commit
stringlengths
40
40
subject
stringlengths
1
1.49k
old_file
stringlengths
4
311
new_file
stringlengths
4
311
new_contents
stringlengths
1
29.8k
old_contents
stringlengths
0
9.9k
lang
stringclasses
3 values
proba
float64
0
1
de65724abf0a01660e413189d1738a72d5afd297
add simple test for create_wininst.
bento/commands/tests/test_wininst.py
bento/commands/tests/test_wininst.py
import os import shutil import tempfile import zipfile import os.path as op import mock import bento.commands.build_wininst from bento.commands.build_wininst \ import \ create_wininst from bento.compat.api.moves \ import \ unittest from bento.core.node \ import \ create_base_nodes from bento.installed_package_description \ import \ InstalledPkgDescription class TestWininstInfo(unittest.TestCase): def setUp(self): self.old_dir = None self.tmpdir = None self.old_dir = os.getcwd() self.tmpdir = tempfile.mkdtemp() try: self.top_node, self.build_node, self.run_node = \ create_base_nodes(self.tmpdir, op.join(self.tmpdir, "build")) os.chdir(self.tmpdir) except: shutil.rmtree(self.tmpdir) raise def tearDown(self): os.chdir(self.old_dir) shutil.rmtree(self.tmpdir) @mock.patch("bento.commands.build_wininst.create_exe", mock.MagicMock()) def test_simple(self): """This just tests whether create_wininst runs at all and produces a zip-file.""" ipackage = InstalledPkgDescription({}, {"name": "foo", "version": "1.0"}, {}) create_wininst(ipackage, self.build_node, self.build_node, wininst="foo.exe", output_dir="dist") arcname = bento.commands.build_wininst.create_exe.call_args[0][1] fp = zipfile.ZipFile(arcname) try: fp.namelist() finally: fp.close()
Python
0
edfd6ddf8e7af41a8b5ed228360b92377bfc8964
add 167. First 200 problems have been finished!
vol4/167.py
vol4/167.py
import time def ulam(a, b): yield a yield b u = [a, b] even_element = 0 while even_element == 0 or u[-1] < 2 * even_element: sums = {} for i in range(len(u)): for j in range(i + 1, len(u)): sums[u[i] + u[j]] = sums.get(u[i] + u[j], 0) + 1 u.append(min(k for k, v in sums.iteritems() if v == 1 and k > u[-1])) yield u[-1] if u[-1] % 2 == 0: even_element = u[-1] index = 0 while even_element + u[index] <= u[-1]: index += 1 while True: if even_element + u[index] > u[-1] + 2: u.append(u[-1] + 2) else: u.append(even_element + u[index + 1]) index = index + 2 yield u[-1] if __name__ == "__main__": N = 10 ** 11 ans = 0 periods = [32, 26, 444, 1628, 5906, 80, 126960, 380882, 2097152] diffs = [126, 126, 1778, 6510, 23622, 510, 507842, 1523526, 8388606] for n in range(2, 11): u = ulam(2, 2 * n + 1) index = 0 even = False while not even or (N - index) % periods[n - 2] != 0: num = u.next() if num % 2 == 0 and num > 2: even = True index += 1 ans += num + (N - index) / periods[n - 2] * diffs[n - 2] print ans
Python
0
a7db805db727fbe1c6e9f37152e6c3c2f94d406d
add require internet
i3pystatus/external_ip.py
i3pystatus/external_ip.py
from i3pystatus import IntervalModule, formatp from i3pystatus.core.util import internet, require import GeoIP import urllib.request class ExternalIP(IntervalModule): """ Shows the external IP with the country code/name. Requires the PyPI package `GeoIP`. .. rubric:: Available formatters * {country_name} the full name of the country from the IP (eg. 'United States') * {country_code} the country code of the country from the IP (eg. 'US') * {ip} the ip """ interval = 15 settings = ( "format", "color", ("color_down", "color when the http request failed"), ("color_hide", "color when the user has decide to switch to the hide format"), ("format_down", "format when the http request failed"), ("format_hide", "format when the user has decide to switch to the hide format"), ("ip_website", "http website where the IP is directly available as raw"), ("timeout", "timeout in seconds when the http request is taking too much time"), ) format = "{country_name} {country_code} {ip}" format_hide = "{country_code}" format_down = "Timeout" ip_website = "https://api.ipify.org" timeout = 5 color = "#FFFFFF" color_hide = "#FFFF00" color_down = "#FF0000" on_leftclick = "switch_hide" on_rightclick = "run" @require(internet) def get_external_ip(self): try: request = urllib.request.urlopen(self.ip_website, timeout=self.timeout) return request.read().decode().strip() except Exception: return None def run(self): ip = self.get_external_ip() if not ip: return self.disable() gi = GeoIP.GeoIP(GeoIP.GEOIP_STANDARD) country_code = gi.country_code_by_addr(ip) country_name = gi.country_name_by_addr(ip) if not country_code: return self.disable() # fail here in the case of a bad IP fdict = { "country_name": country_name, "country_code": country_code, "ip": ip } self.output = { "full_text": formatp(self.format, **fdict).strip(), "color": self.color } def disable(self): self.output = { "full_text": self.format_down, "color": self.color_down } def switch_hide(self): self.format, self.format_hide = self.format_hide, self.format self.color, self.color_hide = self.color_hide, self.color self.run()
from i3pystatus import IntervalModule, formatp import GeoIP import urllib.request class ExternalIP(IntervalModule): """ Shows the external IP with the country code/name. Requires the PyPI package `GeoIP`. .. rubric:: Available formatters * {country_name} the full name of the country from the IP (eg. 'United States') * {country_code} the country code of the country from the IP (eg. 'US') * {ip} the ip """ settings = ( "format", "color", ("color_down", "color when the http request failed"), ("color_hide", "color when the user has decide to switch to the hide format"), ("format_down", "format when the http request failed"), ("format_hide", "format when the user has decide to switch to the hide format"), ("ip_website", "http website where the IP is directly available as raw"), ("timeout", "timeout in seconds when the http request is taking too much time"), ) interval = 15 format = "{country_name} {country_code} {ip}" format_hide = "{country_code}" format_down = "Timeout" ip_website = "https://api.ipify.org" timeout = 5 color = "#FFFFFF" color_hide = "#FFFF00" color_down = "#FF0000" on_leftclick = "switch_hide" on_rightclick = "run" def run(self): try: request = urllib.request.urlopen(self.ip_website, timeout=self.timeout) ip = request.read().decode().strip() except Exception: return self.disable() gi = GeoIP.GeoIP(GeoIP.GEOIP_STANDARD) country_code = gi.country_code_by_addr(ip) country_name = gi.country_name_by_addr(ip) if not ip or not country_code: return self.disable() # fail here in the case of a bad IP fdict = { "country_name": country_name, "country_code": country_code, "ip": ip } self.output = { "full_text": formatp(self.format, **fdict).strip(), "color": self.color } def disable(self): self.output = { "full_text": self.format_down, "color": self.color_down } def switch_hide(self): self.format, self.format_hide = self.format_hide, self.format self.color, self.color_hide = self.color_hide, self.color self.run()
Python
0.000013
e4d222c4e1b05f8d34b2236d05269827c345b0c7
Handle also running rebot
src/robot/jarrunner.py
src/robot/jarrunner.py
# Copyright 2008-2010 Nokia Siemens Networks Oyj # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from org.robotframework import RobotRunner from robot import runner, run_from_cli, rebot, rebot_from_cli class JarRunner(RobotRunner): """Used for Java-Jython interop when RF is executed from .jar file""" def run(self, args): print rebot, rebot.__file__ try: if args and args[0] == 'rebot': print rebot.__doc__ rebot_from_cli(args[1:], rebot.__doc__) else: run_from_cli(args, runner.__doc__) except SystemExit, err: return err.code
# Copyright 2008-2010 Nokia Siemens Networks Oyj # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from org.robotframework import RobotRunner from robot import runner, run_from_cli class JarRunner(RobotRunner): """Used for Java-Jython interop when RF is executed from .jar file""" def run(self, args): try: run_from_cli(args, runner.__doc__) except SystemExit, err: return err.code
Python
0
76399574b7fb914d1baa2719a0e493d4b22bb730
Create PedidoEditar.py
backend/Models/Grau/PedidoEditar.py
backend/Models/Grau/PedidoEditar.py
from Framework.Pedido import Pedido from Framework.ErroNoHTTP import ErroNoHTTP class PedidoEditar(Pedido): def __init__(self,variaveis_do_ambiente): super(PedidoEditar, self).__init__(variaveis_do_ambiente) try: self.nome = self.corpo['nome'] except: raise ErroNoHTTP(400) def getNome(self): return self.nome
Python
0
df146818d004e65102cc6647373b0fddb0d383fd
add basic integration tests
integration-tests/test_builder.py
integration-tests/test_builder.py
import os import subprocess import tempfile from vdist.builder import Builder from vdist.source import git, git_directory, directory def test_generate_deb_from_git(): builder = Builder() builder.add_build( app='vdist-test-generate-deb-from-git', version='1.0', source=git( uri='https://github.com/objectified/vdist', branch='master' ), profile='ubuntu-trusty' ) builder.build() cwd = os.getcwd() target_file = os.path.join( cwd, 'dist', 'vdist-test-generate-deb-from-git-1.0-ubuntu-trusty', 'vdist-test-generate-deb-from-git_1.0_amd64.deb' ) assert os.path.isfile(target_file) assert os.path.getsize(target_file) > 0 def test_generate_deb_from_git_directory(): tempdir = tempfile.gettempdir() checkout_dir = os.path.join(tempdir, 'vdist') git_p = subprocess.Popen( ['git', 'clone', 'https://github.com/objectified/vdist', checkout_dir]) git_p.communicate() builder = Builder() builder.add_build( app='vdist-test-generate-deb-from-git-dir', version='1.0', source=git_directory( path=checkout_dir, branch='master' ), profile='ubuntu-trusty' ) builder.build() cwd = os.getcwd() target_file = os.path.join( cwd, 'dist', 'vdist-test-generate-deb-from-git-dir-1.0-ubuntu-trusty', 'vdist-test-generate-deb-from-git-dir_1.0_amd64.deb' ) assert os.path.isfile(target_file) assert os.path.getsize(target_file) > 0 def test_generate_deb_from_directory(): tempdir = tempfile.gettempdir() checkout_dir = os.path.join(tempdir, 'vdist') git_p = subprocess.Popen( ['git', 'clone', 'https://github.com/objectified/vdist', checkout_dir]) git_p.communicate() builder = Builder() builder.add_build( app='vdist-test-generate-deb-from-dir', version='1.0', source=directory( path=checkout_dir, ), profile='ubuntu-trusty' ) builder.build() cwd = os.getcwd() target_file = os.path.join( cwd, 'dist', 'vdist-test-generate-deb-from-dir-1.0-ubuntu-trusty', 'vdist-test-generate-deb-from-dir_1.0_amd64.deb' ) assert os.path.isfile(target_file) assert os.path.getsize(target_file) > 0
Python
0
dc0ecffd6c4115019cfcbcc13b17a20511888c9b
Add ut for fused ops
python/paddle/fluid/tests/unittests/test_fused_emb_seq_pool_op.py
python/paddle/fluid/tests/unittests/test_fused_emb_seq_pool_op.py
# Copyright (c) 2018 PaddlePaddle Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import print_function import unittest import numpy as np from op_test import OpTest import paddle.fluid.core as core import paddle.fluid as fluid from paddle.fluid.op import Operator import paddle.compat as cpt class TestFusedEmbeddingSeqPoolOp(OpTest): def setUp(self): self.op_type = "fused_embedding_seq_pool" self.emb_size = 2 table = np.random.random((17, self.emb_size)).astype("float32") ids = np.array([[[4], [3]], [[4], [3]], [[2], [1]], [[16], [1]]]).astype("int64") merged_ids = np.array([4, 2, 16]).astype("int64") ids_expand = np.expand_dims(ids, axis=1) self.lod = [[3, 1]] self.attrs = {'is_sparse': True} self.inputs = {'W': table, 'Ids': (ids_expand, self.lod)} self.outputs = { 'Out': np.reshape( np.array([ table[[4, 3]] + table[[4, 3]] + table[[2, 1]], table[[16, 1]] ]), [len(self.lod[0]), 2 * self.emb_size]) } def test_check_output(self): self.check_output() if __name__ == "__main__": unittest.main()
Python
0
a852de81afdf8426cb243115a87856e2767a8d40
Add construct test for known bad inplace string operations.
tests/benchmarks/constructs/InplaceOperationStringAdd.py
tests/benchmarks/constructs/InplaceOperationStringAdd.py
# Copyright 2015, Kay Hayen, mailto:kay.hayen@gmail.com # # Python test originally created or extracted from other peoples work. The # parts from me are licensed as below. It is at least Free Softwar where # it's copied from other people. In these cases, that will normally be # indicated. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # module_value1 = 5 module_value2 = 3 def calledRepeatedly(): # Force frame and eliminate forward propagation (currently). module_value1 # Make sure we have a local variable x anyway s = "2" additiv = "*" * 1000 local_value = module_value1 for x in range(local_value, local_value+15): # construct_begin s += additiv # construct_end pass for x in xrange(50000): calledRepeatedly() print("OK.")
Python
0.000001
40ee2fd436afb7bc459ee8cef563cd4d6f97a30e
extract QMCPACK scalars
static_twists.py
static_twists.py
#!/usr/bin/env python import os import numpy as np import pandas as pd import subprocess as sp import nexus_addon as na def locate_bundle_input(path): # locate bunled QMCPACK input fidx = 0 out_tokens = sp.check_output('ls %s/*.in' %path ,shell=True).split('\n')[:-1] good_in = 0 if len(out_tokens) > 1: for i in range(len(out_tokens)): fname = out_tokens[i] if not fname.endswith('.qsub.in'): good_in += 1 fidx = i # end if # end for # end if if (len(out_tokens) != 1) and (good_in != 1) : raise NotImplementedError( '%d inputs found in %s, can only handle 1' % (len(out_tokens),path) ) # end if return out_tokens[fidx] # end def def collect_raw_data(paths,skip_failed=False,db_name='twists.json',verbose=True): failed = False # initialize analyzer from qmca import QBase options = {"equilibration":"auto"} QBase.options.transfer_from(options) for path in paths: if verbose: print "getting raw data from %s" % path # end if target_json = os.path.join(path,db_name) if os.path.isfile(target_json): continue # end if bundled_input = locate_bundle_input(path) igroup_dict = {} with open(bundled_input,'r') as f: igroup = 0 for line in f: infile = line.strip('\n') igroup_dict[infile] = igroup igroup += 1 # end for line # end with open # make a database of all the scalar files data = [] for qmc_input in igroup_dict.keys(): entry = na.scalars_from_input(os.path.join(path,qmc_input) ,skip_failed=skip_failed,igroup=igroup_dict[qmc_input]) data.append(entry) # end for df = pd.DataFrame([entry for sublist in data for entry in sublist]) # save raw data in local directory if len(df)!=0: pd.concat([df,df['settings'].apply(pd.Series)],axis=1).to_json(target_json) else: failed=True # end if # end for path return failed # end def collect_raw_data def average_twists(paths,src_db_name='twists.json',tar_db_name='scalars.json',manual_twists=None,verbose=True): failed = False for path in paths: if verbose: print "averaging twists in %s" % path # end if target_json = os.path.join(path,tar_db_name) if os.path.isfile(target_json): continue # end if source_json = os.path.join(path,src_db_name) # load local data if not os.path.exists(source_json): raise IOError('cannot locate %s, is it collected?' % source_json) # end if df_all = pd.read_json(source_json) df = df_all # may select twists if manual_twists is not None: sel = df_all['twistnum'].apply(lambda x:x in manual_twists) df = df_all[sel] if len(manual_twists) != len(df): raise NotImplementedError('missing twists') # end if # end if # exclude columns that don't need to be averaged, add more as needed special_colmns = ['iqmc','method','path','settings','vol_unit','volume'] columns_to_average = df.drop(special_colmns,axis=1).columns mean_names = [] error_names= [] for col_name in columns_to_average: if col_name.endswith('_mean'): mean_names.append(col_name) elif col_name.endswith('_error'): error_names.append(col_name) # end if # end for col_name col_names = [] for iname in range(len(mean_names)): mname = mean_names[iname].replace('_mean','') ename = error_names[iname].replace('_error','') assert mname == ename col_names.append(mname) # end for i # perform twist averaging new_means = df.groupby('iqmc')[mean_names].apply(np.mean) ntwists = len(df[df['iqmc']==0]) # better way to determine ntwists? new_errors = df.groupby('iqmc')[error_names].apply( lambda x:np.sqrt((x**2.).sum())/ntwists) # make averaged database dfev = pd.merge(new_means.reset_index(),new_errors.reset_index()) extras = df[special_colmns].groupby('iqmc').apply(lambda x:x.iloc[0]) newdf = pd.merge( extras.drop('iqmc',axis=1).reset_index(), dfev) newdf.to_json(target_json) # end for return failed # end def average_twists if __name__ == '__main__': import argparse # parse command line input for trace file name parser = argparse.ArgumentParser(description='collect DMC data from a directory of QMCPACK runs') parser.add_argument('src_dir', type=str, help='directory containing QMCPACK runs') parser.add_argument('final_target_json', type=str, help='json file to save collected data') parser.add_argument('-rid','--rundir_id', type=str,default='dmc_444',help='run directory identifier, default dmc_444') parser.add_argument('-r','--only_real', action='store_true', help='only use real twists out of 64 twists') parser.add_argument('-v','--verbose', action='store_true', help='report progress') args = parser.parse_args() # parsed inputs # specify source data directory and target database file src_dir = args.src_dir final_target_json = args.final_target_json only_real = args.only_real rundir_id = args.rundir_id verbose = args.verbose # hard-coded inputs sfile_name = 'scalars.json' if only_real: sfile_name = 'new_real_' + sfile_name # end if if only_real: final_target_json = 'real_' + final_target_json # end if # get twist run locations proc = sp.Popen(['find',src_dir,'-name',rundir_id] ,stdout=sp.PIPE,stderr=sp.PIPE) out,err = proc.communicate() paths = out.split('\n')[:-1] # collect raw data in local directories failed = collect_raw_data(paths) if failed: raise NotImplementedError('raw data collection failed') # end if # store twist-averaged data in local directories if only_real: failed = average_twists(paths,tar_db_name=sfile_name,manual_twists=[0,2,8,10,32,34,40,42]) else: # average over all twists failed = average_twists(paths,tar_db_name=sfile_name) # end if if failed: raise NotImplementedError('twist average failed') # end if # analyze data import dmc_databse_analyzer as dda data = [] for path in paths: print "analyzing %s" % path jfile = os.path.join(path,sfile_name) if not os.path.exists(jfile): raise IOError('failed to find %s' % jfile) # end if local_scalars = pd.read_json(jfile) extrap_scalars= dda.process_dmc_data_frame(local_scalars) data.append(extrap_scalars) # end for path df = pd.concat(data).reset_index().drop('index',axis=1) df.to_json(final_target_json) # end __main__
Python
0.998553
cff31f87a57d6e95e9cee848663ef4d5becc97b1
add sharder.py file
storj/sharder.py
storj/sharder.py
import math import os # global SHARD_MULTIPLES_BACK, MAX_SHARD_SIZE # MAX_SHARD_SIZE = 4294967296 # 4Gb # SHARD_MULTIPLES_BACK = 4 class ShardingTools(): def __init__(self): self.MAX_SHARD_SIZE = 4294967296 # 4Gb self.SHARD_MULTIPLES_BACK = 4 def get_optimal_shard_parametrs(self, file_size): shard_parameters = {} accumulator = 0 shard_size = None while (shard_size is None): shard_size = self.determine_shard_size(file_size, accumulator) accumulator += 1 shard_parameters["shard_size"] = str(shard_size) shard_parameters["shard_count"] = math.ceil(file_size / shard_size) shard_parameters["file_size"] = file_size return shard_parameters def determine_shard_size(self, file_size, accumulator): # Based on <https://github.com/aleitner/shard-size-calculator/blob/master/src/shard_size.c> hops = 0 if (file_size <= 0): return 0 # if accumulator != True: # accumulator = 0 print accumulator # Determine hops back by accumulator if ((accumulator - self.SHARD_MULTIPLES_BACK) < 0): hops = 0 else: hops = accumulator - self.SHARD_MULTIPLES_BACK # accumulator = 10 byte_multiple = self.shard_size(accumulator) check = file_size / byte_multiple # print check if (check > 0 and check <= 1): while (hops > 0 and self.shard_size(hops) > self.MAX_SHARD_SIZE): if hops - 1 <= 0: hops = 0 else: hops = hops - 1 return self.shard_size(hops) # Maximum of 2 ^ 41 * 8 * 1024 * 1024 if (accumulator > 41): return 0 # return self.determine_shard_size(file_size, ++accumulator) def shard_size(self, hops): return (8 * (1024 * 1024)) * pow(2, hops) def sort_index(self, f1, f2): index1 = f1.rfind('-') index2 = f2.rfind('-') if index1 != -1 and index2 != -1: i1 = int(f1[index1:len(f1)]) i2 = int(f2[index2:len(f2)]) return i2 - i1 def join_shards(self, shards_filepath, pattern, destination_file_path): # Based on <http://code.activestate.com/recipes/224800-simple-file-splittercombiner-module/> import re print 'Creating file' + destination_file_path bname = (os.path.split(destination_file_path))[1] bname_input = (os.path.split(shards_filepath))[1] bname2_input = bname_input input_directory = (os.path.split(shards_filepath))[0] output_directory = (os.path.split(destination_file_path))[0] # bugfix: if file contains characters like +,.,[] # properly escape them, otherwise re will fail to match. for a, b in zip(['+', '.', '[', ']', '$', '(', ')'], ['\+', '\.', '\[', '\]', '\$', '\(', '\)']): bname2 = bname2_input.replace(a, b) chunkre = re.compile(bname2_input + '-' + '[0-9]+') chunkfiles = [] for f in os.listdir(str(input_directory)): print f if chunkre.match(f): chunkfiles.append(f) print 'Number of chunks ', len(chunkfiles) chunkfiles.sort(self.sort_index) print chunkfiles data = '' for f in chunkfiles: try: print 'Appending chunk', os.path.join(str(input_directory), f) data += open(str(input_directory) + "/" + str(f), 'rb').read() print str(input_directory) + "/" + str(f) + " katalog wejsciowy" except (OSError, IOError, EOFError) as e: print e continue try: print str(output_directory) + " katalog wyjsciowy" f = open(str(output_directory) + "/" + str(bname), 'wb') f.write(data) f.close() except (OSError, IOError, EOFError) as e: raise ShardingException(str(e)) print 'Wrote file', bname return 1 class ShardingException(Exception): def __init__(self, value): self.value = value def __str__(self): return str(self.value)
Python
0.000001
60880e780d611f32a3358bcae76f4eed22feb2d7
Create a module to add "Basic string search algorithms"
string_search.py
string_search.py
'''String search algorithms''' _naive_iterations = 0 def naive_search(string, pattern): '''Naïve string search algorithm Pseudo code: string[1..n] and pattern[1..m] for i from 1 to n-m+1 for j from 1 to m if s[i+j-1] ≠ pattern[j] jump to next iteration of outer loop return i return not found :param string: string :param pattern: pattern to search :return: position in the string where the pattern start or None :reference: https://en.wikipedia.org/wiki/Rabin–Karp_algorithm ''' for i in range(0, len(string) - len(pattern) + 1): global _naive_iterations _naive_iterations += 1 def search(): for j in range(0, len(pattern)): global _naive_iterations _naive_iterations += 1 if string[i+j] != pattern[j]: return None return i value = search() if value != None: return value return None def test_naive_search(): '''Naïve string search algorithm test using Py.Test''' global _naive_iterations _naive_iterations = 0 assert naive_search("abc", "wowxyzabcnice") == None print(_naive_iterations) _naive_iterations = 0 assert naive_search("abc", "wowxyzacbnice") == None print(_naive_iterations) _naive_iterations = 0 assert naive_search("wowxyzabcnice", "abc") == 6 print(_naive_iterations) _naive_iterations = 0 assert naive_search("wowxyzacbnice", "abc") == None print(_naive_iterations) _naive_iterations = 0 assert naive_search("wowxyzniceabc", "abc") == 10 print(_naive_iterations) _naive_iterations = 0 assert naive_search("abcwowxyznice", "abc") == 0 print(_naive_iterations) _naive_iterations = 0 assert naive_search("abc", "abc") == 0 print(_naive_iterations) _naive_iterations = 0 assert naive_search("abc", "") == 0 print(_naive_iterations) _naive_iterations = 0 assert naive_search("", "") == 0 print(_naive_iterations) _naive_iterations = 0 def rabin_karp(string, pattern): '''Rabin–Karp string search algorithm Pseudo Code: function RabinKarp(string s[1..n], string pattern[1..m]) hpattern := hash(pattern[1..m]); for i from 1 to n-m+1 hs := hash(s[i..i+m-1]) if hs = hpattern if s[i..i+m-1] = pattern[1..m] return i return not found ''' hash_pattern = hash(pattern) for i in range(0, len(string) - len(pattern) + 1): global _rabin_iterations _rabin_iterations += 1 hash_string = hash(string[i:i+len(pattern)]) if hash_string == hash_pattern: if string[i:i+len(pattern)] == pattern[:len(pattern)]: return i return None _rabin_iterations = 0 def test_rabin_karp(): '''Naïve string search algorithm test using Py.Test''' print("-------------") global _rabin_iterations assert rabin_karp("abc", "wowxyzabcnice") == None print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("abc", "wowxyzacbnice") == None print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("wowxyzabcnice", "abc") == 6 print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("wowxyzacbnice", "abc") == None print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("wowxyzniceabc", "abc") == 10 print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("abcwowxyznice", "abc") == 0 print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("abc", "abc") == 0 print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("abc", "") == 0 print(_rabin_iterations) _rabin_iterations = 0 assert rabin_karp("", "") == 0 print(_rabin_iterations) _rabin_iterations = 0
Python
0
28df83848a04e45059f4c672fde53f4f84dbd28d
Add module module_pubivisat.py
module_pubivisat.py
module_pubivisat.py
#!/usr/bin/env python # -*- coding: utf-8 -*- import urllib2 from bs4 import BeautifulSoup def command_pubivisat(bot, user, channel, args): """Fetches todays pub quizzes for Tampere from pubivisat.fi""" url = "http://pubivisat.fi/tampere" f = urllib2.urlopen(url) d = f.read() f.close() bs = BeautifulSoup(d) data = bs.find('table', {'class': 'quiz_list'}).find('tbody').findAll('tr') quizzes = [] for row in data: name = row.find('a').string time = row.findAll('td')[1].string quizzes.append("%s: %s" % (str(name), str(time))) output = ' | '.join(reversed(quizzes)) return(bot.say(channel, output))
Python
0.000003
e5736370568adab1334f653c44dd060c06093fae
add basic twisted soap server.
src/rpclib/test/interop/server/soap_http_basic_twisted.py
src/rpclib/test/interop/server/soap_http_basic_twisted.py
#!/usr/bin/env python # # rpclib - Copyright (C) Rpclib contributors. # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 # import logging logging.basicConfig(level=logging.DEBUG) logger = logging.getLogger('rpclib.wsgi') logger.setLevel(logging.DEBUG) import os from rpclib.test.interop.server.soap_http_basic import soap_application from rpclib.server.twisted_ import TwistedWebApplication host = '127.0.0.1' port = 9753 def main(argv): from twisted.python import log from twisted.web.server import Site from twisted.web.static import File from twisted.internet import reactor from twisted.python import log observer = log.PythonLoggingObserver('twisted') log.startLoggingWithObserver(observer.emit, setStdout=False) wr = TwistedWebApplication(soap_application) site = Site(wr) reactor.listenTCP(port, site) logging.info("listening on: %s:%d" % (host,port)) return reactor.run() if __name__ == '__main__': import sys sys.exit(main(sys.argv))
Python
0
e83edea432f16ed6a2c9edcaa6da70c928d75eb5
Create module containing constants
export_layers/pygimplib/constants.py
export_layers/pygimplib/constants.py
# # This file is part of pygimplib. # # Copyright (C) 2014, 2015 khalim19 <khalim19@gmail.com> # # pygimplib is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # pygimplib is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with pygimplib. If not, see <http://www.gnu.org/licenses/>. # """ This module contains constants used in other modules. """ from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals str = unicode #=============================================================================== _LOG_OUTPUT_MODES = (LOG_EXCEPTIONS_ONLY, LOG_OUTPUT_FILES, LOG_OUTPUT_GIMP_CONSOLE) = (0, 1, 2)
Python
0
0421adb2eb391c57d02dfa0b1b14e3c620c53dfc
Create tarea7.py
tareas/tarea7.py
tareas/tarea7.py
#josue de leon # Tarea 7 #8-876-2357 '''1.Crear una aplicacion en Kivy que maneje un registro de asistencia. Basicamente la aplicacion debe contener una etiqueta que diga "Nombre: ", un campo para ingresar cadenas de texto, un boton que diga "Guardar" y otro botin que diga "Exportar". El botn para guardar agrega el contenido del campo a una lista de asistencia. El boton para exportar salva la lista de asistencia a un fichero con extension TXT''' import listasutils as lu from kivy.app import App from kivy.config import Config from kivy.uix.boxlayout import BoxLayout from kivy.uix.label import Label from kivy.uix.floatlayout import FloatLayout from kivy.properties import ObjectProperty Config.set('graphics', 'resizable', '0') Config.set('graphics', 'width', '640') Config.set('graphics', 'height', '480') class Fondo(FloatLayout): lista = [] listgrid = ObjectProperty(None) textbox = ObjectProperty(None) def OnGuardarClick(self,texto): if texto != "": grid = self.listgrid grid.bind(minimum_height=grid.setter('height'), minimum_width=grid.setter('width')) self.textbox.text = '' self.lista.append(texto) RowNombre = Label(text='{0}'.format(texto)) grid.add_widget(RowNombre) def OnExportarClick(self): lu.salvarLista("Tarea7.txt",self.lista) class AsistenciaApp(App): def build(self): return Fondo() if __name__ == '__main__': AsistenciaApp().run() <Fondo>: scroll_view: scrollviewID listgrid: gridlayoutID textbox: textboxID BoxLayout: orientation: 'vertical' size_hint: 1,0.1 pos_hint: {'top':1} BoxLayout: orientation: 'horizontal' Label: text: 'Nombre' TextInput: id: textboxID multiline: False BoxLayout: orientation: 'vertical' size_hint: 1,0.8 pos_hint: {'top':0.9} canvas: Color: rgba: (0.2, 0.2, 0.2, 1) Rectangle: pos: self.pos size: self.size ScrollView: id: scrollviewID orientation: 'vertical' pos_hint: {'x': 0, 'y': 0} bar_width: '20dp' GridLayout: id: gridlayoutID cols: 1 size_hint: 1, None row_default_height: 40 row_force_default: False BoxLayout: canvas: Color: rgba: (0.4, 0.4, 0.4, 1) Rectangle: pos: self.pos size: self.size Label: text: 'Nombre' BoxLayout: orientation: 'vertical' size_hint: 1,0.1 pos_hint: {'top':0.1} BoxLayout: orientation: 'horizontal' Button: text: 'Guardar' on_release: root.OnGuardarClick(textboxID.text) Button: text: 'Exportar' on_release: root.OnExportarClick()
Python
0.000001
b260040bc3ca48b4e76d73c6efe60b964fa5c108
Add test of removing unreachable terminals
tests/UnreachableSymbolsRemove/RemovingTerminalsTest.py
tests/UnreachableSymbolsRemove/RemovingTerminalsTest.py
#!/usr/bin/env python """ :Author Patrik Valkovic :Created 17.08.2017 14:23 :Licence GNUv3 Part of grammpy-transforms """ from unittest import main, TestCase from grammpy import * from grammpy_transforms import * class A(Nonterminal): pass class B(Nonterminal): pass class C(Nonterminal): pass class D(Nonterminal): pass class E(Nonterminal): pass class F(Nonterminal): pass class RuleAto0B(Rule): rule = ([A], [0, B]) class RuleBto1C(Rule): rule = ([B], [1, C]) class RuleCto2C(Rule): rule = ([C], [2, C]) class RemovingTerminalsTest(TestCase): def test_removingTerminals(self): g = Grammar(terminals=[0, 1, 2, 3], nonterminals=[A, B, C, D, E, F], rules=[RuleAto0B, RuleBto1C, RuleCto2C], start_symbol=A) com = ContextFree.remove_unreachable_symbols(g) self.assertTrue(com.have_term([0, 1, 2])) self.assertFalse(com.have_term(3)) self.assertTrue(com.have_nonterm([A, B, C])) self.assertFalse(com.have_nonterm(D)) self.assertFalse(com.have_nonterm(E)) self.assertFalse(com.have_nonterm(F)) def test_removingTerminalsShouldNotChange(self): g = Grammar(terminals=[0, 1, 2, 3], nonterminals=[A, B, C, D, E, F], rules=[RuleAto0B, RuleBto1C, RuleCto2C], start_symbol=A) ContextFree.remove_unreachable_symbols(g) self.assertTrue(g.have_term([0, 1, 2, 3])) self.assertTrue(g.have_nonterm([A, B, C, D, E, F])) def test_removingTerminalsShouldChange(self): g = Grammar(terminals=[0, 1, 2, 3], nonterminals=[A, B, C, D, E, F], rules=[RuleAto0B, RuleBto1C, RuleCto2C], start_symbol=A) ContextFree.remove_unreachable_symbols(g, transform_grammar=True) self.assertTrue(g.have_term([0, 1, 2])) self.assertFalse(g.have_term(3)) self.assertTrue(g.have_nonterm([A, B, C])) self.assertFalse(g.have_nonterm(D)) self.assertFalse(g.have_nonterm(E)) self.assertFalse(g.have_nonterm(F)) if __name__ == '__main__': main()
Python
0.000001
c82473efdeb7b1713f44370de761ec9022d02b5e
Add management command to fill and clear cache
akvo/rsr/management/commands/populate_project_directory_cache.py
akvo/rsr/management/commands/populate_project_directory_cache.py
#!/usr/bin/env python3 # -*- coding: utf-8 -*- # Akvo Reporting is covered by the GNU Affero General Public License. # See more details in the license.txt file located at the root folder of the Akvo RSR module. # For additional details on the GNU license please see < http://www.gnu.org/licenses/agpl.html >. """Populate the project directory cache for all the projects. Usage: python manage.py populate_project_directory_cache """ from django.core.management.base import BaseCommand from akvo.rest.views.project import serialized_project from akvo.rest.cache import delete_project_from_project_directory_cache from akvo.rsr.models import Project class Command(BaseCommand): help = __doc__ def add_arguments(self, parser): parser.add_argument('action', choices=['clear', 'fill'], help='Action to perform') def handle(self, *args, **options): projects = Project.objects.public().published().values_list('pk', flat=True) if options['action'] == 'clear': for project_id in projects: delete_project_from_project_directory_cache(project_id) else: for project_id in projects: serialized_project(project_id)
Python
0
4e6f2ede0a8a9291befe262cbec77d3e7cd873b0
add new package (#26514)
var/spack/repos/builtin/packages/py-rsatoolbox/package.py
var/spack/repos/builtin/packages/py-rsatoolbox/package.py
# Copyright 2013-2021 Lawrence Livermore National Security, LLC and other # Spack Project Developers. See the top-level COPYRIGHT file for details. # # SPDX-License-Identifier: (Apache-2.0 OR MIT) from spack import * class PyRsatoolbox(PythonPackage): """Representational Similarity Analysis (RSA) in Python.""" homepage = "https://github.com/rsagroup/rsatoolbox" pypi = "rsatoolbox/rsatoolbox-0.0.3.tar.gz" version('0.0.3', sha256='9bf6e16d9feadc081f9daaaaab7ef38fc1cd64dd8ef0ccd9f74adb5fe6166649') depends_on('py-setuptools', type='build') depends_on('py-coverage', type=('build', 'run')) depends_on('py-numpy@1.21.2:', type=('build', 'run')) depends_on('py-scipy', type=('build', 'run')) depends_on('py-scikit-learn', type=('build', 'run')) depends_on('py-scikit-image', type=('build', 'run')) depends_on('py-tqdm', type=('build', 'run')) depends_on('py-h5py', type=('build', 'run')) depends_on('py-matplotlib', type=('build', 'run')) depends_on('py-joblib', type=('build', 'run')) def patch(self): # tests are looking for a not existing requirements.txt file with working_dir('tests'): open('requirements.txt', 'a').close()
Python
0
0ac0c81a3427f35447f52c1643229f5dbe607002
Add a merge migration and bring up to date
osf/migrations/0099_merge_20180426_0930.py
osf/migrations/0099_merge_20180426_0930.py
# -*- coding: utf-8 -*- # Generated by Django 1.11.11 on 2018-04-26 14:30 from __future__ import unicode_literals from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('osf', '0098_merge_20180416_1807'), ('osf', '0096_add_provider_doi_prefixes'), ] operations = [ ]
Python
0
2731aba68f86c0adcb26f4105c7418ffa35e3d09
add first auto-test
test/run_test.py
test/run_test.py
#!/usr/bin/env python import sys import os from subprocess import Popen, PIPE import re class TestFailure(Exception): pass def do_bgrep(pattern, paths, options=[], retcode=0): bgrep_path = '../bgrep' args = [bgrep_path] args += list(options) args.append(pattern.encode('hex')) args += list(paths) p = Popen(args, stdout=PIPE) stdout, stderr = p.communicate() if p.returncode != retcode: raise TestFailure('Return code: {0}, expected: {1}'.format(p.returncode, retcode)) pat = re.compile('^(.*):(0x[0-9A-Fa-f]+).*') result = {} for line in stdout.splitlines(): m = pat.match(line) if not m: continue filename = m.group(1) offset = int(m.group(2), 16) if not filename in result: result[filename] = [] result[filename].append(offset) return result def assert_equal(expected, actual): if not expected == actual: raise TestFailure('Expected: {0}, Actual {1}'.format(expected, actual)) def single_test(data, pattern, offsets): filename = 'test.bin' with open(filename, 'wb') as f: f.write(data) try: for retfilename, retoffsets in do_bgrep(pattern, [filename]).iteritems(): assert_equal(filename, retfilename) assert_equal(set(offsets), set(retoffsets)) finally: os.remove(filename) def test1(): n = 100 pattern = '\x12\x34\x56\x78' data = '\0'*n + pattern + '\0'*n offsets = [n] single_test(data, pattern, offsets) all_tests = [ test1, ] def main(): for t in all_tests: name = t.__name__ print '{0}: Starting'.format(name) try: t() except TestFailure as tf: print '{0}: Failure: {1}'.format(name, tf) else: print '{0}: Success'.format(name) if __name__ == '__main__': main()
Python
0.000382
d6315d28ed55b76f3caa3fff26141815f7da7dec
add migration
accelerator/migrations/0027_modify_video_url_help_text.py
accelerator/migrations/0027_modify_video_url_help_text.py
# -*- coding: utf-8 -*- # Generated by Django 1.11.14 on 2018-12-05 16:27 from __future__ import unicode_literals from django.conf import settings from django.db import migrations, models import embed_video.fields class Migration(migrations.Migration): dependencies = [ ('accelerator', '0026_startup_acknowledgement'), ] operations = [ migrations.AlterField( model_name='startup', name='additional_industries', field=models.ManyToManyField( blank=True, db_table='accelerator_startup_related_industry', help_text='You may select up to 5 related industries.', related_name='secondary_startups', to=settings.MPTT_SWAPPABLE_INDUSTRY_MODEL, verbose_name='Additional Industries'), ), migrations.AlterField( model_name='startup', name='video_elevator_pitch_url', field=embed_video.fields.EmbedVideoField( blank=True, help_text=( 'Upload your 1-3 minute video pitch to Vimeo or ' 'Youtube. Paste the shared link here.'), max_length=100), ), ]
Python
0.000001
d573d33cc37ad666d3a4f47a5ac9dfec5a9b5fc5
add app config
app/appconfig.py
app/appconfig.py
# -*- coding:utf8 -*- # Author: shizhenyu96@gamil.com # github: https://github.com/imndszy HOST = "https://www.njuszy.cn/"
Python
0.000002
063512ec551c4ae156ebe26d607c844973d109c8
Test coverage for network v2 security groups client
tempest/tests/lib/services/network/test_security_groups_client.py
tempest/tests/lib/services/network/test_security_groups_client.py
# Copyright 2017 AT&T Corporation. # All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import copy from oslo_serialization import jsonutils as json from tempest.lib.services.network import security_groups_client from tempest.tests.lib import fake_auth_provider from tempest.tests.lib.services import base class TestSecurityGroupsClient(base.BaseServiceTest): FAKE_SEC_GROUP_ID = "85cc3048-abc3-43cc-89b3-377341426ac5" FAKE_SECURITY_GROUPS = { "security_groups": [ { "description": "default", "id": FAKE_SEC_GROUP_ID, "name": "fake-security-group-name", "security_group_rules": [ { "direction": "egress", "ethertype": "IPv4", "id": "38ce2d8e-e8f1-48bd-83c2-d33cb9f50c3d", "port_range_max": None, "port_range_min": None, "protocol": None, "remote_group_id": None, "remote_ip_prefix": None, "security_group_id": FAKE_SEC_GROUP_ID, "project_id": "e4f50856753b4dc6afee5fa6b9b6c550", "tenant_id": "e4f50856753b4dc6afee5fa6b9b6c550", "description": "" }, { "direction": "egress", "ethertype": "IPv6", "id": "565b9502-12de-4ffd-91e9-68885cff6ae1", "port_range_max": None, "port_range_min": None, "protocol": None, "remote_group_id": None, "remote_ip_prefix": None, "security_group_id": FAKE_SEC_GROUP_ID, "project_id": "e4f50856753b4dc6afee5fa6b9b6c550", "tenant_id": "e4f50856753b4dc6afee5fa6b9b6c550", "description": "" } ], "project_id": "e4f50856753b4dc6afee5fa6b9b6c550", "tenant_id": "e4f50856753b4dc6afee5fa6b9b6c550" } ] } FAKE_SECURITY_GROUP = { "security_group": copy.deepcopy( FAKE_SECURITY_GROUPS["security_groups"][0]) } def setUp(self): super(TestSecurityGroupsClient, self).setUp() fake_auth = fake_auth_provider.FakeAuthProvider() self.client = security_groups_client.SecurityGroupsClient( fake_auth, 'network', 'regionOne') def _test_list_security_groups(self, bytes_body=False): self.check_service_client_function( self.client.list_security_groups, 'tempest.lib.common.rest_client.RestClient.get', self.FAKE_SECURITY_GROUPS, bytes_body, mock_args='v2.0/security-groups') def _test_create_security_group(self, bytes_body=False): kwargs = {'name': 'fake-security-group-name'} self.check_service_client_function( self.client.create_security_group, 'tempest.lib.common.rest_client.RestClient.post', self.FAKE_SECURITY_GROUP, bytes_body, status=201, mock_args=['v2.0/security-groups', json.dumps({"security_group": kwargs})], **kwargs) def _test_show_security_group(self, bytes_body=False): self.check_service_client_function( self.client.show_security_group, 'tempest.lib.common.rest_client.RestClient.get', self.FAKE_SECURITY_GROUP, bytes_body, security_group_id=self.FAKE_SEC_GROUP_ID, mock_args='v2.0/security-groups/%s' % self.FAKE_SEC_GROUP_ID) def _test_update_security_group(self, bytes_body=False): kwargs = {'name': 'updated-security-group-name'} resp_body = copy.deepcopy(self.FAKE_SECURITY_GROUP) resp_body["security_group"]["name"] = 'updated-security-group-name' self.check_service_client_function( self.client.update_security_group, 'tempest.lib.common.rest_client.RestClient.put', resp_body, bytes_body, security_group_id=self.FAKE_SEC_GROUP_ID, mock_args=['v2.0/security-groups/%s' % self.FAKE_SEC_GROUP_ID, json.dumps({'security_group': kwargs})], **kwargs) def test_list_security_groups_with_str_body(self): self._test_list_security_groups() def test_list_security_groups_with_bytes_body(self): self._test_list_security_groups(bytes_body=True) def test_create_security_group_with_str_body(self): self._test_create_security_group() def test_create_security_group_with_bytes_body(self): self._test_create_security_group(bytes_body=True) def test_show_security_group_with_str_body(self): self._test_show_security_group() def test_show_security_group_with_bytes_body(self): self._test_show_security_group(bytes_body=True) def test_update_security_group_with_str_body(self): self._test_update_security_group() def test_update_security_group_with_bytes_body(self): self._test_update_security_group(bytes_body=True) def test_delete_security_group(self): self.check_service_client_function( self.client.delete_security_group, 'tempest.lib.common.rest_client.RestClient.delete', {}, status=204, security_group_id=self.FAKE_SEC_GROUP_ID, mock_args='v2.0/security-groups/%s' % self.FAKE_SEC_GROUP_ID)
Python
0.003763
592145cf644262a21d9f5ac8850c1d59eeac83fe
bring over from other repo
GrammarParser.py
GrammarParser.py
''' https://gist.github.com/alexbowe/879414#file-nltk-intro-py-L34''' from nltk.corpus import stopwords import nltk stopwords = stopwords.words('english') lemmatizer = nltk.WordNetLemmatizer() stemmer_alt = nltk.stem.porter.PorterStemmer() # Used when tokenizing words sentence_re = r'''(?x) # set flag to allow verbose regexps ([A-Z])(\.[A-Z])+\.? # abbreviations, e.g. U.S.A. | \w+(-\w+)* # words with optional internal hyphens | \$?\d+(\.\d+)?%? # currency and percentages, e.g. $12.40, 82% | \.\.\. # ellipsis | [][.,;"'?():-_`] # these are separate tokens ''' # This grammar is from: S. N. Kim, T. Baldwin, and M.-Y. Kan. # Evaluating n-gram based evaluation metrics for automatic keyphrase extraction. # Technical report, University of Melbourne, Melbourne 2010. grammar = r""" NBAR: {<NN.*|JJ>*<NN.*>} # Nouns and Adjectives, terminated with Nouns NP: {<NBAR>} {<NBAR><IN><NBAR>} # Above, connected with in/of/etc... """ class GrammarParser(object): """Fancier preprocessing of corpus using a grammar.""" def leaves(self, tree): """Finds NP (nounphrase) leaf nodes of a chunk tree.""" for subtree in tree.subtrees(filter=lambda t:t.label() == 'NP'): yield subtree.leaves() def normalise(self, word): """Normalises words to lowercase and stems and lemmatizes it.""" word = word.lower() word = stemmer_alt.stem_word(word) word = lemmatizer.lemmatize(word) return word def acceptable_word(self, word): """Checks conditions for acceptable word: length, stopword.""" accepted = bool(2 <= len(word) <= 20 and word.lower() not in stopwords) return accepted def get_terms(self, tree): """Filters the main tree and it's subtrees for 'leaves', normalizes the words in the leaves and returns a generator.""" for leaf in self.leaves(tree): term = [ self.normalise(w) for w,_ in leaf if self.acceptable_word(w) ] yield term def get_words(self, terms): """Loops over the terms and returns a single string of the words.""" out = [] for term in terms: for word in term: out.append(word) return " ".join(out) def main(self, text): """Breaks a single string into a tree using the grammar and returns the specified words as a string.""" if text is None: return None chunker = nltk.RegexpParser(grammar) toks = nltk.regexp_tokenize(text, sentence_re) postoks = nltk.tag.pos_tag(toks) #print postoks tree = chunker.parse(postoks) terms = self.get_terms(tree) words = self.get_words(terms) return words
Python
0
ffc32773953da2cf9e1d6e84aed1b53debc2c7c7
Create __init__.py
cltk/stem/middle_english/__init__.py
cltk/stem/middle_english/__init__.py
Python
0.000429
c7529927174b1626a0dc34f635b1d5939f565add
Add problem77.py
euler_python/problem77.py
euler_python/problem77.py
""" problem77.py It is possible to write ten as the sum of primes in exactly five different ways: 7 + 3 5 + 5 5 + 3 + 2 3 + 3 + 2 + 2 2 + 2 + 2 + 2 + 2 What is the first value which can be written as the sum of primes in over five thousand different ways? """ from itertools import count, takewhile from toolset import get_primes, memoize_mutable @memoize_mutable def num_partitions(n, primes): # Using a slightly different algorithm than problem 76. # This one is adapted from SICP: https://mitpress.mit.edu/sicp/full-text/book/book-Z-H-11.html # See the section entitled 'Example: Counting change'. Their logic is # more intuitive than that which I presented in the previous problem. if n < 0: return 0 elif n == 0: return 1 elif primes == []: return 0 else: return num_partitions(n, primes[1:]) + num_partitions(n - primes[0], primes) def problem77(): primes = list(takewhile(lambda x: x < 100, get_primes())) return next(filter(lambda x: num_partitions(x, primes) > 5000, count(2)))
Python
0.000164
f93a79aedde8883241b247244b4d15311ed2967a
Add explanation of url encoding
elasticsearch/connection/http_urllib3.py
elasticsearch/connection/http_urllib3.py
import time import urllib3 from .base import Connection from ..exceptions import ConnectionError from ..compat import urlencode class Urllib3HttpConnection(Connection): """ Default connection class using the `urllib3` library and the http protocol. :arg http_auth: optional http auth information as either ':' separated string or a tuple :arg use_ssl: use ssl for the connection if `True` :arg maxsize: the maximum number of connections which will be kept open to this host. """ def __init__(self, host='localhost', port=9200, http_auth=None, use_ssl=False, maxsize=10, **kwargs): super(Urllib3HttpConnection, self).__init__(host=host, port=port, **kwargs) self.headers = {} if http_auth is not None: if isinstance(http_auth, (tuple, list)): http_auth = ':'.join(http_auth) self.headers = urllib3.make_headers(basic_auth=http_auth) pool_class = urllib3.HTTPConnectionPool if use_ssl: pool_class = urllib3.HTTPSConnectionPool self.pool = pool_class(host, port=port, timeout=self.timeout, maxsize=maxsize) def perform_request(self, method, url, params=None, body=None, timeout=None, ignore=()): url = self.url_prefix + url if params: url = '%s?%s' % (url, urlencode(params or {})) full_url = self.host + url start = time.time() try: kw = {} if timeout: kw['timeout'] = timeout # in python2 we need to make sure the url is not unicode. Otherwise # the body will be decoded into unicode too and that will fail (#133). if not isinstance(url, str): url = url.encode('utf-8') response = self.pool.urlopen(method, url, body, retries=False, headers=self.headers, **kw) duration = time.time() - start raw_data = response.data.decode('utf-8') except Exception as e: self.log_request_fail(method, full_url, body, time.time() - start, exception=e) raise ConnectionError('N/A', str(e), e) if not (200 <= response.status < 300) and response.status not in ignore: self.log_request_fail(method, url, body, duration, response.status) self._raise_error(response.status, raw_data) self.log_request_success(method, full_url, url, body, response.status, raw_data, duration) return response.status, response.getheaders(), raw_data
import time import urllib3 from .base import Connection from ..exceptions import ConnectionError from ..compat import urlencode class Urllib3HttpConnection(Connection): """ Default connection class using the `urllib3` library and the http protocol. :arg http_auth: optional http auth information as either ':' separated string or a tuple :arg use_ssl: use ssl for the connection if `True` :arg maxsize: the maximum number of connections which will be kept open to this host. """ def __init__(self, host='localhost', port=9200, http_auth=None, use_ssl=False, maxsize=10, **kwargs): super(Urllib3HttpConnection, self).__init__(host=host, port=port, **kwargs) self.headers = {} if http_auth is not None: if isinstance(http_auth, (tuple, list)): http_auth = ':'.join(http_auth) self.headers = urllib3.make_headers(basic_auth=http_auth) pool_class = urllib3.HTTPConnectionPool if use_ssl: pool_class = urllib3.HTTPSConnectionPool self.pool = pool_class(host, port=port, timeout=self.timeout, maxsize=maxsize) def perform_request(self, method, url, params=None, body=None, timeout=None, ignore=()): url = self.url_prefix + url if params: url = '%s?%s' % (url, urlencode(params or {})) full_url = self.host + url start = time.time() try: kw = {} if timeout: kw['timeout'] = timeout if not isinstance(url, str): url = url.encode('utf-8') response = self.pool.urlopen(method, url, body, retries=False, headers=self.headers, **kw) duration = time.time() - start raw_data = response.data.decode('utf-8') except Exception as e: self.log_request_fail(method, full_url, body, time.time() - start, exception=e) raise ConnectionError('N/A', str(e), e) if not (200 <= response.status < 300) and response.status not in ignore: self.log_request_fail(method, url, body, duration, response.status) self._raise_error(response.status, raw_data) self.log_request_success(method, full_url, url, body, response.status, raw_data, duration) return response.status, response.getheaders(), raw_data
Python
0.000007
11cbc92e292a54b219f8b5ec64ae8ab58577362d
add standalone davidson test w/ near-degeneracies
tests/test021.py
tests/test021.py
import numpy as np from mmd.utils.davidson import davidson def test_davidson(): np.random.seed(0) dim = 1000 A = np.diag(np.arange(dim,dtype=np.float64)) A[1:3,1:3] = 0 M = np.random.randn(dim,dim) M += M.T A += 1e-4*M roots = 5 E, C = davidson(A, roots) E_true, C_true = np.linalg.eigh(A) E_true, C_true = E_true[:roots], C_true[:,:roots] assert np.allclose(E, E_true)
Python
0.000001
781d43e48e83f00e4cd18e805efed7558b570adf
introduce btc select command
btc/btc_select.py
btc/btc_select.py
import argparse import fnmatch import sys import os import re from .btc import encoder, decoder, error, ordered_dict _description = 'select some values' def main(): parser = argparse.ArgumentParser() parser.add_argument('keys', metavar='KEY', nargs='+', default=None, help='keys associated with values to be selected') args = parser.parse_args() if sys.stdin.isatty(): parser.error('no input, pipe another btc command output into this command') l = sys.stdin.read() if len(l.strip()) == 0: exit(1) try: l = decoder.decode(l) except ValueError: error('unexpected input: %s' % l) if not isinstance(l, list): error('input must be a list') elif not all(isinstance(x, dict) for x in l): error('list items must be dictionaries') out = [] for i, e in enumerate(l): e_out = {} for key in args.keys: try: if len(args.keys) == 1: e_out = e[key] else: e_out[key] = e[key] except KeyError: error('key not found: {}'.format(key)) out.append(e_out) if len(args.keys) > 1: print(encoder.encode([ordered_dict(d) for d in out])) else: print(encoder.encode([e for e in out])) if __name__ == '__main__': main()
Python
0.000002
f947e6766c77f58a6cc1bd0d97758e43d6750c7f
add barycentric coordinates
src/compas/geometry/interpolation/barycentric.py
src/compas/geometry/interpolation/barycentric.py
from __future__ import print_function from __future__ import absolute_import from __future__ import division from compas.geometry import subtract_vectors from compas.geometry import dot_vectors __all__ = [ 'barycentric_coordinates' ] def barycentric_coordinates(point, triangle): """Compute the barycentric coordinates of a point wrt to a triangle. Parameters ---------- point: list Point location. triangle: (point, point, point) A triangle defined by 3 points. Returns ------- list The barycentric coordinates of the point. """ a, b, c = triangle v0 = subtract_vectors(b, a) v1 = subtract_vectors(c, a) v2 = subtract_vectors(point, a) d00 = dot_vectors(v0, v0) d01 = dot_vectors(v0, v1) d11 = dot_vectors(v1, v1) d20 = dot_vectors(v2, v0) d21 = dot_vectors(v2, v1) D = d00 * d11 - d01 * d01 v = (d11 * d20 - d01 * d21) / D w = (d00 * d21 - d01 * d20) / D u = 1.0 - v - w return u, v, w # ============================================================================== # Main # ============================================================================== if __name__ == '__main__': pass
Python
0.000011
ab946575b1050e67e2e6b4fdda237faa2dc342f5
add conversion script for BDDMPipeline
scripts/conversion_bddm.py
scripts/conversion_bddm.py
import argparse import torch from diffusers.pipelines.bddm import DiffWave, BDDMPipeline from diffusers import DDPMScheduler def convert_bddm_orginal(checkpoint_path, noise_scheduler_checkpoint_path, output_path): sd = torch.load(checkpoint_path, map_location="cpu")["model_state_dict"] noise_scheduler_sd = torch.load(noise_scheduler_checkpoint_path, map_location="cpu") model = DiffWave() model.load_state_dict(sd, strict=False) ts, _, betas, _ = noise_scheduler_sd ts, betas = list(ts.numpy().tolist()), list(betas.numpy().tolist()) noise_scheduler = DDPMScheduler( timesteps=12, trained_betas=betas, timestep_values=ts, clip_sample=False, tensor_format="np", ) pipeline = BDDMPipeline(model, noise_scheduler) pipeline.save_pretrained(output_path) if __name__ == "__main__": parser = argparse.ArgumentParser() parser.add_argument("--checkpoint_path", type=str, required=True) parser.add_argument("--noise_scheduler_checkpoint_path", type=str, required=True) parser.add_argument("--output_path", type=str, required=True) args = parser.parse_args() convert_bddm_orginal(args.checkpoint_path, args.noise_scheduler_checkpoint_path, args.output_path)
Python
0
271b042c4dfa2d599e1e5b6920fb996798eac631
Fix port picking logic in Python tests
src/python/grpcio_tests/tests/unit/_reconnect_test.py
src/python/grpcio_tests/tests/unit/_reconnect_test.py
# Copyright 2017 gRPC authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests that a channel will reconnect if a connection is dropped""" import socket import unittest import grpc from grpc.framework.foundation import logging_pool from tests.unit.framework.common import test_constants _REQUEST = b'\x00\x00\x00' _RESPONSE = b'\x00\x00\x01' _UNARY_UNARY = '/test/UnaryUnary' def _handle_unary_unary(unused_request, unused_servicer_context): return _RESPONSE def _get_reuse_socket_option(): try: return socket.SO_REUSEPORT except AttributeError: # SO_REUSEPORT is unavailable on Windows, but SO_REUSEADDR # allows forcibly re-binding to a port return socket.SO_REUSEADDR def _pick_and_bind_port(sock_opt): # Reserve a port, when we restart the server we want # to hold onto the port port = 0 for address_family in (socket.AF_INET6, socket.AF_INET): try: s = socket.socket(address_family, socket.SOCK_STREAM) except socket.error: continue # this address family is unavailable s.setsockopt(socket.SOL_SOCKET, sock_opt, 1) try: s.bind(('localhost', port)) # for socket.SOCK_STREAM sockets, it is necessary to call # listen to get the desired behavior. s.listen(1) port = s.getsockname()[1] except socket.error: # port was not available on the current address family # try again port = 0 break finally: s.close() if s: return port if port != 0 else _pick_and_bind_port(sock_opt) else: return None # no address family was available class ReconnectTest(unittest.TestCase): def test_reconnect(self): server_pool = logging_pool.pool(test_constants.THREAD_CONCURRENCY) handler = grpc.method_handlers_generic_handler('test', { 'UnaryUnary': grpc.unary_unary_rpc_method_handler(_handle_unary_unary) }) sock_opt = _get_reuse_socket_option() port = _pick_and_bind_port(sock_opt) self.assertIsNotNone(port) server = grpc.server(server_pool, (handler,)) server.add_insecure_port('[::]:{}'.format(port)) server.start() channel = grpc.insecure_channel('localhost:%d' % port) multi_callable = channel.unary_unary(_UNARY_UNARY) self.assertEqual(_RESPONSE, multi_callable(_REQUEST)) server.stop(None) server = grpc.server(server_pool, (handler,)) server.add_insecure_port('[::]:{}'.format(port)) server.start() self.assertEqual(_RESPONSE, multi_callable(_REQUEST)) if __name__ == '__main__': unittest.main(verbosity=2)
# Copyright 2017 gRPC authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests that a channel will reconnect if a connection is dropped""" import socket import unittest import grpc from grpc.framework.foundation import logging_pool from tests.unit.framework.common import test_constants _REQUEST = b'\x00\x00\x00' _RESPONSE = b'\x00\x00\x01' _UNARY_UNARY = '/test/UnaryUnary' def _handle_unary_unary(unused_request, unused_servicer_context): return _RESPONSE class ReconnectTest(unittest.TestCase): def test_reconnect(self): server_pool = logging_pool.pool(test_constants.THREAD_CONCURRENCY) handler = grpc.method_handlers_generic_handler('test', { 'UnaryUnary': grpc.unary_unary_rpc_method_handler(_handle_unary_unary) }) # Reserve a port, when we restart the server we want # to hold onto the port s = socket.socket(socket.AF_INET, socket.SOCK_STREAM) try: opt = socket.SO_REUSEPORT except AttributeError: # SO_REUSEPORT is unavailable on Windows, but SO_REUSEADDR # allows forcibly re-binding to a port opt = socket.SO_REUSEADDR s.setsockopt(socket.SOL_SOCKET, opt, 1) s.bind(('localhost', 0)) port = s.getsockname()[1] server = grpc.server(server_pool, (handler,)) server.add_insecure_port('[::]:{}'.format(port)) server.start() channel = grpc.insecure_channel('localhost:%d' % port) multi_callable = channel.unary_unary(_UNARY_UNARY) self.assertEqual(_RESPONSE, multi_callable(_REQUEST)) server.stop(None) server = grpc.server(server_pool, (handler,)) server.add_insecure_port('[::]:{}'.format(port)) server.start() self.assertEqual(_RESPONSE, multi_callable(_REQUEST)) if __name__ == '__main__': unittest.main(verbosity=2)
Python
0.00001
67d409b6be5f90c33e73ddf73ba2966d8f2c44f4
Find max function in python
Maths/FindMax.py
Maths/FindMax.py
# NguyenU import math def find_max(nums): max = 0 for x in nums: if x > max: max = x print max
Python
0.999997
922513b2e0e26432fd4e4addfe83e2b84d631d4f
Create change_function_signature.py
change_function_signature.py
change_function_signature.py
def foo(a): print(a) def bar(a, b): print(a, b) func = foo func(10) func.__code__ = bar.__code__ func(10, 20)
Python
0.000006
2047de88e50ad814cc2ebdae48dc387fb2ab78d7
add migration to add not null constraint to cb
fixcity/bmabr/migrations/0006_constrainnotnull_communityboard.py
fixcity/bmabr/migrations/0006_constrainnotnull_communityboard.py
from south.db import db from django.db import models from fixcity.bmabr.models import * class Migration: def forwards(self, orm): db.alter_column(u'gis_community_board', 'borocd', models.IntegerField(null=False)) # for some reason, south doesn't like altering geometry columns # db.alter_column(u'gis_community_board', 'the_geom', # models.MultiPolygonField(null=False)) db.execute('ALTER TABLE gis_community_board ALTER COLUMN the_geom ' 'SET NOT NULL') def backwards(self, orm): db.alter_column(u'gis_community_board', 'borocd', models.IntegerField(null=True)) db.execute('ALTER TABLE gis_community_board ALTER COLUMN the_geom ' 'DROP NOT NULL') models = { 'bmabr.comment': { 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'rack': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['bmabr.Rack']"}), 'text': ('django.db.models.fields.CharField', [], {'max_length': '300'}) }, 'bmabr.communityboard': { 'Meta': {'db_table': "u'gis_community_board'"}, 'board': ('django.db.models.fields.IntegerField', [], {}), 'boro': ('django.db.models.fields.CharField', [], {'max_length': '50'}), 'borocd': ('django.db.models.fields.IntegerField', [], {}), 'gid': ('django.db.models.fields.IntegerField', [], {'primary_key': 'True'}), 'the_geom': ('django.contrib.gis.db.models.fields.MultiPolygonField', [], {}) }, 'bmabr.emailsource': { 'address': ('django.db.models.fields.EmailField', [], {'max_length': '75'}), 'source_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['bmabr.Source']", 'unique': 'True', 'primary_key': 'True'}) }, 'bmabr.neighborhoods': { 'Meta': {'db_table': "u'gis_neighborhoods'"}, 'city': ('django.db.models.fields.CharField', [], {'max_length': '64'}), 'county': ('django.db.models.fields.CharField', [], {'max_length': '43'}), 'gid': ('django.db.models.fields.IntegerField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '64'}), 'regionid': ('django.db.models.fields.IntegerField', [], {}), 'state': ('django.db.models.fields.CharField', [], {'max_length': '2'}), 'the_geom': ('django.contrib.gis.db.models.fields.MultiPolygonField', [], {}) }, 'bmabr.rack': { 'address': ('django.db.models.fields.CharField', [], {'max_length': '200'}), 'date': ('django.db.models.fields.DateTimeField', [], {}), 'description': ('django.db.models.fields.CharField', [], {'max_length': '300', 'blank': 'True'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'location': ('django.contrib.gis.db.models.fields.PointField', [], {}), 'photo': ('django.db.models.fields.files.ImageField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), 'source': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['bmabr.Source']", 'null': 'True', 'blank': 'True'}), 'title': ('django.db.models.fields.CharField', [], {'max_length': '140'}), 'user': ('django.db.models.fields.CharField', [], {'max_length': '20', 'blank': 'True'}), 'verified': ('django.db.models.fields.BooleanField', [], {'default': 'False', 'blank': 'True'}) }, 'bmabr.seeclickfixsource': { 'image_url': ('django.db.models.fields.URLField', [], {'max_length': '200'}), 'issue_id': ('django.db.models.fields.IntegerField', [], {}), 'reporter': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'source_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['bmabr.Source']", 'unique': 'True', 'primary_key': 'True'}) }, 'bmabr.source': { 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '20'}) }, 'bmabr.statementofsupport': { 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75'}), 'file': ('django.db.models.fields.files.FileField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 's_rack': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['bmabr.Rack']"}) }, 'bmabr.subwaystations': { 'Meta': {'db_table': "u'gis_subway_stations'"}, 'alt_name': ('django.db.models.fields.CharField', [], {'max_length': '38'}), 'borough': ('django.db.models.fields.CharField', [], {'max_length': '15'}), 'closed': ('django.db.models.fields.CharField', [], {'max_length': '10'}), 'color': ('django.db.models.fields.CharField', [], {'max_length': '30'}), 'cross_st': ('django.db.models.fields.CharField', [], {'max_length': '27'}), 'express': ('django.db.models.fields.CharField', [], {'max_length': '10'}), 'gid': ('django.db.models.fields.IntegerField', [], {'primary_key': 'True'}), 'id': ('django.db.models.fields.IntegerField', [], {}), 'label': ('django.db.models.fields.CharField', [], {'max_length': '50'}), 'long_name': ('django.db.models.fields.CharField', [], {'max_length': '60'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '31'}), 'nghbhd': ('django.db.models.fields.CharField', [], {'max_length': '30'}), 'objectid': ('django.db.models.fields.TextField', [], {}), 'routes': ('django.db.models.fields.CharField', [], {'max_length': '20'}), 'the_geom': ('django.contrib.gis.db.models.fields.PointField', [], {}), 'transfers': ('django.db.models.fields.CharField', [], {'max_length': '25'}) }, 'bmabr.twittersource': { 'source_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['bmabr.Source']", 'unique': 'True', 'primary_key': 'True'}), 'status_id': ('django.db.models.fields.CharField', [], {'max_length': '32'}), 'user': ('django.db.models.fields.CharField', [], {'max_length': '50'}) } } complete_apps = ['bmabr']
Python
0
a3b31137ac96bf3480aaecadd5faf3ca051fc4b0
Add bare ConnectionState
litecord/gateway/state.py
litecord/gateway/state.py
class ConnectionState: """State of a connection to the gateway over websockets Attributes ---------- session_id: str Session ID this state refers to. events: `collections.deque`[dict] Deque of sent events to the connection. Used for resuming This is filled up when the connection receives a dispatched event """ def __init__(self, session_id): self.session_id = session_id def clean(self): del self.session_id
Python
0.000002
83f2e11d63168e022d99075d2f35c6c813c4d37d
add a simple linear regression model
gnt_model.py
gnt_model.py
import tensorflow as tf from utils.gnt_record import read_and_decode, BATCH_SIZE with open('label_keys.list') as f: labels = f.readlines() tfrecords_filename = "hwdb1.1.tfrecords" filename_queue = tf.train.string_input_producer( [tfrecords_filename], num_epochs=10) # Even when reading in multiple threads, share the filename # queue. images_batch, labels_batch = read_and_decode(filename_queue) label_one_hot = tf.one_hot(labels_batch, len(labels)) print(label_one_hot) # simple model images_batch_normalized = images_batch / 128 - 0.5 print(images_batch) print(images_batch_normalized) images_batch_normalized = tf.reshape(images_batch_normalized, [BATCH_SIZE, 128*128]) print(images_batch_normalized) w = tf.get_variable("w1", [128*128, len(labels)]) y_pred = tf.matmul(images_batch_normalized, w) print("y pred & labels batch") print(y_pred) print(label_one_hot) loss = tf.nn.sparse_softmax_cross_entropy_with_logits(labels=labels_batch, logits=y_pred) # for monitoring loss_mean = tf.reduce_mean(loss) train_op = tf.train.AdamOptimizer().minimize(loss) # The op for initializing the variables. init_op = tf.group(tf.global_variables_initializer(), tf.local_variables_initializer()) with tf.Session() as sess: sess.run(init_op) coord = tf.train.Coordinator() threads = tf.train.start_queue_runners(coord=coord) while True: _, loss_val = sess.run([train_op, loss_mean]) print(loss_val) coord.request_stop() coord.join(threads)
Python
0.055082
15970841d53e14d3739d8f512f815e8e3c19bf02
Create Opcao.py
backend/Database/Models/Opcao.py
backend/Database/Models/Opcao.py
from Database.Controllers.Curso import Curso class Opcao(object): def __init__(self,dados=None): if dados is not None: self.id = dados ['id'] self.nome = dados ['nome'] self.id_curso = dados ['id_curso'] def getId(self): return self.id def setNome(self,nome): self.nome = nome def getNome(self): return self.nome def setId_curso(self,curso): self.id_curso = (Curso().pegarCurso('nome = %s',(curso))).getId() def getId_curso(self): return self.id_curso def getCurso(self): return (Curso().pegarCurso('id = %s',(self.id_curso,))).getNome()
Python
0
95f07b0b7790c1bdff53389089f5b428e4916e08
add initial version of balancing tree
boltons/treeutils.py
boltons/treeutils.py
# 0 = item # 1 = left # 2 = right # 3 = height """ maintains insertion order on equal values by going right when equal. """ class Tree(object): def __init__(self): self.root = None self.node_count = 0 def insert(self, item): hash(item) cur = self.root if not cur: self.root = [item, None, None, 1] self.node_count += 1 return stack = [] while cur: stack.append(cur) if item < cur[0]: cur = cur[1] else: cur = cur[2] cur = stack[-1] if item <= cur[0]: cur[1] = [item, None, None, 1] else: cur[2] = [item, None, None, 1] self.node_count += 1 self._rebalance(stack) def delete(self, item): if not self.root: raise ValueError("item not in tree: %r" % item) stack = [] cur = self.root while cur: if item == cur[0]: #item break stack.append(cur) if item < cur[0]: #item cur = cur[1] #left else: cur = cur[2] #right if not cur: raise ValueError("item not in tree: "+repr(item)) if not cur[1] or not cur[2]: #no left child or no right child if not cur[1]: #no left child replace = cur[2] elif not cur[2]: #no right child replace = cur[1] if stack[-1][1] is cur: #if left child stack[-1][1] = replace #replace left child elif stack[-1][2] is cur: #if right child stack[-1][2] = replace #replace right child else: #both children exist stack.append(cur) pred = cur[1] #find in-order predecessor; could also use successor is arbitrary while pred[2]: #go right as long as possible stack.append(pred) pred = cur[2] stack[-1][2] = pred[1] #remove predecessor node from tree cur[0] = pred[0] #replace cur value with predecessor value self.node_count -= 1 self._rebalance(stack) def _rebalance(self, stack): #update heights along stack for i in reversed(range(len(stack))): node = stack[i] left = node[1] right = node[2] #update height height = max(left and left[3] or 0, right and right[3] or 0) + 1 if height == node[3]: return #if we have not changed heights, no more rotations are necessary node[3] = height #update balance balance = (left and left[3] or 0) - (right and right[3] or 0) while balance < -1 or balance > 1: if balance > 1: leftleft = left and left[1] or None leftright = left and left[2] or None leftbalance = (leftleft and leftleft[3] or 0) - (leftright and leftright[3] or 0) if leftbalance < 0: #left rotate left node[1] = leftright #left = leftright left[2] = leftright[1] #left.right = leftright.left leftright[1] = left #leftright.left = left left = node[1] #set left to (new) correct value for next rotation #right rotate if i > 0: #right rotate around parent parent = stack[i-1] if parent[1] is node: parent[1] = left elif parent[2] is node: parent[2] = left else: #right rotate around root self.root = left node[1] = left[2] #right = leftright left[2] = node #leftright = node node = parent if i > 0 else self.root #set node to (new) correct value for balance if balance < -1: rightleft = right and right[1] or None rightright = right and right[2] or None rightbalance = (rightleft and rightleft[3] or 0) - (rightright and rightright[3] or 0) if rightbalance > 0: #right rotate right node[2] = rightleft #right = rightleft right[1] = rightleft[2] #right.left = rightleft.right rightleft[2] = right #rightleft.right = right right = node[2] #set right to (new) correct value for next rotation #rotate left if i > 0: #left rotate around parent parent = stack[i-1] if parent[1] is node: parent[1] = right elif parent[2] is node: parent[2] = right else: #left rotate around root self.root = right node[2] = right[1] #right = rightleft right[1] = node #rightleft = node node = parent if i > 0 else self.root #set node to (new) correct value for balance left = node[1] #update left and right to (new) correct value for balance right = node[2] if left: for c in (1,2): cur = left[c] if cur: cur[3] = max(cur[1] and cur[1][3] or 0, cur[2] and cur[2][3] or 0) + 1 left[3] = max(left[1] and left[1][3] or 0, left[2] and left[2][3] or 0) + 1 if right: for c in (1,2): cur = right[c] if cur: cur[3] = max(cur[1] and cur[1][3] or 0, cur[2] and cur[2][3] or 0) + 1 right[3] = max(right[1] and right[1][3] or 0, right[2] and right[2][3] or 0) + 1 node[3] = max(left and left[3] or 0, right and right[3] or 0) + 1 #update balance balance = (left and left[3] or 0) - (right and right[3] or 0) def __iter__(self): cur = self.root stack = [] while stack or cur: if cur: stack.append(cur) cur = cur[1] #left else: cur = stack.pop() yield cur[0] #item cur = cur[2] #right def __contains__(self, item): pass def pop(self): pass def popleft(self): pass def __len__(self): return self.node_count def test(): t = Tree() for i in range(1024): t.insert(i) return t if __name__ == '__main__': import signal, pdb def pdb_int_handler(sig, frame): pdb.set_trace() signal.signal(signal.SIGINT, pdb_int_handler) t = test() pdb.set_trace()
Python
0
3f50dcf6d91192253af320aaf72fcb13d307e137
add new package
var/spack/repos/builtin/packages/memsurfer/package.py
var/spack/repos/builtin/packages/memsurfer/package.py
# Copyright 2013-2019 Lawrence Livermore National Security, LLC and other # Spack Project Developers. See the top-level COPYRIGHT file for details. # # SPDX-License-Identifier: (Apache-2.0 OR MIT) from spack import * class Memsurfer(PythonPackage): """MemSurfer is a tool to compute and analyze membrane surfaces found in a wide variety of large-scale molecular simulations.""" homepage = "https://github.com/LLNL/MemSurfer" git = "git@github.com:LLNL/MemSurfer.git" # url = "https://github.com/LLNL/MemSurfer/archive/1.0.tar.gz" # version('1.0', sha256='06e06eba88754b0c073f1c770981f7bdd501082986e4fbe28399be23b50138de') version('1.0', tag='v1.0', submodules=True) version('master', branch='master', submodules=True) # version('test', branch='ppoisson', submodules=True) variant('vtkmesa', default=False, description='Enable OSMesa support for VTK') extends('python@2.7.16') depends_on('cmake@3.14:') depends_on('swig@3.0.12') depends_on('py-cython') depends_on('py-numpy') depends_on('py-pip') depends_on('eigen@3.3.7') depends_on('cgal@4.13 +shared~core~demos~imageio') # vtk needs to know whether to build with mesa or opengl depends_on('vtk@8.1.2 +python+opengl2~mpi~haru', when='~vtkmesa') depends_on('vtk@8.1.2 +python+opengl2~mpi~haru +osmesa', when='+vtkmesa') # this is needed only to resolve the conflict between # the default and netcdf's spec depends_on('hdf5 +hl') # memsurfer's setup needs path to these deps to build extension modules def setup_environment(self, spack_env, run_env): spack_env.set('VTK_ROOT', self.spec['vtk'].prefix) spack_env.set('CGAL_ROOT', self.spec['cgal'].prefix) spack_env.set('BOOST_ROOT', self.spec['boost'].prefix) spack_env.set('EIGEN_ROOT', self.spec['eigen'].prefix)
Python
0.000001
76cfd2931f3aaacf37e39218833d2307233ddd04
Add tests for bson serialization functions
tests/test_serialization_bson.py
tests/test_serialization_bson.py
import unittest import dimod from dimod.serialization.bson import bqm_bson_decoder, bqm_bson_encoder import numpy as np try: import bson _bson_imported = True except ImportError: _bson_imported = False class TestBSONSerialization(unittest.TestCase): def test_empty_bqm(self): bqm = dimod.BinaryQuadraticModel.from_qubo({}) encoded = bqm_bson_encoder(bqm) expected_encoding = { 'as_complete': False, 'linear': b'', 'quadratic_vals': b'', 'variable_type': 'BINARY', 'offset': 0.0, 'variable_order': [], 'index_dtype': '<u2', 'quadratic_head': b'', 'quadratic_tail': b'', } self.assertDictEqual(encoded, expected_encoding) decoded = bqm_bson_decoder(encoded) self.assertEqual(bqm, decoded) def test_single_variable_bqm(self): bqm = dimod.BinaryQuadraticModel.from_ising({"a": -1}, {}) encoded = bqm_bson_encoder(bqm) expected_encoding = { 'as_complete': False, 'linear': b'\x00\x00\x80\xbf', 'quadratic_vals': b'', 'variable_type': 'SPIN', 'offset': 0.0, 'variable_order': ['a'], 'index_dtype': '<u2', 'quadratic_head': b'', 'quadratic_tail': b'', } self.assertDictEqual(encoded, expected_encoding) decoded = bqm_bson_decoder(encoded) self.assertEqual(bqm, decoded) def test_small_bqm(self): bqm = dimod.BinaryQuadraticModel.from_ising( {"a": 1, "b": 3, "c": 4.5, "d": 0}, {"ab": -3, "cd": 3.5, "ad": 2} ) encoded = bqm_bson_encoder(bqm) expected_encoding = { 'as_complete': True, 'linear': b'\x00\x00\x80?\x00\x00@@\x00\x00\x90@\x00\x00\x00\x00', 'quadratic_vals': b'\x00\x00@\xc0\x00\x00\x00\x00\x00\x00\x00@' b'\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00`@', 'variable_type': 'SPIN', 'offset': 0.0, 'variable_order': ['a', 'b', 'c', 'd'], 'index_dtype': '<u2', } self.assertDictEqual(encoded, expected_encoding) decoded = bqm_bson_decoder(encoded) # no easy way to directly check if the bqm objects are equal (b/c float # precision, missing edges), so for now check if the qubo matrices are # the same var_order = sorted(bqm) np.testing.assert_almost_equal(bqm.to_numpy_matrix(var_order), decoded.to_numpy_matrix(var_order)) @unittest.skipUnless(_bson_imported, "no pymongo bson installed") def test_bsonable(self): bqm = dimod.BinaryQuadraticModel.from_ising( {"a": 1, "b": 3, "c": 4.5, "d": 0}, {"ab": -3, "cd": 3.5, "ad": 2} ) encoded = bqm_bson_encoder(bqm) bson.BSON.encode(encoded)
Python
0
b5db8d8b0620491169d54eaf05bb57e5a61903e1
add bash8 tool (like pep8, but way hackier)
bash8.py
bash8.py
#!/usr/bin/env python # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # bash8 - a pep8 equivalent for bash scripts # # this program attempts to be an automated style checker for bash scripts # to fill the same part of code review that pep8 does in most OpenStack # projects. It starts from humble beginnings, and will evolve over time. # # Currently Supported checks # # Errors # - E001: check that lines do not end with trailing whitespace # - E002: ensure that indents are only spaces, and not hard tabs # - E003: ensure all indents are a multiple of 4 spaces import argparse import fileinput import re import sys ERRORS = 0 def print_error(error, line): global ERRORS ERRORS = ERRORS + 1 print("%s: '%s'" % (error, line.rstrip('\n'))) print(" - %s: L%s" % (fileinput.filename(), fileinput.filelineno())) def check_no_trailing_whitespace(line): if re.search('[ \t]+$', line): print_error('E001: Trailing Whitespace', line) def check_indents(line): m = re.search('^(?P<indent>[ \t]+)', line) if m: if re.search('\t', m.group('indent')): print_error('E002: Tab indents', line) if (len(m.group('indent')) % 4) != 0: print_error('E003: Indent not multiple of 4', line) def check_files(files): for line in fileinput.input(files): check_no_trailing_whitespace(line) check_indents(line) def get_options(): parser = argparse.ArgumentParser( description='A bash script style checker') parser.add_argument('files', metavar='file', nargs='+', help='files to scan for errors') return parser.parse_args() def main(): opts = get_options() check_files(opts.files) if ERRORS > 0: print("%d bash8 error(s) found" % ERRORS) return 1 else: return 0 if __name__ == "__main__": sys.exit(main())
Python
0.000002
db4ba2ca4e0ea96c9bc3f7e9d3eb61e7c7c3bc23
Create softmax
softmax.py
softmax.py
#! /usr/bin/env python """ Author: Umut Eser Program: softmax.py Date: Friday, September 30 2016 Description: Softmax applied over rows of a matrix """ import numpy as np def softmax(X): """ Calculates softmax of the rows of a matrix X. Parameters ---------- X : 2D numpy array Return ------ 2D numpy array of positive numbers between 0 and 1 Examples -------- >>> softmax([[0.1, 0.2],[0.9, -10]]) array([[ 0.47502081, 0.52497919],[ 9.99981542e-01, 1.84578933e-05]]) """ e_X = np.exp(X - np.max(X,axis=1)) return np.divide(e_X.T,e_X.sum(axis=1)).T if __name__ == "__main__": import doctest doctest.testmod()
Python
0.000001
28696b671a5f80f781c67f35ae5abb30efd6379c
Solve Time Conversion in python
solutions/uri/1019/1019.py
solutions/uri/1019/1019.py
import sys h = 0 m = 0 for t in sys.stdin: t = int(t) if t >= 60 * 60: h = t // (60 * 60) t %= 60 * 60 if t >= 60: m = t // 60 t %= 60 print(f"{h}:{m}:{t}") h = 0 m = 0
Python
0.999882
9876f372100bbc4c272378fe9a06f7d7ddd90308
Add twitter daily backup script
twitter/daily.py
twitter/daily.py
#!/usr/bin/env python3 import json from datetime import datetime import pymysql from requests_oauthlib import OAuth1Session class Twitter(): def __init__(self): self.session = OAuth1Session( client_key="{consumer_key}", client_secret="{consumer_secret}", resource_owner_key="{access_token}", resource_owner_secret="{access_secret}", ) def crawl(self, last_id): ''' Crawl new tweet from user timeline. :param last_id: last tweet's id in database :return list: ''' if type(last_id) != int: raise TypeError("arg last_id expects int") url = "https://api.twitter.com/1.1/statuses/user_timeline.json" params = { 'count': 200, 'since_id': last_id, 'max_id': None, 'trim_user': True, 'contributor_details': False, 'exclude_replies': False, 'include_rts': True, } while True: response = self.session.get(url, params=params) tweets = json.loads(response.text) if len(tweets) > 0: yield from tweets params['max_id'] = tweets[-1]['id'] - 1 else: break class Database(): def __init__(self): self.connection = pymysql.connect( host="localhost", user="{mysql_user}", password="{mysql_password}", database="twitter", charset="utf8mb4", ) def insert(self, tweet): try: tweet_id = tweet['id'] user_id = tweet['user']['id'] text = tweet['text'] time = str(datetime.strptime( tweet['created_at'].replace("+0000", ''), "%c")) cursor = self.connection.cursor() cursor.execute( '''INSERT INTO statuses VALUES (%s, %s, %s, %s)''', (tweet_id, user_id, text, time)) except pymysql.err.ProgrammingError as err: print("Fail to insert tweet: %d" % tweet_id, file=sys.stderr) traceback.print_exc() def get_last_id(self): cursor = self.connection.cursor() cursor.execute("SELECT id FROM statuses ORDER BY id DESC LIMIT 1") tweet = cursor.fetchone() return tweet[0] if __name__ == '__main__': twitter = Twitter() database = Database() last_id = database.get_last_id() timeline = twitter.crawl(last_id) for tweet in timeline: database.insert(tweet)
Python
0.000001
69005d995aa0e6d291216101253197c6b2d8260a
Add module for command-line interface
husc/main.py
husc/main.py
import argparse parser = argparse.ArgumentParser(description="Run the HUSC functions.") subpar = parser.add_subparsers() stitch = subpar.add_parser('stitch', help="Stitch four quadrants into one image.") stitch.add_argument('quadrant_image', nargs=4, help="The images for each quadrant in order: NW, NE, " + "SW, SE.") stitch.add_argument('output_image', help="The filename for the stitched image.") illum = subpar.add_parser('illum', help="Estimate and correct illumination.") illum.add_argument('images', nargs='+', help="The input images.") illum.add_argument('-o', '--output-suffix', default='.illum.tif', metavar='SUFFIX', help="What suffix to attach to the corrected images.") def main(): """Fetch commands from the command line.""" args = parser.parse_args() print args if __name__ == '__main__': main()
Python
0.000001
10440cbcde68ecf16c8b8b326ec96d1d7f8c6d6d
add basic PID for sial position
src/boat_pid_control/src/boat_pid_control/sailPID.py
src/boat_pid_control/src/boat_pid_control/sailPID.py
""" PID control for the sailing robot controling sail position based on goal sail direction Inputs: - current heading - goal heading Output: - Change in motor position/motor position TODO: consider tack and jibe """ import rospy PROPORTIONAL_GAIN = 0.1 INTEGRAL_GAIN = 0 DERIVATIVE_GAIN = 0 currentHeading = 23 goalHeading = 35 # with new ROS input for goal or current heading # Error calculation for angular error! error = currentHeading - goalHeading p = error * PROPORTIONAL_GAIN i = 0 d = 0 correction = p + i + d #translate correction to servo change ...
Python
0
ea0087970b0c0adfd8942123899ff0ec231afa03
Handle stealable element with utils
test/selenium/src/lib/page/extended_info.py
test/selenium/src/lib/page/extended_info.py
# Copyright (C) 2015 Google Inc., authors, and contributors <see AUTHORS file> # Licensed under http://www.apache.org/licenses/LICENSE-2.0 <see LICENSE file> # Created By: jernej@reciprocitylabs.com # Maintained By: jernej@reciprocitylabs.com """A module for extended info page models (visible in LHN on hover over object members)""" from selenium.common import exceptions from lib import base from lib.constants import locator from lib.utils import selenium_utils class ExtendedInfo(base.Component): """Model representing an extended info box that allows the object to be mapped""" locator_cls = locator.ExtendedInfo def __init__(self, driver): super(ExtendedInfo, self).__init__(driver) self.is_mapped = None self.button_map = None self.title = base.Label(driver, self.locator_cls.TITLE) self._set_is_mapped() def map_to_object(self): selenium_utils.click_on_staleable_element( self._driver, self.locator_cls.BUTTON_MAP_TO) self.is_mapped = True def _set_is_mapped(self): """Checks if the object is already mapped""" try: self._driver.find_element(*self.locator_cls.ALREADY_MAPPED) self.is_mapped = True except exceptions.NoSuchElementException: self.is_mapped = False
# Copyright (C) 2015 Google Inc., authors, and contributors <see AUTHORS file> # Licensed under http://www.apache.org/licenses/LICENSE-2.0 <see LICENSE file> # Created By: jernej@reciprocitylabs.com # Maintained By: jernej@reciprocitylabs.com """A module for extended info page models (visible in LHN on hover over object members)""" from selenium.common import exceptions from lib import base from lib.constants import locator class ExtendedInfo(base.Component): """Model representing an extended info box that allows the object to be mapped""" _locator = locator.ExtendedInfo def __init__(self, driver): super(ExtendedInfo, self).__init__(driver) self.button_map = None def _reload_contents(self): self.button_map = base.Button( self._driver, self._locator.BUTTON_MAP_TO) def map_to_object(self): try: self.button_map = base.Button( self._driver, self._locator.BUTTON_MAP_TO) self.button_map.click() except exceptions.StaleElementReferenceException: self._reload_contents() return self.map_to_object() def is_already_mapped(self): """Checks if the object is already mapped""" try: self._driver.find_element(*self._locator.ALREADY_MAPPED) return True except exceptions.NoSuchElementException: return False
Python
0
1f47c575cfd310fd4bee18673f7cbb69eb622959
Create block_params.py
block_params.py
block_params.py
# block_params.py # Demonstration of a blockchain 2 of 3 components GENESIS_INDEX = 0 GENESIS_PREVIOUS_HASH = '0' GENESIS_TIMESTAMP = 1495851743 GENESIS_DATA = 'first block' class BlockParams(): def __init__(self, index, previous_hash, timestamp, data): self.index = index self.previous_hash = previous_hash self.timestamp = timestamp self.data = data def __str__(self): return str(self.index) + self.previous_hash + str(self.timestamp) + self.data @classmethod def genesis_params(cls): return cls(GENESIS_INDEX, GENESIS_PREVIOUS_HASH, GENESIS_TIMESTAMP, GENESIS_DATA)
Python
0.000004
aa4f01690c4db950144e520cf11466d7d92de291
Fix for output ports
migrations/versions/910243d8f820_fix_output_ports_with_models.py
migrations/versions/910243d8f820_fix_output_ports_with_models.py
"""fix output ports with models Revision ID: 910243d8f820 Revises: 500f09c2325d Create Date: 2017-12-19 16:19:33.927563 """ import json from alembic import context from alembic import op from sqlalchemy import String, Integer from sqlalchemy.orm import sessionmaker from sqlalchemy.sql import table, column # revision identifiers, used by Alembic. revision = '910243d8f820' down_revision = '500f09c2325d' branch_labels = None depends_on = None def _insert_operation_port(): tb = table( 'operation_port', column('id', Integer), column('type', String), column('tags', String), column('operation_id', Integer), column('order', Integer), column('multiplicity', String), column('slug', String)) all_ops = [ (15, 'OUTPUT', None, 52, 3, 'MANY', 'vector-model'), ] rows = [dict(zip([c.name for c in tb.columns], operation)) for operation in all_ops] op.bulk_insert(tb, rows) def _insert_operation_port_translation(): tb = table( 'operation_port_translation', column('id', Integer), column('locale', String), column('name', String), column('description', String), ) all_ops = [ (15, 'en', 'vector model', 'Vector model'), (15, 'pt', 'modelo de vetores', 'Modelo de vetores'), ] rows = [dict(zip([c.name for c in tb.columns], operation)) for operation in all_ops] op.bulk_insert(tb, rows) def _insert_operation_port_interface_operation_port(): tb = table( 'operation_port_interface_operation_port', column('operation_port_id', Integer), column('operation_port_interface_id', Integer)) columns = [c.name for c in tb.columns] data = [ (15, 20), (83, 20), ] rows = [dict(zip(columns, cat)) for cat in data] op.bulk_insert(tb, rows) new_values = [ {"key": "count", "value": "Count term frequency"}, {"key": "word2vec", "value": "Use word2vec algorithm"}, {"key": "hashing_tf", "value": "Map the sequence of terms to their TF using hashing trick"}, ] old_values = [ {"key": "count", "value": "Count term frequency"}, {"key": "word2vec", "value": "Use word2vec algorithm"}, ] all_commands = [ [_insert_operation_port, 'DELETE from operation_port WHERE id IN (15)'], [_insert_operation_port_translation, 'DELETE from operation_port_translation WHERE id IN (15)'], [ _insert_operation_port_interface_operation_port, 'DELETE FROM operation_port_interface_operation_port ' 'WHERE operation_port_id IN (15, 83) ' ' AND operation_port_interface_id = 20', ], [ "UPDATE operation_form_field SET `values` = '{}' WHERE id = 123".format( json.dumps(new_values)), "UPDATE operation_form_field SET `values` = '{}' WHERE id = 123".format( json.dumps(old_values)) ] ] def upgrade(): ctx = context.get_context() session = sessionmaker(bind=ctx.bind)() connection = session.connection() try: for cmd in all_commands: if isinstance(cmd[0], (unicode, str)): connection.execute(cmd[0]) elif isinstance(cmd[0], list): for row in cmd[0]: connection.execute(row) else: cmd[0]() except: session.rollback() raise session.commit() def downgrade(): ctx = context.get_context() session = sessionmaker(bind=ctx.bind)() connection = session.connection() try: for cmd in reversed(all_commands): if isinstance(cmd[1], (unicode, str)): connection.execute(cmd[1]) elif isinstance(cmd[1], list): for row in cmd[1]: connection.execute(row) else: cmd[1]() except: session.rollback() raise session.commit()
Python
0.000005
65dc2f12d8540d3aa494447033e022fe3995701b
correct language mistake
btc_download.py
btc_download.py
#! /usr/bin/env python import argparse import sys import os from btc import encoder, decoder, error, warning, list_to_dict, dict_to_list, client _description = 'download torrent file locally' def main(): parser = argparse.ArgumentParser() parser.add_argument('-d', '--directory', default='.') parser.add_argument('-o', '--output', default=None) args = parser.parse_args() if sys.stdin.isatty(): error('no input') files = sys.stdin.read() try: files = decoder.decode(files) except ValueError: error('unexpected input: %s' % files) if not os.path.exists(args.directory): error('no such directory: %s' % args.directory) if args.output and len(files) > 1: if sys.stdout.isatty(): warning('multiple files: --output is ignored') for f in files: # FIXME: problems with \\ and / filename = args.output or f['name'] complete = float(f['downloaded']) / float(f['size']) * 100 if sys.stdout.isatty() and complete < 100.0: print 'skipping incomplete file: %s' % f['name'] continue if args.output and len(files) > 1: filename = f['name'] if args.output and len(files) == 1: directory = os.path.dirname(os.path.join(args.directory, args.output)) if not os.path.exists(directory): error('no such directory: %s' % directory) else: directory = os.path.dirname(os.path.join(args.directory, f['name'])) if not os.path.exists(directory): os.makedirs(directory) if sys.stdout.isatty(): print 'downloading: %s' % os.path.join(args.directory, filename) client.torrent_download_file(f['sid'], f['fileid'], filename, args.directory) if not sys.stdout.isatty(): l = client.list_torrents() print encoder.encode(l) if __name__ == '__main__': main()
#! /usr/bin/env python import argparse import sys import os from btc import encoder, decoder, error, warning, list_to_dict, dict_to_list, client _description = 'download torrent file locally' def main(): parser = argparse.ArgumentParser() parser.add_argument('-d', '--directory', default='.') parser.add_argument('-o', '--output', default=None) args = parser.parse_args() if sys.stdin.isatty(): error('no input') files = sys.stdin.read() try: files = decoder.decode(files) except ValueError: error('unexpected input: %s' % files) if not os.path.exists(args.directory): error('no such directory: %s' % args.directory) if args.output and len(files) > 1: if sys.stdout.isatty(): warning('multiple files: --output is ignored') for f in files: # FIXME: problems with \\ and / filename = args.output or f['name'] complete = float(f['downloaded']) / float(f['size']) * 100 if sys.stdout.isatty() and complete < 100.0: print 'skipping uncomplete file: %s' % f['name'] continue if args.output and len(files) > 1: filename = f['name'] if args.output and len(files) == 1: directory = os.path.dirname(os.path.join(args.directory, args.output)) if not os.path.exists(directory): error('no such directory: %s' % directory) else: directory = os.path.dirname(os.path.join(args.directory, f['name'])) if not os.path.exists(directory): os.makedirs(directory) if sys.stdout.isatty(): print 'downloading: %s' % os.path.join(args.directory, filename) client.torrent_download_file(f['sid'], f['fileid'], filename, args.directory) if not sys.stdout.isatty(): l = client.list_torrents() print encoder.encode(l) if __name__ == '__main__': main()
Python
0.999994
7922b24882894cbc83bd4247c11d8c4a66b4b218
Add utility script for database setup
_setup_database.py
_setup_database.py
#!/usr/bin/env python # -*- coding: utf-8 -*- from setup.create_teams import migrate_teams from setup.create_divisions import create_divisions if __name__ == '__main__': # migrating teams from json file to database migrate_teams(simulation=True) # creating divisions from division configuration file create_divisions(simulation=True)
Python
0
af436dd269a959324b495885b9406610f3737a7a
Create addtoindex.py
udacity/webcrawler/addtoindex.py
udacity/webcrawler/addtoindex.py
# Define a procedure, add_to_index, # that takes 3 inputs: # - an index: [[<keyword>,[<url>,...]],...] # - a keyword: String # - a url: String # If the keyword is already # in the index, add the url # to the list of urls associated # with that keyword. # If the keyword is not in the index, # add an entry to the index: [keyword,[url]] index = [] def add_to_index(index,keyword,url): for entry in index: if entry[0] == keyword: entry[1].append(url) return index.append([keyword, [url]]) add_to_index(index,'udacity','http://udacity.com') add_to_index(index,'computing','http://acm.org') add_to_index(index,'udacity','http://npr.org') print index #>>> [['udacity', ['http://udacity.com', 'http://npr.org']], #>>> ['computing', ['http://acm.org']]]
Python
0.000001
01c4554123cbf1d37fe73fdb51ccacdedf870635
1. Two Sum. Brute-force
p001_brute_force.py
p001_brute_force.py
import unittest class Solution(object): def twoSum(self, nums, target): """ :type nums: List[int] :type target: int :rtype: List[int] """ for i, a in enumerate(nums): for j, b in enumerate(nums[i + 1:]): if a + b == target: return [i, i + 1 + j] class Test(unittest.TestCase): def test(self): self._test([2, 7, 11, 15], 9, [0, 1]) self._test([11, 2, 7, 15], 9, [1, 2]) self._test([2, 7, 11, 7, 15], 14, [1, 3]) def _test(self, nums, target, expected): actual = Solution().twoSum(nums, target) self.assertItemsEqual(actual, expected) if __name__ == '__main__': unittest.main()
Python
0.999581
93621f9441af4df77c8364050d7cc3dc2b1b43b2
Add tests for `check` command
tests/functional/registration/test_check.py
tests/functional/registration/test_check.py
""" Test check/validation command. """ import os import subprocess this_folder = os.path.abspath(os.path.dirname(__file__)) def test_check_metamodel(): """ Meta-model is also a model """ metamodel_file = os.path.join(this_folder, 'projects', 'flow_dsl', 'flow_dsl', 'Flow.tx') output = subprocess.check_output(['textx', 'check', metamodel_file], stderr=subprocess.STDOUT) assert b'Flow.tx: OK.' in output def test_check_valid_model(): metamodel_file = os.path.join(this_folder, 'projects', 'flow_dsl', 'tests', 'models', 'data_flow.eflow') output = subprocess.check_output(['textx', 'check', metamodel_file], stderr=subprocess.STDOUT) assert b'data_flow.eflow: OK.' in output def test_check_invalid_model(): metamodel_file = os.path.join(this_folder, 'projects', 'flow_dsl', 'tests', 'models', 'data_flow_including_error.eflow') output = subprocess.check_output(['textx', 'check', metamodel_file], stderr=subprocess.STDOUT) assert b'error: types must be lowercase' in output
Python
0.000003
720e288aba61ecc2214c8074e33d181c0d4584f5
Add do_datasets module
carto/do_datasets.py
carto/do_datasets.py
""" Module for working with Data Observatory Datasets .. module:: carto.do_datasets :platform: Unix, Windows :synopsis: Module for working with Data Observatory Datasets .. moduleauthor:: Jesús Arroyo <jarroyo@carto.com> """ from pyrestcli.fields import CharField from .resources import Resource, Manager from .exceptions import CartoException from .paginators import CartoPaginator API_VERSION = "v4" API_ENDPOINT = "api/{api_version}/do/datasets/" class DODatasets(Resource): """ Represents a Data Observatory Datasets object in CARTO. """ datasets = CharField(many=True) class Meta: collection_endpoint = API_ENDPOINT.format(api_version=API_VERSION) name_field = "datasets" class DODatasetsManager(Manager): """ Manager for the DODatasets class. """ resource_class = DODatasets json_collection_attribute = "result" paginator_class = CartoPaginator def get(self): return super(DODatasetsManager, self).get("datasets")
Python
0.000001
69939f351cd9c9d555fa1cd091b67314558e862b
Add __future__ import
powerline/segments/tmux.py
powerline/segments/tmux.py
# vim:fileencoding=utf-8:noet from __future__ import absolute_import, unicode_literals, division, print_function from powerline.bindings.tmux import get_tmux_output def attached_clients(pl, minimum=1): '''Return the number of tmux clients attached to the currently active session :param int minimum: The minimum number of attached clients that must be present for this segment to be visible. ''' session_output = get_tmux_output('list-panes', '-F', '#{session_name}') if not session_output: return None session_name = session_output.rstrip().split('\n')[0] attached_clients_output = get_tmux_output('list-clients', '-t', session_name) attached_count = len(attached_clients_output.rstrip().split('\n')) return None if attached_count < minimum else str(attached_count)
# vim:fileencoding=utf-8:noet from powerline.bindings.tmux import get_tmux_output def attached_clients(pl, minimum=1): '''Return the number of tmux clients attached to the currently active session :param int minimum: The minimum number of attached clients that must be present for this segment to be visible. ''' session_output = get_tmux_output('list-panes', '-F', '#{session_name}') if not session_output: return None session_name = session_output.rstrip().split('\n')[0] attached_clients_output = get_tmux_output('list-clients', '-t', session_name) attached_count = len(attached_clients_output.rstrip().split('\n')) return None if attached_count < minimum else str(attached_count)
Python
0.999979
6e8c3147938c72114b2fd18db47cca8a23fd147e
fix tests
test/mutations_test.py
test/mutations_test.py
import unittest from exporter.mutations import TerraformMutation, ManifestMutation from exporter.exceptions import FieldNotOptionalException cf_dict = { "cf_orgs":[{ "name": "first_org", "spaces": [ { "name": "first_space", "org": "first_org", "quota": "m", "allow_ssh": True, "asgs": [], "managers": [{"name": "manager"}], "developers": [{"name": "developer"}], "auditors": [{"name": "auditor"}] }, { "name": "second_space", "org": "second_org", "quota": "m", "allow_ssh": False, "asgs": [], "managers": [{"name": "manager"}], "developers": [{"name": "developer"}], "auditors": [{"name": "auditor"}] }] }] } class TestMutations(unittest.TestCase): @classmethod def setUpClass(cls): pass def test_map_field(self): source_dict = {"name": "resource_name", "property": "value", "none_property": None} dest_dict = {} tm = ManifestMutation(source_dict) tm.map_field("name", dest_dict, source_dict) self.assertIn("name", dest_dict) self.assertEqual(dest_dict["name"], "resource_name") # Test renaming cf field tm.map_field("mutated_name", dest_dict, source_dict, cf_field="name") self.assertIn("mutated_name", dest_dict) self.assertEqual(dest_dict["mutated_name"], "resource_name") #Test optionality with self.assertRaises(FieldNotOptionalException): tm.map_field("not_existent", dest_dict, source_dict, optional=False) tm.map_field("not_existent", dest_dict, source_dict, optional=True) self.assertNotIn("not_existent", dest_dict) #Test default tm.map_field("not_existent_w_default", dest_dict, source_dict, cf_field="not_existent", optional=True, default="default") self.assertIn("not_existent_w_default", dest_dict) self.assertEqual(dest_dict["not_existent_w_default"], "default") #Test mapping tm.map_field("mapped_property", dest_dict, source_dict, cf_field="property", mapping={"value": "mapped_value"}) self.assertIn("mapped_property", dest_dict) self.assertEqual(dest_dict["mapped_property"], "mapped_value") #Test mapping when source value is None tm.map_field("none_property", dest_dict, source_dict) self.assertNotIn("none_property", dest_dict) def test_map_list_field(self): source_dict = {"name": "resource_name", "list_item": ["value1", "value2"]} dest_dict = {} tm = ManifestMutation(source_dict) tm.map_list_field("list_item", dest_dict, source_dict) self.assertIn("list_item", dest_dict) self.assertEqual(["value1", "value2"], dest_dict["list_item"]) # Test that key formatting works tm.map_list_field("list_item", dest_dict, source_dict, fmt='fmt_{}') self.assertIn("list_item", dest_dict) self.assertEqual(["fmt_value1", "fmt_value2"], dest_dict["list_item"]) # Test that key mapping works tm.map_list_field("list_item", dest_dict, source_dict, key_fn=lambda x: "mapped") self.assertIn("list_item", dest_dict) self.assertEqual(["mapped", "mapped"], dest_dict["list_item"])
Python
0.000001
ba76ae145c570fce671f0ab115d4a0740a29cde4
add hadoop
conpaas-client/cps/hadoop.py
conpaas-client/cps/hadoop.py
import sys from cps.base import BaseClient class Client(BaseClient): def info(self, service_id): service = BaseClient.info(self, service_id) def usage(self, cmdname): BaseClient.usage(self, cmdname)
Python
0.000001
2476e7202933c197004688d32994d3b24a7ce74f
Add missing fulltoc for Sphinx documentation.
docs/vendor/sphinxcontrib/fulltoc.py
docs/vendor/sphinxcontrib/fulltoc.py
# -*- encoding: utf-8 -*- # # Copyright © 2012 New Dream Network, LLC (DreamHost) # # Author: Doug Hellmann <doug.hellmann@dreamhost.com> # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from sphinx import addnodes def html_page_context(app, pagename, templatename, context, doctree): """Event handler for the html-page-context signal. Modifies the context directly. - Replaces the 'toc' value created by the HTML builder with one that shows all document titles and the local table of contents. - Sets display_toc to True so the table of contents is always displayed, even on empty pages. - Replaces the 'toctree' function with one that uses the entire document structure, ignores the maxdepth argument, and uses only prune and collapse. """ rendered_toc = get_rendered_toctree(app.builder, pagename) context['toc'] = rendered_toc context['display_toc'] = True # force toctree to display if "toctree" not in context: # json builder doesn't use toctree func, so nothing to replace return def make_toctree(collapse=True): return get_rendered_toctree(app.builder, pagename, prune=False, collapse=collapse, ) context['toctree'] = make_toctree def get_rendered_toctree(builder, docname, prune=False, collapse=True): """Build the toctree relative to the named document, with the given parameters, and then return the rendered HTML fragment. """ fulltoc = build_full_toctree(builder, docname, prune=prune, collapse=collapse, ) rendered_toc = builder.render_partial(fulltoc)['fragment'] return rendered_toc def build_full_toctree(builder, docname, prune, collapse): """Return a single toctree starting from docname containing all sub-document doctrees. """ env = builder.env doctree = env.get_doctree(env.config.master_doc) toctrees = [] for toctreenode in doctree.traverse(addnodes.toctree): toctree = env.resolve_toctree(docname, builder, toctreenode, collapse=collapse, prune=prune, ) toctrees.append(toctree) if not toctrees: return None result = toctrees[0] for toctree in toctrees[1:]: if toctree: result.extend(toctree.children) env.resolve_references(result, docname, builder) return result def setup(app): app.connect('html-page-context', html_page_context)
Python
0
0822547f3fcd79a5332c450d78cd24999e5e81d0
Migrate huts
c2corg_api/scripts/migration/documents/waypoints/huts.py
c2corg_api/scripts/migration/documents/waypoints/huts.py
from c2corg_api.scripts.migration.documents.waypoints.waypoint import \ MigrateWaypoints class MigrateHuts(MigrateWaypoints): def get_name(self): return 'huts' def get_count_query(self): return ( 'select count(*) from app_huts_archives;' ) def get_query(self): return ( 'select ' ' id, document_archive_id, is_latest_version, elevation, ' ' is_protected, redirects_to, ' ' ST_Force2D(ST_SetSRID(geom, 3857)) geom, ' ' shelter_type, is_staffed, phone, url, staffed_capacity, ' ' unstaffed_capacity, has_unstaffed_matress, ' ' has_unstaffed_blanket, has_unstaffed_gas, has_unstaffed_wood ' 'from app_huts_archives ' 'order by id, document_archive_id;' ) def get_count_query_locales(self): return ( 'select count(*) from app_huts_i18n_archives;' ) def get_query_locales(self): return ( 'select ' ' id, document_i18n_archive_id, is_latest_version, culture, ' ' name, description, pedestrian_access, staffed_period ' 'from app_huts_i18n_archives ' 'order by id, document_i18n_archive_id;' ) def get_document(self, document_in, version): waypoint_type = self.convert_type( document_in.shelter_type, MigrateHuts.shelter_types) if waypoint_type is None: waypoint_type = 'hut' return dict( document_id=document_in.id, version=version, waypoint_type=waypoint_type, elevation=document_in.elevation, is_staffed=document_in.is_staffed, phone=document_in.phone, url=document_in.url, capacity_staffed=document_in.staffed_capacity, capacity=document_in.unstaffed_capacity, matress_unstaffed=self.convert_type( document_in.has_unstaffed_matress, MigrateHuts.boolean_types), blanket_unstaffed=self.convert_type( document_in.has_unstaffed_blanket, MigrateHuts.boolean_types), gas_unstaffed=self.convert_type( document_in.has_unstaffed_gas, MigrateHuts.boolean_types), heating_unstaffed=self.convert_type( document_in.has_unstaffed_wood, MigrateHuts.boolean_types) ) def get_document_locale(self, document_in, version): # TODO extract summary return dict( document_id=document_in.id, id=document_in.document_i18n_archive_id, version=version, culture=document_in.culture, title=document_in.name, description=document_in.description, access=document_in.pedestrian_access, access_period=document_in.staffed_period ) shelter_types = { '1': 'hut', '5': 'gite', '2': 'shelter', '3': 'bivouac', '4': 'base_camp', '6': 'camp_site' } boolean_types = { '1': False, '8': True, '0': None, '10': None # non applicable }
Python
0.000001
c994c1c86df7e6698ccef342b1b2101f03c01587
Add daily stats
tpt/ppatrigger/management/commands/dailystats.py
tpt/ppatrigger/management/commands/dailystats.py
import traceback import pytz from datetime import datetime, timedelta from django.core.management.base import BaseCommand from ppatrigger.models import Package from ppatrigger.models import DailyStats from ppatrigger.models import Build class Command(BaseCommand): args = '' help = 'Compile daily stats for all projects' def handle(self, *args, **options): packages = Package.objects.all() for package in packages: try: latest_daily = DailyStats.objects.filter( package__exact = package).latest('created_at') latest = latest_daily.created_at except DailyStats.DoesNotExist: # First time running, use package creation latest = package.created_at now = datetime.utcnow().replace(tzinfo = pytz.utc) day = latest while day <= now: self.stdout.write(str(day)) next_day = day + timedelta(days=1) builds = Build.objects.filter( project__package__exact = package, fetched_at__gte = day, fetched_at__lt = next_day) if len(builds): successful = 0 failed = 0 errors = 0 for build in builds: self.stdout.write(str(build)) if build.is_success(): successful += 1 elif build.is_failure(): failed += 1 else: errors += 1 stats = DailyStats(package = package, created_at = now, successful = successful, failed = failed, errors = errors) stats.save() day = next_day
Python
0.000012
7c2095c0330d14382db76bef944efae5f8d76faf
Add file with tests from rainbow categorical type example
dynd/tests/test_types_categorical.py
dynd/tests/test_types_categorical.py
import sys import unittest from dynd import nd, ndt class TestDType(unittest.TestCase): def test_make_categorical(self): # Create categorical type with 256 values tp = ndt.make_categorical(nd.range(0, 512, 2)) self.assertEqual(tp.type_id, 'categorical') self.assertEqual(tp.storage_type, ndt.uint8) self.assertEqual(tp.category_type, ndt.int32) # Create categorical type with 256 < x < 65536 values tp = ndt.make_categorical(nd.range(40000, dtype=ndt.float32)) self.assertEqual(tp.type_id, 'categorical') self.assertEqual(tp.storage_type, ndt.uint16) self.assertEqual(tp.category_type, ndt.float32) # Create categorical type with > 65536 values tp = ndt.make_categorical(nd.range(70000, dtype=ndt.int128)) self.assertEqual(tp.type_id, 'categorical') self.assertEqual(tp.storage_type, ndt.uint32) self.assertEqual(tp.category_type, ndt.int128) def test_factor_categorical(self): a = nd.array(["2012-05-10T02:29:42"] * 100, "datetime") dt1 = ndt.factor_categorical(a.date) #print (dt1) self.assertEqual(nd.as_py(dt1.categories.ucast(ndt.string)), ['2012-05-10']) def test_factor_fixedstring(self): adata = [('M', 13), ('F', 17), ('F', 34), ('M', 19), ('M', 13), ('F', 34), ('F', 22)] a = nd.array(adata, dtype='{gender: string[1], age: int32}') catdt = ndt.factor_categorical(a) b = a.ucast(catdt) x = repr(b) self.assertTrue('["M", 13]' in x) def test_rainbow_example(self): rainbow_vals = ['red', 'orange', 'yellow', 'green', 'blue', 'indigo', 'violet'] color_vals = ['red', 'red', 'violet', 'blue', 'yellow', 'yellow', 'red', 'indigo'] color_vals_int = [rainbow_vals.index(x) for x in color_vals] # Create the type rainbow = ndt.make_categorical(rainbow_vals) # Make sure it looks the way we expect self.assertEqual(rainbow.type_id, 'categorical') self.assertEqual(rainbow.data_size, 1) self.assertEqual(rainbow.data_alignment, 1) self.assertEqual(rainbow.storage_type, ndt.uint8) self.assertEqual(rainbow.category_type, ndt.string) self.assertEqual(nd.as_py(rainbow.categories), rainbow_vals) # Create an array of the type colors = nd.array(color_vals, dtype=rainbow) # Make sure it is convertible back to strings/pyobject/int self.assertEqual(nd.as_py(colors), color_vals) self.assertEqual(nd.as_py(colors.ints), color_vals_int) if __name__ == '__main__': unittest.main()
Python
0
9f73e60ba9d3775ef4dda9c815412f28ed80b518
Add new package: lzop (#17098)
var/spack/repos/builtin/packages/lzop/package.py
var/spack/repos/builtin/packages/lzop/package.py
# Copyright 2013-2020 Lawrence Livermore National Security, LLC and other # Spack Project Developers. See the top-level COPYRIGHT file for details. # # SPDX-License-Identifier: (Apache-2.0 OR MIT) from spack import * class Lzop(CMakePackage): """lzop is a file compressor which is very similar to gzip. lzop uses the LZO data compression library for compression services, and its main advantages over gzip are much higher compression and decompression speed (at the cost of some compression ratio).""" homepage = "https://www.lzop.org" url = "https://www.lzop.org/download/lzop-1.03.tar.gz" version('1.04', sha256='7e72b62a8a60aff5200a047eea0773a8fb205caf7acbe1774d95147f305a2f41') version('1.03', sha256='c1425b8c77d49f5a679d5a126c90ea6ad99585a55e335a613cae59e909dbb2c9') version('1.01', sha256='28acd94d933befbc3af986abcfe833173fb7563b66533fdb4ac592f38bb944c7') depends_on('pkgconfig', type='build') depends_on('lzo')
Python
0
1f5158d7c24e304b1b2ed2c374cd05aa662aa333
Add LruCache object.
statbot/cache.py
statbot/cache.py
# # cache.py # # statbot - Store Discord records for later analysis # Copyright (c) 2017 Ammon Smith # # statbot is available free of charge under the terms of the MIT # License. You are free to redistribute and/or modify it under those # terms. It is distributed in the hopes that it will be useful, but # WITHOUT ANY WARRANTY. See the LICENSE file for more details. # from collections import MutableMapping, OrderedDict __all__ = [ 'LruCache', ] class LruCache(MutableMapping): __slots__ = ( 'store', 'max_size', ) def __init__(self, max_size=None): self.store = OrderedDict() self.max_size = max_size def __getitem__(self, key): obj = self.store.pop(key) self.store[key] = obj return obj def get(self, key, default=None): try: return self[key] except KeyError: return default def __setitem__(self, key, value): self.store.pop(key, None) self.store[key] = value while len(self) > self.max_size: self.store.popitem(last=False) def __delitem__(self, key): del self.store[key] def __contains__(self, key): return key in self.store def __iter__(self): return iter(self.store) def __len__(self): return len(self.store)
Python
0
20b8f5c5d390d8449e4dc18cf98291486aeb7153
[151. Reverse Words in a String][Accepted]committed by Victor
151-Reverse-Words-in-a-String/solution.py
151-Reverse-Words-in-a-String/solution.py
class Solution(object): def reverseWords(self, s): """ :type s: str :rtype: str """ if not s: return "" words=s.split() print words i,j=0,len(words)-1 while i<j: words[i],words[j]=words[j],words[i] i+=1 j-=1 resstr='' for word in words: resstr+=word+' ' return resstr.strip()
Python
0.999993
0eb573afa067e23422c5a5495563a6f4d87a549d
Create soundcloud.py
apis/soundcloud.py
apis/soundcloud.py
""" Contains functions to fetch info from api.soundcloud.com """ from utilities import web # Soundcloud API key. SOUNDCLOUD_API_KEY = '4ce43a6430270a1eea977ff8357a25a3' def soundcloud_search(search): """ Searches soundcloud's API for a given search term. :param search: str the search term to search for. :return: dict{'type=soundcloud', 'video_id', 'video_time', 'video_title'} or None on no match or error. """ if search: search_url = 'http://api.soundcloud.com/tracks/?' \ 'filter=streamable&q=%s&limit=25&client_id=%s' % (search, SOUNDCLOUD_API_KEY) response = web.http_get(search_url, json=True) if response['json'] is not None: try: track_id = response['json'][0]['id'] track_time = response['json'][0]['duration'] track_title = response['json'][0]['title'].encode('ascii', 'ignore') return { 'type': 'soundCloud', 'video_id': track_id, 'video_time': track_time, 'video_title': track_title } except (IndexError, KeyError): return None return None def soundcloud_track_info(track_id): if track_id: info_url = 'http://api.soundcloud.com/tracks/%s?client_id=%s' % (track_id, SOUNDCLOUD_API_KEY) response = web.http_get(info_url, json=True) if response['json'] is not None: try: user_id = response['json'][0]['user_id'] track_time = response['json'][0]['duration'] track_title = response['json'][0]['title'].encode('ascii', 'ignore') return { 'type': 'soundCloud', 'video_id': track_id, 'video_time': track_time, 'video_title': track_title, 'user_id': user_id } except (IndexError, KeyError): return None return None
Python
0.000009
cc55fc564e84718710e1c29ca7e29be522aa70c5
Create OutputNeuronGroup_Liquid.py
examples/OutputNeuronGroup_Liquid.py
examples/OutputNeuronGroup_Liquid.py
''' Example of a spike receptor (only receives spikes) In this example spikes are received and processed creating a raster plot at the end of the simulation. ''' from brian import * import numpy from brian_multiprocess_udp import BrianConnectUDP # The main function with the NeuronGroup(s) and Synapse(s) must be named "main_NeuronGroup". # It will receive two objects: input_Neuron_Group and the simulation_clock. The input_Neuron_Group # will supply the input spikes to the network. The size of the spike train received equals NumOfNeuronsInput. # The size of the output spike train equals NumOfNeuronsOutput and must be the same size of the NeuronGroup who is # going to interface with the rest of the system to send spikes. # The function must return all the NeuronGroup objects and all the Synapse objects this way: # ([list of all NeuronGroups],[list of all Synapses]) # and the FIRST (index 0) NeuronGroup of the list MUST be the one where the OUTPUT spikes will be taken by the simulation. # # Here is also possible to use "dummy" NeuronGroups only to receive and/or send spikes. my_neuron_input_number = 135 def main_NeuronGroup(input_Neuron_Group, simulation_clock): print "main_NeuronGroup!" #DEBUG! simclock = simulation_clock Nr=NeuronGroup(my_neuron_input_number, model='v:1', reset=0, threshold=0.5, clock=simclock) Nr.v=0 # SYNAPSES BETWEEN REAL NEURON NETWORK AND THE INPUT Syn_iNG_Nr=Synapses(input_Neuron_Group, Nr, model='w:1', pre='v+=w', clock=simclock) Syn_iNG_Nr[:,:]='i==j' print "Total Number of Synapses:", len(Syn_iNG_Nr) #DEBUG! Syn_iNG_Nr.w=10 MExt=SpikeMonitor(Nr) # Spikes sent by UDP Mdummy=SpikeMonitor(input_Neuron_Group) # Spikes received by UDP return ([Nr],[Syn_iNG_Nr],[MExt,Mdummy]) def post_simulation_function(input_NG, simulation_NG, simulation_SYN, simulation_MN): """ input_NG: the neuron group that receives the input spikes simulation_NG: the neuron groups list passed to the system by the user function (main_NeuronGroup) simulation_SYN: the synapses list passed to the system by the user function (main_NeuronGroup) simulation_MN: the monitors list passed to the system by the user function (main_NeuronGroup) This way it is possible to plot, save or do whatever you want with these objects after the end of the simulation! """ # pass figure() raster_plot(simulation_MN[0]) title("Spikes Sent by UDP - Output") show(block=False) figure() raster_plot(simulation_MN[1]) title("Spikes Received by UDP - Output") show(block=True) # savefig('output.pdf') if __name__=="__main__": my_simulation = BrianConnectUDP(main_NeuronGroup, NumOfNeuronsInput=my_neuron_input_number, post_simulation_function=post_simulation_function, input_addresses=[("127.0.0.1", 22222, my_neuron_input_number)], simclock_dt=1, inputclock_dt=1, TotalSimulationTime=10000, sim_repetitions=0, brian_address=2)
Python
0
5feef18ca3dda099f33568bf0f2b189fe297a3e0
add test function rosenbrock
pyea/functions/__init__.py
pyea/functions/__init__.py
#TODO: Add documentation import numpy as np def func_rosenbrock(pop, a=1, b=100): # http://en.wikipedia.org/wiki/Rosenbrock_function x = pop[:, 0] y = pop[:, 1] return (a - x)**2 + b * (y - x**2)**2 def print_func(func, **kwargs): from mpl_toolkits.mplot3d import Axes3D import matplotlib.pyplot as plt from matplotlib import cm if func == 'rosenbrock': # Initial parammeters params = dict(range_=[-1.5, 1.5], step_=0.05) # Params in kwargs for param in params.keys(): if param in kwargs: params[param] = kwargs[param] # Fill grid x = np.arange(params['range_'][0], params['range_'][1], params['step_']) y = np.arange(params['range_'][0], params['range_'][1], params['step_']) x, y = np.meshgrid(x, y) pop = np.vstack((x.flatten(), y.flatten())).transpose() z = func_rosenbrock(pop) z = z.reshape(x.shape) # Plot fig = plt.figure() ax = fig.gca(projection='3d') surf = ax.plot_surface(x, y, z, rstride=1, cstride=1, cmap=cm.jet, linewidth=0, antialiased=False) plt.show()
Python
0.000002
378bd7f4d647243a1e736f4dc0bfd0742d5f3d0b
Create Combinations.py
Array/Combinations.py
Array/Combinations.py
``` Given two integers n and k, return all possible combinations of k numbers out of 1 ... n. For example, If n = 4 and k = 2, a solution is: [ [2,4], [3,4], [2,3], [1,2], [1,3], [1,4], ] ``` class Solution: # @return a list of lists of integers def combine(self, n, k): def combine_helper(n, k, start, depth, subres): if depth == k: result.append(subres) return for i in xrange(start, n+1): combine_helper(n, k, i+1, depth+1, subres+[i]) if n == 0 or k == 0: return [[]] result = [] combine_helper( n, k, 1, 0, []) return result
Python
0.000001
be9a1afc61be483e8c585cef247f62071809c894
add BuildWorktree.set_default_config
python/qibuild/worktree.py
python/qibuild/worktree.py
import os import qisys.command import qisys.worktree from qibuild.dependencies_solver import topological_sort import qibuild.build import qibuild.build_config import qibuild.project class BuildWorkTreeError(Exception): pass class BuildWorkTree(qisys.worktree.WorkTreeObserver): """ Stores a list of projects that can be built using CMake """ def __init__(self, worktree): self.worktree = worktree self.root = self.worktree.root self.build_config = qibuild.build_config.CMakeBuildConfig() self.build_projects = self._load_build_projects() worktree.register(self) @property def qibuild_xml(self): config_path = os.path.join(self.worktree.dot_qi, "qibuild.xml") if not os.path.exists(config_path): with open(config_path, "w") as fp: fp.write("<qibuild />\n") return config_path def get_build_project(self, name, raises=True): """ Get a build project given its name """ for build_project in self.build_projects: if build_project.name == name: return build_project if raises: raise BuildWorkTreeError("No such qibuild project: %s" % name) def get_deps(self, top_project, runtime=False, build_deps_only=False): """ Get the depencies of a project """ to_sort = dict() if build_deps_only: for project in self.build_projects: to_sort[project.name] = project.depends elif runtime: for project in self.build_projects: to_sort[project.name] = project.rdepends else: for project in self.build_projects: to_sort[project.name] = project.rdepends.union(project.depends) names = topological_sort(to_sort, [top_project.name]) deps = list() for name in names: dep_project = self.get_build_project(name, raises=False) if dep_project: deps.append(dep_project) return deps def on_project_added(self, project): """ Called when a new project has been registered """ self.build_projects = self._load_build_projects() def on_project_removed(self, project): """ Called when a build project has been removed """ self.build_projects = self._load_build_projects() def _load_build_projects(self): """ Create BuildProject for every buildable project in the worktree """ build_projects = list() for wt_project in self.worktree.projects: if not os.path.exists(wt_project.qiproject_xml): continue build_project = qibuild.project.BuildProject(self, wt_project) build_projects.append(build_project) return build_projects def configure_build_profile(self, name, flags): """ Configure a build profile for the worktree """ qibuild.profile.configure_build_profile(self.qibuild_xml, name, flags) def remove_build_profile(self, name): """ Remove a build profile for this worktree """ qibuild.profile.configure_build_profile(self.qibuild_xml, name) def set_default_config(self, name): """ Set the default toolchain for this worktree """ local_settings = qibuild.config.LocalSettings() tree = qisys.qixml.read(self.qibuild_xml) local_settings.parse(tree) local_settings.defaults.config = name tree = local_settings.tree() qisys.qixml.write(tree, self.qibuild_xml)
import os import qisys.command import qisys.worktree from qibuild.dependencies_solver import topological_sort import qibuild.build import qibuild.build_config import qibuild.project class BuildWorkTreeError(Exception): pass class BuildWorkTree(qisys.worktree.WorkTreeObserver): """ """ def __init__(self, worktree): self.worktree = worktree self.root = self.worktree.root self.build_config = qibuild.build_config.CMakeBuildConfig() self.build_projects = self._load_build_projects() worktree.register(self) @property def qibuild_xml(self): config_path = os.path.join(self.worktree.dot_qi, "qibuild.xml") if not os.path.exists(config_path): with open(config_path, "w") as fp: fp.write("<qibuild />\n") return config_path def get_build_project(self, name, raises=True): """ Get a build project given its name """ for build_project in self.build_projects: if build_project.name == name: return build_project if raises: raise BuildWorkTreeError("No such qibuild project: %s" % name) def get_deps(self, top_project, runtime=False, build_deps_only=False): """ Get the depencies of a project """ to_sort = dict() if build_deps_only: for project in self.build_projects: to_sort[project.name] = project.depends elif runtime: for project in self.build_projects: to_sort[project.name] = project.rdepends else: for project in self.build_projects: to_sort[project.name] = project.rdepends.union(project.depends) names = topological_sort(to_sort, [top_project.name]) deps = list() for name in names: dep_project = self.get_build_project(name, raises=False) if dep_project: deps.append(dep_project) return deps def on_project_added(self, project): """ Called when a new project has been registered """ self.build_projects = self._load_build_projects() def on_project_removed(self, project): """ Called when a build project has been removed """ self.build_projects = self._load_build_projects() def _load_build_projects(self): """ Create BuildProject for every buildable project in the worktree """ build_projects = list() for wt_project in self.worktree.projects: if not os.path.exists(wt_project.qiproject_xml): continue build_project = qibuild.project.BuildProject(self, wt_project) build_projects.append(build_project) return build_projects def configure_build_profile(self, name, flags): """ Configure a build profile for the worktree """ qibuild.profile.configure_build_profile(self.qibuild_xml, name, flags) def remove_build_profile(self, name): """ Remove a build profile for this worktree """ qibuild.profile.configure_build_profile(self.qibuild_xml, name)
Python
0.000001
c042f640b1d841b6779cd69393b47ef65cfedfea
add problem 11
python/problem_11.py
python/problem_11.py
# -*- coding: utf-8 -*- """ Largest product in a grid https://projecteuler.net/problem=11 """ GRID = """ 08 02 22 97 38 15 00 40 00 75 04 05 07 78 52 12 50 77 91 08 49 49 99 40 17 81 18 57 60 87 17 40 98 43 69 48 04 56 62 00 81 49 31 73 55 79 14 29 93 71 40 67 53 88 30 03 49 13 36 65 52 70 95 23 04 60 11 42 69 24 68 56 01 32 56 71 37 02 36 91 22 31 16 71 51 67 63 89 41 92 36 54 22 40 40 28 66 33 13 80 24 47 32 60 99 03 45 02 44 75 33 53 78 36 84 20 35 17 12 50 32 98 81 28 64 23 67 10 26 38 40 67 59 54 70 66 18 38 64 70 67 26 20 68 02 62 12 20 95 63 94 39 63 08 40 91 66 49 94 21 24 55 58 05 66 73 99 26 97 17 78 78 96 83 14 88 34 89 63 72 21 36 23 09 75 00 76 44 20 45 35 14 00 61 33 97 34 31 33 95 78 17 53 28 22 75 31 67 15 94 03 80 04 62 16 14 09 53 56 92 16 39 05 42 96 35 31 47 55 58 88 24 00 17 54 24 36 29 85 57 86 56 00 48 35 71 89 07 05 44 44 37 44 60 21 58 51 54 17 58 19 80 81 68 05 94 47 69 28 73 92 13 86 52 17 77 04 89 55 40 04 52 08 83 97 35 99 16 07 97 57 32 16 26 26 79 33 27 98 66 88 36 68 87 57 62 20 72 03 46 33 67 46 55 12 32 63 93 53 69 04 42 16 73 38 25 39 11 24 94 72 18 08 46 29 32 40 62 76 36 20 69 36 41 72 30 23 88 34 62 99 69 82 67 59 85 74 04 36 16 20 73 35 29 78 31 90 01 74 31 49 71 48 86 81 16 23 57 05 54 01 70 54 71 83 51 54 69 16 92 33 48 61 43 52 01 89 19 67 48 """ def adjacent_numbers_gen(grid): # right for i, row in enumerate(grid): for j, a in enumerate(row): if j + 3 == len(row): break b, c, d = row[j + 1], row[j + 2], row[j + 3] yield a, b, c, d # down for i, row in enumerate(grid): if i + 3 == len(grid): break for j, a in enumerate(row): b, c, d = grid[i + 1][j], grid[i + 2][j], grid[i + 3][j] yield a, b, c, d # diagonally right + down for i, row in enumerate(grid): if i + 3 == len(grid): break for j, a in enumerate(row): if j + 3 == len(row): break b, c, d = grid[i + 1][j + 1], grid[i + 2][j + 2], grid[i + 3][j + 3] yield a, b, c, d # diagonally left + down for i, row in enumerate(grid): if i + 3 == len(grid): break for j, a in enumerate(row): if j - 3 < 0: continue b, c, d = grid[i + 1][j - 1], grid[i + 2][j - 2], grid[i + 3][j - 3] yield a, b, c, d grid = [] for line in GRID.strip().split('\n'): grid.append([int(x.strip()) for x in line.split()]) max_product = 0 for a, b, c, d in adjacent_numbers_gen(grid): max_product = max(max_product, a * b * c * d) print max_product
Python
0.002707
474c5f977ab5b035567f0107c457622c51189ac6
Add new topics migration file
csunplugged/topics/migrations/0086_auto_20171108_0840.py
csunplugged/topics/migrations/0086_auto_20171108_0840.py
# -*- coding: utf-8 -*- # Generated by Django 1.11.5 on 2017-11-08 08:40 from __future__ import unicode_literals from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('topics', '0085_auto_20171030_0035'), ] operations = [ migrations.AddField( model_name='programmingchallengelanguage', name='name_de', field=models.CharField(max_length=200, null=True), ), migrations.AddField( model_name='programmingchallengelanguage', name='name_en', field=models.CharField(max_length=200, null=True), ), migrations.AddField( model_name='programmingchallengelanguage', name='name_fr', field=models.CharField(max_length=200, null=True), ), migrations.AlterField( model_name='classroomresource', name='description', field=models.CharField(default='', max_length=100), ), migrations.AlterField( model_name='classroomresource', name='description_de', field=models.CharField(default='', max_length=100, null=True), ), migrations.AlterField( model_name='classroomresource', name='description_en', field=models.CharField(default='', max_length=100, null=True), ), migrations.AlterField( model_name='classroomresource', name='description_fr', field=models.CharField(default='', max_length=100, null=True), ), migrations.AlterField( model_name='curriculumarea', name='name', field=models.CharField(default='', max_length=100), ), migrations.AlterField( model_name='curriculumarea', name='name_de', field=models.CharField(default='', max_length=100, null=True), ), migrations.AlterField( model_name='curriculumarea', name='name_en', field=models.CharField(default='', max_length=100, null=True), ), migrations.AlterField( model_name='curriculumarea', name='name_fr', field=models.CharField(default='', max_length=100, null=True), ), migrations.AlterField( model_name='programmingchallengelanguage', name='name', field=models.CharField(max_length=200), ), ]
Python
0
afe0f8fc731639cbe28798bb2a554c84ccbd8b2a
Create test_script.py
test_script.py
test_script.py
print "hello world"
Python
0.000004
a2bc05454ba166e3931fba130e44f49f66a79080
Add virtualshackles crawler
comics/comics/virtualshackles.py
comics/comics/virtualshackles.py
import re from comics.aggregator.crawler import CrawlerBase, CrawlerResult from comics.meta.base import MetaBase class Meta(MetaBase): name = 'Virtual Shackles' language = 'en' url = 'http://www.virtualshackles.com/' start_date = '2009-03-27' rights = 'Jeremy Vinar and Mike Fahmie' class Crawler(CrawlerBase): history_capable_days = 32 schedule = 'We,Fr' def crawl(self, pub_date): feed = self.parse_feed('http://feeds.feedburner.com/VirtualShackles?format=atom') for entry in feed.for_date(pub_date): url = entry.summary.src('img[src*="virtualshackles.com/img/"]') title = entry.title page_url = entry.raw_entry.feedburner_origlink page_url = re.sub(r'/(\d+/?)', '/-\g<1>', page_url) page = self.parse_page(page_url) orion = page.text('#orionComments') jack = page.text('#jackComments') if orion and jack: comments = u'orion: %s\n jack: %s' % (orion, jack) elif orion: comments = u'orion: %s' % (orion) elif jack: comments = u'jack: %s' % (jack) else: comments = None return CrawlerResult(url, title, comments)
Python
0
c13014c18496f35c4c94f156a18d442d3859f73b
Add assembly testing module
testing_ops.py
testing_ops.py
from __future__ import absolute_import, print_function, division from firedrake import * mesh = UnitSquareMesh(2, 2, quadrilateral=False) n = FacetNormal(mesh) degree = 1 V = FunctionSpace(mesh, "RT", degree) U = FunctionSpace(mesh, "DG", degree - 1) W = V * U u, p = TrialFunctions(W) v, q = TestFunctions(W) a = (dot(u, v) + div(v)*p + q*div(u))*dx x = SpatialCoordinate(mesh) f = Function(U).assign(0) L = f*q*dx + 42*dot(v, n)*ds(4) bcs = [DirichletBC(W.sub(0), Expression(("0", "0")), (1, 2))] L = assemble(L) y = Function(W) for bc in bcs: bc.apply(y) rhs = assemble(L - assemble(action(a, y))) for bc in bcs: bc.apply(rhs)
Python
0
263cb3990c9e4e387ab409a982e477958fef6f55
Add tests for the coordination number filter.
CDJSVis/filtering/filters/tests/test_coordinationNumber.py
CDJSVis/filtering/filters/tests/test_coordinationNumber.py
""" Unit tests for the coordination number filter """ import unittest import numpy as np from ....lattice_gen import lattice_gen_fcc, lattice_gen_bcc from .. import coordinationNumberFilter from .. import base from ....state.atoms import elements ################################################################################ class TestCoordinationNumber(unittest.TestCase): """ Test ACNA BCC """ def setUp(self): """ Called before each test """ # generate lattice (BCC) args = lattice_gen_bcc.Args(sym="Fe", NCells=[10,10,10], a0=2.87, pbcx=True, pbcy=True, pbcz=True) gen = lattice_gen_bcc.BCCLatticeGenerator() status, self.latticeBCC = gen.generateLattice(args) if status: raise unittest.SkipTest("Generate lattice failed (%d)" % status) # generate lattice (FCC) args = lattice_gen_fcc.Args(sym="Au", NCells=[8,8,8], a0=4.078, pbcx=True, pbcy=True, pbcz=True) gen = lattice_gen_fcc.FCCLatticeGenerator() status, self.latticeFCC = gen.generateLattice(args) if status: raise unittest.SkipTest("Generate lattice failed (%d)" % status) # set bond min/max elements.addBond("Fe", "Fe", 2.0, 2.6) elements.addBond("Au", "Au", 2.5, 3.0) # filter self.filter = coordinationNumberFilter.CoordinationNumberFilter("Coordination number") def tearDown(self): """ Called after each test """ # remove refs self.latticeBCC = None self.latticeFCC = None self.filter = None def test_coordinationNumber(self): """ Coordination number """ # FIRST BCC # settings settings = coordinationNumberFilter.CoordinationNumberFilterSettings() # set PBC self.latticeBCC.PBC[:] = 1 # filter input filterInput = base.FilterInput() filterInput.inputState = self.latticeBCC filterInput.visibleAtoms = np.arange(self.latticeBCC.NAtoms, dtype=np.int32) filterInput.NScalars = 0 filterInput.fullScalars = np.empty(0, np.float64) filterInput.NVectors = 0 filterInput.fullVectors = np.empty(0, np.float64) # call filter result = self.filter.apply(filterInput, settings) self.assertIsInstance(result, base.FilterResult) # make sure num visible is same self.assertEqual(len(filterInput.visibleAtoms), self.latticeBCC.NAtoms) # check coordination scalars = result.getScalars()["Coordination number"] for i in xrange(len(filterInput.visibleAtoms)): self.assertEqual(8, scalars[i]) # NOW FCC # settings settings = coordinationNumberFilter.CoordinationNumberFilterSettings() # set PBC self.latticeFCC.PBC[:] = 1 # filter input filterInput = base.FilterInput() filterInput.inputState = self.latticeFCC filterInput.visibleAtoms = np.arange(self.latticeFCC.NAtoms, dtype=np.int32) filterInput.NScalars = 0 filterInput.fullScalars = np.empty(0, np.float64) filterInput.NVectors = 0 filterInput.fullVectors = np.empty(0, np.float64) # call filter result = self.filter.apply(filterInput, settings) self.assertIsInstance(result, base.FilterResult) # make sure num visible is same self.assertEqual(len(filterInput.visibleAtoms), self.latticeFCC.NAtoms) # check coordination scalars = result.getScalars()["Coordination number"] for i in xrange(len(filterInput.visibleAtoms)): self.assertEqual(12, scalars[i]) def test_coordinationNumberFiltering(self): """ Coordination number filtering """ # FIRST BCC # settings settings = coordinationNumberFilter.CoordinationNumberFilterSettings() settings.updateSetting("filteringEnabled", True) settings.updateSetting("minCoordNum", 10) settings.updateSetting("maxCoordNum", 20) # set PBC self.latticeBCC.PBC[:] = 1 # filter input filterInput = base.FilterInput() filterInput.inputState = self.latticeBCC filterInput.visibleAtoms = np.arange(self.latticeBCC.NAtoms, dtype=np.int32) filterInput.NScalars = 0 filterInput.fullScalars = np.empty(0, np.float64) filterInput.NVectors = 0 filterInput.fullVectors = np.empty(0, np.float64) # call filter result = self.filter.apply(filterInput, settings) self.assertIsInstance(result, base.FilterResult) # make sure num visible is correct self.assertEqual(len(filterInput.visibleAtoms), 0) # NOW FCC # settings settings = coordinationNumberFilter.CoordinationNumberFilterSettings() settings.updateSetting("filteringEnabled", True) settings.updateSetting("minCoordNum", 1) settings.updateSetting("maxCoordNum", 10) # set PBC self.latticeFCC.PBC[:] = 1 # filter input filterInput = base.FilterInput() filterInput.inputState = self.latticeFCC filterInput.visibleAtoms = np.arange(self.latticeFCC.NAtoms, dtype=np.int32) filterInput.NScalars = 0 filterInput.fullScalars = np.empty(0, np.float64) filterInput.NVectors = 0 filterInput.fullVectors = np.empty(0, np.float64) # call filter result = self.filter.apply(filterInput, settings) self.assertIsInstance(result, base.FilterResult) # make sure num visible is correct self.assertEqual(len(filterInput.visibleAtoms), 0)
Python
0
71afe426a84789b65953ccd057014d17a11de859
Add a command to extend the generation_high from generation 1 to 2
mzalendo/core/management/commands/core_extend_areas_to_generation_2.py
mzalendo/core/management/commands/core_extend_areas_to_generation_2.py
# The import of data into Kenyan MapIt had the constituencies in # generation 2, while all the other area types were in generation 1. # This is unfortunate since it makes it appear to later import scripts # that the district type disappeared between generation 1 and 3. # # This script just extends the generation_high to generation 2 for # every area where it was set to generation 2. from django.core.management.base import NoArgsCommand from mapit.models import Area, Generation, Type, NameType, Country, CodeType class Command(NoArgsCommand): help = 'Change all genertion_high=1 to generation_high=2' def handle_noargs(self, **options): g1 = Generation.objects.get(id=1) g2 = Generation.objects.get(id=2) for area in Area.objects.filter(generation_high=g1): area.generation_high = g2 area.save()
Python
0.002458
17fddbb1df78420aaebb811785b8e99769b45fa9
Create keyradius.py
bin/keyradius.py
bin/keyradius.py
import csv from numpy import sqrt # Midpoint for Key Bridge x1 = 38.902543 y1 = -77.069830 # Threshold marker x2 = 38.900122 y2 = -77.071176 radius_squared = (x2 - x1)**2 + (y2 - y1)**2 radius = sqrt(radius_squared) data_file = open("IncidentData_24OCT14.csv", "rU") data = csv.DictReader(data_file) results = [] for row in data: lat = float(row["Latitude"]) lon = float(row["Longitude"]) distance_squared = ((lat) - x1)**2 + ((lon) - y1)**2 distance = sqrt(distance_squared) if distance <= radius: results.append({"Location": row["Location"], "Type": row["Standardized Type"], "Start Time": row["Time Opened"], "End Time": row["Time Closed"], "Latitude": row["Latitude"], "Longitude": row["Longitude"]}) f = open('radiuskeybridge.csv','wb') w = csv.DictWriter(f, fieldnames = ["Location", "Type", "Start Time", "End Time", "Latitude", "Longitude"]) w.writeheader() w.writerows(results)
Python
0
fbc92f8400d4565a86b81329053a1302ce21c2f8
Add English Unique Pupil Number (UPN)
stdnum/gb/upn.py
stdnum/gb/upn.py
# upn.py - functions for handling English UPNs # # Copyright (C) 2017 Arthur de Jong # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA # 02110-1301 USA """UPN (English Unique Pupil Number). The Unique Pupil Number (UPN) is a 13-character code that identifies pupils in English state schools and is designed to aid tracking pupil progress through the school system. The number consists of a check letter, a 3-digit LA (Local Authority) number for the issuing school, a 4-digit DfE number (School Establishment Number), 2 digits for the issue year and 3 digits for a serial number. Temporary numbers have a 2-digit serial and a letter. More information: * https://www.gov.uk/government/publications/unique-pupil-numbers >>> validate('B801200005001') 'B801200005001' >>> validate('A801200005001') Traceback (most recent call last): ... InvalidChecksum: ... >>> validate('X80120000A001') # middle part must be numeric Traceback (most recent call last): ... InvalidFormat: ... >>> validate('E000200005001') # LA number must be known Traceback (most recent call last): ... InvalidComponent: ... """ from stdnum.util import clean from stdnum.exceptions import * # The allowed characters in an UPN. _alphabet = 'ABCDEFGHJKLMNPQRTUVWXYZ0123456789' # The known values for the LA (Local Authority) number. # https://www.gov.uk/government/statistics/new-local-authority-codes-january-2011 _la_numbers = set(( 201, 202, 203, 204, 205, 206, 207, 208, 209, 210, 211, 212, 213, 301, 302, 303, 304, 305, 306, 307, 308, 309, 310, 311, 312, 313, 314, 315, 316, 317, 318, 319, 320, 330, 331, 332, 333, 334, 335, 336, 340, 341, 342, 343, 344, 350, 351, 352, 353, 354, 355, 356, 357, 358, 359, 370, 371, 372, 373, 380, 381, 382, 383, 384, 390, 391, 392, 393, 394, 420, 800, 801, 802, 803, 805, 806, 807, 808, 810, 811, 812, 813, 815, 816, 821, 822, 823, 825, 826, 830, 831, 835, 836, 837, 840, 841, 845, 846, 850, 851, 852, 855, 856, 857, 860, 861, 865, 866, 867, 868, 869, 870, 871, 872, 873, 874, 876, 877, 878, 879, 880, 881, 882, 883, 884, 885, 886, 887, 888, 889, 890, 891, 892, 893, 894, 895, 896, 908, 909, 916, 919, 921, 925, 926, 928, 929, 931, 933, 935, 936, 937, 938)) def compact(number): """Convert the number to the minimal representation. This strips the number of any valid separators and removes surrounding whitespace.""" return clean(number, ' ').upper().strip() def calc_check_digit(number): """Calculate the check digit for the number.""" check = sum(i * _alphabet.index(n) for i, n in enumerate(number[-12:], 2)) % 23 return _alphabet[check] def validate(number): """Check to see if the number provided is a valid UPN. This checks length, formatting and check digits.""" number = compact(number) if len(number) != 13: raise InvalidLength() if not number[1:-1].isdigit() or number[-1] not in _alphabet: raise InvalidFormat() if int(number[1:4]) not in _la_numbers: raise InvalidComponent() if calc_check_digit(number[1:]) != number[0]: raise InvalidChecksum() return number def is_valid(number): """Check to see if the number provided is a valid UPN. This checks length, formatting and check digits.""" try: return bool(validate(number)) except ValidationError: return False
Python
0.00001
c27e97ea959a9863e57ce12b0afc5fa092562548
Create Character.py
Character.py
Character.py
import untangle class Character(object): def __init__(self, data): assert isinstance(data, dict) self.__dict__ = data def get_data(character): ''' :param character: String, character name :return: Dictionary, character data ''' path = 'tests\\' filepath = path + character + '.chum5' try: c = untangle.parse(filepath) except IOError: print("Error: can't find file or read data") data = { 'Name': c.character.name.cdata, 'imageURL': str(c.character.notes.cdata), 'Charisma': int(c.character.attributes.attribute[4].value.cdata), 'Intelligence': int(c.character.attributes.attribute[5].value.cdata), 'Hacking': int(c.character.skills.skill[37].rating.cdata), 'Seduction': int(c.character.skills.skill[37].rating.cdata) } return data ## LIMITS WILL NEED TO BE CALCULATED # Inherent Limits Add appropriate attribute(s); calculate as listed below — # Mental [(Logic x 2) + Intuition + Willpower] / 3 (round up) — # Physical [(Strength x 2) + Body + Reaction] / 3 (round up) — # Social [(Charisma x 2) + Willpower + Essence] / 3 (round up) ##
Python
0
983d6b12db4050ff7d252e1717adbfe39add2f49
Add missing file
Allura/allura/lib/widgets/auth_widgets.py
Allura/allura/lib/widgets/auth_widgets.py
import ew as ew_core import ew.jinja2_ew as ew from ew.core import validator from pylons import request from formencode import Invalid from webob import exc from .forms import ForgeForm from allura.lib import plugin class LoginForm(ForgeForm): submit_text='Login' style='wide' class fields(ew_core.NameList): username = ew.TextField(label='Username') password = ew.PasswordField(label='Password') class hidden_fields(ew_core.NameList): return_to = ew.HiddenField() @validator def validate(self, value, state=None): try: value['username'] = plugin.AuthenticationProvider.get(request).login() except exc.HTTPUnauthorized: msg = 'Invalid login' raise Invalid( msg, dict(username=value['username']), None) return value
Python
0
c349e8df72c09a98fe6b038c763c41008bef70a2
add migration for reimporting universities
hs_dictionary/migrations/0005_reimport_universities.py
hs_dictionary/migrations/0005_reimport_universities.py
# -*- coding: utf-8 -*- from __future__ import unicode_literals import csv import os from django.db import migrations, models from hs_dictionary.models import University def forwards(apps, schema_editor): University.objects.all().delete() with open(os.path.dirname(__file__) + "/world-universities.csv") as f: reader = csv.reader(f) for i, line in enumerate(reader): University.objects.create( name=line[1], country_code=line[0], url=line[2] ) class Migration(migrations.Migration): dependencies = [ ('hs_dictionary', '0004_merge'), ] operations = [ migrations.RunPython(forwards) ]
Python
0
d77e8df3fa913e7a60c1870e49a6b6197d7a9125
Add tests for zerver/views/realm_emoji.py.
zerver/tests/test_realm_emoji.py
zerver/tests/test_realm_emoji.py
# -*- coding: utf-8 -*- from __future__ import absolute_import from zerver.lib.actions import get_realm, check_add_realm_emoji from zerver.lib.test_helpers import AuthedTestCase import ujson class RealmEmojiTest(AuthedTestCase): def test_list(self): self.login("iago@zulip.com") realm = get_realm('zulip.com') check_add_realm_emoji(realm, "my_emoji", "https://example.com/my_emoji") result = self.client.get("/json/realm/emoji") self.assert_json_success(result) self.assertEqual(200, result.status_code) content = ujson.loads(result.content) self.assertEqual(len(content["emoji"]), 1) def test_upload(self): self.login("iago@zulip.com") data = {"name": "my_emoji", "url": "https://example.com/my_emoji"} result = self.client_put("/json/realm/emoji", info=data) self.assert_json_success(result) self.assertEqual(200, result.status_code) result = self.client.get("/json/realm/emoji") content = ujson.loads(result.content) self.assert_json_success(result) self.assertEqual(len(content["emoji"]), 1) def test_upload_exception(self): self.login("iago@zulip.com") data = {"name": "my_em*/oji", "url": "https://example.com/my_emoji"} result = self.client_put("/json/realm/emoji", info=data) self.assert_json_error(result, u'Invalid characters in Emoji name') def test_delete(self): self.login("iago@zulip.com") realm = get_realm('zulip.com') check_add_realm_emoji(realm, "my_emoji", "https://example.com/my_emoji") result = self.client_delete("/json/realm/emoji/my_emoji") self.assert_json_success(result) result = self.client.get("/json/realm/emoji") content = ujson.loads(result.content) self.assert_json_success(result) self.assertEqual(len(content["emoji"]), 0)
Python
0
6cb66978e44d447fd210dd92de194659b5f33fb3
Add debug util for WORKSPACE.
bazel/debug_repository.bzl
bazel/debug_repository.bzl
"""Debug util for repository definitions.""" def debug_repository(repo, *fields): """debug_repository(repo) identifies which version of a repository has been defined in the WORKSPACE by printing some of its fields. Example: # at the bottom of the WORKSPACE file load("//bazel:debug_repository.bzl", "debug_repository") debug_repository("org_golang_x_net") If needed, you can override the printed fields by passing additional parameters: debug_repository("io_grpc_grpc_java", "patches", "urls") """ if len(fields) == 0: fields = ["branch", "commit", "tag", "url", "urls"] rule = native.existing_rule(repo) if rule == None: print(repo, "not found") return for f in fields: if f in rule and len(rule[f]) > 0: print(repo, f, rule[f])
Python
0.000433
316bef330c0770739e95f9c1108e07697655d27e
fix when multi python version bug
cobra/__version__.py
cobra/__version__.py
import sys import platform __title__ = 'cobra' __description__ = 'Code Security Audit' __url__ = 'https://github.com/wufeifei/cobra' __issue_page__ = 'https://github.com/wufeifei/cobra/issues/new' __python_version__ = sys.version.split()[0] __platform__ = platform.platform() __version__ = '2.0.0-alpha' __author__ = 'Feei' __author_email__ = 'feei@feei.cn' __license__ = 'MIT License' __copyright__ = 'Copyright (C) 2017 Feei. All Rights Reserved' __introduction__ = """ ,---. | | ,---.|---.,---.,---. | | || || ,---| `---``---``---`` `---^ v{version} GitHub: https://github.com/wufeifei/cobra Cobra is a static code analysis system that automates the detecting vulnerabilities and security issue.""".format(version=__version__) __epilog__ = """Usage: python {m} -t {td} python {m} -t {td} -r cvi-190001,cvi-190002 python {m} -t {td} -f json -o /tmp/report.json python {m} -t {tg} -f json -o feei@feei.cn python {m} -t {tg} -f json -o http://push.to.com/api sudo python {m} -H 127.0.0.1 -P 80 """.format(m='cobra.py', td='tests/vulnerabilities', tg='https://github.com/ethicalhack3r/DVWA')
import sys import platform __title__ = 'cobra' __description__ = 'Code Security Audit' __url__ = 'https://github.com/wufeifei/cobra' __issue_page__ = 'https://github.com/wufeifei/cobra/issues/new' __python_version__ = sys.version.split()[0] __platform__ = platform.platform() __version__ = '2.0.0-alpha' __author__ = 'Feei' __author_email__ = 'feei@feei.cn' __license__ = 'MIT License' __copyright__ = 'Copyright (C) 2017 Feei. All Rights Reserved' __introduction__ = """ ,---. | | ,---.|---.,---.,---. | | || || ,---| `---``---``---`` `---^ v{version} GitHub: https://github.com/wufeifei/cobra Cobra is a static code analysis system that automates the detecting vulnerabilities and security issue.""".format(version=__version__) __epilog__ = """Usage: {m} -t {td} {m} -t {td} -r cvi-190001,cvi-190002 {m} -t {td} -f json -o /tmp/report.json {m} -t {tg} -f json -o feei@feei.cn {m} -t {tg} -f json -o http://push.to.com/api sudo {m} -H 127.0.0.1 -P 80 """.format(m='./cobra.py', td='tests/vulnerabilities', tg='https://github.com/ethicalhack3r/DVWA')
Python
0.000001
b67041367fcc10da7879c123ab44671f258ef649
support script in python for bootstrapping erlang on a new erts
support/build.py
support/build.py
#! /bin/python """Support for building sinan, bootstraping it on a new version of erlang""" import sys import os import commands from optparse import OptionParser class BuildError(Exception): def __init__(self, value): self.value = value def __str__(self): return repr(self.value) ERTS_VERSION = "5.6.3" BUILD_PATH = "_build/development/apps/%s/ebin" ERLWARE_PATH = "/usr/local/erlware" ERLC = "erlc +debug_info " LOCAL_APPS = [("etask", "0.5.0"), ("sinan", "0.10.0.14"), ("sinan_web_api", "0.1.0.4")] ERLWARE_APPS = ["fconf-0.3.0.0", "ktuo-0.4.0.1", "crary-0.2.3", "eunit-2.0", "cryptographic-0.2.1", "ewlib-0.8.2.0", "ewrepo-0.18.6.0", "gas-6.1.1", "kernel-2.12.3", "ibrowse-1.4", "uri-0.2.0"] def generate_local_path(app): ebin = "_build/development/apps/%s-%s/ebin" % (app[0], app[1]) include = "_build/development/apps/%s-%s/include" % (app[0], app[1]) if not os.path.isdir(ebin): raise BuildError(ebin + " is not a directory") return " -pa %s -I %s " % (ebin, include) def generate_erlware_path(path): ebin = "%s/packages/%s/lib/%s/ebin" % (ERLWARE_PATH, ERTS_VERSION, path) include = "%s/packages/%s/lib/%s/include" % (ERLWARE_PATH, ERTS_VERSION, path) if not os.path.isdir(ebin): raise BuildError(ebin + " is not a directory") return " -pa %s -I %s " % (ebin, include) def compile_app(app): ebin = "_build/development/apps/%s-%s/ebin" % (app[0], app[1]) compile_command = ("erlc +debug_info %s %s -o %s/ ./server/%s/src/*.erl" % (' '.join(map(generate_local_path, LOCAL_APPS)), ' '.join(map(generate_erlware_path, ERLWARE_APPS)), ebin, app[0])) (status, out) = commands.getstatusoutput(compile_command) if 0 != status: raise BuildError(out) def compile_apps(): for app in LOCAL_APPS: compile_app(app) def main(): parser = OptionParser() parser.add_option("-e", "--erlware", dest="erlware", type="string", default="/usr/local/erlware", help="The location of Erlware") (options, args) = parser.parse_args() ERLWARE_PATH = options.erlware compile_apps() if __name__ == "__main__": main()
Python
0
1483b352683ecf126e1063c3a6fa2f07dcdb7720
add new module.wq
cno/core/gtt.py
cno/core/gtt.py
import numpy as np import pylab import pandas as pd from biokit.rtools import RSession from cno.core import CNORBase from easydev import TempFile __all__ = ['GTTBool'] class GTTBool(CNORBase): """ :: from cno import * c = cnorbool.CNORbool(cnodata("PKN-ToyMMB.sif"), cnodata("MD-ToyMMB.csv"), verboseR=False) c.optimise(reltol=0.5) c.optimise(reltol=0.5) g = gtt.GTTBool(c._model, c.data, c.models, c.results.scores) d = g.get_gtt() """ def __init__(self, model, data, models, scores, verboseR=False): """ Note that once, grouped, the scores should be identical albeit the model size [scores[i] for i in grouped.groups.values()[10]] :param model: a instance of :class:`CNOGraph` :param data: an instance of :class:`XMIDAS` :param models: an instance of compatible :class:`Models` :param scores: the scores of each model. """ CNORBase.__init__(self, verboseR) self.models = models self.scores = scores self.model = model self.data = data # a MIDAS file def _init(self): fhmodel = TempFile() fhdata = TempFile() self.model.to_sif(fhmodel.name) self.data.to_midas(fhdata.name) self.session.run("library(CellNOptR)") self.session.run('model=readSIF("%s")' % fhmodel.name) self.session.run('cnolist=CNOlist("%s")' % fhdata.name) def _get_sim(self, bs): self.session.bs1 = bs script = """ png() output = cutAndPlot(cnolist, model, list(bs1), plotPDF=F) dev.off() """ self.session.run(script) res = self.session.output['simResults'][0] res = list(res['t0'].flatten() ) + list(res['t1'].flatten()) return res def get_gtt(self): print("init R library") self._init() N = len(self.models) from easydev import progress_bar b = progress_bar(N) d = {} for i in range(0, N): res = np.array(self._get_sim(self.models.df.ix[i].values)) b.animate(i, N) d[i] = res df = pd.DataFrame(d).transpose() grouped = df.groupby(list(df.columns)) pylab.hist([len(this) for this in grouped.groups.values()], 100) return {'simulation': d, 'grouped':grouped}
Python
0.000001
e307bf72a8aa21088d491c90efd9a731014e63f1
move states into separate file
stacks/states.py
stacks/states.py
FAILED_STACK_STATES = [ 'CREATE_FAILED', 'ROLLBACK_FAILED', 'DELETE_FAILED', 'UPDATE_ROLLBACK_FAILED' ] COMPLETE_STACK_STATES = [ 'CREATE_COMPLETE', 'UPDATE_COMPLETE', ] ROLLBACK_STACK_STATES = [ 'ROLLBACK_COMPLETE', 'UPDATE_ROLLBACK_COMPLETE', ] IN_PROGRESS_STACK_STATES = [ 'CREATE_IN_PROGRESS', 'ROLLBACK_IN_PROGRESS', 'DELETE_IN_PROGRESS', 'UPDATE_IN_PROGRESS', 'UPDATE_COMPLETE_CLEANUP_IN_PROGRESS', 'UPDATE_ROLLBACK_IN_PROGRESS', 'UPDATE_ROLLBACK_COMPLETE_CLEANUP_IN_PROGRESS', ]
Python
0.000004
13dfb4f7d4972edbc7ccc0e4f62ea3db1a5b16f4
Add ctx module
srw/ctx.py
srw/ctx.py
def wd2jd(wd): jd_ref = 2453005.5 return (wd / 86400.) + jd_ref
Python
0.000001
19acf7ad2a14b71f672d02cb8cb47a4393665bc7
Add benchmarks
bin/serialize.py
bin/serialize.py
"""Timing serializtion of deeply nested geometry collections. To and from JSON using dumps and loads from Python's json module. I'm happy to report that writing such GeoJSON geometry collections is more expensive than parsing them and, at least for Python, deeply nested geometry collections aren't an asymmetric attack vector. """ from json import dumps, loads import timeit geom = {'type': 'Point', 'coordinates': [0.0, 0.0]} for i in range(100): geom = {'type': 'GeometryCollection', 'geometries': [geom]} text = dumps(geom) # Time dumps. print("Dumps") print( timeit.timeit( "dumps(geom)", setup="from __main__ import dumps, geom", number=10000)) # Time loads. print("Loads") print( timeit.timeit( "loads(text)", setup="from __main__ import loads, text", number=10000))
Python
0.00001
7c9b97a81d4c8e41ce81cc881d30323dfb1f9c72
Add layer normalization
chainer/links/normalization/layer_normalization.py
chainer/links/normalization/layer_normalization.py
from chainer import functions from chainer import initializers from chainer import link from chainer import links class LayerNormalization(link.Chain): """Layer normalization layer on outputs of linear functions. This is a link of "Layer Normalization". This layer normalizes, scales and shifts input units with :link:`~chainer.links.Scale`. Args: size (int): Size of input units. See: `Layer Normalization <https://arxiv.org/abs/1607.06450>`_ """ def __init__(self, size, eps=1e-6, initial_gamma=None, initial_beta=None): super(LayerNormalization, self).__init__( scale=links.Scale(axis=1, W_shape=(size, ), bias_term=True), ) if initial_gamma is None: initial_gamma = initializers.One() initializers.init_weight(self.scale.W.data, initial_gamma) if initial_beta is None: initial_beta = initializers.Zero() initializers.init_weight(self.scale.bias.b.data, initial_beta) self.eps = eps def normalize(self, x): size = x.shape[1] mean = functions.broadcast_to( (functions.sum(x, axis=1) / size)[:, None], x.shape) std = functions.broadcast_to(functions.sqrt( functions.sum(functions.square(x - mean), axis=1) / size)[:, None], x.shape) + self.eps return (x - mean) / std def __call__(self, x): return self.scale(self.normalize(x))
Python
0.000001
b88b97c7d56506804fc9eb93ce7074454fc492f3
Add the migration for designations.
base/apps/people/migrations/0002_auto_20141223_0316.py
base/apps/people/migrations/0002_auto_20141223_0316.py
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations class Migration(migrations.Migration): dependencies = [ ('people', '0001_initial'), ] operations = [ migrations.CreateModel( name='Designation', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(max_length=60)), ('romanized_name', models.CharField(max_length=60)), ('started', models.DateField(db_index=True)), ('ended', models.DateField(db_index=True, null=True, blank=True)), ('group', models.ForeignKey(related_name=b'designations', to='people.Group')), ], options={ 'get_latest_by': 'started', }, bases=(models.Model,), ), migrations.AlterOrderWithRespectTo( name='designation', order_with_respect_to='group', ), ]
Python
0.000001
3b23e35e58c9269a7fb9275aafadb276ba2b30d0
Problem 12 Completed
project_euler_12.py
project_euler_12.py
''' Shayne Hodge 2/15/2014 Project Euler Problem 12 n -> n/2 (n is even) n -> 3n + 1 (n is odd) Longest sequence under one million? ''' #currently a brute force implementation with no niceities # including, apparently, spell check in the comments import numpy as np import matplotlib.pyplot as plt def make_hist(results): plt.hist(results, bins=100) def next_number(n): next = n/2 if n%2 == 0 else (3*n+1) return next def check_dict(results): pass # check if results in dictionary # return if true else return empty? ending = 1000000 results = dict() lengths = np.empty((ending-1,1)) for k in range(1, ending): temp = [k] n = k while n != 1: n = next_number(n) temp.append(n) results[k] = temp lengths[k-1] = len(temp) max_length = np.max(lengths) max_length_idx = np.argmax(lengths) print 'Max length is '+str(max_length)+' found at '+str(max_length_idx+1)+'.' make_hist(lengths)
Python
0.999244
f3dbe9bb2aa627b3485c2ed44f889a1bc5463081
Bump to version 3.1.3
rest_framework/__init__.py
rest_framework/__init__.py
""" ______ _____ _____ _____ __ | ___ \ ___/ ___|_ _| / _| | | | |_/ / |__ \ `--. | | | |_ _ __ __ _ _ __ ___ _____ _____ _ __| |__ | /| __| `--. \ | | | _| '__/ _` | '_ ` _ \ / _ \ \ /\ / / _ \| '__| |/ / | |\ \| |___/\__/ / | | | | | | | (_| | | | | | | __/\ V V / (_) | | | < \_| \_\____/\____/ \_/ |_| |_| \__,_|_| |_| |_|\___| \_/\_/ \___/|_| |_|\_| """ __title__ = 'Django REST framework' __version__ = '3.1.3' __author__ = 'Tom Christie' __license__ = 'BSD 2-Clause' __copyright__ = 'Copyright 2011-2015 Tom Christie' # Version synonym VERSION = __version__ # Header encoding (see RFC5987) HTTP_HEADER_ENCODING = 'iso-8859-1' # Default datetime input and output formats ISO_8601 = 'iso-8601'
""" ______ _____ _____ _____ __ | ___ \ ___/ ___|_ _| / _| | | | |_/ / |__ \ `--. | | | |_ _ __ __ _ _ __ ___ _____ _____ _ __| |__ | /| __| `--. \ | | | _| '__/ _` | '_ ` _ \ / _ \ \ /\ / / _ \| '__| |/ / | |\ \| |___/\__/ / | | | | | | | (_| | | | | | | __/\ V V / (_) | | | < \_| \_\____/\____/ \_/ |_| |_| \__,_|_| |_| |_|\___| \_/\_/ \___/|_| |_|\_| """ __title__ = 'Django REST framework' __version__ = '3.1.2' __author__ = 'Tom Christie' __license__ = 'BSD 2-Clause' __copyright__ = 'Copyright 2011-2015 Tom Christie' # Version synonym VERSION = __version__ # Header encoding (see RFC5987) HTTP_HEADER_ENCODING = 'iso-8859-1' # Default datetime input and output formats ISO_8601 = 'iso-8601'
Python
0
57714fd6838f48920f7093a24ec4d85abf4278ee
Fix merge issue
src/naarad/naarad_imports.py
src/naarad/naarad_imports.py
# coding=utf-8 """ © 2013 LinkedIn Corp. All rights reserved. Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. """ from naarad.graphing import matplotlib_naarad from naarad.metrics.jmeter_metric import JmeterMetric from naarad.reporting.report import Report #Custom metrics metric_classes = { #'MyMetric' : MyMetricParserClass 'JMETER' : JmeterMetric } graphing_modules = { 'matplotlib' : matplotlib_naarad } reporting_modules = { 'report' : Report } important_sub_metrics_import = { 'GC' : ('GC', 'used'), 'SAR-cpuusage' : ('%sys', '%usr') }
# coding=utf-8 """ © 2013 LinkedIn Corp. All rights reserved. Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. """ from naarad.graphing import matplotlib_naarad from naarad.metrics.jmeter_metric import JmeterMetric from naarad.reporting.report import Report #Custom metrics metric_classes = { #'MyMetric' : MyMetricParserClass 'JMETER' : JmeterMetric } graphing_modules = { 'matplotlib' : matplotlib_naarad } <<<<<<< HEAD reporting_modules = { 'report' : Report } ======= important_sub_metrics_import = { 'GC' : ('GC', 'used'), 'SAR-cpuusage' : ('%sys', '%usr') } >>>>>>> upstream/master
Python
0.000001
6de41e5acfe55b6cb7698f81e3031079a530b1af
test for cli mode
tests/test_cli_mode.py
tests/test_cli_mode.py
import unittest from unittest.mock import Mock from rawdisk.ui.cli.cli_mode import CliMode, CliShell class CliModeTest(unittest.TestCase): def test_initialize_loads_fs_plugins(self): session = Mock() cli = CliShell(session=session) cli.initialize() session.load_plugins.assert_called_once_with()
Python
0.000001
f007cacdba7bb3e46a6c4c730dde50dc495d9c64
Add hypothesis test for metasync
tests/test_metasync.py
tests/test_metasync.py
# -*- coding: utf-8 -*- from hypothesis import given import hypothesis.strategies as st import pytest from vdirsyncer.metasync import MetaSyncConflict, metasync from vdirsyncer.storage.memory import MemoryStorage from . import blow_up def test_irrelevant_status(): a = MemoryStorage() b = MemoryStorage() status = {'foo': 'bar'} metasync(a, b, status, keys=()) assert not status def test_basic(monkeypatch): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == 'bar' a.set_meta('foo', 'baz') metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == 'baz' monkeypatch.setattr(a, 'set_meta', blow_up) monkeypatch.setattr(b, 'set_meta', blow_up) metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == 'baz' monkeypatch.undo() monkeypatch.undo() b.set_meta('foo', None) metasync(a, b, status, keys=['foo']) assert not a.get_meta('foo') and not b.get_meta('foo') def test_conflict(): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') b.set_meta('foo', 'baz') with pytest.raises(MetaSyncConflict): metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == 'bar' assert b.get_meta('foo') == 'baz' assert not status def test_conflict_same_content(): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') b.set_meta('foo', 'bar') metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == status['foo'] == 'bar' @pytest.mark.parametrize('wins', 'ab') def test_conflict_x_wins(wins): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') b.set_meta('foo', 'baz') metasync(a, b, status, keys=['foo'], conflict_resolution='a wins' if wins == 'a' else 'b wins') assert a.get_meta('foo') == b.get_meta('foo') == status['foo'] == ( 'bar' if wins == 'a' else 'baz' ) keys = st.text(min_size=1).filter(lambda x: x.strip() == x) metadata = st.dictionaries( keys, st.text() ) @given( a=metadata, b=metadata, status=metadata, keys=st.sets(keys), conflict_resolution=st.just('a wins') | st.just('b wins') ) def test_fuzzing(a, b, status, keys, conflict_resolution): def _get_storage(m, instance_name): s = MemoryStorage(instance_name=instance_name) s.metadata = m return s a = _get_storage(a, 'A') b = _get_storage(b, 'B') winning_storage = (a if conflict_resolution == 'a wins' else b) expected_values = dict((key, winning_storage.get_meta(key)) for key in keys) metasync(a, b, status, keys=keys, conflict_resolution=conflict_resolution) for key in keys: assert a.get_meta(key) == b.get_meta(key) == status.get(key, '') if expected_values[key]: assert status[key] == expected_values[key]
# -*- coding: utf-8 -*- import pytest from vdirsyncer.metasync import MetaSyncConflict, metasync from vdirsyncer.storage.memory import MemoryStorage from . import blow_up def test_irrelevant_status(): a = MemoryStorage() b = MemoryStorage() status = {'foo': 'bar'} metasync(a, b, status, keys=()) assert not status def test_basic(monkeypatch): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == 'bar' a.set_meta('foo', 'baz') metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == 'baz' monkeypatch.setattr(a, 'set_meta', blow_up) monkeypatch.setattr(b, 'set_meta', blow_up) metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == 'baz' monkeypatch.undo() monkeypatch.undo() b.set_meta('foo', None) metasync(a, b, status, keys=['foo']) assert not a.get_meta('foo') and not b.get_meta('foo') def test_conflict(): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') b.set_meta('foo', 'baz') with pytest.raises(MetaSyncConflict): metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == 'bar' assert b.get_meta('foo') == 'baz' assert not status def test_conflict_same_content(): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') b.set_meta('foo', 'bar') metasync(a, b, status, keys=['foo']) assert a.get_meta('foo') == b.get_meta('foo') == status['foo'] == 'bar' @pytest.mark.parametrize('wins', 'ab') def test_conflict_x_wins(wins): a = MemoryStorage() b = MemoryStorage() status = {} a.set_meta('foo', 'bar') b.set_meta('foo', 'baz') metasync(a, b, status, keys=['foo'], conflict_resolution='a wins' if wins == 'a' else 'b wins') assert a.get_meta('foo') == b.get_meta('foo') == status['foo'] == ( 'bar' if wins == 'a' else 'baz' )
Python
0.000074
be0cb304047c7a410eac577b8aa2765747991100
add script to summarise output
summary.py
summary.py
import string, sys, glob idir = sys.argv[1] fl = glob.glob( '%s/*.txt' % idir ) ee = {} for f in fl: for l in open(f).readlines(): if string.find(l, 'FAILED') != -1: bits = string.split(l, ':' ) if len(bits) > 3: code = bits[0] msg = bits[3] if code not in ee.keys(): ee[code] = [0,msg] ee[code][0] += 1 if ee[code][1] != msg: print 'code %s occurs with multiple messages: %s, %s' % (code,ee[code][1],msg) else: print bits keys = ee.keys() keys.sort() for k in keys: print k,ee[k]
Python
0.000002
6d90ccd7d6f03630106f78ec7d75666429e26e45
Add an example workloads module
configs/example/arm/workloads.py
configs/example/arm/workloads.py
# Copyright (c) 2020 ARM Limited # All rights reserved. # # The license below extends only to copyright in the software and shall # not be construed as granting a license to any other intellectual # property including but not limited to intellectual property relating # to a hardware implementation of the functionality of the software # licensed hereunder. You may use the software subject to the license # terms below provided that you ensure that this notice is replicated # unmodified and in its entirety in all distributions of the software, # modified or unmodified, in source code or in binary form. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer; # redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution; # neither the name of the copyright holders nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # from __future__ import print_function from __future__ import absolute_import import m5 from m5.objects import * from m5.options import * from common.SysPaths import binary, disk class ArmBaremetal(ArmFsWorkload): """ Baremetal workload """ atags_addr = 0 def __init__(self, obj, system, **kwargs): super(ArmBaremetal, self).__init__(**kwargs) self.object_file = obj class ArmTrustedFirmware(ArmFsWorkload): """ Arm Trusted Firmware (TFA) workload. It models the firmware design described at: https://trustedfirmware-a.readthedocs.io/en/latest/design/firmware-design.html The Workload is expecting to find a set of firmare images under the M5_PATH/binaries path. Those images are: * bl1.bin (BL1 = Stage 1 Bootloader) * fip.bin (FIP = Firmware Image Package): BL2, BL31, BL33 binaries compiled under a singe package These are the results of the compilation of Arm Trusted Firmware. https://github.com/ARM-software/arm-trusted-firmware """ atags_addr = 0 def __init__(self, obj, system, **kwargs): super(ArmTrustedFirmware, self).__init__(**kwargs) self.extras = [ binary('bl1.bin'), binary('fip.bin'), ] self.extras_addrs = [ system.realview.bootmem.range.start, system.realview.flash0.range.start ] # Arm Trusted Firmware will provide a PSCI implementation system._have_psci = True
Python
0.000003