VibrationDevice { const NAME: &'static str = "Windows.Phone.Devices.Notification.VibrationDevice"; } impl ::core::convert::From<VibrationDevice> for ::windows::core::IUnknown { fn from(value: VibrationDevice) -> Self { value.0 .0 } } impl ::core::convert::From<&VibrationDevice> for ::windows::core::IUnknown { fn from(value: &VibrationDevice) -> Self { value.0 .0.clone() } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for VibrationDevice { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Owned(self.0 .0) } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IUnknown> for &'a VibrationDevice { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IUnknown> { ::windows::core::Param::Borrowed(&self.0 .0) } } impl ::core::convert::From<VibrationDevice> for ::windows::core::IInspectable { fn from(value: VibrationDevice) -> Self { value.0 } } impl ::core::convert::From<&VibrationDevice> for ::windows::core::IInspectable { fn from(value: &VibrationDevice) -> Self { value.0.clone() } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IInspectable> for VibrationDevice { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IInspectable> { ::windows::core::Param::Owned(self.0) } } impl<'a> ::windows::core::IntoParam<'a, ::windows::core::IInspectable> for &'a VibrationDevice { fn into_param(self) -> ::windows::core::Param<'a, ::windows::core::IInspectable> { ::windows::core::Param::Borrowed(&self.0) } } unsafe impl ::core::marker::Send for VibrationDevice {} unsafe impl ::core::marker::Sync for VibrationDevice {}
mod grid; mod space; mod value; pub use grid::Grid;
use super::{Action, Content, History, Session, Subject, Topic}; use crate::state::SpentTime; use std::error::Error; mod sqlite; pub use sqlite::Sqlite; pub trait Backend { fn transfer_content(&mut self, content: &Content) -> Result<(), Box<dyn Error>>; fn transfer_history(&mut self, history: &History) -> Result<(), Box<dyn Error>>; fn load_content(&mut self) -> Result<Content, Box<dyn Error>>; fn load_history(&mut self, content: &Content) -> Result<History, Box<dyn Error>>; fn create_action(&mut self, name: &str) -> Result<Action, Box<dyn Error>>; fn create_subject(&mut self, name: &str) -> Result<Subject, Box<dyn Error>>; fn update_time(&mut self, topic: &Topic, time: &SpentTime) -> Result<(), Box<dyn Error>>; fn add_session(&mut self, session: &Session) -> Result<(), Box<dyn Error>>; }
pub mod utilities; use crate::utilities::Verify; use proffer::*; #[test] fn impl_basic_gen_with_trait() { let mut ipl = Impl::new("That") .set_impl_trait(Some(Trait::new("This"))) .to_owned(); let expected = r#" impl This for That { } "#; let src_code = ipl.generate_and_verify(); println!("{}", &src_code); assert_eq!(norm_whitespace(expected), norm_whitespace(&src_code)); // Add a function to the impl let expected = r#" impl This for That { fn foo() -> () { } } "#; let ipl = ipl.add_function(Function::new("foo")); let src_code = ipl.generate_and_verify(); println!("{}", &src_code); assert_eq!(norm_whitespace(expected), norm_whitespace(&src_code)); } #[test] fn impl_basic_gen_without_trait() { let ipl = Impl::new("That"); let expected = r#" impl That { } "#; let src_code = ipl.generate_and_verify(); println!("{}", &src_code); assert_eq!(norm_whitespace(expected), norm_whitespace(&src_code)); } #[test] fn impl_with_generics() { let ipl = Impl::new("That") .add_generic( Generic::new("T") .add_trait_bounds(vec!["ToString"]) .to_owned(), ) .add_function( Function::new("foo") .set_is_pub(true) .add_parameter(Parameter::new("bar1", "T")) .add_parameter(Parameter::new("bar2", "S")) .set_return_ty("T") .add_generic(Generic::new("S")) .set_body("bar") .to_owned(), ) .to_owned(); let expected = r#" impl<T> That<T> where T: ToString, { pub fn foo<S>(bar1: T, bar2: S) -> T where S: , { bar } } "#; let src_code = ipl.generate_and_verify(); println!("{}", &src_code); assert_eq!(norm_whitespace(expected), norm_whitespace(&src_code)); } #[test] fn impl_with_associated_types() { let ipl = Impl::new("That") .set_impl_trait(Some(Trait::new("This"))) .add_associated_type(AssociatedTypeDefinition::new("FOO", "Bar")) .add_associated_type(AssociatedTypeDefinition::new("BAR", "Foo")) .to_owned(); let expected = r#" impl This for That { type FOO = Bar; type BAR = Foo; } "#; let src_code = ipl.generate_and_verify(); println!("{}", &src_code); assert_eq!(norm_whitespace(expected), norm_whitespace(&src_code)); } #[test] fn impl_with_associated_type_attributes() { let ipl = Impl::new("That") .set_impl_trait(Some(Trait::new("This"))) .add_associated_type( AssociatedTypeDefinition::new("FOO", "Bar") .add_attribute("#[foo]") .to_owned(), ) .add_associated_type( AssociatedTypeDefinition::new("BAR", "Foo") .add_attributes(&["#[foo]", "#[bar]"]) .to_owned(), ) .to_owned(); let expected = r#" impl This for That { #[foo] type FOO = Bar; #[foo] #[bar] type BAR = Foo; } "#; let src_code = ipl.generate_and_verify(); println!("{}", &src_code); assert_eq!(norm_whitespace(expected), norm_whitespace(&src_code)); }
use std::convert::Into; use std::iter::*; use std::fmt; use std::default::Default; use std::ops::Add; use protobuf_iter::*; #[derive(Clone)] pub struct DeltaEncodedIter<'a, P: Packed<'a>, T: Clone + Add<T, Output=T> + From<<P as Packed<'a>>::Item> + Default> { inner: PackedIter<'a, P, T>, last: T, } impl<'a, P: Packed<'a>, T: Clone + Add<T, Output=T> + From<<P as Packed<'a>>::Item> + Default> DeltaEncodedIter<'a, P, T> { pub fn new(value: ParseValue<'a>) -> Self { DeltaEncodedIter { inner: value.into(), last: Default::default(), // 0 } } } impl<'a, P: Packed<'a>, T: Clone + Add<T, Output=T> + From<<P as Packed<'a>>::Item> + Default> Iterator for DeltaEncodedIter<'a, P, T> { type Item = T; fn next(&mut self) -> Option<Self::Item> { self.inner.next() .map(|value| { let current = self.last.clone() + value; self.last = current.clone(); current }) } } impl<'a, P: Clone + Packed<'a>, T: fmt::Debug + Clone + Add<T, Output=T> + From<<P as Packed<'a>>::Item> + Default> fmt::Debug for DeltaEncodedIter<'a, P, T> { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { self.clone().collect::<Vec<T>>().fmt(f) } }
use cube::corners::Corner; use cube::edges::Edge; #[derive(Clone, Copy)] pub enum Move { Up, Right, Front, Down, Left, Back, } impl Move { pub fn from_u(u :usize) -> Move { match u { 0 => Move::Up, 1 => Move::Right, 2 => Move::Front, 3 => Move::Down, 4 => Move::Left, 5 => Move::Back, _ => unimplemented!(), } } } pub struct Move_ { pub corners_permutation: [Corner; 8], pub corners_orientation: [u8; 8], pub edges_permutation: [Edge; 12], pub edges_orientation: [u8; 12], } impl Move_ { pub fn move_definition(m: Move) -> Self { use cube::corners::Corner::*; use cube::edges::Edge::*; use self::Move::*; match m { Up => Self { corners_permutation: [UBR, URF, UFL, ULB, DFR, DLF, DBL, DRB], corners_orientation: [0; 8], edges_permutation: [UB, UR, UF, UL, DR, DF, DL, DB, FR, FL, BL, BR], edges_orientation: [0; 12], }, Right => Self { corners_permutation: [DFR, UFL, ULB, URF, DRB, DLF, DBL, UBR], corners_orientation: [2, 0, 0, 1, 1, 0, 0, 2], edges_permutation: [FR, UF, UL, UB, BR, DF, DL, DB, DR, FL, BL, UR], edges_orientation: [0; 12], }, Front => Self { corners_permutation: [UFL, DLF, ULB, UBR, URF, DFR, DBL, DRB], corners_orientation: [1, 2, 0, 0, 2, 1, 0, 0], edges_permutation: [UR, FL, UL, UB, DR, FR, DL, DB, UF, DF, BL, BR], edges_orientation: [0, 1, 0, 0, 0, 1, 0, 0, 1, 1, 0, 0], }, Down => Self { corners_permutation: [URF, UFL, ULB, UBR, DLF, DBL, DRB, DFR], corners_orientation: [0; 8], edges_permutation: [UR, UF, UL, UB, DF, DL, DB, DR, FR, FL, BL, BR], edges_orientation: [0; 12], }, Left => Self { corners_permutation: [URF, ULB, DBL, UBR, DFR, UFL, DLF, DRB], corners_orientation: [0, 1, 2, 0, 0, 2, 1, 0], edges_permutation: [UR, UF, BL, UB, DR, DF, FL, DB, FR, UL, DL, BR], edges_orientation: [0; 12], }, Back => Self { corners_permutation: [URF, UFL, UBR, DRB, DFR, DLF, ULB, DBL], corners_orientation: [0, 0, 1, 2, 0, 0, 2, 1], edges_permutation: [UR, UF, UL, BR, DR, DF, DL, BL, FR, FL, UB, DB], edges_orientation: [0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 1, 1], }, } } } #[derive(Clone, Copy)] pub enum UserMove { Front, FrontPrime, Front2, Right, RightPrime, Right2, Up, UpPrime, Up2, Back, BackPrime, Back2, Left, LeftPrime, Left2, Down, DownPrime, Down2, } impl UserMove { pub fn sequence_from_str(s: &str) -> Result<Vec<(Self, usize)>, ()> { let mut sequence = Vec::new(); let splitted = s.split_whitespace(); use self::UserMove::*; for elem in splitted { let move_ = match elem { "F" => (Front, 1), "F'" => (FrontPrime, 3), "F2" => (Front2, 2), "R" => (Right, 1), "R'" => (RightPrime, 3), "R2" => (Right2, 2), "U" => (Up, 1), "U'" => (UpPrime, 3), "U2" => (Up2, 2), "B" => (Back, 1), "B'" => (BackPrime, 3), "B2" => (Back2, 2), "L" => (Left, 1), "L'" => (LeftPrime, 3), "L2" => (Left2, 2), "D" => (Down, 1), "D'" => (DownPrime, 3), "D2" => (Down2, 2), _ => return Err(()), }; sequence.push(move_) } Ok(sequence) } pub fn to_move(&self) -> Move { match *self { UserMove::Front | UserMove::FrontPrime | UserMove::Front2 => Move::Front, UserMove::Right | UserMove::RightPrime | UserMove::Right2 => Move::Right, UserMove::Up | UserMove::UpPrime | UserMove::Up2 => Move::Up, UserMove::Back | UserMove::BackPrime | UserMove::Back2 => Move::Back, UserMove::Left | UserMove::LeftPrime | UserMove::Left2 => Move::Left, UserMove::Down | UserMove::DownPrime | UserMove::Down2 => Move::Down, } } } impl ToString for UserMove { fn to_string(&self) -> String { use self::UserMove::*; let string = match *self { Front => "F", FrontPrime => "F'", Front2 => "F2", Right => "R", RightPrime => "R'", Right2 => "R2", Up => "U", UpPrime => "U'", Up2 => "U2", Back => "B", BackPrime => "B'", Back2 => "B2", Left => "L", LeftPrime => "L'", Left2 => "L2", Down => "D", DownPrime => "D'", Down2 => "D2", }; string.to_string() } }
use crate::parser::{Command, Source}; use anyhow::Result; pub fn parse(cmd: &str, _current_function: &str, source: &Source, _arg1: Option<&str>, _arg2: Option<&str>) -> Option<Result<Command>> { match cmd { "add" => Some(Ok(Command::Add(source.clone()))), "sub" => Some(Ok(Command::Sub(source.clone()))), "neg" => Some(Ok(Command::Neg(source.clone()))), "eq" => Some(Ok(Command::Eq(source.clone()))), "gt" => Some(Ok(Command::Gt(source.clone()))), "lt" => Some(Ok(Command::Lt(source.clone()))), "and" => Some(Ok(Command::And(source.clone()))), "or" => Some(Ok(Command::Or(source.clone()))), "not" => Some(Ok(Command::Not(source.clone()))), _ => None, } }
use P55::*; pub fn main() { let trees = cbal_trees(4, 'x'); for tree in trees { println!("{}", tree); } }
//! A proportional-integral-derivative (PID) controller. #![no_std] extern crate num_traits; use num_traits::float::FloatCore; #[derive(Debug)] pub struct Pid<T: FloatCore> { /// Proportional gain. pub kp: T, /// Integral gain. pub ki: T, /// Derivative gain. pub kd: T, /// Limit of contribution of P term: `(-p_limit <= P <= p_limit)` pub p_limit: T, /// Limit of contribution of I term `(-i_limit <= I <= i_limit)` pub i_limit: T, /// Limit of contribution of D term `(-d_limit <= D <= d_limit)` pub d_limit: T, /// Limit of the sum of PID terms `(-limit <= P + I + D <+ limit)` pub limit: T, pub setpoint: T, prev_measurement: Option<T>, /// `integral_term = sum[error(t) * ki(t)] (for all t)` integral_term: T, } #[derive(Debug)] pub struct ControlOutput<T: FloatCore> { /// Contribution of the P term to the output. pub p: T, /// Contribution of the I term to the output. /// `i = sum[error(t) * ki(t)] (for all t)` pub i: T, /// Contribution of the D term to the output. pub d: T, /// Output of the PID controller. pub output: T, } impl<T> Pid<T> where T: FloatCore, { pub fn new(kp: T, ki: T, kd: T, setpoint: T) -> Self { let inf = T::infinity(); Self { kp, ki, kd, p_limit: inf, i_limit: inf, d_limit: inf, limit: inf, setpoint, prev_measurement: None, integral_term: T::zero(), } } /// Resets the integral term back to zero. This may drastically change the /// control output. pub fn reset_integral_term(&mut self) { self.integral_term = T::zero(); } /// Given a new measurement, calculates the next control output. pub fn next_control_output(&mut self, measurement: T) -> ControlOutput<T> { let error = self.setpoint - measurement; let p_unbounded = error * self.kp; let p = self.p_limit.min(p_unbounded.abs()) * p_unbounded.signum(); // Mitigate output jumps when ki(t) != ki(t-1). // While it's standard to use an error_integral that's a running sum of // just the error (no ki), because we support ki changing dynamically, // we store the entire term so that we don't need to remember previous // ki values. self.integral_term = self.integral_term + error * self.ki; // Mitigate integral windup: Don't want to keep building up error // beyond what i_limit will allow. self.integral_term = self.i_limit.min(self.integral_term.abs()) * self.integral_term.signum(); // Mitigate derivative kick: Use the derivative of the measurement // rather than the derivative of the error. let d_unbounded = -match self.prev_measurement.as_ref() { Some(prev_measurement) => measurement - *prev_measurement, None => T::zero(), } * self.kd; self.prev_measurement = Some(measurement); let d = self.d_limit.min(d_unbounded.abs()) * d_unbounded.signum(); let output_unbounded = p + self.integral_term + d; let output = self.limit.min(output_unbounded.abs()) * output_unbounded.signum(); ControlOutput { p, i: self.integral_term, d, output: output, } } } #[cfg(test)] mod tests { use super::Pid; #[test] fn proportional() { let mut pid = Pid::new(2.0, 0.0, 0.0, 10.0); assert_eq!(pid.setpoint, 10.0); // Test simple proportional assert_eq!(pid.next_control_output(0.0).output, 20.0); // Test proportional limit pid.p_limit = 10.0; assert_eq!(pid.next_control_output(0.0).output, 10.0); } #[test] fn derivative() { let mut pid = Pid::new(0.0, 0.0, 2.0, 10.0); // Test that there's no derivative since it's the first measurement assert_eq!(pid.next_control_output(0.0).output, 0.0); // Test that there's now a derivative assert_eq!(pid.next_control_output(5.0).output, -10.0); // Test derivative limit pid.d_limit = 5.0; assert_eq!(pid.next_control_output(10.0).output, -5.0); } #[test] fn integral() { let mut pid = Pid::new(0.0, 2.0, 0.0, 10.0); // Test basic integration assert_eq!(pid.next_control_output(0.0).output, 20.0); assert_eq!(pid.next_control_output(0.0).output, 40.0); assert_eq!(pid.next_control_output(5.0).output, 50.0); // Test limit pid.i_limit = 50.0; assert_eq!(pid.next_control_output(5.0).output, 50.0); // Test that limit doesn't impede reversal of error integral assert_eq!(pid.next_control_output(15.0).output, 40.0); // Test that error integral accumulates negative values let mut pid2 = Pid::new(0.0, 2.0, 0.0, -10.0); assert_eq!(pid2.next_control_output(0.0).output, -20.0); assert_eq!(pid2.next_control_output(0.0).output, -40.0); pid2.i_limit = 50.0; assert_eq!(pid2.next_control_output(-5.0).output, -50.0); // Test that limit doesn't impede reversal of error integral assert_eq!(pid2.next_control_output(-15.0).output, -40.0); } #[test] fn pid() { let mut pid = Pid::new(1.0, 0.1, 1.0, 10.0); let out = pid.next_control_output(0.0); assert_eq!(out.p, 10.0); // 1.0 * 10.0 assert_eq!(out.i, 1.0); // 0.1 * 10.0 assert_eq!(out.d, 0.0); // -(1.0 * 0.0) assert_eq!(out.output, 11.0); let out = pid.next_control_output(5.0); assert_eq!(out.p, 5.0); // 1.0 * 5.0 assert_eq!(out.i, 1.5); // 0.1 * (10.0 + 5.0) assert_eq!(out.d, -5.0); // -(1.0 * 5.0) assert_eq!(out.output, 1.5); let out = pid.next_control_output(11.0); assert_eq!(out.p, -1.0); // 1.0 * -1.0 assert_eq!(out.i, 1.4); // 0.1 * (10.0 + 5.0 - 1) assert_eq!(out.d, -6.0); // -(1.0 * 6.0) assert_eq!(out.output, -5.6); let out = pid.next_control_output(10.0); assert_eq!(out.p, 0.0); // 1.0 * 0.0 assert_eq!(out.i, 1.4); // 0.1 * (10.0 + 5.0 - 1.0 + 0.0) assert_eq!(out.d, 1.0); // -(1.0 * -1.0) assert_eq!(out.output, 2.4); } #[test] fn f32_and_f64() { let mut pid32 = Pid::new(2.0f32, 0.0, 0.0, 10.0); let mut pid64 = Pid::new(2.0f64, 0.0, 0.0, 10.0); assert_eq!( pid32.next_control_output(0.0).output, pid64.next_control_output(0.0).output as f32 ); assert_eq!( pid32.next_control_output(0.0).output as f64, pid64.next_control_output(0.0).output ); } }
#[macro_use] extern crate allegro; extern crate allegro_font; extern crate allegro_image; extern crate libloading; extern crate game; use allegro_font::FontAddon; use allegro_image::ImageAddon; use libloading::Library; use game::{State, Platform}; use std::fs; const FPS: f64 = 60.0; const SCREEN_WIDTH: i32 = 640; const SCREEN_HEIGHT: i32 = 480; struct Application(Library); impl Application { fn update(&self, p: &Platform, s: State) -> State { unsafe { let f = self.0.get::<fn(&Platform, State) -> State>(b"update\0") .unwrap_or_else(|error| panic!("failed to get symbol `update`: {}", error)); f(p, s) } } fn render(&self, p: &Platform, s: &State) { unsafe { let f = self.0.get::<fn(&Platform, &State)>(b"render\0") .unwrap_or_else(|error| panic!("failed to get symbol `render`: {}", error)); f(p, s) } } fn handle_event(&self, p: &Platform, s: State, e: allegro::Event) -> State { unsafe { let f = self.0.get::<fn(&Platform, State, allegro::Event) -> State>(b"handle_event\0") .unwrap_or_else(|error| panic!("failed to get symbol `handle_event`: {}", error)); f(p, s, e) } } fn clean_up(&self, s: State) { unsafe { let f = self.0.get::<fn(State)>(b"clean_up\0") .unwrap_or_else(|error| panic!("failed to get symbol `clean_up`: {}", error)); f(s) } } } const LIB_PATH: &'static str = "../game/target/debug/libgame.dylib"; allegro_main! { let core = allegro::Core::init().unwrap(); let mut platform = Platform { font_addon: FontAddon::init(&core).unwrap_or_else(|msg| panic!(msg)), image_addon: ImageAddon::init(&core).unwrap_or_else(|msg| panic!(msg)), core: core, }; let disp = allegro::Display::new(&platform.core, SCREEN_WIDTH, SCREEN_HEIGHT).unwrap(); disp.set_window_title("Hello, Allegro!"); platform.core.install_keyboard().unwrap(); platform.core.install_mouse().unwrap(); let mut app = Application(Library::new(LIB_PATH).unwrap()); let mut last_modified = fs::metadata(LIB_PATH).unwrap().modified().unwrap(); let mut state = game::State::new(&platform); let timer = allegro::Timer::new(&platform.core, 1.0 / FPS).unwrap(); let q = allegro::EventQueue::new(&platform.core).unwrap(); q.register_event_source(disp.get_event_source()); q.register_event_source(platform.core.get_keyboard_event_source()); q.register_event_source(platform.core.get_mouse_event_source()); q.register_event_source(timer.get_event_source()); let mut redraw = true; timer.start(); 'main: loop { if redraw && q.is_empty() { app.render(&platform, &state); platform.core.flip_display(); redraw = false; } match q.wait_for_event() { allegro::DisplayClose{..} => break 'main, allegro::TimerTick{..} => { if let Ok(Ok(modified)) = fs::metadata(LIB_PATH).map(|m| m.modified()) { if modified > last_modified { drop(app); app = Application(Library::new(LIB_PATH) .unwrap_or_else(|error| panic!("{}", error))); last_modified = modified; } } state = app.update(&platform, state); redraw = true; }, e => { state = app.handle_event(&platform, state, e); }, } } println!("Cleaning up..."); app.clean_up(state); //mem::forget(state); println!("Bye!"); }
use std::borrow::{Borrow, BorrowMut}; use std::cell::RefCell; use std::fmt; use std::fmt::{Display, Formatter}; use std::iter::{FromIterator, Once}; use std::ops::{Deref, DerefMut, Range}; use std::rc::Rc; use std::time::Duration; use rand::Rng; use rust_tools::bench::Bench; use crate::mcts_tree::mcts::{BRANCH_FACTOR, MCTS, TREE_SIZE}; use crate::mcts_tree::mcts::MStats; use crate::mcts_tree::tree::Tree; pub struct M2<T> { id_gen: usize, arena: Vec<Rc<RefCell<T>>>, } impl Tree<NodeId> for M2<Node> { fn new_node(&mut self, size: usize) -> NodeId { let id = self.id_gen; self.id_gen += 1; let node = Rc::new(RefCell::new(Node::new(id, size))); //TODO: use the arena strategy Some(node) } fn node_count(&self) -> usize { self.id_gen } fn node_size(&self, node: &NodeId) -> usize { match node { None => 0, Some(n) => n.as_ref().borrow().size(), } } fn display(&self, node: &NodeId) { log::trace!("display..."); let data = &node.clone().map(|x| x.as_ref().borrow().to_string()); match data { None => {} Some(data) => { println!("{}", data); } } } fn set_child(&mut self, i: usize, parent: &NodeId, child: &NodeId) { todo!() } } impl MCTS<NodeId> for M2<Node> { fn select_from(&mut self, tree: &NodeId) -> NodeId { match tree { None => panic!(), Some(n) => { if n.as_ref().borrow().data.is_leaf() { n.as_ref().borrow_mut().data.explored += 1; tree.clone() } else { let mut rng = rand::thread_rng(); n.as_ref().borrow_mut().data.explored += 1; let childs = n.as_ref().borrow().children.len(); let index = rng.gen_range(0..childs); self.select_from(&n.as_ref().borrow().children[index]) } } } } fn expand(&mut self, node: &NodeId, max_children: usize) { match &node { None => panic!(), Some(node) => { let nn = node.as_ref().borrow().children.len(); for i in 0..nn { let child = self.new_node(max_children); node.as_ref().borrow_mut().set_child(i, child); } } } } } impl M2<Node> { pub fn new() -> M2<Node> { M2 { id_gen: 0, arena: Vec::new(), } } } //TODO: change to Rc<RefCell<Option<Node>>> ?? (this would make the data easily clonable) pub type NodeId = Option<Rc<RefCell<Node>>>; #[derive(Clone, Debug)] pub struct Node { id: usize, data: MStats, children: Vec<NodeId>, } impl Node { pub fn new(id: usize, size: usize) -> Node { let mut stats = MStats::new(); stats.leafs = size; Node { id, data: stats, children: vec![None; size], } } fn size(&self) -> usize { let cpt: usize = self .children .iter() .map(|c| match c { None => 1, Some(n) => n.as_ref().borrow().size(), }) .sum(); return cpt + 1; } fn set_child(&mut self, i: usize, child: NodeId) { // update child depth match &child { None => {} Some(n) => { n.as_ref().borrow_mut().data.depth = self.data.depth + 1; // n.as_ref().borrow_mut().depth = self.depth + 1; } } match &self.children[i] { None => { self.data.leafs -= 1; } _ => {} } self.children[i] = child; } } impl Display for Node { fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result { let tab = String::from_iter(vec![' '; self.data.depth].iter()); write!(f, "{}{}:{}", tab, self.id, self.data.leafs); if !(self.data.is_leaf()) { for child in self.children.iter() { match child { None => write!(f, "X"), Some(c) => write!(f, "\n{}{}", tab, c.as_ref().borrow()), }; } } Ok(()) } }