seq_id
string
text
string
repo_name
string
sub_path
string
file_name
string
file_ext
string
file_size_in_byte
int64
program_lang
string
lang
string
doc_type
string
stars
int64
dataset
string
pt
string
api
list
26238944709
# coding=utf-8 from __future__ import unicode_literals, absolute_import, print_function, division import errno import json import os.path import sys from sopel.tools import Identifier from sqlalchemy import create_engine, Column, ForeignKey, Integer, String from sqlalchemy.engine.url import URL from sqlalchemy.exc import OperationalError, SQLAlchemyError from sqlalchemy.ext.declarative import declarative_base from sqlalchemy.orm import scoped_session, sessionmaker if sys.version_info.major >= 3: unicode = str basestring = str def _deserialize(value): if value is None: return None # sqlite likes to return ints for strings that look like ints, even though # the column type is string. That's how you do dynamic typing wrong. value = unicode(value) # Just in case someone's mucking with the DB in a way we can't account for, # ignore json parsing errors try: value = json.loads(value) except ValueError: pass return value BASE = declarative_base() MYSQL_TABLE_ARGS = {'mysql_engine': 'InnoDB', 'mysql_charset': 'utf8mb4', 'mysql_collate': 'utf8mb4_unicode_ci'} class NickIDs(BASE): """ NickIDs SQLAlchemy Class """ __tablename__ = 'nick_ids' nick_id = Column(Integer, primary_key=True) class Nicknames(BASE): """ Nicknames SQLAlchemy Class """ __tablename__ = 'nicknames' __table_args__ = MYSQL_TABLE_ARGS nick_id = Column(Integer, ForeignKey('nick_ids.nick_id'), primary_key=True) slug = Column(String(255), primary_key=True) canonical = Column(String(255)) class NickValues(BASE): """ NickValues SQLAlchemy Class """ __tablename__ = 'nick_values' __table_args__ = MYSQL_TABLE_ARGS nick_id = Column(Integer, ForeignKey('nick_ids.nick_id'), primary_key=True) key = Column(String(255), primary_key=True) value = Column(String(255)) class ChannelValues(BASE): """ ChannelValues SQLAlchemy Class """ __tablename__ = 'channel_values' __table_args__ = MYSQL_TABLE_ARGS channel = Column(String(255), primary_key=True) key = Column(String(255), primary_key=True) value = Column(String(255)) class PluginValues(BASE): """ PluginValues SQLAlchemy Class """ __tablename__ = 'plugin_values' __table_args__ = MYSQL_TABLE_ARGS plugin = Column(String(255), primary_key=True) key = Column(String(255), primary_key=True) value = Column(String(255)) class SopelDB(object): """*Availability: 5.0+* This defines an interface for basic, common operations on a sqlite database. It simplifies those common operations, and allows direct access to the database, wherever the user has configured it to be. When configured with a relative filename, it is assumed to be in the directory set (or defaulted to) in the core setting ``homedir``. """ def __init__(self, config): # MySQL - mysql://username:password@localhost/db # SQLite - sqlite:////home/sopel/.sopel/default.db db_type = config.core.db_type # Handle SQLite explicitly as a default if db_type == 'sqlite': path = config.core.db_filename if path is None: path = os.path.join(config.core.homedir, config.basename + '.db') path = os.path.expanduser(path) if not os.path.isabs(path): path = os.path.normpath(os.path.join(config.core.homedir, path)) if not os.path.isdir(os.path.dirname(path)): raise OSError( errno.ENOENT, 'Cannot create database file. ' 'No such directory: "{}". Check that configuration setting ' 'core.db_filename is valid'.format(os.path.dirname(path)), path ) self.filename = path self.url = 'sqlite:///%s' % path # Otherwise, handle all other database engines else: query = {} if db_type == 'mysql': drivername = config.core.db_driver or 'mysql' query = {'charset': 'utf8mb4'} elif db_type == 'postgres': drivername = config.core.db_driver or 'postgresql' elif db_type == 'oracle': drivername = config.core.db_driver or 'oracle' elif db_type == 'mssql': drivername = config.core.db_driver or 'mssql+pymssql' elif db_type == 'firebird': drivername = config.core.db_driver or 'firebird+fdb' elif db_type == 'sybase': drivername = config.core.db_driver or 'sybase+pysybase' else: raise Exception('Unknown db_type') db_user = config.core.db_user db_pass = config.core.db_pass db_host = config.core.db_host db_port = config.core.db_port # Optional db_name = config.core.db_name # Optional, depending on DB # Ensure we have all our variables defined if db_user is None or db_pass is None or db_host is None: raise Exception('Please make sure the following core ' 'configuration values are defined: ' 'db_user, db_pass, db_host') self.url = URL(drivername=drivername, username=db_user, password=db_pass, host=db_host, port=db_port, database=db_name, query=query) self.engine = create_engine(self.url) # Catch any errors connecting to database try: self.engine.connect() except OperationalError: print("OperationalError: Unable to connect to database.") raise # Create our tables BASE.metadata.create_all(self.engine) self.ssession = scoped_session(sessionmaker(bind=self.engine)) def connect(self): """Return a raw database connection object.""" return self.engine.connect() def execute(self, *args, **kwargs): """Execute an arbitrary SQL query against the database. Returns a cursor object, on which things like `.fetchall()` can be called per PEP 249.""" with self.connect() as conn: return conn.execute(*args, **kwargs) def get_uri(self): """Returns a URL for the database, usable to connect with SQLAlchemy.""" return 'sqlite:///{}'.format(self.filename) # NICK FUNCTIONS def get_nick_id(self, nick, create=True): """Return the internal identifier for a given nick. This identifier is unique to a user, and shared across all of that user's aliases. If create is True, a new ID will be created if one does not already exist""" session = self.ssession() slug = nick.lower() try: nickname = session.query(Nicknames) \ .filter(Nicknames.slug == slug) \ .one_or_none() if nickname is None: if not create: raise ValueError('No ID exists for the given nick') # Generate a new ID nick_id = NickIDs() session.add(nick_id) session.commit() # Create a new Nickname nickname = Nicknames(nick_id=nick_id.nick_id, slug=slug, canonical=nick) session.add(nickname) session.commit() return nickname.nick_id except SQLAlchemyError: session.rollback() raise finally: session.close() def alias_nick(self, nick, alias): """Create an alias for a nick. Raises ValueError if the alias already exists. If nick does not already exist, it will be added along with the alias.""" nick = Identifier(nick) alias = Identifier(alias) nick_id = self.get_nick_id(nick) session = self.ssession() try: result = session.query(Nicknames) \ .filter(Nicknames.slug == alias.lower()) \ .filter(Nicknames.canonical == alias) \ .one_or_none() if result: raise ValueError('Given alias is the only entry in its group.') nickname = Nicknames(nick_id=nick_id, slug=alias.lower(), canonical=alias) session.add(nickname) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def set_nick_value(self, nick, key, value): """Sets the value for a given key to be associated with the nick.""" nick = Identifier(nick) value = json.dumps(value, ensure_ascii=False) nick_id = self.get_nick_id(nick) session = self.ssession() try: result = session.query(NickValues) \ .filter(NickValues.nick_id == nick_id) \ .filter(NickValues.key == key) \ .one_or_none() # NickValue exists, update if result: result.value = value session.commit() # DNE - Insert else: new_nickvalue = NickValues(nick_id=nick_id, key=key, value=value) session.add(new_nickvalue) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def delete_nick_value(self, nick, key): """Deletes the value for a given key associated with a nick.""" nick = Identifier(nick) nick_id = self.get_nick_id(nick) session = self.ssession() try: result = session.query(NickValues) \ .filter(NickValues.nick_id == nick_id) \ .filter(NickValues.key == key) \ .one_or_none() # NickValue exists, delete if result: session.delete(result) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def get_nick_value(self, nick, key): """Retrieves the value for a given key associated with a nick.""" nick = Identifier(nick) session = self.ssession() try: result = session.query(NickValues) \ .filter(Nicknames.nick_id == NickValues.nick_id) \ .filter(Nicknames.slug == nick.lower()) \ .filter(NickValues.key == key) \ .one_or_none() if result is not None: result = result.value return _deserialize(result) except SQLAlchemyError: session.rollback() raise finally: session.close() def unalias_nick(self, alias): """Removes an alias. Raises ValueError if there is not at least one other nick in the group. To delete an entire group, use `delete_group`. """ alias = Identifier(alias) nick_id = self.get_nick_id(alias, False) session = self.ssession() try: count = session.query(Nicknames) \ .filter(Nicknames.nick_id == nick_id) \ .count() if count <= 1: raise ValueError('Given alias is the only entry in its group.') session.query(Nicknames).filter(Nicknames.slug == alias.lower()).delete() session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def delete_nick_group(self, nick): """Removes a nickname, and all associated aliases and settings.""" nick = Identifier(nick) nick_id = self.get_nick_id(nick, False) session = self.ssession() try: session.query(Nicknames).filter(Nicknames.nick_id == nick_id).delete() session.query(NickValues).filter(NickValues.nick_id == nick_id).delete() session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def merge_nick_groups(self, first_nick, second_nick): """Merges the nick groups for the specified nicks. Takes two nicks, which may or may not be registered. Unregistered nicks will be registered. Keys which are set for only one of the given nicks will be preserved. Where multiple nicks have values for a given key, the value set for the first nick will be used. Note that merging of data only applies to the native key-value store. If modules define their own tables which rely on the nick table, they will need to have their merging done separately.""" first_id = self.get_nick_id(Identifier(first_nick)) second_id = self.get_nick_id(Identifier(second_nick)) session = self.ssession() try: # Get second_id's values res = session.query(NickValues).filter(NickValues.nick_id == second_id).all() # Update first_id with second_id values if first_id doesn't have that key for row in res: first_res = session.query(NickValues) \ .filter(NickValues.nick_id == first_id) \ .filter(NickValues.key == row.key) \ .one_or_none() if not first_res: self.set_nick_value(first_nick, row.key, _deserialize(row.value)) session.query(NickValues).filter(NickValues.nick_id == second_id).delete() session.query(Nicknames) \ .filter(Nicknames.nick_id == second_id) \ .update({'nick_id': first_id}) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() # CHANNEL FUNCTIONS def set_channel_value(self, channel, key, value): """Sets the value for a given key to be associated with the channel.""" channel = Identifier(channel).lower() value = json.dumps(value, ensure_ascii=False) session = self.ssession() try: result = session.query(ChannelValues) \ .filter(ChannelValues.channel == channel)\ .filter(ChannelValues.key == key) \ .one_or_none() # ChannelValue exists, update if result: result.value = value session.commit() # DNE - Insert else: new_channelvalue = ChannelValues(channel=channel, key=key, value=value) session.add(new_channelvalue) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def delete_channel_value(self, channel, key): """Deletes the value for a given key associated with a channel.""" channel = Identifier(channel).lower() session = self.ssession() try: result = session.query(ChannelValues) \ .filter(ChannelValues.channel == channel)\ .filter(ChannelValues.key == key) \ .one_or_none() # ChannelValue exists, delete if result: session.delete(result) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def get_channel_value(self, channel, key): """Retrieves the value for a given key associated with a channel.""" channel = Identifier(channel).lower() session = self.ssession() try: result = session.query(ChannelValues) \ .filter(ChannelValues.channel == channel)\ .filter(ChannelValues.key == key) \ .one_or_none() if result is not None: result = result.value return _deserialize(result) except SQLAlchemyError: session.rollback() raise finally: session.close() # PLUGIN FUNCTIONS def set_plugin_value(self, plugin, key, value): """Sets the value for a given key to be associated with a plugin.""" plugin = plugin.lower() value = json.dumps(value, ensure_ascii=False) session = self.ssession() try: result = session.query(PluginValues) \ .filter(PluginValues.plugin == plugin)\ .filter(PluginValues.key == key) \ .one_or_none() # PluginValue exists, update if result: result.value = value session.commit() # DNE - Insert else: new_pluginvalue = PluginValues(plugin=plugin, key=key, value=value) session.add(new_pluginvalue) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def delete_plugin_value(self, plugin, key): """Deletes the value for a given key associated with a plugin.""" plugin = plugin.lower() session = self.ssession() try: result = session.query(PluginValues) \ .filter(PluginValues.plugin == plugin)\ .filter(PluginValues.key == key) \ .one_or_none() # PluginValue exists, update if result: session.delete(result) session.commit() except SQLAlchemyError: session.rollback() raise finally: session.close() def get_plugin_value(self, plugin, key): """Retrieves the value for a given key associated with a plugin.""" plugin = plugin.lower() session = self.ssession() try: result = session.query(PluginValues) \ .filter(PluginValues.plugin == plugin)\ .filter(PluginValues.key == key) \ .one_or_none() if result is not None: result = result.value return _deserialize(result) except SQLAlchemyError: session.rollback() raise finally: session.close() # NICK AND CHANNEL FUNCTIONS def get_nick_or_channel_value(self, name, key): """Gets the value `key` associated to the nick or channel `name`.""" name = Identifier(name) if name.is_nick(): return self.get_nick_value(name, key) else: return self.get_channel_value(name, key) def get_preferred_value(self, names, key): """Gets the value for the first name which has it set. `names` is a list of channel and/or user names. Returns None if none of the names have the key set.""" for name in names: value = self.get_nick_or_channel_value(name, key) if value is not None: return value
examknow/Exambot-Source
sopel/db.py
db.py
py
19,385
python
en
code
2
github-code
6
[ { "api_name": "sys.version_info", "line_number": 17, "usage_type": "attribute" }, { "api_name": "json.loads", "line_number": 31, "usage_type": "call" }, { "api_name": "sqlalchemy.ext.declarative.declarative_base", "line_number": 37, "usage_type": "call" }, { "api_...
22916095420
#Create a gspread class and extract the data from the sheets #requires: # 1. Google API credentials json_key file path # 2. scope e.g. ['https://spreadsheets.google.com/feeds','https://www.googleapis.com/auth/drive'] # 3. gspread_url e.g. 'https://docs.google.com/spreadsheets/d/1itaohdPiAeniCXNlntNztZ_oRvjh0HsGuJXUJWET008/edit?usp=sharing' import gspread from oauth2client.service_account import ServiceAccountCredentials import pandas as pd class gspread_obj(object): """ Create a google spreadsheet instance to download sheet(s) and merge them Requires spreadsheet url and Google API json key file Examples: >>>> gc = gspread_obj() >>>> gc.login('home/user/google_api_key.json') >>>> gc.get_sheets('https://docs.google.com/spreadsheets/d/1itaohdPiAeniCXNlntNztZ_oRvjh0HsGuJXUJWET008/edit?usp=sharing') >>>> df = gc.merge_sheets() """ def __init__(self): self.scope = ['https://spreadsheets.google.com/feeds','https://www.googleapis.com/auth/drive'] self.client = None # gspread.Client object self.sheets = None def login(self, credentials_google: str): #set Google spreadsheet credentials credentials = ServiceAccountCredentials.from_json_keyfile_name(credentials_google, self.scope) self.client = gspread.authorize(credentials) def get_sheets(self, gspread_url: str): #Get Google sheet instance wks = self.client.open_by_url(gspread_url) self.sheets = wks.worksheets() def merge_sheets(self): if self.sheets is None: print('No sheets are found!') df = None elif len(self.sheets)==1: data = self.sheets[0].get_all_values() header = data.pop(0) df = pd.DataFrame(data, columns=header) elif len(self.sheets)>1: #read all the sheets df_list = [] for s in self.sheets: data = s.get_all_values() header = data.pop(0) df = pd.DataFrame(data, columns=header) df_list.append(df) df = pd.concat(df_list, axis=0, join='outer', sort=False) else: print("self.sheets must be a list of sheet(s)!") df = None if df is not None: print("Columns: ", df.columns) print("{} Rows x {} Columns".format(df.shape[0],df.shape[1])) return df
yenlow/utils
apis/google.py
google.py
py
2,442
python
en
code
1
github-code
6
[ { "api_name": "oauth2client.service_account.ServiceAccountCredentials.from_json_keyfile_name", "line_number": 33, "usage_type": "call" }, { "api_name": "oauth2client.service_account.ServiceAccountCredentials", "line_number": 33, "usage_type": "name" }, { "api_name": "gspread.auth...
35970918283
from __future__ import annotations __all__: list[str] = [] import argparse import subprocess import sys import cmn class _LintReturnCodes(cmn.ReturnCodes): """Return codes that can be received from pylint.""" SUCCESS = 0 # Error code 1 means a fatal error was hit ERROR = 2 WARNING = 4 ERROR_WARNING = 6 REFACTOR = 8 ERROR_REFACTOR = 10 WARNING_REFACTOR = 12 ERROR_WARNING_REFACTOR = 14 CONVENTION = 16 ERROR_CONVENTION = 18 WARNING_CONVENTION = 20 ERROR_WARNING_CONVENTION = 22 REFACTOR_CONVENTION = 24 ERROR_REFACTOR_CONVENTION = 26 WARNING_REFACTOR_CONVENTION = 28 ERROR_WARNING_REFACTOR_CONVENTION = 30 USAGE_ERROR = 32 COMMAND_NOT_FOUND = 200 def _run_lint(args: argparse.Namespace) -> int: """Runs pylint on python files in workspace. :param args: namespace object with args to run lint with. :return: return code from CLI. """ rc = _LintReturnCodes.SUCCESS include_files = cmn.get_python_files(args.untracked_files) cmd = [cmn.which_python(), "-m", "pylint"] + list(include_files) try: subprocess.run(cmd, check=True) except FileNotFoundError as exc: if exc.errno is cmn.WinErrorCodes.FILE_NOT_FOUND.value: cmn.handle_missing_package_error(exc.filename) rc = _LintReturnCodes.COMMAND_NOT_FOUND else: raise except subprocess.CalledProcessError as exc: cmn.handle_cli_error(_LintReturnCodes, exc.returncode, exc.cmd, exc) rc = _LintReturnCodes.USAGE_ERROR return rc def main() -> None: """Main function for pylint CLI. Parses and handles CLI input.""" parser = argparse.ArgumentParser(description="Run pylint on given files.") parser.add_argument( "-u", "--untracked-files", action="store_true", default=False, help="run on files untracked by git", ) args = parser.parse_args() rc = _run_lint(args) sys.exit(rc) if __name__ == "__main__": main()
kiransingh99/gurbani_analysis
tools/lint.py
lint.py
py
2,043
python
en
code
0
github-code
6
[ { "api_name": "cmn.ReturnCodes", "line_number": 12, "usage_type": "attribute" }, { "api_name": "argparse.Namespace", "line_number": 37, "usage_type": "attribute" }, { "api_name": "cmn.get_python_files", "line_number": 45, "usage_type": "call" }, { "api_name": "cmn...
7640577991
test = 2+3 # 答案存在指定test物件 test # 最後一行打指定物件名稱 import random x=[random.randint(0,100) for i in range(0,12)] x x0_str=str(x[0]) x0_str x_str=[str(x[i]) for i in range(0,len(x))] x_str x6_logi=x[6]<50 x6_logi x_logi=[x[i]<50 for i in range(0,len(x))] x_logi num_false=x_logi.count(False) num_false import pandas as pd df_business=pd.read_csv("http://data.gcis.nat.gov.tw/od/file?oid=340B4FDD-880E-4287-9289-F32782F792B8") dict_business=df_business.to_dict() address=list(dict_business['公司所在地'].values()) num_taoyuan=["桃園市" in address[i] for i in range(0,len(address))].count(True) num_taoyuan capital=list(dict_business['資本額'].values()) logi_largeCapital=[capital[i]>500000 for i in range(0,len(capital))] num_largeCapital=logi_largeCapital.count(True) num_largeCapital import requests response=requests.get("https://cloud.culture.tw/frontsite/trans/SearchShowAction.do?method=doFindTypeJ&category=3") danceInfo=response.json() numDance=len(danceInfo) numDance title1=danceInfo[0]['title'] title1 local1=danceInfo[0]['showInfo'][0]['location'] local1 time1=danceInfo[0]['showInfo'][0]['time'] time1 ## 解答一: 當showInfo不唯一但只考慮每個showInfo的第一個 danceInfoList=[{ 'title': danceInfo[i]['title'], 'time': danceInfo[i]['showInfo'][0]['time'], 'location': danceInfo[i]['showInfo'][0]['location'] } for i in range(0,len(danceInfo))] danceInfoList ## 解答二: danceInfoList2=list([]) for i in range(len(danceInfo)): title_i=danceInfo[i]['title'] for j in range(len(danceInfo[i]['showInfo'])): time_ij=danceInfo[i]['showInfo'][j]['time'] location_ij=danceInfo[i]['showInfo'][j]['location'] danceInfoList2.append({ 'title': title_i, 'time': time_ij, 'location': location_ij }) ## 解答一: 當showInfo不唯一但只考慮每個showInfo的第一個 danceInfoStr=['【{title}】將於{time}在{location}演出'.format( title=danceInfoList[i]['title'], time=danceInfoList[i]['time'], location=danceInfoList[i]['location']) for i in range(0,len(danceInfoList))] danceInfoStr ## 解答二: danceInfoStr2=['【{title}】將於{time}在{location}演出'.format( title=danceInfoList2[i]['title'], time=danceInfoList2[i]['time'], location=danceInfoList2[i]['location']) for i in range(0,len(danceInfoList2))] danceInfoStr2
godgodgod11101/course_mathEcon_practice_1081
hw1_ans.py
hw1_ans.py
py
2,367
python
en
code
0
github-code
6
[ { "api_name": "random.randint", "line_number": 4, "usage_type": "call" }, { "api_name": "pandas.read_csv", "line_number": 17, "usage_type": "call" }, { "api_name": "requests.get", "line_number": 27, "usage_type": "call" } ]
43247812084
import subprocess import os import shutil import pytest TEMP_DIRECTORY = os.path.join(os.path.dirname(__file__), '..', 'tmp') TEMP_HEADER = os.path.join(TEMP_DIRECTORY, 'header.h') TEMP_SOURCE = os.path.join(TEMP_DIRECTORY, 'source.c') def set_up(): os.mkdir(TEMP_DIRECTORY) def tear_down(): shutil.rmtree(TEMP_DIRECTORY) @pytest.fixture(autouse=True) def run_around_tests(): set_up() yield tear_down() def read_file_content(filepath: str) -> str: with open(filepath, 'r') as file: return file.read() def test_integration(): # given: resource_dir = os.path.join(os.path.dirname(__file__), 'resource') input_path = os.path.join(resource_dir, 'example_header.h') expected_header = os.path.join(resource_dir, 'example_mock.h') expected_source = os.path.join(resource_dir, 'example_mock.c') # when: subprocess.run([ 'python', '-m', 'c_mock_generator.generate_mock', '-i', input_path, '-oh', TEMP_HEADER, '-oc', TEMP_SOURCE], check=True) # then: assert os.path.isfile(TEMP_HEADER) assert os.path.isfile(TEMP_SOURCE) assert read_file_content(TEMP_HEADER) == read_file_content(expected_header) assert read_file_content(TEMP_SOURCE) == read_file_content(expected_source)
BjoernLange/C-Mock-Generator
tests/generate_mock_integration_test.py
generate_mock_integration_test.py
py
1,290
python
en
code
0
github-code
6
[ { "api_name": "os.path.join", "line_number": 7, "usage_type": "call" }, { "api_name": "os.path", "line_number": 7, "usage_type": "attribute" }, { "api_name": "os.path.dirname", "line_number": 7, "usage_type": "call" }, { "api_name": "os.path.join", "line_numbe...
28838106101
import numpy as np try: from math import prod except: from functools import reduce def prod(iterable): return reduce(operator.mul, iterable, 1) import zipfile import pickle import sys import ast import re from fickling.pickle import Pickled if sys.version_info >= (3, 9): from ast import unparse else: from astunparse import unparse NO_PICKLE_DEBUG = False ### Unpickling import: def my_unpickle(fb0): key_prelookup = {} class HackTensor: def __new__(cls, *args): #print(args) ident, storage_type, obj_key, location, obj_size = args[0][0:5] assert ident == 'storage' assert prod(args[2]) == obj_size ret = np.zeros(args[2], dtype=storage_type) if obj_key not in key_prelookup: key_prelookup[obj_key] = [] key_prelookup[obj_key].append((storage_type, obj_size, ret, args[2], args[3])) #print(f"File: {obj_key}, references: {len(key_prelookup[obj_key])}, size: {args[2]}, storage_type: {storage_type}") return ret class HackParameter: def __new__(cls, *args): #print(args) pass class Dummy: pass class MyPickle(pickle.Unpickler): def find_class(self, module, name): #print(module, name) if name == 'FloatStorage': return np.float32 if name == 'LongStorage': return np.int64 if name == 'HalfStorage': return np.float16 if module == "torch._utils": if name == "_rebuild_tensor_v2": return HackTensor elif name == "_rebuild_parameter": return HackParameter else: try: return pickle.Unpickler.find_class(self, module, name) except Exception: return Dummy def persistent_load(self, pid): return pid return MyPickle(fb0).load(), key_prelookup def fake_torch_load_zipped(fb0, load_weights=True): with zipfile.ZipFile(fb0, 'r') as myzip: folder_name = [a for a in myzip.namelist() if a.endswith("/data.pkl")] if len(folder_name)== 0: raise ValueError("Looke like the checkpoints file is in the wrong format") folder_name = folder_name[0].replace("/data.pkl" , "").replace("\\data.pkl" , "") with myzip.open(folder_name+'/data.pkl') as myfile: ret = my_unpickle(myfile) if load_weights: for k, v_arr in ret[1].items(): with myzip.open(folder_name + f'/data/{k}') as myfile: #print(f"Eating data file {k} now") file_data = myfile.read() for v in v_arr: if v[2].dtype == "object": print(f"issue assigning object on {k}") continue #weight = np.frombuffer(file_data, v[2].dtype).reshape(v[3]) #np.copyto(v[2], weight) np.copyto(v[2], np.frombuffer(file_data, v[2].dtype).reshape(v[3])) return ret[0] ### No-unpickling import: def extract_weights_from_checkpoint(fb0): torch_weights = {} torch_weights['state_dict'] = {} with zipfile.ZipFile(fb0, 'r') as myzip: folder_name = [a for a in myzip.namelist() if a.endswith("/data.pkl")] if len(folder_name)== 0: raise ValueError("Looks like the checkpoints file is in the wrong format") folder_name = folder_name[0].replace("/data.pkl" , "").replace("\\data.pkl" , "") with myzip.open(folder_name+'/data.pkl') as myfile: load_instructions = examine_pickle(myfile) for sd_key,load_instruction in load_instructions.items(): with myzip.open(folder_name + f'/data/{load_instruction.obj_key}') as myfile: if (load_instruction.load_from_file_buffer(myfile)): torch_weights['state_dict'][sd_key] = load_instruction.get_data() #if len(special_instructions) > 0: # torch_weights['state_dict']['_metadata'] = {} # for sd_key,special in special_instructions.items(): # torch_weights['state_dict']['_metadata'][sd_key] = special return torch_weights def examine_pickle(fb0, return_special=False): ## return_special: ## A rabbit hole I chased trying to debug a model that wouldn't import that had 1300 metadata statements ## If for some reason it's needed in the future turn it on. It is passed into the class AssignInstructions and ## if turned on collect_special will be True ## ## If, by 2023, this hasn't been required, I would strip it out. #turn the pickle file into text we can parse decompiled = unparse(Pickled.load(fb0).ast).splitlines() ## Parsing the decompiled pickle: ## LINES WE CARE ABOUT: ## 1: this defines a data file and what kind of data is in it ## _var1 = _rebuild_tensor_v2(UNPICKLER.persistent_load(('storage', HalfStorage, '0', 'cpu', 11520)), 0, (320, 4, 3, 3), (36, 9, 3, 1), False, _var0) ## ## 2: this massive line assigns the previous data to dictionary entries ## _var2262 = {'model.diffusion_model.input_blocks.0.0.weight': _var1, [..... continue for ever]} ## ## 3: this massive line also assigns values to keys, but does so differently ## _var2262.update({ 'cond_stage_model.transformer.text_model.encoder.layers.3.layer_norm2.bias': _var2001, [ .... and on and on ]}) ## ## 4: in some pruned models, the last line is instead a combination of 2/3 into the final variable: ## result = {'model.diffusion_model.input_blocks.0.0.weight': _var1, 'model.diffusion_model.input_blocks.0.0.bias': _var3, } ## ## that's it # make some REs to match the above. re_rebuild = re.compile('^_var\d+ = _rebuild_tensor_v2\(UNPICKLER\.persistent_load\(\(.*\)$') re_assign = re.compile('^_var\d+ = \{.*\}$') re_update = re.compile('^_var\d+\.update\(\{.*\}\)$') re_ordered_dict = re.compile('^_var\d+ = OrderedDict\(\)$') re_result = re.compile('^result = \{.*\}$') load_instructions = {} assign_instructions = AssignInstructions() for line in decompiled: ## see if line matches patterns of lines we care about: line = line.strip() if re_rebuild.match(line): variable_name, load_instruction = line.split(' = ', 1) load_instructions[variable_name] = LoadInstruction(line, variable_name) elif re_assign.match(line) or re_result.match(line): assign_instructions.parse_assign_line(line) elif re_update.match(line): assign_instructions.parse_update_line(line) elif re_ordered_dict.match(line): #do nothing continue elif NO_PICKLE_DEBUG: print(f'unmatched line: {line}') if NO_PICKLE_DEBUG: print(f"Found {len(load_instructions)} load instructions") assign_instructions.integrate(load_instructions) if return_special: return assign_instructions.integrated_instructions, assign_instructions.special_instructions return assign_instructions.integrated_instructions class AssignInstructions: def __init__(self, collect_special=False): self.instructions = {} self.special_instructions = {} self.integrated_instructions = {} self.collect_special = collect_special; def parse_result_line(self, line): garbage, huge_mess = line.split(' = {', 1) assignments = huge_mess.split(', ') del huge_mess assignments[-1] = assignments[-1].strip('}') #compile RE here to avoid doing it every loop iteration: re_var = re.compile('^_var\d+$') assignment_count = 0 for a in assignments: if self._add_assignment(a, re_var): assignment_count = assignment_count + 1 if NO_PICKLE_DEBUG: print(f"Added/merged {assignment_count} assignments. Total of {len(self.instructions)} assignment instructions") def parse_assign_line(self, line): # input looks like this: # _var2262 = {'model.diffusion_model.input_blocks.0.0.weight': _var1, 'model.diffusion_model.input_blocks.0.0.bias': _var3,\ # ...\ # 'cond_stage_model.transformer.text_model.encoder.layers.3.layer_norm2.weight': _var1999} # input looks like the above, but with 'result' in place of _var2262: # result = {'model.diffusion_model.input_blocks.0.0.weight': _var1, ... } # # or also look like: # result = {'state_dict': _var2314} # ... which will be ignored later garbage, huge_mess = line.split(' = {', 1) assignments = huge_mess.split(', ') del huge_mess assignments[-1] = assignments[-1].strip('}') #compile RE here to avoid doing it every loop iteration: re_var = re.compile('^_var\d+$') assignment_count = 0 for a in assignments: if self._add_assignment(a, re_var): assignment_count = assignment_count + 1 if NO_PICKLE_DEBUG: print(f"Added/merged {assignment_count} assignments. Total of {len(self.instructions)} assignment instructions") def _add_assignment(self, assignment, re_var): # assignment can look like this: # 'cond_stage_model.transformer.text_model.encoder.layers.3.self_attn.out_proj.weight': _var2009 # or assignment can look like this: # 'embedding_manager.embedder.transformer.text_model.encoder.layers.6.mlp.fc1': {'version': 1} sd_key, fickling_var = assignment.split(': ', 1) sd_key = sd_key.strip("'") if sd_key != 'state_dict' and re_var.match(fickling_var): self.instructions[sd_key] = fickling_var return True elif self.collect_special: # now convert the string "{'version': 1}" into a dictionary {'version': 1} entries = fickling_var.split(',') special_dict = {} for e in entries: e = e.strip("{}") k, v = e.split(': ') k = k.strip("'") v = v.strip("'") special_dict[k] = v self.special_instructions[sd_key] = special_dict return False def integrate(self, load_instructions): unfound_keys = {} for sd_key, fickling_var in self.instructions.items(): if fickling_var in load_instructions: self.integrated_instructions[sd_key] = load_instructions[fickling_var] else: if NO_PICKLE_DEBUG: print(f"no load instruction found for {sd_key}") if NO_PICKLE_DEBUG: print(f"Have {len(self.integrated_instructions)} integrated load/assignment instructions") def parse_update_line(self, line): # input looks like: # _var2262.update({'cond_stage_model.transformer.text_model.encoder.layers.3.layer_norm2.bias': _var2001,\ # 'cond_stage_model.transformer.text_model.encoder.layers.4.self_attn.k_proj.weight': _var2003,\ # ...\ #'cond_stage_model.transformer.text_model.final_layer_norm.bias': _var2261}) garbage, huge_mess = line.split('({', 1) updates = huge_mess.split(', ') del huge_mess updates[-1] = updates[-1].strip('})') re_var = re.compile('^_var\d+$') update_count = 0 for u in updates: if self._add_assignment(u, re_var): update_count = update_count + 1 if NO_PICKLE_DEBUG: print(f"Added/merged {update_count} updates. Total of {len(self.instructions)} assignment instructions") class LoadInstruction: def __init__(self, instruction_string, variable_name, extra_debugging = False): self.ident = False self.storage_type = False self.obj_key = False self.location = False #unused self.obj_size = False self.stride = False #unused self.data = False self.variable_name = variable_name self.extra_debugging = extra_debugging self.parse_instruction(instruction_string) def parse_instruction(self, instruction_string): ## this function could probably be cleaned up/shortened. ## this is the API def for _rebuild_tensor_v2: ## _rebuild_tensor_v2(storage, storage_offset, size, stride, requires_grad, backward_hooks): # ## sample instruction from decompiled pickle: # _rebuild_tensor_v2(UNPICKLER.persistent_load(('storage', HalfStorage, '0', 'cpu', 11520)), 0, (320, 4, 3, 3), (36, 9, 3, 1), False, _var0) # # the following comments will show the output of each string manipulation as if it started with the above. if self.extra_debugging: print(f"input: '{instruction_string}'") garbage, storage_etc = instruction_string.split('((', 1) # storage_etc = 'storage', HalfStorage, '0', 'cpu', 11520)), 0, (320, 4, 3, 3), (36, 9, 3, 1), False, _var0) if self.extra_debugging: print("storage_etc, reference: ''storage', HalfStorage, '0', 'cpu', 11520)), 0, (320, 4, 3, 3), (36, 9, 3, 1), False, _var0)'") print(f"storage_etc, actual: '{storage_etc}'\n") storage, etc = storage_etc.split('))', 1) # storage = 'storage', HalfStorage, '0', 'cpu', 11520 # etc = , 0, (320, 4, 3, 3), (36, 9, 3, 1), False, _var0) if self.extra_debugging: print("storage, reference: ''storage', HalfStorage, '0', 'cpu', 11520'") print(f"storage, actual: '{storage}'\n") print("etc, reference: ', 0, (320, 4, 3, 3), (36, 9, 3, 1), False, _var0)'") print(f"etc, actual: '{etc}'\n") ## call below maps to: ('storage', HalfStorage, '0', 'cpu', 11520) self.ident, self.storage_type, self.obj_key, self.location, self.obj_size = storage.split(', ', 4) self.ident = self.ident.strip("'") self.obj_key = self.obj_key.strip("'") self.location = self.location.strip("'") self.obj_size = int(self.obj_size) self.storage_type = self._torch_to_numpy(self.storage_type) if self.extra_debugging: print(f"{self.ident}, {self.obj_key}, {self.location}, {self.obj_size}, {self.storage_type}") assert (self.ident == 'storage') garbage, etc = etc.split(', (', 1) # etc = 320, 4, 3, 3), (36, 9, 3, 1), False, _var0) if self.extra_debugging: print("etc, reference: '320, 4, 3, 3), (36, 9, 3, 1), False, _var0)'") print(f"etc, actual: '{etc}'\n") size, stride, garbage = etc.split('), ', 2) # size = 320, 4, 3, 3 # stride = (36, 9, 3, 1 stride = stride.strip('(,') size = size.strip(',') if (size == ''): # rare case where there is an empty tuple. SDv1.4 has two of these. self.size_tuple = () else: self.size_tuple = tuple(map(int, size.split(', '))) if (stride == ''): self.stride = () else: self.stride = tuple(map(int, stride.split(', '))) if self.extra_debugging: print(f"size: {self.size_tuple}, stride: {self.stride}") prod_size = prod(self.size_tuple) assert prod(self.size_tuple) == self.obj_size # does the size in the storage call match the size tuple # zero out the data self.data = np.zeros(self.size_tuple, dtype=self.storage_type) @staticmethod def _torch_to_numpy(storage_type): if storage_type == 'FloatStorage': return np.float32 if storage_type == 'HalfStorage': return np.float16 if storage_type == 'LongStorage': return np.int64 if storage_type == 'IntStorage': return np.int32 raise Exception("Storage type not defined!") def load_from_file_buffer(self, fb): if self.data.dtype == "object": print(f"issue assigning object on {self.obj_key}") return False else: np.copyto(self.data, np.frombuffer(fb.read(), self.data.dtype).reshape(self.size_tuple)) return True def get_data(self): return self.data
divamgupta/diffusionbee-stable-diffusion-ui
backends/model_converter/fake_torch.py
fake_torch.py
py
15,028
python
en
code
11,138
github-code
6
[ { "api_name": "functools.reduce", "line_number": 8, "usage_type": "call" }, { "api_name": "sys.version_info", "line_number": 16, "usage_type": "attribute" }, { "api_name": "math.prod", "line_number": 32, "usage_type": "call" }, { "api_name": "numpy.zeros", "li...
71409709627
############################### ####### SETUP (OVERALL) ####### ############################### ## Import statements # Import statements import os from flask import Flask, render_template, session, redirect, url_for, flash, request from flask_wtf import FlaskForm from wtforms import StringField, SubmitField, RadioField, ValidationError # Note that you may need to import more here! Check out examples that do what you want to figure out what. from wtforms.validators import Required, Length # Here, too from flask_sqlalchemy import SQLAlchemy import json import requests ## App setup code app = Flask(__name__) app.debug = True app.use_reloader = True app.config['SECRET_KEY'] = 'pokemonpokemon' ## All app.config values app.config["SQLALCHEMY_DATABASE_URI"] = "postgresql://localhost/Midterm-katmazan" ## Provided: app.config['SQLALCHEMY_COMMIT_ON_TEARDOWN'] = True app.config['SQLALCHEMY_TRACK_MODIFICATIONS'] = False ## Statements for db setup (and manager setup if using Manager) db = SQLAlchemy(app) ###################################### ######## HELPER FXNS (If any) ######## ###################################### ################## ##### MODELS ##### ################## class Name(db.Model): __tablename__ = "names" id = db.Column(db.Integer,primary_key=True) name = db.Column(db.String) height_value = db.Column(db.Integer, db.ForeignKey('heights.id')) weight_value = db.Column(db.Integer, db.ForeignKey('weights.id')) def __repr__(self): return ('{' + str(self.name) + '} | ID: {' + str(self.id) + '}') class Height(db.Model): __tablename__ = 'heights' id = db.Column(db.Integer, primary_key=True) poke_height = db.Column(db.Integer) poke_name = db.Column(db.String) names = db.relationship('Name',backref='Height') class Weight(db.Model): __tablename__ = 'weights' id = db.Column(db.Integer,primary_key=True) poke_name = db.Column(db.String) poke_weight = db.Column(db.Integer) names = db.relationship('Name',backref='Weight') ################### ###### FORMS ###### ################### class NameForm(FlaskForm): name = StringField("Pokemon_name",validators=[Required()]) submit = SubmitField() def validate_name(self, field): if len(field.data) <= 1: raise ValidationError('Pokemon does not exist') class FavoriteForm(FlaskForm): fav_name = StringField("Add one of your favorite Pokemon:") nick_name = StringField("Give your favorite a nickname:") submit = SubmitField() def validate_nick_name(self,field): if field.data[-1] != 'y': raise ValidationError("Your nickname must end in y!") class RankForm(FlaskForm): name = StringField('Enter a Pokemon name:', validators = [Required()]) rate = RadioField('Rate this pokemon in terms of how powerful you think it is', choices = [('1', '1 (low)'), ('2', '2'), ('3', '3 (high)')]) submit = SubmitField('Submit') ####################### ###### VIEW FXNS ###### ####################### @app.errorhandler(404) def page_not_found(e): return render_template('404_error.html'), 404 @app.route('/', methods = ['GET', 'POST']) def home(): form = NameForm() # User should be able to enter name after name and each one will be saved, even if it's a duplicate! Sends data with GET if form.validate_on_submit(): poke_name = form.name.data pokemon = Name.query.filter_by(name=poke_name).first() ##only adds pokemon if it is not in database if not pokemon: params = {} params['name'] = str(poke_name) print(params) response = requests.get('http://pokeapi.co/api/v2/pokemon/' + params['name'] + '/') ##if response.status_code != '200': ##return("The data you entered was not available in the data, check spelling") poke_height = int(json.loads(response.text)['height']) new_height = Height(poke_height = poke_height, poke_name = poke_name) db.session.add(new_height) db.session.commit() poke_weight = int(json.loads(response.text)['weight']) new_weight = Weight(poke_weight = poke_weight, poke_name = poke_name) db.session.add(new_weight) db.session.commit() print('hello') newname = Name(name = poke_name, height_value = new_height.id, weight_value = new_weight.id) db.session.add(newname) db.session.commit() return redirect(url_for('all_names')) errors = [v for v in form.errors.values()] if len(errors) > 0: flash("!!!! ERRORS IN FORM SUBMISSION - " + str(errors)) return render_template('base.html',form=form) @app.route('/names') def all_names(): names = Name.query.all() return render_template('name_example.html',names=names) @app.route('/tallest') def tallest_pokemon(): all_heights = Height.query.all() tallest_pokemon = 0 for h in all_heights: height = h.poke_height if height > tallest_pokemon: tallest_pokemon = height tp = h tallest = tp.poke_name height = tp.poke_height return render_template('tallest_pokemon.html', tallest = tallest, height = height, names = all_heights) @app.route('/heaviest') def heaviest_pokemon(): all_weights = Weight.query.all() heaviest_pokemon = 0 for w in all_weights: weight = w.poke_weight if weight > heaviest_pokemon: heaviest_pokemon = weight hp = w heaviest = hp.poke_name weight = hp.poke_weight return render_template('heaviest.html', heaviest = heaviest, weight = weight, names = all_weights) @app.route('/favorite_pokemon') def favorite_form(): form = FavoriteForm() return render_template('favorite_form.html', form = form) @app.route('/fav_answers',methods=["GET","POST"]) def show_favs(): form = FavoriteForm() if request.args: fav_name = form.fav_name.data nickname = form.nick_name.data return render_template('fav_results.html',fav_name=fav_name, nick_name=nickname) flash(form.errors) return redirect(url_for('favorite_form')) ## Code to run the application... # Put the code to do so here! # NOTE: Make sure you include the code you need to initialize the database structure when you run the application! if __name__ == '__main__': db.create_all() # Will create any defined models when you run the application app.run(use_reloader=True,debug=True) # The usual
katmazan/SI364midtermKatmazan
SI364midterm.py
SI364midterm.py
py
6,662
python
en
code
0
github-code
6
[ { "api_name": "flask.Flask", "line_number": 17, "usage_type": "call" }, { "api_name": "flask_sqlalchemy.SQLAlchemy", "line_number": 28, "usage_type": "call" }, { "api_name": "flask_wtf.FlaskForm", "line_number": 67, "usage_type": "name" }, { "api_name": "wtforms.S...
36273427497
from collections import namedtuple import itertools import torch import numpy as np from sklearn.feature_extraction.text import TfidfVectorizer import torch.nn.functional as F import data_utils import train_utils from models import BinaryClassifier, LSTM, CNN import part2_train_utils import helpers ############################################################################## # Settings ############################################################################## CUDA = False ############################################################################## # Load the dataset ############################################################################## Data = namedtuple("Data", "corpus train dev test embeddings word_to_index") data_utils.download_ask_ubuntu_dataset() EMBEDDINGS, WORD_TO_INDEX = data_utils.load_part2_embeddings() ASK_UBUNTU_CORPUS = data_utils.load_corpus(WORD_TO_INDEX) ASK_UBUNTU_TRAIN_DATA = data_utils.load_train_data() ASK_UBUNTU_DEV_DATA, ASK_UBUNTU_TEST_DATA = data_utils.load_eval_data() ASK_UBUNTU_DATA = Data(ASK_UBUNTU_CORPUS, ASK_UBUNTU_TRAIN_DATA,\ ASK_UBUNTU_DEV_DATA, ASK_UBUNTU_TEST_DATA,\ EMBEDDINGS, WORD_TO_INDEX) data_utils.download_android_dataset() ANDROID_CORPUS = data_utils.load_android_corpus(WORD_TO_INDEX) ANDROID_DEV_DATA, ANDROID_TEST_DATA = data_utils.load_android_eval_data() ANDROID_DATA = Data(ANDROID_CORPUS, None,\ ANDROID_DEV_DATA, ANDROID_TEST_DATA,\ EMBEDDINGS, WORD_TO_INDEX) ############################################################################## # Train and evaluate a baseline TFIDF model ############################################################################## TOKENIZED_ANDROID_CORPUS = data_utils.load_tokenized_android_corpus() TOKENIZED_ANDROID_CORPUS = [ entry.title + entry.body for entry in TOKENIZED_ANDROID_CORPUS.values() ] TFIDF_VECTORIZER = TfidfVectorizer() TFIDF_VECTORS = TFIDF_VECTORIZER.fit_transform(TOKENIZED_ANDROID_CORPUS) QUERY_TO_INDEX = dict(zip(ANDROID_DATA.corpus.keys(), range(len(ANDROID_DATA.corpus)))) AUC = helpers.evaluate_tfidf_auc(ANDROID_DATA.dev, TFIDF_VECTORS, QUERY_TO_INDEX) print("AUC", AUC) AUC = helpers.evaluate_tfidf_auc(ANDROID_DATA.test, TFIDF_VECTORS, QUERY_TO_INDEX) print("AUC", AUC) ############################################################################## # Train models by direct transfer and evaluate ############################################################################## RESULTS = [] MARGINS = [0.2] MAX_EPOCHS = 50 BATCH_SIZE = 32 FILTER_WIDTHS = [3] POOL_METHOD = "average" FEATURE_DIMS = [667] DROPOUT_PS = [0.1] NUM_HIDDEN_UNITS = [240] LEARNING_RATES = [1E-3] MODELS = [] LSTM_HYPERPARAMETERS = itertools.product(MARGINS, NUM_HIDDEN_UNITS, LEARNING_RATES) for margin, num_hidden_units, learning_rate in LSTM_HYPERPARAMETERS: model = LSTM(EMBEDDINGS, num_hidden_units, POOL_METHOD, CUDA) criterion = helpers.MaxMarginLoss(margin) parameters = filter(lambda p: p.requires_grad, model.parameters()) optimizer = torch.optim.Adam(parameters, lr=learning_rate) model, mrr = train_utils.train_model(model, optimizer, criterion, ASK_UBUNTU_DATA, \ MAX_EPOCHS, BATCH_SIZE, CUDA, eval_data=ANDROID_DATA) torch.save(model.state_dict(), "./lstm_" + str(margin) + "_" + str(num_hidden_units) + "_" + str(learning_rate) + "_" + "auc=" + str(mrr)) MODELS.append((mrr, margin, num_hidden_units, learning_rate)) ############################################################################## # Train models by adverserial domain adaptation and evaluate ############################################################################## MAX_EPOCHS = 50 BATCH_SIZE = 32 MARGINS = [0.2] FILTER_WIDTH = 2 POOL_METHOD = "average" FEATURE_DIM = 240 DIS_NUM_HIDDEN_UNITS = [150, 200] DIS_LEARNING_RATES = [-1E-3] ENC_LEARNING_RATE = 1E-3 DIS_TRADE_OFF_RATES = [1E-7, 1E-8, 1E-9] DIS_HYPERPARAMETERS = itertools.product(DIS_LEARNING_RATES, DIS_NUM_HIDDEN_UNITS, DIS_TRADE_OFF_RATES, MARGINS) for dis_lr, dis_hidden_units, trade_off, margin in DIS_HYPERPARAMETERS: enc_model = LSTM(EMBEDDINGS, FEATURE_DIM, POOL_METHOD, CUDA) dis_model = BinaryClassifier(FEATURE_DIM, dis_hidden_units) model, auc = part2_train_utils.train_model( enc_model, dis_model, trade_off, ASK_UBUNTU_DATA, ANDROID_DATA, MAX_EPOCHS, BATCH_SIZE, ENC_LEARNING_RATE, dis_lr, margin, CUDA, ) print("max auc", auc) torch.save(model.state_dict(), "./lstm_" +\ str(margin) + "_" +\ str(dis_hidden_units) + "_" +\ str(trade_off) + "_" +\ "auc=" + str(auc))
timt51/question_retrieval
part2.py
part2.py
py
5,017
python
en
code
0
github-code
6
[ { "api_name": "collections.namedtuple", "line_number": 23, "usage_type": "call" }, { "api_name": "data_utils.download_ask_ubuntu_dataset", "line_number": 25, "usage_type": "call" }, { "api_name": "data_utils.load_part2_embeddings", "line_number": 26, "usage_type": "call" ...
3084393112
import numpy as np import pandas as pd import math import json import matplotlib as mpl import matplotlib.pyplot as plt import seaborn as sns import warnings warnings.filterwarnings('ignore') import optuna def create_data(f1, f2, A1, A2, sigma=0.02): outs = [] ts = 1000 theta1 = 1.4 theta2 = 1.0 for t in range(ts): # if t == 500: # theta1 = 1.4 # theta2 = -0.5 # elif t == 1500: # theta1 = 0.7 # theta2 = 0.0 n_f1 = np.random.normal(0.0, 0.05) n_f2 = np.random.normal(0.0, 0.05) val = A1*math.sin(f1*t+theta1+n_f1) + A2*math.sin(f2*t+theta2+n_f2) + np.random.normal(0.0, sigma) outs.append(val) return np.array(outs) def sigmoid(x): return 1.0 / (1.0 + np.exp(-x)) def relu(x): if x > 0: return x else: return 0. ### EKF def predict_phase(x_vec, P_mat, J_s=np.eye(2), dw=np.array([0.01, 0.1]), Q_t=np.ones((2,2))): # J_s: Jacobian x_hat = x_vec + dw P_hat = np.matmul(np.matmul(J_s,P_mat),J_s.T) + Q_t return x_hat, P_hat def update_phase(obs, x_hat, P_hat, x_vec, P_mat, w_vec, R_t=np.eye(2)): y_error = obs - (np.sin(x_hat[0])+0.3*np.sin(x_hat[1])) w_err = np.array([np.tanh(y_error*w_vec[0]), np.tanh(y_error*w_vec[1]), np.tanh(y_error*w_vec[2]), np.tanh(y_error*w_vec[3])]) alpha = sigmoid(np.dot(w_err, w_vec[4:])) J_o = np.array([np.cos(x_hat[0]), 0.3*np.cos(x_hat[1])]) # Jacobian S_t = np.matmul(np.matmul(J_o, P_hat), J_o.T) + R_t K_t = np.matmul(np.matmul(P_hat, J_o.T), np.linalg.inv(S_t)) # Kalman Gain K_t = K_t*np.array([alpha, 1.-alpha]) new_x_vec = x_vec + K_t*y_error new_P_mat = np.matmul((np.eye(2) - np.matmul(K_t, J_o)), P_hat) return new_x_vec, new_P_mat, y_error, alpha, K_t ys = create_data(f1=0.01, f2=0.1, A1=1.0, A2=0.3, sigma=0.05) # w_dict = {'w1': 0.8654948627671226, 'w2': -1.7444762795695032, 'w3': -1.256158244213108, 'w4': 2.9877172040880846, 'w5': 0.7674940690302532, 'w6': -0.5751565428986629, 'w7': -2.1525316155059886, 'w8': -1.593668210140296} w_dict = {'w1': 0.8868339845276003, 'w2': -2.4239527390853723, 'w3': 2.5663446991064536, 'w4': -1.835679959314501, 'w5': 2.668697875044799, 'w6': -0.578802425496894, 'w7': -2.3135794565999737, 'w8': -0.9460572459969298} w1 = w_dict['w1'] w2 = w_dict['w2'] w3 = w_dict['w3'] w4 = w_dict['w4'] w5 = w_dict['w5'] w6 = w_dict['w6'] w7 = w_dict['w7'] w8 = w_dict['w8'] W_1 = np.array([w1, w2, w3, w4, w5, w6, w7, w8]) x_vec = np.array([0.0, 0.0]) P_mat = np.eye(2) total_err = 0.0 alphas = [] y_errors = [] preds = [] k_gains = [] ttt = 1 for _y in ys[1:]: x_hat, P_hat = predict_phase(x_vec, P_mat) new_x_vec, new_P_mat, y_error, _alpha, K_t = update_phase(_y, x_hat, P_hat, x_vec, P_mat, W_1) x_vec = new_x_vec P_mat = new_P_mat total_err = total_err + np.sqrt(y_error*y_error) alphas.append(_alpha) y_errors.append(np.abs(y_error)) preds.append(np.sin(x_vec[0])+0.3*np.sin(x_vec[1])) k_gains.append(K_t.tolist()) # print(ttt, y_error, _alpha) ttt = ttt + 1 total_err = total_err/float(len(ys[1:])) with open("./data/json/test_ekf_no_alpha5.json", "w") as f: out_dict = { "k_gain": k_gains, # "alphas": alphas, "y_errors": y_errors, "ys": ys[1:].tolist(), "preds": preds } json.dump(out_dict, f) # print(alphas) # print(y_errors) # print(ys[1:].tolist()) # print(preds)
ksk-S/DynamicChangeBlindness
workspace_models/mcmc_model/test_ekf.py
test_ekf.py
py
3,468
python
en
code
0
github-code
6
[ { "api_name": "warnings.filterwarnings", "line_number": 10, "usage_type": "call" }, { "api_name": "numpy.random.normal", "line_number": 27, "usage_type": "call" }, { "api_name": "numpy.random", "line_number": 27, "usage_type": "attribute" }, { "api_name": "numpy.r...
29433457016
#! /usr/bin/env python # # Implementation of elliptic curves, for cryptographic applications. # # This module doesn't provide any way to choose a random elliptic # curve, nor to verify that an elliptic curve was chosen randomly, # because one can simply use NIST's standard curves. # # Notes from X9.62-1998 (draft): # Nomenclature: # - Q is a public key. # The "Elliptic Curve Domain Parameters" include: # - q is the "field size", which in our case equals p. # - p is a big prime. # - G is a point of prime order (5.1.1.1). # - n is the order of G (5.1.1.1). # Public-key validation (5.2.2): # - Verify that Q is not the point at infinity. # - Verify that X_Q and Y_Q are in [0,p-1]. # - Verify that Q is on the curve. # - Verify that nQ is the point at infinity. # Signature generation (5.3): # - Pick random k from [1,n-1]. # Signature checking (5.4.2): # - Verify that r and s are in [1,n-1]. # # Version of 2008.11.25. # # Revision history: # 2005.12.31 - Initial version. # 2008.11.25 - Change CurveFp.is_on to contains_point. # # Written in 2005 by Peter Pearson and placed in the public domain. from __future__ import division from .six import print_ from . import numbertheory class CurveFp( object ): """Elliptic Curve over the field of integers modulo a prime.""" def __init__( self, p, a, b ): """The curve of points satisfying y^2 = x^3 + a*x + b (mod p).""" self.__p = p self.__a = a self.__b = b def p( self ): return self.__p def a( self ): return self.__a def b( self ): return self.__b def contains_point( self, x, y ): """Is the point (x,y) on this curve?""" return ( y * y - ( x * x * x + self.__a * x + self.__b ) ) % self.__p == 0 class Point( object ): """A point on an elliptic curve. Altering x and y is forbidding, but they can be read by the x() and y() methods.""" def __init__( self, curve, x, y, order = None ): """curve, x, y, order; order (optional) is the order of this point.""" self.__curve = curve self.__x = x self.__y = y self.__order = order # self.curve is allowed to be None only for INFINITY: if self.__curve: assert self.__curve.contains_point( x, y ) if order: assert self * order == INFINITY def __eq__( self, other ): """Return True if the points are identical, False otherwise.""" if self.__curve == other.__curve \ and self.__x == other.__x \ and self.__y == other.__y: return True else: return False def __add__( self, other ): """Add one point to another point.""" # X9.62 B.3: if other == INFINITY: return self if self == INFINITY: return other assert self.__curve == other.__curve if self.__x == other.__x: if ( self.__y + other.__y ) % self.__curve.p() == 0: return INFINITY else: return self.double() p = self.__curve.p() l = ( ( other.__y - self.__y ) * \ numbertheory.inverse_mod( other.__x - self.__x, p ) ) % p x3 = ( l * l - self.__x - other.__x ) % p y3 = ( l * ( self.__x - x3 ) - self.__y ) % p return Point( self.__curve, x3, y3 ) def __mul__( self, other ): """Multiply a point by an integer.""" def leftmost_bit( x ): assert x > 0 result = 1 while result <= x: result = 2 * result return result // 2 e = other if self.__order: e = e % self.__order if e == 0: return INFINITY if self == INFINITY: return INFINITY assert e > 0 # From X9.62 D.3.2: e3 = 3 * e negative_self = Point( self.__curve, self.__x, -self.__y, self.__order ) i = leftmost_bit( e3 ) // 2 result = self # print_("Multiplying %s by %d (e3 = %d):" % ( self, other, e3 )) while i > 1: result = result.double() if ( e3 & i ) != 0 and ( e & i ) == 0: result = result + self if ( e3 & i ) == 0 and ( e & i ) != 0: result = result + negative_self # print_(". . . i = %d, result = %s" % ( i, result )) i = i // 2 return result def __rmul__( self, other ): """Multiply a point by an integer.""" return self * other def __str__( self ): if self == INFINITY: return "infinity" return "(%d,%d)" % ( self.__x, self.__y ) def double( self ): """Return a new point that is twice the old.""" if self == INFINITY: return INFINITY # X9.62 B.3: p = self.__curve.p() a = self.__curve.a() l = ( ( 3 * self.__x * self.__x + a ) * \ numbertheory.inverse_mod( 2 * self.__y, p ) ) % p x3 = ( l * l - 2 * self.__x ) % p y3 = ( l * ( self.__x - x3 ) - self.__y ) % p return Point( self.__curve, x3, y3 ) def x( self ): return self.__x def y( self ): return self.__y def curve( self ): return self.__curve def order( self ): return self.__order # This one point is the Point At Infinity for all purposes: INFINITY = Point( None, None, None ) def __main__(): class FailedTest(Exception): pass def test_add( c, x1, y1, x2, y2, x3, y3 ): """We expect that on curve c, (x1,y1) + (x2, y2 ) = (x3, y3).""" p1 = Point( c, x1, y1 ) p2 = Point( c, x2, y2 ) p3 = p1 + p2 print_("%s + %s = %s" % ( p1, p2, p3 ), end=' ') if p3.x() != x3 or p3.y() != y3: raise FailedTest("Failure: should give (%d,%d)." % ( x3, y3 )) else: print_(" Good.") def test_double( c, x1, y1, x3, y3 ): """We expect that on curve c, 2*(x1,y1) = (x3, y3).""" p1 = Point( c, x1, y1 ) p3 = p1.double() print_("%s doubled = %s" % ( p1, p3 ), end=' ') if p3.x() != x3 or p3.y() != y3: raise FailedTest("Failure: should give (%d,%d)." % ( x3, y3 )) else: print_(" Good.") def test_double_infinity( c ): """We expect that on curve c, 2*INFINITY = INFINITY.""" p1 = INFINITY p3 = p1.double() print_("%s doubled = %s" % ( p1, p3 ), end=' ') if p3.x() != INFINITY.x() or p3.y() != INFINITY.y(): raise FailedTest("Failure: should give (%d,%d)." % ( INFINITY.x(), INFINITY.y() )) else: print_(" Good.") def test_multiply( c, x1, y1, m, x3, y3 ): """We expect that on curve c, m*(x1,y1) = (x3,y3).""" p1 = Point( c, x1, y1 ) p3 = p1 * m print_("%s * %d = %s" % ( p1, m, p3 ), end=' ') if p3.x() != x3 or p3.y() != y3: raise FailedTest("Failure: should give (%d,%d)." % ( x3, y3 )) else: print_(" Good.") # A few tests from X9.62 B.3: c = CurveFp( 23, 1, 1 ) test_add( c, 3, 10, 9, 7, 17, 20 ) test_double( c, 3, 10, 7, 12 ) test_add( c, 3, 10, 3, 10, 7, 12 ) # (Should just invoke double.) test_multiply( c, 3, 10, 2, 7, 12 ) test_double_infinity(c) # From X9.62 I.1 (p. 96): g = Point( c, 13, 7, 7 ) check = INFINITY for i in range( 7 + 1 ): p = ( i % 7 ) * g print_("%s * %d = %s, expected %s . . ." % ( g, i, p, check ), end=' ') if p == check: print_(" Good.") else: raise FailedTest("Bad.") check = check + g # NIST Curve P-192: p = 6277101735386680763835789423207666416083908700390324961279 r = 6277101735386680763835789423176059013767194773182842284081 #s = 0x3045ae6fc8422f64ed579528d38120eae12196d5L c = 0x3099d2bbbfcb2538542dcd5fb078b6ef5f3d6fe2c745de65 b = 0x64210519e59c80e70fa7e9ab72243049feb8deecc146b9b1 Gx = 0x188da80eb03090f67cbf20eb43a18800f4ff0afd82ff1012 Gy = 0x07192b95ffc8da78631011ed6b24cdd573f977a11e794811 c192 = CurveFp( p, -3, b ) p192 = Point( c192, Gx, Gy, r ) # Checking against some sample computations presented # in X9.62: d = 651056770906015076056810763456358567190100156695615665659 Q = d * p192 if Q.x() != 0x62B12D60690CDCF330BABAB6E69763B471F994DD702D16A5: raise FailedTest("p192 * d came out wrong.") else: print_("p192 * d came out right.") k = 6140507067065001063065065565667405560006161556565665656654 R = k * p192 if R.x() != 0x885052380FF147B734C330C43D39B2C4A89F29B0F749FEAD \ or R.y() != 0x9CF9FA1CBEFEFB917747A3BB29C072B9289C2547884FD835: raise FailedTest("k * p192 came out wrong.") else: print_("k * p192 came out right.") u1 = 2563697409189434185194736134579731015366492496392189760599 u2 = 6266643813348617967186477710235785849136406323338782220568 temp = u1 * p192 + u2 * Q if temp.x() != 0x885052380FF147B734C330C43D39B2C4A89F29B0F749FEAD \ or temp.y() != 0x9CF9FA1CBEFEFB917747A3BB29C072B9289C2547884FD835: raise FailedTest("u1 * p192 + u2 * Q came out wrong.") else: print_("u1 * p192 + u2 * Q came out right.") if __name__ == "__main__": __main__()
espressif/ESP8266_RTOS_SDK
components/esptool_py/esptool/ecdsa/ellipticcurve.py
ellipticcurve.py
py
8,609
python
en
code
3,148
github-code
6
[ { "api_name": "six.print_", "line_number": 192, "usage_type": "call" }, { "api_name": "six.print_", "line_number": 196, "usage_type": "call" }, { "api_name": "six.print_", "line_number": 202, "usage_type": "call" }, { "api_name": "six.print_", "line_number": 2...
74750167547
import torch from transformers import T5ForConditionalGeneration, T5Tokenizer import re def title_generation(data): print("[!] Server logs: Title generation has started") text = data["content"] device = torch.device("cuda" if torch.cuda.is_available() else "cpu") model = T5ForConditionalGeneration.from_pretrained( "Michau/t5-base-en-generate-headline" ) tokenizer = T5Tokenizer.from_pretrained("Michau/t5-base-en-generate-headline") model = model.to(device) encoding = tokenizer.encode_plus(text, return_tensors="pt") input_ids = encoding["input_ids"].to(device) attention_masks = encoding["attention_mask"].to(device) beam_outputs = model.generate( input_ids=input_ids, attention_mask=attention_masks, max_length=64, num_beams=3, early_stopping=True, ) result = tokenizer.decode(beam_outputs[0]) print("[!] Server logs: Title generation completed") regex_pattern = r"(?<=<pad> )(.*)(?=</s>)" result = re.search(regex_pattern, result).group(0) data["title"] = result return data
SVijayB/Gist
scripts/title_generation.py
title_generation.py
py
1,106
python
en
code
4
github-code
6
[ { "api_name": "torch.device", "line_number": 9, "usage_type": "call" }, { "api_name": "torch.cuda.is_available", "line_number": 9, "usage_type": "call" }, { "api_name": "torch.cuda", "line_number": 9, "usage_type": "attribute" }, { "api_name": "transformers.T5ForC...
40696675203
import re from typing import NamedTuple, Optional from magma.magmad.check import subprocess_workflow class LscpuCommandParams(NamedTuple): pass class LscpuCommandResult(NamedTuple): error: Optional[str] core_count: Optional[int] threads_per_core: Optional[int] architecture: Optional[str] model_name: Optional[str] def get_cpu_info() -> LscpuCommandResult: """ Execute lscpu command via subprocess. Blocks while waiting for output. """ return list( subprocess_workflow.exec_and_parse_subprocesses( [LscpuCommandParams()], _get_lscpu_command_args_list, parse_lscpu_output, ), )[0] def _get_lscpu_command_args_list(_): return ['lscpu'] def parse_lscpu_output(stdout, stderr, _): """ Parse stdout output from a lscpu command. """ def _create_error_result(err_msg): return LscpuCommandResult( error=err_msg, core_count=None, threads_per_core=None, architecture=None, model_name=None, ) if stderr: return _create_error_result(stderr) stdout_decoded = stdout.decode() try: cores_per_socket = int( re.search( r'Core\(s\) per socket:\s*(.*)\n', str(stdout_decoded), ).group(1), ) num_sockets = int( re.search( r'Socket\(s\):\s*(.*)\n', str(stdout_decoded), ).group(1), ) threads_per_core = int( re.search( r'Thread\(s\) per core:\s*(.*)\n', str(stdout_decoded), ).group(1), ) architecture = re.search( r'Architecture:\s*(.*)\n', str(stdout_decoded), ).group(1) model_name = re.search( r'Model name:\s*(.*)\n', str(stdout_decoded), ).group(1) return LscpuCommandResult( error=None, core_count=cores_per_socket * num_sockets, threads_per_core=threads_per_core, architecture=architecture, model_name=model_name, ) except (AttributeError, IndexError, ValueError) as e: return _create_error_result( 'Parsing failed: %s\n%s' % (e, stdout_decoded), )
magma/magma
orc8r/gateway/python/magma/magmad/check/machine_check/cpu_info.py
cpu_info.py
py
2,341
python
en
code
1,605
github-code
6
[ { "api_name": "typing.NamedTuple", "line_number": 7, "usage_type": "name" }, { "api_name": "typing.NamedTuple", "line_number": 11, "usage_type": "name" }, { "api_name": "typing.Optional", "line_number": 12, "usage_type": "name" }, { "api_name": "typing.Optional", ...
36703905624
import soundfile as sf import numpy as np import time import matplotlib.pyplot as plt from parameterization import STFT, iSTFT, optimal_synth_window, first_larger_square DEF_PARAMS = { "win_len": 25, "win_ovlap": 0.75, "blocks": 800, "max_h_type": "lin-lin", "min_gain_dry": 0, "bias": 1.01, "alpha": 0.1, "gamma": 0.7, } TITLES = ["aula1_12", "kitchen_12", "stairway1_1", "test"] SAMPLES = ["sploty/aula1/aula1_12.wav", "sploty/kitchen/kitchen_12.wav", "sploty/stairway1/stairway1_1.wav", "deverb_test_samples/test_raw.wav"] TEST_SCOPE = False def get_max_h_matrix(type, freqs, blocks): if type == "log-log": return (np.logspace(np.ones(freqs), np.ones(freqs) * np.finfo(np.float32).eps, blocks) * np.logspace(np.ones(blocks), np.ones(blocks) * np.finfo(np.float32).eps, freqs).T - 1) / 99 elif type == "log-lin": return (np.logspace(np.ones(freqs), np.ones(freqs) * np.finfo(np.float32).eps, blocks) * np.linspace(np.ones(blocks), np.zeros(blocks), freqs).T) / 9 elif type == "log-full": return (np.logspace(np.ones(freqs), np.ones(freqs) * np.finfo(np.float32).eps, blocks) - 1) / 9 elif type == "lin-log": return (np.logspace(np.ones(freqs), np.ones(freqs) * np.finfo(np.float32).eps, blocks) * np.logspace(np.ones(blocks), np.ones(blocks) * np.finfo(np.float32).eps, freqs).T - 1) / 9 elif type == "lin-lin": return np.linspace(np.ones(freqs), np.zeros(freqs), blocks) * \ np.linspace(np.ones(blocks), np.zeros(blocks), freqs).T elif type == "lin-full": return np.linspace(np.ones(freqs), np.zeros(freqs), blocks) else: return np.ones((freqs, blocks)).T def reconstruct(stft, window, overlap): frame_count, frequency_count = stft.shape sym_stft = np.hstack((stft, np.flipud(np.conj(stft[:, 0:frequency_count - 2])))) signal = np.real(iSTFT(sym_stft, window, overlap)) return signal def read_impulse_response(path, target_fs, target_bins, win_len, win_ovlap): h, h_fs = sf.read(path) h /= np.max(np.abs(h)) nfft = int(target_bins * h_fs / target_fs) win_len = int(win_len / 1000 * h_fs) win_ovlap = int(win_len * win_ovlap) window = np.hanning(win_len) H = STFT(h, window, win_ovlap, nfft, power=True) return H[:, 0:target_bins // 2 + 1], H.shape[0] def printProgressBar (iteration, total, prefix='', suffix='', decimals=1, length=100, fill='█', printEnd="\r"): """ Call in a loop to create terminal progress bar @params: iteration - Required : current iteration (Int) total - Required : total iterations (Int) prefix - Optional : prefix string (Str) suffix - Optional : suffix string (Str) decimals - Optional : positive number of decimals in percent complete (Int) length - Optional : character length of bar (Int) fill - Optional : bar fill character (Str) printEnd - Optional : end character (e.g. "\r", "\r\n") (Str) """ percent = ("{0:." + str(decimals) + "f}").format(100 * (iteration / float(total))) filledLength = int(length * iteration // total) bar = fill * filledLength + '-' * (length - filledLength) print(f'\r{prefix} |{bar}| {percent}% {suffix}', end = printEnd) # Print New Line on Complete if iteration == total: print() def dereverberate(wave, fs, params=None, estimate_execution_time=True, show_progress_bar=True): """ Estimates the impulse response in a room the recording took place :param wave: 1-D ndarray of wave samples :param fs: int - sampling frequency :param params: dict containing the algorithm parameters - keys: :param estimate_execution_time: should we print estimated execution time for each next frame :param show_progress_bar: should we print progress bar of estimation :returns: (h_stft_pow) 2-D ndarray power STFT of h_rir, (wave_dry) 1-D ndarray of the dry signal, (wave_wet) 1-D ndarray of the wet signal """ # estimating execution time loop_times = np.zeros(10) # =================== Parameters =================== if params is None: params = DEF_PARAMS # ==================== Windowing =================== win_len_ms = params["win_len"] win_ovlap_p = params["win_ovlap"] # ================ Times to samples ================ win_len = int(win_len_ms / 1000 * fs) win_ovlap = int(win_len * win_ovlap_p) window = np.hanning(win_len) # =================== Signal stft ================== nfft = first_larger_square(win_len) sig_stft = STFT(wave, window, win_ovlap, nfft) sig_stft = sig_stft[:, 0:nfft // 2 + 1] frame_count, frequency_count = sig_stft.shape # ==================== Constants =================== # length of the impulse response blocks = params["blocks"] # minimum gain of dry signal per frequency min_gain_dry = params["min_gain_dry"] # maximum impulse response estimate # max_h, blocks = read_impulse_response("deverb_test_samples/stalbans_a_mono.wav", fs, nfft, win_len_ms, win_ovlap_p) max_h = get_max_h_matrix('const', frequency_count, blocks) # bias used to keep magnitudes from getting stuck on a wrong minimum bias = params["bias"] # alpha and gamma - smoothing factors for impulse response magnitude and gain alpha = params["alpha"] gamma = params["gamma"] # ==================== Algorithm =================== # dry_stft and wet_stft are the estimated dry and reverberant signals in frequency-time domain dry_stft = np.zeros((frame_count, frequency_count), dtype=np.csingle) wet_stft = np.zeros((frame_count, frequency_count), dtype=np.csingle) # h_stft_pow is the estimated impulse response in frequency-time domain h_stft_pow = max_h / 2 # matrices with the information of currently estimated raw and dry signal (power spectra) raw_frames = np.ones((blocks, frequency_count)) dry_frames = np.zeros((blocks, frequency_count)) # c is a matrix to keep the raw estimated powers of the impulse response c = np.zeros((blocks, frequency_count)) # gain_dry and gain_wet are the frequency gains of the dry and wet signals gain_dry = np.ones(frequency_count) gain_wet = np.zeros(frequency_count) for i in range(frame_count): if estimate_execution_time: remaining = round(np.mean(loop_times) * (frame_count - i)) loop_times[1:] = loop_times[0:-1] loop_times[0] = time.time() print("Processing frame {} of {}, estimated time left: {} ms".format(i + 1, frame_count, remaining)) frame = sig_stft[i, :] frame_power = np.power(np.abs(frame), 2) # estimate signals based on i-th frame for b in range(blocks): estimate = frame_power / raw_frames[b, :] np.place(estimate, estimate >= h_stft_pow[b, :], h_stft_pow[b, :] * bias + np.finfo(np.float32).eps) np.fmin(estimate, max_h[b, :], out=c[b, :]) h_stft_pow[b, :] = alpha * h_stft_pow[b, :] + (1 - alpha) * c[b, :] # calculating gains new_gain_dry = 1 - np.sum(dry_frames * h_stft_pow, axis=0) / frame_power np.place(new_gain_dry, new_gain_dry < min_gain_dry, min_gain_dry) gain_dry = gamma * gain_dry + (1 - gamma) * new_gain_dry new_gain_wet = 1 - gain_dry gain_wet = gamma * gain_wet + (1 - gamma) * new_gain_wet # calculatnig signals dry_stft[i, :] = gain_dry * frame wet_stft[i, :] = gain_wet * frame # shifting previous frames dry_frames[1:blocks, :] = dry_frames[0:blocks - 1, :] dry_frames[0, :] = np.power(np.abs(dry_stft[i, :]), 2) raw_frames[1:blocks, :] = raw_frames[0:blocks - 1, :] raw_frames[0, :] = frame_power if estimate_execution_time: loop_times[0] = round(1000 * (time.time() - loop_times[0])) if show_progress_bar: printProgressBar(i, frame_count, prefix='Progress', suffix='Complete', length=30) window = optimal_synth_window(window, win_ovlap) if TEST_SCOPE: t = (np.arange(frame_count) * (win_len_ms * (1 - win_ovlap_p))).astype(int) f = np.linspace(0, fs / 2, frequency_count).astype(int) txx, fxx = np.meshgrid(t, f) fig, axes = plt.subplots(3, 1, figsize=(10, 10)) axes[0].pcolormesh(txx, fxx, np.log10(np.power(np.abs(sig_stft.T), 2)), cmap=plt.get_cmap('plasma')) axes[0].set_title("Original signal") axes[1].pcolormesh(txx, fxx, np.log10(np.power(np.abs(dry_stft.T), 2)), cmap=plt.get_cmap('plasma')) axes[1].set_title("Dry signal") axes[2].pcolormesh(txx, fxx, np.log10(np.power(np.abs(wet_stft.T), 2)), cmap=plt.get_cmap('plasma')) axes[2].set_title("Reverberant signal") fig.show() wave_dry = reconstruct(dry_stft, window, win_ovlap) wave_wet = reconstruct(wet_stft, window, win_ovlap) return h_stft_pow, wave_dry, wave_wet def test_deverb(): for i, item in enumerate(SAMPLES): # i = 3 # item = SAMPLES[3] print("Estimating " + item) wave, fs = sf.read(item) wave = wave / np.max(np.abs(wave)) H_rir, dry_wav, wet_wav = dereverberate(wave, fs, estimate_execution_time=False) min_size = np.min([wave.size, dry_wav.size, wet_wav.size]) t = np.linspace(0, min_size / fs, min_size) fig, axes = plt.subplots(3, 1, figsize=(10, 10)) fig.suptitle("estimated signals - {} reverb".format(TITLES[i])) axes[0].plot(t, wave[0:min_size]) axes[0].set_title("original") axes[1].plot(t, dry_wav[0:min_size]) axes[1].set_title("dry") axes[2].plot(t, wet_wav[0:min_size]) axes[2].set_title("reverberant") axes[2].set_xlabel(r"time $[s]$") fig.tight_layout() fig.show() frames, freqs = H_rir.shape hop = DEF_PARAMS["win_len"] * (1 - DEF_PARAMS["win_ovlap"]) / 1000 f = np.linspace(0, fs / 2000, freqs) t = np.linspace(0, hop * frames, frames) fxx, txx = np.meshgrid(f, t) fig, ax = plt.subplots(figsize=(6, 5)) ax.pcolormesh(txx, fxx, np.log10(H_rir), cmap=plt.get_cmap('plasma')) ax.set_title(r"estimated $H_{rir}$: " + TITLES[i]) ax.set_xlabel(r"time $[s]$") ax.set_ylabel(r"frequency $[kHz]$") fig.show() with open("tmp/dry_{}.wav".format(TITLES[i]), "wb") as f: sf.write(f, dry_wav, fs) with open("tmp/wet_{}.wav".format(TITLES[i]), "wb") as f: sf.write(f, wet_wav, fs) if __name__ == "__main__": TEST_SCOPE = True test_deverb()
Revzik/AGH-ZTPS_Acoustical-Environment-Classification
deverb.py
deverb.py
py
10,820
python
en
code
0
github-code
6
[ { "api_name": "numpy.logspace", "line_number": 26, "usage_type": "call" }, { "api_name": "numpy.ones", "line_number": 26, "usage_type": "call" }, { "api_name": "numpy.finfo", "line_number": 26, "usage_type": "call" }, { "api_name": "numpy.float32", "line_numbe...
74197689149
import workAssyncFile from sora.prediction import prediction from sora.prediction.occmap import plot_occ_map as occmap import json import datetime import restApi import os def __clearName(name): name = "".join(x for x in name if x.isalnum() or x==' ' or x=='-' or x=='_') name = name.replace(' ', '_') return name def processRequest(data, output): outputFile = generateMap(data,output, False) f = open (outputFile, "rb") content = f.read() return content def processFile(input, output, fileName): f = open (os.path.join(input,fileName), "r") data = json.loads(f.read()) generateMap(data, output, True) def generateMap(data, output, forced=False): if 'body' in data: return generateMapWithIternet(data, output, forced) else: return generateMapWithoutIternet(data, output, forced) def generateMapWithIternet(data, output, forced=False): body = data['body'] strDate = data['date'] strTime = data['time'] fileName = __clearName(body+" "+strDate.replace("-","")+" "+strTime.replace(":","")) outputFile = os.path.join(output,fileName+".jpg") if forced or not os.path.exists(outputFile): v = (strDate+'-'+strTime).replace(":","-").split('-') dtRef = datetime.datetime(int(v[0]), int(v[1]), int(v[2]), int(v[3]), int(v[4]), int(v[5])) time0 = dtRef-datetime.timedelta(hours=4, minutes=0) #fuso 3 time1 = time0+datetime.timedelta(hours=2, minutes=0) dtRef = dtRef - datetime.timedelta(hours=3, minutes=0) pred = prediction(body=body, time_beg=time0, time_end=time1, step=10, divs=1, verbose=False) for p in pred: p.plot_occ_map(nameimg=fileName, path=output, fmt='jpg') return outputFile def generateMapWithoutIternet(data, output, forced=False): name = data["name"] radius = data["radius"] coord = data["coord"] time = data["time"] ca = data["ca"] pa = data["pa"] vel = data["vel"] dist = data["dist"] mag = data["mag"] longi = data["longi"] v = time.split("T") strDate = v[0] if '.' in v[1]: v[1] = v[1].split('.')[0] strTime = v[1] fileName = __clearName(name+" "+strDate.replace("-","")+" "+strTime.replace(":","")) outputFile = os.path.join(output,fileName+".jpg") if forced or not os.path.exists(outputFile): occmap(name, radius, coord, time, ca, pa, vel, dist, mag=mag, longi=longi, dpi=50, nameimg=fileName, path=output, fmt='jpg') return outputFile if __name__ == '__main__': waf = workAssyncFile.WorkAssyncFile(os.getenv('INPUT_PATH', '~/media/input'),os.getenv('OUTPUT_PATH', '~/media/output')) waf.setProcessFile(processFile) waf.start() api = restApi.RespApi(port=os.getenv('PORT', 8000), cachePath=os.getenv('CACHE_PATH', '~/media/output')) api.setProcessReponse(processRequest) api.start()
linea-it/tno
container-SORA/src/main.py
main.py
py
2,969
python
en
code
1
github-code
6
[ { "api_name": "os.path.join", "line_number": 21, "usage_type": "call" }, { "api_name": "os.path", "line_number": 21, "usage_type": "attribute" }, { "api_name": "json.loads", "line_number": 22, "usage_type": "call" }, { "api_name": "os.path.join", "line_number"...
11315559084
#coding:utf-8 import sys sys.path.insert(0, "./") import os os.environ["KMP_DUPLICATE_LIB_OK"]="TRUE" from flask import Flask from flask import render_template, redirect, url_for from flask import request, session, json from flask import jsonify from keywords.keywordExtract import getKeywords from parser.analysis_doc import parser_doc, basicInfoExtract from conflict.conflict_detect import Conflict from retrieval.infoRetrieval import find_policy from association.asso_analyze import Association app = Flask(__name__) app.config["SECRET_KEY"] = "123456" conflict = Conflict() asso = Association() @app.route('/') def hello_world(): return '欢迎来到政策关联分析系统算法后台!!!' @app.route('/dataProcess', methods=["POST", "GET"]) def dataProcess(): ''' 对输入到数据库中的政策进行数据处理,进行信息提取操作。 :return: ''' if request.method == 'POST': datax = request.form.get('text',"") name = request.form.get("name", "") if datax: ''' 添加数据处理操作 ''' try: results = basicInfoExtract(datax, source_name=name) return jsonify({"error_code":0, "reason":"", "data":results}) except: return jsonify({"error_code":3, "reason":"输入数据错误,无法进行解析", "data":""}) else: return jsonify({"error_code": 1, "reason": "没有输入政策数据", "data": ""}) else: return jsonify({"error_code":2, "reason":"请求方式错误,应使用post请求", "data":""}) @app.route("/keywords", methods=["POST","GET"]) def keywords(): ''' 关键词提取 :return: ''' if request.method == 'POST': datax = request.form.get('text',"") number = int(request.form.get('number', 3)) if datax: ''' 添加数据处理操作 ''' keyword = getKeywords(datax, num= number, use_value=False) results = { "keywords":keyword,#关键词 } return jsonify({"error_code":0, "reason":"", "data":results}) else: return jsonify({"error_code": 1, "reason": "没有输入政策数据", "data": ""}) else: return jsonify({"error_code":2, "reason":"请求方式错误,应使用post请求", "data":""}) @app.route("/dataAnalyze", methods=["POST","GET"]) def dataAnalyze(): ''' 政策文本结构化解析 :return: ''' if request.method == 'POST': datax = request.form.get('text',"") name = request.form.get('name', "") if datax: ''' 添加数据处理操作 ''' try: results = parser_doc(datax) return jsonify({"error_code":0, "reason":"", "data":results}) except: return jsonify({"error_code": 3, "reason": "输入数据错误,无法进行解析", "data": ""}) else: return jsonify({"error_code": 1, "reason": "没有输入政策数据", "data": ""}) else: return jsonify({"error_code":2, "reason":"请求方式错误,应使用post请求", "data":""}) @app.route("/conflictDetection", methods=["POST", "GET"]) def conflictDetection(): ''' 政策文本冲突检测 :return: ''' if request.method == 'POST': # datax = request.get_data() datax = request.form.get('policy',"") test_policy = request.form.get('test_policy', "") if datax and test_policy: ''' 添加数据处理操作 ''' try: datax = json.loads(datax) print("conflict input: %s"%(datax)) results = conflict.conflict(datax, target_sent=test_policy) # results = { # "result":"存在时间类型的冲突", # "sentence":"到2020年,实现全面建设中国物联网体系平台。" # } return jsonify({"error_code":0, "reason":"", "data":results}) except: return jsonify({"error_code": 3, "reason": "输入数据错误,无法进行解析", "data": ""}) else: return jsonify({"error_code": 1, "reason": "没有输入政策数据或者是待检测文本", "data": ""}) else: return jsonify({"error_code":2, "reason":"请求方式错误,应使用post请求", "data":""}) @app.route("/assoAnalyze", methods=["POST", "GET"]) def assoAnalyze(): ''' 两个政策关联分析 :return: ''' if request.method == 'POST': policy1 = request.form.get('policy1', "") policy2 = request.form.get('policy2', "") if policy1 and policy2: ''' 添加数据处理操作 ''' try: policy1 = json.loads(policy1) policy2 = json.loads(policy2) results = asso.analyzeAll(policy1, policy2) # results = { # "result":"对于政策A来说,政策B是起到理论指导作用", # "policy1":{ # "1":["句子", "理论指导"], # "2":["句子", "理论指导"], # # },#第一个政策每句话的分析 # "policy2":{ # "1":["句子", "理论指导"], # "2":["句子", "理论指导"], # }#第二个政策每句话的分析 # } return jsonify({"error_code":0, "reason":"", "data": results}) except: return jsonify({"error_code": 3, "reason": "输入数据错误,无法进行解析", "data": ""}) else: return jsonify({"error_code": 1, "reason": "没有输入政策数据", "data": ""}) else: return jsonify({"error_code":2, "reason":"请求方式错误,应使用post请求", "data":""}) @app.route("/assoSingleAnalyze", methods=["POST", "GET"]) def assoSingleAnalyze(): ''' 两个政策关联分析 :return: ''' if request.method == 'POST': policy1 = request.form.get('policy1',"") policy2 = request.form.get('policy2', "") sentence = request.form.get('sentence', "") id = request.form.get('id', None) if policy1 and policy2 and sentence and id is not None: try: id = int(id) ''' 添加数据处理操作 ''' policy1 = json.loads(policy1) policy2 = json.loads(policy2) results = asso.assoSingleAnalyze(policy1, policy2, sentence, id) # results = { # "policy":{ # "1":["句子", "相似"], # "2":["句子", "不相似"], # } # } return jsonify({"error_code":0, "reason":"", "data":results}) except: return jsonify({"error_code": 3, "reason": "输入数据错误,无法进行解析", "data": ""}) else: return jsonify({"error_code": 1, "reason": "没有输入政策数据或者输入信息不完整", "data": ""}) else: return jsonify({"error_code":2, "reason":"请求方式错误,应使用post请求", "data":""}) @app.route("/policyFind", methods=["POST", "GET"]) def policyFind(): ''' 政策查找 :return: ''' if request.method == 'POST': policy1 = request.form.get('policy',"") policy_lis = request.form.get('policy_lis', "") number = int(request.form.get('number', 10)) if policy1 and policy_lis and number : ''' 添加数据处理操作 ''' try: print(policy_lis) if not isinstance(policy_lis, list): policy_lis = policy_lis.split("#") res = find_policy(policy1, policy_lis, int(number)) print(res) results = { "result":"#".join(res)#"大数据#互联网#人工智能#物联网" } return jsonify({"error_code":0, "reason":"", "data":results}) except: return jsonify({"error_code": 3, "reason": "输入数据错误,无法进行解析", "data": ""}) else: return jsonify({"error_code": 1, "reason": "没有输入政策数据或者输入信息不完整", "data": ""}) else: return jsonify({"error_code":2, "reason":"请求方式错误,应使用post请求", "data":""}) if __name__ == '__main__': app.debug = True app.run(host="0.0.0.0", port = 5005, debug=True)
nlp520/policy_web
app.py
app.py
py
8,806
python
en
code
0
github-code
6
[ { "api_name": "sys.path.insert", "line_number": 3, "usage_type": "call" }, { "api_name": "sys.path", "line_number": 3, "usage_type": "attribute" }, { "api_name": "os.environ", "line_number": 5, "usage_type": "attribute" }, { "api_name": "flask.Flask", "line_nu...
16413423811
from datetime import datetime, date, time import time from collections import OrderedDict def parametrized_decor(parameter): def decor(foo): def new_foo(*args, **kwargs): print(datetime.now()) print(f'Имя функции - {foo.__name__}') if args is not None: print(f'Позиционные аргументы args - {args}') if kwargs is not None: print(f'Именованные аргументы kwargs - {kwargs}') result = foo(*args, **kwargs) print('result: ', result) print('result type: ', type(result)) return result return new_foo return decor if __name__ == '__main__': # foo(1, 2) documents_list = [{ "type": "passport", "number": "2207 876234", "name": "Василий Гупкин" }, { "type": "invoice", "number": "11-2", "name": "Геннадий Покемонов" }] @parametrized_decor(parameter=None) def give_name(doc_list, num): for doc_dict in doc_list: if num == doc_dict['number']: print( f"Документ под номером {num} соответствует имени {doc_dict['name']}" ) give_name(documents_list, '11-2') print("____" * 15) @parametrized_decor(parameter=None) def summator(x, y): return x + y three = summator(1, 2) five = summator(2, 3) result = summator(three, five)
Smelkovaalla/4.5-Decorator
main.py
main.py
py
1,414
python
en
code
0
github-code
6
[ { "api_name": "datetime.datetime.now", "line_number": 9, "usage_type": "call" }, { "api_name": "datetime.datetime", "line_number": 9, "usage_type": "name" } ]
6606964316
import sys from collections import deque MOVES = [(-1, 0), (0, 1), (1, 0), (0, -1)] input = sys.stdin.readline def isrange(x: int, y: int) -> bool: return 0 <= x < n and 0 <= y < n def get_lands(x: int, y: int, island: int) -> set[tuple[int, int]]: lands: set[tuple[int, int]] = set() que: deque[tuple[int, int]] = deque() que.append((x, y)) lands.add((x, y)) board[x][y] = island while que: x, y = que.popleft() for movex, movey in MOVES: nextx: int = x + movex nexty: int = y + movey if not isrange(nextx, nexty): continue if board[nextx][nexty] == 0: continue if (nextx, nexty) in lands: continue que.append((nextx, nexty)) lands.add((nextx, nexty)) board[nextx][nexty] = island return lands def get_bridge_length(lands: set[tuple[int, int]], island: int) -> int: length: int = 0 que: deque[tuple[int, int]] = deque() visited: list[list[bool]] = [[False for _ in range(n)] for _ in range(n)] for x, y in lands: que.append((x, y)) visited[x][y] = True while que: for _ in range(len(que)): x, y = que.popleft() for movex, movey in MOVES: nextx: int = x + movex nexty: int = y + movey if not isrange(nextx, nexty): continue if board[nextx][nexty] == island: continue if visited[nextx][nexty]: continue if board[nextx][nexty] > 0: return length que.append((nextx, nexty)) visited[nextx][nexty] = True length += 1 return -1 def solve() -> int: island: int = 2 length: int = sys.maxsize for x, row in enumerate(board): for y, elem in enumerate(row): if elem == 1: lands = get_lands(x, y, island) length = min(length, get_bridge_length(lands, island)) island += 1 return length if __name__ == "__main__": n = int(input()) board = [list(map(int, input().split())) for _ in range(n)] print(solve())
JeongGod/Algo-study
seonghoon/week06(22.02.01~22.02.07)/b2146.py
b2146.py
py
2,298
python
en
code
7
github-code
6
[ { "api_name": "sys.stdin", "line_number": 6, "usage_type": "attribute" }, { "api_name": "collections.deque", "line_number": 15, "usage_type": "name" }, { "api_name": "collections.deque", "line_number": 44, "usage_type": "name" }, { "api_name": "sys.maxsize", "...
28912342142
import transformers import torch.nn as nn import config import torch class BERT_wmm(nn.Module): def __init__(self, keep_tokens): super(BERT_wmm,self).__init__() self.bert=transformers.BertModel.from_pretrained(config.BERT_PATH) self.fc=nn.Linear(768,768) self.layer_normalization=nn.LayerNorm((64, 768)) # self.bert_drop=nn.Dropout(0.2) self.out=nn.Linear(768,6932) if keep_tokens is not None: self.embedding = nn.Embedding(6932, 768) weight = torch.load(config.BERT_EMBEDDING) weight = nn.Parameter(weight['weight'][keep_tokens]) self.embedding.weight = weight self.bert.embeddings.word_embeddings = self.embedding print(weight.shape) def forward(self, ids, mask, token_type_ids): out1, _=self.bert( ids, attention_mask=mask, token_type_ids=token_type_ids, return_dict=False ) # mean pooling # max pooling # concat # bert_output=self.bert_drop(out1) output=self.fc(out1) layer_normalized=self.layer_normalization(output) final_output=self.out(layer_normalized) return final_output
Zibo-Zhao/Semantic-Matching
model.py
model.py
py
1,326
python
en
code
0
github-code
6
[ { "api_name": "torch.nn.Module", "line_number": 6, "usage_type": "attribute" }, { "api_name": "torch.nn", "line_number": 6, "usage_type": "name" }, { "api_name": "transformers.BertModel.from_pretrained", "line_number": 9, "usage_type": "call" }, { "api_name": "tra...
73817307386
# # test_ab.py - generic tests for analysis programs # repagh <rene.vanpaassen@gmail.com, May 2020 import pytest from slycot import analysis from slycot.exceptions import SlycotArithmeticError, SlycotResultWarning from .test_exceptions import assert_docstring_parse @pytest.mark.parametrize( 'fun, exception_class, erange, checkvars', ((analysis.ab05nd, SlycotArithmeticError, 1, {'p1': 1}), (analysis.ab07nd, SlycotResultWarning, 2, {'m': 1}), (analysis.ab09ad, SlycotArithmeticError, 3, {'dico': 'C'}), (analysis.ab09ad, SlycotArithmeticError, (2,), {'dico': 'D'}), (analysis.ab09ad, SlycotResultWarning, ((1, 0), ), {'nr': 3, 'Nr': 2}), (analysis.ab09ax, SlycotArithmeticError, 2, {'dico': 'C'}), (analysis.ab09ax, SlycotResultWarning, ((1, 0), ), {'nr': 3, 'Nr': 2}), (analysis.ab09ad, SlycotArithmeticError, 3, {'dico': 'C'}), (analysis.ab09ad, SlycotResultWarning, ((1, 0), ), {'nr': 3, 'Nr': 2}), (analysis.ab09md, SlycotArithmeticError, 3, {'alpha': -0.1}), (analysis.ab09md, SlycotResultWarning, ((1, 0), (2, 0)), {'nr': 3, 'Nr': 2, 'alpha': -0.1}), (analysis.ab09nd, SlycotArithmeticError, 3, {'alpha': -0.1}), (analysis.ab09nd, SlycotResultWarning, ((1, 0), (2, 0)), {'nr': 3, 'Nr': 2, 'alpha': -0.1}), (analysis.ab13bd, SlycotArithmeticError, 6, {'dico': 'C'}), (analysis.ab13bd, SlycotResultWarning, ((1, 0),), {}), (analysis.ab13dd, SlycotArithmeticError, 4, {}), (analysis.ab13ed, SlycotArithmeticError, 1, {}), (analysis.ab13fd, SlycotArithmeticError, (2,), {}), (analysis.ab13fd, SlycotResultWarning, (1,), {}))) def test_ab_docparse(fun, exception_class, erange, checkvars): assert_docstring_parse(fun.__doc__, exception_class, erange, checkvars)
python-control/Slycot
slycot/tests/test_analysis.py
test_analysis.py
py
2,436
python
en
code
115
github-code
6
[ { "api_name": "test_exceptions.assert_docstring_parse", "line_number": 42, "usage_type": "call" }, { "api_name": "pytest.mark.parametrize", "line_number": 13, "usage_type": "call" }, { "api_name": "pytest.mark", "line_number": 13, "usage_type": "attribute" }, { "a...
5654287369
from django.shortcuts import render from django.http import Http404, HttpResponse, JsonResponse from django.template import loader from catalog.models import * from django.forms.models import model_to_dict import random from django.views.decorators.csrf import csrf_exempt from django.middleware.csrf import get_token import json # Create your views here. def index(request): template = loader.get_template('template.html') context = {} questions_id = [] related_choices = [] ID = "" name = "" # get all available modules and randomly pick one module = list(modules.objects.all().values('module_name')) randomed = [i for i in range(len(module))] random.shuffle(randomed) context['module'] = module[randomed[0]] #print(context) # # get related questions and pass to html template module_id = list(modules.objects.filter(module_name=context['module']['module_name']).values("id"))[0]['id'] question = list(questions.objects.all().filter(questions_under_id=module_id)) random.shuffle(question) context['question'] = question #print(context) # #get related answers and pass to html template #print(question) for i in question: questions_id.append(i.id) #print(questions_id) for id in questions_id: related_choices.append(list(answers.objects.filter(answers_under_id=id))) context['answer'] = related_choices #print(context['answer']) # # get Id & scores and pass to html template name = module[randomed[0]]["module_name"] print(name) Id = modules.objects.filter(module_name=name).values('id') for each in Id: ID = each['id'] print(ID) Scores = scores.objects.filter(score_under_id=ID).order_by('scores').reverse() print(Scores) context['scores'] = Scores return HttpResponse(template.render(context,request)) def newScore(request): print("SUCCESS : AJAX ENTERED!") template = loader.get_template('template.html') context = {} under_ID = "" if request.method == "POST" : # handle save logic if request.body: jsonLoad = json.loads(request.body) Scores = jsonLoad['scores'] username = jsonLoad['username'] module = jsonLoad['module'] else : return JsonResponse({"errors": ["POST object has insufficient parameters!"]}) ID = modules.objects.filter(module_name=module).values('id') for each in ID: under_ID = each['id'] errors = scores(scores=Scores, gameId=username, score_under_id=under_ID) errors.save() return HttpResponse(template.render(context,request))
jng27/Agile
psb_project/locallibrary/catalog/views.py
views.py
py
2,686
python
en
code
0
github-code
6
[ { "api_name": "django.template.loader.get_template", "line_number": 13, "usage_type": "call" }, { "api_name": "django.template.loader", "line_number": 13, "usage_type": "name" }, { "api_name": "random.shuffle", "line_number": 22, "usage_type": "call" }, { "api_nam...
10423490633
from __future__ import annotations import pytest from randovania.lib import migration_lib def test_migrate_to_version_missing_migration() -> None: data = { "schema_version": 1, } with pytest.raises( migration_lib.UnsupportedVersion, match=( "Requested a migration from something 1, but it's no longer supported. " "You can try using an older Randovania version." ), ): migration_lib.apply_migrations(data, [None], version_name="something") def test_migrate_to_version_data_too_new() -> None: data = { "schema_version": 3, } with pytest.raises( migration_lib.UnsupportedVersion, match=( "Found version 3, but only up to 2 is supported. This file was created using a newer Randovania version." ), ): migration_lib.apply_migrations(data, [None])
randovania/randovania
test/lib/test_migration_lib.py
test_migration_lib.py
py
899
python
en
code
165
github-code
6
[ { "api_name": "pytest.raises", "line_number": 13, "usage_type": "call" }, { "api_name": "randovania.lib.migration_lib.UnsupportedVersion", "line_number": 14, "usage_type": "attribute" }, { "api_name": "randovania.lib.migration_lib", "line_number": 14, "usage_type": "name"...
33800228048
# BFS from collections import deque import sys input = lambda: sys.stdin.readline() def bfs(i, c): # 정점, 색상 q = deque([i]) visited[i] = True color[i] = c while q: i = q.popleft() for j in arr[i]: if not visited[j]: visited[j] = True q.append(j) color[j] = 3- color[i] else: if color[i] == color[j]: return False return True if __name__ == '__main__': k = int(input()) for _ in range(k): # 테스트 케이스 v,e = map(int, input().split()) color = [0] * (v+1) arr = [[] for _ in range(v+1)] for _ in range(e): a,b = map(int, input().split()) arr[a].append(b) arr[b].append(a) answer = True visited = [False] * (v+1) for i in range(1, v+1): if not visited[i]: if not bfs(i, 1): # return False이면 종료 answer = False break print('YES' if answer else 'NO') # DFS -> 메모리 초과 # from collections import deque # import sys # input = lambda: sys.stdin.readline() # sys.setrecursionlimit(10**6) # def dfs(i, c): # 정점, 색상 # color[i] = c # for j in arr[i]: # if color[j] == 0: # if not dfs(j, 3-c): # return False # elif color[i] == color[j]: # return False # return True # if __name__ == '__main__': # k = int(input()) # for _ in range(k): # 테스트 케이스 # v,e = map(int, input().split()) # color = [0] * (v) # arr = [[] for _ in range(v)] # for _ in range(e): # a,b = map(int, input().split()) # arr[a-1].append(b-1) # arr[b-1].append(a-1) # answer = True # for i in range(0, v): # if color[i] == 0: # if not dfs(i, 1): # answer = False # print('YES' if answer else 'NO')
devAon/Algorithm
BOJ-Python/boj-1707_이분그래프.py
boj-1707_이분그래프.py
py
2,065
python
en
code
0
github-code
6
[ { "api_name": "sys.stdin.readline", "line_number": 4, "usage_type": "call" }, { "api_name": "sys.stdin", "line_number": 4, "usage_type": "attribute" }, { "api_name": "collections.deque", "line_number": 7, "usage_type": "call" } ]
23423087794
import logging from ab.base import NavTable from ab.base import Link, Data, Item class Console (object): def __init__ (self): self._indent = 0 self._nt = NavTable() self.logger = logging.getLogger ('ab') self.log = lambda msg, level=logging.INFO: self.logger.info (msg) def reset (self): self._indent = 0 self._nt = NavTable() def indent_more (self): self._indent += 2 return self._indent def indent_less (self): self._indent -= 2 return self._indent def indent (self): return self._indent # def add_nav_entry (self, **kwa): # href = kwa.get ('href') # # if href: # no = self._nt.set (href = href) # return no # # # def nav_table (self): # if not len (self._nt): # raise UserWarning ('empty nav table') # # return self._nt # # # def next_target_no (self): # self._target_no += 1 def draw (self, thing): out = '\n' # if type (thing) in [list, tuple]: if type (thing) is list: self.indent_more() for t in thing: out += self.draw (t) self.indent_less() elif isinstance (thing, Item): out += '{indent}[{index}] {prompt} ({href})'.format ( indent = ' ' * self.indent(), index = self._nt.set (href = thing.href), prompt = 'Permaurl', href = 'GET ' + thing.href, ) out += self.draw (thing.data) out += self.draw (thing.links) elif isinstance (thing, Data): out += '{indent}{prompt}: {value}'.format ( indent = ' ' * self.indent(), prompt = thing.prompt, value = thing.value, ) elif isinstance (thing, Link): out += '{indent}[{index}] {prompt} ({method} {href})'.format ( indent = ' ' * self.indent(), index = self._nt.set (href = thing.href), prompt = thing.prompt, method = thing.method, href = thing.href, ) else: out += '<%s>' % thing return out
oftl/ab
ui.py
ui.py
py
2,324
python
en
code
0
github-code
6
[ { "api_name": "ab.base.NavTable", "line_number": 10, "usage_type": "call" }, { "api_name": "logging.getLogger", "line_number": 11, "usage_type": "call" }, { "api_name": "logging.INFO", "line_number": 12, "usage_type": "attribute" }, { "api_name": "ab.base.NavTable...
36559608646
import scipy as sci import numpy as np import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D from matplotlib import animation import scipy.integrate #Definitionen G=6.67408e-11 m_nd=1.989e+30 #Masse der Sonne r_nd=5.326e+12 v_nd=30000 t_nd=79.91*365*24*3600*0.51 K1=G*t_nd*m_nd/(r_nd**2*v_nd) K2=v_nd*t_nd/r_nd #Definition der Massen m1=1.1 #Alpha Centauri A m2=0.907 #Alpha Centauri B m3=1.0 #Dritter Stern #Definition der Anfangs-Positionen r1=np.array([-0.5,0,0], dtype="float64") r2=np.array([0.5,0,0], dtype="float64") r3=np.array([0,1,0], dtype="float64") #Definition der Anfangs-Geschwindigkeiten v1=np.array([0.01,0.01,0], dtype="float") v2=np.array([-0.05,0,-0.1], dtype="float64") v3=np.array([0,-0.01,0], dtype="float64") #Updaten der COM Formeln r_com=(m1*r1+m2*r2+m3*r3)/(m1+m2+m3) v_com=(m1*v1+m2*v2+m3*v3)/(m1+m2+m3) #Bewegungsgleichungen def ThreeBodyEquations(w,t,G,m1,m2,m3): r1=w[:3] r2=w[3:6] r3=w[6:9] v1=w[9:12] v2=w[12:15] v3=w[15:18] r12=sci.linalg.norm(r2-r1) r13=sci.linalg.norm(r3-r1) r23=sci.linalg.norm(r3-r2) dv1bydt=K1*m2*(r2-r1)/r12**3+K1*m3*(r3-r1)/r13**3 dv2bydt=K1*m1*(r1-r2)/r12**3+K1*m3*(r3-r2)/r23**3 dv3bydt=K1*m1*(r1-r3)/r13**3+K1*m2*(r2-r3)/r23**3 dr1bydt=K2*v1 dr2bydt=K2*v2 dr3bydt=K2*v3 r12_derivs=np.concatenate((dr1bydt,dr2bydt)) r_derivs=np.concatenate((r12_derivs,dr3bydt)) v12_derivs=np.concatenate((dv1bydt,dv2bydt)) v_derivs=np.concatenate((v12_derivs,dv3bydt)) derivs=np.concatenate((r_derivs,v_derivs)) return derivs init_params=np.array([r1,r2,r3,v1,v2,v3]) init_params=init_params.flatten() #Erstellen eines 1D Array time_span=np.linspace(0,20,500) #20 Perioden und 500 Punkte #Integrieren der Funktion three_body_sol=sci.integrate.odeint(ThreeBodyEquations,init_params,time_span,args=(G,m1,m2,m3)) r1_sol=three_body_sol[:,:3] r2_sol=three_body_sol[:,3:6] r3_sol=three_body_sol[:,6:9] #Erstellen der Figur fig=plt.figure(figsize=(15,15)) #Erstellen der Achsen ax=fig.add_subplot(111,projection="3d") #Ploten der Orbits ax.plot(r1_sol[:,0],r1_sol[:,1],r1_sol[:,2],color="darkblue") ax.plot(r2_sol[:,0],r2_sol[:,1],r2_sol[:,2],color="tab:red") ax.plot(r3_sol[:,0],r3_sol[:,1],r3_sol[:,2],color="tab:green") #Plotten der finalen Position der Körper ax.scatter(r1_sol[-1,0],r1_sol[-1,1],r1_sol[-1,2],color="darkblue",marker="o",s=100,label="Alpha Centauri A") ax.scatter(r2_sol[-1,0],r2_sol[-1,1],r2_sol[-1,2],color="tab:red",marker="o",s=100,label="Alpha Centauri B") ax.scatter(r3_sol[-1,0],r3_sol[-1,1],r3_sol[-1,2],color="tab:green",marker="o",s=100,label="Third Star") #Hinzufügen der Beschriftungen ax.set_xlabel("x-Koordinate",fontsize=14) ax.set_ylabel("y-Koordinate",fontsize=14) ax.set_zlabel("z-Kordinate",fontsize=14) ax.set_title("Visualisierung der Orbits von Objekten im Raum\n",fontsize=14) ax.legend(loc="upper left",fontsize=14) ani = animation.FuncAnimation(fig, ThreeBodyEquations, frames=1000, interval=50) plt.show()
Gauner3000/Facharbeit
Euler_Planetenbewegung_3D.py
Euler_Planetenbewegung_3D.py
py
3,103
python
en
code
0
github-code
6
[ { "api_name": "numpy.array", "line_number": 22, "usage_type": "call" }, { "api_name": "numpy.array", "line_number": 23, "usage_type": "call" }, { "api_name": "numpy.array", "line_number": 24, "usage_type": "call" }, { "api_name": "numpy.array", "line_number": ...
44407906870
import wx import ResizableRuneTag ''' Created on 23/lug/2011 @author: Marco ''' class DrawableFrame(wx.Window): ''' Allows user to put resizable rune tags in a A4 like white frame Configuration realized on that frame is then replicated proportionally at export time ''' def __init__(self, parent, height, width): wx.Window.__init__(self, parent) self.SetSize((height, width)) self.SetMinSize((height, width)) self.SetMaxSize((height, width)) self.SetBackgroundColour(wx.Colour(255, 255, 255)) self.resizableRuneTags = [] ''' Constructor ''' def DrawRuneTag(self, runeTagName, position, size, originalSize, info): self.resizableRuneTags.append(ResizableRuneTag.ResizableRuneTag(self, runeTagName, size, position, originalSize, info)) def Clear(self): for resizableRuneTag in self.resizableRuneTags: resizableRuneTag.Destroy() def checkSpecificPosition(self, changedRuneTag): for tag in self.resizableRuneTags: if changedRuneTag != tag: radius1 = (tag.GetSize().GetHeight())/2 - 5 radius2 = (changedRuneTag.GetSize().GetHeight())/2 - 5 deltax = (tag.GetPosition().x + radius1) - (changedRuneTag.GetPosition().x + radius2) deltay = (tag.GetPosition().y + radius1) - (changedRuneTag.GetPosition().y + radius2) distance = (deltax*deltax + deltay*deltay)**(0.5) radiusSum = radius1 + radius2 if distance <= radiusSum: self.Parent.Parent.runeTagInfo.UpdateOverlap("In the output pdf file\n some slots of "+changedRuneTag.name+" RuneTag\n may laps over "+tag.name+"RuneTag") else: self.Parent.Parent.runeTagInfo.UpdateOverlap("") def checkPosition(self): size = len(self.resizableRuneTags) for i in range(0, size): for j in range(i+1, size): tag1 = self.resizableRuneTags[i] tag2 = self.resizableRuneTags[j] radius1 = (tag1.GetSize().GetHeight())/2 - 5 radius2 = (tag2.GetSize().GetHeight())/2 - 5 deltax = (tag1.GetPosition().x + radius1) - (tag2.GetPosition().x + radius2) deltay = (tag1.GetPosition().y + radius1) - (tag2.GetPosition().y + radius2) distance = (deltax**2 + deltay**2)**(0.5) radiusSum = radius1 + radius2 if distance <= radiusSum: self.Parent.Parent.runeTagInfo.UpdateOverlap("In the output pdf file some slots of\n"+tag1.name+" RuneTag\n may laps over\n"+tag2.name+" RuneTag") else: self.Parent.Parent.runeTagInfo.UpdateOverlap("")
mziccard/RuneTagDrawer
DrawableFrame.py
DrawableFrame.py
py
2,831
python
en
code
3
github-code
6
[ { "api_name": "wx.Window", "line_number": 9, "usage_type": "attribute" }, { "api_name": "wx.Window.__init__", "line_number": 16, "usage_type": "call" }, { "api_name": "wx.Window", "line_number": 16, "usage_type": "attribute" }, { "api_name": "wx.Colour", "line...
36008540577
import sqlite3 import os import shlex class Database(): def __init__(self, db_file): """Connect to the SQLite DB""" try: self.conn = sqlite3.connect(db_file) self.cursor = self.conn.cursor() except BaseException as err: #print(str(err)) self.conn = None self.cursor = None def create_table(self, table_name, columns): query = f"CREATE TABLE IF NOT EXISTS {table_name} ({', '.join([f'{k} {v}' for k, v in columns.items()])})" self.cursor.execute(query) self.conn.commit() def create_index(self, index_name, table_name, column_list): #query = f"CREATE INDEX IF NOT EXISTS {index_name} ON {table_name} ({column_list})" query = f"CREATE INDEX IF NOT EXISTS idx_hash ON file_hash(filepath, filehash)" self.cursor.execute(query) self.conn.commit() def delete_table(self, table_name): query = f"DROP TABLE IF EXISTS {table_name}" self.cursor.execute(query) self.conn.commit() def add_record(self, table_name, record): query = f"INSERT INTO {table_name} ({', '.join(record.keys())}) VALUES ({', '.join(['?' for _ in record.values()])})" #print(query) self.cursor.execute(query, list(record.values())) self.conn.commit() def delete_record(self, table_name, condition): query = f"DELETE FROM {table_name} WHERE {condition}" self.cursor.execute(query) self.conn.commit() def run_query(self, query): #print(query) self.cursor.execute(query, args) return self.cursor.fetchall() def show_all_records(self, table_name): query = f"SELECT * FROM {table_name}" self.cursor.execute(query) return self.cursor.fetchall() def show_record(self, table_name, filepath): file_path = (filepath) #query = f"SELECT * FROM {table_name} WHERE {condition}" #print(f"SELECT filename,filepath, filehash, timestamp FROM {table_name} WHERE filepath = '{file_path}'") query = f'SELECT filename,filepath, filehash, timestamp FROM {table_name} WHERE filepath = "{file_path}"' self.cursor.execute(query) return self.cursor.fetchall() def update_record(self, table, filepath, filehash): """Update the SQLite File Table""" file_path = filepath #print(f"file path: {file_path}") query = f"UPDATE {table} SET filehash = '{filehash}' WHERE filepath = '{file_path}'" self.cursor.execute(query) return self.cursor.fetchall() def is_rec_modifed(filepath,filehash,timestamp): """Check record for any changes Returning false until function is completed""" return False def show_duplicate_records(self, table_name, index_name, value): query = f"SELECT filename, filepath, filehash FROM {table_name} WHERE {index_name} = '{value}'" self.cursor.execute(query) return self.cursor.fetchall() def show_all_tables(self): query = "SELECT name FROM sqlite_master WHERE type='table'" self.cursor.execute(query) return self.cursor.fetchall() def close_connection(self): self.conn.close() if __name__ == '__main__': db = Database('test.db') db.create_table('users', {'id': 'INTEGER PRIMARY KEY', 'name': 'TEXT', 'email': 'TEXT'}) db.add_record('users', {'name': 'Alice', 'email': 'alice@example.com'}) db.add_record('users', {'name': 'Bob', 'email': 'bob@example.com'}) db.add_record('users', {'name': 'Charlie', 'email': 'charlie@example.com'}) print(db.show_all_records('users')) print(db.show_record('users', "name='Alice'")) db.delete_record('users', "name='Bob'") print(db.show_all_records('users')) db.delete_table('users') db.close_connection() os.remove('test.db')
echeadle/File_Track
app/sqlite_db.py
sqlite_db.py
py
3,901
python
en
code
0
github-code
6
[ { "api_name": "sqlite3.connect", "line_number": 9, "usage_type": "call" }, { "api_name": "os.remove", "line_number": 101, "usage_type": "call" } ]
39259262942
#!/usr/bin/env python3 import rclpy from rclpy.node import Node import speech_recognition as sr from custom_if.srv import SendSentence from functools import partial import time ### Node class class SpeechToText(Node): def __init__(self): super().__init__("stt_node") self.get_logger().info("STT node is up.") self.stt = sr.Recognizer() # Methods self.listen_to_user() ## Listen and write def listen_to_user(self): self.call_nlu("Welcome") # Inner loop while True: with sr.Microphone() as source: self.stt.adjust_for_ambient_noise(source, duration=0.2) audio = self.stt.listen(source) try: sentence = "{0}".format(self.stt.recognize_google(audio, language="it-IT")) if 'Marvin' in sentence.split(" "): self.call_nlu(sentence) except sr.UnknownValueError: self.get_logger().warn("Waiting for a command.") except sr.RequestError as e: self.get_logger().error("STT Error; {0}".format(e)) # Definition of the client request to the TTS def call_nlu(self, sentence): client = self.create_client(SendSentence, "send_command") while not client.wait_for_service(1.0): self.get_logger().warn("Waiting for Server...") request = SendSentence.Request() request.sentence = sentence future = client.call_async(request) future.add_done_callback(partial(self.callback_call_nlu, sentence=sentence)) def callback_call_nlu(self, future, sentence): try: response = future.result() self.get_logger().info(f"Request solved: {response}") except Exception as e: self.get_logger().error("Request failed.") def main(args=None): rclpy.init(args=args) node = SpeechToText() rclpy.spin(node) rclpy.shutdown() if __name__ == "__main__": main()
Alessandro-Scarciglia/VoiceAssistant
speech_to_text/speech_to_text/speech_to_text.py
speech_to_text.py
py
1,732
python
en
code
0
github-code
6
[ { "api_name": "rclpy.node.Node", "line_number": 12, "usage_type": "name" }, { "api_name": "speech_recognition.Recognizer", "line_number": 16, "usage_type": "call" }, { "api_name": "speech_recognition.Microphone", "line_number": 29, "usage_type": "call" }, { "api_n...
7920943241
""" Neural Networks - Deep Learning Heart Disease Predictor ( Binary Classification ) Author: Dimitrios Spanos Email: dimitrioss@ece.auth.gr """ import numpy as np from cvxopt import matrix, solvers # ------------ # Kernels # ------------ def poly(x, z, d=3, coef=1, g=1): return (g * np.dot(x, z.T) + coef) ** d def rbf(x, z, sigma): return np.exp(-np.linalg.norm(x-z,axis=1)**2 / (2*(sigma**2))) def linear(x, z): return np.matmul(x, z.T) def sigmoid(x, z, g=1, coef=0): return np.tanh(g * np.dot(x, z.T) + coef) # ------------ # SVM # ------------ class my_SVM: def __init__(self, C, kernel='linear', sigma=1): self.C = C self.kernel = kernel self.sigma = sigma self.sv = 0 self.sv_y = 0 self.alphas = 0 self.w = 0 self.b = 0 def fit(self, X, y): # Calculate the Kernel(xi,xj) m, n = X.shape K = np.zeros((m,m)) if self.kernel == 'rbf': for i in range(m): K[i,:] = rbf(X[i,np.newaxis], X, sigma=self.sigma) elif self.kernel == 'poly': for i in range(m): K[i,:] = poly(X[i,np.newaxis], X) elif self.kernel == 'sigmoid': for i in range(m): K[i,:] = sigmoid(X[i,np.newaxis], X) elif self.kernel == 'linear': for i in range(m): K[i,:] = linear(X[i,np.newaxis], X) # Solve the QP Problem P = matrix(np.outer(y, y) * K) q = matrix(-np.ones((m, 1))) A = matrix(matrix(y.T), (1, m), 'd') b = matrix(np.zeros(1)) G = matrix(np.vstack((np.eye(m)*-1, np.eye(m)))) h = matrix(np.hstack((np.zeros(m),np.ones(m)*self.C))) solvers.options['show_progress'] = False solution = solvers.qp(P, q, G, h, A, b) # Get the solution's results alphas = np.array(solution['x']) S = (alphas > 1e-4).flatten() self.sv = X[S] self.sv_y = y[S] self.w = np.dot((y.reshape(-1,1) * alphas).T, X)[0] self.alphas = alphas[S] # get rid of alphas ~= 0 self.b = np.mean(self.sv_y - np.dot(self.sv, self.w.T)) #print("w:", self.w) #print("b:", self.b) def predict(self, X): K_xi_x = 0 if self.kernel == 'rbf': K_xi_x = rbf(self.sv, X, self.sigma) elif self.kernel == 'poly': K_xi_x = poly(self.sv, X) elif self.kernel == 'sigmoid': K_xi_x = sigmoid(self.sv, X) elif self.kernel == 'linear': K_xi_x = linear(self.sv, X) sum = 0 for i in range(len(K_xi_x)): sum +=self.alphas[i] * self.sv_y[i]* K_xi_x[i] prod = sum + self.b prediction = np.sign(prod) return prediction
DimitriosSpanos/SVM-from-Scratch
SVM.py
SVM.py
py
2,908
python
en
code
0
github-code
6
[ { "api_name": "numpy.dot", "line_number": 14, "usage_type": "call" }, { "api_name": "numpy.exp", "line_number": 17, "usage_type": "call" }, { "api_name": "numpy.linalg.norm", "line_number": 17, "usage_type": "call" }, { "api_name": "numpy.linalg", "line_number...
42710543766
''' @ Carlos Suarez 2020 ''' import requests import datetime import time import json from cachetools import TTLCache import ssl import sys class MoodleControlador(): def __init__(self,domain,token,cert): self.domain = domain self.token = token self.cert = cert #Moodle LTI def getGrabacionesMoodleContextoLTI(self,moodle_id,tiempo): endpoint = 'https://' + self.domain + '/contexts/?extId=' + moodle_id bearer = "Bearer " + self.token headers = { "Authorization":bearer, 'Content-Type': 'application/json', 'Accept': 'application/json' } r = requests.get(endpoint,headers=headers,verify=self.cert) if r.status_code == 200: jsonInfo = json.loads(r.text) if jsonInfo['size'] > 0: contexto_id = jsonInfo['results'][0]['id'] return contexto_id else: return None else: print("Error Moodle ContextoLTI:" , str(r)) def grabacionesMoodleLTI(self,contexto_id): endpoint = 'https://' + self.domain + '/recordings/?contextId=' + contexto_id bearer = "Bearer " + self.token headers = { "Authorization":bearer, 'Content-Type': 'application/json', 'Accept': 'application/json' } r = requests.get(endpoint,headers=headers) if r.status_code == 200: jsonInfo = json.loads(r.text) return jsonInfo else: print("Error GrabacionesLTL: " , str(r)) def get_moodleLTI_recording_data(self,recording_id): authStr = 'Bearer ' + self.token url = 'https://' + self.domain + '/recordings/' + recording_id + '/data' credencial ={ 'Authorization': authStr, 'Content-Type': 'application/json', 'Accept': 'application/json' } r = requests.get(url,headers=credencial, verify=self.cert) if r.status_code == 200: res = json.loads(r.text) return res else: print(r) #Moodle plugin def moodleSesionName(self,sesionId): endpoint = 'https://' + self.domain + '/sessions/' + sesionId credencial = { "Authorization":"Bearer " + self.token, 'Content-Type': 'application/json', 'Accept': 'application/json' } r = requests.get(endpoint,headers=credencial,verify=self.cert) if r.status_code == 200: res = json.loads(r.text) return res['name'] else: print("Error Session:", str(r)) def listaCompletaSessiones(self,criteria): listaFiltrada = [] endpoint = 'https://' + self.domain + '/sessions' credencial = { "Authorization":"Bearer " + self.token, 'Content-Type': 'application/json', 'Accept': 'application/json' } r = requests.get(endpoint,headers=credencial,verify=self.cert) if r.status_code == 200: res = json.loads(r.text) resultado = res['results'] for sesion in resultado: if criteria in sesion['name']: listaFiltrada.append({'id':sesion['id'], 'name':sesion['name']}) return listaFiltrada else: print("Error Session:", str(r)) def listaCompletaMoodleGrabaciones(self): listaGrabaciones = [] endpoint = 'https://' + self.domain + '/recordings' credencial = { 'Authorization': 'Bearer ' + self.token, 'Accept':'application/json' } r = requests.get(endpoint,headers=credencial,verify=self.cert) if r.status_code == 200: jsonInfo = json.loads(r.text) resultado = jsonInfo['results'] if len(resultado) == 0: print("No recordings found") else: for grabacion in resultado: listaGrabaciones.append({'id':grabacion['id'], 'name':grabacion['name']}) print(listaGrabaciones) else: print("Error listaGrabación Moodle:", str(r)) def listaMoodleGrabaciones(self,sname): endpoint = 'https://' + self.domain + '/recordings?name=' + sname credencial = { "Authorization":"Bearer " + self.token, 'Content-Type': 'application/json', 'Accept': 'application/json' } r = requests.get(endpoint,headers=credencial,verify=self.cert) if r.status_code == 200: res = json.loads(r.text) idx = 0 recording_ids = [] try: numero_grabaciones = len(res['results']) if numero_grabaciones <= 0: return None while idx < numero_grabaciones: if 'storageSize' in res['results'][idx]: recording_ids.append({ 'recording_id':res['results'][idx]['id'], 'recording_name':res['results'][idx]['name'], 'duration':res['results'][idx]['duration'], 'storageSize':res['results'][idx]['storageSize'], 'created':res['results'][idx]['created'] }) else: recording_ids.append({ 'recording_id':res['results'][idx]['id'], 'recording_name':res['results'][idx]['name'], 'duration':res['results'][idx]['duration'], 'storageSize':0, 'created':res['results'][idx]['created'] }) idx += 1 return recording_ids except TypeError: return None else: return None
sfc-gh-csuarez/PyCollab
controladores/MoodleControlador.py
MoodleControlador.py
py
6,010
python
en
code
15
github-code
6
[ { "api_name": "requests.get", "line_number": 29, "usage_type": "call" }, { "api_name": "json.loads", "line_number": 31, "usage_type": "call" }, { "api_name": "requests.get", "line_number": 51, "usage_type": "call" }, { "api_name": "json.loads", "line_number": ...
18680754942
import matplotlib.pyplot as plt import numpy as np import os import PIL import tensorflow as tf from tensorflow import keras from tensorflow.keras import layers from tensorflow.keras.models import Sequential import pathlib data_dir = "./Covid(CNN)/Veriseti" data_dir = pathlib.Path(data_dir) image_count = len(list(data_dir.glob('*/*.jpeg'))) print(image_count) ''' roses = list(data_dir.glob('roses/*')) PIL.Image.open(str(roses[0])) PIL.Image.open(str(roses[1])) tulips = list(data_dir.glob('tulips/*')) PIL.Image.open(str(tulips[0])) PIL.Image.open(str(tulips[1])) ''' batch_size = 32 img_height = 180 img_width = 180 #Görüntülerin% 80'ini eğitim için ve% 20'sini doğrulama için kullanalım. train_ds = tf.keras.preprocessing.image_dataset_from_directory( "./Veriseti", validation_split=0.2, subset="training", seed=123, image_size=(img_height, img_width), batch_size=batch_size) val_ds = tf.keras.preprocessing.image_dataset_from_directory( "./Veriseti", validation_split=0.2, subset="validation", seed=123, image_size=(img_height, img_width), batch_size=batch_size) class_names = train_ds.class_names print(class_names) import matplotlib.pyplot as plt #Verileri görselleştirin.Eğitim veri kümesindeki ilk 9 görüntü. plt.figure(figsize=(10, 10)) for images, labels in train_ds.take(1): for i in range(9): ax = plt.subplot(3, 3, i + 1) plt.imshow(images[i].numpy().astype("uint8")) plt.title(class_names[labels[i]]) plt.axis("off") #Bu, 180x180x3 şeklinde 32 görüntüden oluşan bir 180x180x3 (son boyut, RGB renk kanallarına atıfta bulunur) #label_batch , şeklin bir label_batch (32,) , bunlar 32 görüntüye karşılık gelen etiketlerdir. for image_batch, labels_batch in train_ds: print(image_batch.shape) print(labels_batch.shape) break AUTOTUNE = tf.data.experimental.AUTOTUNE #Dataset.cache() , görüntüleri ilk dönemde diskten yüklendikten sonra bellekte tutar. #Bu, modelinizi eğitirken veri kümesinin bir darboğaz haline gelmemesini sağlayacaktır. train_ds = train_ds.cache().shuffle(1000).prefetch(buffer_size=AUTOTUNE) val_ds = val_ds.cache().prefetch(buffer_size=AUTOTUNE) #Dataset.prefetch() , eğitim sırasında veri ön işleme ve model yürütme ile çakışır. #RGB kanal değerleri [0, 255] aralığındadır. Bu bir sinir ağı için ideal değildir #Yeniden Ölçeklendirme katmanı kullanarak değerleri [0, 1] aralığında olacak şekilde standart hale getiriyoruz. normalization_layer = layers.experimental.preprocessing.Rescaling(1./255) #Bu katmanı kullanmanın iki yolu vardır. Haritayı çağırarak veri kümesine uygulayabilirsiniz: normalized_ds = train_ds.map(lambda x, y: (normalization_layer(x), y)) image_batch, labels_batch = next(iter(normalized_ds)) first_image = image_batch[0] # Notice the pixels values are now in `[0,1]`. print(np.min(first_image), np.max(first_image)) #Veya katmanı model tanımınızın içine dahil ederek dağıtımı basitleştirebilirsiniz. Burada ikinci yaklaşımı kullanalım. num_classes = 4 #Modeli oluşturun model = Sequential([ layers.experimental.preprocessing.Rescaling(1./255, input_shape=(img_height, img_width, 3)), layers.Conv2D(16, 3, padding='same', activation='relu'), layers.MaxPooling2D(), layers.Conv2D(32, 3, padding='same', activation='relu'), layers.MaxPooling2D(), layers.Conv2D(64, 3, padding='same', activation='relu'), layers.MaxPooling2D(), layers.Flatten(), layers.Dense(128, activation='relu'), layers.Dense(num_classes) ]) #Modeli derleyin model.compile(optimizer='adam', loss=tf.keras.losses.SparseCategoricalCrossentropy(from_logits=True), metrics=['accuracy']) #Model özeti model.summary() #Modeli eğitin epochs=10 history = model.fit( train_ds, validation_data=val_ds, epochs=epochs ) #Eğitim ve doğrulama setlerinde kayıp ve doğruluk grafikleri oluşturun. acc = history.history['accuracy'] val_acc = history.history['val_accuracy'] loss = history.history['loss'] val_loss = history.history['val_loss'] epochs_range = range(epochs) plt.figure(figsize=(8, 8)) plt.subplot(1, 2, 1) plt.plot(epochs_range, acc, label='Training Accuracy') plt.plot(epochs_range, val_acc, label='Validation Accuracy') plt.legend(loc='lower right') plt.title('Training and Validation Accuracy') plt.subplot(1, 2, 2) plt.plot(epochs_range, loss, label='Training Loss') plt.plot(epochs_range, val_loss, label='Validation Loss') plt.legend(loc='upper right') plt.title('Training and Validation Loss') plt.show() #Veri büyütme data_augmentation = keras.Sequential( [ layers.experimental.preprocessing.RandomFlip("horizontal", input_shape=(img_height, img_width, 3)), layers.experimental.preprocessing.RandomRotation(0.1), layers.experimental.preprocessing.RandomZoom(0.1), ] ) #Birkaç artırılmış örneğin nasıl göründüğünü, aynı görüntüye birkaç kez veri artırma uygulayarak görselleştirelim plt.figure(figsize=(10, 10)) for images, _ in train_ds.take(1): for i in range(9): augmented_images = data_augmentation(images) ax = plt.subplot(3, 3, i + 1) plt.imshow(augmented_images[0].numpy().astype("uint8")) plt.axis("off") #layers.Dropout kullanarak yeni bir sinir ağı oluşturalım. model = Sequential([ data_augmentation, layers.experimental.preprocessing.Rescaling(1./255), layers.Conv2D(16, 3, padding='same', activation='relu'), layers.MaxPooling2D(), layers.Conv2D(32, 3, padding='same', activation='relu'), layers.MaxPooling2D(), layers.Conv2D(64, 3, padding='same', activation='relu'), layers.MaxPooling2D(), layers.Dropout(0.2), layers.Flatten(), layers.Dense(128, activation='relu'), layers.Dense(num_classes) ]) #Modeli derleyin ve eğitin model.compile(optimizer='adam', loss=tf.keras.losses.SparseCategoricalCrossentropy(from_logits=True), metrics=['accuracy']) model.summary() epochs = 15 history = model.fit( train_ds, validation_data=val_ds, epochs=epochs ) #Eğitim sonuçları acc = history.history['accuracy'] val_acc = history.history['val_accuracy'] loss = history.history['loss'] val_loss = history.history['val_loss'] epochs_range = range(epochs) plt.figure(figsize=(8, 8)) plt.subplot(1, 2, 1) plt.plot(epochs_range, acc, label='Training Accuracy') plt.plot(epochs_range, val_acc, label='Validation Accuracy') plt.legend(loc='lower right') plt.title('Training and Validation Accuracy') plt.subplot(1, 2, 2) plt.plot(epochs_range, loss, label='Training Loss') plt.plot(epochs_range, val_loss, label='Validation Loss') plt.legend(loc='upper right') plt.title('Training and Validation Loss') plt.show() #Eğitim veya doğrulama setlerinde yer almayan bir resmi sınıflandırmak için modelimizi kullanalım. img_path = "./Veriseti/Covid.jpeg" img = keras.preprocessing.image.load_img( img_path, target_size=(img_height, img_width) ) img_array = keras.preprocessing.image.img_to_array(img) img_array = tf.expand_dims(img_array, 0) # Create a batch predictions = model.predict(img_array) score = tf.nn.softmax(predictions[0]) print( "This image most likely belongs to {} with a {:.2f} percent confidence." .format(class_names[np.argmax(score)], 100 * np.max(score)) )
elifyelizcelebi/Covid-CNN
model.py
model.py
py
7,465
python
tr
code
0
github-code
6
[ { "api_name": "pathlib.Path", "line_number": 15, "usage_type": "call" }, { "api_name": "tensorflow.keras.preprocessing.image_dataset_from_directory", "line_number": 34, "usage_type": "call" }, { "api_name": "tensorflow.keras", "line_number": 34, "usage_type": "attribute" ...
6425852046
# 한자리 숫자가 적힌 종이 조각이 흩어져있습니다. 흩어진 종이 조각을 붙여 소수를 몇 개 만들 수 있는지 알아내려 합니다. # 각 종이 조각에 적힌 숫자가 적힌 문자열 numbers가 주어졌을 때, # 종이 조각으로 만들 수 있는 소수가 몇 개인지 return 하도록 solution 함수를 완성해주세요. # 제한사항 # numbers는 길이 1 이상 7 이하인 문자열입니다. # numbers는 0~9까지 숫자만으로 이루어져 있습니다. # 013은 0, 1, 3 숫자가 적힌 종이 조각이 흩어져있다는 의미입니다. def find_prime(numbers) -> int: from itertools import permutations def is_prime(n: int) -> bool: if n==2: return True elif n==1 or n%2==0: return False for i in range(3, int(n**0.5)+1, 2): if n%i==0: return False return True answer=0 primes = [] for i in range(1, len(numbers)+1): perms = list(permutations(numbers, i)) for perm in perms: target='' for p in perm: target += p if is_prime(int(target)) and int(target) not in primes: primes.append(int(target)) answer += 1 return answer
script-brew/2019_KCC_Summer_Study
programmers/Lv_2/MaengSanha/findPrime.py
findPrime.py
py
1,326
python
ko
code
0
github-code
6
[ { "api_name": "itertools.permutations", "line_number": 26, "usage_type": "call" } ]
16053211401
import os import sys import glob import argparse from lsdo_viz.problem import Problem from lsdo_viz.utils import clean, get_viz, get_args, exec_python_file def main_viz(args=None): if args is None: args = sys.argv[1:] parser = argparse.ArgumentParser() parser.add_argument('args_file_name', nargs='?', default='viz_args.py') parser.add_argument('--clean_data', '-cd', nargs='?', default=None, const=True) parser.add_argument('--clean_frames', '-cf', nargs='?', default=None, const=True) parser.add_argument('--viz_initial', '-vi', nargs='?', default=None, const=True) parser.add_argument('--viz_final', '-vf', nargs='?', default=None, const=True) parser.add_argument('--viz_initial_show', '-vis', nargs='?', default=None, const=True) parser.add_argument('--viz_final_show', '-vfs', nargs='?', default=None, const=True) parser.add_argument('--viz_all', '-va', nargs='?', default=None, const=True) parser.add_argument('--movie', '-m', nargs='?', default=None, const=True) parsed_args = parser.parse_args(args) args = get_args(parsed_args.args_file_name) show = parsed_args.viz_initial_show or parsed_args.viz_final_show if not show: import matplotlib matplotlib.use('Agg') if parsed_args.clean_data: clean(args.data_dir) if parsed_args.clean_frames: clean(args.frames_dir) modes = [] if parsed_args.viz_initial or parsed_args.viz_initial_show: modes.append('viz_initial') if parsed_args.viz_final or parsed_args.viz_final_show: modes.append('viz_final') if parsed_args.viz_all: modes.append('viz_all') if parsed_args.movie: modes.append('movie') Problem.args = args Problem.viz = get_viz(args.viz_file_name) Problem.viz.args = args Problem.viz.show = show for mode in modes: Problem.mode = mode exec_python_file(args.run_file_name)
MAE155B-Group-3-SP20/Group3Repo
lsdo_viz/lsdo_viz/main_viz.py
main_viz.py
py
1,938
python
en
code
0
github-code
6
[ { "api_name": "sys.argv", "line_number": 12, "usage_type": "attribute" }, { "api_name": "argparse.ArgumentParser", "line_number": 14, "usage_type": "call" }, { "api_name": "lsdo_viz.utils.get_args", "line_number": 26, "usage_type": "call" }, { "api_name": "matplot...
41815384400
from urllib import response import requests from pprint import pprint from time import sleep import os from sqlalchemy import null url = "http://10.0.1.10:8080" # ------------------------ PRINT ------------------------ def menu(): os.system('clear') or None print("-------------------:-------------------") print("| 1 | Cadastrar Usuario |") print("| 2 | Exibir Usuario |") print("| 3 | Alterar Usuario |") print("| 4 | Excluir Usuario |") print("-------------------:-------------------") print("| 5 | Cadastrar Projeto |") print("| 6 | Exibir Projeto |") print("| 7 | Alterar Projeto |") print("| 8 | Excluir Projeto |") print("-------------------:-------------------") print("| 9 | SAIR |") print("-------------------:-------------------") def menu1(): os.system('clear') or None print("-------------------:-------------------") print("| 1 | Pessoa Física |") print("| 2 | Pessoa Jurídica Sair[0] |") print("-------------------:-------------------") def menu2(): print("-------------------:-------------------") print("| Deseja alterar? |") print("| [1] Sim [2] Não |") print("-------------------:-------------------") def main(): opc = None while opc != "9": menu() opc = input("Informe uma opcao: ") if opc == "1": #Cadastrar Usuario cadastroUser() elif opc == "2": #Exibir Usuario exibirUser() elif opc == "3": #Alterar Usuario alterarUser() elif opc == "4": #Excluir Usuario excluirUser() elif opc == "5": #Cadastrar Projeto cadastroProj() elif opc == "6": #Exibir Projeto exibirProj() elif opc == "7": #Alterar Projeto alterarProj() elif opc == "8": #Excluir Projeto excluirProj() elif opc == "9": exit() input("Pressione ENTER para continuar!\n") def jsonPrint(resp): if resp.status_code == 200: pprint(resp.json()) elif resp.status_code == 201: print("deletado!") print(resp) else: print(resp) # ------------------------ USER ------------------------ def cadastroUser(): opc = None while opc != 1 and opc != 2 and opc != 0: menu1() opc = input("Informe uma opcao: ") if opc == "1": #Fisica nome = input("Informe nome: ") idade = input("Informe idade: ") cpf = input("Informe cpf: ") instEnsino = input("Informe Instuicao de ensino: ") data = {"nome": nome, "idade": idade, "cpf": cpf, "instEnsino": instEnsino} requests.post(f"{url}/fisica", json=data) break elif opc == "2": #Juridica nome = input("Informe nome: ") segmento = input("Informe segmento: ") cnpj = input("Informe cnpj: ") data = {"nome": nome, "segmento": segmento, "cnpj": cnpj} requests.post(f"{url}/juridica", json=data) break elif opc == "0": break else: print("Opção invalida!") input("Pressione ENTER para continuar!\n") def exibirUser(): opc = None while opc != 1 and opc != 2 and opc != 0: menu1() opc = input("Informe uma opcao: ") if opc == "1": #Fisica cpf = input("Informe o cpf: ") resp = requests.get(f"{url}/fisica/" + cpf) jsonPrint(resp) break elif opc == "2": #Juridica cnpj = input("Informe o cnpj: ") resp = requests.get(f"{url}/juridica/" + cnpj) jsonPrint(resp) break elif opc == "0": break else: print("Opção invalida!") input("Pressione ENTER para continuar!\n") def alterarUser(): opc = None while opc != 1 and opc != 2 and opc != 0: menu1() opc = input("Informe uma opcao: ") if opc == "1": #Fisica cpf = input("Informe o cpf: ") resp = requests.get(f"{url}/fisica/" + cpf) jsonPrint(resp) menu2() opc1 = input("Informe uma opcao: ") if opc1 == "1": nome = input("Informe nome: ") idade = input("Informe idade: ") instEnsino = input("Informe Instuicao de ensino: ") data = {"nome": nome, "idade": idade, "cpf": cpf, "instEnsino": instEnsino} requests.put(f"{url}/fisica/" + cpf, json=data) else: break input("Pressione ENTER para continuar!\n") elif opc == "2": #Juridica cnpj = input("Informe o cnpj: ") resp = requests.get(f"{url}/juridica/" + cnpj) jsonPrint(resp) menu2() opc1 = input("Informe uma opcao: ") if opc1 == "1": nome = input("Informe nome: ") segmento = input("Informe segmento: ") data = {"nome": nome, "segmento": segmento, "cnpj": cnpj} requests.put(f"{url}/juridica/" + cnpj, json=data) else: break elif opc == "0": break else: print("Opção invalida!") input("Pressione ENTER para continuar!\n") def excluirUser(): opc = None while opc != 1 and opc != 2 and opc != 0: menu1() opc = input("Informe uma opcao: ") if opc == "1": cpf = input("Informe o cpf: ") resp = requests.delete(f"{url}/fisica/" + cpf) jsonPrint(resp) elif opc == "2": cnpj = input("Informe o cnpj: ") resp = requests.delete(f"{url}/juridica/" + cnpj) jsonPrint(resp) elif opc == "0": break else: print("Opção invalida!") input("Pressione ENTER para continuar!\n") # ------------------------ PROJETO ------------------------ def cadastroProj(): cpf = None cnpj = None nome = input("Informe nome: ") segmento = input("Informe o segmento: ") descricao = input("Informe a descrição: ") opc = None while opc != 1 and opc != 2 and opc != 0: menu1() opc = input("Informe uma opcao: ") if opc == "1": #Fisica cpf = input("Informe cpf: ") cnpj = "-" break elif opc == "2": #Juridica cnpj = input("Informe cnpj: ") cpf = "-" break elif opc == "0": break else: print("Opção invalida!") input("Pressione ENTER para continuar!\n") data = {"nome": nome, "segmento": segmento, "descricao": descricao, "cpf": cpf, "cnpj": cnpj} requests.post(f"{url}/projeto", json=data) def exibirProj(): nome = input("Nome do Projeto: ") resp = requests.get(f"{url}/projeto/" + nome) jsonPrint(resp) def alterarProj(): opc = None while opc != 1 and opc != 2 and opc != 0: nome = input("Informe o nome: ") resp = requests.get(f"{url}/projeto/" + nome) jsonPrint(resp) menu2() opc = input("Informe uma opcao: ") if opc == "1": newname = input("Informe nome: ") segmento = input("Informe o segmento: ") descricao = input("Informe a descrição: ") data = {"nome": newname, "segmento": segmento, "descricao": descricao} requests.put(f"{url}/projeto/" + nome, json=data) break else: break def excluirProj(): nome = input("Informe o nome: ") resp = requests.delete(f"{url}/projeto/" + nome) jsonPrint(resp) if __name__ == "__main__": main()
hencabral/Python-BoxCode-API
cliente.py
cliente.py
py
8,346
python
pt
code
0
github-code
6
[ { "api_name": "os.system", "line_number": 13, "usage_type": "call" }, { "api_name": "os.system", "line_number": 29, "usage_type": "call" }, { "api_name": "pprint.pprint", "line_number": 78, "usage_type": "call" }, { "api_name": "requests.post", "line_number": ...
14493907058
# -*- coding: utf-8 -*- # ''' -------------------------------------------------------------------------- # File Name: PATH_ROOT/utils/signal_vis.py # Author: JunJie Ren # Version: v1.1 # Created: 2021/06/15 # Description: — — — — — — — — — — — — — — — — — — — — — — — — — — — --> DD信号识别(可解释)系列代码 <-- -- 可视化信号输入 — — — — — — — — — — — — — — — — — — — — — — — — — — — # Module called: <0> PATH_ROOT/config.py <1> PATH_TOOT/dataset/RML2016.py — — — — — — — — — — — — — — — — — — — — — — — — — — — # Function List: <0> drawAllOriSignal(): 绘制所有信号输入样本的图像,并保存至相应标签的文件夹下 <1> showOriSignal(): 绘制并展示一个样本信号的图像 <2> showImgSignal(): 绘制并展示一个信号样本的二维可视化图像 <3> showCamSignal(): 叠加信号与CAM图,可视化CAM解释结果,并按类型保存 <4> mask_image(): 软阈值擦除CAM对应的判别性特征区域 — — — — — — — — — — — — — — — — — — — — — — — — — — — # Class List: None - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - # History: | <author> | <version> | <time> | <desc> # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - <0> | JunJie Ren | v1.0 | 2020/06/15 | creat # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - <1> | JunJie Ren | v1.1 | 2020/07/09 | 优化无name的数据集调用问题 # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - <2> | JunJie Ren | v1.2 | 2020/07/13 | 增加CAM阈值擦除函数 -------------------------------------------------------------------------- ''' import sys import os import cv2 import torch import torch.nn as nn import numpy as np import matplotlib.pyplot as plt import matplotlib; matplotlib.use('TkAgg') from sklearn.metrics import confusion_matrix sys.path.append("../") from app.configs import cfgs from app.dataset.RML2016 import loadNpy # from app.dataset.RML2016_04c.classes import modName def t2n(t): return t.detach().cpu().numpy().astype(np.int) def fig2data(fig): """ fig = plt.figure() image = fig2data(fig) @brief Convert a Matplotlib figure to a 4D numpy array with RGBA channels and return it @param fig a matplotlib figure @return a numpy 3D array of RGBA values """ import PIL.Image as Image # draw the renderer fig.canvas.draw() # Get the RGBA buffer from the figure w, h = fig.canvas.get_width_height() buf = np.fromstring(fig.canvas.tostring_argb(), dtype=np.uint8) buf.shape = (w, h, 4) # canvas.tostring_argb give pixmap in ARGB mode. Roll the ALPHA channel to have it in RGBA mode buf = np.roll(buf, 3, axis=2) image = Image.frombytes("RGBA", (w, h), buf.tostring()) image = np.asarray(image) return image def showOriSignal(sample, mod_name, idx): ''' 绘制并展示一个样本信号的图像 ''' signal_data = sample[0] figure = plt.figure(figsize=(9, 6)) plt.title(str(idx)+" "+str(mod_name), fontsize=30) plt.xlabel('N', fontsize=20) plt.ylabel("Value", fontsize=20) plt.plot(signal_data[:, 0], label = 'I', linewidth=2.0) plt.plot(signal_data[:, 1], color = 'red', label = 'Q', linewidth=2.0) plt.legend(loc="upper right", fontsize=30) plt.close() image = fig2data(figure) image = cv2.cvtColor(image, cv2.COLOR_RGB2BGR) return image def showCamSignal(signal, CAM, mod): """ Args: signal: numpy.ndarray(size=(1, 128, 2), dtype=np.float) CAM: numpy.ndarray(size=(128, 2), dtype=np.float) Funcs: 叠加信号与CAM图,可视化CAM解释结果,并按类型保存 """ # 绘制信号 signal_data = signal[0] sig_len, channel = signal_data.shape figure = plt.figure(figsize=(18, 12)) plt.title(mod, fontsize=26) plt.xlabel('N', fontsize=20) plt.ylabel("Value", fontsize=20) plt.plot(signal_data[:, 0]*(sig_len//10), label = 'I' ,linewidth=4.0) plt.plot(signal_data[:, 1]*(sig_len//10), color = 'red', label = 'Q', linewidth=4.0) plt.legend(loc="upper right", fontsize=26) # 绘制CAM sig_min, sig_max = np.min(signal_data), np.max(signal_data) CAM = CAM.T # (2, 128) CAM = CAM - np.min(CAM) CAM = CAM / np.max(CAM) # CAM取值归一化 plt.imshow(CAM, cmap='jet', extent=[0., sig_len, (sig_min-0.5)*(sig_len//10), (sig_max+0.5)*(sig_len//10)]) # jet, rainbow # plt.colorbar() ''' save_path = "figs_CAM_ACARS/{}".format(mod_name) if not os.path.exists(save_path): os.makedirs(save_path) plt.savefig(save_path + '/' + str(idx+1)+"_CAM") plt.close() ''' # plt.savefig("figs/CAM_cur") # plt.show() image = fig2data(figure) image = cv2.cvtColor(image, cv2.COLOR_RGB2BGR) plt.close() return image def plot_confusion_matrix(y_true, y_pred, labels, title='Normalized confusion matrix', intFlag = 0): ''' 绘制混淆矩阵 ''' cmap = plt.cm.Blues ''' 颜色参考http://blog.csdn.net/haoji007/article/details/52063168''' cm = confusion_matrix(y_true, y_pred) tick_marks = np.array(range(len(labels))) + 0.5 np.set_printoptions(precision=2) if cm.sum(axis=1)[:, np.newaxis].all() != 0: cm_normalized = cm.astype('float') / cm.sum(axis=1)[:, np.newaxis] else: intFlag = 1 figure = plt.figure(figsize=(10, 9), dpi=360) ind_array = np.arange(len(labels)) x, y = np.meshgrid(ind_array, ind_array) # intFlag = 0 # 标记在图片中对文字是整数型还是浮点型 for x_val, y_val in zip(x.flatten(), y.flatten()): if (intFlag): c = cm[y_val][x_val] plt.text(x_val, y_val, "%d" % (c,), color='red', fontsize=12, va='center', ha='center') else: c = cm_normalized[y_val][x_val] if (c > 0.0001): #这里是绘制数字,可以对数字大小和颜色进行修改 plt.text(x_val, y_val, "%0.2f" % (c*100,) + "%", color='red', fontsize=10, va='center', ha='center') else: plt.text(x_val, y_val, "%d" % (0,), color='red', fontsize=10, va='center', ha='center') if(intFlag): plt.imshow(cm, interpolation='nearest', cmap=cmap) else: plt.imshow(cm_normalized, interpolation='nearest', cmap=cmap) plt.gca().set_xticks(tick_marks, minor=True) plt.gca().set_yticks(tick_marks, minor=True) plt.gca().xaxis.set_ticks_position('none') plt.gca().yaxis.set_ticks_position('none') plt.grid(True, which='minor', linestyle='-') plt.gcf().subplots_adjust(bottom=0.15) plt.title('Confusion Matrix', fontsize=18) plt.colorbar() xlocations = np.array(range(len(labels))) plt.xticks(xlocations, labels, rotation=90) plt.yticks(xlocations, labels) plt.ylabel('Index of True Classes') plt.xlabel('Index of Predict Classes') plt.savefig('./app/figs/confusion_matrix.jpg', dpi=300) image = fig2data(figure) image = cv2.cvtColor(image, cv2.COLOR_RGB2BGR) return image # plt.title(title) # plt.show() def drawAllOriSignal(X, Y): """ Args: X: numpy.ndarray(size = (bz, 1, 128, 2)), 可视化信号原始数据 Y: numpy.ndarray(size = (bz,)), 可视化信号标签 Returns: None Funcs: 绘制所有信号输入样本的图像,并保存至相应标签的文件夹下 """ for idx in range(len(X)): if (idx+1)%50 == 0: print("{} complete!".format(idx+1)) signal_data = X[idx][0] mod_name = str(modName[Y[idx]], "utf-8") \ if cfgs.dataset_name == "RML2016.04c" else "label-"+str(t2n(Y[idx])) plt.figure(figsize=(6, 4)) plt.title(mod_name) plt.xlabel('N') plt.ylabel("Value") plt.plot(signal_data[:, 0], label = 'I') plt.plot(signal_data[:, 1], color = 'red', label = 'Q') plt.legend(loc="upper right") save_path = "../figs/original_signal/{}".format(mod_name) if not os.path.exists(save_path): os.makedirs(save_path) plt.savefig(save_path + '/' + str(idx+1)) plt.close() print(X.shape) print(Y.shape) print("Complete the drawing of all original signals !!!") def showImgSignal(sample, label): ''' 绘制并展示一个信号样本的二维可视化图像 ''' data = sample[0].T # 2*128 data = data - np.min(data) data = data / np.max(data) mod_name = str(modName[label], "utf-8")\ if cfgs.dataset_name == "RML2016.04c" else "label-"+str(t2n(label)) # print(data.shape) h, sig_len = data.shape # 叠加信号,以便显示 img_sig = np.empty([sig_len, sig_len], dtype = float) # for row in range(int(sig_len/h)): # img_sig[row*h:row*h+h, :] = data for row in range(sig_len): if row<sig_len/2: img_sig[row:row+1, :] = data[0] else: img_sig[row:row+1, :] = data[1] img_sig = cv2.resize(img_sig, (sig_len*2,sig_len*2)) cv2.imshow(mod_name, img_sig) cv2.waitKey(0) return img_sig def mask_image(cam, image, reserveORerase): """ Args: cam: numpy.ndarray(size=(4096, 2), dtype=np.float), 0-1 image: torch.Tensor, torch.Size([1, 4096, 2]) reserveORerase: bool 保留(0)或擦除(1)判别性区域 Funcs: 软阈值擦除/保留CAM对应的判别性特征区域 """ cam = torch.from_numpy(cam).cuda() mask = torch.sigmoid(cfgs.CAM_omega * (cam - cfgs.Erase_thr)).squeeze() masked_image = image - (image * mask) if reserveORerase else image * mask return masked_image.float() def mask_image_hard(cam, image, reserveORerase, thr): ''' 阈值硬擦除 ''' mask = np.zeros_like(cam) mask[cam >= thr] = 1 mask[cam < thr] = 0 mask = torch.from_numpy(mask).cuda() # print(mask.shape, image.shape) masked_image = image - (image * mask) if reserveORerase else image * mask return masked_image.float() if __name__ == "__main__": x_train, y_train, x_test, y_test = loadNpy(cfgs.train_path, cfgs.test_path) print(x_train.shape, y_train.shape) # drawAllOriSignal(X=x_train, Y=y_train) for idx in range(len(x_train)): showImgSignal(x_train[idx], y_train[idx]) showOriSignal(x_train[idx], y_train[idx])
jjRen-xd/PyOneDark_Qt_GUI
app/utils/signal_vis.py
signal_vis.py
py
11,107
python
en
code
2
github-code
6
[ { "api_name": "matplotlib.use", "line_number": 47, "usage_type": "call" }, { "api_name": "sys.path.append", "line_number": 50, "usage_type": "call" }, { "api_name": "sys.path", "line_number": 50, "usage_type": "attribute" }, { "api_name": "numpy.int", "line_nu...
4534308606
#!/usr/bin/env python # -*- coding: UTF-8 -*- # REF [site] >> https://scrapy.org/ import scrapy class BlogSpider(scrapy.Spider): name = 'blogspider' start_urls = ['https://blog.scrapinghub.com'] def parse(self, response): for title in response.css('.post-header>h2'): yield {'title': title.css('a ::text').get()} for next_page in response.css('a.next-posts-link'): yield response.follow(next_page, self.parse) #-------------------------------------------------------------------- # Usage: # scrapy runspider scrapy_test.py #if '__main__' == __name__: # main()
sangwook236/SWDT
sw_dev/python/ext/test/networking/scrapy_test.py
scrapy_test.py
py
581
python
en
code
17
github-code
6
[ { "api_name": "scrapy.Spider", "line_number": 8, "usage_type": "attribute" } ]
24650911393
import asyncio import curses import typing from curses_tools import draw_frame class Obstacle: def __init__( self, row: int, column: int, rows_size: int = 1, columns_size: int = 1, uid: str | None = None, ) -> None: self.row = row self.column = column self.rows_size = rows_size self.columns_size = columns_size self.uid = uid def get_bounding_box_frame(self) -> str: """Get frame of bounding box Returns: Bounding box frame. """ # increment box size to compensate obstacle movement rows, columns = self.rows_size + 1, self.columns_size + 1 return '\n'.join(_get_bounding_box_lines(rows, columns)) def get_bounding_box_corner_pos(self) -> tuple[int, int]: """Get left upper position of bounding box.""" return self.row - 1, self.column - 1 def dump_bounding_box(self) -> tuple[int, int, str]: """Get data for drawing the border of an obstacle.""" row, column = self.get_bounding_box_corner_pos() return row, column, self.get_bounding_box_frame() def has_collision( self, obj_corner_row: int, obj_corner_column: int, obj_size_rows: int = 1, obj_size_columns: int = 1, ) -> bool: """Determine if collision has occurred. Args: obj_corner_row: Left upper obj corner row; obj_corner_column: Left upper obj corner column; obj_size_rows: Obj width; obj_size_columns: Obj height. """ return has_collision( (self.row, self.column), (self.rows_size, self.columns_size), (obj_corner_row, obj_corner_column), (obj_size_rows, obj_size_columns), ) def _get_bounding_box_lines( rows: int, columns: int, ) -> typing.Generator[str, None, None]: """Get line of bounding_box frame. Args: rows: Box width; columns: Box height. """ yield ' ' + '-' * columns + ' ' for _ in range(rows): yield '|' + ' ' * columns + '|' yield ' ' + '-' * columns + ' ' async def show_obstacles( canvas: curses.window, obstacles: list[Obstacle], ) -> None: """Display bounding boxes of every obstacle in a list. Args: canvas: Main window; obstacles: List of obstacles. """ while True: boxes = [obstacle.dump_bounding_box() for obstacle in obstacles] for row, column, frame in boxes: draw_frame(canvas, row, column, frame) await asyncio.sleep(0) for row, column, frame in boxes: draw_frame(canvas, row, column, frame, negative=True) def _is_point_inside( corner_row: int, corner_column: int, size_rows: int, size_columns: int, point_row: int, point_row_column: int, ) -> bool: """Check if a point is inside a rectangle of a given size. Args: corner_row: Left upper rectangle row position; corner_column: Left upper rectangle column position size_rows: Rectangle width; size_columns: Rectangle height; point_row: Left upper point row position; point_row_column: Left upper point column position; """ rows_flag = corner_row <= point_row < corner_row + size_rows columns_flag = ( corner_column <= point_row_column < corner_column + size_columns ) return rows_flag and columns_flag def has_collision( obstacle_corner: tuple[int, int], obstacle_size: tuple[int, int], obj_corner: tuple[int, int], obj_size: tuple[int, int] = (1, 1), ) -> bool: """Determine if collision has occurred. Args: obstacle_corner: Left upper corner obstacle position; obstacle_size: Obstacle size (width, height); obj_corner: Left upper corner obj position; obj_size: Obj size (width, height). """ opposite_obstacle_corner = ( obstacle_corner[0] + obstacle_size[0] - 1, obstacle_corner[1] + obstacle_size[1] - 1, ) opposite_obj_corner = ( obj_corner[0] + obj_size[0] - 1, obj_corner[1] + obj_size[1] - 1, ) return any( [ _is_point_inside( *obstacle_corner, *obstacle_size, *obj_corner, ), _is_point_inside( *obstacle_corner, *obstacle_size, *opposite_obj_corner, ), _is_point_inside( *obj_corner, *obj_size, *obstacle_corner, ), _is_point_inside( *obj_corner, *obj_size, *opposite_obstacle_corner, ), ] )
Alex-Men-VL/space_game
src/obstacles.py
obstacles.py
py
4,841
python
en
code
0
github-code
6
[ { "api_name": "typing.Generator", "line_number": 72, "usage_type": "attribute" }, { "api_name": "curses.window", "line_number": 87, "usage_type": "attribute" }, { "api_name": "curses_tools.draw_frame", "line_number": 101, "usage_type": "call" }, { "api_name": "asy...
22368252597
import os, sys import numpy as np import pandas as pd import pickle import argparse from keras import backend from keras.models import load_model from keras.optimizers import * from sklearn.metrics import accuracy_score from sklearn.decomposition import PCA from sklearn.neighbors import KNeighborsClassifier from model import * from io_data import * backend.set_image_dim_ordering('tf') os.environ['TF_CPP_MIN_LOG_LEVEL'] = '3' parser = argparse.ArgumentParser() parser.add_argument('--train', help='train data path') parser.add_argument('--test', help='test data path') parser.add_argument('-l', '--log', help='log path') parser.add_argument('-m', '--model', help='model path') parser.add_argument('-o', '--output', help='output path') parser.add_argument('-s', '--sample', type=int, help='novel sample') parser.add_argument('-e', '--evaluate', type=int, help='novel sample') parser.add_argument('-r', '--randomseed', type=int, help='randomseed') args = parser.parse_args() log_path = args.log model_path = args.model train_path = args.train test_path = args.test sample = args.sample output_path = args.output evaluate = args.evaluate randomseed = args.randomseed width = 32 height= 32 channel = 3 n_batch = 100 epoch = 30 print('Read data') np.random.seed(randomseed) train_imgs, label, test_imgs = read_test(train_path, test_path, sample=sample) height, width, channel = train_imgs.shape[1:] # training imgs flip horizontally model, cnn_model = Recognition() model.load_weights(model_path) train_imgs = cnn_model.predict(train_imgs) test_imgs = cnn_model.predict(test_imgs) T = train_imgs.shape[0] train_imgs = np.reshape(train_imgs, (20, sample, -1)) train_imgs = np.mean(train_imgs, axis=1) label = np.array([label[i*sample] for i in range(20)]) test_imgs = np.reshape(test_imgs, (test_imgs.shape[0], -1)) knc = KNeighborsClassifier(n_neighbors=1) knc.fit(train_imgs, label) predict1 = knc.predict(test_imgs) pca = PCA(n_components=64) pca.fit(np.vstack([train_imgs, test_imgs])) train_pca = pca.transform(train_imgs) test_pca = pca.transform(test_imgs) knc = KNeighborsClassifier(n_neighbors=1) knc.fit(train_pca, label) predict2 = knc.predict(test_pca) save_predict(predict1, os.path.join(output_path, str(sample)+'_knn_predict.csv')) save_predict(predict2, os.path.join(output_path, str(sample)+'_PCA_knn_predict.csv')) del model
tom6311tom6311/dlcv2018final
task2/knn/code/knn_test.py
knn_test.py
py
2,377
python
en
code
0
github-code
6
[ { "api_name": "keras.backend.set_image_dim_ordering", "line_number": 15, "usage_type": "call" }, { "api_name": "keras.backend", "line_number": 15, "usage_type": "name" }, { "api_name": "os.environ", "line_number": 16, "usage_type": "attribute" }, { "api_name": "ar...
32129181331
import logging import pandas as pd from flask import Flask, request, jsonify from data_preprocessing import process_data_for_training import psycopg2 from psycopg2 import sql # Create a Flask app app = Flask(__name__) app.logger.setLevel(logging.DEBUG) app.logger.addHandler(logging.StreamHandler()) db_params = { 'dbname': 'app_db', 'user': 'app_user', 'password': 'password', 'host': 'db', 'port': '5432' } def fetch_warranty_data(): # Establish a connection to the database connection = psycopg2.connect(**db_params) cursor = connection.cursor() # Build the dynamic SQL query select_query = sql.SQL("SELECT * FROM api.claims") cursor.execute(select_query) rows = cursor.fetchall() columns = [desc[0] for desc in cursor.description] warranty_df = pd.DataFrame(rows, columns=columns) cursor.close() connection.close() return warranty_df # Define the API endpoint for data preparation @app.route("/train", methods=["POST"]) def train(): data = request.data.decode('utf-8') warranty_data = fetch_warranty_data() train(process_data_for_training(data, warranty_data)) return 'New model generated' # Run the Flask app if __name__ == "__main__": app.run(host="0.0.0.0", port=5000, debug=True)
evialina/automotive_diagnostic_recommender_system
training-service/script.py
script.py
py
1,290
python
en
code
0
github-code
6
[ { "api_name": "flask.Flask", "line_number": 9, "usage_type": "call" }, { "api_name": "logging.DEBUG", "line_number": 11, "usage_type": "attribute" }, { "api_name": "logging.StreamHandler", "line_number": 12, "usage_type": "call" }, { "api_name": "psycopg2.connect"...
30439578880
import networkx as nx from networkx.generators.degree_seq import expected_degree_graph # make a random graph of 500 nodes with expected degreees of 50 n = 500 # n nodes p = 0.1 w = [p * n for i in range(n)] # w = p*n for all nodes G = expected_degree_graph(w) # configuration model print("Degree Histogram") print("degree (#nodes) ****") dh = nx.degree_histogram(G) low = min(nx.degree(G)) for i in range(low, len(dh)): bar = ''.join(dh[i] * ['*']) print("%2s (%2s) %s" % (i, dh[i], bar))
oimichiu/NetworkX
graph/ex24.py
ex24.py
py
503
python
en
code
0
github-code
6
[ { "api_name": "networkx.generators.degree_seq.expected_degree_graph", "line_number": 8, "usage_type": "call" }, { "api_name": "networkx.degree_histogram", "line_number": 11, "usage_type": "call" }, { "api_name": "networkx.degree", "line_number": 12, "usage_type": "call" ...
5229315790
from django.http import HttpResponsePermanentRedirect, HttpResponseGone def redirect_to(request, url, convert_funcs=None, **kwargs): """ A version of django.views.generic.simple.redirect_to which can handle argument conversion. The 'convert_funcs' parameter is a dictionary mapping 'kwargs' keys to a function. The 'kwargs' value is run through the function before the redirect is applied. Mostly, this is useful for converting a parameter to an int before passing it back to the redirect for formatting via %02d, for example. """ if not url: return HttpResponseGone() if convert_funcs: for name, fn in convert_funcs.items(): if name in kwargs: kwargs[name] = fn(kwargs[name]) return HttpResponsePermanentRedirect(url % kwargs)
gboue/django-util
django_util/view_utils.py
view_utils.py
py
819
python
en
code
2
github-code
6
[ { "api_name": "django.http.HttpResponseGone", "line_number": 14, "usage_type": "call" }, { "api_name": "django.http.HttpResponsePermanentRedirect", "line_number": 19, "usage_type": "call" } ]
36606021901
import os import csv import queue import logging import argparse import traceback import itertools import numpy as np import tensorflow.compat.v1 as tf from fedlearner.trainer.bridge import Bridge from fedlearner.model.tree.tree import BoostingTreeEnsamble from fedlearner.trainer.trainer_master_client import LocalTrainerMasterClient from fedlearner.trainer.trainer_master_client import DataBlockInfo ''' 目前不太理解的地方:worker、verbosity、max-bins、ignore-fields ''' def create_argument_parser(): parser = argparse.ArgumentParser( description='FedLearner Tree Model Trainer.') #训练角色,leader还是follower parser.add_argument('role', type=str, help="Role of this trainer in {'local', " "'leader', 'follower'}") #监听本地地址,ip+port parser.add_argument('--local-addr', type=str, help='Listen address of the local bridge, ' \ 'in [IP]:[PORT] format') #同伴地址,ip+port parser.add_argument('--peer-addr', type=str, help='Address of peer\'s bridge, ' \ 'in [IP]:[PORT] format') #分布式训练时,应用程序的id,默认空 parser.add_argument('--application-id', type=str, default=None, help='application id on distributed ' \ 'training.') #current worker的排名,等级,默认0 parser.add_argument('--worker-rank', type=int, default=0, help='rank of the current worker') #总的worker数量,默认1 parser.add_argument('--num-workers', type=int, default=1, help='total number of workers') #mode,可以为 train,test,eval,默认为train parser.add_argument('--mode', type=str, default='train', help='Running mode in train, test or eval.') #数据文件的路径 parser.add_argument('--data-path', type=str, default=None, help='Path to data file.') #验证数据文件的路径,仅用于test模式 parser.add_argument('--validation-data-path', type=str, default=None, help='Path to validation data file. ' \ 'Only used in train mode.') #bool变量,默认为false,预测不需要数据 parser.add_argument('--no-data', type=bool, default=False, help='Run prediction without data.') #使用的文件扩展 parser.add_argument('--file-ext', type=str, default='.csv', help='File extension to use') #输入文件类型 parser.add_argument('--file-type', type=str, default='csv', help='input file type: csv or tfrecord') #加载已存储模型的路径 parser.add_argument('--load-model-path', type=str, default=None, help='Path load saved models.') #存储输出模型的位置 parser.add_argument('--export-path', type=str, default=None, help='Path to save exported models.') #保存模型的检查点 parser.add_argument('--checkpoint-path', type=str, default=None, help='Path to save model checkpoints.') #存储预测输出的路径 parser.add_argument('--output-path', type=str, default=None, help='Path to save prediction output.') #控制打印日志的数量,默认为1 parser.add_argument('--verbosity', type=int, default=1, help='Controls the amount of logs to print.') #损失函数的选择,默认为logistic parser.add_argument('--loss-type', default='logistic', choices=['logistic', 'mse'], help='What loss to use for training.') #学习率,梯度下降中的步长,默认为0.3 parser.add_argument('--learning-rate', type=float, default=0.3, help='Learning rate (shrinkage).') #boost 迭代次数,默认为5 parser.add_argument('--max-iters', type=int, default=5, help='Number of boosting iterations.') #决策树的最大深度,默认为3 parser.add_argument('--max-depth', type=int, default=3, help='Max depth of decision trees.') #L2正则化参数,默认为1.0 parser.add_argument('--l2-regularization', type=float, default=1.0, help='L2 regularization parameter.') #最大的直方图维度 parser.add_argument('--max-bins', type=int, default=33, help='Max number of histogram bins.') #并行线程的数量,默认1 parser.add_argument('--num-parallel', type=int, default=1, help='Number of parallel threads.') #bool类型,如果被设置为true,数据第一列被认为是双方都匹配的example id parser.add_argument('--verify-example-ids', type=bool, default=False, help='If set to true, the first column of the ' 'data will be treated as example ids that ' 'must match between leader and follower') #通过名字来忽略数据域,默认空字符串 parser.add_argument('--ignore-fields', type=str, default='', help='Ignore data fields by name') #分类特征的字段名称,特征的值应该为非负整数 parser.add_argument('--cat-fields', type=str, default='', help='Field names of categorical features. Feature' ' values should be non-negtive integers') #是否使用流传输,默认为否 parser.add_argument('--use-streaming', type=bool, default=False, help='Whether to use streaming transmit.') #是否发送预测评分给follower,默认为false parser.add_argument('--send-scores-to-follower', type=bool, default=False, help='Whether to send prediction scores to follower.') #是否发送指标(metrics)给follower,默认为follower parser.add_argument('--send-metrics-to-follower', type=bool, default=False, help='Whether to send metrics to follower.') return parser def parse_tfrecord(record): example = tf.train.Example() example.ParseFromString(record) parsed = {} for key, value in example.features.feature.items(): kind = value.WhichOneof('kind') if kind == 'float_list': assert len(value.float_list.value) == 1, "Invalid tfrecord format" parsed[key] = value.float_list.value[0] elif kind == 'int64_list': assert len(value.int64_list.value) == 1, "Invalid tfrecord format" parsed[key] = value.int64_list.value[0] elif kind == 'bytes_list': assert len(value.bytes_list.value) == 1, "Invalid tfrecord format" parsed[key] = value.bytes_list.value[0] else: raise ValueError("Invalid tfrecord format") return parsed def extract_field(field_names, field_name, required): if field_name in field_names: return [] assert not required, \ "Field %s is required but missing in data"%field_name return None def read_data(file_type, filename, require_example_ids, require_labels, ignore_fields, cat_fields): logging.debug('Reading data file from %s', filename) if file_type == 'tfrecord': reader = tf.io.tf_record_iterator(filename) reader, tmp_reader = itertools.tee(reader) first_line = parse_tfrecord(next(tmp_reader)) field_names = first_line.keys() else: fin = tf.io.gfile.GFile(filename, 'r') reader = csv.DictReader(fin) field_names = reader.fieldnames example_ids = extract_field( field_names, 'example_id', require_example_ids) raw_ids = extract_field( field_names, 'raw_id', False) labels = extract_field( field_names, 'label', require_labels) ignore_fields = set(filter(bool, ignore_fields.strip().split(','))) ignore_fields.update(['example_id', 'raw_id', 'label']) cat_fields = set(filter(bool, cat_fields.strip().split(','))) for name in cat_fields: assert name in field_names, "cat_field %s missing"%name cont_columns = list(filter( lambda x: x not in ignore_fields and x not in cat_fields, field_names)) cont_columns.sort(key=lambda x: x[1]) cat_columns = list(filter( lambda x: x in cat_fields and x not in cat_fields, field_names)) cat_columns.sort(key=lambda x: x[1]) features = [] cat_features = [] for line in reader: if file_type == 'tfrecord': line = parse_tfrecord(line) if example_ids is not None: example_ids.append(str(line['example_id'])) if raw_ids is not None: raw_ids.append(str(line['raw_id'])) if labels is not None: labels.append(float(line['label'])) features.append([float(line[i]) for i in cont_columns]) cat_features.append([int(line[i]) for i in cat_columns]) features = np.array(features, dtype=np.float) cat_features = np.array(cat_features, dtype=np.int32) if labels is not None: labels = np.asarray(labels, dtype=np.float) return features, cat_features, cont_columns, cat_columns, \ labels, example_ids, raw_ids def read_data_dir(file_ext, file_type, path, require_example_ids, require_labels, ignore_fields, cat_fields): if not tf.io.gfile.isdir(path): return read_data( file_type, path, require_example_ids, require_labels, ignore_fields, cat_fields) files = [] for dirname, _, filenames in tf.io.gfile.walk(path): for filename in filenames: _, ext = os.path.splitext(filename) if file_ext and ext != file_ext: continue subdirname = os.path.join(path, os.path.relpath(dirname, path)) files.append(os.path.join(subdirname, filename)) features = None for fullname in files: ifeatures, icat_features, icont_columns, icat_columns, \ ilabels, iexample_ids, iraw_ids = read_data( file_type, fullname, require_example_ids, require_labels, ignore_fields, cat_fields ) if features is None: features = ifeatures cat_features = icat_features cont_columns = icont_columns cat_columns = icat_columns labels = ilabels example_ids = iexample_ids raw_ids = iraw_ids else: assert cont_columns == icont_columns, \ "columns mismatch between files %s vs %s"%( cont_columns, icont_columns) assert cat_columns == icat_columns, \ "columns mismatch between files %s vs %s"%( cat_columns, icat_columns) features = np.concatenate((features, ifeatures), axis=0) cat_features = np.concatenate( (cat_features, icat_features), axis=0) if labels is not None: labels = np.concatenate((labels, ilabels), axis=0) if example_ids is not None: example_ids.extend(iexample_ids) if raw_ids is not None: raw_ids.extend(iraw_ids) assert features is not None, "No data found in %s"%path return features, cat_features, cont_columns, cat_columns, \ labels, example_ids, raw_ids def train(args, booster): X, cat_X, X_names, cat_X_names, y, example_ids, _ = read_data_dir( args.file_ext, args.file_type, args.data_path, args.verify_example_ids, args.role != 'follower', args.ignore_fields, args.cat_fields) if args.validation_data_path: val_X, val_cat_X, val_X_names, val_cat_X_names, val_y, \ val_example_ids, _ = \ read_data_dir( args.file_ext, args.file_type, args.validation_data_path, args.verify_example_ids, args.role != 'follower', args.ignore_fields, args.cat_fields) assert X_names == val_X_names, \ "Train data and validation data must have same features" assert cat_X_names == val_cat_X_names, \ "Train data and validation data must have same features" else: val_X = val_cat_X = X_names = val_y = val_example_ids = None if args.output_path: tf.io.gfile.makedirs(os.path.dirname(args.output_path)) if args.checkpoint_path: tf.io.gfile.makedirs(args.checkpoint_path) booster.fit( X, y, cat_features=cat_X, checkpoint_path=args.checkpoint_path, example_ids=example_ids, validation_features=val_X, validation_cat_features=val_cat_X, validation_labels=val_y, validation_example_ids=val_example_ids, output_path=args.output_path, feature_names=X_names, cat_feature_names=cat_X_names) def write_predictions(filename, pred, example_ids=None, raw_ids=None): logging.debug("Writing predictions to %s.tmp", filename) headers = [] lines = [] if example_ids is not None: headers.append('example_id') lines.append(example_ids) if raw_ids is not None: headers.append('raw_id') lines.append(raw_ids) headers.append('prediction') lines.append(pred) lines = zip(*lines) fout = tf.io.gfile.GFile(filename+'.tmp', 'w') fout.write(','.join(headers) + '\n') for line in lines: fout.write(','.join([str(i) for i in line]) + '\n') fout.close() logging.debug("Renaming %s.tmp to %s", filename, filename) tf.io.gfile.rename(filename+'.tmp', filename, overwrite=True) def test_one_file(args, bridge, booster, data_file, output_file): if data_file is None: X = cat_X = X_names = cat_X_names = y = example_ids = raw_ids = None else: X, cat_X, X_names, cat_X_names, y, example_ids, raw_ids = \ read_data( args.file_type, data_file, args.verify_example_ids, False, args.ignore_fields, args.cat_fields) pred = booster.batch_predict( X, example_ids=example_ids, cat_features=cat_X, feature_names=X_names, cat_feature_names=cat_X_names) if y is not None: metrics = booster.loss.metrics(pred, y) else: metrics = {} logging.info("Test metrics: %s", metrics) if args.role == 'follower': bridge.start(bridge.new_iter_id()) bridge.receive(bridge.current_iter_id, 'barrier') bridge.commit() if output_file: tf.io.gfile.makedirs(os.path.dirname(output_file)) write_predictions(output_file, pred, example_ids, raw_ids) if args.role == 'leader': bridge.start(bridge.new_iter_id()) bridge.send( bridge.current_iter_id, 'barrier', np.asarray([1])) bridge.commit() class DataBlockLoader(object): def __init__(self, role, bridge, data_path, ext, worker_rank=0, num_workers=1, output_path=None): self._role = role self._bridge = bridge self._num_workers = num_workers self._worker_rank = worker_rank self._output_path = output_path self._tm_role = 'follower' if role == 'leader' else 'leader' if data_path: files = None if not tf.io.gfile.isdir(data_path): files = [os.path.basename(data_path)] data_path = os.path.dirname(data_path) self._trainer_master = LocalTrainerMasterClient( self._tm_role, data_path, files=files, ext=ext) else: self._trainer_master = None self._count = 0 if self._role == 'leader': self._block_queue = queue.Queue() self._bridge.register_data_block_handler(self._data_block_handler) self._bridge.start(self._bridge.new_iter_id()) self._bridge.send( self._bridge.current_iter_id, 'barrier', np.asarray([1])) self._bridge.commit() elif self._role == 'follower': self._bridge.start(self._bridge.new_iter_id()) self._bridge.receive(self._bridge.current_iter_id, 'barrier') self._bridge.commit() def _data_block_handler(self, msg): logging.debug('DataBlock: recv "%s" at %d', msg.block_id, msg.count) assert self._count == msg.count if not msg.block_id: block = None elif self._trainer_master is not None: block = self._trainer_master.request_data_block(msg.block_id) return False else: block = DataBlockInfo(msg.block_id, None) self._count += 1 self._block_queue.put(block) return True def _request_data_block(self): while True: for _ in range(self._worker_rank): self._trainer_master.request_data_block() block = self._trainer_master.request_data_block() for _ in range(self._num_workers - self._worker_rank - 1): self._trainer_master.request_data_block() if block is None or self._output_path is None or \ not tf.io.gfile.exists(os.path.join( self._output_path, block.block_id) + '.output'): break return block def get_next_block(self): if self._role == 'local': return self._request_data_block() if self._tm_role == 'leader': while True: block = self._request_data_block() if block is not None: if not self._bridge.load_data_block( self._count, block.block_id): continue else: self._bridge.load_data_block(self._count, '') break self._count += 1 else: block = self._block_queue.get() return block def test(args, bridge, booster): if not args.no_data: assert args.data_path, "Data path must not be empty" else: assert not args.data_path and args.role == 'leader' data_loader = DataBlockLoader( args.role, bridge, args.data_path, args.file_ext, args.worker_rank, args.num_workers, args.output_path) while True: data_block = data_loader.get_next_block() if data_block is None: break if args.output_path: output_file = os.path.join( args.output_path, data_block.block_id) + '.output' else: output_file = None test_one_file( args, bridge, booster, data_block.data_path, output_file) def run(args): if args.verbosity == 0: logging.basicConfig(level=logging.WARNING) elif args.verbosity == 1: logging.basicConfig(level=logging.INFO) else: logging.basicConfig(level=logging.DEBUG) assert args.role in ['leader', 'follower', 'local'], \ "role must be leader, follower, or local" assert args.mode in ['train', 'test', 'eval'], \ "mode must be train, test, or eval" #follower或leader if args.role != 'local': bridge = Bridge(args.role, int(args.local_addr.split(':')[1]), args.peer_addr, args.application_id, 0, streaming_mode=args.use_streaming) else: bridge = None try: #boost booster = BoostingTreeEnsamble( bridge, learning_rate=args.learning_rate, max_iters=args.max_iters, max_depth=args.max_depth, l2_regularization=args.l2_regularization, max_bins=args.max_bins, num_parallel=args.num_parallel, loss_type=args.loss_type, send_scores_to_follower=args.send_scores_to_follower, send_metrics_to_follower=args.send_metrics_to_follower) #加载已存储的模型 if args.load_model_path: booster.load_saved_model(args.load_model_path) #训练不需要bridge,为什么呢 if args.mode == 'train': train(args, booster) #测试,评估模型需要bridge else: # args.mode == 'test, eval' test(args, bridge, booster) #把模型存起来 if args.export_path: booster.save_model(args.export_path) except Exception as e: logging.fatal( 'Exception raised during training: %s', traceback.format_exc()) raise e finally: #结束bridge if bridge: bridge.terminate() if __name__ == '__main__': run(create_argument_parser().parse_args())
rain701/fedlearner-explain
fedlearner/fedlearner/model/tree/trainer.py
trainer.py
py
21,840
python
en
code
0
github-code
6
[ { "api_name": "argparse.ArgumentParser", "line_number": 21, "usage_type": "call" }, { "api_name": "tensorflow.compat.v1.train.Example", "line_number": 162, "usage_type": "call" }, { "api_name": "tensorflow.compat.v1.train", "line_number": 162, "usage_type": "attribute" ...
10769330374
"""my_first_django URL Configuration The `urlpatterns` list routes URLs to views. For more information please see: https://docs.djangoproject.com/en/4.0/topics/http/urls/ Examples: Function views 1. Add an import: from my_app import views 2. Add a URL to urlpatterns: path('', views.home, name='home') Class-based views 1. Add an import: from other_app.views import Home 2. Add a URL to urlpatterns: path('', Home.as_view(), name='home') Including another URLconf 1. Import the include() function: from django.urls import include, path 2. Add a URL to urlpatterns: path('blog/', include('blog.urls')) """ from django.contrib import admin from django.shortcuts import render from django.urls import include, path from rest_framework_simplejwt.views import ( TokenObtainPairView, TokenRefreshView, TokenVerifyView ) from rest_framework import routers from myapp.views.person import PersonViewSet from myapp.views.user import UserViewSet, GroupViewSet router = routers.DefaultRouter() router.register(r'users', UserViewSet) router.register(r'groups', GroupViewSet) router.register(r'persons', PersonViewSet) def index(request): return render(request, 'index.html') urlpatterns = [ path("", index, name='index'), path("admin/", admin.site.urls), path("api/", include(router.urls)), path("myapp/", include("myapp.urls")), path("accounts/", include("django.contrib.auth.urls")), path("api-auth/", include("rest_framework.urls")), path('api/token/', TokenObtainPairView.as_view(), name='token_obtain_pair'), path('api/token/refresh/', TokenRefreshView.as_view(), name='token_refresh'), path('api/token/verify/', TokenVerifyView.as_view(), name='token_verify'), ]
shine-codestove/my_first_django
my_first_django/urls.py
urls.py
py
1,750
python
en
code
1
github-code
6
[ { "api_name": "rest_framework.routers.DefaultRouter", "line_number": 31, "usage_type": "call" }, { "api_name": "rest_framework.routers", "line_number": 31, "usage_type": "name" }, { "api_name": "myapp.views.user.UserViewSet", "line_number": 32, "usage_type": "argument" ...
7263711725
# -*- coding: utf-8 -*- from PyQt5.QtWidgets import QMainWindow, QVBoxLayout, QWidget, QTabWidget from .movies_view import MoviesTab from .games_view import GamesTab from .music_view import MusicTab class Window(QMainWindow): """Main Window.""" def __init__(self, parent=None): """Initializer.""" super().__init__(parent) self.setWindowTitle("Media Library") self.resize(720, 360) self.table_widget = MyTableWidget(self) self.setCentralWidget(self.table_widget) class MyTableWidget(QWidget): """Container for all the tabs.""" def __init__(self, parent): super(QWidget, self).__init__(parent) self.layout = QVBoxLayout(self) # Initialize tabs self.tabs = QTabWidget() self.moviesTab = MoviesTab(self) self.gamesTab = GamesTab(self) self.musicTab = MusicTab(self) # Add tabs for each media type self.tabs.addTab(self.moviesTab, "Movies") self.tabs.addTab(self.gamesTab, "Games") self.tabs.addTab(self.musicTab, "Music") # Add tabs to widget self.layout.addWidget(self.tabs) self.setLayout(self.layout)
aisandovalm/media-library
media_library/views/main_view.py
main_view.py
py
1,186
python
en
code
0
github-code
6
[ { "api_name": "PyQt5.QtWidgets.QMainWindow", "line_number": 9, "usage_type": "name" }, { "api_name": "PyQt5.QtWidgets.QWidget", "line_number": 21, "usage_type": "name" }, { "api_name": "PyQt5.QtWidgets.QWidget", "line_number": 25, "usage_type": "argument" }, { "ap...
11849550981
""" Created on Thu Dec 10 22:51:52 2020 @author: yzaghir Image Arthmeric Opeations Add - We can add two images with the OpenCV function , cv.add() -Resize the two images and make sur they are exactly the same size before adding """ # import cv library import cv2 as cv #import numpy as np # read image from computer img1 = cv.imread("images/abhi2.jpg") img2 = cv.imread("images/flower1.jpg") #macke sur both images are same size before adding # pickup matrix of number from image cropped_image1 = img1[60:200 , 50:200] cropped_image2 = img2[60:200 , 50:200] cv.imshow("cropped 1" , cropped_image1) cv.imshow("cropped 2" , cropped_image2) # adding the images added_image = cv.add(cropped_image1 , cropped_image2) cv.imshow("Added Image" , added_image) # adding the images subtracted_image = cv.subtract(cropped_image1 , cropped_image2) cv.imshow("Subtracted Image" , subtracted_image)
zaghir/python
python-opencv/arithmetic_operations_addition_and_subtraction.py
arithmetic_operations_addition_and_subtraction.py
py
906
python
en
code
0
github-code
6
[ { "api_name": "cv2.imread", "line_number": 21, "usage_type": "call" }, { "api_name": "cv2.imread", "line_number": 22, "usage_type": "call" }, { "api_name": "cv2.imshow", "line_number": 30, "usage_type": "call" }, { "api_name": "cv2.imshow", "line_number": 31, ...
28237649684
import typing import requests from requests import Session from zenora.errors import MissingAccess, AvatarError, InvalidSnowflake # Request functions def fetch( url: str, headers: typing.Dict[str, str], params: typing.Dict[str, str] = {}, ) -> typing.Dict: r = requests.get(url=url, headers=headers, params=params) r.raise_for_status() return r.json() def post( url: str, headers: typing.Dict[str, str], params: typing.Dict[str, str] = {}, ) -> typing.Dict: r = requests.post(url=url, headers=headers, json=params) r.raise_for_status() return r.json() def patch( url: str, headers: typing.Dict[str, str], params: typing.Dict[str, str] = {}, ) -> typing.Dict: r = requests.patch(url=url, headers=headers, json=params) r.raise_for_status() return r.json() def delete( url: str, headers: typing.Dict[str, str], params: typing.Dict[str, str] = {}, ) -> typing.Dict: r = requests.delete(url=url, headers=headers, json=params) r.raise_for_status() return r # Utility functions def error_checker(data: typing.Dict) -> None: if data.get("user_id") or data.get("channel_id"): raise InvalidSnowflake( data.get("user_id")[0] if data.get("user_id") is not None else data.get("channel_id")[0] ) elif data.get("code"): if data.get("code") == 50001: raise MissingAccess(data.get("message")) else: raise InvalidSnowflake(data.get("message")) elif data.get("avatar"): if isinstance(data.get("avatar"), list): raise AvatarError(data.get("avatar")[0]) def get_file(url): # Downloading Image from link r = requests.get(url=url, stream=True) return r
StarrMan303/zenora
zenora/utils/helpers.py
helpers.py
py
1,778
python
en
code
0
github-code
6
[ { "api_name": "typing.Dict", "line_number": 11, "usage_type": "attribute" }, { "api_name": "typing.Dict", "line_number": 12, "usage_type": "attribute" }, { "api_name": "requests.get", "line_number": 14, "usage_type": "call" }, { "api_name": "typing.Dict", "lin...
70075742268
# -*- encoding:utf-8 -*- ''' @time: 2019/12/21 9:48 下午 @author: huguimin @email: 718400742@qq.com ''' import os import random import math import torch import argparse import numpy as np from util.util_data_gcn import * from models.word2vec.ecgcn import ECGCN from models.word2vec.ecgat import ECGAT from models.word2vec.fssgcn import ECClassifier from models.word2vec.aggcn import AGClassifier # from models.ecaggcn_no_dcn import ECClassifier from sklearn import metrics import torch.nn as nn import time class Model: def __init__(self, opt, idx): self.opt = opt self.embedding = load_embedding(opt.embedding_path) self.embedding_pos = load_pos_embedding(opt.embedding_dim_pos) self.split_size = math.ceil(opt.data_size / opt.n_split) self.global_f1 = 0 # self.train, self.test = load_data(self.split_size, idx, opt.data_size) #意味着只能从一个角度上训练,应该换几种姿势轮着训练 if opt.dataset == 'EC': self.train, self.test = load_percent_train(opt.per, self.split_size, idx, opt.data_size) elif opt.dataset == 'EC_en': self.train, self.test = load_data_en() else: print('DATASET NOT EXIST') # self.train, self.test = load_data(self.split_size, idx, opt.data_size) self.sub_model = opt.model_class(self.embedding, self.embedding_pos, self.opt).to(opt.device) def _reset_params(self): for p in self.sub_model.parameters(): if p.requires_grad: if len(p.shape) > 1: self.opt.initializer(p) else: stdv = 1. / math.sqrt(p.shape[0]) torch.nn.init.uniform_(p, a=-stdv, b=stdv) def _print_args(self): n_trainable_params, n_nontrainable_params, model_params = 0, 0, 0 for p in self.sub_model.parameters(): n_params = torch.prod(torch.tensor(p.shape)).item() model_params += n_params if p.requires_grad: n_trainable_params += n_params else: n_nontrainable_params += n_params print('n_trainable_params: {0}, n_nontrainable_params: {1}, model_params: {2}'.format(n_trainable_params, n_nontrainable_params, model_params)) print('> training arguments:') for arg in vars(self.opt): print('>>> {0}: {1}'.format(arg, getattr(self.opt, arg))) def _train(self, criterion, optimizer): max_test_pre = 0 max_test_rec = 0 max_test_f1 = 0 global_step = 0 continue_not_increase = 0 for epoch in range(self.opt.num_epoch): print('>' * 100) print('epoch: ', epoch) n_correct, n_total = 0, 0 increase_flag = False for train in get_train_batch_data(self.train, self.opt.batch_size, self.opt.keep_prob1, self.opt.keep_prob2): global_step += 1 self.sub_model.train() optimizer.zero_grad() inputs = [train[col].to(self.opt.device) for col in self.opt.inputs_cols] targets = train['label'].to(self.opt.device) doc_len = train['doc_len'].to(self.opt.device) targets = torch.argmax(targets, dim=2) targets_flatten = torch.reshape(targets, [-1]) outputs = self.sub_model(inputs) outputs_flatten = torch.reshape(outputs, [-1, self.opt.num_class]) loss = criterion(outputs_flatten, targets_flatten) # loss = nn.functional.nll_loss(outputs_flatten, targets_flatten) outputs = torch.argmax(outputs, dim=-1) loss.backward() optimizer.step() if global_step % self.opt.log_step == 0: train_acc, train_pre, train_rec, train_f1 = self._evaluate_prf_binary(targets, outputs, doc_len) print('Train: loss:{:.4f}, train_acc: {:.4f}, train_pre:{:.4f}, train_rec:{:.4f}, train_f1: {:.4f}\n'.format(loss.item(), train_acc, train_pre, train_rec, train_f1)) test_acc, test_pre, test_rec, test_f1 = self._evaluate_acc_f1() # if test_acc > max_test_acc: # max_test_acc = test_acc if test_f1 > max_test_f1: increase_flag = True max_test_f1 = test_f1 max_test_pre = test_pre max_test_rec = test_rec if self.opt.save and test_f1 > self.global_f1: self.global_f1 = test_f1 torch.save(self.sub_model.state_dict(), 'state_dict/'+self.opt.model_name+'_'+self.opt.dataset+'_test.pkl') print('>>> best model saved.') print('Test: test_acc: {:.4f}, test_pre:{:.4f}, test_rec:{:.4f}, test_f1: {:.4f}'.format(test_acc, test_pre, test_rec, test_f1)) if increase_flag == False: continue_not_increase += 1 if continue_not_increase >= 5: print('early stop.') break else: continue_not_increase = 0 return max_test_pre, max_test_rec, max_test_f1 def _evaluate_acc_f1(self): # switch model to evaluation mode self.sub_model.eval() targets_all, outputs_all, doc_len_all = None, None, None inference_time_list = [] with torch.no_grad(): for test in get_test_batch_data(self.test, self.opt.batch_size): inputs = [test[col].to(self.opt.device) for col in self.opt.inputs_cols] targets = test['label'].to(self.opt.device) doc_len = test['doc_len'].to(self.opt.device) targets = torch.argmax(targets, dim=2)#(32,75) if self.opt.infer_time: torch.cuda.synchronize() start_time = time.time() outputs = self.sub_model(inputs) torch.cuda.synchronize() end_time = time.time() inference_time = end_time - start_time inference_time_list.append(inference_time/targets.shape[0]) else: outputs = self.sub_model(inputs) outputs = torch.argmax(outputs, dim=2)#(32, 75) if targets_all is None: targets_all = targets outputs_all = outputs doc_len_all = doc_len else: targets_all = torch.cat((targets_all, targets), dim=0) outputs_all = torch.cat((outputs_all, outputs), dim=0) doc_len_all = torch.cat((doc_len_all, doc_len), dim=0) test_acc, test_pre, test_rec, test_f1 = self._evaluate_prf_binary(targets_all, outputs_all, doc_len_all) infer_time = np.mean(np.array(inference_time_list)) print('infer_time==================', str(infer_time)) return test_acc, test_pre, test_rec, test_f1 def _evaluate_prf_binary(self, targets, outputs, doc_len): """ :param targets: [32,75] :param outputs: [32,75] :return: """ tmp1, tmp2 = [], [] for i in range(outputs.shape[0]): for j in range(doc_len[i]): tmp1.append(outputs[i][j].cpu()) tmp2.append(targets[i][j].cpu()) y_pred, y_true = np.array(tmp1), np.array(tmp2) acc = metrics.precision_score(y_true, y_pred, average='micro') p = metrics.precision_score(y_true, y_pred, average='binary') r = metrics.recall_score(y_true, y_pred, average='binary') f1 = metrics.f1_score(y_true, y_pred, average='binary') return acc, p, r, f1 def run(self, folder, repeats=1): # Loss and Optimizer print(('-'*50 + 'Folder{}' + '-'*50).format(folder)) criterion = nn.CrossEntropyLoss() # criterion = nn.functional.nll_loss() _params = filter(lambda p: p.requires_grad, self.sub_model.parameters()) optimizer = self.opt.optimizer(_params, lr=self.opt.learning_rate, weight_decay=self.opt.l2reg) if not os.path.exists('log/'): os.mkdir('log/') f_out = open('log/' + self.opt.model_name + '_' + str(folder) + '_test.txt', 'a+', encoding='utf-8') max_test_pre_avg = 0 max_test_rec_avg = 0 max_test_f1_avg = 0 for i in range(repeats): print('repeat: ', (i + 1)) f_out.write('repeat: ' + str(i + 1)) self._reset_params() max_test_pre, max_test_rec, max_test_f1 = self._train(criterion, optimizer) print('max_test_acc: {0} max_test_hf1: {1}'.format(max_test_pre, max_test_f1)) f_out.write('max_test_acc: {0}, max_test_f1: {1}'.format(max_test_pre, max_test_f1)) max_test_pre_avg += max_test_pre max_test_rec_avg += max_test_rec max_test_f1_avg += max_test_f1 print('#' * 100) print("max_test_acc_avg: {.4f}", max_test_pre_avg / repeats) print('max_test_acc_rec: {.4f}', max_test_rec_avg / repeats) print("max_test_f1_avg: {.4f}", max_test_f1_avg / repeats) f_out.write("max_test_pre_avg: {0}, max_test_rec_avg: {1}, max_test_f1_avg: {2}".format(max_test_pre_avg / repeats, max_test_rec_avg / repeats, max_test_f1_avg / repeats)) f_out.close() return max_test_pre_avg / repeats, max_test_rec_avg / repeats, max_test_f1_avg / repeats if __name__ == '__main__': # Hyper Parameters parser = argparse.ArgumentParser() parser.add_argument('--model_name', default='fssgcn', type=str) parser.add_argument('--optimizer', default='adam', type=str) parser.add_argument('--initializer', default='xavier_uniform_', type=str) parser.add_argument('--learning_rate', default=0.001, type=float) parser.add_argument('--input_dropout', default=0.1, type=float) parser.add_argument('--gcn_dropout', default=0.1, type=float) parser.add_argument('--head_dropout', default=0.1, type=float) parser.add_argument('--keep_prob2', default=0.1, type=float) parser.add_argument('--keep_prob1', default=0.1, type=float) parser.add_argument('--alpha', default=0.3, type=float) parser.add_argument('--l2reg', default=0.00001, type=float) # parser.add_argument('--l2reg', default=0.000005, type=float) parser.add_argument('--num_epoch', default=100, type=int) parser.add_argument('--batch_size', default=32, type=int) parser.add_argument('--log_step', default=5, type=int) parser.add_argument('--embed_dim', default=200, type=int) parser.add_argument('--embedding_dim_pos', default=100, type=int) ###中文数据集的embedding文件 parser.add_argument('--embedding_path', default='embedding.txt', type=str) ###英文数据集的embedding文件################################ # parser.add_argument('--embedding_path', default='all_embedding_en.txt', type=str) ################################################# parser.add_argument('--pos_num',default=138, type=int) parser.add_argument('--hidden_dim', default=100, type=int) parser.add_argument('--num_layers', default=3, type=int) parser.add_argument('--nheads', default=1, type=int) parser.add_argument('--sublayer_first', default=2, type=int) parser.add_argument('--sublayer_second', default=4, type=int) parser.add_argument('--sublayer', default=1, type=int) parser.add_argument('--no_rnn', default=False, type=bool) parser.add_argument('--rnn_layer', default=1, type=int) parser.add_argument('--rnn_hidden', default=100, type=int) parser.add_argument('--rnn_dropout', default=0.5, type=float) parser.add_argument('--no_pos', default=False, type=bool) parser.add_argument('--n_split', default=10, type=int) parser.add_argument('--per', default=1.0, type=float) parser.add_argument('--num_class', default=2, type=int) parser.add_argument('--save', default=True, type=bool) parser.add_argument('--seed', default=776, type=int) parser.add_argument('--device', default=None, type=str) parser.add_argument('--infer_time', default=False, type=bool) ####数据集为英文数据集 # parser.add_argument('--dataset', default='EC_en', type=str) ####数据集为中文数据集 parser.add_argument('--dataset', default='EC', type=str) opt = parser.parse_args() model_classes = { 'ecgcn': ECGCN, 'ecgat': ECGAT, 'aggcn': AGClassifier, 'fssgcn': ECClassifier } input_colses = { 'ecgcn': ['content', 'sen_len', 'doc_len', 'doc_id', 'emotion_id', 'graph'], 'ecgat': ['content', 'sen_len', 'doc_len', 'doc_id', 'emotion_id', 'graph'], 'aggcn': ['content', 'sen_len', 'doc_len', 'doc_id', 'emotion_id', 'graph'], 'fssgcn': ['content', 'sen_len', 'doc_len', 'doc_id', 'emotion_id', 'graph'] } initializers = { 'xavier_uniform_': torch.nn.init.xavier_uniform_, 'xavier_normal_': torch.nn.init.xavier_normal, 'orthogonal_': torch.nn.init.orthogonal_, } optimizers = { 'adadelta': torch.optim.Adadelta, # default lr=1.0 'adagrad': torch.optim.Adagrad, # default lr=0.01 'adam': torch.optim.Adam, # default lr=0.001 'adamax': torch.optim.Adamax, # default lr=0.002 'asgd': torch.optim.ASGD, # default lr=0.01 'rmsprop': torch.optim.RMSprop, # default lr=0.01 'sgd': torch.optim.SGD, } opt.model_class = model_classes[opt.model_name] opt.inputs_cols = input_colses[opt.model_name] opt.initializer = initializers[opt.initializer] opt.optimizer = optimizers[opt.optimizer] if opt.dataset == 'EC': opt.max_doc_len = 75 opt.max_sen_len = 45 opt.data_size = 2105 opt.hidden_dim = 100 opt.rnn_hidden = 100 opt.embed_dim = 200 opt.embedding_path = 'embedding.txt' else: opt.max_doc_len = 45 opt.max_sen_len = 130 opt.data_size = 2105 opt.hidden_dim = 150 opt.rnn_hidden = 150 opt.embed_dim = 300 opt.embedding_path = 'all_embedding_en.txt' opt.device = torch.device('cuda' if torch.cuda.is_available() else 'cpu') \ if opt.device is None else torch.device(opt.device) if opt.seed is not None: random.seed(opt.seed) np.random.seed(opt.seed) torch.manual_seed(opt.seed) torch.cuda.manual_seed(opt.seed) torch.backends.cudnn.deterministic = True torch.backends.cudnn.benchmark = False p, r, f1 = [], [], [] for i in range(1): model = Model(opt, i) ###计算模型大 model._print_args() p_t, r_t, f1_t = model.run(i) p.append(p_t) r.append(r_t) f1.append(f1_t) print("max_test_pre_avg: {:.4f}, max_test_rec_avg: {:.4f}, max_test_f1_avg: {:.4f}".format(np.mean(p), np.mean(r), np.mean(f1)))
LeMei/FSS-GCN
train.py
train.py
py
15,194
python
en
code
14
github-code
6
[ { "api_name": "math.ceil", "line_number": 30, "usage_type": "call" }, { "api_name": "math.sqrt", "line_number": 50, "usage_type": "call" }, { "api_name": "torch.nn.init.uniform_", "line_number": 51, "usage_type": "call" }, { "api_name": "torch.nn", "line_numbe...
42095752382
import os, settings from app import myApp import uuid from flask import request, render_template from pdf_core import PdfHelper from threading import Timer @myApp.route('/', methods=['GET', 'POST']) def upload_file(): if request.method == 'POST': # create a list with all pdf files files = [] for uploadedFile in request.files.getlist('file'): if allowed_file(uploadedFile.filename): files.append(uploadedFile) # join pdf files pdfHelper = PdfHelper() uniqueFilenamePath = os.path.join(settings.RESULT_PATH, str(uuid.uuid4()) + ".pdf") pdfHelper.merge_pdfs(files, uniqueFilenamePath) # remove the file after 10 min t = Timer(60*10, delete, (uniqueFilenamePath,)) t.start(); # close the files for uploadedFile in files: uploadedFile.close() return render_template('show_links.html', link=uniqueFilenamePath) return render_template('index.html') def allowed_file(filename): return '.' in filename and \ filename.rsplit('.', 1)[1] in settings.ALLOWED_EXTENSIONS def delete(dest): if os.path.exists(dest): os.remove(dest)
icruces/blog-PDFMerging
app/views.py
views.py
py
1,305
python
en
code
2
github-code
6
[ { "api_name": "flask.request.method", "line_number": 10, "usage_type": "attribute" }, { "api_name": "flask.request", "line_number": 10, "usage_type": "name" }, { "api_name": "flask.request.files.getlist", "line_number": 13, "usage_type": "call" }, { "api_name": "f...
72940803068
# This is a sample Python script. # Press ⌃R to execute it or replace it with your code. # Press Double ⇧ to search everywhere for classes, files, tool windows, actions, and settings. import os, requests, json # python request examples # https://www.pythonforbeginners.com/requests/using-requests-in-python def print_hi(name): # Use a breakpoint in the code line below to debug your script. print(f'Hi, {name}') # Press ⌘F8 to toggle the breakpoint. def restexample01(): github_url = "https://api.github.com/user/repos" data = json.dumps({'name': 'test', 'description': 'some test repo'}) r = requests.post(github_url, data, auth=('user', '*****')) print(r.json) # Press the green button in the gutter to run the script. if __name__ == '__main__': restexample01() print_hi("PyCharm. It's end of the code") # See PyCharm help at https://www.jetbrains.com/help/pycharm/
lean35/python101
main.py
main.py
py
915
python
en
code
0
github-code
6
[ { "api_name": "json.dumps", "line_number": 17, "usage_type": "call" }, { "api_name": "requests.post", "line_number": 18, "usage_type": "call" } ]
70082164988
from routersim.interface import LogicalInterface from .messaging import FrameType from .messaging import ICMPType, UnreachableType from .mpls import MPLSPacket, PopStackOperation from .observers import Event, EventType from scapy.layers.inet import IP,ICMP,icmptypes from copy import copy import ipaddress class ForwardingTable: def __init__(self, event_manager, parent_logger): self.fib = None self.event_manager = event_manager self.logger = parent_logger.getChild('forwarding') def __str__(self): return "Forwarding Table" def set_fib(self, fib): self.fib = fib self.logger.debug("Installed new forwarding table") def lookup_ip(self, ip_address): as_network = ipaddress.ip_network(ip_address) # ASSUMPTION: fib is sorted with highest prefix first # so we should always arrive at something more specific first # yes, this is very inefficient if self.fib is None: return None for prefix in self.fib[FrameType.IPV4]: if as_network.overlaps(prefix): self.event_manager.observe( Event( EventType.FORWARDING, self, f"Identified forwarding entry for {ip_address}" ) ) return [self.fib[FrameType.IPV4][prefix]] return None def lookup_label(self, label): if self.fib is None: return None if self.fib is None or FrameType.MPLSU not in self.fib: return None return [self.fib[FrameType.MPLSU][str(label)]] def print_fib(self): print("** IPV4 FIB ***") for prefix in self.fib[FrameType.IPV4]: entry = self.fib[FrameType.IPV4][prefix] print(f"{entry}") print("") print("** MPLS FIB ***") for prefix in self.fib[FrameType.MPLSU]: entry = self.fib[FrameType.MPLSU][prefix] print(f"{entry}") class PacketForwardingEngine(): def __init__(self, forwarding_table: ForwardingTable, router): self.router = router self.forwarding = forwarding_table self.arp_cache = router.arp.cache self.logger = router.logger.getChild("pfe") # Intended for internal communications def accept_frame(self, frame, dest_interface=None): self.router.event_manager.observe( Event( EventType.PACKET_SEND, self.router, f"PFE Sending {frame.type}", object=frame, target=dest_interface, sub_type="LOCAL_SEND") ) # parameter naming was confusing... self.process_frame(frame, dest_interface=dest_interface, from_self=True) def process_frame(self, frame, source_interface=None, from_self=False, dest_interface=None): def process_ip(pdu, dest_interface=None): if pdu.inspectable() and not from_self: self.router.process_packet(source_interface, pdu) return # should be an IPPacket potential_next_hops = self.forwarding.lookup_ip( pdu.dst ) if potential_next_hops is not None: pdu.ttl -= 1 # TODO: Fire event? hop_action = potential_next_hops[0] self.logger.info(f"Will apply action {hop_action.action}") if not isinstance(hop_action.action, str): newpdu = hop_action.action.apply(pdu, self.router, self.router.event_manager) self.logger.info(f"New pdu is {newpdu}") if isinstance(newpdu, MPLSPacket): hop_action.interface.phy.send(FrameType.MPLSU, newpdu) else: self.logger.warn("Didn't get back an MPLSPacket") else: if hop_action.action == 'FORWARD' or dest_interface is not None: # TODO: If we know the dest_interface should we be blindly sending on it? # I'm not too happy about this quite yet # really the link between the RE and PFE is wonky if dest_interface is None: self.logger.debug(f"Using {potential_next_hops[0].interface} for {pdu}") dest_interface = potential_next_hops[0].interface self.logger.debug(f"Using {dest_interface} for {pdu} (potential NH: {potential_next_hops[0]}") self.send_encapsulated( potential_next_hops[0].next_hop_ip, FrameType.IPV4, pdu, dest_interface ) elif hop_action.action == 'CONTROL': if from_self: self.logger.error(f"Unexpectedly have frame from self we need to forward {pdu}") raise Exception(f"Unexpectedly have frame from self we need to forward {pdu}") self.router.process_packet(source_interface, pdu) elif hop_action.action == 'REJECT' and source_interface is not None: #print(f"Sending reject from {source_interface.name}:{source_interface.address().ip} to {pdu.source_ip}") packet = IP( dst=pdu.src, src=source_interface.address().ip ) / ICMP( type = ICMPType.DestinationUnreachable, code=UnreachableType.NetworkUnreachable ) / ( pdu.dst, pdu.src, pdu.payload.payload # IRL its first 8 bytes ) source_interface.send_ip(packet) else: self.logger.info(f"**** Have action {hop_action.action}") else: self.logger.warn("**** Need to issue ICMP UNREACHABLE") pass # send unreachable pdu = copy(frame.pdu) if frame.type == FrameType.IPV4: self.logger.info("Calling process_ip") process_ip(pdu, dest_interface) # This means we're supposed to look at it # special case of control plane... elif frame.type == FrameType.ARP: # So, dilemma: Here we PROBABLY want to make sure # this only happens on switch interfaces? # would is also happen on routed interfaces? self.router.process_arp(source_interface, pdu) # TODO: If we're switching, we also want to forward it! elif frame.type == FrameType.CLNS: self.router.process['isis'].process_pdu(source_interface, frame.pdu) elif frame.type == FrameType.MPLSU: # pdu should be an MPLSPacket potential_next_hops = None try: potential_next_hops = self.forwarding.lookup_label( pdu.label_stack[len(pdu.label_stack)-1] ) except: if pdu.label_stack[0] == '3': newpdu = PopStackOperation().apply(pdu, self.router, event_manager=self.router.event_manager) if isinstance(newpdu, IP): process_ip(newpdu) return self.logger.warn(f"Unable to find {pdu.label_stack[0]}") if potential_next_hops is not None: fibentry = potential_next_hops[0] newpdu = fibentry.action.apply(pdu, self.router, event_manager=self.router.event_manager) if isinstance(newpdu, MPLSPacket): fibentry.interface.parent.send( FrameType.MPLSU, newpdu, logical=None) elif isinstance(newpdu, IP): fibentry.interface.send_ip(newpdu) else: print(f"Unknown de-encapsulated packet type!") else: self.logger.error(f"**** No action found for label {pdu.label_stack[0]}") def send_encapsulated(self, next_hop: ipaddress.IPv4Address, type: FrameType, packet, interface: LogicalInterface): if next_hop is None: dest_ip = packet.dst dest_ip_as_net = ipaddress.ip_network(f"{dest_ip}/32") if interface.address().network.overlaps(dest_ip_as_net): next_hop = dest_ip else: raise Exception("Valid IP is required") hw_address = self.arp_cache[next_hop] if hw_address is None: # TODO: Drop it? self.router.arp.request(next_hop, interface) else: interface.send(hw_address, type, packet)
jdewald/router-sim
routersim/forwarding.py
forwarding.py
py
9,267
python
en
code
5
github-code
6
[ { "api_name": "ipaddress.ip_network", "line_number": 27, "usage_type": "call" }, { "api_name": "messaging.FrameType.IPV4", "line_number": 34, "usage_type": "attribute" }, { "api_name": "messaging.FrameType", "line_number": 34, "usage_type": "name" }, { "api_name":...
21797961836
# make a time series of instantaneous electric power consumption graph from a csv file import csv import glob import re import os import numpy as np import matplotlib.pyplot as plt import pandas as pd from statistics import mean # define variables timestep = 0.01 def csv_to_graph(path): data = pd.read_csv(path, index_col=0, skipinitialspace=True) # comvert csv data to a list format data current = np.array(data['current'].values.tolist()) # find the peak value from the list data peak_value_index = np.argmax(current) # extract useful values from arround the peak value arround_peak_value = current[peak_value_index-100:peak_value_index+500] # calucurate const value const_value = arround_peak_value[len(arround_peak_value)-400:len(arround_peak_value)] avg_const_value = round(mean(const_value),2) text_avg_const_value = "mean const value = " + str(avg_const_value) # make a time series graph count = np.arange(0, len(arround_peak_value)/100, timestep) plt.plot(count, arround_peak_value) plt.xlim(0.0, 6.0) plt.ylim(0.0, 10.0) plt.xlabel('t [s]') plt.ylabel('current [A]') font_dict = dict(style="italic", size=16) bbox_dict = dict(facecolor="#ffffff", edgecolor="#000000", fill=True) plt.text(2.5, 9, text_avg_const_value, font_dict, bbox=bbox_dict) plt.grid() plt.show() def make_result_file(path): # define variables peak_value = [] mean_const_value = [] # make file list file_list = glob.glob(path+'*.csv') # extract the peak value and average const value of each file # and append each value to the list for file in file_list: print(file) data = pd.read_csv(file, index_col=0, skipinitialspace=True) # comvert csv data to a list format data current = np.array(data['current'].values.tolist()) # find the peak value from the list data peak_value_index = np.argmax(current) # extract useful values from arround the peak value arround_peak_value = current[peak_value_index-100:peak_value_index+500] # calucurate const value const_value = arround_peak_value[len(arround_peak_value)-400:len(arround_peak_value)] avg_const_value = round(mean(const_value),2) # calcurate mean value of peak value and average const value peak_value.append(np.max(current)) mean_const_value.append(avg_const_value) # make a result file(write each value) file_name = path + 'result.txt' f = open(file_name, 'a') for i in range(len(file_list)): peak = peak_value[i] const = mean_const_value[i] f.write("FILE%s: Peak value: %s, Mean const value: %s \n" % (i, peak, const)) mean_peak = round(mean(peak_value),2) mean_const = round(mean(mean_const_value),2) f.write("Mean peak value: %s, Mean const value: %s\n" % (mean_peak, mean_const)) f.close() # analyze the step down experiment data def analyze_gradation_exp(file_list): # import csv format file for file in file_list: data = pd.read_csv(file, index_col=0, skipinitialspace=True) # comvert csv data to a list format data current = np.array(data['current'].values.tolist()) # extract the peak value from the list data peak_value_index = np.argmax(current) start_index = peak_value_index # clip the time series data by 1 sec grad_data = [] for i in range(int(len(current[start_index:])/99)): grad_data.append(current[start_index:start_index+99*i]) start_index = start_index + 99 # calcurate mean value of each data set for data in grad_data: mean_grad = mean(data) print(mean_grad) # write results on a text file if __name__ == "__main__": # import csv format file """ # useage: make a time series of power consumption graph path = "test.csv" csv_to_graph(path) """ # useage: make result files path = 'C:/Users/is0232xf/OneDrive - 学校法人立命館/ソースコード/BIWAKO_unit_test/csv/diagonal/25%/' make_result_file(path) """ files = os.listdir(path) # get subdirectory list files_dir = [f for f in files if os.path.isdir(os.path.join(path, f))] for subdir in files_dir: dir = path + subdir + '/' make_result_file(dir) """
is0232xf/BIWAKO_unit_test
csv_to_graph.py
csv_to_graph.py
py
4,460
python
en
code
0
github-code
6
[ { "api_name": "pandas.read_csv", "line_number": 16, "usage_type": "call" }, { "api_name": "numpy.array", "line_number": 18, "usage_type": "call" }, { "api_name": "numpy.argmax", "line_number": 20, "usage_type": "call" }, { "api_name": "statistics.mean", "line_...
70132131389
from typing import Tuple from sqlalchemy import and_, desc from quizard_backend import db from quizard_backend.utils.exceptions import raise_not_found_exception from quizard_backend.utils.transaction import in_transaction def dict_to_filter_args(model, **kwargs): """ Convert a dictionary to Gino/SQLAlchemy's conditions for filtering. Example: A correct Gino's query is: User.query.where( and_( User.role_id == 10, User.location == "Singapore" ) ).gino.all() The given `kwargs` is: { "role_id": 10, "location": "Singapore", } This function unpacks the given dictionary `kwargs` into `and_(*clauses)`. """ return (getattr(model, k) == v for k, v in kwargs.items()) async def get_one(model, **kwargs): return ( await model.query.where(and_(*dict_to_filter_args(model, **kwargs))) .limit(1) .gino.first() ) async def get_many( model, columns=None, after_id=None, limit=15, in_column=None, in_values=None, order_by="internal_id", descrease=False, **kwargs, ): # Get the `internal_id` value from the starting row # And use it to query the next page of results last_internal_id = 0 if after_id: row_of_after_id = await model.query.where(model.id == after_id).gino.first() if not row_of_after_id: raise_not_found_exception(model, **kwargs) last_internal_id = row_of_after_id.internal_id # Get certain columns only if columns: query = db.select([*(getattr(model, column) for column in columns)]) else: query = model.query query = query.where( and_( *dict_to_filter_args(model, **kwargs), model.internal_id < last_internal_id if descrease and last_internal_id else model.internal_id > last_internal_id, getattr(model, in_column).in_(in_values) if in_column and in_values else True, ) ) return ( await query.order_by( desc(getattr(model, order_by)) if descrease else getattr(model, order_by) ) .limit(limit) .gino.all() ) async def get_latest_quiz_attempts(model, user_id, limit=15, after_id=None, **kwargs): # Get the `internal_id` value from the starting row # And use it to query the next page of results last_internal_id = 0 if after_id: row_of_after_id = await model.query.where(model.id == after_id).gino.first() if not row_of_after_id: raise_not_found_exception(model, **kwargs) last_internal_id = row_of_after_id.internal_id return ( await db.status( db.text( """SELECT * FROM ( SELECT DISTINCT ON (quiz_attempt.quiz_id, quiz_attempt.user_id) quiz_attempt.quiz_id, quiz_attempt.user_id, quiz_attempt.is_finished, quiz_attempt.internal_id FROM quiz_attempt WHERE quiz_attempt.user_id = :user_id {} ORDER BY quiz_attempt.quiz_id, quiz_attempt.user_id, quiz_attempt.internal_id DESC ) t ORDER By t.internal_id DESC limit :limit;""".format( "and quiz_attempt.internal_id < :last_internal_id" if after_id else "" ) ), {"user_id": user_id, "limit": limit, "last_internal_id": last_internal_id}, ) )[1] async def get_one_latest(model, **kwargs): return ( await model.query.where(and_(*dict_to_filter_args(model, **kwargs))) .order_by(desc(model.internal_id)) .limit(1) .gino.first() ) async def get_many_with_count_and_group_by( model, *, columns, in_column=None, in_values=None ): return ( await db.select( [*[getattr(model, column) for column in columns], db.func.count()] ) .where( getattr(model, in_column).in_(in_values) if in_column and in_values else True ) .group_by(*[getattr(model, column) for column in columns]) .gino.all() ) @in_transaction async def create_one(model, **kwargs): return await model(**kwargs).create() @in_transaction async def update_one(row, **kwargs): if not kwargs: return row await row.update(**kwargs).apply() return row @in_transaction async def update_many(model, get_kwargs, update_kwargs): status: Tuple[str, list] = await model.update.values(**update_kwargs).where( and_(*and_(*dict_to_filter_args(model, **get_kwargs))) ).gino.status() return status[0] @in_transaction async def delete_many(model, **kwargs): status: Tuple[str, list] = await model.delete.where( and_(*dict_to_filter_args(model, **kwargs)) ).gino.status() return status[0]
donjar/quizard
api/quizard_backend/utils/query.py
query.py
py
5,219
python
en
code
5
github-code
6
[ { "api_name": "sqlalchemy.and_", "line_number": 36, "usage_type": "call" }, { "api_name": "quizard_backend.utils.exceptions.raise_not_found_exception", "line_number": 59, "usage_type": "call" }, { "api_name": "quizard_backend.db.select", "line_number": 65, "usage_type": "...
1883488340
import sys import pefile import re # Pega os headers de um executável def get_headers(executable): pe = pefile.PE(executable) sections = [] for section in pe.sections: sections.append(section.Name.decode('utf-8')) return sections # Pega os headers dos argumentos de entrada sections1 = get_headers(sys.argv[1]) sections2 = get_headers(sys.argv[2]) # Imprime a intersecção entre as listas commonSections = list(set(sections1).intersection(sections2)) print("Seções comuns: [", end="") for i, section in enumerate(commonSections): print("'{}'".format(section), end="") if i < len(commonSections) - 1: print(', ', end="") print("]\n") # Imprime a diferença da lista 1 para a lista 2 difference12 = list(set(sections1).difference(sections2)) print(re.sub(".*/", "", sys.argv[1]) + ": [", end="") for i, section in enumerate(difference12): print("'{}'".format(section), end="") if i < len(difference12) - 1: print(', ', end="") print("]\n") # Imprime a diferença da lista 2 para a lista 1 difference21 = list(set(sections2).difference(sections1)) print(re.sub(".*/", "", sys.argv[2]) + ": [", end="") for i, section in enumerate(difference21): print("'{}'".format(section), end="") if i < len(difference21) - 1: print(', ', end="") print("]\n")
kkatzer/CDadosSeg
T2/Parte2/T2P2b.py
T2P2b.py
py
1,323
python
en
code
0
github-code
6
[ { "api_name": "pefile.PE", "line_number": 7, "usage_type": "call" }, { "api_name": "sys.argv", "line_number": 14, "usage_type": "attribute" }, { "api_name": "sys.argv", "line_number": 15, "usage_type": "attribute" }, { "api_name": "re.sub", "line_number": 28, ...
3235447487
from __future__ import annotations from typing import TYPE_CHECKING from avilla.core.context import Context from avilla.core.event import RelationshipCreated, RelationshipDestroyed from avilla.core.selector import Selector from avilla.core.trait.context import EventParserRecorder from cai.client.events.group import ( GroupLuckyCharacterChangedEvent, GroupLuckyCharacterClosedEvent, GroupLuckyCharacterInitEvent, GroupLuckyCharacterNewEvent, GroupLuckyCharacterOpenedEvent, GroupMemberJoinedEvent, GroupMemberLeaveEvent, GroupMemberMutedEvent, GroupMemberPermissionChangeEvent, GroupMemberSpecialTitleChangedEvent, GroupMemberUnMutedEvent, GroupNameChangedEvent, TransferGroupEvent, ) if TYPE_CHECKING: from ..account import CAIAccount from ..protocol import CAIProtocol event = EventParserRecorder["CAIProtocol", "CAIAccount"] @event("GroupMemberJoinedEvent") async def group_member_joined_event( protocol: CAIProtocol, account: CAIAccount, raw: GroupMemberJoinedEvent ): group = Selector().land(protocol.land.name).group(str(raw.group_id)) member = group.member(str(raw.uin)) context = Context( account=account, client=member, endpoint=group, scene=group, selft=group.member(account.id), ) return RelationshipCreated(context, member, group, context.self), context @event("GroupMemberLeaveEvent") async def group_member_leave_event( protocol: CAIProtocol, account: CAIAccount, raw: GroupMemberLeaveEvent ): group = Selector().land(protocol.land.name).group(str(raw.group_id)) member = group.member(str(raw.uin)) context = Context( account=account, client=member, endpoint=group, scene=group, selft=group.member(account.id), ) res = RelationshipDestroyed(context, member, group, context.self) if raw.operator and raw.operator != raw.uin: res.mediums.append(group.member(str(raw.operator))) return res, context
RF-Tar-Railt/Avilla-CAI
avilla/cai/event/group.py
group.py
py
2,023
python
en
code
3
github-code
6
[ { "api_name": "typing.TYPE_CHECKING", "line_number": 25, "usage_type": "name" }, { "api_name": "avilla.core.trait.context.EventParserRecorder", "line_number": 29, "usage_type": "name" }, { "api_name": "protocol.CAIProtocol", "line_number": 34, "usage_type": "name" }, ...
22034975052
from lib2to3.pgen2 import token from brownie import Test, accounts, interface from eth_utils import to_wei from web3 import Web3 def main(): deploy() def deploy(): amount_in = Web3.toWei(1000000, "ether") # DAI address DAI = "0x6B175474E89094C44Da98b954EedeAC495271d0F" # DAI whale DAI_WHALE = "0xcffad3200574698b78f32232aa9d63eabd290703" # WETH WETH = "0xC02aaA39b223FE8D0A0e5C4F27eAD9083C756Cc2" # WETH whale WETH_WHALE = "0xeD1840223484483C0cb050E6fC344d1eBF0778a9" print("===Transferring gas cost covers===") # covering the transaction cost # accounts[0].transfer(DAI_WHALE, "1 ether") # accounts[0].transfer(WETH_WHALE, "1 ether") tokenA = interface.IERC20(DAI) tokenB = interface.IERC20(WETH) print("===Transferring the tokenA and tokenB amounts from whales to account[0]===") tokenA.transfer(accounts[0], Web3.toWei(2400, "ether"), {"from": DAI_WHALE}) tokenB.transfer(accounts[0], Web3.toWei(1, "ether"), {"from": WETH_WHALE}) contract = Test.deploy({"from": accounts[0]}) tokenA.approve(contract.address, Web3.toWei(2400, "ether"), {"from": accounts[0]}) tokenB.approve(contract.address, Web3.toWei(1, "ether"), {"from": accounts[0]}) print("Adding liquidity...") tx = contract.addLiquidity( DAI, WETH, Web3.toWei(2400, "ether"), Web3.toWei(1, "ether"), {"from": accounts[0]}, ) tx.wait(1) print("Added Liquidity...") for i in tx.events["Log"]: print(i) print("=== Removing Liquidity ===") tx = contract.removeLiquidity(DAI, WETH, {"from": accounts[0]}) tx.wait(1) for i in tx.events["Log"]: print(i)
emrahsariboz/DeFi
uniswap/scripts/_deployAndAddLiquidity.py
_deployAndAddLiquidity.py
py
1,713
python
en
code
0
github-code
6
[ { "api_name": "web3.Web3.toWei", "line_number": 12, "usage_type": "call" }, { "api_name": "web3.Web3", "line_number": 12, "usage_type": "name" }, { "api_name": "brownie.interface.IERC20", "line_number": 31, "usage_type": "call" }, { "api_name": "brownie.interface"...
35800840346
import unittest import numpy as np from numpy import linalg from task import img_rescaled, img_array_transposed, U, s, Vt class TestCase(unittest.TestCase): def test_transpose(self): np.testing.assert_array_equal(img_array_transposed, np.transpose(img_rescaled, (2, 0, 1)), 'The transposed array does not look right.') def test_svd(self): transposed_test = np.transpose(img_rescaled, (2, 0, 1)) U_test, s_test, Vt_test = linalg.svd(transposed_test) np.testing.assert_array_equal(U, U_test, 'Your decomposition does not look right. Go back to "SVD on One Matrix" to refresh the topic.') np.testing.assert_array_equal(s, s_test, 'Your decomposition does not look right. Go back to "SVD on One Matrix" to refresh the topic.') np.testing.assert_array_equal(Vt, Vt_test, 'Your decomposition does not look right. Go back to "SVD on One Matrix" to refresh the topic.')
jetbrains-academy/Python-Libraries-NumPy
Projects/SVD/Applying to All Colors/tests/test_task.py
test_task.py
py
1,073
python
en
code
1
github-code
6
[ { "api_name": "unittest.TestCase", "line_number": 7, "usage_type": "attribute" }, { "api_name": "numpy.testing.assert_array_equal", "line_number": 9, "usage_type": "call" }, { "api_name": "task.img_array_transposed", "line_number": 9, "usage_type": "argument" }, { ...
40467350126
# 1번 풀이 # import sys # dx = [0,0,-1,1] # 우좌상하 # dy = [1,-1,0,0] # def dfs(places, x, y,depth): # if depth == 3: # depth 3까지 찾아봤는데 거리두기 잘 지키는 경우 True # return True # for i in range(4): # nx = x + dx[i] # ny = y + dy[i] # if 0<= nx <5 and 0<= ny <5 and visited[nx][ny] == 0 and places[nx][ny] != 'X': # if places[nx][ny] == 'P': # return False # else: # visited[nx][ny] = 1 # if dfs(places,nx,ny,depth + 1): # visited[nx][ny] = 0 # else: # visited[nx][ny] = 0 # return False # return True # def solution(places): # global visited # answer = [] # for place in places: # flag = 0 # visited = [[0] * 5 for _ in range(5)] # for i in range(5): # if flag == 1: # 이미 거리두기 안지키는 사람을 발견함 # break # for j in range(5): # if place[i][j] == 'P' and not visited[i][j]: # visited[i][j] = 1 # if dfs(place, i, j,1): # continue # else: # 거리두기 안지키는게 발견 # answer.append(0) # flag = 1 # break # else: # answer.append(1) # return answer #2번 풀이 import sys dx = [0,0,-1,1] # 우좌상하 dy = [1,-1,0,0] def dfs(place, x, y,depth): global check if depth == 3: # depth 3까지 찾아봤는데 거리두기 잘 지키는 경우 True return for i in range(4): nx = x + dx[i] ny = y + dy[i] if 0<= nx <5 and 0<= ny <5 and visited[nx][ny] == 0 and place[nx][ny] != 'X': if place[nx][ny] == 'P': check = 0 return else: visited[nx][ny] = 1 dfs(place,nx,ny,depth + 1) visited[nx][ny] = 0 return def solution(places): global visited global check answer = [] for place in places: flag = 0 check = 1 # 거리두기 잘지킴 visited = [[0] * 5 for _ in range(5)] for i in range(5): if flag == 1: # 이미 거리두기 안지키는 사람을 발견함 break for j in range(5): if place[i][j] == 'P' and not visited[i][j]: visited[i][j] = 1 dfs(place,i,j,1) if check: continue else: # 거리두기 안지키는게 발견 answer.append(0) flag = 1 break else: answer.append(1) return answer # 3번 풀이 from collections import deque def bfs(place): dx = [0,0,-1,1] # 우좌상하 dy = [1,-1,0,0] start = [] q = deque() visited = [[0] * 5 for _ in range(5)] for i in range(5): for j in range(5): if place[i][j] == 'P' and not visited[i][j]: start.append((i,j)) for s in start: i,j = s visited = [[0] * 5 for _ in range(5)] visited[i][j] = 1 q.append(s) while q: x, y = q.popleft() if visited[x][y] < 3: for i in range(4): nx = x + dx[i] ny = y + dy[i] if 0 <= nx < 5 and 0<= ny < 5 and place[nx][ny] != 'X' and not visited[nx][ny]: if place[nx][ny] == 'P': return 0 else: visited[nx][ny] = visited[x][y] + 1 q.append((nx,ny)) return 1 def solution(places): answer = [] for place in places: answer.append(bfs(place)) return answer if __name__ == '__main__': places = [["POOPX", "OXPXP", "PXXXO", "OXXXO", "OOOPP"], ["POOOP", "OXXOX", "OPXPX", "OOXOX", "POXXP"], ["PXOPX", "OXOXP", "OXPOX", "OXXOP", "PXPOX"], ["OOOXX", "XOOOX", "OOOXX", "OXOOX", "OOOOO"], ["PXPXP", "XPXPX", "PXPXP", "XPXPX", "PXPXP"]] print(solution(places))
Cho-El/coding-test-practice
프로그래머스 문제/파이썬/level2/거리두기 확인하기.py
거리두기 확인하기.py
py
4,381
python
en
code
0
github-code
6
[ { "api_name": "collections.deque", "line_number": 102, "usage_type": "call" } ]
25182089444
# adapated from munch 2.5.0 from collections.abc import Mapping class Munch(dict): """A dictionary that provides attribute-style access. >>> b = Munch() >>> b.hello = 'world' >>> b.hello 'world' >>> b['hello'] += "!" >>> b.hello 'world!' >>> b.foo = Munch(lol=True) >>> b.foo.lol True >>> b.foo is b['foo'] True A Munch is a subclass of dict; it supports all the methods a dict does... >>> sorted(b.keys()) ['foo', 'hello'] Including update()... >>> b.update({ 'ponies': 'are pretty!' }, hello=42) >>> print (repr(b)) Munch({'ponies': 'are pretty!', 'foo': Munch({'lol': True}), 'hello': 42}) As well as iteration... >>> sorted([ (k,b[k]) for k in b ]) [('foo', Munch({'lol': True})), ('hello', 42), ('ponies', 'are pretty!')] And "splats". >>> "The {knights} who say {ni}!".format(**Munch(knights='lolcats', ni='can haz')) 'The lolcats who say can haz!' See unmunchify/Munch.toDict, munchify/Munch.fromDict for notes about conversion. """ def __init__(self, *args, **kwargs): # pylint: disable=super-init-not-called self.update(*args, **kwargs) # only called if k not found in normal places def __getattr__(self, k): """Gets key if it exists, otherwise throws AttributeError. nb. __getattr__ is only called if key is not found in normal places. >>> b = Munch(bar='baz', lol={}) >>> b.foo Traceback (most recent call last): ... AttributeError: foo >>> b.bar 'baz' >>> getattr(b, 'bar') 'baz' >>> b['bar'] 'baz' >>> b.lol is b['lol'] True >>> b.lol is getattr(b, 'lol') True """ try: # Throws exception if not in prototype chain return object.__getattribute__(self, k) except AttributeError: try: return self[k] except KeyError as exc: raise AttributeError(k) from exc def __setattr__(self, k, v): """Sets attribute k if it exists, otherwise sets key k. A KeyError raised by set-item (only likely if you subclass Munch) will propagate as an AttributeError instead. >>> b = Munch(foo='bar', this_is='useful when subclassing') >>> hasattr(b.values, '__call__') True >>> b.values = 'uh oh' >>> b.values 'uh oh' >>> b['values'] Traceback (most recent call last): ... KeyError: 'values' """ try: # Throws exception if not in prototype chain object.__getattribute__(self, k) except AttributeError: try: self[k] = v except KeyError as exc: raise AttributeError(k) from exc else: object.__setattr__(self, k, v) def __delattr__(self, k): """Deletes attribute k if it exists, otherwise deletes key k. A KeyError raised by deleting the key--such as when the key is missing--will propagate as an AttributeError instead. >>> b = Munch(lol=42) >>> del b.lol >>> b.lol Traceback (most recent call last): ... AttributeError: lol """ try: # Throws exception if not in prototype chain object.__getattribute__(self, k) except AttributeError: try: del self[k] except KeyError as exc: raise AttributeError(k) from exc else: object.__delattr__(self, k) def toDict(self): """Recursively converts a munch back into a dictionary. >>> b = Munch(foo=Munch(lol=True), hello=42, ponies='are pretty!') >>> sorted(b.toDict().items()) [('foo', {'lol': True}), ('hello', 42), ('ponies', 'are pretty!')] See unmunchify for more info. """ return unmunchify(self) @property def __dict__(self): return self.toDict() def __repr__(self): """Invertible* string-form of a Munch. >>> b = Munch(foo=Munch(lol=True), hello=42, ponies='are pretty!') >>> print (repr(b)) Munch({'ponies': 'are pretty!', 'foo': Munch({'lol': True}), 'hello': 42}) >>> eval(repr(b)) Munch({'ponies': 'are pretty!', 'foo': Munch({'lol': True}), 'hello': 42}) >>> with_spaces = Munch({1: 2, 'a b': 9, 'c': Munch({'simple': 5})}) >>> print (repr(with_spaces)) Munch({'a b': 9, 1: 2, 'c': Munch({'simple': 5})}) >>> eval(repr(with_spaces)) Munch({'a b': 9, 1: 2, 'c': Munch({'simple': 5})}) (*) Invertible so long as collection contents are each repr-invertible. """ return f"{self.__class__.__name__}({dict.__repr__(self)})" def __dir__(self): return list(self.keys()) def __getstate__(self): """Implement a serializable interface used for pickling. See https://docs.python.org/3.6/library/pickle.html. """ return {k: v for k, v in self.items()} def __setstate__(self, state): """Implement a serializable interface used for pickling. See https://docs.python.org/3.6/library/pickle.html. """ self.clear() self.update(state) __members__ = __dir__ # for python2.x compatibility @classmethod def fromDict(cls, d): """Recursively transforms a dictionary into a Munch via copy. >>> b = Munch.fromDict({'urmom': {'sez': {'what': 'what'}}}) >>> b.urmom.sez.what 'what' See munchify for more info. """ return munchify(d, cls) def copy(self): return type(self).fromDict(self) def update(self, *args, **kwargs): """ Override built-in method to call custom __setitem__ method that may be defined in subclasses. """ for k, v in dict(*args, **kwargs).items(): self[k] = v def get(self, k, d=None): """ D.get(k[,d]) -> D[k] if k in D, else d. d defaults to None. """ if k not in self: return d return self[k] def setdefault(self, k, d=None): """ D.setdefault(k[,d]) -> D.get(k,d), also set D[k]=d if k not in D """ if k not in self: self[k] = d return self[k] def munchify(x): """Recursively transforms a dictionary into a Munch via copy. >>> b = munchify({'urmom': {'sez': {'what': 'what'}}}) >>> b.urmom.sez.what 'what' munchify can handle intermediary dicts, lists and tuples (as well as their subclasses), but ymmv on custom datatypes. >>> b = munchify({ 'lol': ('cats', {'hah':'i win again'}), ... 'hello': [{'french':'salut', 'german':'hallo'}] }) >>> b.hello[0].french 'salut' >>> b.lol[1].hah 'i win again' nb. As dicts are not hashable, they cannot be nested in sets/frozensets. """ # Munchify x, using `seen` to track object cycles seen = dict() def munchify_cycles(obj): # If we've already begun munchifying obj, just return the already-created munchified obj try: return seen[id(obj)] except KeyError: pass # Otherwise, first partly munchify obj (but without descending into any lists or dicts) and save that seen[id(obj)] = partial = pre_munchify(obj) # Then finish munchifying lists and dicts inside obj (reusing munchified obj if cycles are encountered) return post_munchify(partial, obj) def pre_munchify(obj): # Here we return a skeleton of munchified obj, which is enough to save for later (in case # we need to break cycles) but it needs to filled out in post_munchify if isinstance(obj, Mapping): return Munch({}) elif isinstance(obj, list): return type(obj)() elif isinstance(obj, tuple): type_factory = getattr(obj, "_make", type(obj)) return type_factory(munchify_cycles(item) for item in obj) else: return obj def post_munchify(partial, obj): # Here we finish munchifying the parts of obj that were deferred by pre_munchify because they # might be involved in a cycle if isinstance(obj, Mapping): partial.update((k, munchify_cycles(obj[k])) for k in obj.keys()) elif isinstance(obj, list): partial.extend(munchify_cycles(item) for item in obj) elif isinstance(obj, tuple): for item_partial, item in zip(partial, obj): post_munchify(item_partial, item) return partial return munchify_cycles(x) def unmunchify(x): """Recursively converts a Munch into a dictionary. >>> b = Munch(foo=Munch(lol=True), hello=42, ponies='are pretty!') >>> sorted(unmunchify(b).items()) [('foo', {'lol': True}), ('hello', 42), ('ponies', 'are pretty!')] unmunchify will handle intermediary dicts, lists and tuples (as well as their subclasses), but ymmv on custom datatypes. >>> b = Munch(foo=['bar', Munch(lol=True)], hello=42, ... ponies=('are pretty!', Munch(lies='are trouble!'))) >>> sorted(unmunchify(b).items()) #doctest: +NORMALIZE_WHITESPACE [('foo', ['bar', {'lol': True}]), ('hello', 42), ('ponies', ('are pretty!', {'lies': 'are trouble!'}))] nb. As dicts are not hashable, they cannot be nested in sets/frozensets. """ # Munchify x, using `seen` to track object cycles seen = dict() def unmunchify_cycles(obj): # If we've already begun unmunchifying obj, just return the already-created unmunchified obj try: return seen[id(obj)] except KeyError: pass # Otherwise, first partly unmunchify obj (but without descending into any lists or dicts) and save that seen[id(obj)] = partial = pre_unmunchify(obj) # Then finish unmunchifying lists and dicts inside obj (reusing unmunchified obj if cycles are encountered) return post_unmunchify(partial, obj) def pre_unmunchify(obj): # Here we return a skeleton of unmunchified obj, which is enough to save for later (in case # we need to break cycles) but it needs to filled out in post_unmunchify if isinstance(obj, Mapping): return dict() elif isinstance(obj, list): return type(obj)() elif isinstance(obj, tuple): type_factory = getattr(obj, "_make", type(obj)) return type_factory(unmunchify_cycles(item) for item in obj) else: return obj def post_unmunchify(partial, obj): # Here we finish unmunchifying the parts of obj that were deferred by pre_unmunchify because they # might be involved in a cycle if isinstance(obj, Mapping): partial.update((k, unmunchify_cycles(obj[k])) for k in obj.keys()) elif isinstance(obj, list): partial.extend(unmunchify_cycles(v) for v in obj) elif isinstance(obj, tuple): for value_partial, value in zip(partial, obj): post_unmunchify(value_partial, value) return partial return unmunchify_cycles(x)
SAIL-Labs/AMICAL
amical/externals/munch/__init__.py
__init__.py
py
11,370
python
en
code
9
github-code
6
[ { "api_name": "collections.abc.Mapping", "line_number": 262, "usage_type": "argument" }, { "api_name": "collections.abc.Mapping", "line_number": 275, "usage_type": "argument" }, { "api_name": "collections.abc.Mapping", "line_number": 324, "usage_type": "argument" }, {...
37568054562
# import libraries import sys import nltk nltk.download(['punkt', 'wordnet', 'stopwords']) import re import numpy as np import pandas as pd from sqlalchemy import create_engine from nltk.corpus import stopwords from nltk.tokenize import word_tokenize from nltk.stem import WordNetLemmatizer from sklearn.metrics import classification_report from sklearn.model_selection import train_test_split, GridSearchCV from sklearn.multioutput import MultiOutputClassifier from sklearn.ensemble import RandomForestClassifier, AdaBoostClassifier from sklearn.feature_extraction.text import CountVectorizer, TfidfTransformer from sklearn.pipeline import Pipeline import pickle def load_data(database_filepath): """ Loads table from database as a Pandas Dataframe and returns the following: X -- feature dataset containing the messages to be categorized y -- label dataset containing the 36 categories that each message is assigned to. category_names -- list containing category names Keyword arguments: database_filepath -- filepath (including file name) of the database containing the messages and categories """ engine = create_engine('sqlite:///' + database_filepath) df = pd.read_sql_table('messages_and_categories', engine) X = df['message'] y = df.drop(columns=['id', 'message', 'original', 'genre']) category_names = list(y.columns) return X, y, category_names def tokenize(text): """ Cleans, tokenizes, lemmatizes messages in preparation for classification algorithm 1) finds and replaces urls with a placeholder 2) finds and replaces non alphanumeric characters with a space 3) removes stop words from tokenized messages 4) strips leading and trailing spaces and lowcases lemmatized tokens Keyword arguments: text -- raw message that will be cleaned, tokenized """ url_regex = 'http[s]?://(?:[a-zA-Z]|[0-9]|[$-_@.&+]|[!*\(\),]|(?:%[0-9a-fA-F][0-9a-fA-F]))+' detected_urls = re.findall(url_regex, text) for url in detected_urls: text = text.replace(url, "urlplaceholder") text = re.sub(r'\W+', ' ', text) tokens = word_tokenize(text) tokens = [t for t in tokens if t not in stopwords.words("english")] lemmatizer = WordNetLemmatizer() clean_tokens = [] for tok in tokens: clean_tok = lemmatizer.lemmatize(tok).lower().strip() clean_tokens.append(clean_tok) return clean_tokens def build_model(): """ Creates a pipeline and grid search for hyperparameter tuning returns pipeline with the specified parameter search space """ pipeline = Pipeline([ ('vect', CountVectorizer(tokenizer=tokenize)), ('tfidf', TfidfTransformer()), ('clf', MultiOutputClassifier(estimator=AdaBoostClassifier())) ]) # specify parameters for grid search parameters = { 'vect__ngram_range': ((1, 1), (1, 2),(2,2)), 'tfidf__use_idf': (True, False), 'tfidf__norm': ('l1', 'l2'), 'clf__estimator__learning_rate': [0.1, 0.5], 'clf__estimator__n_estimators': [50, 60, 70] } # create grid search object cv = GridSearchCV(pipeline, param_grid=parameters, verbose=216) return cv def evaluate_model(model, X_test, Y_test, category_names): """ Generates predicted values for test data based on fit model. Outputs a classification report for each category. Keyword arguments: model -- fit model based on training data X_test, Y_test -- message and target category values for testing category_names -- list of possible categories for each message """ Y_pred = model.predict(X_test) for i, label in enumerate(category_names): print(category_names[i]) print(classification_report(Y_test[label], Y_pred[:,i])) def save_model(model, model_filepath): """ Export the classifier to a pickle file Keyword arguments: model -- final model model_filepath -- location and name of saved pickle file """ with open(model_filepath, 'wb') as model_filepath: pickle.dump(model, model_filepath) def main(): if len(sys.argv) == 3: database_filepath, model_filepath = sys.argv[1:] print('Loading data...\n DATABASE: {}'.format(database_filepath)) X, Y, category_names = load_data(database_filepath) X_train, X_test, Y_train, Y_test = train_test_split(X, Y, test_size=0.2, random_state = 42) print('Building model...') model = build_model() print('Training model...') model.fit(X_train, Y_train) print(model.best_score_) print(model.best_params_) print('Evaluating model...') evaluate_model(model, X_test, Y_test, category_names) print('Saving model...\n MODEL: {}'.format(model_filepath)) save_model(model, model_filepath) print('Trained model saved!') else: print('Please provide the filepath of the disaster messages database '\ 'as the first argument and the filepath of the pickle file to '\ 'save the model to as the second argument. \n\nExample: python '\ 'train_classifier.py ../data/DisasterResponse.db classifier.pkl') if __name__ == '__main__': main()
goitom/project_2_disaster_response
models/train_classifier.py
train_classifier.py
py
5,371
python
en
code
0
github-code
6
[ { "api_name": "nltk.download", "line_number": 4, "usage_type": "call" }, { "api_name": "sqlalchemy.create_engine", "line_number": 37, "usage_type": "call" }, { "api_name": "pandas.read_sql_table", "line_number": 38, "usage_type": "call" }, { "api_name": "re.findal...
37272423624
import sys from aspartix_parser import Apx_parser import itertools def conflict_free(arguments, attacks): confl_free_sets = [] combs = [] for i in range(1, len(arguments) + 1): els = [list(x) for x in itertools.combinations(arguments, i)] combs.extend(els) combs_sorted = [list(combs_sorted) for combs_sorted in combs][::-1] # print("Combs: ", combs_sorted) for i in combs_sorted: att_count = 0 # print(i) for att in attacks: # print(att) if set([str(att)[2], str(att)[4]]).issubset(set(i)) or any([i in item for item in confl_free_sets]): # any(x in item for item in confl_free_sets for x in i):#(True if list(filter(lambda x:i in x,confl_free_sets)) else False):#(any([set(i).issubset(set(item)) in item for item in confl_free_sets])): break else: att_count += 1 # print(att_count) # if ((str(att)[2] and str(att)[4]) not in i) and (not any([i in item for item in confl_free_sets])): # att_count += 1 # print(att_count) if att_count == len(attacks): confl_free_sets.append(i) return confl_free_sets def admissible(confl_free, attacks): admissible_sets = [] for ext in confl_free: count = 0 # print(ext) for att in attacks: if str(att)[4] not in ext: count += 1 # print(att, count) else: # print(att, count) for atr in attacks: # print(att, atr, count, str(atr)[4], str(att)[2]) if (str(att)[2] == str(atr)[4]) and (str(atr)[2] in ext): count += 1 # print(count) if count == len(attacks): admissible_sets.append(ext) return admissible_sets # def complete(admissible_sets, attacks): # complete_ext = [] # for adm in admissible_sets: # for att in attacks: # if (str(att)[2] in adm) and # # return complete_ext def preferred(admissible_sets): preferred_exts = [] for adm in admissible_sets: count = 0 # print(adm, count) for adm_t in admissible_sets: if set(adm).issubset(set(adm_t)) and adm_t != adm: pass else: count += 1 # print(adm, adm_t, count) if count == len(admissible_sets): preferred_exts.append(adm) return preferred_exts def stable_extensions(stable_exts): pass if __name__ == '__main__': filepath = 'example.apx' if sys.argv[1:]: filepath = sys.argv[1] arguments = [] attacks = [] parser = Apx_parser(filepath) arguments, attacks = parser.read_file() parser.close() print(arguments, attacks) print("There are ", len(arguments), " arguments and ", len(attacks), " attacks.") # print(str(attacks[0])[4]) confl_free = conflict_free(arguments, attacks) print("Conflict free extensions: ", "[]", sorted(confl_free)) admissible_sets = admissible(confl_free, attacks) print("Admissible extensions: ", "[]", sorted(admissible_sets)) # complete_ext = complete(admissible_sets, attacks) preferred_exts = preferred(admissible_sets) print("Preferred extensions: ", sorted(preferred_exts)) stable_exts = stable_extensions(preferred_exts) print("Stable extensions: ", stable_exts)
Vladimyr23/aspartix_file_parsing_and_reasoning_with_args
Python_parser_and_reasoning_semantics/semantics.py
semantics.py
py
3,690
python
en
code
0
github-code
6
[ { "api_name": "itertools.combinations", "line_number": 12, "usage_type": "call" }, { "api_name": "sys.argv", "line_number": 90, "usage_type": "attribute" }, { "api_name": "sys.argv", "line_number": 91, "usage_type": "attribute" }, { "api_name": "aspartix_parser.Ap...
25546051885
import os import json import flask from vrprot.alphafold_db_parser import AlphafoldDBParser import vrprot from . import map_uniprot from . import settings as st from . import util from .classes import NodeTags as NT def get_scales(uniprot_ids=[], mode=st.DEFAULT_MODE): return vrprot.overview_util.get_scale(uniprot_ids, mode) def run_pipeline(proteins: list, parser: AlphafoldDBParser = st.parser, **kwargs): # create the output directory for the corresponding coloring mode if they do not exist # output_dir = os.path.join(st._MAPS_PATH, parser.processing) output_dir = os.path.join(st._MAPS_PATH) parser.update_output_dir(output_dir) # initialize the structures dictionary of the parser and check wether some processing files do already exist parser.init_structures_dict(proteins) for protein in proteins: parser.update_existence(protein) # run the batched process try: parser.fetch_pipeline(proteins, **kwargs) # batch([parser.fetch_pdb, parser.pdb_pipeline], proteins, parser.batch_size) except vrprot.exceptions.ChimeraXException as e: return {"error": "ChimeraX could not be found. Is it installed?"} result = get_scales(proteins, parser.processing) # update the existence of the processed files for protein in proteins: parser.update_existence(protein) return result def fetch_from_request(request: flask.Request, parser: AlphafoldDBParser = st.parser): # get information from request pdb_id = request.args.get("id") if pdb_id is None: return { "error": "No PDB ID provided.", "example": f"{request.host}/vrprot/fetch?id=P69905", } # extract processing mode and alphafold version from request parser = util.parse_request(parser, request) # if mode is not part of the list of available modes, return an error if isinstance(parser, dict): return parser # create a list of proteins to be processed proteins = [pdb_id] return fetch(proteins, parser) def fetch(proteins: list[str], parser: AlphafoldDBParser = st.parser): # run the batched process parser.not_fetched = set() parser.already_exists = set() result = run_pipeline(proteins, parser) # Try whether you can find an updated UniProt id second_try = {} if len(parser.not_fetched) > 0: try: mapped_ac = map_uniprot.main( parser.not_fetched, source_db=map_uniprot.Databases.uniprot_ac, target_db=map_uniprot.Databases.uniprot, ) for re in mapped_ac["results"]: a, b = True, True while a and b: a = re.get("from") b = re.get("to") b = b.get("uniProtKBCrossReferences") for entry in b: if entry.get("database") == "AlphaFoldDB": b = entry.get("id") second_try[b] = a if a in parser.not_fetched: parser.not_fetched.remove(a) break break result.update(run_pipeline(second_try, parser)) tmp = parser.not_fetched.copy() for ac in tmp: if ac in second_try: parser.not_fetched.remove(ac) parser.not_fetched.add(second_try[ac]) except Exception as e: print(e) return { "not_fetched": list(parser.not_fetched), "already_exists": list(parser.already_processed), "results": result, "alternative_ids": {v: k for k, v in second_try.items()}, } def for_project( project: str, request: flask.request, parser: AlphafoldDBParser = st.parser ): # get information from request if project is None: return {"error": "No project provided."} # extract processing mode and alphafold version from request parser = util.parse_request(parser, request) # if mode is not part of the list of available modes, return an error if isinstance(parser, dict): return parser # extract node data from the projects nodes.json file nodes_files = os.path.join(st._PROJECTS_PATH, project, "nodes.json") if not os.path.isfile(nodes_files): return {"error": "Project does not exist."} with open(nodes_files, "r") as f: nodes = json.load(f)["nodes"] # extract the uniprot ids from the nodes proteins = [",".join(node[NT.uniprot]) for node in nodes if node.get(NT.uniprot)] # run the batched process result = run_pipeline(proteins, parser, on_demand=False) return {"not_fetched": list(parser.not_fetched), "results": result} def fetch_list_from_request( request: flask.Request, parser: AlphafoldDBParser = st.parser ): # get information from request pdb_ids = request.args.get("ids") if pdb_ids is None: return { "error": "No PDB IDs provided.", "example": f"http://{request.host}/vrprot/list?ids=P02655,At1g58602", } # extract processing mode and alphafold version from request parser = util.parse_request(parser, request) # if mode is not part of the list of available modes, return an error if isinstance(parser, dict): return parser # create a list of proteins to be processed proteins = [id for id in pdb_ids.split(",")] return fetch_list(proteins, parser) def fetch_list(proteins: list[str], parser: AlphafoldDBParser = st.parser): # run the batched process result = run_pipeline(proteins, parser, on_demand=False) return {"not_fetched": list(parser.not_fetched), "results": result}
menchelab/ProteinStructureFetch
src/workflows.py
workflows.py
py
5,793
python
en
code
0
github-code
6
[ { "api_name": "vrprot.overview_util.get_scale", "line_number": 16, "usage_type": "call" }, { "api_name": "vrprot.overview_util", "line_number": 16, "usage_type": "attribute" }, { "api_name": "vrprot.alphafold_db_parser.AlphafoldDBParser", "line_number": 19, "usage_type": ...
72473999867
from math import sqrt import numpy as np import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D x1_list = [] x2_list = [] y_list = [] counter = 0 def show(x1_list, x2_list): N = int(x1_list.__len__()) if (N <= 0): return fig, ax = plt.subplots(subplot_kw={"projection": "3d"}) x1_array = np.arange(min(x1_list) - 1, max(x1_list) + 1, 0.01) x2_array = np.arange(min(x2_list) - 1, max(x2_list) + 1, 0.01) #x1_array = np.arange(-6, 3, 0.1) #x2_array = np.arange(-6, 6, 0.1) x1_array, x2_array = np.meshgrid(x1_array, x2_array) R = f(x1_array, x2_array) ax = Axes3D(fig) ax.set_xlabel('x1') ax.set_ylabel('x2') ax.set_zlabel('f(x1,x2)') ax.plot_surface(x1_array, x2_array, R, color='b', alpha=0.5) x1_list2 = [] x2_list2 = [] f_list = [] ax.scatter(x1_list[0], x2_list[0], f(x1_list[0], x2_list[0]), c='black') x1_list2.append(x1_list[0]) x2_list2.append(x2_list[0]) f_list.append(f(x1_list[0], x2_list[0])) #print(x1_list[0], x2_list[0], f(x1_list[0], x2_list[0])) for n in range(1, N): ax.scatter(x1_list[n], x2_list[n], f(x1_list[n], x2_list[n]), c='red') x1_list2.append(x1_list[n]) x2_list2.append(x2_list[n]) f_list.append(f(x1_list[n], x2_list[n])) #print(x1_list[n], x2_list[n], f(x1_list[n], x2_list[n])) ax.scatter(x1_list[N - 1], x2_list[N - 1], f(x1_list[N - 1], x2_list[N - 1]), c='green') #print(x1_list[N - 1], x2_list[N - 1], f(x1_list[N - 1], x2_list[N - 1])) ax.plot(x1_list2, x2_list2, f_list, color="black") plt.show() def f(x1, x2): return 3*x1**4 - x1*x2 + x2**4 - 7*x1 - 8*x2 + 2 def f_x1(x1, x2): return 12*x1**3 - x2 - 7 def f_x2(x1, x2): return 4*x2**3 - x1 - 8 def gradient(x1, x2): i = f_x1(x1, x2) j = f_x2(x1, x2) return [i, j] def module_of_gradient(grad): i = 0; j = 1 return sqrt(grad[i]**2 + grad[j]**2) def dichotomy_mehod(a, b, epsilon, x1, x2, d1, d2): x = (a + b) / 2 global counter counter += 2 if (f(x1 + (x - epsilon)*d1, x2 + (x - epsilon)*d2) < f(x1 + (x + epsilon)*d1, x2 + (x + epsilon)*d2)): b = x else: a = x if(abs(b - a) >= 2 * epsilon): return dichotomy_mehod(a, b, epsilon, x1, x2, d1, d2) return x def the_fletcher_reevse_method(x1, x2, e1, e2, M): global counter k = 0 d_prev = [0, 0] grad_prev = 0 while True: counter += 2 grad = gradient(x1, x2) module_grad = module_of_gradient(grad) if ((module_grad < e1) | (k >= M)): return [(round(x1, round_num), round(x2, round_num), round(f(x1, x2), round_num)), k] B = 0 if k % 2 == 1: B = module_of_gradient(grad)**2 / module_of_gradient(grad_prev)**2 d = [-grad[0] + B * d_prev[0], -grad[1] + B * d_prev[1]] t = dichotomy_mehod(0, 0.1, e1, x1, x2, d[0], d[1]) x1_next = x1 + t * d[0] x2_next = x2 + t * d[1] x1_list.append(x1); x2_list.append(x2) counter += 1 if ((sqrt(abs(x1_next - x1)**2 + abs(x2_next - x2)**2) <= e2) & (abs(f(x1_next, x2_next) - f(x1, x2)) <= e2)): return [(round(x1_next, round_num), round(x2_next, round_num), round(f(x1_next, x2_next), round_num)), k] x1 = x1_next; x2 = x2_next d_prev = d; grad_prev = grad k += 1 round_num = 3 x1 = -5 x2 = 3 e1 = 0.001 e2 = 0.001 M = 100 result = the_fletcher_reevse_method(x1, x2, e1, e2, M) print(f"The Fletcher Reevse method: {result[0]}; count of iteractions = {result[1]}") print('Count of compute function =', counter) #show(x1_list, x2_list)
AlexSmirno/Learning
6 Семестр/Оптимизация/Lab_4_1.py
Lab_4_1.py
py
3,768
python
en
code
0
github-code
6
[ { "api_name": "matplotlib.pyplot.subplots", "line_number": 16, "usage_type": "call" }, { "api_name": "matplotlib.pyplot", "line_number": 16, "usage_type": "name" }, { "api_name": "numpy.arange", "line_number": 18, "usage_type": "call" }, { "api_name": "numpy.arang...
18308754842
from tempfile import gettempdir import urllib.request import platform import zipfile from os.path import join from os import walk pth = "https://github.com/AequilibraE/aequilibrae/releases/download/V0.6.0.post1/mod_spatialite-NG-win-amd64.zip" outfolder = gettempdir() dest_path = join(outfolder, "mod_spatialite-NG-win-amd64.zip") urllib.request.urlretrieve(pth, dest_path) fldr = join(outfolder, "temp_data") zipfile.ZipFile(dest_path).extractall(fldr) if "WINDOWS" in platform.platform().upper(): # We now set sqlite. Only needed in thge windows server in Github plats = { "x86": "https://sqlite.org/2020/sqlite-dll-win32-x86-3320100.zip", "x64": "https://sqlite.org/2020/sqlite-dll-win64-x64-3320100.zip", } outfolder = "C:/" zip_path64 = join(outfolder, "sqlite-dll-win64-x64-3320100.zip") urllib.request.urlretrieve(plats["x64"], zip_path64) zip_path86 = join(outfolder, "sqlite-dll-win32-x86-3320100.zip") urllib.request.urlretrieve(plats["x86"], zip_path86) root = "C:/hostedtoolcache/windows/Python/" file = "sqlite3.dll" for d, subD, f in walk(root): if file in f: if "x64" in d: zipfile.ZipFile(zip_path64).extractall(d) else: zipfile.ZipFile(zip_path86).extractall(d) print(f"Replaces {d}")
AequilibraE/aequilibrae
tests/setup_windows_spatialite.py
setup_windows_spatialite.py
py
1,347
python
en
code
140
github-code
6
[ { "api_name": "tempfile.gettempdir", "line_number": 10, "usage_type": "call" }, { "api_name": "os.path.join", "line_number": 12, "usage_type": "call" }, { "api_name": "urllib.request.request.urlretrieve", "line_number": 13, "usage_type": "call" }, { "api_name": "u...
24072421464
""" Parser.py Used to parse URLs into a linked list of dictionaries. """ from bs4 import BeautifulSoup import requests import re class Node: # pragma: no cover """ Creates a Node that contains data, and a next node Data holds any object. Next points to the next node, and should always be a node. """ def __init__( self, data): """Initialize Node Class""" self.data = data self.next = None class LinkedList: # pragma: no cover """ Creates a Linked List, with a head, and a tail. Head only contains the first link in the list, and should be called at the beginning of scan. Tail only contains the last link in the list, and should not be called. """ def __init__( self): """Initialize Linked List Class""" self.head = None self.tail = None def add_list_item( self, item): """Add an item to the Linked List""" if not isinstance(item, Node): item = Node(item) if self.head is None: self.head = item elif self.tail.data == item: return else: self.tail.next = item self.tail = item def parse_url_feed( incoming) -> LinkedList: """ Receives either a list of URLs or a single URL, and returns a Linked List of Dictionaries """ total_feed = LinkedList() url_list = return_list(incoming) for url_entry in url_list: if not check_url(url_entry): raise Exception("Invalid URL. Must Be a RSS Feed URL ending in " ".rss, .html, or .xml: " + url_entry) parse_value = find_parser(url_entry) response = requests.get(url_entry) soup = BeautifulSoup(response.content, parse_value) if soup.rss is not None: feed = rss_parse(soup) total_feed.add_list_item(feed) elif soup.find_all(re.compile("atom.xml")) is not None: feed = atom_parse(soup) total_feed.add_list_item(feed) return total_feed def check_url( url: str) -> bool: """Checks to see if the URL given is parseable""" url = str(url) if len(url) == 0: return False result1 = re.search("rss?", url) result2 = re.search("xml?", url) result3 = re.search("tml?", url) result4 = re.search("feeds?", url) if result1 is not None: return True elif result2 is not None: return True elif result3 is not None: return True elif result4 is not None: return True else: return False def find_parser( response: str) -> str: """Checks to see which parser to use""" if len(response) <= 3: raise Exception("Invalid URL Length") result = re.search("tml?", response) if result is not None: return "lxml" else: return "lxml-xml" def return_list( incoming) -> list: """ Checks to see if incoming is a String or a List. If a String, adds the string to a list and returns. """ url_list = [] if isinstance(incoming, str): url_list.append(incoming) elif isinstance(incoming, list): url_list = incoming return url_list def rss_parse( soup: BeautifulSoup) -> LinkedList: # pragma: no cover """ When URL is an RSS feed, returns a linked list of dictionaries containing the titles and links """ feed = LinkedList() tag = soup.rss tag = tag.channel channel_dict = {"RSS_String": tag.title.string, "Link": tag.link.string} feed.add_list_item(channel_dict) for item in tag.find_all(re.compile("item?")): feed_dict = {} for title in item.find_all(re.compile("title?")): for entry in title.find_all(string=True): feed_dict["RSS_String"] = entry feed_dict["RSS_String"] = truncate(feed_dict["RSS_String"]) for link in item.find_all(re.compile("link?")): for entry in link.find_all(string=True): feed_dict["Link"] = entry feed.add_list_item(feed_dict) return feed def atom_parse( soup: BeautifulSoup) -> LinkedList: # pragma: no cover """ When URL is an Atom feed, returns a linked list of dictionaries containing the titles and links """ feed = LinkedList() tag = soup.feed for entry in tag.find_all("entry"): feed_dict = {} for title in entry.find_all("title"): for string in title.find_all(string=True): feed_dict["RSS_String"] = string feed_dict["RSS_String"] = truncate(feed_dict["RSS_String"]) for link in entry.find_all(re.compile("link?")): feed_dict["Link"] = link.get('href') feed.add_list_item(feed_dict) return feed def truncate( input_line: str) -> str: """ When a string is over 80 characters long, string is limited to 79 characters for readability in GUI window, An ellipsis (...) is added to denote unseen text """ if len(input_line) >= 80: input_line = input_line[0:79] return input_line + "..." else: return input_line
Jhawk1196/CS3250PythonProject
src/parser.py
parser.py
py
5,232
python
en
code
0
github-code
6
[ { "api_name": "requests.get", "line_number": 69, "usage_type": "call" }, { "api_name": "bs4.BeautifulSoup", "line_number": 70, "usage_type": "call" }, { "api_name": "re.compile", "line_number": 74, "usage_type": "call" }, { "api_name": "re.search", "line_numbe...
3229327686
#!/usr/bin/python ### File Information ### """ Rejector """ __author__ = 'duanqz@gmail.com' import os import fnmatch from config import Config class Rejector: """ Rejector: 1. Check whether conflicts happen. 2. Resolve conflicts automatically. """ CONFILCT_START = "<<<<<<<" CONFLICT_MID = "=======" CONFILCT_END = ">>>>>>>" def __init__(self, target): self.mTarget = target self.mConflictNum = 0 def getConflictNum(self): if fnmatch.fnmatch(self.mTarget, "*.xml"): self.resolveConflict() else: self.collectConflict() return self.mConflictNum def collectConflict(self): """ Check whether conflict happen or not in the target """ self.mConflictNum = 0 top = 0 size = 0 # delLinesNumbers record the lines of conflicts delLineNumbers = [] needToDel = False targetFile = open(self.mTarget, "r+") lineNum = 0 lines = targetFile.readlines() for line in lines: size = self.mConflictNum if line.startswith(Rejector.CONFILCT_START): top += 1 # Modify the conflict in the original lines[lineNum] = "%s #Conflict %d\n" % (line.rstrip(), size) self.mConflictNum += 1 #conflicts.append("#Conflict %d , start at line %d\n" % (size, lineNum)) #conflicts[size] += line delLineNumbers.append(lineNum) elif line.startswith(Rejector.CONFILCT_END): # Modify the conflict in the original lines[lineNum] = "%s #Conflict %d\n" % (line.rstrip(), size-top) #conflicts[size-top] += line #conflicts[size-top] += "#Conflict %d , end at line %d\n\n" % (size-top, lineNum) delLineNumbers.append(lineNum) needToDel = False if top == 0: break; top -= 1 else: if top > 0: #conflicts[size-top] += line if line.startswith(Rejector.CONFLICT_MID): # Modify the conflict in the original #lines[lineNum] = "%s #Conflict %d\n" % (line.rstrip(), size-top) needToDel = True if needToDel: delLineNumbers.append(lineNum) lineNum += 1 # Create a reject file if conflict happen if self.mConflictNum > 0: rejFilename = Rejector.createReject(self.mTarget) rejFile = open(rejFilename, "wb") rejFile.writelines(lines) rejFile.close() # Remove conflict blocks, and write back target. for lineNum in delLineNumbers[::-1]: del lines[lineNum] targetFile.seek(0) targetFile.truncate() targetFile.writelines(lines) targetFile.close() return self @staticmethod def createReject(target): relTarget = os.path.relpath(target, Config.PRJ_ROOT) rejFilename = os.path.join(Config.REJ_ROOT, relTarget) dirname = os.path.dirname(rejFilename) if not os.path.exists(dirname): os.makedirs(dirname) return rejFilename def resolveConflict(self): rejFileHandle = open(self.mTarget, "r+") top = 0 lineNum = 0 delLineNumbers = [] needToDel = True lines = rejFileHandle.readlines() for line in lines: if line.startswith(Rejector.CONFILCT_START): top += 1 delLineNumbers.append(lineNum) elif line.startswith(Rejector.CONFILCT_END): top -= 1 delLineNumbers.append(lineNum) needToDel = True if top < 0: break; else: if top > 0: if needToDel: delLineNumbers.append(lineNum) if line.startswith(Rejector.CONFLICT_MID): needToDel = False lineNum += 1 for lineNum in delLineNumbers[::-1]: del lines[lineNum] rejFileHandle.seek(0) rejFileHandle.truncate() rejFileHandle.writelines(lines) rejFileHandle.close()
baidurom/tools
autopatch/rejector.py
rejector.py
py
4,416
python
en
code
12
github-code
6
[ { "api_name": "fnmatch.fnmatch", "line_number": 32, "usage_type": "call" }, { "api_name": "os.path.relpath", "line_number": 122, "usage_type": "call" }, { "api_name": "os.path", "line_number": 122, "usage_type": "attribute" }, { "api_name": "config.Config.PRJ_ROOT...
29214262320
import os.path import unittest from pathlib import Path from sflkit.analysis.analysis_type import AnalysisType from sflkit.analysis.spectra import Spectrum from sflkit.analysis.suggestion import Location from tests4py import framework from tests4py.constants import DEFAULT_WORK_DIR from utils import BaseTest class TestSFL(BaseTest): @unittest.skip def test_middle(self): project_name = "middle" bug_id = 2 report = framework.default.tests4py_checkout(project_name, bug_id) if report.raised: raise report.raised src = Path(report.location) dst = DEFAULT_WORK_DIR / "sfl" report = framework.sfl.tests4py_sfl_instrument(src, dst) if report.raised: raise report.raised dst_src = dst / "src" dst_src_middle = dst_src / "middle" dst_src_middle___init___py = dst_src_middle / "__init__.py" dst_tests = dst / "tests" dst_tests_test_middle_py = dst_tests / "test_middle.py" dst_gitignore = dst / ".gitignore" dst_license = dst / "LICENSE" dst_readme_md = dst / "README.md" dst_setup_cfg = dst / "setup.cfg" dst_setup_py = dst / "setup.py" src_src = src / "src" src_src_middle = src_src / "middle" src_src_middle___init___py = src_src_middle / "__init__.py" src_tests = src / "tests" src_tests_test_middle_py = src_tests / "test_middle.py" src_gitignore = src / ".gitignore" src_license = src / "LICENSE" src_readme_md = src / "README.md" src_setup_cfg = src / "setup.cfg" src_setup_py = src / "setup.py" exist_files = [ dst_src_middle___init___py, dst_tests_test_middle_py, dst_gitignore, dst_license, dst_readme_md, dst_setup_cfg, dst_setup_py, ] exist_dirs = [dst_src, dst_src_middle, dst_tests] for d in exist_dirs: self.assertTrue(d.exists()) self.assertTrue(d.is_dir()) for f in exist_files: self.assertTrue(f.exists()) self.assertTrue(f.is_file()) for d, s in [ (dst_tests_test_middle_py, src_tests_test_middle_py), (dst_gitignore, src_gitignore), (dst_license, src_license), (dst_readme_md, src_readme_md), (dst_setup_cfg, src_setup_cfg), (dst_setup_py, src_setup_py), ]: with open(d, "r") as fp: d_content = fp.read() with open(s, "r") as fp: s_content = fp.read() self.assertEqual(s_content, d_content, f"{d} has other content then {s}") for d, s in [ (dst_src_middle___init___py, src_src_middle___init___py), ]: with open(d, "r") as fp: d_content = fp.read() with open(s, "r") as fp: s_content = fp.read() self.assertNotEqual( s_content, d_content, f"{d} has the same content then {s}" ) report = framework.sfl.tests4py_sfl_events(dst) if report.raised: raise report.raised report = framework.sfl.tests4py_sfl_analyze(dst, src, predicates="line") if report.raised: raise report.raised suggestions = report.analyzer.get_sorted_suggestions( base_dir=src, type_=AnalysisType.LINE, metric=Spectrum.Ochiai, ) self.assertAlmostEqual( 0.7071067811865475, suggestions[0].suspiciousness, delta=0.0000001 ) self.assertEqual(1, len(suggestions[0].lines)) self.assertIn( Location(os.path.join("src", "middle", "__init__.py"), 6), suggestions[0].lines, )
smythi93/Tests4Py
tests/test_sfl.py
test_sfl.py
py
3,851
python
en
code
8
github-code
6
[ { "api_name": "utils.BaseTest", "line_number": 14, "usage_type": "name" }, { "api_name": "tests4py.framework.default.tests4py_checkout", "line_number": 19, "usage_type": "call" }, { "api_name": "tests4py.framework.default", "line_number": 19, "usage_type": "attribute" }...
27672884251
from typing import Dict, Tuple from copy import deepcopy import torch from config import tqc_config from modules import Actor, TruncatedQuantileEnsembledCritic class TQC: def __init__(self, cfg: tqc_config, actor: Actor, critic: TruncatedQuantileEnsembledCritic) -> None: self.cfg = cfg self.device = cfg.device self.tau = cfg.tau self.discount = cfg.discount self.batch_size = cfg.batch_size self.target_entropy = -float(actor.action_dim) self.log_alpha = torch.tensor([0.0], dtype=torch.float32, device=self.device, requires_grad=True) self.alpha_optimizer = torch.optim.AdamW([self.log_alpha], lr=cfg.alpha_lr) self.alpha = self.log_alpha.exp().detach() self.actor = actor.to(self.device) self.actor_optim = torch.optim.AdamW(self.actor.parameters(), lr=cfg.actor_lr) self.critic = critic.to(self.device) self.critic_target = deepcopy(critic).to(self.device) self.critic_optim = torch.optim.AdamW(self.critic.parameters(), lr=cfg.critic_lr) self.quantiles_total = critic.num_critics * critic.num_quantiles self.quantiles2drop = cfg.quantiles_to_drop_per_critic * cfg.num_critics self.top = self.quantiles_total - self.quantiles2drop huber_tau = torch.arange(self.cfg.num_quantiles, device=self.device).float() / self.top + 1 / (2 * self.top) self.huber_tau = huber_tau[None, None, :, None] self.total_iterations = 0 def train(self, states: torch.Tensor, actions: torch.Tensor, rewards: torch.Tensor, next_states: torch.Tensor, dones: torch.Tensor) -> Dict[str, float]: self.total_iterations += 1 # critic step critic_loss = self.critic_loss(states, actions, rewards, next_states, dones) self.critic_optim.zero_grad() critic_loss.backward() self.critic_optim.step() # actor step actor_loss, batch_entropy, qz_values = self.actor_loss(states) self.actor_optim.zero_grad() actor_loss.backward() self.actor_optim.step() # alpha step alpha_loss = self.alpha_loss(states) self.alpha_optimizer.zero_grad() alpha_loss.backward() self.alpha_optimizer.step() self.alpha = self.log_alpha.exp().detach() self.soft_critic_update() return { "critic_loss": critic_loss.item(), "actor_loss": actor_loss.item(), "actor_batch_entropy": batch_entropy, "qz_values": qz_values, "alpha": self.alpha.item(), "alpha_loss": alpha_loss.item() } def actor_loss(self, states: torch.Tensor) -> Tuple[torch.Tensor, float, float]: actions, log_prob = self.actor(states, need_log_prob=True) qz_values = self.critic(states, actions).mean(dim=2).mean(dim=1, keepdim=True) loss = self.alpha * log_prob - qz_values batch_entropy = -log_prob.mean().item() return loss.mean(), batch_entropy, qz_values.mean().item() def critic_loss(self, states: torch.Tensor, actions: torch.Tensor, rewards: torch.Tensor, next_states: torch.Tensor, dones: torch.Tensor) -> torch.Tensor: with torch.no_grad(): next_actions, next_log_prob = self.actor(next_states, need_log_prob=True) next_z = self.critic_target(next_states, next_actions) sorted_next_z = torch.sort(next_z.reshape(self.batch_size, -1)).values sorted_next_z_top = sorted_next_z[:, :self.top] sorted_next_z_top = sorted_next_z_top - self.alpha * next_log_prob.unsqueeze(-1) quantiles_target = rewards + self.discount * (1.0 - dones) * sorted_next_z_top current_z = self.critic(states, actions) loss = self.quantile_huber_loss(current_z, quantiles_target) return loss def quantile_huber_loss(self, quantiles: torch.Tensor, target: torch.Tensor) -> torch.Tensor: pairwise_diff = target[:, None, None, :] - quantiles[:, :, :, None] abs_val = pairwise_diff.abs() huber_loss = torch.where(abs_val > 1.0, abs_val - 0.5, pairwise_diff.pow(2) / 2) loss = torch.abs(self.huber_tau - (pairwise_diff < 0).float()) * huber_loss return loss.mean() def alpha_loss(self, state: torch.Tensor) -> torch.Tensor: with torch.no_grad(): action, log_prob = self.actor(state, need_log_prob=True) loss = -self.log_alpha * (log_prob + self.target_entropy) return loss.mean() def soft_critic_update(self): for param, tgt_param in zip(self.critic.parameters(), self.critic_target.parameters()): tgt_param.data.copy_(self.tau * param.data + (1 - self.tau) * tgt_param.data)
zzmtsvv/rl_task
offline_tqc/tqc.py
tqc.py
py
5,082
python
en
code
8
github-code
6
[ { "api_name": "config.tqc_config", "line_number": 10, "usage_type": "name" }, { "api_name": "modules.Actor", "line_number": 11, "usage_type": "name" }, { "api_name": "modules.TruncatedQuantileEnsembledCritic", "line_number": 12, "usage_type": "name" }, { "api_name...
19167053066
""" Common utilities for derp used by various classes. """ from collections import namedtuple import cv2 from datetime import datetime import heapq import logging import pathlib import numpy as np import os import socket import time import yaml import zmq import capnp import messages_capnp Bbox = namedtuple("Bbox", ["x", "y", "w", "h"]) TOPICS = { "camera": messages_capnp.Camera, "controller": messages_capnp.Controller, "action": messages_capnp.Action, "imu": messages_capnp.Imu, "quality": messages_capnp.Quality, } DERP_ROOT = pathlib.Path(os.environ["DERP_ROOT"]) MODEL_ROOT = DERP_ROOT / "models" RECORDING_ROOT = DERP_ROOT / "recordings" CONFIG_ROOT = DERP_ROOT / "config" MSG_STEM = "/tmp/derp_" def is_already_running(path): """ For the given PID path check if the PID exists """ if isinstance(path, str): path = pathlib.Path(path) if not path.exists(): return False with open(str(path)) as pid_file: pid = int(pid_file.read()) try: os.kill(pid, 0) except OSError: return False return True def write_pid(path): with open(str(path), 'w') as pid_file: pid_file.write(str(os.getpid())) pid_file.flush() def init_logger(name, recording_path, level=logging.INFO): logger = logging.getLogger(name) formatter = logging.Formatter('%(asctime)s %(levelname)-5s %(message)s') fileHandler = logging.FileHandler(recording_path / ('%s.log' % name), mode='w') fileHandler.setFormatter(formatter) streamHandler = logging.StreamHandler() streamHandler.setFormatter(formatter) logger.setLevel(level) logger.addHandler(fileHandler) logger.addHandler(streamHandler) return logger def make_recording_path(): date = datetime.utcfromtimestamp(time.time()).strftime("%Y%m%d-%H%M%S") folder = RECORDING_ROOT / ("recording-%s-%s" % (date, socket.gethostname())) folder.mkdir(parents=True) return folder def get_timestamp(): return int(time.time() * 1e9) def publisher(path): context = zmq.Context() sock = context.socket(zmq.PUB) sock.bind("ipc://" + path) # sock.bind("tcp://*:%s" % port) return context, sock def subscriber(paths): context = zmq.Context() sock = context.socket(zmq.SUB) # sock.connect("tcp://localhost:%s" % port) for path in paths: sock.connect("ipc://" + path) sock.setsockopt(zmq.SUBSCRIBE, b"") return context, sock def topic_file_reader(folder, topic): return open("%s/%s.bin" % (folder, topic), "rb") def topic_exists(folder, topic): path = folder / ("%s.bin" % topic) return path.exists() def topic_file_writer(folder, topic): return open("%s/%s.bin" % (folder, topic), "wb") def print_image_config(name, config): """ Prints some useful variables about the camera for debugging purposes """ top = config["pitch"] + config["vfov"] / 2 bot = config["pitch"] - config["vfov"] / 2 left = config["yaw"] - config["hfov"] / 2 right = config["yaw"] + config["hfov"] / 2 hppd = config["width"] / config["hfov"] vppd = config["height"] / config["vfov"] print( "%s top: %6.2f bot: %6.2f left: %6.2f right: %6.2f hppd: %5.1f vppd: %5.1f" % (name, top, bot, left, right, hppd, vppd) ) def get_patch_bbox(target_config, source_config): """ Gets a different sub-persepective given a smaller desired hfov/vfov and different yaw/pitch """ hfov_ratio = target_config["hfov"] / source_config["hfov"] vfov_ratio = target_config["vfov"] / source_config["vfov"] hfov_offset = source_config["yaw"] - target_config["yaw"] vfov_offset = source_config["pitch"] - target_config["pitch"] patch_width = int(source_config["width"] * hfov_ratio + 0.5) patch_height = int(source_config["height"] * vfov_ratio + 0.5) x_center = (source_config["width"] - patch_width) // 2 y_center = (source_config["height"] - patch_height) // 2 x_offset = int(hfov_offset / source_config["hfov"] * source_config["width"] + 0.5) y_offset = int(vfov_offset / source_config["vfov"] * source_config["height"] + 0.5) x = x_center + x_offset y = y_center + y_offset if (x >= 0 and x + patch_width <= source_config["width"] and y >= 0 and y + patch_height <= source_config["height"]): return Bbox(x, y, patch_width, patch_height) return None def crop(image, bbox): """ Crops the Bbox(x,y,w,h) from the image. Copy indicates to copy of the ROI"s memory""" return image[bbox.y : bbox.y + bbox.h, bbox.x : bbox.x + bbox.w] def resize(image, size): """ Resize the image to the target (w, h) """ is_larger = size[0] > image.shape[1] or size[1] > image.shape[0] interpolation = cv2.INTER_LINEAR if is_larger else cv2.INTER_AREA return cv2.resize(image, size, interpolation=interpolation) def perturb(frame, camera_config, shift=0, rotate=0): # Estimate how many pixels to rotate by, assuming fixed degrees per pixel pixels_per_degree = camera_config["width"] / camera_config["hfov"] # Figure out where the horizon is in the image horizon_frac = ((camera_config["vfov"] / 2) + camera_config["pitch"]) / camera_config["vfov"] # For each row in the frame shift/rotate it indexs = np.arange(len(frame)) vertical_fracs = np.linspace(0, 1, len(frame)) # For each vertical line, apply shift/rotation rolls for index, vertical_frac in zip(indexs, vertical_fracs): magnitude = rotate * pixels_per_degree if vertical_frac > horizon_frac: ground_angle = (vertical_frac - horizon_frac) * camera_config["vfov"] ground_distance = camera_config["z"] / np.tan(deg2rad(ground_angle)) ground_width = 2 * ground_distance * np.tan(deg2rad(camera_config["hfov"]) / 2) magnitude += (shift / ground_width) * camera_config["width"] magnitude = int(magnitude + 0.5 * np.sign(magnitude)) if magnitude > 0: frame[index, magnitude:, :] = frame[index, : frame.shape[1] - magnitude] frame[index, :magnitude, :] = 0 elif magnitude < 0: frame[index, :magnitude, :] = frame[index, abs(magnitude) :] frame[index, frame.shape[1] + magnitude :] = 0 return frame def deg2rad(val): return val * np.pi / 180 def rad2deg(val): return val * 180 / np.pi def load_image(path): return cv2.imread(str(path)) def save_image(path, image): return cv2.imwrite(str(path), image) def load_config(config_path): """ Load a configuration file, also reading any component configs """ with open(str(config_path)) as config_fd: config = yaml.load(config_fd, Loader=yaml.FullLoader) for component in config: if isinstance(config[component], dict) and "path" in config[component]: component_path = CONFIG_ROOT / config[component]["path"] with open(str(component_path)) as component_fd: component_config = yaml.load(component_fd, Loader=yaml.FullLoader) component_config.update(config[component]) config[component] = component_config if "name" not in config[component]: config[component]["name"] = component_path.stem if "name" not in config: config["name"] = config_path.stem return config def dump_config(config, config_path): """ Write a configuration file """ with open(str(config_path), 'w') as config_fd: yaml.dump(config, config_fd) def extract_latest(desired_times, source_times, source_values): out = [] pos = 0 val = 0 for desired_time in desired_times: while pos < len(source_times) and source_times[pos] < desired_time: val = source_values[pos] pos += 1 out.append(val) return np.array(out) def load_topics(folder): if isinstance(folder, str): folder = pathlib.Path(folder) out = {} for topic in TOPICS: if not topic_exists(folder, topic): continue topic_fd = topic_file_reader(folder, topic) out[topic] = [msg for msg in TOPICS[topic].read_multiple(topic_fd)] topic_fd.close() return out def replay(topics): heap = [] for topic in topics: for msg in topics[topic]: heapq.heappush(heap, [msg.publishNS, topic, msg]) while heap: yield heapq.heappop(heap) def decode_jpg(jpg): return cv2.imdecode(np.frombuffer(jpg, np.uint8), cv2.IMREAD_COLOR) def encode_jpg(image, quality): return cv2.imencode(".jpg", image, [cv2.IMWRITE_JPEG_QUALITY, quality])[1].tostring() def extract_car_actions(topics): out = [] autonomous = False speed_offset = 0 steer_offset = 0 for timestamp, topic, msg in replay(topics): if topic == "controller": autonomous = msg.isAutonomous speed_offset = msg.speedOffset steer_offset = msg.steerOffset elif topic == "action": if autonomous or msg.isManual: out.append([timestamp, msg.speed + speed_offset, msg.steer + steer_offset]) if not out: out.append([0, 0, 0]) return np.array(out)
notkarol/derplearning
derp/util.py
util.py
py
9,198
python
en
code
40
github-code
6
[ { "api_name": "collections.namedtuple", "line_number": 19, "usage_type": "call" }, { "api_name": "messages_capnp.Camera", "line_number": 22, "usage_type": "attribute" }, { "api_name": "messages_capnp.Controller", "line_number": 23, "usage_type": "attribute" }, { "...
2888676781
import numpy as np from matplotlib import pyplot as plt if __name__ == '__main__': ch, time, date = np.genfromtxt("events220302_1d.dat", unpack=True, dtype=(int, float, 'datetime64[ms]')) mask1 = ch==1 mask2 = ch==2 time1 = time[mask1] time2 = time[mask2] date1 = date[mask1] date2 = date[mask2] limit = np.datetime64("2022-03-02T13") fig, ax = plt.subplots(2,1, sharex=True) ax[0].errorbar(date1[date1 < limit], time1[date1 < limit], fmt='.k', markersize=0.6) ax[1].errorbar(date2[date2 < limit], time2[date2 < limit], fmt='.k', markersize=0.6) ax[0].set_ylabel("FPGA timestamp [s]") ax[1].set_ylabel("FPGA timestamp [s]") ax[0].set_title("CHANNEL 1") ax[1].set_title("CHANNEL 2") ax[1].set_xlabel("Local time [dd hh:mm]") plt.show()
brinus/Sciami_lab4
UNIX_vs_FPGA.py
UNIX_vs_FPGA.py
py
841
python
en
code
0
github-code
6
[ { "api_name": "numpy.genfromtxt", "line_number": 5, "usage_type": "call" }, { "api_name": "numpy.datetime64", "line_number": 16, "usage_type": "call" }, { "api_name": "matplotlib.pyplot.subplots", "line_number": 18, "usage_type": "call" }, { "api_name": "matplotli...
25003790859
import math from typing import Tuple import tensorflow as tf class ParityDataset(tf.keras.utils.Sequence): def __init__(self, n_samples: int, n_elems: int = 64, batch_size: int = 128): """ Parameters ---------- n_samples : int Number of samples. n_elems : int, optional Number of elements in the input vector. The default is 64. batch_size : int, optional Batch size. The default is 128. """ self.n_samples = n_samples self.n_elems = n_elems self.batch_size = batch_size def __len__(self) -> int: return int(math.floor(self.n_samples) / self.batch_size) @tf.function def __batch_generation(self) -> Tuple[tf.Tensor, tf.Tensor]: X = [] Y = [] for _ in range(self.batch_size): n_non_zero = tf.random.uniform((), 1, self.n_elems + 1, tf.int32) x = tf.random.uniform((n_non_zero,), 0, 2, tf.int32) * 2 - 1 x = tf.concat( [x, tf.zeros((self.n_elems - n_non_zero), dtype=tf.int32)], axis=0 ) x = tf.random.shuffle(x) y = tf.math.reduce_sum(tf.cast(tf.equal(x, 1), tf.int32)) % 2 X.append(x) Y.append(y) X = tf.cast(tf.stack(X), tf.keras.backend.floatx()) Y = tf.cast(tf.stack(Y), tf.keras.backend.floatx()) return X, Y def __getitem__(self, index: int) -> Tuple[tf.Tensor, tf.Tensor]: batch_X, batch_Y = self.__batch_generation() return batch_X, batch_Y
EMalagoli92/PonderNet-TensorFlow
pondernet_tensorflow/dataset/parity_dataset.py
parity_dataset.py
py
1,598
python
en
code
1
github-code
6
[ { "api_name": "tensorflow.keras", "line_number": 7, "usage_type": "attribute" }, { "api_name": "math.floor", "line_number": 26, "usage_type": "call" }, { "api_name": "tensorflow.random.uniform", "line_number": 33, "usage_type": "call" }, { "api_name": "tensorflow....
23750393543
""" 최적화 비중을 계산해주는 모듈 @author: Younghyun Kim Created on 2021.10.05 """ import numpy as np import pandas as pd import cvxpy as cp import torch from cvxpylayers.torch import CvxpyLayer class ClassicOptimizer: """ Classic Optimizer """ def __init__(self, m=100, buying_fee=0.01, selling_fee=0.01, min_cash_rate=0.01): """ Initialization Args: m: big number """ self.m = m self.buying_fee = buying_fee self.selling_fee = selling_fee self.min_cash_rate = min_cash_rate def max_sr(self, returns, nonneg=True, adjust=True): """ Maximize Sharpe Ratio Args: returns: pd.DataFrame or np.array Return: weights: np.array(N) """ if isinstance(returns, pd.DataFrame): returns = returns.values creturns = returns * self.m cov = np.cov(creturns.transpose()) cov = np.nan_to_num(cov) mu = creturns.mean(0).reshape(-1) mu_min = abs(mu.min()) if mu[mu > 0].shape[0] == 0: mu += mu_min mu = np.nan_to_num(mu) weights = cp.Variable(returns.shape[1]) cov_cp = cp.Parameter((cov.shape[1], cov.shape[0]), symmetric=True) objective = cp.Minimize(cp.sum_squares(cov_cp @ weights)) constraints = [mu.T @ weights >= 1] if nonneg: constraints.append(0 <= weights) prob = cp.Problem(objective, constraints) assert prob.is_dpp() cov = torch.FloatTensor(cov.astype(float)) cvxpylayer = CvxpyLayer(prob, parameters=[cov_cp], variables=[weights]) weights, = cvxpylayer(cov) if adjust: weights = self.adjust_weights(weights) return weights.numpy() def min_var(self, returns): """ Minimum Variance Portfolio Args: returns: pd.DataFrame or np.array Return: weights: np.array(N) """ if isinstance(returns, pd.DataFrame): returns = returns.values creturns = returns * self.m cov = np.cov(creturns.transpose()) cov = np.nan_to_num(cov) weights = cp.Variable(returns.shape[1]) cov_cp = cp.Parameter((cov.shape[1], cov.shape[0]), symmetric=True) objective = cp.Minimize(cp.sum_squares(cov_cp @ weights)) constraints = [cp.sum(weights) == 1, 0 <= weights] prob = cp.Problem(objective, constraints) assert prob.is_dpp() cov = torch.FloatTensor(cov.astype(float)) cvxpylayer = CvxpyLayer(prob, parameters=[cov_cp], variables=[weights]) weights, = cvxpylayer(cov) return weights.numpy() def max_div(self, returns, nonneg=True, adjust=True): """ Maximum Diversification Portfolio Args: returns: pd.DataFrame or np.array Return: weights: np.array(N) """ if isinstance(returns, pd.DataFrame): returns = returns.values creturns = returns * self.m cov = np.cov(creturns.transpose()) cov = np.nan_to_num(cov) sig = creturns.std(0).reshape(-1) sig = np.nan_to_num(sig) weights = cp.Variable(returns.shape[1]) cov_cp = cp.Parameter((cov.shape[1], cov.shape[0]), symmetric=True) objective = cp.Minimize(cp.sum_squares(cov_cp @ weights)) constraints = [sig.T @ weights >= 1] if nonneg: constraints.append(0 <= weights) prob = cp.Problem(objective, constraints) assert prob.is_dpp() cov = torch.FloatTensor(cov.astype(float)) cvxpylayer = CvxpyLayer(prob, parameters=[cov_cp], variables=[weights]) weights, = cvxpylayer(cov) if adjust: weights = self.adjust_weights(weights) return weights.numpy() def mv_mean(self, returns): """ Mean-Variance Portfolio with min ret based on mean ret Args: returns: pd.DataFrame or np.array Return: weights: np.array(N) """ if isinstance(returns, pd.DataFrame): returns = returns.values creturns = returns * self.m cov = np.cov(creturns.transpose()) cov = np.nan_to_num(cov) weights = cp.Variable(returns.shape[1]) cov_cp = cp.Parameter((cov.shape[1], cov.shape[0]), symmetric=True) mu = creturns.mean(0).reshape(-1) mu_min = abs(mu.min()) if mu[mu > 0].shape[0] == 0: mu += mu_min mu = np.nan_to_num(mu) mret = mu.mean().item() objective = cp.Minimize(cp.sum_squares(cov_cp @ weights)) constraints = [cp.sum(weights) == 1, mu.T @ weights >= mret, 0 <= weights] prob = cp.Problem(objective, constraints) assert prob.is_dpp() cov = torch.FloatTensor(cov.astype(float)) cvxpylayer = CvxpyLayer(prob, parameters=[cov_cp], variables=[weights]) weights, = cvxpylayer(cov) return weights.numpy() def pm_port(self, returns, topk=5, return_type='pct'): """ Price Momentum Equal Weight Portfolio with TopK Args: returns: pd.DataFrame or np.array topk: top K return_type: return type(log or pct) Return: weights: np.array(N) """ if isinstance(returns, pd.DataFrame): returns = returns.values if return_type == 'pct': returns = np.log(returns + 1.) crets = returns.sum(0) crets = np.nan_to_num(crets) crank = crets.argsort() weights = np.zeros(returns.shape[1]) weights[crank[-topk:]] = 1. / topk return weights def lowvol_port(self, returns, topk=5): """ Lowvol Equal Weight Portfolio with TopK Args: returns: pd.DataFrame or np.array topk: top K Return: weights: np.array(N) """ if isinstance(returns, pd.DataFrame): returns = returns.values sig = returns.std(0) sig = np.nan_to_num(sig) srank = sig.argsort() weights = np.zeros(returns.shape[1]) weights[srank[:topk]] = 1. / topk return weights def ew_port(self, n): """ Equal Weight Portfolio with n assets Args: n: asset num Return: weights: np.array(n) """ weights = torch.ones(n) / n return weights def solve_amount(self, asset_prices, asset_embs, optimal_emb, wealth): """ Solving method for trading amounts Args: asset_prices: np.array 수량 계산에 필요한 자산 별 가격(1 X N) asset_embs = np.array 자산 별 임베딩(N X M) optimal_emb: 최적 포트폴리오 임베딩(1 X M) wealth: 총 투자금 Return: buying_amount: 종목 별 수량 prob_value: 최적과 최종 포트폴리오 거리(L2) """ wealth =\ wealth * (1. - max(self.buying_fee, self.selling_fee)) # 비용 고려 wealth = wealth * (1. - self.min_cash_rate) # 최소 보유 현금 고려 asset_embs_v = asset_embs.transpose() * asset_prices / wealth asset_prices = asset_prices.reshape(-1) buying_amount = cp.Variable(asset_prices.shape[0]) optimal_emb = optimal_emb.reshape(-1) objective = cp.Minimize(self.m * cp.sum_squares((asset_embs_v @ buying_amount) - optimal_emb)) constraints = [buying_amount >= 0, asset_prices.T @ buying_amount == wealth] prob = cp.Problem(objective, constraints) prob.solve() buying_amount = np.round(buying_amount.value, 0) return buying_amount, prob.value def get_replicated_buying_amounts(self, closes, asset_embs, weights, insts=['A069500', 'A229200', 'A114800', 'A251340'], topk=10, wealth=50000000): """ closes: pd.Series 종목 별 종가(stock_num) asset_embs: torch.tensor 종목 별 임베딩(1, stock_num, emb_dim) weights: torch.tensor 종목 별 투자비중(1, stock_num) insts: list 복제에 활용될 시장 ETF(default: K200, KQ150) topk: 복제하기 위한 상위 종목 수 * closes, asset_embs, weights는 종목 별 순서가 일치해야함 Return: amounts: pd.DataFrame 매수수량 aweights: pd.DataFrame 매수수량을 바탕으로 한 투자비중 value_est: closes를 바탕으로 계산한 총금액 prob_value: 임베딩 거리 """ ins = [] for inst in insts: ind = np.argwhere(closes.index == inst).item() ins.append(ind) ranks = weights.argsort(descending=True) ranks = ranks.cpu().numpy().reshape(-1) sel = np.unique(np.concatenate((ranks[:topk], ins), axis=-1)) optimal_emb = self.calc_optimal_emb(asset_embs, weights) embs = asset_embs[0, sel].cpu().numpy() optimal_emb = optimal_emb.view(-1, 1).cpu().numpy() amounts, prob_value = self.solve_amount(closes.iloc[sel].values, embs, optimal_emb, wealth) amounts = pd.DataFrame(amounts.reshape(-1, 1), index=closes.index[sel], columns=['amounts']) amounts = amounts[amounts['amounts'] > 0] closes = pd.DataFrame(closes.values, index=closes.index, columns=amounts.columns) value_est = (amounts.values.ravel() * closes.loc[amounts.index].values.ravel()).sum() aweights = (amounts * closes.loc[amounts.index]) / value_est return amounts, aweights, value_est, prob_value def calc_optimal_emb(self, asset_embs, weights): """ calculate optimal embedding Args: asset_embs: torch.tensor (batch_size, stock_num, emb_dim) weights: torch.tensor (batch_size, stock_num) """ optimal_emb = torch.matmul(weights, asset_embs) return optimal_emb def adjust_weights(self, weights): """ 비중 조정 * nonneg일때, weights /= weights.sum() * weights[weights > 0].sum() > 0 일때, weights /= weights[weights > 0].sum() * weights[weights > 0].sum() < 0이고, weights[weights < 0] != 0일때, weights /= -weights[weights < 0].sum() """ if (weights != 0).sum() > 0: weights = weights / abs(weights).max() wpos_sum = weights[weights > 0].sum() wneg_sum = -weights[weights < 0].sum() if weights.sum() != 0: weights /= max(wpos_sum, wneg_sum) return weights
kimyoungh/singlemolt
statesman/classic_optimizer.py
classic_optimizer.py
py
11,771
python
en
code
0
github-code
6
[ { "api_name": "pandas.DataFrame", "line_number": 41, "usage_type": "attribute" }, { "api_name": "numpy.cov", "line_number": 45, "usage_type": "call" }, { "api_name": "numpy.nan_to_num", "line_number": 46, "usage_type": "call" }, { "api_name": "numpy.nan_to_num", ...
73529467707
import os.path from sklearn import metrics from torch import nn, optim # noinspection PyUnresolvedReferences from tests.pytest_helpers.data import dataloaders, image # noinspection PyUnresolvedReferences from tests.pytest_helpers.nn import sample_model def test_fit(sample_model, dataloaders): try: model = sample_model( nn.CrossEntropyLoss, optim.Adam, [(metrics.accuracy_score, {})] ) model.fit(dataloaders) except: assert False def test_prediction(sample_model, image): _image = image('../sampleData/images/cat1.jpeg') model = sample_model(nn.CrossEntropyLoss, optim.Adam, [(metrics.recall_score, {'average': 'macro'})]) predictions = model.predict(_image) assert list(predictions.size()) == [1, 2] def test_save(sample_model, dataloaders): model = sample_model( nn.CrossEntropyLoss, optim.Adam, [(metrics.accuracy_score, {})] ) model.fit(dataloaders) assert os.path.exists('./bestModel.pkl.tar')
default-303/easyTorch
tests/testUtils/test_trainer.py
test_trainer.py
py
1,039
python
en
code
2
github-code
6
[ { "api_name": "tests.pytest_helpers.nn.sample_model", "line_number": 13, "usage_type": "call" }, { "api_name": "torch.nn.CrossEntropyLoss", "line_number": 14, "usage_type": "attribute" }, { "api_name": "torch.nn", "line_number": 14, "usage_type": "name" }, { "api_...
21299192914
"""Module to evaluate full pipeline on the validation set. python evaluate.py """ #!/usr/bin/env python # coding: utf-8 import os import sys import glob import numpy as np import image_preprocessing import cnn import bayesian_network import json import pandas as pd # class mapping classes = {"Positive": 0, "Neutral": 1, "Negative": 2, "None": 3} # function to classify an image def classify_image(image_folder_path, image_name, real_label, cnn_model, bayesian_model, labels_list): with open('val_labels.json', mode='r', encoding='utf-8') as f: image_labels_dict = json.load(f) labels = image_labels_dict[image_name] # print("RadhaKrishna") # print(labels) # preprocess the image image_preprocessing.preprocess(image_folder_path, image_name) # get mean cnn predictions for the faces from the image cnn_label, cnn_dict, faces_detected = cnn.predict_image(cnn_model, image_folder_path + "Aligned/", image_name) # get the bayesian and bayesian + cnn predictions for the image bayesian_label, bayesian_cnn_label, emotion_dict, emotion_cnn_dict = bayesian_network.inference(bayesian_model, labels_list, labels, cnn_label) # print("Faces detected: " + str(faces_detected)) # print("Real Label: " + str(real_label)) # print("CNN Label: " + str(cnn_label)) # print("Bayesian Label: " + str(bayesian_label)) # print("Bayesian + CNN Label: " + str(bayesian_cnn_label)) return classes[real_label], classes[str(cnn_label)], classes[str(bayesian_label)], classes[str(bayesian_cnn_label)], faces_detected # load the cnn model cnn_model = cnn.load_model() # load the bayesian model bayesian_model, labels_list = bayesian_network.load_model() # function to evaluate the pipeline on a given directory def evaluate(image_folder_path, real_label): # print("RadhaKrishna") # get the count of total number of files in the directory _, _, files = next(os.walk(image_folder_path)) file_count = len(files)-1 # list to store the predictions predictions = [] # set count = 1 i = 1 # for each image in the directory for file in sorted(glob.glob(image_folder_path + "*.jpg")): # extract the image name image_name = (file.split('/'))[-1] print("Image: " + image_name) print(str(i) + "/" + str(file_count)) # create a dict to store the image name and predictions prediction = {"Image": image_name} prediction["Actual"], prediction["CNN"], prediction["Bayesian"], prediction["Bayesian + CNN"], prediction["Faces Detected"] = classify_image(image_folder_path, image_name, real_label, cnn_model, bayesian_model, labels_list) # append the dict to the list of predictions predictions.append(prediction) # increase the count i+=1 # return the predictions list return predictions # class list class_list = ['Positive', 'Neutral', 'Negative'] predictions_list = [] # for each class in the class list for emotion_class in class_list: # evaluate all the images in that folder predictions = evaluate('input/val/' + emotion_class + '/', emotion_class) # add the predictions to the predictions list predictions_list += predictions # create a pandas dataframe from the predictions list df = pd.DataFrame(predictions_list) # store the dataframe to a file df.to_pickle('predictions')
samanyougarg/Group-Emotion-Recognition
evaluate.py
evaluate.py
py
3,390
python
en
code
43
github-code
6
[ { "api_name": "json.load", "line_number": 25, "usage_type": "call" }, { "api_name": "image_preprocessing.preprocess", "line_number": 32, "usage_type": "call" }, { "api_name": "cnn.predict_image", "line_number": 35, "usage_type": "call" }, { "api_name": "bayesian_n...
23196116357
import pyspark import networkx as nx import pandas as pd from pyspark.sql.types import ( LongType, StringType, FloatType, IntegerType, DoubleType, StructType, StructField, ) import pyspark.sql.functions as f from pyspark.sql.functions import pandas_udf, PandasUDFType from networkx.algorithms.centrality import ( eigenvector_centrality, harmonic_centrality, ) def eigencentrality( sparkdf, src="src", dst="dst", cluster_id_colname="cluster_id", ): """ Args: sparkdf: imput edgelist Spark DataFrame src: src column name dst: dst column name distance_colname: distance column name cluster_id_colname: Graphframes-created connected components created cluster_id Returns: node_id: eigen_centrality: eigenvector centrality of cluster cluster_id cluster_id: cluster_id corresponding to the node_id Eigenvector Centrality is an algorithm that measures the transitive influence or connectivity of nodes. Eigenvector Centrality was proposed by Phillip Bonacich, in his 1986 paper Power and Centrality: A Family of Measures. It was the first of the centrality measures that considered the transitive importance of a node in a graph, rather than only considering its direct importance. Relationships to high-scoring nodes contribute more to the score of a node than connections to low-scoring nodes. A high score means that a node is connected to other nodes that have high scores. example input spark dataframe |src|dst|weight|cluster_id|distance| |---|---|------|----------|--------| | f| d| 0.67| 0| 0.329| | f| g| 0.34| 0| 0.659| | b| c| 0.56|8589934592| 0.439| | g| h| 0.99| 0| 0.010| | a| b| 0.4|8589934592| 0.6| | h| i| 0.5| 0| 0.5| | h| j| 0.8| 0| 0.199| | d| e| 0.84| 0| 0.160| | e| f| 0.65| 0| 0.35| example output spark dataframe |node_id| eigen_centrality|cluster_id| |-------|-------------------|----------| | b | 0.707106690085642|8589934592| | c | 0.5000000644180599|8589934592| | a | 0.5000000644180599|8589934592| | f | 0.5746147732828122| 0| | d | 0.4584903903420785| 0| | g |0.37778352393858183| 0| | h |0.27663243805676946| 0| | i |0.12277029263709134| 0| | j |0.12277029263709134| 0| | e | 0.4584903903420785| 0| """ ecschema = StructType( [ StructField("node_id", StringType()), StructField("eigen_centrality", DoubleType()), StructField(cluster_id_colname, LongType()), ] ) psrc = src pdst = dst @pandas_udf(ecschema, PandasUDFType.GROUPED_MAP) def eigenc(pdf: pd.DataFrame) -> pd.DataFrame: nxGraph = nx.Graph() nxGraph = nx.from_pandas_edgelist(pdf, psrc, pdst) ec = eigenvector_centrality(nxGraph, tol=1e-03) out_df = ( pd.DataFrame.from_dict(ec, orient="index", columns=["eigen_centrality"]) .reset_index() .rename( columns={"index": "node_id", "eigen_centrality": "eigen_centrality"} ) ) cluster_id = pdf[cluster_id_colname][0] out_df[cluster_id_colname] = cluster_id return out_df out = sparkdf.groupby(cluster_id_colname).apply(eigenc) return out def harmoniccentrality(sparkdf, src="src", dst="dst", cluster_id_colname="cluster_id"): """ Args: sparkdf: imput edgelist Spark DataFrame src: src column name dst: dst column name distance_colname: distance column name cluster_id_colname: Graphframes-created connected components created cluster_id Returns: node_id: harmonic_centrality: Harmonic centrality of cluster cluster_id cluster_id: cluster_id corresponding to the node_id Harmonic centrality (also known as valued centrality) is a variant of closeness centrality, that was invented to solve the problem the original formula had when dealing with unconnected graphs. Harmonic centrality was proposed by Marchiori and Latora while trying to come up with a sensible notion of "average shortest path". They suggested a different way of calculating the average distance to that used in the Closeness Centrality algorithm. Rather than summing the distances of a node to all other nodes, the harmonic centrality algorithm sums the inverse of those distances. This enables it deal with infinite values. input spark dataframe: |src|dst|weight|cluster_id|distance| |---|---|------|----------|--------| | f| d| 0.67| 0| 0.329| | f| g| 0.34| 0| 0.659| | b| c| 0.56|8589934592| 0.439| | g| h| 0.99| 0| 0.010| | a| b| 0.4|8589934592| 0.6| | h| i| 0.5| 0| 0.5| | h| j| 0.8| 0| 0.199| | d| e| 0.84| 0| 0.160| | e| f| 0.65| 0| 0.35| output spark dataframe: |node_id|harmonic_centrality|cluster_id| |-------|-------------------|----------| | b | 2.0|8589934592| | c | 1.5|8589934592| | a | 1.5|8589934592| | f | 4.166666666666667| 0| | d | 3.3333333333333335| 0| | g | 4.0| 0| | h | 4.166666666666667| 0| | i | 2.8333333333333335| 0| | j | 2.8333333333333335| 0| | e | 3.3333333333333335| 0| """ hcschema = StructType( [ StructField("node_id", StringType()), StructField("harmonic_centrality", DoubleType()), StructField(cluster_id_colname, LongType()), ] ) psrc = src pdst = dst @pandas_udf(hcschema, PandasUDFType.GROUPED_MAP) def harmc(pdf: pd.DataFrame) -> pd.DataFrame: nxGraph = nx.Graph() nxGraph = nx.from_pandas_edgelist(pdf, psrc, pdst) hc = harmonic_centrality(nxGraph) out_df = ( pd.DataFrame.from_dict(hc, orient="index", columns=["harmonic_centrality"]) .reset_index() .rename( columns={ "index": "node_id", "harmonic_centrality": "harmonic_centrality", } ) ) cluster_id = pdf[cluster_id_colname][0] out_df[cluster_id_colname] = cluster_id return out_df out = sparkdf.groupby(cluster_id_colname).apply(harmc) return out
moj-analytical-services/splink_graph
splink_graph/node_metrics.py
node_metrics.py
py
6,877
python
en
code
6
github-code
6
[ { "api_name": "pyspark.sql.types.StructType", "line_number": 84, "usage_type": "call" }, { "api_name": "pyspark.sql.types.StructField", "line_number": 86, "usage_type": "call" }, { "api_name": "pyspark.sql.types.StringType", "line_number": 86, "usage_type": "call" }, ...
74750230586
import os import pathlib import shutil from datetime import datetime from pathlib import Path from my_logger_object import create_logger_object def copy_component(component_kb_list, component_name, source_folder, target_folder): # source_folder = r"C:\CodeRepos\GetOfficeKBs\Folder_Office2016_KBs\x64_msp" # target_folder = r"C:\CodeRepos\GetOfficeKBs\Folder_Latest_KB_Numbers\x64_msp" # component_name = "" if not os.path.exists(target_folder): os.makedirs(target_folder) for root, dirs, files in os.walk(source_folder): for file_name in files: component_name_in_file = file_name.split("-")[0].strip() if component_name == component_name_in_file: soure_file_path = root + os.sep + file_name target_file_path = target_folder + os.sep + file_name kb_number_in_file = file_name.split("_")[1].strip() if (component_name + "," + kb_number_in_file) not in component_kb_list: component_kb_list.append(component_name + "," + kb_number_in_file) if os.path.isfile(soure_file_path): try: shutil.copy(soure_file_path, target_file_path) except: logger.debug("exception") current_script_folder = str(pathlib.Path(__file__).parent.absolute()) + os.sep FILENAME = current_script_folder + "log_" + os.path.basename(__file__) + ".log" logger = create_logger_object(FILENAME) logger.info("The script starts running.") logger.info("The script folder is " + current_script_folder) component_list = [] try: f = open(current_script_folder + "output_msp_file_name_for_specified_kb.txt", "r") for line in f: component_str = line.split(",")[-1].strip() if component_str in component_list: logger.info("Duplicate component number: " + component_str) else: component_list.append(component_str) except Exception as ex: logger.info("Encounter exception when loading expected kb list." + str(ex)) finally: f.close() logger.info(len(component_list)) component_list.sort() component_list_file = current_script_folder + "output_non_dup_component.txt" with open(component_list_file, "w") as f: for item in component_list: f.write("%s\n" % item) time_now = formatted_date_time = datetime.now().strftime("%Y%m%d%H%M%S") source_folder_x32 = r"C:\CodeRepos\GetOfficeKBs\Folder_Office2016_KBs\x86_msp" target_folder_x32 = ( "C:\CodeRepos\GetOfficeKBs\Folder_Latest_KB_Numbers\\" + time_now + "_x86_msp" ) source_folder_x64 = r"C:\CodeRepos\GetOfficeKBs\Folder_Office2016_KBs\x64_msp" target_folder_x64 = ( "C:\CodeRepos\GetOfficeKBs\Folder_Latest_KB_Numbers\\" + time_now + "_x64_msp" ) component_kb_list = [] for item in component_list: logger.debug(item) copy_component(component_kb_list, item, source_folder_x32, target_folder_x32) copy_component(component_kb_list, item, source_folder_x64, target_folder_x64) component_kb_list.sort() component_kb_list_file = current_script_folder + "output_latest_kb_for_component.txt" with open(component_kb_list_file, "w") as f: for item in component_kb_list: f.write("%s\n" % item) logger.info("Please check output file: " + component_kb_list_file) logger.info(f"Please check output folder: {target_folder_x32}") logger.info(f"Please check output folder: {target_folder_x64}") logger.info("The script ends.")
FullStackEngN/GetOfficeKBs
get_msp_file_for_specified_msp_list.py
get_msp_file_for_specified_msp_list.py
py
3,495
python
en
code
1
github-code
6
[ { "api_name": "os.path.exists", "line_number": 15, "usage_type": "call" }, { "api_name": "os.path", "line_number": 15, "usage_type": "attribute" }, { "api_name": "os.makedirs", "line_number": 16, "usage_type": "call" }, { "api_name": "os.walk", "line_number": ...
23303525367
import pandas as pd from sklearn.cluster import KMeans from sklearn.metrics import silhouette_score import matplotlib.pyplot as plt def kmeans(): data = \ pd.read_csv( '2019-04-28xm_fish.csv', names=['房源名称', '租赁种类', '房源类型', '房源户型', '房源面积', '房源楼层', '房源朝向', '装修等级', '房源地址', '行政区划', '房源租金', '所在小区', '房源描述', '更新时间'], keep_default_na=False, index_col=False ) invalid_list = data.loc[data['房源面积'] == 0] data = data.drop(index=invalid_list.index) invalid_list2 = data.loc[data['房源租金'] > 20000] data = data.drop(index=invalid_list2.index) data1 = data.iloc[:, [4, 10]] km = KMeans(n_clusters=2, max_iter=500) cluster_result = km.fit(data1) # print(cluster_result.inertia_) y_pred = cluster_result.labels_ predict = km.predict(data1) color = ['red', 'green', 'blue', 'black', 'orange'] predict = [color[i] for i in predict] plt.scatter(data1['房源面积'], data1['房源租金'], c=predict) silhouette = silhouette_score(data1, y_pred) print(silhouette) plt.show() # # 尝试归纳户型与租金的关系 # data2 = data.iloc[:, [3, 10]] # km_ = KMeans(n_clusters=2, max_iter=500) # cluster_result_ = km_.fit(data2) # # print(cluster_result.inertia_) # y_pred_ = cluster_result.labels_ # predict_ = km.predict(data2) # # predict_ = [color[i] for i in predict_] # # plt.scatter(data2['房源面积'], data2['房源租金'], c=predict_) # silhouette = silhouette_score(data2, y_pred_) # print(silhouette) # plt.show() if __name__ == '__main__': kmeans() # kmeans对初始值的稳定性较差 # input_file = 'a.csv' # output_file = 'out.csv' # # k = 3 # iteration = 500 # data = pd.read_csv(input_file, index_col='Id') # data_zs = 1.0 * (data - data.mean()) / data.std() # # model = KMeans(n_clusters=k, n_jobs=2, max_iter=iteration) # model.fit(data_zs) # # r1 = pd.Series(model.labels_).value_counts() # r2 = pd.DataFrame(model.cluster_centers_) # r = pd.concat([r2, r1], axis=1) # r.columns = list(data.columns) + [u'类别数目'] # print(r) # # r = pd.concat([data, pd.Series(model.labels_, index=data.index)], axis=1) # r.columns = list(data.columns) + [u'聚类类别'] # r.to_csv(output_file)
Joy1897/Spider_58
kmeans.py
kmeans.py
py
2,423
python
en
code
0
github-code
6
[ { "api_name": "pandas.read_csv", "line_number": 9, "usage_type": "call" }, { "api_name": "sklearn.cluster.KMeans", "line_number": 22, "usage_type": "call" }, { "api_name": "matplotlib.pyplot.scatter", "line_number": 32, "usage_type": "call" }, { "api_name": "matpl...
41543430774
import re import sys from .ply import lex from .ply.lex import TOKEN class CLexer(object): """ A lexer for the C- language. After building it, set the input text with input(), and call token() to get new tokens. The public attribute filename can be set to an initial filaneme, but the lexer will update it upon #line directives. """ def __init__(self, error_func, on_lbrace_func, on_rbrace_func, type_lookup_func): """ Create a new Lexer. error_func: An error function. Will be called with an error message, line and column as arguments, in case of an error during lexing. on_lbrace_func, on_rbrace_func: Called when an LBRACE or RBRACE is encountered (likely to push/pop type_lookup_func's scope) type_lookup_func: A type lookup function. Given a string, it must return True IFF this string is a name of a type that was defined with a typedef earlier. """ self.error_func = error_func self.on_lbrace_func = on_lbrace_func self.on_rbrace_func = on_rbrace_func self.type_lookup_func = type_lookup_func self.filename = '' # Keeps track of the last token returned from self.token() self.last_token = None # Allow either "# line" or "# <num>" to support GCC's # cpp output # self.line_pattern = re.compile(r'([ \t]*line\W)|([ \t]*\d+)') self.pragma_pattern = re.compile(r'[ \t]*pragma\W') def build(self, **kwargs): """ Builds the lexer from the specification. Must be called after the lexer object is created. This method exists separately, because the PLY manual warns against calling lex.lex inside __init__ """ self.lexer = lex.lex(object=self, **kwargs) def reset_lineno(self): """ Resets the internal line number counter of the lexer. """ self.lexer.lineno = 1 def input(self, text): self.lexer.input(text) def token(self): self.last_token = self.lexer.token() return self.last_token def find_tok_column(self, token): """ Find the column of the token in its line. """ last_cr = self.lexer.lexdata.rfind('\n', 0, token.lexpos) return token.lexpos - last_cr def _error(self, msg, token): location = self._make_tok_location(token) self.error_func(msg, location[0], location[1]) self.lexer.skip(1) def _make_tok_location(self, token): return (token.lineno, self.find_tok_column(token)) ## ## Reserved keywords ## keywords = ( 'BOOL', 'BREAK', 'ELSE', 'FALSE', 'FOR', 'IF', 'INT', 'READ', 'RETURN', 'STRING', 'TRUE', 'VOID', 'WHILE', 'WRITE' ) keyword_map = {} for keyword in keywords: if keyword == '_BOOL': keyword_map['_Bool'] = keyword elif keyword == '_COMPLEX': keyword_map['_Complex'] = keyword else: keyword_map[keyword.lower()] = keyword ## ## All the tokens recognized by the lexer ## tokens = keywords + ( # Identifiers 'ID', # Type identifiers (identifiers previously defined as # types with typedef) 'TYPEID', # String literals 'STRING_LITERAL', 'WSTRING_LITERAL', # Operators 'PLUS', 'MINUS', 'TIMES', 'DIVIDE', 'MOD', 'AND', 'OR', 'NOT', 'LSHIFT', 'RSHIFT', # Relations 'EQ', 'NE', 'LT', 'LE', 'GT', 'GE', # Assignment 'EQUALS', 'TIMESEQUAL', 'DIVEQUAL', 'MODEQUAL', 'PLUSEQUAL', 'MINUSEQUAL', 'LSHIFTEQUAL','RSHIFTEQUAL', 'ANDEQUAL', 'XOREQUAL', 'OREQUAL', # Increment/decrement 'PLUSPLUS', 'MINUSMINUS', # Conditional operator (?) 'CONDOP', # Delimeters 'LPAREN', 'RPAREN', # ( ) 'LBRACKET', 'RBRACKET', # [ ] 'LBRACE', 'RBRACE', # { } 'COMMA', 'PERIOD', # . , 'SEMI', 'COLON', # ; : # Ellipsis (...) 'ELLIPSIS', # pre-processor 'PPHASH', # '#' 'PPPRAGMA', # 'pragma' 'PPPRAGMASTR', )
ricoms/mips
compiladorCminus/pycminus/c_lexer.py
c_lexer.py
py
4,426
python
en
code
0
github-code
6
[ { "api_name": "re.compile", "line_number": 43, "usage_type": "call" }, { "api_name": "re.compile", "line_number": 44, "usage_type": "call" }, { "api_name": "ply.lex.lex", "line_number": 53, "usage_type": "call" }, { "api_name": "ply.lex", "line_number": 53, ...
24200680597
from collections import Counter class Solution: def func(self, strings, K): """ Args: strings: list[str] K: int """ counter = Counter(strings) counter_list = [(key, counter[key]) for key in counter] # 频数大, 字母序小 -> 频数小, 字母序大 counter_list.sort(key=lambda x: [-x[1], x]) for i in range(K): print(counter_list[i][0], counter_list[i][1]) counter_list.sort(key=lambda x: [x[1], x]) for i in range(K): print(counter_list[i][0], counter_list[i][1]) if __name__ == "__main__": N, K = list(map(int, input().split())) strings = [] for _ in range(N): strings.append(input()) Solution().func(strings, K)
AiZhanghan/Leetcode
秋招/腾讯/3.py
3.py
py
787
python
en
code
0
github-code
6
[ { "api_name": "collections.Counter", "line_number": 11, "usage_type": "call" } ]
71567683388
import streamlit as st import pandas as pd @st.cache def load_data(): data = pd.read_csv('data.csv', sep=';', encoding='latin1') return data data = load_data() selected_country = st.selectbox("Select a Country", data['Country']) col1, col2 = st.columns(2) with col1: coal_percent = st.slider("Coal %", 0.0, 100.0, 0.0, key="coal_slider") gas_percent = st.slider("Gas %", 0.0, 100.0, 0.0, key="gas_slider") oil_percent = st.slider("Oil %", 0.0, 100.0, 0.0, key="oil_slider") hydro_percent = st.slider("Hydro %", 0.0, 100.0, 0.0, key="hydro_slider") renewable_percent = st.slider("Renewable %", 0.0, 100.0, 0.0, key="renewable_slider") nuclear_percent = st.slider("Nuclear %", 0.0, 100.0, 0.0, key="nuclear_slider") with col2: coal_percent_manual = st.number_input("Coal % (Manual Input)", 0.0, 100.0, 0.0, format="%.2f", key="coal_manual") gas_percent_manual = st.number_input("Gas % (Manual Input)", 0.0, 100.0, 0.0, format="%.2f", key="gas_manual") oil_percent_manual = st.number_input("Oil % (Manual Input)", 0.0, 100.0, 0.0, format="%.2f", key="oil_manual") hydro_percent_manual = st.number_input("Hydro % (Manual Input)", 0.0, 100.0, 0.0, format="%.2f", key="hydro_manual") renewable_percent_manual = st.number_input("Renewable % (Manual Input)", 0.0, 100.0, 0.0, format="%.2f", key="renewable_manual") nuclear_percent_manual = st.number_input("Nuclear % (Manual Input)", 0.0, 100.0, 0.0, format="%.2f", key="nuclear_manual") coal_percent_total = coal_percent_manual if coal_percent_manual else coal_percent gas_percent_total = gas_percent_manual if gas_percent_manual else gas_percent oil_percent_total = oil_percent_manual if oil_percent_manual else oil_percent hydro_percent_total = hydro_percent_manual if hydro_percent_manual else hydro_percent renewable_percent_total = renewable_percent_manual if renewable_percent_manual else renewable_percent nuclear_percent_total = nuclear_percent_manual if nuclear_percent_manual else nuclear_percent Overall_Emission = (coal_percent_total + gas_percent_total + oil_percent_total + hydro_percent_total + renewable_percent_total + nuclear_percent_total) coal_CO2 = data[data['Country'] == selected_country]["Coal"].values[0] gas_CO2 = data[data['Country'] == selected_country]["Gas"].values[0] oil_CO2 = data[data['Country'] == selected_country]["Oil"].values[0] hydro_CO2 = data[data['Country'] == selected_country]["Hydro"].values[0] renewable_CO2 = data[data['Country'] == selected_country]["Renewable"].values[0] nuclear_CO2 = data[data['Country'] == selected_country]["Nuclear"].values[0] kgCO2_result = ((coal_percent_total * coal_CO2 + gas_percent_total * gas_CO2 + oil_percent_total * oil_CO2 + hydro_percent_total * hydro_CO2 + renewable_percent_total * renewable_CO2 + nuclear_percent_total * nuclear_CO2) / 100000) st.markdown("<div class='result-section'>", unsafe_allow_html=True) st.write("Overall Emission %:", Overall_Emission) st.write("CO2 Emissions (tons):", round(kgCO2_result, 2), "tons of CO2") st.markdown("</div>", unsafe_allow_html=True)
sneha-4-22/Energy-Calculator
app.py
app.py
py
3,135
python
en
code
0
github-code
6
[ { "api_name": "pandas.read_csv", "line_number": 7, "usage_type": "call" }, { "api_name": "streamlit.cache", "line_number": 5, "usage_type": "attribute" }, { "api_name": "streamlit.selectbox", "line_number": 13, "usage_type": "call" }, { "api_name": "streamlit.colu...
23202639490
import struct import socket import sys import ipaddress import threading import os class client: """ Responsible for keeping track of the clients information """ def __init__(self, ip_address, ll_address): """ Initialises all variables needed Constructor: __init___(self, ip_address, ll_address) """ self.ip_address = ip_address self.ip_no_mask = ip_address.split("/")[0] self.ll_address = ll_address self.gateway = None self.arpTable = {} #dictionary self.MTU = 1500 self.id_counter = 0 def get_idCounter(self): """ get_idCounter(None) -> (Int) Returns the current packet counter """ return self.id_counter def set_idCounter(self, value): """ set_idCounter(value) sets the packet id counter """ self.id_counter = value def get_ip(self): """ get_ip(None) -> (string) Gets the ip address without CIDR suffix """ return self.ip_no_mask def get_MTU(self): """ get_MTU(None) -> (Int) Returns the Maximum Transmission Unit """ return self.MTU def set_MTU(self, value): """ set_MTU(None) Sets the Maximum Transmission Unit for the network """ self.MTU = value def get_llAddr(self): """ get_llAddr(None) -> (Int) """ return self.ll_address #adds to the arp table def addToArpTable(self, ip_address, ll_address): """ addToArpTable(ip_address, linklayer_address) Adds to ARP Table """ self.arpTable[ip_address] = ll_address def viewArpTable(self): """ viewArpTable(None) Prints all entries within ARP table """ for key, value in self.arpTable.items(): print("Key: ", key, " Value: ", value) def setGateway(self, ipaddress): """ setGateway(ipaddress) Sets the Gateway IP Address """ self.gateway = ipaddress def getGateway(self): """ getGateway(None) -> (String) Returns the Gateway IP address : None if not set """ return self.gateway def hasGateway(self): """ hasGateway(None) -> (Boolean) Checks to see if Gateway has been set Returns True if set else False """ if self.gateway == None: return False else: return True def hasMapping(self, ipaddr): """ hasMapping(ipaddr) -> (Boolean) Checks to see if an IP address has a mapping to a Link Layer Address Returns True if set else False """ if ipaddr in self.arpTable: if self.arpTable.get(ipaddr) != None: return True return False def get_link_layer_addr(self, ipaddress): """ get_link_layer_addr(ipaddress) -> (Int) Returns Link layer address mapped to an IP address """ return self.arpTable.get(ipaddress) def hasArpEntry(self, ipaddress): """ hasArpEntry(ipaddress) -> (Boolean) Checks to see if an IP address has a mapping to a Link Layer Address Returns True if set else False Prints to console if 'No Arp entry found' if ARP table doesnt have a mapping """ if self.arpTable.get(ipaddress) != None: return True else: print("No ARP entry found") return False def get_subnetId(self, CIDR_ipaddress): """ get_subnetId(CIDR_ipaddress) -> (IPv4Interface) Returns Subnet ID """ return ipaddress.ip_interface(CIDR_ipaddress) def same_subnet(self, other_ip_address): """ same_subnet(other_ip_address) -> (Boolean) Compares two IP addresses to see if they are within the same subnet """ return ipaddress.IPv4Address(other_ip_address) >= ipaddress.ip_network(self.ip_address,strict=False).network_address and \ ipaddress.IPv4Address(other_ip_address) <= ipaddress.ip_network(self.ip_address,strict=False).broadcast_address class IPv4_packet: """ Responsible for dealing with the packet creation when sending packets to other clients """ def __init__(self, length, fid, flags, offset, src_ip, dst_ip, payload): """ Initialises all header information Constructor: ___init___(self, length, fid, flags, offset, src_ip, dst_ip, payload) """ self.version = 0b0100 self.header_length = 0b0101 self.type_of_service = 0b00000000 self.total_length = length self.identifier = fid self.flags = flags self.fragment_offset = offset self.time_to_live = 0b00100000 self.protocol = 0b00000000 self.header_checksum = int(format(0b00, '016b')) self.src_address = src_ip self.dest_address = dst_ip self.payload = payload.encode() self.version_hLength_tos = ((self.version << 4) + self.header_length) << 8 + self.type_of_service self.flags_fragoffset = (self.flags << 13) + self.fragment_offset self.ttl_prot = ((self.time_to_live << 8) + self.protocol) self.ip_header = struct.pack('! 6H', self.version_hLength_tos, self.total_length, self.identifier,\ self.flags_fragoffset, self.ttl_prot, self.header_checksum) #print(type(self.ip_header), " - ", type(self.src_address)," - ", type(self.dest_address)," - ", type(self.payload)) self.packet = self.ip_header+self.src_address + self.dest_address + self.payload def getPacket(self): """ getPacket(None) -> (Packet) Returns the packet object """ return self.packet def __bytes__(self): """ __bytes__(None) -> (Bytes) Returns a bytes representation of the packet object """ return self.packet def return_args(string): """ return_args(string) -> <List> separates the arguments and returns them as a list """ args = string.split(' ',maxsplit=2) if len(args) == 3: if args[0]=="msg": return (args[0].strip(),args[1].strip(),args[2],None) #msg ip data elif args[0] == "arp" and args[1] == "set": ip, port = args[2].split(" ") return(args[0].strip(),args[1].strip(), ip.strip(), port.strip()) else: return (args[0].strip(),args[1].strip(), args[2].strip(),None) elif len(args) == 2: return (args[0].strip(" "),args[1].strip(" "),None,None) return (None,None,None,None) def main(): """ Main Function """ arp = client(str(sys.argv[1]),str(sys.argv[2])) s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) s.settimeout(2) port = int(arp.get_llAddr()) s.bind(('LOCALHOST',port)) global terminate terminate = False; thr = threading.Thread(target=receive_data, args=(s,)) thr.start() while True: #sys.stdout.flush() arg1 = arg2 = arg3 = arg4 = "-1" sys.stdout.write("> ") command = input() str(command) arg1,arg2,arg3,arg4 = return_args(command) if str(command) == "gw set " + str(arg3): arp.setGateway(str(arg3)) elif str(command) == "gw get": gway = arp.getGateway() if gway == None: print("None") else: print(gway) elif str(command) == "arp set "+str(arg3)+" "+str(arg4): arp.addToArpTable(str(arg3), int(arg4)) elif str(command) == "arp get "+ str(arg3): ll_add = arp.get_link_layer_addr(str(arg3)) if ll_add != None: print(ll_add) else: print("None") elif str(command) == 'msg '+ str(arg2) +' '+str(arg3): #see if ip is in same gateway dstn_ip = str(arg2) dstn_port = -1 message = str(arg3) if arp.same_subnet(dstn_ip): if arp.hasMapping(dstn_ip): dstn_port = arp.get_link_layer_addr(dstn_ip) send_msg(s,arp,dstn_ip,dstn_port,message[1:-1]) else: print("No ARP entry found") else: #send to gateway #Check if gateway is set if arp.hasGateway(): dstn_port = arp.get_link_layer_addr(arp.getGateway()) send_msg(s,arp,dstn_ip,dstn_port,message[1:-1]) else: print("No gateway found") elif str(command) == "mtu set "+ str(arg3): arp.set_MTU(int(arg3)) elif str(command) == "mtu get": print(arp.get_MTU()) elif str(command) == "exit": terminate = True break sys.stdout.flush() #send message def send_msg(s,arp_details, dest_ip,dest_port, msg): """ send_msg(socket, arp_details, dest_ip, dest_port, msg) Responsible for sending a packet to another client """ source_ip = socket.inet_aton(arp_details.get_ip()) destination_ip = socket.inet_aton(dest_ip) payload_size = arp_details.get_MTU() - 20 #MTU - IP Header if len(msg) <= payload_size: t = IPv4_packet(len(msg) + 20, arp_details.get_idCounter(), 0, 0, source_ip, destination_ip, msg) ipv4_packet = bytes(t) s.sendto(ipv4_packet,('LOCALHOST',dest_port)) else: payload, payload_size = payloads_creator(arp_details, msg) offsets = calc_frag_offsets(payload_size, len(msg)) for i in range(len(payload)): #amount of offsets if i != len(payload) - 1: #length, fid, flags, offset, src_ip, dst_ip, payload packet = IPv4_packet(len(payload[i]) + 20, arp_details.get_idCounter(), 0b001, offsets[i], source_ip, destination_ip, payload[i]) bytes_packet = bytes(packet) s.sendto(bytes_packet,('LOCALHOST',dest_port)) #print("i != offsets length: ", i) else: #print("i == offsets length: ", i) packet = IPv4_packet(len(payload[i]) + 20, arp_details.get_idCounter(), 0b000, offsets[i], source_ip, destination_ip, payload[i]) bytes_packet = bytes(packet) s.sendto(bytes_packet,('LOCALHOST',dest_port)) arp_details.set_idCounter(arp_details.get_idCounter() + 1) return def payloads_creator(arp_details, message): """ payloads_creator(arp_details, message) Handles the creation of the payloads in respect to the Maximum Transmission Unit of the clients network """ payloads = [] count = 0 mtu = arp_details.get_MTU() payload_size = int((mtu - 20)/8) * 8 #divisible by 8 #print("payload size: ",payload_size) #print(len(message)) while count <= len(message): payloads.append(message[count:count + payload_size]) count = count + payload_size #print(len(payloads)) #print("payloads length: ",len(payloads)) #print(payloads) return payloads, payload_size def calc_frag_offsets(max_payload_size, msg_size): """ calc_frag_offests(max_payload_size, msg_size) -> <List> Creates a list of packet offsets for packet fragmentation """ #returns a list of offsets offsets = [] if (msg_size) % (max_payload_size) == 0: # -20 because its only the data offset_amount = (msg_size / max_payload_size) for i in range(int(offset_amount - 1)): offset = (i*(max_payload_size)/8) offsets.append(int(offset)) else: offset_amount = round((msg_size / (max_payload_size)+1)) for i in range(offset_amount): offset = (i*(max_payload_size)/8) offsets.append(int(offset)) return offsets def receive_data(s): """ receive_data(s) Responsible for handling the receiving of data received from other clients """ #print(threading.current_thread().name) packets = {} while True: try: data, addr = s.recvfrom(1500) packets, evaluate_flag = add_packet_to_dict(data, packets) if evaluate_flag == 1: evaluate_packets(packets) packets = {} except OSError as e: if terminate == True: break def add_packet_to_dict(data, packets_dict): """ add_packet_to_dict(data, packets_dict) -> (Dict, Int) Creates a dictionary with all packets / packet fragments received """ eval_flag = 0 pLength, pid, flags_offset, protocol, source_ip = struct.unpack('! 2x 3H x B 2x 4s 4x ', data[:20]) offset = flags_offset & 0x1FFF flags = flags_offset >> 13 protocol = format(int(protocol), '#04x') source_ip = socket.inet_ntoa(bytes(source_ip)) key = source_ip+" " +str(pid) if key in packets_dict: packets_dict[key].append(data) if flags == 0: eval_flag = 1 else: packets_dict[key] = [data] if flags == 0: eval_flag = 1 return packets_dict, eval_flag def evaluate_packets(p_dict): """ evaluate_packets(p_dict) evaluates the packets within the dictionary and outputs the correct message depending on protocol """ for key, value in p_dict.items(): #loop through dict items source_ip = -1 protocol = -1 msg_list =[] msg = "" for v in value: # loop through each value at key pLength, pid, flags_offset, protocol, source_ip = struct.unpack('! 2x 3H x B 2x 4s 4x ', v[:20]) offset = flags_offset & 0x1FFF flags = flags_offset >> 13 source_ip = socket.inet_ntoa(bytes(source_ip)) msg = v[20:].decode() protocol = format(int(protocol), '#04x') msg_list.append(msg) msg = msg.join(msg_list) if protocol == "0x00": print('\b\bMessage received from {}: "{}"'.format(source_ip, msg)) else: print("\b\bMessage received from {} with protocol {}".format(source_ip, protocol)) print("> ", end='', flush=True) return if __name__ == '__main__': main()
TSampey/COMS3200-Assign3
assign3.py
assign3.py
py
12,355
python
en
code
0
github-code
6
[ { "api_name": "ipaddress.ip_interface", "line_number": 151, "usage_type": "call" }, { "api_name": "ipaddress.IPv4Address", "line_number": 159, "usage_type": "call" }, { "api_name": "ipaddress.ip_network", "line_number": 159, "usage_type": "call" }, { "api_name": "...
71353706429
# GMM implementation # good resource http://www.rmki.kfki.hu/~banmi/elte/bishop_em.pdf import numpy as np from scipy import stats import seaborn as sns from random import shuffle, uniform sns.set_style("white") #Generate some data from 2 different distributions x1 = np.linspace(start=-10, stop=10, num=1000) x2 = np.linspace(start=5, stop=10, num=800) y1 = stats.norm.pdf(x1, loc=3, scale=1.5) y2 = stats.norm.pdf(x2, loc=0, scale=3) #Put data in dataframe for better handling x = list(x1) x.extend(list(x2)) shuffle(x) K = 2 #number of assumed distributions within the dataset epsilon = 0.001 #tolerance change for log-likelihood max_iter = 100 #gaussian pdf function def G(datum, mu, sigma): y = (1 / (np.sqrt((2 * np.pi) * sigma * sigma)) * np.exp(datum-mu)*(datum-mu)/(2*sigma*sigma)) return y #compute log-likelihood def L(X, N, mu, sigma, pi): L = 0 for i in range(N): Gk = 0 for k in range(K): Gk += pi[k] * G(X[i], mu[k], sigma[k]) L += Gk print(L) return np.log(L) def estimate_gmm(X, K, epsilon, max_iter): N = len(X) # assign random mean and variance to each distribution mu, sigma = [uniform(0, 10) for _ in range(K)], [uniform(0, 10) for _ in range(K)] # assign random probability to each distribution pi = [uniform(0, 10) for _ in range(K)] mu = [2, 0] sigma = [1, 1] current_loglike = np.inf for _ in range(max_iter): previous_loglike = current_loglike #E step mixture_affiliation_all_k = {} for i in range(N): parts = [pi[k] * G(X[i], mu[k], sigma[k]) for k in range(K)] total = sum(parts) for k in range(K): mixture_affiliation_all_k[(i, k)] = parts[k] / total #M step mixture_affiliation_for_k = [sum(mixture_affiliation_all_k[(i, k)] for i in range(N)) for k in range(K)] for k in range(K): pi[k] = mixture_affiliation_for_k[k] / N mu[k] = sum([mixture_affiliation_all_k[(i, k)] * X[i] for i in range(N)]) / mixture_affiliation_for_k[k] sigma[k] = sum([mixture_affiliation_all_k[(i, k)] * (X[i] - mu[k]) ** 2 for i in range(N)]) / mixture_affiliation_for_k[k] current_loglike = L(X, N, mu, sigma, pi) if abs(previous_loglike - current_loglike) < epsilon: print("break") break return mu, sigma, pi print(estimate_gmm(x, K, epsilon, max_iter))
cristian904/GMMs
GMM.py
GMM.py
py
2,456
python
en
code
0
github-code
6
[ { "api_name": "seaborn.set_style", "line_number": 8, "usage_type": "call" }, { "api_name": "numpy.linspace", "line_number": 11, "usage_type": "call" }, { "api_name": "numpy.linspace", "line_number": 12, "usage_type": "call" }, { "api_name": "scipy.stats.norm.pdf",...
71781170429
import cv2 # read your picture and store into variable "img" img = cv2.imread('picture.jpg') # scale image down 3 times for i in range(3): img = cv2.pyrDown(img) # save scaled image cv2.imwrite(f'picture_scaled_{i}.jpg', img)
yptheangel/opencv-starter-pack
python/basic/image_pyramid.py
image_pyramid.py
py
240
python
en
code
8
github-code
6
[ { "api_name": "cv2.imread", "line_number": 4, "usage_type": "call" }, { "api_name": "cv2.pyrDown", "line_number": 8, "usage_type": "call" }, { "api_name": "cv2.imwrite", "line_number": 11, "usage_type": "call" } ]
38231691013
from django.shortcuts import render, get_object_or_404 from .models import Post, Group def index(request): posts = Post.objects.order_by('-pub_date')[:10] title = 'Это главная страница проекта Yatube' context = { 'posts': posts, 'title': title, } return render(request, 'posts/index.html', context) def group_posts(request, slug): group = get_object_or_404(Group, slug=slug) posts = Post.objects.filter(group=group).order_by('-pub_date')[:10] title = 'Лев Толстой – зеркало русской революции.' context = { 'group': group, 'posts': posts, 'title': title, } return render(request, 'posts/group_list.html', context)
NikitaKorovykovskiy/Yatube_project
yatube/posts/views.py
views.py
py
762
python
en
code
0
github-code
6
[ { "api_name": "models.Post.objects.order_by", "line_number": 6, "usage_type": "call" }, { "api_name": "models.Post.objects", "line_number": 6, "usage_type": "attribute" }, { "api_name": "models.Post", "line_number": 6, "usage_type": "name" }, { "api_name": "django...
5479668707
import argparse import os, numpy as np import os.path as osp from multiprocessing import Process import h5py import json os.environ["D4RL_SUPPRESS_IMPORT_ERROR"] = "1" os.environ["CUDA_DEVICE_ORDER"] = "PCI_BUS_ID" os.environ["MKL_NUM_THREADS"] = "1" os.environ["NUMEXPR_NUM_THREADS"] = "1" os.environ["OMP_NUM_THREADS"] = "1" from maniskill2_learn.env import make_gym_env, ReplayMemory, import_env from maniskill2_learn.utils.data import DictArray, GDict, f64_to_f32 from maniskill2_learn.utils.file import merge_h5_trajectory from maniskill2_learn.utils.meta import get_total_memory, flush_print from maniskill2_learn.utils.math import split_num # from maniskill2_learn.utils.data import compress_f64 def auto_fix_wrong_name(traj): if isinstance(traj, GDict): traj = traj.memory for key in traj: if key in ["action", "reward", "done", "env_level", "next_env_level", "next_env_state", "env_state"]: traj[key + "s"] = traj[key] del traj[key] return traj tmp_folder_in_docker = "/tmp" def render(env): viewer = env.render() def convert_state_representation(keys, args, worker_id, main_process_id): input_dict = { "env_name": args.env_name, "unwrapped": False, "obs_mode": args.obs_mode, "obs_frame": args.obs_frame, "reward_mode": args.reward_mode, "control_mode": args.control_mode, "n_points": args.n_points, "n_goal_points": args.n_goal_points, "camera_cfgs": {}, "render_mode": 'human', } if args.enable_seg: input_dict["camera_cfgs"]["add_segmentation"] = True with open(args.json_name, "r") as f: json_file = json.load(f) env_kwargs = json_file["env_info"]["env_kwargs"] for k in input_dict: env_kwargs.pop(k, None) # update the environment creation args with the extra info from the json file, e.g., cabinet id & target link in OpenCabinetDrawer / Door input_dict.update(env_kwargs) env = make_gym_env(**input_dict) assert hasattr(env, "get_obs"), f"env {env} does not contain get_obs" reset_kwargs = {} for d in json_file["episodes"]: episode_id = d["episode_id"] r_kwargs = d["reset_kwargs"] reset_kwargs[episode_id] = r_kwargs cnt = 0 output_file = osp.join(tmp_folder_in_docker, f"{worker_id}.h5") output_h5 = h5py.File(output_file, "w") input_h5 = h5py.File(args.traj_name, "r") for j, key in enumerate(keys): cur_episode_num = eval(key.split('_')[-1]) trajectory = GDict.from_hdf5(input_h5[key]) trajectory = auto_fix_wrong_name(trajectory) print("Reset kwargs for the current trajectory:", reset_kwargs[cur_episode_num]) env.reset(**reset_kwargs[cur_episode_num]) all_env_states_present = ('env_states' in trajectory.keys()) if all_env_states_present: length = trajectory['env_states'].shape[0] - 1 else: assert 'env_init_state' in trajectory.keys() length = trajectory['actions'].shape[0] assert length == trajectory['actions'].shape[0] == trajectory['success'].shape[0] replay = ReplayMemory(length) next_obs = None for i in range(length): if all_env_states_present: if next_obs is None: env_state = trajectory["env_states"][i] env.set_state(env_state) obs = env.get_obs() else: obs = next_obs _, reward, _, _, _ = env.step(trajectory["actions"][i]) # ^ We cannot directly get rewards when setting env_state. # Instead, reward is only accurate after env.step(); otherwise e.g. grasp criterion will be inaccurate due to zero impulse next_env_state = trajectory["env_states"][i + 1] env.set_state(next_env_state) next_obs = env.get_obs() else: if i == 0: env.set_state(trajectory["env_init_state"]) if next_obs is None: obs = env.get_obs() else: obs = next_obs next_obs, reward, _, _, _ = env.step(trajectory["actions"][i]) item_i = { "obs": obs, "actions": trajectory["actions"][i], "dones": trajectory["success"][i], "episode_dones": False if i < length - 1 else True, "rewards": reward, } if args.with_next: item_i["next_obs"] = next_obs item_i = GDict(item_i).f64_to_f32() replay.push(item_i) if args.render: if args.debug: print("reward", reward) render(env) if worker_id == 0: flush_print(f"Convert Trajectory: completed {cnt + 1} / {len(keys)}; this trajectory has length {length}") group = output_h5.create_group(f"traj_{cnt}") cnt += 1 replay.to_hdf5(group, with_traj_index=False) output_h5.close() input_h5.close() flush_print(f"Finish using {output_file}") def parse_args(): parser = argparse.ArgumentParser(description="Generate visual observations of trajectories given environment states.") # Configurations parser.add_argument("--num-procs", default=1, type=int, help="Number of parallel processes to run") parser.add_argument("--env-name", required=True, help="Environment name, e.g. PickCube-v0") parser.add_argument("--traj-name", required=True, help="Input trajectory path, e.g. pickcube_pd_joint_delta_pos.h5") parser.add_argument("--json-name", required=True, type=str, help=""" Input json path, e.g. pickcube_pd_joint_delta_pos.json | **Json file that contains reset_kwargs is required for properly rendering demonstrations. This is because for environments using more than one assets, asset is different upon each environment reset, and asset info is only contained in the json file, not in the trajectory file. For environments that use a single asset with randomized dimensions, the seed info controls the specific dimension used in a certain trajectory, and this info is only contained in the json file.** """) parser.add_argument("--output-name", required=True, help="Output trajectory path, e.g. pickcube_pd_joint_delta_pos_pcd.h5") parser.add_argument("--max-num-traj", default=-1, type=int, help="Maximum number of trajectories to convert from input file") parser.add_argument("--obs-mode", default="pointcloud", type=str, help="Observation mode") parser.add_argument("--control-mode", default="pd_joint_delta_pos", type=str, help="Environment control Mode") parser.add_argument("--reward-mode", default="dense", type=str, choices=["dense", "sparse"], help="Reward Mode (dense / sparse)") parser.add_argument("--with-next", default=False, action="store_true", help="Add next_obs into the output file (for e.g. SAC+GAIL training)") parser.add_argument("--render", default=False, action="store_true", help="Render the environment while generating demonstrations") parser.add_argument("--debug", default=False, action="store_true", help="Debug print") parser.add_argument("--force", default=False, action="store_true", help="Force-regenerate the output trajectory file") # Extra observation args parser.add_argument("--enable-seg", action='store_true', help="Enable ground truth segmentation") # Specific point cloud generation args parser.add_argument("--n-points", default=1200, type=int, help="If obs_mode == 'pointcloud', the number of points to downsample from the original point cloud") parser.add_argument("--n-goal-points", default=-1, type=int, help="If obs_mode == 'pointcloud' and 'goal_pos' is returned from environment observations (in obs['extra']), \ then randomly sample this number of points near the goal to the returned point cloud. These points serve as helpful visual cue. -1 = disable") parser.add_argument("--obs-frame", default="base", type=str, choices=["base", "world", "ee", "obj"], help="If obs_mode == 'pointcloud', the observation frame (base/world/ee/obj) to transform the point cloud.") args = parser.parse_args() args.traj_name = osp.abspath(args.traj_name) args.output_name = osp.abspath(args.output_name) print(f"Obs mode: {args.obs_mode}; Control mode: {args.control_mode}") if args.obs_mode == 'pointcloud': print(f"Obs frame: {args.obs_frame}; n_points: {args.n_points}; n_goal_points: {args.n_goal_points}") return args def main(): os.makedirs(osp.dirname(args.output_name), exist_ok=True) if osp.exists(args.output_name) and not args.force: print(f"Trajectory generation for {args.env_name} with output path {args.output_name} has been completed!!") return with h5py.File(args.traj_name, "r+") as h5_file: keys = sorted(h5_file.keys()) # remove empty "obs" key from the input h5 file for key in keys: _ = h5_file[key].pop('obs', None) if args.max_num_traj < 0: args.max_num_traj = len(keys) args.max_num_traj = min(len(keys), args.max_num_traj) args.num_procs = min(args.num_procs, args.max_num_traj) keys = keys[: args.max_num_traj] extra_args = () if args.num_procs > 1: running_steps = split_num(len(keys), args.num_procs)[1] flush_print(f"Num of trajs = {len(keys)}", f"Num of process = {args.num_procs}") processes = [] from copy import deepcopy for i, x in enumerate(running_steps): p = Process(target=convert_state_representation, args=( deepcopy(keys[:x]), args, i, os.getpid(), *extra_args)) keys = keys[x:] processes.append(p) p.start() for p in processes: p.join() else: running_steps = [len(keys)] convert_state_representation(keys, args, 0, os.getpid(), *extra_args) files = [] for worker_id in range(len(running_steps)): tmp_h5 = osp.join(tmp_folder_in_docker, f"{worker_id}.h5") files.append(tmp_h5) from shutil import rmtree rmtree(args.output_name, ignore_errors=True) merge_h5_trajectory(files, args.output_name) for file in files: rmtree(file, ignore_errors=True) print(f"Finish merging files to {args.output_name}") if __name__ == "__main__": args = parse_args() main()
haosulab/ManiSkill2-Learn
tools/convert_state.py
convert_state.py
py
10,700
python
en
code
53
github-code
6
[ { "api_name": "os.environ", "line_number": 8, "usage_type": "attribute" }, { "api_name": "os.environ", "line_number": 9, "usage_type": "attribute" }, { "api_name": "os.environ", "line_number": 10, "usage_type": "attribute" }, { "api_name": "os.environ", "line_...
6117949220
from google.cloud import bigquery import os import sys import json import argparse import gzip import configparser import pandas as pd def main(): # Load args args = parse_args() In_config=args.in_config Input_study=args.in_study Configs = configparser.ConfigParser() Configs.read(In_config) client = bigquery.Client() ## LOAD Job: load from GCS to BQ (table_id) # Would it be possible to make this table temporary? Or delete itself automatically after 1 week? Input_sumstats_path=Configs.get("config", "Input_sumstats_GCS") Input_study_URI=Input_sumstats_path+"/"+Input_study+".parquet/*.parquet" temp_BQ_sumstats=Configs.get("config", "Temp_BQ_sumstats") table_id = temp_BQ_sumstats+"."+Input_study print(table_id) load_job_config = bigquery.LoadJobConfig(source_format=bigquery.SourceFormat.PARQUET,) load_job = client.load_table_from_uri( Input_study_URI, table_id, job_config=load_job_config ) # Make an API request. load_job.result() # Waits for the job to complete. destination_table = client.get_table(table_id) # Make an API request. print("Loaded {} rows.".format(destination_table.num_rows)) # Query Job table_id = Configs.get("config", "Temp_BQ_sumstats")+"."+Input_study rsID_table = Configs.get("config", "RSID_BQ_sumstats")+"."+Input_study query_job_config = bigquery.QueryJobConfig(destination=rsID_table) query = """ WITH SNP_info AS ( SELECT CONCAT(CAST(chrom AS string), CAST(pos AS string), CAST(ref AS string), CAST(alt AS string)) AS identifier, ref, alt, n_total, pval, eaf, beta FROM `{0}` ) SELECT rs_id AS RSID, ref AS A1, alt AS A2, n_total AS N, pval AS P, eaf AS EAF, beta AS BETA FROM SNP_info JOIN ( SELECT CONCAT(CAST(chr_id AS string), CAST(position AS string), CAST(ref_allele AS string), CAST(alt_allele AS string)) AS identifier, rs_id FROM `open-targets-genetics.210608.variants` ) variants USING(identifier) """.format(table_id) query_job = client.query(query, job_config=query_job_config) query_job.result() # Extract Job rsID_GCS_bucket=Configs.get("config", "Formatted_sumstats_GCS") rsID_GCS_URI=rsID_GCS_bucket+"/{0}.txt.gz".format(Input_study) extract_job_config = bigquery.ExtractJobConfig() extract_job_config.field_delimiter = '\t' extract_job_config.compression='GZIP' extract_job = client.extract_table( rsID_table, rsID_GCS_URI, # Location must match that of the source table. location="EU", job_config=extract_job_config ) # API request extract_job.result() # Waits for job to complete. print( "Exported {} to {}".format(rsID_table, rsID_GCS_URI) ) def parse_args(): ''' Load command line args ''' parser = argparse.ArgumentParser() parser.add_argument('--in_config', metavar="<str>", type=str, required=True) parser.add_argument('--in_study', metavar="<str>", type=str, required=True, help=("Study ID of input sumstats")) args = parser.parse_args() return args if __name__ == '__main__': main()
xyg123/SNP_enrich_preprocess
scripts/LDSC_format_single_sumstat.py
LDSC_format_single_sumstat.py
py
3,343
python
en
code
1
github-code
6
[ { "api_name": "configparser.ConfigParser", "line_number": 17, "usage_type": "call" }, { "api_name": "google.cloud.bigquery.Client", "line_number": 20, "usage_type": "call" }, { "api_name": "google.cloud.bigquery", "line_number": 20, "usage_type": "name" }, { "api_...
8257233523
# Use the environment variables DIANA_BROKER and DIANA_RESULT to attach the celery # app to a message queue. import os from celery import Celery app = Celery('diana') app.conf.update( result_expires = 3600, task_serializer = "pickle", accept_content = ["pickle"], result_serializer = "pickle", task_default_queue = 'default', task_routes={'*.gpu': {'queue': 'gpu'}, # Only GPU boxes '*.file': {'queue': 'file'} }, # Access to shared fs include=['diana.star.tasks'], broker_url=os.environ.get('DIANA_BROKER', "redis://localhost:6379/1"), result_backend=os.environ.get('DIANA_RESULT', "redis://localhost:6379/2"), timezone = 'America/New_York' ) print(os.environ.get('DIANA_BROKER', "redis://localhost:6379/1"))
derekmerck/DIANA
packages/diana/diana/star/app.py
app.py
py
776
python
en
code
11
github-code
6
[ { "api_name": "celery.Celery", "line_number": 7, "usage_type": "call" }, { "api_name": "os.environ.get", "line_number": 18, "usage_type": "call" }, { "api_name": "os.environ", "line_number": 18, "usage_type": "attribute" }, { "api_name": "os.environ.get", "lin...
3337645854
import time from pyspark import SparkContext,SparkConf #----------------------------------------------- #spark map reduce练习 def mymap(line): return len(line) #在spark中这样对数字进行叠加是不可行对 由于闭包机制,每一份机器上都单独有一份所引用都对象 应该使用saprk提供都累加器 nums_all=0 def test_foreach(nums): global nums_all nums_all+=nums print(nums_all) if __name__ == '__main__': conf = SparkConf().setAppName('test').setMaster('local') sc = SparkContext(conf=conf) text_rdd=sc.textFile('./data/*.txt') map_rdd=text_rdd.map(mymap) #count=map_rdd.foreach(test_foreach) # new_text_rdd=text_rdd.flatMap(lambda x:(x,'hahaha','xxxx')) new_rdd=text_rdd.map(lambda line:line.split('\t')) print(new_rdd.first()) time.sleep(10000) # for i in map_rdd.take(5): # print(i) #rdd2 = sc.textFile('./data/sequence_file', ) # 读取一个目录下的文件 已文件名、内容的形式返回 #print(rdd2.first().encode('utf-8').decode())
zml1996/learn_record
learn_spark/test_spark2.py
test_spark2.py
py
1,066
python
fa
code
2
github-code
6
[ { "api_name": "pyspark.SparkConf", "line_number": 21, "usage_type": "call" }, { "api_name": "pyspark.SparkContext", "line_number": 22, "usage_type": "call" }, { "api_name": "time.sleep", "line_number": 30, "usage_type": "call" } ]
25145650810
import pytest import datetime import pytz from mixer.backend.django import mixer from telegram_message_api.helpers import ( ParsedData, ParseText, CategoryData, ) @pytest.mark.parametrize( 'text', [ '150 test', '150 test 150', '150', ] ) def test_parsetext_dataclass(text): """Testing a ParseText parse text method""" result = ParseText(text)() if result: assert result.amount == '150' assert result.expense == 'test' else: assert result == None def test_categorydata_dataclass(db): """Testing a CategoryData""" category = mixer.blend('core.category') result = CategoryData( expense_text='150 test', category=category )() tz = pytz.timezone("Europe/Moscow") now = datetime.datetime.now(tz).strftime("%Y-%m-%d %H:%M:%S") assert result == { 'amount': '150', 'created': now, 'category': category, 'expense_text': '150 test', }
enamsaraev/telegram_bot_api
telegram_message_api/tests/test_helpers.py
test_helpers.py
py
1,071
python
en
code
0
github-code
6
[ { "api_name": "telegram_message_api.helpers.ParseText", "line_number": 22, "usage_type": "call" }, { "api_name": "pytest.mark.parametrize", "line_number": 12, "usage_type": "call" }, { "api_name": "pytest.mark", "line_number": 12, "usage_type": "attribute" }, { "a...
3982882771
from time import time import sys, argparse, heightfield, os, povray_writer, load_info, read_lidar, cameraUtils, calculate_tile #/media/pablo/280F8D1D0A5B8545/TFG_files/cliente_local/ #/media/pablo/280F8D1D0A5B8545/TFG_files/strummerTFIU.github.io/ def tiles_to_render(c1, c2, zoom): """ Return the tiles needed to render the scene and the limit coordinates. Normal test >>> tiles_to_render((700000, 4600000), (702000, 4602000), 8) ((130, 122), (131, 123), (699452.3984375, 4600406.1953125), (704062.296875, 4595796.296875)) Over limit test >>> tiles_to_render((700000, 4600000), (2702000, 4602000), 8) ('null', 'null', 'null', 'null') """ # Calculate tiles tile1_x, tile1_y = calculate_tile.calculate_tile(c1[0], c1[1], zoom) tile2_x, tile2_y = calculate_tile.calculate_tile(c2[0], c2[1], zoom) if tile1_x == 'null' or tile1_y == 'null' or tile2_x == 'null' or tile2_y == 'null': return ('null', 'null', 'null', 'null') w_tiles = tile2_x - tile1_x + 1 h_tiles = tile2_y - tile1_y + 1 if w_tiles != h_tiles: tile_max = max(w_tiles, h_tiles) w_tiles = tile_max h_tiles = tile_max tile2_x = tile1_x + w_tiles - 1 tile2_y = tile1_y + h_tiles - 1 # Calculate new coordinates c_nw = calculate_tile.calculate_coordinates(tile1_x, tile1_y, zoom) c_se = calculate_tile.calculate_coordinates(tile2_x + 1, tile2_y + 1, zoom) if c_nw == 'null' or c_se == 'null': return('null', 'null', 'null', 'null') return ((tile1_x, tile1_y), (tile2_x, tile2_y), c_nw, c_se) def dir_view_tile(tile, dir_view, zoom): """ Transform north tile number to specified POV tile number. >>> dir_view_tile((222, 111), 'E', 9) (111, 289) """ if dir_view == 'S': return calculate_tile.tile_to_south(tile, zoom) elif dir_view == 'E': return calculate_tile.tile_to_east(tile, zoom) elif dir_view == 'W': return calculate_tile.tile_to_west(tile, zoom) else: return tile def render(tile1, tile2, c1, c2, dir_view, angle, result, lidar): """ Generate the POV-Ray file which represents the scene passed as parameters. """ # Apply a offset off_c1_0 = 0 off_c1_1 = 0 off_c2_0 = 0 off_c2_1 = 0 if dir_view == 'N': off_c1_1 = 500 off_c2_1 = -2500 elif dir_view == 'S': off_c1_1 = 2500 off_c2_1 = -500 elif dir_view == 'E': off_c1_0 = -2500 off_c2_0 = 500 else: off_c1_0 = -500 off_c2_0 = 2500 # Find mdts and ortophotos and write heighfields info mdt_list = load_info.find_mdt(c1[0] + off_c1_0, c1[1] + off_c1_1, c2[0] + off_c2_0, c2[1] + off_c2_1) if len(mdt_list) == 0: return ('null', 'null', 'null') orto_list = load_info.find_orto(c1[0] + off_c1_0, c1[1] + off_c1_1, c2[0] + off_c2_0, c2[1] + off_c2_1, mdt_list) areas_list = load_info.find_a_interest(c1[0], c1[1], c2[0], c2[1]) lidar_list = load_info.find_lidar(areas_list, c1, c2) if len(orto_list) <= 10: if lidar == True: spheres = read_lidar.generate_spheres(lidar_list, areas_list, c1, c2) else: spheres = "" # Create camera, heighfields and spheres cam = cameraUtils.calculate_camera(c1, c2, angle, dir_view) heightfields = povray_writer.write_heightfields(mdt_list, orto_list) # Generate a string which contain the heightfields to pov file. # Generate povray file tile_size_x = 256 tile_size_y = int(256 / cam.get_aspectRatio() + 0.5) povray_writer.write_povray_file(cam, heightfields, spheres) w_tiles = tile2[0] - tile1[0] + 1 h_tiles = tile2[1] - tile1[1] + 1 w = tile_size_x * w_tiles h = tile_size_y * h_tiles # Rendering using new povray file print("Rendering " + result) os.system('povray +Irender.pov +O' + result + ' -D +A -GA +W' + str(w) + ' +H' + str(h) + '> /dev/null 2>&1') return (tile_size_x, tile_size_y, w_tiles) else: print("Error: The zone to render must be smaller (orto_list > 10). Try with other coordinates.") def tessellation(result, tile1, tile_size_x, tile_size_y, w_tiles, zoom, dir_view, angle, dist_tile): """ Create tiles for a few zooms and give them a number. """ if dist_tile[-1] != "/": dist_tile += "/" print("Creating tiles from [" + str(tile1[0]) + ", " + str(tile1[1]) + "]...") os.system("mkdir " + dist_tile + angle + '> /dev/null 2>&1') os.system("mkdir " + dist_tile + angle + "/" + dir_view + '> /dev/null 2>&1') os.system("mkdir " + dist_tile + angle + "/" + dir_view + "/" + str(zoom) + '> /dev/null 2>&1') os.system("convert " + result + " -crop " + str(tile_size_x) + "x" + str(tile_size_y) + " -set filename:tile \"%[fx:page.x/" + str(tile_size_x) + "+" + str(tile1[0]) + "]_%[fx:page.y/" + str(tile_size_y) + "+" + str(tile1[1]) + "]\" +adjoin \"" + dist_tile + angle + "/" + dir_view + "/" + str(zoom) + "/map_%[filename:tile].png\"") count = int(zoom) - 8 aux_zoom = int(zoom) - 1 aux1_x = int(tile1[0] / 2) aux1_y = int(tile1[1] / 2) while(count > 0): # -1 zoom lvl w_tiles = w_tiles / 2 w = tile_size_x * w_tiles h = tile_size_y * w_tiles os.system("mkdir " + dist_tile + angle + "/" + dir_view + "/" + str(aux_zoom) + '> /dev/null 2>&1') os.system("convert " + result + " -resize " + str(w) + "x" + str(h) + " " + result) os.system("convert " + result + " -crop " + str(tile_size_x) + "x" + str(tile_size_y) + " -set filename:tile \"%[fx:page.x/" + str(tile_size_x) + "+" + str(aux1_x) + "]_%[fx:page.y/" + str(tile_size_y) + "+" + str(aux1_y) + "]\" +adjoin \"" + dist_tile + angle + "/" + dir_view + "/" + str(aux_zoom) + "/map_%[filename:tile].png\"") count -= 1 aux_zoom -= 1 aux1_x = aux1_x / 2 aux1_y = aux1_y / 2 os.system("rm " + result) def main(): # Arguments parser = argparse.ArgumentParser(description="First version of Pablo's TFG.") parser.add_argument("mdt_directory", help="Directory of the MDT files to transform.") parser.add_argument("png_directory", help="PNG files transformed destination directory.") parser.add_argument("orto_directory", help="Ortophotos files directory.") parser.add_argument("lidar_directory", help="Directory of LAZ files.") parser.add_argument("dir_view", help="Direction of the view (only N, S, E or W).") parser.add_argument("angle", help="Angle of the view (only 45 or 30).") parser.add_argument("zoom", help="Zoom.") parser.add_argument("--max_height", dest="max_height", type=int, default=2200, metavar="MAX_HEIGHT", help="Max height transforming MDT files. Higher heights will be considered MAX_HEIGHT " + "(default value = 2200)") parser.add_argument("--renderAll", help="Render all available zones.", action="store_true") parser.add_argument("--renderTiles", help="Render especified tiles.", action="store_true") parser.add_argument("--transform", help="Transform all mdt in mdt_directory from .asc to .png.", action="store_true") parser.add_argument("--load", help="Load info from mdts, pnoas and lidar files.", action="store_true") parser.add_argument("--tile", help="Tessellation result/s.", action="store_true") parser.add_argument("--deletePov", help="Delete povray file.", action="store_true") parser.add_argument("--lidar", help="Activate LiDAR render.", action="store_true") args = parser.parse_args() if (args.angle == "30") or (args.angle == "45"): if (args.dir_view == 'S') or (args.dir_view == 'N') or (args.dir_view == 'W') or (args.dir_view == 'E'): t_exe_i = time() if args.mdt_directory[-1] != "/": args.mdt_directory += "/" if args.png_directory[-1] != "/": args.png_directory += "/" if args.orto_directory[-1] != "/": args.orto_directory += "/" if args.lidar_directory[-1] != "/": args.lidar_directory += "/" # Transform to heightfield if args.transform: os.system('mkdir ' + args.png_directory) for base, dirs, files in os.walk(args.mdt_directory): for asc_file in files: heightfield.transform_file_to_heightfield(args.mdt_directory + asc_file, args.png_directory + asc_file[:-4] + ".png", args.max_height) # Load info data to file if args.load: load_info.load_info(args.png_directory, args.orto_directory, args.lidar_directory) if args.tile: dist_tile = input("Introduce tiles destination directory: ") else: os.system("mkdir result_dir") dist_tile = "./result_dir/" minX = 560000 maxX = 789000 minY = 4410000 maxY = 4745000 if args.renderTiles: tile_init = input("Introduce tile number (x y) for upper left vertex: ").split() tile_init = (int(tile_init[0]), int(tile_init[1])) if tile_init[0] >= 0 and tile_init[0] <= (2 ** int(args.zoom) - 1) and tile_init[1] >= 0 or tile_init[1] <= (2 ** int(args.zoom) - 1): tile_end = input("Introduce tile number (x,y) for bottom right vertex: ").split() tile_end = (int(tile_end[0]), int(tile_end[1])) if tile_end[0] >= 0 and tile_end[0] <= (2 ** int(args.zoom) - 1) and tile_end[1] >= 0 or tile_end[1] <= (2 ** int(args.zoom) - 1 and tile_end[0] >= tile_init[0] and tile_end[1] >= tile_init[1]): result = "./result.png" if args.dir_view == 'S': tile_1 = calculate_tile.tile_from_south(tile_end, int(args.zoom)) tile_2 = calculate_tile.tile_from_south(tile_init, int(args.zoom)) elif args.dir_view == 'E': tile_1_aux = calculate_tile.tile_from_east(tile_init, int(args.zoom)) tile_2_aux = calculate_tile.tile_from_east(tile_end, int(args.zoom)) tile_1 = (tile_2_aux[0], tile_1_aux[1]) tile_2 = (tile_1_aux[0], tile_2_aux[1]) elif args.dir_view == 'W': tile_1_aux = calculate_tile.tile_from_west(tile_init, int(args.zoom)) tile_2_aux = calculate_tile.tile_from_west(tile_end, int(args.zoom)) tile_1 = (tile_1_aux[0], tile_2_aux[1]) tile_2 = (tile_2_aux[0], tile_1_aux[1]) else: tile_1 = tile_init tile_2 = tile_end tile_1 = [x - 1 if x % 2 != 0 else x for x in tile_1] tile_2 = [x - 1 if x % 2 == 0 else x for x in tile_2] tile1_x = tile_1[0] tile1_y = tile_1[1] tile2_x = tile_2[0] tile2_y = tile_2[1] n_tiles = 2 ** (int(args.zoom) - 8) print([tile1_x, tile1_y]) print([tile2_x, tile2_y]) while tile1_x % n_tiles != 0: tile1_x -= 1 while tile1_y % n_tiles != 0: tile1_y -= 1 while tile2_x % n_tiles == 0 and n_tiles != 1: tile2_x -= 1 while tile2_x % n_tiles == 0 and n_tiles != 1: tile2_x -= 1 print([tile1_x, tile1_y]) print([tile2_x, tile2_y]) x_number = 0 while(tile1_x + x_number <= tile2_x): aux1_x = tile1_x + x_number y_number = 0 while(tile1_y + y_number <= tile2_y): aux1_y = tile1_y + y_number c_nw = calculate_tile.calculate_coordinates(aux1_x, aux1_y, int(args.zoom)) c_se = calculate_tile.calculate_coordinates(aux1_x + n_tiles, aux1_y + n_tiles, int(args.zoom)) if c_nw == 'null' or c_se == 'null': print("ERROR: Wrong tiles.") else: print("Rendering from tile [" + str(aux1_x) + ", " + str(aux1_y) + "] to [" + str(aux1_x + n_tiles - 1) + "," + str(aux1_y + n_tiles -1) + "] with coordinates from [" + str(c_nw[0]) + ", " + str(c_nw[1]) + "] to [" + str(c_se[0]) + ", " + str(c_se[1]) + "].") tile_size_x, tile_size_y, w_tiles = render((aux1_x, aux1_y), (aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), c_nw, c_se, args.dir_view, args.angle, result, args.lidar) if tile_size_x == 'null' and tile_size_y == 'null': print("ERROR: Nothing to render. Continuing...") else: if args.dir_view == 'S': tile_init = calculate_tile.tile_to_south((aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), int(args.zoom)) elif args.dir_view == 'E': tile1_aux = calculate_tile.tile_to_east((aux1_x, aux1_y), int(args.zoom)) tile2_aux = calculate_tile.tile_to_east((aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), int(args.zoom)) tile_init = (tile1_aux[0], tile2_aux[1]) elif args.dir_view == 'W': tile1_aux = calculate_tile.tile_to_west((aux1_x, aux1_y), int(args.zoom)) tile2_aux = calculate_tile.tile_to_west((aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), int(args.zoom)) tile_init = (tile2_aux[0], tile1_aux[1]) else: tile_init = (aux1_x, aux1_y) tessellation(result, tile_init, tile_size_x, tile_size_y, w_tiles, args.zoom, args.dir_view, args.angle, dist_tile) y_number += n_tiles x_number += n_tiles else: print("ERROR: Introduce tiles correctly.") else: print("ERROR: Introduce tiles correctly.") else: if args.renderAll: if int(args.zoom) > 7 and int(args.zoom) < 13: iTile_z5_x = 9 iTile_z5_y = 8 fTile_z5_x = 26 fTile_z5_y = 25 tile1_x = iTile_z5_x * (2 ** (int(args.zoom) - 5)) tile1_y = iTile_z5_y * (2 ** (int(args.zoom) - 5)) tile2_x = fTile_z5_x * (2 ** (int(args.zoom) - 5)) tile2_y = fTile_z5_y * (2 ** (int(args.zoom) - 5)) #tile1_x = 672 result = "./result.png" n_tiles = 2 ** (int(args.zoom) - 8) x_number = 0 while(tile1_x + x_number <= tile2_x): aux1_x = tile1_x + x_number y_number = 0 while(tile1_y + y_number <= tile2_y): aux1_y = tile1_y + y_number c_nw = calculate_tile.calculate_coordinates(aux1_x, aux1_y, int(args.zoom)) c_se = calculate_tile.calculate_coordinates(aux1_x + n_tiles, aux1_y + n_tiles, int(args.zoom)) if c_nw == 'null' or c_se == 'null': print("ERROR: Wrong tiles.") else: print("Rendering from tile [" + str(aux1_x) + ", " + str(aux1_y) + "] to [" + str(aux1_x + n_tiles - 1) + "," + str(aux1_y + n_tiles -1) + "] with coordinates from [" + str(c_nw[0]) + ", " + str(c_nw[1]) + "] to [" + str(c_se[0]) + ", " + str(c_se[1]) + "].") tile_size_x, tile_size_y, w_tiles = render((aux1_x, aux1_y), (aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), c_nw, c_se, args.dir_view, args.angle, result, args.lidar) if tile_size_x == 'null' and tile_size_y == 'null': print("ERROR: Nothing to render. Continuing...") else: if args.dir_view == 'S': tile_init = calculate_tile.tile_to_south((aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), int(args.zoom)) elif args.dir_view == 'E': tile1_aux = calculate_tile.tile_to_east((aux1_x, aux1_y), int(args.zoom)) tile2_aux = calculate_tile.tile_to_east((aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), int(args.zoom)) tile_init = (tile1_aux[0], tile2_aux[1]) elif args.dir_view == 'W': tile1_aux = calculate_tile.tile_to_west((aux1_x, aux1_y), int(args.zoom)) tile2_aux = calculate_tile.tile_to_west((aux1_x + n_tiles - 1, aux1_y + n_tiles - 1), int(args.zoom)) tile_init = (tile2_aux[0], tile1_aux[1]) else: tile_init = (aux1_x, aux1_y) tessellation(result, tile_init, tile_size_x, tile_size_y, w_tiles, args.zoom, args.dir_view, args.angle, dist_tile) y_number += n_tiles x_number += n_tiles else: print("ERROR: zoom for --renderAll option must be 7 < z < 13.") else: # Ask for coordinates coordinates = input("Introduce UTM X and Y coordinates, separated by a blank space and respecting the values min " + "and max for the coordinates, for upper left vertex (" + str(minX) + " <= X1 <= " + str(maxX) + " " + str(minY) + " <= Y1 <= " + str(maxY) + "): ") coordinates1 = coordinates.split() if (len(coordinates1) == 2 and float(coordinates1[0]) >= minX and float(coordinates1[0]) <= maxX and float(coordinates1[1]) >= minY and float(coordinates1[1]) <= maxY): coordinates = input("Introduce UTM X and Y coordinates, separated by a blank space and respecting the values min " + "and max for the coordinates, for bottom right vertex (" + coordinates1[0] + " <= X2 <= " + str(maxX) + " " + str(minY) + " <= Y2 <= " + coordinates1[1] + "): ") coordinates2 = coordinates.split() if (len(coordinates2) == 2 and float(coordinates2[0]) >= minX and float(coordinates2[0]) <= maxX and float(coordinates2[1]) >= minY and float(coordinates2[1]) <= maxY and coordinates1[0] < coordinates2[0] and coordinates1[1] > coordinates2[1]): # Offset to adjust later during join process coordinates1[0] = float(coordinates1[0]) coordinates2[0] = float(coordinates2[0]) coordinates1[1] = float(coordinates1[1]) coordinates2[1] = float(coordinates2[1]) result = "./result.png" tile1, tile2, c_nw, c_se = tiles_to_render(coordinates1, coordinates2, int(args.zoom)) if tile_1 == 'null': print("ERROR: Introduce UTM coordinates correctly.") else: if args.dir_view == 'S': tile_init = calculate_tile.tile_to_south(tile2, int(args.zoom)) elif args.dir_view == 'E': tile1_aux = calculate_tile.tile_to_east(tile1, int(args.zoom)) tile2_aux = calculate_tile.tile_to_east(tile2, int(args.zoom)) tile_init = (tile1_aux[0], tile2_aux[1]) elif args.dir_view == 'W': tile1_aux = calculate_tile.tile_to_west(tile1, int(args.zoom)) tile2_aux = calculate_tile.tile_to_west(tile2, int(args.zoom)) tile_init = (tile2_aux[0], tile1_aux[1]) else: tile_init = tile1 tile_size_x, tile_size_y, w_tiles = render(tile1, tile2, c_nw, c_se, args.dir_view, args.angle, result, args.lidar) tessellation(result, tile_init, tile_size_x, tile_size_y, w_tiles, args.zoom, args.dir_view, args.angle, dist_tile) print("DONE!") else: print("ERROR: Introduce UTM coordinates correctly.") else: print("ERROR: Introduce UTM coordinates correctly.") if args.deletePov: os.system('rm render.pov') t_exe_f = time() t_exe = t_exe_f - t_exe_i print("Execution time: " + str(int(t_exe / 60)) + "min " + str(int(t_exe % 60)) + "s.") else: print("ERROR: dir_view must be N, S, W or E.") else: print("ERROR: angle must be 45 or 30.") if __name__ == "__main__": main()
strummerTFIU/TFG-IsometricMaps
src/main_program.py
main_program.py
py
18,332
python
en
code
0
github-code
6
[ { "api_name": "calculate_tile.calculate_tile", "line_number": 22, "usage_type": "call" }, { "api_name": "calculate_tile.calculate_tile", "line_number": 23, "usage_type": "call" }, { "api_name": "calculate_tile.calculate_coordinates", "line_number": 41, "usage_type": "call...
37056080424
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """Simple univariate BLUP implementation for starting values estimation.""" import numpy as np from scipy.optimize import minimize def grad(sigmas: np.ndarray, y: np.ndarray, k: np.ndarray): v = 1 / (sigmas[0] + sigmas[1] * k) if np.any(v < 1e-12): return [np.nan, np.nan] yt = y * v g = np.zeros(2) g[0] = np.sum(yt ** 2) - np.sum(np.log(v)) g[1] = np.sum(yt * k * y) - np.sum(np.log(v ** 2 * k)) return g def obj(sigmas: np.ndarray, y: np.ndarray, k: np.ndarray): v = 1 / (sigmas[0] + sigmas[1] * k) if np.any(v < 1e-8): return np.nan yt = y * v return np.sum(yt * y) - np.sum(np.log(v)) def blup(y: np.ndarray, k: np.ndarray, p=0.8, maxiter=50): """ Calculate BLUP estimate for U of a single variable. Parameters ---------- y : np.ndarray Observations of a given variable. k : np.ndarray K matrix. p : float, optional Expected ratio of variable variance to random effect variance. Used for starting values only. The default is 0.8. maxiter : int, optional Maximal number of iterations. Better not be too high or estimation process could take noticable time in some cases. The default is 50. Returns ------- U Random effects estimate (BLUP). """ v = np.var(y) x0 = np.array([p * v, (1 - p) * v]) s = minimize(lambda x: obj(x, y, k), x0, jac=lambda x: grad(x, y, k), method="SLSQP", options={'maxiter': maxiter}, bounds=([0, None], [0, None]) ).x v = 1 / (1 / s[0] + (1 / s[1]) * (1 / k)) return y * v / s[0], s
planplus/pysem
pysem/univariate_blup.py
univariate_blup.py
py
1,705
python
en
code
4
github-code
6
[ { "api_name": "numpy.ndarray", "line_number": 8, "usage_type": "attribute" }, { "api_name": "numpy.any", "line_number": 10, "usage_type": "call" }, { "api_name": "numpy.nan", "line_number": 11, "usage_type": "attribute" }, { "api_name": "numpy.zeros", "line_nu...
71666200828
from django.contrib import admin from .models import newdoc class DocAdmin(admin.ModelAdmin): fieldsets = [ (None, {"fields": ["title"]}), ("Date information", {"fields": ["created_time"]}), (None, {"fields": ["modified_time"]}), ("Author information", {"fields": ["author"]}), (None, {"fields": ["body"]}) ] list_filter = ["created_time"] list_display = ('title', 'created_time', 'author') search_fields = ["title"] #class uploaded(admin.ModelAdmin): # Register models here. admin.site.register(newdoc, DocAdmin)
JarvisDong/Project-CGD
mysite/documents/admin.py
admin.py
py
652
python
en
code
0
github-code
6
[ { "api_name": "django.contrib.admin.ModelAdmin", "line_number": 4, "usage_type": "attribute" }, { "api_name": "django.contrib.admin", "line_number": 4, "usage_type": "name" }, { "api_name": "django.contrib.admin.site.register", "line_number": 20, "usage_type": "call" },...
72060297789
from flask import render_template, Flask, request, jsonify, url_for, redirect import requests from flask_pymongo import PyMongo import json from Model import * import time def after_request(response): response.headers['Access-Control-Allow-Origin'] = '*' response.headers['Access-Control-Allow-Methods'] = 'PUT,GET,POST,DELETE' response.headers['Access-Control-Allow-Headers'] = 'Content-Type,Authorization' return response global Username global token token = "" app = Flask(__name__) app.after_request(after_request) app.config['MONGO_URI'] = 'mongodb://comp9900:z12345@ds161529.mlab.com:61529/comp9900_2019' mongo = PyMongo(app) @app.route('/',methods=['GET', 'POST']) def home_page(): return render_template("test.html"), 200 @app.route('/user',methods=['GET']) def personalpage(): return render_template("Personalinfo.html"), 200 @app.route('/signout', methods=['POST']) def signout(): global token global Username token = '' Username = '' return "ok" @app.route('/login', methods=['GET']) def login_check(): global token if token == '': return '0' else: return Username @app.route('/login', methods=['POST']) def login(): global token global Username global Password Username = request.form["sign_in_account"] Password = request.form["sign_in_password"] url = "http://127.0.0.1:5000/anhao0522/client/v1/login?username={Username}&password={Password}".format(Username=Username,Password=Password) response = requests.get(url, headers={"Accept": "application/json"}) data = response.json() print(data) print(Username) if data['reply'] == "NU": return "No_account" elif data['reply'] == "NM": return "Wrong_password" else: token = data['reply'] return "ok" @app.route('/signup',methods=['GET', 'POST']) def signup(): if request.method == 'POST': Username = request.form["account"] Password1 = request.form["password_1"] dict1 = {"customer_id": Username, "password": Password1, "first_name": "", "last_name": "", "address": "", "email": "", "birthday": "", "credit": 0, "contact_number": "", "gender": "", "account_type": False, "host_order": [], "trip_order": [], "properties": [], "new_message": [], "message_box": []} url = "http://127.0.0.1:5000/anhao0522/client/v1/signup" response = requests.post(url, headers={"Accept": "application/json"}, json=dict1) if response.status_code == 400: return "Account name exist" else: return "ok" else: pass @app.route('/event', methods=['POST']) def get_event(): location = request.form["location"] yelp = Yelp() result = yelp.search_events(location)["events"] #result = yelp.search_restaurant("gym","kingsford")["businesses"] return jsonify(result) @app.route('/order_delete', methods=['POST']) def order_delete(): global Username global token order_id = request.form["order_id"] request_type = request.form["request_type"] if request_type == '0': url = f"http://127.0.0.1:5000/anhao0522/client/v1/user/{Username}/order" url +=f"?order_id={order_id}" response = requests.delete(url, headers={"auth_token": token}) elif request_type == '1': url = f"http://127.0.0.1:5000/anhao0522/client/v1/landlord/{Username}/order" url += f"?order_id={order_id}&cancel_order=false" response = requests.delete(url, headers={"auth_token": token}) elif request_type == '2': url = f"http://127.0.0.1:5000/anhao0522/client/v1/landlord/{Username}/order" url += f"?order_id={order_id}&cancel_order=true" response = requests.delete(url, headers={"auth_token": token}) if response.status_code == 401: print("401") return "timeout" elif response.status_code == 200: return "ok" else: return "Something wrong" @app.route('/new_message_read', methods=['POST']) def new_message_read(): global Username global token delete_new = request.form["delete_new"] url = "http://127.0.0.1:5000/anhao0522/client/v1/messageBox" body = {"mid": f"{Username}", "time": "", "text": delete_new} response = requests.post(url, headers={"auth_token": token}, json=body) if response.status_code == 401: print("401") return "timeout" elif response.status_code == 200: return "ok" else: return "Something wrong" @app.route('/new_message', methods=['POST']) def new_message(): global Username global token url = "http://127.0.0.1:5000/anhao0522/client/v1/messageBox" send_to = request.form["send_to"] message = request.form["message"] message_time = request.form["message_time"] body = {"mid":f"{Username}---{send_to}","time":message_time,"text":message} response = requests.post(url, headers={"auth_token": token}, json=body) if response.status_code == 401: print("401") return "timeout" elif response.status_code == 200: return "ok" else: return "Something wrong" @app.route('/new_comment', methods=['POST']) def new_comment(): global Username global token comment_pid = request.form["comment_pid"] comment_text = request.form["comment_text"] rating_num = request.form["rating_num"] comment_oid = request.form["comment_oid"] time = request.form["time"] url = f"http://127.0.0.1:5000/anhao0522/client/v1/accommodation/room/{comment_pid}/comment?order_id={comment_oid}" body = { "commenter": Username, "avg_mark": rating_num, "cleanliness_mark": 0, "facility_mark": 0, "attitude_mark": 0, "text": comment_text, "reply": "", "photo": [], "date": time } response = requests.post(url, headers={"auth_token": token}, json=body) if response.status_code == 401: print("401") return "timeout" elif response.status_code == 201: return "ok" else: return "Something wrong" @app.route('/message_del', methods=['GET']) def message_del(): AB = request.args["AB"] print(AB) url = f"http://127.0.0.1:5000/anhao0522/client/v1/messageBox?AB={AB}" response = requests.delete(url, headers={"auth_token": token}) if response.status_code == 401: print("401") return "wrong" elif response.status_code == 200: return "ok" else: return "Something wrong" @app.route('/personalinfo', methods=['GET']) def personalinfo(): global Username global token url = "http://127.0.0.1:5000/anhao0522/client/v1/user/" sign_in_account = request.args["sign_in_account"] url = url + sign_in_account print(url) print(sign_in_account) response = requests.get(url, headers={"auth_token": token}) print(response.json()) return jsonify(response.json()) @app.route('/chatbot_msg', methods=['POST']) def chatbot_msg(): global Username global token message = request.form["message"] url = "http://127.0.0.1:5000/anhao0522/client/v1/chatbot?" url+=f"q={message}" response = requests.post(url, headers={"auth_token": token}) return jsonify(response.json()) @app.route('/s/<location>/all') def show_list(location): if request.method == 'POST': destination = location num_persons = request.args["numpeople"] arrive_date = request.args["checkin"] departure_date = request.args["checkout"] if destination != None and num_persons != None and arrive_date != None and departure_date != None: url = "http://127.0.0.1:5000/anhao0522/client/v1/accommodation/all?" \ "location={location}&checkin={checkin}&checkout={checkout}&numberofpeople={num}&searchtype={type}".format() pass @app.route('/<id>/property_post') def picture(id): global Username global token if id != Username: return redirect(url_for('home_page')) return render_template('NewProperty.html', id=id) @app.route('/<id>/post_done',methods=['GET','POST']) def post_property(id): global Username global token if id != Username: return redirect(url_for('home_page')) if request.method == 'POST': #print(request.form) #print(request.values.get('Pet')) tmp_dic = {} tmp_dic.setdefault('property_type',request.values['property_type']) tmp_dic.setdefault('property_bedroom', request.values['property_bedroom']) tmp_dic.setdefault('property_bathroom', request.values['property_bathroom']) tmp_dic.setdefault('property_parking', request.values['property_parking']) tmp_dic.setdefault('property_wifi', request.values['WIFI']) tmp_dic.setdefault('property_air', request.values['Air_condition']) tmp_dic.setdefault('property_cook', request.values['Cooking']) tmp_dic.setdefault('property_pet', request.values['Pet']) property_location = request.form['property_location'].lower() property_suburb = request.form['property_suburb'].lower() property_address = request.form['property_address'] property_size = request.form['property_size'] property_price = request.form['property_price'] property_max_people = request.form['property_max_people'] property_start = request.form['start_date'] property_end = request.form['end_date'] property_title = request.form['property_title'] property_description = request.form['property_description'] for key in tmp_dic: if tmp_dic[key] == "YES": tmp_dic[key] = True elif tmp_dic[key] == "NO": tmp_dic[key] = False else: continue #print(tmp_dic) photo_id = [] if 'upload' in request.files: for file in request.files.getlist("upload"): #print("file ", file, type(file), file.filename) mongo.save_file(file.filename, file) num_photo = str(int(time.time())) photo_id.append(num_photo) mongo.db.test.insert_one({'id': num_photo, 'photo_name': file.filename}) #for i in range(len(request.files.getlist('upload'))): # photo = request.files.getlist('upload') # print(photo.filename) #mongo.save_file(photo.filename, photo) #num_photo = str(int(time.time())) #mongo.db.test.insert_one({'id': num_photo, 'photo_name': photo.filename}) #id = 'Cindy' lis_db = list(mongo.db.property_collection.find()) t_id = lis_db[-1]['property_id'] #print(t_id) url = "https://maps.google.com/maps/api/geocode/json?key=AIzaSyAANyBQ6ikIoa53iMdahFL99Bjt0oBmWpc&address={address}&sensor=false".format( address=property_address) data = requests.request("GET", url) ddic_1 = data.json()['results'][0]['geometry']['location'] lng = ddic_1['lng'] lat = ddic_1['lat'] ava_time = get_date_list(property_start,property_end) ava_time_l = [] for i in ava_time: ava_time_dic = {} ava_time_dic.setdefault('time',i) ava_time_dic.setdefault('status',True) ava_time_l.append(ava_time_dic) post_data_dic = {} post_data_dic.setdefault('customer_id',id) post_data_dic.setdefault('property_id',t_id+1) post_data_dic.setdefault('address',property_address) post_data_dic.setdefault('longitude',float(lng)) post_data_dic.setdefault('latitude',float(lat)) post_data_dic.setdefault('price', float(property_price)) post_data_dic.setdefault('type',tmp_dic['property_type']) post_data_dic.setdefault('size',float(property_size)) post_data_dic.setdefault('wifi', tmp_dic['property_wifi']) post_data_dic.setdefault('air-condition',tmp_dic['property_air']) post_data_dic.setdefault('cooking', tmp_dic['property_cook']) post_data_dic.setdefault('pet',tmp_dic['property_pet']) post_data_dic.setdefault('bed_room',int(tmp_dic['property_bedroom'])) post_data_dic.setdefault('bath_room',int(tmp_dic['property_bathroom'])) post_data_dic.setdefault('parking',int(tmp_dic['property_parking'])) post_data_dic.setdefault('location',property_location) post_data_dic.setdefault('suburb',property_suburb) post_data_dic.setdefault('maxium_people',int(property_max_people)) post_data_dic.setdefault('about_the_place',property_description) post_data_dic.setdefault('title',property_title) post_data_dic.setdefault('rating',0.0) post_data_dic.setdefault('comments',[]) post_data_dic.setdefault('p_photo',photo_id) post_data_dic.setdefault('discount',0.0) post_data_dic.setdefault('available_time',ava_time_l) url1 = "http://127.0.0.1:5000/anhao0522/client/v1/landlord/{customer_id}/properties".format(customer_id=id) #print(token) response = requests.post(url1,json=post_data_dic,headers={"auth_token": token}) #print(response) return redirect(url_for('home_page')) @app.route('/location_center', methods=['POST']) def get_center(): if request.method == 'POST': location_str = request.form['location_list'] print(location_str) location_list = location_str.split(":") print(location_list) location_list_2 = [] for e in location_list: location_list_2.append([float(e.split("/")[0]), float(e.split("/")[1])]) print(location_list_2) reslut = center_geolocation(location_list_2) return jsonify({"result": reslut}) @app.route('/file/<file_id>') def file(file_id): data = mongo.db.test.find_one_or_404({'id': file_id}) filename = data['photo_name'] return mongo.send_file(filename) if __name__ == '__main__': app.run(port=5200, debug=True)
xiechzh/Accomodation-Web-Portal
COMP9900_Proj/COMP9900_Proj.py
COMP9900_Proj.py
py
13,953
python
en
code
1
github-code
6
[ { "api_name": "flask.Flask", "line_number": 21, "usage_type": "call" }, { "api_name": "flask_pymongo.PyMongo", "line_number": 24, "usage_type": "call" }, { "api_name": "flask.render_template", "line_number": 29, "usage_type": "call" }, { "api_name": "flask.render_...
22095502736
from django.urls import path from user import views urlpatterns = [ path('fun',views.fun), path('fun1',views.fun1), path('u',views.us, name='uuu'), path('user',views.user, name='aaaa'), ]
anshifmhd/demo
user/urls.py
urls.py
py
205
python
en
code
0
github-code
6
[ { "api_name": "django.urls.path", "line_number": 6, "usage_type": "call" }, { "api_name": "user.views.fun", "line_number": 6, "usage_type": "attribute" }, { "api_name": "user.views", "line_number": 6, "usage_type": "name" }, { "api_name": "django.urls.path", "...
10699368918
# -*- coding:utf-8 -*- import cv2 import os from glob import glob import numpy as np import shutil '''处理原图片得到人物脸部图片并按比例分配train和test用于训练模型''' SRC = "Raw" # 待处理的文件路径 DST = "data2" # 处理后的文件路径 TRAIN_PER = 5 # train的图片比例 TEST_PER = 1 # test的图片比例 def rename_file(path, new_name="", start_num=0, file_type=""): if not os.path.exists(path): return count = start_num files = os.listdir(path) for file in files: old_path = os.path.join(path, file) if os.path.isfile(old_path): if file_type == "": file_type = os.path.splitext(old_path)[1] new_path = os.path.join(path, new_name + str(count) + file_type) if not os.path.exists(new_path): os.rename(old_path, new_path) count = count + 1 # print("Renamed %d file(s)" % (count - start_num)) def get_faces(src, dst, cascade_file="lbpcascade_animeface.xml"): if not os.path.isfile(cascade_file): raise RuntimeError("%s: not found" % cascade_file) # Create classifier cascade = cv2.CascadeClassifier(cascade_file) files = [y for x in os.walk(src) for y in glob(os.path.join(x[0], '*.*'))] # 妙啊,一句话得到一个文件夹中所有文件 for image_file in files: image_file = image_file.replace('\\', '/') # 解决Windows下的文件路径问题 target_path = "/".join(image_file.strip("/").split('/')[1:-1]) target_path = os.path.join(dst, target_path) + "/" if not os.path.exists(target_path): os.makedirs(target_path) count = len(os.listdir(target_path)) + 1 image = cv2.imdecode(np.fromfile(image_file, dtype=np.uint8), -1) # 解决中文路径读入图片问题 gray = cv2.cvtColor(image, cv2.COLOR_BGR2GRAY) gray = cv2.equalizeHist(gray) faces = cascade.detectMultiScale(gray, # detector options scaleFactor=1.05, # 指定每个图像缩放比例缩小图像大小的参数 minNeighbors=4, # 此参数将影响检测到的面孔。值越高,检测结果越少,但质量越高 minSize=(24, 24) # 最小对象大小。小于此值的对象将被忽略 ) for (x, y, w, h) in faces: crop_img = image[y:y + h, x:x + w] crop_img = cv2.resize(crop_img, (96, 96)) # 重置为96*96 # filename = os.path.basename(image_file).split('.')[0] cv2.imencode('.jpg', crop_img)[1].tofile(os.path.join(target_path, str(count) + ".jpg")) print("All images are cropped") def divide_train_test(src, train_percentage=5, test_percentage=1): if not os.path.exists(src): print("folder %s is not exist" % src) return dirs = os.listdir(src) test_dir = os.path.join(src, "test") train_dir = os.path.join(src, "train") if not os.path.exists(test_dir): os.mkdir(test_dir) if not os.path.exists(train_dir): os.mkdir(train_dir) for dir_name in dirs: if dir_name != "test" and dir_name != "train": current_dir = os.path.join(src, dir_name) test_dir = os.path.join(src, "test", dir_name) train_dir = os.path.join(src, "train", dir_name) if not os.path.exists(test_dir): os.mkdir(test_dir) if not os.path.exists(train_dir): os.mkdir(train_dir) if os.path.isdir(current_dir): images = os.listdir(current_dir) image_num = len(images) for image in images: filename = os.path.basename(image).split('.')[0] if filename.isdigit(): percentage = train_percentage + test_percentage test_num = (image_num / percentage) * test_percentage + 1 if int(filename) <= test_num: if not os.path.exists(os.path.join(test_dir, image)): shutil.move(os.path.join(current_dir, image), os.path.join(test_dir)) else: os.remove(os.path.join(current_dir, image)) else: if not os.path.exists(os.path.join(train_dir, image)): shutil.move(os.path.join(current_dir, image), os.path.join(train_dir)) else: os.remove(os.path.join(current_dir, image)) shutil.rmtree(current_dir) for dirs in os.listdir(src): for name in os.listdir(os.path.join(src, dirs)): if os.path.isdir(os.path.join(src, dirs, name)): rename_file(os.path.join(src, dirs, name)) print("Set all cropped images to train and test") def main(): get_faces(SRC, DST) divide_train_test(src=DST, train_percentage=TRAIN_PER, test_percentage=TEST_PER) if __name__ == '__main__': main()
mikufanliu/AnimeCharacterRecognition
get_faces.py
get_faces.py
py
5,231
python
en
code
4
github-code
6
[ { "api_name": "os.path.exists", "line_number": 17, "usage_type": "call" }, { "api_name": "os.path", "line_number": 17, "usage_type": "attribute" }, { "api_name": "os.listdir", "line_number": 20, "usage_type": "call" }, { "api_name": "os.path.join", "line_numbe...
7161765994
from typing import List class Solution: def calculate(self, nums, k, max_len, s, nums_len): if nums[s:] == []: print("max_len=",max_len) return max_len else: i = 0 temp = k ans = [] temp_nums = nums[s:] print("nums=", temp_nums) while i != len(temp_nums): if temp == 0 and temp_nums[i] == 0: break else: print("*=", temp_nums[i]) if temp_nums[i] == 1: ans.append(temp_nums[i]) elif temp_nums[i] == 0: temp = temp - 1 ans.append(1) i += 1 print("###########################") max_len = max(max_len, len(ans)) print("max=",max_len) s = s + 1 print("s=",s) self.calculate(nums, k, max_len, s, nums_len) def longestOnes(self, nums: List[int], k: int) -> int: max_len = 0 max_len = self.calculate(nums, k, max_len, 0, len(nums)) # print(max_len) obj = Solution() obj.longestOnes([1,1,1,0,0,0,1,1,1,1,0],2) obj.longestOnes([0,0,1,1,0,0,1,1,1,0,1,1,0,0,0,1,1,1,1],3)
CompetitiveCodingLeetcode/LeetcodeEasy
JuneLeetcodeChallenge/MaxConsecutiveOnesIII.py
MaxConsecutiveOnesIII.py
py
1,280
python
en
code
0
github-code
6
[ { "api_name": "typing.List", "line_number": 33, "usage_type": "name" } ]
18609666305
#!/usr/bin/env python # -*- coding: UTF-8 -*- from waveapi import events from waveapi import model from waveapi import robot from pyactiveresource.activeresource import ActiveResource import logging import settings CC_XMPP = 'cc:xmpp' CC_TWITTER = 'cc:twitter' logger = logging.getLogger('GAE_Robot') logger.setLevel(logging.INFO) class Notification(ActiveResource): _site = settings.MPUB_SITE ### Webhooks start def OnParticipantsChanged(properties, context): """Invoked when any participants have been added/removed.""" added = properties['participantsAdded'] for p in added: if p != settings.ROBOT_NICK+'@appspot.com': Notify(context, "Hi, " + p) def OnRobotAdded(properties, context): """Invoked when the robot has been added.""" root_wavelet = context.GetRootWavelet() root_wavelet.CreateBlip().GetDocument().SetText("Connected to XMPP...") def OnBlipSubmitted(properties, context): """Invoked when new blip submitted.""" blip = context.GetBlipById(properties['blipId']) doc = blip.GetDocument() creator = blip.GetCreator() text = doc.GetText() try: if creator in settings.ADMINS and text != '' and text !='cc:xmpp' and text !='cc:twitter': if CC_XMPP in text: text = text.replace('cc:xmpp','') note = Notification({'escalation':10, 'body':text, 'recipients':{'recipient':[{'position':1,'channel':'gchat','address':settings.MPUB_XMPP}]}}) note.save() if CC_TWITTER in text: text = text.replace('cc:twitter','') note = Notification({'escalation':10, 'body':text, 'recipients':{'recipient':[{'position':1,'channel':'twitter','address':settings.MPUB_TWITTER}]}}) note.save() except: logger.debug(context, 'Submit failed. (blip=%s)' % properties['blipId']) pass ### Webhooks end def Notify(context, message): root_wavelet = context.GetRootWavelet() root_wavelet.CreateBlip().GetDocument().SetText(message) if __name__ == '__main__': myRobot = robot.Robot(settings.ROBOT_NICK, image_url='http://%s.appspot.com/assets/bot.png' % settings.ROBOT_NICK, version='1', profile_url='http://%s.appspot.com/' % settings.ROBOT_NICK) myRobot.RegisterHandler(events.WAVELET_PARTICIPANTS_CHANGED, OnParticipantsChanged) myRobot.RegisterHandler(events.WAVELET_SELF_ADDED, OnRobotAdded) myRobot.RegisterHandler(events.BLIP_SUBMITTED, OnBlipSubmitted) myRobot.Run(debug=settings.DEBUG)
zh/gae-robot
gaerobot.py
gaerobot.py
py
2,435
python
en
code
4
github-code
6
[ { "api_name": "logging.getLogger", "line_number": 16, "usage_type": "call" }, { "api_name": "logging.INFO", "line_number": 17, "usage_type": "attribute" }, { "api_name": "pyactiveresource.activeresource.ActiveResource", "line_number": 19, "usage_type": "name" }, { ...
21812044102
import pytest from src.error import InputError from src.auth import auth_register_v2 from src.user import user_profile_v2 from src.other import clear_v1 @pytest.fixture def register_user(): clear_v1() user = auth_register_v2("johnsmith@gmail.com", "123456", "john", "smith") token = user['token'] id = user['auth_user_id'] return token, id def test_valid_input(register_user): token, id = register_user res = user_profile_v2(token, id) assert res['user']['u_id'] == id assert res['user']['email'] == 'johnsmith@gmail.com' assert res['user']['name_first'] == 'john' assert res['user']['name_last'] == 'smith' assert res['user']['handle_str'] == 'johnsmith' def test_invalid_uid(register_user): token, id = register_user id += 1 with pytest.raises(InputError): user_profile_v2(token, id)
TanitPan/comp1531_UNSW_Dreams
tests/user_profile_test.py
user_profile_test.py
py
857
python
en
code
0
github-code
6
[ { "api_name": "src.other.clear_v1", "line_number": 9, "usage_type": "call" }, { "api_name": "src.auth.auth_register_v2", "line_number": 10, "usage_type": "call" }, { "api_name": "pytest.fixture", "line_number": 7, "usage_type": "attribute" }, { "api_name": "src.us...
23950521358
#!/usr/bin/python3 import argparse from iCEburn.libiceblink import ICE40Board def rtype(x): return ('R', int(x, 16)) def wtype(x): return ('W', [int(i,16) for i in x.split(':')]) def main(): ap = argparse.ArgumentParser() ap.add_argument("-r", "--read", dest='actions', type=rtype, action='append') ap.add_argument("-w", "--write", dest='actions', type=wtype, action='append') args = ap.parse_args() board = ICE40Board() with board.get_board_comm() as comm: for atype, arg in args.actions: if atype == 'R': addr = arg print("READ %02x: %02x" % (addr, comm.readReg(addr))) elif atype == 'W': addr, value = arg print("WRITE %02x: %02x" % (addr, value)) comm.writeReg(addr, value) if __name__ == "__main__": main()
davidcarne/iceBurn
iCEburn/regtool.py
regtool.py
py
868
python
en
code
32
github-code
6
[ { "api_name": "argparse.ArgumentParser", "line_number": 13, "usage_type": "call" }, { "api_name": "iCEburn.libiceblink.ICE40Board", "line_number": 18, "usage_type": "call" } ]
14720838146
import torch import torch.nn as nn from collections import OrderedDict from networks.reshape import Reshape class ImageEncoder(nn.Module): def __init__(self, input_channels, layers_channels, prefix, useMaxPool=False, addFlatten=False): ''' If useMaxPool is set to True, Max pooling is used to reduce the image dims instead of stride = 2. ''' super(ImageEncoder, self).__init__() layers = OrderedDict() pr_ch = input_channels stride = 1 if useMaxPool else 2 for i in range(len(layers_channels)): layers[prefix + '_conv' + str(i)] = nn.Conv2d(in_channels=pr_ch, out_channels=layers_channels[i], kernel_size=3, stride=stride, padding=1) layers[prefix + '_relu' + str(i)] = nn.ReLU() if (useMaxPool): layers[prefix + '_maxpool' + str(i)] = nn.MaxPool2d(2, stride=2) pr_ch = layers_channels[i] if addFlatten: layers[prefix + '_flat'] = nn.Flatten() self.net = nn.Sequential(layers) def forward(self, data): return self.net(data) class ImageEncoderFlatInput(ImageEncoder): def __init__(self, input_channels, layers_channels, prefix, useMaxPool=False, addFlatten=False): super(ImageEncoderFlatInput, self).__init__(input_channels, layers_channels, prefix, useMaxPool, addFlatten) self.reshapeInput = Reshape(-1, input_channels, 32, 32) def forward(self, data): return self.net(self.reshapeInput(data))
PradeepKadubandi/DemoPlanner
networks/imageencoder.py
imageencoder.py
py
1,593
python
en
code
0
github-code
6
[ { "api_name": "torch.nn.Module", "line_number": 6, "usage_type": "attribute" }, { "api_name": "torch.nn", "line_number": 6, "usage_type": "name" }, { "api_name": "collections.OrderedDict", "line_number": 14, "usage_type": "call" }, { "api_name": "torch.nn.Conv2d",...
18020255074
import random,argparse,sys parser = argparse.ArgumentParser() import numpy as np class PlannerEncoder: def __init__(self, opponent, p,q) -> None: self.p = p; self.q = q self.idx_to_states = {} self.opp_action_probs = {} with open(opponent,'r') as file: i = 0 for line in file: parts = line.split() if parts[0] == 'state': continue if len(parts[0]) == 7: self.idx_to_states[i] = parts[0] self.opp_action_probs[parts[0]] = [float(parts[1]), float(parts[2]), float(parts[3]), float(parts[4])] i+=1 self.idx_to_states[i] = 'lost' # both of these are terminal states self.idx_to_states[i+1] = 'goal' self.states_to_idx = {} for i in self.idx_to_states: self.states_to_idx[self.idx_to_states[i]] = i self.S = len(self.idx_to_states) self.A = 10 # Next step is to calculate probs based on different situations def player_pos(self, player, action): new = None if action ==0: new = player -1 if (new-1)//4 == (player-1)//4 and new > 0 and new < 17: player = new elif action == 1: new = player +1 if (new-1)//4 == (player-1)//4 and new > 0 and new < 17: player = new elif action ==2: new = player - 4 if new > 0 and new < 17: player = new elif action ==3: new = player + 4 if new > 0 and new < 17: player = new return player def state_after_action(self, curr_state, a): b1_int = int(curr_state[:2]) b2_int = int(curr_state[2:4]) r_int = int(curr_state[4:6]) ball_int = int(curr_state[-1]) if a <4: b1_int = self.player_pos(b1_int, a) elif a < 8: b2_int = self.player_pos(b2_int, a - 4) elif a == 8: if ball_int ==1: ball_int = 2 elif ball_int ==2: ball_int = 1 elif a == 9: return 'goal' b1_str = str(b1_int) ; b2_str = str(b2_int) r_str = str(r_int) ball_str = str(ball_int) if len(b1_str)==1: b1_str = '0' + b1_str if len(b2_str)==1: b2_str = '0' + b2_str if len(r_str)==1: r_str = '0' + r_str new_state = b1_str + b2_str + r_str + ball_str return new_state def cordinates(self, state): b1 = int(state[:2]); b2 = int(state[2:4]); r = int(state[-3:-1]) b1_cor = ( (b1 -1)//4 , (b1-1)%4 ) b2_cor = ( (b2 -1)//4 , (b2-1)%4 ) r_cor = ( (r -1)//4 , (r-1)%4 ) return [b1_cor, b2_cor, r_cor] def transition_function(self, current_s, next_s, action): ball_pos = int(current_s[-1]) if action <4: if ball_pos == 1: b1_old = current_s[:2] ; r_old = current_s[-3:-1] b1_new = next_s[:2] ; r_new = next_s[-3:-1] if b1_new == r_new: return (0.5 - self.p, 0.5 + self.p) elif b1_old == r_new and b1_new == r_old: return (0.5 - self.p, 0.5 + self.p) else: return (1- self.p, self.p) elif ball_pos == 2: return (1- self.p, self.p) elif action <8: if ball_pos == 1: return (1-self.p, self.p) elif ball_pos == 2: b2_old = current_s[2:4] ; r_old = current_s[-3:-1] b2_new = next_s[2:4] ; r_new = next_s[-3:-1] if b2_new == r_new: return (0.5 - self.p, 0.5 + self.p) elif b2_old == r_new and b2_new == r_old: return (0.5 - self.p, 0.5 + self.p) else: return (1- self.p, self.p) if action ==8: b1_cor, b2_cor, r_cor = self.cordinates(next_s) val = self.q - 0.1*max( abs(b1_cor[0] - b2_cor[0]), abs(b1_cor[1] - b2_cor[1])) if b1_cor[0] == r_cor[0] and b2_cor[0] == r_cor[0]: return (0.5*val, 1 - 0.5*val) elif b1_cor == r_cor or b2_cor == r_cor: return (0.5*val, 1 - 0.5*val) elif ((b1_cor[1]- r_cor[1])/(b1_cor[0] - r_cor[0] + 1e-3)) == ((r_cor[1] - b2_cor[1])/(r_cor[0]- b2_cor[0] + 1e-3)): return (0.5*val, 1 - 0.5*val) else: return (val, 1- val) if action ==9: b1_cor, b2_cor, r_cor = self.cordinates(next_s) ball_pos = int(current_s[-1]) if ball_pos ==1: val = self.q - 0.2*(3 - b1_cor[1]) # NOTE my x,y are reverse to the one used in the assgn description # I use like the matrix 0,1 axis if r_cor[0]>0 and r_cor[0]<3 and r_cor[1]>1: return (0.5*val, 1- 0.5*val) else: return( val, 1-val) elif ball_pos ==2: val = self.q - 0.2*(3 - b2_cor[1]) # NOTE if r_cor[0]>0 and r_cor[0]<3 and r_cor[1]>1: return (0.5*val, 1- 0.5*val) else: return( val, 1-val) def calculate_trans_probs(self): self.trans_probs = np.zeros((self.S, self.A, self.S)) for s in range(self.S - 2): # we don't start from lost and goal state current_s = self.idx_to_states[s] for a in range(self.A): if a <9: new_state = self.state_after_action(current_s, a) if new_state != current_s: r_int = int(current_s[-3:-1]) for i, prob_opp in enumerate(self.opp_action_probs[current_s]): # now for the current_s you will get a reaction from the opponent if prob_opp !=0: r_str = str(self.player_pos(r_int, i)) # 'i' would give the action for R if len(r_str)==1: r_str = '0' + r_str # NOTE: I hope the prob's are zero when the R is at the edge next_s = new_state[:4] + r_str + new_state[-1] # Now let's call a helper function to give prob. # It looks if there is tackling or intergecting etc... # it's inputs would be current_s and next_s and the action taking place. prob_s, prob_f = self.transition_function(current_s, next_s, a) self.trans_probs[self.states_to_idx[current_s], a, self.states_to_idx[next_s]] = prob_opp*prob_s self.trans_probs[self.states_to_idx[current_s], a, self.states_to_idx['lost']] = prob_opp*prob_f else: self.trans_probs[self.states_to_idx[current_s], a, self.states_to_idx['lost']] = 1 # regardless of what R does if you take a non feasible action then lossing is 1 elif a ==9: # this has to be separate because state_after_action function gives 'goal' for this so u can't slice like before. new_state = current_s[:] for i, prob_opp in enumerate(self.opp_action_probs[current_s]): if prob_opp != 0: r_int = int(current_s[-3:-1]) r_str = str(self.player_pos(r_int, i)) # 'i' would give the action for R if len(r_str)==1: r_str = '0' + r_str # NOTE: I hope the prob's are zero when the R is at the edge next_s = new_state[:4] + r_str + new_state[-1] prob_s, prob_f = self.transition_function(current_s, next_s, a) self.trans_probs[self.states_to_idx[current_s], a, self.states_to_idx['goal']] = prob_opp*prob_s self.trans_probs[self.states_to_idx[current_s], a, self.states_to_idx['lost']] = prob_opp*prob_f self.rewards = np.zeros((self.S, self.A, self.S)) self.rewards[:,:,8192] = -1 self.rewards[:,:,8193] = 1 def save_transition_probabilities_and_rewards(self, filename): self.calculate_trans_probs() trans_probs = self.trans_probs rewards = self.rewards num_states, num_actions, _ = trans_probs.shape with open(filename, 'w') as file: file.write(f"numStates {num_states}\n") file.write(f"numActions {num_actions}\n") file.write("end 8192 8193\n") for s in range(num_states - 2): # Exclude terminal states 'lost' and 'goal' for a in range(num_actions): for s_prime in range(num_states): prob = trans_probs[s, a, s_prime] reward = rewards[s, a, s_prime] if prob != 0 or reward != 0: file.write(f"transition {s} {a} {s_prime} {prob} {reward}\n") file.write("mdptype episodic\n") file.write("discount 0.9\n") # Example usage: if __name__ == "__main__": parser.add_argument("--opponent",type=str,default='./data/football/test-1.txt') parser.add_argument("--p", type=float) parser.add_argument("--q", type=float) args = parser.parse_args() if not (args.p <=1.0 and args.p >=0.0): print("p is a probability, should be btw 0,1") sys.exit(0) if not (args.q<=1.0 and args.q >=0.0): print("q is a probability, should be btw 0,1") sys.exit(0) enco = PlannerEncoder(args.opponent, args.p, args.q) enco.save_transition_probabilities_and_rewards('t-2.txt')
kiluazen/ReinforcementLearning
Policy Iteration/encoder.py
encoder.py
py
10,197
python
en
code
0
github-code
6
[ { "api_name": "argparse.ArgumentParser", "line_number": 2, "usage_type": "call" }, { "api_name": "numpy.zeros", "line_number": 138, "usage_type": "call" }, { "api_name": "numpy.zeros", "line_number": 174, "usage_type": "call" }, { "api_name": "sys.exit", "line...
7886651161
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Created on Thu Nov 18 21:42:00 2021 @author: fyy """ import scipy.stats as stats import numpy as np import random import scipy.io as scio import matplotlib.pyplot as plt import math dataFile = './_dat/val_dataset.mat' ratio = 0.05 sample_num = 100 # 训练样本的大小 max_len = 250 min_len = 180 max_kn = 4 min_kn = 0 s_length = 200 def stable(maxLen,priValue): priSeq = np.ones(maxLen)*priValue return priSeq def jitter(maxLen,priValue,priDev): maxDevValue = priValue*priDev lowerBound = priValue-maxDevValue upperBound = priValue+maxDevValue priSeq = np.random.randint(lowerBound,upperBound+1,maxLen)#lower<=x<upper params = [priValue,priDev,maxDevValue] return priSeq #周期 def periodic(maxLen,priValue,ratio): amp=priValue*ratio; #正弦幅度 freq=50; #正弦频率 sample = random.randint(2*freq,8*freq) #正弦采样率 fsample=400#正弦采样率 priDSSeq = np.zeros(maxLen) for i in range(maxLen): priDSSeq[i] = amp*math.sin(freq*i/fsample)+priValue#正弦PRI序列 #priDSSeq = priDSSeq[:maxLen] #截断 para = [priValue,ratio,sample] return priDSSeq #滑变 def sliding(maxLen,priValue,ratio): priMax=priValue*ratio #pri最大值 pulseNum=random.randint(ratio,32) #pri点数 slidingStep=(priMax-priValue)/pulseNum; #滑变步长 slidingSeq = np.zeros(pulseNum+1) for i in range(pulseNum+1): #一个周期的滑变PRI序列 slidingSeq[i] = i*slidingStep + priValue seqLen=len(slidingSeq); cycleNum=math.ceil(maxLen/seqLen)#向上取整周期数 priDSSeq = np.tile(slidingSeq, cycleNum)#重复若干个周期 priDSSeq = priDSSeq[:maxLen] #截断 para = [priValue,ratio,priMax,pulseNum,slidingStep] return priDSSeq ''' import numpy as np a = np.array([[1, 2, 0, 3, 0],        [4, 5, 0, 6, 0],        [7, 8, 0, 9, 0]])   idx = np.argwhere(np.all(a[..., :] == 0, axis=0)) a2 = np.delete(a, idx, axis=1) ''' #参差 3-10 def stagger(maxLen,priValue,priNum): seqLen=priNum #一个周期的脉组中脉冲数目 cycleNum=math.ceil(maxLen/seqLen) #周期数 priSeq = priValue priSSeq=np.tile(priSeq,cycleNum)#重复若干周期 priSSeq=priSSeq[:maxLen]#截断 para = [priValue,priNum,cycleNum] return priSSeq def gen_func(m,maxLen): if m==1: return stable(maxLen) elif m==2: return jitter(maxLen) elif m==3: return periodic(maxLen) elif m==4: return sliding(maxLen) elif m==5: return stagger(maxLen) else: print("****error!****") def solve(nums, x, y) : if nums == []: return False if x>y: (x,y) = (y,x) for i in range(len(nums)): if x<= nums[i] <= y: return True else: continue return False def pri2toa(inputseq): #mask = np.logical_not(inputseq) mask = inputseq!=0 inputseq = inputseq[mask] toa = np.zeros(len(inputseq)+1) i = 0 while(i<len(inputseq)): toa[i+1] = toa[i]+inputseq[i] i = i+1 return toa max_len = 250 def lostPul(inputseq,proportion,label,pattern):#缺失脉冲 # inputseq: 输入TOA序列 # proportion: 缺失百分比 # seqTOA: 缺失的TOA序列 # seqPRI: 缺失的PRI序列 lostPulseSeq=pri2toa(inputseq) #每个proportion下面的缺失脉冲TOA序列 lengthWorkModeSample=len(lostPulseSeq) rand_num = math.floor(lengthWorkModeSample*proportion) randomIndex=np.random.randint(0,lengthWorkModeSample,rand_num)#lower<=x<upper randomIndex = sorted(randomIndex) j=0 mask = label!=0 label = label[mask] lostlabel = label*1 #单纯a = b 只是浅复制将a指向b p = pattern*1 for i in range(len(randomIndex)): while(j<len(label) and randomIndex[i]>=label[j]): j = j+1 lostlabel[j:] = lostlabel[j:] - 1 lostPulseSeq=[i for num,i in enumerate(lostPulseSeq) if num not in randomIndex] p =[i for num,i in enumerate(p) if num not in randomIndex] p = np.array(p) for i in range(len(randomIndex)): p[randomIndex[i]-1-i] = 6 lostPulseSeq = np.array(lostPulseSeq) seqPRI=lostPulseSeq[1:]-lostPulseSeq[:-1] seqTOA=lostPulseSeq z = np.zeros(max_len) seqPRI = np.append(seqPRI,z) p = np.append(p,z) z = np.zeros(5) lostlabel = np.append(lostlabel,z) return seqPRI[:max_len],lostlabel[:5],p[:max_len] def findpos(arr,x): for i in range(len(arr)): if arr[i]>x: return i return -1 def suprPul(inputseq,proportion,label,p):#虚警脉冲 # inputseq: 输入TOA序列 # proportion: 虚警百分比 # seqTOA: 虚警的TOA序列 # seqPRI: 虚警的PRI序列 # pw: 脉宽,脉冲串脉宽设置为5us supPulseSeq=pri2toa(inputseq) #每个proportion下面的缺失脉冲TOA序列 lengthWorkModeSample=len(supPulseSeq) tMax = math.floor(max(supPulseSeq)) randomNum = math.floor(lengthWorkModeSample*proportion) randomTime=np.random.randint(0,tMax,randomNum) randomTime = sorted(randomTime) mask = label!=0 label = label[mask] pattern = p*1 j = 0 for i in range(len(randomTime)): pos = findpos(supPulseSeq,randomTime[i]) while(j<len(label) and label[j] < pos): j = j+1 label[j:] = label[j:] + 1 supPulseSeq = np.insert(supPulseSeq, pos,randomTime[i]) pattern[pos-1] = 6 pattern = np.insert(pattern, pos,6) randomIndex=[i for i,val in enumerate(supPulseSeq) if val in randomTime] seqPRI=supPulseSeq[1:]-supPulseSeq[:-1] seqTOA=supPulseSeq z = np.zeros(max_len) seqPRI = np.append(seqPRI,z) z = np.zeros(5) label = np.append(label,z) return seqPRI[:max_len],label[:5],pattern[:max_len] def meaErr(inputseq,stdPRI): # inputseq: 输入TOA序列 # stdPRI: 测量误差的标准差 # seqTOA: 输出TOA序列 # seqPRI: 输出PRI序列 seqTOA=pri2toa(inputseq) lengthWorkModeSample=len(seqTOA) errGenarated = np.random.normal(0, stdPRI, lengthWorkModeSample) #errGenarated=normrnd(0,stdPRI,[1,lengthWorkModeSample]) seqTOA=seqTOA+errGenarated seqPRI=seqTOA[1:]-seqTOA[:-1] return seqPRI[:max_len] def indices(a,func): #实现find函数 return [i for (i,val) in enumerate(a) if func(val)] #a = [1 2 3 1 2 3] #find = indices(a,lambda x:x>2) --> [2,5] data = np.zeros((sample_num, max_len), dtype=np.float32) label = np.zeros((sample_num, max_kn+1), dtype=np.int) pattern = np.zeros((sample_num, max_kn+1), dtype=np.int) p = np.zeros((sample_num, max_len), dtype=np.float32) for i in range(sample_num): #seq_len = random.randint(min_len,max_len) seq_len = max_len knum = random.randint(min_kn,max_kn) k = [] for j in range(knum): a = random.randint(25,s_length-25) while solve(k,a-25,a+25): a = random.randint(25,s_length-25) k.append(a) k.append(seq_len) k = np.array(k) k = sorted(k) priValue = random.randint(10,20)*10 priDev = random.randint(10,20)/20 for j in range(knum+1): label[i,j] = k[j] module = 2 pattern[i,j] = module flag = random.randint(1,3) tempValue = priValue tempDev = priDev if flag == 1:#均值方差全变 while(tempValue==priValue): tempValue = random.randint(10,20)*10 while(tempDev==priDev): tempDev = random.randint(10,20)/20 elif flag == 2:#只变均值 while(tempValue==priValue): tempValue = random.randint(10,20)*10 else:#只变均值 while(tempDev==priDev): tempDev = random.randint(10,20)/20 priValue = tempValue priDev = tempDev if j==0: data[i,:k[j]] = jitter(k[j],priValue,priDev) p[i,:k[j]] = module else: data[i,k[j-1]:k[j]] = jitter(k[j]-k[j-1],priValue,priDev) p[i,k[j-1]:k[j]] = module d = data*1 l = label*1 result = np.zeros((sample_num, s_length), dtype=np.float32) L = np.zeros((sample_num, s_length), dtype=np.float32) ''' for i in range(sample_num): d[i] =meaErr(data[i],1) for i in range(sample_num): d[i],l[i],p[i] = lostPul(data[i],0.1,l[i],p[i])#247.5 for i in range(sample_num): d[i],l[i],p[i] = suprPul(data[i],0.05,l[i],p[i])#247.5 ''' d = d[:,:s_length] p = p[:,:s_length] for i in range(sample_num): for j in range(max_kn+1): if l[i,j]>=s_length: l[i,j:] = 0 l[i,j] = s_length break for i in range(sample_num): for j in range(max_kn+1): if l[i,j] != s_length and l[i,j] != 0: result[i,l[i,j]] = 1 L[i,l[i,j]] = 1 result[i,l[i,j]-1] = 0.8 result[i,l[i,j]+1] = 0.8 plt.plot(d[0]) # scio.savemat(dataFile, {'data':d,'label':result,'pattern':p,'L':L,'Y':d,'l_true':l})
Carty-Bao/BNPHMM
code/gen_new.py
gen_new.py
py
9,565
python
en
code
0
github-code
6
[ { "api_name": "numpy.ones", "line_number": 30, "usage_type": "call" }, { "api_name": "numpy.random.randint", "line_number": 39, "usage_type": "call" }, { "api_name": "numpy.random", "line_number": 39, "usage_type": "attribute" }, { "api_name": "random.randint", ...