text
stringlengths
8
4.13M
use super::{u256mod, ModulusTrait}; use super::super::bignum_u512::u512; // Creation from unsigned integer values // All types other that &u512 are handled by converting to &u512 impl<M: ModulusTrait> From<&u512> for u256mod<M> { fn from(val: &u512) -> u256mod<M> { return u256mod::<M> { value: val % M::modulus(), this_is_stupid_why: std::marker::PhantomData }; } } impl<M: ModulusTrait> From<u8> for u256mod<M> { fn from(val: u8) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<&u8> for u256mod<M> { fn from(val: &u8) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<u16> for u256mod<M> { fn from(val: u16) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<&u16> for u256mod<M> { fn from(val: &u16) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<u32> for u256mod<M> { fn from(val: u32) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<&u32> for u256mod<M> { fn from(val: &u32) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<u64> for u256mod<M> { fn from(val: u64) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<&u64> for u256mod<M> { fn from(val: &u64) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<u128> for u256mod<M> { fn from(val: u128) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<&u128> for u256mod<M> { fn from(val: &u128) -> u256mod<M> { u256mod::from(&u512::from(val)) } } impl<M: ModulusTrait> From<u512> for u256mod<M> { fn from(val: u512) -> u256mod<M> { u256mod::from(&u512::from(val)) } } // Creation from integer values // All types other are handled by converting to i128 impl<M: ModulusTrait> From<i128> for u256mod<M> { fn from(val: i128) -> u256mod<M> { if val >= 0 { return u256mod::from(val as u128); } // if val < 0 then calculate (0 - |val|) % M // TODO - does this work when |val| > M ? - this shouldnt matter for Ed25519 probably // For now lets panic! let positive_val = u512::from(-val); if positive_val >= M::modulus() { panic!("This has not been implemented yet, negative values must be smaller than modulus"); } return u256mod::from(u512::zero()) - u256mod::from(positive_val); } } impl<M: ModulusTrait> From<i8> for u256mod<M> { fn from(val: i8) -> u256mod<M> { u256mod::from(val as i128) }} impl<M: ModulusTrait> From<&i8> for u256mod<M> { fn from(val: &i8) -> u256mod<M> { u256mod::from(*val as i128) }} impl<M: ModulusTrait> From<i16> for u256mod<M> { fn from(val: i16) -> u256mod<M> { u256mod::from(val as i128) }} impl<M: ModulusTrait> From<&i16> for u256mod<M> { fn from(val: &i16) -> u256mod<M> { u256mod::from(*val as i128) }} impl<M: ModulusTrait> From<i32> for u256mod<M> { fn from(val: i32) -> u256mod<M> { u256mod::from(val as i128) }} impl<M: ModulusTrait> From<&i32> for u256mod<M> { fn from(val: &i32) -> u256mod<M> { u256mod::from(*val as i128) }} impl<M: ModulusTrait> From<i64> for u256mod<M> { fn from(val: i64) -> u256mod<M> { u256mod::from(val as i128) }} impl<M: ModulusTrait> From<&i64> for u256mod<M> { fn from(val: &i64) -> u256mod<M> { u256mod::from(*val as i128) }} impl<M: ModulusTrait> From<&i128> for u256mod<M> { fn from(val: &i128) -> u256mod<M> { u256mod::from(*val as i128) }}
mod generated; pub use generated::*; use std::fmt; pub type drr_begin = dmu_replay_record__bindgen_ty_2_drr_begin; pub type drr_end = dmu_replay_record__bindgen_ty_2_drr_end; impl fmt::Debug for drr_begin { fn fmt(&self, out: &mut fmt::Formatter<'_>) -> fmt::Result { /* pub struct drr_begin { pub drr_magic: u64, pub drr_versioninfo: u64, pub drr_creation_time: u64, pub drr_type: dmu_objset_type_t, pub drr_flags: u32, pub drr_toguid: u64, pub drr_fromguid: u64, pub drr_toname: [::std::os::raw::c_char; 256usize], } */ let drr_toname = unsafe { std::slice::from_raw_parts( self.drr_toname[..].as_ptr() as *const u8, self.drr_toname.len(), ) }; let term = drr_toname .iter() .enumerate() .filter_map(|(i, c)| if *c == 0 { Some(i) } else { None }) .next() .expect("drr_toname should be null terminated"); use std::ffi::CStr; let drr_toname = unsafe { CStr::from_bytes_with_nul_unchecked(&drr_toname[0..=term]) }; out.debug_struct("drr_begin") .field("drr_magic", &self.drr_magic) .field("drr_versioninfo", &self.drr_versioninfo) .field("drr_creation_time", &self.drr_creation_time) .field("drr_type", &self.drr_type) .field("drr_flags", &self.drr_flags) .field("drr_toguid", &self.drr_toguid) .field("drr_fromguid", &self.drr_fromguid) .field("drr_toname", &drr_toname) .finish() } } use std::borrow::Borrow; pub struct drr_debug<R: Borrow<dmu_replay_record>>(pub R); impl<R: Borrow<dmu_replay_record>> fmt::Debug for drr_debug<R> { fn fmt(&self, out: &mut fmt::Formatter<'_>) -> fmt::Result { let drr = self.0.borrow(); let dbg: &dyn fmt::Debug = unsafe { if drr.drr_type == dmu_replay_record_DRR_OBJECT { &drr.drr_u.drr_object } else if drr.drr_type == dmu_replay_record_DRR_FREEOBJECTS { &drr.drr_u.drr_freeobjects } else if drr.drr_type == dmu_replay_record_DRR_WRITE { &drr.drr_u.drr_write } else if drr.drr_type == dmu_replay_record_DRR_FREE { &drr.drr_u.drr_free } else if drr.drr_type == dmu_replay_record_DRR_BEGIN { &drr.drr_u.drr_begin } else if drr.drr_type == dmu_replay_record_DRR_END { &drr.drr_u.drr_end } else if drr.drr_type == dmu_replay_record_DRR_SPILL { &drr.drr_u.drr_spill } else if drr.drr_type == dmu_replay_record_DRR_OBJECT_RANGE { &drr.drr_u.drr_object_range } else { unreachable!() } }; if !out.alternate() { write!(out, "{:?}", dbg) } else { write!(out, "{:#?}", dbg) } } } pub mod byte_serialize_impls { use super::dmu_replay_record; use serde::{de::Visitor, Deserialize, Deserializer, Serialize, Serializer}; use std::fmt; struct dmu_replay_record_visitor; impl<'de> Visitor<'de> for dmu_replay_record_visitor { type Value = dmu_replay_record; fn expecting(&self, formatter: &mut fmt::Formatter) -> fmt::Result { write!( formatter, "expecting a byte array of size {}", std::mem::size_of::<Self::Value>() ) } fn visit_bytes<E>(self, v: &[u8]) -> Result<Self::Value, E> where E: serde::de::Error, { assert!(v.len() == std::mem::size_of::<dmu_replay_record>()); let mut record: dmu_replay_record; unsafe { record = std::mem::zeroed(); let record_aligned_ptr = &mut record as *mut _ as *mut u8; std::ptr::copy(v.as_ptr(), record_aligned_ptr, v.len()); } Ok(record) } } impl Serialize for dmu_replay_record { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: Serializer, { let as_bytes = unsafe { std::slice::from_raw_parts( self as *const _ as *const u8, std::mem::size_of_val(&*self), ) }; serializer.serialize_bytes(as_bytes) } } impl<'de> Deserialize<'de> for dmu_replay_record { fn deserialize<D>(deserializer: D) -> Result<Self, D::Error> where D: Deserializer<'de>, { deserializer.deserialize_bytes(dmu_replay_record_visitor) } } }
extern crate actix; #[macro_use] extern crate actix_derive; extern crate futures; use actix::{msgs, Actor, Address, Arbiter, Context, Handler, Response, ResponseType, System}; use futures::{future, Future}; #[derive(Message)] #[Message(usize)] struct Sum(usize, usize); struct SumActor; impl Actor for SumActor { type Context = Context<Self>; } impl Handler<Sum> for SumActor { fn handle(&mut self, message: Sum, _context: &mut Context<Self>) -> Response<Self, Sum> { Self::reply(message.0 + message.1) } } #[test] fn message_derive() { let system = System::new("test"); let addr: Address<_> = SumActor.start(); let res = addr.call_fut(Sum(10, 5)); system.handle().spawn(res.then(|res| { match res { Ok(Ok(result)) => assert!(result == 10 + 5), _ => panic!("Something went wrong"), } Arbiter::system().send(msgs::SystemExit(0)); future::result(Ok(())) })); system.run(); }
use phf; /// Contains replacements for an entity in LaTeX, HTML, ASCII, Latin1 and UTF-8. pub struct EntityReplacement { pub latex: &'static str, pub requires_latex_math: bool, pub html: &'static str, pub ascii: &'static str, pub latin1: &'static str, pub utf8: &'static str, } const fn make( latex: &'static str, requires_latex_math: bool, html: &'static str, ascii: &'static str, latin1: &'static str, utf8: &'static str, ) -> EntityReplacement { EntityReplacement { latex, requires_latex_math, html, ascii, latin1, utf8, } } /// This is a map of entity names to their replacement in the LaTeX, HTML, ASCII, Latin1 and UTF-8 /// exporters. /// /// This list is taken from lisp/org-entities.el in the org-mode repository. pub static ORG_ENTITIES: phf::Map< &'static str, EntityReplacement, //( // &'static str, // bool, // &'static str, // &'static str, // &'static str, // &'static str, //), > = phf_map! { // name => LaTeX, requires LaTeX math?, html, ascii, latin1, utf-8 // Letters // Latin "Agrave" => make("\\`{A}", false, "&Agrave;", "A", "À", "À"), "agrave" => make("\\`{a}", false, "&agrave;", "a", "à", "à"), "Aacute" => make("\\'{A}", false, "&Aacute;", "A", "Á", "Á"), "aacute" => make("\\'{a}", false, "&aacute;", "a", "á", "á"), "Acirc" => make("\\^{A}", false, "&Acirc;", "A", "Â", "Â"), "acirc" => make("\\^{a}", false, "&acirc;", "a", "â", "â"), "Amacr" => make("\\bar{A}", false, "&Amacr;", "A", "Ã", "Ã"), "amacr" => make("\\bar{a}", false, "&amacr;", "a", "ã", "ã"), "Atilde" => make("\\~{A}", false, "&Atilde;", "A", "Ã", "Ã"), "atilde" => make("\\~{a}", false, "&atilde;", "a", "ã", "ã"), "Auml" => make("\\\"{A}", false, "&Auml;", "Ae", "Ä", "Ä"), "auml" => make("\\\"{a}", false, "&auml;", "ae", "ä", "ä"), "Aring" => make("\\AA{}", false, "&Aring;", "A", "Å", "Å"), "AA" => make("\\AA{}", false, "&Aring;", "A", "Å", "Å"), "aring" => make("\\aa{}", false, "&aring;", "a", "å", "å"), "AElig" => make("\\AE{}", false, "&AElig;", "AE", "Æ", "Æ"), "aelig" => make("\\ae{}", false, "&aelig;", "ae", "æ", "æ"), "Ccedil" => make("\\c{C}", false, "&Ccedil;", "C", "Ç", "Ç"), "ccedil" => make("\\c{c}", false, "&ccedil;", "c", "ç", "ç"), "Egrave" => make("\\`{E}", false, "&Egrave;", "E", "È", "È"), "egrave" => make("\\`{e}", false, "&egrave;", "e", "è", "è"), "Eacute" => make("\\'{E}", false, "&Eacute;", "E", "É", "É"), "eacute" => make("\\'{e}", false, "&eacute;", "e", "é", "é"), "Ecirc" => make("\\^{E}", false, "&Ecirc;", "E", "Ê", "Ê"), "ecirc" => make("\\^{e}", false, "&ecirc;", "e", "ê", "ê"), "Euml" => make("\\\"{E}", false, "&Euml;", "E", "Ë", "Ë"), "euml" => make("\\\"{e}", false, "&euml;", "e", "ë", "ë"), "Igrave" => make("\\`{I}", false, "&Igrave;", "I", "Ì", "Ì"), "igrave" => make("\\`{i}", false, "&igrave;", "i", "ì", "ì"), "Iacute" => make("\\'{I}", false, "&Iacute;", "I", "Í", "Í"), "iacute" => make("\\'{i}", false, "&iacute;", "i", "í", "í"), "Icirc" => make("\\^{I}", false, "&Icirc;", "I", "Î", "Î"), "icirc" => make("\\^{i}", false, "&icirc;", "i", "î", "î"), "Iuml" => make("\\\"{I}", false, "&Iuml;", "I", "Ï", "Ï"), "iuml" => make("\\\"{i}", false, "&iuml;", "i", "ï", "ï"), "Ntilde" => make("\\~{N}", false, "&Ntilde;", "N", "Ñ", "Ñ"), "ntilde" => make("\\~{n}", false, "&ntilde;", "n", "ñ", "ñ"), "Ograve" => make("\\`{O}", false, "&Ograve;", "O", "Ò", "Ò"), "ograve" => make("\\`{o}", false, "&ograve;", "o", "ò", "ò"), "Oacute" => make("\\'{O}", false, "&Oacute;", "O", "Ó", "Ó"), "oacute" => make("\\'{o}", false, "&oacute;", "o", "ó", "ó"), "Ocirc" => make("\\^{O}", false, "&Ocirc;", "O", "Ô", "Ô"), "ocirc" => make("\\^{o}", false, "&ocirc;", "o", "ô", "ô"), "Otilde" => make("\\~{O}", false, "&Otilde;", "O", "Õ", "Õ"), "otilde" => make("\\~{o}", false, "&otilde;", "o", "õ", "õ"), "Ouml" => make("\\\"{O}", false, "&Ouml;", "Oe", "Ö", "Ö"), "ouml" => make("\\\"{o}", false, "&ouml;", "oe", "ö", "ö"), "Oslash" => make("\\O", false, "&Oslash;", "O", "Ø", "Ø"), "oslash" => make("\\o{}", false, "&oslash;", "o", "ø", "ø"), "OElig" => make("\\OE{}", false, "&OElig;", "OE", "OE", "Œ"), "oelig" => make("\\oe{}", false, "&oelig;", "oe", "oe", "œ"), "Scaron" => make("\\v{S}", false, "&Scaron;", "S", "S", "Š"), "scaron" => make("\\v{s}", false, "&scaron;", "s", "s", "š"), "szlig" => make("\\ss{}", false, "&szlig;", "ss", "ß", "ß"), "Ugrave" => make("\\`{U}", false, "&Ugrave;", "U", "Ù", "Ù"), "ugrave" => make("\\`{u}", false, "&ugrave;", "u", "ù", "ù"), "Uacute" => make("\\'{U}", false, "&Uacute;", "U", "Ú", "Ú"), "uacute" => make("\\'{u}", false, "&uacute;", "u", "ú", "ú"), "Ucirc" => make("\\^{U}", false, "&Ucirc;", "U", "Û", "Û"), "ucirc" => make("\\^{u}", false, "&ucirc;", "u", "û", "û"), "Uuml" => make("\\\"{U}", false, "&Uuml;", "Ue", "Ü", "Ü"), "uuml" => make("\\\"{u}", false, "&uuml;", "ue", "ü", "ü"), "Yacute" => make("\\'{Y}", false, "&Yacute;", "Y", "Ý", "Ý"), "yacute" => make("\\'{y}", false, "&yacute;", "y", "ý", "ý"), "Yuml" => make("\\\"{Y}", false, "&Yuml;", "Y", "Y", "Ÿ"), "yuml" => make("\\\"{y}", false, "&yuml;", "y", "ÿ", "ÿ"), // Latin (special face) "fnof" => make("\\textit{f}", false, "&fnof;", "f", "f", "ƒ"), "real" => make("\\Re", true, "&real;", "R", "R", "ℜ"), "image" => make("\\Im", true, "&image;", "I", "I", "ℑ"), "weierp" => make("\\wp", true, "&weierp;", "P", "P", "℘"), "ell" => make("\\ell", true, "&ell;", "ell", "ell", "ℓ"), "imath" => make("\\imath", true, "&imath;", "[dotless i]", "dotless i", "ı"), "jmath" => make("\\jmath", true, "&jmath;", "[dotless j]", "dotless j", "ȷ"), // Greek "Alpha" => make("A", false, "&Alpha;", "Alpha", "Alpha", "Α"), "alpha" => make("\\alpha", true, "&alpha;", "alpha", "alpha", "α"), "Beta" => make("B", false, "&Beta;", "Beta", "Beta", "Β"), "beta" => make("\\beta", true, "&beta;", "beta", "beta", "β"), "Gamma" => make("\\Gamma", true, "&Gamma;", "Gamma", "Gamma", "Γ"), "gamma" => make("\\gamma", true, "&gamma;", "gamma", "gamma", "γ"), "Delta" => make("\\Delta", true, "&Delta;", "Delta", "Delta", "Δ"), "delta" => make("\\delta", true, "&delta;", "delta", "delta", "δ"), "Epsilon" => make("E", false, "&Epsilon;", "Epsilon", "Epsilon", "Ε"), "epsilon" => make("\\epsilon", true, "&epsilon;", "epsilon", "epsilon", "ε"), "varepsilon" => make("\\varepsilon", true, "&epsilon;", "varepsilon", "varepsilon", "ε"), "Zeta" => make("Z", false, "&Zeta;", "Zeta", "Zeta", "Ζ"), "zeta" => make("\\zeta", true, "&zeta;", "zeta", "zeta", "ζ"), "Eta" => make("H", false, "&Eta;", "Eta", "Eta", "Η"), "eta" => make("\\eta", true, "&eta;", "eta", "eta", "η"), "Theta" => make("\\Theta", true, "&Theta;", "Theta", "Theta", "Θ"), "theta" => make("\\theta", true, "&theta;", "theta", "theta", "θ"), "thetasym" => make("\\vartheta", true, "&thetasym;", "theta", "theta", "ϑ"), "vartheta" => make("\\vartheta", true, "&thetasym;", "theta", "theta", "ϑ"), "Iota" => make("I", false, "&Iota;", "Iota", "Iota", "Ι"), "iota" => make("\\iota", true, "&iota;", "iota", "iota", "ι"), "Kappa" => make("K", false, "&Kappa;", "Kappa", "Kappa", "Κ"), "kappa" => make("\\kappa", true, "&kappa;", "kappa", "kappa", "κ"), "Lambda" => make("\\Lambda", true, "&Lambda;", "Lambda", "Lambda", "Λ"), "lambda" => make("\\lambda", true, "&lambda;", "lambda", "lambda", "λ"), "Mu" => make("M", false, "&Mu;", "Mu", "Mu", "Μ"), "mu" => make("\\mu", true, "&mu;", "mu", "mu", "μ"), "nu" => make("\\nu", true, "&nu;", "nu", "nu", "ν"), "Nu" => make("N", false, "&Nu;", "Nu", "Nu", "Ν"), "Xi" => make("\\Xi", true, "&Xi;", "Xi", "Xi", "Ξ"), "xi" => make("\\xi", true, "&xi;", "xi", "xi", "ξ"), "Omicron" => make("O", false, "&Omicron;", "Omicron", "Omicron", "Ο"), "omicron" => make("\\textit{o}", false, "&omicron;", "omicron", "omicron", "ο"), "Pi" => make("\\Pi", true, "&Pi;", "Pi", "Pi", "Π"), "pi" => make("\\pi", true, "&pi;", "pi", "pi", "π"), "Rho" => make("P", false, "&Rho;", "Rho", "Rho", "Ρ"), "rho" => make("\\rho", true, "&rho;", "rho", "rho", "ρ"), "Sigma" => make("\\Sigma", true, "&Sigma;", "Sigma", "Sigma", "Σ"), "sigma" => make("\\sigma", true, "&sigma;", "sigma", "sigma", "σ"), "sigmaf" => make("\\varsigma", true, "&sigmaf;", "sigmaf", "sigmaf", "ς"), "varsigma" => make("\\varsigma", true, "&sigmaf;", "varsigma", "varsigma", "ς"), "Tau" => make("T", false, "&Tau;", "Tau", "Tau", "Τ"), "Upsilon" => make("\\Upsilon", true, "&Upsilon;", "Upsilon", "Upsilon", "Υ"), "upsih" => make("\\Upsilon", true, "&upsih;", "upsilon", "upsilon", "ϒ"), "upsilon" => make("\\upsilon", true, "&upsilon;", "upsilon", "upsilon", "υ"), "Phi" => make("\\Phi", true, "&Phi;", "Phi", "Phi", "Φ"), "phi" => make("\\phi", true, "&phi;", "phi", "phi", "ɸ"), "varphi" => make("\\varphi", true, "&varphi;", "varphi", "varphi", "φ"), "Chi" => make("X", false, "&Chi;", "Chi", "Chi", "Χ"), "chi" => make("\\chi", true, "&chi;", "chi", "chi", "χ"), "acutex" => make("\\acute x", true, "&acute;x", "'x", "'x", "𝑥́"), "Psi" => make("\\Psi", true, "&Psi;", "Psi", "Psi", "Ψ"), "psi" => make("\\psi", true, "&psi;", "psi", "psi", "ψ"), "tau" => make("\\tau", true, "&tau;", "tau", "tau", "τ"), "Omega" => make("\\Omega", true, "&Omega;", "Omega", "Omega", "Ω"), "omega" => make("\\omega", true, "&omega;", "omega", "omega", "ω"), "piv" => make("\\varpi", true, "&piv;", "omega-pi", "omega-pi", "ϖ"), "varpi" => make("\\varpi", true, "&piv;", "omega-pi", "omega-pi", "ϖ"), "partial" => make("\\partial", true, "&part;", "[partial differential]", "[partial differential]", "∂"), // Hebrew "alefsym" => make("\\aleph", true, "&alefsym;", "aleph", "aleph", "ℵ"), "aleph" => make("\\aleph", true, "&aleph;", "aleph", "aleph", "ℵ"), "gimel" => make("\\gimel", true, "&gimel;", "gimel", "gimel", "ℷ"), "beth" => make("\\beth", true, "&beth;", "beth", "beth", "ב"), "dalet" => make("\\daleth", true, "&daleth;", "dalet", "dalet", "ד"), // Dead languages "ETH" => make("\\DH{}", false, "&ETH;", "D", "Ð", "Ð"), "eth" => make("\\dh{}", false, "&eth;", "dh", "ð", "ð"), "THORN" => make("\\TH{}", false, "&THORN;", "TH", "Þ", "Þ"), "thorn" => make("\\th{}", false, "&thorn;", "th", "þ", "þ"), // Punctuation // Dots and Marks "dots" => make("\\dots{}", false, "&hellip;", "...", "...", "…"), "cdots" => make("\\cdots{}", true, "&ctdot;", "...", "...", "⋯"), "hellip" => make("\\dots{}", false, "&hellip;", "...", "...", "…"), "middot" => make("\\textperiodcentered{}", false, "&middot;", ".", "·", "·"), "iexcl" => make("!`", false, "&iexcl;", "!", "¡", "¡"), "iquest" => make("?`", false, "&iquest;", "?", "¿", "¿"), // Dash-like "shy" => make("\\-", false, "&shy;", "", "", ""), "ndash" => make("--", false, "&ndash;", "-", "-", "–"), "mdash" => make("---", false, "&mdash;", "--", "--", "—"), // Quotations "quot" => make("\\textquotedbl{}", false, "&quot;", "\"", "\"", "\""), "acute" => make("\\textasciiacute{}", false, "&acute;", "'", "´", "´"), "ldquo" => make("\\textquotedblleft{}", false, "&ldquo;", "\"", "\"", "“"), "rdquo" => make("\\textquotedblright{}", false, "&rdquo;", "\"", "\"", "”"), "bdquo" => make("\\quotedblbase{}", false, "&bdquo;", "\"", "\"", "„"), "lsquo" => make("\\textquoteleft{}", false, "&lsquo;", "`", "`", "‘"), "rsquo" => make("\\textquoteright{}", false, "&rsquo;", "'", "'", "’"), "sbquo" => make("\\quotesinglbase{}", false, "&sbquo;", ",", ",", "‚"), "laquo" => make("\\guillemotleft{}", false, "&laquo;", "<<", "«", "«"), "raquo" => make("\\guillemotright{}", false, "&raquo;", ">>", "»", "»"), "lsaquo" => make("\\guilsinglleft{}", false, "&lsaquo;", "<", "<", "‹"), "rsaquo" => make("\\guilsinglright{}", false, "&rsaquo;", ">", ">", "›"), // Other // Misc. (often used) "circ" => make("\\^{}", false, "&circ;", "^", "^", "∘"), "vert" => make("\\vert{}", true, "&vert;", "|", "|", "|"), "vbar" => make("|", false, "|", "|", "|", "|"), "brvbar" => make("\\textbrokenbar{}", false, "&brvbar;", "|", "¦", "¦"), "S" => make("\\S", false, "&sect;", "paragraph", "§", "§"), "sect" => make("\\S", false, "&sect;", "paragraph", "§", "§"), "amp" => make("\\&", false, "&amp;", "&", "&", "&"), "lt" => make("\\textless{}", false, "&lt;", "<", "<", "<"), "gt" => make("\\textgreater{}", false, "&gt;", ">", ">", ">"), "tilde" => make("\\textasciitilde{}", false, "~", "~", "~", "~"), "slash" => make("/", false, "/", "/", "/", "/"), "plus" => make("+", false, "+", "+", "+", "+"), "under" => make("\\_", false, "_", "_", "_", "_"), "equal" => make("=", false, "=", "=", "=", "="), "asciicirc" => make("\\textasciicircum{}", false, "^", "^", "^", "^"), "dagger" => make("\\textdagger{}", false, "&dagger;", "[dagger]", "[dagger]", "†"), "dag" => make("\\dag{}", false, "&dagger;", "[dagger]", "[dagger]", "†"), "Dagger" => make("\\textdaggerdbl{}", false, "&Dagger;", "[doubledagger]", "[doubledagger]", "‡"), "ddag" => make("\\ddag{}", false, "&Dagger;", "[doubledagger]", "[doubledagger]", "‡"), // Whitespace "nbsp" => make("~", false, "&nbsp;", " ", "\x00A0", "\x00A0"), "ensp" => make("\\hspace*{.5em}", false, "&ensp;", " ", " ", " "), "emsp" => make("\\hspace*{1em}", false, "&emsp;", " ", " ", " "), "thinsp" => make("\\hspace*{.2em}", false, "&thinsp;", " ", " ", " "), // Currency "curren" => make("\\textcurrency{}", false, "&curren;", "curr.", "¤", "¤"), "cent" => make("\\textcent{}", false, "&cent;", "cent", "¢", "¢"), "pound" => make("\\pounds{}", false, "&pound;", "pound", "£", "£"), "yen" => make("\\textyen{}", false, "&yen;", "yen", "¥", "¥"), "euro" => make("\\texteuro{}", false, "&euro;", "EUR", "EUR", "€"), "EUR" => make("\\texteuro{}", false, "&euro;", "EUR", "EUR", "€"), "dollar" => make("\\$", false, "$", "$", "$", "$"), "USD" => make("\\$", false, "$", "$", "$", "$"), // Property Marks "copy" => make("\\textcopyright{}", false, "&copy;", "(c)", "©", "©"), "reg" => make("\\textregistered{}", false, "&reg;", "(r)", "®", "®"), "trade" => make("\\texttrademark{}", false, "&trade;", "TM", "TM", "™"), // Science et al. "minus" => make("\\minus", true, "&minus;", "-", "-", "−"), "pm" => make("\\textpm{}", false, "&plusmn;", "+-", "±", "±"), "plusmn" => make("\\textpm{}", false, "&plusmn;", "+-", "±", "±"), "times" => make("\\texttimes{}", false, "&times;", "*", "×", "×"), "frasl" => make("/", false, "&frasl;", "/", "/", "⁄"), "colon" => make("\\colon", true, ":", ":", ":", ":"), "div" => make("\\textdiv{}", false, "&divide;", "/", "÷", "÷"), "frac12" => make("\\textonehalf{}", false, "&frac12;", "1/2", "½", "½"), "frac14" => make("\\textonequarter{}", false, "&frac14;", "1/4", "¼", "¼"), "frac34" => make("\\textthreequarters{}", false, "&frac34;", "3/4", "¾", "¾"), "permil" => make("\\textperthousand{}", false, "&permil;", "per thousand", "per thousand", "‰"), "sup1" => make("\\textonesuperior{}", false, "&sup1;", "^1", "¹", "¹"), "sup2" => make("\\texttwosuperior{}", false, "&sup2;", "^2", "²", "²"), "sup3" => make("\\textthreesuperior{}", false, "&sup3;", "^3", "³", "³"), "radic" => make("\\sqrt{\\,}", true, "&radic;", "[square root]", "[square root]", "√"), "sum" => make("\\sum", true, "&sum;", "[sum]", "[sum]", "∑"), "prod" => make("\\prod", true, "&prod;", "[product]", "[n-ary product]", "∏"), "micro" => make("\\textmu{}", false, "&micro;", "micro", "µ", "µ"), "macr" => make("\\textasciimacron{}", false, "&macr;", "[macron]", "¯", "¯"), "deg" => make("\\textdegree{}", false, "&deg;", "degree", "°", "°"), "prime" => make("\\prime", true, "&prime;", "'", "'", "′"), "Prime" => make("\\prime{}\\prime", true, "&Prime;", "''", "''", "″"), "infin" => make("\\infty", true, "&infin;", "[infinity]", "[infinity]", "∞"), "infty" => make("\\infty", true, "&infin;", "[infinity]", "[infinity]", "∞"), "prop" => make("\\propto", true, "&prop;", "[proportional to]", "[proportional to]", "∝"), "propto" => make("\\propto", true, "&prop;", "[proportional to]", "[proportional to]", "∝"), "not" => make("\\textlnot{}", false, "&not;", "[angled dash]", "¬", "¬"), "neg" => make("\\neg{}", true, "&not;", "[angled dash]", "¬", "¬"), "land" => make("\\land", true, "&and;", "[logical and]", "[logical and]", "∧"), "wedge" => make("\\wedge", true, "&and;", "[logical and]", "[logical and]", "∧"), "lor" => make("\\lor", true, "&or;", "[logical or]", "[logical or]", "∨"), "vee" => make("\\vee", true, "&or;", "[logical or]", "[logical or]", "∨"), "cap" => make("\\cap", true, "&cap;", "[intersection]", "[intersection]", "∩"), "cup" => make("\\cup", true, "&cup;", "[union]", "[union]", "∪"), "smile" => make("\\smile", true, "&smile;", "[cup product]", "[cup product]", "⌣"), "frown" => make("\\frown", true, "&frown;", "[Cap product]", "[cap product]", "⌢"), "int" => make("\\int", true, "&int;", "[integral]", "[integral]", "∫"), "therefore" => make("\\therefore", true, "&there4;", "[therefore]", "[therefore]", "∴"), "there4" => make("\\therefore", true, "&there4;", "[therefore]", "[therefore]", "∴"), "because" => make("\\because", true, "&because;", "[because]", "[because]", "∵"), "sim" => make("\\sim", true, "&sim;", "~", "~", "∼"), "cong" => make("\\cong", true, "&cong;", "[approx. equal to]", "[approx. equal to]", "≅"), "simeq" => make("\\simeq", true, "&cong;", "[approx. equal to]", "[approx. equal to]", "≅"), "asymp" => make("\\asymp", true, "&asymp;", "[almost equal to]", "[almost equal to]", "≈"), "approx" => make("\\approx", true, "&asymp;", "[almost equal to]", "[almost equal to]", "≈"), "ne" => make("\\ne", true, "&ne;", "[not equal to]", "[not equal to]", "≠"), "neq" => make("\\neq", true, "&ne;", "[not equal to]", "[not equal to]", "≠"), "equiv" => make("\\equiv", true, "&equiv;", "[identical to]", "[identical to]", "≡"), "triangleq" => make("\\triangleq", true, "&triangleq;", "[defined to]", "[defined to]", "≜"), "le" => make("\\le", true, "&le;", "<=", "<=", "≤"), "leq" => make("\\le", true, "&le;", "<=", "<=", "≤"), "ge" => make("\\ge", true, "&ge;", ">=", ">=", "≥"), "geq" => make("\\ge", true, "&ge;", ">=", ">=", "≥"), "lessgtr" => make("\\lessgtr", true, "&lessgtr;", "[less than or greater than]", "[less than or greater than]", "≶"), "lesseqgtr" => make("\\lesseqgtr", true, "&lesseqgtr;", "[less than or equal or greater than or equal]", "[less than or equal or greater than or equal]", "⋚"), "ll" => make("\\ll", true, "&Lt;", "<<", "<<", "≪"), "Ll" => make("\\lll", true, "&Ll;", "<<<", "<<<", "⋘"), "lll" => make("\\lll", true, "&Ll;", "<<<", "<<<", "⋘"), "gg" => make("\\gg", true, "&Gt;", ">>", ">>", "≫"), "Gg" => make("\\ggg", true, "&Gg;", ">>>", ">>>", "⋙"), "ggg" => make("\\ggg", true, "&Gg;", ">>>", ">>>", "⋙"), "prec" => make("\\prec", true, "&pr;", "[precedes]", "[precedes]", "≺"), "preceq" => make("\\preceq", true, "&prcue;", "[precedes or equal]", "[precedes or equal]", "≼"), "preccurlyeq" => make("\\preccurlyeq", true, "&prcue;", "[precedes or equal]", "[precedes or equal]", "≼"), "succ" => make("\\succ", true, "&sc;", "[succeeds]", "[succeeds]", "≻"), "succeq" => make("\\succeq", true, "&sccue;", "[succeeds or equal]", "[succeeds or equal]", "≽"), "succcurlyeq" => make("\\succcurlyeq", true, "&sccue;", "[succeeds or equal]", "[succeeds or equal]", "≽"), "sub" => make("\\subset", true, "&sub;", "[subset of]", "[subset of]", "⊂"), "subset" => make("\\subset", true, "&sub;", "[subset of]", "[subset of]", "⊂"), "sup" => make("\\supset", true, "&sup;", "[superset of]", "[superset of]", "⊃"), "supset" => make("\\supset", true, "&sup;", "[superset of]", "[superset of]", "⊃"), "nsub" => make("\\not\\subset", true, "&nsub;", "[not a subset of]", "[not a subset of", "⊄"), "sube" => make("\\subseteq", true, "&sube;", "[subset of or equal to]", "[subset of or equal to]", "⊆"), "nsup" => make("\\not\\supset", true, "&nsup;", "[not a superset of]", "[not a superset of]", "⊅"), "supe" => make("\\supseteq", true, "&supe;", "[superset of or equal to]", "[superset of or equal to]", "⊇"), "setminus" => make("\\setminus", true, "&setminus;", "\\", "\\", "⧵"), "forall" => make("\\forall", true, "&forall;", "[for all]", "[for all]", "∀"), "exist" => make("\\exists", true, "&exist;", "[there exists]", "[there exists]", "∃"), "exists" => make("\\exists", true, "&exist;", "[there exists]", "[there exists]", "∃"), "nexist" => make("\\nexists", true, "&exist;", "[there does not exists]", "[there does not exists]", "∄"), "nexists" => make("\\nexists", true, "&exist;", "[there does not exists]", "[there does not exists]", "∄"), "empty" => make("\\empty", true, "&empty;", "[empty set]", "[empty set]", "∅"), "emptyset" => make("\\emptyset", true, "&empty;", "[empty set]", "[empty set]", "∅"), "isin" => make("\\in", true, "&isin;", "[element of]", "[element of]", "∈"), "in" => make("\\in", true, "&isin;", "[element of]", "[element of]", "∈"), "notin" => make("\\notin", true, "&notin;", "[not an element of]", "[not an element of]", "∉"), "ni" => make("\\ni", true, "&ni;", "[contains as member]", "[contains as member]", "∋"), "nabla" => make("\\nabla", true, "&nabla;", "[nabla]", "[nabla]", "∇"), "ang" => make("\\angle", true, "&ang;", "[angle]", "[angle]", "∠"), "angle" => make("\\angle", true, "&ang;", "[angle]", "[angle]", "∠"), "perp" => make("\\perp", true, "&perp;", "[up tack]", "[up tack]", "⊥"), "parallel" => make("\\parallel", true, "&parallel;", "||", "||", "∥"), "sdot" => make("\\cdot", true, "&sdot;", "[dot]", "[dot]", "⋅"), "cdot" => make("\\cdot", true, "&sdot;", "[dot]", "[dot]", "⋅"), "lceil" => make("\\lceil", true, "&lceil;", "[left ceiling]", "[left ceiling]", "⌈"), "rceil" => make("\\rceil", true, "&rceil;", "[right ceiling]", "[right ceiling]", "⌉"), "lfloor" => make("\\lfloor", true, "&lfloor;", "[left floor]", "[left floor]", "⌊"), "rfloor" => make("\\rfloor", true, "&rfloor;", "[right floor]", "[right floor]", "⌋"), "lang" => make("\\langle", true, "&lang;", "<", "<", "⟨"), "rang" => make("\\rangle", true, "&rang;", ">", ">", "⟩"), "langle" => make("\\langle", true, "&lang;", "<", "<", "⟨"), "rangle" => make("\\rangle", true, "&rang;", ">", ">", "⟩"), "hbar" => make("\\hbar", true, "&hbar;", "hbar", "hbar", "ℏ"), "mho" => make("\\mho", true, "&mho;", "mho", "mho", "℧"), // Arrows "larr" => make("\\leftarrow", true, "&larr;", "<-", "<-", "←"), "leftarrow" => make("\\leftarrow", true, "&larr;", "<-", "<-", "←"), "gets" => make("\\gets", true, "&larr;", "<-", "<-", "←"), "lArr" => make("\\Leftarrow", true, "&lArr;", "<=", "<=", "⇐"), "Leftarrow" => make("\\Leftarrow", true, "&lArr;", "<=", "<=", "⇐"), "uarr" => make("\\uparrow", true, "&uarr;", "[uparrow]", "[uparrow]", "↑"), "uparrow" => make("\\uparrow", true, "&uarr;", "[uparrow]", "[uparrow]", "↑"), "uArr" => make("\\Uparrow", true, "&uArr;", "[dbluparrow]", "[dbluparrow]", "⇑"), "Uparrow" => make("\\Uparrow", true, "&uArr;", "[dbluparrow]", "[dbluparrow]", "⇑"), "rarr" => make("\\rightarrow", true, "&rarr;", "->", "->", "→"), "to" => make("\\to", true, "&rarr;", "->", "->", "→"), "rightarrow" => make("\\rightarrow", true, "&rarr;", "->", "->", "→"), "rArr" => make("\\Rightarrow", true, "&rArr;", "=>", "=>", "⇒"), "Rightarrow" => make("\\Rightarrow", true, "&rArr;", "=>", "=>", "⇒"), "darr" => make("\\downarrow", true, "&darr;", "[downarrow]", "[downarrow]", "↓"), "downarrow" => make("\\downarrow", true, "&darr;", "[downarrow]", "[downarrow]", "↓"), "dArr" => make("\\Downarrow", true, "&dArr;", "[dbldownarrow]", "[dbldownarrow]", "⇓"), "Downarrow" => make("\\Downarrow", true, "&dArr;", "[dbldownarrow]", "[dbldownarrow]", "⇓"), "harr" => make("\\leftrightarrow", true, "&harr;", "<->", "<->", "↔"), "leftrightarrow" => make("\\leftrightarrow", true, "&harr;", "<->", "<->", "↔"), "hArr" => make("\\Leftrightarrow", true, "&hArr;", "<=>", "<=>", "⇔"), "Leftrightarrow" => make("\\Leftrightarrow", true, "&hArr;", "<=>", "<=>", "⇔"), "crarr" => make("\\hookleftarrow", true, "&crarr;", "<-'", "<-'", "↵"), "hookleftarrow" => make("\\hookleftarrow", true, "&crarr;", "<-'", "<-'", "↵"), // Function names "arccos" => make("\\arccos", true, "arccos", "arccos", "arccos", "arccos"), "arcsin" => make("\\arcsin", true, "arcsin", "arcsin", "arcsin", "arcsin"), "arctan" => make("\\arctan", true, "arctan", "arctan", "arctan", "arctan"), "arg" => make("\\arg", true, "arg", "arg", "arg", "arg"), "cos" => make("\\cos", true, "cos", "cos", "cos", "cos"), "cosh" => make("\\cosh", true, "cosh", "cosh", "cosh", "cosh"), "cot" => make("\\cot", true, "cot", "cot", "cot", "cot"), "coth" => make("\\coth", true, "coth", "coth", "coth", "coth"), "csc" => make("\\csc", true, "csc", "csc", "csc", "csc"), //"deg" => make("\\deg", true, "&deg;", "deg", "deg", "deg"), // duplicate key "det" => make("\\det", true, "det", "det", "det", "det"), "dim" => make("\\dim", true, "dim", "dim", "dim", "dim"), "exp" => make("\\exp", true, "exp", "exp", "exp", "exp"), "gcd" => make("\\gcd", true, "gcd", "gcd", "gcd", "gcd"), "hom" => make("\\hom", true, "hom", "hom", "hom", "hom"), "inf" => make("\\inf", true, "inf", "inf", "inf", "inf"), "ker" => make("\\ker", true, "ker", "ker", "ker", "ker"), "lg" => make("\\lg", true, "lg", "lg", "lg", "lg"), "lim" => make("\\lim", true, "lim", "lim", "lim", "lim"), "liminf" => make("\\liminf", true, "liminf", "liminf", "liminf", "liminf"), "limsup" => make("\\limsup", true, "limsup", "limsup", "limsup", "limsup"), "ln" => make("\\ln", true, "ln", "ln", "ln", "ln"), "log" => make("\\log", true, "log", "log", "log", "log"), "max" => make("\\max", true, "max", "max", "max", "max"), "min" => make("\\min", true, "min", "min", "min", "min"), "Pr" => make("\\Pr", true, "Pr", "Pr", "Pr", "Pr"), "sec" => make("\\sec", true, "sec", "sec", "sec", "sec"), "sin" => make("\\sin", true, "sin", "sin", "sin", "sin"), "sinh" => make("\\sinh", true, "sinh", "sinh", "sinh", "sinh"), //"sup" => make("\\sup", true, "&sup;", "sup", "sup", "sup"), // duplicate key "tan" => make("\\tan", true, "tan", "tan", "tan", "tan"), "tanh" => make("\\tanh", true, "tanh", "tanh", "tanh", "tanh"), // Signs & Symbols "bull" => make("\\textbullet{}", false, "&bull;", "*", "*", "•"), "bullet" => make("\\textbullet{}", false, "&bull;", "*", "*", "•"), "star" => make("\\star", true, "*", "*", "*", "⋆"), "lowast" => make("\\ast", true, "&lowast;", "*", "*", "∗"), "ast" => make("\\ast", true, "&lowast;", "*", "*", "*"), "odot" => make("\\odot", true, "o", "[circled dot]", "[circled dot]", "ʘ"), "oplus" => make("\\oplus", true, "&oplus;", "[circled plus]", "[circled plus]", "⊕"), "otimes" => make("\\otimes", true, "&otimes;", "[circled times]", "[circled times]", "⊗"), "check" => make("\\checkmark", true, "&checkmark;", "[checkmark]", "[checkmark]", "✓"), "checkmark" => make("\\checkmark", true, "&check;", "[checkmark]", "[checkmark]", "✓"), // Miscellaneous (seldom used) "para" => make("\\P{}", false, "&para;", "[pilcrow]", "¶", "¶"), "ordf" => make("\\textordfeminine{}", false, "&ordf;", "_a_", "ª", "ª"), "ordm" => make("\\textordmasculine{}", false, "&ordm;", "_o_", "º", "º"), "cedil" => make("\\c{}", false, "&cedil;", "[cedilla]", "¸", "¸"), "oline" => make("\\overline{~}", true, "&oline;", "[overline]", "¯", "‾"), "uml" => make("\\textasciidieresis{}", false, "&uml;", "[diaeresis]", "¨", "¨"), "zwnj" => make("\\/{}", false, "&zwnj;", "", "", "‌"), "zwj" => make("", false, "&zwj;", "", "", "‍"), "lrm" => make("", false, "&lrm;", "", "", "‎"), "rlm" => make("", false, "&rlm;", "", "", "‏"), // Smilies "smiley" => make("\\ddot\\smile", true, "&#9786;", ":-)", ":-)", "☺"), "blacksmile" => make("\\ddot\\smile", true, "&#9787;", ":-)", ":-)", "☻"), "sad" => make("\\ddot\\frown", true, "&#9785;", ":-(", ":-(", "☹"), "frowny" => make("\\ddot\\frown", true, "&#9785;", ":-(", ":-(", "☹"), // Suits "clubs" => make("\\clubsuit", true, "&clubs;", "[clubs]", "[clubs]", "♣"), "clubsuit" => make("\\clubsuit", true, "&clubs;", "[clubs]", "[clubs]", "♣"), "spades" => make("\\spadesuit", true, "&spades;", "[spades]", "[spades]", "♠"), "spadesuit" => make("\\spadesuit", true, "&spades;", "[spades]", "[spades]", "♠"), "hearts" => make("\\heartsuit", true, "&hearts;", "[hearts]", "[hearts]", "♥"), "heartsuit" => make("\\heartsuit", true, "&heartsuit;", "[hearts]", "[hearts]", "♥"), "diams" => make("\\diamondsuit", true, "&diams;", "[diamonds]", "[diamonds]", "◆"), "diamondsuit" => make("\\diamondsuit", true, "&diams;", "[diamonds]", "[diamonds]", "◆"), "diamond" => make("\\diamondsuit", true, "&diamond;", "[diamond]", "[diamond]", "◆"), "Diamond" => make("\\diamondsuit", true, "&diamond;", "[diamond]", "[diamond]", "◆"), "loz" => make("\\lozenge", true, "&loz;", "[lozenge]", "[lozenge]", "⧫"), // TODO needs build script to include at compile time // Spaces ("\_ ") // (let (space-entities html-spaces (entity "_")) // (dolist (n (number-sequence 1 20) (nreverse space-entities)) // (let ((spaces (make-string n ?\s))) // (push (list (setq entity (concat entity " ")) // (format "\\hspace*{%sem}" (* n .5)) // nil // (setq html-spaces (concat "&ensp;" html-spaces)) // spaces // spaces // (make-string n ?\x2002)) // space-entities)))) };
extern crate subprocess; use subprocess::Exec; use std::env; // Try running "cargo build -vv" to see this output. // For development, just run npm commands in "web" directly. fn main() { env::set_current_dir("web").unwrap(); Exec::shell("npm run build").join().unwrap(); println!("cargo:rerun-if-changed=web"); }
use schema::horus_licenses; #[derive(Insertable, Queryable, Serialize)] #[table_name = "horus_licenses"] pub struct License { pub key: String, pub owner: i32, pub type_: Option<i16>, // Since "type" is a rust keyword, needed for diesel pub resource_count: i32 }
#![deny(missing_docs)] #![deny(missing_debug_implementations)] #![cfg_attr(test, deny(warnings))] #![cfg_attr(not(feature = "std"), no_std)] //! # semval //! //! A lightweight and versatile toolbox for implementing semantic validation. //! //! Please refer to the bundled `reservation.rs` example to get an idea of how it works. //! //! Without any macro magic, at least not now. /// Invalidity context pub mod context; /// The crate's prelude /// /// A proposed set of imports to ease usage of this crate. pub mod prelude { pub use super::{ context::Context as ValidationContext, Invalidity, Result as ValidationResult, Validate, }; } use context::Context; use core::{any::Any, fmt::Debug}; /// Result of a validation /// /// The result is `Ok` and empty if the validation succeeded. It is /// a validation context wrapped into `Err` that carries one or more /// invalidities. /// /// In contrast to common results the actual payload is carried by /// the error variant while a successful result is just the unit type. pub type Result<V> = core::result::Result<(), Context<V>>; /// Invalidities that cause validation failures /// /// Validations fail if one or more objectives are considered invalid. /// These invalidity objectives are typically represented by sum types /// (`enum`) with one variant per objective. Some of the variants may /// recursively wrap an invalidity of a subordinate validation to trace /// back root causes. /// /// Implementations are required to implement `Debug` to enable analysis /// and low-level logging of those recursively wrapped sum types. /// /// The trait bound `Any` is implicitly implemented for most types and /// enables basic type inspection and downcasting for generically handling /// validation results though runtime reflection. pub trait Invalidity: Any + Debug {} impl<V> Invalidity for V where V: Any + Debug {} /// A trait for validating types /// /// Validation is expected to be an expensive operation that should /// only be invoked when crossing boundaries between independent /// components. pub trait Validate { /// Invalidity objectives type Invalidity: Invalidity; /// Perform the validation fn validate(&self) -> Result<Self::Invalidity>; } /// Validate `Some` or otherwise implicitly evaluate to `Ok` /// in case of `None` /// /// If the absence of an optional value is considered a validation /// error this must be checked separately. impl<V> Validate for Option<V> where V: Validate, { type Invalidity = V::Invalidity; fn validate(&self) -> Result<Self::Invalidity> { if let Some(ref some) = self { some.validate() } else { Ok(()) } } } #[cfg(test)] mod tests { use super::*; struct AlwaysValid; impl Validate for AlwaysValid { type Invalidity = (); fn validate(&self) -> Result<Self::Invalidity> { Context::new().into() } } struct AlwaysInvalid; impl Validate for AlwaysInvalid { type Invalidity = (); fn validate(&self) -> Result<Self::Invalidity> { Context::new().invalidate(()).into() } } #[test] fn validate() { assert!(AlwaysValid.validate().is_ok()); assert!(AlwaysInvalid.validate().is_err()); } #[test] fn validate_option_none() { assert!((None as Option<AlwaysValid>).validate().is_ok()); assert!((None as Option<AlwaysInvalid>).validate().is_ok()); } #[test] fn validate_option_some() { assert!(Some(AlwaysValid).validate().is_ok()); assert!(Some(AlwaysInvalid).validate().is_err()); } }
use std::convert::TryFrom; use num_enum::TryFromPrimitive; use crate::crtc::Crtc; use crate::device::Device; use crate::error::Result; #[derive(Debug)] #[derive(TryFromPrimitive)] #[repr(u32)] pub enum EncoderType { None, DAC, TMDS, LVDS, TVDAC, Virtual, DSI, DPMST, } #[derive(Debug)] pub struct Encoder<'a> { dev: &'a Device, id: u32, type_: EncoderType, } impl<'a> Encoder<'a> { pub(crate) fn new_from_id(dev: &'a Device, id: u32) -> Result<Encoder<'a>> { let encoder = dev.raw.get_encoder(id)?; Ok(Encoder { dev, id, type_: EncoderType::try_from(encoder.encoder_type).unwrap(), }) } pub fn get_possible_crtcs(&'_ self) -> Result<Vec<Crtc<'a>>> { let encoder = self.dev.raw.get_encoder(self.id)?; let crtcs = self.dev.get_crtcs()?; let ret = crtcs .into_iter() .enumerate() .filter(|&(index, _)| ((1 << index) & encoder.possible_crtcs) > 0) .map(|(_, crtc)| crtc) .collect(); Ok(ret) } }
use tlsh::{BucketKind, ChecksumKind, TlshBuilder}; use rustler::Binary; #[rustler::nif] pub fn hash(b64: Binary) -> String { let mut builder = TlshBuilder::new( BucketKind::Bucket128, ChecksumKind::OneByte, tlsh::Version::Version4, ); builder.update(&b64); let tlsh1 = builder.build().unwrap(); tlsh1.hash() } rustler::init!("Elixir.ExTlsh", [hash]);
#![feature(const_generics)] use std::fs::File; use std::io::prelude::*; use struct ThreshArray<U, const N : usize> { len : usize, member : [U ; N], } impl<U, const N : usize> ThreshArray<U,N> { fn new() -> Self { return } } struct Instruction { prefix: ThreshArray<u8, 4>, instruction: ThreshArray<u8, 2>, modreg: ThreshArray<u8, 1>, OSIB: ThreshArray<u8, 1>, displacement : ThreshArray<u8, 4>, constant: ThreshArray<u8, 4> } struct ByteReader { cursor : usize, vec : Vec<u8>, } impl ByteReader { fn new(v : Vec<u8>) -> Self { Self { cursor : 0, vec : v } } fn skip_elf_header(&mut self) { self.cursor += 0x40; } fn match_prefix(&mut self) -> { match self.vec[self.cursor] { 0xf0..0xf3 => , _ => } } fn match_opcode } fn openfile(filename : impl AsRef<str>) -> Result<Vec<u8>, std::io::Error> { let mut file = File::open(filename.as_ref())?; let mut contents = Vec::new(); match file.read_to_end(&mut contents) { Ok(_) => Ok(contents), Err(e) => Err(e) } } fn main() { let v = openfile("lab4_ex1").unwrap(); let br = ByteReader::new(v); }
#![allow(dead_code)] #[macro_use] extern crate log; extern crate chrono; extern crate crossbeam_channel; #[macro_export] macro_rules! import { ($($name:ident),+) => { $( mod $name; #[allow(unused_imports)] use self::$name::*; )* }; } mod config; mod irc; mod ui; pub use self::config::Config; pub use self::ui::Gui;
use jni::sys::jlong; use wasmer::{Instance, NativeFunc}; use std::ops::Deref; #[allow(non_camel_case_types)] pub type jptr = jlong; #[derive(Debug)] pub struct Pointer<Kind> { value: Box<Kind>, } impl<Kind> Pointer<Kind> { pub fn new(value: Kind) -> Self { Pointer { value: Box::new(value), } } pub fn borrow<'a>(self) -> &'a mut Kind { Box::leak(self.value) } } impl<Kind> From<Pointer<Kind>> for jptr { fn from(pointer: Pointer<Kind>) -> Self { Box::into_raw(pointer.value) as _ } } impl<Kind> From<jptr> for Pointer<Kind> { fn from(pointer: jptr) -> Self { Self { value: unsafe { Box::from_raw(pointer as *mut Kind) }, } } } impl<Kind> Deref for Pointer<Kind> { type Target = Kind; fn deref(&self) -> &Self::Target { &self.value } } pub struct WasmModule { pub instance: Pointer<Instance>, pub alloc_func: NativeFunc<i64, i32>, pub dealloc_func: NativeFunc<(i64, i64)>, } #[repr(C)] #[derive(Debug)] pub struct Tuple (pub i64, pub i64 );
use tch::{Tensor, kind}; // struct LidarSimulator { // } // impl LidarSimulator { // fn // } // struct MySLAM { // lsim: &LidarSimulator, // /// Step size for scan // step_size: f32, // /// Maximum scanning range // max_step: f32, // /// Threshold of probability in (0, 1) for collision check in scan // col_threshold: f32, // } /// Return scan points given parameters /// /// This function is used to compute simulated observations (distances) and /// log probability of observations. /// Poses `x` is batched for particles. Its size is (n, 3), /// where n is the number of particles. The size of scan points, /// which is the return value, is (n, n_dirs, max_step, 2). /// n_dirs is the number of scan directions: length of `dirs`. /// `max_step` is `int(max_range / step_size)`, which is determined by /// `Tensor::arange2()`. The last dimension is for x and y coordinate of /// the map. /// /// # Arguments /// * `xs` - Poses of the agent: (x, y, theta) /// * `step_size` - Step size for scan /// * `max_range` - Maximum scanning range /// * `dirs` - Scan directions in radian fn scan_points(xs: &Tensor, step_size: f64, max_range: f64, dirs: &Tensor) -> Tensor { let n = xs.size()[0]; let n_dirs = dirs.size()[0]; // Angles, shape is (n, n_dirs) let thetas = xs.slice(1, 2, 3, 1).reshape(&[-1, 1]) + dirs.reshape(&[1, -1]); // Directional vectors, shape is (n, n_dirs, 2) let dxs = thetas.cos(); let dys = thetas.sin(); let dxys = Tensor::stack(&[dxs, dys], -1); // shape is (n, n_dirs, 1, 2) for broadcasting let dxys = dxys.reshape(&[n, n_dirs, 1, 2]); // Replicate directional vectors let steps = Tensor::arange2(0.0, max_range, step_size, kind::FLOAT_CPU); let steps = steps.reshape(&[1, 1, -1, 1]); let dxys = dxys * steps; // Reshape xs[:, :2] into (n, 1, 1, 2) let xs = xs.slice(1, 0, 2, 1); let xs = xs.reshape(&[-1, 1, 1, 2]); dxys + xs } /// Collision check based on given log probability /// /// Argument `lps` is log probabilities of scan points. /// It can be occupancy grid values of a simulated map. In this case, /// the values would be `log(1)=0` or `log(small_val)`, because occupancy /// values woule be binalized. The size of `lps` is (n, n_dirs, max_step), /// where `n` is the batch size, `n_dirs` is the number of scan directions and /// `max_step` is the number of scan steps (see `scan_points()`). /// /// The size of the return value of this function is (n, n_dirs). /// It contains the minimum value of the scan index, whose log probability /// is greater than the threshold `threshold_lp`, in each direction. /// You would multiply `step_size` with these indices in order to get the /// distance where collision happens. It's precision is up to `step_size`. fn check_collision(lps: &Tensor, threshold_lp: f64) -> Tensor { let n = lps.size()[0]; let n_dirs = lps.size()[1]; let mut buf = vec![0.0 as f32; (n * n_dirs) as usize]; for i in 0..n { let lps_i = lps.slice(0, i, i + 1, 1).squeeze(); for j in 0..n_dirs { // Get vector of length max_steps let lps_ij = lps_i.slice(0, j, j + 1, 1); // Collision check for each scan (direction) let ix = lps_ij.ge(threshold_lp).nonzero().min().double_value(&[]); buf.push(ix as f32); } } Tensor::of_slice(buf.as_slice()).reshape(&[n, n_dirs]) } #[cfg(test)] mod tests { // TODO: is importing here idiomatic? use tch::{Tensor}; use crate::scan_points; // This test is intended to run with `cargo test -- --nocapture`, // print debug #[test] fn test_scan_points() { let xs = Tensor::of_slice( &[ 0.0, 0.0, 0.0, -10.0, 10.0, -0.1 as f32] ).reshape(&[2, 3]); let step_size = 0.1; let max_range = 0.5; let dirs = Tensor::of_slice(&[-0.1 as f32, 0.0, 0.1]); let xys = scan_points(&xs, step_size, max_range, &dirs); xys.print(); assert_eq!(2 + 2, 4); } } // impl MySLAM { // /// Log probability of Lidar observation // /// // fn logp_obs(z: Tensor&, x: Tensor&) -> Tensor { // let n_directions = z.size()[z.dim() - 1]; // for i in 0..n_directions { // } // } // }
#[doc = "Register `DOUTR27` reader"] pub type R = crate::R<DOUTR27_SPEC>; #[doc = "Register `DOUTR27` writer"] pub type W = crate::W<DOUTR27_SPEC>; #[doc = "Field `DOUT27` reader - Output data sent to MDIO Master during read frames"] pub type DOUT27_R = crate::FieldReader<u16>; #[doc = "Field `DOUT27` writer - Output data sent to MDIO Master during read frames"] pub type DOUT27_W<'a, REG, const O: u8> = crate::FieldWriter<'a, REG, 16, O, u16>; impl R { #[doc = "Bits 0:15 - Output data sent to MDIO Master during read frames"] #[inline(always)] pub fn dout27(&self) -> DOUT27_R { DOUT27_R::new((self.bits & 0xffff) as u16) } } impl W { #[doc = "Bits 0:15 - Output data sent to MDIO Master during read frames"] #[inline(always)] #[must_use] pub fn dout27(&mut self) -> DOUT27_W<DOUTR27_SPEC, 0> { DOUT27_W::new(self) } #[doc = "Writes raw bits to the register."] #[inline(always)] pub unsafe fn bits(&mut self, bits: u32) -> &mut Self { self.bits = bits; self } } #[doc = "MDIOS output data register 27\n\nYou can [`read`](crate::generic::Reg::read) this register and get [`doutr27::R`](R). You can [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero) this register using [`doutr27::W`](W). You can also [`modify`](crate::generic::Reg::modify) this register. See [API](https://docs.rs/svd2rust/#read--modify--write-api)."] pub struct DOUTR27_SPEC; impl crate::RegisterSpec for DOUTR27_SPEC { type Ux = u32; } #[doc = "`read()` method returns [`doutr27::R`](R) reader structure"] impl crate::Readable for DOUTR27_SPEC {} #[doc = "`write(|w| ..)` method takes [`doutr27::W`](W) writer structure"] impl crate::Writable for DOUTR27_SPEC { const ZERO_TO_MODIFY_FIELDS_BITMAP: Self::Ux = 0; const ONE_TO_MODIFY_FIELDS_BITMAP: Self::Ux = 0; } #[doc = "`reset()` method sets DOUTR27 to value 0"] impl crate::Resettable for DOUTR27_SPEC { const RESET_VALUE: Self::Ux = 0; }
use crypto::PublicKey; use assets::AssetBundle; use transactions::components::service::SERVICE_ID; use error::{Error, ErrorKind}; /// Transaction ID. pub const TRANSFER_ID: u16 = 200; evo_message! { /// `transfer` transaction. struct Transfer { const TYPE = SERVICE_ID; const ID = TRANSFER_ID; from: &PublicKey, to: &PublicKey, amount: u64, assets: Vec<AssetBundle>, seed: u64, memo: &str, } } #[derive(Debug, Clone)] pub struct TransferWrapper { from: PublicKey, to: PublicKey, amount: u64, assets: Vec<AssetBundle>, seed: u64, memo: String, } impl TransferWrapper { pub fn new(from: &PublicKey, to: &PublicKey, amount: u64, seed: u64, memo: &str) -> Self { TransferWrapper { from: *from, to: *to, amount: amount, assets: Vec::new(), seed: seed, memo: memo.to_string(), } } pub fn from_ptr<'a>(wrapper: *mut TransferWrapper) -> Result<&'a mut TransferWrapper, Error> { if wrapper.is_null() { return Err(Error::new(ErrorKind::Text( "wrapper isn't initialized".to_string(), ))); } Ok(unsafe { &mut *wrapper }) } pub fn add_asset(&mut self, asset: AssetBundle) { self.assets.push(asset); } pub fn unwrap(&self) -> Transfer { Transfer::new( &self.from, &self.to, self.amount, self.assets.clone(), self.seed, &self.memo ) } }
#[cfg(test)] mod test { extern crate interior_mut; use super::*; use std::cell::RefCell; struct MockMessenger { sent_messages: RefCell<Vec<String>>, } impl MockMessenger { fn new() -> MockMessenger { MockMessenger { sent_messages: RefCell::new(vec![]), } } } impl interior_mut::Messenger for MockMessenger { fn send(&self, message: &str) { self.sent_messages.borrow_mut().push(String::from(message)); } } #[test] fn it_sends_an_over_75_percent_warning_message() { // --snip-- let mock_messenger = MockMessenger::new(); let mut limit_tracker = interior_mut::LimitTracker::new(&mock_messenger, 100); limit_tracker.set_value(80); assert_eq!(mock_messenger.sent_messages.borrow().len(), 1); } }
use radmin::uuid::Uuid; use serde::{Deserialize, Serialize}; use super::OrganizationInfo as Organization; use crate::models::Address; use crate::schema::organization_addresses; #[derive( Debug, PartialEq, Clone, Serialize, Deserialize, Queryable, Identifiable, AsChangeset, Associations, )] #[belongs_to(Organization)] #[belongs_to(Address)] #[table_name = "organization_addresses"] pub struct OrganizationAddress { pub id: Uuid, pub organization_id: Uuid, pub address_id: Uuid, pub address_type: String, }
#![allow(non_camel_case_types)] pub use libc::c_char; pub use libc::c_int; pub use libc::c_long; pub use libc::c_ulong; pub use libc::size_t; //mod bitset_macro; pub static TERMKEY_VERSION_MAJOR: c_int = 0; pub static TERMKEY_VERSION_MINOR: c_int = 17; #[allow(non_snake_case)] pub unsafe fn TERMKEY_CHECK_VERSION() { termkey_check_version(TERMKEY_VERSION_MAJOR, TERMKEY_VERSION_MINOR); } #[repr(C)] #[deriving(PartialEq, PartialOrd)] pub enum TermKeySym { TERMKEY_SYM_UNKNOWN = -1, TERMKEY_SYM_NONE = 0, /* Special names in C0 */ TERMKEY_SYM_BACKSPACE, TERMKEY_SYM_TAB, TERMKEY_SYM_ENTER, TERMKEY_SYM_ESCAPE, /* Special names in G0 */ TERMKEY_SYM_SPACE, TERMKEY_SYM_DEL, /* Special keys */ TERMKEY_SYM_UP, TERMKEY_SYM_DOWN, TERMKEY_SYM_LEFT, TERMKEY_SYM_RIGHT, TERMKEY_SYM_BEGIN, TERMKEY_SYM_FIND, TERMKEY_SYM_INSERT, TERMKEY_SYM_DELETE, TERMKEY_SYM_SELECT, TERMKEY_SYM_PAGEUP, TERMKEY_SYM_PAGEDOWN, TERMKEY_SYM_HOME, TERMKEY_SYM_END, /* Special keys from terminfo */ TERMKEY_SYM_CANCEL, TERMKEY_SYM_CLEAR, TERMKEY_SYM_CLOSE, TERMKEY_SYM_COMMAND, TERMKEY_SYM_COPY, TERMKEY_SYM_EXIT, TERMKEY_SYM_HELP, TERMKEY_SYM_MARK, TERMKEY_SYM_MESSAGE, TERMKEY_SYM_MOVE, TERMKEY_SYM_OPEN, TERMKEY_SYM_OPTIONS, TERMKEY_SYM_PRINT, TERMKEY_SYM_REDO, TERMKEY_SYM_REFERENCE, TERMKEY_SYM_REFRESH, TERMKEY_SYM_REPLACE, TERMKEY_SYM_RESTART, TERMKEY_SYM_RESUME, TERMKEY_SYM_SAVE, TERMKEY_SYM_SUSPEND, TERMKEY_SYM_UNDO, /* Numeric keypad special keys */ TERMKEY_SYM_KP0, TERMKEY_SYM_KP1, TERMKEY_SYM_KP2, TERMKEY_SYM_KP3, TERMKEY_SYM_KP4, TERMKEY_SYM_KP5, TERMKEY_SYM_KP6, TERMKEY_SYM_KP7, TERMKEY_SYM_KP8, TERMKEY_SYM_KP9, TERMKEY_SYM_KPENTER, TERMKEY_SYM_KPPLUS, TERMKEY_SYM_KPMINUS, TERMKEY_SYM_KPMULT, TERMKEY_SYM_KPDIV, TERMKEY_SYM_KPCOMMA, TERMKEY_SYM_KPPERIOD, TERMKEY_SYM_KPEQUALS, /* et cetera ad nauseum */ TERMKEY_N_SYMS } impl ::std::fmt::Show for TermKeySym { fn fmt(&self, fmt: &mut ::std::fmt::Formatter) -> ::std::fmt::Result { let symi: c_int = unsafe { ::std::mem::transmute(*self) }; let _ = write!(fmt, "{}", symi); Ok(()) } } #[repr(C)] pub enum TermKeyType { TERMKEY_TYPE_UNICODE, TERMKEY_TYPE_FUNCTION, TERMKEY_TYPE_KEYSYM, TERMKEY_TYPE_MOUSE, TERMKEY_TYPE_POSITION, TERMKEY_TYPE_MODEREPORT, /* add other recognised types here */ TERMKEY_TYPE_UNKNOWN_CSI = -1 } #[repr(C)] #[deriving(PartialEq)] pub enum TermKeyResult { TERMKEY_RES_NONE, TERMKEY_RES_KEY, TERMKEY_RES_EOF, TERMKEY_RES_AGAIN, TERMKEY_RES_ERROR } #[repr(C)] #[deriving(PartialEq, PartialOrd)] pub enum TermKeyMouseEvent { TERMKEY_MOUSE_UNKNOWN, TERMKEY_MOUSE_PRESS, TERMKEY_MOUSE_DRAG, TERMKEY_MOUSE_RELEASE } impl ::std::fmt::Show for TermKeyMouseEvent { fn fmt(&self, fmt: &mut ::std::fmt::Formatter) -> ::std::fmt::Result { let symi: c_int = unsafe { ::std::mem::transmute(*self) }; let _ = write!(fmt, "{}", symi); Ok(()) } } bitset!(X_TermKey_KeyMod: c_int { TERMKEY_KEYMOD_SHIFT = 1 << 0, TERMKEY_KEYMOD_ALT = 1 << 1, TERMKEY_KEYMOD_CTRL = 1 << 2 }) impl ::std::fmt::Show for X_TermKey_KeyMod { fn fmt(&self, fmt: &mut ::std::fmt::Formatter) -> ::std::fmt::Result { let symi: c_int = unsafe { ::std::mem::transmute(*self) }; let _ = write!(fmt, "{}", symi); Ok(()) } } #[repr(C)] pub struct TermKeyKey { pub type_: TermKeyType, pub code: c_long, /* union { long codepoint; /* TERMKEY_TYPE_UNICODE */ int number; /* TERMKEY_TYPE_FUNCTION */ TermKeySym sym; /* TERMKEY_TYPE_KEYSYM */ char mouse[4]; /* TERMKEY_TYPE_MOUSE */ /* opaque. see termkey_interpret_mouse */ } code; */ pub modifiers: c_int, /* Any Unicode character can be UTF-8 encoded in no more than 6 bytes, plus * terminating NUL */ pub utf8: [c_char, ..7], } impl ::std::default::Default for TermKeyKey { fn default() -> TermKeyKey { TermKeyKey{type_: TERMKEY_TYPE_UNICODE, code: 0, modifiers: 0, utf8: [0, ..7]} } } impl TermKeyKey { pub unsafe fn codepoint(&self) -> c_long { self.code } pub unsafe fn num(&self) -> c_int { let s: &c_int = ::std::mem::transmute(&self.code); *s } pub unsafe fn sym(&self) -> TermKeySym { let s: &TermKeySym = ::std::mem::transmute(&self.code); *s } } impl TermKeyKey { pub fn from_codepoint(mods: X_TermKey_KeyMod, codepoint: char, utf8: [c_char, ..7]) -> TermKeyKey { unsafe { let mods: c_int = ::std::mem::transmute(mods); let codepoint: c_long = codepoint as c_long; TermKeyKey{type_: TERMKEY_TYPE_UNICODE, code: codepoint, modifiers: mods, utf8: utf8} } } pub fn from_num(mods: X_TermKey_KeyMod, num: int) -> TermKeyKey { unsafe { let mods: c_int = ::std::mem::transmute(mods); let num: c_int = num as c_int; let mut key = TermKeyKey{type_: TERMKEY_TYPE_FUNCTION, code: 0, modifiers: mods, utf8: [0, ..7]}; let code: &mut c_int = ::std::mem::transmute(&mut key.code); *code = num; key } } pub fn from_sym(mods: X_TermKey_KeyMod, sym: TermKeySym) -> TermKeyKey { unsafe { let mods: c_int = ::std::mem::transmute(mods); let mut key = TermKeyKey{type_: TERMKEY_TYPE_KEYSYM, code: 0, modifiers: mods, utf8: [0, ..7]}; let code: &mut TermKeySym = ::std::mem::transmute(&mut key.code); *code = sym; key } } pub fn from_mouse(tk: *mut TermKey, mods: X_TermKey_KeyMod, ev: TermKeyMouseEvent, button: c_int, line: c_int, col: c_int) -> TermKeyKey { unsafe { let mods: c_int = ::std::mem::transmute(mods); let mut key = TermKeyKey{type_: TERMKEY_TYPE_UNICODE, code: 0, modifiers: mods, utf8: [0, ..7]}; termkey_construct_mouse(tk, &mut key, ev, button, line, col); key } } pub fn from_position(tk: *mut TermKey, line: c_int, col: c_int) -> TermKeyKey { unsafe { let mut key = TermKeyKey{type_: TERMKEY_TYPE_UNICODE, code: 0, modifiers: 0, utf8: [0, ..7]}; termkey_construct_position(tk, &mut key, line, col); key } } pub fn from_mode_report(tk: *mut TermKey, initial: c_int, mode: c_int, value: c_int) -> TermKeyKey { unsafe { let mut key = TermKeyKey{type_: TERMKEY_TYPE_UNICODE, code: 0, modifiers: 0, utf8: [0, ..7]}; termkey_construct_modereport(tk, &mut key, initial, mode, value); key } } } pub enum TermKey {} bitset!(X_TermKey_Flag : c_int { TERMKEY_FLAG_NOINTERPRET = 1 << 0, /* Do not interpret C0//DEL codes if possible */ TERMKEY_FLAG_CONVERTKP = 1 << 1, /* Convert KP codes to regular keypresses */ TERMKEY_FLAG_RAW = 1 << 2, /* Input is raw bytes, not UTF-8 */ TERMKEY_FLAG_UTF8 = 1 << 3, /* Input is definitely UTF-8 */ TERMKEY_FLAG_NOTERMIOS = 1 << 4, /* Do not make initial termios calls on construction */ TERMKEY_FLAG_SPACESYMBOL = 1 << 5, /* Sets TERMKEY_CANON_SPACESYMBOL */ TERMKEY_FLAG_CTRLC = 1 << 6, /* Allow Ctrl-C to be read as normal, disabling SIGINT */ TERMKEY_FLAG_EINTR = 1 << 7 /* Return ERROR on signal (EINTR) rather than retry */ }) bitset!(X_TermKey_Canon : c_int { TERMKEY_CANON_SPACESYMBOL = 1 << 0, /* Space is symbolic rather than Unicode */ TERMKEY_CANON_DELBS = 1 << 1 /* Del is converted to Backspace */ }) bitset!(TermKeyFormat : c_int { TERMKEY_FORMAT_LONGMOD = 1 << 0, /* Shift-... instead of S-... */ TERMKEY_FORMAT_CARETCTRL = 1 << 1, /* ^X instead of C-X */ TERMKEY_FORMAT_ALTISMETA = 1 << 2, /* Meta- or M- instead of Alt- or A- */ TERMKEY_FORMAT_WRAPBRACKET = 1 << 3, /* Wrap special keys in brackets like <Escape> */ TERMKEY_FORMAT_SPACEMOD = 1 << 4, /* M Foo instead of M-Foo */ TERMKEY_FORMAT_LOWERMOD = 1 << 5, /* meta or m instead of Meta or M */ TERMKEY_FORMAT_LOWERSPACE = 1 << 6, /* page down instead of PageDown */ TERMKEY_FORMAT_MOUSE_POS = 1 << 8, /* Include mouse position if relevant; @ col,line */ /* Some useful combinations */ TERMKEY_FORMAT_VIM = (TERMKEY_FORMAT_ALTISMETA.bits|TERMKEY_FORMAT_WRAPBRACKET.bits), TERMKEY_FORMAT_URWID = (TERMKEY_FORMAT_LONGMOD.bits|TERMKEY_FORMAT_ALTISMETA.bits| TERMKEY_FORMAT_LOWERMOD.bits|TERMKEY_FORMAT_SPACEMOD.bits|TERMKEY_FORMAT_LOWERSPACE.bits) }) // Better to handle in makefile //#[link(name = "termkey")] extern { pub fn termkey_check_version(major: c_int, minor: c_int); pub fn termkey_new(fd: c_int, flags: c_int) -> *mut TermKey; pub fn termkey_new_abstract(term: *const c_char, flags: c_int) -> *mut TermKey; pub fn termkey_free(tk: *mut TermKey); pub fn termkey_destroy(tk: *mut TermKey); pub fn termkey_start(tk: *mut TermKey) -> c_int; pub fn termkey_stop(tk: *mut TermKey) -> c_int; pub fn termkey_is_started(tk: *mut TermKey) -> c_int; pub fn termkey_get_fd(tk: *mut TermKey) -> c_int; pub fn termkey_get_flags(tk: *mut TermKey) -> c_int; pub fn termkey_set_flags(tk: *mut TermKey, newflags: c_int); pub fn termkey_get_waittime(tk: *mut TermKey) -> c_int; pub fn termkey_set_waittime(tk: *mut TermKey, msec: c_int); pub fn termkey_get_canonflags(tk: *mut TermKey) -> c_int; pub fn termkey_set_canonflags(tk: *mut TermKey, cflags: c_int); pub fn termkey_get_buffer_size(tk: *mut TermKey) -> size_t; pub fn termkey_set_buffer_size(tk: *mut TermKey, size: size_t) -> c_int; pub fn termkey_get_buffer_remaining(tk: *mut TermKey) -> size_t; pub fn termkey_canonicalise(tk: *mut TermKey, key: *mut TermKeyKey); pub fn termkey_getkey(tk: *mut TermKey, key: *mut TermKeyKey) -> TermKeyResult; pub fn termkey_getkey_force(tk: *mut TermKey, key: *mut TermKeyKey) -> TermKeyResult; pub fn termkey_waitkey(tk: *mut TermKey, key: *mut TermKeyKey) -> TermKeyResult; pub fn termkey_advisereadable(tk: *mut TermKey) -> TermKeyResult; pub fn termkey_push_bytes(tk: *mut TermKey, bytes: *const c_char, len: size_t) -> size_t; pub fn termkey_register_keyname(tk: *mut TermKey, sym: TermKeySym, name: *const c_char) -> TermKeySym; pub fn termkey_get_keyname(tk: *mut TermKey, sym: TermKeySym) -> *const c_char; pub fn termkey_lookup_keyname(tk: *mut TermKey, str: *const c_char, sym: *mut TermKeySym) -> *const c_char; pub fn termkey_keyname2sym(tk: *mut TermKey, keyname: *const c_char) -> TermKeySym; pub fn termkey_interpret_mouse(tk: *mut TermKey, key: *const TermKeyKey, event: *mut TermKeyMouseEvent, button: *mut c_int, line: *mut c_int, col: *mut c_int) -> TermKeyResult; pub fn termkey_construct_mouse(tk: *mut TermKey, key: *mut TermKeyKey, event: TermKeyMouseEvent, button: c_int, line: c_int, col: c_int); pub fn termkey_interpret_position(tk: *mut TermKey, key: *const TermKeyKey, line: *mut c_int, col: *mut c_int) -> TermKeyResult; pub fn termkey_construct_position(tk: *mut TermKey, key: *mut TermKeyKey, line: c_int, col: c_int); pub fn termkey_interpret_modereport(tk: *mut TermKey, key: *const TermKeyKey, initial: *mut c_int, mode: *mut c_int, value: *mut c_int) -> TermKeyResult; pub fn termkey_construct_modereport(tk: *mut TermKey, key: *mut TermKeyKey, initial: c_int, mode: c_int, value: c_int); pub fn termkey_interpret_csi(tk: *mut TermKey, key: *const TermKeyKey, args: *mut c_long, nargs: *mut size_t, cmd: *mut c_ulong) -> TermKeyResult; pub fn termkey_strfkey(tk: *mut TermKey, buffer: *mut c_char, len: size_t, key: *mut TermKeyKey, format: TermKeyFormat) -> size_t; pub fn termkey_strpkey(tk: *mut TermKey, str: *const c_char, key: *mut TermKeyKey, format: TermKeyFormat) -> *const c_char; pub fn termkey_keycmp(tk: *mut TermKey, key1: *const TermKeyKey, key2: *const TermKeyKey) -> c_int; }
use amethyst::core::transform::Transform; use amethyst::prelude::World; use amethyst::prelude::WorldExt; use amethyst::ecs::Entity; pub trait CanTransform { fn set_position(&mut self,position:(f32,f32,f32)); fn get_entity(&self)-> Entity; fn set_rotation(&mut self, dir: RotateDirection, rad: f32); } #[derive(Copy, Clone)] pub enum RotateDirection { Vertical, Horizontal } pub fn r#move(world: &mut World, movable: &mut impl CanTransform, position:(f32, f32, f32)){ let mut storage = world.write_storage::<Transform>(); let transform = storage.get_mut(movable.get_entity()).expect("Failed to get transform for the entity"); movable.set_position(position); transform.set_translation_xyz(position.0,position.1,position.2); } pub fn rotate(world: &mut World, rotatable: &mut impl CanTransform, dir: RotateDirection, rad: f32 ){ let mut storage = world.write_storage::<Transform>(); let transform = storage.get_mut(rotatable.get_entity()).expect("Failed to get transform for the entity"); rotatable.set_rotation(dir, rad); match dir { RotateDirection::Horizontal=>{ transform.append_rotation_y_axis(rad); } RotateDirection::Vertical=>{ transform.append_rotation_x_axis(rad); } }; }
use borsh::{BorshDeserialize, BorshSchema, BorshSerialize}; use serum_common::pack::*; use solana_client_gen::prelude::*; #[derive(Debug, Clone, Copy, BorshSerialize, BorshDeserialize, BorshSchema, PartialEq)] pub enum FundType { /// similar to a gofundme FundMe, Raise { private: bool, }, } impl Default for FundType { fn default() -> Self { FundType::FundMe } } /// The Owner of the fund has the right to withdraw all or some of the funds #[derive(Default, Debug, BorshSerialize, BorshDeserialize, BorshSchema)] pub struct Fund { /// check to see if a fund is ininitialized pub initialized: bool, /// open defines if a fund is open for deposits pub open: bool, /// type of fund pub fund_type: FundType, /// fund Owner pub owner: Pubkey, /// Owner authority pub authority: Pubkey, /// max size of the fund pub max_balance: u64, /// balance of the pub balance: u64, /// Nonce of the program account pub nonce: u8, /// Mint pub mint: Pubkey, /// Address of the token vault controlled by the Safe. pub vault: Pubkey, /// Params /// shares, shares increment with investment, but do not decrement with withdraw pub shares: u64, /// nft account pub nft_account: Pubkey, /// nft mint pub nft_mint: Pubkey, /// whitelist represents a list of pubkeys that can deposit into a fund pub whitelist: Pubkey, /// Payback info pub paybacks: Vec<Payback>, /// round refers to the round of payback pub round: u32, } impl Fund { pub fn deduct(&mut self, amount: u64) { if self.balance > 0 { self.balance -= amount; } } /// Add adds the depoist amount to the total balance and shares pub fn add(&mut self, amount: u64) { self.balance += amount; if self.fund_type.eq(&FundType::Raise { private: true }) || self.fund_type.eq(&FundType::Raise { private: false }) { self.shares += amount; } } /// close_fund is called when the owner starts the withdrawl process pub fn close_fund(&mut self) { if self.open { self.open = false; } } pub fn add_new_payback(&mut self, total: u64, per_share: u64) { let pb = Payback::new(total, per_share); self.paybacks.push(pb); self.round += 1; } } serum_common::packable!(Fund); #[derive(Default, Debug, BorshSerialize, BorshDeserialize, BorshSchema)] pub struct Payback { /// total of the paybck pub total: u64, /// per_share pub per_share: u64, } impl Payback { pub fn new(total: u64, per_share: u64) -> Self { Payback { total, per_share } } pub fn add_total(&mut self, amount: u64) { self.total += amount; } pub fn add_payback_per_share(&mut self, amount: u64) { self.per_share += amount; } }
mod camera; mod mask_renderer; mod model_matrix; mod program; mod view_renderer; mod webgl; use crate::{ block::{self, BlockId}, resource, }; pub use camera::Camera; use mask_renderer::MaskRenderer; pub use mask_renderer::TableBlock; use model_matrix::ModelMatrix; use ndarray::{arr1, Array2}; use std::rc::Rc; use view_renderer::ViewRenderer; use wasm_bindgen::prelude::*; use wasm_bindgen::JsCast; use webgl::WebGlRenderingContext; pub struct Renderer { gl: Rc<WebGlRenderingContext>, view_renderer: ViewRenderer, mask_renderer: MaskRenderer, } impl Renderer { pub fn new(canvas: web_sys::HtmlCanvasElement) -> Self { let option = object! {stencil: true}; let option: js_sys::Object = option.into(); let gl = canvas .get_context_with_context_options("webgl", &option.into()) .unwrap() .unwrap() .dyn_into::<web_sys::WebGlRenderingContext>() .unwrap(); gl.get_extension("EXT_frag_depth") .map_err(|err| crate::debug::log_1(&err)) .unwrap() .unwrap(); let gl = Rc::new(WebGlRenderingContext(gl)); let view_renderer = ViewRenderer::new(&gl); let mask_renderer = MaskRenderer::new(); Self { gl, view_renderer, mask_renderer, } } pub fn table_object_id( &self, canvas_size: &[f32; 2], position: &[f32; 2], ) -> Option<&TableBlock> { self.mask_renderer.table_object_id(canvas_size, position) } pub fn table_position( vertex: &[f32; 3], movement: &[f32; 3], camera: &Camera, canvas_size: &[f32; 2], is_billboard: bool, ) -> [f32; 3] { let vp_matrix = camera .perspective_matrix(&canvas_size) .dot(&camera.view_matrix()); let model_matrix: Array2<f32> = if is_billboard { ModelMatrix::new() .with_x_axis_rotation(camera.x_axis_rotation() - std::f32::consts::FRAC_PI_2) .with_z_axis_rotation(camera.z_axis_rotation()) .with_movement(&movement) .into() } else { ModelMatrix::new().with_movement(&movement).into() }; let mvp_matrix = vp_matrix.dot(&model_matrix); let screen_position = mvp_matrix.dot(&arr1(&[vertex[0], vertex[1], vertex[2], 1.0])); [ screen_position[0] / screen_position[3], screen_position[1] / screen_position[3], screen_position[2], ] } pub async fn render( &mut self, block_arena: &block::Arena, resource_arena: &resource::Arena, world_id: &BlockId, camera: &Camera, canvas_size: &[f32; 2], floating_object: &Option<&BlockId>, client_id: &String, ) { if Rc::strong_count(&self.gl) < 3 { block_arena .map(world_id, { let block_arena = block::Arena::clone(&block_arena); let resource_arena = resource::Arena::clone(&resource_arena); move |world: &block::world::World| async move { self.view_renderer.render( &self.gl, &canvas_size, &camera, &block_arena, &resource_arena, world, client_id, ); self.mask_renderer.render( &canvas_size, &camera, block_arena, world, floating_object, client_id, ); let view_gl = Rc::clone(&self.gl); let mask_gl = self.mask_renderer.gl(); let a = Closure::once(Box::new(move || { view_gl.flush(); mask_gl.flush(); }) as Box<dyn FnOnce()>); let _ = web_sys::window() .unwrap() .request_animation_frame(a.as_ref().unchecked_ref()); a.forget(); } }) .await; } } }
use super::prelude::*; pub(crate) fn config(cfg: &mut web::ServiceConfig) { cfg.service(show_executor_groups) .service(show_executor_group_detail) .service(create_executor_group) .service(update_executor_group) .service(delete_executor_group); } #[post("/api/executor_group/create")] async fn create_executor_group( web::Json(executor_group): web::Json<model::NewExecutorGroup>, pool: ShareData<db::ConnectionPool>, ) -> HttpResponse { use db::schema::executor_group; if let Ok(conn) = pool.get() { return HttpResponse::Ok().json(Into::<UnifiedResponseMessages<u64>>::into( web::block(move || { diesel::insert_into(executor_group::table) .values(&executor_group) .execute(&conn)?; diesel::select(db::last_insert_id).get_result::<u64>(&conn) }) .await, )); } HttpResponse::Ok().json(UnifiedResponseMessages::<()>::error()) } #[post("/api/executor_group/list")] async fn show_executor_groups( web::Json(query_params): web::Json<model::QueryParamsExecutorGroup>, pool: ShareData<db::ConnectionPool>, ) -> HttpResponse { if let Ok(conn) = pool.get() { return HttpResponse::Ok().json(Into::< UnifiedResponseMessages<PaginateData<model::ExecutorGroup>>, >::into( web::block::<_, _, diesel::result::Error>(move || { let query_builder = model::ExecutorGroupQueryBuilder::query_all_columns(); let executor_groups = query_params .clone() .query_filter(query_builder) .paginate(query_params.page) .set_per_page(query_params.per_page) .load::<model::ExecutorGroup>(&conn)?; let per_page = query_params.per_page; let count_builder = model::ExecutorGroupQueryBuilder::query_count(); let count = query_params .query_filter(count_builder) .get_result::<i64>(&conn)?; Ok(PaginateData::<model::ExecutorGroup>::default() .set_data_source(executor_groups) .set_page_size(per_page) .set_total(count)) }) .await, )); } HttpResponse::Ok().json(UnifiedResponseMessages::<PaginateData<model::ExecutorGroup>>::error()) } #[post("/api/executor_group/detail")] async fn show_executor_group_detail( web::Json(model::ExecutorGroupId { executor_group_id }): web::Json<model::ExecutorGroupId>, pool: ShareData<db::ConnectionPool>, ) -> HttpResponse { let executor_group_detail_result = pre_show_executor_group_detail(executor_group_id, pool).await; if let Ok(executor_group_detail) = executor_group_detail_result { return HttpResponse::Ok().json( UnifiedResponseMessages::<model::ExecutorGroupDetail>::success_with_data( executor_group_detail, ), ); }; HttpResponse::Ok().json( UnifiedResponseMessages::<()>::error() .customized_error_msg(executor_group_detail_result.expect_err("").to_string()), ) } async fn pre_show_executor_group_detail( executor_group_id: i64, pool: ShareData<db::ConnectionPool>, ) -> Result<model::ExecutorGroupDetail, CommonError> { use db::schema::{executor_group, executor_processor, executor_processor_bind}; let conn = pool.get()?; let executor_group_detail: model::ExecutorGroupDetail = web::block::<_, _, diesel::result::Error>(move || { let executor_group_detail_inner = executor_group::table .select(executor_group::all_columns) .find(executor_group_id) .first::<model::ExecutorGroup>(&conn)?; let bindings = executor_processor_bind::table .inner_join(executor_processor::table) .filter(executor_processor_bind::group_id.eq(executor_group_id)) .select(( executor_processor_bind::id, executor_processor_bind::name, executor_processor_bind::executor_id, executor_processor_bind::weight, executor_processor::name, executor_processor::host, executor_processor::machine_id, )) .load::<model::ExecutorGroupBinding>(&conn)?; Ok(model::ExecutorGroupDetail { inner: executor_group_detail_inner, bindings, }) }) .await?; Ok(executor_group_detail) } #[post("/api/executor_group/update")] async fn update_executor_group( web::Json(executor_group): web::Json<model::UpdateExecutorGroup>, pool: ShareData<db::ConnectionPool>, ) -> HttpResponse { if let Ok(conn) = pool.get() { return HttpResponse::Ok().json(Into::<UnifiedResponseMessages<usize>>::into( web::block(move || { diesel::update(&executor_group) .set(&executor_group) .execute(&conn) }) .await, )); } HttpResponse::Ok().json(UnifiedResponseMessages::<usize>::error()) } #[post("/api/executor_group/delete")] async fn delete_executor_group( web::Json(model::ExecutorGroupId { executor_group_id }): web::Json<model::ExecutorGroupId>, pool: ShareData<db::ConnectionPool>, ) -> HttpResponse { use db::schema::executor_group::dsl::*; if let Ok(conn) = pool.get() { return HttpResponse::Ok().json(Into::<UnifiedResponseMessages<usize>>::into( web::block(move || { // Cannot link to delete internal bindings, otherwise it will cause data misalignment. diesel::delete(executor_group.find(executor_group_id)).execute(&conn) }) .await, )); } HttpResponse::Ok().json(UnifiedResponseMessages::<usize>::error()) }
//! Counts the number of points in a las file. extern crate las; use las::{Read, Reader}; fn main() { let path = std::env::args() .skip(1) .next() .expect("Must provide a path to a las file"); let mut reader = Reader::from_path(path).expect("Unable to open reader"); let npoints = reader .points() .map(|p| p.expect("Unable to read point")) .count(); println!("Number of points: {}", npoints); }
use std::collections::HashMap; use super::dom::{ ElementData, Node, NodeType }; use super::css::{ Selector, SimpleSelector, Rule, Specificity, Stylesheet, Value }; pub type PropertyMap = HashMap<String, Value>; pub enum Display { Inline, Block, None, } #[derive(Debug)] pub struct StyleNode<'a> { pub node: &'a Node, pub specified_values: PropertyMap, pub children: Vec<StyleNode<'a>>, } impl<'a> StyleNode<'a> { pub fn value(&self, name: &str) -> Option<Value> { self.specified_values.get(name).map(|v| v.clone()) } pub fn display(&self) -> Display { match self.value("display") { Some(Value::Keyword(s)) => match &*s { "block" => Display::Block, "none" => Display::None, _ => Display::Inline, }, _ => Display::Inline } } pub fn lookup(&self, name: &str, fallback_name: &str, default: &Value) -> Value { self.value(name).unwrap_or_else(|| self.value(fallback_name) .unwrap_or_else(|| default.clone())) } } pub fn style_tree<'a>(root: &'a Node, stylesheet: &'a Stylesheet) -> StyleNode<'a> { StyleNode { node: root, specified_values: match root.node_type { NodeType::Element(ref elem) => specified_values(elem, &stylesheet), NodeType::Text(_) => HashMap::new(), }, children: root.children.iter().map(|child| style_tree(child, stylesheet)).collect() } } fn specified_values(elem: &ElementData, stylesheet: &Stylesheet) -> PropertyMap { let mut values = HashMap::new(); let mut rules = match_rules(elem, stylesheet); rules.sort_by(|&(a, _), &(b, _)| a.cmp(&b) ); for (_, rule) in rules { for declaration in &rule.declarations { values.insert(declaration.name.clone(), declaration.value.clone()); } } return values; } type MatchedRule<'a> = (Specificity, &'a Rule); fn match_rules<'a>(elem: &'a ElementData, stylesheet: &'a Stylesheet) -> Vec<MatchedRule<'a>> { stylesheet.rules.iter() .filter_map(|rule| match_rule(elem, rule)).collect() } fn match_rule<'a>(elem: &'a ElementData, rule: &'a Rule) -> Option<MatchedRule<'a>> { rule.selectors.iter().find(|selector| matches(elem, *selector)) .map(|selector| (selector.specificity(), rule)) } fn matches(elem: &ElementData, selector: &Selector) -> bool { match *selector { Selector::Simple(ref simple_selector) => matches_simple_selector(elem, simple_selector) } } fn matches_simple_selector(elem: &ElementData, selector: &SimpleSelector) -> bool { if selector.tag_name.iter().any(|name| elem.tag_name != *name) { return false; } if selector.id.iter().any(|id| elem.id() != Some(id)) { return false; } let classes = elem.classes(); if selector.class.iter().any(|class| !classes.contains(&**class)) { return false; } return true; }
use super::*; #[test] fn test_decode_add() { let inst = decode(&vec!(1,2,3,4)[..], 0).unwrap(); assert_eq!(inst, Inst::Add(InParam::Position(2), InParam::Position(3), OutParam::Position(4))); let inst = decode(&vec!(101,2,3,4)[..], 0).unwrap(); assert_eq!(inst, Inst::Add(InParam::Immediate(2), InParam::Position(3), OutParam::Position(4))); let inst = decode(&vec!(1001,2,3,4)[..], 0).unwrap(); assert_eq!(inst, Inst::Add(InParam::Position(2), InParam::Immediate(3), OutParam::Position(4))); } #[test] fn test_decode_mult() { let inst = decode(&vec!(2,2,3,4)[..], 0).unwrap(); assert_eq!(inst, Inst::Mult(InParam::Position(2), InParam::Position(3), OutParam::Position(4))); let inst = decode(&vec!(102,2,3,4)[..], 0).unwrap(); assert_eq!(inst, Inst::Mult(InParam::Immediate(2), InParam::Position(3), OutParam::Position(4))); let inst = decode(&vec!(1002,2,3,4)[..], 0).unwrap(); assert_eq!(inst, Inst::Mult(InParam::Position(2), InParam::Immediate(3), OutParam::Position(4))); } #[test] fn test_decode_input() { let inst = decode(&vec!(3,0)[..], 0).unwrap(); assert_eq!(inst, Inst::Input(OutParam::Position(0))); } #[test] fn test_decode_output() { let inst = decode(&vec!(4,0)[..], 0).unwrap(); assert_eq!(inst, Inst::Output(InParam::Position(0))); let inst = decode(&vec!(104,0)[..], 0).unwrap(); assert_eq!(inst, Inst::Output(InParam::Immediate(0))); } #[test] fn test_decode_jumpiftrue() { let inst = decode(&vec!(5,1,2)[..], 0).unwrap(); assert_eq!(inst, Inst::JumpIfTrue(InParam::Position(1), InParam::Position(2))); let inst = decode(&vec!(105,1,2)[..], 0).unwrap(); assert_eq!(inst, Inst::JumpIfTrue(InParam::Immediate(1), InParam::Position(2))); let inst = decode(&vec!(1105,1,2)[..], 0).unwrap(); assert_eq!(inst, Inst::JumpIfTrue(InParam::Immediate(1), InParam::Immediate(2))); } #[test] fn test_decode_jumpiffalse() { let inst = decode(&vec!(6,1,2)[..], 0).unwrap(); assert_eq!(inst, Inst::JumpIfFalse(InParam::Position(1), InParam::Position(2))); let inst = decode(&vec!(106,1,2)[..], 0).unwrap(); assert_eq!(inst, Inst::JumpIfFalse(InParam::Immediate(1), InParam::Position(2))); let inst = decode(&vec!(1106,1,2)[..], 0).unwrap(); assert_eq!(inst, Inst::JumpIfFalse(InParam::Immediate(1), InParam::Immediate(2))); } #[test] fn test_decode_lessthan() { let inst = decode(&vec!(7,1,2,3)[..], 0).unwrap(); assert_eq!(inst, Inst::LessThan(InParam::Position(1), InParam::Position(2), OutParam::Position(3))); let inst = decode(&vec!(107,1,2,3)[..], 0).unwrap(); assert_eq!(inst, Inst::LessThan(InParam::Immediate(1), InParam::Position(2), OutParam::Position(3))); let inst = decode(&vec!(1107,1,2,3)[..], 0).unwrap(); assert_eq!(inst, Inst::LessThan(InParam::Immediate(1), InParam::Immediate(2), OutParam::Position(3))); } #[test] fn test_decode_equal() { let inst = decode(&vec!(8,1,2,3)[..], 0).unwrap(); assert_eq!(inst, Inst::Equal(InParam::Position(1), InParam::Position(2), OutParam::Position(3))); let inst = decode(&vec!(108,1,2,3)[..], 0).unwrap(); assert_eq!(inst, Inst::Equal(InParam::Immediate(1), InParam::Position(2), OutParam::Position(3))); let inst = decode(&vec!(1108,1,2,3)[..], 0).unwrap(); assert_eq!(inst, Inst::Equal(InParam::Immediate(1), InParam::Immediate(2), OutParam::Position(3))); } #[test] fn provided_case_1() { let mut c = Computer::new(vec!(1,9,10,3,2,3,11,0,99,30,40,50)); c.run().unwrap(); assert_eq!(c.mem, vec!(3500,9,10,70,2,3,11,0,99,30,40,50)); } #[test] fn provided_case_2() { let mut c = Computer::new(vec!(1,0,0,0,99)); c.run().unwrap(); assert_eq!(c.mem, vec!(2,0,0,0,99)); } #[test] fn run_with_io() { // single input let mut computer = Computer::new(vec!(3,1,99)); computer.input.push_back(7); computer.run().unwrap(); assert_eq!(computer.mem, vec!(3,7,99)); assert_eq!(computer.output.len(), 0); // input + output let mut computer = Computer::new(vec!(3,5,104,10,4,11,99)); computer.input.push_back(0); computer.run().unwrap(); assert_eq!(computer.mem, vec!(3,5,104,10,4,0,99)); assert_eq!(computer.take_output(), vec!(10,3)); } #[test] fn run_with_multiple_io() { // multiple inputs, multiple outputs let mut c = Computer::new(vec!(3,13,3,14,3,15,4,15,4,14,4,13,99,0,0,0)); c.input.push_back(22); c.input.push_back(33); c.input.push_back(44); c.run().unwrap(); assert_eq!(c.mem, vec!(3,13,3,14,3,15,4,15,4,14,4,13,99,22,33,44)); assert_eq!(c.take_output(), vec!(44,33,22)); } #[test] fn run_with_branches() { let mut c = Computer::new(vec!( 1001,12,-1,12, // [12] = ADD [12],-1 108,0,12,13, // [13] = EQ 0,[12] 1006,13,0, // IF ![13] GOTO 0 99, // EXIT 10,0)); // 12, 13 c.run().unwrap(); assert_eq!(c.mem, vec!(1001,12,-1,12,108,0,12,13,1006,13,0,99,0,1)); } #[test] fn run_with_comparisons() { let mut c = Computer::new(vec!(3,9,8,9,10,9,4,9,99,-1,8)); c.input.push_back(7); c.run().unwrap(); assert_eq!(c.take_output(), vec!(0)); let mut c = Computer::new(vec!(3,9,8,9,10,9,4,9,99,-1,8)); c.input.push_back(8); c.run().unwrap(); assert_eq!(c.take_output(), vec!(1)); } #[test] fn day9_case_1() { // takes no input and produces a copy of itself as output let input = vec!(109,1,204,-1,1001,100,1,100,1008,100,16,101,1006,101,0,99); let mut c = Computer::new(input.clone()); c.run().unwrap(); assert_eq!(input, c.take_output()); } #[test] fn day9_case_2() { // should output a 16-digit number let mut c = Computer::new(vec!(1102,34915192,34915192,7,4,7,99,0)); c.run().unwrap(); let output_as_string = format!("{}", c.take_output()[0]); assert_eq!(output_as_string.len(), 16); } #[test] fn day9_case_3() { let mut c = Computer::new(vec!(104,1125899906842624,99)); c.run().unwrap(); assert_eq!(c.take_output()[0], 1125899906842624); }
mod filter; mod searchable; pub use self::{filter::*, searchable::*};
//! This module contains macros which implements `egml!` macro //! and JSX-like templates. #![allow(non_camel_case_types, dead_code)] use crate::egml::{Component, Node, Comp, Rect, Circle, Path, Group, Text, Word, Listener}; #[macro_export] macro_rules! egml_impl { // Start of component tag ($state:ident (< $comp:ty : $($tail:tt)*)) => { #[allow(unused_mut)] let mut pair = $crate::egml::Comp::lazy::<$comp>(); $crate::egml_impl! { @comp $state $comp, pair ($($tail)*) } }; // Set a whole struct as a properties (@comp $state:ident $comp:ty, $pair:ident (with $props:ident, $($tail:tt)*)) => { $pair.0 = $props; $crate::egml_impl! { @comp $state $comp, $pair ($($tail)*) } }; (@comp $state:ident $comp:ty, $pair:ident (id = $val:expr, $($tail:tt)*)) => { ($pair.1).inner_mut::<$comp>().id = $crate::egml::Converter::convert($val); $crate::egml_impl! { @comp $state $comp, $pair ($($tail)*) } }; (@comp $state:ident $comp:ty, $pair:ident (modifier = | $this:pat, $model:ident | $handler:expr, $($tail:tt)*)) => { $crate::egml_impl! { @comp $state $comp, $pair (modifier = | $this, $model : $comp | $handler, $($tail)*) } }; (@comp $state:ident $comp:ty, $pair:ident (modifier = | $this:pat, $model:ident : $pcm:ty | $handler:expr, $($tail:tt)*)) => { ($pair.1).modifier = Some(move |$this: &mut $crate::egml::Comp, $model: &dyn $crate::egml::AnyModel| { let $model = $model.as_any().downcast_ref::<$pcm>() .expect(concat!("Modifier of ", stringify!($comp), " can't downcast model to ", stringify!($pcm))); $handler }); $crate::egml_impl! { @comp $state $comp, $pair ($($tail)*) } }; (@comp $state:ident $comp:ty, $pair:ident (modifier = for <$pcm:ty> $handler:ident, $($tail:tt)*)) => { $crate::egml_impl! { @comp $state $comp, $pair (modifier = | this, model : $pcm | $handler(this, model), $($tail)*) } }; (@comp $state:ident $comp:ty, $pair:ident (modifier = for <$pcm:ty> $handler:expr, $($tail:tt)*)) => { $crate::egml_impl! { @comp $state $comp, $pair (modifier = | this, model : $pcm | ($handler)(this, model), $($tail)*) } }; (@comp $state:ident $comp:ty, $pair:ident (pass_up = | $msg:ident | $handler:expr, $($tail:tt)*)) => { ($pair.1).inner_mut::<$comp>().pass_up_handler = Some(move |$msg: &dyn $crate::egml::AnyMessage| { let $msg = $msg.as_any().downcast_ref::<<$comp as $crate::egml::Component>::Message>() .expect(concat!("Pass up handler of ", stringify!($comp), " can't downcast msg to ", stringify!($comp::Message))) .clone(); Box::new($handler) as Box<dyn $crate::egml::AnyMessage> }); $crate::egml_impl! { @comp $state $comp, $pair ($($tail)*) } }; // Set a specific field as a property. // It uses `Transformer` trait to convert a type used in template to a type of the field. (@comp $state:ident $comp:ty, $pair:ident ($attr:ident = $val:expr, $($tail:tt)*)) => { // It cloned for ergonomics in templates. Attribute with // `self.param` value could be reused and sholdn't be cloned // by yourself ($pair.0).$attr = $crate::egml::comp::Transformer::<$comp, _, _>::transform(&mut $pair.1, $val); $crate::egml_impl! { @comp $state $comp, $pair ($($tail)*) } }; // Self-closing of tag (@comp $state:ident $comp:ty, $pair:ident (/ > $($tail:tt)*)) => { let (props, mut comp) = $pair; comp.inner_mut::<$comp>().init(props); $state.init_inner_comp::<$comp>(&mut comp); $state.stack.push(comp.into()); $crate::egml::macros::child_to_parent(&mut $state.stack, None); $crate::egml_impl! { $state ($($tail)*) } }; // Start of opening prim tag ($state:ident (< $starttag:ident $($tail:tt)*)) => { let prim = $crate::egml::Prim::new(stringify!($starttag), $crate::egml::macros::$starttag::default().into()); $state.stack.push(prim.into()); $crate::egml_impl! { @prim $state $starttag ($($tail)*) } }; (@prim $state:ident $shape:ident (modifier = | $this:pat, $model:ident : $cm:ty | $handler:expr, $($tail:tt)*)) => { $crate::egml_impl! { $state $shape (false, modifier = |$this, $model:$cm| $handler, $($tail)*) } $crate::egml_impl! { @prim $state $shape ($($tail)*) } }; (@prim $state:ident $shape:ident (modifier = for <$cm:ty> $handler:ident, $($tail:tt)*)) => { $crate::egml_impl! { @prim $state $shape (modifier = |this, model:$cm| $handler(this, model), $($tail)*) } }; (@prim $state:ident $shape:ident (modifier = for <$cm:ty> $handler:expr, $($tail:tt)*)) => { $crate::egml_impl! { @prim $state $shape (modifier = |this, model:$cm| ($handler)(this, model), $($tail)*) } }; // Events: (@prim $state:ident $shape:ident (onclick = | $var:pat | $handler:expr, $($tail:tt)*)) => { $crate::egml_impl! { @prim $state $shape ((onclick) = move | $var: $crate::egml::event::ClickEvent | $handler, $($tail)*) } }; // PATTERN: (action)=expression, (@prim $state:ident $shape:ident (($action:ident) = $handler:expr, $($tail:tt)*)) => { // Catch value to a separate variable for clear error messages let handler = $handler; let listener = $crate::egml::event::listener::$action(handler); $crate::egml::macros::attach_listener(&mut $state.stack, Box::new(listener)); $crate::egml_impl! { @prim $state $shape ($($tail)*) } }; (@prim $state:ident $shape:ident ($attr:ident = $val:expr, $($tail:tt)*)) => { $crate::set_attr!($state, $shape.$attr = $crate::egml::Converter::convert($val)); $crate::egml_impl! { @prim $state $shape ($($tail)*) } }; // End of openging tag (@prim $state:ident $shape:ident (> $($tail:tt)*)) => { $crate::egml_impl! { $state ($($tail)*) } }; // Self-closing of tag (@prim $state:ident $shape:ident (/ > $($tail:tt)*)) => { $crate::egml::macros::child_to_parent(&mut $state.stack, None); $crate::egml_impl! { $state ($($tail)*) } }; // Traditional tag closing ($state:ident (< / $endtag:ident > $($tail:tt)*)) => { let endtag = stringify!($endtag); $crate::egml::macros::child_to_parent(&mut $state.stack, Some(endtag)); $crate::egml_impl! { $state ($($tail)*) } }; // PATTERN: { for expression } ($state:ident ({ for $eval:expr } $($tail:tt)*)) => { let nodes = $eval; let mut prim = $crate::egml::Prim::new("list group", $crate::egml::Group::default().into()); for node in nodes { prim.add_child($crate::egml::Node::from(node)); } $crate::egml::macros::add_child(&mut $state.stack, prim.into()); $crate::egml_impl! { $state ($($tail)*) } }; // PATTERN: { expression } ($state:ident ({ $eval:expr } $($tail:tt)*)) => { let node = $crate::egml::Node::from($eval); $crate::egml::macros::add_child(&mut $state.stack, node); $crate::egml_impl! { $state ($($tail)*) } }; ($state:ident (. $shape:ident . modifier = | $this:pat, $model:ident : $cm:ty | $handler:expr, $($tail:tt)*)) => { $crate::egml_impl! { $state $shape (true, modifier = |$this, $model:$cm| $handler, $($tail)*) } $crate::egml_impl! { $state ($($tail)*) } }; ($state:ident $shape:ident ($for_child:expr, modifier = | $this:pat, $model:ident : $cm:ty | $handler:expr, $($tail:tt)*)) => { $crate::set_child_attr!($state, $for_child, $shape.modifier = Some(move |$this: &mut $crate::egml::macros::$shape, $model: &dyn $crate::egml::AnyModel| { let $model = $model.as_any().downcast_ref::<$cm>() .expect(concat!("Modifier of ", stringify!($shape), " can't downcast model to ", stringify!($cm))); $handler })); }; // "End of paring" rule ($state:ident ()) => { $crate::egml::macros::unpack($state.stack) }; ($state:ident $($tail:tt)*) => { compile_error!("You should use curly bracets for text nodes: <a>{ \"Link\" }</a>"); }; } // This entrypoint and implementation had separated to prevent infinite recursion. #[macro_export] macro_rules! egml { ($($tail:tt)*) => {{ let mut state = $crate::macros::State { stack: Vec::new() }; $crate::egml_impl! { state ($($tail)*) } }}; } #[doc(hidden)] #[macro_export] macro_rules! set_attr { ($state:ident, $shape:ident.$attr:ident = $val:expr) => { $crate::set_child_attr!($state, false, $shape.$attr = $val); }; } #[doc(hidden)] #[macro_export] macro_rules! set_child_attr { ($state:ident, $for_child:expr, $shape:ident.$attr:ident = $val:expr) => { { let last = $state.stack.last_mut() .and_then(|node| if $for_child { if let &mut Node::Prim(ref mut prim) = node { prim.childs.last_mut() } else { None } } else { Some(node) }); if let Some(&mut Node::Prim(ref mut prim)) = last { if let Some(shape) = prim.shape.as_ref_mut().$shape() { shape.$attr = $val; } else { panic!("no shape '{}' to set attribute '{}'", stringify!($shape), stringify!($attr)); } } else { panic!("no prim to set attribute: {}", stringify!($attr)); } } }; } pub type Stack<M> = Vec<Node<M>>; pub struct State<M: Component> { pub stack: Stack<M>, } impl<M: Component> State<M> { pub fn init_inner_comp<CM: Component>(&self, comp: &mut Comp) { comp.inner_mut::<CM>().init_as_child::<M>(); } } pub type rect = Rect; pub type circle = Circle; pub type path = Path; pub type group = Group; pub type text = Text; pub type word = Word; #[doc(hidden)] pub fn unpack<MC: Component>(mut stack: Stack<MC>) -> Node<MC> { if stack.len() != 1 { panic!("exactly one element have to be in hgml!"); } stack.pop().expect("no hgml elements in the stack") } #[doc(hidden)] pub fn attach_listener<MC: Component>(stack: &mut Stack<MC>, listener: Box<dyn Listener<MC>>) { if let Some(&mut Node::Prim(ref mut prim)) = stack.last_mut() { prim.add_listener(listener); } else { panic!("no prim to attach listener: {:?}", listener); } } #[doc(hidden)] pub fn add_child<MC: Component>(stack: &mut Stack<MC>, child: Node<MC>) { match stack.last_mut() { Some(&mut Node::Prim(ref mut prim)) => { prim.add_child(child); } // Some(&mut Node::VList(ref mut vlist)) => { // vlist.add_child(child); // } _ => { panic!("parent must be a prim or a fragment to add the node: {:?}", child); } } } #[doc(hidden)] pub fn child_to_parent<MC: Component>(stack: &mut Stack<MC>, endtag: Option<&'static str>) { if let Some(mut node) = stack.pop() { // Check the enclosing prim // TODO Check it during compilation. Possible? if let (&mut Node::Prim(ref mut prim), Some(endtag)) = (&mut node, endtag) { let starttag = prim.name(); if !starttag.eq_ignore_ascii_case(endtag) { panic!("wrong closing tag: <{}> -> </{}>", starttag, endtag); } } // Push the popped element to the last in the stack if !stack.is_empty() { match stack.last_mut() { Some(&mut Node::Prim(ref mut prim)) => { prim.add_child(node); } // Some(&mut Node::VList(ref mut vlist)) => { // vlist.add_child(node); // } _ => { panic!("can't add child to this type of node"); } } } else { // Keep the last node in the stack stack.push(node); } } else { panic!("redundant closing tag: {:?}", endtag); } } #[cfg(test)] mod tests { use super::*; use crate::egml::{self, Shapeable, Color, ChangeView}; struct Model { val: f32, } #[derive(Copy, Clone)] enum Msg { InnerToggle(i32), } impl Component for Model { type Message = Msg; type Properties = (); fn create(_props: &Self::Properties) -> Self { Model { val: 0.0, } } fn update(&mut self, msg: Self::Message) -> ChangeView { match msg { Msg::InnerToggle(_) => ChangeView::None, } } fn view(&self) -> Node<Self> { egml! { <rect /> } } } struct InnerModel { val: bool, } #[derive(Copy, Clone)] enum InnerMsg { Toggle(i32), } impl Component for InnerModel { type Message = InnerMsg; type Properties = (); fn create(_props: &Self::Properties) -> Self { InnerModel { val: false, } } fn update(&mut self, msg: Self::Message) -> ChangeView { match msg { InnerMsg::Toggle(_) => ChangeView::None, } } fn view(&self) -> Node<Self> { egml! { <rect /> } } } #[test] fn set_attr() { let mut state = State { stack: Vec::<Node<Model>>::new() }; let rect = egml::macros::rect::default(); let prim = egml::Prim::new("rect", rect.into()); state.stack.push(prim.into()); set_attr!(state, rect.x = 1.2.into()); match state.stack.last().unwrap() { Node::Prim(ref prim) => { let x = prim.rect().unwrap().x.val(); assert_eq!(1.2, x); }, _ => (), } let circle = egml::macros::circle::default(); let prim = egml::Prim::new("circle", circle.into()); state.stack.push(prim.into()); set_attr!(state, circle.r = 2.5.into()); match state.stack.last().unwrap() { Node::Prim(ref prim) => { let r = prim.circle().unwrap().r.val(); assert_eq!(2.5, r); }, _ => (), } } #[test] fn set_prim_modifier() { let _node: Node<Model> = egml! { <group translate = (50.0, 50.0), > <rect x = 0.0, y = 0.0, width = 300.0, height = 300.0, fill = None, stroke = (Color::Black, 2.0, 0.5), > <circle cx = 150.0, cy = 150.0, r = 20.0, fill = Color::Blue, modifier = |circle, model: Model| { circle.cy = model.val.into(); }, /> <circle modifier = for <Model> get_prim_handler(), /> <circle modifier = for <Model> prim_handler, /> </rect> </group> }; } fn get_prim_handler() -> impl Fn(&mut Circle, &Model) { |circle: &mut Circle, model: &Model| { circle.cy = model.val.into(); } } fn prim_handler(circle: &mut Circle, model: &Model) { circle.cy = model.val.into(); } #[test] fn set_comp_modifier() { let _node: Node<Model> = egml! { <group translate = (50.0, 50.0), > <rect x = 0.0, y = 0.0, width = 300.0, height = 300.0, fill = None, stroke = (Color::Black, 2.0, 0.5), > <InnerModel : modifier = |this, model: Model| { this.send_self(InnerMsg::Toggle(model.val as i32)); }, /> <InnerModel : modifier = for <Model> get_comp_handler(), /> <InnerModel : modifier = for <Model> comp_handler, /> </rect> </group> }; } fn get_comp_handler() -> impl Fn(&mut Comp, &Model) { |this: &mut Comp, model: &Model| { this.send_self(InnerMsg::Toggle(model.val as i32)); } } fn comp_handler(this: &mut Comp, model: &Model) { this.send_self(InnerMsg::Toggle(model.val as i32)); } #[test] fn set_pass_up() { let _node: Node<Model> = egml! { <group translate = (50.0, 50.0), > <rect x = 0.0, y = 0.0, width = 300.0, height = 300.0, fill = None, stroke = (Color::Black, 2.0, 0.5), > <InnerModel : pass_up = |msg| { match msg { InnerMsg::Toggle(s) => Msg::InnerToggle(s) } }, /> </rect> </group> }; } }
pub mod boxify; pub mod flatten_closures; pub mod generate_bytecode; use super::syntax::Expression; pub trait Transformer { fn visit(&mut self, expr: Expression) -> Visited; } pub enum Visited { Transformed(Expression), Recurse(Expression), } impl<T: Into<Expression>> From<T> for Visited { fn from(x: T) -> Self { Visited::Transformed(x.into()) } }
pub mod player; pub mod block; pub mod stage; pub mod object; pub mod score;
/* * Datadog API V1 Collection * * Collection of all Datadog Public endpoints. * * The version of the OpenAPI document: 1.0 * Contact: support@datadoghq.com * Generated by: https://openapi-generator.tech */ /// SyntheticsListTestsResponse : Object containing an array of Synthetic tests configuration. #[derive(Clone, Debug, PartialEq, Serialize, Deserialize)] pub struct SyntheticsListTestsResponse { /// Array of Synthetic tests configuration. #[serde(rename = "tests", skip_serializing_if = "Option::is_none")] pub tests: Option<Vec<crate::models::SyntheticsTestDetails>>, } impl SyntheticsListTestsResponse { /// Object containing an array of Synthetic tests configuration. pub fn new() -> SyntheticsListTestsResponse { SyntheticsListTestsResponse { tests: None, } } }
use super::super::context::{Context, ParentOrRoot}; use super::super::error::*; use super::super::traits::WorkType; use super::super::utils::station_fn_ctx2; use super::super::work::{WorkBox, WorkOutput}; use conveyor::{futures::prelude::*, into_box, station_fn, Result, Station, WorkStation}; use conveyor_work::package::Package; use pathutils; use std::fmt; use std::sync::Arc; use vfs::{VPath, WritePath, VFS}; use std::io::Write; #[derive(Serialize, Deserialize, Clone)] pub struct WriteDirectory { pub path: String, } impl fmt::Debug for WriteDirectory { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "WriteDirectory") } } #[typetag::serde] impl WorkType for WriteDirectory { fn request_station(&self, ctx: &mut Context) -> CrawlResult<WorkBox<Package>> { let log = ctx.log().new(o!("worktype" => "write-directory")); info!(log, "request write-directory station"); let mut path = ctx.interpolate(self.path.as_str()).unwrap(); if !pathutils::is_absolute(&path) { path = pathutils::to_absolute(&path, ctx.root().target().path().to_str().unwrap()) .map_err(|_| CrawlError::new(CrawlErrorKind::Unknown))?; } info!(log, "using path"; "path" => &path); if !std::path::Path::new(&path).exists() { return Err(CrawlErrorKind::NotFound("path does not exits".to_string()).into()); } let ctx = Context::new(ParentOrRoot::Parent(Box::new(ctx.clone())), None, Some(log)); Ok(into_box(WorkStation::new( 1, |mut package: Package, ctx: &mut (vfs::physical::PhysicalFS, Context)| { let path = ctx.0.path(package.name()); if path.exists() { return Ok(vec![WorkOutput::Result(Ok(package))]); } info!(ctx.1.log(), "writing path"; "path" => format!("{:?}", path)); let buf = conveyor::futures::executor::block_on(package.read_content())?; let mut file = path.create().unwrap(); file.write(&buf); file.flush(); Ok(vec![WorkOutput::Result(Ok(package))]) }, move || (vfs::physical::PhysicalFS::new(&path).unwrap(), ctx.clone()), ))) } fn box_clone(&self) -> Box<WorkType> { Box::new(self.clone()) } }
use std::path::{Path, PathBuf}; use crate::{error::TtsError, TtsEngine}; use async_trait::async_trait; use enum_product::enum_product; use reqwest::Client; use tokio::{ fs, io::{AsyncWriteExt, BufWriter}, }; use yup_oauth2 as oauth; #[derive(Clone, Debug)] pub struct GcpToken(String, PathBuf); impl GcpToken { pub async fn issue<P: AsRef<Path>>(cert_path: P) -> Result<Self, TtsError> { let key = oauth::read_service_account_key(cert_path.as_ref()).await?; let authenticator = oauth::ServiceAccountAuthenticator::builder(key) .build() .await?; let token = authenticator .token(&["https://www.googleapis.com/auth/cloud-platform"]) .await?; Ok(Self( token.as_str().to_string(), cert_path.as_ref().to_path_buf(), )) } pub fn show(&self) -> String { self.0.clone() } pub async fn renew_token(&mut self) -> Result<(), TtsError> { let key = oauth::read_service_account_key(&self.1).await?; let authenticator = oauth::ServiceAccountAuthenticator::builder(key) .build() .await?; let token = authenticator .token(&["https://www.googleapis.com/auth/cloud-platform"]) .await?; self.0 = token.as_str().to_string(); Ok(()) } } #[derive(Clone, Debug)] pub struct GcpTts { pub config: GcpConfig, } #[async_trait] impl TtsEngine for GcpTts { type Config = GcpConfig; fn from_config(config: Self::Config) -> Result<Self, crate::error::TtsError> { Ok(Self { config }) } async fn save(&self, text: &str) -> Result<String, crate::error::TtsError> { let client = Client::builder().gzip(true).build()?; let token = if self.config.access_token.trim().starts_with("Bearer ") { self.config.access_token.replace("Bearer ", "") } else { self.config.access_token.clone() }; let url = "https://texttospeech.googleapis.com/v1/text:synthesize"; let req = GcpRequest { input: GcpInputRequest { text: text.to_string(), }, voice: self.config.voice.clone(), audio_config: self.config.audio_config.clone(), }; info!("Request: {:?}", serde_json::to_string(&req)); let buff = client .post(url) .bearer_auth(token) .json(&req) .send() .await? .json::<GcpResponse>() .await?; let buff = tokio::spawn(async move { base64::decode(buff.audio_content) }).await??; let filename: String = uuid::Uuid::new_v4().to_string(); let output_path = format!("{}.mp3", filename); let mut output_file = BufWriter::new(fs::File::create(&output_path).await?); output_file.write_all(&buff).await?; output_file.flush().await?; Ok(output_path) } } #[derive(Clone, Debug, Serialize, Deserialize)] #[serde(rename_all = "camelCase")] pub struct GcpResponse { pub audio_content: String, } #[derive(Clone, Debug, Serialize, Deserialize)] #[serde(rename_all = "camelCase")] pub struct GcpRequest { pub input: GcpInputRequest, pub voice: GcpVoiceRequest, pub audio_config: GcpAudioConfigRequest, } #[derive(Clone, Debug, Serialize, Deserialize, Default)] #[serde(rename_all = "camelCase")] pub struct GcpInputRequest { pub text: String, } #[derive(Clone, Debug, Serialize, Deserialize, Default)] #[serde(rename_all = "camelCase")] pub struct GcpVoiceRequest { pub language_code: String, pub name: String, pub ssml_gender: String, } #[derive(Clone, Debug, Serialize, Deserialize, Default)] #[serde(rename_all = "camelCase")] pub struct GcpAudioConfigRequest { pub audio_encoding: String, #[serde(skip_serializing_if = "Option::is_none")] #[serde(default)] pub speaking_rate: Option<f64>, #[serde(skip_serializing_if = "Option::is_none")] #[serde(default)] pub pitch: Option<f64>, #[serde(skip_serializing_if = "Option::is_none")] #[serde(default)] pub voice_gain_db: Option<f64>, #[serde(skip_serializing_if = "Option::is_none")] #[serde(default)] pub sample_rate_hertz: Option<u64>, } #[derive(Clone, Debug)] pub struct GcpConfig { pub access_token: String, pub voice: GcpVoiceRequest, pub audio_config: GcpAudioConfigRequest, } impl GcpConfig { pub fn new( token: &str, voice: GcpVoiceRequest, audio_config: GcpAudioConfigRequest, ) -> GcpConfig { Self { access_token: token.to_string(), voice, audio_config, } } } enum_product! { pub enum LanguageCode { [ "ar-XA", "bn-IN", "yue-HK", "cs-CZ", "da-DK", "nl-NL", "en-AU", "en-IN", "en-GB", "en-US", "fil-PH", "fi-FI", "fr-CA", "fr-FR", "de-DE", "el-GR", "hi-IN", "hu-HU", "id-ID", "it-IT", "ja-JP", "kn-IN", "ko-KR", "cmn-CN", "cmn-TW", "nb-NO", "pl-PL", "pt-PT", "ru-RU", "es-ES", "tr-TR", "vi-VN" ] } } enum_product! { pub enum VoiceCode { [ "ar-XA", "bn-IN", "yue-HK", "cs-CZ", "da-DK", "nl-NL", "en-AU", "en-IN", "en-GB", "en-US", "fil-PH", "fi-FI", "fr-CA", "fr-FR", "de-DE", "el-GR", "hi-IN", "hu-HU", "id-ID", "it-IT", "ja-JP", "kn-IN", "ko-KR", "cmn-CN", "cmn-TW", "nb-NO", "pl-PL", "pt-PT", "ru-RU", "es-ES", "tr-TR", "vi-VN" ], ["-Standard-", "-Wavenet-"], ["A", "B", "C", "D", "E"] } } #[derive(Clone, Debug)] pub enum GenderCode { Male, Female, } impl std::string::ToString for GenderCode { fn to_string(&self) -> String { use GenderCode::*; match self { &Male => "MALE", &Female => "FEMALE", } .to_string() } } #[cfg(test)] mod tests { #[cfg(all(feature = "tokio_10", not(feature = "tokio_02")))] use tokio; #[cfg(all(feature = "tokio_02", not(feature = "tokio_10")))] use tokio_compat as tokio; use super::*; use yup_oauth2 as oauth; #[tokio::test] async fn test_gcp() { dotenv::dotenv().ok(); let cert_path = std::env::var("GCP_SERVICE_ACCOUNT_CREDENTIAL_FILE").unwrap(); let access_token = GcpToken::issue(cert_path).await.unwrap().show(); let voice = GcpVoiceRequest { language_code: LanguageCode::JaJP.to_string(), name: VoiceCode::JaJPWavenetA.to_string(), ssml_gender: GenderCode::Female.to_string(), }; let audio_config = GcpAudioConfigRequest { audio_encoding: "MP3".to_string(), ..Default::default() }; let config = GcpConfig::new(&access_token, voice, audio_config); let engine = GcpTts::from_config(config).unwrap(); let file = engine .save("効率的で信頼できるソフトウェアを誰もがつくれる言語") .await .unwrap(); println!("{:?}", file); } #[tokio::test] async fn test_oauth() { dotenv::dotenv().ok(); let cert_path = std::env::var("GCP_SERVICE_ACCOUNT_CREDENTIAL_FILE").unwrap(); let key = oauth::read_service_account_key(cert_path).await.unwrap(); let authenticator = oauth::ServiceAccountAuthenticator::builder(key) .build() .await .unwrap(); let token = authenticator .token(&["https://www.googleapis.com/auth/cloud-platform"]) .await .unwrap(); println!("{:?}", token); } }
use crate::solver::evolution::*; use crate::solver::hyper::HyperHeuristic; use crate::solver::{RefinementContext, Telemetry}; use crate::utils::Timer; /// A simple evolution algorithm which maintains single population. pub struct RunSimple {} impl Default for RunSimple { fn default() -> Self { Self {} } } impl EvolutionStrategy for RunSimple { fn run( &self, refinement_ctx: RefinementContext, hyper: Box<dyn HyperHeuristic + Send + Sync>, termination: &(dyn Termination + Send + Sync), telemetry: Telemetry, ) -> EvolutionResult { let mut refinement_ctx = refinement_ctx; let mut hyper = hyper; let mut telemetry = telemetry; while !should_stop(&mut refinement_ctx, termination) { let generation_time = Timer::start(); let parents = refinement_ctx.population.select().collect(); let offspring = hyper.search(&refinement_ctx, parents); let is_improved = if should_add_solution(&refinement_ctx) { refinement_ctx.population.add_all(offspring) } else { false }; on_generation(&mut refinement_ctx, &mut telemetry, termination, generation_time, is_improved); } telemetry.on_result(&refinement_ctx); Ok((refinement_ctx.population, telemetry.get_metrics())) } }
extern crate minictrl; use std::env; use sqlx::postgres::PgPoolOptions; use minictrl::database::run_migrations; use minictrl::web::webserver_start; #[async_std::main] async fn main() -> anyhow::Result<()> { // Setup logging tracing_subscriber::fmt() // Configure formatting settings. .with_target(false) .with_timer(tracing_subscriber::fmt::time::time()) .with_level(true) // Set the collector as the default. .init(); // Establish database connection pool let pool = PgPoolOptions::new() .max_connections(5) .connect(env::var("DATABASE_URL")?.as_str()) .await?; run_migrations(&pool).await?; webserver_start(pool).await }
use crate::common::did::DidValue; use crate::ledger::constants; use crate::ledger::requests::nym::role_to_code; use crate::tests::utils::crypto::Identity; use crate::tests::utils::helpers; use crate::tests::utils::pool::*; const ALIAS: &str = "alias"; const ROLE: &str = "TRUSTEE"; #[cfg(test)] mod builder { use super::*; use crate::tests::utils::constants::{ MY1_DID, MY1_DID_FQ, MY1_VERKEY, TRUSTEE_DID, TRUSTEE_DID_FQ, }; mod nym { use super::*; #[test] fn test_pool_build_nym_request() { let pool = TestPool::new(); let nym_request = pool .request_builder() .build_nym_request( &DidValue(String::from(TRUSTEE_DID)), &DidValue(String::from(MY1_DID)), None, None, None, ) .unwrap(); let expected_result = json!({ "type": constants::NYM, "dest": MY1_DID, }); helpers::check_request_operation(&nym_request, expected_result); } #[test] fn test_pool_build_nym_request_for_optional_fields() { let pool = TestPool::new(); let nym_request = pool .request_builder() .build_nym_request( &DidValue(String::from(TRUSTEE_DID)), &DidValue(String::from(MY1_DID)), Some(MY1_VERKEY.to_string()), Some(ALIAS.to_string()), Some(ROLE.to_string()), ) .unwrap(); let expected_result = json!({ "type": constants::NYM, "dest": MY1_DID, "verkey": MY1_VERKEY, "alias": ALIAS, "role": role_to_code(Some(String::from(ROLE))).unwrap(), }); helpers::check_request_operation(&nym_request, expected_result); } #[test] fn test_pool_build_nym_request_for_empty_role() { let pool = TestPool::new(); let nym_request = pool .request_builder() .build_nym_request( &DidValue(String::from(TRUSTEE_DID)), &DidValue(String::from(MY1_DID)), None, None, Some(String::from("")), ) .unwrap(); let expected_result = json!({ "type": constants::NYM, "dest": MY1_DID, "role": serde_json::Value::Null, }); helpers::check_request_operation(&nym_request, expected_result); } #[test] fn test_pool_build_nym_request_for_fully_qualified_dids() { let pool = TestPool::new(); let nym_request = pool .request_builder() .build_nym_request( &DidValue(String::from(TRUSTEE_DID_FQ)), &DidValue(String::from(MY1_DID_FQ)), None, None, None, ) .unwrap(); let expected_result = json!({ "type": constants::NYM, "dest": MY1_DID, }); helpers::check_request_operation(&nym_request, expected_result); } #[test] fn test_build_nym_request_works_for_invalid_role() { let pool = TestPool::new(); let trustee = Identity::trustee(); let new_identity = Identity::new(None); let role = "INALID_ROLE_ALIAS"; let _err = pool .request_builder() .build_nym_request( &trustee.did, &new_identity.did, Some(new_identity.verkey.to_string()), None, Some(role.to_string()), ) .unwrap_err(); } } mod get_nym { use super::*; #[test] fn test_pool_build_get_nym_request() { let pool = TestPool::new(); let nym_request = pool .request_builder() .build_get_nym_request( Some(&DidValue(String::from(TRUSTEE_DID))), &DidValue(String::from(MY1_DID)), ) .unwrap(); let expected_result = json!({ "type": constants::GET_NYM, "dest": MY1_DID, }); helpers::check_request_operation(&nym_request, expected_result); } #[test] fn test_pool_build_get_nym_request_for_qualified_dids() { let pool = TestPool::new(); let nym_request = pool .request_builder() .build_get_nym_request( Some(&DidValue(String::from(TRUSTEE_DID_FQ))), &DidValue(String::from(MY1_DID_FQ)), ) .unwrap(); let expected_result = json!({ "type": constants::GET_NYM, "dest": MY1_DID, }); helpers::check_request_operation(&nym_request, expected_result); } } } #[cfg(test)] mod send_nym { use super::*; use crate::ledger::constants::ROLE_REMOVE; #[test] fn test_pool_send_nym_request() { let pool = TestPool::new(); let trustee = Identity::trustee(); let new_identity = Identity::new(None); // Send NYM let mut nym_request = pool .request_builder() .build_nym_request( &trustee.did, &new_identity.did, Some(new_identity.verkey.to_string()), None, None, ) .unwrap(); trustee.sign_request(&mut nym_request); let nym_response = pool.send_request(&nym_request).unwrap(); // Get NYM let get_nym_request = pool .request_builder() .build_get_nym_request(None, &new_identity.did) .unwrap(); let response = pool .send_request_with_retries(&get_nym_request, &nym_response) .unwrap(); let expected_data = json!({ "dest": &new_identity.did, "verkey": &new_identity.verkey, "role": serde_json::Value::Null }); assert_eq!(expected_data, parse_get_nym_response(&response)); } #[test] fn test_pool_send_nym_request_for_optional_fields() { let pool = TestPool::new(); let trustee = Identity::trustee(); let new_identity = Identity::new(None); // Send NYM let mut nym_request = pool .request_builder() .build_nym_request( &trustee.did, &new_identity.did, Some(new_identity.verkey.to_string()), Some(ALIAS.to_string()), Some(ROLE.to_string()), ) .unwrap(); trustee.sign_request(&mut nym_request); let nym_response = pool.send_request(&nym_request).unwrap(); // Get NYM let get_nym_request = pool .request_builder() .build_get_nym_request(None, &new_identity.did) .unwrap(); let response = pool .send_request_with_retries(&get_nym_request, &nym_response) .unwrap(); let expected_data = json!({ "dest": &new_identity.did, "verkey": &new_identity.verkey, "role": role_to_code(Some(String::from(ROLE))).unwrap(), }); assert_eq!(expected_data, parse_get_nym_response(&response)); } #[test] fn test_pool_send_nym_request_for_different_roles() { let pool = TestPool::new(); let trustee = Identity::trustee(); for role in [ "STEWARD", "TRUSTEE", "TRUST_ANCHOR", "ENDORSER", "NETWORK_MONITOR", ] .iter() { let new_identity = Identity::new(None); // Send NYM let mut nym_request = pool .request_builder() .build_nym_request( &trustee.did, &new_identity.did, Some(new_identity.verkey.to_string()), None, Some(role.to_string()), ) .unwrap(); trustee.sign_request(&mut nym_request); let nym_response = pool.send_request(&nym_request).unwrap(); // Get NYM let get_nym_request = pool .request_builder() .build_get_nym_request(None, &new_identity.did) .unwrap(); let response = pool .send_request_with_retries(&get_nym_request, &nym_response) .unwrap(); let expected_data = json!({ "dest": &new_identity.did, "verkey": &new_identity.verkey, "role": role_to_code(Some(role.to_string())).unwrap(), }); assert_eq!(expected_data, parse_get_nym_response(&response)); } } #[test] fn test_pool_send_nym_request_for_resetting_role() { let pool = TestPool::new(); let trustee = Identity::trustee(); let new_identity = Identity::new(None); // Send NYM with TRUSTEE role let mut nym_request = pool .request_builder() .build_nym_request( &trustee.did, &new_identity.did, Some(new_identity.verkey.to_string()), None, Some(ROLE.to_string()), ) .unwrap(); trustee.sign_request(&mut nym_request); let nym_response = pool.send_request(&nym_request).unwrap(); // Get NYM to ensure role is TRUSTEE let get_nym_request = pool .request_builder() .build_get_nym_request(None, &new_identity.did) .unwrap(); let response = pool .send_request_with_retries(&get_nym_request, &nym_response) .unwrap(); let expected_data = json!({ "dest": &new_identity.did, "verkey": &new_identity.verkey, "role": role_to_code(Some(String::from(ROLE))).unwrap(), }); assert_eq!(expected_data, parse_get_nym_response(&response)); // Send NYM with empty role to reset current let mut nym_request = pool .request_builder() .build_nym_request( &trustee.did, &new_identity.did, None, None, Some(ROLE_REMOVE.to_string()), ) .unwrap(); trustee.sign_request(&mut nym_request); let nym_response = pool.send_request(&nym_request).unwrap(); // Get NYM to ensure role was reset let get_nym_request = pool .request_builder() .build_get_nym_request(None, &new_identity.did) .unwrap(); let response = pool .send_request_with_retries(&get_nym_request, &nym_response) .unwrap(); let expected_data = json!({ "dest": &new_identity.did, "verkey": &new_identity.verkey, "role": serde_json::Value::Null, }); assert_eq!(expected_data, parse_get_nym_response(&response)); } #[test] fn test_pool_send_nym_request_without_signature() { let pool = TestPool::new(); let trustee = Identity::trustee(); let new_identity = Identity::new(None); // Send NYM let nym_request = pool .request_builder() .build_nym_request( &trustee.did, &new_identity.did, Some(new_identity.verkey.to_string()), None, None, ) .unwrap(); let err = pool.send_request(&nym_request).unwrap_err(); helpers::check_response_type(&err, "REQNACK"); } #[test] fn test_pool_send_nym_request_for_unknown_signer() { let pool = TestPool::new(); let new_identity = Identity::new(None); // Send NYM let mut nym_request = pool .request_builder() .build_nym_request(&new_identity.did, &new_identity.did, None, None, None) .unwrap(); new_identity.sign_request(&mut nym_request); let err = pool.send_request(&nym_request).unwrap_err(); helpers::check_response_type(&err, "REQNACK"); } #[test] fn test_pool_send_get_nym_request_for_unknown_target() { let pool = TestPool::new(); let new_identity = Identity::new(None); // Get NYM let get_nym_request = pool .request_builder() .build_get_nym_request(None, &new_identity.did) .unwrap(); let response = pool.send_request(&get_nym_request).unwrap(); helpers::get_response_data(&response).unwrap_err(); } fn parse_get_nym_response(response: &str) -> serde_json::Value { let data = helpers::get_response_data(response).unwrap(); let data: serde_json::Value = serde_json::from_str(&data.as_str().unwrap()).unwrap(); json!({ "dest": data["dest"], "verkey": data["verkey"], "role": data["role"], }) } }
use regex::Regex; use std::result::Result; pub enum LineType { NewGuard, FallAsleep, WakeUp, } pub fn get_line_data(line: &str) -> Result<(usize, LineType), String> { if let Some(id) = get_guard_id(line) { return Ok((id, LineType::NewGuard)); } if let Some(min) = get_fall_asleep_minute(line) { return Ok((min, LineType::FallAsleep)); } if let Some(min) = get_wake_up_minute(line) { return Ok((min, LineType::WakeUp)); } Err("Unable to parse line".to_owned()) } const DATE_SECTION: &'static str = r"^\[(?P<date>\d{4}-\d{2}-\d{2}) (?P<hour>\d{2}):(?P<minute>\d{2})\]"; fn get_guard_id(line: &str) -> Option<usize> { lazy_static! { static ref PARSE_EXPR: Regex = Regex::new(&(DATE_SECTION.clone().to_owned() + r" Guard #(?P<id>\d+) begins shift$")) .unwrap(); } PARSE_EXPR.captures(line).map(|caps| caps["id"].parse::<usize>().unwrap()) } fn get_fall_asleep_minute(line: &str) -> Option<usize> { lazy_static! { static ref PARSE_EXPR: Regex = Regex::new(&(DATE_SECTION.clone().to_owned() + r" falls asleep$")).unwrap(); } PARSE_EXPR.captures(line).map(|caps| caps["minute"].parse::<usize>().unwrap()) } fn get_wake_up_minute(line: &str) -> Option<usize> { lazy_static! { static ref PARSE_EXPR: Regex = Regex::new(&(DATE_SECTION.clone().to_owned() + r" wakes up$")).unwrap(); } PARSE_EXPR.captures(line).map(|caps| caps["minute"].parse::<usize>().unwrap()) } #[cfg(test)] mod get_guard_id_tests { use super::get_guard_id; #[test] fn has_guard_id() { assert_eq!( get_guard_id("[1518-11-01 00:00] Guard #10 begins shift"), Some(10) ); } #[test] fn no_guard_id() { assert_eq!(get_guard_id("[1518-11-01 00:05] falls asleep"), None); assert_eq!(get_guard_id("[1518-11-01 00:25] wakes up"), None); } } #[cfg(test)] mod get_fall_asleep_minute_tests { use super::get_fall_asleep_minute; #[test] fn has_fall_asleep_minute() { assert_eq!( get_fall_asleep_minute("[1518-11-01 00:05] falls asleep"), Some(5) ); } #[test] fn no_fall_asleep_minute() { assert_eq!( get_fall_asleep_minute("[1518-11-01 00:00] Guard #10 begins shift"), None ); assert_eq!(get_fall_asleep_minute("[1518-11-01 00:25] wakes up"), None); } } #[cfg(test)] mod get_wake_up_minute_tests { use super::get_wake_up_minute; #[test] fn has_fall_asleep_minute() { assert_eq!(get_wake_up_minute("[1518-11-01 00:25] wakes up"), Some(25)); } #[test] fn no_fall_asleep_minute() { assert_eq!( get_wake_up_minute("[1518-11-01 00:00] Guard #10 begins shift"), None ); assert_eq!(get_wake_up_minute("[1518-11-01 00:05] falls asleep"), None); } }
pub mod open_dialog; pub mod save_dialog; pub use self::open_dialog::OpenDialog; pub use self::save_dialog::SaveDialog;
use rustlearn::base_language_demo::{function, tuple_array}; #[macro_use] extern crate rustlearn; fn main() { let value = fmt!(100); println!("{}", value); tuple_array::tuple(); tuple_array::array(); let func_result = function::func_mult_return(100, 200); println!("func result value 1: {}", func_result.0); println!("func result value 2: {}", func_result.1); function::for_func(); }
pub fn parse(tokens: Scanner) { for token in &tokens { println!("Got token {:?}.", token); } }
pub fn firstn(s: &str, n: usize) -> &str { let idx = s .char_indices() .nth(n) .map(|(i, _)| i) .unwrap_or(s.len()); return &s[..idx]; } pub fn lastn(s: &str, n: usize) -> &str { let mut new_n = 0; let mut d = 0; // default // hacky? if n == 0 { return ""; } if n > s.len() { return s; } // if n > 0 { new_n = n - 1; } if s.len() > 0 { d = s.len() - 1; } let idx = s .char_indices() .rev() .nth(new_n) .map(|(i, _)| i) .unwrap_or(d); return &s[idx..]; } pub fn slice(s: &str, start: usize, end: usize) -> &str { let mut start_byte = s.len(); let mut end_byte = s.len(); if end < start { return ""; } for (i, (byte_idx, _)) in s.char_indices().enumerate() { if i == start { start_byte = byte_idx; } if i == end { end_byte = byte_idx; break; } } return unsafe { s.get_unchecked(start_byte..end_byte) }; } #[cfg(test)] mod tests { use crate::{firstn, lastn, slice}; #[test] fn it_works() { assert_eq!(2 + 2, 4); } #[test] fn test_nth() { assert_eq!("", firstn("test", 0)); assert_eq!("t", firstn("test", 1)); assert_eq!("te", firstn("test", 2)); assert_eq!("tes", firstn("test", 3)); assert_eq!("test", firstn("test", 4)); assert_eq!("test", firstn("test", 10)); assert_eq!("Hello", firstn("Hello, World!", 5)); assert_eq!("", firstn("", 0)); assert_eq!("", firstn("", 1)); assert_eq!("", firstn("", 5)); } #[test] fn test_last() { assert_eq!("", lastn("test", 0)); assert_eq!("t", lastn("test", 1)); assert_eq!("st", lastn("test", 2)); assert_eq!("est", lastn("test", 3)); assert_eq!("test", lastn("test", 4)); assert_eq!("test", lastn("test", 10)); assert_eq!("World!", lastn("Hello, World!", 6)); assert_eq!("", lastn("", 0)); assert_eq!("", lastn("", 1)); assert_eq!("", lastn("", 11)); } #[test] fn test_slice() { assert_eq!("", slice("test", 0, 0)); assert_eq!("", slice("test", 3, 3)); assert_eq!("t", slice("test", 0, 1)); assert_eq!("es", slice("test", 1, 3)); assert_eq!("st", slice("test", 2, 10)); assert_eq!("", slice("test", 10, 15)); assert_eq!("", slice("", 0, 5)); assert_eq!("", slice("test", 3, 1)); } }
use std::io::{Read, Write, Error, ErrorKind}; pub fn read_varint_u64<T: Read>(r: &mut T) -> Result<u64, Error> { let mut buf = [0u8; 1]; let mut value = 0; for i in 0..10 { try!(r.read_exact(&mut buf[..])); value |= ((buf[0] & 0b01111111) as u64) << (i * 7); if buf[0] & 0b10000000 == 0 { break; } else if i == 9 { return Err(Error::new(ErrorKind::InvalidData, "varint overflow")); } } Ok(value) } pub fn write_varint_u64<T: Write>(w: &mut T, value: u64) -> Result<(), Error> { let mut value = value; let mut buf = [0; 1]; while value >= 0b10000000 { buf[0] = (value | 0b10000000) as u8; try!(w.write_all(&buf[..])); value = value >> 7; } buf[0] = (value & 0b01111111) as u8; try!(w.write_all(&buf[..])); Ok(()) } #[cfg(test)] mod tests { use super::*; use std::io::Cursor; use std::{u8, u32, u64}; #[test] fn test_write_read_varint_u64() { let mut buf = Cursor::new(Vec::new()); assert!(write_varint_u64(&mut buf, 0).is_ok()); assert!(write_varint_u64(&mut buf, 1).is_ok()); assert!(write_varint_u64(&mut buf, 17).is_ok()); assert!(write_varint_u64(&mut buf, 126).is_ok()); assert!(write_varint_u64(&mut buf, 127).is_ok()); assert!(write_varint_u64(&mut buf, u8::MAX as u64).is_ok()); assert!(write_varint_u64(&mut buf, (u8::MAX as u64) + 1).is_ok()); assert!(write_varint_u64(&mut buf, 1024).is_ok()); assert!(write_varint_u64(&mut buf, u32::MAX as u64).is_ok()); assert!(write_varint_u64(&mut buf, (u32::MAX as u64) + 1).is_ok()); assert!(write_varint_u64(&mut buf, u64::MAX).is_ok()); assert!(write_varint_u64(&mut buf, 0).is_ok()); buf.set_position(0); assert_eq!(read_varint_u64(&mut buf).unwrap(), 0); assert_eq!(read_varint_u64(&mut buf).unwrap(), 1); assert_eq!(read_varint_u64(&mut buf).unwrap(), 17); assert_eq!(read_varint_u64(&mut buf).unwrap(), 126); assert_eq!(read_varint_u64(&mut buf).unwrap(), 127); assert_eq!(read_varint_u64(&mut buf).unwrap(), u8::MAX as u64); assert_eq!(read_varint_u64(&mut buf).unwrap(), (u8::MAX as u64) + 1); assert_eq!(read_varint_u64(&mut buf).unwrap(), 1024); assert_eq!(read_varint_u64(&mut buf).unwrap(), u32::MAX as u64); assert_eq!(read_varint_u64(&mut buf).unwrap(), (u32::MAX as u64) + 1); assert_eq!(read_varint_u64(&mut buf).unwrap(), u64::MAX); assert_eq!(read_varint_u64(&mut buf).unwrap(), 0); } #[test] fn test_detects_overflow() { let mut buf = Cursor::new(vec![0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF]); assert!(read_varint_u64(&mut buf).is_err()); } }
fn check_question(message: &str) -> bool { message.trim().ends_with("?") } fn check_silence(message: &str) -> bool { message.trim().is_empty() } fn check_yell(message: &str) -> bool { message.chars().any(char::is_alphabetic) && !message.chars().any(char::is_lowercase) } pub fn reply(message: &str) -> &str { match ( check_question(message), check_yell(message), check_silence(message), ) { (_, _, true) => return "Fine. Be that way!", (true, true, _) => return "Calm down, I know what I'm doing!", (true, false, _) => return "Sure.", (false, true, _) => return "Whoa, chill out!", (_, _, _) => return "Whatever.", } }
use wasm_bindgen::prelude::*; #[wasm_bindgen] pub fn bubble_sort(data: Vec<i32>)-> Vec <i32> { let mut copy = data.to_vec(); let mut temp: i32; for i in 0.. copy.len() { for j in 0.. copy.len(){ if copy[j] > copy[i] { temp = copy[j]; copy[j] = copy[i]; copy[i] = temp; } } } return copy; } #[wasm_bindgen] pub fn bubble_sort_no_ret(data: Vec<i32>){ let mut copy = data.to_vec(); let mut temp: i32; for i in 0.. copy.len() { for j in 0.. copy.len(){ if copy[j] > copy[i] { temp = copy[j]; copy[j] = copy[i]; copy[i] = temp; } } } }
#[doc = "Register `RCC_MP_APB2LPENCLRR` reader"] pub type R = crate::R<RCC_MP_APB2LPENCLRR_SPEC>; #[doc = "Register `RCC_MP_APB2LPENCLRR` writer"] pub type W = crate::W<RCC_MP_APB2LPENCLRR_SPEC>; #[doc = "Field `TIM1LPEN` reader - TIM1LPEN"] pub type TIM1LPEN_R = crate::BitReader; #[doc = "Field `TIM1LPEN` writer - TIM1LPEN"] pub type TIM1LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `TIM8LPEN` reader - TIM8LPEN"] pub type TIM8LPEN_R = crate::BitReader; #[doc = "Field `TIM8LPEN` writer - TIM8LPEN"] pub type TIM8LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `TIM15LPEN` reader - TIM15LPEN"] pub type TIM15LPEN_R = crate::BitReader; #[doc = "Field `TIM15LPEN` writer - TIM15LPEN"] pub type TIM15LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `TIM16LPEN` reader - TIM16LPEN"] pub type TIM16LPEN_R = crate::BitReader; #[doc = "Field `TIM16LPEN` writer - TIM16LPEN"] pub type TIM16LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `TIM17LPEN` reader - TIM17LPEN"] pub type TIM17LPEN_R = crate::BitReader; #[doc = "Field `TIM17LPEN` writer - TIM17LPEN"] pub type TIM17LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `SPI1LPEN` reader - SPI1LPEN"] pub type SPI1LPEN_R = crate::BitReader; #[doc = "Field `SPI1LPEN` writer - SPI1LPEN"] pub type SPI1LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `SPI4LPEN` reader - SPI4LPEN"] pub type SPI4LPEN_R = crate::BitReader; #[doc = "Field `SPI4LPEN` writer - SPI4LPEN"] pub type SPI4LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `SPI5LPEN` reader - SPI5LPEN"] pub type SPI5LPEN_R = crate::BitReader; #[doc = "Field `SPI5LPEN` writer - SPI5LPEN"] pub type SPI5LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `USART6LPEN` reader - USART6LPEN"] pub type USART6LPEN_R = crate::BitReader; #[doc = "Field `USART6LPEN` writer - USART6LPEN"] pub type USART6LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `SAI1LPEN` reader - SAI1LPEN"] pub type SAI1LPEN_R = crate::BitReader; #[doc = "Field `SAI1LPEN` writer - SAI1LPEN"] pub type SAI1LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `SAI2LPEN` reader - SAI2LPEN"] pub type SAI2LPEN_R = crate::BitReader; #[doc = "Field `SAI2LPEN` writer - SAI2LPEN"] pub type SAI2LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `SAI3LPEN` reader - SAI3LPEN"] pub type SAI3LPEN_R = crate::BitReader; #[doc = "Field `SAI3LPEN` writer - SAI3LPEN"] pub type SAI3LPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `DFSDMLPEN` reader - DFSDMLPEN"] pub type DFSDMLPEN_R = crate::BitReader; #[doc = "Field `DFSDMLPEN` writer - DFSDMLPEN"] pub type DFSDMLPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `ADFSDMLPEN` reader - ADFSDMLPEN"] pub type ADFSDMLPEN_R = crate::BitReader; #[doc = "Field `ADFSDMLPEN` writer - ADFSDMLPEN"] pub type ADFSDMLPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; #[doc = "Field `FDCANLPEN` reader - FDCANLPEN"] pub type FDCANLPEN_R = crate::BitReader; #[doc = "Field `FDCANLPEN` writer - FDCANLPEN"] pub type FDCANLPEN_W<'a, REG, const O: u8> = crate::BitWriter<'a, REG, O>; impl R { #[doc = "Bit 0 - TIM1LPEN"] #[inline(always)] pub fn tim1lpen(&self) -> TIM1LPEN_R { TIM1LPEN_R::new((self.bits & 1) != 0) } #[doc = "Bit 1 - TIM8LPEN"] #[inline(always)] pub fn tim8lpen(&self) -> TIM8LPEN_R { TIM8LPEN_R::new(((self.bits >> 1) & 1) != 0) } #[doc = "Bit 2 - TIM15LPEN"] #[inline(always)] pub fn tim15lpen(&self) -> TIM15LPEN_R { TIM15LPEN_R::new(((self.bits >> 2) & 1) != 0) } #[doc = "Bit 3 - TIM16LPEN"] #[inline(always)] pub fn tim16lpen(&self) -> TIM16LPEN_R { TIM16LPEN_R::new(((self.bits >> 3) & 1) != 0) } #[doc = "Bit 4 - TIM17LPEN"] #[inline(always)] pub fn tim17lpen(&self) -> TIM17LPEN_R { TIM17LPEN_R::new(((self.bits >> 4) & 1) != 0) } #[doc = "Bit 8 - SPI1LPEN"] #[inline(always)] pub fn spi1lpen(&self) -> SPI1LPEN_R { SPI1LPEN_R::new(((self.bits >> 8) & 1) != 0) } #[doc = "Bit 9 - SPI4LPEN"] #[inline(always)] pub fn spi4lpen(&self) -> SPI4LPEN_R { SPI4LPEN_R::new(((self.bits >> 9) & 1) != 0) } #[doc = "Bit 10 - SPI5LPEN"] #[inline(always)] pub fn spi5lpen(&self) -> SPI5LPEN_R { SPI5LPEN_R::new(((self.bits >> 10) & 1) != 0) } #[doc = "Bit 13 - USART6LPEN"] #[inline(always)] pub fn usart6lpen(&self) -> USART6LPEN_R { USART6LPEN_R::new(((self.bits >> 13) & 1) != 0) } #[doc = "Bit 16 - SAI1LPEN"] #[inline(always)] pub fn sai1lpen(&self) -> SAI1LPEN_R { SAI1LPEN_R::new(((self.bits >> 16) & 1) != 0) } #[doc = "Bit 17 - SAI2LPEN"] #[inline(always)] pub fn sai2lpen(&self) -> SAI2LPEN_R { SAI2LPEN_R::new(((self.bits >> 17) & 1) != 0) } #[doc = "Bit 18 - SAI3LPEN"] #[inline(always)] pub fn sai3lpen(&self) -> SAI3LPEN_R { SAI3LPEN_R::new(((self.bits >> 18) & 1) != 0) } #[doc = "Bit 20 - DFSDMLPEN"] #[inline(always)] pub fn dfsdmlpen(&self) -> DFSDMLPEN_R { DFSDMLPEN_R::new(((self.bits >> 20) & 1) != 0) } #[doc = "Bit 21 - ADFSDMLPEN"] #[inline(always)] pub fn adfsdmlpen(&self) -> ADFSDMLPEN_R { ADFSDMLPEN_R::new(((self.bits >> 21) & 1) != 0) } #[doc = "Bit 24 - FDCANLPEN"] #[inline(always)] pub fn fdcanlpen(&self) -> FDCANLPEN_R { FDCANLPEN_R::new(((self.bits >> 24) & 1) != 0) } } impl W { #[doc = "Bit 0 - TIM1LPEN"] #[inline(always)] #[must_use] pub fn tim1lpen(&mut self) -> TIM1LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 0> { TIM1LPEN_W::new(self) } #[doc = "Bit 1 - TIM8LPEN"] #[inline(always)] #[must_use] pub fn tim8lpen(&mut self) -> TIM8LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 1> { TIM8LPEN_W::new(self) } #[doc = "Bit 2 - TIM15LPEN"] #[inline(always)] #[must_use] pub fn tim15lpen(&mut self) -> TIM15LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 2> { TIM15LPEN_W::new(self) } #[doc = "Bit 3 - TIM16LPEN"] #[inline(always)] #[must_use] pub fn tim16lpen(&mut self) -> TIM16LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 3> { TIM16LPEN_W::new(self) } #[doc = "Bit 4 - TIM17LPEN"] #[inline(always)] #[must_use] pub fn tim17lpen(&mut self) -> TIM17LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 4> { TIM17LPEN_W::new(self) } #[doc = "Bit 8 - SPI1LPEN"] #[inline(always)] #[must_use] pub fn spi1lpen(&mut self) -> SPI1LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 8> { SPI1LPEN_W::new(self) } #[doc = "Bit 9 - SPI4LPEN"] #[inline(always)] #[must_use] pub fn spi4lpen(&mut self) -> SPI4LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 9> { SPI4LPEN_W::new(self) } #[doc = "Bit 10 - SPI5LPEN"] #[inline(always)] #[must_use] pub fn spi5lpen(&mut self) -> SPI5LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 10> { SPI5LPEN_W::new(self) } #[doc = "Bit 13 - USART6LPEN"] #[inline(always)] #[must_use] pub fn usart6lpen(&mut self) -> USART6LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 13> { USART6LPEN_W::new(self) } #[doc = "Bit 16 - SAI1LPEN"] #[inline(always)] #[must_use] pub fn sai1lpen(&mut self) -> SAI1LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 16> { SAI1LPEN_W::new(self) } #[doc = "Bit 17 - SAI2LPEN"] #[inline(always)] #[must_use] pub fn sai2lpen(&mut self) -> SAI2LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 17> { SAI2LPEN_W::new(self) } #[doc = "Bit 18 - SAI3LPEN"] #[inline(always)] #[must_use] pub fn sai3lpen(&mut self) -> SAI3LPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 18> { SAI3LPEN_W::new(self) } #[doc = "Bit 20 - DFSDMLPEN"] #[inline(always)] #[must_use] pub fn dfsdmlpen(&mut self) -> DFSDMLPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 20> { DFSDMLPEN_W::new(self) } #[doc = "Bit 21 - ADFSDMLPEN"] #[inline(always)] #[must_use] pub fn adfsdmlpen(&mut self) -> ADFSDMLPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 21> { ADFSDMLPEN_W::new(self) } #[doc = "Bit 24 - FDCANLPEN"] #[inline(always)] #[must_use] pub fn fdcanlpen(&mut self) -> FDCANLPEN_W<RCC_MP_APB2LPENCLRR_SPEC, 24> { FDCANLPEN_W::new(self) } #[doc = "Writes raw bits to the register."] #[inline(always)] pub unsafe fn bits(&mut self, bits: u32) -> &mut Self { self.bits = bits; self } } #[doc = "This register is used by the MCU in order to clear the PERxLPEN bits\n\nYou can [`read`](crate::generic::Reg::read) this register and get [`rcc_mp_apb2lpenclrr::R`](R). You can [`reset`](crate::generic::Reg::reset), [`write`](crate::generic::Reg::write), [`write_with_zero`](crate::generic::Reg::write_with_zero) this register using [`rcc_mp_apb2lpenclrr::W`](W). You can also [`modify`](crate::generic::Reg::modify) this register. See [API](https://docs.rs/svd2rust/#read--modify--write-api)."] pub struct RCC_MP_APB2LPENCLRR_SPEC; impl crate::RegisterSpec for RCC_MP_APB2LPENCLRR_SPEC { type Ux = u32; } #[doc = "`read()` method returns [`rcc_mp_apb2lpenclrr::R`](R) reader structure"] impl crate::Readable for RCC_MP_APB2LPENCLRR_SPEC {} #[doc = "`write(|w| ..)` method takes [`rcc_mp_apb2lpenclrr::W`](W) writer structure"] impl crate::Writable for RCC_MP_APB2LPENCLRR_SPEC { const ZERO_TO_MODIFY_FIELDS_BITMAP: Self::Ux = 0; const ONE_TO_MODIFY_FIELDS_BITMAP: Self::Ux = 0; } #[doc = "`reset()` method sets RCC_MP_APB2LPENCLRR to value 0x0137_271f"] impl crate::Resettable for RCC_MP_APB2LPENCLRR_SPEC { const RESET_VALUE: Self::Ux = 0x0137_271f; }
// Copyright 2019, 2020 Wingchain // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. use crate::errors::ErrorKind; use crate::protocol::{ ConsensusMessage, MessageType, Node, Proposal, RequestId, RequestProposalReq, RequestProposalRes, QC, }; use crate::stream::{get_address, sign, verify, verify_qc, HotStuffStream, InternalMessage}; use futures::prelude::*; use log::{trace, warn}; use node_consensus_base::scheduler::{ScheduleInfo, Scheduler}; use node_consensus_base::support::ConsensusSupport; use node_consensus_base::PeerId; use node_executor::module::hotstuff::Authorities; use primitives::errors::CommonResult; use primitives::{codec, BuildBlockParams, FullTransaction, Transaction}; use primitives::{Address, Hash}; use rand::{thread_rng, Rng}; use std::collections::HashMap; use std::sync::Arc; use tokio::time::sleep_until; #[derive(PartialEq, Debug)] pub enum State { Leader, Replica, Observer, } pub struct LeaderState<'a, S> where S: ConsensusSupport, { stream: &'a mut HotStuffStream<S>, new_view_collector: ConsensusMessageCollector, prepare_collector: ConsensusMessageCollector, pre_commit_collector: ConsensusMessageCollector, commit_collector: ConsensusMessageCollector, work_schedule_signal: Option<ScheduleInfo>, work_new_view_signal: Option<QC>, pending_remote_proposal: Option<Hash>, prepare_message: Option<ConsensusMessage>, pre_commit_message: Option<ConsensusMessage>, commit_message: Option<ConsensusMessage>, decide_message: Option<ConsensusMessage>, } impl<'a, S> LeaderState<'a, S> where S: ConsensusSupport, { pub fn new(stream: &'a mut HotStuffStream<S>) -> Self { Self { stream, new_view_collector: ConsensusMessageCollector::new(), prepare_collector: ConsensusMessageCollector::new(), pre_commit_collector: ConsensusMessageCollector::new(), commit_collector: ConsensusMessageCollector::new(), work_schedule_signal: None, work_new_view_signal: None, pending_remote_proposal: None, prepare_message: None, pre_commit_message: None, commit_message: None, decide_message: None, } } pub async fn start(mut self) -> CommonResult<()> { let current_view = self.stream.storage.get_view(); self.process_pending_new_view()?; self.send_new_view_to_self()?; let mut scheduler = Scheduler::new(self.stream.hotstuff_meta.block_interval); loop { if self.stream.shutdown { return Ok(()); } if self.stream.storage.get_view() != current_view { return Ok(()); } let next_timeout = sleep_until(self.stream.next_timeout_instant()); tokio::select! { _ = next_timeout => { self.stream.on_timeout()?; }, Some(schedule_info) = scheduler.next() => { self.try_work(Some(schedule_info), None) .unwrap_or_else(|e| warn!("HotStuff stream handle work error: {}", e)); } Some(internal_message) = self.stream.internal_rx.next() => { match internal_message { InternalMessage::ValidatorRegistered { address, peer_id } => { self.on_validator_registered(address, peer_id) .unwrap_or_else(|e| warn!("HotStuff stream handle validator registered message error: {}", e)); }, InternalMessage::Proposal { address, proposal } => { self.on_remote_proposal(address, proposal) .unwrap_or_else(|e| warn!("HotStuff stream handle proposal message error: {}", e)); }, InternalMessage::ConsensusMessage {message, peer_id } => { self.on_consensus_message(message, peer_id) .unwrap_or_else(|e| warn!("HotStuff stream handle consensus message error: {}", e)); } } }, in_message = self.stream.in_rx.next() => { match in_message { Some(in_message) => { self.stream.on_in_message(in_message) .unwrap_or_else(|e| warn!("HotStuff stream handle in message error: {}", e)); }, // in tx has been dropped None => { self.stream.shutdown = true; }, } }, } } } fn try_work( &mut self, work_schedule_signal: Option<ScheduleInfo>, work_new_view_signal: Option<QC>, ) -> CommonResult<()> { if let Some(work_schedule_signal) = work_schedule_signal { self.work_schedule_signal = Some(work_schedule_signal); } if let Some(work_new_view_signal) = work_new_view_signal { self.work_new_view_signal = Some(work_new_view_signal); } if self.work_new_view_signal.is_some() && self.work_schedule_signal.is_some() && self.prepare_message.is_none() && self.pending_remote_proposal.is_none() { self.work()?; } Ok(()) } fn work(&mut self) -> CommonResult<()> { let high_qc = self.work_new_view_signal.clone().expect("qed"); let base_commit_qc = self.stream.storage.get_base_commit_qc(); if high_qc.node.block_hash == base_commit_qc.node.block_hash { let schedule_info = self.work_schedule_signal.clone().expect("qed"); self.create_proposal(schedule_info)?; } else if high_qc.node.parent_hash == base_commit_qc.node.block_hash { self.reuse_proposal(&high_qc)?; } Ok(()) } fn create_proposal(&mut self, schedule_info: ScheduleInfo) -> CommonResult<()> { trace!("Create proposal: {:?}", schedule_info); let build_block_params = self.stream.support.prepare_block(schedule_info)?; let mut proposal = Proposal { parent_hash: Hash(vec![]), block_hash: Hash(vec![]), number: build_block_params.number, timestamp: build_block_params.timestamp, meta_txs: build_block_params .meta_txs .iter() .map(|x| x.tx.clone()) .collect(), payload_txs: build_block_params .payload_txs .iter() .map(|x| x.tx.clone()) .collect(), execution_number: build_block_params.execution_number, }; let commit_block_params = self.stream.support.build_block(build_block_params)?; proposal.parent_hash = commit_block_params.header.parent_hash.clone(); proposal.block_hash = commit_block_params.block_hash.clone(); self.stream.commit_block_params = Some(commit_block_params); self.stream.storage.put_proposal(proposal.clone())?; self.on_proposal(proposal)?; Ok(()) } fn reuse_proposal(&mut self, high_qc: &QC) -> CommonResult<()> { trace!("Reuse proposal: {:?}", high_qc); let proposal = self.stream.storage.get_proposal(&high_qc.node.block_hash)?; match proposal { Some(proposal) => { self.on_local_proposal(proposal)?; } None => { let addresses = self.new_view_collector.get_high_qc_addresses(high_qc); let remote_addresses = addresses .iter() .filter(|x| *x != &self.stream.address) .collect::<Vec<_>>(); let rand = thread_rng().gen_range(0, remote_addresses.len()); let target_address = remote_addresses[rand]; trace!("Request proposal from remote: {}", target_address); let req = RequestProposalReq { request_id: RequestId(0), block_hash: high_qc.node.block_hash.clone(), }; self.stream.request_proposal(target_address.clone(), req)?; self.pending_remote_proposal = Some(high_qc.node.block_hash.clone()); } } Ok(()) } fn on_remote_proposal(&mut self, _address: Address, proposal: Proposal) -> CommonResult<()> { if let Some(pending_remote_proposal) = self.pending_remote_proposal.take() { if pending_remote_proposal != proposal.block_hash { self.pending_remote_proposal = Some(pending_remote_proposal); return Ok(()); } self.on_local_proposal(proposal)?; } Ok(()) } fn on_local_proposal(&mut self, proposal: Proposal) -> CommonResult<()> { // prepare commit_block_params if needed if self .stream .commit_block_params .as_ref() .map(|x| &x.block_hash) != Some(&proposal.block_hash) { let get_txs = |txs: &Vec<Transaction>| -> CommonResult<Vec<Arc<FullTransaction>>> { let mut result = Vec::with_capacity(txs.len()); for tx in txs { let tx_hash = self.stream.support.hash_transaction(&tx)?; let tx = Arc::new(FullTransaction { tx_hash, tx: tx.clone(), }); result.push(tx); } Ok(result) }; let build_block_params = BuildBlockParams { number: proposal.number, timestamp: proposal.timestamp, meta_txs: get_txs(&proposal.meta_txs)?, payload_txs: get_txs(&proposal.payload_txs)?, execution_number: proposal.execution_number, }; let commit_block_params = self.stream.support.build_block(build_block_params)?; self.stream.commit_block_params = Some(commit_block_params); } self.on_proposal(proposal)?; Ok(()) } fn on_validator_registered(&mut self, address: Address, peer_id: PeerId) -> CommonResult<()> { if let Some(messages) = self.stream.pending_consensus_messages.remove(&peer_id) { for message in messages { self.on_validator_consensus_message(message, address.clone())?; } } Ok(()) } fn on_consensus_message( &mut self, message: ConsensusMessage, peer_id: PeerId, ) -> CommonResult<()> { if let Some(address) = self.stream.get_peer_address(&peer_id) { if self .stream .authorities .members .iter() .any(|(addr, _)| addr == &address) { self.on_validator_consensus_message(message, address)?; } } else { let messages = self .stream .pending_consensus_messages .entry(peer_id) .or_insert_with(Vec::new); messages.push(message); } Ok(()) } fn on_validator_consensus_message( &mut self, message: ConsensusMessage, address: Address, ) -> CommonResult<()> { if message.view != self.stream.storage.get_view() { return Ok(()); } match &message.message_type { MessageType::NewView => self.on_new_view(message, address)?, MessageType::Prepare => self.on_prepare(message, address)?, MessageType::PreCommit => self.on_pre_commit(message, address)?, MessageType::Commit => self.on_commit(message, address)?, _ => {} } Ok(()) } fn on_new_view(&mut self, message: ConsensusMessage, address: Address) -> CommonResult<()> { let justify = match &message.justify { Some(justify) => justify, None => return Ok(()), }; let authorities = if justify.view == self.stream.storage.get_base_commit_qc().view { &self.stream.last_authorities } else { &self.stream.authorities }; match verify_qc(&justify, None, &authorities, &self.stream.support) { Err(e) => { println!( "on_new_view verify qc failed: {}, view: {}, base_commit_qc_view: {}", e, justify.view, self.stream.storage.get_base_commit_qc().view ); return Ok(()); } _ => {} } self.new_view_collector.add(address, message); let mut high_qc = self .new_view_collector .get_high_qc(&self.stream.authorities); if let Some(high_qc) = high_qc.take() { if self.work_new_view_signal.is_none() { trace!("New view collected high qc: {:?}", high_qc); self.try_work(None, Some(high_qc))?; } } Ok(()) } fn on_proposal(&mut self, proposal: Proposal) -> CommonResult<()> { trace!( "Proposal: number: {}, execution_number: {}, block_hash: {}", proposal.number, proposal.execution_number, proposal.block_hash ); let node = Node { block_hash: proposal.block_hash.clone(), parent_hash: proposal.parent_hash.clone(), }; let high_qc = self.work_new_view_signal.clone().expect("qed"); let prepare_message = ConsensusMessage { request_id: RequestId(0), message_type: MessageType::Prepare, view: self.stream.storage.get_view(), node: Some(node), justify: Some(high_qc), sig: None, }; self.prepare_message = Some(prepare_message.clone()); self.on_prepare(prepare_message.clone(), self.stream.address.clone())?; let addresses = self .stream .authorities .members .iter() .map(|x| x.0.clone()) .collect::<Vec<_>>(); let res = RequestProposalRes { request_id: RequestId(0), proposal: Some(proposal), }; for address in addresses { if address != self.stream.address { // send proposal if let Some(peer_id) = self.stream.known_validators.get(&address) { self.stream.response(peer_id.clone(), res.clone())?; } // send prepare message self.stream .consensus_message(address, prepare_message.clone())?; } } Ok(()) } fn on_prepare(&mut self, mut message: ConsensusMessage, address: Address) -> CommonResult<()> { match self.verify_message(&mut message, &address) { Err(_e) => return Ok(()), _ => {} } self.prepare_collector.add(address, message); let mut prepare_qc = self .prepare_collector .get_qc(&self.stream.authorities, self.stream.address.clone()); if let Some(prepare_qc) = prepare_qc.take() { if self.pre_commit_message.is_none() { trace!("Prepare collected qc: {:?}", prepare_qc); self.stream.storage.update_prepare_qc(prepare_qc.clone())?; let pre_commit_message = ConsensusMessage { request_id: RequestId(0), message_type: MessageType::PreCommit, view: self.stream.storage.get_view(), node: None, justify: Some(prepare_qc), sig: None, }; self.pre_commit_message = Some(pre_commit_message.clone()); self.on_pre_commit(pre_commit_message.clone(), self.stream.address.clone())?; self.broadcast_message(pre_commit_message)?; } } Ok(()) } fn on_pre_commit( &mut self, mut message: ConsensusMessage, address: Address, ) -> CommonResult<()> { match self.verify_message(&mut message, &address) { Err(_e) => return Ok(()), _ => {} } self.pre_commit_collector.add(address, message); let mut pre_commit_qc = self .pre_commit_collector .get_qc(&self.stream.authorities, self.stream.address.clone()); if let Some(pre_commit_qc) = pre_commit_qc.take() { if self.commit_message.is_none() { trace!("PreCommit collected qc: {:?}", pre_commit_qc); self.stream .storage .update_locked_qc(pre_commit_qc.clone())?; let commit_message = ConsensusMessage { request_id: RequestId(0), message_type: MessageType::Commit, view: self.stream.storage.get_view(), node: None, justify: Some(pre_commit_qc), sig: None, }; self.commit_message = Some(commit_message.clone()); self.on_commit(commit_message.clone(), self.stream.address.clone())?; self.broadcast_message(commit_message)?; } } Ok(()) } fn on_commit(&mut self, mut message: ConsensusMessage, address: Address) -> CommonResult<()> { match self.verify_message(&mut message, &address) { Err(_e) => return Ok(()), _ => {} } self.commit_collector.add(address, message); let mut commit_qc = self .commit_collector .get_qc(&self.stream.authorities, self.stream.address.clone()); if let Some(commit_qc) = commit_qc.take() { if self.decide_message.is_none() { trace!("Commit collected qc: {:?}", commit_qc); let decide_message = ConsensusMessage { request_id: RequestId(0), message_type: MessageType::Decide, view: self.stream.storage.get_view(), node: None, justify: Some(commit_qc.clone()), sig: None, }; self.decide_message = Some(decide_message.clone()); self.on_decide(commit_qc)?; self.broadcast_message(decide_message)?; } } Ok(()) } fn on_decide(&mut self, commit_qc: QC) -> CommonResult<()> { let block_hash = &commit_qc.node.block_hash; let proposal = self.stream.storage.get_proposal(block_hash)?; let proposal = match proposal { Some(proposal) => proposal, None => return Ok(()), }; let commit_block_params = match self.stream.commit_block_params.take() { Some(v) => { if v.block_hash == proposal.block_hash { v } else { return Ok(()); } } None => return Ok(()), }; self.stream.on_decide(commit_block_params, commit_qc)?; Ok(()) } fn process_pending_new_view(&mut self) -> CommonResult<()> { let messages = self .stream .pending_new_view_messages .drain(..) .collect::<Vec<_>>(); for (message, address) in messages { self.on_new_view(message, address)?; } Ok(()) } fn send_new_view_to_self(&mut self) -> CommonResult<()> { let message = ConsensusMessage { request_id: RequestId(0), message_type: MessageType::NewView, view: self.stream.storage.get_view(), node: None, justify: Some(self.stream.storage.get_prepare_qc()), sig: None, }; self.on_new_view(message, self.stream.address.clone())?; Ok(()) } fn sign_message(&self, message: &mut ConsensusMessage) -> CommonResult<()> { let leader_address = self.stream.current_leader.clone().expect("qed"); let sig_message = codec::encode(&( &message.message_type, &message.view, &message.node, &leader_address, ))?; let sig = sign(&sig_message, &self.stream.secret_key, &self.stream.support)?; message.sig = Some((self.stream.public_key.clone(), sig)); Ok(()) } fn verify_message( &self, message: &mut ConsensusMessage, address: &Address, ) -> CommonResult<()> { if &self.stream.address == address { message.node = self.prepare_message.as_ref().expect("qed").node.clone(); message.justify = None; self.sign_message(message)?; return Ok(()); } // verify sig let (public_key, signature) = match message.sig { Some(ref sig) => sig, None => return Err(ErrorKind::MessageError("Missing sig".to_string()).into()), }; let expected_address = get_address(&public_key, &self.stream.support)?; if &expected_address != address { return Err(ErrorKind::MessageError("Unexpected address".to_string()).into()); } let sig_message = codec::encode(&( &message.message_type, &message.view, &message.node, &self.stream.address, ))?; verify(&sig_message, &public_key, &signature, &self.stream.support)?; // verify node if message.node != self.prepare_message.as_ref().expect("qed").node { return Err(ErrorKind::MessageError("Unexpected node".to_string()).into()); } Ok(()) } fn broadcast_message(&mut self, message: ConsensusMessage) -> CommonResult<()> { let addresses = self .stream .authorities .members .iter() .map(|x| x.0.clone()) .collect::<Vec<_>>(); for address in addresses { if address != self.stream.address { self.stream.consensus_message(address, message.clone())?; } } Ok(()) } } pub struct ReplicaState<'a, S> where S: ConsensusSupport, { stream: &'a mut HotStuffStream<S>, } impl<'a, S> ReplicaState<'a, S> where S: ConsensusSupport, { pub fn new(stream: &'a mut HotStuffStream<S>) -> Self { Self { stream } } pub async fn start(mut self) -> CommonResult<()> { let current_view = self.stream.storage.get_view(); self.send_new_view()?; loop { if self.stream.shutdown { return Ok(()); } if self.stream.storage.get_view() != current_view { return Ok(()); } let next_timeout = sleep_until(self.stream.next_timeout_instant()); tokio::select! { _ = next_timeout => { self.stream.on_timeout()?; }, Some(internal_message) = self.stream.internal_rx.next() => { match internal_message { InternalMessage::ValidatorRegistered { address, peer_id } => { self.on_validator_registered(address, peer_id) .unwrap_or_else(|e| warn!("HotStuff stream handle validator registered message error: {}", e)); }, InternalMessage::ConsensusMessage {message, peer_id } => { self.on_consensus_message(message, peer_id) .unwrap_or_else(|e| warn!("HotStuff stream handle consensus message error: {}", e)); } _ => { self.stream.on_internal_message(internal_message) .unwrap_or_else(|e| warn!("HotStuff stream handle internal message error: {}", e)); } } }, in_message = self.stream.in_rx.next() => { match in_message { Some(in_message) => { self.stream.on_in_message(in_message) .unwrap_or_else(|e| warn!("HotStuff stream handle in message error: {}", e)); }, // in tx has been dropped None => { self.stream.shutdown = true; }, } }, } } } fn on_validator_registered(&mut self, address: Address, peer_id: PeerId) -> CommonResult<()> { if self.stream.current_leader.as_ref() == Some(&address) { self.send_new_view()?; } if let Some(messages) = self.stream.pending_consensus_messages.remove(&peer_id) { for message in messages { self.on_validator_consensus_message(message, address.clone())?; } } Ok(()) } fn on_consensus_message( &mut self, message: ConsensusMessage, peer_id: PeerId, ) -> CommonResult<()> { if let Some(address) = self.stream.get_peer_address(&peer_id) { if self .stream .authorities .members .iter() .any(|(addr, _)| addr == &address) { self.on_validator_consensus_message(message, address)?; } } else { let messages = self .stream .pending_consensus_messages .entry(peer_id) .or_insert_with(Vec::new); messages.push(message); } Ok(()) } fn on_validator_consensus_message( &mut self, message: ConsensusMessage, address: Address, ) -> CommonResult<()> { if let MessageType::NewView = &message.message_type { self.on_new_view(message.clone(), address.clone())? } if message.view != self.stream.storage.get_view() { return Ok(()); } match &message.message_type { MessageType::Prepare => self.on_prepare(message, address)?, MessageType::PreCommit => self.on_pre_commit(message, address)?, MessageType::Commit => self.on_commit(message, address)?, MessageType::Decide => self.on_decide(message, address)?, _ => {} } Ok(()) } fn on_new_view(&mut self, message: ConsensusMessage, address: Address) -> CommonResult<()> { self.stream .pending_new_view_messages .push((message, address)); Ok(()) } fn on_prepare(&mut self, message: ConsensusMessage, _address: Address) -> CommonResult<()> { let justify = match message.justify { Some(justify) => justify, None => return Ok(()), }; let authorities = if justify.view == self.stream.storage.get_base_commit_qc().view { &self.stream.last_authorities } else { &self.stream.authorities }; match verify_qc(&justify, None, &authorities, &self.stream.support) { Err(_e) => return Ok(()), _ => {} } let node = match &message.node { Some(node) => node, None => return Ok(()), }; let block_hash = &node.block_hash; let proposal = self.stream.storage.get_proposal(block_hash)?; let proposal = match proposal { Some(proposal) => proposal, None => return Ok(()), }; // check safe node if node.parent_hash != proposal.parent_hash { return Ok(()); } let base_commit_qc = self.stream.storage.get_base_commit_qc(); let locked_qc = self.stream.storage.get_locked_qc(); let extend_from_justify_node = if justify.node.block_hash == base_commit_qc.node.block_hash { node.parent_hash == base_commit_qc.node.block_hash } else { node.block_hash == justify.node.block_hash }; let extend_from_locked_qc_node = if locked_qc.node.block_hash == base_commit_qc.node.block_hash { node.parent_hash == base_commit_qc.node.block_hash } else { node.block_hash == locked_qc.node.block_hash }; let higher_view = justify.view > locked_qc.view; let safe_node = extend_from_justify_node && (extend_from_locked_qc_node || higher_view); if !safe_node { warn!("Not safe node: {:?}", node); return Ok(()); } let mut vote_message = ConsensusMessage { request_id: RequestId(0), message_type: message.message_type, view: message.view, node: message.node, justify: None, sig: None, }; self.sign_message(&mut vote_message)?; let leader_address = self.stream.current_leader.clone().expect("qed"); self.stream .consensus_message(leader_address, vote_message)?; Ok(()) } fn on_pre_commit(&mut self, message: ConsensusMessage, _address: Address) -> CommonResult<()> { let justify = match message.justify { Some(justify) => justify, None => return Ok(()), }; match verify_qc( &justify, Some(MessageType::Prepare), &self.stream.authorities, &self.stream.support, ) { Err(_e) => return Ok(()), _ => {} } self.stream.storage.update_prepare_qc(justify.clone())?; let mut vote_message = ConsensusMessage { request_id: RequestId(0), message_type: message.message_type, view: message.view, node: Some(justify.node), justify: None, sig: None, }; self.sign_message(&mut vote_message)?; let leader_address = self.stream.current_leader.clone().expect("qed"); self.stream .consensus_message(leader_address, vote_message)?; Ok(()) } fn on_commit(&mut self, message: ConsensusMessage, _address: Address) -> CommonResult<()> { let justify = match message.justify { Some(justify) => justify, None => return Ok(()), }; match verify_qc( &justify, Some(MessageType::PreCommit), &self.stream.authorities, &self.stream.support, ) { Err(_e) => return Ok(()), _ => {} } self.stream.storage.update_locked_qc(justify.clone())?; let mut vote_message = ConsensusMessage { request_id: RequestId(0), message_type: message.message_type, view: message.view, node: Some(justify.node), justify: None, sig: None, }; self.sign_message(&mut vote_message)?; let leader_address = self.stream.current_leader.clone().expect("qed"); self.stream .consensus_message(leader_address, vote_message)?; Ok(()) } fn on_decide(&mut self, message: ConsensusMessage, _address: Address) -> CommonResult<()> { let justify = match message.justify { Some(justify) => justify, None => return Ok(()), }; match verify_qc( &justify, Some(MessageType::Commit), &self.stream.authorities, &self.stream.support, ) { Err(_e) => return Ok(()), _ => {} } let block_hash = &justify.node.block_hash; let proposal = self.stream.storage.get_proposal(block_hash)?; let proposal = match proposal { Some(proposal) => proposal, None => return Ok(()), }; let commit_block_params = match self.stream.commit_block_params.take() { Some(v) => { if v.block_hash == proposal.block_hash { v } else { return Ok(()); } } None => return Ok(()), }; self.stream.on_decide(commit_block_params, justify)?; Ok(()) } fn send_new_view(&mut self) -> CommonResult<()> { let leader_address = self.stream.current_leader.clone().expect("qed"); let message = ConsensusMessage { request_id: RequestId(0), message_type: MessageType::NewView, view: self.stream.storage.get_view(), node: None, justify: Some(self.stream.storage.get_prepare_qc()), sig: None, }; self.stream.consensus_message(leader_address, message)?; Ok(()) } fn sign_message(&self, message: &mut ConsensusMessage) -> CommonResult<()> { let leader_address = self.stream.current_leader.clone().expect("qed"); let sig_message = codec::encode(&( &message.message_type, &message.view, &message.node, &leader_address, ))?; let sig = sign(&sig_message, &self.stream.secret_key, &self.stream.support)?; message.sig = Some((self.stream.public_key.clone(), sig)); Ok(()) } } pub struct ObserverState<'a, S> where S: ConsensusSupport, { stream: &'a mut HotStuffStream<S>, } impl<'a, S> ObserverState<'a, S> where S: ConsensusSupport, { pub fn new(stream: &'a mut HotStuffStream<S>) -> Self { Self { stream } } pub async fn start(mut self) -> CommonResult<()> { let current_view = self.stream.storage.get_view(); loop { if self.stream.shutdown { return Ok(()); } if self.stream.storage.get_view() != current_view { return Ok(()); } tokio::select! { Some(internal_message) = self.stream.internal_rx.next() => { match internal_message { InternalMessage::ValidatorRegistered { address, peer_id } => { self.on_validator_registered(address, peer_id) .unwrap_or_else(|e| warn!("HotStuff stream handle validator registered message error: {}", e)); }, InternalMessage::ConsensusMessage {message, peer_id } => { self.on_consensus_message(message, peer_id) .unwrap_or_else(|e| warn!("HotStuff stream handle consensus message error: {}", e)); } _ => { self.stream.on_internal_message(internal_message) .unwrap_or_else(|e| warn!("HotStuff stream handle internal message error: {}", e)); } } }, in_message = self.stream.in_rx.next() => { match in_message { Some(in_message) => { self.stream.on_in_message(in_message) .unwrap_or_else(|e| warn!("HotStuff stream handle in message error: {}", e)); }, // in tx has been dropped None => { self.stream.shutdown = true; }, } }, } } } fn on_validator_registered(&mut self, address: Address, peer_id: PeerId) -> CommonResult<()> { if let Some(messages) = self.stream.pending_consensus_messages.remove(&peer_id) { for message in messages { self.on_validator_consensus_message(message, address.clone())?; } } Ok(()) } fn on_consensus_message( &mut self, message: ConsensusMessage, peer_id: PeerId, ) -> CommonResult<()> { if let Some(address) = self.stream.get_peer_address(&peer_id) { if self .stream .authorities .members .iter() .any(|(addr, _)| addr == &address) { self.on_validator_consensus_message(message, address)?; } } else { let messages = self .stream .pending_consensus_messages .entry(peer_id) .or_insert_with(Vec::new); messages.push(message); } Ok(()) } fn on_validator_consensus_message( &mut self, message: ConsensusMessage, address: Address, ) -> CommonResult<()> { if let MessageType::NewView = &message.message_type { self.on_new_view(message, address)? } Ok(()) } fn on_new_view(&mut self, message: ConsensusMessage, address: Address) -> CommonResult<()> { self.stream .pending_new_view_messages .push((message, address)); Ok(()) } } struct ConsensusMessageCollector { messages: HashMap<Address, ConsensusMessage>, } impl ConsensusMessageCollector { fn new() -> Self { Self { messages: Default::default(), } } fn add(&mut self, address: Address, message: ConsensusMessage) { self.messages.insert(address, message); } fn get_high_qc(&self, authorities: &Authorities) -> Option<QC> { let n = authorities.members.iter().fold(0u32, |sum, x| sum + x.1); let f = (n - 1) / 3; let member_weight = authorities .members .iter() .map(|x| (&x.0, x.1)) .collect::<HashMap<_, _>>(); let mut total_weight = 0; let mut high_qc = None; for (address, message) in &self.messages { let justify = message.justify.as_ref().expect("qed"); if let Some(weight) = member_weight.get(address) { total_weight += weight; high_qc = match high_qc { None => Some(justify.clone()), Some(high_qc) => { if justify.view > high_qc.view { Some(justify.clone()) } else { Some(high_qc) } } } } if total_weight >= n - f { return high_qc; } } None } fn get_high_qc_addresses(&self, qc: &QC) -> Vec<Address> { self.messages .iter() .filter_map(|(address, message)| { if message.justify.as_ref() == Some(qc) { Some(address.clone()) } else { None } }) .collect() } fn get_qc(&self, authorities: &Authorities, leader_address: Address) -> Option<QC> { let n = authorities.members.iter().fold(0u32, |sum, x| sum + x.1); let f = (n - 1) / 3; let member_weight = authorities .members .iter() .map(|x| (&x.0, x.1)) .collect::<HashMap<_, _>>(); let mut total_weight = 0; let mut qc_sig = vec![]; for (address, message) in &self.messages { if let Some(weight) = member_weight.get(address) { total_weight += weight; qc_sig.push(message.sig.clone().expect("qed")); } if total_weight >= n - f { let qc = QC { message_type: message.message_type.clone(), view: message.view, node: message.node.clone().expect("qed"), leader_address, sig: qc_sig, }; return Some(qc); } } None } }
use hyper::header; use hyper::Uri; use websub_sub::hub; use crate::feed::{self, RawFeed}; use crate::websub::Connection; #[derive(clap::Args)] pub struct Opt { callback: Uri, hub: Option<String>, topic: String, } pub async fn main(opt: Opt) -> anyhow::Result<()> { let client = crate::common::http_client(); let mut conn = Connection::new(crate::common::open_database()?); if let Some(hub) = opt.hub { hub::subscribe(&opt.callback, hub, opt.topic, &client, &mut conn)?.await?; } else { let res = client.get((&opt.topic[..]).try_into()?).await?; if res.status() != hyper::StatusCode::OK { anyhow::bail!("Bad status: {}", res.status()); } let mime = res .headers() .get(header::CONTENT_TYPE) .and_then(|v| v.to_str().ok()) .and_then(|v| v.parse().ok()) .unwrap_or(feed::MediaType::Xml); let body = hyper::body::to_bytes(res.into_body()).await?; let feed::Meta { topic, hubs, .. } = RawFeed::parse(mime, &body).unwrap().take_meta(); let topic = topic.as_deref().unwrap_or(&opt.topic); for hub in hubs { hub::subscribe( &opt.callback, hub.to_string(), topic.to_owned(), &client, &mut conn, )? .await?; } } Ok(()) }
#![deny(warnings)] #![no_main] #![no_std] extern crate panic_semihosting; use maple_mini::{ gpio::{Output, PushPull}, pins::*, prelude::*, timer, }; use rtfm::app; #[app(device = maple_mini::device)] const APP: () = { static mut LED: LedPin<Output<PushPull>> = (); #[init] fn init() { let mut rcc = device.RCC.constrain(); let mut flash = device.FLASH.constrain(); let clocks = rcc.cfgr.freeze(&mut flash.acr); let mut gpiob = device.GPIOB.split(&mut rcc.apb2); timer::Timer::syst(core.SYST, 1.hz(), clocks).listen(timer::Event::Update); LED = gpiob.pb1.into_push_pull_output(&mut gpiob.crl); } #[exception(resources = [LED], binds=SysTick)] fn toggle_led() { if resources.LED.is_set_high() { resources.LED.set_low(); } else { resources.LED.set_high(); } } };
mod json; mod package_key; mod target; pub use json::{JsonMarshaler, JsonRefMarshaler}; pub use package_key::PackageKeyMarshaler; pub use target::TargetMarshaler;
#!/usr/local/bin/rust run fn main(){ let mut sum = 0; let mut term0; let mut term1 = 0; let mut term2 = 1; loop{ term0 = term1 + term2; if term0 >= 4000000{ break; }else if term0 % 2 == 0{ sum += term0 } term2 = term1; term1 = term0; } println(fmt!("The total sum is %u", sum)) }
mod blake2b; mod blake2s; use crate::consts::{IV32, IV64, SIGMA}; pub use blake2b::Blake2b; pub use blake2s::Blake2s; struct Blake2<T> { f: bool, // finalization flag l: usize, // 未処理のバイト数 h: [T; 8], t: [T; 2], // counter: 処理したバイト数(と次に処理をするブロックのバイト数?) n: usize, // 出力バイト数 v: [T; 16], // state } impl Blake2<u32> { fn new(n: usize) -> Self { if !(1..=32).contains(&n) { panic!("{} is not a valid number. n must be between 1 and 32.", n); } Self { f: false, l: 0, h: [ IV32[0] ^ (0x0101_0000 | n as u32), IV32[1], IV32[2], IV32[3], IV32[4], IV32[5], IV32[6], IV32[7], ], t: [0; 2], n, v: [0; 16], } } fn with_key(n: usize, k: usize, salt: [u32; 2], personal: [u32; 2]) -> Self { if !(1..=32).contains(&n) { panic!("{} is not a valid number. n must be between 1 and 32.", n); } if k > 32 { panic!("{} is not a valid number. k must be between 0 and 32.", k) } if k == 0 { return Self::new(n); } Self { f: false, l: 0, h: [ IV32[0] ^ (0x0101_0000 | (k << 8) as u32 | n as u32), IV32[1], IV32[2], IV32[3], IV32[4] ^ salt[0].swap_bytes(), IV32[5] ^ salt[1].swap_bytes(), IV32[6] ^ personal[0].swap_bytes(), IV32[7] ^ personal[1].swap_bytes(), ], t: [0; 2], n, v: [0; 16], } } #[inline(always)] #[allow(clippy::too_many_arguments, clippy::many_single_char_names)] fn g(&mut self, block: &[u32; 16], i: usize, r: usize, a: usize, b: usize, c: usize, d: usize) { self.v[a] = self.v[a] .wrapping_add(self.v[b]) .wrapping_add(block[SIGMA[r][2 * i]]); self.v[d] = (self.v[d] ^ self.v[a]).rotate_right(16); self.v[c] = self.v[c].wrapping_add(self.v[d]); self.v[b] = (self.v[b] ^ self.v[c]).rotate_right(12); self.v[a] = self.v[a] .wrapping_add(self.v[b]) .wrapping_add(block[SIGMA[r][2 * i + 1]]); self.v[d] = (self.v[d] ^ self.v[a]).rotate_right(8); self.v[c] = self.v[c].wrapping_add(self.v[d]); self.v[b] = (self.v[b] ^ self.v[c]).rotate_right(7); } #[inline(always)] fn compress(&mut self, block: &[u32; 16]) { // update counter if self.l > 64 { self.t[0] += 64; self.l -= 64; } else { self.t[0] += self.l as u32; self.l = 0; self.f = true; } // initialize state self.v[0] = self.h[0]; self.v[1] = self.h[1]; self.v[2] = self.h[2]; self.v[3] = self.h[3]; self.v[4] = self.h[4]; self.v[5] = self.h[5]; self.v[6] = self.h[6]; self.v[7] = self.h[7]; self.v[8] = IV32[0]; self.v[9] = IV32[1]; self.v[10] = IV32[2]; self.v[11] = IV32[3]; self.v[12] = IV32[4] ^ self.t[0]; self.v[13] = IV32[5] ^ self.t[1]; if self.f { self.v[14] = IV32[6] ^ u32::MAX; self.v[15] = IV32[7] ^ u32::MIN; } else { self.v[14] = IV32[6]; self.v[15] = IV32[7]; } // round for r in 0..10 { self.g(block, 0, r, 0, 4, 8, 12); self.g(block, 1, r, 1, 5, 9, 13); self.g(block, 2, r, 2, 6, 10, 14); self.g(block, 3, r, 3, 7, 11, 15); self.g(block, 4, r, 0, 5, 10, 15); self.g(block, 5, r, 1, 6, 11, 12); self.g(block, 6, r, 2, 7, 8, 13); self.g(block, 7, r, 3, 4, 9, 14); } // finalize for i in 0..8 { self.h[i] = self.h[i] ^ self.v[i] ^ self.v[i + 8]; } } } impl Blake2<u64> { fn new(n: usize) -> Self { if !(1..=64).contains(&n) { panic!("{} is not a valid number. n must be between 1 and 32.", n); } Self { f: false, l: 0, h: [ IV64[0] ^ (0x0101_0000 | n as u64), IV64[1], IV64[2], IV64[3], IV64[4], IV64[5], IV64[6], IV64[7], ], t: [0; 2], n, v: [0; 16], } } fn with_key(n: usize, k: usize, salt: [u64; 2], personal: [u64; 2]) -> Self { if !(1..=64).contains(&n) { panic!("{} is not a valid number. n must be between 1 and 32.", n); } if k > 64 { panic!("{} is not a valid number. k must be between 0 and 64.", k) } if k == 0 { return Self::new(n); } Self { f: false, l: 0, h: [ IV64[0] ^ (0x0101_0000 | (k << 8) as u64 | n as u64), IV64[1], IV64[2], IV64[3], IV64[4] ^ salt[0].swap_bytes(), IV64[5] ^ salt[1].swap_bytes(), IV64[6] ^ personal[0].swap_bytes(), IV64[7] ^ personal[1].swap_bytes(), ], t: [0; 2], n, v: [0; 16], } } #[inline(always)] #[allow(clippy::too_many_arguments, clippy::many_single_char_names)] fn g(&mut self, block: &[u64; 16], i: usize, r: usize, a: usize, b: usize, c: usize, d: usize) { // a,b,c,d: index of self.v // i: number of function G // r: round count self.v[a] = self.v[a] .wrapping_add(self.v[b]) .wrapping_add(block[SIGMA[r % 10][2 * i]]); self.v[d] = (self.v[d] ^ self.v[a]).rotate_right(32); self.v[c] = self.v[c].wrapping_add(self.v[d]); self.v[b] = (self.v[b] ^ self.v[c]).rotate_right(24); self.v[a] = self.v[a] .wrapping_add(self.v[b]) .wrapping_add(block[SIGMA[r % 10][2 * i + 1]]); self.v[d] = (self.v[d] ^ self.v[a]).rotate_right(16); self.v[c] = self.v[c].wrapping_add(self.v[d]); self.v[b] = (self.v[b] ^ self.v[c]).rotate_right(63); } #[inline(always)] fn compress(&mut self, block: &[u64; 16]) { // update counter if self.l > 128 { self.t[0] += 128; self.l -= 128; } else { self.t[0] += self.l as u64; self.l = 0; self.f = true; } // initialize state self.v[0] = self.h[0]; self.v[1] = self.h[1]; self.v[2] = self.h[2]; self.v[3] = self.h[3]; self.v[4] = self.h[4]; self.v[5] = self.h[5]; self.v[6] = self.h[6]; self.v[7] = self.h[7]; self.v[8] = IV64[0]; self.v[9] = IV64[1]; self.v[10] = IV64[2]; self.v[11] = IV64[3]; self.v[12] = IV64[4] ^ self.t[0]; self.v[13] = IV64[5] ^ self.t[1]; if self.f { self.v[14] = IV64[6] ^ u64::MAX; self.v[15] = IV64[7] ^ u64::MIN; } else { self.v[14] = IV64[6]; self.v[15] = IV64[7]; } // round for r in 0..12 { self.g(block, 0, r, 0, 4, 8, 12); self.g(block, 1, r, 1, 5, 9, 13); self.g(block, 2, r, 2, 6, 10, 14); self.g(block, 3, r, 3, 7, 11, 15); self.g(block, 4, r, 0, 5, 10, 15); self.g(block, 5, r, 1, 6, 11, 12); self.g(block, 6, r, 2, 7, 8, 13); self.g(block, 7, r, 3, 4, 9, 14); } // finalize for i in 0..8 { self.h[i] = self.h[i] ^ self.v[i] ^ self.v[i + 8]; } } }
use crate::models::{Company, WorkerTypes, Department, GroupTypes, Contract, EqGroupList, EquipmentType, Project, Worker, ConstrAttr, EngAttr, LabAttr, MechAttr, Equipment, GroupsBind, WorkingCompany, DepartmentHead, EqGroup, Groups, PcBind}; use diesel::{PgConnection, QueryDsl, ExpressionMethods, AppearsOnTable, RunQueryDsl}; use diesel::query_builder::QueryFragment; use diesel::pg::Pg; use crate::pagination::Paginate; #[derive(Debug, Deserialize)] pub struct Params { pub page: Option<i64>, pub page_size: Option<i64>, } impl Company{ pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::company; let column = match column_name.as_str(){ "company_name"=>{company::company_name} _=>{company::company_name} }; let mut query = company::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let res = match order.as_str(){ "ASC"=>{ match query.order_by(column.asc()).paginate(page).load::<(Company, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } "DESC" | _=>{ match query.order_by(column.desc()).paginate(page).load::<(Company, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl WorkerTypes{ pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::worker_types; let column = match column_name.as_str(){ "worker_type"=>{worker_types::worker_type} _=>{worker_types::worker_type} }; let mut query = worker_types::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let res = match order.as_str(){ "ASC"=>{ match query.order_by(column.asc()).paginate(page).load::<(WorkerTypes, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } "DESC" | _=>{ match query.order_by(column.desc()).paginate(page).load::<(WorkerTypes, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl Department{ pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::department; let column = match column_name.as_str(){ "department_name"=>{department::department_name} _=>{department::department_name} }; let mut query = department::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let res = match order.as_str(){ "ASC"=>{ match query.order_by(column.asc()).paginate(page).load::<(Department, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } "DESC" | _=>{ match query.order_by(column.desc()).paginate(page).load::<(Department, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl GroupTypes{ pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::group_types; let column = match column_name.as_str(){ "group_type"=>{group_types::group_type} _=>{group_types::group_type} }; let mut query = group_types::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let res = match order.as_str(){ "ASC"=>{ match query.order_by(column.asc()).paginate(page).load::<(GroupTypes, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } "DESC" | _=>{ match query.order_by(column.desc()).paginate(page).load::<(GroupTypes, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, } } }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl Contract{ fn sort_by_column<U: 'static>(mut query: crate::schema::contract::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::contract::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::contract::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::contract; let mut query = contract::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "contract_id" => Contract::sort_by_column(query, contract::contract_id, order), "contract_start" => Contract::sort_by_column(query, contract::contract_start, order), "contract_end" => Contract::sort_by_column(query, contract::contract_end, order), "cost" => Contract::sort_by_column(query, contract::cost, order), _ => Contract::sort_by_column(query, contract::contract_id, order) }; let res =match query_res.paginate(page).load::<(Contract, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl EqGroupList{ fn sort_by_column<U: 'static>(mut query: crate::schema::eq_group_list::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::eq_group_list::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::eq_group_list::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::eq_group_list; let mut query = eq_group_list::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "eq_list_id" => EqGroupList::sort_by_column(query, eq_group_list::eq_list_id, order), _ => EqGroupList::sort_by_column(query, eq_group_list::eq_list_id, order) }; let res =match query_res.paginate(page).load::<(EqGroupList, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl EquipmentType{ fn sort_by_column<U: 'static>(mut query: crate::schema::equipment_type::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::equipment_type::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::equipment_type::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::equipment_type; let mut query = equipment_type::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "type" => EquipmentType::sort_by_column(query, equipment_type::type_, order), _ => EquipmentType::sort_by_column(query, equipment_type::type_, order) }; let res =match query_res.paginate(page).load::<(EquipmentType, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl Project{ fn sort_by_column<U: 'static>(mut query: crate::schema::project::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::project::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::project::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::project; let mut query = project::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "project_id" => Project::sort_by_column(query, project::project_id, order), "cost" => Project::sort_by_column(query, project::cost, order), "data" => Project::sort_by_column(query, project::data, order), _ => Project::sort_by_column(query, project::project_id, order) }; let res =match query_res.paginate(page).load::<(Project, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl Worker{ fn sort_by_column<U: 'static>(mut query: crate::schema::worker::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::worker::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::worker::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::worker; let mut query = worker::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "worker_id" => Worker::sort_by_column(query, worker::worker_id, order), "firstname" => Worker::sort_by_column(query, worker::firstname, order), "secondname" => Worker::sort_by_column(query, worker::secondname, order), "familyname" => Worker::sort_by_column(query, worker::familyname, order), "worker_type" => Worker::sort_by_column(query, worker::worker_type, order), "department_name" => Worker::sort_by_column(query, worker::department_name, order), "age" => Worker::sort_by_column(query, worker::age, order), "salary" => Worker::sort_by_column(query, worker::salary, order), _ => Worker::sort_by_column(query, worker::worker_id, order) }; let res =match query_res.paginate(page).load::<(Worker, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl ConstrAttr{ fn sort_by_column<U: 'static>(mut query: crate::schema::constr_attr::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::constr_attr::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::constr_attr::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::constr_attr; let mut query = constr_attr::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "worker_id" => ConstrAttr::sort_by_column(query, constr_attr::worker_id, order), "cert_number" => ConstrAttr::sort_by_column(query, constr_attr::cert_number, order), _ => ConstrAttr::sort_by_column(query, constr_attr::worker_id, order) }; let res =match query_res.paginate(page).load::<(ConstrAttr, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl EngAttr{ fn sort_by_column<U: 'static>(mut query: crate::schema::eng_attr::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::eng_attr::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::eng_attr::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::eng_attr; let mut query = eng_attr::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "worker_id" => EngAttr::sort_by_column(query, eng_attr::worker_id, order), "category" => EngAttr::sort_by_column(query, eng_attr::category, order), _ => EngAttr::sort_by_column(query, eng_attr::worker_id, order) }; let res =match query_res.paginate(page).load::<(EngAttr, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl LabAttr{ fn sort_by_column<U: 'static>(mut query: crate::schema::lab_attr::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::lab_attr::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::lab_attr::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::lab_attr; let mut query = lab_attr::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "worker_id" => LabAttr::sort_by_column(query, lab_attr::worker_id, order), "lab_number" => LabAttr::sort_by_column(query, lab_attr::lab_number, order), _ => LabAttr::sort_by_column(query, lab_attr::worker_id, order) }; let res =match query_res.paginate(page).load::<(LabAttr, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl MechAttr{ fn sort_by_column<U: 'static>(mut query: crate::schema::mech_attr::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::mech_attr::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::mech_attr::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::mech_attr; let mut query = mech_attr::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "worker_id" => MechAttr::sort_by_column(query, mech_attr::worker_id, order), "repair_type" => MechAttr::sort_by_column(query, mech_attr::repair_type, order), _ => MechAttr::sort_by_column(query, mech_attr::worker_id, order) }; let res =match query_res.paginate(page).load::<(MechAttr, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl Equipment{ fn sort_by_column<U: 'static>(mut query: crate::schema::equipment::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::equipment::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::equipment::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::equipment; let mut query = equipment::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "eq_id" => Equipment::sort_by_column(query, equipment::eq_id, order), "name" => Equipment::sort_by_column(query, equipment::name, order), "type" => Equipment::sort_by_column(query, equipment::type_, order), "department_name" => Equipment::sort_by_column(query, equipment::department_name, order), _ => Equipment::sort_by_column(query, equipment::eq_id, order) }; let res =match query_res.paginate(page).load::<(Equipment, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl GroupsBind{ fn sort_by_column<U: 'static>(mut query: crate::schema::groups_bind::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::groups_bind::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::groups_bind::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::groups_bind; let mut query = groups_bind::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "group_id" => GroupsBind::sort_by_column(query, groups_bind::group_id, order), "cost" => GroupsBind::sort_by_column(query, groups_bind::cost, order), "group_type" => GroupsBind::sort_by_column(query, groups_bind::group_type, order), _ => GroupsBind::sort_by_column(query, groups_bind::group_id, order) }; let res =match query_res.paginate(page).load::<(GroupsBind, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl WorkingCompany{ fn sort_by_column<U: 'static>(mut query: crate::schema::working_company::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::working_company::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::working_company::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::working_company; let mut query = working_company::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "group_id" => WorkingCompany::sort_by_column(query, working_company::group_id, order), "company_name" => WorkingCompany::sort_by_column(query, working_company::company_name, order), _ => WorkingCompany::sort_by_column(query, working_company::group_id, order) }; let res =match query_res.paginate(page).load::<(WorkingCompany, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl DepartmentHead{ fn sort_by_column<U: 'static>(mut query: crate::schema::department_head::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::department_head::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::department_head::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::department_head; let mut query = department_head::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "department_name" => DepartmentHead::sort_by_column(query, department_head::department_name, order), "worker_id" => DepartmentHead::sort_by_column(query, department_head::worker_id, order), _ => DepartmentHead::sort_by_column(query, department_head::department_name, order) }; let res =match query_res.paginate(page).load::<(DepartmentHead, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl EqGroup{ fn sort_by_column<U: 'static>(mut query: crate::schema::eq_group::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::eq_group::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::eq_group::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::eq_group; let mut query = eq_group::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "id" => EqGroup::sort_by_column(query, eq_group::id, order), "eq_list_id" => EqGroup::sort_by_column(query, eq_group::eq_list_id, order), "eq_id" => EqGroup::sort_by_column(query, eq_group::eq_id, order), _ => EqGroup::sort_by_column(query, eq_group::eq_list_id, order) }; let res =match query_res.paginate(page).load::<(EqGroup, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl Groups{ fn sort_by_column<U: 'static>(mut query: crate::schema::groups::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::groups::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::groups::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::groups; let mut query = groups::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "id" => Groups::sort_by_column(query, groups::id, order), "group_id" => Groups::sort_by_column(query, groups::group_id, order), "worker_id" => Groups::sort_by_column(query, groups::worker_id, order), _ => Groups::sort_by_column(query, groups::group_id, order) }; let res =match query_res.paginate(page).load::<(Groups, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } } impl PcBind{ fn sort_by_column<U: 'static>(mut query: crate::schema::pc_bind::BoxedQuery<'static, Pg>, column: U, sort_dir: String) -> crate::schema::pc_bind::BoxedQuery<'static, Pg> where U: ExpressionMethods + QueryFragment<Pg> + AppearsOnTable<crate::schema::pc_bind::table>{ match sort_dir.as_str() { "ASC" => query.order_by(column.asc()), "DESC" => query.order_by(column.desc()), _ => query.order_by(column.desc()) } } pub fn get_page(params: Params, connection: &PgConnection,column_name:String,order:String)->Result<(Vec<Self>, i64),&'static str>{ use crate::schema::pc_bind; let mut query = pc_bind::table.into_boxed(); let (values,total_pages) = match params.page{ None => { ( match query.load(connection) { Ok(res)=>{res} Err(_)=>{return Err("Error at loading table")} }, 1)} Some(page) => { let query_res = match column_name.as_str() { "contract_id" => PcBind::sort_by_column(query, pc_bind::contract_id, order), "project_id" => PcBind::sort_by_column(query, pc_bind::project_id, order), "head_id" => PcBind::sort_by_column(query, pc_bind::group_id, order), "group_id" => PcBind::sort_by_column(query, pc_bind::head_id, order), "project_start" => PcBind::sort_by_column(query, pc_bind::project_start, order), "project_end" => PcBind::sort_by_column(query, pc_bind::project_end, order), "eq_list_id" => PcBind::sort_by_column(query, pc_bind::eq_list_id, order), _ => PcBind::sort_by_column(query, pc_bind::contract_id, order) }; let res =match query_res.paginate(page).load::<(PcBind, i64)>(connection) { Ok(sub_res)=>{sub_res}, Err(_)=>{return Err("Error at loading page")}, }; let total = res.get(0).map(|x| x.1).unwrap_or(0); let values = res.into_iter().map(|x| x.0).collect(); let total_pages = (total as f64 / 10 as f64).ceil() as i64; (values, total_pages) } }; Ok((values,total_pages)) } }
// This file is part of Substrate. // Copyright (C) 2019-2020 Parity Technologies (UK) Ltd. // SPDX-License-Identifier: Apache-2.0 // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. use futures::{ channel::{mpsc, oneshot}, compat::*, future::{ok, ready, select}, prelude::*, }; use futures01::sync::mpsc as mpsc01; use libp2p_wasm_ext::{ffi, ExtTransport}; use log::{debug, info}; use sc_chain_spec::Extension; use sc_network::config::TransportConfig; use sc_service::{ config::{DatabaseConfig, KeystoreConfig, NetworkConfiguration}, Configuration, GenericChainSpec, Role, RpcHandlers, RpcSession, RuntimeGenesis, TaskManager, }; use std::pin::Pin; use wasm_bindgen::prelude::*; pub use console_error_panic_hook::set_once as set_console_error_panic_hook; pub use console_log::init_with_level as init_console_log; /// Create a service configuration from a chain spec. /// /// This configuration contains good defaults for a browser light client. pub async fn browser_configuration<G, E>( chain_spec: GenericChainSpec<G, E>, ) -> Result<Configuration, Box<dyn std::error::Error>> where G: RuntimeGenesis + 'static, E: Extension + 'static + Send, { let name = chain_spec.name().to_string(); let transport = ExtTransport::new(ffi::websocket_transport()); let mut network = NetworkConfiguration::new( format!("{} (Browser)", name), "unknown", Default::default(), None, ); network.boot_nodes = chain_spec.boot_nodes().to_vec(); network.transport = TransportConfig::Normal { wasm_external_transport: Some(transport.clone()), allow_private_ipv4: true, enable_mdns: false, use_yamux_flow_control: true, }; let config = Configuration { network, telemetry_endpoints: chain_spec.telemetry_endpoints().clone(), chain_spec: Box::new(chain_spec), task_executor: (|fut, _| { wasm_bindgen_futures::spawn_local(fut); async {} }) .into(), telemetry_external_transport: Some(transport), role: Role::Light, database: { info!("Opening Indexed DB database '{}'...", name); let db = kvdb_web::Database::open(name, 10).await?; DatabaseConfig::Custom(sp_database::as_database(db)) }, keystore: KeystoreConfig::InMemory, default_heap_pages: Default::default(), dev_key_seed: Default::default(), disable_grandpa: Default::default(), execution_strategies: Default::default(), force_authoring: Default::default(), impl_name: String::from("parity-substrate"), impl_version: String::from("0.0.0"), offchain_worker: Default::default(), prometheus_config: Default::default(), pruning: Default::default(), rpc_cors: Default::default(), rpc_http: Default::default(), rpc_ipc: Default::default(), rpc_ws: Default::default(), rpc_ws_max_connections: Default::default(), rpc_methods: Default::default(), state_cache_child_ratio: Default::default(), state_cache_size: Default::default(), tracing_receiver: Default::default(), tracing_targets: Default::default(), transaction_pool: Default::default(), wasm_method: Default::default(), max_runtime_instances: 8, announce_block: true, base_path: None, informant_output_format: sc_informant::OutputFormat { enable_color: false, prefix: String::new(), }, }; Ok(config) } /// A running client. #[wasm_bindgen] pub struct Client { rpc_send_tx: mpsc::UnboundedSender<RpcMessage>, } struct RpcMessage { rpc_json: String, session: RpcSession, send_back: oneshot::Sender<Pin<Box<dyn futures::Future<Output = Option<String>> + Send>>>, } /// Create a Client object that connects to a service. pub fn start_client(mut task_manager: TaskManager, rpc_handlers: RpcHandlers) -> Client { // We dispatch a background task responsible for processing the service. // // The main action performed by the code below consists in polling the service with // `service.poll()`. // The rest consists in handling RPC requests. let (rpc_send_tx, rpc_send_rx) = mpsc::unbounded::<RpcMessage>(); wasm_bindgen_futures::spawn_local( select( rpc_send_rx.for_each(move |message| { let fut = rpc_handlers.rpc_query(&message.session, &message.rpc_json); let _ = message.send_back.send(fut); ready(()) }), Box::pin(async move { let _ = task_manager.future().await; }), ) .map(drop), ); Client { rpc_send_tx } } #[wasm_bindgen] impl Client { /// Allows starting an RPC request. Returns a `Promise` containing the result of that request. #[wasm_bindgen(js_name = "rpcSend")] pub fn rpc_send(&mut self, rpc: &str) -> js_sys::Promise { let rpc_session = RpcSession::new(mpsc01::channel(1).0); let (tx, rx) = oneshot::channel(); let _ = self.rpc_send_tx.unbounded_send(RpcMessage { rpc_json: rpc.to_owned(), session: rpc_session, send_back: tx, }); wasm_bindgen_futures::future_to_promise(async { match rx.await { Ok(fut) => fut.await.map(|s| JsValue::from_str(&s)).ok_or_else(|| JsValue::NULL), Err(_) => Err(JsValue::NULL), } }) } /// Subscribes to an RPC pubsub endpoint. #[wasm_bindgen(js_name = "rpcSubscribe")] pub fn rpc_subscribe(&mut self, rpc: &str, callback: js_sys::Function) { let (tx, rx) = mpsc01::channel(4); let rpc_session = RpcSession::new(tx); let (fut_tx, fut_rx) = oneshot::channel(); let _ = self.rpc_send_tx.unbounded_send(RpcMessage { rpc_json: rpc.to_owned(), session: rpc_session.clone(), send_back: fut_tx, }); wasm_bindgen_futures::spawn_local(async { if let Ok(fut) = fut_rx.await { fut.await; } }); wasm_bindgen_futures::spawn_local(async move { let _ = rx .compat() .try_for_each(|s| { let _ = callback.call1(&callback, &JsValue::from_str(&s)); ok(()) }) .await; // We need to keep `rpc_session` alive. debug!("RPC subscription has ended"); drop(rpc_session); }); } }
use super::blockid::BlockId; use super::filemanager::FileMgr; use super::logmanager::LogMgr; use super::page::Page; use std::cell::RefCell; use std::fmt; use std::sync::Arc; use anyhow::Result; #[derive(Debug)] enum BufferError { BlockNotFound, } impl std::error::Error for BufferError {} impl fmt::Display for BufferError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { match self { BufferError::BlockNotFound => { write!(f, "block not found") } } } } pub struct Buffer { fm: Arc<RefCell<FileMgr>>, lm: Arc<RefCell<LogMgr>>, contents: Page, blk: Option<BlockId>, // reference to the block assigned to its page pins: u64, // the number of times the page is pinned txnum: i32, // an integer indicating if the page has been modified. The integer indentifies the transaction that make the change lsn: i32, // log information. if the page has been modified, the buffer holds the LSN of the most recent log record. } impl Buffer { pub fn new(fm: Arc<RefCell<FileMgr>>, lm: Arc<RefCell<LogMgr>>) -> Buffer { let blksize = fm.borrow().blocksize() as usize; Buffer { fm, lm, contents: Page::new_from_size(blksize), blk: None, pins: 0, txnum: -1, lsn: -1, } } pub fn contents(&mut self) -> &mut Page { &mut self.contents } pub fn block(&self) -> Option<&BlockId> { self.blk.as_ref() } pub fn set_modified(&mut self, txnum: i32, lsn: i32) { self.txnum = txnum; if lsn >= 0 { self.lsn = lsn; } } pub fn is_pinned(&self) -> bool { self.pins > 0 } pub fn modifying_tx(&self) -> i32 { self.txnum } // associate the buffer with the specific block, reading its content from disk pub fn assign_to_block(&mut self, b: BlockId) -> Result<()> { self.flush()?; self.fm.borrow_mut().read(&b, &mut self.contents)?; self.blk = Some(b); self.pins = 0; Ok(()) } // ensure the buffer's assigned disk block has the same values as its page pub fn flush(&mut self) -> Result<()> { // page has been changed if self.txnum >= 0 { self.lm.borrow_mut().flush_from_lsn(self.lsn as u64)?; if let Some(br) = self.blk.as_ref() { self.fm.borrow_mut().write(br, &mut self.contents)?; // need not flush again self.txnum = -1; } else { return Err(From::from(BufferError::BlockNotFound)); } } Ok(()) } pub fn pin(&mut self) { self.pins += 1; } pub fn unpin(&mut self) { self.pins -= 1; } }
#![feature(test)] extern crate fnv; extern crate hashbrown; extern crate test; #[cfg(test)] use fnv::FnvHashSet; #[cfg(test)] use hashbrown::HashSet as HashbrownSet; #[cfg(test)] use std::collections::BTreeSet; #[cfg(test)] use std::collections::HashSet; macro_rules! bench_set { ($name: ident, $type: ident, $size: expr) => { #[bench] pub fn $name(b: &mut test::Bencher) { // setup let s: $type<i32> = (0..$size).collect(); assert_eq!(s.len(), $size); // measure b.iter(|| { let set = test::black_box(&s); let elt = *set.iter().next().unwrap(); test::black_box(elt); }) } }; } bench_set!(peek_btreeset_1, BTreeSet, 1); bench_set!(peek_btreeset_100, BTreeSet, 100); bench_set!(peek_btreeset_10k, BTreeSet, 10_000); bench_set!(peek_btreeset_1kk, BTreeSet, 1_000_000); bench_set!(peek_hashset_1, HashSet, 1); bench_set!(peek_hashset_100, HashSet, 100); bench_set!(peek_hashset_10k, HashSet, 10_000); bench_set!(peek_hashset_1kk, HashSet, 1_000_000); bench_set!(peek_fnvhashtreeset_1, FnvHashSet, 1); bench_set!(peek_fnvhashtreeset_100, FnvHashSet, 100); bench_set!(peek_fnvhashtreeset_10k, FnvHashSet, 10_000); bench_set!(peek_fnvhashtreeset_1kk, FnvHashSet, 1_000_000); bench_set!(peek_hashbrownset_1, HashbrownSet, 1); bench_set!(peek_hashbrownset_100, HashbrownSet, 100); bench_set!(peek_hashbrownset_10k, HashbrownSet, 10_000); bench_set!(peek_hashbrownset_1kk, HashbrownSet, 1_000_000);
// Copyright 2020 ChainSafe Systems // SPDX-License-Identifier: Apache-2.0, MIT #![cfg(feature = "serde_tests")] use crypto::Signature; use serde::Deserialize; #[derive(Debug, Deserialize)] pub struct SignatureVector { #[serde(alias = "Type")] sig_type: u8, #[serde(alias = "Data")] data: String, } impl From<SignatureVector> for Signature { fn from(v: SignatureVector) -> Self { match v.sig_type { 1 => Signature::new_secp256k1(base64::decode(&v.data).unwrap()), 2 => Signature::new_bls(base64::decode(&v.data).unwrap()), _ => panic!("unsupported signature type"), } } }
use hlua::{self, Lua}; use std::fs::File; use std::io::Read; pub fn hello_world() { let mut script = String::new(); File::open("scripts/hello.lua").unwrap() .read_to_string(&mut script).unwrap(); let mut lua = Lua::new(); lua.openlibs(); // Load standard lua libraries lua.set("log", hlua::function1(log)); // Add log capability lua.execute(&script).unwrap() } fn log(text: String) { println!("{}", text); }
//! This sub-mod provides some facilities about memory performance profiling. //! # Memory usage of current process //! There's a platform-related function called `get_process_memory_info` available on MacOS and Windows. //! # Memory usage of ALL Rust allocations //! We provide a `CountingAllocator` that wraps the system allocator but tracks the bytes used by rust allocations. //! This crate DOES NOT replace the global allocator by default. You need to make it as a `global_allocator` or enable the `allocation_counter` feature. //! ```ignore //! #[global_allocator] //! static _COUNTER: perf_monitor::mem::CountingAllocator = perf_monitor:mem::CountingAllocator; //! ``` mod allocation_counter; pub use allocation_counter::CountingAllocator; #[cfg(any(target_os = "macos", target_os = "windows"))] mod process_memory_info; #[cfg(any(target_os = "macos", target_os = "windows"))] pub use process_memory_info::{get_process_memory_info, ProcessMemoryInfo, ProcessMemoryInfoError}; #[cfg(target_os = "macos")] #[cfg_attr(doc, doc(cfg(macos)))] pub mod apple;
use num_bigint::{BigUint, RandBigInt}; use num_integer::Integer; use num_traits::{One, Zero}; use once_cell::sync::Lazy; use rand::{CryptoRng, Rng}; static DH_GENERATOR: Lazy<BigUint> = Lazy::new(|| BigUint::from_bytes_be(&[0x02])); static DH_PRIME: Lazy<BigUint> = Lazy::new(|| { BigUint::from_bytes_be(&[ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xc9, 0x0f, 0xda, 0xa2, 0x21, 0x68, 0xc2, 0x34, 0xc4, 0xc6, 0x62, 0x8b, 0x80, 0xdc, 0x1c, 0xd1, 0x29, 0x02, 0x4e, 0x08, 0x8a, 0x67, 0xcc, 0x74, 0x02, 0x0b, 0xbe, 0xa6, 0x3b, 0x13, 0x9b, 0x22, 0x51, 0x4a, 0x08, 0x79, 0x8e, 0x34, 0x04, 0xdd, 0xef, 0x95, 0x19, 0xb3, 0xcd, 0x3a, 0x43, 0x1b, 0x30, 0x2b, 0x0a, 0x6d, 0xf2, 0x5f, 0x14, 0x37, 0x4f, 0xe1, 0x35, 0x6d, 0x6d, 0x51, 0xc2, 0x45, 0xe4, 0x85, 0xb5, 0x76, 0x62, 0x5e, 0x7e, 0xc6, 0xf4, 0x4c, 0x42, 0xe9, 0xa6, 0x3a, 0x36, 0x20, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, ]) }); fn powm(base: &BigUint, exp: &BigUint, modulus: &BigUint) -> BigUint { let mut base = base.clone(); let mut exp = exp.clone(); let mut result: BigUint = One::one(); while !exp.is_zero() { if exp.is_odd() { result = (result * &base) % modulus; } exp >>= 1; base = (&base * &base) % modulus; } result } pub struct DhLocalKeys { private_key: BigUint, public_key: BigUint, } impl DhLocalKeys { pub fn random<R: Rng + CryptoRng>(rng: &mut R) -> DhLocalKeys { let private_key = rng.gen_biguint(95 * 8); let public_key = powm(&DH_GENERATOR, &private_key, &DH_PRIME); DhLocalKeys { private_key, public_key, } } pub fn public_key(&self) -> Vec<u8> { self.public_key.to_bytes_be() } pub fn shared_secret(&self, remote_key: &[u8]) -> Vec<u8> { let shared_key = powm( &BigUint::from_bytes_be(remote_key), &self.private_key, &DH_PRIME, ); shared_key.to_bytes_be() } }
use log::Level; pub fn output_log() { // env_logger::init(); log::debug!("{}", "this is a log msg only shown on debug mode"); eprintln!("this is a log from std lib"); log::error!("{}", "this is a log msg on staout"); use env_logger::{Builder, Target}; Builder::new().target(Target::Stdout).init(); log::debug!("ssssssss"); } pub fn customed_logger() { use log::{Metadata, Record}; struct ConsoleLogger; impl log::Log for ConsoleLogger { // Determines if a log message with the specified metadata would be logged. fn enabled(&self, metadata: &Metadata) -> bool { println!( "{} ? {} => {}", metadata.level(), Level::Info, metadata.level() <= Level::Info ); metadata.level() <= Level::Info } // Logs the `Record`. fn log(&self, record: &Record) { if self.enabled(record.metadata()) { println!("Rust says: {} - {}", record.level(), record.args()); } } // Flushes any buffered records. fn flush(&self) {} } static CONSOLE_LOGGER: ConsoleLogger = ConsoleLogger; log::set_logger(&CONSOLE_LOGGER).unwrap(); log::set_max_level(log::LevelFilter::Info); log::debug!("debug"); log::warn!("warn"); log::error!("error"); log::info!("info"); log::trace!("trace"); } pub fn log_to_sys() { // use syslog:: } pub fn customed_env() { use env_logger::Builder; use std::env; Builder::new() // .parse_env(env::var("MY_APP_LOG").unwrap()) .init(); for argument in env::args() { println!("=================={}", argument); } } pub fn env_test() { use std::env; println!("{:?}", env::current_dir()); for argument in env::args() { println!("=================={}", argument); } for argument in env::args_os() { println!("*******************8{:?}", argument); } } use error_chain::error_chain; error_chain! { foreign_links { Io(std::io::Error); SetLogger(log::SetLoggerError); LogConfig(log4rs::config::runtime::ConfigErrors); } } pub fn customed_log_path() -> Result<()> { use log::LevelFilter; use log4rs::append::file::FileAppender; use log4rs::config::{Appender, Config, Root}; use log4rs::encode::pattern::PatternEncoder; let logfile = FileAppender::builder() .encoder(Box::new(PatternEncoder::new("{l} - {m}\n"))) .build("log/output.log")?; let config = Config::builder() .appender(Appender::builder().build("logfile", Box::new(logfile))) .build(Root::builder().appender("logfile").build(LevelFilter::Info))?; log4rs::init_config(config)?; log::info!("Hello, world!"); log::debug!("debug"); log::warn!("warn"); log::error!("error"); log::info!("info"); log::trace!("trace"); Ok(()) } #[test] fn test() { // output_log(); // customed_logger(); // env_test(); // customed_env(); customed_log_path(); }
#[doc = "Reader of register DDRCTRL_PCCFG"] pub type R = crate::R<u32, super::DDRCTRL_PCCFG>; #[doc = "Writer for register DDRCTRL_PCCFG"] pub type W = crate::W<u32, super::DDRCTRL_PCCFG>; #[doc = "Register DDRCTRL_PCCFG `reset()`'s with value 0"] impl crate::ResetValue for super::DDRCTRL_PCCFG { type Type = u32; #[inline(always)] fn reset_value() -> Self::Type { 0 } } #[doc = "Reader of field `GO2CRITICAL_EN`"] pub type GO2CRITICAL_EN_R = crate::R<bool, bool>; #[doc = "Write proxy for field `GO2CRITICAL_EN`"] pub struct GO2CRITICAL_EN_W<'a> { w: &'a mut W, } impl<'a> GO2CRITICAL_EN_W<'a> { #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !0x01) | ((value as u32) & 0x01); self.w } } #[doc = "Reader of field `PAGEMATCH_LIMIT`"] pub type PAGEMATCH_LIMIT_R = crate::R<bool, bool>; #[doc = "Write proxy for field `PAGEMATCH_LIMIT`"] pub struct PAGEMATCH_LIMIT_W<'a> { w: &'a mut W, } impl<'a> PAGEMATCH_LIMIT_W<'a> { #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 4)) | (((value as u32) & 0x01) << 4); self.w } } #[doc = "Reader of field `BL_EXP_MODE`"] pub type BL_EXP_MODE_R = crate::R<bool, bool>; #[doc = "Write proxy for field `BL_EXP_MODE`"] pub struct BL_EXP_MODE_W<'a> { w: &'a mut W, } impl<'a> BL_EXP_MODE_W<'a> { #[doc = r"Sets the field bit"] #[inline(always)] pub fn set_bit(self) -> &'a mut W { self.bit(true) } #[doc = r"Clears the field bit"] #[inline(always)] pub fn clear_bit(self) -> &'a mut W { self.bit(false) } #[doc = r"Writes raw bits to the field"] #[inline(always)] pub fn bit(self, value: bool) -> &'a mut W { self.w.bits = (self.w.bits & !(0x01 << 8)) | (((value as u32) & 0x01) << 8); self.w } } impl R { #[doc = "Bit 0 - GO2CRITICAL_EN"] #[inline(always)] pub fn go2critical_en(&self) -> GO2CRITICAL_EN_R { GO2CRITICAL_EN_R::new((self.bits & 0x01) != 0) } #[doc = "Bit 4 - PAGEMATCH_LIMIT"] #[inline(always)] pub fn pagematch_limit(&self) -> PAGEMATCH_LIMIT_R { PAGEMATCH_LIMIT_R::new(((self.bits >> 4) & 0x01) != 0) } #[doc = "Bit 8 - BL_EXP_MODE"] #[inline(always)] pub fn bl_exp_mode(&self) -> BL_EXP_MODE_R { BL_EXP_MODE_R::new(((self.bits >> 8) & 0x01) != 0) } } impl W { #[doc = "Bit 0 - GO2CRITICAL_EN"] #[inline(always)] pub fn go2critical_en(&mut self) -> GO2CRITICAL_EN_W { GO2CRITICAL_EN_W { w: self } } #[doc = "Bit 4 - PAGEMATCH_LIMIT"] #[inline(always)] pub fn pagematch_limit(&mut self) -> PAGEMATCH_LIMIT_W { PAGEMATCH_LIMIT_W { w: self } } #[doc = "Bit 8 - BL_EXP_MODE"] #[inline(always)] pub fn bl_exp_mode(&mut self) -> BL_EXP_MODE_W { BL_EXP_MODE_W { w: self } } }
//! Tests auto-converted from "sass-spec/spec/non_conformant/parser/interpolate/07_comma_list_complex" #[allow(unused)] use super::rsass; // From "sass-spec/spec/non_conformant/parser/interpolate/07_comma_list_complex/01_inline.hrx" #[test] fn t01_inline() { assert_eq!( rsass( ".result {\ \n output: gamma, \"\'\"delta\"\'\";\ \n output: #{gamma, \"\'\"delta\"\'\"};\ \n output: \"[#{gamma, \"\'\"delta\"\'\"}]\";\ \n output: \"#{gamma, \"\'\"delta\"\'\"}\";\ \n output: \'#{gamma, \"\'\"delta\"\'\"}\';\ \n output: \"[\'#{gamma, \"\'\"delta\"\'\"}\']\";\ \n}\ \n" ) .unwrap(), ".result {\ \n output: gamma, \"\'\" delta \"\'\";\ \n output: gamma, \' delta \';\ \n output: \"[gamma, \' delta \']\";\ \n output: \"gamma, \' delta \'\";\ \n output: \"gamma, \' delta \'\";\ \n output: \"[\'gamma, \' delta \'\']\";\ \n}\ \n" ); } // From "sass-spec/spec/non_conformant/parser/interpolate/07_comma_list_complex/02_variable.hrx" #[test] fn t02_variable() { assert_eq!( rsass( "$input: gamma, \"\'\"delta\"\'\";\ \n.result {\ \n output: $input;\ \n output: #{$input};\ \n output: \"[#{$input}]\";\ \n output: \"#{$input}\";\ \n output: \'#{$input}\';\ \n output: \"[\'#{$input}\']\";\ \n}\ \n" ) .unwrap(), ".result {\ \n output: gamma, \"\'\" delta \"\'\";\ \n output: gamma, \' delta \';\ \n output: \"[gamma, \' delta \']\";\ \n output: \"gamma, \' delta \'\";\ \n output: \"gamma, \' delta \'\";\ \n output: \"[\'gamma, \' delta \'\']\";\ \n}\ \n" ); } // From "sass-spec/spec/non_conformant/parser/interpolate/07_comma_list_complex/03_inline_double.hrx" #[test] fn t03_inline_double() { assert_eq!( rsass( ".result {\ \n output: #{#{gamma, \"\'\"delta\"\'\"}};\ \n output: #{\"[#{gamma, \"\'\"delta\"\'\"}]\"};\ \n output: #{\"#{gamma, \"\'\"delta\"\'\"}\"};\ \n output: #{\'#{gamma, \"\'\"delta\"\'\"}\'};\ \n output: #{\"[\'#{gamma, \"\'\"delta\"\'\"}\']\"};\ \n}\ \n" ) .unwrap(), ".result {\ \n output: gamma, \' delta \';\ \n output: [gamma, \' delta \'];\ \n output: gamma, \' delta \';\ \n output: gamma, \' delta \';\ \n output: [\'gamma, \' delta \'\'];\ \n}\ \n" ); } // From "sass-spec/spec/non_conformant/parser/interpolate/07_comma_list_complex/04_variable_double.hrx" #[test] fn t04_variable_double() { assert_eq!( rsass( "$input: gamma, \"\'\"delta\"\'\";\ \n.result {\ \n output: #{#{$input}};\ \n output: #{\"[#{$input}]\"};\ \n output: #{\"#{$input}\"};\ \n output: #{\'#{$input}\'};\ \n output: #{\"[\'#{$input}\']\"};\ \n}\ \n" ) .unwrap(), ".result {\ \n output: gamma, \' delta \';\ \n output: [gamma, \' delta \'];\ \n output: gamma, \' delta \';\ \n output: gamma, \' delta \';\ \n output: [\'gamma, \' delta \'\'];\ \n}\ \n" ); } // From "sass-spec/spec/non_conformant/parser/interpolate/07_comma_list_complex/05_variable_quoted_double.hrx" #[test] fn t05_variable_quoted_double() { assert_eq!( rsass( "$input: gamma, \"\'\"delta\"\'\";\ \n.result {\ \n dquoted: \"#{#{$input}}\";\ \n dquoted: \"#{\"[#{$input}]\"}\";\ \n dquoted: \"#{\"#{$input}\"}\";\ \n dquoted: \"#{\'#{$input}\'}\";\ \n dquoted: \"#{\"[\'#{$input}\']\"}\";\ \n squoted: \'#{#{$input}}\';\ \n squoted: \'#{\"[#{$input}]\"}\';\ \n squoted: \'#{\"#{$input}\"}\';\ \n squoted: \'#{\'#{$input}\'}\';\ \n squoted: \'#{\"[\'#{$input}\']\"}\';\ \n}\ \n" ) .unwrap(), ".result {\ \n dquoted: \"gamma, \' delta \'\";\ \n dquoted: \"[gamma, \' delta \']\";\ \n dquoted: \"gamma, \' delta \'\";\ \n dquoted: \"gamma, \' delta \'\";\ \n dquoted: \"[\'gamma, \' delta \'\']\";\ \n squoted: \"gamma, \' delta \'\";\ \n squoted: \"[gamma, \' delta \']\";\ \n squoted: \"gamma, \' delta \'\";\ \n squoted: \"gamma, \' delta \'\";\ \n squoted: \"[\'gamma, \' delta \'\']\";\ \n}\ \n" ); } // From "sass-spec/spec/non_conformant/parser/interpolate/07_comma_list_complex/06_escape_interpolation.hrx" #[test] fn t06_escape_interpolation() { assert_eq!( rsass( "$input: gamma, \"\'\"delta\"\'\";\ \n.result {\ \n output: \"[\\#{gamma, \"\'\"delta\"\'\"}]\";\ \n output: \"\\#{gamma, \"\'\"delta\"\'\"}\";\ \n output: \'\\#{gamma, \"\'\"delta\"\'\"}\';\ \n output: \"[\'\\#{gamma, \"\'\"delta\"\'\"}\']\";\ \n}\ \n" ) .unwrap(), ".result {\ \n output: \"[#{gamma, \" \'\"delta\"\' \"}]\";\ \n output: \"#{gamma, \" \'\"delta\"\' \"}\";\ \n output: \'#{gamma, \"\' \"delta\" \'\"}\';\ \n output: \"[\'#{gamma, \" \'\"delta\"\' \"}\']\";\ \n}\ \n" ); }
#![feature(proc_macro_hygiene, decl_macro)] #[macro_use] extern crate rocket; #[macro_use] extern crate rocket_contrib; #[macro_use] extern crate serde_json; pub mod utils; pub mod api; use utils::block::Block; use utils::{Conf, BotUser}; use rocket_contrib::json::{Json}; use rocket_contrib::serve::{StaticFiles, Options}; use rocket::config::{Config, Environment}; use rocket::State; use log::{info, warn}; use rocket::request::Form; use std::sync::{Arc, Mutex}; #[derive(Clone)] pub struct BotMessenger { conf: Conf, blocks: Vec<Block>, block_default: Block, static_file: Option<String>, } impl Drop for BotMessenger { fn drop(&mut self) { println!("> Dropping BotMessenger"); } } impl BotMessenger { // New BotMessenger struct pub fn new() -> Self { BotMessenger { conf: Conf::default(), blocks: Vec::new(), block_default: Block::default(), static_file: None, } } // Add conf struct pub fn block(mut self, value: Block) -> Self { let mut block = value; block.set_token(self.get_conf().get_token_fb_page()); self.add_block(block); self } pub fn block_default(mut self, value: Block) -> Self { let mut block = value; block.set_token(self.get_conf().get_token_fb_page()); self.block_default = block; self } // Add user connection pub fn add_user(&mut self, user: BotUser) -> &mut Self { let block_match = self.blocks.iter_mut().find(|x| { x.get_name() == user.get_message().message() }); if let Some(i) = block_match { info!("Message match with block"); i.remove_child(&user); i.root(&user); } else { match self.blocks.iter_mut().enumerate().find(|x| { x.1.find(&user)}) { Some(u) => { info!("Find a user match in block"); u.1.root(&user); }, None => { warn!("Don't match with any of blocks"); self.block_default.root(&user); } } } self } pub fn with_conf(mut self, conf: Conf) -> Self { self.conf = conf; self } pub fn with_token_fb(mut self, token: &str) -> Self { self.conf.set_token_fb_page(token); self.blocks.iter_mut().for_each(|x| x.set_token(token)); self.block_default.set_token(token); self } pub fn with_token_wh(mut self, token: &str) -> Self { self.conf.set_token_webhook(token); self } pub fn with_port(mut self, port: u16) -> Self { self.conf.set_port(port); self } pub fn with_static_file(mut self, file: &str) -> Self{ self.static_file = Some(file.to_string()); self } pub fn rooting_user(&self, user: &BotUser) { } // Launch server rocket pub fn launch(&self) { //let bot = self.clone(); let config = Config::build(Environment::Development) .address(self.get_conf().get_ip()) .port(*self.get_conf().get_port()) .workers(*self.get_conf().get_workers()) .finalize(); let selfy = Arc::new(Mutex::new(self.clone())); //println!("Token {}",selfy.get_conf().get_token_fb_page()); match config { Ok(e) => { let route = format!("/{}",self.get_conf().get_uri()); let mut rocket = rocket::custom(e).manage(selfy).mount(&route,routes![root_connection, root_message]) .mount("/", routes![get_basic]); if self.static_file.is_some() { let s = self.static_file.clone().unwrap(); rocket = rocket.mount("/static", StaticFiles::from(s.as_str())); } rocket.launch(); } Err(e) => panic!("Failed init config : {}", e) } } pub fn get_conf(&self) -> &Conf { &self.conf } pub fn get_conf_mut(&mut self) -> &mut Conf { &mut self.conf } pub fn add_block(&mut self, block: Block){ self.blocks.push(block); } } #[derive(FromForm)] struct FbForm { #[form(field = "hub.verify_token")] verify_token: String, #[form(field = "hub.challenge")] challenge: String, #[form(field = "hub.mode")] mode: String, } // routes #[get("/?<hub..>")] fn root_connection(bot: State<Arc<Mutex<BotMessenger>>>, hub: Form<FbForm>) -> String { let bot = bot.clone(); let bot = bot.lock().unwrap(); if hub.mode == "subscribe" && hub.verify_token == bot.get_conf().get_token_webhook() { let s = hub.challenge.clone(); s } else { "Sorry I don't understand".to_string() } } #[post("/" ,format = "json", data = "<user>")] fn root_message(bot: State<Arc<Mutex<BotMessenger>>> ,user: Json<BotUser>) -> &'static str { let bot = bot.clone(); let bot = &mut bot.lock(); if let Ok(b) = bot { info!("New user: {}",*user); b.add_user(user.clone()); "ok" } else { "Don't understand ?" } } #[get("/")] fn get_basic() -> &'static str { "ok" } #[cfg(test)] mod tests { use crate::BotMessenger; use crate::utils; use crate::api; use utils::block::Block; use utils::block::CartBox; use api::card::Card; use api::card::DefaultAction; use api::card::CardGeneric; use api::card::CardButtons; use api::button::Button; #[test] fn it_works() { BotMessenger::new() .block_default(Block::new("default") .cartBox(CartBox::new() .text("Sorry I don't understand 🐻"))) .block(Block::new("Hello") .cartBox(CartBox::new() .text("Hello new user")) .cartBox(CartBox::new() .text("Hello new user 2")) .cartBox(CartBox::new() .text("Hello new user 3")) .cartBox(CartBox::new() .text("It's a new day") .button_postback("Push", "Hello")) .cartBox(CartBox::new() .card(CardGeneric::new("Hello") .button(Button::new_button_pb("Welcom back Mr potter", "Hello")) .image("https://images.ladepeche.fr/api/v1/images/view/5c34fb833e454650457f60ce/large/image.jpg") .subtitle("Bouyah")) .card(CardGeneric::new("Hello") .button(Button::new_button_pb("Welcom back Mr potter", "Hello")) .image("https://images.ladepeche.fr/api/v1/images/view/5c34fb833e454650457f60ce/large/image.jpg") .subtitle("Bouyah"))) .cartBox(CartBox::new() .card(CardButtons::new("Can you choose !") .button(Button::new_button_url("wake me up", "www.google.fr")) .button(Button::new_button_pb("not me !", "Hello"))))) .block(Block::new("#Start") .cartBox(CartBox::new() .text("New start user"))) .with_token_fb(&std::env::var("TOKEN_FB").unwrap()) .with_token_wh("MamaGuriba") .launch(); } }
use crate::{ datastructures::{ AtomSpatial, AtomSpatial::{PointsTo, LS}, Entailment, Expr, Expr::{Nil, Var}, Formula, Op, Op::{AtomEq, AtomNeq}, Pure, Pure::{And, True}, Rule, Spatial, Spatial::{Emp, SepConj}, }, misc::find_and_remove, }; /// Π[E/x] | Σ[E/x] |- Π'[E/x] | Σ'[E/x] ==> Π ∧ x=E | Σ |- Π' | Σ' pub struct Substitution; impl Substitution { fn subst_impl(subst: &(String, Expr), x: &Expr) -> Expr { match x { Var(v) => { if v.0 == subst.0 { subst.1.clone() } else { Var(v.clone()) } } Nil => Nil, } } fn subst_pure(subst: &(String, Expr), p: &mut Pure) -> Pure { match p { And(pure_sub) => { let pure_vec: Vec<Op> = pure_sub .iter_mut() .map(|x| match x { AtomEq(l, r) => { AtomEq(Self::subst_impl(&subst, l), Self::subst_impl(&subst, r)) } AtomNeq(l, r) => { AtomNeq(Self::subst_impl(&subst, l), Self::subst_impl(&subst, r)) } }) .collect(); And(pure_vec) } True => True, } } fn subst_atom_spatial(subst: &(String, Expr), sp: &mut AtomSpatial) -> AtomSpatial { match sp { PointsTo(v, e) => PointsTo(Self::subst_impl(subst, v), Self::subst_impl(subst, e)), LS(v, e) => LS(Self::subst_impl(subst, v), Self::subst_impl(subst, e)), } } fn subst_spatial(subst: &(String, Expr), sp: &mut Spatial) -> Spatial { match sp { SepConj(atom_spatials) => SepConj( atom_spatials .iter_mut() .map(move |asp| Self::subst_atom_spatial(subst, asp)) .collect::<Vec<AtomSpatial>>(), ), Emp => Emp, } } fn substitute(subst: (String, Expr), goal: Entailment) -> Entailment { let (mut antecedent, mut consequent) = goal.destroy(); let new_pure_ant = Self::subst_pure(&subst, antecedent.get_pure_mut()); let new_spatial_ant = Self::subst_spatial(&subst, antecedent.get_spatial_mut()); let new_pure_cons = Self::subst_pure(&subst, consequent.get_pure_mut()); let new_spatial_cons = Self::subst_spatial(&subst, consequent.get_spatial_mut()); Entailment { antecedent: Formula(new_pure_ant, new_spatial_ant), consequent: Formula(new_pure_cons, new_spatial_cons), } } } impl Rule for Substitution { fn predicate(&self, _goal: &Entailment) -> bool { true } fn premisses(&self, mut goal: Entailment) -> Option<Vec<Entailment>> { if let And(pure_sub) = goal.antecedent.get_pure_mut() { if let Some(elem) = find_and_remove(pure_sub, move |x| x.is_eq()) { let mut subst = ("".to_string(), Nil); if let AtomEq(l, r) = elem { if let Var(v) = l { subst = (v.0, r.clone()); } else if let Var(v) = r { subst = (v.0, l.clone()); } return Some(vec![Self::substitute(subst, goal)]); } } } None } } #[cfg(test)] mod test { use super::Substitution; use crate::datastructures::{ AtomSpatial::{PointsTo, LS}, Entailment, Expr, Expr::Nil, Formula, Op::{AtomEq, AtomNeq}, Pure::And, Rule, Spatial::SepConj, }; #[test] pub fn test_substitute() -> Result<(), String> { let goal = Entailment { antecedent: Formula( And(vec![ AtomEq(Expr::new_var("x"), Nil), AtomNeq(Expr::new_var("y"), Expr::new_var("x")), ]), SepConj(vec![PointsTo(Expr::new_var("y"), Expr::new_var("x"))]), ), consequent: Formula( And(vec![AtomNeq(Expr::new_var("z"), Expr::new_var("x"))]), SepConj(vec![LS(Expr::new_var("x"), Nil)]), ), }; let goal_expected = Entailment { antecedent: Formula( And(vec![AtomNeq(Expr::new_var("y"), Nil)]), SepConj(vec![PointsTo(Expr::new_var("y"), Nil)]), ), consequent: Formula( And(vec![AtomNeq(Expr::new_var("z"), Nil)]), SepConj(vec![LS(Nil, Nil)]), ), }; let premisses = Substitution.premisses(goal); if let Some(prem) = premisses { assert_eq!(1, prem.len()); assert_eq!(goal_expected, prem[0]); Ok(()) } else { Err("Expected third test to succeed!".to_string()) } } }
use std::any::Any; use std::ffi::CString; use std::fs::File; use std::os::raw::{c_char, c_int}; use rustc::middle::cstore::EncodedMetadata; use rustc::mir::mono::{Linkage as RLinkage, Visibility}; use rustc::session::config::{DebugInfo, OutputType}; use rustc_codegen_ssa::back::linker::LinkerInfo; use rustc_codegen_ssa::CrateInfo; use cranelift_faerie::*; use crate::prelude::*; pub fn codegen_crate( tcx: TyCtxt<'_>, metadata: EncodedMetadata, need_metadata_module: bool, ) -> Box<dyn Any> { tcx.sess.abort_if_errors(); let mut log = if cfg!(debug_assertions) { Some(File::create(concat!(env!("CARGO_MANIFEST_DIR"), "/target/out/log.txt")).unwrap()) } else { None }; if std::env::var("SHOULD_RUN").is_ok() && tcx.sess.crate_types.get().contains(&CrateType::Executable) { #[cfg(not(target_arch = "wasm32"))] let _: ! = run_jit(tcx, &mut log); #[cfg(target_arch = "wasm32")] panic!("jit not supported on wasm"); } run_aot(tcx, metadata, need_metadata_module, &mut log) } #[cfg(not(target_arch = "wasm32"))] fn run_jit(tcx: TyCtxt<'_>, log: &mut Option<File>) -> ! { use cranelift_simplejit::{SimpleJITBackend, SimpleJITBuilder}; let imported_symbols = load_imported_symbols_for_jit(tcx); let mut jit_builder = SimpleJITBuilder::with_isa( crate::build_isa(tcx.sess, false), cranelift_module::default_libcall_names(), ); jit_builder.symbols(imported_symbols); let mut jit_module: Module<SimpleJITBackend> = Module::new(jit_builder); assert_eq!(pointer_ty(tcx), jit_module.target_config().pointer_type()); let sig = Signature { params: vec![ AbiParam::new(jit_module.target_config().pointer_type()), AbiParam::new(jit_module.target_config().pointer_type()), ], returns: vec![AbiParam::new( jit_module.target_config().pointer_type(), /*isize*/ )], call_conv: CallConv::SystemV, }; let main_func_id = jit_module .declare_function("main", Linkage::Import, &sig) .unwrap(); codegen_cgus(tcx, &mut jit_module, &mut None, log); crate::allocator::codegen(tcx.sess, &mut jit_module); jit_module.finalize_definitions(); tcx.sess.abort_if_errors(); let finalized_main: *const u8 = jit_module.get_finalized_function(main_func_id); println!("Rustc codegen cranelift will JIT run the executable, because the SHOULD_RUN env var is set"); let f: extern "C" fn(c_int, *const *const c_char) -> c_int = unsafe { ::std::mem::transmute(finalized_main) }; let args = ::std::env::var("JIT_ARGS").unwrap_or_else(|_| String::new()); let args = args .split(" ") .chain(Some(&*tcx.crate_name(LOCAL_CRATE).as_str().to_string())) .map(|arg| CString::new(arg).unwrap()) .collect::<Vec<_>>(); let argv = args.iter().map(|arg| arg.as_ptr()).collect::<Vec<_>>(); // TODO: Rust doesn't care, but POSIX argv has a NULL sentinel at the end let ret = f(args.len() as c_int, argv.as_ptr()); jit_module.finish(); std::process::exit(ret); } fn load_imported_symbols_for_jit(tcx: TyCtxt<'_>) -> Vec<(String, *const u8)> { use rustc::middle::dependency_format::Linkage; let mut dylib_paths = Vec::new(); let crate_info = CrateInfo::new(tcx); let formats = tcx.sess.dependency_formats.borrow(); let data = formats.get(&CrateType::Executable).unwrap(); for &(cnum, _) in &crate_info.used_crates_dynamic { let src = &crate_info.used_crate_source[&cnum]; match data[cnum.as_usize() - 1] { Linkage::NotLinked | Linkage::IncludedFromDylib => {} Linkage::Static => { let name = tcx.crate_name(cnum); let mut err = tcx .sess .struct_err(&format!("Can't load static lib {}", name.as_str())); err.note("rustc_codegen_cranelift can only load dylibs in JIT mode."); err.emit(); } Linkage::Dynamic => { dylib_paths.push(src.dylib.as_ref().unwrap().0.clone()); } } } let mut imported_symbols = Vec::new(); for path in dylib_paths { use object::Object; let lib = libloading::Library::new(&path).unwrap(); let obj = std::fs::read(path).unwrap(); let obj = object::File::parse(&obj).unwrap(); imported_symbols.extend(obj.dynamic_symbols().filter_map(|(_idx, symbol)| { let name = symbol.name().unwrap().to_string(); if name.is_empty() || !symbol.is_global() || symbol.is_undefined() { return None; } let symbol: libloading::Symbol<*const u8> = unsafe { lib.get(name.as_bytes()) }.unwrap(); Some((name, *symbol)) })); std::mem::forget(lib) } tcx.sess.abort_if_errors(); imported_symbols } fn run_aot( tcx: TyCtxt<'_>, metadata: EncodedMetadata, need_metadata_module: bool, log: &mut Option<File>, ) -> Box<CodegenResults> { let new_module = |name: String| { let module: Module<FaerieBackend> = Module::new( FaerieBuilder::new( crate::build_isa(tcx.sess, true), name + ".o", FaerieTrapCollection::Disabled, cranelift_module::default_libcall_names(), ) .unwrap(), ); assert_eq!(pointer_ty(tcx), module.target_config().pointer_type()); module }; let emit_module = |kind: ModuleKind, mut module: Module<FaerieBackend>, debug: Option<DebugContext>| { module.finalize_definitions(); let mut artifact = module.finish().artifact; if let Some(mut debug) = debug { debug.emit(&mut artifact); } let tmp_file = tcx .output_filenames(LOCAL_CRATE) .temp_path(OutputType::Object, Some(&artifact.name)); let obj = artifact.emit().unwrap(); std::fs::write(&tmp_file, obj).unwrap(); CompiledModule { name: artifact.name, kind, object: Some(tmp_file), bytecode: None, bytecode_compressed: None, } }; let mut faerie_module = new_module("some_file".to_string()); let mut debug = if tcx.sess.opts.debuginfo != DebugInfo::None // macOS debuginfo doesn't work yet (see #303) && !tcx.sess.target.target.options.is_like_osx { let debug = DebugContext::new( tcx, faerie_module.target_config().pointer_type().bytes() as u8, ); Some(debug) } else { None }; codegen_cgus(tcx, &mut faerie_module, &mut debug, log); tcx.sess.abort_if_errors(); let mut allocator_module = new_module("allocator_shim".to_string()); let created_alloc_shim = crate::allocator::codegen(tcx.sess, &mut allocator_module); rustc_incremental::assert_dep_graph(tcx); rustc_incremental::save_dep_graph(tcx); rustc_incremental::finalize_session_directory(tcx.sess, tcx.crate_hash(LOCAL_CRATE)); let metadata_module = if need_metadata_module { use rustc::mir::mono::CodegenUnitNameBuilder; let cgu_name_builder = &mut CodegenUnitNameBuilder::new(tcx); let metadata_cgu_name = cgu_name_builder .build_cgu_name(LOCAL_CRATE, &["crate"], Some("metadata")) .as_str() .to_string(); let mut metadata_artifact = faerie::Artifact::new( crate::build_isa(tcx.sess, true).triple().clone(), metadata_cgu_name.clone(), ); crate::metadata::write_metadata(tcx, &mut metadata_artifact); let tmp_file = tcx .output_filenames(LOCAL_CRATE) .temp_path(OutputType::Metadata, Some(&metadata_cgu_name)); let obj = metadata_artifact.emit().unwrap(); std::fs::write(&tmp_file, obj).unwrap(); Some(CompiledModule { name: metadata_cgu_name, kind: ModuleKind::Metadata, object: Some(tmp_file), bytecode: None, bytecode_compressed: None, }) } else { None }; Box::new(CodegenResults { crate_name: tcx.crate_name(LOCAL_CRATE), modules: vec![emit_module( ModuleKind::Regular, faerie_module, debug, )], allocator_module: if created_alloc_shim { Some(emit_module( ModuleKind::Allocator, allocator_module, None, )) } else { None }, metadata_module, crate_hash: tcx.crate_hash(LOCAL_CRATE), metadata, windows_subsystem: None, // Windows is not yet supported linker_info: LinkerInfo::new(tcx), crate_info: CrateInfo::new(tcx), }) } fn codegen_cgus<'tcx>( tcx: TyCtxt<'tcx>, module: &mut Module<impl Backend + 'static>, debug: &mut Option<DebugContext<'tcx>>, log: &mut Option<File>, ) { let (_, cgus) = tcx.collect_and_partition_mono_items(LOCAL_CRATE); let mono_items = cgus .iter() .map(|cgu| cgu.items_in_deterministic_order(tcx).into_iter()) .flatten() .collect::<FxHashMap<_, (_, _)>>(); codegen_mono_items(tcx, module, debug.as_mut(), log, mono_items); crate::main_shim::maybe_create_entry_wrapper(tcx, module); } fn codegen_mono_items<'tcx>( tcx: TyCtxt<'tcx>, module: &mut Module<impl Backend + 'static>, debug_context: Option<&mut DebugContext<'tcx>>, log: &mut Option<File>, mono_items: FxHashMap<MonoItem<'tcx>, (RLinkage, Visibility)>, ) { let mut cx = CodegenCx::new(tcx, module, debug_context); time("codegen mono items", move || { for (mono_item, (linkage, visibility)) in mono_items { crate::unimpl::try_unimpl(tcx, log, || { let linkage = crate::linkage::get_clif_linkage(mono_item, linkage, visibility); trans_mono_item(&mut cx, mono_item, linkage); }); } cx.finalize(); }); } fn trans_mono_item<'clif, 'tcx, B: Backend + 'static>( cx: &mut crate::CodegenCx<'clif, 'tcx, B>, mono_item: MonoItem<'tcx>, linkage: Linkage, ) { let tcx = cx.tcx; match mono_item { MonoItem::Fn(inst) => { let _inst_guard = PrintOnPanic(|| format!("{:?} {}", inst, tcx.symbol_name(inst).name.as_str())); debug_assert!(!inst.substs.needs_infer()); let _mir_guard = PrintOnPanic(|| { match inst.def { InstanceDef::Item(_) | InstanceDef::DropGlue(_, _) | InstanceDef::Virtual(_, _) => { let mut mir = ::std::io::Cursor::new(Vec::new()); crate::rustc_mir::util::write_mir_pretty( tcx, Some(inst.def_id()), &mut mir, ) .unwrap(); String::from_utf8(mir.into_inner()).unwrap() } _ => { // FIXME fix write_mir_pretty for these instances format!("{:#?}", tcx.instance_mir(inst.def)) } } }); crate::base::trans_fn(cx, inst, linkage); } MonoItem::Static(def_id) => { crate::constant::codegen_static(&mut cx.constants_cx, def_id); } MonoItem::GlobalAsm(node_id) => tcx .sess .fatal(&format!("Unimplemented global asm mono item {:?}", node_id)), } } fn time<R>(name: &str, f: impl FnOnce() -> R) -> R { println!("[{}] start", name); let before = std::time::Instant::now(); let res = f(); let after = std::time::Instant::now(); println!("[{}] end time: {:?}", name, after - before); res }
use core::future::Future; #[derive(Copy, Clone, Debug, Eq, PartialEq)] #[cfg_attr(feature = "defmt", derive(defmt::Format))] #[non_exhaustive] pub enum Error { Failed, AddressMisaligned, BufferMisaligned, } pub trait Flash { type ReadFuture<'a>: Future<Output = Result<(), Error>> where Self: 'a; type WriteFuture<'a>: Future<Output = Result<(), Error>> where Self: 'a; type ErasePageFuture<'a>: Future<Output = Result<(), Error>> where Self: 'a; /// Reads data from the flash device. /// /// address must be a multiple of self.read_size(). /// buf.len() must be a multiple of self.read_size(). fn read<'a>(&'a mut self, address: usize, buf: &'a mut [u8]) -> Self::ReadFuture<'a>; /// Writes data to the flash device. /// /// address must be a multiple of self.write_size(). /// buf.len() must be a multiple of self.write_size(). fn write<'a>(&'a mut self, address: usize, buf: &'a [u8]) -> Self::WriteFuture<'a>; /// Erases a single page from the flash device. /// /// address must be a multiple of self.erase_size(). fn erase<'a>(&'a mut self, address: usize) -> Self::ErasePageFuture<'a>; /// Returns the total size, in bytes. /// This is not guaranteed to be a power of 2. fn size(&self) -> usize; /// Returns the read size in bytes. /// This is guaranteed to be a power of 2. fn read_size(&self) -> usize; /// Returns the write size in bytes. /// This is guaranteed to be a power of 2. fn write_size(&self) -> usize; /// Returns the erase size in bytes. /// This is guaranteed to be a power of 2. fn erase_size(&self) -> usize; }
use rusqlite::{params, Connection, Result}; #[derive(Debug)] struct User { id: i32, name: String, age: i32, } fn main1() -> Result<()> { // インメモリーデータベースの作成 let cn = Connection::open_in_memory()?; // テーブル作成とデータ挿入 cn.execute_batch( " CREATE TABLE users (id INTEGER, name TEXT, age INTEGER) ; INSERT INTO users (id, name, age) VALUES (1, 'Kongo', 20) ; INSERT INTO users (id, name, age) VALUES (2, 'Hieai', 20) ; INSERT INTO users (id, name, age) VALUES (3, 'Haruna', 18) ; INSERT INTO users (id, name, age) VALUES (4, 'Kirishima', 15) ; " )? ; // クエリの作成 let mut stmt = cn.prepare("SELECT * FROM users WHERE age > 15")? ; let iter = stmt.query_map(params![], |row| { Ok(User{ id: row.get(0)?, name: row.get(1)?, age: row.get(2)?, }) })?; // データを取得 for it in iter { println!("user is {:?}", it.unwrap()); } Ok(()) } fn main() -> Result<()> { // インメモリーデータベースの作成 let cn = Connection::open_in_memory()?; // テーブル作成とデータ挿入 cn.execute_batch( " CREATE TABLE users (id INTEGER, name TEXT, age INTEGER) ; INSERT INTO users (id, name, age) VALUES (1, 'Kongo', 20) ; INSERT INTO users (id, name, age) VALUES (2, 'Hieai', 20) ; INSERT INTO users (id, name, age) VALUES (3, 'Haruna', 18) ; INSERT INTO users (id, name, age) VALUES (4, 'Kirishima', 15) ; " )? ; // クエリの作成 let mut stmt = cn.prepare("SELECT * FROM users WHERE age > 15")? ; let mut rows = stmt.query(params![])?; while let Some(row) = rows.next()? { let it = User { id: row.get(0)?, name: row.get(1)?, age: row.get(2)?, }; println!("it is {:?}", it ); } Ok(()) } fn main3() -> Result<()> { // インメモリーデータベースの作成 let cn = Connection::open_in_memory()?; // テーブル作成 cn.execute("CREATE TABLE users (id INTEGER, name TEXT, age INTEGER)", params![] )?; // データ挿入 let mut stmt = cn.prepare("INSERT INTO users (id, name, age) VALUES (?1, ?2, ?3)")?; stmt.execute(params![1, "Kongo", 20 ])?; stmt.execute(params![2, "Hieai", 20 ])?; stmt.execute(params![3, "Haruna", 18 ])?; stmt.execute(params![4, "Kirishima", 15 ])?; // クエリの作成 let mut stmt = cn.prepare("SELECT * FROM users WHERE age > ?")? ; let iter = stmt.query_map(params![15], |row| { Ok(User{ id: row.get(0)?, name: row.get(1)?, age: row.get(2)?, }) })?; // データを取得 for it in iter { println!("user is {:?}", it.unwrap()); } Ok(()) }
// This file is part of Substrate. // Copyright (C) 2017-2020 Parity Technologies (UK) Ltd. // SPDX-License-Identifier: Apache-2.0 // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. //! Parsing of decl_storage input. use frame_support_procedural_tools::{syn_ext as ext, Parse, ToTokens}; use syn::{spanned::Spanned, Ident, Token}; mod keyword { syn::custom_keyword!(hiddencrate); syn::custom_keyword!(add_extra_genesis); syn::custom_keyword!(extra_genesis_skip_phantom_data_field); syn::custom_keyword!(config); syn::custom_keyword!(build); syn::custom_keyword!(get); syn::custom_keyword!(map); syn::custom_keyword!(double_map); syn::custom_keyword!(opaque_blake2_256); syn::custom_keyword!(opaque_blake2_128); syn::custom_keyword!(blake2_128_concat); syn::custom_keyword!(opaque_twox_256); syn::custom_keyword!(opaque_twox_128); syn::custom_keyword!(twox_64_concat); syn::custom_keyword!(identity); syn::custom_keyword!(hasher); syn::custom_keyword!(tainted); syn::custom_keyword!(natural); syn::custom_keyword!(prehashed); } /// Specific `Opt` to implement structure with optional parsing #[derive(Debug, Clone)] pub struct Opt<P> { pub inner: Option<P>, } impl<P: syn::export::ToTokens> syn::export::ToTokens for Opt<P> { fn to_tokens(&self, tokens: &mut proc_macro2::TokenStream) { if let Some(ref p) = self.inner { p.to_tokens(tokens); } } } macro_rules! impl_parse_for_opt { ($struct:ident => $token:path) => { impl syn::parse::Parse for Opt<$struct> { fn parse(input: syn::parse::ParseStream) -> syn::parse::Result<Self> { if input.peek($token) { input.parse().map(|p| Opt { inner: Some(p) }) } else { Ok(Opt { inner: None }) } } } }; } /// Parsing usage only #[derive(Parse, ToTokens, Debug)] struct StorageDefinition { pub hidden_crate: Opt<SpecificHiddenCrate>, pub visibility: syn::Visibility, pub trait_token: Token![trait], pub ident: Ident, pub for_token: Token![for], pub module_ident: Ident, pub mod_lt_token: Token![<], pub mod_param_generic: syn::Ident, pub mod_param_bound_token: Option<Token![:]>, pub mod_param_bound: syn::Path, pub mod_instance_param_token: Option<Token![,]>, pub mod_instance: Option<syn::Ident>, pub mod_instantiable_token: Option<Token![:]>, pub mod_instantiable: Option<syn::Ident>, pub mod_default_instance_token: Option<Token![=]>, pub mod_default_instance: Option<syn::Ident>, pub mod_gt_token: Token![>], pub as_token: Token![as], pub crate_ident: Ident, pub where_clause: Option<syn::WhereClause>, pub content: ext::Braces<ext::Punctuated<DeclStorageLine, Token![;]>>, pub extra_genesis: Opt<AddExtraGenesis>, } #[derive(Parse, ToTokens, Debug)] struct SpecificHiddenCrate { pub keyword: keyword::hiddencrate, pub ident: ext::Parens<Ident>, } impl_parse_for_opt!(SpecificHiddenCrate => keyword::hiddencrate); #[derive(Parse, ToTokens, Debug)] struct AddExtraGenesis { pub extragenesis_keyword: keyword::add_extra_genesis, pub content: ext::Braces<AddExtraGenesisContent>, } impl_parse_for_opt!(AddExtraGenesis => keyword::add_extra_genesis); #[derive(Parse, ToTokens, Debug)] struct AddExtraGenesisContent { pub lines: ext::Punctuated<AddExtraGenesisLineEnum, Token![;]>, } #[derive(ToTokens, Debug)] enum AddExtraGenesisLineEnum { AddExtraGenesisLine(AddExtraGenesisLine), AddExtraGenesisBuild(DeclStorageBuild), } impl syn::parse::Parse for AddExtraGenesisLineEnum { fn parse(input: syn::parse::ParseStream) -> syn::parse::Result<Self> { let input_fork = input.fork(); // OuterAttributes are forbidden for build variant, // However to have better documentation we match against the keyword after those attributes. let _: ext::OuterAttributes = input_fork.parse()?; let lookahead = input_fork.lookahead1(); if lookahead.peek(keyword::build) { Ok(Self::AddExtraGenesisBuild(input.parse()?)) } else if lookahead.peek(keyword::config) { Ok(Self::AddExtraGenesisLine(input.parse()?)) } else { Err(lookahead.error()) } } } #[derive(Parse, ToTokens, Debug)] struct AddExtraGenesisLine { pub attrs: ext::OuterAttributes, pub config_keyword: keyword::config, pub extra_field: ext::Parens<Ident>, pub coldot_token: Token![:], pub extra_type: syn::Type, pub default_value: Opt<DeclStorageDefault>, } #[derive(Parse, ToTokens, Debug)] struct DeclStorageLine { // attrs (main use case is doc) pub attrs: ext::OuterAttributes, // visibility (no need to make optional pub visibility: syn::Visibility, // name pub name: Ident, pub getter: Opt<DeclStorageGetter>, pub config: Opt<DeclStorageConfig>, pub build: Opt<DeclStorageBuild>, pub coldot_token: Token![:], pub storage_type: DeclStorageType, pub default_value: Opt<DeclStorageDefault>, } #[derive(Parse, ToTokens, Debug)] struct DeclStorageGetterBody { fn_keyword: Token![fn], ident: Ident, } #[derive(Parse, ToTokens, Debug)] struct DeclStorageGetter { pub getter_keyword: keyword::get, pub getfn: ext::Parens<DeclStorageGetterBody>, } impl_parse_for_opt!(DeclStorageGetter => keyword::get); #[derive(Parse, ToTokens, Debug)] struct DeclStorageConfig { pub config_keyword: keyword::config, pub expr: ext::Parens<Option<syn::Ident>>, } impl_parse_for_opt!(DeclStorageConfig => keyword::config); #[derive(Parse, ToTokens, Debug)] struct DeclStorageBuild { pub build_keyword: keyword::build, pub expr: ext::Parens<syn::Expr>, } impl_parse_for_opt!(DeclStorageBuild => keyword::build); #[derive(ToTokens, Debug)] enum DeclStorageType { Map(DeclStorageMap), DoubleMap(Box<DeclStorageDoubleMap>), Simple(syn::Type), } impl syn::parse::Parse for DeclStorageType { fn parse(input: syn::parse::ParseStream) -> syn::parse::Result<Self> { if input.peek(keyword::map) { Ok(Self::Map(input.parse()?)) } else if input.peek(keyword::double_map) { Ok(Self::DoubleMap(input.parse()?)) } else { Ok(Self::Simple(input.parse()?)) } } } #[derive(Parse, ToTokens, Debug)] struct DeclStorageMap { pub map_keyword: keyword::map, pub hasher: Opt<SetHasher>, pub key: syn::Type, pub ass_keyword: Token![=>], pub value: syn::Type, } #[derive(Parse, ToTokens, Debug)] struct DeclStorageDoubleMap { pub map_keyword: keyword::double_map, pub hasher1: Opt<SetHasher>, pub key1: syn::Type, pub comma_keyword: Token![,], pub hasher2: Opt<SetHasher>, pub key2: syn::Type, pub ass_keyword: Token![=>], pub value: syn::Type, } #[derive(ToTokens, Debug)] enum Hasher { Blake2_256(keyword::opaque_blake2_256), Blake2_128(keyword::opaque_blake2_128), Blake2_128Concat(keyword::blake2_128_concat), Twox256(keyword::opaque_twox_256), Twox128(keyword::opaque_twox_128), Twox64Concat(keyword::twox_64_concat), Identity(keyword::identity), } impl syn::parse::Parse for Hasher { fn parse(input: syn::parse::ParseStream) -> syn::parse::Result<Self> { let lookahead = input.lookahead1(); if lookahead.peek(keyword::opaque_blake2_256) { Ok(Self::Blake2_256(input.parse()?)) } else if lookahead.peek(keyword::opaque_blake2_128) { Ok(Self::Blake2_128(input.parse()?)) } else if lookahead.peek(keyword::blake2_128_concat) { Ok(Self::Blake2_128Concat(input.parse()?)) } else if lookahead.peek(keyword::opaque_twox_256) { Ok(Self::Twox256(input.parse()?)) } else if lookahead.peek(keyword::opaque_twox_128) { Ok(Self::Twox128(input.parse()?)) } else if lookahead.peek(keyword::twox_64_concat) { Ok(Self::Twox64Concat(input.parse()?)) } else if lookahead.peek(keyword::identity) { Ok(Self::Identity(input.parse()?)) } else if lookahead.peek(keyword::tainted) { Ok(Self::Blake2_128Concat(input.parse()?)) } else if lookahead.peek(keyword::natural) { Ok(Self::Twox64Concat(input.parse()?)) } else if lookahead.peek(keyword::prehashed) { Ok(Self::Identity(input.parse()?)) } else { Err(lookahead.error()) } } } #[derive(Parse, ToTokens, Debug)] struct DeclStorageDefault { pub equal_token: Token![=], pub expr: syn::Expr, } impl syn::parse::Parse for Opt<DeclStorageDefault> { fn parse(input: syn::parse::ParseStream) -> syn::parse::Result<Self> { if input.peek(Token![=]) { input.parse().map(|p| Opt { inner: Some(p) }) } else { Ok(Opt { inner: None }) } } } #[derive(Parse, ToTokens, Debug)] struct SetHasher { pub hasher_keyword: keyword::hasher, pub inner: ext::Parens<Hasher>, } impl_parse_for_opt!(SetHasher => keyword::hasher); impl From<SetHasher> for super::HasherKind { fn from(set_hasher: SetHasher) -> Self { set_hasher.inner.content.into() } } impl From<Hasher> for super::HasherKind { fn from(hasher: Hasher) -> Self { match hasher { Hasher::Blake2_256(_) => super::HasherKind::Blake2_256, Hasher::Blake2_128(_) => super::HasherKind::Blake2_128, Hasher::Blake2_128Concat(_) => super::HasherKind::Blake2_128Concat, Hasher::Twox256(_) => super::HasherKind::Twox256, Hasher::Twox128(_) => super::HasherKind::Twox128, Hasher::Twox64Concat(_) => super::HasherKind::Twox64Concat, Hasher::Identity(_) => super::HasherKind::Identity, } } } fn get_module_instance( instance: Option<syn::Ident>, instantiable: Option<syn::Ident>, default_instance: Option<syn::Ident>, ) -> syn::Result<Option<super::ModuleInstanceDef>> { let right_syntax = "Should be $I: $Instance = $DefaultInstance"; if instantiable.as_ref().map_or(false, |i| i != "Instance") { let msg = format!( "Instance trait must be named `Instance`, other names are no longer supported, because \ it is now defined at frame_support::traits::Instance. Expect `Instance` found `{}`", instantiable.as_ref().unwrap(), ); return Err(syn::Error::new(instantiable.span(), msg)) } match (instance, instantiable, default_instance) { (Some(instance), Some(instantiable), default_instance) => Ok(Some(super::ModuleInstanceDef { instance_generic: instance, instance_trait: instantiable, instance_default: default_instance, })), (None, None, None) => Ok(None), (Some(instance), None, _) => Err(syn::Error::new( instance.span(), format!("Expect instantiable trait bound for instance: {}. {}", instance, right_syntax,), )), (None, Some(instantiable), _) => Err(syn::Error::new( instantiable.span(), format!( "Expect instance generic for bound instantiable: {}. {}", instantiable, right_syntax, ), )), (None, _, Some(default_instance)) => Err(syn::Error::new( default_instance.span(), format!( "Expect instance generic for default instance: {}. {}", default_instance, right_syntax, ), )), } } pub fn parse(input: syn::parse::ParseStream) -> syn::Result<super::DeclStorageDef> { use syn::parse::Parse; let def = StorageDefinition::parse(input)?; let module_instance = get_module_instance(def.mod_instance, def.mod_instantiable, def.mod_default_instance)?; let mut extra_genesis_config_lines = vec![]; let mut extra_genesis_build = None; for line in def.extra_genesis.inner.into_iter().flat_map(|o| o.content.content.lines.inner.into_iter()) { match line { AddExtraGenesisLineEnum::AddExtraGenesisLine(def) => { extra_genesis_config_lines.push(super::ExtraGenesisLineDef { attrs: def.attrs.inner, name: def.extra_field.content, typ: def.extra_type, default: def.default_value.inner.map(|o| o.expr), }); }, AddExtraGenesisLineEnum::AddExtraGenesisBuild(def) => { if extra_genesis_build.is_some() { return Err(syn::Error::new( def.span(), "Only one build expression allowed for extra genesis", )) } extra_genesis_build = Some(def.expr.content); }, } } let storage_lines = parse_storage_line_defs(def.content.content.inner.into_iter())?; Ok(super::DeclStorageDef { hidden_crate: def.hidden_crate.inner.map(|i| i.ident.content), visibility: def.visibility, module_name: def.module_ident, store_trait: def.ident, module_runtime_generic: def.mod_param_generic, module_runtime_trait: def.mod_param_bound, where_clause: def.where_clause, crate_name: def.crate_ident, module_instance, extra_genesis_build, extra_genesis_config_lines, storage_lines, }) } /// Parse the `DeclStorageLine` into `StorageLineDef`. fn parse_storage_line_defs( defs: impl Iterator<Item = DeclStorageLine>, ) -> syn::Result<Vec<super::StorageLineDef>> { let mut storage_lines = Vec::<super::StorageLineDef>::new(); for line in defs { let getter = line.getter.inner.map(|o| o.getfn.content.ident); let config = if let Some(config) = line.config.inner { if let Some(ident) = config.expr.content { Some(ident) } else if let Some(ref ident) = getter { Some(ident.clone()) } else { return Err(syn::Error::new( config.span(), "Invalid storage definition, couldn't find config identifier: storage must \ either have a get identifier `get(fn ident)` or a defined config identifier \ `config(ident)`", )) } } else { None }; if let Some(ref config) = config { storage_lines.iter().filter_map(|sl| sl.config.as_ref()).try_for_each( |other_config| { if other_config == config { Err(syn::Error::new( config.span(), "`config()`/`get()` with the same name already defined.", )) } else { Ok(()) } }, )?; } let span = line.storage_type.span(); let no_hasher_error = || { syn::Error::new( span, "Default hasher has been removed, use explicit hasher(blake2_128_concat) instead.", ) }; let storage_type = match line.storage_type { DeclStorageType::Map(map) => super::StorageLineTypeDef::Map(super::MapDef { hasher: map.hasher.inner.ok_or_else(no_hasher_error)?.into(), key: map.key, value: map.value, }), DeclStorageType::DoubleMap(map) => super::StorageLineTypeDef::DoubleMap(Box::new(super::DoubleMapDef { hasher1: map.hasher1.inner.ok_or_else(no_hasher_error)?.into(), hasher2: map.hasher2.inner.ok_or_else(no_hasher_error)?.into(), key1: map.key1, key2: map.key2, value: map.value, })), DeclStorageType::Simple(expr) => super::StorageLineTypeDef::Simple(expr), }; storage_lines.push(super::StorageLineDef { attrs: line.attrs.inner, visibility: line.visibility, name: line.name, getter, config, build: line.build.inner.map(|o| o.expr.content), default_value: line.default_value.inner.map(|o| o.expr), storage_type, }) } Ok(storage_lines) }
extern crate rand; extern crate sha2; extern crate ed25519_dalek as dalek; extern crate pbp; use rand::OsRng; use sha2::{Sha256, Sha512}; use dalek::Keypair; use pbp::{PgpKey, KeyFlags}; fn main() { let mut cspring = OsRng::new().unwrap(); let keypair = Keypair::generate::<Sha512>(&mut cspring); let key = PgpKey::from_dalek::<Sha256, Sha512>(&keypair, KeyFlags::NONE, "withoutboats"); println!("{}", key); }
//! Leetcode-cil plugins //! //! + chrome cookie parser //! + leetcode API //! //! ## login to `leetcode.com` //! Leetcode-cli use chrome cookie directly, do not need to login, please make sure you have loggined in `leetcode.com` before usnig `leetcode-cli` //! // FIXME: Read cookies from local storage. (issue #122) mod chrome; mod leetcode; pub use leetcode::LeetCode;
//! The Styx [`Visitor`] trait, and implementations. use prelude::*; use expr::BuiltIns; use typesystem::TyParameters; /// A structure that can go through an expression tree in order to visit it immutably, /// or mutably. pub trait Visitor<T> { /// Visits the given expression, returning an object of type `T`. fn visit(&mut self, expr: &Expr) -> T; /// Mutably visits the given expression, optionally rewriting it and its children, /// and returning an object of type `T`. fn rewrite(&mut self, expr: &mut Expr) -> T; /// Visits the children of the given expression. fn visit_children(&mut self, expr: &Expr) -> Vec<T> { let childc = expr.child_count(); let mut vec = Vec::with_capacity(childc); for i in 0..childc { vec.push(self.visit(expr.child(i).unwrap())) } vec } /// Rewrites the children of the given expression. fn rewrite_children(&mut self, expr: &mut Expr) -> Vec<T> { let childc = expr.child_count(); let mut vec = Vec::with_capacity(childc); for i in 0..childc { vec.push(self.rewrite(expr.mut_child(i).unwrap())) } vec } } /// A `Visitor` that verifies that an expression tree can be emitted. pub struct Verifier<'a, 'cx: 'a> { #[allow(dead_code)] diagnostics: Diags<'a>, #[allow(dead_code)] parameters: &'a TyParameters<'a, 'cx>, invalid: bool } impl<'a, 'cx> Verifier<'a, 'cx> { /// Creates a new verifying visitor, given the generic parameters used in this context. pub fn new(diagnostics: Diags<'a>, parameters: &'a TyParameters<'a, 'cx>) -> Self { Verifier { diagnostics, parameters, invalid: false } } /// Returns whether the visited expression was valid, and can thus be compiled. pub fn is_valid(&self) -> bool { !self.invalid } } impl<'a, 'cx> Visitor<()> for Verifier<'a, 'cx> { fn visit(&mut self, _expr: &Expr) -> () { } fn rewrite(&mut self, expr: &mut Expr) -> () { self.visit(expr) } } /// A [`Visitor`] that inlines method calls in an expression tree. /// /// # Note /// This type only inlines calls at the *expression* level, but not at the IR level. /// /// # Panics /// This type assumes that the given expressions have been verified and are valid. /// If an invalid expression is encountered, a panic will take place. /// /// Additionally, expression trees can only be mutably visited (using [`Visitor::rewrite`]). pub struct Inliner<'a, 'cx: 'a> { #[allow(dead_code)] parameters: &'a TyParameters<'a, 'cx> } impl<'a, 'cx> Inliner<'a, 'cx> { /// Creates a new inlining visitor, given the generic parameters used in this context. pub fn new(parameters: &'a TyParameters<'a, 'cx>) -> Self { Inliner { parameters } } } impl<'a, 'cx> Visitor<()> for Inliner<'a, 'cx> { fn visit(&mut self, _: &Expr) -> () { panic!("Inliner cannot visit immutable expressions.") } fn rewrite(&mut self, expr: &mut Expr) -> () { if expr.expr_ty() != BuiltIns::call() { return } } } /// A closure-invoking [`Visitor`]. pub struct ClosureVisitor<'a, T: 'a> { closure: &'a Fn(&mut ClosureVisitor<'a, T>, &Expr) -> T } impl<'a, T> ClosureVisitor<'a, T> { /// Creates a new closure-based visitor, given the closure to invoke on all expressions. pub fn new(visit: &'a Fn(&mut Self, &Expr) -> T) -> Self { ClosureVisitor { closure: visit } } } impl<'a, T> Visitor<T> for ClosureVisitor<'a, T> { fn visit(&mut self, expr: &Expr) -> T { (self.closure)(self, expr) } fn rewrite(&mut self, expr: &mut Expr) -> T { (self.closure)(self, expr) } }
use serde::{Deserialize, Serialize}; use super::{data, extended_identifiers::ExtendedIdentifiers, geo::Geo}; #[derive(Serialize, Deserialize, Debug, PartialEq)] pub struct User { id: Option<String>, buyeruid: Option<String>, yob: Option<u32>, gender: Option<String>, keywords: Option<String>, consent: Option<String>, geo: Option<Geo>, data: Option<data::Data>, eids: Option<ExtendedIdentifiers>, ext: Option<UserExt>, } #[derive(Serialize, Deserialize, Debug, PartialEq)] pub struct UserExt {}
use spirv_builder::{MemoryModel, SpirvBuilder}; fn main() -> anyhow::Result<()> { let result = SpirvBuilder::new("shader") .spirv_version(1, 0) .memory_model(MemoryModel::GLSL450) .print_metadata(false) .build_multimodule()?; let directory = result .values() .next() .and_then(|path| path.parent()) .unwrap(); println!("cargo:rustc-env=spv={}", directory.to_str().unwrap()); Ok(()) }
fn main() { let mut number = 12; println!("{}", number); number = 53; println!("{}", number); }
#[macro_use] extern crate raui_core; mod app; mod ui; use crate::app::App; use ggez::{event, ContextBuilder}; fn main() { let resource_dir = if let Ok(manifest_dir) = std::env::var("CARGO_MANIFEST_DIR") { let mut path = std::path::PathBuf::from(manifest_dir); path.push("resources"); path } else { std::path::PathBuf::from("./resources") }; let (mut ctx, mut event_loop) = ContextBuilder::new("In-Game Demo", "Cool Game Author") .add_resource_path(resource_dir) .window_mode( ggez::conf::WindowMode::default() .resizable(true) .maximized(false), ) .build() .expect("Could not create GGEZ context"); let mut app = App::new(&mut ctx); if let Err(error) = event::run(&mut ctx, &mut event_loop, &mut app) { println!("Error: {}", error); } }
//! # Line use derive_getters::Getters; use cgmath::{Point3, Vector3, BaseFloat}; /// Line stored as the line equation. #[derive(Debug, Clone, Getters)] pub struct Line<S: BaseFloat> { point: Point3<S>, vector: Vector3<S>, } impl<S: BaseFloat> Line<S> { pub fn new(point: Point3<S>, vector: Vector3<S>) -> Self { Line { point, vector } } } /* impl<S: BaseFloat> From<(Point3<S>, Point3<S>)> for Line<S> { fn from(t: (Point3<S>, Point3<S>)) -> Self { Line::new(t.0, t.1) } } */
// // Copyright 2021 The Project Oak Authors // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. // //! Test utilities to help with unit testing of Oak-Functions SDK code. use anyhow::Context; use log::info; use std::{path::PathBuf, process::Command}; // TODO(#1965): Move this and the similar function in `oak/sdk` to a common crate. /// Uses cargo to compile a Rust manifest to Wasm bytes. pub fn compile_rust_wasm( manifest_path: &str, module_wasm_file_name: &str, ) -> anyhow::Result<Vec<u8>> { let mut module_path = PathBuf::from(manifest_path); module_path.pop(); module_path.push("bin"); let args = vec![ // `--out-dir` is unstable and requires `-Zunstable-options`. "-Zunstable-options".to_string(), "build".to_string(), "--release".to_string(), "--target=wasm32-unknown-unknown".to_string(), format!("--manifest-path={}", manifest_path), // Use a fixed target directory, because `--target-dir` influences SHA256 hash // of Wasm module. Target directory should also be synchronized with // `--target-dir` used in [`oak_tests::compile_rust_wasm`] in order to have // same SHA256 hashes. format!("--target-dir={}", { let mut target_dir = PathBuf::from(manifest_path); target_dir.pop(); target_dir.push("target"); target_dir.to_str().expect("Invalid target dir").to_string() }), format!( "--out-dir={}", module_path .to_str() .expect("Invalid target dir") .to_string() ), ]; Command::new("cargo") .args(args) .env_remove("RUSTFLAGS") .spawn() .context("Couldn't spawn cargo build")? .wait() .context("Couldn't wait for cargo build to finish")?; module_path.push(module_wasm_file_name); info!("Compiled Wasm module path: {:?}", module_path); std::fs::read(module_path).context("Couldn't read compiled module") }
mod decoder; mod values; mod types; mod instructions; pub mod modules;
use crate::error::{ViuError, ViuResult}; use crate::printer::Printer; use crate::Config; use image::DynamicImage; use image::GenericImageView; use lazy_static::lazy_static; use std::env; use std::io::{Read, Write}; pub struct SixelPrinter {} impl Printer for SixelPrinter { fn print(&self, img: &DynamicImage, _config: &Config) -> ViuResult<(u32, u32)> { print_sixel(img) } } fn print_sixel(img: &image::DynamicImage) -> ViuResult<(u32, u32)> { use sixel::encoder::{Encoder, QuickFrameBuilder}; use sixel::optflags::EncodePolicy; let (x_pixles, y_pixels) = img.dimensions(); let rgba = img.to_rgba8(); let raw = rgba.as_raw(); let encoder = Encoder::new()?; encoder.set_encode_policy(EncodePolicy::Fast)?; let frame = QuickFrameBuilder::new() .width(x_pixles as usize) .height(y_pixels as usize) .format(sixel_sys::PixelFormat::RGBA8888) .pixels(raw.to_vec()); encoder.encode_bytes(frame)?; // No end of line printed by encoder let mut stdout = std::io::stdout(); stdout.flush()?; let y_pixel_size = get_pixel_size(); let small_y_pixels = y_pixels as u16; Ok(( x_pixles, if y_pixel_size <= 0 { 5000 } else { (small_y_pixels / y_pixel_size + 1) as u32 }, )) } #[cfg(windows)] fn get_pixel_size() -> u16 { 0 } #[cfg(unix)] #[derive(Debug)] #[repr(C)] struct winsize { ws_row: libc::c_ushort, ws_col: libc::c_ushort, ws_xpixel: libc::c_ushort, ws_ypixel: libc::c_ushort, } #[cfg(unix)] fn get_pixel_size() -> u16 { #[cfg(any(target_os = "macos", target_os = "freebsd"))] const TIOCGWINSZ: libc::c_ulong = 0x40087468; #[cfg(any(target_os = "linux", target_os = "android"))] const TIOCGWINSZ: libc::c_ulong = 0x5413; let size_out = winsize { ws_row: 0, ws_col: 0, ws_xpixel: 0, ws_ypixel: 0, }; unsafe { if libc::ioctl(1, TIOCGWINSZ, &size_out) != 0 { return 0; } } if size_out.ws_ypixel <= 0 || size_out.ws_row <= 0 { return 0; } size_out.ws_ypixel / size_out.ws_row } impl std::convert::From<sixel::status::Error> for crate::error::ViuError { fn from(e: sixel::status::Error) -> Self { ViuError::SixelError(e) } } lazy_static! { static ref SIXEL_SUPPORT: SixelSupport = check_sixel_support(); } /// Returns the terminal's support for the Kitty graphics protocol. pub fn get_sixel_support() -> SixelSupport { *SIXEL_SUPPORT } #[derive(PartialEq, Copy, Clone)] /// The extend to which the Kitty graphics protocol can be used. pub enum SixelSupport { /// The Sixel graphics protocol is not supported. None, /// The Sixel graphics protocol is supported. Supported, } ///TODO check for sixel support on windows #[cfg(windows)] fn xterm_check_sixel_support() -> Result<SixelSupport, std::io::Error> { SixelSupport::None } // Parsing the escape code sequence // see // http://www.ecma-international.org/publications/files/ECMA-ST/Ecma-048.pdf // section 5.4.2 // about parsing Parameter string format // and section // and 8.3.16 for the definition of CSI (spoiler alert, it's Escape [) // Note: In ECMA-048 docs, 05/11 is the same as 0x5B which is the hex ascii code for [ // And see // https://invisible-island.net/xterm/ctlseqs/ctlseqs.html#h3-Functions-using-CSI-_-ordered-by-the-final-character_s_ // CSI Ps c Send Device Attributes (Primary DA). enum XTERMSupportParserState { ExpectCSIESC, ExpectCSIOpenBracket, ExpectQuestionMark, ParseParameter, ParseParameterNotFour, ParseParameterMightBeFour, InvalidState, FoundFour, } #[cfg(unix)] fn xterm_check_sixel_support() -> Result<SixelSupport, std::io::Error> { use std::fs::write; use std::io::stdin; use termios::*; //STDOUT_FILENO let file_descriptor = 1; let mut term_info = Termios::from_fd(file_descriptor)?; let old_iflag = term_info.c_iflag; let old_lflag = term_info.c_lflag; //setup the terminal so that it will send the device attributes //to stdin rather than writing them to the screen term_info.c_iflag &= !(ISTRIP); term_info.c_iflag &= !(INLCR); term_info.c_iflag &= !(ICRNL); term_info.c_iflag &= !(IGNCR); term_info.c_iflag &= !(IXOFF); term_info.c_lflag &= !(ECHO); term_info.c_lflag &= !(ICANON); tcsetattr(file_descriptor, TCSANOW, &mut term_info)?; //Send Device Attributes // see https://invisible-island.net/xterm/ctlseqs/ctlseqs.html#h3-Functions-using-CSI-_-ordered-by-the-final-character_s_ write("/dev/tty", "\x1b[0c")?; let mut std_in_buffer: [u8; 256] = [0; 256]; let size_read = stdin().read(&mut std_in_buffer)?; let mut state = XTERMSupportParserState::ExpectCSIESC; for i in 0..size_read { let current_char = std_in_buffer[i]; use XTERMSupportParserState::{ ExpectCSIESC, ExpectCSIOpenBracket, ExpectQuestionMark, FoundFour, InvalidState, ParseParameter, ParseParameterMightBeFour, ParseParameterNotFour, }; match state { ExpectCSIESC => { //ascii for ESC if current_char != 27 { state = InvalidState; break; } state = ExpectCSIOpenBracket; } ExpectCSIOpenBracket => { //ascii for [ if current_char != 91 { state = InvalidState; break; } state = ExpectQuestionMark; } ExpectQuestionMark => { //ascii for ? if current_char != 63 { state = InvalidState; break; } state = ParseParameter; } //ascii for 4 ParseParameter => { state = if current_char != 52 { ParseParameterNotFour } else { ParseParameterMightBeFour } } //ascii for ; which is the separator ParseParameterNotFour => { state = if current_char != 59 { ParseParameterNotFour } else { ParseParameter } } //59 is ascii for ; which is the separator and // 99 is ascii for c which marks the end of the phrase ParseParameterMightBeFour => { if current_char == 59 || current_char == 99 { state = FoundFour; break; } state = ParseParameterNotFour; } InvalidState => break, FoundFour => break, } } term_info.c_iflag = old_iflag; term_info.c_lflag = old_lflag; tcsetattr(file_descriptor, TCSANOW, &mut term_info)?; Ok(if let XTERMSupportParserState::FoundFour = state { SixelSupport::Supported } else { SixelSupport::None }) } // // Check if Sixel protocol can be used fn check_sixel_support() -> SixelSupport { use SixelSupport::{None, Supported}; match env::var("TERM").unwrap_or(String::from("None")).as_str() { "mlterm" => Supported, "yaft-256color" => Supported, "st-256color" => xterm_check_sixel_support().unwrap_or(None), "xterm" => xterm_check_sixel_support().unwrap_or(None), "xterm-256color" => xterm_check_sixel_support().unwrap_or(None), _ => match env::var("TERM_PROGRAM") .unwrap_or(String::from("None")) .as_str() { "MacTerm" => Supported, _ => None, }, } } ///Ignore this test because it ///only passes on systems with ///sixel support #[test] #[ignore] fn sixel_support() { match check_sixel_support() { SixelSupport::Supported => (), SixelSupport::None => assert!(false), } }
use super::TokenCredential; use azure_core::TokenResponse; use chrono::Utc; use oauth2::{ basic::{BasicClient, BasicErrorResponseType}, reqwest::async_http_client, AccessToken, AuthType, AuthUrl, Scope, StandardErrorResponse, TokenUrl, }; use std::{str, time::Duration}; use url::Url; /// Provides options to configure how the Identity library makes authentication /// requests to Azure Active Directory. #[derive(Clone, Debug, PartialEq)] pub struct TokenCredentialOptions { authority_host: String, } impl Default for TokenCredentialOptions { fn default() -> Self { Self { authority_host: authority_hosts::AZURE_PUBLIC_CLOUD.to_owned(), } } } impl TokenCredentialOptions { /// Create a new TokenCredentialsOptions. `default()` may also be used. pub fn new(authority_host: String) -> Self { Self { authority_host } } pub fn set_authority_host(&mut self, authority_host: String) { self.authority_host = authority_host } /// The authority host to use for authentication requests. The default is /// "https://login.microsoftonline.com". pub fn authority_host(&self) -> &str { &self.authority_host } } /// A list of known Azure authority hosts pub mod authority_hosts { /// China-based Azure Authority Host pub const AZURE_CHINA: &str = "https://login.chinacloudapi.cn"; /// Germany-based Azure Authority Host pub const AZURE_GERMANY: &str = "https://login.microsoftonline.de"; /// US Government Azure Authority Host pub const AZURE_GOVERNMENT: &str = "https://login.microsoftonline.us"; /// Public Cloud Azure Authority Host pub const AZURE_PUBLIC_CLOUD: &str = "https://login.microsoftonline.com"; } pub mod tenant_ids { /// The tenant ID for multi-tenant apps /// /// https://docs.microsoft.com/azure/active-directory/develop/howto-convert-app-to-be-multi-tenant pub const TENANT_ID_COMMON: &str = "common"; /// The tenant ID for Active Directory Federated Services pub const TENANT_ID_ADFS: &str = "adfs"; } /// Enables authentication to Azure Active Directory using a client secret that was generated for an App Registration. /// /// More information on how to configure a client secret can be found here: /// https://docs.microsoft.com/azure/active-directory/develop/quickstart-configure-app-access-web-apis#add-credentials-to-your-web-application pub struct ClientSecretCredential { tenant_id: String, client_id: oauth2::ClientId, client_secret: Option<oauth2::ClientSecret>, options: TokenCredentialOptions, } impl ClientSecretCredential { pub fn new( tenant_id: String, client_id: String, client_secret: String, options: TokenCredentialOptions, ) -> ClientSecretCredential { ClientSecretCredential { tenant_id, client_id: oauth2::ClientId::new(client_id), client_secret: Some(oauth2::ClientSecret::new(client_secret)), options, } } fn options(&self) -> &TokenCredentialOptions { &self.options } } #[non_exhaustive] #[derive(Debug, thiserror::Error)] pub enum ClientSecretCredentialError { #[error("Failed to construct token endpoint with tenant id {1}: {0}")] FailedConstructTokenEndpoint(url::ParseError, String), #[error("Failed to construct authorize endpoint with tenant id {1}: {0}")] FailedConstructAuthorizeEndpoint(url::ParseError, String), #[error("Request token error: {0}")] RequestTokenError( oauth2::RequestTokenError< oauth2::reqwest::Error<reqwest::Error>, StandardErrorResponse<BasicErrorResponseType>, >, ), } #[async_trait::async_trait] impl TokenCredential for ClientSecretCredential { type Error = ClientSecretCredentialError; async fn get_token(&self, resource: &str) -> Result<TokenResponse, Self::Error> { let options = self.options(); let authority_host = options.authority_host(); let token_url = TokenUrl::from_url( Url::parse(&format!( "{}/{}/oauth2/v2.0/token", authority_host, self.tenant_id )) .map_err(|error| { ClientSecretCredentialError::FailedConstructTokenEndpoint( error, self.tenant_id.clone(), ) })?, ); let auth_url = AuthUrl::from_url( Url::parse(&format!( "{}/{}/oauth2/v2.0/authorize", authority_host, self.tenant_id )) .map_err(|error| { ClientSecretCredentialError::FailedConstructAuthorizeEndpoint( error, self.tenant_id.clone(), ) })?, ); let client = BasicClient::new( self.client_id.clone(), self.client_secret.clone(), auth_url, Some(token_url), ) .set_auth_type(AuthType::RequestBody); let token_result = client .exchange_client_credentials() .add_scope(Scope::new(format!("{}/.default", resource))) .request_async(async_http_client) .await .map(|r| { use oauth2::TokenResponse as _; TokenResponse::new( AccessToken::new(r.access_token().secret().to_owned()), Utc::now() + chrono::Duration::from_std( r.expires_in().unwrap_or_else(|| Duration::from_secs(0)), ) .unwrap(), ) }) .map_err(ClientSecretCredentialError::RequestTokenError)?; Ok(token_result) } } #[async_trait::async_trait] impl azure_core::TokenCredential for ClientSecretCredential { async fn get_token( &self, resource: &str, ) -> Result<azure_core::TokenResponse, azure_core::Error> { TokenCredential::get_token(self, resource) .await .map_err(|error| azure_core::Error::GetTokenError(Box::new(error))) } }
use clap::{ Arg, App, crate_name, crate_version, crate_authors, }; use bio::{ seq::{ parser::LeadingColumns, fasta::* } }; use chunks; fn main() { let matches = App::new(crate_name!()) .version(crate_version!()) .author(crate_authors!()) .about("Converts embl files to fasta files") .arg(Arg::with_name("seqIn") .short("i") .long("seqIn") .multiple(false) .takes_value(true) .help("EMBL-formatted sequence input file. If not provided, defaults to STDIN.") ) .arg(Arg::with_name("seqOut") .short("o") .long("seqOut") .multiple(false) .takes_value(true) .help("Sequence output file. If not provided, defaults to STDOUT.")) .get_matches(); let mut out = chunks::write_to_file_or_stdout(matches.value_of("seqOut")) .expect("Failed to open output file for writing"); let ins = chunks::read_from_files_or_stdin(matches.values_of("seqIn")) .expect("Failed to open input file for reading"); let delim = chunks::Delim::new(b"\n//\n", true); let fasta = FastaFormat::new(); let embl_stanzas = LeadingColumns { tag_columns: 5, merge_tags: true }; for in_reader in ins { for chunk in chunks::chunks(in_reader, &delim) { let chunk = chunk.expect("Failed to read chunk"); let chunk_text = std::str::from_utf8(&chunk).unwrap(); // println!("<<<"); let stanzas = embl_stanzas.stanzas(chunk_text.lines()).collect::<Vec<_>>(); // println!("Stanza view:"); // println!("{:?}", stanzas); let id = stanzas.iter() .filter(|s| s.tag == Some("ID")) .flat_map(|s| s.lines.iter().flat_map(|l| l.split(';'))) .next(); // println!("ID line:"); // println!("{:?}", id); let descr = stanzas.iter() .filter(|s| s.tag == Some("DE")) .map(|s| s.lines.iter() .copied() .collect::<String>()) // fixme: this may abolish whitespace between lines .next(); // println!("Sequence:"); let seq = stanzas.iter() .filter(|s| s.tag == Some("SQ")) .flat_map(|s| s.lines.iter() .skip(1) .flat_map(|l| l.split_whitespace() .filter(|&t| t.chars().all(|c| c.is_ascii_alphabetic())))) .collect::<String>(); // println!("{:?}", seq); if !seq.is_empty() { let descr_line = FastaRecord::descr_line(id, descr.as_ref().map(String::as_str)); // println!("ID line text: {}", descr_line); let fasta_record = FastaRecord { descr_line, seq }; fasta_record.write(&fasta, &mut out) .expect("Problem writing fasta record out"); } // println!(">>>") } } }
//! Reference counted handles to various TableProperties* types, that safely //! preserve destruction order. use crocksdb_ffi::{ DBTableProperties, DBTablePropertiesCollection, DBTablePropertiesCollectionIterator, DBUserCollectedProperties, }; use librocksdb_sys as crocksdb_ffi; use std::rc::Rc; /// This is a shared wrapper around a DBTablePropertiesCollection w/ dtor #[derive(Clone)] pub struct TablePropertiesCollectionHandle { shared: Rc<TablePropertiesCollectionHandleWithDrop>, } impl TablePropertiesCollectionHandle { pub unsafe fn new(ptr: *mut DBTablePropertiesCollection) -> TablePropertiesCollectionHandle { assert!(!ptr.is_null()); TablePropertiesCollectionHandle { shared: Rc::new(TablePropertiesCollectionHandleWithDrop { ptr }), } } pub fn ptr(&self) -> *mut DBTablePropertiesCollection { self.shared.ptr } } struct TablePropertiesCollectionHandleWithDrop { ptr: *mut DBTablePropertiesCollection, } impl Drop for TablePropertiesCollectionHandleWithDrop { fn drop(&mut self) { unsafe { crocksdb_ffi::crocksdb_table_properties_collection_destroy(self.ptr); } } } /// This is a shared wrapper around a DBTablePropertiesCollection w/ dtor. // // # Safety // // The safety of this struct depends on drop order, with the iterator // needing to drop before the collection. #[derive(Clone)] pub struct TablePropertiesCollectionIteratorHandle { shared: Rc<TablePropertiesCollectionIteratorHandleWithDrop>, _collection: TablePropertiesCollectionHandle, } impl TablePropertiesCollectionIteratorHandle { pub fn new( collection: TablePropertiesCollectionHandle, ) -> TablePropertiesCollectionIteratorHandle { unsafe { let ptr = crocksdb_ffi::crocksdb_table_properties_collection_iter_create(collection.ptr()); TablePropertiesCollectionIteratorHandle { shared: Rc::new(TablePropertiesCollectionIteratorHandleWithDrop { ptr }), _collection: collection, } } } pub fn ptr(&self) -> *mut DBTablePropertiesCollectionIterator { self.shared.ptr } } struct TablePropertiesCollectionIteratorHandleWithDrop { ptr: *mut DBTablePropertiesCollectionIterator, } impl Drop for TablePropertiesCollectionIteratorHandleWithDrop { fn drop(&mut self) { unsafe { crocksdb_ffi::crocksdb_table_properties_collection_iter_destroy(self.ptr); } } } // # Safety // // `ptr` is valid as long as the iterator is #[derive(Clone)] pub struct TablePropertiesHandle { ptr: *const DBTableProperties, _iter_handle: TablePropertiesCollectionIteratorHandle, } impl TablePropertiesHandle { pub fn new( ptr: *const DBTableProperties, _iter_handle: TablePropertiesCollectionIteratorHandle, ) -> TablePropertiesHandle { TablePropertiesHandle { ptr, _iter_handle } } pub fn ptr(&self) -> *const DBTableProperties { self.ptr } } // # Safety // // `ptr` is valid as long as the table properties are #[derive(Clone)] pub struct UserCollectedPropertiesHandle { ptr: *const DBUserCollectedProperties, _table_props_handle: TablePropertiesHandle, } impl UserCollectedPropertiesHandle { pub fn new(table_props_handle: TablePropertiesHandle) -> UserCollectedPropertiesHandle { unsafe { let ptr = crocksdb_ffi::crocksdb_table_properties_get_user_properties( table_props_handle.ptr(), ); UserCollectedPropertiesHandle { ptr, _table_props_handle: table_props_handle, } } } pub fn ptr(&self) -> *const DBUserCollectedProperties { self.ptr } }
// src/db.rs use std::env; use diesel::prelude::*; use diesel::{r2d2, PgConnection}; use crate::models::*; use crate::schema::*; use crate::StdErr; type PgPool = r2d2::Pool<r2d2::ConnectionManager<PgConnection>>; pub struct Db { pool: PgPool, } impl Db { pub fn connect() -> Result<Self, StdErr> { let db_url = env::var("DATABASE_URL")?; let manager = r2d2::ConnectionManager::new(db_url); let pool = r2d2::Builder::new() .max_size(100) .min_idle(Some(50)) .build(manager)?; Ok(Db { pool }) } // token methods pub fn validate_token(&self, token_id: &str) -> Result<Token, StdErr> { let conn = self.pool.get()?; let token = tokens::table .filter(tokens::id.eq(token_id)) .filter(tokens::expired_at.ge(diesel::dsl::now)) .first(&conn)?; Ok(token) } // board methods pub fn boards(&self) -> Result<Vec<Board>, StdErr> { let conn = self.pool.get()?; Ok(boards::table.load(&conn)?) } pub fn board_summary(&self, board_id: i64) -> Result<BoardSummary, StdErr> { let conn = self.pool.get()?; let counts: Vec<StatusCount> = diesel::sql_query(format!( "select count(*), status from cards where cards.board_id = {} group by status", board_id )) .load(&conn)?; Ok(counts.into()) } pub fn create_board(&self, create_board: CreateBoard) -> Result<Board, StdErr> { let conn = self.pool.get()?; let board = diesel::insert_into(boards::table) .values(&create_board) .get_result(&conn)?; Ok(board) } pub fn delete_board(&self, board_id: i64) -> Result<(), StdErr> { let conn = self.pool.get()?; diesel::delete(boards::table.filter(boards::id.eq(board_id))).execute(&conn)?; Ok(()) } // card methods pub fn cards(&self, board_id: i64) -> Result<Vec<Card>, StdErr> { let conn = self.pool.get()?; let cards = cards::table .filter(cards::board_id.eq(board_id)) .load(&conn)?; Ok(cards) } pub fn create_card(&self, create_card: CreateCard) -> Result<Card, StdErr> { let conn = self.pool.get()?; let card = diesel::insert_into(cards::table) .values(create_card) .get_result(&conn)?; Ok(card) } pub fn update_card(&self, card_id: i64, update_card: UpdateCard) -> Result<Card, StdErr> { let conn = self.pool.get()?; let card = diesel::update(cards::table.filter(cards::id.eq(card_id))) .set(update_card) .get_result(&conn)?; Ok(card) } pub fn delete_card(&self, card_id: i64) -> Result<(), StdErr> { let conn = self.pool.get()?; diesel::delete(cards::table.filter(cards::id.eq(card_id))).execute(&conn)?; Ok(()) } }
/// An enum to represent all characters in the EnclosedAlphanumericSupplement block. #[derive(Debug, Clone, Copy, Hash, PartialEq, Eq)] pub enum EnclosedAlphanumericSupplement { /// \u{1f100}: '🄀' DigitZeroFullStop, /// \u{1f101}: '🄁' DigitZeroComma, /// \u{1f102}: '🄂' DigitOneComma, /// \u{1f103}: '🄃' DigitTwoComma, /// \u{1f104}: '🄄' DigitThreeComma, /// \u{1f105}: '🄅' DigitFourComma, /// \u{1f106}: '🄆' DigitFiveComma, /// \u{1f107}: '🄇' DigitSixComma, /// \u{1f108}: '🄈' DigitSevenComma, /// \u{1f109}: '🄉' DigitEightComma, /// \u{1f10a}: '🄊' DigitNineComma, /// \u{1f10b}: '🄋' DingbatCircledSansDashSerifDigitZero, /// \u{1f10c}: '🄌' DingbatNegativeCircledSansDashSerifDigitZero, /// \u{1f110}: '🄐' ParenthesizedLatinCapitalLetterA, /// \u{1f111}: '🄑' ParenthesizedLatinCapitalLetterB, /// \u{1f112}: '🄒' ParenthesizedLatinCapitalLetterC, /// \u{1f113}: '🄓' ParenthesizedLatinCapitalLetterD, /// \u{1f114}: '🄔' ParenthesizedLatinCapitalLetterE, /// \u{1f115}: '🄕' ParenthesizedLatinCapitalLetterF, /// \u{1f116}: '🄖' ParenthesizedLatinCapitalLetterG, /// \u{1f117}: '🄗' ParenthesizedLatinCapitalLetterH, /// \u{1f118}: '🄘' ParenthesizedLatinCapitalLetterI, /// \u{1f119}: '🄙' ParenthesizedLatinCapitalLetterJ, /// \u{1f11a}: '🄚' ParenthesizedLatinCapitalLetterK, /// \u{1f11b}: '🄛' ParenthesizedLatinCapitalLetterL, /// \u{1f11c}: '🄜' ParenthesizedLatinCapitalLetterM, /// \u{1f11d}: '🄝' ParenthesizedLatinCapitalLetterN, /// \u{1f11e}: '🄞' ParenthesizedLatinCapitalLetterO, /// \u{1f11f}: '🄟' ParenthesizedLatinCapitalLetterP, /// \u{1f120}: '🄠' ParenthesizedLatinCapitalLetterQ, /// \u{1f121}: '🄡' ParenthesizedLatinCapitalLetterR, /// \u{1f122}: '🄢' ParenthesizedLatinCapitalLetterS, /// \u{1f123}: '🄣' ParenthesizedLatinCapitalLetterT, /// \u{1f124}: '🄤' ParenthesizedLatinCapitalLetterU, /// \u{1f125}: '🄥' ParenthesizedLatinCapitalLetterV, /// \u{1f126}: '🄦' ParenthesizedLatinCapitalLetterW, /// \u{1f127}: '🄧' ParenthesizedLatinCapitalLetterX, /// \u{1f128}: '🄨' ParenthesizedLatinCapitalLetterY, /// \u{1f129}: '🄩' ParenthesizedLatinCapitalLetterZ, /// \u{1f12a}: '🄪' TortoiseShellBracketedLatinCapitalLetterS, /// \u{1f12b}: '🄫' CircledItalicLatinCapitalLetterC, /// \u{1f12c}: '🄬' CircledItalicLatinCapitalLetterR, /// \u{1f12d}: '🄭' CircledCd, /// \u{1f12e}: '🄮' CircledWz, /// \u{1f12f}: '🄯' CopyleftSymbol, /// \u{1f130}: '🄰' SquaredLatinCapitalLetterA, /// \u{1f131}: '🄱' SquaredLatinCapitalLetterB, /// \u{1f132}: '🄲' SquaredLatinCapitalLetterC, /// \u{1f133}: '🄳' SquaredLatinCapitalLetterD, /// \u{1f134}: '🄴' SquaredLatinCapitalLetterE, /// \u{1f135}: '🄵' SquaredLatinCapitalLetterF, /// \u{1f136}: '🄶' SquaredLatinCapitalLetterG, /// \u{1f137}: '🄷' SquaredLatinCapitalLetterH, /// \u{1f138}: '🄸' SquaredLatinCapitalLetterI, /// \u{1f139}: '🄹' SquaredLatinCapitalLetterJ, /// \u{1f13a}: '🄺' SquaredLatinCapitalLetterK, /// \u{1f13b}: '🄻' SquaredLatinCapitalLetterL, /// \u{1f13c}: '🄼' SquaredLatinCapitalLetterM, /// \u{1f13d}: '🄽' SquaredLatinCapitalLetterN, /// \u{1f13e}: '🄾' SquaredLatinCapitalLetterO, /// \u{1f13f}: '🄿' SquaredLatinCapitalLetterP, /// \u{1f140}: '🅀' SquaredLatinCapitalLetterQ, /// \u{1f141}: '🅁' SquaredLatinCapitalLetterR, /// \u{1f142}: '🅂' SquaredLatinCapitalLetterS, /// \u{1f143}: '🅃' SquaredLatinCapitalLetterT, /// \u{1f144}: '🅄' SquaredLatinCapitalLetterU, /// \u{1f145}: '🅅' SquaredLatinCapitalLetterV, /// \u{1f146}: '🅆' SquaredLatinCapitalLetterW, /// \u{1f147}: '🅇' SquaredLatinCapitalLetterX, /// \u{1f148}: '🅈' SquaredLatinCapitalLetterY, /// \u{1f149}: '🅉' SquaredLatinCapitalLetterZ, /// \u{1f14a}: '🅊' SquaredHv, /// \u{1f14b}: '🅋' SquaredMv, /// \u{1f14c}: '🅌' SquaredSd, /// \u{1f14d}: '🅍' SquaredSs, /// \u{1f14e}: '🅎' SquaredPpv, /// \u{1f14f}: '🅏' SquaredWc, /// \u{1f150}: '🅐' NegativeCircledLatinCapitalLetterA, /// \u{1f151}: '🅑' NegativeCircledLatinCapitalLetterB, /// \u{1f152}: '🅒' NegativeCircledLatinCapitalLetterC, /// \u{1f153}: '🅓' NegativeCircledLatinCapitalLetterD, /// \u{1f154}: '🅔' NegativeCircledLatinCapitalLetterE, /// \u{1f155}: '🅕' NegativeCircledLatinCapitalLetterF, /// \u{1f156}: '🅖' NegativeCircledLatinCapitalLetterG, /// \u{1f157}: '🅗' NegativeCircledLatinCapitalLetterH, /// \u{1f158}: '🅘' NegativeCircledLatinCapitalLetterI, /// \u{1f159}: '🅙' NegativeCircledLatinCapitalLetterJ, /// \u{1f15a}: '🅚' NegativeCircledLatinCapitalLetterK, /// \u{1f15b}: '🅛' NegativeCircledLatinCapitalLetterL, /// \u{1f15c}: '🅜' NegativeCircledLatinCapitalLetterM, /// \u{1f15d}: '🅝' NegativeCircledLatinCapitalLetterN, /// \u{1f15e}: '🅞' NegativeCircledLatinCapitalLetterO, /// \u{1f15f}: '🅟' NegativeCircledLatinCapitalLetterP, /// \u{1f160}: '🅠' NegativeCircledLatinCapitalLetterQ, /// \u{1f161}: '🅡' NegativeCircledLatinCapitalLetterR, /// \u{1f162}: '🅢' NegativeCircledLatinCapitalLetterS, /// \u{1f163}: '🅣' NegativeCircledLatinCapitalLetterT, /// \u{1f164}: '🅤' NegativeCircledLatinCapitalLetterU, /// \u{1f165}: '🅥' NegativeCircledLatinCapitalLetterV, /// \u{1f166}: '🅦' NegativeCircledLatinCapitalLetterW, /// \u{1f167}: '🅧' NegativeCircledLatinCapitalLetterX, /// \u{1f168}: '🅨' NegativeCircledLatinCapitalLetterY, /// \u{1f169}: '🅩' NegativeCircledLatinCapitalLetterZ, /// \u{1f16a}: '🅪' RaisedMcSign, /// \u{1f16b}: '🅫' RaisedMdSign, /// \u{1f16c}: '🅬' RaisedMrSign, /// \u{1f170}: '🅰' NegativeSquaredLatinCapitalLetterA, /// \u{1f171}: '🅱' NegativeSquaredLatinCapitalLetterB, /// \u{1f172}: '🅲' NegativeSquaredLatinCapitalLetterC, /// \u{1f173}: '🅳' NegativeSquaredLatinCapitalLetterD, /// \u{1f174}: '🅴' NegativeSquaredLatinCapitalLetterE, /// \u{1f175}: '🅵' NegativeSquaredLatinCapitalLetterF, /// \u{1f176}: '🅶' NegativeSquaredLatinCapitalLetterG, /// \u{1f177}: '🅷' NegativeSquaredLatinCapitalLetterH, /// \u{1f178}: '🅸' NegativeSquaredLatinCapitalLetterI, /// \u{1f179}: '🅹' NegativeSquaredLatinCapitalLetterJ, /// \u{1f17a}: '🅺' NegativeSquaredLatinCapitalLetterK, /// \u{1f17b}: '🅻' NegativeSquaredLatinCapitalLetterL, /// \u{1f17c}: '🅼' NegativeSquaredLatinCapitalLetterM, /// \u{1f17d}: '🅽' NegativeSquaredLatinCapitalLetterN, /// \u{1f17e}: '🅾' NegativeSquaredLatinCapitalLetterO, /// \u{1f17f}: '🅿' NegativeSquaredLatinCapitalLetterP, /// \u{1f180}: '🆀' NegativeSquaredLatinCapitalLetterQ, /// \u{1f181}: '🆁' NegativeSquaredLatinCapitalLetterR, /// \u{1f182}: '🆂' NegativeSquaredLatinCapitalLetterS, /// \u{1f183}: '🆃' NegativeSquaredLatinCapitalLetterT, /// \u{1f184}: '🆄' NegativeSquaredLatinCapitalLetterU, /// \u{1f185}: '🆅' NegativeSquaredLatinCapitalLetterV, /// \u{1f186}: '🆆' NegativeSquaredLatinCapitalLetterW, /// \u{1f187}: '🆇' NegativeSquaredLatinCapitalLetterX, /// \u{1f188}: '🆈' NegativeSquaredLatinCapitalLetterY, /// \u{1f189}: '🆉' NegativeSquaredLatinCapitalLetterZ, /// \u{1f18a}: '🆊' CrossedNegativeSquaredLatinCapitalLetterP, /// \u{1f18b}: '🆋' NegativeSquaredIc, /// \u{1f18c}: '🆌' NegativeSquaredPa, /// \u{1f18d}: '🆍' NegativeSquaredSa, /// \u{1f18e}: '🆎' NegativeSquaredAb, /// \u{1f18f}: '🆏' NegativeSquaredWc, /// \u{1f190}: '🆐' SquareDj, /// \u{1f191}: '🆑' SquaredCl, /// \u{1f192}: '🆒' SquaredCool, /// \u{1f193}: '🆓' SquaredFree, /// \u{1f194}: '🆔' SquaredId, /// \u{1f195}: '🆕' SquaredNew, /// \u{1f196}: '🆖' SquaredNg, /// \u{1f197}: '🆗' SquaredOk, /// \u{1f198}: '🆘' SquaredSos, /// \u{1f199}: '🆙' SquaredUpWithExclamationMark, /// \u{1f19a}: '🆚' SquaredVs, /// \u{1f19b}: '🆛' SquaredThreeD, /// \u{1f19c}: '🆜' SquaredSecondScreen, /// \u{1f19d}: '🆝' SquaredTwoK, /// \u{1f19e}: '🆞' SquaredFourK, /// \u{1f19f}: '🆟' SquaredEightK, /// \u{1f1a0}: '🆠' SquaredFivePointOne, /// \u{1f1a1}: '🆡' SquaredSevenPointOne, /// \u{1f1a2}: '🆢' SquaredTwentyDashTwoPointTwo, /// \u{1f1a3}: '🆣' SquaredSixtyP, /// \u{1f1a4}: '🆤' SquaredOneHundredTwentyP, /// \u{1f1a5}: '🆥' SquaredLatinSmallLetterD, /// \u{1f1a6}: '🆦' SquaredHc, /// \u{1f1a7}: '🆧' SquaredHdr, /// \u{1f1a8}: '🆨' SquaredHiDashRes, /// \u{1f1a9}: '🆩' SquaredLossless, /// \u{1f1aa}: '🆪' SquaredShv, /// \u{1f1ab}: '🆫' SquaredUhd, /// \u{1f1ac}: '🆬' SquaredVod, /// \u{1f1e6}: '🇦' RegionalIndicatorSymbolLetterA, /// \u{1f1e7}: '🇧' RegionalIndicatorSymbolLetterB, /// \u{1f1e8}: '🇨' RegionalIndicatorSymbolLetterC, /// \u{1f1e9}: '🇩' RegionalIndicatorSymbolLetterD, /// \u{1f1ea}: '🇪' RegionalIndicatorSymbolLetterE, /// \u{1f1eb}: '🇫' RegionalIndicatorSymbolLetterF, /// \u{1f1ec}: '🇬' RegionalIndicatorSymbolLetterG, /// \u{1f1ed}: '🇭' RegionalIndicatorSymbolLetterH, /// \u{1f1ee}: '🇮' RegionalIndicatorSymbolLetterI, /// \u{1f1ef}: '🇯' RegionalIndicatorSymbolLetterJ, /// \u{1f1f0}: '🇰' RegionalIndicatorSymbolLetterK, /// \u{1f1f1}: '🇱' RegionalIndicatorSymbolLetterL, /// \u{1f1f2}: '🇲' RegionalIndicatorSymbolLetterM, /// \u{1f1f3}: '🇳' RegionalIndicatorSymbolLetterN, /// \u{1f1f4}: '🇴' RegionalIndicatorSymbolLetterO, /// \u{1f1f5}: '🇵' RegionalIndicatorSymbolLetterP, /// \u{1f1f6}: '🇶' RegionalIndicatorSymbolLetterQ, /// \u{1f1f7}: '🇷' RegionalIndicatorSymbolLetterR, /// \u{1f1f8}: '🇸' RegionalIndicatorSymbolLetterS, /// \u{1f1f9}: '🇹' RegionalIndicatorSymbolLetterT, /// \u{1f1fa}: '🇺' RegionalIndicatorSymbolLetterU, /// \u{1f1fb}: '🇻' RegionalIndicatorSymbolLetterV, /// \u{1f1fc}: '🇼' RegionalIndicatorSymbolLetterW, /// \u{1f1fd}: '🇽' RegionalIndicatorSymbolLetterX, /// \u{1f1fe}: '🇾' RegionalIndicatorSymbolLetterY, } impl Into<char> for EnclosedAlphanumericSupplement { fn into(self) -> char { match self { EnclosedAlphanumericSupplement::DigitZeroFullStop => '🄀', EnclosedAlphanumericSupplement::DigitZeroComma => '🄁', EnclosedAlphanumericSupplement::DigitOneComma => '🄂', EnclosedAlphanumericSupplement::DigitTwoComma => '🄃', EnclosedAlphanumericSupplement::DigitThreeComma => '🄄', EnclosedAlphanumericSupplement::DigitFourComma => '🄅', EnclosedAlphanumericSupplement::DigitFiveComma => '🄆', EnclosedAlphanumericSupplement::DigitSixComma => '🄇', EnclosedAlphanumericSupplement::DigitSevenComma => '🄈', EnclosedAlphanumericSupplement::DigitEightComma => '🄉', EnclosedAlphanumericSupplement::DigitNineComma => '🄊', EnclosedAlphanumericSupplement::DingbatCircledSansDashSerifDigitZero => '🄋', EnclosedAlphanumericSupplement::DingbatNegativeCircledSansDashSerifDigitZero => '🄌', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterA => '🄐', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterB => '🄑', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterC => '🄒', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterD => '🄓', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterE => '🄔', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterF => '🄕', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterG => '🄖', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterH => '🄗', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterI => '🄘', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterJ => '🄙', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterK => '🄚', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterL => '🄛', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterM => '🄜', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterN => '🄝', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterO => '🄞', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterP => '🄟', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterQ => '🄠', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterR => '🄡', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterS => '🄢', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterT => '🄣', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterU => '🄤', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterV => '🄥', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterW => '🄦', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterX => '🄧', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterY => '🄨', EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterZ => '🄩', EnclosedAlphanumericSupplement::TortoiseShellBracketedLatinCapitalLetterS => '🄪', EnclosedAlphanumericSupplement::CircledItalicLatinCapitalLetterC => '🄫', EnclosedAlphanumericSupplement::CircledItalicLatinCapitalLetterR => '🄬', EnclosedAlphanumericSupplement::CircledCd => '🄭', EnclosedAlphanumericSupplement::CircledWz => '🄮', EnclosedAlphanumericSupplement::CopyleftSymbol => '🄯', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterA => '🄰', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterB => '🄱', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterC => '🄲', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterD => '🄳', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterE => '🄴', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterF => '🄵', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterG => '🄶', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterH => '🄷', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterI => '🄸', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterJ => '🄹', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterK => '🄺', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterL => '🄻', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterM => '🄼', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterN => '🄽', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterO => '🄾', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterP => '🄿', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterQ => '🅀', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterR => '🅁', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterS => '🅂', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterT => '🅃', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterU => '🅄', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterV => '🅅', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterW => '🅆', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterX => '🅇', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterY => '🅈', EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterZ => '🅉', EnclosedAlphanumericSupplement::SquaredHv => '🅊', EnclosedAlphanumericSupplement::SquaredMv => '🅋', EnclosedAlphanumericSupplement::SquaredSd => '🅌', EnclosedAlphanumericSupplement::SquaredSs => '🅍', EnclosedAlphanumericSupplement::SquaredPpv => '🅎', EnclosedAlphanumericSupplement::SquaredWc => '🅏', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterA => '🅐', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterB => '🅑', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterC => '🅒', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterD => '🅓', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterE => '🅔', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterF => '🅕', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterG => '🅖', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterH => '🅗', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterI => '🅘', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterJ => '🅙', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterK => '🅚', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterL => '🅛', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterM => '🅜', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterN => '🅝', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterO => '🅞', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterP => '🅟', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterQ => '🅠', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterR => '🅡', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterS => '🅢', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterT => '🅣', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterU => '🅤', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterV => '🅥', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterW => '🅦', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterX => '🅧', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterY => '🅨', EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterZ => '🅩', EnclosedAlphanumericSupplement::RaisedMcSign => '🅪', EnclosedAlphanumericSupplement::RaisedMdSign => '🅫', EnclosedAlphanumericSupplement::RaisedMrSign => '🅬', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterA => '🅰', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterB => '🅱', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterC => '🅲', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterD => '🅳', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterE => '🅴', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterF => '🅵', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterG => '🅶', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterH => '🅷', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterI => '🅸', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterJ => '🅹', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterK => '🅺', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterL => '🅻', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterM => '🅼', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterN => '🅽', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterO => '🅾', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterP => '🅿', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterQ => '🆀', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterR => '🆁', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterS => '🆂', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterT => '🆃', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterU => '🆄', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterV => '🆅', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterW => '🆆', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterX => '🆇', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterY => '🆈', EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterZ => '🆉', EnclosedAlphanumericSupplement::CrossedNegativeSquaredLatinCapitalLetterP => '🆊', EnclosedAlphanumericSupplement::NegativeSquaredIc => '🆋', EnclosedAlphanumericSupplement::NegativeSquaredPa => '🆌', EnclosedAlphanumericSupplement::NegativeSquaredSa => '🆍', EnclosedAlphanumericSupplement::NegativeSquaredAb => '🆎', EnclosedAlphanumericSupplement::NegativeSquaredWc => '🆏', EnclosedAlphanumericSupplement::SquareDj => '🆐', EnclosedAlphanumericSupplement::SquaredCl => '🆑', EnclosedAlphanumericSupplement::SquaredCool => '🆒', EnclosedAlphanumericSupplement::SquaredFree => '🆓', EnclosedAlphanumericSupplement::SquaredId => '🆔', EnclosedAlphanumericSupplement::SquaredNew => '🆕', EnclosedAlphanumericSupplement::SquaredNg => '🆖', EnclosedAlphanumericSupplement::SquaredOk => '🆗', EnclosedAlphanumericSupplement::SquaredSos => '🆘', EnclosedAlphanumericSupplement::SquaredUpWithExclamationMark => '🆙', EnclosedAlphanumericSupplement::SquaredVs => '🆚', EnclosedAlphanumericSupplement::SquaredThreeD => '🆛', EnclosedAlphanumericSupplement::SquaredSecondScreen => '🆜', EnclosedAlphanumericSupplement::SquaredTwoK => '🆝', EnclosedAlphanumericSupplement::SquaredFourK => '🆞', EnclosedAlphanumericSupplement::SquaredEightK => '🆟', EnclosedAlphanumericSupplement::SquaredFivePointOne => '🆠', EnclosedAlphanumericSupplement::SquaredSevenPointOne => '🆡', EnclosedAlphanumericSupplement::SquaredTwentyDashTwoPointTwo => '🆢', EnclosedAlphanumericSupplement::SquaredSixtyP => '🆣', EnclosedAlphanumericSupplement::SquaredOneHundredTwentyP => '🆤', EnclosedAlphanumericSupplement::SquaredLatinSmallLetterD => '🆥', EnclosedAlphanumericSupplement::SquaredHc => '🆦', EnclosedAlphanumericSupplement::SquaredHdr => '🆧', EnclosedAlphanumericSupplement::SquaredHiDashRes => '🆨', EnclosedAlphanumericSupplement::SquaredLossless => '🆩', EnclosedAlphanumericSupplement::SquaredShv => '🆪', EnclosedAlphanumericSupplement::SquaredUhd => '🆫', EnclosedAlphanumericSupplement::SquaredVod => '🆬', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterA => '🇦', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterB => '🇧', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterC => '🇨', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterD => '🇩', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterE => '🇪', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterF => '🇫', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterG => '🇬', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterH => '🇭', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterI => '🇮', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterJ => '🇯', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterK => '🇰', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterL => '🇱', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterM => '🇲', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterN => '🇳', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterO => '🇴', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterP => '🇵', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterQ => '🇶', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterR => '🇷', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterS => '🇸', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterT => '🇹', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterU => '🇺', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterV => '🇻', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterW => '🇼', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterX => '🇽', EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterY => '🇾', } } } impl std::convert::TryFrom<char> for EnclosedAlphanumericSupplement { type Error = (); fn try_from(c: char) -> Result<Self, Self::Error> { match c { '🄀' => Ok(EnclosedAlphanumericSupplement::DigitZeroFullStop), '🄁' => Ok(EnclosedAlphanumericSupplement::DigitZeroComma), '🄂' => Ok(EnclosedAlphanumericSupplement::DigitOneComma), '🄃' => Ok(EnclosedAlphanumericSupplement::DigitTwoComma), '🄄' => Ok(EnclosedAlphanumericSupplement::DigitThreeComma), '🄅' => Ok(EnclosedAlphanumericSupplement::DigitFourComma), '🄆' => Ok(EnclosedAlphanumericSupplement::DigitFiveComma), '🄇' => Ok(EnclosedAlphanumericSupplement::DigitSixComma), '🄈' => Ok(EnclosedAlphanumericSupplement::DigitSevenComma), '🄉' => Ok(EnclosedAlphanumericSupplement::DigitEightComma), '🄊' => Ok(EnclosedAlphanumericSupplement::DigitNineComma), '🄋' => Ok(EnclosedAlphanumericSupplement::DingbatCircledSansDashSerifDigitZero), '🄌' => Ok(EnclosedAlphanumericSupplement::DingbatNegativeCircledSansDashSerifDigitZero), '🄐' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterA), '🄑' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterB), '🄒' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterC), '🄓' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterD), '🄔' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterE), '🄕' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterF), '🄖' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterG), '🄗' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterH), '🄘' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterI), '🄙' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterJ), '🄚' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterK), '🄛' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterL), '🄜' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterM), '🄝' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterN), '🄞' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterO), '🄟' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterP), '🄠' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterQ), '🄡' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterR), '🄢' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterS), '🄣' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterT), '🄤' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterU), '🄥' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterV), '🄦' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterW), '🄧' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterX), '🄨' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterY), '🄩' => Ok(EnclosedAlphanumericSupplement::ParenthesizedLatinCapitalLetterZ), '🄪' => Ok(EnclosedAlphanumericSupplement::TortoiseShellBracketedLatinCapitalLetterS), '🄫' => Ok(EnclosedAlphanumericSupplement::CircledItalicLatinCapitalLetterC), '🄬' => Ok(EnclosedAlphanumericSupplement::CircledItalicLatinCapitalLetterR), '🄭' => Ok(EnclosedAlphanumericSupplement::CircledCd), '🄮' => Ok(EnclosedAlphanumericSupplement::CircledWz), '🄯' => Ok(EnclosedAlphanumericSupplement::CopyleftSymbol), '🄰' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterA), '🄱' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterB), '🄲' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterC), '🄳' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterD), '🄴' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterE), '🄵' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterF), '🄶' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterG), '🄷' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterH), '🄸' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterI), '🄹' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterJ), '🄺' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterK), '🄻' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterL), '🄼' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterM), '🄽' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterN), '🄾' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterO), '🄿' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterP), '🅀' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterQ), '🅁' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterR), '🅂' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterS), '🅃' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterT), '🅄' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterU), '🅅' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterV), '🅆' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterW), '🅇' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterX), '🅈' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterY), '🅉' => Ok(EnclosedAlphanumericSupplement::SquaredLatinCapitalLetterZ), '🅊' => Ok(EnclosedAlphanumericSupplement::SquaredHv), '🅋' => Ok(EnclosedAlphanumericSupplement::SquaredMv), '🅌' => Ok(EnclosedAlphanumericSupplement::SquaredSd), '🅍' => Ok(EnclosedAlphanumericSupplement::SquaredSs), '🅎' => Ok(EnclosedAlphanumericSupplement::SquaredPpv), '🅏' => Ok(EnclosedAlphanumericSupplement::SquaredWc), '🅐' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterA), '🅑' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterB), '🅒' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterC), '🅓' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterD), '🅔' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterE), '🅕' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterF), '🅖' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterG), '🅗' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterH), '🅘' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterI), '🅙' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterJ), '🅚' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterK), '🅛' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterL), '🅜' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterM), '🅝' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterN), '🅞' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterO), '🅟' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterP), '🅠' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterQ), '🅡' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterR), '🅢' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterS), '🅣' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterT), '🅤' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterU), '🅥' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterV), '🅦' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterW), '🅧' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterX), '🅨' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterY), '🅩' => Ok(EnclosedAlphanumericSupplement::NegativeCircledLatinCapitalLetterZ), '🅪' => Ok(EnclosedAlphanumericSupplement::RaisedMcSign), '🅫' => Ok(EnclosedAlphanumericSupplement::RaisedMdSign), '🅬' => Ok(EnclosedAlphanumericSupplement::RaisedMrSign), '🅰' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterA), '🅱' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterB), '🅲' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterC), '🅳' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterD), '🅴' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterE), '🅵' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterF), '🅶' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterG), '🅷' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterH), '🅸' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterI), '🅹' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterJ), '🅺' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterK), '🅻' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterL), '🅼' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterM), '🅽' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterN), '🅾' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterO), '🅿' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterP), '🆀' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterQ), '🆁' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterR), '🆂' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterS), '🆃' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterT), '🆄' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterU), '🆅' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterV), '🆆' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterW), '🆇' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterX), '🆈' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterY), '🆉' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredLatinCapitalLetterZ), '🆊' => Ok(EnclosedAlphanumericSupplement::CrossedNegativeSquaredLatinCapitalLetterP), '🆋' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredIc), '🆌' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredPa), '🆍' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredSa), '🆎' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredAb), '🆏' => Ok(EnclosedAlphanumericSupplement::NegativeSquaredWc), '🆐' => Ok(EnclosedAlphanumericSupplement::SquareDj), '🆑' => Ok(EnclosedAlphanumericSupplement::SquaredCl), '🆒' => Ok(EnclosedAlphanumericSupplement::SquaredCool), '🆓' => Ok(EnclosedAlphanumericSupplement::SquaredFree), '🆔' => Ok(EnclosedAlphanumericSupplement::SquaredId), '🆕' => Ok(EnclosedAlphanumericSupplement::SquaredNew), '🆖' => Ok(EnclosedAlphanumericSupplement::SquaredNg), '🆗' => Ok(EnclosedAlphanumericSupplement::SquaredOk), '🆘' => Ok(EnclosedAlphanumericSupplement::SquaredSos), '🆙' => Ok(EnclosedAlphanumericSupplement::SquaredUpWithExclamationMark), '🆚' => Ok(EnclosedAlphanumericSupplement::SquaredVs), '🆛' => Ok(EnclosedAlphanumericSupplement::SquaredThreeD), '🆜' => Ok(EnclosedAlphanumericSupplement::SquaredSecondScreen), '🆝' => Ok(EnclosedAlphanumericSupplement::SquaredTwoK), '🆞' => Ok(EnclosedAlphanumericSupplement::SquaredFourK), '🆟' => Ok(EnclosedAlphanumericSupplement::SquaredEightK), '🆠' => Ok(EnclosedAlphanumericSupplement::SquaredFivePointOne), '🆡' => Ok(EnclosedAlphanumericSupplement::SquaredSevenPointOne), '🆢' => Ok(EnclosedAlphanumericSupplement::SquaredTwentyDashTwoPointTwo), '🆣' => Ok(EnclosedAlphanumericSupplement::SquaredSixtyP), '🆤' => Ok(EnclosedAlphanumericSupplement::SquaredOneHundredTwentyP), '🆥' => Ok(EnclosedAlphanumericSupplement::SquaredLatinSmallLetterD), '🆦' => Ok(EnclosedAlphanumericSupplement::SquaredHc), '🆧' => Ok(EnclosedAlphanumericSupplement::SquaredHdr), '🆨' => Ok(EnclosedAlphanumericSupplement::SquaredHiDashRes), '🆩' => Ok(EnclosedAlphanumericSupplement::SquaredLossless), '🆪' => Ok(EnclosedAlphanumericSupplement::SquaredShv), '🆫' => Ok(EnclosedAlphanumericSupplement::SquaredUhd), '🆬' => Ok(EnclosedAlphanumericSupplement::SquaredVod), '🇦' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterA), '🇧' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterB), '🇨' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterC), '🇩' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterD), '🇪' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterE), '🇫' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterF), '🇬' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterG), '🇭' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterH), '🇮' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterI), '🇯' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterJ), '🇰' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterK), '🇱' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterL), '🇲' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterM), '🇳' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterN), '🇴' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterO), '🇵' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterP), '🇶' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterQ), '🇷' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterR), '🇸' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterS), '🇹' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterT), '🇺' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterU), '🇻' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterV), '🇼' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterW), '🇽' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterX), '🇾' => Ok(EnclosedAlphanumericSupplement::RegionalIndicatorSymbolLetterY), _ => Err(()), } } } impl Into<u32> for EnclosedAlphanumericSupplement { fn into(self) -> u32 { let c: char = self.into(); let hex = c .escape_unicode() .to_string() .replace("\\u{", "") .replace("}", ""); u32::from_str_radix(&hex, 16).unwrap() } } impl std::convert::TryFrom<u32> for EnclosedAlphanumericSupplement { type Error = (); fn try_from(u: u32) -> Result<Self, Self::Error> { if let Ok(c) = char::try_from(u) { Self::try_from(c) } else { Err(()) } } } impl Iterator for EnclosedAlphanumericSupplement { type Item = Self; fn next(&mut self) -> Option<Self> { let index: u32 = (*self).into(); use std::convert::TryFrom; Self::try_from(index + 1).ok() } } impl EnclosedAlphanumericSupplement { /// The character with the lowest index in this unicode block pub fn new() -> Self { EnclosedAlphanumericSupplement::DigitZeroFullStop } /// The character's name, in sentence case pub fn name(&self) -> String { let s = std::format!("EnclosedAlphanumericSupplement{:#?}", self); string_morph::to_sentence_case(&s) } }
use dotenv; use std::env; use diesel::prelude::*; use diesel::r2d2::{ Pool, PooledConnection, ConnectionManager }; pub type SqlitePool = Pool<ConnectionManager<SqliteConnection>>; pub type SqlitePooledConnection = PooledConnection<ConnectionManager<SqliteConnection>>; pub fn init_pool() -> SqlitePool { dotenv::dotenv().ok(); let database_url = env::var("DATABASE_URL").expect("DATABASE_URL"); let manager = ConnectionManager::<SqliteConnection>::new(database_url); Pool::builder().build(manager).expect("Failed to create pool") }
#![allow(unused_assignments, unreachable_patterns)] use win32::{HINSTANCE, HWND}; pub const VK_KHR_WIN32_SURFACE_SPEC_VERSION: u32 = 6; pub const VK_KHR_SURFACE_SPEC_VERSION: u32 = 25; pub const VK_KHR_SWAPCHAIN_SPEC_VERSION: u32 = 70; pub const VK_EXT_DEBUG_UTILS_SPEC_VERSION: u32 = 1; pub const VK_SUBPASS_EXTERNAL: u32 = 4294967295; pub const VK_QUEUE_FAMILY_IGNORED: u32 = 4294967295; pub const VK_FALSE: u32 = 0; pub const VK_TRUE: u32 = 1; pub const VK_ATTACHMENT_UNUSED: u32 = 4294967295; pub const VK_WHOLE_SIZE: u64 = 18446744073709551615; pub const VK_REMAINING_ARRAY_LAYERS: u32 = 4294967295; pub const VK_REMAINING_MIP_LEVELS: u32 = 4294967295; pub const VK_LOD_CLAMP_NONE: f32 = 1000.000000; pub const VK_KHR_WIN32_SURFACE_EXTENSION_NAME: &str = "VK_KHR_win32_surface"; pub const VK_KHR_WIN32_SURFACE_EXTENSION_NAME__C: &[u8] = b"VK_KHR_win32_surface\0"; pub const VK_KHR_SURFACE_EXTENSION_NAME: &str = "VK_KHR_surface"; pub const VK_KHR_SURFACE_EXTENSION_NAME__C: &[u8] = b"VK_KHR_surface\0"; pub const VK_KHR_SWAPCHAIN_EXTENSION_NAME: &str = "VK_KHR_swapchain"; pub const VK_KHR_SWAPCHAIN_EXTENSION_NAME__C: &[u8] = b"VK_KHR_swapchain\0"; pub const VK_EXT_DEBUG_UTILS_EXTENSION_NAME: &str = "VK_EXT_debug_utils"; pub const VK_EXT_DEBUG_UTILS_EXTENSION_NAME__C: &[u8] = b"VK_EXT_debug_utils\0"; pub type VkBool32 = u32; pub type VkFlags = u32; pub type VkDeviceSize = u64; pub type VkSampleMask = u32; pub type VkImageUsageFlags = VkImageUsageFlagBits; pub type VkCompositeAlphaFlagsKHR = VkCompositeAlphaFlagBitsKHR; pub type VkSurfaceTransformFlagsKHR = VkSurfaceTransformFlagBitsKHR; pub type VkSwapchainCreateFlagsKHR = VkSwapchainCreateFlagBitsKHR; pub type VkDebugUtilsMessageTypeFlagsEXT = VkDebugUtilsMessageTypeFlagBitsEXT; pub type VkDebugUtilsMessageSeverityFlagsEXT = VkDebugUtilsMessageSeverityFlagBitsEXT; pub type VkAccessFlags = VkAccessFlagBits; pub type VkImageAspectFlags = VkImageAspectFlagBits; pub type VkShaderStageFlags = VkShaderStageFlagBits; pub type VkQueryResultFlags = VkQueryResultFlagBits; pub type VkQueryControlFlags = VkQueryControlFlagBits; pub type VkDependencyFlags = VkDependencyFlagBits; pub type VkPipelineStageFlags = VkPipelineStageFlagBits; pub type VkStencilFaceFlags = VkStencilFaceFlagBits; pub type VkCommandBufferResetFlags = VkCommandBufferResetFlagBits; pub type VkQueryPipelineStatisticFlags = VkQueryPipelineStatisticFlagBits; pub type VkCommandBufferUsageFlags = VkCommandBufferUsageFlagBits; pub type VkCommandPoolResetFlags = VkCommandPoolResetFlagBits; pub type VkCommandPoolCreateFlags = VkCommandPoolCreateFlagBits; pub type VkSubpassDescriptionFlags = VkSubpassDescriptionFlagBits; pub type VkAttachmentDescriptionFlags = VkAttachmentDescriptionFlagBits; pub type VkDescriptorPoolCreateFlags = VkDescriptorPoolCreateFlagBits; pub type VkDescriptorSetLayoutCreateFlags = VkDescriptorSetLayoutCreateFlagBits; pub type VkSamplerCreateFlags = VkSamplerCreateFlagBits; pub type VkPipelineCreateFlags = VkPipelineCreateFlagBits; pub type VkColorComponentFlags = VkColorComponentFlagBits; pub type VkCullModeFlags = VkCullModeFlagBits; pub type VkImageViewCreateFlags = VkImageViewCreateFlagBits; pub type VkImageCreateFlags = VkImageCreateFlagBits; pub type VkBufferUsageFlags = VkBufferUsageFlagBits; pub type VkBufferCreateFlags = VkBufferCreateFlagBits; pub type VkFenceCreateFlags = VkFenceCreateFlagBits; pub type VkSparseMemoryBindFlags = VkSparseMemoryBindFlagBits; pub type VkSparseImageFormatFlags = VkSparseImageFormatFlagBits; pub type VkDeviceQueueCreateFlags = VkDeviceQueueCreateFlagBits; pub type VkMemoryHeapFlags = VkMemoryHeapFlagBits; pub type VkMemoryPropertyFlags = VkMemoryPropertyFlagBits; pub type VkQueueFlags = VkQueueFlagBits; pub type VkSampleCountFlags = VkSampleCountFlagBits; pub type VkFormatFeatureFlags = VkFormatFeatureFlagBits; #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkPhysicalDevice(usize); impl VkPhysicalDevice { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: usize) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> usize { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkSurfaceKHR(u64); impl VkSurfaceKHR { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkInstance(usize); impl VkInstance { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: usize) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> usize { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkSwapchainKHR(u64); impl VkSwapchainKHR { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkSemaphore(u64); impl VkSemaphore { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkQueue(usize); impl VkQueue { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: usize) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> usize { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkFence(u64); impl VkFence { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkDevice(usize); impl VkDevice { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: usize) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> usize { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkImage(u64); impl VkImage { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkDebugUtilsMessengerEXT(u64); impl VkDebugUtilsMessengerEXT { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkCommandBuffer(usize); impl VkCommandBuffer { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: usize) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> usize { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkBuffer(u64); impl VkBuffer { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkFramebuffer(u64); impl VkFramebuffer { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkRenderPass(u64); impl VkRenderPass { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkPipelineLayout(u64); impl VkPipelineLayout { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkQueryPool(u64); impl VkQueryPool { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkEvent(u64); impl VkEvent { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkDescriptorSet(u64); impl VkDescriptorSet { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkPipeline(u64); impl VkPipeline { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkCommandPool(u64); impl VkCommandPool { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkImageView(u64); impl VkImageView { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkBufferView(u64); impl VkBufferView { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkSampler(u64); impl VkSampler { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkDescriptorPool(u64); impl VkDescriptorPool { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkDescriptorSetLayout(u64); impl VkDescriptorSetLayout { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkShaderModule(u64); impl VkShaderModule { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkPipelineCache(u64); impl VkPipelineCache { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialEq, Eq)] pub struct VkDeviceMemory(u64); impl VkDeviceMemory { #[inline] pub fn null() -> Self { Self(0) } #[inline] pub fn from_raw(r: u64) -> Self { Self(r) } #[inline] pub fn as_raw(&self) -> u64 { self.0 } } pub type VkWin32SurfaceCreateFlagsKHR = VkFlags; pub type VkDebugUtilsMessengerCallbackDataFlagsEXT = VkFlags; pub type VkDebugUtilsMessengerCreateFlagsEXT = VkFlags; pub type VkRenderPassCreateFlags = VkFlags; pub type VkFramebufferCreateFlags = VkFlags; pub type VkDescriptorPoolResetFlags = VkFlags; pub type VkPipelineLayoutCreateFlags = VkFlags; pub type VkPipelineShaderStageCreateFlags = VkFlags; pub type VkPipelineDynamicStateCreateFlags = VkFlags; pub type VkPipelineColorBlendStateCreateFlags = VkFlags; pub type VkPipelineDepthStencilStateCreateFlags = VkFlags; pub type VkPipelineMultisampleStateCreateFlags = VkFlags; pub type VkPipelineRasterizationStateCreateFlags = VkFlags; pub type VkPipelineViewportStateCreateFlags = VkFlags; pub type VkPipelineTessellationStateCreateFlags = VkFlags; pub type VkPipelineInputAssemblyStateCreateFlags = VkFlags; pub type VkPipelineVertexInputStateCreateFlags = VkFlags; pub type VkPipelineCacheCreateFlags = VkFlags; pub type VkShaderModuleCreateFlags = VkFlags; pub type VkBufferViewCreateFlags = VkFlags; pub type VkQueryPoolCreateFlags = VkFlags; pub type VkEventCreateFlags = VkFlags; pub type VkSemaphoreCreateFlags = VkFlags; pub type VkMemoryMapFlags = VkFlags; pub type VkDeviceCreateFlags = VkFlags; pub type VkInstanceCreateFlags = VkFlags; #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkSystemAllocationScope(u32); impl VkSystemAllocationScope { pub const COMMAND: VkSystemAllocationScope = VkSystemAllocationScope(0); pub const OBJECT: VkSystemAllocationScope = VkSystemAllocationScope(1); pub const CACHE: VkSystemAllocationScope = VkSystemAllocationScope(2); pub const DEVICE: VkSystemAllocationScope = VkSystemAllocationScope(3); pub const INSTANCE: VkSystemAllocationScope = VkSystemAllocationScope(4); } impl core::fmt::Debug for VkSystemAllocationScope { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkSystemAllocationScope::COMMAND => write!(f, "VkSystemAllocationScope(COMMAND)"), VkSystemAllocationScope::OBJECT => write!(f, "VkSystemAllocationScope(OBJECT)"), VkSystemAllocationScope::CACHE => write!(f, "VkSystemAllocationScope(CACHE)"), VkSystemAllocationScope::DEVICE => write!(f, "VkSystemAllocationScope(DEVICE)"), VkSystemAllocationScope::INSTANCE => write!(f, "VkSystemAllocationScope(INSTANCE)"), _ => write!(f, "VkSystemAllocationScope({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkInternalAllocationType(u32); impl VkInternalAllocationType { pub const EXECUTABLE: VkInternalAllocationType = VkInternalAllocationType(0); } impl core::fmt::Debug for VkInternalAllocationType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkInternalAllocationType::EXECUTABLE => { write!(f, "VkInternalAllocationType(EXECUTABLE)") } _ => write!(f, "VkInternalAllocationType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkStructureType(u32); impl VkStructureType { pub const APPLICATION_INFO: VkStructureType = VkStructureType(0); pub const INSTANCE_CREATE_INFO: VkStructureType = VkStructureType(1); pub const DEVICE_QUEUE_CREATE_INFO: VkStructureType = VkStructureType(2); pub const DEVICE_CREATE_INFO: VkStructureType = VkStructureType(3); pub const SUBMIT_INFO: VkStructureType = VkStructureType(4); pub const MEMORY_ALLOCATE_INFO: VkStructureType = VkStructureType(5); pub const MAPPED_MEMORY_RANGE: VkStructureType = VkStructureType(6); pub const BIND_SPARSE_INFO: VkStructureType = VkStructureType(7); pub const FENCE_CREATE_INFO: VkStructureType = VkStructureType(8); pub const SEMAPHORE_CREATE_INFO: VkStructureType = VkStructureType(9); pub const EVENT_CREATE_INFO: VkStructureType = VkStructureType(10); pub const QUERY_POOL_CREATE_INFO: VkStructureType = VkStructureType(11); pub const BUFFER_CREATE_INFO: VkStructureType = VkStructureType(12); pub const BUFFER_VIEW_CREATE_INFO: VkStructureType = VkStructureType(13); pub const IMAGE_CREATE_INFO: VkStructureType = VkStructureType(14); pub const IMAGE_VIEW_CREATE_INFO: VkStructureType = VkStructureType(15); pub const SHADER_MODULE_CREATE_INFO: VkStructureType = VkStructureType(16); pub const PIPELINE_CACHE_CREATE_INFO: VkStructureType = VkStructureType(17); pub const PIPELINE_SHADER_STAGE_CREATE_INFO: VkStructureType = VkStructureType(18); pub const PIPELINE_VERTEX_INPUT_STATE_CREATE_INFO: VkStructureType = VkStructureType(19); pub const PIPELINE_INPUT_ASSEMBLY_STATE_CREATE_INFO: VkStructureType = VkStructureType(20); pub const PIPELINE_TESSELLATION_STATE_CREATE_INFO: VkStructureType = VkStructureType(21); pub const PIPELINE_VIEWPORT_STATE_CREATE_INFO: VkStructureType = VkStructureType(22); pub const PIPELINE_RASTERIZATION_STATE_CREATE_INFO: VkStructureType = VkStructureType(23); pub const PIPELINE_MULTISAMPLE_STATE_CREATE_INFO: VkStructureType = VkStructureType(24); pub const PIPELINE_DEPTH_STENCIL_STATE_CREATE_INFO: VkStructureType = VkStructureType(25); pub const PIPELINE_COLOR_BLEND_STATE_CREATE_INFO: VkStructureType = VkStructureType(26); pub const PIPELINE_DYNAMIC_STATE_CREATE_INFO: VkStructureType = VkStructureType(27); pub const GRAPHICS_PIPELINE_CREATE_INFO: VkStructureType = VkStructureType(28); pub const COMPUTE_PIPELINE_CREATE_INFO: VkStructureType = VkStructureType(29); pub const PIPELINE_LAYOUT_CREATE_INFO: VkStructureType = VkStructureType(30); pub const SAMPLER_CREATE_INFO: VkStructureType = VkStructureType(31); pub const DESCRIPTOR_SET_LAYOUT_CREATE_INFO: VkStructureType = VkStructureType(32); pub const DESCRIPTOR_POOL_CREATE_INFO: VkStructureType = VkStructureType(33); pub const DESCRIPTOR_SET_ALLOCATE_INFO: VkStructureType = VkStructureType(34); pub const WRITE_DESCRIPTOR_SET: VkStructureType = VkStructureType(35); pub const COPY_DESCRIPTOR_SET: VkStructureType = VkStructureType(36); pub const FRAMEBUFFER_CREATE_INFO: VkStructureType = VkStructureType(37); pub const RENDER_PASS_CREATE_INFO: VkStructureType = VkStructureType(38); pub const COMMAND_POOL_CREATE_INFO: VkStructureType = VkStructureType(39); pub const COMMAND_BUFFER_ALLOCATE_INFO: VkStructureType = VkStructureType(40); pub const COMMAND_BUFFER_INHERITANCE_INFO: VkStructureType = VkStructureType(41); pub const COMMAND_BUFFER_BEGIN_INFO: VkStructureType = VkStructureType(42); pub const RENDER_PASS_BEGIN_INFO: VkStructureType = VkStructureType(43); pub const BUFFER_MEMORY_BARRIER: VkStructureType = VkStructureType(44); pub const IMAGE_MEMORY_BARRIER: VkStructureType = VkStructureType(45); pub const MEMORY_BARRIER: VkStructureType = VkStructureType(46); pub const LOADER_INSTANCE_CREATE_INFO: VkStructureType = VkStructureType(47); pub const LOADER_DEVICE_CREATE_INFO: VkStructureType = VkStructureType(48); pub const SWAPCHAIN_CREATE_INFO_KHR: VkStructureType = VkStructureType(1000001000); pub const PRESENT_INFO_KHR: VkStructureType = VkStructureType(1000001001); pub const WIN32_SURFACE_CREATE_INFO_KHR: VkStructureType = VkStructureType(1000009000); pub const DEBUG_UTILS_OBJECT_NAME_INFO_EXT: VkStructureType = VkStructureType(1000128000); pub const DEBUG_UTILS_OBJECT_TAG_INFO_EXT: VkStructureType = VkStructureType(1000128001); pub const DEBUG_UTILS_LABEL_EXT: VkStructureType = VkStructureType(1000128002); pub const DEBUG_UTILS_MESSENGER_CALLBACK_DATA_EXT: VkStructureType = VkStructureType(1000128003); pub const DEBUG_UTILS_MESSENGER_CREATE_INFO_EXT: VkStructureType = VkStructureType(1000128004); } impl core::fmt::Debug for VkStructureType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkStructureType::APPLICATION_INFO => write!(f, "VkStructureType(APPLICATION_INFO)"), VkStructureType::INSTANCE_CREATE_INFO => { write!(f, "VkStructureType(INSTANCE_CREATE_INFO)") } VkStructureType::DEVICE_QUEUE_CREATE_INFO => { write!(f, "VkStructureType(DEVICE_QUEUE_CREATE_INFO)") } VkStructureType::DEVICE_CREATE_INFO => write!(f, "VkStructureType(DEVICE_CREATE_INFO)"), VkStructureType::SUBMIT_INFO => write!(f, "VkStructureType(SUBMIT_INFO)"), VkStructureType::MEMORY_ALLOCATE_INFO => { write!(f, "VkStructureType(MEMORY_ALLOCATE_INFO)") } VkStructureType::MAPPED_MEMORY_RANGE => { write!(f, "VkStructureType(MAPPED_MEMORY_RANGE)") } VkStructureType::BIND_SPARSE_INFO => write!(f, "VkStructureType(BIND_SPARSE_INFO)"), VkStructureType::FENCE_CREATE_INFO => write!(f, "VkStructureType(FENCE_CREATE_INFO)"), VkStructureType::SEMAPHORE_CREATE_INFO => { write!(f, "VkStructureType(SEMAPHORE_CREATE_INFO)") } VkStructureType::EVENT_CREATE_INFO => write!(f, "VkStructureType(EVENT_CREATE_INFO)"), VkStructureType::QUERY_POOL_CREATE_INFO => { write!(f, "VkStructureType(QUERY_POOL_CREATE_INFO)") } VkStructureType::BUFFER_CREATE_INFO => write!(f, "VkStructureType(BUFFER_CREATE_INFO)"), VkStructureType::BUFFER_VIEW_CREATE_INFO => { write!(f, "VkStructureType(BUFFER_VIEW_CREATE_INFO)") } VkStructureType::IMAGE_CREATE_INFO => write!(f, "VkStructureType(IMAGE_CREATE_INFO)"), VkStructureType::IMAGE_VIEW_CREATE_INFO => { write!(f, "VkStructureType(IMAGE_VIEW_CREATE_INFO)") } VkStructureType::SHADER_MODULE_CREATE_INFO => { write!(f, "VkStructureType(SHADER_MODULE_CREATE_INFO)") } VkStructureType::PIPELINE_CACHE_CREATE_INFO => { write!(f, "VkStructureType(PIPELINE_CACHE_CREATE_INFO)") } VkStructureType::PIPELINE_SHADER_STAGE_CREATE_INFO => { write!(f, "VkStructureType(PIPELINE_SHADER_STAGE_CREATE_INFO)") } VkStructureType::PIPELINE_VERTEX_INPUT_STATE_CREATE_INFO => write!( f, "VkStructureType(PIPELINE_VERTEX_INPUT_STATE_CREATE_INFO)" ), VkStructureType::PIPELINE_INPUT_ASSEMBLY_STATE_CREATE_INFO => write!( f, "VkStructureType(PIPELINE_INPUT_ASSEMBLY_STATE_CREATE_INFO)" ), VkStructureType::PIPELINE_TESSELLATION_STATE_CREATE_INFO => write!( f, "VkStructureType(PIPELINE_TESSELLATION_STATE_CREATE_INFO)" ), VkStructureType::PIPELINE_VIEWPORT_STATE_CREATE_INFO => { write!(f, "VkStructureType(PIPELINE_VIEWPORT_STATE_CREATE_INFO)") } VkStructureType::PIPELINE_RASTERIZATION_STATE_CREATE_INFO => write!( f, "VkStructureType(PIPELINE_RASTERIZATION_STATE_CREATE_INFO)" ), VkStructureType::PIPELINE_MULTISAMPLE_STATE_CREATE_INFO => { write!(f, "VkStructureType(PIPELINE_MULTISAMPLE_STATE_CREATE_INFO)") } VkStructureType::PIPELINE_DEPTH_STENCIL_STATE_CREATE_INFO => write!( f, "VkStructureType(PIPELINE_DEPTH_STENCIL_STATE_CREATE_INFO)" ), VkStructureType::PIPELINE_COLOR_BLEND_STATE_CREATE_INFO => { write!(f, "VkStructureType(PIPELINE_COLOR_BLEND_STATE_CREATE_INFO)") } VkStructureType::PIPELINE_DYNAMIC_STATE_CREATE_INFO => { write!(f, "VkStructureType(PIPELINE_DYNAMIC_STATE_CREATE_INFO)") } VkStructureType::GRAPHICS_PIPELINE_CREATE_INFO => { write!(f, "VkStructureType(GRAPHICS_PIPELINE_CREATE_INFO)") } VkStructureType::COMPUTE_PIPELINE_CREATE_INFO => { write!(f, "VkStructureType(COMPUTE_PIPELINE_CREATE_INFO)") } VkStructureType::PIPELINE_LAYOUT_CREATE_INFO => { write!(f, "VkStructureType(PIPELINE_LAYOUT_CREATE_INFO)") } VkStructureType::SAMPLER_CREATE_INFO => { write!(f, "VkStructureType(SAMPLER_CREATE_INFO)") } VkStructureType::DESCRIPTOR_SET_LAYOUT_CREATE_INFO => { write!(f, "VkStructureType(DESCRIPTOR_SET_LAYOUT_CREATE_INFO)") } VkStructureType::DESCRIPTOR_POOL_CREATE_INFO => { write!(f, "VkStructureType(DESCRIPTOR_POOL_CREATE_INFO)") } VkStructureType::DESCRIPTOR_SET_ALLOCATE_INFO => { write!(f, "VkStructureType(DESCRIPTOR_SET_ALLOCATE_INFO)") } VkStructureType::WRITE_DESCRIPTOR_SET => { write!(f, "VkStructureType(WRITE_DESCRIPTOR_SET)") } VkStructureType::COPY_DESCRIPTOR_SET => { write!(f, "VkStructureType(COPY_DESCRIPTOR_SET)") } VkStructureType::FRAMEBUFFER_CREATE_INFO => { write!(f, "VkStructureType(FRAMEBUFFER_CREATE_INFO)") } VkStructureType::RENDER_PASS_CREATE_INFO => { write!(f, "VkStructureType(RENDER_PASS_CREATE_INFO)") } VkStructureType::COMMAND_POOL_CREATE_INFO => { write!(f, "VkStructureType(COMMAND_POOL_CREATE_INFO)") } VkStructureType::COMMAND_BUFFER_ALLOCATE_INFO => { write!(f, "VkStructureType(COMMAND_BUFFER_ALLOCATE_INFO)") } VkStructureType::COMMAND_BUFFER_INHERITANCE_INFO => { write!(f, "VkStructureType(COMMAND_BUFFER_INHERITANCE_INFO)") } VkStructureType::COMMAND_BUFFER_BEGIN_INFO => { write!(f, "VkStructureType(COMMAND_BUFFER_BEGIN_INFO)") } VkStructureType::RENDER_PASS_BEGIN_INFO => { write!(f, "VkStructureType(RENDER_PASS_BEGIN_INFO)") } VkStructureType::BUFFER_MEMORY_BARRIER => { write!(f, "VkStructureType(BUFFER_MEMORY_BARRIER)") } VkStructureType::IMAGE_MEMORY_BARRIER => { write!(f, "VkStructureType(IMAGE_MEMORY_BARRIER)") } VkStructureType::MEMORY_BARRIER => write!(f, "VkStructureType(MEMORY_BARRIER)"), VkStructureType::LOADER_INSTANCE_CREATE_INFO => { write!(f, "VkStructureType(LOADER_INSTANCE_CREATE_INFO)") } VkStructureType::LOADER_DEVICE_CREATE_INFO => { write!(f, "VkStructureType(LOADER_DEVICE_CREATE_INFO)") } VkStructureType::SWAPCHAIN_CREATE_INFO_KHR => { write!(f, "VkStructureType(SWAPCHAIN_CREATE_INFO_KHR)") } VkStructureType::PRESENT_INFO_KHR => write!(f, "VkStructureType(PRESENT_INFO_KHR)"), VkStructureType::WIN32_SURFACE_CREATE_INFO_KHR => { write!(f, "VkStructureType(WIN32_SURFACE_CREATE_INFO_KHR)") } VkStructureType::DEBUG_UTILS_OBJECT_NAME_INFO_EXT => { write!(f, "VkStructureType(DEBUG_UTILS_OBJECT_NAME_INFO_EXT)") } VkStructureType::DEBUG_UTILS_OBJECT_TAG_INFO_EXT => { write!(f, "VkStructureType(DEBUG_UTILS_OBJECT_TAG_INFO_EXT)") } VkStructureType::DEBUG_UTILS_LABEL_EXT => { write!(f, "VkStructureType(DEBUG_UTILS_LABEL_EXT)") } VkStructureType::DEBUG_UTILS_MESSENGER_CALLBACK_DATA_EXT => write!( f, "VkStructureType(DEBUG_UTILS_MESSENGER_CALLBACK_DATA_EXT)" ), VkStructureType::DEBUG_UTILS_MESSENGER_CREATE_INFO_EXT => { write!(f, "VkStructureType(DEBUG_UTILS_MESSENGER_CREATE_INFO_EXT)") } _ => write!(f, "VkStructureType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkResult(u32); impl VkResult { pub const ERROR_OUT_OF_DATE_KHR: VkResult = VkResult(-1000001004i32 as u32); pub const ERROR_NATIVE_WINDOW_IN_USE_KHR: VkResult = VkResult(-1000000001i32 as u32); pub const ERROR_SURFACE_LOST_KHR: VkResult = VkResult(-1000000000i32 as u32); pub const ERROR_FRAGMENTED_POOL: VkResult = VkResult(-12i32 as u32); pub const ERROR_FORMAT_NOT_SUPPORTED: VkResult = VkResult(-11i32 as u32); pub const ERROR_TOO_MANY_OBJECTS: VkResult = VkResult(-10i32 as u32); pub const ERROR_INCOMPATIBLE_DRIVER: VkResult = VkResult(-9i32 as u32); pub const ERROR_FEATURE_NOT_PRESENT: VkResult = VkResult(-8i32 as u32); pub const ERROR_EXTENSION_NOT_PRESENT: VkResult = VkResult(-7i32 as u32); pub const ERROR_LAYER_NOT_PRESENT: VkResult = VkResult(-6i32 as u32); pub const ERROR_MEMORY_MAP_FAILED: VkResult = VkResult(-5i32 as u32); pub const ERROR_DEVICE_LOST: VkResult = VkResult(-4i32 as u32); pub const ERROR_INITIALIZATION_FAILED: VkResult = VkResult(-3i32 as u32); pub const ERROR_OUT_OF_DEVICE_MEMORY: VkResult = VkResult(-2i32 as u32); pub const ERROR_OUT_OF_HOST_MEMORY: VkResult = VkResult(-1i32 as u32); pub const SUCCESS: VkResult = VkResult(0); pub const NOT_READY: VkResult = VkResult(1); pub const TIMEOUT: VkResult = VkResult(2); pub const EVENT_SET: VkResult = VkResult(3); pub const EVENT_RESET: VkResult = VkResult(4); pub const INCOMPLETE: VkResult = VkResult(5); pub const SUBOPTIMAL_KHR: VkResult = VkResult(1000001003); } impl core::fmt::Debug for VkResult { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkResult::ERROR_OUT_OF_DATE_KHR => write!(f, "VkResult(ERROR_OUT_OF_DATE_KHR)"), VkResult::ERROR_NATIVE_WINDOW_IN_USE_KHR => { write!(f, "VkResult(ERROR_NATIVE_WINDOW_IN_USE_KHR)") } VkResult::ERROR_SURFACE_LOST_KHR => write!(f, "VkResult(ERROR_SURFACE_LOST_KHR)"), VkResult::ERROR_FRAGMENTED_POOL => write!(f, "VkResult(ERROR_FRAGMENTED_POOL)"), VkResult::ERROR_FORMAT_NOT_SUPPORTED => { write!(f, "VkResult(ERROR_FORMAT_NOT_SUPPORTED)") } VkResult::ERROR_TOO_MANY_OBJECTS => write!(f, "VkResult(ERROR_TOO_MANY_OBJECTS)"), VkResult::ERROR_INCOMPATIBLE_DRIVER => write!(f, "VkResult(ERROR_INCOMPATIBLE_DRIVER)"), VkResult::ERROR_FEATURE_NOT_PRESENT => write!(f, "VkResult(ERROR_FEATURE_NOT_PRESENT)"), VkResult::ERROR_EXTENSION_NOT_PRESENT => { write!(f, "VkResult(ERROR_EXTENSION_NOT_PRESENT)") } VkResult::ERROR_LAYER_NOT_PRESENT => write!(f, "VkResult(ERROR_LAYER_NOT_PRESENT)"), VkResult::ERROR_MEMORY_MAP_FAILED => write!(f, "VkResult(ERROR_MEMORY_MAP_FAILED)"), VkResult::ERROR_DEVICE_LOST => write!(f, "VkResult(ERROR_DEVICE_LOST)"), VkResult::ERROR_INITIALIZATION_FAILED => { write!(f, "VkResult(ERROR_INITIALIZATION_FAILED)") } VkResult::ERROR_OUT_OF_DEVICE_MEMORY => { write!(f, "VkResult(ERROR_OUT_OF_DEVICE_MEMORY)") } VkResult::ERROR_OUT_OF_HOST_MEMORY => write!(f, "VkResult(ERROR_OUT_OF_HOST_MEMORY)"), VkResult::SUCCESS => write!(f, "VkResult(SUCCESS)"), VkResult::NOT_READY => write!(f, "VkResult(NOT_READY)"), VkResult::TIMEOUT => write!(f, "VkResult(TIMEOUT)"), VkResult::EVENT_SET => write!(f, "VkResult(EVENT_SET)"), VkResult::EVENT_RESET => write!(f, "VkResult(EVENT_RESET)"), VkResult::INCOMPLETE => write!(f, "VkResult(INCOMPLETE)"), VkResult::SUBOPTIMAL_KHR => write!(f, "VkResult(SUBOPTIMAL_KHR)"), _ => write!(f, "VkResult({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkPresentModeKHR(u32); impl VkPresentModeKHR { pub const IMMEDIATE_KHR: VkPresentModeKHR = VkPresentModeKHR(0); pub const MAILBOX_KHR: VkPresentModeKHR = VkPresentModeKHR(1); pub const FIFO_KHR: VkPresentModeKHR = VkPresentModeKHR(2); pub const FIFO_RELAXED_KHR: VkPresentModeKHR = VkPresentModeKHR(3); } impl core::fmt::Debug for VkPresentModeKHR { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkPresentModeKHR::IMMEDIATE_KHR => write!(f, "VkPresentModeKHR(IMMEDIATE_KHR)"), VkPresentModeKHR::MAILBOX_KHR => write!(f, "VkPresentModeKHR(MAILBOX_KHR)"), VkPresentModeKHR::FIFO_KHR => write!(f, "VkPresentModeKHR(FIFO_KHR)"), VkPresentModeKHR::FIFO_RELAXED_KHR => write!(f, "VkPresentModeKHR(FIFO_RELAXED_KHR)"), _ => write!(f, "VkPresentModeKHR({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkColorSpaceKHR(u32); impl VkColorSpaceKHR { pub const SRGB_NONLINEAR_KHR: VkColorSpaceKHR = VkColorSpaceKHR(0); pub const VK_COLORSPACE_SRGB_NONLINEAR_KHR: VkColorSpaceKHR = VkColorSpaceKHR(0); } impl core::fmt::Debug for VkColorSpaceKHR { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkColorSpaceKHR::SRGB_NONLINEAR_KHR => write!(f, "VkColorSpaceKHR(SRGB_NONLINEAR_KHR)"), VkColorSpaceKHR::VK_COLORSPACE_SRGB_NONLINEAR_KHR => { write!(f, "VkColorSpaceKHR(VK_COLORSPACE_SRGB_NONLINEAR_KHR)") } _ => write!(f, "VkColorSpaceKHR({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkFormat(u32); impl VkFormat { pub const UNDEFINED: VkFormat = VkFormat(0); pub const R4G4_UNORM_PACK8: VkFormat = VkFormat(1); pub const R4G4B4A4_UNORM_PACK16: VkFormat = VkFormat(2); pub const B4G4R4A4_UNORM_PACK16: VkFormat = VkFormat(3); pub const R5G6B5_UNORM_PACK16: VkFormat = VkFormat(4); pub const B5G6R5_UNORM_PACK16: VkFormat = VkFormat(5); pub const R5G5B5A1_UNORM_PACK16: VkFormat = VkFormat(6); pub const B5G5R5A1_UNORM_PACK16: VkFormat = VkFormat(7); pub const A1R5G5B5_UNORM_PACK16: VkFormat = VkFormat(8); pub const R8_UNORM: VkFormat = VkFormat(9); pub const R8_SNORM: VkFormat = VkFormat(10); pub const R8_USCALED: VkFormat = VkFormat(11); pub const R8_SSCALED: VkFormat = VkFormat(12); pub const R8_UINT: VkFormat = VkFormat(13); pub const R8_SINT: VkFormat = VkFormat(14); pub const R8_SRGB: VkFormat = VkFormat(15); pub const R8G8_UNORM: VkFormat = VkFormat(16); pub const R8G8_SNORM: VkFormat = VkFormat(17); pub const R8G8_USCALED: VkFormat = VkFormat(18); pub const R8G8_SSCALED: VkFormat = VkFormat(19); pub const R8G8_UINT: VkFormat = VkFormat(20); pub const R8G8_SINT: VkFormat = VkFormat(21); pub const R8G8_SRGB: VkFormat = VkFormat(22); pub const R8G8B8_UNORM: VkFormat = VkFormat(23); pub const R8G8B8_SNORM: VkFormat = VkFormat(24); pub const R8G8B8_USCALED: VkFormat = VkFormat(25); pub const R8G8B8_SSCALED: VkFormat = VkFormat(26); pub const R8G8B8_UINT: VkFormat = VkFormat(27); pub const R8G8B8_SINT: VkFormat = VkFormat(28); pub const R8G8B8_SRGB: VkFormat = VkFormat(29); pub const B8G8R8_UNORM: VkFormat = VkFormat(30); pub const B8G8R8_SNORM: VkFormat = VkFormat(31); pub const B8G8R8_USCALED: VkFormat = VkFormat(32); pub const B8G8R8_SSCALED: VkFormat = VkFormat(33); pub const B8G8R8_UINT: VkFormat = VkFormat(34); pub const B8G8R8_SINT: VkFormat = VkFormat(35); pub const B8G8R8_SRGB: VkFormat = VkFormat(36); pub const R8G8B8A8_UNORM: VkFormat = VkFormat(37); pub const R8G8B8A8_SNORM: VkFormat = VkFormat(38); pub const R8G8B8A8_USCALED: VkFormat = VkFormat(39); pub const R8G8B8A8_SSCALED: VkFormat = VkFormat(40); pub const R8G8B8A8_UINT: VkFormat = VkFormat(41); pub const R8G8B8A8_SINT: VkFormat = VkFormat(42); pub const R8G8B8A8_SRGB: VkFormat = VkFormat(43); pub const B8G8R8A8_UNORM: VkFormat = VkFormat(44); pub const B8G8R8A8_SNORM: VkFormat = VkFormat(45); pub const B8G8R8A8_USCALED: VkFormat = VkFormat(46); pub const B8G8R8A8_SSCALED: VkFormat = VkFormat(47); pub const B8G8R8A8_UINT: VkFormat = VkFormat(48); pub const B8G8R8A8_SINT: VkFormat = VkFormat(49); pub const B8G8R8A8_SRGB: VkFormat = VkFormat(50); pub const A8B8G8R8_UNORM_PACK32: VkFormat = VkFormat(51); pub const A8B8G8R8_SNORM_PACK32: VkFormat = VkFormat(52); pub const A8B8G8R8_USCALED_PACK32: VkFormat = VkFormat(53); pub const A8B8G8R8_SSCALED_PACK32: VkFormat = VkFormat(54); pub const A8B8G8R8_UINT_PACK32: VkFormat = VkFormat(55); pub const A8B8G8R8_SINT_PACK32: VkFormat = VkFormat(56); pub const A8B8G8R8_SRGB_PACK32: VkFormat = VkFormat(57); pub const A2R10G10B10_UNORM_PACK32: VkFormat = VkFormat(58); pub const A2R10G10B10_SNORM_PACK32: VkFormat = VkFormat(59); pub const A2R10G10B10_USCALED_PACK32: VkFormat = VkFormat(60); pub const A2R10G10B10_SSCALED_PACK32: VkFormat = VkFormat(61); pub const A2R10G10B10_UINT_PACK32: VkFormat = VkFormat(62); pub const A2R10G10B10_SINT_PACK32: VkFormat = VkFormat(63); pub const A2B10G10R10_UNORM_PACK32: VkFormat = VkFormat(64); pub const A2B10G10R10_SNORM_PACK32: VkFormat = VkFormat(65); pub const A2B10G10R10_USCALED_PACK32: VkFormat = VkFormat(66); pub const A2B10G10R10_SSCALED_PACK32: VkFormat = VkFormat(67); pub const A2B10G10R10_UINT_PACK32: VkFormat = VkFormat(68); pub const A2B10G10R10_SINT_PACK32: VkFormat = VkFormat(69); pub const R16_UNORM: VkFormat = VkFormat(70); pub const R16_SNORM: VkFormat = VkFormat(71); pub const R16_USCALED: VkFormat = VkFormat(72); pub const R16_SSCALED: VkFormat = VkFormat(73); pub const R16_UINT: VkFormat = VkFormat(74); pub const R16_SINT: VkFormat = VkFormat(75); pub const R16_SFLOAT: VkFormat = VkFormat(76); pub const R16G16_UNORM: VkFormat = VkFormat(77); pub const R16G16_SNORM: VkFormat = VkFormat(78); pub const R16G16_USCALED: VkFormat = VkFormat(79); pub const R16G16_SSCALED: VkFormat = VkFormat(80); pub const R16G16_UINT: VkFormat = VkFormat(81); pub const R16G16_SINT: VkFormat = VkFormat(82); pub const R16G16_SFLOAT: VkFormat = VkFormat(83); pub const R16G16B16_UNORM: VkFormat = VkFormat(84); pub const R16G16B16_SNORM: VkFormat = VkFormat(85); pub const R16G16B16_USCALED: VkFormat = VkFormat(86); pub const R16G16B16_SSCALED: VkFormat = VkFormat(87); pub const R16G16B16_UINT: VkFormat = VkFormat(88); pub const R16G16B16_SINT: VkFormat = VkFormat(89); pub const R16G16B16_SFLOAT: VkFormat = VkFormat(90); pub const R16G16B16A16_UNORM: VkFormat = VkFormat(91); pub const R16G16B16A16_SNORM: VkFormat = VkFormat(92); pub const R16G16B16A16_USCALED: VkFormat = VkFormat(93); pub const R16G16B16A16_SSCALED: VkFormat = VkFormat(94); pub const R16G16B16A16_UINT: VkFormat = VkFormat(95); pub const R16G16B16A16_SINT: VkFormat = VkFormat(96); pub const R16G16B16A16_SFLOAT: VkFormat = VkFormat(97); pub const R32_UINT: VkFormat = VkFormat(98); pub const R32_SINT: VkFormat = VkFormat(99); pub const R32_SFLOAT: VkFormat = VkFormat(100); pub const R32G32_UINT: VkFormat = VkFormat(101); pub const R32G32_SINT: VkFormat = VkFormat(102); pub const R32G32_SFLOAT: VkFormat = VkFormat(103); pub const R32G32B32_UINT: VkFormat = VkFormat(104); pub const R32G32B32_SINT: VkFormat = VkFormat(105); pub const R32G32B32_SFLOAT: VkFormat = VkFormat(106); pub const R32G32B32A32_UINT: VkFormat = VkFormat(107); pub const R32G32B32A32_SINT: VkFormat = VkFormat(108); pub const R32G32B32A32_SFLOAT: VkFormat = VkFormat(109); pub const R64_UINT: VkFormat = VkFormat(110); pub const R64_SINT: VkFormat = VkFormat(111); pub const R64_SFLOAT: VkFormat = VkFormat(112); pub const R64G64_UINT: VkFormat = VkFormat(113); pub const R64G64_SINT: VkFormat = VkFormat(114); pub const R64G64_SFLOAT: VkFormat = VkFormat(115); pub const R64G64B64_UINT: VkFormat = VkFormat(116); pub const R64G64B64_SINT: VkFormat = VkFormat(117); pub const R64G64B64_SFLOAT: VkFormat = VkFormat(118); pub const R64G64B64A64_UINT: VkFormat = VkFormat(119); pub const R64G64B64A64_SINT: VkFormat = VkFormat(120); pub const R64G64B64A64_SFLOAT: VkFormat = VkFormat(121); pub const B10G11R11_UFLOAT_PACK32: VkFormat = VkFormat(122); pub const E5B9G9R9_UFLOAT_PACK32: VkFormat = VkFormat(123); pub const D16_UNORM: VkFormat = VkFormat(124); pub const X8_D24_UNORM_PACK32: VkFormat = VkFormat(125); pub const D32_SFLOAT: VkFormat = VkFormat(126); pub const S8_UINT: VkFormat = VkFormat(127); pub const D16_UNORM_S8_UINT: VkFormat = VkFormat(128); pub const D24_UNORM_S8_UINT: VkFormat = VkFormat(129); pub const D32_SFLOAT_S8_UINT: VkFormat = VkFormat(130); pub const BC1_RGB_UNORM_BLOCK: VkFormat = VkFormat(131); pub const BC1_RGB_SRGB_BLOCK: VkFormat = VkFormat(132); pub const BC1_RGBA_UNORM_BLOCK: VkFormat = VkFormat(133); pub const BC1_RGBA_SRGB_BLOCK: VkFormat = VkFormat(134); pub const BC2_UNORM_BLOCK: VkFormat = VkFormat(135); pub const BC2_SRGB_BLOCK: VkFormat = VkFormat(136); pub const BC3_UNORM_BLOCK: VkFormat = VkFormat(137); pub const BC3_SRGB_BLOCK: VkFormat = VkFormat(138); pub const BC4_UNORM_BLOCK: VkFormat = VkFormat(139); pub const BC4_SNORM_BLOCK: VkFormat = VkFormat(140); pub const BC5_UNORM_BLOCK: VkFormat = VkFormat(141); pub const BC5_SNORM_BLOCK: VkFormat = VkFormat(142); pub const BC6H_UFLOAT_BLOCK: VkFormat = VkFormat(143); pub const BC6H_SFLOAT_BLOCK: VkFormat = VkFormat(144); pub const BC7_UNORM_BLOCK: VkFormat = VkFormat(145); pub const BC7_SRGB_BLOCK: VkFormat = VkFormat(146); pub const ETC2_R8G8B8_UNORM_BLOCK: VkFormat = VkFormat(147); pub const ETC2_R8G8B8_SRGB_BLOCK: VkFormat = VkFormat(148); pub const ETC2_R8G8B8A1_UNORM_BLOCK: VkFormat = VkFormat(149); pub const ETC2_R8G8B8A1_SRGB_BLOCK: VkFormat = VkFormat(150); pub const ETC2_R8G8B8A8_UNORM_BLOCK: VkFormat = VkFormat(151); pub const ETC2_R8G8B8A8_SRGB_BLOCK: VkFormat = VkFormat(152); pub const EAC_R11_UNORM_BLOCK: VkFormat = VkFormat(153); pub const EAC_R11_SNORM_BLOCK: VkFormat = VkFormat(154); pub const EAC_R11G11_UNORM_BLOCK: VkFormat = VkFormat(155); pub const EAC_R11G11_SNORM_BLOCK: VkFormat = VkFormat(156); pub const ASTC_4X4_UNORM_BLOCK: VkFormat = VkFormat(157); pub const ASTC_4X4_SRGB_BLOCK: VkFormat = VkFormat(158); pub const ASTC_5X4_UNORM_BLOCK: VkFormat = VkFormat(159); pub const ASTC_5X4_SRGB_BLOCK: VkFormat = VkFormat(160); pub const ASTC_5X5_UNORM_BLOCK: VkFormat = VkFormat(161); pub const ASTC_5X5_SRGB_BLOCK: VkFormat = VkFormat(162); pub const ASTC_6X5_UNORM_BLOCK: VkFormat = VkFormat(163); pub const ASTC_6X5_SRGB_BLOCK: VkFormat = VkFormat(164); pub const ASTC_6X6_UNORM_BLOCK: VkFormat = VkFormat(165); pub const ASTC_6X6_SRGB_BLOCK: VkFormat = VkFormat(166); pub const ASTC_8X5_UNORM_BLOCK: VkFormat = VkFormat(167); pub const ASTC_8X5_SRGB_BLOCK: VkFormat = VkFormat(168); pub const ASTC_8X6_UNORM_BLOCK: VkFormat = VkFormat(169); pub const ASTC_8X6_SRGB_BLOCK: VkFormat = VkFormat(170); pub const ASTC_8X8_UNORM_BLOCK: VkFormat = VkFormat(171); pub const ASTC_8X8_SRGB_BLOCK: VkFormat = VkFormat(172); pub const ASTC_10X5_UNORM_BLOCK: VkFormat = VkFormat(173); pub const ASTC_10X5_SRGB_BLOCK: VkFormat = VkFormat(174); pub const ASTC_10X6_UNORM_BLOCK: VkFormat = VkFormat(175); pub const ASTC_10X6_SRGB_BLOCK: VkFormat = VkFormat(176); pub const ASTC_10X8_UNORM_BLOCK: VkFormat = VkFormat(177); pub const ASTC_10X8_SRGB_BLOCK: VkFormat = VkFormat(178); pub const ASTC_10X10_UNORM_BLOCK: VkFormat = VkFormat(179); pub const ASTC_10X10_SRGB_BLOCK: VkFormat = VkFormat(180); pub const ASTC_12X10_UNORM_BLOCK: VkFormat = VkFormat(181); pub const ASTC_12X10_SRGB_BLOCK: VkFormat = VkFormat(182); pub const ASTC_12X12_UNORM_BLOCK: VkFormat = VkFormat(183); pub const ASTC_12X12_SRGB_BLOCK: VkFormat = VkFormat(184); } impl core::fmt::Debug for VkFormat { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkFormat::UNDEFINED => write!(f, "VkFormat(UNDEFINED)"), VkFormat::R4G4_UNORM_PACK8 => write!(f, "VkFormat(R4G4_UNORM_PACK8)"), VkFormat::R4G4B4A4_UNORM_PACK16 => write!(f, "VkFormat(R4G4B4A4_UNORM_PACK16)"), VkFormat::B4G4R4A4_UNORM_PACK16 => write!(f, "VkFormat(B4G4R4A4_UNORM_PACK16)"), VkFormat::R5G6B5_UNORM_PACK16 => write!(f, "VkFormat(R5G6B5_UNORM_PACK16)"), VkFormat::B5G6R5_UNORM_PACK16 => write!(f, "VkFormat(B5G6R5_UNORM_PACK16)"), VkFormat::R5G5B5A1_UNORM_PACK16 => write!(f, "VkFormat(R5G5B5A1_UNORM_PACK16)"), VkFormat::B5G5R5A1_UNORM_PACK16 => write!(f, "VkFormat(B5G5R5A1_UNORM_PACK16)"), VkFormat::A1R5G5B5_UNORM_PACK16 => write!(f, "VkFormat(A1R5G5B5_UNORM_PACK16)"), VkFormat::R8_UNORM => write!(f, "VkFormat(R8_UNORM)"), VkFormat::R8_SNORM => write!(f, "VkFormat(R8_SNORM)"), VkFormat::R8_USCALED => write!(f, "VkFormat(R8_USCALED)"), VkFormat::R8_SSCALED => write!(f, "VkFormat(R8_SSCALED)"), VkFormat::R8_UINT => write!(f, "VkFormat(R8_UINT)"), VkFormat::R8_SINT => write!(f, "VkFormat(R8_SINT)"), VkFormat::R8_SRGB => write!(f, "VkFormat(R8_SRGB)"), VkFormat::R8G8_UNORM => write!(f, "VkFormat(R8G8_UNORM)"), VkFormat::R8G8_SNORM => write!(f, "VkFormat(R8G8_SNORM)"), VkFormat::R8G8_USCALED => write!(f, "VkFormat(R8G8_USCALED)"), VkFormat::R8G8_SSCALED => write!(f, "VkFormat(R8G8_SSCALED)"), VkFormat::R8G8_UINT => write!(f, "VkFormat(R8G8_UINT)"), VkFormat::R8G8_SINT => write!(f, "VkFormat(R8G8_SINT)"), VkFormat::R8G8_SRGB => write!(f, "VkFormat(R8G8_SRGB)"), VkFormat::R8G8B8_UNORM => write!(f, "VkFormat(R8G8B8_UNORM)"), VkFormat::R8G8B8_SNORM => write!(f, "VkFormat(R8G8B8_SNORM)"), VkFormat::R8G8B8_USCALED => write!(f, "VkFormat(R8G8B8_USCALED)"), VkFormat::R8G8B8_SSCALED => write!(f, "VkFormat(R8G8B8_SSCALED)"), VkFormat::R8G8B8_UINT => write!(f, "VkFormat(R8G8B8_UINT)"), VkFormat::R8G8B8_SINT => write!(f, "VkFormat(R8G8B8_SINT)"), VkFormat::R8G8B8_SRGB => write!(f, "VkFormat(R8G8B8_SRGB)"), VkFormat::B8G8R8_UNORM => write!(f, "VkFormat(B8G8R8_UNORM)"), VkFormat::B8G8R8_SNORM => write!(f, "VkFormat(B8G8R8_SNORM)"), VkFormat::B8G8R8_USCALED => write!(f, "VkFormat(B8G8R8_USCALED)"), VkFormat::B8G8R8_SSCALED => write!(f, "VkFormat(B8G8R8_SSCALED)"), VkFormat::B8G8R8_UINT => write!(f, "VkFormat(B8G8R8_UINT)"), VkFormat::B8G8R8_SINT => write!(f, "VkFormat(B8G8R8_SINT)"), VkFormat::B8G8R8_SRGB => write!(f, "VkFormat(B8G8R8_SRGB)"), VkFormat::R8G8B8A8_UNORM => write!(f, "VkFormat(R8G8B8A8_UNORM)"), VkFormat::R8G8B8A8_SNORM => write!(f, "VkFormat(R8G8B8A8_SNORM)"), VkFormat::R8G8B8A8_USCALED => write!(f, "VkFormat(R8G8B8A8_USCALED)"), VkFormat::R8G8B8A8_SSCALED => write!(f, "VkFormat(R8G8B8A8_SSCALED)"), VkFormat::R8G8B8A8_UINT => write!(f, "VkFormat(R8G8B8A8_UINT)"), VkFormat::R8G8B8A8_SINT => write!(f, "VkFormat(R8G8B8A8_SINT)"), VkFormat::R8G8B8A8_SRGB => write!(f, "VkFormat(R8G8B8A8_SRGB)"), VkFormat::B8G8R8A8_UNORM => write!(f, "VkFormat(B8G8R8A8_UNORM)"), VkFormat::B8G8R8A8_SNORM => write!(f, "VkFormat(B8G8R8A8_SNORM)"), VkFormat::B8G8R8A8_USCALED => write!(f, "VkFormat(B8G8R8A8_USCALED)"), VkFormat::B8G8R8A8_SSCALED => write!(f, "VkFormat(B8G8R8A8_SSCALED)"), VkFormat::B8G8R8A8_UINT => write!(f, "VkFormat(B8G8R8A8_UINT)"), VkFormat::B8G8R8A8_SINT => write!(f, "VkFormat(B8G8R8A8_SINT)"), VkFormat::B8G8R8A8_SRGB => write!(f, "VkFormat(B8G8R8A8_SRGB)"), VkFormat::A8B8G8R8_UNORM_PACK32 => write!(f, "VkFormat(A8B8G8R8_UNORM_PACK32)"), VkFormat::A8B8G8R8_SNORM_PACK32 => write!(f, "VkFormat(A8B8G8R8_SNORM_PACK32)"), VkFormat::A8B8G8R8_USCALED_PACK32 => write!(f, "VkFormat(A8B8G8R8_USCALED_PACK32)"), VkFormat::A8B8G8R8_SSCALED_PACK32 => write!(f, "VkFormat(A8B8G8R8_SSCALED_PACK32)"), VkFormat::A8B8G8R8_UINT_PACK32 => write!(f, "VkFormat(A8B8G8R8_UINT_PACK32)"), VkFormat::A8B8G8R8_SINT_PACK32 => write!(f, "VkFormat(A8B8G8R8_SINT_PACK32)"), VkFormat::A8B8G8R8_SRGB_PACK32 => write!(f, "VkFormat(A8B8G8R8_SRGB_PACK32)"), VkFormat::A2R10G10B10_UNORM_PACK32 => write!(f, "VkFormat(A2R10G10B10_UNORM_PACK32)"), VkFormat::A2R10G10B10_SNORM_PACK32 => write!(f, "VkFormat(A2R10G10B10_SNORM_PACK32)"), VkFormat::A2R10G10B10_USCALED_PACK32 => { write!(f, "VkFormat(A2R10G10B10_USCALED_PACK32)") } VkFormat::A2R10G10B10_SSCALED_PACK32 => { write!(f, "VkFormat(A2R10G10B10_SSCALED_PACK32)") } VkFormat::A2R10G10B10_UINT_PACK32 => write!(f, "VkFormat(A2R10G10B10_UINT_PACK32)"), VkFormat::A2R10G10B10_SINT_PACK32 => write!(f, "VkFormat(A2R10G10B10_SINT_PACK32)"), VkFormat::A2B10G10R10_UNORM_PACK32 => write!(f, "VkFormat(A2B10G10R10_UNORM_PACK32)"), VkFormat::A2B10G10R10_SNORM_PACK32 => write!(f, "VkFormat(A2B10G10R10_SNORM_PACK32)"), VkFormat::A2B10G10R10_USCALED_PACK32 => { write!(f, "VkFormat(A2B10G10R10_USCALED_PACK32)") } VkFormat::A2B10G10R10_SSCALED_PACK32 => { write!(f, "VkFormat(A2B10G10R10_SSCALED_PACK32)") } VkFormat::A2B10G10R10_UINT_PACK32 => write!(f, "VkFormat(A2B10G10R10_UINT_PACK32)"), VkFormat::A2B10G10R10_SINT_PACK32 => write!(f, "VkFormat(A2B10G10R10_SINT_PACK32)"), VkFormat::R16_UNORM => write!(f, "VkFormat(R16_UNORM)"), VkFormat::R16_SNORM => write!(f, "VkFormat(R16_SNORM)"), VkFormat::R16_USCALED => write!(f, "VkFormat(R16_USCALED)"), VkFormat::R16_SSCALED => write!(f, "VkFormat(R16_SSCALED)"), VkFormat::R16_UINT => write!(f, "VkFormat(R16_UINT)"), VkFormat::R16_SINT => write!(f, "VkFormat(R16_SINT)"), VkFormat::R16_SFLOAT => write!(f, "VkFormat(R16_SFLOAT)"), VkFormat::R16G16_UNORM => write!(f, "VkFormat(R16G16_UNORM)"), VkFormat::R16G16_SNORM => write!(f, "VkFormat(R16G16_SNORM)"), VkFormat::R16G16_USCALED => write!(f, "VkFormat(R16G16_USCALED)"), VkFormat::R16G16_SSCALED => write!(f, "VkFormat(R16G16_SSCALED)"), VkFormat::R16G16_UINT => write!(f, "VkFormat(R16G16_UINT)"), VkFormat::R16G16_SINT => write!(f, "VkFormat(R16G16_SINT)"), VkFormat::R16G16_SFLOAT => write!(f, "VkFormat(R16G16_SFLOAT)"), VkFormat::R16G16B16_UNORM => write!(f, "VkFormat(R16G16B16_UNORM)"), VkFormat::R16G16B16_SNORM => write!(f, "VkFormat(R16G16B16_SNORM)"), VkFormat::R16G16B16_USCALED => write!(f, "VkFormat(R16G16B16_USCALED)"), VkFormat::R16G16B16_SSCALED => write!(f, "VkFormat(R16G16B16_SSCALED)"), VkFormat::R16G16B16_UINT => write!(f, "VkFormat(R16G16B16_UINT)"), VkFormat::R16G16B16_SINT => write!(f, "VkFormat(R16G16B16_SINT)"), VkFormat::R16G16B16_SFLOAT => write!(f, "VkFormat(R16G16B16_SFLOAT)"), VkFormat::R16G16B16A16_UNORM => write!(f, "VkFormat(R16G16B16A16_UNORM)"), VkFormat::R16G16B16A16_SNORM => write!(f, "VkFormat(R16G16B16A16_SNORM)"), VkFormat::R16G16B16A16_USCALED => write!(f, "VkFormat(R16G16B16A16_USCALED)"), VkFormat::R16G16B16A16_SSCALED => write!(f, "VkFormat(R16G16B16A16_SSCALED)"), VkFormat::R16G16B16A16_UINT => write!(f, "VkFormat(R16G16B16A16_UINT)"), VkFormat::R16G16B16A16_SINT => write!(f, "VkFormat(R16G16B16A16_SINT)"), VkFormat::R16G16B16A16_SFLOAT => write!(f, "VkFormat(R16G16B16A16_SFLOAT)"), VkFormat::R32_UINT => write!(f, "VkFormat(R32_UINT)"), VkFormat::R32_SINT => write!(f, "VkFormat(R32_SINT)"), VkFormat::R32_SFLOAT => write!(f, "VkFormat(R32_SFLOAT)"), VkFormat::R32G32_UINT => write!(f, "VkFormat(R32G32_UINT)"), VkFormat::R32G32_SINT => write!(f, "VkFormat(R32G32_SINT)"), VkFormat::R32G32_SFLOAT => write!(f, "VkFormat(R32G32_SFLOAT)"), VkFormat::R32G32B32_UINT => write!(f, "VkFormat(R32G32B32_UINT)"), VkFormat::R32G32B32_SINT => write!(f, "VkFormat(R32G32B32_SINT)"), VkFormat::R32G32B32_SFLOAT => write!(f, "VkFormat(R32G32B32_SFLOAT)"), VkFormat::R32G32B32A32_UINT => write!(f, "VkFormat(R32G32B32A32_UINT)"), VkFormat::R32G32B32A32_SINT => write!(f, "VkFormat(R32G32B32A32_SINT)"), VkFormat::R32G32B32A32_SFLOAT => write!(f, "VkFormat(R32G32B32A32_SFLOAT)"), VkFormat::R64_UINT => write!(f, "VkFormat(R64_UINT)"), VkFormat::R64_SINT => write!(f, "VkFormat(R64_SINT)"), VkFormat::R64_SFLOAT => write!(f, "VkFormat(R64_SFLOAT)"), VkFormat::R64G64_UINT => write!(f, "VkFormat(R64G64_UINT)"), VkFormat::R64G64_SINT => write!(f, "VkFormat(R64G64_SINT)"), VkFormat::R64G64_SFLOAT => write!(f, "VkFormat(R64G64_SFLOAT)"), VkFormat::R64G64B64_UINT => write!(f, "VkFormat(R64G64B64_UINT)"), VkFormat::R64G64B64_SINT => write!(f, "VkFormat(R64G64B64_SINT)"), VkFormat::R64G64B64_SFLOAT => write!(f, "VkFormat(R64G64B64_SFLOAT)"), VkFormat::R64G64B64A64_UINT => write!(f, "VkFormat(R64G64B64A64_UINT)"), VkFormat::R64G64B64A64_SINT => write!(f, "VkFormat(R64G64B64A64_SINT)"), VkFormat::R64G64B64A64_SFLOAT => write!(f, "VkFormat(R64G64B64A64_SFLOAT)"), VkFormat::B10G11R11_UFLOAT_PACK32 => write!(f, "VkFormat(B10G11R11_UFLOAT_PACK32)"), VkFormat::E5B9G9R9_UFLOAT_PACK32 => write!(f, "VkFormat(E5B9G9R9_UFLOAT_PACK32)"), VkFormat::D16_UNORM => write!(f, "VkFormat(D16_UNORM)"), VkFormat::X8_D24_UNORM_PACK32 => write!(f, "VkFormat(X8_D24_UNORM_PACK32)"), VkFormat::D32_SFLOAT => write!(f, "VkFormat(D32_SFLOAT)"), VkFormat::S8_UINT => write!(f, "VkFormat(S8_UINT)"), VkFormat::D16_UNORM_S8_UINT => write!(f, "VkFormat(D16_UNORM_S8_UINT)"), VkFormat::D24_UNORM_S8_UINT => write!(f, "VkFormat(D24_UNORM_S8_UINT)"), VkFormat::D32_SFLOAT_S8_UINT => write!(f, "VkFormat(D32_SFLOAT_S8_UINT)"), VkFormat::BC1_RGB_UNORM_BLOCK => write!(f, "VkFormat(BC1_RGB_UNORM_BLOCK)"), VkFormat::BC1_RGB_SRGB_BLOCK => write!(f, "VkFormat(BC1_RGB_SRGB_BLOCK)"), VkFormat::BC1_RGBA_UNORM_BLOCK => write!(f, "VkFormat(BC1_RGBA_UNORM_BLOCK)"), VkFormat::BC1_RGBA_SRGB_BLOCK => write!(f, "VkFormat(BC1_RGBA_SRGB_BLOCK)"), VkFormat::BC2_UNORM_BLOCK => write!(f, "VkFormat(BC2_UNORM_BLOCK)"), VkFormat::BC2_SRGB_BLOCK => write!(f, "VkFormat(BC2_SRGB_BLOCK)"), VkFormat::BC3_UNORM_BLOCK => write!(f, "VkFormat(BC3_UNORM_BLOCK)"), VkFormat::BC3_SRGB_BLOCK => write!(f, "VkFormat(BC3_SRGB_BLOCK)"), VkFormat::BC4_UNORM_BLOCK => write!(f, "VkFormat(BC4_UNORM_BLOCK)"), VkFormat::BC4_SNORM_BLOCK => write!(f, "VkFormat(BC4_SNORM_BLOCK)"), VkFormat::BC5_UNORM_BLOCK => write!(f, "VkFormat(BC5_UNORM_BLOCK)"), VkFormat::BC5_SNORM_BLOCK => write!(f, "VkFormat(BC5_SNORM_BLOCK)"), VkFormat::BC6H_UFLOAT_BLOCK => write!(f, "VkFormat(BC6H_UFLOAT_BLOCK)"), VkFormat::BC6H_SFLOAT_BLOCK => write!(f, "VkFormat(BC6H_SFLOAT_BLOCK)"), VkFormat::BC7_UNORM_BLOCK => write!(f, "VkFormat(BC7_UNORM_BLOCK)"), VkFormat::BC7_SRGB_BLOCK => write!(f, "VkFormat(BC7_SRGB_BLOCK)"), VkFormat::ETC2_R8G8B8_UNORM_BLOCK => write!(f, "VkFormat(ETC2_R8G8B8_UNORM_BLOCK)"), VkFormat::ETC2_R8G8B8_SRGB_BLOCK => write!(f, "VkFormat(ETC2_R8G8B8_SRGB_BLOCK)"), VkFormat::ETC2_R8G8B8A1_UNORM_BLOCK => write!(f, "VkFormat(ETC2_R8G8B8A1_UNORM_BLOCK)"), VkFormat::ETC2_R8G8B8A1_SRGB_BLOCK => write!(f, "VkFormat(ETC2_R8G8B8A1_SRGB_BLOCK)"), VkFormat::ETC2_R8G8B8A8_UNORM_BLOCK => write!(f, "VkFormat(ETC2_R8G8B8A8_UNORM_BLOCK)"), VkFormat::ETC2_R8G8B8A8_SRGB_BLOCK => write!(f, "VkFormat(ETC2_R8G8B8A8_SRGB_BLOCK)"), VkFormat::EAC_R11_UNORM_BLOCK => write!(f, "VkFormat(EAC_R11_UNORM_BLOCK)"), VkFormat::EAC_R11_SNORM_BLOCK => write!(f, "VkFormat(EAC_R11_SNORM_BLOCK)"), VkFormat::EAC_R11G11_UNORM_BLOCK => write!(f, "VkFormat(EAC_R11G11_UNORM_BLOCK)"), VkFormat::EAC_R11G11_SNORM_BLOCK => write!(f, "VkFormat(EAC_R11G11_SNORM_BLOCK)"), VkFormat::ASTC_4X4_UNORM_BLOCK => write!(f, "VkFormat(ASTC_4X4_UNORM_BLOCK)"), VkFormat::ASTC_4X4_SRGB_BLOCK => write!(f, "VkFormat(ASTC_4X4_SRGB_BLOCK)"), VkFormat::ASTC_5X4_UNORM_BLOCK => write!(f, "VkFormat(ASTC_5X4_UNORM_BLOCK)"), VkFormat::ASTC_5X4_SRGB_BLOCK => write!(f, "VkFormat(ASTC_5X4_SRGB_BLOCK)"), VkFormat::ASTC_5X5_UNORM_BLOCK => write!(f, "VkFormat(ASTC_5X5_UNORM_BLOCK)"), VkFormat::ASTC_5X5_SRGB_BLOCK => write!(f, "VkFormat(ASTC_5X5_SRGB_BLOCK)"), VkFormat::ASTC_6X5_UNORM_BLOCK => write!(f, "VkFormat(ASTC_6X5_UNORM_BLOCK)"), VkFormat::ASTC_6X5_SRGB_BLOCK => write!(f, "VkFormat(ASTC_6X5_SRGB_BLOCK)"), VkFormat::ASTC_6X6_UNORM_BLOCK => write!(f, "VkFormat(ASTC_6X6_UNORM_BLOCK)"), VkFormat::ASTC_6X6_SRGB_BLOCK => write!(f, "VkFormat(ASTC_6X6_SRGB_BLOCK)"), VkFormat::ASTC_8X5_UNORM_BLOCK => write!(f, "VkFormat(ASTC_8X5_UNORM_BLOCK)"), VkFormat::ASTC_8X5_SRGB_BLOCK => write!(f, "VkFormat(ASTC_8X5_SRGB_BLOCK)"), VkFormat::ASTC_8X6_UNORM_BLOCK => write!(f, "VkFormat(ASTC_8X6_UNORM_BLOCK)"), VkFormat::ASTC_8X6_SRGB_BLOCK => write!(f, "VkFormat(ASTC_8X6_SRGB_BLOCK)"), VkFormat::ASTC_8X8_UNORM_BLOCK => write!(f, "VkFormat(ASTC_8X8_UNORM_BLOCK)"), VkFormat::ASTC_8X8_SRGB_BLOCK => write!(f, "VkFormat(ASTC_8X8_SRGB_BLOCK)"), VkFormat::ASTC_10X5_UNORM_BLOCK => write!(f, "VkFormat(ASTC_10X5_UNORM_BLOCK)"), VkFormat::ASTC_10X5_SRGB_BLOCK => write!(f, "VkFormat(ASTC_10X5_SRGB_BLOCK)"), VkFormat::ASTC_10X6_UNORM_BLOCK => write!(f, "VkFormat(ASTC_10X6_UNORM_BLOCK)"), VkFormat::ASTC_10X6_SRGB_BLOCK => write!(f, "VkFormat(ASTC_10X6_SRGB_BLOCK)"), VkFormat::ASTC_10X8_UNORM_BLOCK => write!(f, "VkFormat(ASTC_10X8_UNORM_BLOCK)"), VkFormat::ASTC_10X8_SRGB_BLOCK => write!(f, "VkFormat(ASTC_10X8_SRGB_BLOCK)"), VkFormat::ASTC_10X10_UNORM_BLOCK => write!(f, "VkFormat(ASTC_10X10_UNORM_BLOCK)"), VkFormat::ASTC_10X10_SRGB_BLOCK => write!(f, "VkFormat(ASTC_10X10_SRGB_BLOCK)"), VkFormat::ASTC_12X10_UNORM_BLOCK => write!(f, "VkFormat(ASTC_12X10_UNORM_BLOCK)"), VkFormat::ASTC_12X10_SRGB_BLOCK => write!(f, "VkFormat(ASTC_12X10_SRGB_BLOCK)"), VkFormat::ASTC_12X12_UNORM_BLOCK => write!(f, "VkFormat(ASTC_12X12_UNORM_BLOCK)"), VkFormat::ASTC_12X12_SRGB_BLOCK => write!(f, "VkFormat(ASTC_12X12_SRGB_BLOCK)"), _ => write!(f, "VkFormat({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkObjectType(u32); impl VkObjectType { pub const UNKNOWN: VkObjectType = VkObjectType(0); pub const INSTANCE: VkObjectType = VkObjectType(1); pub const PHYSICAL_DEVICE: VkObjectType = VkObjectType(2); pub const DEVICE: VkObjectType = VkObjectType(3); pub const QUEUE: VkObjectType = VkObjectType(4); pub const SEMAPHORE: VkObjectType = VkObjectType(5); pub const COMMAND_BUFFER: VkObjectType = VkObjectType(6); pub const FENCE: VkObjectType = VkObjectType(7); pub const DEVICE_MEMORY: VkObjectType = VkObjectType(8); pub const BUFFER: VkObjectType = VkObjectType(9); pub const IMAGE: VkObjectType = VkObjectType(10); pub const EVENT: VkObjectType = VkObjectType(11); pub const QUERY_POOL: VkObjectType = VkObjectType(12); pub const BUFFER_VIEW: VkObjectType = VkObjectType(13); pub const IMAGE_VIEW: VkObjectType = VkObjectType(14); pub const SHADER_MODULE: VkObjectType = VkObjectType(15); pub const PIPELINE_CACHE: VkObjectType = VkObjectType(16); pub const PIPELINE_LAYOUT: VkObjectType = VkObjectType(17); pub const RENDER_PASS: VkObjectType = VkObjectType(18); pub const PIPELINE: VkObjectType = VkObjectType(19); pub const DESCRIPTOR_SET_LAYOUT: VkObjectType = VkObjectType(20); pub const SAMPLER: VkObjectType = VkObjectType(21); pub const DESCRIPTOR_POOL: VkObjectType = VkObjectType(22); pub const DESCRIPTOR_SET: VkObjectType = VkObjectType(23); pub const FRAMEBUFFER: VkObjectType = VkObjectType(24); pub const COMMAND_POOL: VkObjectType = VkObjectType(25); pub const SURFACE_KHR: VkObjectType = VkObjectType(1000000000); pub const SWAPCHAIN_KHR: VkObjectType = VkObjectType(1000001000); pub const DEBUG_UTILS_MESSENGER_EXT: VkObjectType = VkObjectType(1000128000); } impl core::fmt::Debug for VkObjectType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkObjectType::UNKNOWN => write!(f, "VkObjectType(UNKNOWN)"), VkObjectType::INSTANCE => write!(f, "VkObjectType(INSTANCE)"), VkObjectType::PHYSICAL_DEVICE => write!(f, "VkObjectType(PHYSICAL_DEVICE)"), VkObjectType::DEVICE => write!(f, "VkObjectType(DEVICE)"), VkObjectType::QUEUE => write!(f, "VkObjectType(QUEUE)"), VkObjectType::SEMAPHORE => write!(f, "VkObjectType(SEMAPHORE)"), VkObjectType::COMMAND_BUFFER => write!(f, "VkObjectType(COMMAND_BUFFER)"), VkObjectType::FENCE => write!(f, "VkObjectType(FENCE)"), VkObjectType::DEVICE_MEMORY => write!(f, "VkObjectType(DEVICE_MEMORY)"), VkObjectType::BUFFER => write!(f, "VkObjectType(BUFFER)"), VkObjectType::IMAGE => write!(f, "VkObjectType(IMAGE)"), VkObjectType::EVENT => write!(f, "VkObjectType(EVENT)"), VkObjectType::QUERY_POOL => write!(f, "VkObjectType(QUERY_POOL)"), VkObjectType::BUFFER_VIEW => write!(f, "VkObjectType(BUFFER_VIEW)"), VkObjectType::IMAGE_VIEW => write!(f, "VkObjectType(IMAGE_VIEW)"), VkObjectType::SHADER_MODULE => write!(f, "VkObjectType(SHADER_MODULE)"), VkObjectType::PIPELINE_CACHE => write!(f, "VkObjectType(PIPELINE_CACHE)"), VkObjectType::PIPELINE_LAYOUT => write!(f, "VkObjectType(PIPELINE_LAYOUT)"), VkObjectType::RENDER_PASS => write!(f, "VkObjectType(RENDER_PASS)"), VkObjectType::PIPELINE => write!(f, "VkObjectType(PIPELINE)"), VkObjectType::DESCRIPTOR_SET_LAYOUT => write!(f, "VkObjectType(DESCRIPTOR_SET_LAYOUT)"), VkObjectType::SAMPLER => write!(f, "VkObjectType(SAMPLER)"), VkObjectType::DESCRIPTOR_POOL => write!(f, "VkObjectType(DESCRIPTOR_POOL)"), VkObjectType::DESCRIPTOR_SET => write!(f, "VkObjectType(DESCRIPTOR_SET)"), VkObjectType::FRAMEBUFFER => write!(f, "VkObjectType(FRAMEBUFFER)"), VkObjectType::COMMAND_POOL => write!(f, "VkObjectType(COMMAND_POOL)"), VkObjectType::SURFACE_KHR => write!(f, "VkObjectType(SURFACE_KHR)"), VkObjectType::SWAPCHAIN_KHR => write!(f, "VkObjectType(SWAPCHAIN_KHR)"), VkObjectType::DEBUG_UTILS_MESSENGER_EXT => { write!(f, "VkObjectType(DEBUG_UTILS_MESSENGER_EXT)") } _ => write!(f, "VkObjectType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkSharingMode(u32); impl VkSharingMode { pub const EXCLUSIVE: VkSharingMode = VkSharingMode(0); pub const CONCURRENT: VkSharingMode = VkSharingMode(1); } impl core::fmt::Debug for VkSharingMode { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkSharingMode::EXCLUSIVE => write!(f, "VkSharingMode(EXCLUSIVE)"), VkSharingMode::CONCURRENT => write!(f, "VkSharingMode(CONCURRENT)"), _ => write!(f, "VkSharingMode({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkImageLayout(u32); impl VkImageLayout { pub const UNDEFINED: VkImageLayout = VkImageLayout(0); pub const GENERAL: VkImageLayout = VkImageLayout(1); pub const COLOR_ATTACHMENT_OPTIMAL: VkImageLayout = VkImageLayout(2); pub const DEPTH_STENCIL_ATTACHMENT_OPTIMAL: VkImageLayout = VkImageLayout(3); pub const DEPTH_STENCIL_READ_ONLY_OPTIMAL: VkImageLayout = VkImageLayout(4); pub const SHADER_READ_ONLY_OPTIMAL: VkImageLayout = VkImageLayout(5); pub const TRANSFER_SRC_OPTIMAL: VkImageLayout = VkImageLayout(6); pub const TRANSFER_DST_OPTIMAL: VkImageLayout = VkImageLayout(7); pub const PREINITIALIZED: VkImageLayout = VkImageLayout(8); pub const PRESENT_SRC_KHR: VkImageLayout = VkImageLayout(1000001002); } impl core::fmt::Debug for VkImageLayout { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkImageLayout::UNDEFINED => write!(f, "VkImageLayout(UNDEFINED)"), VkImageLayout::GENERAL => write!(f, "VkImageLayout(GENERAL)"), VkImageLayout::COLOR_ATTACHMENT_OPTIMAL => { write!(f, "VkImageLayout(COLOR_ATTACHMENT_OPTIMAL)") } VkImageLayout::DEPTH_STENCIL_ATTACHMENT_OPTIMAL => { write!(f, "VkImageLayout(DEPTH_STENCIL_ATTACHMENT_OPTIMAL)") } VkImageLayout::DEPTH_STENCIL_READ_ONLY_OPTIMAL => { write!(f, "VkImageLayout(DEPTH_STENCIL_READ_ONLY_OPTIMAL)") } VkImageLayout::SHADER_READ_ONLY_OPTIMAL => { write!(f, "VkImageLayout(SHADER_READ_ONLY_OPTIMAL)") } VkImageLayout::TRANSFER_SRC_OPTIMAL => write!(f, "VkImageLayout(TRANSFER_SRC_OPTIMAL)"), VkImageLayout::TRANSFER_DST_OPTIMAL => write!(f, "VkImageLayout(TRANSFER_DST_OPTIMAL)"), VkImageLayout::PREINITIALIZED => write!(f, "VkImageLayout(PREINITIALIZED)"), VkImageLayout::PRESENT_SRC_KHR => write!(f, "VkImageLayout(PRESENT_SRC_KHR)"), _ => write!(f, "VkImageLayout({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkVendorId(u32); impl VkVendorId { pub const VIV: VkVendorId = VkVendorId(65537); pub const VSI: VkVendorId = VkVendorId(65538); pub const KAZAN: VkVendorId = VkVendorId(65539); } impl core::fmt::Debug for VkVendorId { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkVendorId::VIV => write!(f, "VkVendorId(VIV)"), VkVendorId::VSI => write!(f, "VkVendorId(VSI)"), VkVendorId::KAZAN => write!(f, "VkVendorId(KAZAN)"), _ => write!(f, "VkVendorId({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkSubpassContents(u32); impl VkSubpassContents { pub const INLINE: VkSubpassContents = VkSubpassContents(0); pub const SECONDARY_COMMAND_BUFFERS: VkSubpassContents = VkSubpassContents(1); } impl core::fmt::Debug for VkSubpassContents { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkSubpassContents::INLINE => write!(f, "VkSubpassContents(INLINE)"), VkSubpassContents::SECONDARY_COMMAND_BUFFERS => { write!(f, "VkSubpassContents(SECONDARY_COMMAND_BUFFERS)") } _ => write!(f, "VkSubpassContents({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkFilter(u32); impl VkFilter { pub const NEAREST: VkFilter = VkFilter(0); pub const LINEAR: VkFilter = VkFilter(1); } impl core::fmt::Debug for VkFilter { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkFilter::NEAREST => write!(f, "VkFilter(NEAREST)"), VkFilter::LINEAR => write!(f, "VkFilter(LINEAR)"), _ => write!(f, "VkFilter({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkIndexType(u32); impl VkIndexType { pub const UINT16: VkIndexType = VkIndexType(0); pub const UINT32: VkIndexType = VkIndexType(1); } impl core::fmt::Debug for VkIndexType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkIndexType::UINT16 => write!(f, "VkIndexType(UINT16)"), VkIndexType::UINT32 => write!(f, "VkIndexType(UINT32)"), _ => write!(f, "VkIndexType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkPipelineBindPoint(u32); impl VkPipelineBindPoint { pub const GRAPHICS: VkPipelineBindPoint = VkPipelineBindPoint(0); pub const COMPUTE: VkPipelineBindPoint = VkPipelineBindPoint(1); } impl core::fmt::Debug for VkPipelineBindPoint { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkPipelineBindPoint::GRAPHICS => write!(f, "VkPipelineBindPoint(GRAPHICS)"), VkPipelineBindPoint::COMPUTE => write!(f, "VkPipelineBindPoint(COMPUTE)"), _ => write!(f, "VkPipelineBindPoint({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkCommandBufferLevel(u32); impl VkCommandBufferLevel { pub const PRIMARY: VkCommandBufferLevel = VkCommandBufferLevel(0); pub const SECONDARY: VkCommandBufferLevel = VkCommandBufferLevel(1); } impl core::fmt::Debug for VkCommandBufferLevel { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkCommandBufferLevel::PRIMARY => write!(f, "VkCommandBufferLevel(PRIMARY)"), VkCommandBufferLevel::SECONDARY => write!(f, "VkCommandBufferLevel(SECONDARY)"), _ => write!(f, "VkCommandBufferLevel({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkAttachmentStoreOp(u32); impl VkAttachmentStoreOp { pub const STORE: VkAttachmentStoreOp = VkAttachmentStoreOp(0); pub const DONT_CARE: VkAttachmentStoreOp = VkAttachmentStoreOp(1); } impl core::fmt::Debug for VkAttachmentStoreOp { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkAttachmentStoreOp::STORE => write!(f, "VkAttachmentStoreOp(STORE)"), VkAttachmentStoreOp::DONT_CARE => write!(f, "VkAttachmentStoreOp(DONT_CARE)"), _ => write!(f, "VkAttachmentStoreOp({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkAttachmentLoadOp(u32); impl VkAttachmentLoadOp { pub const LOAD: VkAttachmentLoadOp = VkAttachmentLoadOp(0); pub const CLEAR: VkAttachmentLoadOp = VkAttachmentLoadOp(1); pub const DONT_CARE: VkAttachmentLoadOp = VkAttachmentLoadOp(2); } impl core::fmt::Debug for VkAttachmentLoadOp { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkAttachmentLoadOp::LOAD => write!(f, "VkAttachmentLoadOp(LOAD)"), VkAttachmentLoadOp::CLEAR => write!(f, "VkAttachmentLoadOp(CLEAR)"), VkAttachmentLoadOp::DONT_CARE => write!(f, "VkAttachmentLoadOp(DONT_CARE)"), _ => write!(f, "VkAttachmentLoadOp({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkDescriptorType(u32); impl VkDescriptorType { pub const SAMPLER: VkDescriptorType = VkDescriptorType(0); pub const COMBINED_IMAGE_SAMPLER: VkDescriptorType = VkDescriptorType(1); pub const SAMPLED_IMAGE: VkDescriptorType = VkDescriptorType(2); pub const STORAGE_IMAGE: VkDescriptorType = VkDescriptorType(3); pub const UNIFORM_TEXEL_BUFFER: VkDescriptorType = VkDescriptorType(4); pub const STORAGE_TEXEL_BUFFER: VkDescriptorType = VkDescriptorType(5); pub const UNIFORM_BUFFER: VkDescriptorType = VkDescriptorType(6); pub const STORAGE_BUFFER: VkDescriptorType = VkDescriptorType(7); pub const UNIFORM_BUFFER_DYNAMIC: VkDescriptorType = VkDescriptorType(8); pub const STORAGE_BUFFER_DYNAMIC: VkDescriptorType = VkDescriptorType(9); pub const INPUT_ATTACHMENT: VkDescriptorType = VkDescriptorType(10); } impl core::fmt::Debug for VkDescriptorType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkDescriptorType::SAMPLER => write!(f, "VkDescriptorType(SAMPLER)"), VkDescriptorType::COMBINED_IMAGE_SAMPLER => { write!(f, "VkDescriptorType(COMBINED_IMAGE_SAMPLER)") } VkDescriptorType::SAMPLED_IMAGE => write!(f, "VkDescriptorType(SAMPLED_IMAGE)"), VkDescriptorType::STORAGE_IMAGE => write!(f, "VkDescriptorType(STORAGE_IMAGE)"), VkDescriptorType::UNIFORM_TEXEL_BUFFER => { write!(f, "VkDescriptorType(UNIFORM_TEXEL_BUFFER)") } VkDescriptorType::STORAGE_TEXEL_BUFFER => { write!(f, "VkDescriptorType(STORAGE_TEXEL_BUFFER)") } VkDescriptorType::UNIFORM_BUFFER => write!(f, "VkDescriptorType(UNIFORM_BUFFER)"), VkDescriptorType::STORAGE_BUFFER => write!(f, "VkDescriptorType(STORAGE_BUFFER)"), VkDescriptorType::UNIFORM_BUFFER_DYNAMIC => { write!(f, "VkDescriptorType(UNIFORM_BUFFER_DYNAMIC)") } VkDescriptorType::STORAGE_BUFFER_DYNAMIC => { write!(f, "VkDescriptorType(STORAGE_BUFFER_DYNAMIC)") } VkDescriptorType::INPUT_ATTACHMENT => write!(f, "VkDescriptorType(INPUT_ATTACHMENT)"), _ => write!(f, "VkDescriptorType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkBorderColor(u32); impl VkBorderColor { pub const FLOAT_TRANSPARENT_BLACK: VkBorderColor = VkBorderColor(0); pub const INT_TRANSPARENT_BLACK: VkBorderColor = VkBorderColor(1); pub const FLOAT_OPAQUE_BLACK: VkBorderColor = VkBorderColor(2); pub const INT_OPAQUE_BLACK: VkBorderColor = VkBorderColor(3); pub const FLOAT_OPAQUE_WHITE: VkBorderColor = VkBorderColor(4); pub const INT_OPAQUE_WHITE: VkBorderColor = VkBorderColor(5); } impl core::fmt::Debug for VkBorderColor { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkBorderColor::FLOAT_TRANSPARENT_BLACK => { write!(f, "VkBorderColor(FLOAT_TRANSPARENT_BLACK)") } VkBorderColor::INT_TRANSPARENT_BLACK => { write!(f, "VkBorderColor(INT_TRANSPARENT_BLACK)") } VkBorderColor::FLOAT_OPAQUE_BLACK => write!(f, "VkBorderColor(FLOAT_OPAQUE_BLACK)"), VkBorderColor::INT_OPAQUE_BLACK => write!(f, "VkBorderColor(INT_OPAQUE_BLACK)"), VkBorderColor::FLOAT_OPAQUE_WHITE => write!(f, "VkBorderColor(FLOAT_OPAQUE_WHITE)"), VkBorderColor::INT_OPAQUE_WHITE => write!(f, "VkBorderColor(INT_OPAQUE_WHITE)"), _ => write!(f, "VkBorderColor({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkCompareOp(u32); impl VkCompareOp { pub const NEVER: VkCompareOp = VkCompareOp(0); pub const LESS: VkCompareOp = VkCompareOp(1); pub const EQUAL: VkCompareOp = VkCompareOp(2); pub const LESS_OR_EQUAL: VkCompareOp = VkCompareOp(3); pub const GREATER: VkCompareOp = VkCompareOp(4); pub const NOT_EQUAL: VkCompareOp = VkCompareOp(5); pub const GREATER_OR_EQUAL: VkCompareOp = VkCompareOp(6); pub const ALWAYS: VkCompareOp = VkCompareOp(7); } impl core::fmt::Debug for VkCompareOp { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkCompareOp::NEVER => write!(f, "VkCompareOp(NEVER)"), VkCompareOp::LESS => write!(f, "VkCompareOp(LESS)"), VkCompareOp::EQUAL => write!(f, "VkCompareOp(EQUAL)"), VkCompareOp::LESS_OR_EQUAL => write!(f, "VkCompareOp(LESS_OR_EQUAL)"), VkCompareOp::GREATER => write!(f, "VkCompareOp(GREATER)"), VkCompareOp::NOT_EQUAL => write!(f, "VkCompareOp(NOT_EQUAL)"), VkCompareOp::GREATER_OR_EQUAL => write!(f, "VkCompareOp(GREATER_OR_EQUAL)"), VkCompareOp::ALWAYS => write!(f, "VkCompareOp(ALWAYS)"), _ => write!(f, "VkCompareOp({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkSamplerAddressMode(u32); impl VkSamplerAddressMode { pub const REPEAT: VkSamplerAddressMode = VkSamplerAddressMode(0); pub const MIRRORED_REPEAT: VkSamplerAddressMode = VkSamplerAddressMode(1); pub const CLAMP_TO_EDGE: VkSamplerAddressMode = VkSamplerAddressMode(2); pub const CLAMP_TO_BORDER: VkSamplerAddressMode = VkSamplerAddressMode(3); } impl core::fmt::Debug for VkSamplerAddressMode { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkSamplerAddressMode::REPEAT => write!(f, "VkSamplerAddressMode(REPEAT)"), VkSamplerAddressMode::MIRRORED_REPEAT => { write!(f, "VkSamplerAddressMode(MIRRORED_REPEAT)") } VkSamplerAddressMode::CLAMP_TO_EDGE => write!(f, "VkSamplerAddressMode(CLAMP_TO_EDGE)"), VkSamplerAddressMode::CLAMP_TO_BORDER => { write!(f, "VkSamplerAddressMode(CLAMP_TO_BORDER)") } _ => write!(f, "VkSamplerAddressMode({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkSamplerMipmapMode(u32); impl VkSamplerMipmapMode { pub const NEAREST: VkSamplerMipmapMode = VkSamplerMipmapMode(0); pub const LINEAR: VkSamplerMipmapMode = VkSamplerMipmapMode(1); } impl core::fmt::Debug for VkSamplerMipmapMode { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkSamplerMipmapMode::NEAREST => write!(f, "VkSamplerMipmapMode(NEAREST)"), VkSamplerMipmapMode::LINEAR => write!(f, "VkSamplerMipmapMode(LINEAR)"), _ => write!(f, "VkSamplerMipmapMode({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkDynamicState(u32); impl VkDynamicState { pub const VIEWPORT: VkDynamicState = VkDynamicState(0); pub const SCISSOR: VkDynamicState = VkDynamicState(1); pub const LINE_WIDTH: VkDynamicState = VkDynamicState(2); pub const DEPTH_BIAS: VkDynamicState = VkDynamicState(3); pub const BLEND_CONSTANTS: VkDynamicState = VkDynamicState(4); pub const DEPTH_BOUNDS: VkDynamicState = VkDynamicState(5); pub const STENCIL_COMPARE_MASK: VkDynamicState = VkDynamicState(6); pub const STENCIL_WRITE_MASK: VkDynamicState = VkDynamicState(7); pub const STENCIL_REFERENCE: VkDynamicState = VkDynamicState(8); } impl core::fmt::Debug for VkDynamicState { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkDynamicState::VIEWPORT => write!(f, "VkDynamicState(VIEWPORT)"), VkDynamicState::SCISSOR => write!(f, "VkDynamicState(SCISSOR)"), VkDynamicState::LINE_WIDTH => write!(f, "VkDynamicState(LINE_WIDTH)"), VkDynamicState::DEPTH_BIAS => write!(f, "VkDynamicState(DEPTH_BIAS)"), VkDynamicState::BLEND_CONSTANTS => write!(f, "VkDynamicState(BLEND_CONSTANTS)"), VkDynamicState::DEPTH_BOUNDS => write!(f, "VkDynamicState(DEPTH_BOUNDS)"), VkDynamicState::STENCIL_COMPARE_MASK => { write!(f, "VkDynamicState(STENCIL_COMPARE_MASK)") } VkDynamicState::STENCIL_WRITE_MASK => write!(f, "VkDynamicState(STENCIL_WRITE_MASK)"), VkDynamicState::STENCIL_REFERENCE => write!(f, "VkDynamicState(STENCIL_REFERENCE)"), _ => write!(f, "VkDynamicState({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkBlendOp(u32); impl VkBlendOp { pub const ADD: VkBlendOp = VkBlendOp(0); pub const SUBTRACT: VkBlendOp = VkBlendOp(1); pub const REVERSE_SUBTRACT: VkBlendOp = VkBlendOp(2); pub const MIN: VkBlendOp = VkBlendOp(3); pub const MAX: VkBlendOp = VkBlendOp(4); } impl core::fmt::Debug for VkBlendOp { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkBlendOp::ADD => write!(f, "VkBlendOp(ADD)"), VkBlendOp::SUBTRACT => write!(f, "VkBlendOp(SUBTRACT)"), VkBlendOp::REVERSE_SUBTRACT => write!(f, "VkBlendOp(REVERSE_SUBTRACT)"), VkBlendOp::MIN => write!(f, "VkBlendOp(MIN)"), VkBlendOp::MAX => write!(f, "VkBlendOp(MAX)"), _ => write!(f, "VkBlendOp({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkBlendFactor(u32); impl VkBlendFactor { pub const ZERO: VkBlendFactor = VkBlendFactor(0); pub const ONE: VkBlendFactor = VkBlendFactor(1); pub const SRC_COLOR: VkBlendFactor = VkBlendFactor(2); pub const ONE_MINUS_SRC_COLOR: VkBlendFactor = VkBlendFactor(3); pub const DST_COLOR: VkBlendFactor = VkBlendFactor(4); pub const ONE_MINUS_DST_COLOR: VkBlendFactor = VkBlendFactor(5); pub const SRC_ALPHA: VkBlendFactor = VkBlendFactor(6); pub const ONE_MINUS_SRC_ALPHA: VkBlendFactor = VkBlendFactor(7); pub const DST_ALPHA: VkBlendFactor = VkBlendFactor(8); pub const ONE_MINUS_DST_ALPHA: VkBlendFactor = VkBlendFactor(9); pub const CONSTANT_COLOR: VkBlendFactor = VkBlendFactor(10); pub const ONE_MINUS_CONSTANT_COLOR: VkBlendFactor = VkBlendFactor(11); pub const CONSTANT_ALPHA: VkBlendFactor = VkBlendFactor(12); pub const ONE_MINUS_CONSTANT_ALPHA: VkBlendFactor = VkBlendFactor(13); pub const SRC_ALPHA_SATURATE: VkBlendFactor = VkBlendFactor(14); pub const SRC1_COLOR: VkBlendFactor = VkBlendFactor(15); pub const ONE_MINUS_SRC1_COLOR: VkBlendFactor = VkBlendFactor(16); pub const SRC1_ALPHA: VkBlendFactor = VkBlendFactor(17); pub const ONE_MINUS_SRC1_ALPHA: VkBlendFactor = VkBlendFactor(18); } impl core::fmt::Debug for VkBlendFactor { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkBlendFactor::ZERO => write!(f, "VkBlendFactor(ZERO)"), VkBlendFactor::ONE => write!(f, "VkBlendFactor(ONE)"), VkBlendFactor::SRC_COLOR => write!(f, "VkBlendFactor(SRC_COLOR)"), VkBlendFactor::ONE_MINUS_SRC_COLOR => write!(f, "VkBlendFactor(ONE_MINUS_SRC_COLOR)"), VkBlendFactor::DST_COLOR => write!(f, "VkBlendFactor(DST_COLOR)"), VkBlendFactor::ONE_MINUS_DST_COLOR => write!(f, "VkBlendFactor(ONE_MINUS_DST_COLOR)"), VkBlendFactor::SRC_ALPHA => write!(f, "VkBlendFactor(SRC_ALPHA)"), VkBlendFactor::ONE_MINUS_SRC_ALPHA => write!(f, "VkBlendFactor(ONE_MINUS_SRC_ALPHA)"), VkBlendFactor::DST_ALPHA => write!(f, "VkBlendFactor(DST_ALPHA)"), VkBlendFactor::ONE_MINUS_DST_ALPHA => write!(f, "VkBlendFactor(ONE_MINUS_DST_ALPHA)"), VkBlendFactor::CONSTANT_COLOR => write!(f, "VkBlendFactor(CONSTANT_COLOR)"), VkBlendFactor::ONE_MINUS_CONSTANT_COLOR => { write!(f, "VkBlendFactor(ONE_MINUS_CONSTANT_COLOR)") } VkBlendFactor::CONSTANT_ALPHA => write!(f, "VkBlendFactor(CONSTANT_ALPHA)"), VkBlendFactor::ONE_MINUS_CONSTANT_ALPHA => { write!(f, "VkBlendFactor(ONE_MINUS_CONSTANT_ALPHA)") } VkBlendFactor::SRC_ALPHA_SATURATE => write!(f, "VkBlendFactor(SRC_ALPHA_SATURATE)"), VkBlendFactor::SRC1_COLOR => write!(f, "VkBlendFactor(SRC1_COLOR)"), VkBlendFactor::ONE_MINUS_SRC1_COLOR => write!(f, "VkBlendFactor(ONE_MINUS_SRC1_COLOR)"), VkBlendFactor::SRC1_ALPHA => write!(f, "VkBlendFactor(SRC1_ALPHA)"), VkBlendFactor::ONE_MINUS_SRC1_ALPHA => write!(f, "VkBlendFactor(ONE_MINUS_SRC1_ALPHA)"), _ => write!(f, "VkBlendFactor({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkLogicOp(u32); impl VkLogicOp { pub const CLEAR: VkLogicOp = VkLogicOp(0); pub const AND: VkLogicOp = VkLogicOp(1); pub const AND_REVERSE: VkLogicOp = VkLogicOp(2); pub const COPY: VkLogicOp = VkLogicOp(3); pub const AND_INVERTED: VkLogicOp = VkLogicOp(4); pub const NO_OP: VkLogicOp = VkLogicOp(5); pub const XOR: VkLogicOp = VkLogicOp(6); pub const OR: VkLogicOp = VkLogicOp(7); pub const NOR: VkLogicOp = VkLogicOp(8); pub const EQUIVALENT: VkLogicOp = VkLogicOp(9); pub const INVERT: VkLogicOp = VkLogicOp(10); pub const OR_REVERSE: VkLogicOp = VkLogicOp(11); pub const COPY_INVERTED: VkLogicOp = VkLogicOp(12); pub const OR_INVERTED: VkLogicOp = VkLogicOp(13); pub const NAND: VkLogicOp = VkLogicOp(14); pub const SET: VkLogicOp = VkLogicOp(15); } impl core::fmt::Debug for VkLogicOp { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkLogicOp::CLEAR => write!(f, "VkLogicOp(CLEAR)"), VkLogicOp::AND => write!(f, "VkLogicOp(AND)"), VkLogicOp::AND_REVERSE => write!(f, "VkLogicOp(AND_REVERSE)"), VkLogicOp::COPY => write!(f, "VkLogicOp(COPY)"), VkLogicOp::AND_INVERTED => write!(f, "VkLogicOp(AND_INVERTED)"), VkLogicOp::NO_OP => write!(f, "VkLogicOp(NO_OP)"), VkLogicOp::XOR => write!(f, "VkLogicOp(XOR)"), VkLogicOp::OR => write!(f, "VkLogicOp(OR)"), VkLogicOp::NOR => write!(f, "VkLogicOp(NOR)"), VkLogicOp::EQUIVALENT => write!(f, "VkLogicOp(EQUIVALENT)"), VkLogicOp::INVERT => write!(f, "VkLogicOp(INVERT)"), VkLogicOp::OR_REVERSE => write!(f, "VkLogicOp(OR_REVERSE)"), VkLogicOp::COPY_INVERTED => write!(f, "VkLogicOp(COPY_INVERTED)"), VkLogicOp::OR_INVERTED => write!(f, "VkLogicOp(OR_INVERTED)"), VkLogicOp::NAND => write!(f, "VkLogicOp(NAND)"), VkLogicOp::SET => write!(f, "VkLogicOp(SET)"), _ => write!(f, "VkLogicOp({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkStencilOp(u32); impl VkStencilOp { pub const KEEP: VkStencilOp = VkStencilOp(0); pub const ZERO: VkStencilOp = VkStencilOp(1); pub const REPLACE: VkStencilOp = VkStencilOp(2); pub const INCREMENT_AND_CLAMP: VkStencilOp = VkStencilOp(3); pub const DECREMENT_AND_CLAMP: VkStencilOp = VkStencilOp(4); pub const INVERT: VkStencilOp = VkStencilOp(5); pub const INCREMENT_AND_WRAP: VkStencilOp = VkStencilOp(6); pub const DECREMENT_AND_WRAP: VkStencilOp = VkStencilOp(7); } impl core::fmt::Debug for VkStencilOp { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkStencilOp::KEEP => write!(f, "VkStencilOp(KEEP)"), VkStencilOp::ZERO => write!(f, "VkStencilOp(ZERO)"), VkStencilOp::REPLACE => write!(f, "VkStencilOp(REPLACE)"), VkStencilOp::INCREMENT_AND_CLAMP => write!(f, "VkStencilOp(INCREMENT_AND_CLAMP)"), VkStencilOp::DECREMENT_AND_CLAMP => write!(f, "VkStencilOp(DECREMENT_AND_CLAMP)"), VkStencilOp::INVERT => write!(f, "VkStencilOp(INVERT)"), VkStencilOp::INCREMENT_AND_WRAP => write!(f, "VkStencilOp(INCREMENT_AND_WRAP)"), VkStencilOp::DECREMENT_AND_WRAP => write!(f, "VkStencilOp(DECREMENT_AND_WRAP)"), _ => write!(f, "VkStencilOp({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkFrontFace(u32); impl VkFrontFace { pub const COUNTER_CLOCKWISE: VkFrontFace = VkFrontFace(0); pub const CLOCKWISE: VkFrontFace = VkFrontFace(1); } impl core::fmt::Debug for VkFrontFace { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkFrontFace::COUNTER_CLOCKWISE => write!(f, "VkFrontFace(COUNTER_CLOCKWISE)"), VkFrontFace::CLOCKWISE => write!(f, "VkFrontFace(CLOCKWISE)"), _ => write!(f, "VkFrontFace({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkPolygonMode(u32); impl VkPolygonMode { pub const FILL: VkPolygonMode = VkPolygonMode(0); pub const LINE: VkPolygonMode = VkPolygonMode(1); pub const POINT: VkPolygonMode = VkPolygonMode(2); } impl core::fmt::Debug for VkPolygonMode { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkPolygonMode::FILL => write!(f, "VkPolygonMode(FILL)"), VkPolygonMode::LINE => write!(f, "VkPolygonMode(LINE)"), VkPolygonMode::POINT => write!(f, "VkPolygonMode(POINT)"), _ => write!(f, "VkPolygonMode({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkPrimitiveTopology(u32); impl VkPrimitiveTopology { pub const POINT_LIST: VkPrimitiveTopology = VkPrimitiveTopology(0); pub const LINE_LIST: VkPrimitiveTopology = VkPrimitiveTopology(1); pub const LINE_STRIP: VkPrimitiveTopology = VkPrimitiveTopology(2); pub const TRIANGLE_LIST: VkPrimitiveTopology = VkPrimitiveTopology(3); pub const TRIANGLE_STRIP: VkPrimitiveTopology = VkPrimitiveTopology(4); pub const TRIANGLE_FAN: VkPrimitiveTopology = VkPrimitiveTopology(5); pub const LINE_LIST_WITH_ADJACENCY: VkPrimitiveTopology = VkPrimitiveTopology(6); pub const LINE_STRIP_WITH_ADJACENCY: VkPrimitiveTopology = VkPrimitiveTopology(7); pub const TRIANGLE_LIST_WITH_ADJACENCY: VkPrimitiveTopology = VkPrimitiveTopology(8); pub const TRIANGLE_STRIP_WITH_ADJACENCY: VkPrimitiveTopology = VkPrimitiveTopology(9); pub const PATCH_LIST: VkPrimitiveTopology = VkPrimitiveTopology(10); } impl core::fmt::Debug for VkPrimitiveTopology { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkPrimitiveTopology::POINT_LIST => write!(f, "VkPrimitiveTopology(POINT_LIST)"), VkPrimitiveTopology::LINE_LIST => write!(f, "VkPrimitiveTopology(LINE_LIST)"), VkPrimitiveTopology::LINE_STRIP => write!(f, "VkPrimitiveTopology(LINE_STRIP)"), VkPrimitiveTopology::TRIANGLE_LIST => write!(f, "VkPrimitiveTopology(TRIANGLE_LIST)"), VkPrimitiveTopology::TRIANGLE_STRIP => write!(f, "VkPrimitiveTopology(TRIANGLE_STRIP)"), VkPrimitiveTopology::TRIANGLE_FAN => write!(f, "VkPrimitiveTopology(TRIANGLE_FAN)"), VkPrimitiveTopology::LINE_LIST_WITH_ADJACENCY => { write!(f, "VkPrimitiveTopology(LINE_LIST_WITH_ADJACENCY)") } VkPrimitiveTopology::LINE_STRIP_WITH_ADJACENCY => { write!(f, "VkPrimitiveTopology(LINE_STRIP_WITH_ADJACENCY)") } VkPrimitiveTopology::TRIANGLE_LIST_WITH_ADJACENCY => { write!(f, "VkPrimitiveTopology(TRIANGLE_LIST_WITH_ADJACENCY)") } VkPrimitiveTopology::TRIANGLE_STRIP_WITH_ADJACENCY => { write!(f, "VkPrimitiveTopology(TRIANGLE_STRIP_WITH_ADJACENCY)") } VkPrimitiveTopology::PATCH_LIST => write!(f, "VkPrimitiveTopology(PATCH_LIST)"), _ => write!(f, "VkPrimitiveTopology({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkVertexInputRate(u32); impl VkVertexInputRate { pub const VERTEX: VkVertexInputRate = VkVertexInputRate(0); pub const INSTANCE: VkVertexInputRate = VkVertexInputRate(1); } impl core::fmt::Debug for VkVertexInputRate { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkVertexInputRate::VERTEX => write!(f, "VkVertexInputRate(VERTEX)"), VkVertexInputRate::INSTANCE => write!(f, "VkVertexInputRate(INSTANCE)"), _ => write!(f, "VkVertexInputRate({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkComponentSwizzle(u32); impl VkComponentSwizzle { pub const IDENTITY: VkComponentSwizzle = VkComponentSwizzle(0); pub const ZERO: VkComponentSwizzle = VkComponentSwizzle(1); pub const ONE: VkComponentSwizzle = VkComponentSwizzle(2); pub const R: VkComponentSwizzle = VkComponentSwizzle(3); pub const G: VkComponentSwizzle = VkComponentSwizzle(4); pub const B: VkComponentSwizzle = VkComponentSwizzle(5); pub const A: VkComponentSwizzle = VkComponentSwizzle(6); } impl core::fmt::Debug for VkComponentSwizzle { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkComponentSwizzle::IDENTITY => write!(f, "VkComponentSwizzle(IDENTITY)"), VkComponentSwizzle::ZERO => write!(f, "VkComponentSwizzle(ZERO)"), VkComponentSwizzle::ONE => write!(f, "VkComponentSwizzle(ONE)"), VkComponentSwizzle::R => write!(f, "VkComponentSwizzle(R)"), VkComponentSwizzle::G => write!(f, "VkComponentSwizzle(G)"), VkComponentSwizzle::B => write!(f, "VkComponentSwizzle(B)"), VkComponentSwizzle::A => write!(f, "VkComponentSwizzle(A)"), _ => write!(f, "VkComponentSwizzle({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkImageViewType(u32); impl VkImageViewType { pub const K_1D: VkImageViewType = VkImageViewType(0); pub const K_2D: VkImageViewType = VkImageViewType(1); pub const K_3D: VkImageViewType = VkImageViewType(2); pub const CUBE: VkImageViewType = VkImageViewType(3); pub const K_1D_ARRAY: VkImageViewType = VkImageViewType(4); pub const K_2D_ARRAY: VkImageViewType = VkImageViewType(5); pub const CUBE_ARRAY: VkImageViewType = VkImageViewType(6); } impl core::fmt::Debug for VkImageViewType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkImageViewType::K_1D => write!(f, "VkImageViewType(K_1D)"), VkImageViewType::K_2D => write!(f, "VkImageViewType(K_2D)"), VkImageViewType::K_3D => write!(f, "VkImageViewType(K_3D)"), VkImageViewType::CUBE => write!(f, "VkImageViewType(CUBE)"), VkImageViewType::K_1D_ARRAY => write!(f, "VkImageViewType(K_1D_ARRAY)"), VkImageViewType::K_2D_ARRAY => write!(f, "VkImageViewType(K_2D_ARRAY)"), VkImageViewType::CUBE_ARRAY => write!(f, "VkImageViewType(CUBE_ARRAY)"), _ => write!(f, "VkImageViewType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkImageTiling(u32); impl VkImageTiling { pub const OPTIMAL: VkImageTiling = VkImageTiling(0); pub const LINEAR: VkImageTiling = VkImageTiling(1); } impl core::fmt::Debug for VkImageTiling { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkImageTiling::OPTIMAL => write!(f, "VkImageTiling(OPTIMAL)"), VkImageTiling::LINEAR => write!(f, "VkImageTiling(LINEAR)"), _ => write!(f, "VkImageTiling({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkImageType(u32); impl VkImageType { pub const K_1D: VkImageType = VkImageType(0); pub const K_2D: VkImageType = VkImageType(1); pub const K_3D: VkImageType = VkImageType(2); } impl core::fmt::Debug for VkImageType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkImageType::K_1D => write!(f, "VkImageType(K_1D)"), VkImageType::K_2D => write!(f, "VkImageType(K_2D)"), VkImageType::K_3D => write!(f, "VkImageType(K_3D)"), _ => write!(f, "VkImageType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkQueryType(u32); impl VkQueryType { pub const OCCLUSION: VkQueryType = VkQueryType(0); pub const PIPELINE_STATISTICS: VkQueryType = VkQueryType(1); pub const TIMESTAMP: VkQueryType = VkQueryType(2); } impl core::fmt::Debug for VkQueryType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkQueryType::OCCLUSION => write!(f, "VkQueryType(OCCLUSION)"), VkQueryType::PIPELINE_STATISTICS => write!(f, "VkQueryType(PIPELINE_STATISTICS)"), VkQueryType::TIMESTAMP => write!(f, "VkQueryType(TIMESTAMP)"), _ => write!(f, "VkQueryType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkPhysicalDeviceType(u32); impl VkPhysicalDeviceType { pub const OTHER: VkPhysicalDeviceType = VkPhysicalDeviceType(0); pub const INTEGRATED_GPU: VkPhysicalDeviceType = VkPhysicalDeviceType(1); pub const DISCRETE_GPU: VkPhysicalDeviceType = VkPhysicalDeviceType(2); pub const VIRTUAL_GPU: VkPhysicalDeviceType = VkPhysicalDeviceType(3); pub const CPU: VkPhysicalDeviceType = VkPhysicalDeviceType(4); } impl core::fmt::Debug for VkPhysicalDeviceType { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkPhysicalDeviceType::OTHER => write!(f, "VkPhysicalDeviceType(OTHER)"), VkPhysicalDeviceType::INTEGRATED_GPU => { write!(f, "VkPhysicalDeviceType(INTEGRATED_GPU)") } VkPhysicalDeviceType::DISCRETE_GPU => write!(f, "VkPhysicalDeviceType(DISCRETE_GPU)"), VkPhysicalDeviceType::VIRTUAL_GPU => write!(f, "VkPhysicalDeviceType(VIRTUAL_GPU)"), VkPhysicalDeviceType::CPU => write!(f, "VkPhysicalDeviceType(CPU)"), _ => write!(f, "VkPhysicalDeviceType({})", self.0), } } } #[repr(transparent)] #[derive(Default, PartialOrd, Copy, Clone, Ord, PartialEq, Eq, Hash)] pub struct VkPipelineCacheHeaderVersion(u32); impl VkPipelineCacheHeaderVersion { pub const ONE: VkPipelineCacheHeaderVersion = VkPipelineCacheHeaderVersion(1); } impl core::fmt::Debug for VkPipelineCacheHeaderVersion { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { match *self { VkPipelineCacheHeaderVersion::ONE => write!(f, "VkPipelineCacheHeaderVersion(ONE)"), _ => write!(f, "VkPipelineCacheHeaderVersion({})", self.0), } } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkImageUsageFlagBits(VkFlags); impl VkImageUsageFlagBits { pub const TRANSFER_SRC_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(1); pub const TRANSFER_DST_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(2); pub const SAMPLED_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(4); pub const STORAGE_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(8); pub const COLOR_ATTACHMENT_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(16); pub const DEPTH_STENCIL_ATTACHMENT_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(32); pub const TRANSIENT_ATTACHMENT_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(64); pub const INPUT_ATTACHMENT_BIT: VkImageUsageFlagBits = VkImageUsageFlagBits(128); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkImageUsageFlagBits { type Output = VkImageUsageFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkImageUsageFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkImageUsageFlagBits { type Output = VkImageUsageFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkImageUsageFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkImageUsageFlagBits { type Output = VkImageUsageFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkImageUsageFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkImageUsageFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkImageUsageFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkImageUsageFlagBits::TRANSFER_SRC_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_SRC_BIT")?; } if self.contains(VkImageUsageFlagBits::TRANSFER_DST_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_DST_BIT")?; } if self.contains(VkImageUsageFlagBits::SAMPLED_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SAMPLED_BIT")?; } if self.contains(VkImageUsageFlagBits::STORAGE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STORAGE_BIT")?; } if self.contains(VkImageUsageFlagBits::COLOR_ATTACHMENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COLOR_ATTACHMENT_BIT")?; } if self.contains(VkImageUsageFlagBits::DEPTH_STENCIL_ATTACHMENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DEPTH_STENCIL_ATTACHMENT_BIT")?; } if self.contains(VkImageUsageFlagBits::TRANSIENT_ATTACHMENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSIENT_ATTACHMENT_BIT")?; } if self.contains(VkImageUsageFlagBits::INPUT_ATTACHMENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INPUT_ATTACHMENT_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkCompositeAlphaFlagBitsKHR(VkFlags); impl VkCompositeAlphaFlagBitsKHR { pub const OPAQUE_BIT_KHR: VkCompositeAlphaFlagBitsKHR = VkCompositeAlphaFlagBitsKHR(1); pub const PRE_MULTIPLIED_BIT_KHR: VkCompositeAlphaFlagBitsKHR = VkCompositeAlphaFlagBitsKHR(2); pub const POST_MULTIPLIED_BIT_KHR: VkCompositeAlphaFlagBitsKHR = VkCompositeAlphaFlagBitsKHR(4); pub const INHERIT_BIT_KHR: VkCompositeAlphaFlagBitsKHR = VkCompositeAlphaFlagBitsKHR(8); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkCompositeAlphaFlagBitsKHR { type Output = VkCompositeAlphaFlagBitsKHR; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkCompositeAlphaFlagBitsKHR { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkCompositeAlphaFlagBitsKHR { type Output = VkCompositeAlphaFlagBitsKHR; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkCompositeAlphaFlagBitsKHR { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkCompositeAlphaFlagBitsKHR { type Output = VkCompositeAlphaFlagBitsKHR; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkCompositeAlphaFlagBitsKHR { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkCompositeAlphaFlagBitsKHR { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkCompositeAlphaFlagBitsKHR(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkCompositeAlphaFlagBitsKHR::OPAQUE_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("OPAQUE_BIT_KHR")?; } if self.contains(VkCompositeAlphaFlagBitsKHR::PRE_MULTIPLIED_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("PRE_MULTIPLIED_BIT_KHR")?; } if self.contains(VkCompositeAlphaFlagBitsKHR::POST_MULTIPLIED_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("POST_MULTIPLIED_BIT_KHR")?; } if self.contains(VkCompositeAlphaFlagBitsKHR::INHERIT_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INHERIT_BIT_KHR")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkSurfaceTransformFlagBitsKHR(VkFlags); impl VkSurfaceTransformFlagBitsKHR { pub const IDENTITY_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(1); pub const ROTATE_90_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(2); pub const ROTATE_180_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(4); pub const ROTATE_270_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(8); pub const HORIZONTAL_MIRROR_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(16); pub const HORIZONTAL_MIRROR_ROTATE_90_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(32); pub const HORIZONTAL_MIRROR_ROTATE_180_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(64); pub const HORIZONTAL_MIRROR_ROTATE_270_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(128); pub const INHERIT_BIT_KHR: VkSurfaceTransformFlagBitsKHR = VkSurfaceTransformFlagBitsKHR(256); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkSurfaceTransformFlagBitsKHR { type Output = VkSurfaceTransformFlagBitsKHR; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkSurfaceTransformFlagBitsKHR { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkSurfaceTransformFlagBitsKHR { type Output = VkSurfaceTransformFlagBitsKHR; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkSurfaceTransformFlagBitsKHR { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkSurfaceTransformFlagBitsKHR { type Output = VkSurfaceTransformFlagBitsKHR; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkSurfaceTransformFlagBitsKHR { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkSurfaceTransformFlagBitsKHR { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkSurfaceTransformFlagBitsKHR(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkSurfaceTransformFlagBitsKHR::IDENTITY_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("IDENTITY_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::ROTATE_90_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ROTATE_90_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::ROTATE_180_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ROTATE_180_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::ROTATE_270_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ROTATE_270_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::HORIZONTAL_MIRROR_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HORIZONTAL_MIRROR_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::HORIZONTAL_MIRROR_ROTATE_90_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HORIZONTAL_MIRROR_ROTATE_90_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::HORIZONTAL_MIRROR_ROTATE_180_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HORIZONTAL_MIRROR_ROTATE_180_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::HORIZONTAL_MIRROR_ROTATE_270_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HORIZONTAL_MIRROR_ROTATE_270_BIT_KHR")?; } if self.contains(VkSurfaceTransformFlagBitsKHR::INHERIT_BIT_KHR) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INHERIT_BIT_KHR")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkSwapchainCreateFlagBitsKHR(VkFlags); impl VkSwapchainCreateFlagBitsKHR { #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkSwapchainCreateFlagBitsKHR { type Output = VkSwapchainCreateFlagBitsKHR; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkSwapchainCreateFlagBitsKHR { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkSwapchainCreateFlagBitsKHR { type Output = VkSwapchainCreateFlagBitsKHR; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkSwapchainCreateFlagBitsKHR { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkSwapchainCreateFlagBitsKHR { type Output = VkSwapchainCreateFlagBitsKHR; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkSwapchainCreateFlagBitsKHR { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkSwapchainCreateFlagBitsKHR { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkSwapchainCreateFlagBitsKHR(")?; #[allow(unused_mut, unused)] let mut first = true; return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkDebugUtilsMessageTypeFlagBitsEXT(VkFlags); impl VkDebugUtilsMessageTypeFlagBitsEXT { pub const GENERAL_BIT_EXT: VkDebugUtilsMessageTypeFlagBitsEXT = VkDebugUtilsMessageTypeFlagBitsEXT(1); pub const VALIDATION_BIT_EXT: VkDebugUtilsMessageTypeFlagBitsEXT = VkDebugUtilsMessageTypeFlagBitsEXT(2); pub const PERFORMANCE_BIT_EXT: VkDebugUtilsMessageTypeFlagBitsEXT = VkDebugUtilsMessageTypeFlagBitsEXT(4); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkDebugUtilsMessageTypeFlagBitsEXT { type Output = VkDebugUtilsMessageTypeFlagBitsEXT; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkDebugUtilsMessageTypeFlagBitsEXT { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkDebugUtilsMessageTypeFlagBitsEXT { type Output = VkDebugUtilsMessageTypeFlagBitsEXT; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkDebugUtilsMessageTypeFlagBitsEXT { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkDebugUtilsMessageTypeFlagBitsEXT { type Output = VkDebugUtilsMessageTypeFlagBitsEXT; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkDebugUtilsMessageTypeFlagBitsEXT { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkDebugUtilsMessageTypeFlagBitsEXT { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkDebugUtilsMessageTypeFlagBitsEXT(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkDebugUtilsMessageTypeFlagBitsEXT::GENERAL_BIT_EXT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("GENERAL_BIT_EXT")?; } if self.contains(VkDebugUtilsMessageTypeFlagBitsEXT::VALIDATION_BIT_EXT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VALIDATION_BIT_EXT")?; } if self.contains(VkDebugUtilsMessageTypeFlagBitsEXT::PERFORMANCE_BIT_EXT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("PERFORMANCE_BIT_EXT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkDebugUtilsMessageSeverityFlagBitsEXT(VkFlags); impl VkDebugUtilsMessageSeverityFlagBitsEXT { pub const VERBOSE_BIT_EXT: VkDebugUtilsMessageSeverityFlagBitsEXT = VkDebugUtilsMessageSeverityFlagBitsEXT(1); pub const INFO_BIT_EXT: VkDebugUtilsMessageSeverityFlagBitsEXT = VkDebugUtilsMessageSeverityFlagBitsEXT(16); pub const WARNING_BIT_EXT: VkDebugUtilsMessageSeverityFlagBitsEXT = VkDebugUtilsMessageSeverityFlagBitsEXT(256); pub const ERROR_BIT_EXT: VkDebugUtilsMessageSeverityFlagBitsEXT = VkDebugUtilsMessageSeverityFlagBitsEXT(4096); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkDebugUtilsMessageSeverityFlagBitsEXT { type Output = VkDebugUtilsMessageSeverityFlagBitsEXT; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkDebugUtilsMessageSeverityFlagBitsEXT { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkDebugUtilsMessageSeverityFlagBitsEXT { type Output = VkDebugUtilsMessageSeverityFlagBitsEXT; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkDebugUtilsMessageSeverityFlagBitsEXT { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkDebugUtilsMessageSeverityFlagBitsEXT { type Output = VkDebugUtilsMessageSeverityFlagBitsEXT; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkDebugUtilsMessageSeverityFlagBitsEXT { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkDebugUtilsMessageSeverityFlagBitsEXT { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkDebugUtilsMessageSeverityFlagBitsEXT(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkDebugUtilsMessageSeverityFlagBitsEXT::VERBOSE_BIT_EXT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERBOSE_BIT_EXT")?; } if self.contains(VkDebugUtilsMessageSeverityFlagBitsEXT::INFO_BIT_EXT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INFO_BIT_EXT")?; } if self.contains(VkDebugUtilsMessageSeverityFlagBitsEXT::WARNING_BIT_EXT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("WARNING_BIT_EXT")?; } if self.contains(VkDebugUtilsMessageSeverityFlagBitsEXT::ERROR_BIT_EXT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ERROR_BIT_EXT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkAccessFlagBits(VkFlags); impl VkAccessFlagBits { pub const INDIRECT_COMMAND_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(1); pub const INDEX_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(2); pub const VERTEX_ATTRIBUTE_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(4); pub const UNIFORM_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(8); pub const INPUT_ATTACHMENT_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(16); pub const SHADER_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(32); pub const SHADER_WRITE_BIT: VkAccessFlagBits = VkAccessFlagBits(64); pub const COLOR_ATTACHMENT_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(128); pub const COLOR_ATTACHMENT_WRITE_BIT: VkAccessFlagBits = VkAccessFlagBits(256); pub const DEPTH_STENCIL_ATTACHMENT_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(512); pub const DEPTH_STENCIL_ATTACHMENT_WRITE_BIT: VkAccessFlagBits = VkAccessFlagBits(1024); pub const TRANSFER_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(2048); pub const TRANSFER_WRITE_BIT: VkAccessFlagBits = VkAccessFlagBits(4096); pub const HOST_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(8192); pub const HOST_WRITE_BIT: VkAccessFlagBits = VkAccessFlagBits(16384); pub const MEMORY_READ_BIT: VkAccessFlagBits = VkAccessFlagBits(32768); pub const MEMORY_WRITE_BIT: VkAccessFlagBits = VkAccessFlagBits(65536); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkAccessFlagBits { type Output = VkAccessFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkAccessFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkAccessFlagBits { type Output = VkAccessFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkAccessFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkAccessFlagBits { type Output = VkAccessFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkAccessFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkAccessFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkAccessFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkAccessFlagBits::INDIRECT_COMMAND_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INDIRECT_COMMAND_READ_BIT")?; } if self.contains(VkAccessFlagBits::INDEX_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INDEX_READ_BIT")?; } if self.contains(VkAccessFlagBits::VERTEX_ATTRIBUTE_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERTEX_ATTRIBUTE_READ_BIT")?; } if self.contains(VkAccessFlagBits::UNIFORM_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("UNIFORM_READ_BIT")?; } if self.contains(VkAccessFlagBits::INPUT_ATTACHMENT_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INPUT_ATTACHMENT_READ_BIT")?; } if self.contains(VkAccessFlagBits::SHADER_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SHADER_READ_BIT")?; } if self.contains(VkAccessFlagBits::SHADER_WRITE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SHADER_WRITE_BIT")?; } if self.contains(VkAccessFlagBits::COLOR_ATTACHMENT_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COLOR_ATTACHMENT_READ_BIT")?; } if self.contains(VkAccessFlagBits::COLOR_ATTACHMENT_WRITE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COLOR_ATTACHMENT_WRITE_BIT")?; } if self.contains(VkAccessFlagBits::DEPTH_STENCIL_ATTACHMENT_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DEPTH_STENCIL_ATTACHMENT_READ_BIT")?; } if self.contains(VkAccessFlagBits::DEPTH_STENCIL_ATTACHMENT_WRITE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DEPTH_STENCIL_ATTACHMENT_WRITE_BIT")?; } if self.contains(VkAccessFlagBits::TRANSFER_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_READ_BIT")?; } if self.contains(VkAccessFlagBits::TRANSFER_WRITE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_WRITE_BIT")?; } if self.contains(VkAccessFlagBits::HOST_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HOST_READ_BIT")?; } if self.contains(VkAccessFlagBits::HOST_WRITE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HOST_WRITE_BIT")?; } if self.contains(VkAccessFlagBits::MEMORY_READ_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("MEMORY_READ_BIT")?; } if self.contains(VkAccessFlagBits::MEMORY_WRITE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("MEMORY_WRITE_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkImageAspectFlagBits(VkFlags); impl VkImageAspectFlagBits { pub const COLOR_BIT: VkImageAspectFlagBits = VkImageAspectFlagBits(1); pub const DEPTH_BIT: VkImageAspectFlagBits = VkImageAspectFlagBits(2); pub const STENCIL_BIT: VkImageAspectFlagBits = VkImageAspectFlagBits(4); pub const METADATA_BIT: VkImageAspectFlagBits = VkImageAspectFlagBits(8); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkImageAspectFlagBits { type Output = VkImageAspectFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkImageAspectFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkImageAspectFlagBits { type Output = VkImageAspectFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkImageAspectFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkImageAspectFlagBits { type Output = VkImageAspectFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkImageAspectFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkImageAspectFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkImageAspectFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkImageAspectFlagBits::COLOR_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COLOR_BIT")?; } if self.contains(VkImageAspectFlagBits::DEPTH_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DEPTH_BIT")?; } if self.contains(VkImageAspectFlagBits::STENCIL_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STENCIL_BIT")?; } if self.contains(VkImageAspectFlagBits::METADATA_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("METADATA_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkShaderStageFlagBits(VkFlags); impl VkShaderStageFlagBits { pub const VERTEX_BIT: VkShaderStageFlagBits = VkShaderStageFlagBits(1); pub const TESSELLATION_CONTROL_BIT: VkShaderStageFlagBits = VkShaderStageFlagBits(2); pub const TESSELLATION_EVALUATION_BIT: VkShaderStageFlagBits = VkShaderStageFlagBits(4); pub const GEOMETRY_BIT: VkShaderStageFlagBits = VkShaderStageFlagBits(8); pub const FRAGMENT_BIT: VkShaderStageFlagBits = VkShaderStageFlagBits(16); pub const ALL_GRAPHICS: VkShaderStageFlagBits = VkShaderStageFlagBits(31); pub const COMPUTE_BIT: VkShaderStageFlagBits = VkShaderStageFlagBits(32); pub const ALL: VkShaderStageFlagBits = VkShaderStageFlagBits(2147483647); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkShaderStageFlagBits { type Output = VkShaderStageFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkShaderStageFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkShaderStageFlagBits { type Output = VkShaderStageFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkShaderStageFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkShaderStageFlagBits { type Output = VkShaderStageFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkShaderStageFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkShaderStageFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkShaderStageFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkShaderStageFlagBits::VERTEX_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERTEX_BIT")?; } if self.contains(VkShaderStageFlagBits::TESSELLATION_CONTROL_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TESSELLATION_CONTROL_BIT")?; } if self.contains(VkShaderStageFlagBits::TESSELLATION_EVALUATION_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TESSELLATION_EVALUATION_BIT")?; } if self.contains(VkShaderStageFlagBits::GEOMETRY_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("GEOMETRY_BIT")?; } if self.contains(VkShaderStageFlagBits::FRAGMENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FRAGMENT_BIT")?; } if self.contains(VkShaderStageFlagBits::ALL_GRAPHICS) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ALL_GRAPHICS")?; } if self.contains(VkShaderStageFlagBits::COMPUTE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COMPUTE_BIT")?; } if self.contains(VkShaderStageFlagBits::ALL) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ALL")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkQueryResultFlagBits(VkFlags); impl VkQueryResultFlagBits { pub const K_64_BIT: VkQueryResultFlagBits = VkQueryResultFlagBits(1); pub const WAIT_BIT: VkQueryResultFlagBits = VkQueryResultFlagBits(2); pub const WITH_AVAILABILITY_BIT: VkQueryResultFlagBits = VkQueryResultFlagBits(4); pub const PARTIAL_BIT: VkQueryResultFlagBits = VkQueryResultFlagBits(8); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkQueryResultFlagBits { type Output = VkQueryResultFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkQueryResultFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkQueryResultFlagBits { type Output = VkQueryResultFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkQueryResultFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkQueryResultFlagBits { type Output = VkQueryResultFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkQueryResultFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkQueryResultFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkQueryResultFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkQueryResultFlagBits::K_64_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_64_BIT")?; } if self.contains(VkQueryResultFlagBits::WAIT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("WAIT_BIT")?; } if self.contains(VkQueryResultFlagBits::WITH_AVAILABILITY_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("WITH_AVAILABILITY_BIT")?; } if self.contains(VkQueryResultFlagBits::PARTIAL_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("PARTIAL_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkPipelineStageFlagBits(VkFlags); impl VkPipelineStageFlagBits { pub const TOP_OF_PIPE_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(1); pub const DRAW_INDIRECT_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(2); pub const VERTEX_INPUT_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(4); pub const VERTEX_SHADER_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(8); pub const TESSELLATION_CONTROL_SHADER_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(16); pub const TESSELLATION_EVALUATION_SHADER_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(32); pub const GEOMETRY_SHADER_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(64); pub const FRAGMENT_SHADER_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(128); pub const EARLY_FRAGMENT_TESTS_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(256); pub const LATE_FRAGMENT_TESTS_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(512); pub const COLOR_ATTACHMENT_OUTPUT_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(1024); pub const COMPUTE_SHADER_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(2048); pub const TRANSFER_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(4096); pub const BOTTOM_OF_PIPE_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(8192); pub const HOST_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(16384); pub const ALL_GRAPHICS_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(32768); pub const ALL_COMMANDS_BIT: VkPipelineStageFlagBits = VkPipelineStageFlagBits(65536); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkPipelineStageFlagBits { type Output = VkPipelineStageFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkPipelineStageFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkPipelineStageFlagBits { type Output = VkPipelineStageFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkPipelineStageFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkPipelineStageFlagBits { type Output = VkPipelineStageFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkPipelineStageFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkPipelineStageFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkPipelineStageFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkPipelineStageFlagBits::TOP_OF_PIPE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TOP_OF_PIPE_BIT")?; } if self.contains(VkPipelineStageFlagBits::DRAW_INDIRECT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DRAW_INDIRECT_BIT")?; } if self.contains(VkPipelineStageFlagBits::VERTEX_INPUT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERTEX_INPUT_BIT")?; } if self.contains(VkPipelineStageFlagBits::VERTEX_SHADER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERTEX_SHADER_BIT")?; } if self.contains(VkPipelineStageFlagBits::TESSELLATION_CONTROL_SHADER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TESSELLATION_CONTROL_SHADER_BIT")?; } if self.contains(VkPipelineStageFlagBits::TESSELLATION_EVALUATION_SHADER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TESSELLATION_EVALUATION_SHADER_BIT")?; } if self.contains(VkPipelineStageFlagBits::GEOMETRY_SHADER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("GEOMETRY_SHADER_BIT")?; } if self.contains(VkPipelineStageFlagBits::FRAGMENT_SHADER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FRAGMENT_SHADER_BIT")?; } if self.contains(VkPipelineStageFlagBits::EARLY_FRAGMENT_TESTS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("EARLY_FRAGMENT_TESTS_BIT")?; } if self.contains(VkPipelineStageFlagBits::LATE_FRAGMENT_TESTS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("LATE_FRAGMENT_TESTS_BIT")?; } if self.contains(VkPipelineStageFlagBits::COLOR_ATTACHMENT_OUTPUT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COLOR_ATTACHMENT_OUTPUT_BIT")?; } if self.contains(VkPipelineStageFlagBits::COMPUTE_SHADER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COMPUTE_SHADER_BIT")?; } if self.contains(VkPipelineStageFlagBits::TRANSFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_BIT")?; } if self.contains(VkPipelineStageFlagBits::BOTTOM_OF_PIPE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("BOTTOM_OF_PIPE_BIT")?; } if self.contains(VkPipelineStageFlagBits::HOST_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HOST_BIT")?; } if self.contains(VkPipelineStageFlagBits::ALL_GRAPHICS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ALL_GRAPHICS_BIT")?; } if self.contains(VkPipelineStageFlagBits::ALL_COMMANDS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ALL_COMMANDS_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkQueryControlFlagBits(VkFlags); impl VkQueryControlFlagBits { pub const PRECISE_BIT: VkQueryControlFlagBits = VkQueryControlFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkQueryControlFlagBits { type Output = VkQueryControlFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkQueryControlFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkQueryControlFlagBits { type Output = VkQueryControlFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkQueryControlFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkQueryControlFlagBits { type Output = VkQueryControlFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkQueryControlFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkQueryControlFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkQueryControlFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkQueryControlFlagBits::PRECISE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("PRECISE_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkDependencyFlagBits(VkFlags); impl VkDependencyFlagBits { pub const BY_REGION_BIT: VkDependencyFlagBits = VkDependencyFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkDependencyFlagBits { type Output = VkDependencyFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkDependencyFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkDependencyFlagBits { type Output = VkDependencyFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkDependencyFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkDependencyFlagBits { type Output = VkDependencyFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkDependencyFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkDependencyFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkDependencyFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkDependencyFlagBits::BY_REGION_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("BY_REGION_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkStencilFaceFlagBits(VkFlags); impl VkStencilFaceFlagBits { pub const FRONT_BIT: VkStencilFaceFlagBits = VkStencilFaceFlagBits(1); pub const BACK_BIT: VkStencilFaceFlagBits = VkStencilFaceFlagBits(2); pub const FRONT_AND_BACK: VkStencilFaceFlagBits = VkStencilFaceFlagBits(3); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkStencilFaceFlagBits { type Output = VkStencilFaceFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkStencilFaceFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkStencilFaceFlagBits { type Output = VkStencilFaceFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkStencilFaceFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkStencilFaceFlagBits { type Output = VkStencilFaceFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkStencilFaceFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkStencilFaceFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkStencilFaceFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkStencilFaceFlagBits::FRONT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FRONT_BIT")?; } if self.contains(VkStencilFaceFlagBits::BACK_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("BACK_BIT")?; } if self.contains(VkStencilFaceFlagBits::FRONT_AND_BACK) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FRONT_AND_BACK")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkCommandBufferResetFlagBits(VkFlags); impl VkCommandBufferResetFlagBits { pub const RELEASE_RESOURCES_BIT: VkCommandBufferResetFlagBits = VkCommandBufferResetFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkCommandBufferResetFlagBits { type Output = VkCommandBufferResetFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkCommandBufferResetFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkCommandBufferResetFlagBits { type Output = VkCommandBufferResetFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkCommandBufferResetFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkCommandBufferResetFlagBits { type Output = VkCommandBufferResetFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkCommandBufferResetFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkCommandBufferResetFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkCommandBufferResetFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkCommandBufferResetFlagBits::RELEASE_RESOURCES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("RELEASE_RESOURCES_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkQueryPipelineStatisticFlagBits(VkFlags); impl VkQueryPipelineStatisticFlagBits { pub const INPUT_ASSEMBLY_VERTICES_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(1); pub const INPUT_ASSEMBLY_PRIMITIVES_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(2); pub const VERTEX_SHADER_INVOCATIONS_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(4); pub const GEOMETRY_SHADER_INVOCATIONS_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(8); pub const GEOMETRY_SHADER_PRIMITIVES_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(16); pub const CLIPPING_INVOCATIONS_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(32); pub const CLIPPING_PRIMITIVES_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(64); pub const FRAGMENT_SHADER_INVOCATIONS_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(128); pub const TESSELLATION_CONTROL_SHADER_PATCHES_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(256); pub const TESSELLATION_EVALUATION_SHADER_INVOCATIONS_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(512); pub const COMPUTE_SHADER_INVOCATIONS_BIT: VkQueryPipelineStatisticFlagBits = VkQueryPipelineStatisticFlagBits(1024); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkQueryPipelineStatisticFlagBits { type Output = VkQueryPipelineStatisticFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkQueryPipelineStatisticFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkQueryPipelineStatisticFlagBits { type Output = VkQueryPipelineStatisticFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkQueryPipelineStatisticFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkQueryPipelineStatisticFlagBits { type Output = VkQueryPipelineStatisticFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkQueryPipelineStatisticFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkQueryPipelineStatisticFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkQueryPipelineStatisticFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkQueryPipelineStatisticFlagBits::INPUT_ASSEMBLY_VERTICES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INPUT_ASSEMBLY_VERTICES_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::INPUT_ASSEMBLY_PRIMITIVES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INPUT_ASSEMBLY_PRIMITIVES_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::VERTEX_SHADER_INVOCATIONS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERTEX_SHADER_INVOCATIONS_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::GEOMETRY_SHADER_INVOCATIONS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("GEOMETRY_SHADER_INVOCATIONS_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::GEOMETRY_SHADER_PRIMITIVES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("GEOMETRY_SHADER_PRIMITIVES_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::CLIPPING_INVOCATIONS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("CLIPPING_INVOCATIONS_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::CLIPPING_PRIMITIVES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("CLIPPING_PRIMITIVES_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::FRAGMENT_SHADER_INVOCATIONS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FRAGMENT_SHADER_INVOCATIONS_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::TESSELLATION_CONTROL_SHADER_PATCHES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TESSELLATION_CONTROL_SHADER_PATCHES_BIT")?; } if self.contains( VkQueryPipelineStatisticFlagBits::TESSELLATION_EVALUATION_SHADER_INVOCATIONS_BIT, ) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TESSELLATION_EVALUATION_SHADER_INVOCATIONS_BIT")?; } if self.contains(VkQueryPipelineStatisticFlagBits::COMPUTE_SHADER_INVOCATIONS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COMPUTE_SHADER_INVOCATIONS_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkCommandBufferUsageFlagBits(VkFlags); impl VkCommandBufferUsageFlagBits { pub const ONE_TIME_SUBMIT_BIT: VkCommandBufferUsageFlagBits = VkCommandBufferUsageFlagBits(1); pub const RENDER_PASS_CONTINUE_BIT: VkCommandBufferUsageFlagBits = VkCommandBufferUsageFlagBits(2); pub const SIMULTANEOUS_USE_BIT: VkCommandBufferUsageFlagBits = VkCommandBufferUsageFlagBits(4); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkCommandBufferUsageFlagBits { type Output = VkCommandBufferUsageFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkCommandBufferUsageFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkCommandBufferUsageFlagBits { type Output = VkCommandBufferUsageFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkCommandBufferUsageFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkCommandBufferUsageFlagBits { type Output = VkCommandBufferUsageFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkCommandBufferUsageFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkCommandBufferUsageFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkCommandBufferUsageFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkCommandBufferUsageFlagBits::ONE_TIME_SUBMIT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ONE_TIME_SUBMIT_BIT")?; } if self.contains(VkCommandBufferUsageFlagBits::RENDER_PASS_CONTINUE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("RENDER_PASS_CONTINUE_BIT")?; } if self.contains(VkCommandBufferUsageFlagBits::SIMULTANEOUS_USE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SIMULTANEOUS_USE_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkCommandPoolResetFlagBits(VkFlags); impl VkCommandPoolResetFlagBits { pub const RELEASE_RESOURCES_BIT: VkCommandPoolResetFlagBits = VkCommandPoolResetFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkCommandPoolResetFlagBits { type Output = VkCommandPoolResetFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkCommandPoolResetFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkCommandPoolResetFlagBits { type Output = VkCommandPoolResetFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkCommandPoolResetFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkCommandPoolResetFlagBits { type Output = VkCommandPoolResetFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkCommandPoolResetFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkCommandPoolResetFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkCommandPoolResetFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkCommandPoolResetFlagBits::RELEASE_RESOURCES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("RELEASE_RESOURCES_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkCommandPoolCreateFlagBits(VkFlags); impl VkCommandPoolCreateFlagBits { pub const TRANSIENT_BIT: VkCommandPoolCreateFlagBits = VkCommandPoolCreateFlagBits(1); pub const RESET_COMMAND_BUFFER_BIT: VkCommandPoolCreateFlagBits = VkCommandPoolCreateFlagBits(2); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkCommandPoolCreateFlagBits { type Output = VkCommandPoolCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkCommandPoolCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkCommandPoolCreateFlagBits { type Output = VkCommandPoolCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkCommandPoolCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkCommandPoolCreateFlagBits { type Output = VkCommandPoolCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkCommandPoolCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkCommandPoolCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkCommandPoolCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkCommandPoolCreateFlagBits::TRANSIENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSIENT_BIT")?; } if self.contains(VkCommandPoolCreateFlagBits::RESET_COMMAND_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("RESET_COMMAND_BUFFER_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkSubpassDescriptionFlagBits(VkFlags); impl VkSubpassDescriptionFlagBits { #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkSubpassDescriptionFlagBits { type Output = VkSubpassDescriptionFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkSubpassDescriptionFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkSubpassDescriptionFlagBits { type Output = VkSubpassDescriptionFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkSubpassDescriptionFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkSubpassDescriptionFlagBits { type Output = VkSubpassDescriptionFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkSubpassDescriptionFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkSubpassDescriptionFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkSubpassDescriptionFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkSampleCountFlagBits(VkFlags); impl VkSampleCountFlagBits { pub const K_1_BIT: VkSampleCountFlagBits = VkSampleCountFlagBits(1); pub const K_2_BIT: VkSampleCountFlagBits = VkSampleCountFlagBits(2); pub const K_4_BIT: VkSampleCountFlagBits = VkSampleCountFlagBits(4); pub const K_8_BIT: VkSampleCountFlagBits = VkSampleCountFlagBits(8); pub const K_16_BIT: VkSampleCountFlagBits = VkSampleCountFlagBits(16); pub const K_32_BIT: VkSampleCountFlagBits = VkSampleCountFlagBits(32); pub const K_64_BIT: VkSampleCountFlagBits = VkSampleCountFlagBits(64); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkSampleCountFlagBits { type Output = VkSampleCountFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkSampleCountFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkSampleCountFlagBits { type Output = VkSampleCountFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkSampleCountFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkSampleCountFlagBits { type Output = VkSampleCountFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkSampleCountFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkSampleCountFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkSampleCountFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkSampleCountFlagBits::K_1_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_1_BIT")?; } if self.contains(VkSampleCountFlagBits::K_2_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_2_BIT")?; } if self.contains(VkSampleCountFlagBits::K_4_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_4_BIT")?; } if self.contains(VkSampleCountFlagBits::K_8_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_8_BIT")?; } if self.contains(VkSampleCountFlagBits::K_16_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_16_BIT")?; } if self.contains(VkSampleCountFlagBits::K_32_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_32_BIT")?; } if self.contains(VkSampleCountFlagBits::K_64_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("K_64_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkAttachmentDescriptionFlagBits(VkFlags); impl VkAttachmentDescriptionFlagBits { pub const MAY_ALIAS_BIT: VkAttachmentDescriptionFlagBits = VkAttachmentDescriptionFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkAttachmentDescriptionFlagBits { type Output = VkAttachmentDescriptionFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkAttachmentDescriptionFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkAttachmentDescriptionFlagBits { type Output = VkAttachmentDescriptionFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkAttachmentDescriptionFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkAttachmentDescriptionFlagBits { type Output = VkAttachmentDescriptionFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkAttachmentDescriptionFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkAttachmentDescriptionFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkAttachmentDescriptionFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkAttachmentDescriptionFlagBits::MAY_ALIAS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("MAY_ALIAS_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkDescriptorPoolCreateFlagBits(VkFlags); impl VkDescriptorPoolCreateFlagBits { pub const FREE_DESCRIPTOR_SET_BIT: VkDescriptorPoolCreateFlagBits = VkDescriptorPoolCreateFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkDescriptorPoolCreateFlagBits { type Output = VkDescriptorPoolCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkDescriptorPoolCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkDescriptorPoolCreateFlagBits { type Output = VkDescriptorPoolCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkDescriptorPoolCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkDescriptorPoolCreateFlagBits { type Output = VkDescriptorPoolCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkDescriptorPoolCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkDescriptorPoolCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkDescriptorPoolCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkDescriptorPoolCreateFlagBits::FREE_DESCRIPTOR_SET_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FREE_DESCRIPTOR_SET_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkDescriptorSetLayoutCreateFlagBits(VkFlags); impl VkDescriptorSetLayoutCreateFlagBits { #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkDescriptorSetLayoutCreateFlagBits { type Output = VkDescriptorSetLayoutCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkDescriptorSetLayoutCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkDescriptorSetLayoutCreateFlagBits { type Output = VkDescriptorSetLayoutCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkDescriptorSetLayoutCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkDescriptorSetLayoutCreateFlagBits { type Output = VkDescriptorSetLayoutCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkDescriptorSetLayoutCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkDescriptorSetLayoutCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkDescriptorSetLayoutCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkSamplerCreateFlagBits(VkFlags); impl VkSamplerCreateFlagBits { #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkSamplerCreateFlagBits { type Output = VkSamplerCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkSamplerCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkSamplerCreateFlagBits { type Output = VkSamplerCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkSamplerCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkSamplerCreateFlagBits { type Output = VkSamplerCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkSamplerCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkSamplerCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkSamplerCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkPipelineCreateFlagBits(VkFlags); impl VkPipelineCreateFlagBits { pub const DISABLE_OPTIMIZATION_BIT: VkPipelineCreateFlagBits = VkPipelineCreateFlagBits(1); pub const ALLOW_DERIVATIVES_BIT: VkPipelineCreateFlagBits = VkPipelineCreateFlagBits(2); pub const DERIVATIVE_BIT: VkPipelineCreateFlagBits = VkPipelineCreateFlagBits(4); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkPipelineCreateFlagBits { type Output = VkPipelineCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkPipelineCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkPipelineCreateFlagBits { type Output = VkPipelineCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkPipelineCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkPipelineCreateFlagBits { type Output = VkPipelineCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkPipelineCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkPipelineCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkPipelineCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkPipelineCreateFlagBits::DISABLE_OPTIMIZATION_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DISABLE_OPTIMIZATION_BIT")?; } if self.contains(VkPipelineCreateFlagBits::ALLOW_DERIVATIVES_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ALLOW_DERIVATIVES_BIT")?; } if self.contains(VkPipelineCreateFlagBits::DERIVATIVE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DERIVATIVE_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkColorComponentFlagBits(VkFlags); impl VkColorComponentFlagBits { pub const R_BIT: VkColorComponentFlagBits = VkColorComponentFlagBits(1); pub const G_BIT: VkColorComponentFlagBits = VkColorComponentFlagBits(2); pub const B_BIT: VkColorComponentFlagBits = VkColorComponentFlagBits(4); pub const A_BIT: VkColorComponentFlagBits = VkColorComponentFlagBits(8); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkColorComponentFlagBits { type Output = VkColorComponentFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkColorComponentFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkColorComponentFlagBits { type Output = VkColorComponentFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkColorComponentFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkColorComponentFlagBits { type Output = VkColorComponentFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkColorComponentFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkColorComponentFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkColorComponentFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkColorComponentFlagBits::R_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("R_BIT")?; } if self.contains(VkColorComponentFlagBits::G_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("G_BIT")?; } if self.contains(VkColorComponentFlagBits::B_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("B_BIT")?; } if self.contains(VkColorComponentFlagBits::A_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("A_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkCullModeFlagBits(VkFlags); impl VkCullModeFlagBits { pub const NONE: VkCullModeFlagBits = VkCullModeFlagBits(0); pub const FRONT_BIT: VkCullModeFlagBits = VkCullModeFlagBits(1); pub const BACK_BIT: VkCullModeFlagBits = VkCullModeFlagBits(2); pub const FRONT_AND_BACK: VkCullModeFlagBits = VkCullModeFlagBits(3); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkCullModeFlagBits { type Output = VkCullModeFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkCullModeFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkCullModeFlagBits { type Output = VkCullModeFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkCullModeFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkCullModeFlagBits { type Output = VkCullModeFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkCullModeFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkCullModeFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkCullModeFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkCullModeFlagBits::NONE) { if !first { f.write_str(" | ")?; } first = false; f.write_str("NONE")?; } if self.contains(VkCullModeFlagBits::FRONT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FRONT_BIT")?; } if self.contains(VkCullModeFlagBits::BACK_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("BACK_BIT")?; } if self.contains(VkCullModeFlagBits::FRONT_AND_BACK) { if !first { f.write_str(" | ")?; } first = false; f.write_str("FRONT_AND_BACK")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkImageViewCreateFlagBits(VkFlags); impl VkImageViewCreateFlagBits { #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkImageViewCreateFlagBits { type Output = VkImageViewCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkImageViewCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkImageViewCreateFlagBits { type Output = VkImageViewCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkImageViewCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkImageViewCreateFlagBits { type Output = VkImageViewCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkImageViewCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkImageViewCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkImageViewCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkImageCreateFlagBits(VkFlags); impl VkImageCreateFlagBits { pub const SPARSE_BINDING_BIT: VkImageCreateFlagBits = VkImageCreateFlagBits(1); pub const SPARSE_RESIDENCY_BIT: VkImageCreateFlagBits = VkImageCreateFlagBits(2); pub const SPARSE_ALIASED_BIT: VkImageCreateFlagBits = VkImageCreateFlagBits(4); pub const MUTABLE_FORMAT_BIT: VkImageCreateFlagBits = VkImageCreateFlagBits(8); pub const CUBE_COMPATIBLE_BIT: VkImageCreateFlagBits = VkImageCreateFlagBits(16); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkImageCreateFlagBits { type Output = VkImageCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkImageCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkImageCreateFlagBits { type Output = VkImageCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkImageCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkImageCreateFlagBits { type Output = VkImageCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkImageCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkImageCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkImageCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkImageCreateFlagBits::SPARSE_BINDING_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SPARSE_BINDING_BIT")?; } if self.contains(VkImageCreateFlagBits::SPARSE_RESIDENCY_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SPARSE_RESIDENCY_BIT")?; } if self.contains(VkImageCreateFlagBits::SPARSE_ALIASED_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SPARSE_ALIASED_BIT")?; } if self.contains(VkImageCreateFlagBits::MUTABLE_FORMAT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("MUTABLE_FORMAT_BIT")?; } if self.contains(VkImageCreateFlagBits::CUBE_COMPATIBLE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("CUBE_COMPATIBLE_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkBufferUsageFlagBits(VkFlags); impl VkBufferUsageFlagBits { pub const TRANSFER_SRC_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(1); pub const TRANSFER_DST_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(2); pub const UNIFORM_TEXEL_BUFFER_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(4); pub const STORAGE_TEXEL_BUFFER_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(8); pub const UNIFORM_BUFFER_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(16); pub const STORAGE_BUFFER_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(32); pub const INDEX_BUFFER_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(64); pub const VERTEX_BUFFER_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(128); pub const INDIRECT_BUFFER_BIT: VkBufferUsageFlagBits = VkBufferUsageFlagBits(256); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkBufferUsageFlagBits { type Output = VkBufferUsageFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkBufferUsageFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkBufferUsageFlagBits { type Output = VkBufferUsageFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkBufferUsageFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkBufferUsageFlagBits { type Output = VkBufferUsageFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkBufferUsageFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkBufferUsageFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkBufferUsageFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkBufferUsageFlagBits::TRANSFER_SRC_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_SRC_BIT")?; } if self.contains(VkBufferUsageFlagBits::TRANSFER_DST_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_DST_BIT")?; } if self.contains(VkBufferUsageFlagBits::UNIFORM_TEXEL_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("UNIFORM_TEXEL_BUFFER_BIT")?; } if self.contains(VkBufferUsageFlagBits::STORAGE_TEXEL_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STORAGE_TEXEL_BUFFER_BIT")?; } if self.contains(VkBufferUsageFlagBits::UNIFORM_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("UNIFORM_BUFFER_BIT")?; } if self.contains(VkBufferUsageFlagBits::STORAGE_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STORAGE_BUFFER_BIT")?; } if self.contains(VkBufferUsageFlagBits::INDEX_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INDEX_BUFFER_BIT")?; } if self.contains(VkBufferUsageFlagBits::VERTEX_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERTEX_BUFFER_BIT")?; } if self.contains(VkBufferUsageFlagBits::INDIRECT_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("INDIRECT_BUFFER_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkBufferCreateFlagBits(VkFlags); impl VkBufferCreateFlagBits { pub const SPARSE_BINDING_BIT: VkBufferCreateFlagBits = VkBufferCreateFlagBits(1); pub const SPARSE_RESIDENCY_BIT: VkBufferCreateFlagBits = VkBufferCreateFlagBits(2); pub const SPARSE_ALIASED_BIT: VkBufferCreateFlagBits = VkBufferCreateFlagBits(4); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkBufferCreateFlagBits { type Output = VkBufferCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkBufferCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkBufferCreateFlagBits { type Output = VkBufferCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkBufferCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkBufferCreateFlagBits { type Output = VkBufferCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkBufferCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkBufferCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkBufferCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkBufferCreateFlagBits::SPARSE_BINDING_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SPARSE_BINDING_BIT")?; } if self.contains(VkBufferCreateFlagBits::SPARSE_RESIDENCY_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SPARSE_RESIDENCY_BIT")?; } if self.contains(VkBufferCreateFlagBits::SPARSE_ALIASED_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SPARSE_ALIASED_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkFenceCreateFlagBits(VkFlags); impl VkFenceCreateFlagBits { pub const SIGNALED_BIT: VkFenceCreateFlagBits = VkFenceCreateFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkFenceCreateFlagBits { type Output = VkFenceCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkFenceCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkFenceCreateFlagBits { type Output = VkFenceCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkFenceCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkFenceCreateFlagBits { type Output = VkFenceCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkFenceCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkFenceCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkFenceCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkFenceCreateFlagBits::SIGNALED_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SIGNALED_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkSparseMemoryBindFlagBits(VkFlags); impl VkSparseMemoryBindFlagBits { pub const METADATA_BIT: VkSparseMemoryBindFlagBits = VkSparseMemoryBindFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkSparseMemoryBindFlagBits { type Output = VkSparseMemoryBindFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkSparseMemoryBindFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkSparseMemoryBindFlagBits { type Output = VkSparseMemoryBindFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkSparseMemoryBindFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkSparseMemoryBindFlagBits { type Output = VkSparseMemoryBindFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkSparseMemoryBindFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkSparseMemoryBindFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkSparseMemoryBindFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkSparseMemoryBindFlagBits::METADATA_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("METADATA_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkSparseImageFormatFlagBits(VkFlags); impl VkSparseImageFormatFlagBits { pub const SINGLE_MIPTAIL_BIT: VkSparseImageFormatFlagBits = VkSparseImageFormatFlagBits(1); pub const ALIGNED_MIP_SIZE_BIT: VkSparseImageFormatFlagBits = VkSparseImageFormatFlagBits(2); pub const NONSTANDARD_BLOCK_SIZE_BIT: VkSparseImageFormatFlagBits = VkSparseImageFormatFlagBits(4); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkSparseImageFormatFlagBits { type Output = VkSparseImageFormatFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkSparseImageFormatFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkSparseImageFormatFlagBits { type Output = VkSparseImageFormatFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkSparseImageFormatFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkSparseImageFormatFlagBits { type Output = VkSparseImageFormatFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkSparseImageFormatFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkSparseImageFormatFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkSparseImageFormatFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkSparseImageFormatFlagBits::SINGLE_MIPTAIL_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SINGLE_MIPTAIL_BIT")?; } if self.contains(VkSparseImageFormatFlagBits::ALIGNED_MIP_SIZE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("ALIGNED_MIP_SIZE_BIT")?; } if self.contains(VkSparseImageFormatFlagBits::NONSTANDARD_BLOCK_SIZE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("NONSTANDARD_BLOCK_SIZE_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkDeviceQueueCreateFlagBits(VkFlags); impl VkDeviceQueueCreateFlagBits { #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkDeviceQueueCreateFlagBits { type Output = VkDeviceQueueCreateFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkDeviceQueueCreateFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkDeviceQueueCreateFlagBits { type Output = VkDeviceQueueCreateFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkDeviceQueueCreateFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkDeviceQueueCreateFlagBits { type Output = VkDeviceQueueCreateFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkDeviceQueueCreateFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkDeviceQueueCreateFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkDeviceQueueCreateFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkMemoryHeapFlagBits(VkFlags); impl VkMemoryHeapFlagBits { pub const DEVICE_LOCAL_BIT: VkMemoryHeapFlagBits = VkMemoryHeapFlagBits(1); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkMemoryHeapFlagBits { type Output = VkMemoryHeapFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkMemoryHeapFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkMemoryHeapFlagBits { type Output = VkMemoryHeapFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkMemoryHeapFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkMemoryHeapFlagBits { type Output = VkMemoryHeapFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkMemoryHeapFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkMemoryHeapFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkMemoryHeapFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkMemoryHeapFlagBits::DEVICE_LOCAL_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DEVICE_LOCAL_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkMemoryPropertyFlagBits(VkFlags); impl VkMemoryPropertyFlagBits { pub const DEVICE_LOCAL_BIT: VkMemoryPropertyFlagBits = VkMemoryPropertyFlagBits(1); pub const HOST_VISIBLE_BIT: VkMemoryPropertyFlagBits = VkMemoryPropertyFlagBits(2); pub const HOST_COHERENT_BIT: VkMemoryPropertyFlagBits = VkMemoryPropertyFlagBits(4); pub const HOST_CACHED_BIT: VkMemoryPropertyFlagBits = VkMemoryPropertyFlagBits(8); pub const LAZILY_ALLOCATED_BIT: VkMemoryPropertyFlagBits = VkMemoryPropertyFlagBits(16); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkMemoryPropertyFlagBits { type Output = VkMemoryPropertyFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkMemoryPropertyFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkMemoryPropertyFlagBits { type Output = VkMemoryPropertyFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkMemoryPropertyFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkMemoryPropertyFlagBits { type Output = VkMemoryPropertyFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkMemoryPropertyFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkMemoryPropertyFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkMemoryPropertyFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkMemoryPropertyFlagBits::DEVICE_LOCAL_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DEVICE_LOCAL_BIT")?; } if self.contains(VkMemoryPropertyFlagBits::HOST_VISIBLE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HOST_VISIBLE_BIT")?; } if self.contains(VkMemoryPropertyFlagBits::HOST_COHERENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HOST_COHERENT_BIT")?; } if self.contains(VkMemoryPropertyFlagBits::HOST_CACHED_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("HOST_CACHED_BIT")?; } if self.contains(VkMemoryPropertyFlagBits::LAZILY_ALLOCATED_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("LAZILY_ALLOCATED_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkQueueFlagBits(VkFlags); impl VkQueueFlagBits { pub const GRAPHICS_BIT: VkQueueFlagBits = VkQueueFlagBits(1); pub const COMPUTE_BIT: VkQueueFlagBits = VkQueueFlagBits(2); pub const TRANSFER_BIT: VkQueueFlagBits = VkQueueFlagBits(4); pub const SPARSE_BINDING_BIT: VkQueueFlagBits = VkQueueFlagBits(8); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkQueueFlagBits { type Output = VkQueueFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkQueueFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkQueueFlagBits { type Output = VkQueueFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkQueueFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkQueueFlagBits { type Output = VkQueueFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkQueueFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkQueueFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkQueueFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkQueueFlagBits::GRAPHICS_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("GRAPHICS_BIT")?; } if self.contains(VkQueueFlagBits::COMPUTE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COMPUTE_BIT")?; } if self.contains(VkQueueFlagBits::TRANSFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("TRANSFER_BIT")?; } if self.contains(VkQueueFlagBits::SPARSE_BINDING_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SPARSE_BINDING_BIT")?; } return f.write_str(")"); } } #[repr(transparent)] #[derive(Default, Copy, Clone, PartialOrd, Ord, PartialEq, Eq, Hash)] pub struct VkFormatFeatureFlagBits(VkFlags); impl VkFormatFeatureFlagBits { pub const SAMPLED_IMAGE_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(1); pub const STORAGE_IMAGE_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(2); pub const STORAGE_IMAGE_ATOMIC_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(4); pub const UNIFORM_TEXEL_BUFFER_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(8); pub const STORAGE_TEXEL_BUFFER_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(16); pub const STORAGE_TEXEL_BUFFER_ATOMIC_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(32); pub const VERTEX_BUFFER_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(64); pub const COLOR_ATTACHMENT_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(128); pub const COLOR_ATTACHMENT_BLEND_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(256); pub const DEPTH_STENCIL_ATTACHMENT_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(512); pub const BLIT_SRC_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(1024); pub const BLIT_DST_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(2048); pub const SAMPLED_IMAGE_FILTER_LINEAR_BIT: VkFormatFeatureFlagBits = VkFormatFeatureFlagBits(4096); #[inline] pub fn contains(&self, other: Self) -> bool { return (self.0 & other.0) == other.0; } } impl core::ops::BitOr for VkFormatFeatureFlagBits { type Output = VkFormatFeatureFlagBits; #[inline] fn bitor(self, rhs: Self) -> Self { Self(self.0 | rhs.0) } } impl core::ops::BitOrAssign for VkFormatFeatureFlagBits { #[inline] fn bitor_assign(&mut self, rhs: Self) { self.0 |= rhs.0; } } impl core::ops::BitAnd for VkFormatFeatureFlagBits { type Output = VkFormatFeatureFlagBits; #[inline] fn bitand(self, rhs: Self) -> Self { Self(self.0 & rhs.0) } } impl core::ops::BitAndAssign for VkFormatFeatureFlagBits { #[inline] fn bitand_assign(&mut self, rhs: Self) { self.0 &= rhs.0; } } impl core::ops::BitXor for VkFormatFeatureFlagBits { type Output = VkFormatFeatureFlagBits; #[inline] fn bitxor(self, rhs: Self) -> Self { Self(self.0 ^ rhs.0) } } impl core::ops::BitXorAssign for VkFormatFeatureFlagBits { #[inline] fn bitxor_assign(&mut self, rhs: Self) { self.0 ^= rhs.0; } } impl core::fmt::Debug for VkFormatFeatureFlagBits { fn fmt(&self, f: &mut core::fmt::Formatter) -> core::fmt::Result { f.write_str("VkFormatFeatureFlagBits(")?; #[allow(unused_mut, unused)] let mut first = true; if self.contains(VkFormatFeatureFlagBits::SAMPLED_IMAGE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SAMPLED_IMAGE_BIT")?; } if self.contains(VkFormatFeatureFlagBits::STORAGE_IMAGE_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STORAGE_IMAGE_BIT")?; } if self.contains(VkFormatFeatureFlagBits::STORAGE_IMAGE_ATOMIC_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STORAGE_IMAGE_ATOMIC_BIT")?; } if self.contains(VkFormatFeatureFlagBits::UNIFORM_TEXEL_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("UNIFORM_TEXEL_BUFFER_BIT")?; } if self.contains(VkFormatFeatureFlagBits::STORAGE_TEXEL_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STORAGE_TEXEL_BUFFER_BIT")?; } if self.contains(VkFormatFeatureFlagBits::STORAGE_TEXEL_BUFFER_ATOMIC_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("STORAGE_TEXEL_BUFFER_ATOMIC_BIT")?; } if self.contains(VkFormatFeatureFlagBits::VERTEX_BUFFER_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("VERTEX_BUFFER_BIT")?; } if self.contains(VkFormatFeatureFlagBits::COLOR_ATTACHMENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COLOR_ATTACHMENT_BIT")?; } if self.contains(VkFormatFeatureFlagBits::COLOR_ATTACHMENT_BLEND_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("COLOR_ATTACHMENT_BLEND_BIT")?; } if self.contains(VkFormatFeatureFlagBits::DEPTH_STENCIL_ATTACHMENT_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("DEPTH_STENCIL_ATTACHMENT_BIT")?; } if self.contains(VkFormatFeatureFlagBits::BLIT_SRC_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("BLIT_SRC_BIT")?; } if self.contains(VkFormatFeatureFlagBits::BLIT_DST_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("BLIT_DST_BIT")?; } if self.contains(VkFormatFeatureFlagBits::SAMPLED_IMAGE_FILTER_LINEAR_BIT) { if !first { f.write_str(" | ")?; } first = false; f.write_str("SAMPLED_IMAGE_FILTER_LINEAR_BIT")?; } return f.write_str(")"); } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkAllocationCallbacks { pub p_user_data: *mut core::ffi::c_void, pub pfn_allocation: Option<PfnVkAllocationFunction>, pub pfn_reallocation: Option<PfnVkReallocationFunction>, pub pfn_free: Option<PfnVkFreeFunction>, pub pfn_internal_allocation: Option<PfnVkInternalAllocationNotification>, pub pfn_internal_free: Option<PfnVkInternalFreeNotification>, } pub trait ExtendsAllocationCallbacks { } impl Default for VkAllocationCallbacks { fn default() -> Self { Self { p_user_data: core::ptr::null_mut(), pfn_allocation: unsafe { core::mem::zeroed() }, pfn_reallocation: unsafe { core::mem::zeroed() }, pfn_free: unsafe { core::mem::zeroed() }, pfn_internal_allocation: unsafe { core::mem::zeroed() }, pfn_internal_free: unsafe { core::mem::zeroed() }, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkWin32SurfaceCreateInfoKHR { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkWin32SurfaceCreateFlagsKHR, pub hinstance: HINSTANCE, pub hwnd: HWND, } pub trait ExtendsWin32SurfaceCreateInfoKHR { } impl Default for VkWin32SurfaceCreateInfoKHR { fn default() -> Self { Self { s_type: VkStructureType::WIN32_SURFACE_CREATE_INFO_KHR, p_next: core::ptr::null(), flags: VkWin32SurfaceCreateFlagsKHR::default(), hinstance: core::ptr::null_mut(), hwnd: core::ptr::null_mut(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSurfaceFormatKHR { pub format: VkFormat, pub color_space: VkColorSpaceKHR, } pub trait ExtendsSurfaceFormatKHR { } impl Default for VkSurfaceFormatKHR { fn default() -> Self { Self { format: VkFormat::default(), color_space: VkColorSpaceKHR::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSurfaceCapabilitiesKHR { pub min_image_count: u32, pub max_image_count: u32, pub current_extent: VkExtent2D, pub min_image_extent: VkExtent2D, pub max_image_extent: VkExtent2D, pub max_image_array_layers: u32, pub supported_transforms: VkSurfaceTransformFlagsKHR, pub current_transform: VkSurfaceTransformFlagBitsKHR, pub supported_composite_alpha: VkCompositeAlphaFlagsKHR, pub supported_usage_flags: VkImageUsageFlags, } pub trait ExtendsSurfaceCapabilitiesKHR { } impl Default for VkSurfaceCapabilitiesKHR { fn default() -> Self { Self { min_image_count: 0, max_image_count: 0, current_extent: VkExtent2D::default(), min_image_extent: VkExtent2D::default(), max_image_extent: VkExtent2D::default(), max_image_array_layers: 0, supported_transforms: VkSurfaceTransformFlagsKHR::default(), current_transform: VkSurfaceTransformFlagBitsKHR::default(), supported_composite_alpha: VkCompositeAlphaFlagsKHR::default(), supported_usage_flags: VkImageUsageFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkExtent2D { pub width: u32, pub height: u32, } pub trait ExtendsExtent2D { } impl Default for VkExtent2D { fn default() -> Self { Self { width: 0, height: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPresentInfoKHR { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub wait_semaphore_count: u32, pub p_wait_semaphores: *const VkSemaphore, pub swapchain_count: u32, pub p_swapchains: *const VkSwapchainKHR, pub p_image_indices: *const u32, pub p_results: *mut VkResult, } pub trait ExtendsPresentInfoKHR { } impl Default for VkPresentInfoKHR { fn default() -> Self { Self { s_type: VkStructureType::PRESENT_INFO_KHR, p_next: core::ptr::null(), wait_semaphore_count: 0, p_wait_semaphores: core::ptr::null(), swapchain_count: 0, p_swapchains: core::ptr::null(), p_image_indices: core::ptr::null(), p_results: core::ptr::null_mut(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSwapchainCreateInfoKHR { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkSwapchainCreateFlagsKHR, pub surface: VkSurfaceKHR, pub min_image_count: u32, pub image_format: VkFormat, pub image_color_space: VkColorSpaceKHR, pub image_extent: VkExtent2D, pub image_array_layers: u32, pub image_usage: VkImageUsageFlags, pub image_sharing_mode: VkSharingMode, pub queue_family_index_count: u32, pub p_queue_family_indices: *const u32, pub pre_transform: VkSurfaceTransformFlagBitsKHR, pub composite_alpha: VkCompositeAlphaFlagBitsKHR, pub present_mode: VkPresentModeKHR, pub clipped: VkBool32, pub old_swapchain: VkSwapchainKHR, } pub trait ExtendsSwapchainCreateInfoKHR { } impl Default for VkSwapchainCreateInfoKHR { fn default() -> Self { Self { s_type: VkStructureType::SWAPCHAIN_CREATE_INFO_KHR, p_next: core::ptr::null(), flags: VkSwapchainCreateFlagsKHR::default(), surface: VkSurfaceKHR::default(), min_image_count: 0, image_format: VkFormat::default(), image_color_space: VkColorSpaceKHR::default(), image_extent: VkExtent2D::default(), image_array_layers: 0, image_usage: VkImageUsageFlags::default(), image_sharing_mode: VkSharingMode::default(), queue_family_index_count: 0, p_queue_family_indices: core::ptr::null(), pre_transform: VkSurfaceTransformFlagBitsKHR::default(), composite_alpha: VkCompositeAlphaFlagBitsKHR::default(), present_mode: VkPresentModeKHR::default(), clipped: VkBool32::default(), old_swapchain: VkSwapchainKHR::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDebugUtilsMessengerCallbackDataEXT { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkDebugUtilsMessengerCallbackDataFlagsEXT, pub p_message_id_name: *const u8, pub message_id_number: i32, pub p_message: *const u8, pub queue_label_count: u32, pub p_queue_labels: *const VkDebugUtilsLabelEXT, pub cmd_buf_label_count: u32, pub p_cmd_buf_labels: *const VkDebugUtilsLabelEXT, pub object_count: u32, pub p_objects: *const VkDebugUtilsObjectNameInfoEXT, } pub trait ExtendsDebugUtilsMessengerCallbackDataEXT { } impl Default for VkDebugUtilsMessengerCallbackDataEXT { fn default() -> Self { Self { s_type: VkStructureType::DEBUG_UTILS_MESSENGER_CALLBACK_DATA_EXT, p_next: core::ptr::null(), flags: VkDebugUtilsMessengerCallbackDataFlagsEXT::default(), p_message_id_name: core::ptr::null(), message_id_number: 0, p_message: core::ptr::null(), queue_label_count: 0, p_queue_labels: core::ptr::null(), cmd_buf_label_count: 0, p_cmd_buf_labels: core::ptr::null(), object_count: 0, p_objects: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDebugUtilsObjectNameInfoEXT { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub object_type: VkObjectType, pub object_handle: u64, pub p_object_name: *const u8, } pub trait ExtendsDebugUtilsObjectNameInfoEXT { } impl Default for VkDebugUtilsObjectNameInfoEXT { fn default() -> Self { Self { s_type: VkStructureType::DEBUG_UTILS_OBJECT_NAME_INFO_EXT, p_next: core::ptr::null(), object_type: VkObjectType::default(), object_handle: 0, p_object_name: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDebugUtilsLabelEXT { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub p_label_name: *const u8, pub color: [f32; 4], } pub trait ExtendsDebugUtilsLabelEXT { } impl Default for VkDebugUtilsLabelEXT { fn default() -> Self { Self { s_type: VkStructureType::DEBUG_UTILS_LABEL_EXT, p_next: core::ptr::null(), p_label_name: core::ptr::null(), color: [0.0, 0.0, 0.0, 0.0], } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDebugUtilsMessengerCreateInfoEXT { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkDebugUtilsMessengerCreateFlagsEXT, pub message_severity: VkDebugUtilsMessageSeverityFlagsEXT, pub message_type: VkDebugUtilsMessageTypeFlagsEXT, pub pfn_user_callback: Option<PfnVkDebugUtilsMessengerCallbackEXT>, pub p_user_data: *mut core::ffi::c_void, } pub trait ExtendsDebugUtilsMessengerCreateInfoEXT { } impl ExtendsInstanceCreateInfo for VkDebugUtilsMessengerCreateInfoEXT {} impl Default for VkDebugUtilsMessengerCreateInfoEXT { fn default() -> Self { Self { s_type: VkStructureType::DEBUG_UTILS_MESSENGER_CREATE_INFO_EXT, p_next: core::ptr::null(), flags: VkDebugUtilsMessengerCreateFlagsEXT::default(), message_severity: VkDebugUtilsMessageSeverityFlagsEXT::default(), message_type: VkDebugUtilsMessageTypeFlagsEXT::default(), pfn_user_callback: unsafe { core::mem::zeroed() }, p_user_data: core::ptr::null_mut(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDebugUtilsObjectTagInfoEXT { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub object_type: VkObjectType, pub object_handle: u64, pub tag_name: u64, pub tag_size: usize, pub p_tag: *const core::ffi::c_void, } pub trait ExtendsDebugUtilsObjectTagInfoEXT { } impl Default for VkDebugUtilsObjectTagInfoEXT { fn default() -> Self { Self { s_type: VkStructureType::DEBUG_UTILS_OBJECT_TAG_INFO_EXT, p_next: core::ptr::null(), object_type: VkObjectType::default(), object_handle: 0, tag_name: 0, tag_size: 0, p_tag: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBaseInStructure { pub s_type: VkStructureType, pub p_next: *const VkBaseInStructure, } pub trait ExtendsBaseInStructure { } impl Default for VkBaseInStructure { fn default() -> Self { Self { s_type: VkStructureType::default(), p_next: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBaseOutStructure { pub s_type: VkStructureType, pub p_next: *mut VkBaseOutStructure, } pub trait ExtendsBaseOutStructure { } impl Default for VkBaseOutStructure { fn default() -> Self { Self { s_type: VkStructureType::default(), p_next: core::ptr::null_mut(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkMemoryBarrier { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub src_access_mask: VkAccessFlags, pub dst_access_mask: VkAccessFlags, } pub trait ExtendsMemoryBarrier { } impl Default for VkMemoryBarrier { fn default() -> Self { Self { s_type: VkStructureType::MEMORY_BARRIER, p_next: core::ptr::null(), src_access_mask: VkAccessFlags::default(), dst_access_mask: VkAccessFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageMemoryBarrier { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub src_access_mask: VkAccessFlags, pub dst_access_mask: VkAccessFlags, pub old_layout: VkImageLayout, pub new_layout: VkImageLayout, pub src_queue_family_index: u32, pub dst_queue_family_index: u32, pub image: VkImage, pub subresource_range: VkImageSubresourceRange, } pub trait ExtendsImageMemoryBarrier { } impl Default for VkImageMemoryBarrier { fn default() -> Self { Self { s_type: VkStructureType::IMAGE_MEMORY_BARRIER, p_next: core::ptr::null(), src_access_mask: VkAccessFlags::default(), dst_access_mask: VkAccessFlags::default(), old_layout: VkImageLayout::default(), new_layout: VkImageLayout::default(), src_queue_family_index: 0, dst_queue_family_index: 0, image: VkImage::default(), subresource_range: VkImageSubresourceRange::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageSubresourceRange { pub aspect_mask: VkImageAspectFlags, pub base_mip_level: u32, pub level_count: u32, pub base_array_layer: u32, pub layer_count: u32, } pub trait ExtendsImageSubresourceRange { } impl Default for VkImageSubresourceRange { fn default() -> Self { Self { aspect_mask: VkImageAspectFlags::default(), base_mip_level: 0, level_count: 0, base_array_layer: 0, layer_count: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDrawIndirectCommand { pub vertex_count: u32, pub instance_count: u32, pub first_vertex: u32, pub first_instance: u32, } pub trait ExtendsDrawIndirectCommand { } impl Default for VkDrawIndirectCommand { fn default() -> Self { Self { vertex_count: 0, instance_count: 0, first_vertex: 0, first_instance: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDrawIndexedIndirectCommand { pub index_count: u32, pub instance_count: u32, pub first_index: u32, pub vertex_offset: i32, pub first_instance: u32, } pub trait ExtendsDrawIndexedIndirectCommand { } impl Default for VkDrawIndexedIndirectCommand { fn default() -> Self { Self { index_count: 0, instance_count: 0, first_index: 0, vertex_offset: 0, first_instance: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDispatchIndirectCommand { pub x: u32, pub y: u32, pub z: u32, } pub trait ExtendsDispatchIndirectCommand { } impl Default for VkDispatchIndirectCommand { fn default() -> Self { Self { x: 0, y: 0, z: 0 } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBufferMemoryBarrier { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub src_access_mask: VkAccessFlags, pub dst_access_mask: VkAccessFlags, pub src_queue_family_index: u32, pub dst_queue_family_index: u32, pub buffer: VkBuffer, pub offset: VkDeviceSize, pub size: VkDeviceSize, } pub trait ExtendsBufferMemoryBarrier { } impl Default for VkBufferMemoryBarrier { fn default() -> Self { Self { s_type: VkStructureType::BUFFER_MEMORY_BARRIER, p_next: core::ptr::null(), src_access_mask: VkAccessFlags::default(), dst_access_mask: VkAccessFlags::default(), src_queue_family_index: 0, dst_queue_family_index: 0, buffer: VkBuffer::default(), offset: VkDeviceSize::default(), size: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkRenderPassBeginInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub render_pass: VkRenderPass, pub framebuffer: VkFramebuffer, pub render_area: VkRect2D, pub clear_value_count: u32, pub p_clear_values: *const VkClearValue, } pub trait ExtendsRenderPassBeginInfo { } impl Default for VkRenderPassBeginInfo { fn default() -> Self { Self { s_type: VkStructureType::RENDER_PASS_BEGIN_INFO, p_next: core::ptr::null(), render_pass: VkRenderPass::default(), framebuffer: VkFramebuffer::default(), render_area: VkRect2D::default(), clear_value_count: 0, p_clear_values: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkClearDepthStencilValue { pub depth: f32, pub stencil: u32, } pub trait ExtendsClearDepthStencilValue { } impl Default for VkClearDepthStencilValue { fn default() -> Self { Self { depth: 0.0, stencil: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkRect2D { pub offset: VkOffset2D, pub extent: VkExtent2D, } pub trait ExtendsRect2D { } impl Default for VkRect2D { fn default() -> Self { Self { offset: VkOffset2D::default(), extent: VkExtent2D::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkOffset2D { pub x: i32, pub y: i32, } pub trait ExtendsOffset2D { } impl Default for VkOffset2D { fn default() -> Self { Self { x: 0, y: 0 } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageResolve { pub src_subresource: VkImageSubresourceLayers, pub src_offset: VkOffset3D, pub dst_subresource: VkImageSubresourceLayers, pub dst_offset: VkOffset3D, pub extent: VkExtent3D, } pub trait ExtendsImageResolve { } impl Default for VkImageResolve { fn default() -> Self { Self { src_subresource: VkImageSubresourceLayers::default(), src_offset: VkOffset3D::default(), dst_subresource: VkImageSubresourceLayers::default(), dst_offset: VkOffset3D::default(), extent: VkExtent3D::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkExtent3D { pub width: u32, pub height: u32, pub depth: u32, } pub trait ExtendsExtent3D { } impl Default for VkExtent3D { fn default() -> Self { Self { width: 0, height: 0, depth: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkOffset3D { pub x: i32, pub y: i32, pub z: i32, } pub trait ExtendsOffset3D { } impl Default for VkOffset3D { fn default() -> Self { Self { x: 0, y: 0, z: 0 } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageSubresourceLayers { pub aspect_mask: VkImageAspectFlags, pub mip_level: u32, pub base_array_layer: u32, pub layer_count: u32, } pub trait ExtendsImageSubresourceLayers { } impl Default for VkImageSubresourceLayers { fn default() -> Self { Self { aspect_mask: VkImageAspectFlags::default(), mip_level: 0, base_array_layer: 0, layer_count: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkClearRect { pub rect: VkRect2D, pub base_array_layer: u32, pub layer_count: u32, } pub trait ExtendsClearRect { } impl Default for VkClearRect { fn default() -> Self { Self { rect: VkRect2D::default(), base_array_layer: 0, layer_count: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkClearAttachment { pub aspect_mask: VkImageAspectFlags, pub color_attachment: u32, pub clear_value: VkClearValue, } pub trait ExtendsClearAttachment { } impl Default for VkClearAttachment { fn default() -> Self { Self { aspect_mask: VkImageAspectFlags::default(), color_attachment: 0, clear_value: VkClearValue::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBufferImageCopy { pub buffer_offset: VkDeviceSize, pub buffer_row_length: u32, pub buffer_image_height: u32, pub image_subresource: VkImageSubresourceLayers, pub image_offset: VkOffset3D, pub image_extent: VkExtent3D, } pub trait ExtendsBufferImageCopy { } impl Default for VkBufferImageCopy { fn default() -> Self { Self { buffer_offset: VkDeviceSize::default(), buffer_row_length: 0, buffer_image_height: 0, image_subresource: VkImageSubresourceLayers::default(), image_offset: VkOffset3D::default(), image_extent: VkExtent3D::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageBlit { pub src_subresource: VkImageSubresourceLayers, pub src_offsets: [VkOffset3D; 2], pub dst_subresource: VkImageSubresourceLayers, pub dst_offsets: [VkOffset3D; 2], } pub trait ExtendsImageBlit { } impl Default for VkImageBlit { fn default() -> Self { Self { src_subresource: VkImageSubresourceLayers::default(), src_offsets: [VkOffset3D::default(), VkOffset3D::default()], dst_subresource: VkImageSubresourceLayers::default(), dst_offsets: [VkOffset3D::default(), VkOffset3D::default()], } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageCopy { pub src_subresource: VkImageSubresourceLayers, pub src_offset: VkOffset3D, pub dst_subresource: VkImageSubresourceLayers, pub dst_offset: VkOffset3D, pub extent: VkExtent3D, } pub trait ExtendsImageCopy { } impl Default for VkImageCopy { fn default() -> Self { Self { src_subresource: VkImageSubresourceLayers::default(), src_offset: VkOffset3D::default(), dst_subresource: VkImageSubresourceLayers::default(), dst_offset: VkOffset3D::default(), extent: VkExtent3D::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBufferCopy { pub src_offset: VkDeviceSize, pub dst_offset: VkDeviceSize, pub size: VkDeviceSize, } pub trait ExtendsBufferCopy { } impl Default for VkBufferCopy { fn default() -> Self { Self { src_offset: VkDeviceSize::default(), dst_offset: VkDeviceSize::default(), size: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkViewport { pub x: f32, pub y: f32, pub width: f32, pub height: f32, pub min_depth: f32, pub max_depth: f32, } pub trait ExtendsViewport { } impl Default for VkViewport { fn default() -> Self { Self { x: 0.0, y: 0.0, width: 0.0, height: 0.0, min_depth: 0.0, max_depth: 0.0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkCommandBufferBeginInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkCommandBufferUsageFlags, pub p_inheritance_info: *const VkCommandBufferInheritanceInfo, } pub trait ExtendsCommandBufferBeginInfo { } impl Default for VkCommandBufferBeginInfo { fn default() -> Self { Self { s_type: VkStructureType::COMMAND_BUFFER_BEGIN_INFO, p_next: core::ptr::null(), flags: VkCommandBufferUsageFlags::default(), p_inheritance_info: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkCommandBufferInheritanceInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub render_pass: VkRenderPass, pub subpass: u32, pub framebuffer: VkFramebuffer, pub occlusion_query_enable: VkBool32, pub query_flags: VkQueryControlFlags, pub pipeline_statistics: VkQueryPipelineStatisticFlags, } pub trait ExtendsCommandBufferInheritanceInfo { } impl Default for VkCommandBufferInheritanceInfo { fn default() -> Self { Self { s_type: VkStructureType::COMMAND_BUFFER_INHERITANCE_INFO, p_next: core::ptr::null(), render_pass: VkRenderPass::default(), subpass: 0, framebuffer: VkFramebuffer::default(), occlusion_query_enable: VkBool32::default(), query_flags: VkQueryControlFlags::default(), pipeline_statistics: VkQueryPipelineStatisticFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkCommandBufferAllocateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub command_pool: VkCommandPool, pub level: VkCommandBufferLevel, pub command_buffer_count: u32, } pub trait ExtendsCommandBufferAllocateInfo { } impl Default for VkCommandBufferAllocateInfo { fn default() -> Self { Self { s_type: VkStructureType::COMMAND_BUFFER_ALLOCATE_INFO, p_next: core::ptr::null(), command_pool: VkCommandPool::default(), level: VkCommandBufferLevel::default(), command_buffer_count: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkCommandPoolCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkCommandPoolCreateFlags, pub queue_family_index: u32, } pub trait ExtendsCommandPoolCreateInfo { } impl Default for VkCommandPoolCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::COMMAND_POOL_CREATE_INFO, p_next: core::ptr::null(), flags: VkCommandPoolCreateFlags::default(), queue_family_index: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkRenderPassCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkRenderPassCreateFlags, pub attachment_count: u32, pub p_attachments: *const VkAttachmentDescription, pub subpass_count: u32, pub p_subpasses: *const VkSubpassDescription, pub dependency_count: u32, pub p_dependencies: *const VkSubpassDependency, } pub trait ExtendsRenderPassCreateInfo { } impl Default for VkRenderPassCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::RENDER_PASS_CREATE_INFO, p_next: core::ptr::null(), flags: VkRenderPassCreateFlags::default(), attachment_count: 0, p_attachments: core::ptr::null(), subpass_count: 0, p_subpasses: core::ptr::null(), dependency_count: 0, p_dependencies: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSubpassDependency { pub src_subpass: u32, pub dst_subpass: u32, pub src_stage_mask: VkPipelineStageFlags, pub dst_stage_mask: VkPipelineStageFlags, pub src_access_mask: VkAccessFlags, pub dst_access_mask: VkAccessFlags, pub dependency_flags: VkDependencyFlags, } pub trait ExtendsSubpassDependency { } impl Default for VkSubpassDependency { fn default() -> Self { Self { src_subpass: 0, dst_subpass: 0, src_stage_mask: VkPipelineStageFlags::default(), dst_stage_mask: VkPipelineStageFlags::default(), src_access_mask: VkAccessFlags::default(), dst_access_mask: VkAccessFlags::default(), dependency_flags: VkDependencyFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSubpassDescription { pub flags: VkSubpassDescriptionFlags, pub pipeline_bind_point: VkPipelineBindPoint, pub input_attachment_count: u32, pub p_input_attachments: *const VkAttachmentReference, pub color_attachment_count: u32, pub p_color_attachments: *const VkAttachmentReference, pub p_resolve_attachments: *const VkAttachmentReference, pub p_depth_stencil_attachment: *const VkAttachmentReference, pub preserve_attachment_count: u32, pub p_preserve_attachments: *const u32, } pub trait ExtendsSubpassDescription { } impl Default for VkSubpassDescription { fn default() -> Self { Self { flags: VkSubpassDescriptionFlags::default(), pipeline_bind_point: VkPipelineBindPoint::default(), input_attachment_count: 0, p_input_attachments: core::ptr::null(), color_attachment_count: 0, p_color_attachments: core::ptr::null(), p_resolve_attachments: core::ptr::null(), p_depth_stencil_attachment: core::ptr::null(), preserve_attachment_count: 0, p_preserve_attachments: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkAttachmentReference { pub attachment: u32, pub layout: VkImageLayout, } pub trait ExtendsAttachmentReference { } impl Default for VkAttachmentReference { fn default() -> Self { Self { attachment: 0, layout: VkImageLayout::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkAttachmentDescription { pub flags: VkAttachmentDescriptionFlags, pub format: VkFormat, pub samples: VkSampleCountFlagBits, pub load_op: VkAttachmentLoadOp, pub store_op: VkAttachmentStoreOp, pub stencil_load_op: VkAttachmentLoadOp, pub stencil_store_op: VkAttachmentStoreOp, pub initial_layout: VkImageLayout, pub final_layout: VkImageLayout, } pub trait ExtendsAttachmentDescription { } impl Default for VkAttachmentDescription { fn default() -> Self { Self { flags: VkAttachmentDescriptionFlags::default(), format: VkFormat::default(), samples: VkSampleCountFlagBits::default(), load_op: VkAttachmentLoadOp::default(), store_op: VkAttachmentStoreOp::default(), stencil_load_op: VkAttachmentLoadOp::default(), stencil_store_op: VkAttachmentStoreOp::default(), initial_layout: VkImageLayout::default(), final_layout: VkImageLayout::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkFramebufferCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkFramebufferCreateFlags, pub render_pass: VkRenderPass, pub attachment_count: u32, pub p_attachments: *const VkImageView, pub width: u32, pub height: u32, pub layers: u32, } pub trait ExtendsFramebufferCreateInfo { } impl Default for VkFramebufferCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::FRAMEBUFFER_CREATE_INFO, p_next: core::ptr::null(), flags: VkFramebufferCreateFlags::default(), render_pass: VkRenderPass::default(), attachment_count: 0, p_attachments: core::ptr::null(), width: 0, height: 0, layers: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkCopyDescriptorSet { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub src_set: VkDescriptorSet, pub src_binding: u32, pub src_array_element: u32, pub dst_set: VkDescriptorSet, pub dst_binding: u32, pub dst_array_element: u32, pub descriptor_count: u32, } pub trait ExtendsCopyDescriptorSet { } impl Default for VkCopyDescriptorSet { fn default() -> Self { Self { s_type: VkStructureType::COPY_DESCRIPTOR_SET, p_next: core::ptr::null(), src_set: VkDescriptorSet::default(), src_binding: 0, src_array_element: 0, dst_set: VkDescriptorSet::default(), dst_binding: 0, dst_array_element: 0, descriptor_count: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkWriteDescriptorSet { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub dst_set: VkDescriptorSet, pub dst_binding: u32, pub dst_array_element: u32, pub descriptor_count: u32, pub descriptor_type: VkDescriptorType, pub p_image_info: *const VkDescriptorImageInfo, pub p_buffer_info: *const VkDescriptorBufferInfo, pub p_texel_buffer_view: *const VkBufferView, } pub trait ExtendsWriteDescriptorSet { } impl Default for VkWriteDescriptorSet { fn default() -> Self { Self { s_type: VkStructureType::WRITE_DESCRIPTOR_SET, p_next: core::ptr::null(), dst_set: VkDescriptorSet::default(), dst_binding: 0, dst_array_element: 0, descriptor_count: 0, descriptor_type: VkDescriptorType::default(), p_image_info: core::ptr::null(), p_buffer_info: core::ptr::null(), p_texel_buffer_view: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDescriptorBufferInfo { pub buffer: VkBuffer, pub offset: VkDeviceSize, pub range: VkDeviceSize, } pub trait ExtendsDescriptorBufferInfo { } impl Default for VkDescriptorBufferInfo { fn default() -> Self { Self { buffer: VkBuffer::default(), offset: VkDeviceSize::default(), range: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDescriptorImageInfo { pub sampler: VkSampler, pub image_view: VkImageView, pub image_layout: VkImageLayout, } pub trait ExtendsDescriptorImageInfo { } impl Default for VkDescriptorImageInfo { fn default() -> Self { Self { sampler: VkSampler::default(), image_view: VkImageView::default(), image_layout: VkImageLayout::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDescriptorSetAllocateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub descriptor_pool: VkDescriptorPool, pub descriptor_set_count: u32, pub p_set_layouts: *const VkDescriptorSetLayout, } pub trait ExtendsDescriptorSetAllocateInfo { } impl Default for VkDescriptorSetAllocateInfo { fn default() -> Self { Self { s_type: VkStructureType::DESCRIPTOR_SET_ALLOCATE_INFO, p_next: core::ptr::null(), descriptor_pool: VkDescriptorPool::default(), descriptor_set_count: 0, p_set_layouts: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDescriptorPoolCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkDescriptorPoolCreateFlags, pub max_sets: u32, pub pool_size_count: u32, pub p_pool_sizes: *const VkDescriptorPoolSize, } pub trait ExtendsDescriptorPoolCreateInfo { } impl Default for VkDescriptorPoolCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::DESCRIPTOR_POOL_CREATE_INFO, p_next: core::ptr::null(), flags: VkDescriptorPoolCreateFlags::default(), max_sets: 0, pool_size_count: 0, p_pool_sizes: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDescriptorPoolSize { pub kind: VkDescriptorType, pub descriptor_count: u32, } pub trait ExtendsDescriptorPoolSize { } impl Default for VkDescriptorPoolSize { fn default() -> Self { Self { kind: VkDescriptorType::default(), descriptor_count: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDescriptorSetLayoutCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkDescriptorSetLayoutCreateFlags, pub binding_count: u32, pub p_bindings: *const VkDescriptorSetLayoutBinding, } pub trait ExtendsDescriptorSetLayoutCreateInfo { } impl Default for VkDescriptorSetLayoutCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::DESCRIPTOR_SET_LAYOUT_CREATE_INFO, p_next: core::ptr::null(), flags: VkDescriptorSetLayoutCreateFlags::default(), binding_count: 0, p_bindings: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDescriptorSetLayoutBinding { pub binding: u32, pub descriptor_type: VkDescriptorType, pub descriptor_count: u32, pub stage_flags: VkShaderStageFlags, pub p_immutable_samplers: *const VkSampler, } pub trait ExtendsDescriptorSetLayoutBinding { } impl Default for VkDescriptorSetLayoutBinding { fn default() -> Self { Self { binding: 0, descriptor_type: VkDescriptorType::default(), descriptor_count: 0, stage_flags: VkShaderStageFlags::default(), p_immutable_samplers: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSamplerCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkSamplerCreateFlags, pub mag_filter: VkFilter, pub min_filter: VkFilter, pub mipmap_mode: VkSamplerMipmapMode, pub address_mode_u: VkSamplerAddressMode, pub address_mode_v: VkSamplerAddressMode, pub address_mode_w: VkSamplerAddressMode, pub mip_lod_bias: f32, pub anisotropy_enable: VkBool32, pub max_anisotropy: f32, pub compare_enable: VkBool32, pub compare_op: VkCompareOp, pub min_lod: f32, pub max_lod: f32, pub border_color: VkBorderColor, pub unnormalized_coordinates: VkBool32, } pub trait ExtendsSamplerCreateInfo { } impl Default for VkSamplerCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::SAMPLER_CREATE_INFO, p_next: core::ptr::null(), flags: VkSamplerCreateFlags::default(), mag_filter: VkFilter::default(), min_filter: VkFilter::default(), mipmap_mode: VkSamplerMipmapMode::default(), address_mode_u: VkSamplerAddressMode::default(), address_mode_v: VkSamplerAddressMode::default(), address_mode_w: VkSamplerAddressMode::default(), mip_lod_bias: 0.0, anisotropy_enable: VkBool32::default(), max_anisotropy: 0.0, compare_enable: VkBool32::default(), compare_op: VkCompareOp::default(), min_lod: 0.0, max_lod: 0.0, border_color: VkBorderColor::default(), unnormalized_coordinates: VkBool32::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineLayoutCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineLayoutCreateFlags, pub set_layout_count: u32, pub p_set_layouts: *const VkDescriptorSetLayout, pub push_constant_range_count: u32, pub p_push_constant_ranges: *const VkPushConstantRange, } pub trait ExtendsPipelineLayoutCreateInfo { } impl Default for VkPipelineLayoutCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_LAYOUT_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineLayoutCreateFlags::default(), set_layout_count: 0, p_set_layouts: core::ptr::null(), push_constant_range_count: 0, p_push_constant_ranges: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPushConstantRange { pub stage_flags: VkShaderStageFlags, pub offset: u32, pub size: u32, } pub trait ExtendsPushConstantRange { } impl Default for VkPushConstantRange { fn default() -> Self { Self { stage_flags: VkShaderStageFlags::default(), offset: 0, size: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkComputePipelineCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineCreateFlags, pub stage: VkPipelineShaderStageCreateInfo, pub layout: VkPipelineLayout, pub base_pipeline_handle: VkPipeline, pub base_pipeline_index: i32, } pub trait ExtendsComputePipelineCreateInfo { } impl Default for VkComputePipelineCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::COMPUTE_PIPELINE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineCreateFlags::default(), stage: VkPipelineShaderStageCreateInfo::default(), layout: VkPipelineLayout::default(), base_pipeline_handle: VkPipeline::default(), base_pipeline_index: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineShaderStageCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineShaderStageCreateFlags, pub stage: VkShaderStageFlagBits, pub module: VkShaderModule, pub p_name: *const u8, pub p_specialization_info: *const VkSpecializationInfo, } pub trait ExtendsPipelineShaderStageCreateInfo { } impl Default for VkPipelineShaderStageCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_SHADER_STAGE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineShaderStageCreateFlags::default(), stage: VkShaderStageFlagBits::default(), module: VkShaderModule::default(), p_name: core::ptr::null(), p_specialization_info: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSpecializationInfo { pub map_entry_count: u32, pub p_map_entries: *const VkSpecializationMapEntry, pub data_size: usize, pub p_data: *const core::ffi::c_void, } pub trait ExtendsSpecializationInfo { } impl Default for VkSpecializationInfo { fn default() -> Self { Self { map_entry_count: 0, p_map_entries: core::ptr::null(), data_size: 0, p_data: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSpecializationMapEntry { pub ant_id: u32, pub offset: u32, pub size: usize, } pub trait ExtendsSpecializationMapEntry { } impl Default for VkSpecializationMapEntry { fn default() -> Self { Self { ant_id: 0, offset: 0, size: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkGraphicsPipelineCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineCreateFlags, pub stage_count: u32, pub p_stages: *const VkPipelineShaderStageCreateInfo, pub p_vertex_input_state: *const VkPipelineVertexInputStateCreateInfo, pub p_input_assembly_state: *const VkPipelineInputAssemblyStateCreateInfo, pub p_tessellation_state: *const VkPipelineTessellationStateCreateInfo, pub p_viewport_state: *const VkPipelineViewportStateCreateInfo, pub p_rasterization_state: *const VkPipelineRasterizationStateCreateInfo, pub p_multisample_state: *const VkPipelineMultisampleStateCreateInfo, pub p_depth_stencil_state: *const VkPipelineDepthStencilStateCreateInfo, pub p_color_blend_state: *const VkPipelineColorBlendStateCreateInfo, pub p_dynamic_state: *const VkPipelineDynamicStateCreateInfo, pub layout: VkPipelineLayout, pub render_pass: VkRenderPass, pub subpass: u32, pub base_pipeline_handle: VkPipeline, pub base_pipeline_index: i32, } pub trait ExtendsGraphicsPipelineCreateInfo { } impl Default for VkGraphicsPipelineCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::GRAPHICS_PIPELINE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineCreateFlags::default(), stage_count: 0, p_stages: core::ptr::null(), p_vertex_input_state: core::ptr::null(), p_input_assembly_state: core::ptr::null(), p_tessellation_state: core::ptr::null(), p_viewport_state: core::ptr::null(), p_rasterization_state: core::ptr::null(), p_multisample_state: core::ptr::null(), p_depth_stencil_state: core::ptr::null(), p_color_blend_state: core::ptr::null(), p_dynamic_state: core::ptr::null(), layout: VkPipelineLayout::default(), render_pass: VkRenderPass::default(), subpass: 0, base_pipeline_handle: VkPipeline::default(), base_pipeline_index: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineDynamicStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineDynamicStateCreateFlags, pub dynamic_state_count: u32, pub p_dynamic_states: *const VkDynamicState, } pub trait ExtendsPipelineDynamicStateCreateInfo { } impl Default for VkPipelineDynamicStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_DYNAMIC_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineDynamicStateCreateFlags::default(), dynamic_state_count: 0, p_dynamic_states: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineColorBlendStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineColorBlendStateCreateFlags, pub logic_op_enable: VkBool32, pub logic_op: VkLogicOp, pub attachment_count: u32, pub p_attachments: *const VkPipelineColorBlendAttachmentState, pub blend_constants: [f32; 4], } pub trait ExtendsPipelineColorBlendStateCreateInfo { } impl Default for VkPipelineColorBlendStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_COLOR_BLEND_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineColorBlendStateCreateFlags::default(), logic_op_enable: VkBool32::default(), logic_op: VkLogicOp::default(), attachment_count: 0, p_attachments: core::ptr::null(), blend_constants: [0.0, 0.0, 0.0, 0.0], } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineColorBlendAttachmentState { pub blend_enable: VkBool32, pub src_color_blend_factor: VkBlendFactor, pub dst_color_blend_factor: VkBlendFactor, pub color_blend_op: VkBlendOp, pub src_alpha_blend_factor: VkBlendFactor, pub dst_alpha_blend_factor: VkBlendFactor, pub alpha_blend_op: VkBlendOp, pub color_write_mask: VkColorComponentFlags, } pub trait ExtendsPipelineColorBlendAttachmentState { } impl Default for VkPipelineColorBlendAttachmentState { fn default() -> Self { Self { blend_enable: VkBool32::default(), src_color_blend_factor: VkBlendFactor::default(), dst_color_blend_factor: VkBlendFactor::default(), color_blend_op: VkBlendOp::default(), src_alpha_blend_factor: VkBlendFactor::default(), dst_alpha_blend_factor: VkBlendFactor::default(), alpha_blend_op: VkBlendOp::default(), color_write_mask: VkColorComponentFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineDepthStencilStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineDepthStencilStateCreateFlags, pub depth_test_enable: VkBool32, pub depth_write_enable: VkBool32, pub depth_compare_op: VkCompareOp, pub depth_bounds_test_enable: VkBool32, pub stencil_test_enable: VkBool32, pub front: VkStencilOpState, pub back: VkStencilOpState, pub min_depth_bounds: f32, pub max_depth_bounds: f32, } pub trait ExtendsPipelineDepthStencilStateCreateInfo { } impl Default for VkPipelineDepthStencilStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_DEPTH_STENCIL_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineDepthStencilStateCreateFlags::default(), depth_test_enable: VkBool32::default(), depth_write_enable: VkBool32::default(), depth_compare_op: VkCompareOp::default(), depth_bounds_test_enable: VkBool32::default(), stencil_test_enable: VkBool32::default(), front: VkStencilOpState::default(), back: VkStencilOpState::default(), min_depth_bounds: 0.0, max_depth_bounds: 0.0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkStencilOpState { pub fail_op: VkStencilOp, pub pass_op: VkStencilOp, pub depth_fail_op: VkStencilOp, pub compare_op: VkCompareOp, pub compare_mask: u32, pub write_mask: u32, pub reference: u32, } pub trait ExtendsStencilOpState { } impl Default for VkStencilOpState { fn default() -> Self { Self { fail_op: VkStencilOp::default(), pass_op: VkStencilOp::default(), depth_fail_op: VkStencilOp::default(), compare_op: VkCompareOp::default(), compare_mask: 0, write_mask: 0, reference: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineMultisampleStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineMultisampleStateCreateFlags, pub rasterization_samples: VkSampleCountFlagBits, pub sample_shading_enable: VkBool32, pub min_sample_shading: f32, pub p_sample_mask: *const VkSampleMask, pub alpha_to_coverage_enable: VkBool32, pub alpha_to_one_enable: VkBool32, } pub trait ExtendsPipelineMultisampleStateCreateInfo { } impl Default for VkPipelineMultisampleStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_MULTISAMPLE_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineMultisampleStateCreateFlags::default(), rasterization_samples: VkSampleCountFlagBits::default(), sample_shading_enable: VkBool32::default(), min_sample_shading: 0.0, p_sample_mask: core::ptr::null(), alpha_to_coverage_enable: VkBool32::default(), alpha_to_one_enable: VkBool32::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineRasterizationStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineRasterizationStateCreateFlags, pub depth_clamp_enable: VkBool32, pub rasterizer_discard_enable: VkBool32, pub polygon_mode: VkPolygonMode, pub cull_mode: VkCullModeFlags, pub front_face: VkFrontFace, pub depth_bias_enable: VkBool32, pub depth_bias_constant_factor: f32, pub depth_bias_clamp: f32, pub depth_bias_slope_factor: f32, pub line_width: f32, } pub trait ExtendsPipelineRasterizationStateCreateInfo { } impl Default for VkPipelineRasterizationStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_RASTERIZATION_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineRasterizationStateCreateFlags::default(), depth_clamp_enable: VkBool32::default(), rasterizer_discard_enable: VkBool32::default(), polygon_mode: VkPolygonMode::default(), cull_mode: VkCullModeFlags::default(), front_face: VkFrontFace::default(), depth_bias_enable: VkBool32::default(), depth_bias_constant_factor: 0.0, depth_bias_clamp: 0.0, depth_bias_slope_factor: 0.0, line_width: 0.0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineViewportStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineViewportStateCreateFlags, pub viewport_count: u32, pub p_viewports: *const VkViewport, pub scissor_count: u32, pub p_scissors: *const VkRect2D, } pub trait ExtendsPipelineViewportStateCreateInfo { } impl Default for VkPipelineViewportStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_VIEWPORT_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineViewportStateCreateFlags::default(), viewport_count: 0, p_viewports: core::ptr::null(), scissor_count: 0, p_scissors: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineTessellationStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineTessellationStateCreateFlags, pub patch_control_points: u32, } pub trait ExtendsPipelineTessellationStateCreateInfo { } impl Default for VkPipelineTessellationStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_TESSELLATION_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineTessellationStateCreateFlags::default(), patch_control_points: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineInputAssemblyStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineInputAssemblyStateCreateFlags, pub topology: VkPrimitiveTopology, pub primitive_restart_enable: VkBool32, } pub trait ExtendsPipelineInputAssemblyStateCreateInfo { } impl Default for VkPipelineInputAssemblyStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_INPUT_ASSEMBLY_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineInputAssemblyStateCreateFlags::default(), topology: VkPrimitiveTopology::default(), primitive_restart_enable: VkBool32::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineVertexInputStateCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineVertexInputStateCreateFlags, pub vertex_binding_description_count: u32, pub p_vertex_binding_descriptions: *const VkVertexInputBindingDescription, pub vertex_attribute_description_count: u32, pub p_vertex_attribute_descriptions: *const VkVertexInputAttributeDescription, } pub trait ExtendsPipelineVertexInputStateCreateInfo { } impl Default for VkPipelineVertexInputStateCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_VERTEX_INPUT_STATE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineVertexInputStateCreateFlags::default(), vertex_binding_description_count: 0, p_vertex_binding_descriptions: core::ptr::null(), vertex_attribute_description_count: 0, p_vertex_attribute_descriptions: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkVertexInputAttributeDescription { pub location: u32, pub binding: u32, pub format: VkFormat, pub offset: u32, } pub trait ExtendsVertexInputAttributeDescription { } impl Default for VkVertexInputAttributeDescription { fn default() -> Self { Self { location: 0, binding: 0, format: VkFormat::default(), offset: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkVertexInputBindingDescription { pub binding: u32, pub stride: u32, pub input_rate: VkVertexInputRate, } pub trait ExtendsVertexInputBindingDescription { } impl Default for VkVertexInputBindingDescription { fn default() -> Self { Self { binding: 0, stride: 0, input_rate: VkVertexInputRate::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPipelineCacheCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkPipelineCacheCreateFlags, pub initial_data_size: usize, pub p_initial_data: *const core::ffi::c_void, } pub trait ExtendsPipelineCacheCreateInfo { } impl Default for VkPipelineCacheCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::PIPELINE_CACHE_CREATE_INFO, p_next: core::ptr::null(), flags: VkPipelineCacheCreateFlags::default(), initial_data_size: 0, p_initial_data: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkShaderModuleCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkShaderModuleCreateFlags, pub code_size: usize, pub p_code: *const u32, } pub trait ExtendsShaderModuleCreateInfo { } impl Default for VkShaderModuleCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::SHADER_MODULE_CREATE_INFO, p_next: core::ptr::null(), flags: VkShaderModuleCreateFlags::default(), code_size: 0, p_code: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageViewCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkImageViewCreateFlags, pub image: VkImage, pub view_type: VkImageViewType, pub format: VkFormat, pub components: VkComponentMapping, pub subresource_range: VkImageSubresourceRange, } pub trait ExtendsImageViewCreateInfo { } impl Default for VkImageViewCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::IMAGE_VIEW_CREATE_INFO, p_next: core::ptr::null(), flags: VkImageViewCreateFlags::default(), image: VkImage::default(), view_type: VkImageViewType::default(), format: VkFormat::default(), components: VkComponentMapping::default(), subresource_range: VkImageSubresourceRange::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkComponentMapping { pub r: VkComponentSwizzle, pub g: VkComponentSwizzle, pub b: VkComponentSwizzle, pub a: VkComponentSwizzle, } pub trait ExtendsComponentMapping { } impl Default for VkComponentMapping { fn default() -> Self { Self { r: VkComponentSwizzle::default(), g: VkComponentSwizzle::default(), b: VkComponentSwizzle::default(), a: VkComponentSwizzle::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSubresourceLayout { pub offset: VkDeviceSize, pub size: VkDeviceSize, pub row_pitch: VkDeviceSize, pub array_pitch: VkDeviceSize, pub depth_pitch: VkDeviceSize, } pub trait ExtendsSubresourceLayout { } impl Default for VkSubresourceLayout { fn default() -> Self { Self { offset: VkDeviceSize::default(), size: VkDeviceSize::default(), row_pitch: VkDeviceSize::default(), array_pitch: VkDeviceSize::default(), depth_pitch: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageSubresource { pub aspect_mask: VkImageAspectFlags, pub mip_level: u32, pub array_layer: u32, } pub trait ExtendsImageSubresource { } impl Default for VkImageSubresource { fn default() -> Self { Self { aspect_mask: VkImageAspectFlags::default(), mip_level: 0, array_layer: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkImageCreateFlags, pub image_type: VkImageType, pub format: VkFormat, pub extent: VkExtent3D, pub mip_levels: u32, pub array_layers: u32, pub samples: VkSampleCountFlagBits, pub tiling: VkImageTiling, pub usage: VkImageUsageFlags, pub sharing_mode: VkSharingMode, pub queue_family_index_count: u32, pub p_queue_family_indices: *const u32, pub initial_layout: VkImageLayout, } pub trait ExtendsImageCreateInfo { } impl Default for VkImageCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::IMAGE_CREATE_INFO, p_next: core::ptr::null(), flags: VkImageCreateFlags::default(), image_type: VkImageType::default(), format: VkFormat::default(), extent: VkExtent3D::default(), mip_levels: 0, array_layers: 0, samples: VkSampleCountFlagBits::default(), tiling: VkImageTiling::default(), usage: VkImageUsageFlags::default(), sharing_mode: VkSharingMode::default(), queue_family_index_count: 0, p_queue_family_indices: core::ptr::null(), initial_layout: VkImageLayout::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBufferViewCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkBufferViewCreateFlags, pub buffer: VkBuffer, pub format: VkFormat, pub offset: VkDeviceSize, pub range: VkDeviceSize, } pub trait ExtendsBufferViewCreateInfo { } impl Default for VkBufferViewCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::BUFFER_VIEW_CREATE_INFO, p_next: core::ptr::null(), flags: VkBufferViewCreateFlags::default(), buffer: VkBuffer::default(), format: VkFormat::default(), offset: VkDeviceSize::default(), range: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBufferCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkBufferCreateFlags, pub size: VkDeviceSize, pub usage: VkBufferUsageFlags, pub sharing_mode: VkSharingMode, pub queue_family_index_count: u32, pub p_queue_family_indices: *const u32, } pub trait ExtendsBufferCreateInfo { } impl Default for VkBufferCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::BUFFER_CREATE_INFO, p_next: core::ptr::null(), flags: VkBufferCreateFlags::default(), size: VkDeviceSize::default(), usage: VkBufferUsageFlags::default(), sharing_mode: VkSharingMode::default(), queue_family_index_count: 0, p_queue_family_indices: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkQueryPoolCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkQueryPoolCreateFlags, pub query_type: VkQueryType, pub query_count: u32, pub pipeline_statistics: VkQueryPipelineStatisticFlags, } pub trait ExtendsQueryPoolCreateInfo { } impl Default for VkQueryPoolCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::QUERY_POOL_CREATE_INFO, p_next: core::ptr::null(), flags: VkQueryPoolCreateFlags::default(), query_type: VkQueryType::default(), query_count: 0, pipeline_statistics: VkQueryPipelineStatisticFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkEventCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkEventCreateFlags, } pub trait ExtendsEventCreateInfo { } impl Default for VkEventCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::EVENT_CREATE_INFO, p_next: core::ptr::null(), flags: VkEventCreateFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSemaphoreCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkSemaphoreCreateFlags, } pub trait ExtendsSemaphoreCreateInfo { } impl Default for VkSemaphoreCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::SEMAPHORE_CREATE_INFO, p_next: core::ptr::null(), flags: VkSemaphoreCreateFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkFenceCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkFenceCreateFlags, } pub trait ExtendsFenceCreateInfo { } impl Default for VkFenceCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::FENCE_CREATE_INFO, p_next: core::ptr::null(), flags: VkFenceCreateFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkBindSparseInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub wait_semaphore_count: u32, pub p_wait_semaphores: *const VkSemaphore, pub buffer_bind_count: u32, pub p_buffer_binds: *const VkSparseBufferMemoryBindInfo, pub image_opaque_bind_count: u32, pub p_image_opaque_binds: *const VkSparseImageOpaqueMemoryBindInfo, pub image_bind_count: u32, pub p_image_binds: *const VkSparseImageMemoryBindInfo, pub signal_semaphore_count: u32, pub p_signal_semaphores: *const VkSemaphore, } pub trait ExtendsBindSparseInfo { } impl Default for VkBindSparseInfo { fn default() -> Self { Self { s_type: VkStructureType::BIND_SPARSE_INFO, p_next: core::ptr::null(), wait_semaphore_count: 0, p_wait_semaphores: core::ptr::null(), buffer_bind_count: 0, p_buffer_binds: core::ptr::null(), image_opaque_bind_count: 0, p_image_opaque_binds: core::ptr::null(), image_bind_count: 0, p_image_binds: core::ptr::null(), signal_semaphore_count: 0, p_signal_semaphores: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSparseImageMemoryBindInfo { pub image: VkImage, pub bind_count: u32, pub p_binds: *const VkSparseImageMemoryBind, } pub trait ExtendsSparseImageMemoryBindInfo { } impl Default for VkSparseImageMemoryBindInfo { fn default() -> Self { Self { image: VkImage::default(), bind_count: 0, p_binds: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSparseImageMemoryBind { pub subresource: VkImageSubresource, pub offset: VkOffset3D, pub extent: VkExtent3D, pub memory: VkDeviceMemory, pub memory_offset: VkDeviceSize, pub flags: VkSparseMemoryBindFlags, } pub trait ExtendsSparseImageMemoryBind { } impl Default for VkSparseImageMemoryBind { fn default() -> Self { Self { subresource: VkImageSubresource::default(), offset: VkOffset3D::default(), extent: VkExtent3D::default(), memory: VkDeviceMemory::default(), memory_offset: VkDeviceSize::default(), flags: VkSparseMemoryBindFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSparseImageOpaqueMemoryBindInfo { pub image: VkImage, pub bind_count: u32, pub p_binds: *const VkSparseMemoryBind, } pub trait ExtendsSparseImageOpaqueMemoryBindInfo { } impl Default for VkSparseImageOpaqueMemoryBindInfo { fn default() -> Self { Self { image: VkImage::default(), bind_count: 0, p_binds: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSparseMemoryBind { pub resource_offset: VkDeviceSize, pub size: VkDeviceSize, pub memory: VkDeviceMemory, pub memory_offset: VkDeviceSize, pub flags: VkSparseMemoryBindFlags, } pub trait ExtendsSparseMemoryBind { } impl Default for VkSparseMemoryBind { fn default() -> Self { Self { resource_offset: VkDeviceSize::default(), size: VkDeviceSize::default(), memory: VkDeviceMemory::default(), memory_offset: VkDeviceSize::default(), flags: VkSparseMemoryBindFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSparseBufferMemoryBindInfo { pub buffer: VkBuffer, pub bind_count: u32, pub p_binds: *const VkSparseMemoryBind, } pub trait ExtendsSparseBufferMemoryBindInfo { } impl Default for VkSparseBufferMemoryBindInfo { fn default() -> Self { Self { buffer: VkBuffer::default(), bind_count: 0, p_binds: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSparseImageFormatProperties { pub aspect_mask: VkImageAspectFlags, pub image_granularity: VkExtent3D, pub flags: VkSparseImageFormatFlags, } pub trait ExtendsSparseImageFormatProperties { } impl Default for VkSparseImageFormatProperties { fn default() -> Self { Self { aspect_mask: VkImageAspectFlags::default(), image_granularity: VkExtent3D::default(), flags: VkSparseImageFormatFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSparseImageMemoryRequirements { pub format_properties: VkSparseImageFormatProperties, pub image_mip_tail_first_lod: u32, pub image_mip_tail_size: VkDeviceSize, pub image_mip_tail_offset: VkDeviceSize, pub image_mip_tail_stride: VkDeviceSize, } pub trait ExtendsSparseImageMemoryRequirements { } impl Default for VkSparseImageMemoryRequirements { fn default() -> Self { Self { format_properties: VkSparseImageFormatProperties::default(), image_mip_tail_first_lod: 0, image_mip_tail_size: VkDeviceSize::default(), image_mip_tail_offset: VkDeviceSize::default(), image_mip_tail_stride: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkMemoryRequirements { pub size: VkDeviceSize, pub alignment: VkDeviceSize, pub memory_type_bits: u32, } pub trait ExtendsMemoryRequirements { } impl Default for VkMemoryRequirements { fn default() -> Self { Self { size: VkDeviceSize::default(), alignment: VkDeviceSize::default(), memory_type_bits: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkMappedMemoryRange { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub memory: VkDeviceMemory, pub offset: VkDeviceSize, pub size: VkDeviceSize, } pub trait ExtendsMappedMemoryRange { } impl Default for VkMappedMemoryRange { fn default() -> Self { Self { s_type: VkStructureType::MAPPED_MEMORY_RANGE, p_next: core::ptr::null(), memory: VkDeviceMemory::default(), offset: VkDeviceSize::default(), size: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkMemoryAllocateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub allocation_size: VkDeviceSize, pub memory_type_index: u32, } pub trait ExtendsMemoryAllocateInfo { } impl Default for VkMemoryAllocateInfo { fn default() -> Self { Self { s_type: VkStructureType::MEMORY_ALLOCATE_INFO, p_next: core::ptr::null(), allocation_size: VkDeviceSize::default(), memory_type_index: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkSubmitInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub wait_semaphore_count: u32, pub p_wait_semaphores: *const VkSemaphore, pub p_wait_dst_stage_mask: *const VkPipelineStageFlags, pub command_buffer_count: u32, pub p_command_buffers: *const VkCommandBuffer, pub signal_semaphore_count: u32, pub p_signal_semaphores: *const VkSemaphore, } pub trait ExtendsSubmitInfo { } impl Default for VkSubmitInfo { fn default() -> Self { Self { s_type: VkStructureType::SUBMIT_INFO, p_next: core::ptr::null(), wait_semaphore_count: 0, p_wait_semaphores: core::ptr::null(), p_wait_dst_stage_mask: core::ptr::null(), command_buffer_count: 0, p_command_buffers: core::ptr::null(), signal_semaphore_count: 0, p_signal_semaphores: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkLayerProperties { pub layer_name: [u8; 256], pub spec_version: u32, pub implementation_version: u32, pub description: [u8; 256], } pub trait ExtendsLayerProperties { } impl Default for VkLayerProperties { fn default() -> Self { Self { layer_name: [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ], spec_version: 0, implementation_version: 0, description: [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ], } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkExtensionProperties { pub extension_name: [u8; 256], pub spec_version: u32, } pub trait ExtendsExtensionProperties { } impl Default for VkExtensionProperties { fn default() -> Self { Self { extension_name: [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ], spec_version: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDeviceCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkDeviceCreateFlags, pub queue_create_info_count: u32, pub p_queue_create_infos: *const VkDeviceQueueCreateInfo, pub enabled_layer_count: u32, pub pp_enabled_layer_names: *const *const u8, pub enabled_extension_count: u32, pub pp_enabled_extension_names: *const *const u8, pub p_enabled_features: *const VkPhysicalDeviceFeatures, } pub trait ExtendsDeviceCreateInfo { } impl Default for VkDeviceCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::DEVICE_CREATE_INFO, p_next: core::ptr::null(), flags: VkDeviceCreateFlags::default(), queue_create_info_count: 0, p_queue_create_infos: core::ptr::null(), enabled_layer_count: 0, pp_enabled_layer_names: core::ptr::null(), enabled_extension_count: 0, pp_enabled_extension_names: core::ptr::null(), p_enabled_features: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPhysicalDeviceFeatures { pub robust_buffer_access: VkBool32, pub full_draw_index_uint_32: VkBool32, pub image_cube_array: VkBool32, pub independent_blend: VkBool32, pub geometry_shader: VkBool32, pub tessellation_shader: VkBool32, pub sample_rate_shading: VkBool32, pub dual_src_blend: VkBool32, pub logic_op: VkBool32, pub multi_draw_indirect: VkBool32, pub draw_indirect_first_instance: VkBool32, pub depth_clamp: VkBool32, pub depth_bias_clamp: VkBool32, pub fill_mode_non_solid: VkBool32, pub depth_bounds: VkBool32, pub wide_lines: VkBool32, pub large_points: VkBool32, pub alpha_to_one: VkBool32, pub multi_viewport: VkBool32, pub sampler_anisotropy: VkBool32, pub texture_compression_etc_2: VkBool32, pub texture_compression_astc_ldr: VkBool32, pub texture_compression_bc: VkBool32, pub occlusion_query_precise: VkBool32, pub pipeline_statistics_query: VkBool32, pub vertex_pipeline_stores_and_atomics: VkBool32, pub fragment_stores_and_atomics: VkBool32, pub shader_tessellation_and_geometry_point_size: VkBool32, pub shader_image_gather_extended: VkBool32, pub shader_storage_image_extended_formats: VkBool32, pub shader_storage_image_multisample: VkBool32, pub shader_storage_image_read_without_format: VkBool32, pub shader_storage_image_write_without_format: VkBool32, pub shader_uniform_buffer_array_dynamic_indexing: VkBool32, pub shader_sampled_image_array_dynamic_indexing: VkBool32, pub shader_storage_buffer_array_dynamic_indexing: VkBool32, pub shader_storage_image_array_dynamic_indexing: VkBool32, pub shader_clip_distance: VkBool32, pub shader_cull_distance: VkBool32, pub shader_float_64: VkBool32, pub shader_int_64: VkBool32, pub shader_int_16: VkBool32, pub shader_resource_residency: VkBool32, pub shader_resource_min_lod: VkBool32, pub sparse_binding: VkBool32, pub sparse_residency_buffer: VkBool32, pub sparse_residency_image_2_d: VkBool32, pub sparse_residency_image_3_d: VkBool32, pub sparse_residency_2_samples: VkBool32, pub sparse_residency_4_samples: VkBool32, pub sparse_residency_8_samples: VkBool32, pub sparse_residency_16_samples: VkBool32, pub sparse_residency_aliased: VkBool32, pub variable_multisample_rate: VkBool32, pub inherited_queries: VkBool32, } pub trait ExtendsPhysicalDeviceFeatures { } impl Default for VkPhysicalDeviceFeatures { fn default() -> Self { Self { robust_buffer_access: VkBool32::default(), full_draw_index_uint_32: VkBool32::default(), image_cube_array: VkBool32::default(), independent_blend: VkBool32::default(), geometry_shader: VkBool32::default(), tessellation_shader: VkBool32::default(), sample_rate_shading: VkBool32::default(), dual_src_blend: VkBool32::default(), logic_op: VkBool32::default(), multi_draw_indirect: VkBool32::default(), draw_indirect_first_instance: VkBool32::default(), depth_clamp: VkBool32::default(), depth_bias_clamp: VkBool32::default(), fill_mode_non_solid: VkBool32::default(), depth_bounds: VkBool32::default(), wide_lines: VkBool32::default(), large_points: VkBool32::default(), alpha_to_one: VkBool32::default(), multi_viewport: VkBool32::default(), sampler_anisotropy: VkBool32::default(), texture_compression_etc_2: VkBool32::default(), texture_compression_astc_ldr: VkBool32::default(), texture_compression_bc: VkBool32::default(), occlusion_query_precise: VkBool32::default(), pipeline_statistics_query: VkBool32::default(), vertex_pipeline_stores_and_atomics: VkBool32::default(), fragment_stores_and_atomics: VkBool32::default(), shader_tessellation_and_geometry_point_size: VkBool32::default(), shader_image_gather_extended: VkBool32::default(), shader_storage_image_extended_formats: VkBool32::default(), shader_storage_image_multisample: VkBool32::default(), shader_storage_image_read_without_format: VkBool32::default(), shader_storage_image_write_without_format: VkBool32::default(), shader_uniform_buffer_array_dynamic_indexing: VkBool32::default(), shader_sampled_image_array_dynamic_indexing: VkBool32::default(), shader_storage_buffer_array_dynamic_indexing: VkBool32::default(), shader_storage_image_array_dynamic_indexing: VkBool32::default(), shader_clip_distance: VkBool32::default(), shader_cull_distance: VkBool32::default(), shader_float_64: VkBool32::default(), shader_int_64: VkBool32::default(), shader_int_16: VkBool32::default(), shader_resource_residency: VkBool32::default(), shader_resource_min_lod: VkBool32::default(), sparse_binding: VkBool32::default(), sparse_residency_buffer: VkBool32::default(), sparse_residency_image_2_d: VkBool32::default(), sparse_residency_image_3_d: VkBool32::default(), sparse_residency_2_samples: VkBool32::default(), sparse_residency_4_samples: VkBool32::default(), sparse_residency_8_samples: VkBool32::default(), sparse_residency_16_samples: VkBool32::default(), sparse_residency_aliased: VkBool32::default(), variable_multisample_rate: VkBool32::default(), inherited_queries: VkBool32::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkDeviceQueueCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkDeviceQueueCreateFlags, pub queue_family_index: u32, pub queue_count: u32, pub p_queue_priorities: *const f32, } pub trait ExtendsDeviceQueueCreateInfo { } impl Default for VkDeviceQueueCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::DEVICE_QUEUE_CREATE_INFO, p_next: core::ptr::null(), flags: VkDeviceQueueCreateFlags::default(), queue_family_index: 0, queue_count: 0, p_queue_priorities: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPhysicalDeviceMemoryProperties { pub memory_type_count: u32, pub memory_types: [VkMemoryType; 32], pub memory_heap_count: u32, pub memory_heaps: [VkMemoryHeap; 16], } pub trait ExtendsPhysicalDeviceMemoryProperties { } impl Default for VkPhysicalDeviceMemoryProperties { fn default() -> Self { Self { memory_type_count: 0, memory_types: [ VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), VkMemoryType::default(), ], memory_heap_count: 0, memory_heaps: [ VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), VkMemoryHeap::default(), ], } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkMemoryHeap { pub size: VkDeviceSize, pub flags: VkMemoryHeapFlags, } pub trait ExtendsMemoryHeap { } impl Default for VkMemoryHeap { fn default() -> Self { Self { size: VkDeviceSize::default(), flags: VkMemoryHeapFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkMemoryType { pub property_flags: VkMemoryPropertyFlags, pub heap_index: u32, } pub trait ExtendsMemoryType { } impl Default for VkMemoryType { fn default() -> Self { Self { property_flags: VkMemoryPropertyFlags::default(), heap_index: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkQueueFamilyProperties { pub queue_flags: VkQueueFlags, pub queue_count: u32, pub timestamp_valid_bits: u32, pub min_image_transfer_granularity: VkExtent3D, } pub trait ExtendsQueueFamilyProperties { } impl Default for VkQueueFamilyProperties { fn default() -> Self { Self { queue_flags: VkQueueFlags::default(), queue_count: 0, timestamp_valid_bits: 0, min_image_transfer_granularity: VkExtent3D::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPhysicalDeviceProperties { pub api_version: u32, pub driver_version: u32, pub vendor_id: u32, pub device_id: u32, pub device_type: VkPhysicalDeviceType, pub device_name: [u8; 256], pub pipeline_cache_uuid: [u8; 16], pub limits: VkPhysicalDeviceLimits, pub sparse_properties: VkPhysicalDeviceSparseProperties, } pub trait ExtendsPhysicalDeviceProperties { } impl Default for VkPhysicalDeviceProperties { fn default() -> Self { Self { api_version: 0, driver_version: 0, vendor_id: 0, device_id: 0, device_type: VkPhysicalDeviceType::default(), device_name: [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, ], pipeline_cache_uuid: [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], limits: VkPhysicalDeviceLimits::default(), sparse_properties: VkPhysicalDeviceSparseProperties::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPhysicalDeviceSparseProperties { pub residency_standard_2_d_block_shape: VkBool32, pub residency_standard_2_d_multisample_block_shape: VkBool32, pub residency_standard_3_d_block_shape: VkBool32, pub residency_aligned_mip_size: VkBool32, pub residency_non_resident_strict: VkBool32, } pub trait ExtendsPhysicalDeviceSparseProperties { } impl Default for VkPhysicalDeviceSparseProperties { fn default() -> Self { Self { residency_standard_2_d_block_shape: VkBool32::default(), residency_standard_2_d_multisample_block_shape: VkBool32::default(), residency_standard_3_d_block_shape: VkBool32::default(), residency_aligned_mip_size: VkBool32::default(), residency_non_resident_strict: VkBool32::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkPhysicalDeviceLimits { pub max_image_dimension_1_d: u32, pub max_image_dimension_2_d: u32, pub max_image_dimension_3_d: u32, pub max_image_dimension_cube: u32, pub max_image_array_layers: u32, pub max_texel_buffer_elements: u32, pub max_uniform_buffer_range: u32, pub max_storage_buffer_range: u32, pub max_push_constants_size: u32, pub max_memory_allocation_count: u32, pub max_sampler_allocation_count: u32, pub buffer_image_granularity: VkDeviceSize, pub sparse_address_space_size: VkDeviceSize, pub max_bound_descriptor_sets: u32, pub max_per_stage_descriptor_samplers: u32, pub max_per_stage_descriptor_uniform_buffers: u32, pub max_per_stage_descriptor_storage_buffers: u32, pub max_per_stage_descriptor_sampled_images: u32, pub max_per_stage_descriptor_storage_images: u32, pub max_per_stage_descriptor_input_attachments: u32, pub max_per_stage_resources: u32, pub max_descriptor_set_samplers: u32, pub max_descriptor_set_uniform_buffers: u32, pub max_descriptor_set_uniform_buffers_dynamic: u32, pub max_descriptor_set_storage_buffers: u32, pub max_descriptor_set_storage_buffers_dynamic: u32, pub max_descriptor_set_sampled_images: u32, pub max_descriptor_set_storage_images: u32, pub max_descriptor_set_input_attachments: u32, pub max_vertex_input_attributes: u32, pub max_vertex_input_bindings: u32, pub max_vertex_input_attribute_offset: u32, pub max_vertex_input_binding_stride: u32, pub max_vertex_output_components: u32, pub max_tessellation_generation_level: u32, pub max_tessellation_patch_size: u32, pub max_tessellation_control_per_vertex_input_components: u32, pub max_tessellation_control_per_vertex_output_components: u32, pub max_tessellation_control_per_patch_output_components: u32, pub max_tessellation_control_total_output_components: u32, pub max_tessellation_evaluation_input_components: u32, pub max_tessellation_evaluation_output_components: u32, pub max_geometry_shader_invocations: u32, pub max_geometry_input_components: u32, pub max_geometry_output_components: u32, pub max_geometry_output_vertices: u32, pub max_geometry_total_output_components: u32, pub max_fragment_input_components: u32, pub max_fragment_output_attachments: u32, pub max_fragment_dual_src_attachments: u32, pub max_fragment_combined_output_resources: u32, pub max_compute_shared_memory_size: u32, pub max_compute_work_group_count: [u32; 3], pub max_compute_work_group_invocations: u32, pub max_compute_work_group_size: [u32; 3], pub sub_pixel_precision_bits: u32, pub sub_texel_precision_bits: u32, pub mipmap_precision_bits: u32, pub max_draw_indexed_index_value: u32, pub max_draw_indirect_count: u32, pub max_sampler_lod_bias: f32, pub max_sampler_anisotropy: f32, pub max_viewports: u32, pub max_viewport_dimensions: [u32; 2], pub viewport_bounds_range: [f32; 2], pub viewport_sub_pixel_bits: u32, pub min_memory_map_alignment: usize, pub min_texel_buffer_offset_alignment: VkDeviceSize, pub min_uniform_buffer_offset_alignment: VkDeviceSize, pub min_storage_buffer_offset_alignment: VkDeviceSize, pub min_texel_offset: i32, pub max_texel_offset: u32, pub min_texel_gather_offset: i32, pub max_texel_gather_offset: u32, pub min_interpolation_offset: f32, pub max_interpolation_offset: f32, pub sub_pixel_interpolation_offset_bits: u32, pub max_framebuffer_width: u32, pub max_framebuffer_height: u32, pub max_framebuffer_layers: u32, pub framebuffer_color_sample_counts: VkSampleCountFlags, pub framebuffer_depth_sample_counts: VkSampleCountFlags, pub framebuffer_stencil_sample_counts: VkSampleCountFlags, pub framebuffer_no_attachments_sample_counts: VkSampleCountFlags, pub max_color_attachments: u32, pub sampled_image_color_sample_counts: VkSampleCountFlags, pub sampled_image_integer_sample_counts: VkSampleCountFlags, pub sampled_image_depth_sample_counts: VkSampleCountFlags, pub sampled_image_stencil_sample_counts: VkSampleCountFlags, pub storage_image_sample_counts: VkSampleCountFlags, pub max_sample_mask_words: u32, pub timestamp_compute_and_graphics: VkBool32, pub timestamp_period: f32, pub max_clip_distances: u32, pub max_cull_distances: u32, pub max_combined_clip_and_cull_distances: u32, pub discrete_queue_priorities: u32, pub point_size_range: [f32; 2], pub line_width_range: [f32; 2], pub point_size_granularity: f32, pub line_width_granularity: f32, pub strict_lines: VkBool32, pub standard_sample_locations: VkBool32, pub optimal_buffer_copy_offset_alignment: VkDeviceSize, pub optimal_buffer_copy_row_pitch_alignment: VkDeviceSize, pub non_coherent_atom_size: VkDeviceSize, } pub trait ExtendsPhysicalDeviceLimits { } impl Default for VkPhysicalDeviceLimits { fn default() -> Self { Self { max_image_dimension_1_d: 0, max_image_dimension_2_d: 0, max_image_dimension_3_d: 0, max_image_dimension_cube: 0, max_image_array_layers: 0, max_texel_buffer_elements: 0, max_uniform_buffer_range: 0, max_storage_buffer_range: 0, max_push_constants_size: 0, max_memory_allocation_count: 0, max_sampler_allocation_count: 0, buffer_image_granularity: VkDeviceSize::default(), sparse_address_space_size: VkDeviceSize::default(), max_bound_descriptor_sets: 0, max_per_stage_descriptor_samplers: 0, max_per_stage_descriptor_uniform_buffers: 0, max_per_stage_descriptor_storage_buffers: 0, max_per_stage_descriptor_sampled_images: 0, max_per_stage_descriptor_storage_images: 0, max_per_stage_descriptor_input_attachments: 0, max_per_stage_resources: 0, max_descriptor_set_samplers: 0, max_descriptor_set_uniform_buffers: 0, max_descriptor_set_uniform_buffers_dynamic: 0, max_descriptor_set_storage_buffers: 0, max_descriptor_set_storage_buffers_dynamic: 0, max_descriptor_set_sampled_images: 0, max_descriptor_set_storage_images: 0, max_descriptor_set_input_attachments: 0, max_vertex_input_attributes: 0, max_vertex_input_bindings: 0, max_vertex_input_attribute_offset: 0, max_vertex_input_binding_stride: 0, max_vertex_output_components: 0, max_tessellation_generation_level: 0, max_tessellation_patch_size: 0, max_tessellation_control_per_vertex_input_components: 0, max_tessellation_control_per_vertex_output_components: 0, max_tessellation_control_per_patch_output_components: 0, max_tessellation_control_total_output_components: 0, max_tessellation_evaluation_input_components: 0, max_tessellation_evaluation_output_components: 0, max_geometry_shader_invocations: 0, max_geometry_input_components: 0, max_geometry_output_components: 0, max_geometry_output_vertices: 0, max_geometry_total_output_components: 0, max_fragment_input_components: 0, max_fragment_output_attachments: 0, max_fragment_dual_src_attachments: 0, max_fragment_combined_output_resources: 0, max_compute_shared_memory_size: 0, max_compute_work_group_count: [0, 0, 0], max_compute_work_group_invocations: 0, max_compute_work_group_size: [0, 0, 0], sub_pixel_precision_bits: 0, sub_texel_precision_bits: 0, mipmap_precision_bits: 0, max_draw_indexed_index_value: 0, max_draw_indirect_count: 0, max_sampler_lod_bias: 0.0, max_sampler_anisotropy: 0.0, max_viewports: 0, max_viewport_dimensions: [0, 0], viewport_bounds_range: [0.0, 0.0], viewport_sub_pixel_bits: 0, min_memory_map_alignment: 0, min_texel_buffer_offset_alignment: VkDeviceSize::default(), min_uniform_buffer_offset_alignment: VkDeviceSize::default(), min_storage_buffer_offset_alignment: VkDeviceSize::default(), min_texel_offset: 0, max_texel_offset: 0, min_texel_gather_offset: 0, max_texel_gather_offset: 0, min_interpolation_offset: 0.0, max_interpolation_offset: 0.0, sub_pixel_interpolation_offset_bits: 0, max_framebuffer_width: 0, max_framebuffer_height: 0, max_framebuffer_layers: 0, framebuffer_color_sample_counts: VkSampleCountFlags::default(), framebuffer_depth_sample_counts: VkSampleCountFlags::default(), framebuffer_stencil_sample_counts: VkSampleCountFlags::default(), framebuffer_no_attachments_sample_counts: VkSampleCountFlags::default(), max_color_attachments: 0, sampled_image_color_sample_counts: VkSampleCountFlags::default(), sampled_image_integer_sample_counts: VkSampleCountFlags::default(), sampled_image_depth_sample_counts: VkSampleCountFlags::default(), sampled_image_stencil_sample_counts: VkSampleCountFlags::default(), storage_image_sample_counts: VkSampleCountFlags::default(), max_sample_mask_words: 0, timestamp_compute_and_graphics: VkBool32::default(), timestamp_period: 0.0, max_clip_distances: 0, max_cull_distances: 0, max_combined_clip_and_cull_distances: 0, discrete_queue_priorities: 0, point_size_range: [0.0, 0.0], line_width_range: [0.0, 0.0], point_size_granularity: 0.0, line_width_granularity: 0.0, strict_lines: VkBool32::default(), standard_sample_locations: VkBool32::default(), optimal_buffer_copy_offset_alignment: VkDeviceSize::default(), optimal_buffer_copy_row_pitch_alignment: VkDeviceSize::default(), non_coherent_atom_size: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkImageFormatProperties { pub max_extent: VkExtent3D, pub max_mip_levels: u32, pub max_array_layers: u32, pub sample_counts: VkSampleCountFlags, pub max_resource_size: VkDeviceSize, } pub trait ExtendsImageFormatProperties { } impl Default for VkImageFormatProperties { fn default() -> Self { Self { max_extent: VkExtent3D::default(), max_mip_levels: 0, max_array_layers: 0, sample_counts: VkSampleCountFlags::default(), max_resource_size: VkDeviceSize::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkFormatProperties { pub linear_tiling_features: VkFormatFeatureFlags, pub optimal_tiling_features: VkFormatFeatureFlags, pub buffer_features: VkFormatFeatureFlags, } pub trait ExtendsFormatProperties { } impl Default for VkFormatProperties { fn default() -> Self { Self { linear_tiling_features: VkFormatFeatureFlags::default(), optimal_tiling_features: VkFormatFeatureFlags::default(), buffer_features: VkFormatFeatureFlags::default(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkInstanceCreateInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub flags: VkInstanceCreateFlags, pub p_application_info: *const VkApplicationInfo, pub enabled_layer_count: u32, pub pp_enabled_layer_names: *const *const u8, pub enabled_extension_count: u32, pub pp_enabled_extension_names: *const *const u8, } pub trait ExtendsInstanceCreateInfo { } impl Default for VkInstanceCreateInfo { fn default() -> Self { Self { s_type: VkStructureType::INSTANCE_CREATE_INFO, p_next: core::ptr::null(), flags: VkInstanceCreateFlags::default(), p_application_info: core::ptr::null(), enabled_layer_count: 0, pp_enabled_layer_names: core::ptr::null(), enabled_extension_count: 0, pp_enabled_extension_names: core::ptr::null(), } } } #[repr(C)] #[derive(Copy, Clone)] pub struct VkApplicationInfo { pub s_type: VkStructureType, pub p_next: *const core::ffi::c_void, pub p_application_name: *const u8, pub application_version: u32, pub p_engine_name: *const u8, pub engine_version: u32, pub api_version: u32, } pub trait ExtendsApplicationInfo { } impl Default for VkApplicationInfo { fn default() -> Self { Self { s_type: VkStructureType::APPLICATION_INFO, p_next: core::ptr::null(), p_application_name: core::ptr::null(), application_version: 0, p_engine_name: core::ptr::null(), engine_version: 0, api_version: 0, } } } #[repr(C)] #[derive(Copy, Clone)] pub union VkClearValue { pub color: VkClearColorValue, pub depth_stencil: VkClearDepthStencilValue, } impl Default for VkClearValue { fn default() -> Self { unsafe { core::mem::zeroed() } } } #[repr(C)] #[derive(Copy, Clone)] pub union VkClearColorValue { pub float_32: [f32; 4], pub int_32: [i32; 4], pub uint_32: [u32; 4], } impl Default for VkClearColorValue { fn default() -> Self { unsafe { core::mem::zeroed() } } } pub type PfnVkInternalFreeNotification = extern "system" fn( p_user_data: *mut core::ffi::c_void, size: usize, allocation_type: VkInternalAllocationType, allocation_scope: VkSystemAllocationScope, ); pub type PfnVkInternalAllocationNotification = extern "system" fn( p_user_data: *mut core::ffi::c_void, size: usize, allocation_type: VkInternalAllocationType, allocation_scope: VkSystemAllocationScope, ); pub type PfnVkFreeFunction = extern "system" fn(p_user_data: *mut core::ffi::c_void, p_memory: *mut core::ffi::c_void); pub type PfnVkReallocationFunction = extern "system" fn( p_user_data: *mut core::ffi::c_void, p_original: *mut core::ffi::c_void, size: usize, alignment: usize, allocation_scope: VkSystemAllocationScope, ) -> *mut core::ffi::c_void; pub type PfnVkAllocationFunction = extern "system" fn( p_user_data: *mut core::ffi::c_void, size: usize, alignment: usize, allocation_scope: VkSystemAllocationScope, ) -> *mut core::ffi::c_void; pub type PfnVkDebugUtilsMessengerCallbackEXT = extern "system" fn( message_severity: VkDebugUtilsMessageSeverityFlagBitsEXT, message_types: VkDebugUtilsMessageTypeFlagsEXT, p_callback_data: *const VkDebugUtilsMessengerCallbackDataEXT, p_user_data: *mut core::ffi::c_void, ) -> VkBool32; pub type PfnVkVoidFunction = extern "system" fn(); pub type PfnVkGetPhysicalDeviceWin32PresentationSupportKHR = extern "system" fn(physical_device: VkPhysicalDevice, queue_family_index: u32) -> VkBool32; pub type PfnVkCreateWin32SurfaceKHR = extern "system" fn( instance: VkInstance, p_create_info: *const VkWin32SurfaceCreateInfoKHR, p_allocator: *const VkAllocationCallbacks, p_surface: *mut VkSurfaceKHR, ) -> VkResult; pub type PfnVkGetPhysicalDeviceSurfacePresentModesKHR = extern "system" fn( physical_device: VkPhysicalDevice, surface: VkSurfaceKHR, p_present_mode_count: *mut u32, p_present_modes: *mut VkPresentModeKHR, ) -> VkResult; pub type PfnVkGetPhysicalDeviceSurfaceFormatsKHR = extern "system" fn( physical_device: VkPhysicalDevice, surface: VkSurfaceKHR, p_surface_format_count: *mut u32, p_surface_formats: *mut VkSurfaceFormatKHR, ) -> VkResult; pub type PfnVkGetPhysicalDeviceSurfaceCapabilitiesKHR = extern "system" fn( physical_device: VkPhysicalDevice, surface: VkSurfaceKHR, p_surface_capabilities: *mut VkSurfaceCapabilitiesKHR, ) -> VkResult; pub type PfnVkGetPhysicalDeviceSurfaceSupportKHR = extern "system" fn( physical_device: VkPhysicalDevice, queue_family_index: u32, surface: VkSurfaceKHR, p_supported: *mut VkBool32, ) -> VkResult; pub type PfnVkDestroySurfaceKHR = extern "system" fn( instance: VkInstance, surface: VkSurfaceKHR, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkQueuePresentKHR = extern "system" fn(queue: VkQueue, p_present_info: *const VkPresentInfoKHR) -> VkResult; pub type PfnVkAcquireNextImageKHR = extern "system" fn( device: VkDevice, swapchain: VkSwapchainKHR, timeout: u64, semaphore: VkSemaphore, fence: VkFence, p_image_index: *mut u32, ) -> VkResult; pub type PfnVkGetSwapchainImagesKHR = extern "system" fn( device: VkDevice, swapchain: VkSwapchainKHR, p_swapchain_image_count: *mut u32, p_swapchain_images: *mut VkImage, ) -> VkResult; pub type PfnVkDestroySwapchainKHR = extern "system" fn( device: VkDevice, swapchain: VkSwapchainKHR, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateSwapchainKHR = extern "system" fn( device: VkDevice, p_create_info: *const VkSwapchainCreateInfoKHR, p_allocator: *const VkAllocationCallbacks, p_swapchain: *mut VkSwapchainKHR, ) -> VkResult; pub type PfnVkSubmitDebugUtilsMessageEXT = extern "system" fn( instance: VkInstance, message_severity: VkDebugUtilsMessageSeverityFlagBitsEXT, message_types: VkDebugUtilsMessageTypeFlagsEXT, p_callback_data: *const VkDebugUtilsMessengerCallbackDataEXT, ); pub type PfnVkDestroyDebugUtilsMessengerEXT = extern "system" fn( instance: VkInstance, messenger: VkDebugUtilsMessengerEXT, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateDebugUtilsMessengerEXT = extern "system" fn( instance: VkInstance, p_create_info: *const VkDebugUtilsMessengerCreateInfoEXT, p_allocator: *const VkAllocationCallbacks, p_messenger: *mut VkDebugUtilsMessengerEXT, ) -> VkResult; pub type PfnVkCmdInsertDebugUtilsLabelEXT = extern "system" fn(command_buffer: VkCommandBuffer, p_label_info: *const VkDebugUtilsLabelEXT); pub type PfnVkCmdEndDebugUtilsLabelEXT = extern "system" fn(command_buffer: VkCommandBuffer); pub type PfnVkCmdBeginDebugUtilsLabelEXT = extern "system" fn(command_buffer: VkCommandBuffer, p_label_info: *const VkDebugUtilsLabelEXT); pub type PfnVkQueueInsertDebugUtilsLabelEXT = extern "system" fn(queue: VkQueue, p_label_info: *const VkDebugUtilsLabelEXT); pub type PfnVkQueueEndDebugUtilsLabelEXT = extern "system" fn(queue: VkQueue); pub type PfnVkQueueBeginDebugUtilsLabelEXT = extern "system" fn(queue: VkQueue, p_label_info: *const VkDebugUtilsLabelEXT); pub type PfnVkSetDebugUtilsObjectTagEXT = extern "system" fn( device: VkDevice, p_tag_info: *const VkDebugUtilsObjectTagInfoEXT, ) -> VkResult; pub type PfnVkSetDebugUtilsObjectNameEXT = extern "system" fn( device: VkDevice, p_name_info: *const VkDebugUtilsObjectNameInfoEXT, ) -> VkResult; pub type PfnVkCmdExecuteCommands = extern "system" fn( command_buffer: VkCommandBuffer, command_buffer_count: u32, p_command_buffers: *const VkCommandBuffer, ); pub type PfnVkCmdEndRenderPass = extern "system" fn(command_buffer: VkCommandBuffer); pub type PfnVkCmdNextSubpass = extern "system" fn(command_buffer: VkCommandBuffer, contents: VkSubpassContents); pub type PfnVkCmdBeginRenderPass = extern "system" fn( command_buffer: VkCommandBuffer, p_render_pass_begin: *const VkRenderPassBeginInfo, contents: VkSubpassContents, ); pub type PfnVkCmdPushConstants = extern "system" fn( command_buffer: VkCommandBuffer, layout: VkPipelineLayout, stage_flags: VkShaderStageFlags, offset: u32, size: u32, p_values: *const core::ffi::c_void, ); pub type PfnVkCmdCopyQueryPoolResults = extern "system" fn( command_buffer: VkCommandBuffer, query_pool: VkQueryPool, first_query: u32, query_count: u32, dst_buffer: VkBuffer, dst_offset: VkDeviceSize, stride: VkDeviceSize, flags: VkQueryResultFlags, ); pub type PfnVkCmdWriteTimestamp = extern "system" fn( command_buffer: VkCommandBuffer, pipeline_stage: VkPipelineStageFlagBits, query_pool: VkQueryPool, query: u32, ); pub type PfnVkCmdResetQueryPool = extern "system" fn( command_buffer: VkCommandBuffer, query_pool: VkQueryPool, first_query: u32, query_count: u32, ); pub type PfnVkCmdEndQuery = extern "system" fn(command_buffer: VkCommandBuffer, query_pool: VkQueryPool, query: u32); pub type PfnVkCmdBeginQuery = extern "system" fn( command_buffer: VkCommandBuffer, query_pool: VkQueryPool, query: u32, flags: VkQueryControlFlags, ); pub type PfnVkCmdPipelineBarrier = extern "system" fn( command_buffer: VkCommandBuffer, src_stage_mask: VkPipelineStageFlags, dst_stage_mask: VkPipelineStageFlags, dependency_flags: VkDependencyFlags, memory_barrier_count: u32, p_memory_barriers: *const VkMemoryBarrier, buffer_memory_barrier_count: u32, p_buffer_memory_barriers: *const VkBufferMemoryBarrier, image_memory_barrier_count: u32, p_image_memory_barriers: *const VkImageMemoryBarrier, ); pub type PfnVkCmdWaitEvents = extern "system" fn( command_buffer: VkCommandBuffer, event_count: u32, p_events: *const VkEvent, src_stage_mask: VkPipelineStageFlags, dst_stage_mask: VkPipelineStageFlags, memory_barrier_count: u32, p_memory_barriers: *const VkMemoryBarrier, buffer_memory_barrier_count: u32, p_buffer_memory_barriers: *const VkBufferMemoryBarrier, image_memory_barrier_count: u32, p_image_memory_barriers: *const VkImageMemoryBarrier, ); pub type PfnVkCmdResetEvent = extern "system" fn( command_buffer: VkCommandBuffer, event: VkEvent, stage_mask: VkPipelineStageFlags, ); pub type PfnVkCmdSetEvent = extern "system" fn( command_buffer: VkCommandBuffer, event: VkEvent, stage_mask: VkPipelineStageFlags, ); pub type PfnVkCmdResolveImage = extern "system" fn( command_buffer: VkCommandBuffer, src_image: VkImage, src_image_layout: VkImageLayout, dst_image: VkImage, dst_image_layout: VkImageLayout, region_count: u32, p_regions: *const VkImageResolve, ); pub type PfnVkCmdClearAttachments = extern "system" fn( command_buffer: VkCommandBuffer, attachment_count: u32, p_attachments: *const VkClearAttachment, rect_count: u32, p_rects: *const VkClearRect, ); pub type PfnVkCmdClearDepthStencilImage = extern "system" fn( command_buffer: VkCommandBuffer, image: VkImage, image_layout: VkImageLayout, p_depth_stencil: *const VkClearDepthStencilValue, range_count: u32, p_ranges: *const VkImageSubresourceRange, ); pub type PfnVkCmdClearColorImage = extern "system" fn( command_buffer: VkCommandBuffer, image: VkImage, image_layout: VkImageLayout, p_color: *const VkClearColorValue, range_count: u32, p_ranges: *const VkImageSubresourceRange, ); pub type PfnVkCmdFillBuffer = extern "system" fn( command_buffer: VkCommandBuffer, dst_buffer: VkBuffer, dst_offset: VkDeviceSize, size: VkDeviceSize, data: u32, ); pub type PfnVkCmdUpdateBuffer = extern "system" fn( command_buffer: VkCommandBuffer, dst_buffer: VkBuffer, dst_offset: VkDeviceSize, data_size: VkDeviceSize, p_data: *const core::ffi::c_void, ); pub type PfnVkCmdCopyImageToBuffer = extern "system" fn( command_buffer: VkCommandBuffer, src_image: VkImage, src_image_layout: VkImageLayout, dst_buffer: VkBuffer, region_count: u32, p_regions: *const VkBufferImageCopy, ); pub type PfnVkCmdCopyBufferToImage = extern "system" fn( command_buffer: VkCommandBuffer, src_buffer: VkBuffer, dst_image: VkImage, dst_image_layout: VkImageLayout, region_count: u32, p_regions: *const VkBufferImageCopy, ); pub type PfnVkCmdBlitImage = extern "system" fn( command_buffer: VkCommandBuffer, src_image: VkImage, src_image_layout: VkImageLayout, dst_image: VkImage, dst_image_layout: VkImageLayout, region_count: u32, p_regions: *const VkImageBlit, filter: VkFilter, ); pub type PfnVkCmdCopyImage = extern "system" fn( command_buffer: VkCommandBuffer, src_image: VkImage, src_image_layout: VkImageLayout, dst_image: VkImage, dst_image_layout: VkImageLayout, region_count: u32, p_regions: *const VkImageCopy, ); pub type PfnVkCmdCopyBuffer = extern "system" fn( command_buffer: VkCommandBuffer, src_buffer: VkBuffer, dst_buffer: VkBuffer, region_count: u32, p_regions: *const VkBufferCopy, ); pub type PfnVkCmdDispatchIndirect = extern "system" fn(command_buffer: VkCommandBuffer, buffer: VkBuffer, offset: VkDeviceSize); pub type PfnVkCmdDispatch = extern "system" fn( command_buffer: VkCommandBuffer, group_count_x: u32, group_count_y: u32, group_count_z: u32, ); pub type PfnVkCmdDrawIndexedIndirect = extern "system" fn( command_buffer: VkCommandBuffer, buffer: VkBuffer, offset: VkDeviceSize, draw_count: u32, stride: u32, ); pub type PfnVkCmdDrawIndirect = extern "system" fn( command_buffer: VkCommandBuffer, buffer: VkBuffer, offset: VkDeviceSize, draw_count: u32, stride: u32, ); pub type PfnVkCmdDrawIndexed = extern "system" fn( command_buffer: VkCommandBuffer, index_count: u32, instance_count: u32, first_index: u32, vertex_offset: i32, first_instance: u32, ); pub type PfnVkCmdDraw = extern "system" fn( command_buffer: VkCommandBuffer, vertex_count: u32, instance_count: u32, first_vertex: u32, first_instance: u32, ); pub type PfnVkCmdBindVertexBuffers = extern "system" fn( command_buffer: VkCommandBuffer, first_binding: u32, binding_count: u32, p_buffers: *const VkBuffer, p_offsets: *const VkDeviceSize, ); pub type PfnVkCmdBindIndexBuffer = extern "system" fn( command_buffer: VkCommandBuffer, buffer: VkBuffer, offset: VkDeviceSize, index_type: VkIndexType, ); pub type PfnVkCmdBindDescriptorSets = extern "system" fn( command_buffer: VkCommandBuffer, pipeline_bind_point: VkPipelineBindPoint, layout: VkPipelineLayout, first_set: u32, descriptor_set_count: u32, p_descriptor_sets: *const VkDescriptorSet, dynamic_offset_count: u32, p_dynamic_offsets: *const u32, ); pub type PfnVkCmdSetStencilReference = extern "system" fn( command_buffer: VkCommandBuffer, face_mask: VkStencilFaceFlags, reference: u32, ); pub type PfnVkCmdSetStencilWriteMask = extern "system" fn( command_buffer: VkCommandBuffer, face_mask: VkStencilFaceFlags, write_mask: u32, ); pub type PfnVkCmdSetStencilCompareMask = extern "system" fn( command_buffer: VkCommandBuffer, face_mask: VkStencilFaceFlags, compare_mask: u32, ); pub type PfnVkCmdSetDepthBounds = extern "system" fn( command_buffer: VkCommandBuffer, min_depth_bounds: f32, max_depth_bounds: f32, ); pub type PfnVkCmdSetBlendConstants = extern "system" fn(command_buffer: VkCommandBuffer, blend_constants: [f32; 4]); pub type PfnVkCmdSetDepthBias = extern "system" fn( command_buffer: VkCommandBuffer, depth_bias_constant_factor: f32, depth_bias_clamp: f32, depth_bias_slope_factor: f32, ); pub type PfnVkCmdSetLineWidth = extern "system" fn(command_buffer: VkCommandBuffer, line_width: f32); pub type PfnVkCmdSetScissor = extern "system" fn( command_buffer: VkCommandBuffer, first_scissor: u32, scissor_count: u32, p_scissors: *const VkRect2D, ); pub type PfnVkCmdSetViewport = extern "system" fn( command_buffer: VkCommandBuffer, first_viewport: u32, viewport_count: u32, p_viewports: *const VkViewport, ); pub type PfnVkCmdBindPipeline = extern "system" fn( command_buffer: VkCommandBuffer, pipeline_bind_point: VkPipelineBindPoint, pipeline: VkPipeline, ); pub type PfnVkResetCommandBuffer = extern "system" fn( command_buffer: VkCommandBuffer, flags: VkCommandBufferResetFlags, ) -> VkResult; pub type PfnVkEndCommandBuffer = extern "system" fn(command_buffer: VkCommandBuffer) -> VkResult; pub type PfnVkBeginCommandBuffer = extern "system" fn( command_buffer: VkCommandBuffer, p_begin_info: *const VkCommandBufferBeginInfo, ) -> VkResult; pub type PfnVkFreeCommandBuffers = extern "system" fn( device: VkDevice, command_pool: VkCommandPool, command_buffer_count: u32, p_command_buffers: *const VkCommandBuffer, ); pub type PfnVkAllocateCommandBuffers = extern "system" fn( device: VkDevice, p_allocate_info: *const VkCommandBufferAllocateInfo, p_command_buffers: *mut VkCommandBuffer, ) -> VkResult; pub type PfnVkResetCommandPool = extern "system" fn( device: VkDevice, command_pool: VkCommandPool, flags: VkCommandPoolResetFlags, ) -> VkResult; pub type PfnVkDestroyCommandPool = extern "system" fn( device: VkDevice, command_pool: VkCommandPool, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateCommandPool = extern "system" fn( device: VkDevice, p_create_info: *const VkCommandPoolCreateInfo, p_allocator: *const VkAllocationCallbacks, p_command_pool: *mut VkCommandPool, ) -> VkResult; pub type PfnVkGetRenderAreaGranularity = extern "system" fn(device: VkDevice, render_pass: VkRenderPass, p_granularity: *mut VkExtent2D); pub type PfnVkDestroyRenderPass = extern "system" fn( device: VkDevice, render_pass: VkRenderPass, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateRenderPass = extern "system" fn( device: VkDevice, p_create_info: *const VkRenderPassCreateInfo, p_allocator: *const VkAllocationCallbacks, p_render_pass: *mut VkRenderPass, ) -> VkResult; pub type PfnVkDestroyFramebuffer = extern "system" fn( device: VkDevice, framebuffer: VkFramebuffer, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateFramebuffer = extern "system" fn( device: VkDevice, p_create_info: *const VkFramebufferCreateInfo, p_allocator: *const VkAllocationCallbacks, p_framebuffer: *mut VkFramebuffer, ) -> VkResult; pub type PfnVkUpdateDescriptorSets = extern "system" fn( device: VkDevice, descriptor_write_count: u32, p_descriptor_writes: *const VkWriteDescriptorSet, descriptor_copy_count: u32, p_descriptor_copies: *const VkCopyDescriptorSet, ); pub type PfnVkFreeDescriptorSets = extern "system" fn( device: VkDevice, descriptor_pool: VkDescriptorPool, descriptor_set_count: u32, p_descriptor_sets: *const VkDescriptorSet, ) -> VkResult; pub type PfnVkAllocateDescriptorSets = extern "system" fn( device: VkDevice, p_allocate_info: *const VkDescriptorSetAllocateInfo, p_descriptor_sets: *mut VkDescriptorSet, ) -> VkResult; pub type PfnVkResetDescriptorPool = extern "system" fn( device: VkDevice, descriptor_pool: VkDescriptorPool, flags: VkDescriptorPoolResetFlags, ) -> VkResult; pub type PfnVkDestroyDescriptorPool = extern "system" fn( device: VkDevice, descriptor_pool: VkDescriptorPool, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateDescriptorPool = extern "system" fn( device: VkDevice, p_create_info: *const VkDescriptorPoolCreateInfo, p_allocator: *const VkAllocationCallbacks, p_descriptor_pool: *mut VkDescriptorPool, ) -> VkResult; pub type PfnVkDestroyDescriptorSetLayout = extern "system" fn( device: VkDevice, descriptor_set_layout: VkDescriptorSetLayout, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateDescriptorSetLayout = extern "system" fn( device: VkDevice, p_create_info: *const VkDescriptorSetLayoutCreateInfo, p_allocator: *const VkAllocationCallbacks, p_set_layout: *mut VkDescriptorSetLayout, ) -> VkResult; pub type PfnVkDestroySampler = extern "system" fn( device: VkDevice, sampler: VkSampler, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateSampler = extern "system" fn( device: VkDevice, p_create_info: *const VkSamplerCreateInfo, p_allocator: *const VkAllocationCallbacks, p_sampler: *mut VkSampler, ) -> VkResult; pub type PfnVkDestroyPipelineLayout = extern "system" fn( device: VkDevice, pipeline_layout: VkPipelineLayout, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreatePipelineLayout = extern "system" fn( device: VkDevice, p_create_info: *const VkPipelineLayoutCreateInfo, p_allocator: *const VkAllocationCallbacks, p_pipeline_layout: *mut VkPipelineLayout, ) -> VkResult; pub type PfnVkDestroyPipeline = extern "system" fn( device: VkDevice, pipeline: VkPipeline, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateComputePipelines = extern "system" fn( device: VkDevice, pipeline_cache: VkPipelineCache, create_info_count: u32, p_create_infos: *const VkComputePipelineCreateInfo, p_allocator: *const VkAllocationCallbacks, p_pipelines: *mut VkPipeline, ) -> VkResult; pub type PfnVkCreateGraphicsPipelines = extern "system" fn( device: VkDevice, pipeline_cache: VkPipelineCache, create_info_count: u32, p_create_infos: *const VkGraphicsPipelineCreateInfo, p_allocator: *const VkAllocationCallbacks, p_pipelines: *mut VkPipeline, ) -> VkResult; pub type PfnVkMergePipelineCaches = extern "system" fn( device: VkDevice, dst_cache: VkPipelineCache, src_cache_count: u32, p_src_caches: *const VkPipelineCache, ) -> VkResult; pub type PfnVkGetPipelineCacheData = extern "system" fn( device: VkDevice, pipeline_cache: VkPipelineCache, p_data_size: *mut usize, p_data: *mut core::ffi::c_void, ) -> VkResult; pub type PfnVkDestroyPipelineCache = extern "system" fn( device: VkDevice, pipeline_cache: VkPipelineCache, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreatePipelineCache = extern "system" fn( device: VkDevice, p_create_info: *const VkPipelineCacheCreateInfo, p_allocator: *const VkAllocationCallbacks, p_pipeline_cache: *mut VkPipelineCache, ) -> VkResult; pub type PfnVkDestroyShaderModule = extern "system" fn( device: VkDevice, shader_module: VkShaderModule, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateShaderModule = extern "system" fn( device: VkDevice, p_create_info: *const VkShaderModuleCreateInfo, p_allocator: *const VkAllocationCallbacks, p_shader_module: *mut VkShaderModule, ) -> VkResult; pub type PfnVkDestroyImageView = extern "system" fn( device: VkDevice, image_view: VkImageView, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateImageView = extern "system" fn( device: VkDevice, p_create_info: *const VkImageViewCreateInfo, p_allocator: *const VkAllocationCallbacks, p_view: *mut VkImageView, ) -> VkResult; pub type PfnVkGetImageSubresourceLayout = extern "system" fn( device: VkDevice, image: VkImage, p_subresource: *const VkImageSubresource, p_layout: *mut VkSubresourceLayout, ); pub type PfnVkDestroyImage = extern "system" fn(device: VkDevice, image: VkImage, p_allocator: *const VkAllocationCallbacks); pub type PfnVkCreateImage = extern "system" fn( device: VkDevice, p_create_info: *const VkImageCreateInfo, p_allocator: *const VkAllocationCallbacks, p_image: *mut VkImage, ) -> VkResult; pub type PfnVkDestroyBufferView = extern "system" fn( device: VkDevice, buffer_view: VkBufferView, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateBufferView = extern "system" fn( device: VkDevice, p_create_info: *const VkBufferViewCreateInfo, p_allocator: *const VkAllocationCallbacks, p_view: *mut VkBufferView, ) -> VkResult; pub type PfnVkDestroyBuffer = extern "system" fn( device: VkDevice, buffer: VkBuffer, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateBuffer = extern "system" fn( device: VkDevice, p_create_info: *const VkBufferCreateInfo, p_allocator: *const VkAllocationCallbacks, p_buffer: *mut VkBuffer, ) -> VkResult; pub type PfnVkGetQueryPoolResults = extern "system" fn( device: VkDevice, query_pool: VkQueryPool, first_query: u32, query_count: u32, data_size: usize, p_data: *mut core::ffi::c_void, stride: VkDeviceSize, flags: VkQueryResultFlags, ) -> VkResult; pub type PfnVkDestroyQueryPool = extern "system" fn( device: VkDevice, query_pool: VkQueryPool, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateQueryPool = extern "system" fn( device: VkDevice, p_create_info: *const VkQueryPoolCreateInfo, p_allocator: *const VkAllocationCallbacks, p_query_pool: *mut VkQueryPool, ) -> VkResult; pub type PfnVkResetEvent = extern "system" fn(device: VkDevice, event: VkEvent) -> VkResult; pub type PfnVkSetEvent = extern "system" fn(device: VkDevice, event: VkEvent) -> VkResult; pub type PfnVkGetEventStatus = extern "system" fn(device: VkDevice, event: VkEvent) -> VkResult; pub type PfnVkDestroyEvent = extern "system" fn(device: VkDevice, event: VkEvent, p_allocator: *const VkAllocationCallbacks); pub type PfnVkCreateEvent = extern "system" fn( device: VkDevice, p_create_info: *const VkEventCreateInfo, p_allocator: *const VkAllocationCallbacks, p_event: *mut VkEvent, ) -> VkResult; pub type PfnVkDestroySemaphore = extern "system" fn( device: VkDevice, semaphore: VkSemaphore, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkCreateSemaphore = extern "system" fn( device: VkDevice, p_create_info: *const VkSemaphoreCreateInfo, p_allocator: *const VkAllocationCallbacks, p_semaphore: *mut VkSemaphore, ) -> VkResult; pub type PfnVkWaitForFences = extern "system" fn( device: VkDevice, fence_count: u32, p_fences: *const VkFence, wait_all: VkBool32, timeout: u64, ) -> VkResult; pub type PfnVkGetFenceStatus = extern "system" fn(device: VkDevice, fence: VkFence) -> VkResult; pub type PfnVkResetFences = extern "system" fn(device: VkDevice, fence_count: u32, p_fences: *const VkFence) -> VkResult; pub type PfnVkDestroyFence = extern "system" fn(device: VkDevice, fence: VkFence, p_allocator: *const VkAllocationCallbacks); pub type PfnVkCreateFence = extern "system" fn( device: VkDevice, p_create_info: *const VkFenceCreateInfo, p_allocator: *const VkAllocationCallbacks, p_fence: *mut VkFence, ) -> VkResult; pub type PfnVkQueueBindSparse = extern "system" fn( queue: VkQueue, bind_info_count: u32, p_bind_info: *const VkBindSparseInfo, fence: VkFence, ) -> VkResult; pub type PfnVkGetPhysicalDeviceSparseImageFormatProperties = extern "system" fn( physical_device: VkPhysicalDevice, format: VkFormat, kind: VkImageType, samples: VkSampleCountFlagBits, usage: VkImageUsageFlags, tiling: VkImageTiling, p_property_count: *mut u32, p_properties: *mut VkSparseImageFormatProperties, ); pub type PfnVkGetImageSparseMemoryRequirements = extern "system" fn( device: VkDevice, image: VkImage, p_sparse_memory_requirement_count: *mut u32, p_sparse_memory_requirements: *mut VkSparseImageMemoryRequirements, ); pub type PfnVkGetImageMemoryRequirements = extern "system" fn( device: VkDevice, image: VkImage, p_memory_requirements: *mut VkMemoryRequirements, ); pub type PfnVkGetBufferMemoryRequirements = extern "system" fn( device: VkDevice, buffer: VkBuffer, p_memory_requirements: *mut VkMemoryRequirements, ); pub type PfnVkBindImageMemory = extern "system" fn( device: VkDevice, image: VkImage, memory: VkDeviceMemory, memory_offset: VkDeviceSize, ) -> VkResult; pub type PfnVkBindBufferMemory = extern "system" fn( device: VkDevice, buffer: VkBuffer, memory: VkDeviceMemory, memory_offset: VkDeviceSize, ) -> VkResult; pub type PfnVkGetDeviceMemoryCommitment = extern "system" fn( device: VkDevice, memory: VkDeviceMemory, p_committed_memory_in_bytes: *mut VkDeviceSize, ); pub type PfnVkInvalidateMappedMemoryRanges = extern "system" fn( device: VkDevice, memory_range_count: u32, p_memory_ranges: *const VkMappedMemoryRange, ) -> VkResult; pub type PfnVkFlushMappedMemoryRanges = extern "system" fn( device: VkDevice, memory_range_count: u32, p_memory_ranges: *const VkMappedMemoryRange, ) -> VkResult; pub type PfnVkUnmapMemory = extern "system" fn(device: VkDevice, memory: VkDeviceMemory); pub type PfnVkMapMemory = extern "system" fn( device: VkDevice, memory: VkDeviceMemory, offset: VkDeviceSize, size: VkDeviceSize, flags: VkMemoryMapFlags, pp_data: *mut *mut core::ffi::c_void, ) -> VkResult; pub type PfnVkFreeMemory = extern "system" fn( device: VkDevice, memory: VkDeviceMemory, p_allocator: *const VkAllocationCallbacks, ); pub type PfnVkAllocateMemory = extern "system" fn( device: VkDevice, p_allocate_info: *const VkMemoryAllocateInfo, p_allocator: *const VkAllocationCallbacks, p_memory: *mut VkDeviceMemory, ) -> VkResult; pub type PfnVkDeviceWaitIdle = extern "system" fn(device: VkDevice) -> VkResult; pub type PfnVkQueueWaitIdle = extern "system" fn(queue: VkQueue) -> VkResult; pub type PfnVkQueueSubmit = extern "system" fn( queue: VkQueue, submit_count: u32, p_submits: *const VkSubmitInfo, fence: VkFence, ) -> VkResult; pub type PfnVkGetDeviceQueue = extern "system" fn( device: VkDevice, queue_family_index: u32, queue_index: u32, p_queue: *mut VkQueue, ); pub type PfnVkEnumerateDeviceLayerProperties = extern "system" fn( physical_device: VkPhysicalDevice, p_property_count: *mut u32, p_properties: *mut VkLayerProperties, ) -> VkResult; pub type PfnVkEnumerateInstanceLayerProperties = extern "system" fn( p_property_count: *mut u32, p_properties: *mut VkLayerProperties, ) -> VkResult; pub type PfnVkEnumerateDeviceExtensionProperties = extern "system" fn( physical_device: VkPhysicalDevice, p_layer_name: *const u8, p_property_count: *mut u32, p_properties: *mut VkExtensionProperties, ) -> VkResult; pub type PfnVkEnumerateInstanceExtensionProperties = extern "system" fn( p_layer_name: *const u8, p_property_count: *mut u32, p_properties: *mut VkExtensionProperties, ) -> VkResult; pub type PfnVkDestroyDevice = extern "system" fn(device: VkDevice, p_allocator: *const VkAllocationCallbacks); pub type PfnVkCreateDevice = extern "system" fn( physical_device: VkPhysicalDevice, p_create_info: *const VkDeviceCreateInfo, p_allocator: *const VkAllocationCallbacks, p_device: *mut VkDevice, ) -> VkResult; pub type PfnVkGetDeviceProcAddr = extern "system" fn(device: VkDevice, p_name: *const u8) -> Option<PfnVkVoidFunction>; pub type PfnVkGetInstanceProcAddr = extern "system" fn(instance: VkInstance, p_name: *const u8) -> Option<PfnVkVoidFunction>; pub type PfnVkGetPhysicalDeviceMemoryProperties = extern "system" fn( physical_device: VkPhysicalDevice, p_memory_properties: *mut VkPhysicalDeviceMemoryProperties, ); pub type PfnVkGetPhysicalDeviceQueueFamilyProperties = extern "system" fn( physical_device: VkPhysicalDevice, p_queue_family_property_count: *mut u32, p_queue_family_properties: *mut VkQueueFamilyProperties, ); pub type PfnVkGetPhysicalDeviceProperties = extern "system" fn( physical_device: VkPhysicalDevice, p_properties: *mut VkPhysicalDeviceProperties, ); pub type PfnVkGetPhysicalDeviceImageFormatProperties = extern "system" fn( physical_device: VkPhysicalDevice, format: VkFormat, kind: VkImageType, tiling: VkImageTiling, usage: VkImageUsageFlags, flags: VkImageCreateFlags, p_image_format_properties: *mut VkImageFormatProperties, ) -> VkResult; pub type PfnVkGetPhysicalDeviceFormatProperties = extern "system" fn( physical_device: VkPhysicalDevice, format: VkFormat, p_format_properties: *mut VkFormatProperties, ); pub type PfnVkGetPhysicalDeviceFeatures = extern "system" fn( physical_device: VkPhysicalDevice, p_features: *mut VkPhysicalDeviceFeatures, ); pub type PfnVkEnumeratePhysicalDevices = extern "system" fn( instance: VkInstance, p_physical_device_count: *mut u32, p_physical_devices: *mut VkPhysicalDevice, ) -> VkResult; pub type PfnVkDestroyInstance = extern "system" fn(instance: VkInstance, p_allocator: *const VkAllocationCallbacks); pub type PfnVkCreateInstance = extern "system" fn( p_create_info: *const VkInstanceCreateInfo, p_allocator: *const VkAllocationCallbacks, p_instance: *mut VkInstance, ) -> VkResult;
/* * Datadog API V1 Collection * * Collection of all Datadog Public endpoints. * * The version of the OpenAPI document: 1.0 * Contact: support@datadoghq.com * Generated by: https://openapi-generator.tech */ /// UsageProfilingResponse : Response containing the number of profiled hosts for each hour for a given organization. #[derive(Clone, Debug, PartialEq, Serialize, Deserialize)] pub struct UsageProfilingResponse { /// Get hourly usage for profiled hosts. #[serde(rename = "usage", skip_serializing_if = "Option::is_none")] pub usage: Option<Vec<crate::models::UsageProfilingHour>>, } impl UsageProfilingResponse { /// Response containing the number of profiled hosts for each hour for a given organization. pub fn new() -> UsageProfilingResponse { UsageProfilingResponse { usage: None, } } }
//! Components for the LIS3DSH sensor. //! //! SPI Interface //! //! Usage //! ----- //! ```rust //! let lis3dsh = components::lis3dsh::Lis3dshSpiComponent::new().finalize( //! components::lis3dsh_spi_component_helper!( //! // spi type //! stm32f407vg::spi::Spi, //! // chip select //! stm32f407vg::gpio::PinId::PE03, //! // spi mux //! spi_mux //! ) //! ); //! ``` use my_capsules::lis3dsh::Lis3dshSpi; use capsules::virtual_spi::VirtualSpiMasterDevice; use core::marker::PhantomData; use core::mem::MaybeUninit; use kernel::component::Component; use kernel::hil::spi; use kernel::static_init_half; // オブジェクト用の静的空間を設定 #[macro_export] macro_rules! lis3dsh_spi_component_helper { ($A:ty, $select: expr, $spi_mux: expr) => {{ use my_capsules::lis3dsh::Lis3dshSpi; use capsules::virtual_spi::VirtualSpiMasterDevice; use core::mem::MaybeUninit; let mut lis3dsh_spi: &'static capsules::virtual_spi::VirtualSpiMasterDevice<'static, $A> = components::spi::SpiComponent::new($spi_mux, $select) .finalize(components::spi_component_helper!($A)); static mut lis3dshspi: MaybeUninit<Lis3dshSpi<'static>> = MaybeUninit::uninit(); (&mut lis3dsh_spi, &mut lis3dshspi) };}; } pub struct Lis3dshSpiComponent<S: 'static + spi::SpiMaster> { _select: PhantomData<S>, } impl<S: 'static + spi::SpiMaster> Lis3dshSpiComponent<S> { pub fn new() -> Lis3dshSpiComponent<S> { Lis3dshSpiComponent { _select: PhantomData, } } } impl<S: 'static + spi::SpiMaster> Component for Lis3dshSpiComponent<S> { type StaticInput = ( &'static VirtualSpiMasterDevice<'static, S>, &'static mut MaybeUninit<Lis3dshSpi<'static>>, ); type Output = &'static Lis3dshSpi<'static>; unsafe fn finalize(self, static_buffer: Self::StaticInput) -> Self::Output { let lis3dsh = static_init_half!( static_buffer.1, Lis3dshSpi<'static>, Lis3dshSpi::new( static_buffer.0, &mut my_capsules::lis3dsh::TXBUFFER, &mut my_capsules::lis3dsh::RXBUFFER ) ); static_buffer.0.set_client(lis3dsh); lis3dsh } }
// #![allow(dead_code)] // #![allow(unused_must_use)] // #![allow(unused_imports)] // #![allow(unused_variables)] #![allow(warnings)] #![feature(box_syntax)] #![cfg_attr(rustfmt, rustfmt_skip)] pub mod fragment_shaders; pub mod linux_display_opengl; pub mod vertex_shaders; pub mod types;
use clap::{App, Arg, ArgMatches}; use conv; use std::ops::Deref; pub fn build_app<'a>(name: &str) -> ArgMatches<'a> { App::new(format!("{} - Конвертер кодировок текста", name).as_ref()) .version("1.0.0") .author("Sergey Kacheev <uo0@ya.ru>") .about( format!("\n\ Конвертер текстов между кодировками {:?}\n\ По умолчанию утилита читает stdin и выводит результат на stdout\n\ Если указан флаг 'safety', то при первой ошибке декодирования\n\ символа источника утилита завершает свою работу. ", conv::SUPPORTED_CODES.deref() ).as_ref() ) .arg(Arg::with_name("from") .short("f") .long("from") .required(true) .takes_value(true) .help("Кодировка источника")) .arg(Arg::with_name("to") .short("t") .long("to") .required(true) .takes_value(true) .help("Кодировка результата"), ) .arg(Arg::with_name("output") .short("o") .long("output") .takes_value(true) .help("Имя фала для записи результата") ) .arg(Arg::with_name("safely") .short("s") .long("safely") .takes_value(false) .help("Прекратить конвертацию при первой ошибке") ) .arg(Arg::with_name("replace") .short("r") .long("replace") .takes_value(true) .help("Символ для замены ошибок декодирования 8 битных кодировок (по умолчанию '?')") ) .arg(Arg::with_name("SOURCE") .help("Файл для конвертации") ).get_matches() }
struct Person { name: String, age: i32 } impl Person { fn sayhi(&self) -> String { format!("Meu nome é {} eu tenho {} anos\n", self.name, self.age) } } fn main() { let person = Person { name: "Vilmar Catafesta".to_string(), age: 53}; print!("{}\n", person.sayhi()) }
use anyhow::Error; use fehler::throws; use std::io; use std::io::prelude::*; mod document; #[cfg(test)] mod tests; pub use crate::document::Document; #[throws(_)] fn main() { let mut input = String::new(); io::stdin().read_to_string(&mut input)?; let doc = Document::parse(&input)?; doc.to_writer(&mut io::stdout())?; }
// Copyright (c) The Starcoin Core Contributors // SPDX-License-Identifier: Apache-2.0 use forkable_jellyfish_merkle::proof::SparseMerkleProof; use serde::{Deserialize, Serialize}; use starcoin_config::ChainNetwork; use starcoin_crypto::{hash::PlainCryptoHash, HashValue}; use starcoin_rpc_api::node::NodeInfo; use starcoin_state_api::StateWithProof; use starcoin_types::block::{Block, BlockHeader}; use starcoin_types::peer_info::{PeerId, PeerInfo}; use starcoin_types::{account_address::AccountAddress, transaction::SignedUserTransaction, U256}; use starcoin_wallet_api::WalletAccount; use std::collections::HashMap; //TODO add a derive to auto generate View Object #[derive(Debug, Serialize, Deserialize)] pub struct AccountWithStateView { pub account: WalletAccount, // hex encoded bytes pub auth_key_prefix: String, pub sequence_number: Option<u64>, pub balances: HashMap<String, u64>, } #[derive(Debug, Serialize, Deserialize)] pub struct AccountView { pub sequence_number: Option<u64>, pub balance: Option<u64>, } #[derive(Debug, Serialize, Deserialize)] pub struct StateWithProofView { pub state: String, pub account_proof: SparseMerkleProof, pub account_state_proof: SparseMerkleProof, } impl From<StateWithProof> for StateWithProofView { fn from(state_proof: StateWithProof) -> Self { let account_state = hex::encode(state_proof.state.unwrap()); Self { state: account_state, account_proof: state_proof.proof.account_proof, account_state_proof: state_proof.proof.account_state_proof, } } } #[derive(Debug, Serialize, Deserialize)] pub struct BlockHeaderView { pub parent_hash: HashValue, pub number: u64, pub id: HashValue, pub author: AccountAddress, pub accumulator_root: HashValue, pub state_root: HashValue, pub gas_used: u64, } impl From<Block> for BlockHeaderView { fn from(block: Block) -> Self { BlockHeaderView::from(block.header) } } impl From<BlockHeader> for BlockHeaderView { fn from(header: BlockHeader) -> Self { Self { parent_hash: header.parent_hash, number: header.number, id: header.id(), author: header.author, accumulator_root: header.accumulator_root, state_root: header.state_root, gas_used: header.gas_used, } } } #[derive(Debug, Serialize, Deserialize)] pub struct TransactionView { pub id: HashValue, pub sender: AccountAddress, pub sequence_number: u64, pub gas_unit_price: u64, pub max_gas_amount: u64, } impl From<SignedUserTransaction> for TransactionView { fn from(txn: SignedUserTransaction) -> Self { Self { id: txn.raw_txn().crypto_hash(), sender: txn.sender(), sequence_number: txn.sequence_number(), gas_unit_price: txn.gas_unit_price(), max_gas_amount: txn.max_gas_amount(), } } } #[derive(Debug, Serialize, Deserialize)] pub struct PeerInfoView { pub peer_id: PeerId, pub latest_header: BlockHeaderView, pub total_difficulty: U256, } impl From<PeerInfo> for PeerInfoView { fn from(peer_info: PeerInfo) -> Self { Self { peer_id: peer_info.peer_id, latest_header: peer_info.latest_header.into(), total_difficulty: peer_info.total_difficulty, } } } #[derive(Debug, Serialize, Deserialize)] pub struct NodeInfoView { pub peer_info: PeerInfoView, pub self_address: String, pub net: ChainNetwork, } impl From<NodeInfo> for NodeInfoView { fn from(node_info: NodeInfo) -> Self { Self { peer_info: node_info.peer_info.into(), self_address: node_info.self_address, net: node_info.net, } } }
use crate::bytes::JsonBytes; use crate::{BlockNumber, Capacity, EpochNumber, ProposalShortId, Timestamp, Unsigned, Version}; use ckb_core::block::{Block as CoreBlock, BlockBuilder}; use ckb_core::header::{Header as CoreHeader, HeaderBuilder, Seal as CoreSeal}; use ckb_core::script::{Script as CoreScript, ScriptHashType as CoreScriptHashType}; use ckb_core::transaction::{ CellInput as CoreCellInput, CellOutPoint as CoreCellOutPoint, CellOutput as CoreCellOutput, OutPoint as CoreOutPoint, Transaction as CoreTransaction, TransactionBuilder, Witness as CoreWitness, }; use ckb_core::uncle::UncleBlock as CoreUncleBlock; use numext_fixed_hash::H256; use numext_fixed_uint::U256; use serde_derive::{Deserialize, Serialize}; #[derive(Clone, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub enum ScriptHashType { Data, Type, } impl Default for ScriptHashType { fn default() -> Self { ScriptHashType::Data } } impl From<ScriptHashType> for CoreScriptHashType { fn from(json: ScriptHashType) -> Self { match json { ScriptHashType::Data => CoreScriptHashType::Data, ScriptHashType::Type => CoreScriptHashType::Type, } } } impl From<CoreScriptHashType> for ScriptHashType { fn from(core: CoreScriptHashType) -> ScriptHashType { match core { CoreScriptHashType::Data => ScriptHashType::Data, CoreScriptHashType::Type => ScriptHashType::Type, } } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct Script { pub args: Vec<JsonBytes>, pub code_hash: H256, pub hash_type: ScriptHashType, } impl From<Script> for CoreScript { fn from(json: Script) -> Self { let Script { args, code_hash, hash_type, } = json; CoreScript::new( args.into_iter().map(JsonBytes::into_bytes).collect(), code_hash, hash_type.into(), ) } } impl From<CoreScript> for Script { fn from(core: CoreScript) -> Script { let (args, code_hash, hash_type) = core.destruct(); Script { code_hash, args: args.into_iter().map(JsonBytes::from_bytes).collect(), hash_type: hash_type.into(), } } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct CellOutput { pub capacity: Capacity, pub data_hash: H256, pub lock: Script, #[serde(rename = "type")] pub type_: Option<Script>, } impl From<CoreCellOutput> for CellOutput { fn from(core: CoreCellOutput) -> CellOutput { let (capacity, data_hash, lock, type_) = core.destruct(); CellOutput { capacity: Capacity(capacity), data_hash, lock: lock.into(), type_: type_.map(Into::into), } } } impl From<CellOutput> for CoreCellOutput { fn from(json: CellOutput) -> Self { let CellOutput { capacity, data_hash, lock, type_, } = json; let type_ = match type_ { Some(type_) => Some(type_.into()), None => None, }; CoreCellOutput::new(capacity.0, data_hash, lock.into(), type_) } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct CellOutPoint { pub tx_hash: H256, pub index: Unsigned, } impl From<CoreCellOutPoint> for CellOutPoint { fn from(core: CoreCellOutPoint) -> CellOutPoint { let (tx_hash, index) = core.destruct(); CellOutPoint { tx_hash, index: Unsigned(u64::from(index)), } } } impl From<CellOutPoint> for CoreCellOutPoint { fn from(json: CellOutPoint) -> Self { let CellOutPoint { tx_hash, index } = json; CoreCellOutPoint { tx_hash, index: index.0 as u32, } } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct OutPoint { pub cell: Option<CellOutPoint>, pub block_hash: Option<H256>, } impl From<CoreOutPoint> for OutPoint { fn from(core: CoreOutPoint) -> OutPoint { let (block_hash, cell) = core.destruct(); OutPoint { cell: cell.map(Into::into), block_hash: block_hash.map(Into::into), } } } impl From<OutPoint> for CoreOutPoint { fn from(json: OutPoint) -> Self { let OutPoint { cell, block_hash } = json; CoreOutPoint { cell: cell.map(Into::into), block_hash, } } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct CellInput { pub previous_output: OutPoint, pub since: Unsigned, } impl From<CoreCellInput> for CellInput { fn from(core: CoreCellInput) -> CellInput { let (previous_output, since) = core.destruct(); CellInput { previous_output: previous_output.into(), since: Unsigned(since), } } } impl From<CellInput> for CoreCellInput { fn from(json: CellInput) -> Self { let CellInput { previous_output, since, } = json; CoreCellInput::new(previous_output.into(), since.0) } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct Witness { data: Vec<JsonBytes>, } impl<'a> From<&'a CoreWitness> for Witness { fn from(core: &CoreWitness) -> Witness { Witness { data: core.iter().cloned().map(JsonBytes::from_bytes).collect(), } } } impl From<Witness> for CoreWitness { fn from(json: Witness) -> Self { json.data.into_iter().map(JsonBytes::into_bytes).collect() } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct Transaction { pub version: Version, pub deps: Vec<OutPoint>, pub inputs: Vec<CellInput>, pub outputs: Vec<CellOutput>, pub outputs_data: Vec<JsonBytes>, pub witnesses: Vec<Witness>, } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct TransactionView { #[serde(flatten)] pub inner: Transaction, pub hash: H256, } impl<'a> From<&'a CoreTransaction> for Transaction { fn from(core: &CoreTransaction) -> Self { Self { version: Version(core.version()), deps: core.deps().iter().cloned().map(Into::into).collect(), inputs: core.inputs().iter().cloned().map(Into::into).collect(), outputs: core.outputs().iter().cloned().map(Into::into).collect(), outputs_data: core .outputs_data() .iter() .cloned() .map(JsonBytes::from_bytes) .collect(), witnesses: core.witnesses().iter().map(Into::into).collect(), } } } impl<'a> From<&'a CoreTransaction> for TransactionView { fn from(core: &CoreTransaction) -> Self { Self { hash: core.hash().to_owned(), inner: core.into(), } } } impl From<Transaction> for CoreTransaction { fn from(json: Transaction) -> Self { let Transaction { version, deps, inputs, outputs, outputs_data, witnesses, } = json; TransactionBuilder::default() .version(version.0) .deps(deps) .inputs(inputs) .outputs(outputs) .outputs_data(outputs_data.into_iter().map(JsonBytes::into_bytes)) .witnesses(witnesses) .build() } } impl From<TransactionView> for CoreTransaction { fn from(json: TransactionView) -> Self { json.inner.into() } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct Seal { pub nonce: Unsigned, pub proof: JsonBytes, } impl From<CoreSeal> for Seal { fn from(core: CoreSeal) -> Seal { let (nonce, proof) = core.destruct(); Seal { nonce: Unsigned(nonce), proof: JsonBytes::from_bytes(proof), } } } impl From<Seal> for CoreSeal { fn from(json: Seal) -> Self { let Seal { nonce, proof } = json; CoreSeal::new(nonce.0, proof.into_bytes()) } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct Header { pub version: Version, pub parent_hash: H256, pub timestamp: Timestamp, pub number: BlockNumber, pub epoch: EpochNumber, pub transactions_root: H256, pub witnesses_root: H256, pub proposals_hash: H256, pub difficulty: U256, pub uncles_hash: H256, pub uncles_count: Unsigned, pub dao: JsonBytes, pub seal: Seal, } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct HeaderView { #[serde(flatten)] pub inner: Header, pub hash: H256, } impl<'a> From<&'a CoreHeader> for Header { fn from(core: &CoreHeader) -> Self { Self { version: Version(core.version()), parent_hash: core.parent_hash().to_owned(), timestamp: Timestamp(core.timestamp()), number: BlockNumber(core.number()), epoch: EpochNumber(core.epoch()), transactions_root: core.transactions_root().to_owned(), witnesses_root: core.witnesses_root().to_owned(), proposals_hash: core.proposals_hash().to_owned(), difficulty: core.difficulty().to_owned(), uncles_hash: core.uncles_hash().to_owned(), uncles_count: Unsigned(u64::from(core.uncles_count())), dao: JsonBytes::from_bytes(core.dao().to_owned()), seal: core.seal().to_owned().into(), } } } impl<'a> From<&'a CoreHeader> for HeaderView { fn from(core: &CoreHeader) -> Self { Self { hash: core.hash().to_owned(), inner: core.into(), } } } impl From<Header> for CoreHeader { fn from(json: Header) -> Self { let Header { version, parent_hash, timestamp, number, epoch, transactions_root, witnesses_root, proposals_hash, difficulty, uncles_hash, uncles_count, seal, dao, } = json; HeaderBuilder::default() .version(version.0) .parent_hash(parent_hash) .timestamp(timestamp.0) .number(number.0) .epoch(epoch.0) .transactions_root(transactions_root) .witnesses_root(witnesses_root) .proposals_hash(proposals_hash) .difficulty(difficulty) .uncles_hash(uncles_hash) .uncles_count(uncles_count.0 as u32) .seal(seal.into()) .dao(dao.into_bytes()) .build() } } impl From<HeaderView> for CoreHeader { fn from(json: HeaderView) -> Self { json.inner.into() } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct UncleBlock { pub header: Header, pub proposals: Vec<ProposalShortId>, } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct UncleBlockView { pub header: HeaderView, pub proposals: Vec<ProposalShortId>, } impl<'a> From<&'a CoreUncleBlock> for UncleBlock { fn from(core: &CoreUncleBlock) -> Self { Self { header: core.header().into(), proposals: core.proposals().iter().cloned().map(Into::into).collect(), } } } impl<'a> From<&'a CoreUncleBlock> for UncleBlockView { fn from(core: &CoreUncleBlock) -> Self { Self { header: core.header().into(), proposals: core.proposals().iter().cloned().map(Into::into).collect(), } } } impl From<UncleBlock> for CoreUncleBlock { fn from(json: UncleBlock) -> Self { let UncleBlock { header, proposals } = json; CoreUncleBlock::new( header.into(), proposals.into_iter().map(Into::into).collect::<Vec<_>>(), ) } } impl From<UncleBlockView> for CoreUncleBlock { fn from(json: UncleBlockView) -> Self { let UncleBlockView { header, proposals } = json; CoreUncleBlock::new( header.into(), proposals.into_iter().map(Into::into).collect::<Vec<_>>(), ) } } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct Block { pub header: Header, pub uncles: Vec<UncleBlock>, pub transactions: Vec<Transaction>, pub proposals: Vec<ProposalShortId>, } #[derive(Clone, Default, Serialize, Deserialize, PartialEq, Eq, Hash, Debug)] pub struct BlockView { pub header: HeaderView, pub uncles: Vec<UncleBlockView>, pub transactions: Vec<TransactionView>, pub proposals: Vec<ProposalShortId>, } impl<'a> From<&'a CoreBlock> for Block { fn from(core: &CoreBlock) -> Self { Self { header: core.header().into(), uncles: core.uncles().iter().map(Into::into).collect(), transactions: core.transactions().iter().map(Into::into).collect(), proposals: core.proposals().iter().cloned().map(Into::into).collect(), } } } impl<'a> From<&'a CoreBlock> for BlockView { fn from(core: &CoreBlock) -> Self { Self { header: core.header().into(), uncles: core.uncles().iter().map(Into::into).collect(), transactions: core.transactions().iter().map(Into::into).collect(), proposals: core.proposals().iter().cloned().map(Into::into).collect(), } } } impl From<Block> for CoreBlock { fn from(json: Block) -> Self { let Block { header, uncles, transactions, proposals, } = json; BlockBuilder::default() .header(header) .uncles(uncles) .transactions(transactions) .proposals(proposals) .build() } } impl From<BlockView> for CoreBlock { fn from(json: BlockView) -> Self { let BlockView { header, uncles, transactions, proposals, } = json; BlockBuilder::default() .header(header) .uncles(uncles) .transactions(transactions) .proposals(proposals) .build() } } #[cfg(test)] mod tests { use super::*; use ckb_core::script::ScriptHashType; use ckb_core::transaction::ProposalShortId as CoreProposalShortId; use ckb_core::{Bytes, Capacity}; use proptest::{collection::size_range, prelude::*}; fn mock_script(arg: Bytes) -> CoreScript { CoreScript::new(vec![arg], H256::default(), ScriptHashType::Data) } fn mock_cell_output(data: Bytes, arg: Bytes) -> CoreCellOutput { CoreCellOutput::new( Capacity::zero(), CoreCellOutput::calculate_data_hash(&data), CoreScript::default(), Some(mock_script(arg)), ) } fn mock_cell_input() -> CoreCellInput { CoreCellInput::new(CoreOutPoint::default(), 0) } fn mock_full_tx(data: Bytes, arg: Bytes) -> CoreTransaction { TransactionBuilder::default() .deps(vec![CoreOutPoint::default()]) .inputs(vec![mock_cell_input()]) .outputs(vec![mock_cell_output(data.clone(), arg.clone())]) .outputs_data(vec![data]) .witness(vec![arg]) .build() } fn mock_uncle() -> CoreUncleBlock { CoreUncleBlock::new( HeaderBuilder::default().build(), vec![CoreProposalShortId::default()], ) } fn mock_full_block(data: Bytes, arg: Bytes) -> CoreBlock { BlockBuilder::default() .transactions(vec![mock_full_tx(data, arg)]) .uncles(vec![mock_uncle()]) .proposals(vec![CoreProposalShortId::default()]) .build() } fn _test_block_convert(data: Bytes, arg: Bytes) -> Result<(), TestCaseError> { let block = mock_full_block(data, arg); let json_block: Block = (&block).into(); let encoded = serde_json::to_string(&json_block).unwrap(); let decode: Block = serde_json::from_str(&encoded).unwrap(); let decode_block: CoreBlock = decode.into(); prop_assert_eq!(decode_block, block); Ok(()) } proptest! { #[test] fn test_block_convert( data in any_with::<Vec<u8>>(size_range(80).lift()), arg in any_with::<Vec<u8>>(size_range(80).lift()), ) { _test_block_convert(Bytes::from(data), Bytes::from(arg))?; } } }
//! You can choose between multiple backends to store your session data. The easiest to manage is //! `SignedCookieBackend`. You need to compile with the `redis-backend` feature to use the Redis //! backend. mod signedcookie; pub use self::signedcookie::SignedCookieBackend; #[cfg(feature = "redis-backend")] mod redis; #[cfg(feature = "redis-backend")] pub use self::redis::RedisBackend;
use ash::version::DeviceV1_0; use ash::{vk, Device}; use handlegraph::handle::NodeId; use rustc_hash::FxHashSet; use std::ops::RangeInclusive; use nalgebra_glm as glm; use anyhow::*; use crate::view::View; use crate::vulkan::context::NodeRendererType; use crate::vulkan::GfaestusVk; use crate::{geometry::Point, vulkan::texture::GradientTexture}; use crate::vulkan::render_pass::Framebuffers; pub mod base; pub mod overlay; pub mod vertices; pub use base::*; pub use overlay::*; pub use vertices::*; pub struct NodePipelines { pub pipelines: OverlayPipelines, selection_descriptors: SelectionDescriptors, pub vertices: NodeVertices, device: Device, renderer_type: NodeRendererType, } impl NodePipelines { pub fn new(app: &GfaestusVk, selection_buffer: vk::Buffer) -> Result<Self> { let vk_context = app.vk_context(); let device = vk_context.device(); let renderer_type = vk_context.renderer_config.nodes; log::warn!("node_renderer_type: {:?}", renderer_type); let vertices = NodeVertices::new(renderer_type); let selection_descriptors = SelectionDescriptors::new(app, selection_buffer, 1)?; let pipelines = OverlayPipelines::new( app, renderer_type, selection_descriptors.layout, )?; Ok(Self { pipelines, vertices, selection_descriptors, device: device.clone(), renderer_type, }) } pub fn device(&self) -> &Device { &self.device } pub fn has_overlay(&self) -> bool { self.pipelines.overlay_set_id.is_some() } pub fn draw( &mut self, cmd_buf: vk::CommandBuffer, render_pass: vk::RenderPass, framebuffers: &Framebuffers, viewport_dims: [f32; 2], node_width: f32, view: View, offset: Point, background_color: rgb::RGB<f32>, overlay_id: usize, color_scheme: &GradientTexture, ) -> Result<()> { self.pipelines.write_overlay(overlay_id, color_scheme)?; let overlay = self.pipelines.overlays.get(&overlay_id).unwrap(); let device = &self.pipelines.device; let clear_values = { let bg = background_color; [ vk::ClearValue { color: vk::ClearColorValue { float32: [bg.r, bg.g, bg.b, 1.0], }, }, vk::ClearValue { color: vk::ClearColorValue { uint32: [0, 0, 0, 0], }, }, vk::ClearValue { color: vk::ClearColorValue { float32: [0.0, 0.0, 0.0, 1.0], }, }, ] }; let extent = vk::Extent2D { width: viewport_dims[0] as u32, height: viewport_dims[1] as u32, }; let render_pass_begin_info = vk::RenderPassBeginInfo::builder() .render_pass(render_pass) .framebuffer(framebuffers.nodes) .render_area(vk::Rect2D { offset: vk::Offset2D { x: 0, y: 0 }, extent, }) .clear_values(&clear_values) .build(); unsafe { device.cmd_begin_render_pass( cmd_buf, &render_pass_begin_info, vk::SubpassContents::INLINE, ) }; self.pipelines.bind_pipeline(device, cmd_buf, overlay.kind); let vx_bufs = [self.vertices.vertex_buffer]; let offsets = [0]; unsafe { device.cmd_bind_vertex_buffers(cmd_buf, 0, &vx_bufs, &offsets); } self.pipelines.bind_descriptor_sets( device, cmd_buf, overlay_id, self.selection_descriptors.descriptor_set, )?; let push_constants = NodePushConstants::new( [offset.x, offset.y], viewport_dims, view, node_width, 7, ); let pc_bytes = push_constants.bytes(); let layout = self.pipelines.pipeline_layout_kind(overlay.kind); unsafe { use vk::ShaderStageFlags as Flags; let mut stages = Flags::VERTEX | Flags::FRAGMENT; if self.renderer_type == NodeRendererType::TessellationQuads { stages |= Flags::TESSELLATION_CONTROL | Flags::TESSELLATION_EVALUATION; } device.cmd_push_constants(cmd_buf, layout, stages, 0, &pc_bytes) }; unsafe { device.cmd_draw(cmd_buf, self.vertices.vertex_count as u32, 1, 0, 0) }; // End render pass unsafe { device.cmd_end_render_pass(cmd_buf) }; Ok(()) } pub fn destroy(&mut self, app: &super::super::GfaestusVk) { let device = &self.device; unsafe { device.destroy_descriptor_set_layout( self.selection_descriptors.layout, None, ); device .destroy_descriptor_pool(self.selection_descriptors.pool, None); } self.vertices.destroy(app).unwrap(); self.pipelines.destroy(&app.allocator).unwrap(); } } pub struct SelectionDescriptors { pool: vk::DescriptorPool, layout: vk::DescriptorSetLayout, // TODO should be one per swapchain image descriptor_set: vk::DescriptorSet, // should not be owned by this, but MainView // buffer: vk::Buffer, } impl SelectionDescriptors { fn new( app: &GfaestusVk, buffer: vk::Buffer, image_count: u32, // msaa_samples: vk::SampleCountFlags, ) -> Result<Self> { let vk_context = app.vk_context(); let device = vk_context.device(); let layout = Self::create_descriptor_set_layout(device)?; let descriptor_pool = { let pool_size = vk::DescriptorPoolSize { ty: vk::DescriptorType::STORAGE_BUFFER, descriptor_count: image_count, }; let pool_sizes = [pool_size]; let pool_info = vk::DescriptorPoolCreateInfo::builder() .pool_sizes(&pool_sizes) .max_sets(image_count) .build(); unsafe { device.create_descriptor_pool(&pool_info, None) } }?; let descriptor_sets = { let layouts = vec![layout]; let alloc_info = vk::DescriptorSetAllocateInfo::builder() .descriptor_pool(descriptor_pool) .set_layouts(&layouts) .build(); unsafe { device.allocate_descriptor_sets(&alloc_info) } }?; for set in descriptor_sets.iter() { let buf_info = vk::DescriptorBufferInfo::builder() .buffer(buffer) .offset(0) .range(vk::WHOLE_SIZE) .build(); let buf_infos = [buf_info]; let descriptor_write = vk::WriteDescriptorSet::builder() .dst_set(*set) .dst_binding(0) .dst_array_element(0) .descriptor_type(vk::DescriptorType::STORAGE_BUFFER) .buffer_info(&buf_infos) .build(); let descriptor_writes = [descriptor_write]; unsafe { device.update_descriptor_sets(&descriptor_writes, &[]) } } Ok(Self { pool: descriptor_pool, layout, // TODO should be one per swapchain image descriptor_set: descriptor_sets[0], // should not be owned by this, but MainView // buffer, }) } fn layout_binding() -> vk::DescriptorSetLayoutBinding { use vk::ShaderStageFlags as Stages; vk::DescriptorSetLayoutBinding::builder() .binding(0) .descriptor_type(vk::DescriptorType::STORAGE_BUFFER) .descriptor_count(1) .stage_flags(Stages::FRAGMENT) .build() } fn create_descriptor_set_layout( device: &Device, ) -> Result<vk::DescriptorSetLayout> { let binding = Self::layout_binding(); let bindings = [binding]; let layout_info = vk::DescriptorSetLayoutCreateInfo::builder() .bindings(&bindings) .build(); let layout = unsafe { device.create_descriptor_set_layout(&layout_info, None) }?; Ok(layout) } } pub struct NodeIdBuffer { pub buffer: vk::Buffer, memory: vk::DeviceMemory, size: vk::DeviceSize, pub width: u32, pub height: u32, elem_size: u32, } impl NodeIdBuffer { pub fn read_rect( &self, device: &Device, x_range: RangeInclusive<u32>, y_range: RangeInclusive<u32>, ) -> FxHashSet<NodeId> { let min_x = (*x_range.start()).max(0); let max_x = (*x_range.end()).min(self.width - 1); let min_y = (*y_range.start()).max(0); let max_y = (*y_range.end()).min(self.height - 1); let mut values: FxHashSet<NodeId> = FxHashSet::default(); let rows = min_y..=max_y; let row_width = (max_x - min_x) as usize; unsafe { let data_ptr = device .map_memory( self.memory, 0, self.size, vk::MemoryMapFlags::empty(), ) .unwrap(); for y in rows { let row_start = ((y * self.width) + min_x) as usize; let val_ptr = (data_ptr as *const u32).add(row_start); let slice = std::slice::from_raw_parts(val_ptr, row_width); values.extend(slice.iter().filter_map(|&id| { if id == 0 { None } else { Some(NodeId::from(id as u64)) } })); } device.unmap_memory(self.memory); } values } pub fn read(&self, device: &Device, x: u32, y: u32) -> Option<u32> { if x >= self.width || y >= self.height { return None; } let value = unsafe { let data_ptr = device .map_memory( self.memory, 0, self.size, vk::MemoryMapFlags::empty(), ) .unwrap(); let x_offset = |x: u32, o: i32| -> u32 { let x = x as i32; (x + o).clamp(0, (self.width - 1) as i32) as u32 }; let y_offset = |y: u32, o: i32| -> u32 { let y = y as i32; (y + o).clamp(0, (self.height - 1) as i32) as u32 }; let to_ix = |x: u32, y: u32| -> usize { (y * self.width + x) as usize }; let index = (y * self.width + x) as usize; let ix_l = to_ix(x_offset(x, -1), y); let ix_r = to_ix(x_offset(x, 1), y); let ix_u = to_ix(x, y_offset(y, -1)); let ix_d = to_ix(x, y_offset(y, 1)); let indices = [index, ix_l, ix_r, ix_u, ix_d]; let mut value = 0; for &ix in indices.iter() { let val_ptr = (data_ptr as *const u32).add(ix); value = val_ptr.read(); if value != 0 { break; } } device.unmap_memory(self.memory); value }; if value == 0 { None } else { Some(value) } } pub fn new( app: &GfaestusVk, width: u32, height: u32, id_format: vk::Format, ) -> Result<Self> { use std::mem; let elem_size = match id_format { vk::Format::R32_UINT => Ok(mem::size_of::<u32>()), vk::Format::R32G32_UINT => Ok(mem::size_of::<[u32; 2]>()), vk::Format::R32G32B32_UINT => Ok(mem::size_of::<[u32; 3]>()), vk::Format::R32G32B32A32_UINT => Ok(mem::size_of::<[u32; 4]>()), _ => Err(anyhow!("Incompatible ID format")), }?; let img_size = (width * height * elem_size as u32) as vk::DeviceSize; let usage = vk::BufferUsageFlags::TRANSFER_DST | vk::BufferUsageFlags::STORAGE_BUFFER; let mem_props = vk::MemoryPropertyFlags::HOST_VISIBLE | vk::MemoryPropertyFlags::HOST_COHERENT | vk::MemoryPropertyFlags::HOST_CACHED; let (buffer, memory, size) = app.create_buffer(img_size, usage, mem_props)?; app.set_debug_object_name(buffer, "Node ID Buffer")?; Ok(Self { buffer, memory, size, width, height, elem_size: elem_size as u32, }) } pub fn destroy(&mut self, device: &Device) { unsafe { device.destroy_buffer(self.buffer, None); device.free_memory(self.memory, None); } self.buffer = vk::Buffer::null(); self.memory = vk::DeviceMemory::null(); self.size = 0 as vk::DeviceSize; self.width = 0; self.height = 0; } pub fn recreate( &mut self, app: &GfaestusVk, width: u32, height: u32, ) -> Result<()> { if self.width * self.height == width * height { return Ok(()); } self.destroy(app.vk_context().device()); let img_size = (width * height * self.elem_size) as vk::DeviceSize; let usage = vk::BufferUsageFlags::TRANSFER_DST | vk::BufferUsageFlags::STORAGE_BUFFER; let mem_props = vk::MemoryPropertyFlags::HOST_VISIBLE | vk::MemoryPropertyFlags::HOST_COHERENT; let (buffer, memory, size) = app.create_buffer(img_size, usage, mem_props)?; app.set_debug_object_name(buffer, "Node ID Buffer")?; self.buffer = buffer; self.memory = memory; self.size = size; self.width = width; self.height = height; Ok(()) } } pub struct NodePushConstants { view_transform: glm::Mat4, node_width: f32, scale: f32, viewport_dims: [f32; 2], texture_period: u32, } impl NodePushConstants { #[inline] pub fn new( offset: [f32; 2], viewport_dims: [f32; 2], view: crate::view::View, node_width: f32, texture_period: u32, ) -> Self { use crate::view; let model_mat = glm::mat4( 1.0, 0.0, 0.0, offset[0], 0.0, 1.0, 0.0, offset[1], 0.0, 0.0, 1.0, 0.0, 0.0, 0.0, 0.0, 1.0, ); let view_mat = view.to_scaled_matrix(); let width = viewport_dims[0]; let height = viewport_dims[1]; let viewport_mat = view::viewport_scale(width, height); let matrix = viewport_mat * view_mat * model_mat; Self { view_transform: matrix, node_width, viewport_dims, scale: view.scale, texture_period, } } #[inline] pub fn bytes(&self) -> [u8; 84] { use crate::view; let mut bytes = [0u8; 84]; let view_transform_array = view::mat4_to_array(&self.view_transform); { let mut offset = 0; let mut add_float = |f: f32| { let f_bytes = f.to_ne_bytes(); for i in 0..4 { bytes[offset] = f_bytes[i]; offset += 1; } }; for i in 0..4 { let row = view_transform_array[i]; for j in 0..4 { let val = row[j]; add_float(val); } } add_float(self.node_width); add_float(self.scale); add_float(self.viewport_dims[0]); add_float(self.viewport_dims[1]); } let u_bytes = self.texture_period.to_ne_bytes(); let mut offset = 80; for i in 0..4 { bytes[offset] = u_bytes[i]; offset += 1; } bytes } }
use crate::hittable::HitRecord; use crate::material::{Material, MaterialType, Scatter}; use crate::ray::Ray; use crate::texture::{Texture, TextureColor}; use crate::vec::Vec3; use rand::rngs::SmallRng; use std::sync::Arc; // Isotropic #[derive(Debug, Clone)] pub struct Isotropic { pub albedo: Texture, } impl Isotropic { pub fn new(albedo: Texture) -> Arc<MaterialType> { Arc::new(MaterialType::from(Isotropic { albedo: albedo })) } } impl Material for Isotropic { fn scatter(&self, rayin: &Ray, hit: &HitRecord, rng: &mut SmallRng) -> Option<Scatter> { let ray = Ray { origin: rayin.origin, direction: Vec3::random_in_unit_sphere(rng), time: rayin.time, }; let attenuation = self.albedo.value(hit.u, hit.v, hit.point); Some(Scatter { ray: ray, attenuation: attenuation, pdf: None, }) } }
use std::f64::consts::PI; #[allow( dead_code, non_camel_case_types, non_snake_case, non_upper_case_globals, unused_variables )] mod ffi_bindgen { include!(concat!(env!("OUT_DIR"), "/bindings_libint2.rs")); } #[allow(dead_code, unused_variables)] fn compute_eri( am1: i32, am2: i32, am3: i32, am4: i32, alpha1: f64, alpha2: f64, alpha3: f64, alpha4: f64, ra: &[f64; 3], rb: &[f64; 3], rc: &[f64; 3], rd: &[f64; 3], ) -> f64 { let gammap = alpha1 + alpha2; let px = (alpha1 * ra[0] + alpha2 * rb[0]) / gammap; let py = (alpha1 * ra[1] + alpha2 * rb[1]) / gammap; let pz = (alpha1 * ra[2] + alpha2 * rb[2]) / gammap; let pax = px - ra[0]; let pay = py - ra[1]; let paz = pz - ra[2]; let pbx = px - rb[0]; let pby = py - rb[1]; let pbz = pz - rb[2]; let ab2 = (ra[0] - rb[0]) * (ra[0] - rb[0]) + (ra[1] - rb[1]) * (ra[1] - rb[1]) + (ra[2] - rb[2]) * (ra[2] - rb[2]); let gammaq = alpha3 + alpha4; let gammapq = gammap * gammaq / (gammap + gammaq); let qx = (alpha3 * rc[0] + alpha4 * rd[0]) / gammaq; let qy = (alpha3 * rc[1] + alpha4 * rd[1]) / gammaq; let qz = (alpha3 * rc[2] + alpha4 * rd[2]) / gammaq; let qcx = qx - rc[0]; let qcy = qy - rc[1]; let qcz = qz - rc[2]; let qdx = qx - rd[0]; let qdy = qy - rd[1]; let qdz = qz - rd[2]; let cd2 = (rc[0] - rd[0]) * (rc[0] - rd[0]) + (rc[1] - rd[1]) * (rc[1] - rd[1]) + (rc[2] - rd[2]) * (rc[2] - rd[2]); let pqx = px - qx; let pqy = py - qy; let pqz = pz - qz; let pq2 = pqx * pqx + pqy * pqy + pqz * pqz; let wx = (gammap * px + gammaq * qx) / (gammap + gammaq); let wy = (gammap * py + gammaq * qy) / (gammap + gammaq); let wz = (gammap * pz + gammaq * qz) / (gammap + gammaq); let k1 = (-alpha1 * alpha2 * ab2 / gammap).exp(); let k2 = (-alpha3 * alpha4 * cd2 / gammaq).exp(); let pfac = 2.0 * PI.powf(2.5) * k1 * k2 / (gammap * gammaq * (gammap + gammaq).sqrt()); let am = am1 + am2 + am3 + am4; // TODO Boys let erieval = ffi_bindgen::Libint_t { PA_x: [pax], PA_y: [pay], PA_z: [paz], PB_x: [pbx], PB_y: [pby], PB_z: [pbz], AB_x: [ra[0] - rb[0]], AB_y: [ra[1] - rb[1]], AB_z: [ra[2] - rb[2]], oo2z: [0.5 / gammap], QC_x: [qcx], QC_y: [qcy], QC_z: [qcz], CD_x: [rc[0] - rd[0]], CD_y: [rc[1] - rd[1]], CD_z: [rc[2] - rd[2]], oo2e: [0.5 / gammaq], WP_x: [wx - px], WP_y: [wy - py], WP_z: [wz - pz], WQ_x: [wx - qx], WQ_y: [wy - qy], WQ_z: [wz - qz], oo2ze: [0.5 / (gammap + gammaq)], roz: [gammapq / gammap], roe: [gammapq / gammaq], contrdepth: 1, stack: unsafe { std::mem::zeroed() }, vstack: unsafe { std::mem::zeroed() }, targets: unsafe { std::mem::zeroed() }, veclen: ffi_bindgen::LIBINT2_MAX_VECLEN as i32, ..Default::default() }; let f = unsafe { ffi_bindgen::libint2_build_eri }[am1 as usize][am2 as usize][am3 as usize] [am4 as usize] .unwrap(); let erieval_ref = &erieval; let f2 = unsafe { f(erieval_ref) }; 0.0 } #[cxx::bridge] mod ffi { struct LibintContraction { l: i32, pure: bool, coeff: Vec<f64>, } struct LibintShell { alpha: Vec<f64>, contr: Vec<LibintContraction>, // origin: [f64; 3], origin: Vec<f64>, } enum LibintOperator { Overlap, Kinetic, Nuclear, ErfNuclear, ErfcNuclear, EMultipole1, EMultipole2, EMultipole3, SphEMultipole, Delta, Coulomb, Cgtg, CgtgTimesCoulomb, DelCgtgSquared, R12, ErfCoulomb, ErfcCoulomb, Stg, StgTimesCoulomb, } unsafe extern "C++" { include!("/usr/include/libint2/engine.h"); #[namespace = "libint2"] type Engine; include!("libint2/include/libint2_wrapper.hpp"); fn libint2_init(); fn libint2_finalize(); fn libint2_test_c_api( am1: i32, am2: i32, am3: i32, am4: i32, alpha1: f64, alpha2: f64, alpha3: f64, alpha4: f64, A: &Vec<f64>, B: &Vec<f64>, C: &Vec<f64>, D: &Vec<f64>, ); fn libint2_calc_boys_reference_single(T: f64, m: usize) -> f64; fn libint2_calc_boys_chebyshev7(T: f64, max_m: usize) -> UniquePtr<CxxVector<f64>>; fn libint2_create_engine( op: LibintOperator, max_nprim: usize, max_l: i32, ) -> UniquePtr<Engine>; } } // fn create_engine(oper: Operator, max_nprim: u64, max_l: i32) -> Engine {} #[cfg(test)] mod tests { use super::*; // use std::cmp; #[test] fn test_c_api() { //! A partial translation of the test at //! https://github.com/evaleev/libint/blob/3bf3a07b58650fe2ed4cd3dc6517d741562e1249/tests/unit/test-c-api.cc#L23. ffi::libint2_init(); let am1 = 1; let am2 = 1; let am3 = 1; let am4 = 1; let alpha1 = 1.1; let alpha2 = 2.3; let alpha3 = 3.4; let alpha4 = 4.8; let A = vec![0.0, 1.0, 2.0]; let B = vec![1.0, 2.0, 0.0]; let C = vec![2.0, 0.0, 1.0]; let D = vec![0.0, 1.0, 2.0]; ffi::libint2_test_c_api( am1, am2, am3, am4, alpha1, alpha2, alpha3, alpha4, &A, &B, &C, &D, ); // let sh1 = ffi::LibintShell { // alpha: vec![alpha1], // contr: vec![ffi::LibintContraction { // l: am1, // pure: false, // coeff: vec![1.0], // }], // origin: vec![0.0, 1.0, 2.0], // }; // let sh2 = ffi::LibintShell { // alpha: vec![alpha2], // contr: vec![ffi::LibintContraction { // l: am2, // pure: false, // coeff: vec![1.0], // }], // origin: vec![1.0, 2.0, 0.0], // }; // let sh3 = ffi::LibintShell { // alpha: vec![alpha3], // contr: vec![ffi::LibintContraction { // l: am3, // pure: false, // coeff: vec![1.0], // }], // origin: vec![2.0, 0.0, 1.0], // }; // let sh4 = ffi::LibintShell { // alpha: vec![alpha4], // contr: vec![ffi::LibintContraction { // l: am4, // pure: false, // coeff: vec![1.0], // }], // origin: vec![0.0, 1.0, 2.0], // }; // let shls = vec![sh1, sh2, sh3, sh4]; // let max_am = cmp::max(cmp::max(am1, am2), cmp::max(am3, am4)); // let engine = create_engine(Operator::Coulomb, 1, max_am); // let result = engine.compute(&shls); ffi::libint2_finalize(); } #[test] fn test_calc_boys() { println!("{}", ffi::libint2_calc_boys_reference_single(2.0, 2)); println!( "{:#?}", ffi::libint2_calc_boys_chebyshev7(2.0, 2) .iter() .collect::<Vec<_>>() ); } }
use ability::{Ability, AbilityFactory}; #[derive(Clone)] pub struct Player { name: String, strength: Ability, dexterity: Ability, constitution: Ability, intelligence: Ability, wisdom: Ability, charisma: Ability } pub struct PlayerBuilder { name: String, strength: Ability, dexterity: Ability, constitution: Ability, intelligence: Ability, wisdom: Ability, charisma: Ability } impl Player { pub fn get_name(&self) -> &String { &self.name } pub fn get_strength(&self) -> &Ability { &self.strength } pub fn get_dexterity(&self) -> &Ability { &self.dexterity } pub fn get_constitution(&self) -> &Ability { &self.constitution } pub fn get_intelligence(&self) -> &Ability { &self.intelligence } pub fn get_wisdom(&self) -> &Ability { &self.wisdom } pub fn get_charisma(&self) -> &Ability { &self.charisma } } impl PlayerBuilder { pub fn new() -> PlayerBuilder { PlayerBuilder { name: "None".to_string(), strength: AbilityFactory::new().finalize(), dexterity: AbilityFactory::new().finalize(), constitution: AbilityFactory::new().finalize(), intelligence: AbilityFactory::new().finalize(), wisdom: AbilityFactory::new().finalize(), charisma: AbilityFactory::new().finalize() } } pub fn name(&mut self, name: String) -> &mut PlayerBuilder { self.name = name; self } pub fn strength(&mut self, strength: Ability) -> &mut PlayerBuilder { self.strength = strength; self } pub fn dexterity(&mut self, dexterity: Ability) -> &mut PlayerBuilder { self.dexterity = dexterity; self } pub fn constitution(&mut self, constitution: Ability) -> &mut PlayerBuilder { self.constitution = constitution; self } pub fn intelligence(&mut self, intelligence: Ability) -> &mut PlayerBuilder { self.intelligence = intelligence; self } pub fn wisdom(&mut self, wisdom: Ability) -> &mut PlayerBuilder { self.wisdom = wisdom; self } pub fn charisma(&mut self, charisma: Ability) -> &mut PlayerBuilder { self.charisma = charisma; self } pub fn finalize(&mut self) -> Player { Player { name: self.name.clone(), strength: self.strength.clone(), dexterity: self.dexterity.clone(), constitution: self.constitution.clone(), intelligence: self.intelligence.clone(), wisdom: self.wisdom.clone(), charisma: self.charisma.clone() } } }
use method::Method; use response::Response; use address::Address; #[derive(Debug)] pub struct LogEntry { pub address: Address, pub method: Method, pub response: Response, } impl LogEntry { pub fn is_valid(&self) -> bool { self.address.is_valid() && self.method.is_valid() && self.response.is_valid() } } #[cfg(test)] mod tests { use super::*; #[test] fn all_empty() { let entry = LogEntry { address: Address::from(""), method: Method::from(""), response: Response::from("") }; assert_eq!(entry.is_valid(), false); } #[test] fn empty_address() { let entry = LogEntry { address: Address::from(""), method: Method::from("GET"), response: Response::from("200") }; assert_eq!(entry.is_valid(), false); } #[test] fn empty_method() { let entry = LogEntry { address: Address::from("1.1.1.1"), method: Method::from(""), response: Response::from("200") }; assert_eq!(entry.is_valid(), false); } #[test] fn empty_response() { let entry = LogEntry { address: Address::from("1.1.1.1"), method: Method::from("GET"), response: Response::from("") }; assert_eq!(entry.is_valid(), false); } #[test] fn valid() { let entry = LogEntry { address: Address::from("1.1.1.1"), method: Method::from("GET"), response: Response::from("200") }; assert_eq!(entry.is_valid(), true); } }
//! //! #[derive(Debug, Clone)] pub struct Permutation { state: Vec<usize>, status: Status, dim: usize, n: usize, end: Vec<usize>, } #[derive(Debug, Clone)] enum Status { Ini, Run, End } impl Permutation { pub fn new( dim: usize, n: usize ) -> Permutation { Permutation { state: (0..dim).collect(), status: Status::Ini, dim, n, end: (n-dim..n).rev().collect(), } } fn has_duplication(&self) -> bool { let mut list: Vec<bool> = vec![ false; self.n ]; for &i in self.state.iter() { if list[i] { return true; } else { list[i] = true; } } false } } #[cfg(feature = "streaming")] mod streaming_iterator { use super::{Permutation, Status}; use streaming_iterator::StreamingIterator; impl StreamingIterator for Permutation { type Item = [usize]; fn advance(&mut self) { match self.status { Status::Ini => { self.status = Status::Run; }, Status::Run => { if self.state == self.end { self.status = Status::End; } else { while { self.state[self.dim-1] += 1; for idx in (1..self.dim).rev() { if self.state[idx] == self.n { self.state[idx] = 0; self.state[idx-1] += 1; } } self.has_duplication() } {} } }, Status::End => {}, } } fn get(&self) -> Option<&[usize]> { match self.status { Status::Ini => None, Status::Run => Some(&self.state), Status::End => None, } } fn size_hint(&self) -> (usize,Option<usize>) { let size = (self.n-self.dim+1..self.n+1).fold(1, |prod, i| prod * i); ( 0, Some(size) ) } } } #[cfg(not(feature = "streaming"))] mod iterator { use super::{Permutation, Status}; use std::iter::Iterator; impl Iterator for Permutation { type Item = Vec<usize>; fn next(&mut self) -> Option<Vec<usize>> { match self.status { Status::Ini => { self.status = Status::Run; }, Status::Run => { if self.state == self.end { self.status = Status::End; } else { while { self.state[self.dim-1] += 1; for idx in (1..self.dim).rev() { if self.state[idx] == self.n { self.state[idx] = 0; self.state[idx-1] += 1; } } self.has_duplication() } {} } }, Status::End => {}, } match self.status { Status::Ini => None, Status::Run => Some(self.state.clone()), Status::End => None, } } fn size_hint(&self) -> (usize,Option<usize>) { let size = (self.n-self.dim+1..self.n+1).fold(1, |prod, i| prod * i); ( 0, Some(size) ) } } } #[cfg(test)] mod tests { use crate::*; #[test] fn permutation() { let dim = 2; let n = 8; let mut iter = Permutation::new( dim, n ); let mut count = 0; while let Some(idx) = iter.next() { count += 1; println!("{:?}", idx); } assert_eq!( count, n * (n-1) ); } #[test] fn datial() { let dim = 3; let n = 4; let mut iter = Permutation::new( dim, n ); assert_eq!( iter.next().unwrap(), &[0,1,2] ); assert_eq!( iter.next().unwrap(), &[0,1,3] ); assert_eq!( iter.next().unwrap(), &[0,2,1] ); assert_eq!( iter.next().unwrap(), &[0,2,3] ); assert_eq!( iter.next().unwrap(), &[0,3,1] ); assert_eq!( iter.next().unwrap(), &[0,3,2] ); assert_eq!( iter.next().unwrap(), &[1,0,2] ); assert_eq!( iter.next().unwrap(), &[1,0,3] ); assert_eq!( iter.next().unwrap(), &[1,2,0] ); assert_eq!( iter.next().unwrap(), &[1,2,3] ); assert_eq!( iter.next().unwrap(), &[1,3,0] ); assert_eq!( iter.next().unwrap(), &[1,3,2] ); assert_eq!( iter.next().unwrap(), &[2,0,1] ); assert_eq!( iter.next().unwrap(), &[2,0,3] ); assert_eq!( iter.next().unwrap(), &[2,1,0] ); assert_eq!( iter.next().unwrap(), &[2,1,3] ); assert_eq!( iter.next().unwrap(), &[2,3,0] ); assert_eq!( iter.next().unwrap(), &[2,3,1] ); assert_eq!( iter.next().unwrap(), &[3,0,1] ); assert_eq!( iter.next().unwrap(), &[3,0,2] ); assert_eq!( iter.next().unwrap(), &[3,1,0] ); assert_eq!( iter.next().unwrap(), &[3,1,2] ); assert_eq!( iter.next().unwrap(), &[3,2,0] ); assert_eq!( iter.next().unwrap(), &[3,2,1] ); assert_eq!( iter.next(), None ); } }